Illumina Body Map 2: averaged replicates
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
SIN3A
|
ENSG00000169375.11 | SIN3 transcription regulator family member A |
|
CHD1
|
ENSG00000153922.6 | chromodomain helicase DNA binding protein 1 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| SIN3A | hg19_v2_chr15_-_75748115_75748126 | 0.47 | 6.5e-03 | Click! |
| CHD1 | hg19_v2_chr5_-_98262240_98262240 | 0.27 | 1.4e-01 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr19_+_589893 | 6.26 |
ENST00000251287.2
|
HCN2
|
hyperpolarization activated cyclic nucleotide-gated potassium channel 2 |
| chr14_+_29236269 | 5.00 |
ENST00000313071.4
|
FOXG1
|
forkhead box G1 |
| chr17_+_54671047 | 4.98 |
ENST00000332822.4
|
NOG
|
noggin |
| chr5_-_16179884 | 4.52 |
ENST00000332432.8
|
MARCH11
|
membrane-associated ring finger (C3HC4) 11 |
| chr9_-_92112953 | 4.12 |
ENST00000339861.4
ENST00000422704.2 ENST00000455551.2 |
SEMA4D
|
sema domain, immunoglobulin domain (Ig), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 4D |
| chr2_+_105471969 | 4.09 |
ENST00000361360.2
|
POU3F3
|
POU class 3 homeobox 3 |
| chr6_+_73331520 | 3.76 |
ENST00000342056.2
ENST00000355194.4 |
KCNQ5
|
potassium voltage-gated channel, KQT-like subfamily, member 5 |
| chr19_-_55658281 | 3.73 |
ENST00000585321.2
ENST00000587465.2 |
TNNT1
|
troponin T type 1 (skeletal, slow) |
| chr16_+_87636474 | 3.66 |
ENST00000284262.2
|
JPH3
|
junctophilin 3 |
| chrX_+_72223352 | 3.64 |
ENST00000373521.2
ENST00000538388.1 |
PABPC1L2B
|
poly(A) binding protein, cytoplasmic 1-like 2B |
| chr6_+_73331918 | 3.41 |
ENST00000402622.2
ENST00000355635.3 ENST00000403813.2 ENST00000414165.2 |
KCNQ5
|
potassium voltage-gated channel, KQT-like subfamily, member 5 |
| chr20_-_43438912 | 3.40 |
ENST00000541604.2
ENST00000372851.3 |
RIMS4
|
regulating synaptic membrane exocytosis 4 |
| chr2_+_79740118 | 3.38 |
ENST00000496558.1
ENST00000451966.1 |
CTNNA2
|
catenin (cadherin-associated protein), alpha 2 |
| chr9_+_34958254 | 3.33 |
ENST00000242315.3
|
KIAA1045
|
KIAA1045 |
| chr21_+_34442439 | 3.31 |
ENST00000382348.1
ENST00000333063.5 |
OLIG1
|
oligodendrocyte transcription factor 1 |
| chr8_-_140715294 | 3.31 |
ENST00000303015.1
ENST00000520439.1 |
KCNK9
|
potassium channel, subfamily K, member 9 |
| chr7_-_143059780 | 3.24 |
ENST00000409578.1
ENST00000409346.1 |
FAM131B
|
family with sequence similarity 131, member B |
| chr3_+_14989186 | 3.23 |
ENST00000435454.1
ENST00000323373.6 |
NR2C2
|
nuclear receptor subfamily 2, group C, member 2 |
| chr8_+_31497271 | 3.23 |
ENST00000520407.1
|
NRG1
|
neuregulin 1 |
| chr19_-_47975106 | 3.16 |
ENST00000539381.1
ENST00000594353.1 ENST00000542837.1 |
SLC8A2
|
solute carrier family 8 (sodium/calcium exchanger), member 2 |
| chr19_+_54412517 | 3.14 |
ENST00000391767.1
|
CACNG7
|
calcium channel, voltage-dependent, gamma subunit 7 |
| chr19_-_47975417 | 3.13 |
ENST00000236877.6
|
SLC8A2
|
solute carrier family 8 (sodium/calcium exchanger), member 2 |
| chr1_-_38512450 | 3.08 |
ENST00000373012.2
|
POU3F1
|
POU class 3 homeobox 1 |
| chr9_-_120177216 | 3.07 |
ENST00000373996.3
ENST00000313400.4 ENST00000361477.3 |
ASTN2
|
astrotactin 2 |
| chr11_-_46142948 | 3.07 |
ENST00000257821.4
|
PHF21A
|
PHD finger protein 21A |
| chr7_-_150864635 | 3.07 |
ENST00000297537.4
|
GBX1
|
gastrulation brain homeobox 1 |
| chr6_+_73331776 | 3.05 |
ENST00000370398.1
|
KCNQ5
|
potassium voltage-gated channel, KQT-like subfamily, member 5 |
| chr22_-_17602143 | 3.04 |
ENST00000331437.3
|
CECR6
|
cat eye syndrome chromosome region, candidate 6 |
| chr17_-_58469329 | 2.96 |
ENST00000393003.3
|
USP32
|
ubiquitin specific peptidase 32 |
| chr16_+_25703274 | 2.92 |
ENST00000331351.5
|
HS3ST4
|
heparan sulfate (glucosamine) 3-O-sulfotransferase 4 |
| chr19_+_30017406 | 2.92 |
ENST00000335523.7
|
VSTM2B
|
V-set and transmembrane domain containing 2B |
| chr3_+_71803201 | 2.91 |
ENST00000304411.2
|
GPR27
|
G protein-coupled receptor 27 |
| chr13_+_100634004 | 2.90 |
ENST00000376335.3
|
ZIC2
|
Zic family member 2 |
| chr1_+_156611704 | 2.89 |
ENST00000329117.5
|
BCAN
|
brevican |
| chr13_+_112721913 | 2.85 |
ENST00000330949.1
|
SOX1
|
SRY (sex determining region Y)-box 1 |
| chr12_-_58131931 | 2.83 |
ENST00000547588.1
|
AGAP2
|
ArfGAP with GTPase domain, ankyrin repeat and PH domain 2 |
| chr17_+_36508111 | 2.83 |
ENST00000331159.5
ENST00000577233.1 |
SOCS7
|
suppressor of cytokine signaling 7 |
| chr7_-_143059845 | 2.81 |
ENST00000443739.2
|
FAM131B
|
family with sequence similarity 131, member B |
| chr16_+_6069072 | 2.81 |
ENST00000547605.1
ENST00000550418.1 ENST00000553186.1 |
RBFOX1
|
RNA binding protein, fox-1 homolog (C. elegans) 1 |
| chr9_-_120177342 | 2.79 |
ENST00000361209.2
|
ASTN2
|
astrotactin 2 |
| chr19_+_55795493 | 2.78 |
ENST00000309383.1
|
BRSK1
|
BR serine/threonine kinase 1 |
| chr16_+_1031762 | 2.77 |
ENST00000293894.3
|
SOX8
|
SRY (sex determining region Y)-box 8 |
| chr3_-_157823839 | 2.76 |
ENST00000425436.3
ENST00000389589.4 ENST00000441443.2 |
SHOX2
|
short stature homeobox 2 |
| chr7_+_128431444 | 2.76 |
ENST00000459946.1
ENST00000378685.4 ENST00000464832.1 ENST00000472049.1 ENST00000488925.1 |
CCDC136
|
coiled-coil domain containing 136 |
| chr16_+_56225248 | 2.68 |
ENST00000262493.6
|
GNAO1
|
guanine nucleotide binding protein (G protein), alpha activating activity polypeptide O |
| chr6_-_84419101 | 2.68 |
ENST00000520302.1
ENST00000520213.1 ENST00000439399.2 ENST00000428679.2 ENST00000437520.1 |
SNAP91
|
synaptosomal-associated protein, 91kDa |
| chr1_-_99470368 | 2.68 |
ENST00000263177.4
|
LPPR5
|
Lipid phosphate phosphatase-related protein type 5 |
| chr22_+_26565440 | 2.68 |
ENST00000404234.3
ENST00000529632.2 ENST00000360929.3 ENST00000248933.6 ENST00000343706.4 |
SEZ6L
|
seizure related 6 homolog (mouse)-like |
| chr5_-_45696253 | 2.68 |
ENST00000303230.4
|
HCN1
|
hyperpolarization activated cyclic nucleotide-gated potassium channel 1 |
| chr1_-_53793725 | 2.65 |
ENST00000371454.2
|
LRP8
|
low density lipoprotein receptor-related protein 8, apolipoprotein e receptor |
| chr6_+_99282570 | 2.62 |
ENST00000328345.5
|
POU3F2
|
POU class 3 homeobox 2 |
| chr4_-_102268708 | 2.62 |
ENST00000525819.1
|
PPP3CA
|
protein phosphatase 3, catalytic subunit, alpha isozyme |
| chr17_+_30813576 | 2.61 |
ENST00000313401.3
|
CDK5R1
|
cyclin-dependent kinase 5, regulatory subunit 1 (p35) |
| chr1_-_99470558 | 2.59 |
ENST00000370188.3
|
LPPR5
|
Lipid phosphate phosphatase-related protein type 5 |
| chr4_-_6202291 | 2.59 |
ENST00000282924.5
|
JAKMIP1
|
janus kinase and microtubule interacting protein 1 |
| chr6_+_44238203 | 2.58 |
ENST00000451188.2
|
TMEM151B
|
transmembrane protein 151B |
| chr16_-_755819 | 2.57 |
ENST00000397621.1
|
FBXL16
|
F-box and leucine-rich repeat protein 16 |
| chr4_-_6202247 | 2.54 |
ENST00000409021.3
ENST00000409371.3 |
JAKMIP1
|
janus kinase and microtubule interacting protein 1 |
| chr1_+_70034081 | 2.53 |
ENST00000310961.5
ENST00000370958.1 |
LRRC7
|
leucine rich repeat containing 7 |
| chr17_-_58469591 | 2.51 |
ENST00000589335.1
|
USP32
|
ubiquitin specific peptidase 32 |
| chrX_-_72299258 | 2.50 |
ENST00000453389.1
ENST00000373519.1 |
PABPC1L2A
|
poly(A) binding protein, cytoplasmic 1-like 2A |
| chr19_+_12949251 | 2.46 |
ENST00000251472.4
|
MAST1
|
microtubule associated serine/threonine kinase 1 |
| chr6_+_73331814 | 2.45 |
ENST00000370392.1
|
KCNQ5
|
potassium voltage-gated channel, KQT-like subfamily, member 5 |
| chr17_+_36508826 | 2.43 |
ENST00000580660.1
|
SOCS7
|
suppressor of cytokine signaling 7 |
| chr19_-_47975143 | 2.43 |
ENST00000597014.1
|
SLC8A2
|
solute carrier family 8 (sodium/calcium exchanger), member 2 |
| chr16_-_30042580 | 2.43 |
ENST00000380495.4
|
FAM57B
|
family with sequence similarity 57, member B |
| chr10_-_133109947 | 2.41 |
ENST00000368642.4
|
TCERG1L
|
transcription elongation regulator 1-like |
| chr10_+_105315102 | 2.41 |
ENST00000369777.2
|
NEURL
|
neuralized E3 ubiquitin protein ligase 1 |
| chr3_+_32859510 | 2.39 |
ENST00000383763.5
|
TRIM71
|
tripartite motif containing 71, E3 ubiquitin protein ligase |
| chr2_+_210636697 | 2.38 |
ENST00000439458.1
ENST00000272845.6 |
UNC80
|
unc-80 homolog (C. elegans) |
| chr13_-_45151259 | 2.37 |
ENST00000493016.1
|
TSC22D1
|
TSC22 domain family, member 1 |
| chrX_-_51239425 | 2.36 |
ENST00000375992.3
|
NUDT11
|
nudix (nucleoside diphosphate linked moiety X)-type motif 11 |
| chr20_-_62103862 | 2.35 |
ENST00000344462.4
ENST00000357249.2 ENST00000359125.2 ENST00000360480.3 ENST00000370224.1 ENST00000344425.5 ENST00000354587.3 ENST00000359689.1 |
KCNQ2
|
potassium voltage-gated channel, KQT-like subfamily, member 2 |
| chr19_-_42498369 | 2.35 |
ENST00000302102.5
ENST00000545399.1 |
ATP1A3
|
ATPase, Na+/K+ transporting, alpha 3 polypeptide |
| chr20_+_19193269 | 2.33 |
ENST00000328041.6
|
SLC24A3
|
solute carrier family 24 (sodium/potassium/calcium exchanger), member 3 |
| chr1_-_156390128 | 2.33 |
ENST00000368242.3
|
C1orf61
|
chromosome 1 open reading frame 61 |
| chr16_-_58231782 | 2.31 |
ENST00000565188.1
ENST00000262506.3 |
CSNK2A2
|
casein kinase 2, alpha prime polypeptide |
| chr8_-_30891078 | 2.30 |
ENST00000339382.2
ENST00000475541.1 |
PURG
|
purine-rich element binding protein G |
| chr19_-_55660561 | 2.30 |
ENST00000587758.1
ENST00000356783.5 ENST00000291901.8 ENST00000588426.1 ENST00000588147.1 ENST00000536926.1 ENST00000588981.1 |
TNNT1
|
troponin T type 1 (skeletal, slow) |
| chr5_+_110559784 | 2.30 |
ENST00000282356.4
|
CAMK4
|
calcium/calmodulin-dependent protein kinase IV |
| chr8_-_132052458 | 2.30 |
ENST00000377928.3
|
ADCY8
|
adenylate cyclase 8 (brain) |
| chr19_+_30302805 | 2.28 |
ENST00000262643.3
ENST00000575243.1 ENST00000357943.5 |
CCNE1
|
cyclin E1 |
| chr22_+_29876197 | 2.28 |
ENST00000310624.6
|
NEFH
|
neurofilament, heavy polypeptide |
| chr6_-_31864977 | 2.26 |
ENST00000395728.3
ENST00000375528.4 |
EHMT2
|
euchromatic histone-lysine N-methyltransferase 2 |
| chr6_-_13711773 | 2.25 |
ENST00000011619.3
|
RANBP9
|
RAN binding protein 9 |
| chr4_-_7044657 | 2.24 |
ENST00000310085.4
|
CCDC96
|
coiled-coil domain containing 96 |
| chr12_-_99288986 | 2.23 |
ENST00000552407.1
ENST00000551613.1 ENST00000548447.1 ENST00000546364.3 ENST00000552748.1 |
ANKS1B
|
ankyrin repeat and sterile alpha motif domain containing 1B |
| chr7_+_29874341 | 2.22 |
ENST00000409290.1
ENST00000242140.5 |
WIPF3
|
WAS/WASL interacting protein family, member 3 |
| chr19_+_35634146 | 2.21 |
ENST00000586063.1
ENST00000270310.2 ENST00000588265.1 |
FXYD7
|
FXYD domain containing ion transport regulator 7 |
| chr17_-_37353950 | 2.21 |
ENST00000394310.3
ENST00000394303.3 ENST00000344140.5 |
CACNB1
|
calcium channel, voltage-dependent, beta 1 subunit |
| chr4_+_2061119 | 2.20 |
ENST00000423729.2
|
NAT8L
|
N-acetyltransferase 8-like (GCN5-related, putative) |
| chr12_+_113012831 | 2.19 |
ENST00000547686.1
ENST00000543106.2 ENST00000551593.1 ENST00000546426.1 ENST00000551748.1 |
RPH3A
|
rabphilin 3A homolog (mouse) |
| chr19_+_12944722 | 2.16 |
ENST00000591495.1
|
MAST1
|
microtubule associated serine/threonine kinase 1 |
| chr1_-_200992827 | 2.15 |
ENST00000332129.2
ENST00000422435.2 |
KIF21B
|
kinesin family member 21B |
| chrX_-_108868390 | 2.15 |
ENST00000372101.2
|
KCNE1L
|
KCNE1-like |
| chr18_-_70535177 | 2.15 |
ENST00000327305.6
|
NETO1
|
neuropilin (NRP) and tolloid (TLL)-like 1 |
| chr20_+_37353084 | 2.14 |
ENST00000217420.1
|
SLC32A1
|
solute carrier family 32 (GABA vesicular transporter), member 1 |
| chr17_-_58469687 | 2.13 |
ENST00000590133.1
|
USP32
|
ubiquitin specific peptidase 32 |
| chr10_+_105314881 | 2.13 |
ENST00000437579.1
|
NEURL
|
neuralized E3 ubiquitin protein ligase 1 |
| chr1_-_6240183 | 2.12 |
ENST00000262450.3
ENST00000378021.1 |
CHD5
|
chromodomain helicase DNA binding protein 5 |
| chr19_-_42498231 | 2.12 |
ENST00000602133.1
|
ATP1A3
|
ATPase, Na+/K+ transporting, alpha 3 polypeptide |
| chr1_-_91182794 | 2.11 |
ENST00000370445.4
|
BARHL2
|
BarH-like homeobox 2 |
| chr2_+_74212073 | 2.09 |
ENST00000441217.1
|
AC073046.25
|
AC073046.25 |
| chr7_-_139876734 | 2.09 |
ENST00000006967.5
|
JHDM1D
|
lysine (K)-specific demethylase 7A |
| chr19_+_50094866 | 2.09 |
ENST00000418929.2
|
PRR12
|
proline rich 12 |
| chr4_+_4388805 | 2.08 |
ENST00000504171.1
|
NSG1
|
Homo sapiens neuron specific gene family member 1 (NSG1), transcript variant 3, mRNA. |
| chrX_+_147582130 | 2.06 |
ENST00000370460.2
ENST00000370457.5 |
AFF2
|
AF4/FMR2 family, member 2 |
| chr20_+_57466629 | 2.05 |
ENST00000371081.1
ENST00000338783.6 |
GNAS
|
GNAS complex locus |
| chr1_+_156611960 | 2.05 |
ENST00000361588.5
|
BCAN
|
brevican |
| chr7_-_105029329 | 2.04 |
ENST00000393651.3
ENST00000460391.1 |
SRPK2
|
SRSF protein kinase 2 |
| chr16_+_2039946 | 2.03 |
ENST00000248121.2
ENST00000568896.1 |
SYNGR3
|
synaptogyrin 3 |
| chr18_+_54814288 | 2.01 |
ENST00000585477.1
|
BOD1L2
|
biorientation of chromosomes in cell division 1-like 2 |
| chr1_-_35395178 | 2.00 |
ENST00000373347.1
|
DLGAP3
|
discs, large (Drosophila) homolog-associated protein 3 |
| chr4_-_153457197 | 2.00 |
ENST00000281708.4
|
FBXW7
|
F-box and WD repeat domain containing 7, E3 ubiquitin protein ligase |
| chr12_-_99288536 | 2.00 |
ENST00000549797.1
ENST00000333732.7 ENST00000341752.7 |
ANKS1B
|
ankyrin repeat and sterile alpha motif domain containing 1B |
| chr5_-_131347501 | 2.00 |
ENST00000543479.1
|
ACSL6
|
acyl-CoA synthetase long-chain family member 6 |
| chr1_-_53793584 | 1.99 |
ENST00000354412.3
ENST00000347547.2 ENST00000306052.6 |
LRP8
|
low density lipoprotein receptor-related protein 8, apolipoprotein e receptor |
| chr8_-_141645645 | 1.98 |
ENST00000519980.1
ENST00000220592.5 |
AGO2
|
argonaute RISC catalytic component 2 |
| chr2_-_191399073 | 1.98 |
ENST00000421038.1
|
TMEM194B
|
transmembrane protein 194B |
| chr4_-_102268628 | 1.98 |
ENST00000323055.6
ENST00000512215.1 ENST00000394854.3 |
PPP3CA
|
protein phosphatase 3, catalytic subunit, alpha isozyme |
| chr4_+_147560042 | 1.97 |
ENST00000281321.3
|
POU4F2
|
POU class 4 homeobox 2 |
| chr8_-_142318398 | 1.97 |
ENST00000520137.1
|
SLC45A4
|
solute carrier family 45, member 4 |
| chr7_-_140179146 | 1.96 |
ENST00000437223.2
|
MKRN1
|
makorin ring finger protein 1 |
| chr10_-_134599556 | 1.96 |
ENST00000368592.5
|
NKX6-2
|
NK6 homeobox 2 |
| chr5_+_167956121 | 1.96 |
ENST00000338333.4
|
FBLL1
|
fibrillarin-like 1 |
| chr22_-_17602200 | 1.96 |
ENST00000399875.1
|
CECR6
|
cat eye syndrome chromosome region, candidate 6 |
| chr13_+_88324870 | 1.95 |
ENST00000325089.6
|
SLITRK5
|
SLIT and NTRK-like family, member 5 |
| chr2_+_220306238 | 1.95 |
ENST00000435853.1
|
SPEG
|
SPEG complex locus |
| chr5_-_127873659 | 1.95 |
ENST00000262464.4
|
FBN2
|
fibrillin 2 |
| chr16_+_23847267 | 1.92 |
ENST00000321728.7
|
PRKCB
|
protein kinase C, beta |
| chr17_+_30814707 | 1.91 |
ENST00000584792.1
|
CDK5R1
|
cyclin-dependent kinase 5, regulatory subunit 1 (p35) |
| chr16_-_17564738 | 1.91 |
ENST00000261381.6
|
XYLT1
|
xylosyltransferase I |
| chr11_+_125774258 | 1.91 |
ENST00000263576.6
|
DDX25
|
DEAD (Asp-Glu-Ala-Asp) box helicase 25 |
| chr10_-_103535657 | 1.90 |
ENST00000344255.3
ENST00000320185.2 ENST00000346714.3 ENST00000347978.2 |
FGF8
|
fibroblast growth factor 8 (androgen-induced) |
| chr21_+_34398153 | 1.89 |
ENST00000382357.3
ENST00000430860.1 ENST00000333337.3 |
OLIG2
|
oligodendrocyte lineage transcription factor 2 |
| chr15_+_92397051 | 1.89 |
ENST00000424469.2
|
SLCO3A1
|
solute carrier organic anion transporter family, member 3A1 |
| chr16_+_6069586 | 1.87 |
ENST00000547372.1
|
RBFOX1
|
RNA binding protein, fox-1 homolog (C. elegans) 1 |
| chr9_-_23821273 | 1.86 |
ENST00000380110.4
|
ELAVL2
|
ELAV like neuron-specific RNA binding protein 2 |
| chr2_-_46769694 | 1.86 |
ENST00000522587.1
|
ATP6V1E2
|
ATPase, H+ transporting, lysosomal 31kDa, V1 subunit E2 |
| chrX_-_139587225 | 1.86 |
ENST00000370536.2
|
SOX3
|
SRY (sex determining region Y)-box 3 |
| chr22_-_37823468 | 1.86 |
ENST00000402918.2
|
ELFN2
|
extracellular leucine-rich repeat and fibronectin type III domain containing 2 |
| chr1_-_241520525 | 1.84 |
ENST00000366565.1
|
RGS7
|
regulator of G-protein signaling 7 |
| chr19_-_6502341 | 1.83 |
ENST00000598006.1
ENST00000601152.1 |
TUBB4A
|
tubulin, beta 4A class IVa |
| chr10_-_134121438 | 1.83 |
ENST00000298630.3
|
STK32C
|
serine/threonine kinase 32C |
| chr15_+_76352178 | 1.83 |
ENST00000388942.3
|
C15orf27
|
chromosome 15 open reading frame 27 |
| chr1_+_156611900 | 1.83 |
ENST00000457777.2
ENST00000424639.1 |
BCAN
|
brevican |
| chr6_-_84418841 | 1.82 |
ENST00000369694.2
ENST00000195649.6 |
SNAP91
|
synaptosomal-associated protein, 91kDa |
| chr5_+_110559603 | 1.82 |
ENST00000512453.1
|
CAMK4
|
calcium/calmodulin-dependent protein kinase IV |
| chr7_-_140179276 | 1.81 |
ENST00000443720.2
ENST00000255977.2 |
MKRN1
|
makorin ring finger protein 1 |
| chr3_-_62860878 | 1.79 |
ENST00000283269.9
|
CADPS
|
Ca++-dependent secretion activator |
| chr11_-_77184739 | 1.79 |
ENST00000524847.1
|
PAK1
|
p21 protein (Cdc42/Rac)-activated kinase 1 |
| chr9_+_82187487 | 1.79 |
ENST00000435650.1
ENST00000414465.1 ENST00000376537.4 ENST00000376534.4 |
TLE4
|
transducin-like enhancer of split 4 (E(sp1) homolog, Drosophila) |
| chr11_+_48002076 | 1.77 |
ENST00000418331.2
ENST00000440289.2 |
PTPRJ
|
protein tyrosine phosphatase, receptor type, J |
| chr19_-_51222707 | 1.77 |
ENST00000391814.1
|
SHANK1
|
SH3 and multiple ankyrin repeat domains 1 |
| chr4_-_102268484 | 1.76 |
ENST00000394853.4
|
PPP3CA
|
protein phosphatase 3, catalytic subunit, alpha isozyme |
| chrX_-_125299934 | 1.75 |
ENST00000360028.2
ENST00000538699.1 |
DCAF12L2
|
DDB1 and CUL4 associated factor 12-like 2 |
| chr18_-_70534745 | 1.74 |
ENST00000583169.1
|
NETO1
|
neuropilin (NRP) and tolloid (TLL)-like 1 |
| chrX_+_147582228 | 1.74 |
ENST00000342251.3
|
AFF2
|
AF4/FMR2 family, member 2 |
| chr12_+_7023735 | 1.73 |
ENST00000538763.1
ENST00000544774.1 ENST00000545045.2 |
ENO2
|
enolase 2 (gamma, neuronal) |
| chr6_-_36807762 | 1.73 |
ENST00000244751.2
|
CPNE5
|
copine V |
| chr3_-_71802760 | 1.73 |
ENST00000295612.3
|
EIF4E3
|
eukaryotic translation initiation factor 4E family member 3 |
| chr17_+_78234625 | 1.73 |
ENST00000508628.2
ENST00000582970.1 ENST00000456466.1 ENST00000319921.4 |
RNF213
|
ring finger protein 213 |
| chrX_+_49644470 | 1.73 |
ENST00000508866.2
|
USP27X
|
ubiquitin specific peptidase 27, X-linked |
| chr11_-_129149197 | 1.72 |
ENST00000525234.1
|
ARHGAP32
|
Rho GTPase activating protein 32 |
| chr1_+_77747656 | 1.72 |
ENST00000354567.2
|
AK5
|
adenylate kinase 5 |
| chr20_-_62130474 | 1.71 |
ENST00000217182.3
|
EEF1A2
|
eukaryotic translation elongation factor 1 alpha 2 |
| chr14_-_65346555 | 1.71 |
ENST00000542895.1
ENST00000556626.1 |
SPTB
|
spectrin, beta, erythrocytic |
| chr5_+_7396141 | 1.71 |
ENST00000338316.4
|
ADCY2
|
adenylate cyclase 2 (brain) |
| chr19_-_46000251 | 1.70 |
ENST00000590526.1
ENST00000344680.4 ENST00000245923.4 |
RTN2
|
reticulon 2 |
| chr5_-_131347583 | 1.70 |
ENST00000379255.1
ENST00000430403.1 ENST00000544770.1 ENST00000379246.1 ENST00000414078.1 ENST00000441995.1 |
ACSL6
|
acyl-CoA synthetase long-chain family member 6 |
| chr7_-_44365020 | 1.70 |
ENST00000395747.2
ENST00000347193.4 ENST00000346990.4 ENST00000258682.6 ENST00000353625.4 ENST00000421607.1 ENST00000424197.1 ENST00000502837.2 ENST00000350811.3 ENST00000395749.2 |
CAMK2B
|
calcium/calmodulin-dependent protein kinase II beta |
| chr20_-_49547910 | 1.70 |
ENST00000396032.3
|
ADNP
|
activity-dependent neuroprotector homeobox |
| chr4_-_44450814 | 1.69 |
ENST00000360029.3
|
KCTD8
|
potassium channel tetramerization domain containing 8 |
| chr22_-_19279201 | 1.69 |
ENST00000353891.5
ENST00000263200.10 ENST00000427926.1 ENST00000449918.1 |
CLTCL1
|
clathrin, heavy chain-like 1 |
| chr8_-_144512576 | 1.69 |
ENST00000333480.2
|
MAFA
|
v-maf avian musculoaponeurotic fibrosarcoma oncogene homolog A |
| chr8_+_24771265 | 1.68 |
ENST00000518131.1
ENST00000437366.2 |
NEFM
|
neurofilament, medium polypeptide |
| chrX_-_142722897 | 1.67 |
ENST00000338017.4
|
SLITRK4
|
SLIT and NTRK-like family, member 4 |
| chr17_+_64298944 | 1.67 |
ENST00000413366.3
|
PRKCA
|
protein kinase C, alpha |
| chr3_+_54156664 | 1.67 |
ENST00000474759.1
ENST00000288197.5 |
CACNA2D3
|
calcium channel, voltage-dependent, alpha 2/delta subunit 3 |
| chr9_+_841690 | 1.67 |
ENST00000382276.3
|
DMRT1
|
doublesex and mab-3 related transcription factor 1 |
| chr5_+_443280 | 1.66 |
ENST00000508022.1
|
EXOC3
|
exocyst complex component 3 |
| chr3_-_13921594 | 1.66 |
ENST00000285018.4
|
WNT7A
|
wingless-type MMTV integration site family, member 7A |
| chr3_-_18466787 | 1.65 |
ENST00000338745.6
ENST00000450898.1 |
SATB1
|
SATB homeobox 1 |
| chr18_+_49866496 | 1.65 |
ENST00000442544.2
|
DCC
|
deleted in colorectal carcinoma |
| chr19_-_6502590 | 1.65 |
ENST00000264071.2
|
TUBB4A
|
tubulin, beta 4A class IVa |
| chr6_-_84418738 | 1.64 |
ENST00000519779.1
|
SNAP91
|
synaptosomal-associated protein, 91kDa |
| chr16_+_6069664 | 1.64 |
ENST00000422070.4
|
RBFOX1
|
RNA binding protein, fox-1 homolog (C. elegans) 1 |
| chr11_+_120382417 | 1.64 |
ENST00000527524.2
ENST00000375081.2 |
GRIK4
AP002348.1
|
glutamate receptor, ionotropic, kainate 4 Uncharacterized protein |
| chr16_-_30022735 | 1.64 |
ENST00000564944.1
|
DOC2A
|
double C2-like domains, alpha |
| chr7_+_103969104 | 1.63 |
ENST00000424859.1
ENST00000535008.1 ENST00000401970.2 ENST00000543266.1 |
LHFPL3
|
lipoma HMGIC fusion partner-like 3 |
| chrX_-_153095945 | 1.62 |
ENST00000164640.4
|
PDZD4
|
PDZ domain containing 4 |
| chr20_+_1206679 | 1.62 |
ENST00000402452.1
ENST00000409241.1 ENST00000381882.2 ENST00000246108.3 |
RAD21L1
|
RAD21-like 1 (S. pombe) |
| chr7_-_140178726 | 1.61 |
ENST00000480552.1
|
MKRN1
|
makorin ring finger protein 1 |
| chr7_+_145813453 | 1.61 |
ENST00000361727.3
|
CNTNAP2
|
contactin associated protein-like 2 |
| chr15_+_89905705 | 1.61 |
ENST00000560008.1
ENST00000561327.1 |
LINC00925
|
long intergenic non-protein coding RNA 925 |
| chr8_+_104512976 | 1.61 |
ENST00000504942.2
|
RIMS2
|
regulating synaptic membrane exocytosis 2 |
| chr6_-_143266297 | 1.60 |
ENST00000367603.2
|
HIVEP2
|
human immunodeficiency virus type I enhancer binding protein 2 |
| chr4_-_113437328 | 1.60 |
ENST00000313341.3
|
NEUROG2
|
neurogenin 2 |
| chr18_+_77160282 | 1.60 |
ENST00000318065.5
ENST00000545796.1 ENST00000592223.1 ENST00000329101.4 ENST00000586434.1 |
NFATC1
|
nuclear factor of activated T-cells, cytoplasmic, calcineurin-dependent 1 |
| chr12_-_49393092 | 1.60 |
ENST00000421952.2
|
DDN
|
dendrin |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.9 | 7.7 | GO:1905205 | positive regulation of connective tissue replacement(GO:1905205) |
| 1.5 | 4.5 | GO:0021718 | superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
| 1.4 | 5.7 | GO:0035408 | histone H3-T6 phosphorylation(GO:0035408) |
| 1.4 | 4.1 | GO:0002372 | myeloid dendritic cell cytokine production(GO:0002372) |
| 1.4 | 8.2 | GO:0035063 | nuclear speck organization(GO:0035063) |
| 1.3 | 4.0 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
| 1.0 | 5.2 | GO:2000313 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
| 0.9 | 0.9 | GO:0031630 | regulation of synaptic vesicle fusion to presynaptic membrane(GO:0031630) |
| 0.9 | 2.7 | GO:0072034 | renal vesicle induction(GO:0072034) |
| 0.9 | 2.7 | GO:1903452 | regulation of G1 to G0 transition(GO:1903450) positive regulation of G1 to G0 transition(GO:1903452) |
| 0.9 | 3.5 | GO:0099525 | presynaptic dense core granule exocytosis(GO:0099525) |
| 0.9 | 7.7 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 0.9 | 2.6 | GO:0071109 | superior temporal gyrus development(GO:0071109) |
| 0.8 | 1.7 | GO:2000569 | T-helper 2 cell activation(GO:0035712) regulation of T-helper 2 cell activation(GO:2000569) positive regulation of T-helper 2 cell activation(GO:2000570) |
| 0.8 | 2.5 | GO:0097534 | lymphoid lineage cell migration(GO:0097534) lymphoid lineage cell migration into thymus(GO:0097535) |
| 0.8 | 2.5 | GO:0040040 | thermosensory behavior(GO:0040040) |
| 0.8 | 4.1 | GO:0072233 | thick ascending limb development(GO:0072023) metanephric thick ascending limb development(GO:0072233) |
| 0.8 | 0.8 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
| 0.8 | 3.9 | GO:2000312 | regulation of kainate selective glutamate receptor activity(GO:2000312) |
| 0.8 | 2.3 | GO:0021529 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 0.7 | 2.2 | GO:0019858 | cytosine metabolic process(GO:0019858) |
| 0.7 | 1.4 | GO:0044029 | DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
| 0.7 | 4.9 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.7 | 4.1 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.7 | 4.1 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
| 0.7 | 4.7 | GO:0032252 | secretory granule localization(GO:0032252) |
| 0.7 | 2.6 | GO:0006542 | glutamine biosynthetic process(GO:0006542) |
| 0.7 | 2.0 | GO:0034963 | box C/D snoRNA 3'-end processing(GO:0000494) box C/D snoRNA metabolic process(GO:0033967) box C/D snoRNA processing(GO:0034963) histone glutamine methylation(GO:1990258) |
| 0.7 | 2.0 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
| 0.6 | 3.2 | GO:0019230 | proprioception(GO:0019230) |
| 0.6 | 3.1 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
| 0.6 | 2.5 | GO:0031133 | regulation of axon diameter(GO:0031133) |
| 0.6 | 0.6 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
| 0.6 | 3.0 | GO:2000639 | regulation of SREBP signaling pathway(GO:2000638) negative regulation of SREBP signaling pathway(GO:2000639) |
| 0.6 | 1.8 | GO:0050894 | determination of affect(GO:0050894) |
| 0.6 | 2.9 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.6 | 2.3 | GO:1904800 | regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.6 | 1.7 | GO:0006173 | dADP biosynthetic process(GO:0006173) |
| 0.6 | 13.9 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.5 | 8.8 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.5 | 0.5 | GO:0019368 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation(GO:0030497) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.5 | 1.1 | GO:0021586 | pons maturation(GO:0021586) |
| 0.5 | 2.1 | GO:1902869 | regulation of amacrine cell differentiation(GO:1902869) |
| 0.5 | 2.1 | GO:0046671 | negative regulation of cellular pH reduction(GO:0032848) CD8-positive, alpha-beta T cell lineage commitment(GO:0043375) negative regulation of retinal cell programmed cell death(GO:0046671) |
| 0.5 | 2.6 | GO:1904566 | response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 0.5 | 5.0 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.5 | 3.5 | GO:2000567 | memory T cell activation(GO:0035709) regulation of memory T cell activation(GO:2000567) positive regulation of memory T cell activation(GO:2000568) |
| 0.5 | 1.5 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.5 | 1.5 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
| 0.5 | 4.8 | GO:0021840 | directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) |
| 0.5 | 2.9 | GO:1902499 | positive regulation of protein autoubiquitination(GO:1902499) |
| 0.5 | 2.4 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
| 0.5 | 0.5 | GO:0050909 | sensory perception of taste(GO:0050909) |
| 0.5 | 0.9 | GO:0060999 | positive regulation of dendritic spine development(GO:0060999) |
| 0.5 | 1.4 | GO:0031548 | regulation of brain-derived neurotrophic factor receptor signaling pathway(GO:0031548) |
| 0.4 | 1.3 | GO:0033058 | directional locomotion(GO:0033058) |
| 0.4 | 0.4 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
| 0.4 | 4.4 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.4 | 0.4 | GO:0021511 | spinal cord patterning(GO:0021511) |
| 0.4 | 5.2 | GO:0071321 | cellular response to cGMP(GO:0071321) |
| 0.4 | 1.7 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.4 | 9.0 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.4 | 0.4 | GO:1900449 | regulation of glutamate receptor signaling pathway(GO:1900449) |
| 0.4 | 3.0 | GO:1990539 | fructose import(GO:0032445) carbohydrate import into cell(GO:0097319) carbohydrate import across plasma membrane(GO:0098704) fructose import across plasma membrane(GO:1990539) |
| 0.4 | 2.6 | GO:0071543 | diadenosine polyphosphate catabolic process(GO:0015961) diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
| 0.4 | 0.4 | GO:0042756 | drinking behavior(GO:0042756) |
| 0.4 | 4.2 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.4 | 1.7 | GO:0007206 | phospholipase C-activating G-protein coupled glutamate receptor signaling pathway(GO:0007206) |
| 0.4 | 1.2 | GO:0045720 | negative regulation of integrin biosynthetic process(GO:0045720) |
| 0.4 | 1.2 | GO:0060168 | positive regulation of adenosine receptor signaling pathway(GO:0060168) |
| 0.4 | 1.2 | GO:1902103 | metaphase/anaphase transition of meiotic cell cycle(GO:0044785) regulation of metaphase/anaphase transition of meiotic cell cycle(GO:1902102) negative regulation of metaphase/anaphase transition of meiotic cell cycle(GO:1902103) regulation of meiotic chromosome separation(GO:1905132) negative regulation of meiotic chromosome separation(GO:1905133) |
| 0.4 | 1.2 | GO:0071629 | cytoplasm-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071629) |
| 0.4 | 2.8 | GO:0006540 | glutamate decarboxylation to succinate(GO:0006540) |
| 0.4 | 3.5 | GO:0099590 | neurotransmitter receptor internalization(GO:0099590) |
| 0.4 | 2.3 | GO:0060997 | dendritic spine morphogenesis(GO:0060997) |
| 0.4 | 1.5 | GO:0007538 | primary sex determination(GO:0007538) |
| 0.4 | 14.7 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.4 | 0.4 | GO:0002663 | B cell tolerance induction(GO:0002514) regulation of B cell tolerance induction(GO:0002661) positive regulation of B cell tolerance induction(GO:0002663) |
| 0.4 | 3.4 | GO:0060025 | regulation of synaptic activity(GO:0060025) |
| 0.4 | 2.6 | GO:0090625 | mRNA cleavage involved in gene silencing by siRNA(GO:0090625) |
| 0.4 | 2.6 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.4 | 1.1 | GO:2000687 | negative regulation of rubidium ion transport(GO:2000681) negative regulation of rubidium ion transmembrane transporter activity(GO:2000687) |
| 0.4 | 1.1 | GO:0034085 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.4 | 3.3 | GO:1990034 | calcium ion export from cell(GO:1990034) |
| 0.4 | 3.7 | GO:0033183 | negative regulation of histone ubiquitination(GO:0033183) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) |
| 0.4 | 1.1 | GO:0036060 | filtration diaphragm assembly(GO:0036058) slit diaphragm assembly(GO:0036060) |
| 0.4 | 1.1 | GO:1904397 | negative regulation of neuromuscular junction development(GO:1904397) |
| 0.4 | 2.5 | GO:0015798 | myo-inositol transport(GO:0015798) |
| 0.4 | 1.1 | GO:1905051 | regulation of base-excision repair(GO:1905051) positive regulation of base-excision repair(GO:1905053) |
| 0.4 | 1.8 | GO:1901091 | regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
| 0.4 | 0.7 | GO:0034453 | microtubule anchoring(GO:0034453) |
| 0.4 | 4.6 | GO:1903416 | response to glycoside(GO:1903416) |
| 0.3 | 2.8 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.3 | 1.0 | GO:0097503 | sialylation(GO:0097503) |
| 0.3 | 1.0 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
| 0.3 | 3.1 | GO:0097116 | gephyrin clustering involved in postsynaptic density assembly(GO:0097116) |
| 0.3 | 2.8 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
| 0.3 | 1.0 | GO:0033037 | polysaccharide localization(GO:0033037) |
| 0.3 | 1.0 | GO:0044727 | DNA demethylation of male pronucleus(GO:0044727) |
| 0.3 | 1.0 | GO:0060166 | olfactory pit development(GO:0060166) |
| 0.3 | 1.0 | GO:0051758 | homologous chromosome movement towards spindle pole involved in homologous chromosome segregation(GO:0051758) |
| 0.3 | 3.4 | GO:0060573 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 0.3 | 3.7 | GO:0098814 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
| 0.3 | 1.7 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.3 | 1.3 | GO:0098582 | innate vocalization behavior(GO:0098582) |
| 0.3 | 1.3 | GO:0016598 | protein arginylation(GO:0016598) |
| 0.3 | 1.7 | GO:0010157 | response to chlorate(GO:0010157) |
| 0.3 | 4.3 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.3 | 0.7 | GO:0036146 | cellular response to mycotoxin(GO:0036146) |
| 0.3 | 1.6 | GO:0099553 | trans-synaptic signaling by lipid, modulating synaptic transmission(GO:0099552) trans-synaptic signaling by endocannabinoid, modulating synaptic transmission(GO:0099553) |
| 0.3 | 1.0 | GO:0044861 | protein transport into plasma membrane raft(GO:0044861) |
| 0.3 | 2.2 | GO:0033484 | nitric oxide homeostasis(GO:0033484) |
| 0.3 | 1.3 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.3 | 2.5 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.3 | 1.3 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.3 | 0.3 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
| 0.3 | 0.9 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
| 0.3 | 2.8 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.3 | 1.2 | GO:0007068 | negative regulation of transcription during mitosis(GO:0007068) negative regulation of transcription from RNA polymerase II promoter during mitosis(GO:0007070) |
| 0.3 | 2.8 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) |
| 0.3 | 6.5 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.3 | 1.2 | GO:1903566 | positive regulation of protein localization to cilium(GO:1903566) |
| 0.3 | 2.1 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.3 | 0.9 | GO:0035508 | positive regulation of myosin-light-chain-phosphatase activity(GO:0035508) |
| 0.3 | 0.9 | GO:1904886 | beta-catenin destruction complex disassembly(GO:1904886) |
| 0.3 | 1.5 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
| 0.3 | 0.9 | GO:0046832 | negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.3 | 1.5 | GO:1901503 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) ether biosynthetic process(GO:1901503) |
| 0.3 | 0.6 | GO:0021846 | cell proliferation in forebrain(GO:0021846) |
| 0.3 | 0.3 | GO:0060364 | frontal suture morphogenesis(GO:0060364) |
| 0.3 | 1.2 | GO:0071469 | detection of mechanical stimulus involved in sensory perception of touch(GO:0050976) cellular response to alkaline pH(GO:0071469) |
| 0.3 | 13.1 | GO:2000300 | regulation of synaptic vesicle exocytosis(GO:2000300) |
| 0.3 | 0.6 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
| 0.3 | 1.8 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
| 0.3 | 4.4 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.3 | 0.9 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
| 0.3 | 2.9 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.3 | 0.9 | GO:1904017 | cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.3 | 0.3 | GO:0042940 | D-amino acid transport(GO:0042940) |
| 0.3 | 0.6 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.3 | 1.4 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
| 0.3 | 2.0 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
| 0.3 | 0.3 | GO:0003032 | detection of oxygen(GO:0003032) |
| 0.3 | 1.4 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.3 | 3.1 | GO:0035583 | sequestering of TGFbeta in extracellular matrix(GO:0035583) |
| 0.3 | 0.8 | GO:1901340 | negative regulation of store-operated calcium channel activity(GO:1901340) |
| 0.3 | 8.3 | GO:0006337 | nucleosome disassembly(GO:0006337) |
| 0.3 | 0.8 | GO:0001172 | transcription, RNA-templated(GO:0001172) |
| 0.3 | 1.1 | GO:1904978 | regulation of endosome organization(GO:1904978) |
| 0.3 | 0.8 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
| 0.3 | 0.3 | GO:0014029 | neural crest formation(GO:0014029) |
| 0.3 | 1.9 | GO:2001034 | positive regulation of double-strand break repair via nonhomologous end joining(GO:2001034) |
| 0.3 | 0.8 | GO:1990108 | protein linear deubiquitination(GO:1990108) |
| 0.3 | 1.6 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
| 0.3 | 0.5 | GO:0044340 | canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
| 0.3 | 1.8 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.3 | 2.1 | GO:1901189 | positive regulation of ephrin receptor signaling pathway(GO:1901189) positive regulation of canonical Wnt signaling pathway involved in cardiac muscle cell fate commitment(GO:1901297) positive regulation of canonical Wnt signaling pathway involved in heart development(GO:1905068) |
| 0.3 | 1.3 | GO:0090650 | response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
| 0.3 | 0.8 | GO:0060629 | regulation of homologous chromosome segregation(GO:0060629) |
| 0.3 | 2.5 | GO:0097338 | response to clozapine(GO:0097338) |
| 0.3 | 1.3 | GO:0060460 | subthalamic nucleus development(GO:0021763) prolactin secreting cell differentiation(GO:0060127) left lung morphogenesis(GO:0060460) superior vena cava morphogenesis(GO:0060578) |
| 0.2 | 0.7 | GO:1904562 | phosphatidylinositol 5-phosphate metabolic process(GO:1904562) |
| 0.2 | 0.7 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.2 | 3.9 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.2 | 1.0 | GO:0009386 | translational attenuation(GO:0009386) |
| 0.2 | 5.8 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
| 0.2 | 0.7 | GO:0035566 | regulation of metanephros size(GO:0035566) |
| 0.2 | 1.4 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 0.2 | 0.5 | GO:1901383 | negative regulation of chorionic trophoblast cell proliferation(GO:1901383) |
| 0.2 | 1.2 | GO:0007198 | adenylate cyclase-inhibiting serotonin receptor signaling pathway(GO:0007198) |
| 0.2 | 1.2 | GO:0042539 | hypotonic salinity response(GO:0042539) cellular hypotonic salinity response(GO:0071477) |
| 0.2 | 2.1 | GO:1902748 | positive regulation of lens fiber cell differentiation(GO:1902748) |
| 0.2 | 5.8 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.2 | 0.9 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.2 | 1.2 | GO:1902659 | regulation of glucose mediated signaling pathway(GO:1902659) |
| 0.2 | 1.1 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
| 0.2 | 5.4 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
| 0.2 | 2.3 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.2 | 1.1 | GO:0072709 | cellular response to sorbitol(GO:0072709) |
| 0.2 | 1.8 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.2 | 11.6 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.2 | 0.7 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
| 0.2 | 2.7 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
| 0.2 | 1.1 | GO:1905075 | occluding junction disassembly(GO:1905071) regulation of occluding junction disassembly(GO:1905073) positive regulation of occluding junction disassembly(GO:1905075) |
| 0.2 | 2.2 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.2 | 0.4 | GO:1900226 | negative regulation of NLRP3 inflammasome complex assembly(GO:1900226) |
| 0.2 | 1.3 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.2 | 0.7 | GO:2000742 | anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 0.2 | 0.4 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.2 | 0.6 | GO:1902746 | regulation of lens fiber cell differentiation(GO:1902746) |
| 0.2 | 0.2 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.2 | 3.4 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
| 0.2 | 0.4 | GO:2000758 | positive regulation of histone acetylation(GO:0035066) positive regulation of peptidyl-lysine acetylation(GO:2000758) |
| 0.2 | 1.5 | GO:0060013 | righting reflex(GO:0060013) |
| 0.2 | 0.6 | GO:0050760 | negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
| 0.2 | 0.2 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
| 0.2 | 0.8 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.2 | 0.4 | GO:0032915 | positive regulation of transforming growth factor beta2 production(GO:0032915) |
| 0.2 | 0.2 | GO:1902595 | regulation of DNA replication origin binding(GO:1902595) |
| 0.2 | 0.4 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.2 | 0.4 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.2 | 0.4 | GO:0014908 | myotube differentiation involved in skeletal muscle regeneration(GO:0014908) |
| 0.2 | 1.0 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.2 | 0.6 | GO:0061181 | regulation of chondrocyte development(GO:0061181) |
| 0.2 | 1.4 | GO:0016188 | synaptic vesicle maturation(GO:0016188) |
| 0.2 | 0.6 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
| 0.2 | 1.9 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
| 0.2 | 0.8 | GO:2000176 | regulation of pro-T cell differentiation(GO:2000174) positive regulation of pro-T cell differentiation(GO:2000176) |
| 0.2 | 0.6 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.2 | 0.6 | GO:0044771 | meiotic cell cycle phase transition(GO:0044771) regulation of meiotic cell cycle phase transition(GO:1901993) |
| 0.2 | 0.4 | GO:2000255 | regulation of male germ cell proliferation(GO:2000254) negative regulation of male germ cell proliferation(GO:2000255) |
| 0.2 | 0.6 | GO:0042414 | epinephrine metabolic process(GO:0042414) epinephrine biosynthetic process(GO:0042418) |
| 0.2 | 0.6 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) type B pancreatic cell maturation(GO:0072560) |
| 0.2 | 2.4 | GO:0021702 | cerebellar Purkinje cell layer formation(GO:0021694) cerebellar Purkinje cell differentiation(GO:0021702) |
| 0.2 | 0.2 | GO:0043486 | histone exchange(GO:0043486) |
| 0.2 | 0.9 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.2 | 1.9 | GO:0042670 | retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
| 0.2 | 1.5 | GO:0019236 | response to pheromone(GO:0019236) |
| 0.2 | 0.6 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
| 0.2 | 3.2 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.2 | 3.1 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.2 | 0.2 | GO:0048769 | sarcomerogenesis(GO:0048769) |
| 0.2 | 1.1 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
| 0.2 | 1.3 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.2 | 0.6 | GO:1903461 | Okazaki fragment processing involved in mitotic DNA replication(GO:1903461) |
| 0.2 | 1.3 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.2 | 1.5 | GO:0003322 | pancreatic A cell development(GO:0003322) |
| 0.2 | 1.3 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.2 | 0.5 | GO:0090630 | activation of GTPase activity(GO:0090630) |
| 0.2 | 1.4 | GO:0032484 | Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
| 0.2 | 4.1 | GO:0034587 | piRNA metabolic process(GO:0034587) |
| 0.2 | 1.8 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
| 0.2 | 0.9 | GO:2001074 | regulation of metanephric ureteric bud development(GO:2001074) positive regulation of metanephric ureteric bud development(GO:2001076) |
| 0.2 | 6.4 | GO:0097484 | dendrite extension(GO:0097484) |
| 0.2 | 0.7 | GO:0045356 | positive regulation of interferon-alpha biosynthetic process(GO:0045356) |
| 0.2 | 0.2 | GO:0021898 | commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
| 0.2 | 0.5 | GO:0001579 | medium-chain fatty acid transport(GO:0001579) |
| 0.2 | 0.9 | GO:0038169 | somatostatin receptor signaling pathway(GO:0038169) somatostatin signaling pathway(GO:0038170) |
| 0.2 | 1.4 | GO:0048630 | skeletal muscle tissue growth(GO:0048630) |
| 0.2 | 0.2 | GO:0099543 | retrograde trans-synaptic signaling by soluble gas(GO:0098923) trans-synaptic signaling by soluble gas(GO:0099543) |
| 0.2 | 0.7 | GO:0070843 | misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 0.2 | 3.1 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.2 | 0.7 | GO:0099566 | regulation of postsynaptic cytosolic calcium ion concentration(GO:0099566) |
| 0.2 | 2.1 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
| 0.2 | 1.0 | GO:1903527 | positive regulation of membrane tubulation(GO:1903527) |
| 0.2 | 2.2 | GO:0034398 | telomere tethering at nuclear periphery(GO:0034398) |
| 0.2 | 1.4 | GO:0010459 | negative regulation of heart rate(GO:0010459) |
| 0.2 | 0.9 | GO:0035983 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
| 0.2 | 1.5 | GO:0045988 | negative regulation of striated muscle contraction(GO:0045988) |
| 0.2 | 1.7 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.2 | 4.9 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
| 0.2 | 0.5 | GO:0060032 | notochord regression(GO:0060032) |
| 0.2 | 0.5 | GO:0086018 | SA node cell action potential(GO:0086015) SA node cell to atrial cardiac muscle cell signalling(GO:0086018) |
| 0.2 | 5.2 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
| 0.2 | 3.4 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.2 | 1.0 | GO:1902988 | neurofibrillary tangle assembly(GO:1902988) |
| 0.2 | 0.2 | GO:0000706 | meiotic DNA double-strand break processing(GO:0000706) |
| 0.2 | 5.7 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
| 0.2 | 0.8 | GO:0060295 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
| 0.2 | 1.3 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.2 | 1.0 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
| 0.2 | 0.2 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
| 0.2 | 0.7 | GO:0097010 | eukaryotic translation initiation factor 4F complex assembly(GO:0097010) |
| 0.2 | 0.2 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.2 | 0.5 | GO:0031064 | negative regulation of histone deacetylation(GO:0031064) |
| 0.2 | 0.6 | GO:0048691 | modulation by virus of host transcription(GO:0019056) positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) modulation by symbiont of host transcription(GO:0052026) |
| 0.2 | 1.0 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
| 0.2 | 0.8 | GO:0060010 | Sertoli cell fate commitment(GO:0060010) |
| 0.2 | 0.3 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
| 0.2 | 1.6 | GO:0098700 | neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.2 | 0.9 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
| 0.2 | 1.7 | GO:0032264 | IMP salvage(GO:0032264) |
| 0.2 | 0.3 | GO:0031498 | chromatin disassembly(GO:0031498) |
| 0.2 | 0.9 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.2 | 0.6 | GO:0019417 | sulfur oxidation(GO:0019417) |
| 0.2 | 0.3 | GO:0045925 | positive regulation of female receptivity(GO:0045925) |
| 0.2 | 0.5 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.2 | 2.6 | GO:0023041 | neuronal signal transduction(GO:0023041) |
| 0.2 | 2.5 | GO:0038203 | TORC2 signaling(GO:0038203) |
| 0.2 | 0.5 | GO:0072365 | regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.2 | 1.5 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.2 | 0.2 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
| 0.2 | 0.9 | GO:0021993 | initiation of neural tube closure(GO:0021993) |
| 0.2 | 0.9 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.2 | 0.9 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.2 | 2.0 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.1 | 0.3 | GO:0044313 | protein K6-linked deubiquitination(GO:0044313) |
| 0.1 | 0.6 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.1 | 1.8 | GO:0060242 | contact inhibition(GO:0060242) |
| 0.1 | 0.1 | GO:0048147 | negative regulation of fibroblast proliferation(GO:0048147) |
| 0.1 | 0.4 | GO:0044805 | late nucleophagy(GO:0044805) |
| 0.1 | 0.9 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.1 | 4.7 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.1 | 1.0 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.1 | 10.5 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
| 0.1 | 0.3 | GO:0016185 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
| 0.1 | 0.9 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.1 | 1.2 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.1 | 0.3 | GO:1900248 | cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
| 0.1 | 0.7 | GO:0046203 | spermidine catabolic process(GO:0046203) |
| 0.1 | 0.6 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.1 | 0.6 | GO:0072663 | protein targeting to peroxisome(GO:0006625) peroxisomal transport(GO:0043574) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
| 0.1 | 0.6 | GO:1903367 | positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
| 0.1 | 1.4 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.1 | 1.4 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.1 | 0.6 | GO:0014052 | regulation of gamma-aminobutyric acid secretion(GO:0014052) |
| 0.1 | 2.4 | GO:0051256 | mitotic spindle midzone assembly(GO:0051256) |
| 0.1 | 0.1 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
| 0.1 | 2.5 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
| 0.1 | 0.6 | GO:0035669 | TRAM-dependent toll-like receptor signaling pathway(GO:0035668) TRAM-dependent toll-like receptor 4 signaling pathway(GO:0035669) |
| 0.1 | 0.6 | GO:0003357 | noradrenergic neuron differentiation(GO:0003357) |
| 0.1 | 1.0 | GO:0048165 | ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.1 | 0.4 | GO:0001544 | initiation of primordial ovarian follicle growth(GO:0001544) |
| 0.1 | 0.3 | GO:0097012 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
| 0.1 | 2.4 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
| 0.1 | 1.0 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 | 0.3 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.1 | 0.3 | GO:1903935 | response to diamide(GO:0072737) cellular response to diamide(GO:0072738) response to sodium arsenite(GO:1903935) cellular response to sodium arsenite(GO:1903936) |
| 0.1 | 0.5 | GO:0036071 | N-glycan fucosylation(GO:0036071) |
| 0.1 | 0.1 | GO:0008627 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) |
| 0.1 | 0.5 | GO:0002326 | B cell lineage commitment(GO:0002326) |
| 0.1 | 0.4 | GO:0032053 | ciliary basal body organization(GO:0032053) |
| 0.1 | 0.5 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
| 0.1 | 0.9 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
| 0.1 | 1.5 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
| 0.1 | 1.3 | GO:0010265 | SCF complex assembly(GO:0010265) |
| 0.1 | 0.1 | GO:0035357 | peroxisome proliferator activated receptor signaling pathway(GO:0035357) |
| 0.1 | 0.7 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
| 0.1 | 0.4 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) positive regulation of interleukin-6-mediated signaling pathway(GO:0070105) |
| 0.1 | 2.3 | GO:0000380 | alternative mRNA splicing, via spliceosome(GO:0000380) |
| 0.1 | 0.4 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) positive regulation of somatostatin secretion(GO:0090274) |
| 0.1 | 0.5 | GO:0071233 | cellular response to leucine(GO:0071233) |
| 0.1 | 2.1 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
| 0.1 | 0.9 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.1 | 0.5 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.1 | 0.3 | GO:0014004 | microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.1 | 0.5 | GO:1990785 | response to water-immersion restraint stress(GO:1990785) |
| 0.1 | 0.8 | GO:0006612 | protein targeting to membrane(GO:0006612) |
| 0.1 | 0.4 | GO:0006427 | histidyl-tRNA aminoacylation(GO:0006427) |
| 0.1 | 0.4 | GO:0017186 | peptidyl-pyroglutamic acid biosynthetic process, using glutaminyl-peptide cyclotransferase(GO:0017186) |
| 0.1 | 1.9 | GO:0060613 | fat pad development(GO:0060613) |
| 0.1 | 1.5 | GO:0090204 | protein localization to nuclear pore(GO:0090204) |
| 0.1 | 1.7 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.1 | 0.4 | GO:0016256 | N-glycan processing to lysosome(GO:0016256) |
| 0.1 | 5.3 | GO:0035338 | long-chain fatty-acyl-CoA biosynthetic process(GO:0035338) |
| 0.1 | 0.5 | GO:0036292 | DNA rewinding(GO:0036292) |
| 0.1 | 1.4 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.1 | 2.3 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
| 0.1 | 1.3 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
| 0.1 | 0.3 | GO:0001709 | cell fate determination(GO:0001709) |
| 0.1 | 0.2 | GO:1902219 | negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 0.1 | 1.0 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
| 0.1 | 0.4 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
| 0.1 | 0.2 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.1 | 0.9 | GO:0009048 | dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.1 | 0.4 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.1 | 0.4 | GO:1903980 | positive regulation of microglial cell activation(GO:1903980) |
| 0.1 | 1.0 | GO:1990416 | cellular response to brain-derived neurotrophic factor stimulus(GO:1990416) |
| 0.1 | 1.0 | GO:0006281 | DNA repair(GO:0006281) |
| 0.1 | 1.1 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.1 | 0.2 | GO:1903542 | negative regulation of exosomal secretion(GO:1903542) |
| 0.1 | 0.5 | GO:2000342 | negative regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000342) |
| 0.1 | 1.2 | GO:0086024 | adrenergic receptor signaling pathway involved in positive regulation of heart rate(GO:0086024) |
| 0.1 | 1.6 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
| 0.1 | 0.4 | GO:0046010 | positive regulation of circadian sleep/wake cycle, non-REM sleep(GO:0046010) |
| 0.1 | 0.5 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
| 0.1 | 1.1 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.1 | 0.4 | GO:0033364 | mast cell secretory granule organization(GO:0033364) |
| 0.1 | 3.1 | GO:0070262 | peptidyl-serine dephosphorylation(GO:0070262) |
| 0.1 | 0.6 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
| 0.1 | 0.4 | GO:0010979 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
| 0.1 | 0.2 | GO:0002266 | follicular dendritic cell activation(GO:0002266) follicular dendritic cell differentiation(GO:0002268) |
| 0.1 | 0.2 | GO:1901877 | regulation of calcium ion binding(GO:1901876) negative regulation of calcium ion binding(GO:1901877) |
| 0.1 | 0.7 | GO:0061187 | regulation of chromatin silencing at rDNA(GO:0061187) negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 0.1 | 0.4 | GO:0051780 | mevalonate transport(GO:0015728) behavioral response to nutrient(GO:0051780) |
| 0.1 | 0.1 | GO:0035261 | external genitalia morphogenesis(GO:0035261) |
| 0.1 | 1.3 | GO:0046958 | nonassociative learning(GO:0046958) |
| 0.1 | 0.7 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.1 | 0.6 | GO:0090076 | relaxation of skeletal muscle(GO:0090076) |
| 0.1 | 0.8 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
| 0.1 | 3.9 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
| 0.1 | 0.9 | GO:0089712 | L-aspartate transport(GO:0070778) L-aspartate transmembrane transport(GO:0089712) |
| 0.1 | 1.8 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.1 | 0.3 | GO:1904502 | regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
| 0.1 | 0.1 | GO:0045401 | positive regulation of interleukin-3 production(GO:0032752) interleukin-3 biosynthetic process(GO:0042223) regulation of interleukin-3 biosynthetic process(GO:0045399) positive regulation of interleukin-3 biosynthetic process(GO:0045401) positive regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045425) |
| 0.1 | 0.5 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
| 0.1 | 1.9 | GO:0090168 | Golgi reassembly(GO:0090168) |
| 0.1 | 1.6 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.1 | 1.2 | GO:0042059 | negative regulation of epidermal growth factor receptor signaling pathway(GO:0042059) |
| 0.1 | 0.6 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.1 | 2.4 | GO:0051014 | actin filament severing(GO:0051014) |
| 0.1 | 0.7 | GO:1902162 | regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) positive regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902164) |
| 0.1 | 1.0 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.1 | 0.7 | GO:1901355 | cellular response to rapamycin(GO:0072752) response to rapamycin(GO:1901355) |
| 0.1 | 1.0 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.1 | 1.7 | GO:0060252 | positive regulation of glial cell proliferation(GO:0060252) |
| 0.1 | 1.7 | GO:1900364 | negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.1 | 0.3 | GO:0038109 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
| 0.1 | 0.8 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 | 2.1 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.1 | 0.1 | GO:0060126 | somatotropin secreting cell differentiation(GO:0060126) |
| 0.1 | 6.5 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.1 | 0.7 | GO:0098881 | exocytic insertion of neurotransmitter receptor to plasma membrane(GO:0098881) exocytic insertion of neurotransmitter receptor to postsynaptic membrane(GO:0098967) |
| 0.1 | 0.5 | GO:0016240 | autophagosome docking(GO:0016240) |
| 0.1 | 0.8 | GO:0046823 | negative regulation of nucleocytoplasmic transport(GO:0046823) |
| 0.1 | 2.5 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 0.1 | 0.1 | GO:2000812 | regulation of barbed-end actin filament capping(GO:2000812) |
| 0.1 | 1.0 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
| 0.1 | 0.3 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
| 0.1 | 1.2 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.1 | 2.0 | GO:0034250 | positive regulation of cellular amide metabolic process(GO:0034250) |
| 0.1 | 0.8 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
| 0.1 | 1.0 | GO:0051901 | positive regulation of mitochondrial depolarization(GO:0051901) |
| 0.1 | 0.7 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.1 | 0.4 | GO:0002032 | desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
| 0.1 | 0.3 | GO:0045599 | negative regulation of fat cell differentiation(GO:0045599) |
| 0.1 | 1.4 | GO:0019375 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.1 | 0.1 | GO:0045200 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
| 0.1 | 0.1 | GO:0010955 | negative regulation of protein processing(GO:0010955) negative regulation of protein maturation(GO:1903318) |
| 0.1 | 0.6 | GO:0036493 | positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
| 0.1 | 0.4 | GO:1900224 | positive regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900224) |
| 0.1 | 1.6 | GO:0032875 | regulation of DNA endoreduplication(GO:0032875) DNA endoreduplication(GO:0042023) |
| 0.1 | 0.5 | GO:0032849 | regulation of cellular pH reduction(GO:0032847) positive regulation of cellular pH reduction(GO:0032849) |
| 0.1 | 1.5 | GO:0071313 | cellular response to caffeine(GO:0071313) |
| 0.1 | 0.6 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
| 0.1 | 2.3 | GO:0071397 | cellular response to cholesterol(GO:0071397) |
| 0.1 | 0.3 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
| 0.1 | 0.3 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 0.1 | 0.4 | GO:0075044 | autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
| 0.1 | 0.7 | GO:1902951 | negative regulation of dendritic spine maintenance(GO:1902951) |
| 0.1 | 6.1 | GO:0006735 | NADH regeneration(GO:0006735) canonical glycolysis(GO:0061621) glucose catabolic process to pyruvate(GO:0061718) |
| 0.1 | 0.5 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
| 0.1 | 0.9 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
| 0.1 | 0.1 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
| 0.1 | 3.4 | GO:0034199 | activation of protein kinase A activity(GO:0034199) |
| 0.1 | 0.4 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
| 0.1 | 3.8 | GO:0043278 | response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
| 0.1 | 0.5 | GO:2000323 | negative regulation of glucocorticoid receptor signaling pathway(GO:2000323) |
| 0.1 | 4.7 | GO:0007129 | synapsis(GO:0007129) |
| 0.1 | 0.3 | GO:0021551 | central nervous system morphogenesis(GO:0021551) cardiac muscle tissue regeneration(GO:0061026) |
| 0.1 | 0.6 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.1 | 0.7 | GO:0070444 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.1 | 0.9 | GO:0051383 | kinetochore organization(GO:0051383) |
| 0.1 | 0.2 | GO:2001178 | mediator complex assembly(GO:0036034) regulation of mediator complex assembly(GO:2001176) positive regulation of mediator complex assembly(GO:2001178) |
| 0.1 | 0.6 | GO:0031054 | pre-miRNA processing(GO:0031054) |
| 0.1 | 1.6 | GO:0035020 | regulation of Rac protein signal transduction(GO:0035020) |
| 0.1 | 0.1 | GO:0009649 | entrainment of circadian clock(GO:0009649) |
| 0.1 | 0.9 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.1 | 0.4 | GO:0016476 | regulation of embryonic cell shape(GO:0016476) |
| 0.1 | 1.0 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
| 0.1 | 0.7 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.1 | 0.3 | GO:0051541 | elastin metabolic process(GO:0051541) |
| 0.1 | 0.3 | GO:0098727 | stem cell population maintenance(GO:0019827) maintenance of cell number(GO:0098727) |
| 0.1 | 0.8 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
| 0.1 | 4.0 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.1 | 4.1 | GO:0007020 | microtubule nucleation(GO:0007020) |
| 0.1 | 3.1 | GO:0035640 | exploration behavior(GO:0035640) |
| 0.1 | 0.4 | GO:0032675 | regulation of interleukin-6 production(GO:0032675) |
| 0.1 | 2.1 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.1 | 0.6 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
| 0.1 | 1.1 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 0.1 | 0.1 | GO:0070734 | histone H3-K27 methylation(GO:0070734) |
| 0.1 | 1.2 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.1 | 0.3 | GO:0060591 | chondroblast differentiation(GO:0060591) |
| 0.1 | 0.3 | GO:0006267 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 0.1 | 0.2 | GO:1902965 | regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 0.1 | 0.3 | GO:0071415 | cellular response to purine-containing compound(GO:0071415) |
| 0.1 | 1.6 | GO:0021680 | cerebellar Purkinje cell layer development(GO:0021680) |
| 0.1 | 0.8 | GO:0072520 | seminiferous tubule development(GO:0072520) |
| 0.1 | 0.6 | GO:0097577 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.1 | 0.4 | GO:0050992 | dimethylallyl diphosphate biosynthetic process(GO:0050992) dimethylallyl diphosphate metabolic process(GO:0050993) |
| 0.1 | 0.3 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
| 0.1 | 0.7 | GO:0006772 | thiamine metabolic process(GO:0006772) |
| 0.1 | 0.3 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
| 0.1 | 2.7 | GO:0022011 | myelination in peripheral nervous system(GO:0022011) peripheral nervous system axon ensheathment(GO:0032292) |
| 0.1 | 0.7 | GO:0014062 | regulation of serotonin secretion(GO:0014062) |
| 0.1 | 0.1 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
| 0.1 | 0.9 | GO:2000291 | regulation of myoblast proliferation(GO:2000291) |
| 0.1 | 0.5 | GO:0007343 | egg activation(GO:0007343) |
| 0.1 | 1.5 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
| 0.1 | 1.3 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
| 0.1 | 0.4 | GO:0031642 | negative regulation of myelination(GO:0031642) |
| 0.1 | 3.5 | GO:0007019 | microtubule depolymerization(GO:0007019) |
| 0.1 | 0.5 | GO:1901675 | negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 0.1 | 0.2 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.1 | 0.6 | GO:0071372 | cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
| 0.1 | 0.2 | GO:0071500 | cellular response to nitrosative stress(GO:0071500) |
| 0.1 | 0.4 | GO:1903445 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.1 | 1.3 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
| 0.1 | 1.1 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) |
| 0.1 | 0.4 | GO:0048102 | autophagic cell death(GO:0048102) |
| 0.1 | 0.3 | GO:2001286 | angiotensin-activated signaling pathway involved in heart process(GO:0086098) regulation of caveolin-mediated endocytosis(GO:2001286) |
| 0.1 | 0.6 | GO:1904029 | regulation of cyclin-dependent protein kinase activity(GO:1904029) |
| 0.1 | 0.4 | GO:0033029 | regulation of neutrophil apoptotic process(GO:0033029) |
| 0.1 | 0.3 | GO:0070914 | UV-damage excision repair(GO:0070914) |
| 0.1 | 0.2 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 0.1 | 0.3 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
| 0.1 | 0.8 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.1 | 0.8 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.1 | 0.5 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
| 0.1 | 0.6 | GO:0051893 | regulation of focal adhesion assembly(GO:0051893) regulation of cell-substrate junction assembly(GO:0090109) regulation of adherens junction organization(GO:1903391) |
| 0.1 | 0.7 | GO:0007506 | gonadal mesoderm development(GO:0007506) |
| 0.1 | 4.3 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
| 0.1 | 0.1 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 0.1 | 1.1 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
| 0.1 | 0.3 | GO:0030225 | macrophage differentiation(GO:0030225) |
| 0.1 | 0.5 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.1 | 0.8 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.1 | 0.7 | GO:0002249 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 0.1 | 0.5 | GO:0045359 | positive regulation of interferon-beta biosynthetic process(GO:0045359) |
| 0.1 | 0.3 | GO:0072356 | chromosome passenger complex localization to kinetochore(GO:0072356) |
| 0.1 | 2.7 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
| 0.1 | 0.5 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
| 0.1 | 1.3 | GO:0006306 | DNA alkylation(GO:0006305) DNA methylation(GO:0006306) |
| 0.1 | 0.9 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
| 0.1 | 0.1 | GO:0061373 | mammillary body development(GO:0021767) mammillary axonal complex development(GO:0061373) |
| 0.1 | 0.2 | GO:0035621 | ER to Golgi ceramide transport(GO:0035621) |
| 0.1 | 0.1 | GO:0036506 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.1 | 0.5 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.1 | 24.0 | GO:0071804 | cellular potassium ion transport(GO:0071804) potassium ion transmembrane transport(GO:0071805) |
| 0.1 | 0.2 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
| 0.1 | 0.2 | GO:0015670 | carbon dioxide transport(GO:0015670) |
| 0.1 | 0.4 | GO:0048659 | smooth muscle cell proliferation(GO:0048659) |
| 0.1 | 1.3 | GO:0016998 | cell wall macromolecule catabolic process(GO:0016998) |
| 0.1 | 0.6 | GO:0071105 | response to interleukin-11(GO:0071105) |
| 0.1 | 0.3 | GO:0032223 | negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 0.1 | 0.6 | GO:0033153 | somatic diversification of T cell receptor genes(GO:0002568) somatic recombination of T cell receptor gene segments(GO:0002681) T cell receptor V(D)J recombination(GO:0033153) |
| 0.1 | 3.9 | GO:0071174 | mitotic spindle checkpoint(GO:0071174) |
| 0.1 | 0.5 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
| 0.1 | 0.4 | GO:0031577 | spindle checkpoint(GO:0031577) |
| 0.1 | 3.0 | GO:0046856 | phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.1 | 0.2 | GO:0003365 | establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
| 0.1 | 0.5 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
| 0.1 | 0.6 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
| 0.1 | 1.0 | GO:0014877 | response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 0.1 | 0.6 | GO:0019075 | virus maturation(GO:0019075) |
| 0.1 | 1.0 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
| 0.1 | 0.3 | GO:0006857 | oligopeptide transport(GO:0006857) |
| 0.1 | 0.6 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.1 | 2.5 | GO:0032011 | ARF protein signal transduction(GO:0032011) |
| 0.1 | 3.5 | GO:1902850 | microtubule cytoskeleton organization involved in mitosis(GO:1902850) |
| 0.1 | 0.3 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.1 | 0.6 | GO:0032471 | negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
| 0.1 | 0.5 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
| 0.1 | 0.1 | GO:0030505 | inorganic diphosphate transport(GO:0030505) |
| 0.1 | 0.1 | GO:0032230 | positive regulation of synaptic transmission, GABAergic(GO:0032230) |
| 0.1 | 0.1 | GO:2000523 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.1 | 3.3 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 0.1 | 1.1 | GO:0030279 | negative regulation of ossification(GO:0030279) |
| 0.1 | 0.7 | GO:0007191 | adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
| 0.1 | 0.5 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
| 0.1 | 0.4 | GO:0002286 | T cell activation involved in immune response(GO:0002286) |
| 0.1 | 0.1 | GO:0006414 | translational elongation(GO:0006414) |
| 0.1 | 0.7 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 0.1 | 0.4 | GO:0035553 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.1 | 0.7 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
| 0.1 | 0.3 | GO:1904106 | protein localization to microvillus(GO:1904106) |
| 0.1 | 1.4 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
| 0.1 | 1.2 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.1 | 0.5 | GO:0000019 | regulation of mitotic recombination(GO:0000019) |
| 0.1 | 0.2 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.1 | 0.9 | GO:0052805 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
| 0.1 | 0.7 | GO:1990403 | embryonic brain development(GO:1990403) |
| 0.1 | 2.0 | GO:0045724 | positive regulation of cilium assembly(GO:0045724) |
| 0.1 | 0.6 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
| 0.1 | 0.2 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
| 0.1 | 0.6 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
| 0.1 | 0.2 | GO:0097026 | dendritic cell dendrite assembly(GO:0097026) |
| 0.1 | 0.2 | GO:0070781 | response to biotin(GO:0070781) |
| 0.1 | 0.7 | GO:0051451 | myoblast migration(GO:0051451) |
| 0.1 | 0.8 | GO:0071392 | cellular response to estradiol stimulus(GO:0071392) |
| 0.1 | 0.1 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
| 0.1 | 4.8 | GO:0051298 | centrosome duplication(GO:0051298) |
| 0.1 | 0.1 | GO:0045402 | interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 0.1 | 0.3 | GO:0044208 | 'de novo' AMP biosynthetic process(GO:0044208) |
| 0.1 | 0.4 | GO:0042733 | embryonic digit morphogenesis(GO:0042733) |
| 0.1 | 1.1 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
| 0.1 | 2.3 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
| 0.1 | 0.1 | GO:1902732 | positive regulation of chondrocyte proliferation(GO:1902732) |
| 0.1 | 2.2 | GO:0048873 | homeostasis of number of cells within a tissue(GO:0048873) |
| 0.1 | 0.5 | GO:0060213 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
| 0.1 | 0.7 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 0.1 | 0.6 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.1 | 0.9 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
| 0.1 | 2.4 | GO:0016574 | histone ubiquitination(GO:0016574) |
| 0.1 | 0.3 | GO:0002528 | regulation of vascular permeability involved in acute inflammatory response(GO:0002528) |
| 0.1 | 0.3 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.1 | 0.2 | GO:0034091 | regulation of maintenance of sister chromatid cohesion(GO:0034091) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) |
| 0.1 | 0.5 | GO:0098909 | regulation of cardiac muscle cell action potential involved in regulation of contraction(GO:0098909) |
| 0.1 | 1.0 | GO:0034629 | cellular protein complex localization(GO:0034629) |
| 0.1 | 0.1 | GO:0035397 | helper T cell enhancement of adaptive immune response(GO:0035397) |
| 0.1 | 0.6 | GO:0051934 | dopamine uptake involved in synaptic transmission(GO:0051583) catecholamine uptake involved in synaptic transmission(GO:0051934) catecholamine uptake(GO:0090493) dopamine uptake(GO:0090494) neurotransmitter reuptake(GO:0098810) |
| 0.1 | 1.1 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
| 0.1 | 0.8 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.1 | 2.0 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.1 | 2.9 | GO:1904837 | beta-catenin-TCF complex assembly(GO:1904837) |
| 0.1 | 0.7 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 0.1 | 0.4 | GO:0034214 | protein hexamerization(GO:0034214) |
| 0.1 | 0.1 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.1 | 0.1 | GO:0035815 | positive regulation of renal sodium excretion(GO:0035815) |
| 0.1 | 0.5 | GO:0006198 | cAMP catabolic process(GO:0006198) |
| 0.1 | 0.1 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 0.1 | 0.7 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
| 0.1 | 0.3 | GO:0071873 | response to norepinephrine(GO:0071873) cellular response to norepinephrine stimulus(GO:0071874) |
| 0.1 | 0.4 | GO:0042048 | olfactory behavior(GO:0042048) |
| 0.1 | 0.2 | GO:0015801 | aromatic amino acid transport(GO:0015801) |
| 0.1 | 0.6 | GO:0038166 | angiotensin-activated signaling pathway(GO:0038166) |
| 0.1 | 0.3 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
| 0.1 | 0.1 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.1 | 0.1 | GO:0032272 | negative regulation of protein polymerization(GO:0032272) |
| 0.1 | 0.2 | GO:0006781 | succinyl-CoA pathway(GO:0006781) |
| 0.1 | 0.2 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.1 | 0.4 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.1 | 0.2 | GO:1903317 | regulation of protein processing(GO:0070613) regulation of protein maturation(GO:1903317) |
| 0.1 | 0.2 | GO:0072553 | terminal button organization(GO:0072553) |
| 0.1 | 0.4 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.1 | 0.4 | GO:1904550 | chemotaxis to arachidonic acid(GO:0034670) response to arachidonic acid(GO:1904550) |
| 0.1 | 0.6 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.1 | 0.7 | GO:0009304 | tRNA transcription(GO:0009304) |
| 0.1 | 7.3 | GO:0006334 | nucleosome assembly(GO:0006334) |
| 0.1 | 0.3 | GO:0060766 | negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.1 | 24.3 | GO:0000209 | protein polyubiquitination(GO:0000209) |
| 0.1 | 0.2 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.1 | 0.2 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
| 0.1 | 0.6 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.1 | 0.4 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
| 0.1 | 0.4 | GO:0050482 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
| 0.1 | 0.3 | GO:1903593 | regulation of histamine secretion by mast cell(GO:1903593) |
| 0.1 | 0.5 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
| 0.1 | 0.1 | GO:1990314 | cellular response to insulin-like growth factor stimulus(GO:1990314) |
| 0.1 | 0.2 | GO:0036269 | swimming behavior(GO:0036269) |
| 0.1 | 1.2 | GO:1904152 | regulation of retrograde protein transport, ER to cytosol(GO:1904152) |
| 0.1 | 0.3 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.1 | 0.6 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 0.1 | 3.1 | GO:0050690 | regulation of defense response to virus by virus(GO:0050690) |
| 0.1 | 0.2 | GO:0052151 | induction of programmed cell death(GO:0012502) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) positive regulation of apoptotic process by virus(GO:0060139) |
| 0.1 | 0.9 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.1 | 0.2 | GO:1902412 | regulation of mitotic cytokinesis(GO:1902412) |
| 0.1 | 0.2 | GO:0015910 | peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.1 | 1.2 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 0.1 | 0.8 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
| 0.1 | 0.7 | GO:1900004 | negative regulation of serine-type endopeptidase activity(GO:1900004) negative regulation of serine-type peptidase activity(GO:1902572) |
| 0.1 | 0.4 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
| 0.1 | 0.2 | GO:0035865 | cellular response to potassium ion(GO:0035865) |
| 0.1 | 0.3 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.1 | 0.1 | GO:0090290 | regulation of osteoclast proliferation(GO:0090289) positive regulation of osteoclast proliferation(GO:0090290) |
| 0.1 | 1.1 | GO:0051568 | histone H3-K4 methylation(GO:0051568) |
| 0.1 | 0.4 | GO:0070459 | prolactin secretion(GO:0070459) |
| 0.1 | 0.2 | GO:1902100 | negative regulation of mitotic metaphase/anaphase transition(GO:0045841) negative regulation of metaphase/anaphase transition of cell cycle(GO:1902100) |
| 0.1 | 1.1 | GO:0033139 | regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033139) |
| 0.1 | 0.4 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.1 | 0.3 | GO:0007289 | spermatid nucleus differentiation(GO:0007289) |
| 0.1 | 0.2 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
| 0.1 | 0.2 | GO:0035544 | negative regulation of SNARE complex assembly(GO:0035544) |
| 0.1 | 0.2 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.1 | 0.4 | GO:1902116 | negative regulation of organelle assembly(GO:1902116) |
| 0.1 | 0.4 | GO:0032380 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.1 | 0.4 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.1 | 3.2 | GO:0043631 | RNA polyadenylation(GO:0043631) |
| 0.1 | 2.2 | GO:0008089 | anterograde axonal transport(GO:0008089) |
| 0.1 | 0.9 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.1 | 0.3 | GO:1903615 | regulation of protein tyrosine phosphatase activity(GO:1903613) positive regulation of protein tyrosine phosphatase activity(GO:1903615) |
| 0.1 | 0.4 | GO:0070055 | mRNA splicing via endonucleolytic cleavage and ligation involved in unfolded protein response(GO:0030969) regulation of mRNA cleavage(GO:0031437) negative regulation of mRNA cleavage(GO:0031438) mRNA splicing, via endonucleolytic cleavage and ligation(GO:0070054) mRNA endonucleolytic cleavage involved in unfolded protein response(GO:0070055) negative regulation of IRE1-mediated unfolded protein response(GO:1903895) regulation of mRNA endonucleolytic cleavage involved in unfolded protein response(GO:1904720) negative regulation of mRNA endonucleolytic cleavage involved in unfolded protein response(GO:1904721) |
| 0.1 | 0.9 | GO:0044458 | motile cilium assembly(GO:0044458) |
| 0.1 | 0.2 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.1 | 0.5 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
| 0.0 | 0.9 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
| 0.0 | 2.1 | GO:0032456 | endocytic recycling(GO:0032456) |
| 0.0 | 0.4 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.0 | 0.1 | GO:1903691 | positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
| 0.0 | 0.4 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.0 | 0.1 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.0 | 1.1 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
| 0.0 | 0.2 | GO:0036116 | medium-chain fatty-acyl-CoA catabolic process(GO:0036114) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
| 0.0 | 3.6 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
| 0.0 | 0.4 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.0 | 1.3 | GO:0051865 | protein autoubiquitination(GO:0051865) |
| 0.0 | 0.3 | GO:0001964 | startle response(GO:0001964) |
| 0.0 | 0.2 | GO:0042144 | vacuole fusion, non-autophagic(GO:0042144) |
| 0.0 | 2.0 | GO:0043966 | histone H3 acetylation(GO:0043966) |
| 0.0 | 0.8 | GO:0043313 | regulation of neutrophil degranulation(GO:0043313) |
| 0.0 | 0.2 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.0 | 0.3 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.0 | 0.3 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
| 0.0 | 0.0 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 0.0 | 0.2 | GO:0043570 | maintenance of DNA repeat elements(GO:0043570) |
| 0.0 | 0.1 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
| 0.0 | 0.1 | GO:0046794 | transport of virus(GO:0046794) |
| 0.0 | 0.8 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.0 | 0.2 | GO:1903028 | positive regulation of opsonization(GO:1903028) |
| 0.0 | 0.2 | GO:0097237 | cellular response to toxic substance(GO:0097237) |
| 0.0 | 0.6 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.0 | 0.2 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
| 0.0 | 0.2 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.0 | 0.4 | GO:0048298 | positive regulation of isotype switching to IgA isotypes(GO:0048298) |
| 0.0 | 0.5 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
| 0.0 | 0.9 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.0 | 0.4 | GO:0045835 | negative regulation of meiotic nuclear division(GO:0045835) |
| 0.0 | 0.3 | GO:0061025 | membrane fusion(GO:0061025) |
| 0.0 | 0.3 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.0 | 0.4 | GO:0070070 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.0 | 0.2 | GO:0051892 | negative regulation of cardioblast differentiation(GO:0051892) regulation of cardiac muscle cell myoblast differentiation(GO:2000690) negative regulation of cardiac muscle cell myoblast differentiation(GO:2000691) |
| 0.0 | 2.5 | GO:0032465 | regulation of cytokinesis(GO:0032465) |
| 0.0 | 0.2 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.0 | 2.2 | GO:0019226 | transmission of nerve impulse(GO:0019226) |
| 0.0 | 0.1 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
| 0.0 | 0.1 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.0 | 2.6 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
| 0.0 | 0.2 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) |
| 0.0 | 0.1 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
| 0.0 | 0.1 | GO:0009437 | carnitine metabolic process(GO:0009437) |
| 0.0 | 0.9 | GO:0036148 | phosphatidylglycerol acyl-chain remodeling(GO:0036148) |
| 0.0 | 0.0 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
| 0.0 | 0.6 | GO:0050901 | leukocyte tethering or rolling(GO:0050901) leukocyte adhesion to vascular endothelial cell(GO:0061756) |
| 0.0 | 0.3 | GO:0021794 | thalamus development(GO:0021794) |
| 0.0 | 1.5 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.0 | 0.3 | GO:0009181 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
| 0.0 | 0.6 | GO:0060314 | regulation of ryanodine-sensitive calcium-release channel activity(GO:0060314) |
| 0.0 | 0.1 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.0 | 0.6 | GO:0022410 | circadian sleep/wake cycle process(GO:0022410) |
| 0.0 | 0.7 | GO:0071467 | cellular response to pH(GO:0071467) |
| 0.0 | 0.1 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
| 0.0 | 0.3 | GO:0043415 | positive regulation of satellite cell activation involved in skeletal muscle regeneration(GO:0014718) positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.0 | 0.2 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.0 | 0.3 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
| 0.0 | 0.8 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.0 | 0.5 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
| 0.0 | 0.3 | GO:0090669 | telomerase RNA stabilization(GO:0090669) |
| 0.0 | 0.1 | GO:0038030 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.0 | 0.1 | GO:0001507 | acetylcholine catabolic process in synaptic cleft(GO:0001507) acetylcholine catabolic process(GO:0006581) |
| 0.0 | 0.2 | GO:0070173 | regulation of enamel mineralization(GO:0070173) |
| 0.0 | 0.3 | GO:1904627 | response to phorbol 13-acetate 12-myristate(GO:1904627) cellular response to phorbol 13-acetate 12-myristate(GO:1904628) |
| 0.0 | 0.1 | GO:0019085 | early viral transcription(GO:0019085) |
| 0.0 | 0.6 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 0.0 | 0.1 | GO:0051531 | NFAT protein import into nucleus(GO:0051531) |
| 0.0 | 1.1 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
| 0.0 | 0.3 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.0 | 0.5 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.0 | 0.5 | GO:0008340 | determination of adult lifespan(GO:0008340) |
| 0.0 | 0.1 | GO:0006288 | base-excision repair, DNA ligation(GO:0006288) |
| 0.0 | 2.7 | GO:0032508 | DNA duplex unwinding(GO:0032508) |
| 0.0 | 1.8 | GO:0051438 | regulation of ubiquitin-protein transferase activity(GO:0051438) |
| 0.0 | 0.3 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.0 | 1.2 | GO:0006813 | potassium ion transport(GO:0006813) |
| 0.0 | 0.1 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
| 0.0 | 0.0 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
| 0.0 | 1.1 | GO:0003009 | skeletal muscle contraction(GO:0003009) |
| 0.0 | 0.2 | GO:0021781 | glial cell fate commitment(GO:0021781) |
| 0.0 | 0.2 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.0 | 0.1 | GO:0006043 | glucosamine catabolic process(GO:0006043) |
| 0.0 | 0.1 | GO:0032785 | negative regulation of DNA-templated transcription, elongation(GO:0032785) |
| 0.0 | 0.8 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.0 | 1.8 | GO:0072384 | organelle transport along microtubule(GO:0072384) |
| 0.0 | 0.3 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
| 0.0 | 0.2 | GO:0060023 | soft palate development(GO:0060023) |
| 0.0 | 0.1 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.0 | 0.7 | GO:0038083 | peptidyl-tyrosine autophosphorylation(GO:0038083) |
| 0.0 | 0.2 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.0 | 0.2 | GO:0097021 | lymphocyte migration into lymphoid organs(GO:0097021) |
| 0.0 | 0.1 | GO:0035803 | egg coat formation(GO:0035803) |
| 0.0 | 0.1 | GO:0070902 | mitochondrial tRNA pseudouridine synthesis(GO:0070902) |
| 0.0 | 0.2 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
| 0.0 | 0.6 | GO:0043555 | regulation of translation in response to stress(GO:0043555) |
| 0.0 | 1.2 | GO:0042795 | snRNA transcription(GO:0009301) snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.0 | 0.6 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
| 0.0 | 1.1 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.0 | 0.1 | GO:0036496 | regulation of translational initiation by eIF2 alpha dephosphorylation(GO:0036496) |
| 0.0 | 0.4 | GO:0001866 | NK T cell proliferation(GO:0001866) |
| 0.0 | 0.1 | GO:1904885 | beta-catenin destruction complex assembly(GO:1904885) |
| 0.0 | 1.4 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
| 0.0 | 1.4 | GO:0016575 | histone deacetylation(GO:0016575) |
| 0.0 | 0.1 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.0 | 0.5 | GO:0030261 | chromosome condensation(GO:0030261) |
| 0.0 | 0.2 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
| 0.0 | 0.5 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.0 | 0.3 | GO:0071918 | urea transmembrane transport(GO:0071918) |
| 0.0 | 0.1 | GO:0034243 | regulation of transcription elongation from RNA polymerase II promoter(GO:0034243) |
| 0.0 | 0.2 | GO:0070458 | cellular detoxification of nitrogen compound(GO:0070458) |
| 0.0 | 0.8 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.0 | 0.2 | GO:1903524 | positive regulation of blood circulation(GO:1903524) |
| 0.0 | 0.2 | GO:0006167 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) AMP biosynthetic process(GO:0006167) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.0 | 0.0 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
| 0.0 | 0.1 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
| 0.0 | 0.1 | GO:0033599 | regulation of mammary gland epithelial cell proliferation(GO:0033599) |
| 0.0 | 0.1 | GO:0050705 | regulation of interleukin-1 alpha secretion(GO:0050705) positive regulation of interleukin-1 alpha secretion(GO:0050717) |
| 0.0 | 0.4 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.0 | 0.2 | GO:0038155 | interleukin-23-mediated signaling pathway(GO:0038155) positive regulation of T-helper 17 cell lineage commitment(GO:2000330) |
| 0.0 | 0.2 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.0 | 0.5 | GO:0070911 | global genome nucleotide-excision repair(GO:0070911) |
| 0.0 | 0.0 | GO:0034770 | histone H4-K20 methylation(GO:0034770) |
| 0.0 | 0.2 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.0 | 0.1 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
| 0.0 | 0.1 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
| 0.0 | 1.0 | GO:0097352 | autophagosome maturation(GO:0097352) |
| 0.0 | 0.3 | GO:0002088 | lens development in camera-type eye(GO:0002088) |
| 0.0 | 0.1 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
| 0.0 | 0.8 | GO:0007131 | reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
| 0.0 | 0.1 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
| 0.0 | 2.8 | GO:0006368 | transcription elongation from RNA polymerase II promoter(GO:0006368) |
| 0.0 | 0.7 | GO:0021515 | cell differentiation in spinal cord(GO:0021515) |
| 0.0 | 0.3 | GO:0060219 | camera-type eye photoreceptor cell differentiation(GO:0060219) |
| 0.0 | 5.0 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
| 0.0 | 1.0 | GO:0016239 | positive regulation of macroautophagy(GO:0016239) |
| 0.0 | 0.1 | GO:0045994 | regulation of translational initiation by iron(GO:0006447) positive regulation of translational initiation by iron(GO:0045994) |
| 0.0 | 0.3 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 0.0 | 0.2 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
| 0.0 | 0.3 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
| 0.0 | 0.2 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.0 | 0.3 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
| 0.0 | 0.0 | GO:0000117 | regulation of transcription involved in G2/M transition of mitotic cell cycle(GO:0000117) |
| 0.0 | 0.7 | GO:0030148 | sphingolipid biosynthetic process(GO:0030148) |
| 0.0 | 0.3 | GO:0010819 | regulation of T cell chemotaxis(GO:0010819) positive regulation of T cell chemotaxis(GO:0010820) |
| 0.0 | 0.0 | GO:0071875 | adrenergic receptor signaling pathway(GO:0071875) |
| 0.0 | 7.7 | GO:0016579 | protein deubiquitination(GO:0016579) |
| 0.0 | 0.6 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.0 | 0.0 | GO:0033363 | secretory granule organization(GO:0033363) |
| 0.0 | 0.1 | GO:0002625 | regulation of T cell antigen processing and presentation(GO:0002625) |
| 0.0 | 0.5 | GO:0010259 | multicellular organism aging(GO:0010259) |
| 0.0 | 0.4 | GO:0043501 | skeletal muscle adaptation(GO:0043501) |
| 0.0 | 0.4 | GO:0031297 | replication fork processing(GO:0031297) |
| 0.0 | 0.2 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
| 0.0 | 0.2 | GO:1904995 | negative regulation of leukocyte tethering or rolling(GO:1903237) negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
| 0.0 | 1.0 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.0 | 0.2 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.0 | 0.8 | GO:0007271 | synaptic transmission, cholinergic(GO:0007271) |
| 0.0 | 0.1 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
| 0.0 | 0.5 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.0 | 0.1 | GO:0001767 | establishment of lymphocyte polarity(GO:0001767) |
| 0.0 | 0.1 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
| 0.0 | 0.2 | GO:0071318 | cellular response to ATP(GO:0071318) |
| 0.0 | 0.7 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.0 | 0.2 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
| 0.0 | 0.6 | GO:0050885 | neuromuscular process controlling balance(GO:0050885) |
| 0.0 | 0.1 | GO:0044565 | dendritic cell proliferation(GO:0044565) |
| 0.0 | 0.1 | GO:0006333 | chromatin assembly or disassembly(GO:0006333) |
| 0.0 | 0.5 | GO:0006559 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
| 0.0 | 0.1 | GO:0033341 | regulation of collagen binding(GO:0033341) |
| 0.0 | 0.1 | GO:0034349 | glial cell apoptotic process(GO:0034349) |
| 0.0 | 0.3 | GO:1990822 | basic amino acid transmembrane transport(GO:1990822) |
| 0.0 | 0.2 | GO:0045204 | MAPK export from nucleus(GO:0045204) |
| 0.0 | 1.3 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
| 0.0 | 0.2 | GO:0070383 | DNA deamination(GO:0045006) DNA cytosine deamination(GO:0070383) |
| 0.0 | 0.1 | GO:0071638 | negative regulation of monocyte chemotactic protein-1 production(GO:0071638) |
| 0.0 | 0.0 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.0 | 0.2 | GO:0003373 | dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
| 0.0 | 0.0 | GO:0002644 | negative regulation of tolerance induction(GO:0002644) |
| 0.0 | 0.3 | GO:0048484 | enteric nervous system development(GO:0048484) |
| 0.0 | 0.3 | GO:1902363 | regulation of spindle elongation(GO:0032887) regulation of mitotic spindle elongation(GO:0032888) anastral spindle assembly(GO:0055048) protein localization to spindle pole body(GO:0071988) regulation of protein localization to spindle pole body(GO:1902363) positive regulation of protein localization to spindle pole body(GO:1902365) positive regulation of mitotic spindle elongation(GO:1902846) |
| 0.0 | 0.2 | GO:0036150 | phosphatidylserine acyl-chain remodeling(GO:0036150) |
| 0.0 | 0.1 | GO:1904970 | brush border assembly(GO:1904970) |
| 0.0 | 0.1 | GO:0034088 | maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
| 0.0 | 0.1 | GO:0044872 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.0 | 0.1 | GO:0032700 | negative regulation of interleukin-17 production(GO:0032700) |
| 0.0 | 0.3 | GO:0035137 | hindlimb morphogenesis(GO:0035137) |
| 0.0 | 0.1 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
| 0.0 | 0.1 | GO:0046061 | dATP catabolic process(GO:0046061) |
| 0.0 | 0.1 | GO:0001306 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 0.0 | 0.4 | GO:0010524 | positive regulation of calcium ion transport into cytosol(GO:0010524) |
| 0.0 | 0.1 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
| 0.0 | 0.2 | GO:1902751 | positive regulation of cell cycle G2/M phase transition(GO:1902751) |
| 0.0 | 0.7 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
| 0.0 | 0.1 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.0 | 0.4 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
| 0.0 | 0.1 | GO:0048625 | myoblast fate commitment(GO:0048625) |
| 0.0 | 0.2 | GO:0006972 | hyperosmotic response(GO:0006972) |
| 0.0 | 0.2 | GO:0071391 | cellular response to estrogen stimulus(GO:0071391) |
| 0.0 | 1.2 | GO:0071277 | cellular response to calcium ion(GO:0071277) |
| 0.0 | 0.1 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.0 | 1.5 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.0 | 0.2 | GO:0045669 | positive regulation of osteoblast differentiation(GO:0045669) |
| 0.0 | 0.0 | GO:0046666 | retinal cell programmed cell death(GO:0046666) |
| 0.0 | 0.1 | GO:0008052 | sensory organ boundary specification(GO:0008052) formation of organ boundary(GO:0010160) taste bud development(GO:0061193) |
| 0.0 | 0.1 | GO:0035879 | plasma membrane lactate transport(GO:0035879) |
| 0.0 | 0.1 | GO:0046984 | regulation of hemoglobin biosynthetic process(GO:0046984) positive regulation of hemoglobin biosynthetic process(GO:0046985) |
| 0.0 | 0.4 | GO:0048278 | vesicle docking(GO:0048278) |
| 0.0 | 0.4 | GO:0043101 | purine-containing compound salvage(GO:0043101) |
| 0.0 | 0.7 | GO:0050890 | cognition(GO:0050890) |
| 0.0 | 0.2 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
| 0.0 | 0.3 | GO:0031122 | cytoplasmic microtubule organization(GO:0031122) |
| 0.0 | 0.2 | GO:0000423 | macromitophagy(GO:0000423) |
| 0.0 | 0.4 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
| 0.0 | 0.1 | GO:0061015 | snRNA transport(GO:0051030) snRNA import into nucleus(GO:0061015) |
| 0.0 | 0.4 | GO:0042462 | eye photoreceptor cell development(GO:0042462) |
| 0.0 | 0.4 | GO:0042417 | dopamine metabolic process(GO:0042417) |
| 0.0 | 0.0 | GO:0032869 | cellular response to insulin stimulus(GO:0032869) |
| 0.0 | 0.6 | GO:0010761 | fibroblast migration(GO:0010761) |
| 0.0 | 0.2 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.0 | 0.2 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.0 | 0.3 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.0 | 0.1 | GO:0072600 | establishment of protein localization to Golgi(GO:0072600) |
| 0.0 | 0.1 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
| 0.0 | 0.1 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.0 | 0.2 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.0 | 0.1 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.0 | 0.2 | GO:0048820 | hair follicle maturation(GO:0048820) |
| 0.0 | 0.1 | GO:0003016 | respiratory system process(GO:0003016) |
| 0.0 | 0.0 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.0 | 0.5 | GO:0071431 | tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.0 | 0.1 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
| 0.0 | 0.3 | GO:0016024 | CDP-diacylglycerol biosynthetic process(GO:0016024) |
| 0.0 | 0.1 | GO:0006360 | transcription from RNA polymerase I promoter(GO:0006360) positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.0 | 9.6 | GO:0016567 | protein ubiquitination(GO:0016567) |
| 0.0 | 0.3 | GO:0007172 | signal complex assembly(GO:0007172) |
| 0.0 | 0.2 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
| 0.0 | 0.1 | GO:0000075 | cell cycle checkpoint(GO:0000075) |
| 0.0 | 0.0 | GO:0070601 | centromeric sister chromatid cohesion(GO:0070601) |
| 0.0 | 0.3 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
| 0.0 | 0.2 | GO:0097398 | response to interleukin-17(GO:0097396) cellular response to interleukin-17(GO:0097398) |
| 0.0 | 0.2 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
| 0.0 | 0.1 | GO:0001832 | blastocyst growth(GO:0001832) |
| 0.0 | 0.3 | GO:0070646 | protein modification by small protein removal(GO:0070646) |
| 0.0 | 0.1 | GO:0051295 | polar body extrusion after meiotic divisions(GO:0040038) establishment of meiotic spindle localization(GO:0051295) formin-nucleated actin cable assembly(GO:0070649) |
| 0.0 | 0.1 | GO:0006825 | copper ion transport(GO:0006825) |
| 0.0 | 1.0 | GO:0021762 | substantia nigra development(GO:0021762) |
| 0.0 | 0.0 | GO:0035036 | sperm-egg recognition(GO:0035036) |
| 0.0 | 0.2 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 0.0 | 0.1 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.0 | 0.2 | GO:1990089 | response to nerve growth factor(GO:1990089) |
| 0.0 | 0.2 | GO:0042354 | fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
| 0.0 | 0.1 | GO:0006983 | ER overload response(GO:0006983) |
| 0.0 | 0.2 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
| 0.0 | 0.3 | GO:0015669 | gas transport(GO:0015669) oxygen transport(GO:0015671) |
| 0.0 | 0.7 | GO:0032204 | regulation of telomere maintenance(GO:0032204) |
| 0.0 | 0.1 | GO:0016246 | RNA interference(GO:0016246) |
| 0.0 | 0.5 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.0 | 0.5 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
| 0.0 | 0.1 | GO:0035994 | response to muscle stretch(GO:0035994) |
| 0.0 | 0.3 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.0 | 0.0 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.0 | 0.1 | GO:0021554 | optic nerve development(GO:0021554) |
| 0.0 | 0.0 | GO:0042727 | flavin-containing compound biosynthetic process(GO:0042727) |
| 0.0 | 0.9 | GO:0007602 | phototransduction(GO:0007602) |
| 0.0 | 0.1 | GO:0046452 | dihydrofolate metabolic process(GO:0046452) |
| 0.0 | 0.2 | GO:2000272 | negative regulation of receptor activity(GO:2000272) |
| 0.0 | 0.0 | GO:1905247 | regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902959) positive regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902961) regulation of aspartic-type peptidase activity(GO:1905245) positive regulation of aspartic-type peptidase activity(GO:1905247) |
| 0.0 | 0.2 | GO:0006688 | glycosphingolipid biosynthetic process(GO:0006688) |
| 0.0 | 0.1 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.0 | 0.2 | GO:0051588 | regulation of neurotransmitter transport(GO:0051588) |
| 0.0 | 0.0 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
| 0.0 | 0.1 | GO:0070487 | monocyte aggregation(GO:0070487) |
| 0.0 | 0.2 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.0 | 0.1 | GO:0042635 | positive regulation of hair cycle(GO:0042635) positive regulation of hair follicle development(GO:0051798) |
| 0.0 | 0.4 | GO:0060218 | hematopoietic stem cell differentiation(GO:0060218) |
| 0.0 | 0.1 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.0 | 0.2 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.0 | 0.4 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
| 0.0 | 0.1 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 0.0 | 0.0 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.0 | 0.0 | GO:0048853 | forebrain morphogenesis(GO:0048853) |
| 0.0 | 0.1 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
| 0.0 | 0.3 | GO:0050855 | regulation of B cell receptor signaling pathway(GO:0050855) |
| 0.0 | 0.0 | GO:0003331 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
| 0.0 | 0.3 | GO:0045954 | positive regulation of natural killer cell mediated cytotoxicity(GO:0045954) |
| 0.0 | 0.1 | GO:2000345 | regulation of hepatocyte proliferation(GO:2000345) |
| 0.0 | 0.5 | GO:0046579 | positive regulation of Ras protein signal transduction(GO:0046579) |
| 0.0 | 0.1 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.0 | 0.0 | GO:0048821 | erythrocyte development(GO:0048821) |
| 0.0 | 1.7 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
| 0.0 | 0.2 | GO:0048747 | muscle fiber development(GO:0048747) |
| 0.0 | 0.1 | GO:0009756 | carbohydrate mediated signaling(GO:0009756) |
| 0.0 | 0.0 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.0 | 0.0 | GO:0071481 | cellular response to X-ray(GO:0071481) |
| 0.0 | 0.1 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
| 0.0 | 0.0 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.0 | 0.1 | GO:0043652 | engulfment of apoptotic cell(GO:0043652) |
| 0.0 | 0.1 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
| 0.0 | 0.1 | GO:0010165 | response to X-ray(GO:0010165) |
| 0.0 | 0.0 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
| 0.0 | 0.2 | GO:0090659 | walking behavior(GO:0090659) |
| 0.0 | 0.2 | GO:0042921 | corticosteroid receptor signaling pathway(GO:0031958) glucocorticoid receptor signaling pathway(GO:0042921) |
| 0.0 | 0.1 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.0 | 0.0 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
| 0.0 | 0.1 | GO:0003351 | epithelial cilium movement(GO:0003351) |
| 0.0 | 0.1 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
| 0.0 | 0.1 | GO:0051928 | positive regulation of calcium ion transport(GO:0051928) |
| 0.0 | 0.0 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
| 0.0 | 0.4 | GO:0046513 | ceramide biosynthetic process(GO:0046513) |
| 0.0 | 5.1 | GO:0007283 | spermatogenesis(GO:0007283) |
| 0.0 | 0.1 | GO:0097009 | energy homeostasis(GO:0097009) |
| 0.0 | 0.0 | GO:0046056 | dADP metabolic process(GO:0046056) |
| 0.0 | 0.2 | GO:2000401 | regulation of lymphocyte migration(GO:2000401) |
| 0.0 | 0.1 | GO:0000394 | RNA splicing, via endonucleolytic cleavage and ligation(GO:0000394) |
| 0.0 | 0.2 | GO:0046785 | microtubule polymerization(GO:0046785) |
| 0.0 | 0.0 | GO:0097576 | vacuole fusion(GO:0097576) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.0 | 8.9 | GO:0098855 | HCN channel complex(GO:0098855) |
| 1.1 | 4.5 | GO:0060187 | cell pole(GO:0060187) |
| 1.1 | 4.5 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 1.0 | 9.6 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.8 | 1.5 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
| 0.6 | 3.1 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.6 | 4.2 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
| 0.6 | 1.7 | GO:0097134 | cyclin E1-CDK2 complex(GO:0097134) |
| 0.5 | 7.7 | GO:0098839 | postsynaptic density membrane(GO:0098839) |
| 0.5 | 1.6 | GO:0002945 | cyclin K-CDK13 complex(GO:0002945) |
| 0.5 | 4.7 | GO:0044326 | dendritic spine neck(GO:0044326) |
| 0.5 | 3.7 | GO:0014802 | terminal cisterna(GO:0014802) |
| 0.4 | 3.9 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.4 | 9.1 | GO:0005861 | troponin complex(GO:0005861) |
| 0.4 | 5.0 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.4 | 1.1 | GO:0075341 | host cell PML body(GO:0075341) |
| 0.3 | 3.8 | GO:0071546 | pi-body(GO:0071546) |
| 0.3 | 4.7 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.3 | 4.2 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.3 | 6.4 | GO:0061200 | clathrin-sculpted gamma-aminobutyric acid transport vesicle(GO:0061200) clathrin-sculpted gamma-aminobutyric acid transport vesicle membrane(GO:0061202) |
| 0.3 | 1.9 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.3 | 3.8 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.3 | 3.1 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
| 0.3 | 9.7 | GO:0071565 | nBAF complex(GO:0071565) |
| 0.3 | 1.8 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
| 0.3 | 1.7 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.3 | 0.8 | GO:0098844 | postsynaptic endocytic zone membrane(GO:0098844) |
| 0.3 | 1.3 | GO:0036398 | TCR signalosome(GO:0036398) |
| 0.3 | 2.9 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.3 | 2.1 | GO:0098845 | postsynaptic endosome(GO:0098845) |
| 0.3 | 1.0 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.3 | 4.7 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.3 | 2.3 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.3 | 2.3 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.2 | 0.7 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.2 | 4.0 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.2 | 0.9 | GO:0038038 | G-protein coupled receptor homodimeric complex(GO:0038038) |
| 0.2 | 5.1 | GO:0005845 | mRNA cap binding complex(GO:0005845) |
| 0.2 | 1.1 | GO:0031417 | NatC complex(GO:0031417) |
| 0.2 | 2.0 | GO:0036020 | endolysosome membrane(GO:0036020) |
| 0.2 | 0.7 | GO:0042025 | host cell nucleus(GO:0042025) |
| 0.2 | 0.9 | GO:0097224 | sperm connecting piece(GO:0097224) |
| 0.2 | 0.7 | GO:0005940 | septin ring(GO:0005940) septin collar(GO:0032173) |
| 0.2 | 21.3 | GO:0030118 | clathrin coat(GO:0030118) |
| 0.2 | 0.9 | GO:0097635 | extrinsic component of autophagosome membrane(GO:0097635) |
| 0.2 | 3.7 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.2 | 5.8 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.2 | 8.4 | GO:1902710 | GABA receptor complex(GO:1902710) |
| 0.2 | 0.8 | GO:0097450 | astrocyte end-foot(GO:0097450) |
| 0.2 | 2.4 | GO:0072487 | MSL complex(GO:0072487) |
| 0.2 | 2.0 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.2 | 0.8 | GO:0098843 | postsynaptic endocytic zone(GO:0098843) |
| 0.2 | 12.4 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.2 | 0.8 | GO:0001740 | Barr body(GO:0001740) |
| 0.2 | 3.0 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.2 | 3.0 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.2 | 3.0 | GO:0060091 | kinocilium(GO:0060091) |
| 0.2 | 1.9 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.2 | 1.5 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.2 | 7.7 | GO:0030673 | axolemma(GO:0030673) |
| 0.2 | 1.8 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.2 | 12.4 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.2 | 0.7 | GO:0016013 | syntrophin complex(GO:0016013) |
| 0.2 | 0.7 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.2 | 1.0 | GO:1990769 | proximal neuron projection(GO:1990769) |
| 0.2 | 0.3 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.2 | 4.0 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.2 | 0.3 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.2 | 0.7 | GO:1990796 | photoreceptor cell terminal bouton(GO:1990796) |
| 0.2 | 2.3 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
| 0.2 | 4.6 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.2 | 2.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.2 | 0.5 | GO:0031372 | UBC13-MMS2 complex(GO:0031372) |
| 0.2 | 4.5 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.2 | 11.8 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.2 | 4.4 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.2 | 0.5 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 0.2 | 0.5 | GO:0002947 | tumor necrosis factor receptor superfamily complex(GO:0002947) |
| 0.2 | 0.5 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.2 | 0.8 | GO:1990031 | pinceau fiber(GO:1990031) |
| 0.2 | 2.9 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.2 | 1.1 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.2 | 2.1 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.1 | 0.7 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.1 | 1.6 | GO:0005943 | phosphatidylinositol 3-kinase complex, class IA(GO:0005943) |
| 0.1 | 1.5 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.1 | 2.0 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
| 0.1 | 2.5 | GO:0005818 | astral microtubule(GO:0000235) aster(GO:0005818) |
| 0.1 | 0.6 | GO:0032437 | cuticular plate(GO:0032437) |
| 0.1 | 0.1 | GO:0000806 | Y chromosome(GO:0000806) |
| 0.1 | 2.3 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.1 | 0.5 | GO:0044753 | amphisome(GO:0044753) |
| 0.1 | 0.4 | GO:0030689 | Noc complex(GO:0030689) |
| 0.1 | 25.2 | GO:0043204 | perikaryon(GO:0043204) |
| 0.1 | 0.7 | GO:0060076 | excitatory synapse(GO:0060076) |
| 0.1 | 1.7 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.1 | 0.8 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.1 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
| 0.1 | 2.0 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.1 | 20.1 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.1 | 2.1 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.1 | 4.9 | GO:0097228 | sperm principal piece(GO:0097228) |
| 0.1 | 0.4 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.1 | 0.2 | GO:0044308 | axonal spine(GO:0044308) |
| 0.1 | 1.0 | GO:0033165 | interphotoreceptor matrix(GO:0033165) |
| 0.1 | 2.3 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.1 | 0.4 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 0.1 | 0.4 | GO:0032002 | interleukin-28 receptor complex(GO:0032002) |
| 0.1 | 0.7 | GO:0000308 | cytoplasmic cyclin-dependent protein kinase holoenzyme complex(GO:0000308) |
| 0.1 | 1.6 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.1 | 0.6 | GO:0000333 | telomerase catalytic core complex(GO:0000333) |
| 0.1 | 2.7 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.1 | 2.1 | GO:0010369 | chromocenter(GO:0010369) |
| 0.1 | 1.2 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.1 | 9.1 | GO:0042734 | presynaptic membrane(GO:0042734) |
| 0.1 | 1.1 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.1 | 1.2 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.1 | 0.8 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.1 | 0.2 | GO:0089701 | U2AF(GO:0089701) |
| 0.1 | 9.4 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.1 | 0.2 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
| 0.1 | 5.7 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.1 | 1.2 | GO:0033503 | HULC complex(GO:0033503) |
| 0.1 | 2.0 | GO:0044298 | neuronal cell body membrane(GO:0032809) cell body membrane(GO:0044298) |
| 0.1 | 0.4 | GO:0043291 | RAVE complex(GO:0043291) |
| 0.1 | 1.0 | GO:0008278 | cohesin complex(GO:0008278) |
| 0.1 | 2.6 | GO:0001527 | microfibril(GO:0001527) fibril(GO:0043205) |
| 0.1 | 0.5 | GO:0001652 | granular component(GO:0001652) |
| 0.1 | 1.5 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
| 0.1 | 4.1 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.1 | 0.3 | GO:0008091 | spectrin(GO:0008091) |
| 0.1 | 0.3 | GO:0034515 | proteasome storage granule(GO:0034515) |
| 0.1 | 2.4 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
| 0.1 | 1.2 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.1 | 0.3 | GO:1990298 | mitotic checkpoint complex(GO:0033597) bub1-bub3 complex(GO:1990298) |
| 0.1 | 1.1 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.1 | 3.3 | GO:0098878 | ionotropic glutamate receptor complex(GO:0008328) neurotransmitter receptor complex(GO:0098878) |
| 0.1 | 0.3 | GO:0005656 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
| 0.1 | 7.8 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.1 | 0.8 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.1 | 0.5 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
| 0.1 | 0.5 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
| 0.1 | 0.4 | GO:0031213 | RSF complex(GO:0031213) |
| 0.1 | 1.0 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.1 | 0.8 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.1 | 0.1 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.1 | 3.1 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.1 | 1.5 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.1 | 4.2 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.1 | 1.6 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.1 | 0.3 | GO:0000126 | transcription factor TFIIIB complex(GO:0000126) |
| 0.1 | 4.5 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
| 0.1 | 0.8 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.1 | 13.0 | GO:0016605 | PML body(GO:0016605) |
| 0.1 | 0.7 | GO:0071203 | WASH complex(GO:0071203) |
| 0.1 | 0.9 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.1 | 0.3 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
| 0.1 | 6.4 | GO:0015030 | Cajal body(GO:0015030) |
| 0.1 | 0.2 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.1 | 0.9 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.1 | 0.4 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.1 | 0.5 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.1 | 0.2 | GO:0044305 | calyx of Held(GO:0044305) |
| 0.1 | 0.1 | GO:0032280 | symmetric synapse(GO:0032280) |
| 0.1 | 0.2 | GO:0000796 | condensin complex(GO:0000796) |
| 0.1 | 0.2 | GO:1990923 | PET complex(GO:1990923) |
| 0.1 | 5.5 | GO:0005844 | polysome(GO:0005844) |
| 0.1 | 1.4 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
| 0.1 | 0.4 | GO:0032127 | dense core granule membrane(GO:0032127) |
| 0.1 | 9.7 | GO:0034705 | potassium channel complex(GO:0034705) |
| 0.1 | 0.4 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.1 | 2.1 | GO:0008287 | protein serine/threonine phosphatase complex(GO:0008287) phosphatase complex(GO:1903293) |
| 0.1 | 0.5 | GO:0010008 | endosome membrane(GO:0010008) |
| 0.1 | 0.5 | GO:0033565 | ESCRT-0 complex(GO:0033565) |
| 0.1 | 1.0 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.1 | 0.5 | GO:0000799 | nuclear condensin complex(GO:0000799) |
| 0.1 | 5.4 | GO:0043198 | dendritic shaft(GO:0043198) |
| 0.1 | 2.6 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.1 | 0.4 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.1 | 0.7 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.1 | 24.7 | GO:0098793 | presynapse(GO:0098793) |
| 0.1 | 0.1 | GO:0030897 | HOPS complex(GO:0030897) |
| 0.1 | 0.9 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.1 | 1.2 | GO:0032039 | integrator complex(GO:0032039) |
| 0.1 | 6.7 | GO:0005871 | kinesin complex(GO:0005871) |
| 0.1 | 0.5 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.1 | 3.9 | GO:0016235 | aggresome(GO:0016235) |
| 0.1 | 0.2 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
| 0.1 | 0.4 | GO:0032021 | NELF complex(GO:0032021) |
| 0.1 | 0.5 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.1 | 0.8 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
| 0.1 | 0.3 | GO:0030906 | retromer, cargo-selective complex(GO:0030906) |
| 0.1 | 0.3 | GO:0098791 | Golgi subcompartment(GO:0098791) |
| 0.1 | 0.1 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.1 | 0.5 | GO:0097227 | sperm annulus(GO:0097227) |
| 0.1 | 3.5 | GO:0016592 | mediator complex(GO:0016592) |
| 0.1 | 1.3 | GO:0033202 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 0.1 | 0.9 | GO:0043034 | costamere(GO:0043034) |
| 0.1 | 1.3 | GO:0032059 | bleb(GO:0032059) |
| 0.1 | 0.5 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.1 | 0.3 | GO:0031436 | BRCA1-BARD1 complex(GO:0031436) |
| 0.1 | 0.1 | GO:0043614 | multi-eIF complex(GO:0043614) |
| 0.1 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.1 | 1.3 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.1 | 1.0 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.1 | 0.3 | GO:0042584 | chromaffin granule(GO:0042583) chromaffin granule membrane(GO:0042584) |
| 0.1 | 0.3 | GO:0051286 | cell tip(GO:0051286) |
| 0.1 | 1.4 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.1 | 14.1 | GO:0014069 | postsynaptic density(GO:0014069) postsynaptic specialization(GO:0099572) |
| 0.1 | 0.6 | GO:0000803 | sex chromosome(GO:0000803) |
| 0.1 | 0.2 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
| 0.1 | 0.2 | GO:0008623 | CHRAC(GO:0008623) |
| 0.1 | 0.5 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.1 | 2.1 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.1 | 0.2 | GO:0039714 | viral factory(GO:0039713) cytoplasmic viral factory(GO:0039714) host cell viral assembly compartment(GO:0072517) |
| 0.1 | 0.2 | GO:0042022 | interleukin-12 receptor complex(GO:0042022) |
| 0.1 | 1.4 | GO:0046930 | pore complex(GO:0046930) |
| 0.1 | 0.9 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.1 | 0.2 | GO:0005798 | Golgi-associated vesicle(GO:0005798) |
| 0.1 | 0.5 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.1 | 0.6 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
| 0.1 | 2.3 | GO:0000145 | exocyst(GO:0000145) |
| 0.1 | 7.5 | GO:0005814 | centriole(GO:0005814) |
| 0.1 | 0.2 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
| 0.1 | 0.3 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.1 | 1.0 | GO:0090544 | BAF-type complex(GO:0090544) |
| 0.1 | 0.3 | GO:0005638 | lamin filament(GO:0005638) |
| 0.1 | 0.1 | GO:0032302 | MutSbeta complex(GO:0032302) |
| 0.1 | 0.4 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.1 | 1.8 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.1 | 3.6 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
| 0.1 | 1.3 | GO:0097546 | ciliary base(GO:0097546) |
| 0.1 | 0.4 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.1 | 0.2 | GO:0034657 | GID complex(GO:0034657) |
| 0.1 | 2.5 | GO:0030427 | site of polarized growth(GO:0030427) |
| 0.1 | 1.6 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.1 | 0.3 | GO:0032044 | DSIF complex(GO:0032044) |
| 0.1 | 0.5 | GO:0000974 | Prp19 complex(GO:0000974) |
| 0.1 | 0.3 | GO:0031941 | filamentous actin(GO:0031941) |
| 0.1 | 0.4 | GO:1990589 | ATF4-CREB1 transcription factor complex(GO:1990589) |
| 0.1 | 1.1 | GO:0032156 | septin cytoskeleton(GO:0032156) |
| 0.1 | 0.6 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) |
| 0.1 | 1.6 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
| 0.1 | 0.2 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.0 | 1.3 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.0 | 0.3 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.0 | 1.8 | GO:0030315 | T-tubule(GO:0030315) |
| 0.0 | 0.0 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.0 | 0.1 | GO:0000939 | condensed chromosome inner kinetochore(GO:0000939) |
| 0.0 | 0.7 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.0 | 0.6 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.0 | 2.1 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.0 | 0.2 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.0 | 0.2 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.0 | 0.0 | GO:0031523 | Myb complex(GO:0031523) |
| 0.0 | 2.3 | GO:0031430 | M band(GO:0031430) |
| 0.0 | 0.2 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.0 | 4.9 | GO:0000776 | kinetochore(GO:0000776) |
| 0.0 | 2.4 | GO:0005875 | microtubule associated complex(GO:0005875) |
| 0.0 | 0.1 | GO:0030895 | apolipoprotein B mRNA editing enzyme complex(GO:0030895) |
| 0.0 | 0.6 | GO:0001726 | ruffle(GO:0001726) |
| 0.0 | 0.3 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.0 | 2.5 | GO:0000794 | condensed nuclear chromosome(GO:0000794) |
| 0.0 | 0.7 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.0 | 0.2 | GO:0030891 | VCB complex(GO:0030891) |
| 0.0 | 1.3 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
| 0.0 | 0.5 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 0.0 | 0.4 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.0 | 0.9 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.0 | 0.2 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.0 | 0.2 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.0 | 0.8 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.0 | 1.0 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 0.2 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.0 | 0.5 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.0 | 1.2 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
| 0.0 | 2.1 | GO:0000123 | histone acetyltransferase complex(GO:0000123) |
| 0.0 | 0.6 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
| 0.0 | 0.1 | GO:0036457 | keratohyalin granule(GO:0036457) |
| 0.0 | 19.0 | GO:0016607 | nuclear speck(GO:0016607) |
| 0.0 | 1.2 | GO:0000793 | condensed chromosome(GO:0000793) |
| 0.0 | 2.0 | GO:0000786 | nucleosome(GO:0000786) |
| 0.0 | 0.5 | GO:0045111 | intermediate filament cytoskeleton(GO:0045111) |
| 0.0 | 0.2 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.0 | 0.5 | GO:0031211 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
| 0.0 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
| 0.0 | 0.4 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.0 | 3.2 | GO:0031901 | early endosome membrane(GO:0031901) |
| 0.0 | 0.1 | GO:0044609 | DBIRD complex(GO:0044609) |
| 0.0 | 1.4 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.0 | 0.4 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
| 0.0 | 4.3 | GO:0005778 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.0 | 0.3 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.0 | 0.2 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.0 | 0.2 | GO:0045272 | plasma membrane respiratory chain complex I(GO:0045272) |
| 0.0 | 0.8 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
| 0.0 | 0.6 | GO:0034399 | nuclear periphery(GO:0034399) |
| 0.0 | 0.2 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
| 0.0 | 0.5 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.0 | 0.1 | GO:0071942 | XPC complex(GO:0071942) |
| 0.0 | 2.2 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.0 | 0.1 | GO:0044450 | microtubule organizing center part(GO:0044450) |
| 0.0 | 0.8 | GO:0043679 | axon terminus(GO:0043679) |
| 0.0 | 0.1 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| 0.0 | 0.5 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
| 0.0 | 0.2 | GO:0030904 | retromer complex(GO:0030904) |
| 0.0 | 3.1 | GO:0016363 | nuclear matrix(GO:0016363) |
| 0.0 | 0.1 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
| 0.0 | 0.3 | GO:0090543 | Flemming body(GO:0090543) |
| 0.0 | 0.7 | GO:0016234 | inclusion body(GO:0016234) |
| 0.0 | 0.1 | GO:0101003 | ficolin-1-rich granule membrane(GO:0101003) |
| 0.0 | 0.3 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
| 0.0 | 0.2 | GO:0070938 | contractile ring(GO:0070938) |
| 0.0 | 0.2 | GO:0030424 | axon(GO:0030424) |
| 0.0 | 0.2 | GO:0043235 | receptor complex(GO:0043235) |
| 0.0 | 0.2 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.0 | 0.1 | GO:0043293 | apoptosome(GO:0043293) |
| 0.0 | 1.1 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.0 | 0.1 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.0 | 0.5 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.0 | 0.1 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.0 | 0.2 | GO:0002177 | manchette(GO:0002177) |
| 0.0 | 3.8 | GO:0030018 | Z disc(GO:0030018) |
| 0.0 | 1.8 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.0 | 2.8 | GO:0045211 | postsynaptic membrane(GO:0045211) |
| 0.0 | 0.6 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.0 | 0.1 | GO:0034464 | BBSome(GO:0034464) |
| 0.0 | 0.1 | GO:0032301 | MutSalpha complex(GO:0032301) |
| 0.0 | 0.3 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.0 | 1.1 | GO:0070821 | tertiary granule membrane(GO:0070821) |
| 0.0 | 0.2 | GO:0098559 | cytoplasmic side of early endosome membrane(GO:0098559) |
| 0.0 | 0.8 | GO:1990391 | DNA repair complex(GO:1990391) |
| 0.0 | 0.0 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.0 | 0.4 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.0 | 0.1 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.0 | 0.1 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.0 | 0.0 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.0 | 0.8 | GO:0043596 | nuclear replication fork(GO:0043596) |
| 0.0 | 1.3 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
| 0.0 | 0.2 | GO:1902560 | GMP reductase complex(GO:1902560) |
| 0.0 | 0.1 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.0 | 0.1 | GO:0030425 | dendrite(GO:0030425) |
| 0.0 | 0.1 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.0 | 0.2 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.0 | 0.1 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.0 | 1.9 | GO:0005776 | autophagosome(GO:0005776) |
| 0.0 | 3.2 | GO:1904813 | ficolin-1-rich granule(GO:0101002) ficolin-1-rich granule lumen(GO:1904813) |
| 0.0 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.0 | 0.3 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.0 | 4.8 | GO:0005802 | trans-Golgi network(GO:0005802) |
| 0.0 | 0.1 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.0 | 0.1 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.0 | 0.3 | GO:0042555 | MCM complex(GO:0042555) |
| 0.0 | 0.4 | GO:0097381 | photoreceptor disc membrane(GO:0097381) |
| 0.0 | 0.1 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.0 | 0.3 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 0.1 | GO:0035692 | macrophage migration inhibitory factor receptor complex(GO:0035692) |
| 0.0 | 0.2 | GO:0030496 | midbody(GO:0030496) |
| 0.0 | 0.8 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 0.1 | GO:0071159 | NF-kappaB p50/p65 complex(GO:0035525) NF-kappaB complex(GO:0071159) |
| 0.0 | 0.1 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.0 | 0.2 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.0 | 0.4 | GO:0043025 | neuronal cell body(GO:0043025) |
| 0.0 | 0.1 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.0 | 0.1 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.0 | 0.1 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
| 0.0 | 0.1 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
| 0.0 | 0.2 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.0 | 0.1 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.0 | 0.3 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.0 | 1.0 | GO:0015630 | microtubule cytoskeleton(GO:0015630) |
| 0.0 | 1.0 | GO:0043657 | host(GO:0018995) host cell(GO:0043657) |
| 0.0 | 0.7 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
| 0.0 | 0.1 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 3.0 | GO:0005819 | spindle(GO:0005819) |
| 0.0 | 0.3 | GO:0031527 | filopodium membrane(GO:0031527) |
| 0.0 | 0.2 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.0 | 0.1 | GO:0045179 | apical cortex(GO:0045179) |
| 0.0 | 0.3 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.0 | 0.1 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.0 | 2.9 | GO:0000151 | ubiquitin ligase complex(GO:0000151) |
| 0.0 | 0.1 | GO:0009898 | cytoplasmic side of plasma membrane(GO:0009898) |
| 0.0 | 0.1 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.0 | 0.5 | GO:0005929 | cilium(GO:0005929) |
| 0.0 | 0.1 | GO:0032797 | SMN complex(GO:0032797) |
| 0.0 | 0.6 | GO:0044449 | contractile fiber part(GO:0044449) |
| 0.0 | 0.1 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.0 | 0.1 | GO:0031906 | late endosome lumen(GO:0031906) |
| 0.0 | 0.1 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.0 | 0.5 | GO:0036064 | ciliary basal body(GO:0036064) |
| 0.0 | 0.7 | GO:0055029 | nuclear DNA-directed RNA polymerase complex(GO:0055029) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.8 | 8.9 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 1.5 | 4.5 | GO:0016534 | cyclin-dependent protein kinase 5 activator activity(GO:0016534) |
| 1.4 | 5.7 | GO:0035403 | histone kinase activity (H3-T6 specific)(GO:0035403) |
| 0.9 | 6.1 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.8 | 10.6 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.7 | 5.4 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.7 | 2.0 | GO:0036009 | protein-glutamine N-methyltransferase activity(GO:0036009) histone-glutamine methyltransferase activity(GO:1990259) |
| 0.6 | 1.9 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.6 | 8.6 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.6 | 6.5 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.6 | 1.8 | GO:0031877 | somatostatin receptor binding(GO:0031877) |
| 0.5 | 0.5 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
| 0.5 | 2.1 | GO:0061628 | H3K27me3 modified histone binding(GO:0061628) |
| 0.5 | 4.0 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.5 | 2.0 | GO:0098808 | mRNA cap binding(GO:0098808) |
| 0.5 | 4.3 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.5 | 3.2 | GO:0023025 | MHC class Ib protein complex binding(GO:0023025) MHC class Ib protein binding, via antigen binding groove(GO:0023030) |
| 0.5 | 1.8 | GO:0004727 | prenylated protein tyrosine phosphatase activity(GO:0004727) |
| 0.5 | 3.2 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.4 | 8.8 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.4 | 8.8 | GO:1990239 | steroid hormone binding(GO:1990239) |
| 0.4 | 1.7 | GO:0015154 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.4 | 3.0 | GO:0005353 | fructose transmembrane transporter activity(GO:0005353) |
| 0.4 | 2.6 | GO:0052848 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) inositol diphosphate tetrakisphosphate diphosphatase activity(GO:0052840) inositol bisdiphosphate tetrakisphosphate diphosphatase activity(GO:0052841) inositol diphosphate pentakisphosphate diphosphatase activity(GO:0052842) inositol-1-diphosphate-2,3,4,5,6-pentakisphosphate diphosphatase activity(GO:0052843) inositol-3-diphosphate-1,2,4,5,6-pentakisphosphate diphosphatase activity(GO:0052844) inositol-5-diphosphate-1,2,3,4,6-pentakisphosphate diphosphatase activity(GO:0052845) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 1-diphosphatase activity(GO:0052846) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052847) inositol-3,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052848) |
| 0.4 | 7.4 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.4 | 1.2 | GO:0098782 | mechanically-gated potassium channel activity(GO:0098782) |
| 0.4 | 1.2 | GO:0061752 | telomeric repeat-containing RNA binding(GO:0061752) |
| 0.4 | 5.9 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
| 0.4 | 1.5 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.4 | 3.0 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.4 | 4.3 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.4 | 1.1 | GO:0052725 | inositol tetrakisphosphate 1-kinase activity(GO:0047325) inositol-1,3,4-trisphosphate 6-kinase activity(GO:0052725) inositol-1,3,4-trisphosphate 5-kinase activity(GO:0052726) inositol-1,3,4,5,6-pentakisphosphate 1-phosphatase activity(GO:0052825) inositol-1,3,4,6-tetrakisphosphate 6-phosphatase activity(GO:0052830) inositol-1,3,4,6-tetrakisphosphate 1-phosphatase activity(GO:0052831) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) |
| 0.4 | 2.1 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
| 0.4 | 1.4 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.4 | 1.8 | GO:0042799 | histone methyltransferase activity (H4-K20 specific)(GO:0042799) |
| 0.3 | 1.7 | GO:0031208 | POZ domain binding(GO:0031208) |
| 0.3 | 1.4 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
| 0.3 | 1.4 | GO:0031811 | G-protein coupled nucleotide receptor binding(GO:0031811) P2Y1 nucleotide receptor binding(GO:0031812) |
| 0.3 | 0.7 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.3 | 1.7 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.3 | 3.0 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
| 0.3 | 1.3 | GO:0004057 | arginyltransferase activity(GO:0004057) |
| 0.3 | 1.6 | GO:0050659 | N-acetylgalactosamine 4-sulfate 6-O-sulfotransferase activity(GO:0050659) |
| 0.3 | 10.2 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.3 | 5.1 | GO:0098960 | postsynaptic neurotransmitter receptor activity(GO:0098960) |
| 0.3 | 3.1 | GO:0001225 | RNA polymerase II transcription coactivator binding(GO:0001225) |
| 0.3 | 0.9 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.3 | 1.2 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
| 0.3 | 1.2 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.3 | 2.4 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.3 | 2.1 | GO:0043813 | phosphatidylinositol-3,5-bisphosphate 5-phosphatase activity(GO:0043813) |
| 0.3 | 8.1 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.3 | 3.0 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.3 | 1.8 | GO:0080019 | fatty-acyl-CoA reductase (alcohol-forming) activity(GO:0080019) |
| 0.3 | 2.3 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
| 0.3 | 1.7 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
| 0.3 | 4.6 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.3 | 0.3 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.3 | 2.5 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.3 | 3.1 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
| 0.3 | 0.3 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.3 | 0.8 | GO:0003968 | RNA-directed RNA polymerase activity(GO:0003968) |
| 0.3 | 1.1 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.3 | 0.8 | GO:0031798 | type 1 metabotropic glutamate receptor binding(GO:0031798) |
| 0.3 | 1.6 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.3 | 0.5 | GO:1904455 | ubiquitin-specific protease activity involved in negative regulation of ERAD pathway(GO:1904455) |
| 0.3 | 3.5 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.3 | 3.4 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.3 | 0.5 | GO:0010465 | nerve growth factor receptor activity(GO:0010465) |
| 0.3 | 3.4 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.3 | 1.5 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
| 0.3 | 2.3 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.3 | 6.4 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.3 | 1.0 | GO:0032427 | GBD domain binding(GO:0032427) |
| 0.3 | 5.3 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.2 | 8.4 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.2 | 1.5 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
| 0.2 | 0.7 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.2 | 2.9 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.2 | 8.7 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.2 | 0.7 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
| 0.2 | 2.2 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.2 | 2.2 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.2 | 1.6 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.2 | 0.9 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.2 | 1.6 | GO:0005119 | smoothened binding(GO:0005119) |
| 0.2 | 0.7 | GO:0005298 | proline:sodium symporter activity(GO:0005298) |
| 0.2 | 0.7 | GO:0070698 | type I activin receptor binding(GO:0070698) |
| 0.2 | 0.7 | GO:1904713 | beta-catenin destruction complex binding(GO:1904713) |
| 0.2 | 0.5 | GO:0098640 | integrin binding involved in cell-matrix adhesion(GO:0098640) |
| 0.2 | 2.9 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.2 | 1.1 | GO:0015056 | corticotrophin-releasing factor receptor activity(GO:0015056) |
| 0.2 | 1.5 | GO:0047493 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
| 0.2 | 1.7 | GO:0098988 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) G-protein coupled glutamate receptor activity(GO:0098988) |
| 0.2 | 0.9 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.2 | 1.1 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.2 | 0.9 | GO:0099609 | microtubule lateral binding(GO:0099609) |
| 0.2 | 3.0 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.2 | 0.6 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.2 | 3.4 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
| 0.2 | 0.8 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.2 | 1.0 | GO:0044378 | non-sequence-specific DNA binding, bending(GO:0044378) |
| 0.2 | 0.6 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
| 0.2 | 1.2 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.2 | 0.6 | GO:0008386 | cholesterol monooxygenase (side-chain-cleaving) activity(GO:0008386) |
| 0.2 | 0.8 | GO:0052810 | 1-phosphatidylinositol-5-kinase activity(GO:0052810) |
| 0.2 | 8.0 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.2 | 4.8 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.2 | 1.0 | GO:0004306 | ethanolamine-phosphate cytidylyltransferase activity(GO:0004306) |
| 0.2 | 0.6 | GO:0004603 | phenylethanolamine N-methyltransferase activity(GO:0004603) |
| 0.2 | 0.6 | GO:0001026 | TFIIIB-type transcription factor activity(GO:0001026) |
| 0.2 | 3.1 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.2 | 0.5 | GO:0019948 | SUMO activating enzyme activity(GO:0019948) |
| 0.2 | 5.4 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.2 | 5.5 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.2 | 1.8 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.2 | 0.2 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.2 | 2.8 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.2 | 1.9 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.2 | 0.9 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.2 | 7.7 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.2 | 1.9 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.2 | 3.8 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.2 | 0.5 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.2 | 4.8 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.2 | 0.8 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.2 | 0.3 | GO:0001076 | transcription factor activity, RNA polymerase II transcription factor binding(GO:0001076) |
| 0.2 | 8.1 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.2 | 0.8 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.2 | 1.5 | GO:1903136 | cuprous ion binding(GO:1903136) |
| 0.2 | 0.7 | GO:0034057 | RNA strand-exchange activity(GO:0034057) |
| 0.2 | 1.8 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.2 | 1.5 | GO:0034597 | phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) |
| 0.2 | 6.5 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
| 0.2 | 0.6 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
| 0.2 | 1.5 | GO:0004396 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.2 | 7.6 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.2 | 0.6 | GO:0050211 | procollagen galactosyltransferase activity(GO:0050211) |
| 0.2 | 1.0 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.2 | 1.0 | GO:1902444 | riboflavin binding(GO:1902444) |
| 0.2 | 0.5 | GO:0038100 | nodal binding(GO:0038100) |
| 0.2 | 3.7 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.2 | 0.5 | GO:0086039 | lutropin-choriogonadotropic hormone receptor binding(GO:0031775) calcium-transporting ATPase activity involved in regulation of cardiac muscle cell membrane potential(GO:0086039) |
| 0.2 | 0.6 | GO:0030305 | heparanase activity(GO:0030305) |
| 0.2 | 1.9 | GO:0001733 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.2 | 0.9 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.2 | 4.1 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.1 | 1.5 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.1 | 1.2 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
| 0.1 | 0.4 | GO:0031783 | corticotropin hormone receptor binding(GO:0031780) type 5 melanocortin receptor binding(GO:0031783) |
| 0.1 | 0.4 | GO:0050254 | rhodopsin kinase activity(GO:0050254) |
| 0.1 | 0.7 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.1 | 0.6 | GO:0004113 | 2',3'-cyclic-nucleotide 3'-phosphodiesterase activity(GO:0004113) |
| 0.1 | 0.4 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
| 0.1 | 1.9 | GO:0051378 | amine binding(GO:0043176) serotonin binding(GO:0051378) |
| 0.1 | 1.0 | GO:0043426 | MRF binding(GO:0043426) |
| 0.1 | 1.2 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.1 | 0.7 | GO:0046592 | polyamine oxidase activity(GO:0046592) spermine:oxygen oxidoreductase (spermidine-forming) activity(GO:0052901) |
| 0.1 | 0.4 | GO:0015288 | porin activity(GO:0015288) |
| 0.1 | 0.4 | GO:0031691 | alpha-1A adrenergic receptor binding(GO:0031691) follicle-stimulating hormone receptor binding(GO:0031762) |
| 0.1 | 0.6 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 0.1 | 3.2 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
| 0.1 | 0.5 | GO:0046921 | glycoprotein 6-alpha-L-fucosyltransferase activity(GO:0008424) alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
| 0.1 | 0.4 | GO:0001160 | transcription termination site sequence-specific DNA binding(GO:0001147) transcription termination site DNA binding(GO:0001160) |
| 0.1 | 3.8 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.1 | 2.0 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.1 | 0.7 | GO:0008267 | poly-glutamine tract binding(GO:0008267) |
| 0.1 | 15.9 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
| 0.1 | 1.1 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
| 0.1 | 4.5 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.1 | 1.2 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.1 | 4.8 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.1 | 0.8 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.1 | 0.5 | GO:0004802 | transketolase activity(GO:0004802) |
| 0.1 | 10.0 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.1 | 4.2 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
| 0.1 | 2.9 | GO:0099604 | calcium-release channel activity(GO:0015278) ligand-gated calcium channel activity(GO:0099604) |
| 0.1 | 0.5 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.1 | 3.0 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.1 | 0.4 | GO:0004821 | histidine-tRNA ligase activity(GO:0004821) |
| 0.1 | 0.6 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 0.1 | 0.4 | GO:0016603 | glutaminyl-peptide cyclotransferase activity(GO:0016603) |
| 0.1 | 5.6 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.1 | 2.3 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.1 | 1.3 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.1 | 0.6 | GO:0004910 | interleukin-1, Type II, blocking receptor activity(GO:0004910) |
| 0.1 | 0.5 | GO:0005334 | norepinephrine:sodium symporter activity(GO:0005334) |
| 0.1 | 0.6 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.1 | 28.9 | GO:0042393 | histone binding(GO:0042393) |
| 0.1 | 1.8 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
| 0.1 | 0.9 | GO:0047820 | D-glutamate cyclase activity(GO:0047820) |
| 0.1 | 1.1 | GO:0042835 | BRE binding(GO:0042835) |
| 0.1 | 0.4 | GO:0034041 | sterol-transporting ATPase activity(GO:0034041) |
| 0.1 | 0.7 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
| 0.1 | 0.9 | GO:0051219 | phosphoprotein binding(GO:0051219) |
| 0.1 | 1.4 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.1 | 0.4 | GO:0015130 | mevalonate transmembrane transporter activity(GO:0015130) |
| 0.1 | 0.7 | GO:0015333 | peptide:proton symporter activity(GO:0015333) proton-dependent peptide secondary active transmembrane transporter activity(GO:0022897) |
| 0.1 | 0.9 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.1 | 1.8 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.1 | 0.2 | GO:0035254 | glutamate receptor binding(GO:0035254) |
| 0.1 | 2.3 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.1 | 1.4 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.1 | 0.6 | GO:0010861 | thyroid hormone receptor activator activity(GO:0010861) thyroid hormone receptor coactivator activity(GO:0030375) |
| 0.1 | 1.7 | GO:0047144 | 2-acylglycerol-3-phosphate O-acyltransferase activity(GO:0047144) |
| 0.1 | 1.4 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.1 | 2.8 | GO:0022848 | acetylcholine-gated cation channel activity(GO:0022848) |
| 0.1 | 0.7 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
| 0.1 | 2.2 | GO:0005522 | profilin binding(GO:0005522) |
| 0.1 | 1.4 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.1 | 0.2 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.1 | 1.9 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.1 | 2.1 | GO:0042923 | neuropeptide binding(GO:0042923) |
| 0.1 | 0.9 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.1 | 2.2 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
| 0.1 | 0.5 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.1 | 2.2 | GO:0008430 | selenium binding(GO:0008430) |
| 0.1 | 0.9 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
| 0.1 | 1.4 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.1 | 1.3 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.1 | 5.5 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 0.1 | 0.2 | GO:0015078 | hydrogen ion transmembrane transporter activity(GO:0015078) |
| 0.1 | 1.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.1 | 0.4 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
| 0.1 | 0.1 | GO:0038049 | transcription factor activity, ligand-activated RNA polymerase II transcription factor binding(GO:0038049) |
| 0.1 | 3.9 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.1 | 0.3 | GO:0015235 | cobalamin transporter activity(GO:0015235) |
| 0.1 | 0.9 | GO:0017018 | myosin phosphatase activity(GO:0017018) |
| 0.1 | 0.1 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.1 | 0.3 | GO:0008511 | sodium:potassium:chloride symporter activity(GO:0008511) |
| 0.1 | 3.4 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.1 | 0.1 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.1 | 1.2 | GO:0051434 | BH3 domain binding(GO:0051434) |
| 0.1 | 0.8 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.1 | 1.1 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.1 | 0.2 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.1 | 0.1 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
| 0.1 | 3.0 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.1 | 8.9 | GO:0005249 | voltage-gated potassium channel activity(GO:0005249) |
| 0.1 | 2.4 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.1 | 0.4 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.1 | 0.3 | GO:0098770 | FBXO family protein binding(GO:0098770) |
| 0.1 | 1.2 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.1 | 1.4 | GO:0022821 | potassium ion antiporter activity(GO:0022821) |
| 0.1 | 0.4 | GO:0004452 | isopentenyl-diphosphate delta-isomerase activity(GO:0004452) |
| 0.1 | 0.6 | GO:0044736 | acid-sensing ion channel activity(GO:0044736) |
| 0.1 | 0.4 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.1 | 0.7 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.1 | 0.5 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.1 | 1.5 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.1 | 0.5 | GO:0030348 | syntaxin-3 binding(GO:0030348) |
| 0.1 | 0.2 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
| 0.1 | 3.7 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.1 | 2.1 | GO:0008066 | glutamate receptor activity(GO:0008066) |
| 0.1 | 9.1 | GO:0004004 | ATP-dependent RNA helicase activity(GO:0004004) |
| 0.1 | 0.4 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
| 0.1 | 0.9 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.1 | 2.6 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.1 | 4.4 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.1 | 2.7 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
| 0.1 | 0.4 | GO:0042954 | lipoprotein transporter activity(GO:0042954) |
| 0.1 | 1.2 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.1 | 0.4 | GO:0003947 | (N-acetylneuraminyl)-galactosylglucosylceramide N-acetylgalactosaminyltransferase activity(GO:0003947) |
| 0.1 | 0.3 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.1 | 0.3 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.1 | 0.2 | GO:0030984 | kininogen binding(GO:0030984) |
| 0.1 | 0.9 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.1 | 1.3 | GO:0046870 | cadmium ion binding(GO:0046870) |
| 0.1 | 1.0 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.1 | 1.5 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.1 | 0.8 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
| 0.1 | 0.9 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) |
| 0.1 | 1.6 | GO:0043422 | protein kinase B binding(GO:0043422) |
| 0.1 | 4.9 | GO:0003682 | chromatin binding(GO:0003682) |
| 0.1 | 1.0 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.1 | 0.4 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.1 | 3.5 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.1 | 1.6 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.1 | 4.6 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.1 | 0.9 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.1 | 0.6 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.1 | 2.2 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.1 | 1.6 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.1 | 0.7 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.1 | 3.3 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.1 | 11.8 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.1 | 1.7 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
| 0.1 | 6.9 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.1 | 0.3 | GO:0046404 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.1 | 0.6 | GO:0004331 | 6-phosphofructo-2-kinase activity(GO:0003873) fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.1 | 4.6 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
| 0.1 | 0.3 | GO:0004530 | deoxyribonuclease I activity(GO:0004530) |
| 0.1 | 1.9 | GO:0032452 | histone demethylase activity(GO:0032452) |
| 0.1 | 0.6 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.1 | 0.7 | GO:0016618 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.1 | 0.4 | GO:0034596 | phosphatidylinositol phosphate 4-phosphatase activity(GO:0034596) |
| 0.1 | 0.4 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.1 | 0.8 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
| 0.1 | 0.2 | GO:0038131 | neuregulin receptor activity(GO:0038131) |
| 0.1 | 0.8 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
| 0.1 | 1.2 | GO:0019894 | kinesin binding(GO:0019894) |
| 0.1 | 0.8 | GO:0042165 | neurotransmitter binding(GO:0042165) |
| 0.1 | 1.3 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.1 | 0.4 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.1 | 0.4 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.1 | 0.3 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
| 0.1 | 0.4 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.1 | 0.4 | GO:0051916 | granulocyte colony-stimulating factor binding(GO:0051916) |
| 0.1 | 3.2 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 0.1 | 1.0 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.1 | 6.1 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
| 0.1 | 1.2 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
| 0.1 | 0.5 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.1 | 7.3 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
| 0.1 | 0.2 | GO:0004019 | adenylosuccinate synthase activity(GO:0004019) |
| 0.1 | 3.8 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.1 | 3.4 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.1 | 0.9 | GO:0003910 | DNA ligase (ATP) activity(GO:0003910) |
| 0.1 | 1.9 | GO:0000339 | RNA cap binding(GO:0000339) |
| 0.1 | 0.7 | GO:0010859 | calcium-dependent cysteine-type endopeptidase inhibitor activity(GO:0010859) |
| 0.1 | 6.3 | GO:0048365 | Rac GTPase binding(GO:0048365) |
| 0.1 | 0.1 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
| 0.1 | 0.4 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.1 | 0.4 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.1 | 0.2 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
| 0.1 | 0.9 | GO:0005003 | ephrin receptor activity(GO:0005003) |
| 0.1 | 0.9 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
| 0.1 | 0.9 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
| 0.1 | 0.3 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.1 | 1.7 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.1 | 0.3 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
| 0.1 | 0.2 | GO:0005128 | erythropoietin receptor binding(GO:0005128) interleukin-3 receptor binding(GO:0005135) |
| 0.1 | 1.8 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.1 | 1.3 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.1 | 0.1 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.1 | 0.1 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.1 | 1.9 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.1 | 0.6 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
| 0.1 | 1.0 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
| 0.1 | 0.2 | GO:0016517 | interleukin-12 receptor activity(GO:0016517) |
| 0.1 | 0.1 | GO:0043492 | ATPase activity, coupled to movement of substances(GO:0043492) |
| 0.1 | 0.3 | GO:0015265 | urea channel activity(GO:0015265) |
| 0.1 | 5.4 | GO:0022832 | voltage-gated ion channel activity(GO:0005244) voltage-gated channel activity(GO:0022832) |
| 0.1 | 0.2 | GO:0030197 | extracellular matrix constituent, lubricant activity(GO:0030197) |
| 0.1 | 0.1 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
| 0.1 | 0.2 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
| 0.1 | 0.2 | GO:0019781 | NEDD8 activating enzyme activity(GO:0019781) |
| 0.1 | 0.5 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
| 0.1 | 0.4 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.1 | 18.5 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) |
| 0.1 | 0.5 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
| 0.1 | 0.2 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 0.1 | 0.2 | GO:0004180 | carboxypeptidase activity(GO:0004180) |
| 0.1 | 0.4 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.1 | 0.1 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
| 0.1 | 0.2 | GO:0005174 | CD40 receptor binding(GO:0005174) |
| 0.1 | 0.1 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.1 | 1.3 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.1 | 0.2 | GO:0048257 | 3'-flap endonuclease activity(GO:0048257) |
| 0.1 | 18.9 | GO:0004842 | ubiquitin-protein transferase activity(GO:0004842) |
| 0.1 | 1.9 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.1 | 0.2 | GO:0016608 | growth hormone-releasing hormone activity(GO:0016608) |
| 0.1 | 1.8 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
| 0.1 | 0.2 | GO:0031531 | thyrotropin-releasing hormone receptor binding(GO:0031531) |
| 0.1 | 2.0 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.1 | 0.2 | GO:0004507 | steroid 11-beta-monooxygenase activity(GO:0004507) corticosterone 18-monooxygenase activity(GO:0047783) |
| 0.1 | 0.2 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.1 | 0.5 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.1 | 0.1 | GO:0090631 | pre-miRNA transporter activity(GO:0090631) |
| 0.1 | 0.3 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.1 | 2.4 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.1 | 3.7 | GO:0008408 | 3'-5' exonuclease activity(GO:0008408) |
| 0.1 | 0.2 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
| 0.1 | 4.0 | GO:0001071 | nucleic acid binding transcription factor activity(GO:0001071) |
| 0.0 | 0.4 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.0 | 0.6 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.0 | 0.3 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
| 0.0 | 0.0 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.0 | 0.2 | GO:0004775 | succinate-CoA ligase (ADP-forming) activity(GO:0004775) |
| 0.0 | 7.0 | GO:0019208 | phosphatase regulator activity(GO:0019208) |
| 0.0 | 0.5 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.0 | 1.8 | GO:0036459 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) |
| 0.0 | 0.6 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.0 | 0.3 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.0 | 0.8 | GO:0051018 | protein kinase A binding(GO:0051018) |
| 0.0 | 0.4 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.0 | 0.3 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.0 | 0.1 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.0 | 0.1 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.0 | 0.4 | GO:0060698 | endoribonuclease inhibitor activity(GO:0060698) |
| 0.0 | 1.7 | GO:0019707 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.0 | 1.8 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.0 | 0.1 | GO:0004772 | sterol O-acyltransferase activity(GO:0004772) cholesterol O-acyltransferase activity(GO:0034736) |
| 0.0 | 1.2 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
| 0.0 | 0.2 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.0 | 9.4 | GO:0017137 | Rab GTPase binding(GO:0017137) |
| 0.0 | 0.3 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.0 | 2.3 | GO:0001104 | RNA polymerase II transcription cofactor activity(GO:0001104) |
| 0.0 | 2.5 | GO:0043130 | ubiquitin binding(GO:0043130) |
| 0.0 | 0.6 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.0 | 0.5 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.0 | 0.5 | GO:0004952 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) dopamine neurotransmitter receptor activity(GO:0004952) |
| 0.0 | 0.9 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.0 | 0.1 | GO:0004342 | glucosamine-6-phosphate deaminase activity(GO:0004342) |
| 0.0 | 0.7 | GO:0008061 | chitin binding(GO:0008061) |
| 0.0 | 0.2 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 0.0 | 0.2 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 0.0 | 0.3 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.0 | 0.3 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.0 | 0.1 | GO:0004730 | pseudouridylate synthase activity(GO:0004730) |
| 0.0 | 1.3 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
| 0.0 | 0.2 | GO:0047977 | hepoxilin-epoxide hydrolase activity(GO:0047977) |
| 0.0 | 0.2 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.0 | 0.1 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
| 0.0 | 0.1 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.0 | 0.4 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.0 | 0.4 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 0.0 | 0.1 | GO:0004320 | oleoyl-[acyl-carrier-protein] hydrolase activity(GO:0004320) myristoyl-[acyl-carrier-protein] hydrolase activity(GO:0016295) palmitoyl-[acyl-carrier-protein] hydrolase activity(GO:0016296) acyl-[acyl-carrier-protein] hydrolase activity(GO:0016297) |
| 0.0 | 0.8 | GO:0046961 | hydrogen-exporting ATPase activity(GO:0036442) proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.0 | 0.2 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.0 | 0.5 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
| 0.0 | 0.5 | GO:0019826 | oxygen sensor activity(GO:0019826) |
| 0.0 | 1.3 | GO:0031491 | nucleosome binding(GO:0031491) |
| 0.0 | 2.3 | GO:0030276 | clathrin binding(GO:0030276) |
| 0.0 | 0.1 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.0 | 0.1 | GO:0000404 | heteroduplex DNA loop binding(GO:0000404) |
| 0.0 | 0.3 | GO:0033857 | diphosphoinositol-pentakisphosphate kinase activity(GO:0033857) |
| 0.0 | 0.4 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.0 | 0.2 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
| 0.0 | 1.1 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.0 | 0.7 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.0 | 0.3 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.0 | 0.4 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 0.0 | 1.9 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.0 | 2.7 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
| 0.0 | 0.3 | GO:0050664 | oxidoreductase activity, acting on NAD(P)H, oxygen as acceptor(GO:0050664) |
| 0.0 | 0.5 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
| 0.0 | 0.2 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.0 | 0.1 | GO:0004660 | protein farnesyltransferase activity(GO:0004660) |
| 0.0 | 1.3 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
| 0.0 | 0.3 | GO:0003916 | DNA topoisomerase activity(GO:0003916) DNA topoisomerase type I activity(GO:0003917) |
| 0.0 | 0.1 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.0 | 2.9 | GO:0000149 | SNARE binding(GO:0000149) |
| 0.0 | 0.6 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.0 | 0.1 | GO:0070728 | leucine binding(GO:0070728) |
| 0.0 | 0.3 | GO:0019789 | SUMO transferase activity(GO:0019789) |
| 0.0 | 0.3 | GO:0071253 | connexin binding(GO:0071253) |
| 0.0 | 0.2 | GO:0055077 | gap junction hemi-channel activity(GO:0055077) |
| 0.0 | 0.2 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.0 | 1.1 | GO:0008080 | N-acetyltransferase activity(GO:0008080) |
| 0.0 | 0.6 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.0 | 1.0 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
| 0.0 | 0.4 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.0 | 0.5 | GO:0001190 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
| 0.0 | 0.2 | GO:0046625 | sphingolipid binding(GO:0046625) |
| 0.0 | 0.1 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
| 0.0 | 0.1 | GO:0008665 | 2'-phosphotransferase activity(GO:0008665) |
| 0.0 | 0.1 | GO:0004483 | mRNA (nucleoside-2'-O-)-methyltransferase activity(GO:0004483) |
| 0.0 | 0.8 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.0 | 1.2 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.0 | 0.2 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
| 0.0 | 0.1 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
| 0.0 | 0.1 | GO:0060002 | plus-end directed microfilament motor activity(GO:0060002) |
| 0.0 | 0.6 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.0 | 0.9 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.0 | 0.7 | GO:0005230 | extracellular ligand-gated ion channel activity(GO:0005230) |
| 0.0 | 1.7 | GO:0042826 | histone deacetylase binding(GO:0042826) |
| 0.0 | 0.1 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.0 | 0.1 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
| 0.0 | 0.2 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 0.0 | 1.4 | GO:0008094 | DNA-dependent ATPase activity(GO:0008094) |
| 0.0 | 0.1 | GO:0051393 | alpha-actinin binding(GO:0051393) |
| 0.0 | 0.1 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.0 | 0.2 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.0 | 0.2 | GO:0016657 | GMP reductase activity(GO:0003920) oxidoreductase activity, acting on NAD(P)H, nitrogenous group as acceptor(GO:0016657) |
| 0.0 | 0.1 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.0 | 0.1 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.0 | 0.1 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 0.0 | 0.1 | GO:0043532 | angiostatin binding(GO:0043532) |
| 0.0 | 0.2 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.0 | 0.1 | GO:0030331 | estrogen receptor binding(GO:0030331) |
| 0.0 | 0.5 | GO:0015485 | cholesterol binding(GO:0015485) sterol binding(GO:0032934) |
| 0.0 | 4.9 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
| 0.0 | 0.4 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.0 | 1.4 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.0 | 0.3 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
| 0.0 | 0.1 | GO:0004157 | dihydropyrimidinase activity(GO:0004157) |
| 0.0 | 0.2 | GO:0004467 | long-chain fatty acid-CoA ligase activity(GO:0004467) |
| 0.0 | 0.7 | GO:0005521 | lamin binding(GO:0005521) |
| 0.0 | 0.2 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.0 | 10.9 | GO:0004674 | protein serine/threonine kinase activity(GO:0004674) |
| 0.0 | 0.5 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.0 | 1.2 | GO:0051117 | ATPase binding(GO:0051117) |
| 0.0 | 0.3 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.0 | 0.1 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.0 | 0.1 | GO:0015218 | pyrimidine nucleotide transmembrane transporter activity(GO:0015218) |
| 0.0 | 0.1 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.0 | 0.3 | GO:0001191 | transcriptional repressor activity, RNA polymerase II transcription factor binding(GO:0001191) |
| 0.0 | 0.1 | GO:0043199 | sulfate binding(GO:0043199) |
| 0.0 | 6.5 | GO:0005096 | GTPase activator activity(GO:0005096) |
| 0.0 | 0.1 | GO:0050146 | nucleoside phosphotransferase activity(GO:0050146) |
| 0.0 | 0.1 | GO:0004532 | exoribonuclease activity(GO:0004532) |
| 0.0 | 0.1 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.0 | 0.1 | GO:0019787 | ubiquitin-like protein transferase activity(GO:0019787) |
| 0.0 | 0.1 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
| 0.0 | 0.1 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.0 | 0.1 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.0 | 0.2 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.0 | 0.1 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
| 0.0 | 0.2 | GO:0046935 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.0 | 0.0 | GO:0030626 | U12 snRNA binding(GO:0030626) |
| 0.0 | 0.6 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.0 | 0.3 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.0 | 0.3 | GO:0070063 | RNA polymerase binding(GO:0070063) |
| 0.0 | 0.3 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.0 | 0.0 | GO:0003878 | ATP citrate synthase activity(GO:0003878) |
| 0.0 | 0.3 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
| 0.0 | 0.1 | GO:0070735 | protein-glycine ligase activity(GO:0070735) |
| 0.0 | 0.0 | GO:0004513 | neolactotetraosylceramide alpha-2,3-sialyltransferase activity(GO:0004513) lactosylceramide alpha-2,3-sialyltransferase activity(GO:0047291) |
| 0.0 | 0.2 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.1 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
| 0.0 | 0.1 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.0 | 0.2 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.0 | 0.5 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.0 | 0.0 | GO:0009383 | rRNA (cytosine-C5-)-methyltransferase activity(GO:0009383) |
| 0.0 | 0.0 | GO:0005169 | neurotrophin TRKB receptor binding(GO:0005169) |
| 0.0 | 0.1 | GO:0050682 | AF-2 domain binding(GO:0050682) |
| 0.0 | 0.0 | GO:0015275 | stretch-activated, cation-selective, calcium channel activity(GO:0015275) |
| 0.0 | 0.1 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.0 | 0.1 | GO:0008798 | beta-aspartyl-peptidase activity(GO:0008798) |
| 0.0 | 0.2 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
| 0.0 | 0.1 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
| 0.0 | 0.6 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.2 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.0 | 0.3 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.0 | 0.1 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 6.0 | PID BMP PATHWAY | BMP receptor signaling |
| 0.3 | 9.4 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.2 | 12.8 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.2 | 15.6 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
| 0.2 | 1.3 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.2 | 3.6 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.2 | 12.8 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.2 | 2.0 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
| 0.2 | 16.5 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.2 | 1.1 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.1 | 3.5 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.1 | 5.7 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.1 | 3.4 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.1 | 14.8 | PID NOTCH PATHWAY | Notch signaling pathway |
| 0.1 | 1.1 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.1 | 7.8 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.1 | 7.7 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.1 | 3.2 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.1 | 0.9 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.1 | 3.3 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.1 | 1.0 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.1 | 4.0 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
| 0.1 | 0.2 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.1 | 4.6 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
| 0.1 | 6.9 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.1 | 4.9 | PID RAS PATHWAY | Regulation of Ras family activation |
| 0.1 | 8.9 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.1 | 12.2 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.1 | 6.3 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.1 | 1.6 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.1 | 4.9 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.1 | 5.4 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.1 | 3.3 | PID ATR PATHWAY | ATR signaling pathway |
| 0.1 | 0.9 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.1 | 1.0 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.1 | 1.5 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.1 | 0.8 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.1 | 3.8 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.1 | 1.4 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.1 | 0.7 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.1 | 0.7 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 0.0 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.0 | 1.0 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.0 | 0.5 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.0 | 1.1 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.0 | 0.9 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 0.3 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.0 | 0.5 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.0 | 0.3 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.0 | 1.6 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.0 | 1.5 | PID ATM PATHWAY | ATM pathway |
| 0.0 | 1.8 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.0 | 1.0 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.0 | 1.9 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.0 | 2.5 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
| 0.0 | 0.4 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.0 | 0.6 | PID FOXO PATHWAY | FoxO family signaling |
| 0.0 | 0.8 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.0 | 1.3 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 0.0 | 1.7 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
| 0.0 | 1.2 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.0 | 0.5 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.0 | 1.4 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.0 | 0.5 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.0 | 0.5 | PID MYC PATHWAY | C-MYC pathway |
| 0.0 | 0.7 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.0 | 0.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.0 | 0.6 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 0.4 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.0 | 1.4 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.0 | 0.5 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
| 0.0 | 0.2 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.0 | 0.3 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.0 | 0.2 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.0 | 0.2 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 27.0 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.3 | 0.7 | REACTOME NEURONAL SYSTEM | Genes involved in Neuronal System |
| 0.3 | 6.3 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.3 | 12.0 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.3 | 4.1 | REACTOME RAF MAP KINASE CASCADE | Genes involved in RAF/MAP kinase cascade |
| 0.3 | 8.1 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.2 | 9.0 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.2 | 0.7 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.2 | 16.4 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.2 | 4.7 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.2 | 8.3 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.2 | 8.6 | REACTOME DAG AND IP3 SIGNALING | Genes involved in DAG and IP3 signaling |
| 0.2 | 3.3 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
| 0.2 | 7.8 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.2 | 1.7 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.2 | 2.9 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
| 0.2 | 2.8 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.2 | 8.6 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.2 | 7.0 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.2 | 3.2 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.2 | 2.8 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.2 | 7.0 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.2 | 2.8 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
| 0.2 | 4.9 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
| 0.1 | 5.7 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.1 | 1.8 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |
| 0.1 | 3.7 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
| 0.1 | 3.7 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.1 | 7.6 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.1 | 2.7 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.1 | 10.8 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
| 0.1 | 5.0 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
| 0.1 | 5.4 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.1 | 1.1 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.1 | 0.5 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.1 | 12.4 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.1 | 6.1 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.1 | 3.0 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
| 0.1 | 0.5 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
| 0.1 | 4.7 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.1 | 3.7 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.1 | 3.7 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.1 | 2.3 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.1 | 3.3 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.1 | 7.1 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.1 | 0.2 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
| 0.1 | 5.9 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.1 | 1.4 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.1 | 2.5 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.1 | 3.6 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
| 0.1 | 1.3 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.1 | 0.1 | REACTOME SIGNALING BY NOTCH2 | Genes involved in Signaling by NOTCH2 |
| 0.1 | 1.1 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.1 | 2.1 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.1 | 2.7 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.1 | 10.7 | REACTOME TRANSMISSION ACROSS CHEMICAL SYNAPSES | Genes involved in Transmission across Chemical Synapses |
| 0.1 | 1.7 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.1 | 3.1 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.1 | 3.7 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.1 | 1.9 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.1 | 2.9 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.1 | 1.2 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.1 | 5.6 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.1 | 2.1 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.1 | 23.3 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.1 | 2.1 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.1 | 1.9 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.1 | 0.5 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.1 | 2.0 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.1 | 1.5 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.1 | 0.3 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.1 | 3.7 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.1 | 1.0 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.1 | 4.2 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 0.1 | 1.3 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.1 | 2.4 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.1 | 0.8 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.1 | 1.3 | REACTOME PROCESSIVE SYNTHESIS ON THE LAGGING STRAND | Genes involved in Processive synthesis on the lagging strand |
| 0.1 | 0.7 | REACTOME FORMATION OF THE HIV1 EARLY ELONGATION COMPLEX | Genes involved in Formation of the HIV-1 Early Elongation Complex |
| 0.1 | 2.9 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.1 | 2.0 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.1 | 6.6 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.1 | 1.2 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.1 | 0.6 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
| 0.1 | 1.2 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 0.1 | 1.4 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
| 0.1 | 1.9 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.1 | 3.1 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.1 | 3.4 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.1 | 1.9 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
| 0.1 | 0.1 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.1 | 1.0 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.1 | 0.9 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.1 | 0.4 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
| 0.0 | 0.9 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 1.2 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.0 | 1.1 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.0 | 0.7 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.0 | 9.4 | REACTOME G ALPHA I SIGNALLING EVENTS | Genes involved in G alpha (i) signalling events |
| 0.0 | 1.0 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.0 | 0.8 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.0 | 0.2 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 0.0 | 1.0 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.0 | 0.1 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
| 0.0 | 0.6 | REACTOME ACYL CHAIN REMODELLING OF PE | Genes involved in Acyl chain remodelling of PE |
| 0.0 | 0.6 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.0 | 0.5 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.0 | 0.8 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.0 | 1.0 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.0 | 0.4 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
| 0.0 | 0.5 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
| 0.0 | 0.5 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| 0.0 | 0.4 | REACTOME REVERSIBLE HYDRATION OF CARBON DIOXIDE | Genes involved in Reversible Hydration of Carbon Dioxide |
| 0.0 | 0.6 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.0 | 2.8 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
| 0.0 | 0.3 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.0 | 0.6 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
| 0.0 | 0.3 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.0 | 0.6 | REACTOME 3 UTR MEDIATED TRANSLATIONAL REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
| 0.0 | 0.3 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
| 0.0 | 0.2 | REACTOME EARLY PHASE OF HIV LIFE CYCLE | Genes involved in Early Phase of HIV Life Cycle |
| 0.0 | 0.2 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
| 0.0 | 0.5 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.0 | 0.8 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.0 | 0.3 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
| 0.0 | 0.3 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 0.0 | 0.4 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.0 | 3.2 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.0 | 0.2 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.0 | 0.4 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.0 | 0.4 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.0 | 0.4 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 0.2 | REACTOME PROCESSING OF CAPPED INTRONLESS PRE MRNA | Genes involved in Processing of Capped Intronless Pre-mRNA |
| 0.0 | 0.1 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.0 | 0.3 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.0 | 0.4 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
| 0.0 | 0.5 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 0.0 | 0.4 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.0 | 0.9 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.0 | 0.1 | REACTOME RNA POL II PRE TRANSCRIPTION EVENTS | Genes involved in RNA Polymerase II Pre-transcription Events |
| 0.0 | 0.1 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |