Illumina Body Map 2: averaged replicates
Gene Symbol | Gene ID | Gene Info |
---|---|---|
ZBTB33
|
ENSG00000177485.6 | zinc finger and BTB domain containing 33 |
CHD2
|
ENSG00000173575.14 | chromodomain helicase DNA binding protein 2 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
CHD2 | hg19_v2_chr15_+_93426514_93426562 | -0.43 | 1.5e-02 | Click! |
ZBTB33 | hg19_v2_chrX_+_119384607_119384720 | 0.02 | 9.3e-01 | Click! |
Promoter | Log-likelihood | Transcript | Gene | Gene Info |
---|---|---|---|---|
chr15_+_78730531 | 5.72 |
ENST00000258886.8
|
IREB2
|
iron-responsive element binding protein 2 |
chr1_+_232940643 | 5.50 |
ENST00000418460.1
|
MAP10
|
microtubule-associated protein 10 |
chr1_-_111991850 | 5.14 |
ENST00000411751.2
|
WDR77
|
WD repeat domain 77 |
chr15_+_78730622 | 4.92 |
ENST00000560440.1
|
IREB2
|
iron-responsive element binding protein 2 |
chrX_-_53711064 | 4.42 |
ENST00000342160.3
ENST00000446750.1 |
HUWE1
|
HECT, UBA and WWE domain containing 1, E3 ubiquitin protein ligase |
chrY_+_15016725 | 4.40 |
ENST00000336079.3
|
DDX3Y
|
DEAD (Asp-Glu-Ala-Asp) box helicase 3, Y-linked |
chr1_-_111991908 | 4.22 |
ENST00000235090.5
|
WDR77
|
WD repeat domain 77 |
chr10_+_51565188 | 4.09 |
ENST00000430396.2
ENST00000374087.4 ENST00000414907.2 |
NCOA4
|
nuclear receptor coactivator 4 |
chr6_+_35995552 | 3.97 |
ENST00000468133.1
|
MAPK14
|
mitogen-activated protein kinase 14 |
chr10_+_51565108 | 3.89 |
ENST00000438493.1
ENST00000452682.1 |
NCOA4
|
nuclear receptor coactivator 4 |
chr6_+_35995531 | 3.76 |
ENST00000229794.4
|
MAPK14
|
mitogen-activated protein kinase 14 |
chr1_+_111992064 | 3.74 |
ENST00000483994.1
|
ATP5F1
|
ATP synthase, H+ transporting, mitochondrial Fo complex, subunit B1 |
chr17_-_4843206 | 3.67 |
ENST00000576951.1
|
SLC25A11
|
solute carrier family 25 (mitochondrial carrier; oxoglutarate carrier), member 11 |
chr1_+_111991474 | 3.64 |
ENST00000369722.3
|
ATP5F1
|
ATP synthase, H+ transporting, mitochondrial Fo complex, subunit B1 |
chr6_+_35995488 | 3.56 |
ENST00000229795.3
|
MAPK14
|
mitogen-activated protein kinase 14 |
chr7_-_2272566 | 3.45 |
ENST00000402746.1
ENST00000265854.7 ENST00000429779.1 ENST00000399654.2 |
MAD1L1
|
MAD1 mitotic arrest deficient-like 1 (yeast) |
chr19_-_51014345 | 3.26 |
ENST00000391815.3
ENST00000594350.1 ENST00000601423.1 |
JOSD2
|
Josephin domain containing 2 |
chr17_-_53046058 | 3.24 |
ENST00000571584.1
ENST00000299335.3 |
COX11
|
cytochrome c oxidase assembly homolog 11 (yeast) |
chr19_-_51014460 | 3.00 |
ENST00000595669.1
|
JOSD2
|
Josephin domain containing 2 |
chr17_+_7761301 | 3.00 |
ENST00000332439.4
ENST00000570446.1 |
CYB5D1
|
cytochrome b5 domain containing 1 |
chrY_+_15016013 | 2.95 |
ENST00000360160.4
ENST00000454054.1 |
DDX3Y
|
DEAD (Asp-Glu-Ala-Asp) box helicase 3, Y-linked |
chr16_-_2014804 | 2.90 |
ENST00000526522.1
ENST00000527302.1 ENST00000529806.1 ENST00000563194.1 ENST00000343262.4 |
RPS2
|
ribosomal protein S2 |
chr17_-_37607497 | 2.82 |
ENST00000394287.3
ENST00000300651.6 |
MED1
|
mediator complex subunit 1 |
chr13_+_21750780 | 2.77 |
ENST00000309594.4
|
MRP63
|
mitochondrial ribosomal protein 63 |
chr7_+_75677354 | 2.65 |
ENST00000461263.2
ENST00000315758.5 ENST00000443006.1 |
MDH2
|
malate dehydrogenase 2, NAD (mitochondrial) |
chr1_+_100316041 | 2.56 |
ENST00000370165.3
ENST00000370163.3 ENST00000294724.4 |
AGL
|
amylo-alpha-1, 6-glucosidase, 4-alpha-glucanotransferase |
chr7_+_75677465 | 2.45 |
ENST00000432020.2
|
MDH2
|
malate dehydrogenase 2, NAD (mitochondrial) |
chr14_+_105266933 | 2.44 |
ENST00000555360.1
|
ZBTB42
|
zinc finger and BTB domain containing 42 |
chr15_-_64126084 | 2.43 |
ENST00000560316.1
ENST00000443617.2 ENST00000560462.1 ENST00000558532.1 ENST00000561400.1 |
HERC1
|
HECT and RLD domain containing E3 ubiquitin protein ligase family member 1 |
chr19_-_51014588 | 2.40 |
ENST00000598418.1
|
JOSD2
|
Josephin domain containing 2 |
chr1_-_6614565 | 2.36 |
ENST00000377705.5
|
NOL9
|
nucleolar protein 9 |
chr2_+_120517174 | 2.35 |
ENST00000263708.2
|
PTPN4
|
protein tyrosine phosphatase, non-receptor type 4 (megakaryocyte) |
chrX_-_63615297 | 2.31 |
ENST00000374852.3
ENST00000453546.1 |
MTMR8
|
myotubularin related protein 8 |
chr4_+_84457529 | 2.30 |
ENST00000264409.4
|
AGPAT9
|
1-acylglycerol-3-phosphate O-acyltransferase 9 |
chr1_+_167906056 | 2.27 |
ENST00000367840.3
|
DCAF6
|
DDB1 and CUL4 associated factor 6 |
chr17_-_2415169 | 2.25 |
ENST00000263092.6
ENST00000538844.1 ENST00000576976.1 |
METTL16
|
methyltransferase like 16 |
chr9_-_125667494 | 2.17 |
ENST00000335387.5
ENST00000357244.2 ENST00000373665.2 |
RC3H2
|
ring finger and CCCH-type domains 2 |
chr9_-_125667618 | 2.15 |
ENST00000423239.2
|
RC3H2
|
ring finger and CCCH-type domains 2 |
chr15_+_22833395 | 2.13 |
ENST00000283645.4
|
TUBGCP5
|
tubulin, gamma complex associated protein 5 |
chr15_+_22833482 | 2.12 |
ENST00000453949.2
|
TUBGCP5
|
tubulin, gamma complex associated protein 5 |
chr1_+_100315613 | 2.08 |
ENST00000361915.3
|
AGL
|
amylo-alpha-1, 6-glucosidase, 4-alpha-glucanotransferase |
chr7_-_129845188 | 2.03 |
ENST00000462753.1
ENST00000471077.1 ENST00000473456.1 ENST00000336804.8 |
TMEM209
|
transmembrane protein 209 |
chr4_+_140374961 | 2.01 |
ENST00000305626.5
|
RAB33B
|
RAB33B, member RAS oncogene family |
chr2_+_170683942 | 1.98 |
ENST00000272793.5
|
UBR3
|
ubiquitin protein ligase E3 component n-recognin 3 (putative) |
chr1_-_27226928 | 1.98 |
ENST00000361720.5
|
GPATCH3
|
G patch domain containing 3 |
chr4_+_84457250 | 1.97 |
ENST00000395226.2
|
AGPAT9
|
1-acylglycerol-3-phosphate O-acyltransferase 9 |
chr1_+_207226574 | 1.97 |
ENST00000367080.3
ENST00000367079.2 |
PFKFB2
|
6-phosphofructo-2-kinase/fructose-2,6-biphosphatase 2 |
chr2_-_43823093 | 1.95 |
ENST00000405006.4
|
THADA
|
thyroid adenoma associated |
chr12_-_27090896 | 1.94 |
ENST00000539625.1
ENST00000538727.1 |
ASUN
|
asunder spermatogenesis regulator |
chr1_+_231473990 | 1.94 |
ENST00000008440.9
|
SPRTN
|
SprT-like N-terminal domain |
chr2_+_170683979 | 1.93 |
ENST00000418381.1
|
UBR3
|
ubiquitin protein ligase E3 component n-recognin 3 (putative) |
chr15_-_76603727 | 1.93 |
ENST00000560595.1
ENST00000433983.2 ENST00000559386.1 ENST00000559602.1 ENST00000560726.1 ENST00000557943.1 |
ETFA
|
electron-transfer-flavoprotein, alpha polypeptide |
chr1_+_167905894 | 1.88 |
ENST00000367843.3
ENST00000432587.2 ENST00000312263.6 |
DCAF6
|
DDB1 and CUL4 associated factor 6 |
chr17_-_7017559 | 1.88 |
ENST00000446679.2
|
ASGR2
|
asialoglycoprotein receptor 2 |
chr17_-_17184546 | 1.87 |
ENST00000417352.1
|
COPS3
|
COP9 signalosome subunit 3 |
chr17_-_17184605 | 1.85 |
ENST00000268717.5
|
COPS3
|
COP9 signalosome subunit 3 |
chr6_+_44355257 | 1.85 |
ENST00000371477.3
|
CDC5L
|
cell division cycle 5-like |
chr2_-_43823119 | 1.85 |
ENST00000403856.1
ENST00000404790.1 ENST00000405975.2 ENST00000415080.2 |
THADA
|
thyroid adenoma associated |
chr4_-_15683118 | 1.84 |
ENST00000507899.1
ENST00000510802.1 |
FBXL5
|
F-box and leucine-rich repeat protein 5 |
chr7_-_35734176 | 1.78 |
ENST00000413517.1
ENST00000438224.1 |
HERPUD2
|
HERPUD family member 2 |
chr1_-_78148324 | 1.75 |
ENST00000370801.3
ENST00000433749.1 |
ZZZ3
|
zinc finger, ZZ-type containing 3 |
chr12_-_125002827 | 1.75 |
ENST00000420698.1
|
NCOR2
|
nuclear receptor corepressor 2 |
chr5_+_70883154 | 1.74 |
ENST00000509358.2
|
MCCC2
|
methylcrotonoyl-CoA carboxylase 2 (beta) |
chr17_-_4843316 | 1.73 |
ENST00000544061.2
|
SLC25A11
|
solute carrier family 25 (mitochondrial carrier; oxoglutarate carrier), member 11 |
chrX_+_41192595 | 1.70 |
ENST00000399959.2
|
DDX3X
|
DEAD (Asp-Glu-Ala-Asp) box helicase 3, X-linked |
chr1_+_179923873 | 1.67 |
ENST00000367607.3
ENST00000491495.2 |
CEP350
|
centrosomal protein 350kDa |
chr8_-_42698433 | 1.65 |
ENST00000345117.2
ENST00000254250.3 |
THAP1
|
THAP domain containing, apoptosis associated protein 1 |
chr12_+_118454500 | 1.65 |
ENST00000537315.1
ENST00000229043.3 ENST00000484086.2 ENST00000420967.1 ENST00000454402.2 ENST00000392542.2 ENST00000535092.1 |
RFC5
|
replication factor C (activator 1) 5, 36.5kDa |
chr14_+_100705322 | 1.64 |
ENST00000262238.4
|
YY1
|
YY1 transcription factor |
chr7_-_129845313 | 1.64 |
ENST00000397622.2
|
TMEM209
|
transmembrane protein 209 |
chr1_-_167906020 | 1.64 |
ENST00000458574.1
|
MPC2
|
mitochondrial pyruvate carrier 2 |
chr17_-_7761256 | 1.63 |
ENST00000575208.1
|
LSMD1
|
LSM domain containing 1 |
chr12_-_102513843 | 1.63 |
ENST00000551744.2
ENST00000552283.1 |
NUP37
|
nucleoporin 37kDa |
chr16_+_30709530 | 1.62 |
ENST00000411466.2
|
SRCAP
|
Snf2-related CREBBP activator protein |
chr5_-_176449586 | 1.62 |
ENST00000509236.1
|
UIMC1
|
ubiquitin interaction motif containing 1 |
chr2_+_120517717 | 1.62 |
ENST00000420482.1
ENST00000488279.2 |
PTPN4
|
protein tyrosine phosphatase, non-receptor type 4 (megakaryocyte) |
chr12_-_125473600 | 1.62 |
ENST00000308736.2
|
DHX37
|
DEAH (Asp-Glu-Ala-His) box polypeptide 37 |
chr5_+_70883117 | 1.62 |
ENST00000340941.6
|
MCCC2
|
methylcrotonoyl-CoA carboxylase 2 (beta) |
chr9_+_136215087 | 1.62 |
ENST00000426651.1
|
RPL7A
|
ribosomal protein L7a |
chr4_-_15683230 | 1.61 |
ENST00000515679.1
|
FBXL5
|
F-box and leucine-rich repeat protein 5 |
chr12_-_129308041 | 1.61 |
ENST00000376740.4
|
SLC15A4
|
solute carrier family 15 (oligopeptide transporter), member 4 |
chr5_+_138629628 | 1.60 |
ENST00000508689.1
ENST00000514528.1 |
MATR3
|
matrin 3 |
chr4_-_2965052 | 1.60 |
ENST00000398071.4
ENST00000502735.1 ENST00000314262.6 ENST00000416614.2 |
NOP14
|
NOP14 nucleolar protein |
chr3_-_195270162 | 1.59 |
ENST00000438848.1
ENST00000328432.3 |
PPP1R2
|
protein phosphatase 1, regulatory (inhibitor) subunit 2 |
chr1_-_247095236 | 1.59 |
ENST00000478568.1
|
AHCTF1
|
AT hook containing transcription factor 1 |
chr6_+_149638876 | 1.57 |
ENST00000392282.1
|
TAB2
|
TGF-beta activated kinase 1/MAP3K7 binding protein 2 |
chr8_+_37963011 | 1.55 |
ENST00000250635.7
ENST00000517719.1 ENST00000545394.1 |
ASH2L
|
ash2 (absent, small, or homeotic)-like (Drosophila) |
chr5_+_138629417 | 1.54 |
ENST00000510056.1
ENST00000511249.1 ENST00000503811.1 ENST00000511378.1 |
MATR3
|
matrin 3 |
chr17_+_7591639 | 1.53 |
ENST00000396463.2
|
WRAP53
|
WD repeat containing, antisense to TP53 |
chr8_+_37963311 | 1.52 |
ENST00000428278.2
ENST00000521652.1 |
ASH2L
|
ash2 (absent, small, or homeotic)-like (Drosophila) |
chr16_-_89724051 | 1.52 |
ENST00000550102.1
|
CHMP1A
|
charged multivesicular body protein 1A |
chr15_-_40074996 | 1.52 |
ENST00000350221.3
|
FSIP1
|
fibrous sheath interacting protein 1 |
chr12_-_27091183 | 1.51 |
ENST00000544548.1
ENST00000261191.7 ENST00000537336.1 |
ASUN
|
asunder spermatogenesis regulator |
chr8_-_134501873 | 1.51 |
ENST00000523634.1
|
ST3GAL1
|
ST3 beta-galactoside alpha-2,3-sialyltransferase 1 |
chr3_-_18466026 | 1.51 |
ENST00000417717.2
|
SATB1
|
SATB homeobox 1 |
chr8_-_42698292 | 1.50 |
ENST00000529779.1
|
THAP1
|
THAP domain containing, apoptosis associated protein 1 |
chr1_+_231473743 | 1.49 |
ENST00000295050.7
|
SPRTN
|
SprT-like N-terminal domain |
chr3_-_49131614 | 1.48 |
ENST00000450685.1
|
QRICH1
|
glutamine-rich 1 |
chr19_+_42364460 | 1.47 |
ENST00000593863.1
|
RPS19
|
ribosomal protein S19 |
chr5_+_70883178 | 1.45 |
ENST00000323375.8
|
MCCC2
|
methylcrotonoyl-CoA carboxylase 2 (beta) |
chr19_-_4124079 | 1.44 |
ENST00000394867.4
ENST00000262948.5 |
MAP2K2
|
mitogen-activated protein kinase kinase 2 |
chr8_-_134501937 | 1.42 |
ENST00000519924.1
|
ST3GAL1
|
ST3 beta-galactoside alpha-2,3-sialyltransferase 1 |
chr2_+_207630081 | 1.41 |
ENST00000236980.6
ENST00000418289.1 ENST00000402774.3 ENST00000403094.3 |
FASTKD2
|
FAST kinase domains 2 |
chr16_-_84150392 | 1.41 |
ENST00000570012.1
|
MBTPS1
|
membrane-bound transcription factor peptidase, site 1 |
chr16_-_188624 | 1.41 |
ENST00000399953.3
|
NPRL3
|
nitrogen permease regulator-like 3 (S. cerevisiae) |
chr17_+_7591747 | 1.40 |
ENST00000534050.1
|
WRAP53
|
WD repeat containing, antisense to TP53 |
chr9_+_136215044 | 1.40 |
ENST00000323345.6
|
RPL7A
|
ribosomal protein L7a |
chr5_+_138629389 | 1.40 |
ENST00000504045.1
ENST00000504311.1 ENST00000502499.1 |
MATR3
|
matrin 3 |
chr22_-_37571089 | 1.35 |
ENST00000453962.1
ENST00000429622.1 ENST00000445595.1 |
IL2RB
|
interleukin 2 receptor, beta |
chr1_-_231473578 | 1.34 |
ENST00000360394.2
ENST00000366645.1 |
EXOC8
|
exocyst complex component 8 |
chr15_-_41408409 | 1.34 |
ENST00000361937.3
|
INO80
|
INO80 complex subunit |
chr1_-_6295975 | 1.32 |
ENST00000343813.5
ENST00000362035.3 |
ICMT
|
isoprenylcysteine carboxyl methyltransferase |
chr6_+_116575329 | 1.31 |
ENST00000430252.2
ENST00000540275.1 ENST00000448740.2 |
DSE
RP3-486I3.7
|
dermatan sulfate epimerase RP3-486I3.7 |
chr6_-_107436473 | 1.30 |
ENST00000369042.1
|
BEND3
|
BEN domain containing 3 |
chr2_+_160568978 | 1.27 |
ENST00000409175.1
ENST00000539065.1 ENST00000259050.4 ENST00000421037.1 |
MARCH7
|
membrane-associated ring finger (C3HC4) 7, E3 ubiquitin protein ligase |
chr2_-_225450013 | 1.27 |
ENST00000264414.4
|
CUL3
|
cullin 3 |
chr10_+_124768482 | 1.27 |
ENST00000368869.4
ENST00000358776.4 |
ACADSB
|
acyl-CoA dehydrogenase, short/branched chain |
chr12_-_129308487 | 1.27 |
ENST00000266771.5
|
SLC15A4
|
solute carrier family 15 (oligopeptide transporter), member 4 |
chr17_-_2239729 | 1.26 |
ENST00000576112.2
|
TSR1
|
TSR1, 20S rRNA accumulation, homolog (S. cerevisiae) |
chr10_-_5855350 | 1.26 |
ENST00000456041.1
ENST00000380181.3 ENST00000418688.1 ENST00000380132.4 ENST00000609712.1 ENST00000380191.4 |
GDI2
|
GDP dissociation inhibitor 2 |
chrX_+_10126488 | 1.24 |
ENST00000380829.1
ENST00000421085.2 ENST00000454850.1 |
CLCN4
|
chloride channel, voltage-sensitive 4 |
chr19_+_38924316 | 1.23 |
ENST00000355481.4
ENST00000360985.3 ENST00000359596.3 |
RYR1
|
ryanodine receptor 1 (skeletal) |
chrX_+_123095860 | 1.23 |
ENST00000428941.1
|
STAG2
|
stromal antigen 2 |
chr5_+_138629337 | 1.22 |
ENST00000394805.3
ENST00000512876.1 ENST00000513678.1 |
MATR3
|
matrin 3 |
chr15_-_66797172 | 1.22 |
ENST00000569438.1
ENST00000569696.1 ENST00000307961.6 |
RPL4
|
ribosomal protein L4 |
chr6_+_47445467 | 1.21 |
ENST00000359314.5
|
CD2AP
|
CD2-associated protein |
chr19_-_8386238 | 1.21 |
ENST00000301457.2
|
NDUFA7
|
NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 7, 14.5kDa |
chr3_-_14220068 | 1.21 |
ENST00000449060.2
ENST00000511155.1 |
XPC
|
xeroderma pigmentosum, complementation group C |
chr22_+_31795509 | 1.20 |
ENST00000331457.4
|
DRG1
|
developmentally regulated GTP binding protein 1 |
chr11_-_46142948 | 1.20 |
ENST00000257821.4
|
PHF21A
|
PHD finger protein 21A |
chr15_-_41408339 | 1.20 |
ENST00000401393.3
|
INO80
|
INO80 complex subunit |
chr12_+_123237321 | 1.20 |
ENST00000280557.6
ENST00000455982.2 |
DENR
|
density-regulated protein |
chr9_-_123605177 | 1.19 |
ENST00000373904.5
ENST00000210313.3 |
PSMD5
|
proteasome (prosome, macropain) 26S subunit, non-ATPase, 5 |
chrX_-_19905703 | 1.19 |
ENST00000397821.3
|
SH3KBP1
|
SH3-domain kinase binding protein 1 |
chr16_+_57481382 | 1.18 |
ENST00000564655.1
ENST00000567072.1 ENST00000567933.1 ENST00000563166.1 |
COQ9
|
coenzyme Q9 |
chr19_+_9251052 | 1.18 |
ENST00000247956.6
ENST00000360385.3 |
ZNF317
|
zinc finger protein 317 |
chr4_+_83821835 | 1.18 |
ENST00000302236.5
|
THAP9
|
THAP domain containing 9 |
chr3_+_49044765 | 1.17 |
ENST00000429900.2
|
WDR6
|
WD repeat domain 6 |
chr2_+_149402009 | 1.17 |
ENST00000457184.1
|
EPC2
|
enhancer of polycomb homolog 2 (Drosophila) |
chr8_+_42249346 | 1.17 |
ENST00000392935.3
ENST00000520115.1 ENST00000522069.1 ENST00000522572.1 |
VDAC3
|
voltage-dependent anion channel 3 |
chr15_+_75315896 | 1.16 |
ENST00000342932.3
ENST00000564923.1 ENST00000569562.1 ENST00000568649.1 |
PPCDC
|
phosphopantothenoylcysteine decarboxylase |
chrX_+_40944871 | 1.16 |
ENST00000378308.2
ENST00000324545.8 |
USP9X
|
ubiquitin specific peptidase 9, X-linked |
chr6_-_43484621 | 1.15 |
ENST00000506469.1
ENST00000503972.1 |
YIPF3
|
Yip1 domain family, member 3 |
chr19_+_45458503 | 1.15 |
ENST00000337392.5
ENST00000591304.1 |
CLPTM1
|
cleft lip and palate associated transmembrane protein 1 |
chr12_-_133464118 | 1.15 |
ENST00000540963.1
|
CHFR
|
checkpoint with forkhead and ring finger domains, E3 ubiquitin protein ligase |
chr5_+_138940742 | 1.14 |
ENST00000398733.3
ENST00000253815.2 ENST00000505007.1 |
UBE2D2
|
ubiquitin-conjugating enzyme E2D 2 |
chr12_-_29534074 | 1.14 |
ENST00000546839.1
ENST00000360150.4 ENST00000552155.1 ENST00000550353.1 ENST00000548441.1 ENST00000552132.1 |
ERGIC2
|
ERGIC and golgi 2 |
chr14_+_64854958 | 1.14 |
ENST00000555709.2
ENST00000554739.1 ENST00000554768.1 ENST00000216605.8 |
MTHFD1
|
methylenetetrahydrofolate dehydrogenase (NADP+ dependent) 1, methenyltetrahydrofolate cyclohydrolase, formyltetrahydrofolate synthetase |
chr2_-_85555385 | 1.14 |
ENST00000377386.3
|
TGOLN2
|
trans-golgi network protein 2 |
chr8_+_42249418 | 1.14 |
ENST00000521158.1
ENST00000022615.4 |
VDAC3
|
voltage-dependent anion channel 3 |
chr3_+_171758344 | 1.11 |
ENST00000336824.4
ENST00000423424.1 |
FNDC3B
|
fibronectin type III domain containing 3B |
chr16_+_2014993 | 1.11 |
ENST00000564014.1
|
SNHG9
|
small nucleolar RNA host gene 9 (non-protein coding) |
chr1_+_156182773 | 1.10 |
ENST00000490491.1
ENST00000368276.4 ENST00000320139.5 ENST00000368279.3 ENST00000368273.4 ENST00000368277.3 ENST00000567140.1 ENST00000565805.1 |
PMF1-BGLAP
PMF1
|
PMF1-BGLAP readthrough polyamine-modulated factor 1 |
chr17_-_73401567 | 1.10 |
ENST00000392562.1
|
GRB2
|
growth factor receptor-bound protein 2 |
chrX_+_77154935 | 1.10 |
ENST00000481445.1
|
COX7B
|
cytochrome c oxidase subunit VIIb |
chr2_-_225450100 | 1.09 |
ENST00000344951.4
|
CUL3
|
cullin 3 |
chr11_+_117049854 | 1.09 |
ENST00000278951.7
|
SIDT2
|
SID1 transmembrane family, member 2 |
chr16_+_57481349 | 1.08 |
ENST00000262507.6
ENST00000565964.1 |
COQ9
|
coenzyme Q9 |
chr12_+_69202795 | 1.08 |
ENST00000539479.1
ENST00000393415.3 ENST00000523991.1 ENST00000543323.1 ENST00000393416.2 |
MDM2
|
MDM2 oncogene, E3 ubiquitin protein ligase |
chr9_+_86595626 | 1.08 |
ENST00000445877.1
ENST00000325875.3 |
RMI1
|
RecQ mediated genome instability 1 |
chr9_-_130213652 | 1.08 |
ENST00000536368.1
ENST00000361436.5 |
RPL12
|
ribosomal protein L12 |
chr4_-_74124502 | 1.08 |
ENST00000358602.4
ENST00000330838.6 ENST00000561029.1 |
ANKRD17
|
ankyrin repeat domain 17 |
chr3_+_57261859 | 1.08 |
ENST00000495803.1
ENST00000444459.1 |
APPL1
|
adaptor protein, phosphotyrosine interaction, PH domain and leucine zipper containing 1 |
chr19_+_34663397 | 1.07 |
ENST00000540746.2
ENST00000544216.3 ENST00000433627.5 |
LSM14A
|
LSM14A, SCD6 homolog A (S. cerevisiae) |
chr3_+_49044798 | 1.07 |
ENST00000438660.1
ENST00000608424.1 ENST00000415265.2 |
WDR6
|
WD repeat domain 6 |
chr2_-_214148921 | 1.07 |
ENST00000360083.3
|
AC079610.2
|
AC079610.2 |
chr5_-_171404730 | 1.07 |
ENST00000518752.1
|
FBXW11
|
F-box and WD repeat domain containing 11 |
chr20_-_49547910 | 1.06 |
ENST00000396032.3
|
ADNP
|
activity-dependent neuroprotector homeobox |
chr4_+_128886532 | 1.06 |
ENST00000444616.1
ENST00000388795.5 |
C4orf29
|
chromosome 4 open reading frame 29 |
chr9_+_19049372 | 1.06 |
ENST00000380527.1
|
RRAGA
|
Ras-related GTP binding A |
chr17_+_27046988 | 1.06 |
ENST00000496182.1
|
RPL23A
|
ribosomal protein L23a |
chr19_+_34663551 | 1.06 |
ENST00000586157.1
|
LSM14A
|
LSM14A, SCD6 homolog A (S. cerevisiae) |
chr4_-_103749313 | 1.05 |
ENST00000394803.5
|
UBE2D3
|
ubiquitin-conjugating enzyme E2D 3 |
chr9_+_88556036 | 1.05 |
ENST00000361671.5
ENST00000416045.1 |
NAA35
|
N(alpha)-acetyltransferase 35, NatC auxiliary subunit |
chr6_-_7313381 | 1.05 |
ENST00000489567.1
ENST00000479365.1 ENST00000462112.1 ENST00000397511.2 ENST00000534851.1 ENST00000474597.1 ENST00000244763.4 |
SSR1
|
signal sequence receptor, alpha |
chr15_+_45923776 | 1.04 |
ENST00000565227.1
ENST00000563296.1 |
SQRDL
|
sulfide quinone reductase-like (yeast) |
chr2_-_136743436 | 1.04 |
ENST00000441323.1
ENST00000449218.1 |
DARS
|
aspartyl-tRNA synthetase |
chr2_+_30454390 | 1.04 |
ENST00000395323.3
ENST00000406087.1 ENST00000404397.1 |
LBH
|
limb bud and heart development |
chr14_+_64970662 | 1.03 |
ENST00000556965.1
ENST00000554015.1 |
ZBTB1
|
zinc finger and BTB domain containing 1 |
chr16_-_188600 | 1.03 |
ENST00000399951.3
|
NPRL3
|
nitrogen permease regulator-like 3 (S. cerevisiae) |
chr21_+_45285050 | 1.03 |
ENST00000291572.8
|
AGPAT3
|
1-acylglycerol-3-phosphate O-acyltransferase 3 |
chr16_-_25269134 | 1.03 |
ENST00000328086.7
|
ZKSCAN2
|
zinc finger with KRAB and SCAN domains 2 |
chr5_+_139493665 | 1.03 |
ENST00000331327.3
|
PURA
|
purine-rich element binding protein A |
chr13_+_28712614 | 1.02 |
ENST00000380958.3
|
PAN3
|
PAN3 poly(A) specific ribonuclease subunit homolog (S. cerevisiae) |
chr18_-_59854203 | 1.02 |
ENST00000589339.1
ENST00000357637.5 ENST00000585458.1 ENST00000400334.3 ENST00000587134.1 ENST00000585923.1 ENST00000590765.1 ENST00000589720.1 ENST00000588571.1 ENST00000585344.1 |
PIGN
|
phosphatidylinositol glycan anchor biosynthesis, class N |
chr3_-_137893721 | 1.02 |
ENST00000505015.2
ENST00000260803.4 |
DBR1
|
debranching RNA lariats 1 |
chr2_+_105654441 | 1.02 |
ENST00000258455.3
|
MRPS9
|
mitochondrial ribosomal protein S9 |
chr12_-_133464151 | 1.01 |
ENST00000315585.7
ENST00000266880.7 ENST00000443047.2 ENST00000432561.2 ENST00000450056.2 |
CHFR
|
checkpoint with forkhead and ring finger domains, E3 ubiquitin protein ligase |
chr10_-_135187193 | 1.01 |
ENST00000368547.3
|
ECHS1
|
enoyl CoA hydratase, short chain, 1, mitochondrial |
chr19_+_8386371 | 1.01 |
ENST00000600659.2
|
RPS28
|
ribosomal protein S28 |
chr7_-_35734607 | 1.01 |
ENST00000427455.1
|
HERPUD2
|
HERPUD family member 2 |
chr1_-_111682813 | 1.01 |
ENST00000539140.1
|
DRAM2
|
DNA-damage regulated autophagy modulator 2 |
chr1_+_41157361 | 1.01 |
ENST00000427410.2
ENST00000447388.3 ENST00000425457.2 ENST00000453631.1 ENST00000456393.2 |
NFYC
|
nuclear transcription factor Y, gamma |
chr17_-_4167142 | 1.00 |
ENST00000570535.1
ENST00000574367.1 ENST00000341657.4 ENST00000433651.1 |
ANKFY1
|
ankyrin repeat and FYVE domain containing 1 |
chr19_-_40324255 | 0.99 |
ENST00000593685.1
ENST00000600611.1 |
DYRK1B
|
dual-specificity tyrosine-(Y)-phosphorylation regulated kinase 1B |
chr10_+_64893039 | 0.99 |
ENST00000277746.6
ENST00000435510.2 |
NRBF2
|
nuclear receptor binding factor 2 |
chr20_-_49547731 | 0.99 |
ENST00000396029.3
|
ADNP
|
activity-dependent neuroprotector homeobox |
chr11_-_6624801 | 0.99 |
ENST00000534343.1
ENST00000254605.6 |
RRP8
|
ribosomal RNA processing 8, methyltransferase, homolog (yeast) |
chr4_+_71768043 | 0.98 |
ENST00000502869.1
ENST00000309395.2 ENST00000396051.2 |
MOB1B
|
MOB kinase activator 1B |
chr17_-_1531635 | 0.98 |
ENST00000571650.1
|
SLC43A2
|
solute carrier family 43 (amino acid system L transporter), member 2 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.3 | 11.3 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
1.6 | 9.4 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
1.1 | 3.2 | GO:0032203 | telomere formation via telomerase(GO:0032203) |
1.0 | 3.8 | GO:1901895 | negative regulation of calcium-transporting ATPase activity(GO:1901895) |
0.8 | 3.2 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.8 | 3.9 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.8 | 5.4 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
0.7 | 2.8 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.7 | 2.0 | GO:0071301 | cellular response to vitamin B1(GO:0071301) response to formaldehyde(GO:1904404) |
0.6 | 2.5 | GO:1902361 | mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
0.6 | 1.7 | GO:0072365 | regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
0.6 | 2.2 | GO:0045014 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
0.5 | 2.1 | GO:0070845 | misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
0.5 | 1.6 | GO:0000967 | endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
0.5 | 4.7 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.5 | 2.0 | GO:0006422 | aspartyl-tRNA aminoacylation(GO:0006422) |
0.5 | 4.8 | GO:0006552 | leucine catabolic process(GO:0006552) |
0.5 | 2.4 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
0.5 | 1.8 | GO:1990637 | response to prolactin(GO:1990637) |
0.4 | 1.8 | GO:2000174 | regulation of pro-T cell differentiation(GO:2000174) positive regulation of pro-T cell differentiation(GO:2000176) |
0.4 | 1.3 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.4 | 1.7 | GO:1903778 | protein localization to vacuolar membrane(GO:1903778) |
0.4 | 2.6 | GO:0015853 | adenine transport(GO:0015853) |
0.4 | 1.3 | GO:0006433 | glutamyl-tRNA aminoacylation(GO:0006424) prolyl-tRNA aminoacylation(GO:0006433) |
0.4 | 4.3 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.4 | 1.2 | GO:0002188 | translation reinitiation(GO:0002188) |
0.4 | 1.1 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
0.4 | 1.1 | GO:0060733 | regulation of eIF2 alpha phosphorylation by amino acid starvation(GO:0060733) regulation of translational initiation in response to starvation(GO:0071262) positive regulation of translational initiation in response to starvation(GO:0071264) |
0.3 | 2.4 | GO:1903301 | positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
0.3 | 1.3 | GO:0016094 | polyprenol biosynthetic process(GO:0016094) |
0.3 | 0.7 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
0.3 | 1.6 | GO:0072369 | regulation of lipid transport by positive regulation of transcription from RNA polymerase II promoter(GO:0072369) |
0.3 | 1.9 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
0.3 | 1.9 | GO:0015878 | biotin transport(GO:0015878) pantothenate transmembrane transport(GO:0015887) |
0.3 | 2.2 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.3 | 0.6 | GO:0018312 | peptidyl-serine ADP-ribosylation(GO:0018312) |
0.3 | 2.4 | GO:0071651 | positive regulation of chemokine (C-C motif) ligand 5 production(GO:0071651) |
0.3 | 0.9 | GO:0097198 | histone H3-K36 trimethylation(GO:0097198) |
0.3 | 1.8 | GO:1904044 | response to aldosterone(GO:1904044) |
0.3 | 2.0 | GO:0033484 | nitric oxide homeostasis(GO:0033484) |
0.3 | 2.3 | GO:1901189 | positive regulation of ephrin receptor signaling pathway(GO:1901189) positive regulation of canonical Wnt signaling pathway involved in cardiac muscle cell fate commitment(GO:1901297) positive regulation of canonical Wnt signaling pathway involved in heart development(GO:1905068) |
0.3 | 5.5 | GO:0051256 | mitotic spindle midzone assembly(GO:0051256) |
0.3 | 1.4 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.3 | 2.3 | GO:0070475 | rRNA base methylation(GO:0070475) |
0.3 | 1.7 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.3 | 3.6 | GO:0000479 | endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
0.3 | 2.5 | GO:1902255 | positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
0.3 | 3.8 | GO:0090235 | regulation of metaphase plate congression(GO:0090235) |
0.3 | 1.6 | GO:1904674 | positive regulation of somatic stem cell population maintenance(GO:1904674) |
0.3 | 8.9 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
0.3 | 2.0 | GO:1903433 | regulation of constitutive secretory pathway(GO:1903433) |
0.2 | 2.0 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.2 | 0.2 | GO:0014839 | myoblast migration involved in skeletal muscle regeneration(GO:0014839) |
0.2 | 2.9 | GO:0006857 | oligopeptide transport(GO:0006857) |
0.2 | 1.0 | GO:1990167 | protein K27-linked deubiquitination(GO:1990167) protein K33-linked deubiquitination(GO:1990168) |
0.2 | 0.5 | GO:0006272 | leading strand elongation(GO:0006272) |
0.2 | 1.1 | GO:0009257 | 10-formyltetrahydrofolate biosynthetic process(GO:0009257) |
0.2 | 0.9 | GO:0015910 | peroxisomal long-chain fatty acid import(GO:0015910) |
0.2 | 1.3 | GO:0001927 | exocyst assembly(GO:0001927) |
0.2 | 0.7 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
0.2 | 0.9 | GO:0006844 | acyl carnitine transport(GO:0006844) acyl carnitine transmembrane transport(GO:1902616) |
0.2 | 1.3 | GO:0045903 | positive regulation of translational fidelity(GO:0045903) |
0.2 | 1.4 | GO:0090170 | regulation of Golgi inheritance(GO:0090170) |
0.2 | 1.2 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.2 | 1.6 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
0.2 | 1.2 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.2 | 2.4 | GO:0010225 | response to UV-C(GO:0010225) |
0.2 | 1.0 | GO:0071043 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
0.2 | 2.8 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
0.2 | 2.5 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
0.2 | 0.6 | GO:0072717 | cellular response to actinomycin D(GO:0072717) |
0.2 | 0.6 | GO:0006286 | base-excision repair, base-free sugar-phosphate removal(GO:0006286) |
0.2 | 22.9 | GO:0006879 | cellular iron ion homeostasis(GO:0006879) |
0.2 | 3.7 | GO:0000338 | protein deneddylation(GO:0000338) |
0.2 | 1.3 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
0.2 | 3.1 | GO:0036500 | ATF6-mediated unfolded protein response(GO:0036500) |
0.2 | 1.1 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
0.2 | 0.9 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.2 | 3.4 | GO:0070987 | error-free translesion synthesis(GO:0070987) |
0.2 | 0.5 | GO:0007388 | anterior compartment pattern formation(GO:0007387) posterior compartment specification(GO:0007388) |
0.2 | 0.7 | GO:0036292 | DNA rewinding(GO:0036292) |
0.2 | 0.5 | GO:0060661 | submandibular salivary gland formation(GO:0060661) hair follicle cell proliferation(GO:0071335) regulation of hair follicle cell proliferation(GO:0071336) positive regulation of hair follicle cell proliferation(GO:0071338) |
0.2 | 0.7 | GO:0072642 | interferon-alpha secretion(GO:0072642) regulation of interferon-alpha secretion(GO:1902739) positive regulation of interferon-alpha secretion(GO:1902741) |
0.2 | 1.4 | GO:0038110 | interleukin-2-mediated signaling pathway(GO:0038110) cellular response to interleukin-2(GO:0071352) |
0.2 | 3.8 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.2 | 0.5 | GO:1903630 | regulation of aminoacyl-tRNA ligase activity(GO:1903630) |
0.2 | 0.5 | GO:0006864 | pyrimidine nucleotide transport(GO:0006864) mitochondrial pyrimidine nucleotide import(GO:1990519) |
0.2 | 0.5 | GO:2000816 | negative regulation of mitotic sister chromatid segregation(GO:0033048) negative regulation of mitotic sister chromatid separation(GO:2000816) |
0.2 | 0.8 | GO:1902659 | regulation of glucose mediated signaling pathway(GO:1902659) |
0.2 | 0.9 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.2 | 0.6 | GO:1904808 | regulation of protein oxidation(GO:1904806) positive regulation of protein oxidation(GO:1904808) |
0.2 | 0.2 | GO:0045990 | carbon catabolite regulation of transcription(GO:0045990) |
0.2 | 2.4 | GO:0021694 | cerebellar Purkinje cell layer formation(GO:0021694) cerebellar Purkinje cell differentiation(GO:0021702) |
0.2 | 0.6 | GO:0006617 | SRP-dependent cotranslational protein targeting to membrane, signal sequence recognition(GO:0006617) |
0.1 | 0.9 | GO:0018343 | protein farnesylation(GO:0018343) |
0.1 | 0.4 | GO:0035508 | positive regulation of myosin-light-chain-phosphatase activity(GO:0035508) |
0.1 | 1.0 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.1 | 0.6 | GO:1903542 | negative regulation of exosomal secretion(GO:1903542) regulation of centriole elongation(GO:1903722) |
0.1 | 0.4 | GO:0031064 | negative regulation of histone deacetylation(GO:0031064) |
0.1 | 1.4 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
0.1 | 4.7 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.1 | 0.9 | GO:2001295 | malonyl-CoA biosynthetic process(GO:2001295) |
0.1 | 0.6 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 10.3 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.1 | 1.0 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
0.1 | 1.7 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
0.1 | 0.5 | GO:0021849 | neuroblast division in subventricular zone(GO:0021849) |
0.1 | 1.3 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.1 | 2.0 | GO:0033227 | dsRNA transport(GO:0033227) |
0.1 | 0.8 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.1 | 0.5 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.1 | 0.5 | GO:1903381 | neuron intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0036483) regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903381) negative regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903382) |
0.1 | 0.4 | GO:0061485 | memory T cell proliferation(GO:0061485) |
0.1 | 1.0 | GO:0048549 | endosome localization(GO:0032439) positive regulation of pinocytosis(GO:0048549) |
0.1 | 3.3 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
0.1 | 1.0 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
0.1 | 0.9 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) |
0.1 | 0.7 | GO:1904751 | positive regulation of protein localization to nucleolus(GO:1904751) |
0.1 | 0.6 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
0.1 | 0.4 | GO:0006117 | acetaldehyde metabolic process(GO:0006117) |
0.1 | 0.4 | GO:1904784 | NLRP1 inflammasome complex assembly(GO:1904784) |
0.1 | 2.2 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
0.1 | 1.4 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.1 | 1.0 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.1 | 0.9 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.1 | 1.8 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
0.1 | 0.2 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
0.1 | 0.2 | GO:0015966 | diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
0.1 | 0.1 | GO:0070627 | regulation of iron ion transport(GO:0034756) positive regulation of iron ion transport(GO:0034758) regulation of iron ion transmembrane transport(GO:0034759) positive regulation of iron ion transmembrane transport(GO:0034761) ferrous iron import(GO:0070627) ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) regulation of iron ion import(GO:1900390) regulation of ferrous iron import into cell(GO:1903989) positive regulation of ferrous iron import into cell(GO:1903991) regulation of ferrous iron binding(GO:1904432) positive regulation of ferrous iron binding(GO:1904434) regulation of transferrin receptor binding(GO:1904435) positive regulation of transferrin receptor binding(GO:1904437) regulation of ferrous iron import across plasma membrane(GO:1904438) positive regulation of ferrous iron import across plasma membrane(GO:1904440) |
0.1 | 0.8 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
0.1 | 0.6 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
0.1 | 0.4 | GO:0042223 | response to molecule of fungal origin(GO:0002238) positive regulation of interleukin-3 production(GO:0032752) interleukin-3 biosynthetic process(GO:0042223) regulation of interleukin-3 biosynthetic process(GO:0045399) positive regulation of interleukin-3 biosynthetic process(GO:0045401) cellular response to molecule of fungal origin(GO:0071226) |
0.1 | 0.7 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.1 | 0.5 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.1 | 0.3 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.1 | 5.3 | GO:0005980 | glycogen catabolic process(GO:0005980) |
0.1 | 0.9 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
0.1 | 0.5 | GO:0015917 | aminophospholipid transport(GO:0015917) |
0.1 | 0.3 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
0.1 | 0.4 | GO:1990022 | RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
0.1 | 0.6 | GO:2000234 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
0.1 | 0.6 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.1 | 0.7 | GO:0019918 | peptidyl-arginine methylation, to symmetrical-dimethyl arginine(GO:0019918) |
0.1 | 0.6 | GO:0033489 | cholesterol biosynthetic process via desmosterol(GO:0033489) cholesterol biosynthetic process via lathosterol(GO:0033490) |
0.1 | 1.1 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.1 | 0.9 | GO:1901098 | positive regulation of autophagosome maturation(GO:1901098) |
0.1 | 3.0 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.1 | 0.7 | GO:0007000 | nucleolus organization(GO:0007000) |
0.1 | 2.8 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
0.1 | 0.3 | GO:0035621 | ER to Golgi ceramide transport(GO:0035621) |
0.1 | 0.2 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
0.1 | 0.5 | GO:1901503 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) ether biosynthetic process(GO:1901503) |
0.1 | 0.2 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.1 | 1.6 | GO:0010566 | regulation of ketone biosynthetic process(GO:0010566) |
0.1 | 0.6 | GO:0008218 | bioluminescence(GO:0008218) |
0.1 | 5.3 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.1 | 1.2 | GO:0071313 | cellular response to caffeine(GO:0071313) |
0.1 | 0.8 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.1 | 1.9 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.1 | 1.7 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
0.1 | 1.5 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.1 | 0.4 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
0.1 | 1.8 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
0.1 | 1.7 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.1 | 0.8 | GO:0002480 | antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
0.1 | 1.0 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.1 | 0.3 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.1 | 0.8 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.1 | 0.5 | GO:0039019 | pronephric nephron development(GO:0039019) |
0.1 | 1.7 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
0.1 | 5.3 | GO:1904837 | beta-catenin-TCF complex assembly(GO:1904837) |
0.1 | 0.7 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.1 | 1.0 | GO:0046149 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.1 | 4.4 | GO:0006284 | base-excision repair(GO:0006284) |
0.1 | 0.7 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.1 | 0.3 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.1 | 1.8 | GO:0035635 | entry of bacterium into host cell(GO:0035635) |
0.1 | 1.2 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.1 | 0.5 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
0.1 | 0.4 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.1 | 1.7 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
0.1 | 0.2 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) DNA replication, removal of RNA primer(GO:0043137) |
0.1 | 0.4 | GO:0031291 | Ran protein signal transduction(GO:0031291) |
0.1 | 0.5 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
0.1 | 8.5 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.1 | 0.1 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
0.1 | 0.4 | GO:0051083 | 'de novo' cotranslational protein folding(GO:0051083) |
0.1 | 1.8 | GO:1900364 | negative regulation of mRNA polyadenylation(GO:1900364) |
0.1 | 0.4 | GO:0031392 | regulation of prostaglandin biosynthetic process(GO:0031392) regulation of unsaturated fatty acid biosynthetic process(GO:2001279) |
0.1 | 0.2 | GO:0007113 | endomitotic cell cycle(GO:0007113) |
0.1 | 1.0 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
0.1 | 2.4 | GO:0046931 | pore complex assembly(GO:0046931) |
0.1 | 1.8 | GO:1901663 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
0.1 | 0.1 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
0.1 | 0.3 | GO:1901804 | beta-glucoside metabolic process(GO:1901804) beta-glucoside catabolic process(GO:1901805) positive regulation of neuronal action potential(GO:1904457) |
0.1 | 1.3 | GO:0002643 | regulation of tolerance induction(GO:0002643) |
0.1 | 0.3 | GO:0070901 | mitochondrial tRNA methylation(GO:0070901) |
0.1 | 0.2 | GO:0090102 | cochlea development(GO:0090102) |
0.1 | 0.1 | GO:0031441 | negative regulation of mRNA 3'-end processing(GO:0031441) |
0.1 | 1.5 | GO:0033630 | positive regulation of cell adhesion mediated by integrin(GO:0033630) |
0.1 | 1.5 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
0.1 | 2.4 | GO:0038202 | TORC1 signaling(GO:0038202) |
0.1 | 1.0 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
0.1 | 0.4 | GO:2000288 | positive regulation of myoblast proliferation(GO:2000288) |
0.1 | 0.6 | GO:0031022 | nuclear migration along microfilament(GO:0031022) |
0.1 | 0.2 | GO:0097156 | fasciculation of motor neuron axon(GO:0097156) |
0.1 | 0.5 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.1 | 0.7 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
0.1 | 0.6 | GO:0034351 | regulation of glial cell apoptotic process(GO:0034350) negative regulation of glial cell apoptotic process(GO:0034351) |
0.1 | 1.3 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
0.1 | 0.3 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.1 | 0.5 | GO:1905097 | regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
0.1 | 1.3 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
0.1 | 3.1 | GO:0031648 | protein destabilization(GO:0031648) |
0.1 | 0.7 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.1 | 0.7 | GO:0035437 | protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
0.1 | 0.5 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.1 | 1.0 | GO:0006853 | carnitine shuttle(GO:0006853) |
0.1 | 0.2 | GO:0019521 | aldonic acid metabolic process(GO:0019520) D-gluconate metabolic process(GO:0019521) |
0.1 | 0.8 | GO:0019317 | fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
0.1 | 0.6 | GO:0051096 | positive regulation of helicase activity(GO:0051096) |
0.0 | 0.2 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.0 | 1.3 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.0 | 0.1 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
0.0 | 0.3 | GO:2000291 | regulation of myoblast proliferation(GO:2000291) |
0.0 | 0.3 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.0 | 0.7 | GO:0015074 | DNA integration(GO:0015074) |
0.0 | 0.5 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
0.0 | 1.3 | GO:0016254 | preassembly of GPI anchor in ER membrane(GO:0016254) |
0.0 | 0.3 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
0.0 | 0.3 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.0 | 0.4 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) regulation of parathyroid hormone secretion(GO:2000828) |
0.0 | 1.0 | GO:0016024 | CDP-diacylglycerol biosynthetic process(GO:0016024) |
0.0 | 0.3 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.0 | 0.3 | GO:0021539 | subthalamus development(GO:0021539) |
0.0 | 1.4 | GO:0006907 | pinocytosis(GO:0006907) |
0.0 | 1.0 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
0.0 | 0.5 | GO:0006657 | CDP-choline pathway(GO:0006657) |
0.0 | 1.3 | GO:0060334 | regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
0.0 | 0.4 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
0.0 | 0.4 | GO:0070862 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
0.0 | 0.5 | GO:0001866 | NK T cell proliferation(GO:0001866) |
0.0 | 4.2 | GO:0010507 | negative regulation of autophagy(GO:0010507) |
0.0 | 0.9 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.0 | 1.4 | GO:0045663 | positive regulation of myoblast differentiation(GO:0045663) |
0.0 | 3.1 | GO:0000266 | mitochondrial fission(GO:0000266) |
0.0 | 0.4 | GO:0072734 | response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
0.0 | 0.7 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
0.0 | 0.1 | GO:0035509 | negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) negative regulation of bicellular tight junction assembly(GO:1903347) |
0.0 | 1.7 | GO:0034453 | microtubule anchoring(GO:0034453) |
0.0 | 0.3 | GO:0031580 | membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
0.0 | 0.9 | GO:0010885 | regulation of cholesterol storage(GO:0010885) positive regulation of cholesterol storage(GO:0010886) |
0.0 | 0.2 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) |
0.0 | 1.6 | GO:0071431 | tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
0.0 | 0.2 | GO:0006669 | sphinganine-1-phosphate biosynthetic process(GO:0006669) |
0.0 | 6.6 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
0.0 | 0.3 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
0.0 | 0.3 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.0 | 0.5 | GO:0000079 | regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0000079) |
0.0 | 2.5 | GO:0045540 | regulation of cholesterol biosynthetic process(GO:0045540) |
0.0 | 0.3 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.0 | 0.2 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.0 | 0.7 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.0 | 0.2 | GO:0035990 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
0.0 | 0.2 | GO:0006924 | activation-induced cell death of T cells(GO:0006924) |
0.0 | 0.8 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.0 | 0.4 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.0 | 0.8 | GO:0042773 | ATP synthesis coupled electron transport(GO:0042773) |
0.0 | 0.5 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
0.0 | 0.1 | GO:0002326 | B cell lineage commitment(GO:0002326) |
0.0 | 0.1 | GO:0042137 | sequestering of neurotransmitter(GO:0042137) |
0.0 | 3.7 | GO:0006094 | gluconeogenesis(GO:0006094) |
0.0 | 0.8 | GO:1902808 | positive regulation of cell cycle G1/S phase transition(GO:1902808) |
0.0 | 0.1 | GO:0061419 | positive regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061419) |
0.0 | 0.4 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.0 | 0.2 | GO:0030311 | poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.1 | GO:1903445 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
0.0 | 1.1 | GO:2000398 | regulation of T cell differentiation in thymus(GO:0033081) regulation of thymocyte aggregation(GO:2000398) |
0.0 | 0.2 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.0 | 0.3 | GO:0060033 | anatomical structure regression(GO:0060033) |
0.0 | 0.3 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
0.0 | 0.2 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.0 | 0.3 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) |
0.0 | 0.3 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.0 | 2.3 | GO:0005977 | glycogen metabolic process(GO:0005977) |
0.0 | 0.6 | GO:0071542 | dopaminergic neuron differentiation(GO:0071542) |
0.0 | 0.5 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
0.0 | 2.7 | GO:0032981 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 1.8 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.0 | 1.2 | GO:1903959 | regulation of anion transmembrane transport(GO:1903959) |
0.0 | 0.6 | GO:1990118 | sodium ion import(GO:0097369) sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.0 | 0.8 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
0.0 | 0.5 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.0 | 1.1 | GO:0035666 | TRIF-dependent toll-like receptor signaling pathway(GO:0035666) |
0.0 | 0.3 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.0 | 0.9 | GO:0031935 | regulation of chromatin silencing(GO:0031935) |
0.0 | 1.3 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.0 | 3.0 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.0 | 0.6 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
0.0 | 0.1 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.0 | 0.1 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
0.0 | 0.3 | GO:1903943 | regulation of hepatocyte apoptotic process(GO:1903943) negative regulation of hepatocyte apoptotic process(GO:1903944) |
0.0 | 1.0 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
0.0 | 0.6 | GO:0071539 | protein localization to centrosome(GO:0071539) |
0.0 | 0.6 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
0.0 | 0.2 | GO:0042045 | epithelial fluid transport(GO:0042045) |
0.0 | 0.2 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
0.0 | 0.7 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
0.0 | 0.1 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.0 | 0.8 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.0 | 0.3 | GO:1904871 | regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) |
0.0 | 0.2 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.0 | 2.2 | GO:0006364 | rRNA processing(GO:0006364) |
0.0 | 1.0 | GO:0031952 | regulation of protein autophosphorylation(GO:0031952) |
0.0 | 0.6 | GO:0038092 | nodal signaling pathway(GO:0038092) |
0.0 | 0.2 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
0.0 | 0.8 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.0 | 0.4 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.0 | 1.0 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.0 | 0.1 | GO:0010446 | response to alkaline pH(GO:0010446) |
0.0 | 1.7 | GO:0097192 | signal transduction in absence of ligand(GO:0038034) extrinsic apoptotic signaling pathway in absence of ligand(GO:0097192) |
0.0 | 1.0 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
0.0 | 1.3 | GO:0048701 | embryonic cranial skeleton morphogenesis(GO:0048701) |
0.0 | 0.2 | GO:1900623 | regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
0.0 | 0.5 | GO:0034243 | regulation of transcription elongation from RNA polymerase II promoter(GO:0034243) |
0.0 | 1.8 | GO:0043550 | regulation of lipid kinase activity(GO:0043550) |
0.0 | 0.3 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
0.0 | 1.6 | GO:0018279 | peptidyl-asparagine modification(GO:0018196) protein N-linked glycosylation via asparagine(GO:0018279) |
0.0 | 1.2 | GO:0042059 | negative regulation of epidermal growth factor receptor signaling pathway(GO:0042059) |
0.0 | 0.6 | GO:0071425 | hematopoietic stem cell proliferation(GO:0071425) |
0.0 | 0.4 | GO:0034644 | cellular response to UV(GO:0034644) |
0.0 | 0.4 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.0 | 1.3 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
0.0 | 0.3 | GO:0048853 | forebrain morphogenesis(GO:0048853) |
0.0 | 0.4 | GO:0032802 | low-density lipoprotein particle receptor catabolic process(GO:0032802) |
0.0 | 0.4 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
0.0 | 0.3 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
0.0 | 0.3 | GO:0007020 | microtubule nucleation(GO:0007020) |
0.0 | 0.7 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.0 | 0.3 | GO:0010666 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
0.0 | 0.1 | GO:0035063 | nuclear speck organization(GO:0035063) |
0.0 | 0.3 | GO:0097264 | self proteolysis(GO:0097264) |
0.0 | 0.1 | GO:0046349 | amino sugar biosynthetic process(GO:0046349) |
0.0 | 0.5 | GO:0006359 | regulation of transcription from RNA polymerase III promoter(GO:0006359) |
0.0 | 0.3 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
0.0 | 0.5 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
0.0 | 0.8 | GO:0016575 | histone deacetylation(GO:0016575) |
0.0 | 0.3 | GO:0006085 | acetyl-CoA biosynthetic process(GO:0006085) |
0.0 | 0.1 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
0.0 | 0.8 | GO:0008156 | negative regulation of DNA replication(GO:0008156) |
0.0 | 0.1 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
0.0 | 0.1 | GO:0018057 | peptidyl-lysine oxidation(GO:0018057) |
0.0 | 1.0 | GO:0015804 | neutral amino acid transport(GO:0015804) |
0.0 | 1.0 | GO:0090501 | RNA phosphodiester bond hydrolysis(GO:0090501) |
0.0 | 0.1 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
0.0 | 0.1 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.0 | 0.4 | GO:0033146 | regulation of intracellular estrogen receptor signaling pathway(GO:0033146) |
0.0 | 0.4 | GO:0014829 | vascular smooth muscle contraction(GO:0014829) |
0.0 | 1.2 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.0 | 0.2 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
0.0 | 0.6 | GO:0031572 | G2 DNA damage checkpoint(GO:0031572) |
0.0 | 0.4 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
0.0 | 0.2 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.0 | 2.2 | GO:0016573 | histone acetylation(GO:0016573) |
0.0 | 0.2 | GO:0016180 | snRNA processing(GO:0016180) |
0.0 | 3.1 | GO:0016579 | protein deubiquitination(GO:0016579) |
0.0 | 0.2 | GO:0010972 | negative regulation of G2/M transition of mitotic cell cycle(GO:0010972) |
0.0 | 0.0 | GO:0097476 | spinal cord motor neuron migration(GO:0097476) |
0.0 | 1.8 | GO:0090305 | nucleic acid phosphodiester bond hydrolysis(GO:0090305) |
0.0 | 0.2 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.0 | 0.1 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.0 | 0.3 | GO:0032012 | regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 0.6 | GO:0072332 | intrinsic apoptotic signaling pathway by p53 class mediator(GO:0072332) |
0.0 | 1.4 | GO:0007030 | Golgi organization(GO:0007030) |
0.0 | 0.2 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.8 | 4.8 | GO:1905202 | 3-methylcrotonyl-CoA carboxylase complex, mitochondrial(GO:0002169) methylcrotonoyl-CoA carboxylase complex(GO:1905202) |
0.5 | 1.6 | GO:0030689 | Noc complex(GO:0030689) |
0.5 | 4.7 | GO:0000923 | equatorial microtubule organizing center(GO:0000923) |
0.5 | 3.5 | GO:1990130 | Iml1 complex(GO:1990130) |
0.5 | 1.5 | GO:0034455 | t-UTP complex(GO:0034455) |
0.5 | 1.4 | GO:0070685 | macropinocytic cup(GO:0070685) |
0.4 | 8.9 | GO:0034709 | methylosome(GO:0034709) |
0.4 | 4.0 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
0.4 | 7.5 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.4 | 7.1 | GO:0044754 | autolysosome(GO:0044754) |
0.3 | 1.6 | GO:0031417 | NatC complex(GO:0031417) |
0.3 | 1.9 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.3 | 1.8 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
0.3 | 4.3 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.3 | 2.4 | GO:0005827 | polar microtubule(GO:0005827) |
0.3 | 1.0 | GO:0031251 | PAN complex(GO:0031251) |
0.2 | 1.2 | GO:1990425 | ryanodine receptor complex(GO:1990425) |
0.2 | 1.2 | GO:0071942 | XPC complex(GO:0071942) |
0.2 | 2.3 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.2 | 3.0 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.2 | 1.4 | GO:0032044 | DSIF complex(GO:0032044) |
0.2 | 2.5 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.2 | 0.7 | GO:0002944 | cyclin K-CDK12 complex(GO:0002944) |
0.2 | 0.9 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
0.2 | 1.1 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.2 | 2.0 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.2 | 1.3 | GO:1990246 | uniplex complex(GO:1990246) |
0.2 | 5.8 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.2 | 1.3 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
0.2 | 3.2 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.2 | 1.8 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) |
0.2 | 0.7 | GO:0036284 | tubulobulbar complex(GO:0036284) |
0.2 | 4.0 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.2 | 1.0 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.2 | 1.8 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.2 | 1.5 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.1 | 0.4 | GO:0005668 | RNA polymerase transcription factor SL1 complex(GO:0005668) |
0.1 | 0.4 | GO:1990723 | cytoplasmic periphery of the nuclear pore complex(GO:1990723) |
0.1 | 0.9 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.1 | 4.5 | GO:0031011 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
0.1 | 0.7 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.1 | 0.7 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.1 | 0.4 | GO:0032002 | interleukin-28 receptor complex(GO:0032002) |
0.1 | 4.9 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.1 | 10.7 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.1 | 2.8 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
0.1 | 1.8 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.1 | 0.9 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) |
0.1 | 0.5 | GO:1990423 | RZZ complex(GO:1990423) |
0.1 | 0.9 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
0.1 | 2.2 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.1 | 0.5 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.1 | 0.4 | GO:0071159 | NF-kappaB p50/p65 complex(GO:0035525) NF-kappaB complex(GO:0071159) |
0.1 | 0.3 | GO:0034657 | GID complex(GO:0034657) |
0.1 | 0.5 | GO:1990031 | pinceau fiber(GO:1990031) |
0.1 | 4.0 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.1 | 0.3 | GO:0005674 | transcription factor TFIIF complex(GO:0005674) |
0.1 | 1.5 | GO:0005869 | dynactin complex(GO:0005869) |
0.1 | 0.3 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.1 | 2.6 | GO:0031932 | TORC2 complex(GO:0031932) |
0.1 | 1.7 | GO:0071439 | clathrin complex(GO:0071439) |
0.1 | 22.7 | GO:0101002 | ficolin-1-rich granule(GO:0101002) ficolin-1-rich granule lumen(GO:1904813) |
0.1 | 1.0 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.1 | 2.8 | GO:0046930 | pore complex(GO:0046930) |
0.1 | 1.0 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.1 | 0.5 | GO:0036156 | inner dynein arm(GO:0036156) |
0.1 | 6.0 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.1 | 0.9 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
0.1 | 0.6 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
0.1 | 4.2 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.1 | 0.8 | GO:0035976 | AP1 complex(GO:0035976) |
0.1 | 2.3 | GO:0005844 | polysome(GO:0005844) |
0.1 | 0.8 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.1 | 0.9 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.1 | 0.8 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.1 | 1.6 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.1 | 0.7 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.1 | 1.6 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.1 | 0.6 | GO:1990393 | 3M complex(GO:1990393) |
0.1 | 7.7 | GO:0005637 | nuclear inner membrane(GO:0005637) |
0.1 | 0.6 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) |
0.1 | 7.4 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.1 | 1.0 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.1 | 3.6 | GO:0016592 | mediator complex(GO:0016592) |
0.1 | 1.5 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.1 | 1.0 | GO:0005845 | mRNA cap binding complex(GO:0005845) |
0.1 | 2.8 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
0.1 | 0.9 | GO:0019774 | proteasome core complex, beta-subunit complex(GO:0019774) |
0.1 | 0.4 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.1 | 0.4 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.1 | 0.8 | GO:0045171 | intercellular bridge(GO:0045171) |
0.1 | 1.0 | GO:0000124 | SAGA complex(GO:0000124) |
0.1 | 1.3 | GO:0045277 | respiratory chain complex IV(GO:0045277) |
0.1 | 3.5 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
0.1 | 1.0 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.1 | 0.7 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.1 | 3.1 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.1 | 2.2 | GO:0005840 | ribosome(GO:0005840) |
0.1 | 0.3 | GO:0008537 | proteasome activator complex(GO:0008537) |
0.1 | 4.0 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.1 | 0.6 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.1 | 0.4 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
0.0 | 0.4 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.0 | 0.2 | GO:0032279 | axonemal microtubule(GO:0005879) asymmetric synapse(GO:0032279) |
0.0 | 0.1 | GO:1902636 | kinociliary basal body(GO:1902636) |
0.0 | 8.3 | GO:0016605 | PML body(GO:0016605) |
0.0 | 0.7 | GO:0071986 | Ragulator complex(GO:0071986) |
0.0 | 2.3 | GO:0000421 | autophagosome membrane(GO:0000421) |
0.0 | 1.2 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.0 | 0.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.0 | 13.7 | GO:0036464 | cytoplasmic ribonucleoprotein granule(GO:0036464) |
0.0 | 0.1 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.0 | 1.2 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.0 | 0.4 | GO:0097504 | SMN-Sm protein complex(GO:0034719) Gemini of coiled bodies(GO:0097504) |
0.0 | 0.5 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.0 | 1.6 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
0.0 | 4.6 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.0 | 6.5 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.0 | 0.3 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.0 | 22.6 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
0.0 | 0.2 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 2.2 | GO:0043034 | costamere(GO:0043034) |
0.0 | 2.5 | GO:0000786 | nucleosome(GO:0000786) |
0.0 | 0.3 | GO:0005642 | annulate lamellae(GO:0005642) |
0.0 | 0.6 | GO:0090543 | Flemming body(GO:0090543) |
0.0 | 3.3 | GO:0072686 | mitotic spindle(GO:0072686) |
0.0 | 0.5 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
0.0 | 0.2 | GO:0000974 | Prp19 complex(GO:0000974) |
0.0 | 0.5 | GO:0030897 | HOPS complex(GO:0030897) |
0.0 | 0.6 | GO:0005916 | fascia adherens(GO:0005916) |
0.0 | 1.3 | GO:0000145 | exocyst(GO:0000145) |
0.0 | 0.2 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
0.0 | 0.9 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.0 | 0.3 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.0 | 0.5 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.0 | 0.3 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.0 | 0.3 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.0 | 2.5 | GO:0035578 | azurophil granule lumen(GO:0035578) |
0.0 | 0.2 | GO:0005638 | lamin filament(GO:0005638) |
0.0 | 0.1 | GO:1990745 | EARP complex(GO:1990745) |
0.0 | 0.8 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.0 | 0.3 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.0 | 0.3 | GO:0070652 | HAUS complex(GO:0070652) |
0.0 | 0.3 | GO:0097470 | ribbon synapse(GO:0097470) |
0.0 | 0.3 | GO:0005581 | collagen trimer(GO:0005581) |
0.0 | 0.3 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.0 | 0.5 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 0.1 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.0 | 0.5 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.0 | 0.3 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.0 | 0.1 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.0 | 0.2 | GO:0035692 | macrophage migration inhibitory factor receptor complex(GO:0035692) |
0.0 | 2.7 | GO:0044439 | microbody part(GO:0044438) peroxisomal part(GO:0044439) |
0.0 | 0.3 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
0.0 | 0.3 | GO:0017059 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
0.0 | 0.5 | GO:0032156 | septin complex(GO:0031105) septin cytoskeleton(GO:0032156) |
0.0 | 4.7 | GO:0005795 | Golgi stack(GO:0005795) |
0.0 | 2.3 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
0.0 | 3.2 | GO:0031902 | late endosome membrane(GO:0031902) |
0.0 | 1.9 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.0 | 0.4 | GO:0036020 | endolysosome membrane(GO:0036020) |
0.0 | 3.3 | GO:0035579 | specific granule membrane(GO:0035579) |
0.0 | 1.3 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
0.0 | 1.2 | GO:0045178 | basal part of cell(GO:0045178) |
0.0 | 0.4 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) ripoptosome(GO:0097342) |
0.0 | 1.1 | GO:0031526 | brush border membrane(GO:0031526) |
0.0 | 0.8 | GO:0005776 | autophagosome(GO:0005776) |
0.0 | 5.9 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.0 | 0.8 | GO:0015030 | Cajal body(GO:0015030) |
0.0 | 0.4 | GO:0043596 | nuclear replication fork(GO:0043596) |
0.0 | 0.2 | GO:0030008 | TRAPP complex(GO:0030008) |
0.0 | 14.6 | GO:0005730 | nucleolus(GO:0005730) |
0.0 | 0.2 | GO:0032039 | integrator complex(GO:0032039) |
0.0 | 0.2 | GO:0097225 | sperm midpiece(GO:0097225) |
0.0 | 0.3 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.0 | 0.1 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.0 | 0.2 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.0 | 0.1 | GO:0071817 | MMXD complex(GO:0071817) |
0.0 | 0.2 | GO:0036064 | ciliary basal body(GO:0036064) |
0.0 | 0.5 | GO:0019897 | extrinsic component of plasma membrane(GO:0019897) |
0.0 | 0.1 | GO:0016272 | prefoldin complex(GO:0016272) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
3.5 | 10.6 | GO:0030350 | iron-responsive element binding(GO:0030350) |
1.1 | 5.4 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
0.9 | 3.6 | GO:0036033 | mediator complex binding(GO:0036033) |
0.9 | 11.4 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.8 | 4.8 | GO:0004485 | methylcrotonoyl-CoA carboxylase activity(GO:0004485) |
0.8 | 3.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.7 | 2.0 | GO:0061663 | NEDD8 ligase activity(GO:0061663) |
0.6 | 1.9 | GO:0016422 | mRNA (2'-O-methyladenosine-N6-)-methyltransferase activity(GO:0016422) |
0.5 | 1.0 | GO:0051538 | 3 iron, 4 sulfur cluster binding(GO:0051538) |
0.5 | 2.9 | GO:0015333 | peptide:proton symporter activity(GO:0015333) proton-dependent peptide secondary active transmembrane transporter activity(GO:0022897) |
0.5 | 2.4 | GO:0051731 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) |
0.5 | 2.4 | GO:0031208 | POZ domain binding(GO:0031208) |
0.5 | 10.1 | GO:0016274 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
0.4 | 1.3 | GO:0003880 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) |
0.4 | 1.3 | GO:0004827 | glutamate-tRNA ligase activity(GO:0004818) proline-tRNA ligase activity(GO:0004827) |
0.4 | 1.1 | GO:0004487 | methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
0.4 | 4.6 | GO:0090599 | alpha-glucosidase activity(GO:0090599) |
0.3 | 1.0 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
0.3 | 1.3 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.3 | 2.0 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.3 | 2.0 | GO:0004815 | aspartate-tRNA ligase activity(GO:0004815) |
0.3 | 1.9 | GO:0045145 | single-stranded DNA 5'-3' exodeoxyribonuclease activity(GO:0045145) |
0.3 | 1.3 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.3 | 2.5 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.3 | 1.2 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.3 | 2.1 | GO:0042903 | tubulin deacetylase activity(GO:0042903) |
0.3 | 1.2 | GO:0000404 | heteroduplex DNA loop binding(GO:0000404) |
0.3 | 1.2 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.3 | 1.2 | GO:0004803 | transposase activity(GO:0004803) |
0.3 | 1.7 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.3 | 8.4 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.3 | 1.4 | GO:0019976 | interleukin-2 receptor activity(GO:0004911) interleukin-2 binding(GO:0019976) |
0.3 | 4.0 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.3 | 1.0 | GO:1904455 | ubiquitin-specific protease activity involved in negative regulation of ERAD pathway(GO:1904455) |
0.3 | 1.0 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.2 | 2.0 | GO:0004331 | 6-phosphofructo-2-kinase activity(GO:0003873) fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
0.2 | 1.0 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
0.2 | 9.6 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
0.2 | 2.3 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
0.2 | 1.9 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
0.2 | 0.7 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.2 | 0.9 | GO:0004660 | protein farnesyltransferase activity(GO:0004660) |
0.2 | 1.1 | GO:0047757 | chondroitin-glucuronate 5-epimerase activity(GO:0047757) |
0.2 | 0.9 | GO:0015227 | acyl carnitine transmembrane transporter activity(GO:0015227) |
0.2 | 1.3 | GO:0004906 | interferon-gamma receptor activity(GO:0004906) |
0.2 | 1.9 | GO:0004873 | asialoglycoprotein receptor activity(GO:0004873) |
0.2 | 2.1 | GO:1990948 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
0.2 | 4.6 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.2 | 0.8 | GO:0031685 | adenosine receptor binding(GO:0031685) |
0.2 | 2.0 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.2 | 0.6 | GO:0001160 | transcription termination site sequence-specific DNA binding(GO:0001147) transcription termination site DNA binding(GO:0001160) |
0.2 | 1.0 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
0.2 | 0.6 | GO:0090541 | MIT domain binding(GO:0090541) |
0.2 | 0.6 | GO:0030626 | U12 snRNA binding(GO:0030626) |
0.2 | 0.6 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.2 | 2.4 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.2 | 0.5 | GO:0015439 | heme-transporting ATPase activity(GO:0015439) |
0.2 | 2.3 | GO:0015288 | porin activity(GO:0015288) |
0.2 | 1.4 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
0.2 | 0.7 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
0.2 | 0.5 | GO:0015218 | pyrimidine nucleotide transmembrane transporter activity(GO:0015218) |
0.2 | 0.5 | GO:0008193 | tRNA guanylyltransferase activity(GO:0008193) |
0.2 | 1.3 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.2 | 0.5 | GO:0045155 | electron transporter, transferring electrons from CoQH2-cytochrome c reductase complex and cytochrome c oxidase complex activity(GO:0045155) |
0.2 | 2.3 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.2 | 0.3 | GO:0008169 | C-methyltransferase activity(GO:0008169) |
0.2 | 0.9 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
0.2 | 0.6 | GO:1990404 | protein ADP-ribosylase activity(GO:1990404) |
0.2 | 0.6 | GO:0034046 | poly(G) binding(GO:0034046) |
0.1 | 0.6 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.1 | 0.4 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.1 | 1.4 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.1 | 0.7 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
0.1 | 0.9 | GO:0003989 | acetyl-CoA carboxylase activity(GO:0003989) |
0.1 | 2.3 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
0.1 | 0.5 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) ethanolaminephosphotransferase activity(GO:0004307) |
0.1 | 2.3 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.1 | 0.8 | GO:0017060 | 3-galactosyl-N-acetylglucosaminide 4-alpha-L-fucosyltransferase activity(GO:0017060) |
0.1 | 0.5 | GO:0032427 | GBD domain binding(GO:0032427) |
0.1 | 4.0 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.1 | 0.9 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.1 | 4.5 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.1 | 0.9 | GO:0043426 | MRF binding(GO:0043426) |
0.1 | 0.5 | GO:0004492 | methylmalonyl-CoA decarboxylase activity(GO:0004492) |
0.1 | 2.6 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.1 | 1.7 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.1 | 0.4 | GO:0005136 | interleukin-4 receptor binding(GO:0005136) |
0.1 | 0.5 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.1 | 0.8 | GO:0047522 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
0.1 | 12.5 | GO:0004004 | ATP-dependent RNA helicase activity(GO:0004004) |
0.1 | 2.3 | GO:0000150 | recombinase activity(GO:0000150) |
0.1 | 1.3 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.1 | 0.9 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.1 | 0.8 | GO:0046979 | TAP2 binding(GO:0046979) |
0.1 | 1.8 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.1 | 0.3 | GO:0061711 | N(6)-L-threonylcarbamoyladenine synthase(GO:0061711) |
0.1 | 6.3 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.1 | 0.5 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.1 | 0.8 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.1 | 0.3 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.1 | 1.3 | GO:0000182 | rDNA binding(GO:0000182) |
0.1 | 1.8 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.1 | 0.4 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.1 | 0.8 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
0.1 | 4.1 | GO:0070034 | telomerase RNA binding(GO:0070034) |
0.1 | 3.7 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
0.1 | 0.3 | GO:0003878 | ATP citrate synthase activity(GO:0003878) |
0.1 | 1.7 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.1 | 1.0 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.1 | 0.6 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.1 | 1.6 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
0.1 | 1.0 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
0.1 | 5.8 | GO:0019843 | rRNA binding(GO:0019843) |
0.1 | 1.8 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
0.1 | 1.4 | GO:0034452 | dynactin binding(GO:0034452) |
0.1 | 1.3 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.1 | 0.8 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.1 | 7.1 | GO:0050681 | androgen receptor binding(GO:0050681) |
0.1 | 0.7 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.1 | 0.6 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.1 | 1.9 | GO:0030515 | snoRNA binding(GO:0030515) |
0.1 | 1.9 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.1 | 0.2 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.1 | 1.2 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.1 | 0.5 | GO:0080019 | fatty-acyl-CoA reductase (alcohol-forming) activity(GO:0080019) |
0.1 | 0.9 | GO:0000990 | transcription factor activity, core RNA polymerase binding(GO:0000990) |
0.1 | 0.3 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
0.1 | 0.3 | GO:0005471 | ATP:ADP antiporter activity(GO:0005471) adenine transmembrane transporter activity(GO:0015207) |
0.1 | 2.8 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.1 | 0.2 | GO:0019781 | NEDD8 activating enzyme activity(GO:0019781) |
0.1 | 0.4 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.1 | 14.6 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.1 | 0.1 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
0.1 | 8.4 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
0.1 | 1.5 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.1 | 0.6 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.1 | 1.0 | GO:0016891 | endoribonuclease activity, producing 5'-phosphomonoesters(GO:0016891) |
0.1 | 4.2 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
0.1 | 1.7 | GO:0005112 | Notch binding(GO:0005112) |
0.1 | 0.7 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.1 | 3.9 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.1 | 1.2 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
0.1 | 5.1 | GO:0043621 | protein self-association(GO:0043621) |
0.1 | 0.2 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
0.1 | 0.3 | GO:0017089 | glycolipid transporter activity(GO:0017089) ceramide binding(GO:0097001) |
0.1 | 0.5 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
0.1 | 1.7 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.1 | 0.3 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
0.1 | 0.3 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
0.1 | 1.2 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
0.1 | 0.4 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.1 | 0.3 | GO:0004666 | prostaglandin-endoperoxide synthase activity(GO:0004666) |
0.1 | 1.1 | GO:0005542 | folic acid binding(GO:0005542) |
0.0 | 1.2 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.0 | 3.8 | GO:0043022 | ribosome binding(GO:0043022) |
0.0 | 1.3 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
0.0 | 0.2 | GO:0042731 | PH domain binding(GO:0042731) |
0.0 | 1.2 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.0 | 0.4 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 1.3 | GO:0070403 | NAD+ binding(GO:0070403) |
0.0 | 0.6 | GO:0086083 | cell adhesive protein binding involved in bundle of His cell-Purkinje myocyte communication(GO:0086083) |
0.0 | 0.6 | GO:0043199 | sulfate binding(GO:0043199) |
0.0 | 1.9 | GO:0016896 | 3'-5'-exoribonuclease activity(GO:0000175) exoribonuclease activity, producing 5'-phosphomonoesters(GO:0016896) |
0.0 | 1.4 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.0 | 14.9 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) |
0.0 | 1.1 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.0 | 0.6 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
0.0 | 0.2 | GO:0004102 | choline O-acetyltransferase activity(GO:0004102) |
0.0 | 0.4 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.0 | 0.3 | GO:0030267 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
0.0 | 0.3 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.0 | 2.7 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
0.0 | 2.8 | GO:0031491 | nucleosome binding(GO:0031491) |
0.0 | 0.4 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.0 | 1.9 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
0.0 | 0.8 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.0 | 0.1 | GO:0071633 | dihydroceramidase activity(GO:0071633) |
0.0 | 4.0 | GO:0000980 | RNA polymerase II distal enhancer sequence-specific DNA binding(GO:0000980) |
0.0 | 0.3 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.0 | 0.1 | GO:0004583 | dolichyl-phosphate-glucose-glycolipid alpha-glucosyltransferase activity(GO:0004583) |
0.0 | 0.3 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.0 | 0.4 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
0.0 | 0.2 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.0 | 0.3 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
0.0 | 0.7 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.0 | 1.2 | GO:0005521 | lamin binding(GO:0005521) |
0.0 | 1.3 | GO:0005123 | death receptor binding(GO:0005123) |
0.0 | 0.2 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.0 | 0.5 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.0 | 2.2 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
0.0 | 1.0 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.0 | 0.4 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
0.0 | 0.7 | GO:0047617 | acyl-CoA hydrolase activity(GO:0047617) |
0.0 | 0.4 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.0 | 0.3 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.0 | 6.1 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
0.0 | 0.4 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
0.0 | 0.9 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.9 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
0.0 | 1.6 | GO:0030507 | spectrin binding(GO:0030507) |
0.0 | 1.7 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
0.0 | 0.5 | GO:0010181 | FMN binding(GO:0010181) |
0.0 | 0.1 | GO:0004608 | phosphatidyl-N-methylethanolamine N-methyltransferase activity(GO:0000773) phosphatidylethanolamine N-methyltransferase activity(GO:0004608) phosphatidyl-N-dimethylethanolamine N-methyltransferase activity(GO:0080101) |
0.0 | 0.1 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.0 | 0.9 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
0.0 | 0.4 | GO:0033549 | MAP kinase phosphatase activity(GO:0033549) |
0.0 | 0.9 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
0.0 | 0.7 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.0 | 0.1 | GO:0048039 | ubiquinone binding(GO:0048039) |
0.0 | 0.6 | GO:0008201 | heparin binding(GO:0008201) |
0.0 | 2.2 | GO:0003725 | double-stranded RNA binding(GO:0003725) |
0.0 | 0.2 | GO:0017050 | sphinganine kinase activity(GO:0008481) D-erythro-sphingosine kinase activity(GO:0017050) |
0.0 | 1.7 | GO:0050660 | flavin adenine dinucleotide binding(GO:0050660) |
0.0 | 3.6 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.0 | 0.2 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
0.0 | 0.5 | GO:0051400 | BH domain binding(GO:0051400) |
0.0 | 0.4 | GO:0019789 | SUMO transferase activity(GO:0019789) |
0.0 | 0.8 | GO:0030506 | ankyrin binding(GO:0030506) |
0.0 | 0.8 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.0 | 0.2 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
0.0 | 2.0 | GO:0019209 | kinase activator activity(GO:0019209) |
0.0 | 0.1 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
0.0 | 0.3 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.5 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 0.4 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.0 | 0.4 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.0 | 0.8 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.0 | 1.4 | GO:0035064 | methylated histone binding(GO:0035064) |
0.0 | 0.4 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
0.0 | 0.4 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
0.0 | 0.1 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.0 | 1.0 | GO:0015175 | neutral amino acid transmembrane transporter activity(GO:0015175) |
0.0 | 4.3 | GO:0017124 | SH3 domain binding(GO:0017124) |
0.0 | 0.3 | GO:0043225 | anion transmembrane-transporting ATPase activity(GO:0043225) |
0.0 | 0.3 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 5.8 | GO:0004842 | ubiquitin-protein transferase activity(GO:0004842) |
0.0 | 0.5 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.0 | 0.1 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
0.0 | 0.4 | GO:0032041 | NAD-dependent histone deacetylase activity(GO:0017136) histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.0 | 0.3 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.0 | 0.5 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.0 | 0.3 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.0 | 0.1 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.0 | 0.5 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.0 | 0.4 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.0 | 0.3 | GO:0030331 | estrogen receptor binding(GO:0030331) |
0.0 | 0.4 | GO:0016790 | thiolester hydrolase activity(GO:0016790) |
0.0 | 0.4 | GO:0008494 | translation activator activity(GO:0008494) |
0.0 | 0.4 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.0 | 0.1 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.0 | 0.1 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.0 | 0.6 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
0.0 | 0.1 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.0 | 1.1 | GO:0051219 | phosphoprotein binding(GO:0051219) |
0.0 | 0.5 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
0.0 | 0.1 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.0 | 6.2 | GO:0003682 | chromatin binding(GO:0003682) |
0.0 | 0.5 | GO:0019905 | syntaxin binding(GO:0019905) |
0.0 | 1.4 | GO:0016651 | oxidoreductase activity, acting on NAD(P)H(GO:0016651) |
0.0 | 0.1 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
0.0 | 0.1 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.0 | 0.4 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.0 | 3.7 | GO:0008017 | microtubule binding(GO:0008017) |
0.0 | 1.3 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.0 | 2.5 | GO:0017137 | Rab GTPase binding(GO:0017137) |
0.0 | 0.7 | GO:0043130 | ubiquitin binding(GO:0043130) |
0.0 | 1.2 | GO:0017048 | Rho GTPase binding(GO:0017048) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 2.0 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.3 | 13.3 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.1 | 16.5 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
0.1 | 17.6 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.1 | 4.0 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.1 | 12.0 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.1 | 2.8 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.1 | 1.4 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.1 | 3.9 | PID ATM PATHWAY | ATM pathway |
0.1 | 2.2 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.1 | 3.6 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.1 | 0.9 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.0 | 0.8 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 1.4 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.0 | 5.5 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.0 | 3.8 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.0 | 0.5 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.0 | 1.3 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
0.0 | 2.6 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.0 | 3.0 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 0.6 | PID MYC PATHWAY | C-MYC pathway |
0.0 | 1.7 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.0 | 1.2 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.0 | 0.4 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 3.4 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.0 | 0.6 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 1.4 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.0 | 1.6 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.0 | 0.4 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 1.3 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 0.6 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.0 | 1.4 | PID MTOR 4PATHWAY | mTOR signaling pathway |
0.0 | 1.1 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
0.0 | 1.1 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.0 | 0.3 | ST GAQ PATHWAY | G alpha q Pathway |
0.0 | 0.6 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.0 | 0.6 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.0 | 0.8 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.7 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.0 | 0.5 | PID P53 REGULATION PATHWAY | p53 pathway |
0.0 | 0.1 | PID BARD1 PATHWAY | BARD1 signaling events |
0.0 | 0.5 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.0 | 0.6 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 0.5 | PID NOTCH PATHWAY | Notch signaling pathway |
0.0 | 0.5 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.0 | 0.5 | PID BCR 5PATHWAY | BCR signaling pathway |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 11.3 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.4 | 8.5 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.2 | 7.2 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.2 | 6.1 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.2 | 5.1 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.2 | 5.3 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.2 | 3.7 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.2 | 3.2 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
0.1 | 13.3 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.1 | 21.5 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.1 | 5.6 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.1 | 1.2 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
0.1 | 7.9 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.1 | 1.4 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
0.1 | 1.9 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.1 | 5.7 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
0.1 | 5.0 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
0.1 | 2.3 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.1 | 6.2 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.1 | 2.7 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
0.1 | 2.1 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
0.1 | 0.4 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
0.1 | 0.9 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.1 | 2.2 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.1 | 3.0 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.1 | 1.2 | REACTOME GLOBAL GENOMIC NER GG NER | Genes involved in Global Genomic NER (GG-NER) |
0.1 | 5.4 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.1 | 0.9 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.1 | 2.9 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
0.1 | 5.9 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.1 | 1.7 | REACTOME FORMATION OF THE HIV1 EARLY ELONGATION COMPLEX | Genes involved in Formation of the HIV-1 Early Elongation Complex |
0.1 | 1.1 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.1 | 4.4 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.1 | 1.5 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.1 | 2.3 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
0.1 | 0.8 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
0.1 | 0.4 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.1 | 1.0 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
0.1 | 0.8 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.1 | 1.5 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.1 | 1.4 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.1 | 1.0 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
0.1 | 1.0 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
0.0 | 0.6 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.0 | 1.0 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.0 | 2.1 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.0 | 14.6 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.0 | 1.2 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.0 | 2.2 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
0.0 | 0.5 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
0.0 | 0.6 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.0 | 2.0 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
0.0 | 1.4 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.0 | 1.7 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.0 | 3.9 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
0.0 | 0.5 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.0 | 3.9 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
0.0 | 5.1 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.0 | 0.9 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.0 | 1.3 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 1.4 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.0 | 1.0 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.0 | 0.6 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.0 | 1.2 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.0 | 0.3 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.0 | 0.3 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
0.0 | 0.5 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
0.0 | 0.7 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.0 | 1.9 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 0.5 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
0.0 | 0.5 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
0.0 | 0.9 | REACTOME APOPTOTIC CLEAVAGE OF CELLULAR PROTEINS | Genes involved in Apoptotic cleavage of cellular proteins |
0.0 | 0.4 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
0.0 | 0.1 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
0.0 | 0.5 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
0.0 | 0.5 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.0 | 0.4 | REACTOME NEF MEDIATES DOWN MODULATION OF CELL SURFACE RECEPTORS BY RECRUITING THEM TO CLATHRIN ADAPTERS | Genes involved in Nef-mediates down modulation of cell surface receptors by recruiting them to clathrin adapters |
0.0 | 0.6 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.0 | 0.5 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.0 | 1.4 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.0 | 6.6 | REACTOME GENERIC TRANSCRIPTION PATHWAY | Genes involved in Generic Transcription Pathway |
0.0 | 0.6 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.0 | 0.4 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
0.0 | 1.1 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
0.0 | 0.4 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 0.6 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.0 | 0.3 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.0 | 0.7 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.0 | 0.1 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.0 | 0.2 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |