Project
Illumina Body Map 2
Navigation
Downloads
Results for KLF16_SP2
Z-value: 2.75
Motif logo
Transcription factors associated with KLF16_SP2
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
KLF16
|
ENSG00000129911.4 | Kruppel like factor 16 |
|
SP2
|
ENSG00000167182.11 | Sp2 transcription factor |
Activity-expression correlation:
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| KLF16 | hg19_v2_chr19_-_1863567_1863586 | 0.23 | 2.1e-01 | Click! |
| SP2 | hg19_v2_chr17_+_45973516_45973618 | 0.01 | 9.6e-01 | Click! |
Activity profile of KLF16_SP2 motif
Sorted Z-values of KLF16_SP2 motif
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr14_+_94640633 | 12.92 |
ENST00000304338.3
|
PPP4R4
|
protein phosphatase 4, regulatory subunit 4 |
| chr19_+_55795493 | 11.78 |
ENST00000309383.1
|
BRSK1
|
BR serine/threonine kinase 1 |
| chr19_+_1491144 | 9.67 |
ENST00000233596.3
|
REEP6
|
receptor accessory protein 6 |
| chr14_+_94640671 | 8.02 |
ENST00000328839.3
|
PPP4R4
|
protein phosphatase 4, regulatory subunit 4 |
| chr19_-_38878632 | 7.76 |
ENST00000586599.1
ENST00000334928.6 ENST00000587676.1 |
GGN
|
gametogenetin |
| chr18_+_55102917 | 7.38 |
ENST00000491143.2
|
ONECUT2
|
one cut homeobox 2 |
| chr20_+_1206679 | 6.89 |
ENST00000402452.1
ENST00000409241.1 ENST00000381882.2 ENST00000246108.3 |
RAD21L1
|
RAD21-like 1 (S. pombe) |
| chr19_-_55658687 | 6.51 |
ENST00000593046.1
|
TNNT1
|
troponin T type 1 (skeletal, slow) |
| chr12_-_103310987 | 6.51 |
ENST00000307000.2
|
PAH
|
phenylalanine hydroxylase |
| chr7_-_100240328 | 6.32 |
ENST00000462107.1
|
TFR2
|
transferrin receptor 2 |
| chr9_+_139846708 | 6.02 |
ENST00000371633.3
|
LCN12
|
lipocalin 12 |
| chr1_+_43637996 | 6.01 |
ENST00000528956.1
ENST00000529956.1 |
WDR65
|
WD repeat domain 65 |
| chr6_-_110500826 | 6.00 |
ENST00000265601.3
ENST00000447287.1 ENST00000444391.1 |
WASF1
|
WAS protein family, member 1 |
| chr12_+_130822417 | 5.94 |
ENST00000245255.3
|
PIWIL1
|
piwi-like RNA-mediated gene silencing 1 |
| chr19_-_55658650 | 5.91 |
ENST00000589226.1
|
TNNT1
|
troponin T type 1 (skeletal, slow) |
| chr19_-_51893827 | 5.89 |
ENST00000574814.1
|
CTD-2616J11.4
|
chromosome 19 open reading frame 84 |
| chr13_-_114018400 | 5.88 |
ENST00000375430.4
ENST00000375431.4 |
GRTP1
|
growth hormone regulated TBC protein 1 |
| chr21_-_10990888 | 5.85 |
ENST00000298232.7
|
TPTE
|
transmembrane phosphatase with tensin homology |
| chr13_-_52027134 | 5.80 |
ENST00000311234.4
ENST00000425000.1 ENST00000463928.1 ENST00000442263.3 ENST00000398119.2 |
INTS6
|
integrator complex subunit 6 |
| chr21_-_10990830 | 5.78 |
ENST00000361285.4
ENST00000342420.5 ENST00000328758.5 |
TPTE
|
transmembrane phosphatase with tensin homology |
| chr19_-_14168391 | 5.69 |
ENST00000589048.1
|
PALM3
|
paralemmin 3 |
| chr11_-_2182388 | 5.63 |
ENST00000421783.1
ENST00000397262.1 ENST00000250971.3 ENST00000381330.4 ENST00000397270.1 |
INS
INS-IGF2
|
insulin INS-IGF2 readthrough |
| chr11_-_68519026 | 5.62 |
ENST00000255087.5
|
MTL5
|
metallothionein-like 5, testis-specific (tesmin) |
| chr22_+_43808014 | 5.62 |
ENST00000334209.5
ENST00000443721.1 ENST00000414469.2 ENST00000439548.1 |
MPPED1
|
metallophosphoesterase domain containing 1 |
| chr19_+_50433476 | 5.60 |
ENST00000596658.1
|
ATF5
|
activating transcription factor 5 |
| chr16_+_87636474 | 5.49 |
ENST00000284262.2
|
JPH3
|
junctophilin 3 |
| chr15_+_72947079 | 5.35 |
ENST00000421285.3
|
GOLGA6B
|
golgin A6 family, member B |
| chr9_+_91150016 | 5.31 |
ENST00000375854.3
ENST00000375855.3 |
NXNL2
|
nucleoredoxin-like 2 |
| chr19_+_49866851 | 5.20 |
ENST00000221498.2
ENST00000596402.1 |
DKKL1
|
dickkopf-like 1 |
| chr4_-_819901 | 5.20 |
ENST00000304062.6
|
CPLX1
|
complexin 1 |
| chr20_-_62103862 | 5.08 |
ENST00000344462.4
ENST00000357249.2 ENST00000359125.2 ENST00000360480.3 ENST00000370224.1 ENST00000344425.5 ENST00000354587.3 ENST00000359689.1 |
KCNQ2
|
potassium voltage-gated channel, KQT-like subfamily, member 2 |
| chr17_+_41177220 | 5.07 |
ENST00000587250.2
ENST00000544533.1 |
RND2
|
Rho family GTPase 2 |
| chr17_-_7080227 | 5.06 |
ENST00000574330.1
|
ASGR1
|
asialoglycoprotein receptor 1 |
| chr6_-_110500905 | 4.99 |
ENST00000392587.2
|
WASF1
|
WAS protein family, member 1 |
| chr19_-_1490398 | 4.96 |
ENST00000588671.1
ENST00000300954.5 |
PCSK4
|
proprotein convertase subtilisin/kexin type 4 |
| chr19_+_3224700 | 4.95 |
ENST00000292672.2
ENST00000541430.2 |
CELF5
|
CUGBP, Elav-like family member 5 |
| chr19_+_51815102 | 4.92 |
ENST00000270642.8
|
IGLON5
|
IgLON family member 5 |
| chr22_-_43583079 | 4.85 |
ENST00000216129.6
|
TTLL12
|
tubulin tyrosine ligase-like family, member 12 |
| chr21_-_45682099 | 4.83 |
ENST00000270172.3
ENST00000418993.1 |
DNMT3L
|
DNA (cytosine-5-)-methyltransferase 3-like |
| chr19_+_8943074 | 4.82 |
ENST00000595891.1
|
MBD3L1
|
methyl-CpG binding domain protein 3-like 1 |
| chr19_-_3479086 | 4.80 |
ENST00000587847.1
|
C19orf77
|
chromosome 19 open reading frame 77 |
| chr16_+_89238149 | 4.79 |
ENST00000289746.2
|
CDH15
|
cadherin 15, type 1, M-cadherin (myotubule) |
| chr19_+_2096868 | 4.71 |
ENST00000395296.1
ENST00000395301.3 |
IZUMO4
|
IZUMO family member 4 |
| chr2_+_16080659 | 4.67 |
ENST00000281043.3
|
MYCN
|
v-myc avian myelocytomatosis viral oncogene neuroblastoma derived homolog |
| chr17_-_7082861 | 4.60 |
ENST00000269299.3
|
ASGR1
|
asialoglycoprotein receptor 1 |
| chr19_+_49867181 | 4.59 |
ENST00000597546.1
|
DKKL1
|
dickkopf-like 1 |
| chr7_-_105029329 | 4.55 |
ENST00000393651.3
ENST00000460391.1 |
SRPK2
|
SRSF protein kinase 2 |
| chrX_+_9754461 | 4.52 |
ENST00000380913.3
|
SHROOM2
|
shroom family member 2 |
| chr19_+_48867652 | 4.49 |
ENST00000344846.2
|
SYNGR4
|
synaptogyrin 4 |
| chr19_-_59010565 | 4.46 |
ENST00000594786.1
|
SLC27A5
|
solute carrier family 27 (fatty acid transporter), member 5 |
| chr7_-_100239132 | 4.45 |
ENST00000223051.3
ENST00000431692.1 |
TFR2
|
transferrin receptor 2 |
| chr2_+_73144604 | 4.44 |
ENST00000258106.6
|
EMX1
|
empty spiracles homeobox 1 |
| chr16_+_29817841 | 4.39 |
ENST00000322945.6
ENST00000562337.1 ENST00000566906.2 ENST00000563402.1 ENST00000219782.6 |
MAZ
|
MYC-associated zinc finger protein (purine-binding transcription factor) |
| chr16_+_2521500 | 4.29 |
ENST00000293973.1
|
NTN3
|
netrin 3 |
| chr19_-_10024496 | 4.25 |
ENST00000593091.1
|
OLFM2
|
olfactomedin 2 |
| chr5_+_92228 | 4.19 |
ENST00000512035.1
|
CTD-2231H16.1
|
CTD-2231H16.1 |
| chr6_-_11044509 | 4.18 |
ENST00000354666.3
|
ELOVL2
|
ELOVL fatty acid elongase 2 |
| chr22_-_22900001 | 4.18 |
ENST00000403441.1
|
PRAME
|
preferentially expressed antigen in melanoma |
| chr19_-_55658281 | 4.17 |
ENST00000585321.2
ENST00000587465.2 |
TNNT1
|
troponin T type 1 (skeletal, slow) |
| chrX_-_54384425 | 4.14 |
ENST00000375169.3
ENST00000354646.2 |
WNK3
|
WNK lysine deficient protein kinase 3 |
| chr19_-_51472031 | 4.11 |
ENST00000391808.1
|
KLK6
|
kallikrein-related peptidase 6 |
| chr15_-_28344439 | 4.10 |
ENST00000431101.1
ENST00000445578.1 ENST00000353809.5 ENST00000382996.2 ENST00000354638.3 |
OCA2
|
oculocutaneous albinism II |
| chr19_-_51893782 | 4.07 |
ENST00000570516.1
|
CTD-2616J11.4
|
chromosome 19 open reading frame 84 |
| chr7_+_5111723 | 4.04 |
ENST00000498308.1
|
RBAKDN
|
RBAK downstream neighbor (non-protein coding) |
| chr11_+_64009072 | 4.04 |
ENST00000535135.1
ENST00000394540.3 |
FKBP2
|
FK506 binding protein 2, 13kDa |
| chr1_+_233463507 | 4.04 |
ENST00000366623.3
ENST00000366624.3 |
MLK4
|
Mitogen-activated protein kinase kinase kinase MLK4 |
| chr10_-_118429461 | 4.03 |
ENST00000588184.1
ENST00000369210.3 |
C10orf82
|
chromosome 10 open reading frame 82 |
| chr8_+_144161874 | 4.02 |
ENST00000562505.1
|
RP11-520P18.5
|
Uncharacterized protein |
| chr1_+_3689325 | 4.01 |
ENST00000444870.2
ENST00000452264.1 |
SMIM1
|
small integral membrane protein 1 (Vel blood group) |
| chr22_-_51001332 | 4.00 |
ENST00000406915.3
|
SYCE3
|
synaptonemal complex central element protein 3 |
| chr9_-_127533519 | 3.99 |
ENST00000487099.2
ENST00000344523.4 ENST00000373584.3 |
NR6A1
|
nuclear receptor subfamily 6, group A, member 1 |
| chr9_+_95820966 | 3.97 |
ENST00000375472.3
ENST00000465709.1 |
SUSD3
|
sushi domain containing 3 |
| chr7_-_4998802 | 3.96 |
ENST00000406755.1
ENST00000404774.3 ENST00000401401.3 |
MMD2
|
monocyte to macrophage differentiation-associated 2 |
| chr11_-_64410787 | 3.95 |
ENST00000301894.2
|
NRXN2
|
neurexin 2 |
| chr21_-_44496441 | 3.95 |
ENST00000359624.3
ENST00000352178.5 |
CBS
|
cystathionine-beta-synthase |
| chr20_-_32580924 | 3.93 |
ENST00000432859.1
|
RP5-1125A11.1
|
RP5-1125A11.1 |
| chr1_-_11714700 | 3.89 |
ENST00000354287.4
|
FBXO2
|
F-box protein 2 |
| chr19_+_7660716 | 3.85 |
ENST00000160298.4
ENST00000446248.2 |
CAMSAP3
|
calmodulin regulated spectrin-associated protein family, member 3 |
| chr9_+_139377947 | 3.85 |
ENST00000354376.1
|
C9orf163
|
chromosome 9 open reading frame 163 |
| chr17_-_79008373 | 3.85 |
ENST00000577066.1
ENST00000573167.1 |
BAIAP2-AS1
|
BAIAP2 antisense RNA 1 (head to head) |
| chr8_+_144328991 | 3.83 |
ENST00000520584.1
ENST00000330701.4 ENST00000522452.1 |
ZFP41
ZFP41
|
ZFP41 zinc finger protein ZFP41 |
| chr3_+_52444651 | 3.83 |
ENST00000327906.3
|
PHF7
|
PHD finger protein 7 |
| chr19_-_47975143 | 3.79 |
ENST00000597014.1
|
SLC8A2
|
solute carrier family 8 (sodium/calcium exchanger), member 2 |
| chr19_-_55865908 | 3.77 |
ENST00000590900.1
|
COX6B2
|
cytochrome c oxidase subunit VIb polypeptide 2 (testis) |
| chr5_+_140566 | 3.74 |
ENST00000502646.1
|
PLEKHG4B
|
pleckstrin homology domain containing, family G (with RhoGef domain) member 4B |
| chr10_-_135171178 | 3.71 |
ENST00000368551.1
|
FUOM
|
fucose mutarotase |
| chr9_-_127533582 | 3.67 |
ENST00000416460.2
|
NR6A1
|
nuclear receptor subfamily 6, group A, member 1 |
| chr10_+_134973905 | 3.65 |
ENST00000304613.3
ENST00000368572.2 |
KNDC1
|
kinase non-catalytic C-lobe domain (KIND) containing 1 |
| chr19_-_10047219 | 3.64 |
ENST00000264833.4
|
OLFM2
|
olfactomedin 2 |
| chr16_-_755726 | 3.63 |
ENST00000324361.5
|
FBXL16
|
F-box and leucine-rich repeat protein 16 |
| chr1_-_35395178 | 3.63 |
ENST00000373347.1
|
DLGAP3
|
discs, large (Drosophila) homolog-associated protein 3 |
| chr2_+_219187871 | 3.62 |
ENST00000258362.3
|
PNKD
|
paroxysmal nonkinesigenic dyskinesia |
| chr8_+_11561660 | 3.59 |
ENST00000526716.1
ENST00000335135.4 ENST00000528027.1 |
GATA4
|
GATA binding protein 4 |
| chr17_+_1646130 | 3.58 |
ENST00000453066.1
ENST00000324015.3 ENST00000450523.2 ENST00000453723.1 ENST00000382061.4 |
SERPINF2
|
serpin peptidase inhibitor, clade F (alpha-2 antiplasmin, pigment epithelium derived factor), member 2 |
| chrX_+_152912616 | 3.56 |
ENST00000342782.3
|
DUSP9
|
dual specificity phosphatase 9 |
| chr11_+_64008525 | 3.56 |
ENST00000449942.2
|
FKBP2
|
FK506 binding protein 2, 13kDa |
| chr19_-_5784610 | 3.53 |
ENST00000390672.2
ENST00000419421.2 |
PRR22
|
proline rich 22 |
| chr7_+_73082152 | 3.51 |
ENST00000324941.4
ENST00000451519.1 |
VPS37D
|
vacuolar protein sorting 37 homolog D (S. cerevisiae) |
| chr12_-_56881909 | 3.49 |
ENST00000461077.1
|
GLS2
|
glutaminase 2 (liver, mitochondrial) |
| chr11_-_65816591 | 3.47 |
ENST00000312006.4
|
GAL3ST3
|
galactose-3-O-sulfotransferase 3 |
| chr19_-_47975106 | 3.47 |
ENST00000539381.1
ENST00000594353.1 ENST00000542837.1 |
SLC8A2
|
solute carrier family 8 (sodium/calcium exchanger), member 2 |
| chr19_+_38826477 | 3.46 |
ENST00000409410.2
ENST00000215069.4 |
CATSPERG
|
catsper channel auxiliary subunit gamma |
| chr1_-_32801825 | 3.45 |
ENST00000329421.7
|
MARCKSL1
|
MARCKS-like 1 |
| chr1_+_41707996 | 3.44 |
ENST00000425554.1
|
RP11-399E6.1
|
RP11-399E6.1 |
| chr1_+_60280458 | 3.44 |
ENST00000455990.1
ENST00000371208.3 |
HOOK1
|
hook microtubule-tethering protein 1 |
| chr17_+_29815013 | 3.44 |
ENST00000394744.2
|
RAB11FIP4
|
RAB11 family interacting protein 4 (class II) |
| chr17_-_7081435 | 3.43 |
ENST00000380920.4
|
ASGR1
|
asialoglycoprotein receptor 1 |
| chrX_-_102319092 | 3.42 |
ENST00000372728.3
|
BEX1
|
brain expressed, X-linked 1 |
| chr19_-_48673552 | 3.41 |
ENST00000536218.1
ENST00000596549.1 |
LIG1
|
ligase I, DNA, ATP-dependent |
| chr15_-_74374891 | 3.40 |
ENST00000290438.3
|
GOLGA6A
|
golgin A6 family, member A |
| chr1_-_200992827 | 3.38 |
ENST00000332129.2
ENST00000422435.2 |
KIF21B
|
kinesin family member 21B |
| chr19_-_48673580 | 3.37 |
ENST00000427526.2
|
LIG1
|
ligase I, DNA, ATP-dependent |
| chr19_+_49866331 | 3.36 |
ENST00000597873.1
|
DKKL1
|
dickkopf-like 1 |
| chr10_-_135171510 | 3.36 |
ENST00000278025.4
ENST00000368552.3 |
FUOM
|
fucose mutarotase |
| chrX_+_152338301 | 3.35 |
ENST00000453825.2
|
PNMA6A
|
paraneoplastic Ma antigen family member 6A |
| chr5_+_612387 | 3.35 |
ENST00000264935.5
ENST00000444221.1 |
CEP72
|
centrosomal protein 72kDa |
| chr9_-_140335789 | 3.34 |
ENST00000344119.2
ENST00000371506.2 |
ENTPD8
|
ectonucleoside triphosphate diphosphohydrolase 8 |
| chr2_+_175352114 | 3.33 |
ENST00000444196.1
ENST00000417038.1 ENST00000606406.1 |
AC010894.3
|
AC010894.3 |
| chrX_+_51075658 | 3.33 |
ENST00000356450.2
|
NUDT10
|
nudix (nucleoside diphosphate linked moiety X)-type motif 10 |
| chrX_+_30671476 | 3.32 |
ENST00000378946.3
ENST00000378943.3 ENST00000378945.3 ENST00000427190.1 ENST00000378941.3 |
GK
|
glycerol kinase |
| chr16_+_67465016 | 3.31 |
ENST00000326152.5
|
HSD11B2
|
hydroxysteroid (11-beta) dehydrogenase 2 |
| chr6_+_31620191 | 3.30 |
ENST00000375918.2
ENST00000375920.4 |
APOM
|
apolipoprotein M |
| chr17_-_26926005 | 3.29 |
ENST00000536674.2
|
SPAG5
|
sperm associated antigen 5 |
| chr12_+_109273806 | 3.28 |
ENST00000228476.3
ENST00000547768.1 |
DAO
|
D-amino-acid oxidase |
| chr4_-_819880 | 3.28 |
ENST00000505203.1
|
CPLX1
|
complexin 1 |
| chr22_+_42394780 | 3.27 |
ENST00000328823.9
|
WBP2NL
|
WBP2 N-terminal like |
| chr5_-_114505624 | 3.24 |
ENST00000513154.1
|
TRIM36
|
tripartite motif containing 36 |
| chr5_-_114505591 | 3.22 |
ENST00000508894.1
|
TRIM36
|
tripartite motif containing 36 |
| chr1_+_173837488 | 3.21 |
ENST00000427304.1
ENST00000432989.1 ENST00000367702.1 |
ZBTB37
|
zinc finger and BTB domain containing 37 |
| chr9_+_136325089 | 3.21 |
ENST00000291722.7
ENST00000316948.4 ENST00000540581.1 |
CACFD1
|
calcium channel flower domain containing 1 |
| chr16_+_84178850 | 3.20 |
ENST00000334315.5
|
DNAAF1
|
dynein, axonemal, assembly factor 1 |
| chr19_+_2977444 | 3.20 |
ENST00000246112.4
ENST00000453329.1 ENST00000482627.1 ENST00000452088.1 |
TLE6
|
transducin-like enhancer of split 6 (E(sp1) homolog, Drosophila) |
| chr15_+_72410629 | 3.18 |
ENST00000340912.4
ENST00000544171.1 |
SENP8
|
SUMO/sentrin specific peptidase family member 8 |
| chr12_+_56075330 | 3.18 |
ENST00000394252.3
|
METTL7B
|
methyltransferase like 7B |
| chr12_-_56882136 | 3.15 |
ENST00000311966.4
|
GLS2
|
glutaminase 2 (liver, mitochondrial) |
| chr6_+_159290917 | 3.12 |
ENST00000367072.1
|
C6orf99
|
chromosome 6 open reading frame 99 |
| chr5_-_114515734 | 3.12 |
ENST00000514154.1
ENST00000282369.3 |
TRIM36
|
tripartite motif containing 36 |
| chr12_+_130822606 | 3.11 |
ENST00000546060.1
ENST00000539400.1 |
PIWIL1
|
piwi-like RNA-mediated gene silencing 1 |
| chr7_+_99775366 | 3.10 |
ENST00000394018.2
ENST00000416412.1 |
STAG3
|
stromal antigen 3 |
| chr19_-_56135928 | 3.10 |
ENST00000591479.1
ENST00000325351.4 |
ZNF784
|
zinc finger protein 784 |
| chr13_+_52158610 | 3.09 |
ENST00000298125.5
|
WDFY2
|
WD repeat and FYVE domain containing 2 |
| chrX_+_152240819 | 3.08 |
ENST00000421798.3
ENST00000535416.1 |
PNMA6C
PNMA6A
|
paraneoplastic Ma antigen family member 6C paraneoplastic Ma antigen family member 6A |
| chr19_-_3480540 | 3.08 |
ENST00000215531.4
|
C19orf77
|
chromosome 19 open reading frame 77 |
| chr11_-_134281812 | 3.07 |
ENST00000392580.1
ENST00000312527.4 |
B3GAT1
|
beta-1,3-glucuronyltransferase 1 (glucuronosyltransferase P) |
| chr15_-_23414193 | 3.07 |
ENST00000558241.1
|
RP11-467N20.5
|
Protein LOC440233 |
| chr4_+_1795012 | 3.04 |
ENST00000481110.2
ENST00000340107.4 ENST00000440486.2 ENST00000412135.2 |
FGFR3
|
fibroblast growth factor receptor 3 |
| chr15_+_63569785 | 3.03 |
ENST00000380343.4
ENST00000560353.1 |
APH1B
|
APH1B gamma secretase subunit |
| chr1_+_34632484 | 3.03 |
ENST00000373374.3
|
C1orf94
|
chromosome 1 open reading frame 94 |
| chr3_-_10547192 | 3.02 |
ENST00000360273.2
ENST00000343816.4 |
ATP2B2
|
ATPase, Ca++ transporting, plasma membrane 2 |
| chr8_-_57123815 | 3.01 |
ENST00000316981.3
ENST00000423799.2 ENST00000429357.2 |
PLAG1
|
pleiomorphic adenoma gene 1 |
| chr17_+_29718642 | 2.98 |
ENST00000325874.8
|
RAB11FIP4
|
RAB11 family interacting protein 4 (class II) |
| chr19_-_3869012 | 2.98 |
ENST00000592398.1
ENST00000262961.4 ENST00000439086.2 |
ZFR2
|
zinc finger RNA binding protein 2 |
| chr1_-_220101944 | 2.97 |
ENST00000366926.3
ENST00000536992.1 |
SLC30A10
|
solute carrier family 30, member 10 |
| chr2_-_233792837 | 2.97 |
ENST00000373552.4
ENST00000409079.1 |
NGEF
|
neuronal guanine nucleotide exchange factor |
| chr15_+_27216297 | 2.96 |
ENST00000333743.6
|
GABRG3
|
gamma-aminobutyric acid (GABA) A receptor, gamma 3 |
| chr17_-_42277203 | 2.95 |
ENST00000587097.1
|
ATXN7L3
|
ataxin 7-like 3 |
| chr16_-_1922109 | 2.95 |
ENST00000496541.2
ENST00000412554.2 ENST00000452149.2 ENST00000397344.3 |
MEIOB
|
meiosis specific with OB domains |
| chr11_-_64490634 | 2.94 |
ENST00000377559.3
ENST00000265459.6 |
NRXN2
|
neurexin 2 |
| chr19_-_17414179 | 2.92 |
ENST00000594194.1
ENST00000247706.3 |
ABHD8
|
abhydrolase domain containing 8 |
| chr1_+_228362251 | 2.92 |
ENST00000546123.1
|
IBA57
|
IBA57, iron-sulfur cluster assembly homolog (S. cerevisiae) |
| chr4_-_186392843 | 2.92 |
ENST00000393540.3
ENST00000506876.1 |
CCDC110
|
coiled-coil domain containing 110 |
| chr1_-_1850697 | 2.91 |
ENST00000378598.4
ENST00000416272.1 ENST00000310991.3 |
TMEM52
|
transmembrane protein 52 |
| chr15_-_23692381 | 2.90 |
ENST00000567107.1
ENST00000345070.5 ENST00000312015.5 |
GOLGA6L2
|
golgin A6 family-like 2 |
| chr12_-_56881874 | 2.90 |
ENST00000539272.1
|
GLS2
|
glutaminase 2 (liver, mitochondrial) |
| chrX_-_139587225 | 2.90 |
ENST00000370536.2
|
SOX3
|
SRY (sex determining region Y)-box 3 |
| chr1_-_1535455 | 2.89 |
ENST00000422725.1
|
C1orf233
|
chromosome 1 open reading frame 233 |
| chr10_+_135160844 | 2.88 |
ENST00000423766.1
ENST00000458230.1 |
PRAP1
|
proline-rich acidic protein 1 |
| chr1_+_45140360 | 2.88 |
ENST00000418644.1
ENST00000458657.2 ENST00000441519.1 ENST00000535358.1 ENST00000445071.1 |
C1orf228
|
chromosome 1 open reading frame 228 |
| chr20_+_37377085 | 2.88 |
ENST00000243903.4
|
ACTR5
|
ARP5 actin-related protein 5 homolog (yeast) |
| chr16_+_84002234 | 2.88 |
ENST00000305202.4
|
NECAB2
|
N-terminal EF-hand calcium binding protein 2 |
| chr2_-_17699691 | 2.86 |
ENST00000399080.2
|
RAD51AP2
|
RAD51 associated protein 2 |
| chr2_-_61108449 | 2.85 |
ENST00000439412.1
ENST00000452343.1 |
AC010733.4
|
AC010733.4 |
| chrX_-_152486108 | 2.84 |
ENST00000356661.5
|
MAGEA1
|
melanoma antigen family A, 1 (directs expression of antigen MZ2-E) |
| chr12_-_323689 | 2.83 |
ENST00000428720.1
|
SLC6A12
|
solute carrier family 6 (neurotransmitter transporter), member 12 |
| chr14_+_29236269 | 2.83 |
ENST00000313071.4
|
FOXG1
|
forkhead box G1 |
| chr5_-_89770582 | 2.83 |
ENST00000316610.6
|
MBLAC2
|
metallo-beta-lactamase domain containing 2 |
| chr16_+_88519669 | 2.82 |
ENST00000319555.3
|
ZFPM1
|
zinc finger protein, FOG family member 1 |
| chr1_-_38273840 | 2.82 |
ENST00000373044.2
|
YRDC
|
yrdC N(6)-threonylcarbamoyltransferase domain containing |
| chr2_-_99757876 | 2.81 |
ENST00000539964.1
ENST00000393482.3 |
TSGA10
|
testis specific, 10 |
| chr19_+_36132631 | 2.80 |
ENST00000379026.2
ENST00000379023.4 ENST00000402764.2 ENST00000479824.1 |
ETV2
|
ets variant 2 |
| chr12_-_100660833 | 2.78 |
ENST00000551642.1
ENST00000416321.1 ENST00000550587.1 ENST00000549249.1 |
DEPDC4
|
DEP domain containing 4 |
| chr7_-_124405681 | 2.77 |
ENST00000303921.2
|
GPR37
|
G protein-coupled receptor 37 (endothelin receptor type B-like) |
| chr11_-_560703 | 2.77 |
ENST00000441853.1
ENST00000329451.3 |
C11orf35
|
chromosome 11 open reading frame 35 |
| chr21_+_18885430 | 2.77 |
ENST00000356275.6
ENST00000400165.1 ENST00000400169.1 ENST00000306618.10 |
CXADR
|
coxsackie virus and adenovirus receptor |
| chrX_-_152343394 | 2.76 |
ENST00000370261.1
|
PNMA6B
|
paraneoplastic Ma antigen family member 6B (pseudogene) |
| chr4_-_152329987 | 2.74 |
ENST00000508847.1
|
RP11-610P16.1
|
RP11-610P16.1 |
| chr12_+_123849462 | 2.72 |
ENST00000543072.1
|
hsa-mir-8072
|
hsa-mir-8072 |
| chr1_-_21948906 | 2.71 |
ENST00000374761.2
ENST00000599760.1 |
RAP1GAP
|
RAP1 GTPase activating protein |
| chr11_-_66725837 | 2.71 |
ENST00000393958.2
ENST00000393960.1 ENST00000524491.1 ENST00000355677.3 |
PC
|
pyruvate carboxylase |
| chr11_+_64008443 | 2.71 |
ENST00000309366.4
|
FKBP2
|
FK506 binding protein 2, 13kDa |
| chr19_-_50666431 | 2.70 |
ENST00000293405.3
|
IZUMO2
|
IZUMO family member 2 |
| chr12_+_129338008 | 2.70 |
ENST00000442111.2
ENST00000281703.6 |
GLT1D1
|
glycosyltransferase 1 domain containing 1 |
| chr8_+_1711918 | 2.69 |
ENST00000331222.4
|
CLN8
|
ceroid-lipofuscinosis, neuronal 8 (epilepsy, progressive with mental retardation) |
| chr11_-_116708302 | 2.69 |
ENST00000375320.1
ENST00000359492.2 ENST00000375329.2 ENST00000375323.1 |
APOA1
|
apolipoprotein A-I |
| chr18_+_77867177 | 2.69 |
ENST00000560752.1
|
ADNP2
|
ADNP homeobox 2 |
| chr16_+_23847355 | 2.68 |
ENST00000498058.1
|
PRKCB
|
protein kinase C, beta |
| chr4_-_186392898 | 2.67 |
ENST00000510617.1
ENST00000307588.3 |
CCDC110
|
coiled-coil domain containing 110 |
| chr19_-_42348692 | 2.67 |
ENST00000330743.3
ENST00000601246.1 |
LYPD4
|
LY6/PLAUR domain containing 4 |
| chr11_+_57227981 | 2.66 |
ENST00000335099.3
|
RTN4RL2
|
reticulon 4 receptor-like 2 |
| chr11_+_94706804 | 2.66 |
ENST00000335080.5
|
KDM4D
|
lysine (K)-specific demethylase 4D |
Network of associatons between targets according to the STRING database.
First level regulatory network of KLF16_SP2
Gene Ontology Analysis
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.0 | 9.1 | GO:1903452 | regulation of G1 to G0 transition(GO:1903450) positive regulation of G1 to G0 transition(GO:1903452) |
| 2.7 | 8.2 | GO:1903461 | Okazaki fragment processing involved in mitotic DNA replication(GO:1903461) |
| 2.3 | 9.1 | GO:0006535 | cysteine biosynthetic process from serine(GO:0006535) |
| 2.0 | 18.3 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 2.0 | 6.0 | GO:1903697 | negative regulation of microvillus assembly(GO:1903697) |
| 2.0 | 6.0 | GO:0033861 | negative regulation of NAD(P)H oxidase activity(GO:0033861) |
| 2.0 | 11.8 | GO:0098707 | ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
| 1.7 | 6.8 | GO:0010903 | negative regulation of very-low-density lipoprotein particle remodeling(GO:0010903) |
| 1.6 | 6.6 | GO:1990926 | short-term synaptic potentiation(GO:1990926) |
| 1.6 | 3.2 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 1.6 | 6.2 | GO:0035408 | histone H3-T6 phosphorylation(GO:0035408) |
| 1.5 | 10.7 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 1.5 | 1.5 | GO:0031630 | regulation of synaptic vesicle fusion to presynaptic membrane(GO:0031630) |
| 1.5 | 4.5 | GO:0008057 | eye pigment granule organization(GO:0008057) |
| 1.5 | 8.7 | GO:0015878 | biotin transport(GO:0015878) pantothenate transmembrane transport(GO:0015887) |
| 1.4 | 4.3 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 1.4 | 1.4 | GO:1903802 | L-glutamate import(GO:0051938) L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
| 1.4 | 4.3 | GO:0071629 | cytoplasm-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071629) |
| 1.4 | 5.6 | GO:0034445 | regulation of plasma lipoprotein particle oxidation(GO:0034444) negative regulation of plasma lipoprotein particle oxidation(GO:0034445) |
| 1.4 | 1.4 | GO:1990641 | response to iron ion starvation(GO:1990641) |
| 1.3 | 4.0 | GO:1901052 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
| 1.3 | 4.0 | GO:0061727 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 1.3 | 2.7 | GO:0060129 | thyroid-stimulating hormone-secreting cell differentiation(GO:0060129) |
| 1.3 | 4.0 | GO:0021919 | BMP signaling pathway involved in spinal cord dorsal/ventral patterning(GO:0021919) |
| 1.3 | 13.2 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 1.3 | 3.9 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
| 1.2 | 7.4 | GO:0043324 | eye pigment biosynthetic process(GO:0006726) eye pigment metabolic process(GO:0042441) pigment metabolic process involved in developmental pigmentation(GO:0043324) pigment metabolic process involved in pigmentation(GO:0043474) |
| 1.2 | 3.6 | GO:0015729 | thiosulfate transport(GO:0015709) oxaloacetate transport(GO:0015729) malate transport(GO:0015743) malate transmembrane transport(GO:0071423) oxaloacetate(2-) transmembrane transport(GO:1902356) |
| 1.2 | 1.2 | GO:0016103 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
| 1.2 | 4.7 | GO:0036483 | neuron intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0036483) regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903381) negative regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903382) |
| 1.2 | 3.5 | GO:1990697 | protein depalmitoleylation(GO:1990697) |
| 1.1 | 6.8 | GO:0035063 | nuclear speck organization(GO:0035063) |
| 1.1 | 4.4 | GO:1900111 | positive regulation of histone H3-K9 dimethylation(GO:1900111) |
| 1.1 | 4.4 | GO:0009447 | putrescine catabolic process(GO:0009447) |
| 1.1 | 3.3 | GO:0035038 | female pronucleus assembly(GO:0035038) |
| 1.1 | 3.2 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
| 1.1 | 3.2 | GO:1902103 | metaphase/anaphase transition of meiotic cell cycle(GO:0044785) regulation of metaphase/anaphase transition of meiotic cell cycle(GO:1902102) negative regulation of metaphase/anaphase transition of meiotic cell cycle(GO:1902103) regulation of meiotic chromosome separation(GO:1905132) negative regulation of meiotic chromosome separation(GO:1905133) |
| 1.1 | 1.1 | GO:0046619 | optic placode formation involved in camera-type eye formation(GO:0046619) |
| 1.1 | 3.2 | GO:0050894 | determination of affect(GO:0050894) |
| 1.0 | 14.6 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 1.0 | 5.1 | GO:0019464 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 1.0 | 4.1 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 1.0 | 1.0 | GO:0071372 | cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
| 1.0 | 4.1 | GO:0006669 | sphinganine-1-phosphate biosynthetic process(GO:0006669) |
| 1.0 | 3.0 | GO:0006742 | NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
| 1.0 | 4.0 | GO:1904106 | protein localization to microvillus(GO:1904106) |
| 1.0 | 6.9 | GO:0019557 | histidine catabolic process to glutamate and formamide(GO:0019556) histidine catabolic process to glutamate and formate(GO:0019557) formamide metabolic process(GO:0043606) |
| 1.0 | 2.9 | GO:0080121 | coenzyme A transport(GO:0015880) coenzyme A transmembrane transport(GO:0035349) adenosine 3',5'-bisphosphate transmembrane transport(GO:0071106) AMP transport(GO:0080121) |
| 1.0 | 1.0 | GO:0006114 | glycerol biosynthetic process(GO:0006114) alditol biosynthetic process(GO:0019401) |
| 1.0 | 9.6 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.9 | 2.8 | GO:1904772 | hepatocyte homeostasis(GO:0036333) response to tetrachloromethane(GO:1904772) |
| 0.9 | 2.8 | GO:1990108 | protein linear deubiquitination(GO:1990108) |
| 0.9 | 4.7 | GO:0090202 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 0.9 | 2.8 | GO:0046210 | nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) |
| 0.9 | 6.4 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.9 | 2.8 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
| 0.9 | 0.9 | GO:0060629 | regulation of homologous chromosome segregation(GO:0060629) |
| 0.9 | 3.6 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
| 0.9 | 3.6 | GO:0010900 | negative regulation of phosphatidylcholine catabolic process(GO:0010900) |
| 0.9 | 2.7 | GO:0048627 | myoblast development(GO:0048627) |
| 0.9 | 3.6 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.9 | 5.4 | GO:0071543 | diadenosine polyphosphate catabolic process(GO:0015961) diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
| 0.9 | 3.5 | GO:0072299 | negative regulation of metanephric glomerulus development(GO:0072299) negative regulation of metanephric glomerular mesangial cell proliferation(GO:0072302) |
| 0.9 | 6.1 | GO:0036102 | leukotriene catabolic process(GO:0036100) leukotriene B4 catabolic process(GO:0036101) leukotriene B4 metabolic process(GO:0036102) icosanoid catabolic process(GO:1901523) fatty acid derivative catabolic process(GO:1901569) |
| 0.9 | 2.6 | GO:0033488 | cholesterol biosynthetic process via 24,25-dihydrolanosterol(GO:0033488) |
| 0.9 | 6.9 | GO:0046618 | drug export(GO:0046618) |
| 0.8 | 3.4 | GO:0015910 | peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.8 | 28.3 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
| 0.8 | 2.5 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
| 0.8 | 1.6 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.8 | 2.5 | GO:0035674 | tricarboxylic acid transmembrane transport(GO:0035674) |
| 0.8 | 9.0 | GO:0032776 | DNA methylation on cytosine(GO:0032776) |
| 0.8 | 0.8 | GO:2000124 | regulation of endocannabinoid signaling pathway(GO:2000124) |
| 0.8 | 0.8 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
| 0.8 | 2.3 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.8 | 7.8 | GO:0021840 | directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) |
| 0.8 | 3.1 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
| 0.8 | 2.3 | GO:0006579 | amino-acid betaine catabolic process(GO:0006579) |
| 0.7 | 2.2 | GO:0043012 | regulation of fusion of sperm to egg plasma membrane(GO:0043012) |
| 0.7 | 3.0 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.7 | 2.9 | GO:0046452 | dihydrofolate metabolic process(GO:0046452) |
| 0.7 | 5.9 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.7 | 2.9 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.7 | 2.9 | GO:0060168 | positive regulation of adenosine receptor signaling pathway(GO:0060168) |
| 0.7 | 2.2 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
| 0.7 | 0.7 | GO:0072069 | DCT cell differentiation(GO:0072069) metanephric DCT cell differentiation(GO:0072240) |
| 0.7 | 1.4 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.7 | 0.7 | GO:0070673 | response to interleukin-18(GO:0070673) |
| 0.7 | 1.4 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
| 0.7 | 3.5 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
| 0.7 | 2.8 | GO:0021938 | ventral midline development(GO:0007418) smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) notochord regression(GO:0060032) |
| 0.7 | 6.2 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.7 | 5.5 | GO:0089712 | L-aspartate transport(GO:0070778) L-aspartate transmembrane transport(GO:0089712) |
| 0.7 | 2.1 | GO:0071109 | superior temporal gyrus development(GO:0071109) |
| 0.7 | 2.1 | GO:0021530 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 0.7 | 2.1 | GO:0009443 | pyridoxal 5'-phosphate salvage(GO:0009443) |
| 0.7 | 0.7 | GO:0007512 | adult heart development(GO:0007512) |
| 0.7 | 5.4 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.7 | 5.4 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.7 | 2.7 | GO:0009386 | translational attenuation(GO:0009386) |
| 0.7 | 2.7 | GO:0019072 | viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
| 0.7 | 0.7 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.7 | 8.0 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
| 0.7 | 2.0 | GO:0016999 | antibiotic metabolic process(GO:0016999) |
| 0.7 | 4.0 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.7 | 2.0 | GO:0036496 | regulation of translational initiation by eIF2 alpha dephosphorylation(GO:0036496) |
| 0.7 | 0.7 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
| 0.7 | 4.0 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.7 | 2.6 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
| 0.7 | 2.0 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.6 | 1.9 | GO:0038162 | erythropoietin-mediated signaling pathway(GO:0038162) |
| 0.6 | 3.2 | GO:1904640 | response to methionine(GO:1904640) |
| 0.6 | 3.9 | GO:0007506 | gonadal mesoderm development(GO:0007506) |
| 0.6 | 3.8 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
| 0.6 | 3.8 | GO:2000195 | negative regulation of female gonad development(GO:2000195) |
| 0.6 | 1.9 | GO:0051086 | chaperone mediated protein folding independent of cofactor(GO:0051086) |
| 0.6 | 0.6 | GO:0030575 | nuclear body organization(GO:0030575) |
| 0.6 | 1.9 | GO:0021718 | superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
| 0.6 | 12.7 | GO:0006559 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
| 0.6 | 4.5 | GO:2001034 | positive regulation of double-strand break repair via nonhomologous end joining(GO:2001034) |
| 0.6 | 1.3 | GO:2000705 | dense core granule biogenesis(GO:0061110) regulation of dense core granule biogenesis(GO:2000705) |
| 0.6 | 4.4 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
| 0.6 | 1.9 | GO:0045994 | positive regulation of translational initiation by iron(GO:0045994) |
| 0.6 | 5.6 | GO:0097116 | gephyrin clustering involved in postsynaptic density assembly(GO:0097116) |
| 0.6 | 1.9 | GO:0048213 | Golgi vesicle prefusion complex stabilization(GO:0048213) |
| 0.6 | 2.5 | GO:0070845 | misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 0.6 | 1.8 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.6 | 2.5 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.6 | 1.8 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
| 0.6 | 0.6 | GO:0002720 | positive regulation of cytokine production involved in immune response(GO:0002720) |
| 0.6 | 3.6 | GO:0061034 | olfactory bulb mitral cell layer development(GO:0061034) |
| 0.6 | 1.8 | GO:0042816 | vitamin B6 metabolic process(GO:0042816) |
| 0.6 | 2.4 | GO:1903422 | negative regulation of synaptic vesicle recycling(GO:1903422) |
| 0.6 | 3.0 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
| 0.6 | 4.1 | GO:0014050 | negative regulation of glutamate secretion(GO:0014050) |
| 0.6 | 0.6 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 0.6 | 3.5 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
| 0.6 | 16.2 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
| 0.6 | 4.0 | GO:0002933 | lipid hydroxylation(GO:0002933) |
| 0.6 | 2.3 | GO:1902361 | mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
| 0.6 | 2.3 | GO:0045212 | negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 0.6 | 1.7 | GO:0035566 | regulation of metanephros size(GO:0035566) |
| 0.6 | 7.9 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.6 | 3.4 | GO:0009137 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
| 0.6 | 2.2 | GO:1904481 | response to tetrahydrofolate(GO:1904481) cellular response to tetrahydrofolate(GO:1904482) |
| 0.6 | 6.7 | GO:0060180 | female mating behavior(GO:0060180) |
| 0.6 | 3.9 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
| 0.6 | 8.9 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.6 | 1.1 | GO:1902850 | mitotic spindle assembly(GO:0090307) microtubule cytoskeleton organization involved in mitosis(GO:1902850) |
| 0.6 | 1.1 | GO:0042450 | arginine biosynthetic process via ornithine(GO:0042450) |
| 0.6 | 2.2 | GO:0036228 | protein targeting to nuclear inner membrane(GO:0036228) |
| 0.6 | 1.7 | GO:0035604 | fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) |
| 0.6 | 2.2 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
| 0.6 | 2.2 | GO:0032416 | negative regulation of sodium:proton antiporter activity(GO:0032416) |
| 0.6 | 3.3 | GO:0033489 | cholesterol biosynthetic process via desmosterol(GO:0033489) cholesterol biosynthetic process via lathosterol(GO:0033490) |
| 0.5 | 2.2 | GO:0035521 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
| 0.5 | 2.7 | GO:0060292 | long term synaptic depression(GO:0060292) |
| 0.5 | 2.7 | GO:0030070 | insulin processing(GO:0030070) |
| 0.5 | 2.7 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
| 0.5 | 0.5 | GO:0090212 | regulation of establishment of blood-brain barrier(GO:0090210) negative regulation of establishment of blood-brain barrier(GO:0090212) |
| 0.5 | 9.1 | GO:0003351 | epithelial cilium movement(GO:0003351) |
| 0.5 | 1.6 | GO:0070781 | response to biotin(GO:0070781) |
| 0.5 | 0.5 | GO:1900449 | regulation of glutamate receptor signaling pathway(GO:1900449) |
| 0.5 | 2.7 | GO:0044208 | 'de novo' AMP biosynthetic process(GO:0044208) |
| 0.5 | 0.5 | GO:0042822 | pyridoxal phosphate metabolic process(GO:0042822) |
| 0.5 | 2.1 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 0.5 | 1.6 | GO:0007497 | posterior midgut development(GO:0007497) |
| 0.5 | 1.6 | GO:0040040 | thermosensory behavior(GO:0040040) |
| 0.5 | 2.6 | GO:0015810 | aspartate transport(GO:0015810) |
| 0.5 | 1.6 | GO:1902595 | regulation of DNA replication origin binding(GO:1902595) |
| 0.5 | 1.6 | GO:0006267 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 0.5 | 0.5 | GO:2000380 | regulation of mesoderm development(GO:2000380) |
| 0.5 | 15.2 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.5 | 1.0 | GO:0010259 | multicellular organism aging(GO:0010259) |
| 0.5 | 1.0 | GO:0033594 | response to hydroxyisoflavone(GO:0033594) |
| 0.5 | 3.1 | GO:0061143 | alveolar primary septum development(GO:0061143) |
| 0.5 | 0.5 | GO:0072221 | distal convoluted tubule development(GO:0072025) metanephric distal convoluted tubule development(GO:0072221) |
| 0.5 | 0.5 | GO:0006668 | sphinganine-1-phosphate metabolic process(GO:0006668) |
| 0.5 | 2.0 | GO:2000611 | positive regulation of thyroid hormone generation(GO:2000611) |
| 0.5 | 9.7 | GO:0021930 | cell proliferation in external granule layer(GO:0021924) cerebellar granule cell precursor proliferation(GO:0021930) |
| 0.5 | 2.0 | GO:0031054 | pre-miRNA processing(GO:0031054) |
| 0.5 | 2.0 | GO:0036292 | DNA rewinding(GO:0036292) |
| 0.5 | 1.0 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.5 | 2.5 | GO:1905247 | positive regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902961) positive regulation of aspartic-type peptidase activity(GO:1905247) |
| 0.5 | 17.9 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
| 0.5 | 0.5 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.5 | 0.5 | GO:0019230 | proprioception(GO:0019230) |
| 0.5 | 2.0 | GO:0044537 | regulation of circulating fibrinogen levels(GO:0044537) |
| 0.5 | 2.0 | GO:0019860 | uracil metabolic process(GO:0019860) |
| 0.5 | 1.5 | GO:0002372 | myeloid dendritic cell cytokine production(GO:0002372) |
| 0.5 | 2.5 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
| 0.5 | 1.5 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.5 | 0.5 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
| 0.5 | 3.3 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.5 | 1.9 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
| 0.5 | 2.8 | GO:0021993 | initiation of neural tube closure(GO:0021993) |
| 0.5 | 2.4 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.5 | 3.3 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.5 | 3.3 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.5 | 6.1 | GO:2000664 | positive regulation of interleukin-5 secretion(GO:2000664) |
| 0.5 | 0.9 | GO:0035990 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
| 0.5 | 2.3 | GO:1901091 | regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
| 0.5 | 3.3 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.5 | 0.5 | GO:0021896 | forebrain astrocyte differentiation(GO:0021896) forebrain astrocyte development(GO:0021897) |
| 0.5 | 1.4 | GO:0098727 | maintenance of cell number(GO:0098727) |
| 0.5 | 5.6 | GO:0034625 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.5 | 2.8 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.5 | 0.5 | GO:1904393 | regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) negative regulation of neuromuscular junction development(GO:1904397) |
| 0.5 | 0.5 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 0.5 | 3.2 | GO:0032185 | septin cytoskeleton organization(GO:0032185) |
| 0.5 | 1.4 | GO:0051389 | inactivation of MAPKK activity(GO:0051389) |
| 0.5 | 1.8 | GO:0042351 | 'de novo' GDP-L-fucose biosynthetic process(GO:0042351) |
| 0.5 | 2.7 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) |
| 0.4 | 0.4 | GO:0034433 | steroid esterification(GO:0034433) sterol esterification(GO:0034434) cholesterol esterification(GO:0034435) |
| 0.4 | 0.9 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
| 0.4 | 1.3 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 0.4 | 1.3 | GO:0006173 | dADP biosynthetic process(GO:0006173) |
| 0.4 | 0.9 | GO:0018352 | protein-pyridoxal-5-phosphate linkage(GO:0018352) |
| 0.4 | 0.4 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.4 | 1.8 | GO:0097350 | neutrophil clearance(GO:0097350) |
| 0.4 | 2.6 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
| 0.4 | 1.7 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
| 0.4 | 1.7 | GO:0098838 | reduced folate transmembrane transport(GO:0098838) |
| 0.4 | 9.1 | GO:0016540 | protein autoprocessing(GO:0016540) |
| 0.4 | 5.2 | GO:0021759 | globus pallidus development(GO:0021759) |
| 0.4 | 4.8 | GO:0060992 | response to fungicide(GO:0060992) |
| 0.4 | 9.5 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
| 0.4 | 4.3 | GO:0060013 | righting reflex(GO:0060013) |
| 0.4 | 2.6 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) |
| 0.4 | 1.3 | GO:0015882 | L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
| 0.4 | 2.6 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.4 | 1.3 | GO:0006478 | peptidyl-tyrosine sulfation(GO:0006478) |
| 0.4 | 0.4 | GO:0042446 | hormone biosynthetic process(GO:0042446) |
| 0.4 | 0.4 | GO:0043616 | keratinocyte proliferation(GO:0043616) |
| 0.4 | 1.7 | GO:0023021 | termination of signal transduction(GO:0023021) |
| 0.4 | 3.4 | GO:1902998 | regulation of neuronal signal transduction(GO:1902847) positive regulation of neurofibrillary tangle assembly(GO:1902998) |
| 0.4 | 0.8 | GO:0015670 | carbon dioxide transport(GO:0015670) |
| 0.4 | 2.5 | GO:0009212 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) |
| 0.4 | 1.7 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.4 | 1.6 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.4 | 8.6 | GO:0000076 | DNA replication checkpoint(GO:0000076) |
| 0.4 | 2.5 | GO:0009635 | response to herbicide(GO:0009635) |
| 0.4 | 0.8 | GO:1990426 | homologous recombination-dependent replication fork processing(GO:1990426) |
| 0.4 | 1.2 | GO:0042938 | dipeptide transport(GO:0042938) |
| 0.4 | 1.2 | GO:0090675 | intermicrovillar adhesion(GO:0090675) |
| 0.4 | 11.8 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
| 0.4 | 1.2 | GO:0003365 | establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
| 0.4 | 1.6 | GO:1903281 | positive regulation of calcium:sodium antiporter activity(GO:1903281) |
| 0.4 | 2.0 | GO:0045915 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
| 0.4 | 1.6 | GO:1903691 | positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
| 0.4 | 2.0 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
| 0.4 | 2.0 | GO:0002415 | immunoglobulin transcytosis in epithelial cells mediated by polymeric immunoglobulin receptor(GO:0002415) |
| 0.4 | 1.6 | GO:0090487 | toxin catabolic process(GO:0009407) secondary metabolite catabolic process(GO:0090487) |
| 0.4 | 1.6 | GO:0031455 | glycine betaine biosynthetic process from choline(GO:0019285) glycine betaine metabolic process(GO:0031455) glycine betaine biosynthetic process(GO:0031456) |
| 0.4 | 1.2 | GO:0007352 | zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.4 | 0.4 | GO:0018023 | peptidyl-lysine trimethylation(GO:0018023) |
| 0.4 | 4.7 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.4 | 3.5 | GO:1904779 | regulation of protein localization to centrosome(GO:1904779) |
| 0.4 | 1.2 | GO:0006311 | meiotic gene conversion(GO:0006311) |
| 0.4 | 1.2 | GO:0043634 | polyadenylation-dependent ncRNA catabolic process(GO:0043634) |
| 0.4 | 1.2 | GO:0035623 | renal glucose absorption(GO:0035623) |
| 0.4 | 1.9 | GO:1905225 | response to thyrotropin-releasing hormone(GO:1905225) |
| 0.4 | 4.2 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.4 | 1.5 | GO:0019520 | aldonic acid metabolic process(GO:0019520) D-gluconate metabolic process(GO:0019521) |
| 0.4 | 1.1 | GO:0015920 | lipopolysaccharide transport(GO:0015920) |
| 0.4 | 1.5 | GO:0021551 | central nervous system morphogenesis(GO:0021551) |
| 0.4 | 0.4 | GO:0060738 | epithelial-mesenchymal signaling involved in prostate gland development(GO:0060738) |
| 0.4 | 1.1 | GO:0006097 | glyoxylate cycle(GO:0006097) |
| 0.4 | 2.7 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
| 0.4 | 0.4 | GO:0046174 | polyol catabolic process(GO:0046174) |
| 0.4 | 0.8 | GO:0070092 | regulation of glucagon secretion(GO:0070092) |
| 0.4 | 0.4 | GO:1903659 | complement-dependent cytotoxicity(GO:0097278) regulation of complement-dependent cytotoxicity(GO:1903659) |
| 0.4 | 0.4 | GO:0051066 | dihydrobiopterin metabolic process(GO:0051066) |
| 0.4 | 1.5 | GO:0035574 | histone H4-K20 demethylation(GO:0035574) |
| 0.4 | 1.1 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.4 | 1.5 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.4 | 1.8 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
| 0.4 | 2.6 | GO:0002034 | regulation of blood vessel size by renin-angiotensin(GO:0002034) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) |
| 0.4 | 1.1 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.4 | 1.8 | GO:0030573 | bile acid catabolic process(GO:0030573) |
| 0.4 | 1.8 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) |
| 0.4 | 19.6 | GO:0007340 | acrosome reaction(GO:0007340) |
| 0.4 | 0.7 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
| 0.4 | 1.4 | GO:1904031 | positive regulation of cyclin-dependent protein kinase activity(GO:1904031) |
| 0.4 | 3.6 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.4 | 3.2 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
| 0.4 | 2.1 | GO:0021819 | layer formation in cerebral cortex(GO:0021819) |
| 0.4 | 3.5 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
| 0.4 | 2.5 | GO:0006772 | thiamine metabolic process(GO:0006772) |
| 0.4 | 1.1 | GO:0002347 | response to tumor cell(GO:0002347) |
| 0.4 | 8.8 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.4 | 0.7 | GO:0051792 | medium-chain fatty acid biosynthetic process(GO:0051792) |
| 0.4 | 1.1 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 0.4 | 1.1 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.3 | 0.7 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.3 | 0.7 | GO:0044205 | 'de novo' UMP biosynthetic process(GO:0044205) |
| 0.3 | 10.0 | GO:0050908 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.3 | 9.3 | GO:0007141 | male meiosis I(GO:0007141) |
| 0.3 | 1.7 | GO:0009107 | lipoate biosynthetic process(GO:0009107) |
| 0.3 | 2.1 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
| 0.3 | 2.4 | GO:0045819 | positive regulation of glycogen catabolic process(GO:0045819) |
| 0.3 | 5.8 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.3 | 1.7 | GO:0044752 | response to human chorionic gonadotropin(GO:0044752) |
| 0.3 | 10.2 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.3 | 4.1 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.3 | 0.3 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.3 | 3.4 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.3 | 2.7 | GO:0044334 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) canonical Wnt signaling pathway involved in positive regulation of epithelial to mesenchymal transition(GO:0044334) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.3 | 1.7 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.3 | 1.3 | GO:0045013 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 0.3 | 1.7 | GO:0045607 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.3 | 1.0 | GO:0014908 | myotube differentiation involved in skeletal muscle regeneration(GO:0014908) |
| 0.3 | 0.3 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.3 | 2.7 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.3 | 2.7 | GO:1902856 | negative regulation of nonmotile primary cilium assembly(GO:1902856) |
| 0.3 | 1.3 | GO:0010873 | positive regulation of cholesterol esterification(GO:0010873) |
| 0.3 | 1.3 | GO:0045872 | positive regulation of rhodopsin gene expression(GO:0045872) |
| 0.3 | 0.3 | GO:0072301 | regulation of metanephric glomerular mesangial cell proliferation(GO:0072301) |
| 0.3 | 4.0 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
| 0.3 | 1.0 | GO:0033058 | directional locomotion(GO:0033058) |
| 0.3 | 15.7 | GO:1903861 | positive regulation of dendrite extension(GO:1903861) |
| 0.3 | 0.3 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
| 0.3 | 0.3 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
| 0.3 | 2.0 | GO:0051944 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.3 | 6.5 | GO:0035020 | regulation of Rac protein signal transduction(GO:0035020) |
| 0.3 | 1.3 | GO:0021978 | telencephalon regionalization(GO:0021978) |
| 0.3 | 0.6 | GO:0071400 | cellular response to oleic acid(GO:0071400) |
| 0.3 | 2.3 | GO:0097056 | selenocysteinyl-tRNA(Sec) biosynthetic process(GO:0097056) |
| 0.3 | 1.6 | GO:0070253 | somatostatin secretion(GO:0070253) |
| 0.3 | 0.3 | GO:0035803 | egg coat formation(GO:0035803) |
| 0.3 | 5.5 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.3 | 1.9 | GO:0032098 | regulation of appetite(GO:0032098) |
| 0.3 | 4.5 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.3 | 1.6 | GO:0009113 | purine nucleobase biosynthetic process(GO:0009113) |
| 0.3 | 0.3 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
| 0.3 | 3.5 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.3 | 0.6 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
| 0.3 | 1.6 | GO:0034224 | cellular response to zinc ion starvation(GO:0034224) |
| 0.3 | 1.6 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.3 | 0.6 | GO:0002681 | somatic diversification of T cell receptor genes(GO:0002568) somatic recombination of T cell receptor gene segments(GO:0002681) T cell receptor V(D)J recombination(GO:0033153) |
| 0.3 | 0.9 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
| 0.3 | 4.1 | GO:0061088 | regulation of sequestering of zinc ion(GO:0061088) |
| 0.3 | 0.9 | GO:0033319 | UDP-D-xylose metabolic process(GO:0033319) UDP-D-xylose biosynthetic process(GO:0033320) |
| 0.3 | 0.3 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) protein K27-linked deubiquitination(GO:1990167) |
| 0.3 | 0.3 | GO:0042148 | strand invasion(GO:0042148) |
| 0.3 | 0.9 | GO:0071922 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.3 | 1.6 | GO:0050893 | sensory processing(GO:0050893) |
| 0.3 | 2.8 | GO:0045329 | carnitine biosynthetic process(GO:0045329) |
| 0.3 | 2.2 | GO:0015798 | myo-inositol transport(GO:0015798) |
| 0.3 | 1.2 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.3 | 0.6 | GO:0018312 | peptidyl-serine ADP-ribosylation(GO:0018312) |
| 0.3 | 1.2 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.3 | 0.3 | GO:0006565 | L-serine catabolic process(GO:0006565) |
| 0.3 | 1.5 | GO:0070858 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.3 | 0.6 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.3 | 6.1 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
| 0.3 | 0.3 | GO:0060516 | primary prostatic bud elongation(GO:0060516) |
| 0.3 | 0.3 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
| 0.3 | 0.9 | GO:0070105 | positive regulation of interleukin-6-mediated signaling pathway(GO:0070105) |
| 0.3 | 4.0 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.3 | 4.3 | GO:0071941 | nitrogen cycle metabolic process(GO:0071941) |
| 0.3 | 3.4 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.3 | 0.3 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.3 | 4.9 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.3 | 2.4 | GO:0019236 | response to pheromone(GO:0019236) |
| 0.3 | 0.3 | GO:0046356 | acetyl-CoA catabolic process(GO:0046356) |
| 0.3 | 0.9 | GO:0045829 | negative regulation of isotype switching(GO:0045829) |
| 0.3 | 2.4 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.3 | 1.8 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.3 | 0.9 | GO:0036446 | myofibroblast differentiation(GO:0036446) regulation of myofibroblast differentiation(GO:1904760) negative regulation of myofibroblast differentiation(GO:1904761) |
| 0.3 | 2.4 | GO:0033152 | immunoglobulin V(D)J recombination(GO:0033152) |
| 0.3 | 0.6 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
| 0.3 | 4.5 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
| 0.3 | 1.5 | GO:0072526 | pyridine-containing compound catabolic process(GO:0072526) |
| 0.3 | 1.2 | GO:1990502 | dense core granule maturation(GO:1990502) |
| 0.3 | 0.9 | GO:0038163 | thrombopoietin-mediated signaling pathway(GO:0038163) |
| 0.3 | 0.9 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
| 0.3 | 1.2 | GO:0050993 | dimethylallyl diphosphate biosynthetic process(GO:0050992) dimethylallyl diphosphate metabolic process(GO:0050993) |
| 0.3 | 2.9 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
| 0.3 | 0.6 | GO:0000915 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 0.3 | 0.3 | GO:0032425 | positive regulation of mismatch repair(GO:0032425) |
| 0.3 | 0.3 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.3 | 1.5 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.3 | 0.3 | GO:0016078 | tRNA catabolic process(GO:0016078) |
| 0.3 | 0.9 | GO:1904954 | canonical Wnt signaling pathway involved in midbrain dopaminergic neuron differentiation(GO:1904954) |
| 0.3 | 0.6 | GO:0035963 | cellular response to interleukin-13(GO:0035963) |
| 0.3 | 0.9 | GO:0046022 | positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
| 0.3 | 1.2 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.3 | 0.9 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
| 0.3 | 2.3 | GO:0003322 | pancreatic A cell development(GO:0003322) |
| 0.3 | 2.0 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.3 | 1.1 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.3 | 0.3 | GO:0060042 | retina morphogenesis in camera-type eye(GO:0060042) |
| 0.3 | 0.9 | GO:0050955 | thermoception(GO:0050955) |
| 0.3 | 0.9 | GO:0071163 | DNA replication preinitiation complex assembly(GO:0071163) |
| 0.3 | 1.1 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
| 0.3 | 4.8 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.3 | 1.4 | GO:0072709 | cellular response to sorbitol(GO:0072709) |
| 0.3 | 2.3 | GO:0003340 | negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) |
| 0.3 | 0.8 | GO:1903251 | multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.3 | 2.5 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
| 0.3 | 2.0 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
| 0.3 | 3.1 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.3 | 1.9 | GO:1902022 | lysine transport(GO:0015819) L-lysine transport(GO:1902022) L-lysine transmembrane transport(GO:1903401) |
| 0.3 | 1.7 | GO:1900147 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
| 0.3 | 1.4 | GO:0019303 | D-ribose catabolic process(GO:0019303) |
| 0.3 | 3.9 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.3 | 4.4 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
| 0.3 | 0.3 | GO:1901994 | negative regulation of meiotic cell cycle phase transition(GO:1901994) |
| 0.3 | 0.8 | GO:0035283 | rhombomere 5 development(GO:0021571) central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| 0.3 | 1.9 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.3 | 0.8 | GO:1990481 | mRNA pseudouridine synthesis(GO:1990481) |
| 0.3 | 0.5 | GO:0032915 | positive regulation of transforming growth factor beta2 production(GO:0032915) |
| 0.3 | 1.9 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
| 0.3 | 1.6 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.3 | 7.8 | GO:0036315 | cellular response to sterol(GO:0036315) |
| 0.3 | 0.3 | GO:0035995 | detection of muscle stretch(GO:0035995) |
| 0.3 | 1.3 | GO:0002528 | regulation of vascular permeability involved in acute inflammatory response(GO:0002528) |
| 0.3 | 0.8 | GO:1903926 | signal transduction involved in intra-S DNA damage checkpoint(GO:0072428) negative regulation of mitotic cell cycle DNA replication(GO:1903464) response to bisphenol A(GO:1903925) cellular response to bisphenol A(GO:1903926) |
| 0.3 | 1.3 | GO:1902019 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
| 0.3 | 0.8 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
| 0.3 | 0.8 | GO:0038007 | netrin-activated signaling pathway(GO:0038007) |
| 0.3 | 4.2 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.3 | 1.0 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
| 0.3 | 3.4 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.3 | 2.6 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.3 | 1.6 | GO:0030860 | regulation of polarized epithelial cell differentiation(GO:0030860) |
| 0.3 | 1.0 | GO:0071469 | sensory perception of touch(GO:0050975) detection of mechanical stimulus involved in sensory perception of touch(GO:0050976) cellular response to alkaline pH(GO:0071469) |
| 0.3 | 0.8 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) regulation of kinetochore assembly(GO:0090234) |
| 0.3 | 0.3 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
| 0.3 | 2.1 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.3 | 1.3 | GO:0051029 | rRNA transport(GO:0051029) |
| 0.3 | 0.3 | GO:1904751 | positive regulation of protein localization to nucleolus(GO:1904751) |
| 0.3 | 1.3 | GO:0061015 | snRNA import into nucleus(GO:0061015) |
| 0.3 | 5.9 | GO:0033540 | fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
| 0.3 | 0.3 | GO:0061366 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
| 0.3 | 2.8 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.3 | 2.3 | GO:0051552 | flavone metabolic process(GO:0051552) |
| 0.3 | 2.5 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.3 | 4.5 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.3 | 1.8 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
| 0.3 | 1.5 | GO:0048630 | skeletal muscle tissue growth(GO:0048630) |
| 0.2 | 0.2 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
| 0.2 | 0.5 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
| 0.2 | 0.5 | GO:0048203 | vesicle targeting, trans-Golgi to endosome(GO:0048203) |
| 0.2 | 0.2 | GO:0021511 | spinal cord patterning(GO:0021511) |
| 0.2 | 0.5 | GO:1903438 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 0.2 | 2.5 | GO:0010182 | hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
| 0.2 | 2.2 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.2 | 2.2 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) |
| 0.2 | 0.7 | GO:0043000 | Golgi to plasma membrane CFTR protein transport(GO:0043000) |
| 0.2 | 2.7 | GO:0060746 | maternal behavior(GO:0042711) parental behavior(GO:0060746) |
| 0.2 | 0.7 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
| 0.2 | 1.2 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.2 | 0.2 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
| 0.2 | 0.7 | GO:0019858 | cytosine metabolic process(GO:0019858) |
| 0.2 | 9.1 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
| 0.2 | 0.7 | GO:0033385 | geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
| 0.2 | 0.2 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
| 0.2 | 0.5 | GO:2001183 | negative regulation of interleukin-12 secretion(GO:2001183) |
| 0.2 | 1.7 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.2 | 1.2 | GO:0016240 | autophagosome docking(GO:0016240) |
| 0.2 | 1.7 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.2 | 1.0 | GO:0046021 | negative regulation of transcription during mitosis(GO:0007068) negative regulation of transcription from RNA polymerase II promoter during mitosis(GO:0007070) regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) |
| 0.2 | 17.2 | GO:0050885 | neuromuscular process controlling balance(GO:0050885) |
| 0.2 | 2.4 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.2 | 0.5 | GO:0033182 | regulation of histone ubiquitination(GO:0033182) |
| 0.2 | 0.5 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
| 0.2 | 1.2 | GO:0009133 | nucleoside diphosphate biosynthetic process(GO:0009133) |
| 0.2 | 1.2 | GO:2000543 | positive regulation of gastrulation(GO:2000543) |
| 0.2 | 0.2 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.2 | 0.2 | GO:0072003 | kidney rudiment formation(GO:0072003) |
| 0.2 | 1.0 | GO:0006272 | leading strand elongation(GO:0006272) |
| 0.2 | 1.0 | GO:0042853 | L-alanine metabolic process(GO:0042851) L-alanine catabolic process(GO:0042853) |
| 0.2 | 6.0 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.2 | 1.0 | GO:0048690 | modulation by virus of host transcription(GO:0019056) regulation of sprouting of injured axon(GO:0048686) positive regulation of sprouting of injured axon(GO:0048687) regulation of axon extension involved in regeneration(GO:0048690) positive regulation of axon extension involved in regeneration(GO:0048691) modulation by symbiont of host transcription(GO:0052026) |
| 0.2 | 2.4 | GO:0007617 | mating behavior(GO:0007617) multi-organism reproductive behavior(GO:0044705) |
| 0.2 | 0.5 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.2 | 0.7 | GO:0007509 | mesoderm migration involved in gastrulation(GO:0007509) |
| 0.2 | 3.5 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.2 | 1.6 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.2 | 2.3 | GO:0033183 | negative regulation of histone ubiquitination(GO:0033183) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) |
| 0.2 | 1.9 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.2 | 0.9 | GO:1903412 | response to bile acid(GO:1903412) |
| 0.2 | 0.7 | GO:0016572 | histone phosphorylation(GO:0016572) |
| 0.2 | 0.5 | GO:0090135 | actin filament branching(GO:0090135) |
| 0.2 | 1.2 | GO:0043686 | co-translational protein modification(GO:0043686) |
| 0.2 | 0.7 | GO:0035750 | protein localization to myelin sheath abaxonal region(GO:0035750) |
| 0.2 | 1.8 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.2 | 3.4 | GO:0045475 | locomotor rhythm(GO:0045475) |
| 0.2 | 2.3 | GO:0006415 | translational termination(GO:0006415) |
| 0.2 | 0.7 | GO:0034970 | histone H3-R2 methylation(GO:0034970) |
| 0.2 | 1.1 | GO:0007056 | spindle assembly involved in female meiosis(GO:0007056) |
| 0.2 | 2.7 | GO:0044849 | estrous cycle(GO:0044849) |
| 0.2 | 1.1 | GO:0043335 | protein unfolding(GO:0043335) |
| 0.2 | 0.7 | GO:0042178 | xenobiotic catabolic process(GO:0042178) |
| 0.2 | 12.5 | GO:0035036 | sperm-egg recognition(GO:0035036) |
| 0.2 | 1.4 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.2 | 1.8 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
| 0.2 | 0.5 | GO:0031247 | actin rod assembly(GO:0031247) |
| 0.2 | 0.2 | GO:0000706 | meiotic DNA double-strand break processing(GO:0000706) |
| 0.2 | 2.0 | GO:1990034 | calcium ion export from cell(GO:1990034) |
| 0.2 | 0.2 | GO:0034447 | very-low-density lipoprotein particle clearance(GO:0034447) |
| 0.2 | 0.7 | GO:0060382 | regulation of DNA strand elongation(GO:0060382) |
| 0.2 | 8.9 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
| 0.2 | 0.7 | GO:0071848 | regulation of fever generation by regulation of prostaglandin secretion(GO:0071810) positive regulation of fever generation by positive regulation of prostaglandin secretion(GO:0071812) positive regulation of ERK1 and ERK2 cascade via TNFSF11-mediated signaling(GO:0071848) regulation of fever generation by prostaglandin secretion(GO:0100009) |
| 0.2 | 0.4 | GO:1900027 | regulation of ruffle assembly(GO:1900027) |
| 0.2 | 4.2 | GO:0038203 | TORC2 signaling(GO:0038203) |
| 0.2 | 0.9 | GO:0071393 | cellular response to progesterone stimulus(GO:0071393) |
| 0.2 | 1.1 | GO:0008628 | hormone-mediated apoptotic signaling pathway(GO:0008628) |
| 0.2 | 0.7 | GO:1903568 | negative regulation of protein localization to cilium(GO:1903565) regulation of protein localization to ciliary membrane(GO:1903567) negative regulation of protein localization to ciliary membrane(GO:1903568) |
| 0.2 | 0.7 | GO:0044727 | DNA demethylation of male pronucleus(GO:0044727) |
| 0.2 | 2.6 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.2 | 0.4 | GO:0042940 | D-amino acid transport(GO:0042940) |
| 0.2 | 1.1 | GO:0097484 | dendrite extension(GO:0097484) |
| 0.2 | 0.4 | GO:0072134 | nephrogenic mesenchyme morphogenesis(GO:0072134) kidney mesenchymal cell proliferation(GO:0072135) metanephric mesenchymal cell proliferation involved in metanephros development(GO:0072136) |
| 0.2 | 1.7 | GO:0006591 | ornithine metabolic process(GO:0006591) |
| 0.2 | 1.3 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
| 0.2 | 0.6 | GO:0019516 | lactate oxidation(GO:0019516) |
| 0.2 | 1.3 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.2 | 2.2 | GO:0051382 | kinetochore assembly(GO:0051382) |
| 0.2 | 1.9 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.2 | 0.2 | GO:2000819 | regulation of nucleotide-excision repair(GO:2000819) |
| 0.2 | 0.2 | GO:2000182 | regulation of progesterone biosynthetic process(GO:2000182) |
| 0.2 | 2.4 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.2 | 1.1 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
| 0.2 | 1.3 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
| 0.2 | 0.9 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
| 0.2 | 1.1 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
| 0.2 | 0.9 | GO:0006657 | CDP-choline pathway(GO:0006657) |
| 0.2 | 0.9 | GO:1904398 | positive regulation of neuromuscular junction development(GO:1904398) |
| 0.2 | 0.2 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.2 | 0.4 | GO:1900045 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.2 | 0.9 | GO:0071663 | granzyme B production(GO:0071613) regulation of granzyme B production(GO:0071661) positive regulation of granzyme B production(GO:0071663) |
| 0.2 | 0.8 | GO:0019471 | 4-hydroxyproline metabolic process(GO:0019471) |
| 0.2 | 0.8 | GO:0005986 | sucrose biosynthetic process(GO:0005986) |
| 0.2 | 5.1 | GO:0051865 | protein autoubiquitination(GO:0051865) |
| 0.2 | 3.4 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.2 | 2.7 | GO:0036155 | acylglycerol acyl-chain remodeling(GO:0036155) |
| 0.2 | 1.2 | GO:0042256 | mature ribosome assembly(GO:0042256) |
| 0.2 | 0.6 | GO:1900369 | negative regulation of RNA interference(GO:1900369) |
| 0.2 | 1.2 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
| 0.2 | 2.5 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
| 0.2 | 0.2 | GO:0045136 | development of secondary sexual characteristics(GO:0045136) development of secondary female sexual characteristics(GO:0046543) |
| 0.2 | 0.6 | GO:0097112 | molybdenum incorporation into molybdenum-molybdopterin complex(GO:0018315) metal incorporation into metallo-molybdopterin complex(GO:0042040) glycine receptor clustering(GO:0072579) gamma-aminobutyric acid receptor clustering(GO:0097112) |
| 0.2 | 1.0 | GO:0033274 | response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.2 | 1.4 | GO:0072520 | seminiferous tubule development(GO:0072520) |
| 0.2 | 0.4 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
| 0.2 | 0.8 | GO:1902908 | regulation of melanosome transport(GO:1902908) |
| 0.2 | 0.6 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.2 | 1.4 | GO:0031642 | negative regulation of myelination(GO:0031642) |
| 0.2 | 1.6 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
| 0.2 | 1.8 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.2 | 0.8 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) |
| 0.2 | 1.0 | GO:0036079 | GDP-fucose transport(GO:0015783) purine nucleotide-sugar transport(GO:0036079) |
| 0.2 | 2.2 | GO:0032782 | bile acid secretion(GO:0032782) |
| 0.2 | 1.4 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.2 | 1.6 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.2 | 0.6 | GO:0002663 | B cell tolerance induction(GO:0002514) regulation of B cell tolerance induction(GO:0002661) positive regulation of B cell tolerance induction(GO:0002663) |
| 0.2 | 0.8 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.2 | 1.8 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.2 | 0.6 | GO:1904562 | phosphatidylinositol 5-phosphate metabolic process(GO:1904562) |
| 0.2 | 0.6 | GO:1903348 | positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.2 | 1.6 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.2 | 1.0 | GO:0007635 | chemosensory behavior(GO:0007635) |
| 0.2 | 1.2 | GO:0060157 | urinary bladder development(GO:0060157) |
| 0.2 | 0.4 | GO:0014859 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.2 | 4.5 | GO:0045199 | maintenance of apical/basal cell polarity(GO:0035090) maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.2 | 0.4 | GO:0000961 | negative regulation of mitochondrial RNA catabolic process(GO:0000961) |
| 0.2 | 0.4 | GO:0055009 | atrial cardiac muscle tissue development(GO:0003228) atrial cardiac muscle tissue morphogenesis(GO:0055009) |
| 0.2 | 1.7 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
| 0.2 | 0.6 | GO:0030505 | inorganic diphosphate transport(GO:0030505) |
| 0.2 | 1.0 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) positive regulation of natural killer cell degranulation(GO:0043323) |
| 0.2 | 0.8 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
| 0.2 | 0.6 | GO:2000588 | positive regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000588) |
| 0.2 | 0.2 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.2 | 0.4 | GO:0007231 | osmosensory signaling pathway(GO:0007231) |
| 0.2 | 0.8 | GO:0060151 | peroxisome localization(GO:0060151) microtubule-based peroxisome localization(GO:0060152) |
| 0.2 | 10.7 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.2 | 0.8 | GO:0035616 | histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.2 | 1.1 | GO:0006188 | IMP biosynthetic process(GO:0006188) |
| 0.2 | 0.6 | GO:0042727 | flavin-containing compound biosynthetic process(GO:0042727) |
| 0.2 | 0.6 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.2 | 1.3 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.2 | 0.8 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
| 0.2 | 0.8 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.2 | 1.5 | GO:0000730 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.2 | 0.8 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
| 0.2 | 0.4 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.2 | 1.9 | GO:0018103 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.2 | 0.9 | GO:2000313 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
| 0.2 | 5.2 | GO:0007080 | mitotic metaphase plate congression(GO:0007080) |
| 0.2 | 1.1 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
| 0.2 | 0.4 | GO:0031204 | posttranslational protein targeting to membrane, translocation(GO:0031204) |
| 0.2 | 0.4 | GO:0060214 | endocardium formation(GO:0060214) |
| 0.2 | 0.7 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.2 | 0.4 | GO:0097187 | dentinogenesis(GO:0097187) |
| 0.2 | 1.3 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.2 | 0.6 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
| 0.2 | 1.3 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
| 0.2 | 0.4 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
| 0.2 | 2.0 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.2 | 8.2 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.2 | 2.0 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.2 | 0.5 | GO:0034471 | endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
| 0.2 | 2.2 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
| 0.2 | 1.6 | GO:0021521 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 0.2 | 2.0 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.2 | 1.3 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.2 | 0.7 | GO:0034343 | type III interferon production(GO:0034343) regulation of type III interferon production(GO:0034344) |
| 0.2 | 0.9 | GO:0051595 | response to methylglyoxal(GO:0051595) negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 0.2 | 0.9 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
| 0.2 | 1.6 | GO:0051415 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.2 | 1.4 | GO:0007625 | grooming behavior(GO:0007625) |
| 0.2 | 0.7 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 0.2 | 3.6 | GO:0060736 | prostate gland growth(GO:0060736) |
| 0.2 | 1.1 | GO:0018022 | peptidyl-lysine methylation(GO:0018022) |
| 0.2 | 0.4 | GO:0006447 | regulation of translational initiation by iron(GO:0006447) |
| 0.2 | 1.8 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.2 | 0.7 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
| 0.2 | 1.2 | GO:1902896 | terminal web assembly(GO:1902896) |
| 0.2 | 0.7 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
| 0.2 | 0.5 | GO:0010984 | regulation of lipoprotein particle clearance(GO:0010984) |
| 0.2 | 1.2 | GO:1900060 | negative regulation of sphingolipid biosynthetic process(GO:0090155) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.2 | 16.6 | GO:0018279 | protein N-linked glycosylation via asparagine(GO:0018279) |
| 0.2 | 0.2 | GO:1902914 | regulation of protein polyubiquitination(GO:1902914) positive regulation of protein polyubiquitination(GO:1902916) |
| 0.2 | 3.0 | GO:0097502 | mannosylation(GO:0097502) |
| 0.2 | 1.0 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.2 | 1.9 | GO:0034214 | protein hexamerization(GO:0034214) |
| 0.2 | 0.7 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.2 | 1.4 | GO:2001033 | negative regulation of double-strand break repair via nonhomologous end joining(GO:2001033) |
| 0.2 | 0.9 | GO:0044210 | 'de novo' CTP biosynthetic process(GO:0044210) |
| 0.2 | 1.0 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.2 | 0.2 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
| 0.2 | 10.2 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.2 | 0.2 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.2 | 2.6 | GO:0031297 | replication fork processing(GO:0031297) |
| 0.2 | 0.9 | GO:0001880 | Mullerian duct regression(GO:0001880) |
| 0.2 | 0.9 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.2 | 1.5 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.2 | 0.5 | GO:0019075 | virus maturation(GO:0019075) |
| 0.2 | 0.3 | GO:0044313 | protein K6-linked deubiquitination(GO:0044313) |
| 0.2 | 4.9 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.2 | 0.8 | GO:0003310 | pancreatic A cell differentiation(GO:0003310) |
| 0.2 | 1.7 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.2 | 2.0 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
| 0.2 | 0.2 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
| 0.2 | 1.7 | GO:0006489 | dolichyl diphosphate biosynthetic process(GO:0006489) dolichyl diphosphate metabolic process(GO:0046465) |
| 0.2 | 1.0 | GO:0002225 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antimicrobial humoral response(GO:0002760) positive regulation of antibacterial peptide production(GO:0002803) |
| 0.2 | 2.3 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
| 0.2 | 1.3 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.2 | 1.2 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
| 0.2 | 0.2 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
| 0.2 | 1.3 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
| 0.2 | 1.2 | GO:0006562 | proline catabolic process(GO:0006562) |
| 0.2 | 1.5 | GO:1903298 | regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) |
| 0.2 | 0.3 | GO:0042214 | terpene metabolic process(GO:0042214) |
| 0.2 | 1.3 | GO:1990416 | cellular response to brain-derived neurotrophic factor stimulus(GO:1990416) |
| 0.2 | 0.5 | GO:0002513 | tolerance induction to self antigen(GO:0002513) |
| 0.2 | 0.3 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
| 0.2 | 0.5 | GO:0006433 | prolyl-tRNA aminoacylation(GO:0006433) |
| 0.2 | 2.3 | GO:0030433 | ER-associated ubiquitin-dependent protein catabolic process(GO:0030433) |
| 0.2 | 0.2 | GO:0034378 | chylomicron assembly(GO:0034378) |
| 0.2 | 0.3 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.2 | 1.6 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.2 | 1.5 | GO:0023041 | neuronal signal transduction(GO:0023041) |
| 0.2 | 0.7 | GO:0000717 | nucleotide-excision repair, DNA duplex unwinding(GO:0000717) |
| 0.2 | 0.8 | GO:0060023 | soft palate development(GO:0060023) |
| 0.2 | 11.5 | GO:0051298 | centrosome duplication(GO:0051298) |
| 0.2 | 2.4 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 0.2 | 1.6 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.2 | 1.9 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) nucleoside bisphosphate biosynthetic process(GO:0033866) ribonucleoside bisphosphate biosynthetic process(GO:0034030) purine nucleoside bisphosphate biosynthetic process(GO:0034033) |
| 0.2 | 1.3 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.2 | 0.5 | GO:1904975 | response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
| 0.2 | 0.5 | GO:0021764 | amygdala development(GO:0021764) |
| 0.2 | 0.3 | GO:0006577 | amino-acid betaine metabolic process(GO:0006577) |
| 0.2 | 3.0 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.2 | 0.3 | GO:0006105 | succinate metabolic process(GO:0006105) |
| 0.2 | 1.4 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.2 | 2.2 | GO:0036109 | alpha-linolenic acid metabolic process(GO:0036109) |
| 0.2 | 8.2 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.2 | 0.6 | GO:0035544 | negative regulation of SNARE complex assembly(GO:0035544) |
| 0.2 | 0.9 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.2 | 2.0 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
| 0.2 | 0.2 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
| 0.2 | 2.0 | GO:0009750 | response to fructose(GO:0009750) |
| 0.2 | 5.2 | GO:0031018 | endocrine pancreas development(GO:0031018) |
| 0.2 | 0.5 | GO:0019695 | choline metabolic process(GO:0019695) |
| 0.2 | 0.3 | GO:0060139 | positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation of apoptotic process by virus(GO:0060139) |
| 0.2 | 0.3 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
| 0.2 | 1.1 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
| 0.2 | 0.8 | GO:0046108 | uridine metabolic process(GO:0046108) |
| 0.2 | 1.2 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
| 0.2 | 3.4 | GO:0043574 | peroxisomal transport(GO:0043574) |
| 0.2 | 2.3 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.2 | 0.3 | GO:1903979 | negative regulation of microglial cell activation(GO:1903979) |
| 0.2 | 0.6 | GO:0006788 | heme oxidation(GO:0006788) |
| 0.2 | 0.3 | GO:0072205 | metanephric collecting duct development(GO:0072205) |
| 0.2 | 0.3 | GO:0044331 | cell-cell adhesion mediated by cadherin(GO:0044331) |
| 0.2 | 1.4 | GO:0035494 | SNARE complex disassembly(GO:0035494) |
| 0.2 | 0.2 | GO:0060298 | positive regulation of sarcomere organization(GO:0060298) |
| 0.2 | 0.9 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.2 | 0.2 | GO:0018196 | peptidyl-asparagine modification(GO:0018196) |
| 0.2 | 2.3 | GO:1904380 | endoplasmic reticulum mannose trimming(GO:1904380) |
| 0.2 | 0.5 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
| 0.2 | 5.9 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.2 | 0.6 | GO:0052696 | flavonoid glucuronidation(GO:0052696) xenobiotic glucuronidation(GO:0052697) |
| 0.2 | 0.5 | GO:2000870 | regulation of progesterone secretion(GO:2000870) |
| 0.2 | 0.6 | GO:0010430 | fatty acid omega-oxidation(GO:0010430) |
| 0.2 | 1.7 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) |
| 0.2 | 0.2 | GO:0042398 | cellular modified amino acid biosynthetic process(GO:0042398) |
| 0.2 | 0.2 | GO:0099543 | retrograde trans-synaptic signaling by soluble gas(GO:0098923) trans-synaptic signaling by soluble gas(GO:0099543) |
| 0.2 | 0.8 | GO:1901419 | regulation of vitamin D receptor signaling pathway(GO:0070562) regulation of response to alcohol(GO:1901419) |
| 0.1 | 1.2 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) |
| 0.1 | 5.5 | GO:0032094 | response to food(GO:0032094) |
| 0.1 | 1.9 | GO:1901750 | leukotriene D4 metabolic process(GO:1901748) leukotriene D4 biosynthetic process(GO:1901750) |
| 0.1 | 7.8 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.1 | 2.3 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.1 | 0.7 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
| 0.1 | 0.7 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
| 0.1 | 0.3 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
| 0.1 | 0.6 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
| 0.1 | 1.0 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
| 0.1 | 0.1 | GO:0010911 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
| 0.1 | 1.0 | GO:0010310 | regulation of hydrogen peroxide metabolic process(GO:0010310) |
| 0.1 | 1.9 | GO:0002836 | positive regulation of response to tumor cell(GO:0002836) positive regulation of immune response to tumor cell(GO:0002839) |
| 0.1 | 1.7 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
| 0.1 | 0.4 | GO:0002881 | negative regulation of chronic inflammatory response to non-antigenic stimulus(GO:0002881) |
| 0.1 | 1.1 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.1 | 0.7 | GO:0000117 | regulation of transcription involved in G2/M transition of mitotic cell cycle(GO:0000117) |
| 0.1 | 1.3 | GO:0030242 | pexophagy(GO:0030242) |
| 0.1 | 0.4 | GO:1901253 | regulation of intracellular transport of viral material(GO:1901252) negative regulation of intracellular transport of viral material(GO:1901253) |
| 0.1 | 1.4 | GO:0009125 | nucleoside monophosphate catabolic process(GO:0009125) |
| 0.1 | 2.1 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
| 0.1 | 0.4 | GO:0006429 | leucyl-tRNA aminoacylation(GO:0006429) |
| 0.1 | 0.6 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
| 0.1 | 2.7 | GO:0045008 | depyrimidination(GO:0045008) |
| 0.1 | 0.7 | GO:0006498 | N-terminal protein lipidation(GO:0006498) N-terminal protein palmitoylation(GO:0006500) |
| 0.1 | 1.0 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
| 0.1 | 1.0 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.1 | 0.3 | GO:0006258 | UDP-glucose catabolic process(GO:0006258) |
| 0.1 | 1.3 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
| 0.1 | 1.4 | GO:0015820 | leucine transport(GO:0015820) |
| 0.1 | 4.5 | GO:0031055 | chromatin remodeling at centromere(GO:0031055) CENP-A containing nucleosome assembly(GO:0034080) centromere complex assembly(GO:0034508) CENP-A containing chromatin organization(GO:0061641) |
| 0.1 | 0.6 | GO:0032377 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.1 | 1.0 | GO:0035709 | memory T cell activation(GO:0035709) regulation of memory T cell activation(GO:2000567) positive regulation of memory T cell activation(GO:2000568) |
| 0.1 | 0.3 | GO:0036506 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.1 | 1.8 | GO:0030091 | protein repair(GO:0030091) |
| 0.1 | 1.8 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
| 0.1 | 0.1 | GO:1990009 | retinal cell apoptotic process(GO:1990009) |
| 0.1 | 4.1 | GO:0003416 | endochondral bone growth(GO:0003416) |
| 0.1 | 0.8 | GO:0098967 | exocytic insertion of neurotransmitter receptor to plasma membrane(GO:0098881) exocytic insertion of neurotransmitter receptor to postsynaptic membrane(GO:0098967) |
| 0.1 | 2.3 | GO:0007530 | sex determination(GO:0007530) |
| 0.1 | 0.5 | GO:1903593 | regulation of histamine secretion by mast cell(GO:1903593) |
| 0.1 | 0.5 | GO:0051085 | chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.1 | 2.2 | GO:0070914 | UV-damage excision repair(GO:0070914) |
| 0.1 | 2.3 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.1 | 1.1 | GO:0032439 | endosome localization(GO:0032439) |
| 0.1 | 2.7 | GO:0031441 | negative regulation of mRNA 3'-end processing(GO:0031441) |
| 0.1 | 0.4 | GO:0044240 | multicellular organism lipid catabolic process(GO:0044240) |
| 0.1 | 0.5 | GO:1904978 | regulation of endosome organization(GO:1904978) |
| 0.1 | 4.9 | GO:0014047 | glutamate secretion(GO:0014047) |
| 0.1 | 1.9 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.1 | 0.8 | GO:0008595 | tripartite regional subdivision(GO:0007351) anterior/posterior axis specification, embryo(GO:0008595) |
| 0.1 | 0.5 | GO:1903236 | regulation of leukocyte tethering or rolling(GO:1903236) negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
| 0.1 | 0.9 | GO:0045599 | negative regulation of fat cell differentiation(GO:0045599) |
| 0.1 | 2.1 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.1 | 0.4 | GO:1905245 | regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902959) regulation of aspartic-type peptidase activity(GO:1905245) |
| 0.1 | 0.9 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.1 | 0.9 | GO:0043570 | maintenance of DNA repeat elements(GO:0043570) |
| 0.1 | 0.4 | GO:2000616 | negative regulation of histone H3-K9 acetylation(GO:2000616) |
| 0.1 | 0.8 | GO:0034587 | piRNA metabolic process(GO:0034587) |
| 0.1 | 0.1 | GO:1904868 | telomerase catalytic core complex assembly(GO:1904868) regulation of telomerase catalytic core complex assembly(GO:1904882) positive regulation of telomerase catalytic core complex assembly(GO:1904884) |
| 0.1 | 2.1 | GO:0007140 | male meiosis(GO:0007140) |
| 0.1 | 0.5 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.1 | 1.0 | GO:0010459 | negative regulation of heart rate(GO:0010459) |
| 0.1 | 0.7 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.1 | 1.0 | GO:0033138 | positive regulation of peptidyl-serine phosphorylation(GO:0033138) |
| 0.1 | 1.6 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.1 | 0.5 | GO:0051256 | mitotic spindle midzone assembly(GO:0051256) |
| 0.1 | 0.1 | GO:0042137 | sequestering of neurotransmitter(GO:0042137) |
| 0.1 | 3.1 | GO:0031034 | myosin filament assembly(GO:0031034) |
| 0.1 | 1.0 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
| 0.1 | 76.5 | GO:0007283 | spermatogenesis(GO:0007283) |
| 0.1 | 0.1 | GO:0071211 | protein targeting to vacuole involved in autophagy(GO:0071211) |
| 0.1 | 0.3 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
| 0.1 | 0.4 | GO:0043392 | negative regulation of DNA binding(GO:0043392) |
| 0.1 | 0.5 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
| 0.1 | 0.3 | GO:0097104 | postsynaptic membrane assembly(GO:0097104) |
| 0.1 | 1.2 | GO:1990822 | basic amino acid transmembrane transport(GO:1990822) |
| 0.1 | 0.5 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.1 | 0.5 | GO:0002572 | pro-T cell differentiation(GO:0002572) regulation of pro-T cell differentiation(GO:2000174) positive regulation of pro-T cell differentiation(GO:2000176) |
| 0.1 | 1.0 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.1 | 0.5 | GO:0034260 | negative regulation of GTPase activity(GO:0034260) |
| 0.1 | 0.3 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.1 | 0.4 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
| 0.1 | 0.9 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) |
| 0.1 | 1.9 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.1 | 0.3 | GO:0045226 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
| 0.1 | 0.5 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
| 0.1 | 0.9 | GO:0034127 | regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034127) negative regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034128) |
| 0.1 | 0.6 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.1 | 3.1 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.1 | 1.0 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
| 0.1 | 2.6 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.1 | 0.5 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
| 0.1 | 2.0 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
| 0.1 | 2.2 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
| 0.1 | 0.6 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.1 | 1.6 | GO:0006555 | methionine metabolic process(GO:0006555) |
| 0.1 | 0.2 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.1 | 1.8 | GO:0042749 | regulation of circadian sleep/wake cycle(GO:0042749) |
| 0.1 | 0.4 | GO:0098502 | DNA dephosphorylation(GO:0098502) |
| 0.1 | 0.5 | GO:0090669 | telomerase RNA stabilization(GO:0090669) |
| 0.1 | 3.3 | GO:0051568 | histone H3-K4 methylation(GO:0051568) |
| 0.1 | 1.0 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
| 0.1 | 1.2 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
| 0.1 | 0.5 | GO:0046329 | negative regulation of JNK cascade(GO:0046329) |
| 0.1 | 1.2 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.1 | 0.5 | GO:1904885 | beta-catenin destruction complex assembly(GO:1904885) |
| 0.1 | 0.1 | GO:0006424 | glutamyl-tRNA aminoacylation(GO:0006424) |
| 0.1 | 0.1 | GO:0001824 | blastocyst development(GO:0001824) blastocyst formation(GO:0001825) |
| 0.1 | 1.4 | GO:0007131 | reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
| 0.1 | 1.8 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.1 | 0.7 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 | 0.4 | GO:0060039 | pericardium development(GO:0060039) |
| 0.1 | 0.8 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.1 | 2.0 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.1 | 0.6 | GO:0051083 | 'de novo' cotranslational protein folding(GO:0051083) |
| 0.1 | 0.8 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.1 | 0.5 | GO:0002762 | negative regulation of myeloid leukocyte differentiation(GO:0002762) |
| 0.1 | 1.9 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
| 0.1 | 0.2 | GO:1990418 | response to insulin-like growth factor stimulus(GO:1990418) |
| 0.1 | 0.4 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
| 0.1 | 0.7 | GO:0007320 | insemination(GO:0007320) |
| 0.1 | 0.2 | GO:0072425 | signal transduction involved in G2 DNA damage checkpoint(GO:0072425) signal transduction involved in mitotic G2 DNA damage checkpoint(GO:0072434) |
| 0.1 | 1.4 | GO:0000732 | strand displacement(GO:0000732) |
| 0.1 | 2.3 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.1 | 1.5 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
| 0.1 | 1.2 | GO:0006552 | leucine catabolic process(GO:0006552) |
| 0.1 | 1.8 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
| 0.1 | 0.6 | GO:0070723 | response to cholesterol(GO:0070723) |
| 0.1 | 2.2 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
| 0.1 | 2.5 | GO:0010818 | T cell chemotaxis(GO:0010818) |
| 0.1 | 7.1 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
| 0.1 | 0.2 | GO:0014062 | regulation of serotonin secretion(GO:0014062) |
| 0.1 | 2.8 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.1 | 0.2 | GO:0009448 | gamma-aminobutyric acid metabolic process(GO:0009448) |
| 0.1 | 0.5 | GO:0032826 | natural killer cell differentiation involved in immune response(GO:0002325) regulation of natural killer cell differentiation involved in immune response(GO:0032826) |
| 0.1 | 0.1 | GO:0036216 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
| 0.1 | 3.2 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
| 0.1 | 3.9 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.1 | 0.3 | GO:1904730 | negative regulation of intestinal phytosterol absorption(GO:0010949) negative regulation of intestinal cholesterol absorption(GO:0045796) intestinal phytosterol absorption(GO:0060752) negative regulation of intestinal lipid absorption(GO:1904730) |
| 0.1 | 1.2 | GO:0071313 | cellular response to caffeine(GO:0071313) |
| 0.1 | 3.4 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
| 0.1 | 0.4 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
| 0.1 | 1.0 | GO:0071830 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 0.1 | 0.7 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
| 0.1 | 0.2 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
| 0.1 | 0.9 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
| 0.1 | 0.6 | GO:0007525 | somatic muscle development(GO:0007525) |
| 0.1 | 0.4 | GO:0007063 | regulation of sister chromatid cohesion(GO:0007063) |
| 0.1 | 1.0 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.1 | 6.3 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
| 0.1 | 3.4 | GO:0022400 | regulation of rhodopsin mediated signaling pathway(GO:0022400) |
| 0.1 | 0.4 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
| 0.1 | 2.0 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 0.1 | 1.4 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 0.1 | 0.5 | GO:1990523 | bone regeneration(GO:1990523) |
| 0.1 | 1.3 | GO:0042953 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.1 | 1.0 | GO:0034379 | very-low-density lipoprotein particle assembly(GO:0034379) |
| 0.1 | 0.4 | GO:0021794 | thalamus development(GO:0021794) |
| 0.1 | 0.5 | GO:0000432 | carbon catabolite regulation of transcription from RNA polymerase II promoter(GO:0000429) regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) carbon catabolite activation of transcription from RNA polymerase II promoter(GO:0000436) |
| 0.1 | 0.5 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.1 | 0.3 | GO:0006405 | RNA export from nucleus(GO:0006405) |
| 0.1 | 2.7 | GO:1901663 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.1 | 0.2 | GO:0006208 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
| 0.1 | 1.5 | GO:0015780 | nucleotide-sugar transport(GO:0015780) |
| 0.1 | 0.2 | GO:0050655 | dermatan sulfate proteoglycan metabolic process(GO:0050655) |
| 0.1 | 1.6 | GO:0070166 | enamel mineralization(GO:0070166) |
| 0.1 | 0.4 | GO:1904637 | response to ionomycin(GO:1904636) cellular response to ionomycin(GO:1904637) |
| 0.1 | 1.9 | GO:1903831 | acetylcholine receptor signaling pathway(GO:0095500) postsynaptic signal transduction(GO:0098926) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
| 0.1 | 0.3 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
| 0.1 | 0.5 | GO:0072248 | metanephric glomerular epithelium development(GO:0072244) metanephric glomerular visceral epithelial cell differentiation(GO:0072248) metanephric glomerular visceral epithelial cell development(GO:0072249) metanephric glomerular epithelial cell differentiation(GO:0072312) metanephric glomerular epithelial cell development(GO:0072313) |
| 0.1 | 0.3 | GO:0061193 | sensory organ boundary specification(GO:0008052) formation of organ boundary(GO:0010160) taste bud development(GO:0061193) |
| 0.1 | 0.2 | GO:0036324 | vascular endothelial growth factor receptor-2 signaling pathway(GO:0036324) |
| 0.1 | 0.3 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.1 | 0.5 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
| 0.1 | 0.3 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.1 | 0.2 | GO:0048867 | stem cell fate determination(GO:0048867) |
| 0.1 | 0.1 | GO:1902074 | response to salt(GO:1902074) |
| 0.1 | 5.5 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.1 | 0.3 | GO:0071468 | cellular response to acidic pH(GO:0071468) |
| 0.1 | 5.9 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
| 0.1 | 1.3 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
| 0.1 | 0.9 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 0.1 | 0.2 | GO:0036146 | response to mycotoxin(GO:0010046) cellular response to mycotoxin(GO:0036146) |
| 0.1 | 0.3 | GO:1902166 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
| 0.1 | 1.2 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
| 0.1 | 0.1 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.1 | 0.6 | GO:2000234 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.1 | 0.5 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
| 0.1 | 0.8 | GO:0060539 | diaphragm development(GO:0060539) |
| 0.1 | 0.9 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.1 | 0.2 | GO:0045879 | negative regulation of smoothened signaling pathway(GO:0045879) |
| 0.1 | 0.1 | GO:2000451 | positive regulation of T cell extravasation(GO:2000409) positive regulation of CD8-positive, alpha-beta T cell extravasation(GO:2000451) |
| 0.1 | 0.7 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.1 | 2.2 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.1 | 0.4 | GO:0002115 | store-operated calcium entry(GO:0002115) |
| 0.1 | 0.9 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.1 | 0.4 | GO:1904808 | regulation of protein oxidation(GO:1904806) positive regulation of protein oxidation(GO:1904808) |
| 0.1 | 0.8 | GO:0002249 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 0.1 | 1.2 | GO:0030210 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.1 | 2.3 | GO:0009584 | detection of visible light(GO:0009584) |
| 0.1 | 0.7 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
| 0.1 | 1.3 | GO:0006400 | tRNA modification(GO:0006400) |
| 0.1 | 0.1 | GO:0045349 | interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) |
| 0.1 | 0.1 | GO:0030299 | intestinal cholesterol absorption(GO:0030299) intestinal lipid absorption(GO:0098856) |
| 0.1 | 0.2 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.1 | 0.9 | GO:0070071 | proton-transporting V-type ATPase complex assembly(GO:0070070) proton-transporting two-sector ATPase complex assembly(GO:0070071) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.1 | 0.5 | GO:0032252 | secretory granule localization(GO:0032252) |
| 0.1 | 0.8 | GO:0015939 | pantothenate metabolic process(GO:0015939) |
| 0.1 | 0.6 | GO:0042738 | exogenous drug catabolic process(GO:0042738) |
| 0.1 | 0.1 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
| 0.1 | 0.5 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.1 | 0.5 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
| 0.1 | 0.5 | GO:0071542 | dopaminergic neuron differentiation(GO:0071542) |
| 0.1 | 0.2 | GO:0071484 | cellular response to light intensity(GO:0071484) |
| 0.1 | 0.2 | GO:0046222 | mycotoxin metabolic process(GO:0043385) aflatoxin metabolic process(GO:0046222) organic heteropentacyclic compound metabolic process(GO:1901376) |
| 0.1 | 0.1 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
| 0.1 | 0.4 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.1 | 0.2 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
| 0.1 | 1.7 | GO:0038092 | nodal signaling pathway(GO:0038092) |
| 0.1 | 0.2 | GO:0099624 | membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) atrial cardiac muscle cell membrane repolarization(GO:0099624) |
| 0.1 | 1.5 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
| 0.1 | 2.6 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.1 | 0.4 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
| 0.1 | 0.7 | GO:0035094 | response to nicotine(GO:0035094) |
| 0.1 | 0.2 | GO:0061386 | closure of optic fissure(GO:0061386) |
| 0.1 | 0.3 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
| 0.1 | 0.9 | GO:1902236 | negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
| 0.1 | 0.4 | GO:1903028 | positive regulation of opsonization(GO:1903028) |
| 0.1 | 0.3 | GO:0000066 | mitochondrial ornithine transport(GO:0000066) |
| 0.1 | 0.5 | GO:0048753 | melanosome organization(GO:0032438) pigment granule organization(GO:0048753) |
| 0.1 | 0.6 | GO:1904381 | Golgi apparatus mannose trimming(GO:1904381) |
| 0.1 | 0.7 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.1 | 1.2 | GO:0016246 | RNA interference(GO:0016246) |
| 0.1 | 1.2 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
| 0.1 | 0.4 | GO:0006574 | valine catabolic process(GO:0006574) |
| 0.1 | 3.1 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
| 0.1 | 0.2 | GO:0006817 | phosphate ion transport(GO:0006817) |
| 0.1 | 0.6 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.1 | 1.7 | GO:0006012 | galactose metabolic process(GO:0006012) |
| 0.1 | 0.5 | GO:0072092 | ureteric bud invasion(GO:0072092) metanephric renal vesicle formation(GO:0072093) |
| 0.1 | 0.3 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.1 | 0.3 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.1 | 0.3 | GO:0008631 | intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0008631) |
| 0.1 | 0.6 | GO:0030201 | heparan sulfate proteoglycan metabolic process(GO:0030201) |
| 0.1 | 0.5 | GO:2000537 | regulation of B cell chemotaxis(GO:2000537) positive regulation of B cell chemotaxis(GO:2000538) |
| 0.1 | 0.8 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
| 0.1 | 0.3 | GO:0030186 | melatonin metabolic process(GO:0030186) melatonin biosynthetic process(GO:0030187) |
| 0.1 | 0.6 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.1 | 0.1 | GO:1904869 | regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) |
| 0.1 | 0.2 | GO:0031133 | regulation of axon diameter(GO:0031133) |
| 0.1 | 1.2 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.1 | 0.2 | GO:0035989 | tendon development(GO:0035989) |
| 0.1 | 1.0 | GO:0043090 | amino acid import(GO:0043090) |
| 0.1 | 1.3 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
| 0.1 | 1.1 | GO:0042026 | protein refolding(GO:0042026) |
| 0.1 | 0.3 | GO:0007398 | ectoderm development(GO:0007398) |
| 0.1 | 0.6 | GO:0032648 | regulation of interferon-beta production(GO:0032648) |
| 0.1 | 0.3 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
| 0.1 | 0.2 | GO:1902108 | regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902108) |
| 0.1 | 0.1 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.1 | 0.2 | GO:0000154 | rRNA modification(GO:0000154) |
| 0.1 | 0.7 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
| 0.1 | 2.0 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.1 | 0.2 | GO:0071415 | cellular response to purine-containing compound(GO:0071415) |
| 0.1 | 0.2 | GO:0061582 | colon epithelial cell migration(GO:0061580) intestinal epithelial cell migration(GO:0061582) |
| 0.1 | 0.4 | GO:0046092 | deoxycytidine metabolic process(GO:0046092) |
| 0.1 | 3.4 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
| 0.1 | 0.3 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
| 0.1 | 0.7 | GO:0006813 | potassium ion transport(GO:0006813) |
| 0.1 | 0.3 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
| 0.1 | 0.3 | GO:1902037 | negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
| 0.1 | 0.4 | GO:0039526 | suppression by virus of host apoptotic process(GO:0019050) modulation by virus of host molecular function(GO:0039506) suppression by virus of host molecular function(GO:0039507) suppression by virus of host catalytic activity(GO:0039513) modulation by virus of host catalytic activity(GO:0039516) modulation by virus of host apoptotic process(GO:0039526) suppression by virus of host cysteine-type endopeptidase activity involved in apoptotic process(GO:0039650) negative regulation by symbiont of host catalytic activity(GO:0052053) negative regulation by symbiont of host molecular function(GO:0052056) modulation by symbiont of host catalytic activity(GO:0052148) |
| 0.1 | 0.6 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.1 | 0.4 | GO:0071539 | protein localization to centrosome(GO:0071539) |
| 0.1 | 0.3 | GO:0046146 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.1 | 1.0 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.1 | 0.2 | GO:0007079 | mitotic chromosome movement towards spindle pole(GO:0007079) |
| 0.1 | 2.1 | GO:0050482 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
| 0.1 | 0.2 | GO:0051340 | regulation of ligase activity(GO:0051340) |
| 0.1 | 0.2 | GO:0051305 | chromosome movement towards spindle pole(GO:0051305) |
| 0.1 | 2.4 | GO:0032392 | DNA geometric change(GO:0032392) |
| 0.1 | 0.3 | GO:1904222 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.1 | 0.1 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
| 0.1 | 1.7 | GO:0044804 | nucleophagy(GO:0044804) |
| 0.1 | 0.6 | GO:0032228 | regulation of synaptic transmission, GABAergic(GO:0032228) |
| 0.1 | 7.3 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.1 | 0.3 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
| 0.1 | 0.2 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
| 0.1 | 0.6 | GO:0071285 | cellular response to lithium ion(GO:0071285) |
| 0.1 | 0.2 | GO:0002097 | tRNA wobble base modification(GO:0002097) |
| 0.1 | 1.6 | GO:0016574 | histone ubiquitination(GO:0016574) |
| 0.1 | 0.4 | GO:0016129 | ergosterol biosynthetic process(GO:0006696) ergosterol metabolic process(GO:0008204) phytosteroid metabolic process(GO:0016128) phytosteroid biosynthetic process(GO:0016129) |
| 0.1 | 0.2 | GO:1901340 | negative regulation of store-operated calcium channel activity(GO:1901340) |
| 0.1 | 0.2 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.1 | 0.8 | GO:0060022 | hard palate development(GO:0060022) |
| 0.1 | 0.2 | GO:0038193 | thromboxane A2 signaling pathway(GO:0038193) |
| 0.1 | 0.3 | GO:0090649 | response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
| 0.1 | 0.2 | GO:0035621 | ER to Golgi ceramide transport(GO:0035621) |
| 0.1 | 0.3 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
| 0.1 | 0.8 | GO:0007127 | meiosis I(GO:0007127) |
| 0.1 | 1.1 | GO:0016998 | cell wall macromolecule catabolic process(GO:0016998) |
| 0.1 | 0.4 | GO:0007185 | transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
| 0.1 | 1.7 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.1 | 0.3 | GO:0010002 | cardioblast differentiation(GO:0010002) |
| 0.1 | 1.2 | GO:0099601 | regulation of neurotransmitter receptor activity(GO:0099601) |
| 0.1 | 0.5 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.1 | 1.5 | GO:0060074 | synapse maturation(GO:0060074) |
| 0.1 | 0.4 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
| 0.1 | 0.5 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.1 | 0.2 | GO:1902033 | regulation of hematopoietic stem cell proliferation(GO:1902033) |
| 0.1 | 0.8 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.1 | 0.1 | GO:0003356 | regulation of cilium beat frequency(GO:0003356) |
| 0.1 | 1.2 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
| 0.1 | 0.1 | GO:0010666 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.1 | 12.0 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
| 0.1 | 0.4 | GO:0032510 | endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
| 0.1 | 0.1 | GO:0046533 | negative regulation of photoreceptor cell differentiation(GO:0046533) |
| 0.1 | 0.1 | GO:0006751 | glutathione catabolic process(GO:0006751) |
| 0.1 | 0.1 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
| 0.1 | 0.8 | GO:0014809 | regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014809) |
| 0.1 | 0.6 | GO:0034629 | cellular protein complex localization(GO:0034629) |
| 0.1 | 0.4 | GO:0060481 | lobar bronchus epithelium development(GO:0060481) |
| 0.1 | 1.0 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
| 0.1 | 0.2 | GO:0038188 | cholecystokinin signaling pathway(GO:0038188) |
| 0.1 | 0.2 | GO:0036451 | cap mRNA methylation(GO:0036451) |
| 0.1 | 0.3 | GO:1905224 | clathrin-coated pit assembly(GO:1905224) |
| 0.1 | 0.3 | GO:0035865 | cellular response to potassium ion(GO:0035865) |
| 0.1 | 0.1 | GO:1903630 | regulation of aminoacyl-tRNA ligase activity(GO:1903630) |
| 0.1 | 2.2 | GO:0006409 | tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.1 | 0.3 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.1 | 0.3 | GO:1904425 | negative regulation of GTP binding(GO:1904425) |
| 0.1 | 7.8 | GO:0051438 | regulation of ubiquitin-protein transferase activity(GO:0051438) |
| 0.1 | 1.3 | GO:1902475 | L-alpha-amino acid transmembrane transport(GO:1902475) |
| 0.1 | 0.9 | GO:0090266 | regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
| 0.1 | 0.3 | GO:2000639 | regulation of SREBP signaling pathway(GO:2000638) negative regulation of SREBP signaling pathway(GO:2000639) |
| 0.1 | 0.1 | GO:0042538 | hyperosmotic salinity response(GO:0042538) |
| 0.1 | 0.4 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.1 | 0.5 | GO:0007094 | mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
| 0.1 | 0.7 | GO:0035583 | sequestering of TGFbeta in extracellular matrix(GO:0035583) |
| 0.1 | 0.2 | GO:0044268 | multicellular organismal protein metabolic process(GO:0044268) |
| 0.1 | 1.7 | GO:0010965 | regulation of mitotic sister chromatid separation(GO:0010965) |
| 0.1 | 0.4 | GO:0048296 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) |
| 0.1 | 0.2 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
| 0.1 | 0.2 | GO:0006768 | biotin metabolic process(GO:0006768) |
| 0.1 | 0.3 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.1 | 0.4 | GO:0043461 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 0.1 | 0.4 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
| 0.1 | 0.5 | GO:0010226 | response to lithium ion(GO:0010226) |
| 0.1 | 1.0 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
| 0.1 | 0.2 | GO:0043435 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.1 | 2.1 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
| 0.1 | 0.1 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
| 0.1 | 0.1 | GO:0051958 | methotrexate transport(GO:0051958) |
| 0.1 | 0.2 | GO:0070945 | neutrophil mediated killing of gram-negative bacterium(GO:0070945) |
| 0.1 | 0.7 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
| 0.1 | 0.7 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
| 0.1 | 1.6 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.1 | 1.0 | GO:0015747 | urate transport(GO:0015747) |
| 0.1 | 0.3 | GO:0030432 | peristalsis(GO:0030432) |
| 0.1 | 0.2 | GO:0015801 | aromatic amino acid transport(GO:0015801) |
| 0.1 | 0.8 | GO:0015705 | iodide transport(GO:0015705) |
| 0.1 | 0.8 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.1 | 0.6 | GO:0048003 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
| 0.1 | 0.4 | GO:0034036 | purine ribonucleoside bisphosphate biosynthetic process(GO:0034036) 3'-phosphoadenosine 5'-phosphosulfate biosynthetic process(GO:0050428) |
| 0.1 | 0.3 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.1 | 0.1 | GO:0009146 | purine nucleoside triphosphate catabolic process(GO:0009146) |
| 0.1 | 0.3 | GO:0006548 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
| 0.1 | 1.2 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.1 | 2.2 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
| 0.1 | 0.2 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) |
| 0.1 | 0.1 | GO:0042737 | drug catabolic process(GO:0042737) |
| 0.1 | 0.2 | GO:1903564 | regulation of protein localization to cilium(GO:1903564) |
| 0.1 | 0.8 | GO:0035666 | TRIF-dependent toll-like receptor signaling pathway(GO:0035666) |
| 0.1 | 0.8 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
| 0.1 | 5.1 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
| 0.1 | 0.3 | GO:0034982 | mitochondrial protein processing(GO:0034982) |
| 0.1 | 0.6 | GO:0090083 | regulation of inclusion body assembly(GO:0090083) |
| 0.1 | 0.3 | GO:0003404 | optic vesicle morphogenesis(GO:0003404) |
| 0.1 | 0.3 | GO:0006700 | C21-steroid hormone biosynthetic process(GO:0006700) |
| 0.1 | 2.1 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.1 | 0.2 | GO:0048611 | ectodermal digestive tract development(GO:0007439) embryonic ectodermal digestive tract development(GO:0048611) |
| 0.1 | 0.2 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.1 | 0.2 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
| 0.1 | 0.4 | GO:0042346 | positive regulation of NF-kappaB import into nucleus(GO:0042346) |
| 0.1 | 0.2 | GO:0090222 | centrosome-templated microtubule nucleation(GO:0090222) |
| 0.1 | 0.2 | GO:0006566 | threonine metabolic process(GO:0006566) |
| 0.1 | 0.1 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
| 0.1 | 0.3 | GO:1902230 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
| 0.1 | 0.7 | GO:0060563 | neuroepithelial cell differentiation(GO:0060563) |
| 0.1 | 1.1 | GO:0061436 | establishment of skin barrier(GO:0061436) |
| 0.1 | 0.2 | GO:2000637 | positive regulation of gene silencing by miRNA(GO:2000637) |
| 0.1 | 0.1 | GO:1901620 | regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901620) |
| 0.1 | 0.1 | GO:0015688 | iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
| 0.1 | 0.5 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
| 0.1 | 0.1 | GO:0045763 | negative regulation of cellular amino acid metabolic process(GO:0045763) |
| 0.1 | 0.3 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.1 | 0.8 | GO:0006590 | thyroid hormone generation(GO:0006590) |
| 0.1 | 0.4 | GO:0010714 | positive regulation of collagen metabolic process(GO:0010714) positive regulation of collagen biosynthetic process(GO:0032967) positive regulation of multicellular organismal metabolic process(GO:0044253) |
| 0.1 | 0.8 | GO:0009083 | branched-chain amino acid metabolic process(GO:0009081) branched-chain amino acid catabolic process(GO:0009083) |
| 0.1 | 0.1 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
| 0.1 | 1.1 | GO:0048490 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
| 0.1 | 1.3 | GO:0030317 | sperm motility(GO:0030317) |
| 0.1 | 0.3 | GO:0044565 | dendritic cell proliferation(GO:0044565) |
| 0.1 | 0.1 | GO:0048266 | behavioral response to pain(GO:0048266) |
| 0.1 | 0.5 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
| 0.1 | 0.1 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
| 0.1 | 0.4 | GO:1904152 | regulation of retrograde protein transport, ER to cytosol(GO:1904152) |
| 0.1 | 2.7 | GO:0046513 | ceramide biosynthetic process(GO:0046513) |
| 0.0 | 0.1 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
| 0.0 | 1.1 | GO:0035338 | long-chain fatty-acyl-CoA biosynthetic process(GO:0035338) |
| 0.0 | 0.2 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.0 | 0.1 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
| 0.0 | 0.1 | GO:0051096 | positive regulation of helicase activity(GO:0051096) |
| 0.0 | 0.2 | GO:0075071 | autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
| 0.0 | 0.6 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 | 0.1 | GO:0046040 | IMP metabolic process(GO:0046040) |
| 0.0 | 0.6 | GO:2000291 | regulation of myoblast proliferation(GO:2000291) |
| 0.0 | 0.9 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.0 | 0.2 | GO:0090100 | positive regulation of transmembrane receptor protein serine/threonine kinase signaling pathway(GO:0090100) |
| 0.0 | 0.1 | GO:1902993 | positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
| 0.0 | 0.1 | GO:0009644 | response to high light intensity(GO:0009644) |
| 0.0 | 0.6 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.0 | 0.2 | GO:0001573 | ganglioside metabolic process(GO:0001573) |
| 0.0 | 0.4 | GO:0045839 | negative regulation of mitotic nuclear division(GO:0045839) |
| 0.0 | 0.2 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
| 0.0 | 0.3 | GO:0046782 | regulation of viral transcription(GO:0046782) |
| 0.0 | 0.2 | GO:0046073 | dTMP biosynthetic process(GO:0006231) dTMP metabolic process(GO:0046073) |
| 0.0 | 0.1 | GO:0051084 | 'de novo' posttranslational protein folding(GO:0051084) |
| 0.0 | 0.1 | GO:0051957 | positive regulation of amino acid transport(GO:0051957) |
| 0.0 | 0.3 | GO:0009812 | flavonoid metabolic process(GO:0009812) |
| 0.0 | 0.1 | GO:0061056 | sclerotome development(GO:0061056) |
| 0.0 | 0.8 | GO:0032196 | transposition(GO:0032196) |
| 0.0 | 0.0 | GO:0048538 | thymus development(GO:0048538) |
| 0.0 | 5.5 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
| 0.0 | 1.3 | GO:0072600 | establishment of protein localization to Golgi(GO:0072600) |
| 0.0 | 0.1 | GO:0048254 | snoRNA localization(GO:0048254) |
| 0.0 | 0.4 | GO:0060767 | epithelial cell proliferation involved in prostate gland development(GO:0060767) |
| 0.0 | 0.1 | GO:0061485 | memory T cell proliferation(GO:0061485) |
| 0.0 | 0.5 | GO:0050775 | positive regulation of dendrite morphogenesis(GO:0050775) |
| 0.0 | 0.1 | GO:0045643 | regulation of eosinophil differentiation(GO:0045643) positive regulation of eosinophil differentiation(GO:0045645) |
| 0.0 | 0.6 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.0 | 0.2 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
| 0.0 | 0.8 | GO:0022038 | corpus callosum development(GO:0022038) |
| 0.0 | 2.9 | GO:0007062 | sister chromatid cohesion(GO:0007062) |
| 0.0 | 0.2 | GO:0052651 | monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.0 | 0.1 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.0 | 1.0 | GO:0034453 | microtubule anchoring(GO:0034453) |
| 0.0 | 0.3 | GO:0045954 | positive regulation of natural killer cell mediated cytotoxicity(GO:0045954) |
| 0.0 | 0.1 | GO:0032470 | regulation of twitch skeletal muscle contraction(GO:0014724) positive regulation of endoplasmic reticulum calcium ion concentration(GO:0032470) |
| 0.0 | 1.3 | GO:0006301 | postreplication repair(GO:0006301) |
| 0.0 | 0.3 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
| 0.0 | 0.1 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
| 0.0 | 0.2 | GO:0018874 | benzoate metabolic process(GO:0018874) |
| 0.0 | 0.0 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
| 0.0 | 0.2 | GO:0033033 | negative regulation of myeloid cell apoptotic process(GO:0033033) |
| 0.0 | 0.3 | GO:0032485 | Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
| 0.0 | 0.3 | GO:0030643 | cellular phosphate ion homeostasis(GO:0030643) cellular divalent inorganic anion homeostasis(GO:0072501) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.0 | 0.3 | GO:0048104 | establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 0.0 | 0.1 | GO:0046133 | pyrimidine ribonucleoside catabolic process(GO:0046133) |
| 0.0 | 0.1 | GO:1905244 | regulation of modification of synaptic structure(GO:1905244) |
| 0.0 | 0.1 | GO:0035397 | helper T cell enhancement of adaptive immune response(GO:0035397) |
| 0.0 | 0.2 | GO:0032328 | alanine transport(GO:0032328) |
| 0.0 | 0.8 | GO:0050427 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 0.0 | 0.1 | GO:2000744 | anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 0.0 | 0.1 | GO:0006423 | cysteinyl-tRNA aminoacylation(GO:0006423) |
| 0.0 | 0.1 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.0 | 0.2 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
| 0.0 | 0.8 | GO:0008228 | opsonization(GO:0008228) |
| 0.0 | 1.1 | GO:0006342 | chromatin silencing(GO:0006342) |
| 0.0 | 0.7 | GO:1901796 | regulation of signal transduction by p53 class mediator(GO:1901796) |
| 0.0 | 0.0 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) |
| 0.0 | 0.2 | GO:0033146 | regulation of intracellular estrogen receptor signaling pathway(GO:0033146) |
| 0.0 | 0.4 | GO:0035608 | protein deglutamylation(GO:0035608) |
| 0.0 | 0.3 | GO:0000737 | DNA catabolic process, endonucleolytic(GO:0000737) |
| 0.0 | 0.1 | GO:0008343 | adult feeding behavior(GO:0008343) |
| 0.0 | 0.0 | GO:0006533 | aspartate catabolic process(GO:0006533) |
| 0.0 | 0.9 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
| 0.0 | 0.2 | GO:1901341 | activation of store-operated calcium channel activity(GO:0032237) regulation of store-operated calcium channel activity(GO:1901339) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.0 | 0.1 | GO:0090296 | regulation of mitochondrial DNA replication(GO:0090296) negative regulation of mitochondrial DNA replication(GO:0090298) negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
| 0.0 | 0.2 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.0 | 0.2 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.0 | 0.3 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.0 | 0.1 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.0 | 0.5 | GO:0009068 | aspartate family amino acid catabolic process(GO:0009068) |
| 0.0 | 0.1 | GO:0043418 | homocysteine catabolic process(GO:0043418) |
| 0.0 | 0.2 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.0 | 0.3 | GO:0000380 | alternative mRNA splicing, via spliceosome(GO:0000380) |
| 0.0 | 1.7 | GO:0006953 | acute-phase response(GO:0006953) |
| 0.0 | 0.1 | GO:0006581 | acetylcholine catabolic process in synaptic cleft(GO:0001507) acetylcholine catabolic process(GO:0006581) |
| 0.0 | 0.1 | GO:0048484 | enteric nervous system development(GO:0048484) |
| 0.0 | 0.8 | GO:0042104 | positive regulation of activated T cell proliferation(GO:0042104) |
| 0.0 | 0.1 | GO:0070541 | response to platinum ion(GO:0070541) |
| 0.0 | 0.1 | GO:0003157 | endocardium development(GO:0003157) |
| 0.0 | 0.2 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
| 0.0 | 0.4 | GO:0046605 | regulation of centrosome cycle(GO:0046605) |
| 0.0 | 0.2 | GO:0043383 | negative T cell selection(GO:0043383) |
| 0.0 | 0.8 | GO:2000479 | regulation of cAMP-dependent protein kinase activity(GO:2000479) |
| 0.0 | 0.2 | GO:0033260 | nuclear DNA replication(GO:0033260) |
| 0.0 | 0.1 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.0 | 0.1 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.0 | 0.1 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.0 | 0.6 | GO:0034116 | positive regulation of heterotypic cell-cell adhesion(GO:0034116) |
| 0.0 | 0.2 | GO:1904209 | regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904207) positive regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904209) |
| 0.0 | 0.1 | GO:0002328 | pro-B cell differentiation(GO:0002328) |
| 0.0 | 0.3 | GO:0042159 | lipoprotein catabolic process(GO:0042159) |
| 0.0 | 0.0 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.0 | 0.5 | GO:0090023 | positive regulation of neutrophil chemotaxis(GO:0090023) |
| 0.0 | 0.4 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
| 0.0 | 0.1 | GO:2001287 | negative regulation of caveolin-mediated endocytosis(GO:2001287) |
| 0.0 | 0.1 | GO:0019323 | pentose catabolic process(GO:0019323) |
| 0.0 | 0.1 | GO:0007194 | negative regulation of adenylate cyclase activity(GO:0007194) |
| 0.0 | 1.1 | GO:0001580 | detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
| 0.0 | 0.2 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) protein localization to ciliary membrane(GO:1903441) |
| 0.0 | 0.3 | GO:0042791 | 5S class rRNA transcription from RNA polymerase III type 1 promoter(GO:0042791) tRNA transcription from RNA polymerase III promoter(GO:0042797) |
| 0.0 | 0.1 | GO:0000466 | maturation of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000466) |
| 0.0 | 0.5 | GO:0015838 | quaternary ammonium group transport(GO:0015697) amino-acid betaine transport(GO:0015838) carnitine transport(GO:0015879) |
| 0.0 | 0.1 | GO:0071418 | cellular response to amine stimulus(GO:0071418) |
| 0.0 | 0.2 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
| 0.0 | 0.1 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
| 0.0 | 0.1 | GO:0001172 | transcription, RNA-templated(GO:0001172) |
| 0.0 | 0.2 | GO:0019566 | arabinose metabolic process(GO:0019566) L-arabinose metabolic process(GO:0046373) |
| 0.0 | 0.0 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
| 0.0 | 0.1 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 0.0 | 0.4 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
| 0.0 | 0.1 | GO:0036269 | swimming behavior(GO:0036269) |
| 0.0 | 0.1 | GO:0002710 | negative regulation of T cell mediated immunity(GO:0002710) |
| 0.0 | 0.3 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.0 | 0.1 | GO:1903243 | negative regulation of cardiac muscle adaptation(GO:0010616) negative regulation of cardiac muscle hypertrophy in response to stress(GO:1903243) |
| 0.0 | 0.9 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
| 0.0 | 0.3 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
| 0.0 | 0.6 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
| 0.0 | 0.0 | GO:0071907 | determination of digestive tract left/right asymmetry(GO:0071907) |
| 0.0 | 0.2 | GO:0003025 | regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
| 0.0 | 0.7 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.0 | 0.1 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
| 0.0 | 0.9 | GO:2001222 | regulation of neuron migration(GO:2001222) |
| 0.0 | 0.0 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
| 0.0 | 0.0 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
| 0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 | 0.3 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
| 0.0 | 0.1 | GO:0000479 | endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
| 0.0 | 0.1 | GO:0042636 | negative regulation of hair cycle(GO:0042636) |
| 0.0 | 1.6 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
| 0.0 | 0.5 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
| 0.0 | 0.2 | GO:0097338 | response to clozapine(GO:0097338) |
| 0.0 | 0.2 | GO:0050951 | sensory perception of temperature stimulus(GO:0050951) |
| 0.0 | 0.2 | GO:0021522 | spinal cord motor neuron differentiation(GO:0021522) |
| 0.0 | 0.2 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.0 | 0.0 | GO:0046530 | photoreceptor cell differentiation(GO:0046530) |
| 0.0 | 1.0 | GO:0050690 | regulation of defense response to virus by virus(GO:0050690) |
| 0.0 | 0.8 | GO:0019835 | cytolysis(GO:0019835) |
| 0.0 | 0.1 | GO:0003366 | cell-matrix adhesion involved in ameboidal cell migration(GO:0003366) |
| 0.0 | 0.2 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.0 | 0.0 | GO:0023019 | signal transduction involved in regulation of gene expression(GO:0023019) |
| 0.0 | 0.0 | GO:0098915 | membrane repolarization during ventricular cardiac muscle cell action potential(GO:0098915) |
| 0.0 | 0.1 | GO:0070102 | interleukin-6-mediated signaling pathway(GO:0070102) |
| 0.0 | 2.4 | GO:0090630 | activation of GTPase activity(GO:0090630) |
| 0.0 | 0.0 | GO:0072708 | response to sorbitol(GO:0072708) |
| 0.0 | 0.2 | GO:0021692 | cerebellar Purkinje cell layer morphogenesis(GO:0021692) |
| 0.0 | 0.1 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
| 0.0 | 0.0 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
| 0.0 | 0.0 | GO:0038169 | somatostatin receptor signaling pathway(GO:0038169) somatostatin signaling pathway(GO:0038170) |
| 0.0 | 0.1 | GO:0071421 | manganese ion transmembrane transport(GO:0071421) |
| 0.0 | 0.4 | GO:0001510 | RNA methylation(GO:0001510) |
| 0.0 | 0.1 | GO:0008214 | protein demethylation(GO:0006482) protein dealkylation(GO:0008214) |
| 0.0 | 0.2 | GO:0042407 | cristae formation(GO:0042407) |
| 0.0 | 0.4 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
| 0.0 | 0.1 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.0 | 0.2 | GO:0006896 | Golgi to vacuole transport(GO:0006896) |
| 0.0 | 0.2 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.0 | 0.0 | GO:0071048 | nuclear mRNA surveillance of spliceosomal pre-mRNA splicing(GO:0071030) nuclear retention of unspliced pre-mRNA at the site of transcription(GO:0071048) |
| 0.0 | 0.1 | GO:0002276 | basophil activation involved in immune response(GO:0002276) |
| 0.0 | 0.0 | GO:0000349 | generation of catalytic spliceosome for first transesterification step(GO:0000349) |
| 0.0 | 0.0 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.0 | 0.0 | GO:0060137 | maternal process involved in parturition(GO:0060137) |
| 0.0 | 0.2 | GO:0019441 | tryptophan catabolic process to kynurenine(GO:0019441) kynurenine metabolic process(GO:0070189) |
| 0.0 | 0.7 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.0 | 0.2 | GO:0032784 | regulation of DNA-templated transcription, elongation(GO:0032784) |
| 0.0 | 0.2 | GO:0008209 | androgen metabolic process(GO:0008209) |
| 0.0 | 0.2 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.0 | 0.1 | GO:0006238 | CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) CMP metabolic process(GO:0046035) |
| 0.0 | 0.6 | GO:0008033 | tRNA processing(GO:0008033) |
| 0.0 | 0.2 | GO:0016601 | Rac protein signal transduction(GO:0016601) |
| 0.0 | 0.4 | GO:0030261 | chromosome condensation(GO:0030261) |
| 0.0 | 0.0 | GO:1905051 | regulation of base-excision repair(GO:1905051) positive regulation of base-excision repair(GO:1905053) |
| 0.0 | 0.1 | GO:0033344 | cholesterol efflux(GO:0033344) |
| 0.0 | 0.0 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.0 | 0.1 | GO:0032494 | response to peptidoglycan(GO:0032494) |
| 0.0 | 0.7 | GO:0071166 | ribonucleoprotein complex localization(GO:0071166) ribonucleoprotein complex export from nucleus(GO:0071426) |
| 0.0 | 0.0 | GO:0070986 | left/right axis specification(GO:0070986) |
| 0.0 | 0.0 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
| 0.0 | 0.0 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.0 | 0.1 | GO:0045724 | positive regulation of cilium assembly(GO:0045724) |
| 0.0 | 0.4 | GO:0045071 | negative regulation of viral genome replication(GO:0045071) |
| 0.0 | 0.1 | GO:0032755 | positive regulation of interleukin-6 production(GO:0032755) |
| 0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
| 0.0 | 0.0 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.0 | 0.3 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
| 0.0 | 0.0 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.0 | 0.0 | GO:0001970 | positive regulation of activation of membrane attack complex(GO:0001970) |
| 0.0 | 4.0 | GO:0007608 | sensory perception of smell(GO:0007608) |
| 0.0 | 0.1 | GO:0099637 | neurotransmitter receptor transport(GO:0099637) |
| 0.0 | 0.2 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
| 0.0 | 0.0 | GO:1903432 | regulation of TORC1 signaling(GO:1903432) |
| 0.0 | 0.2 | GO:0033139 | regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033139) positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.0 | 3.2 | GO:0000209 | protein polyubiquitination(GO:0000209) |
| 0.0 | 0.0 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
| 0.0 | 0.0 | GO:0051097 | negative regulation of helicase activity(GO:0051097) |
| 0.0 | 0.0 | GO:0006336 | DNA replication-independent nucleosome assembly(GO:0006336) |
| 0.0 | 0.1 | GO:0019054 | modulation by virus of host process(GO:0019054) |
| 0.0 | 0.0 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.0 | 0.1 | GO:0051149 | positive regulation of muscle cell differentiation(GO:0051149) |
| 0.0 | 0.2 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.0 | 0.2 | GO:0001709 | cell fate determination(GO:0001709) |
| 0.0 | 0.1 | GO:0060219 | camera-type eye photoreceptor cell differentiation(GO:0060219) |
| 0.0 | 0.1 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.0 | 0.1 | GO:0060969 | negative regulation of gene silencing(GO:0060969) |
| 0.0 | 0.1 | GO:0033240 | positive regulation of cellular amine metabolic process(GO:0033240) |
| 0.0 | 0.1 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.9 | 3.9 | GO:0005915 | zonula adherens(GO:0005915) |
| 2.5 | 7.6 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
| 1.7 | 5.1 | GO:0005960 | glycine cleavage complex(GO:0005960) |
| 1.6 | 14.7 | GO:0030893 | meiotic cohesin complex(GO:0030893) |
| 1.4 | 11.0 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 1.1 | 11.4 | GO:0000801 | central element(GO:0000801) |
| 1.1 | 2.1 | GO:0044297 | cell body(GO:0044297) |
| 1.0 | 3.1 | GO:0098855 | HCN channel complex(GO:0098855) |
| 1.0 | 1.0 | GO:0031312 | extrinsic component of organelle membrane(GO:0031312) |
| 1.0 | 1.0 | GO:0031436 | BRCA1-BARD1 complex(GO:0031436) |
| 0.9 | 2.6 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.8 | 15.2 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.8 | 3.3 | GO:0033011 | perinuclear theca(GO:0033011) |
| 0.8 | 2.3 | GO:0075341 | host cell PML body(GO:0075341) |
| 0.8 | 0.8 | GO:0097449 | astrocyte projection(GO:0097449) |
| 0.7 | 0.7 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.7 | 3.0 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.7 | 2.9 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.7 | 3.7 | GO:0034753 | nuclear aryl hydrocarbon receptor complex(GO:0034753) |
| 0.7 | 4.3 | GO:0071547 | piP-body(GO:0071547) |
| 0.7 | 2.9 | GO:1990923 | PET complex(GO:1990923) |
| 0.7 | 1.4 | GO:0043159 | acrosomal matrix(GO:0043159) |
| 0.7 | 11.2 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.7 | 4.8 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 0.7 | 12.6 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.6 | 1.9 | GO:0071546 | pi-body(GO:0071546) |
| 0.6 | 15.0 | GO:0005861 | troponin complex(GO:0005861) |
| 0.6 | 3.6 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.6 | 6.0 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.6 | 2.3 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.5 | 8.8 | GO:0032039 | integrator complex(GO:0032039) |
| 0.5 | 1.6 | GO:0002947 | tumor necrosis factor receptor superfamily complex(GO:0002947) |
| 0.5 | 2.7 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.5 | 7.9 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.5 | 6.8 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.5 | 1.0 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.5 | 1.5 | GO:0008091 | spectrin(GO:0008091) |
| 0.5 | 1.5 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
| 0.5 | 2.0 | GO:0043293 | apoptosome(GO:0043293) |
| 0.5 | 4.5 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
| 0.5 | 3.4 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.5 | 1.0 | GO:0071458 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) |
| 0.5 | 1.9 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.5 | 6.2 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.5 | 2.9 | GO:0042025 | host cell nucleus(GO:0042025) |
| 0.5 | 8.9 | GO:0000800 | lateral element(GO:0000800) |
| 0.5 | 2.8 | GO:1990769 | proximal neuron projection(GO:1990769) |
| 0.5 | 2.3 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.5 | 5.5 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.4 | 1.8 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.4 | 7.0 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.4 | 0.9 | GO:0030990 | intraciliary transport particle(GO:0030990) intraciliary transport particle A(GO:0030991) |
| 0.4 | 4.8 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
| 0.4 | 5.6 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.4 | 4.3 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.4 | 18.0 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.4 | 2.6 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.4 | 2.5 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.4 | 8.4 | GO:0042627 | chylomicron(GO:0042627) |
| 0.4 | 7.5 | GO:0045179 | apical cortex(GO:0045179) |
| 0.4 | 2.5 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
| 0.4 | 10.6 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.4 | 1.5 | GO:0032798 | Swi5-Sfr1 complex(GO:0032798) |
| 0.4 | 1.1 | GO:0002139 | stereocilia coupling link(GO:0002139) |
| 0.4 | 4.8 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.4 | 15.4 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.4 | 5.0 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
| 0.4 | 1.4 | GO:0016589 | NURF complex(GO:0016589) |
| 0.4 | 4.2 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.4 | 2.5 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
| 0.3 | 4.9 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.3 | 0.3 | GO:1902636 | kinociliary basal body(GO:1902636) |
| 0.3 | 3.1 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.3 | 6.5 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.3 | 1.0 | GO:0097123 | cyclin A1-CDK2 complex(GO:0097123) |
| 0.3 | 1.4 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.3 | 0.7 | GO:0061673 | mitotic spindle astral microtubule(GO:0061673) |
| 0.3 | 3.0 | GO:0044292 | dendrite terminus(GO:0044292) |
| 0.3 | 2.3 | GO:0070554 | synaptobrevin 2-SNAP-25-syntaxin-3-complexin complex(GO:0070554) |
| 0.3 | 0.3 | GO:0042175 | nuclear outer membrane-endoplasmic reticulum membrane network(GO:0042175) |
| 0.3 | 1.9 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.3 | 1.0 | GO:0002945 | cyclin K-CDK13 complex(GO:0002945) |
| 0.3 | 4.4 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.3 | 1.2 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.3 | 1.5 | GO:0016342 | catenin complex(GO:0016342) |
| 0.3 | 0.3 | GO:0097546 | ciliary base(GO:0097546) |
| 0.3 | 3.0 | GO:1990391 | DNA repair complex(GO:1990391) |
| 0.3 | 0.6 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.3 | 3.3 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.3 | 3.0 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.3 | 0.9 | GO:0000229 | cytoplasmic chromosome(GO:0000229) |
| 0.3 | 3.8 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.3 | 2.7 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.3 | 1.5 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
| 0.3 | 9.3 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
| 0.3 | 0.9 | GO:0035101 | FACT complex(GO:0035101) |
| 0.3 | 8.7 | GO:0031231 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
| 0.3 | 8.9 | GO:0071565 | nBAF complex(GO:0071565) |
| 0.3 | 1.1 | GO:0097224 | sperm connecting piece(GO:0097224) |
| 0.3 | 4.0 | GO:0030136 | clathrin-coated vesicle(GO:0030136) |
| 0.3 | 3.4 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.3 | 1.7 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
| 0.3 | 1.7 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.3 | 6.7 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.3 | 2.2 | GO:0033165 | interphotoreceptor matrix(GO:0033165) |
| 0.3 | 1.9 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.3 | 1.4 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.3 | 2.5 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.3 | 0.3 | GO:0042565 | RNA nuclear export complex(GO:0042565) |
| 0.3 | 4.3 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.3 | 2.4 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.3 | 1.9 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.3 | 2.3 | GO:0098845 | postsynaptic endosome(GO:0098845) |
| 0.3 | 3.4 | GO:0016235 | aggresome(GO:0016235) |
| 0.3 | 1.0 | GO:0036025 | protein C inhibitor-TMPRSS7 complex(GO:0036024) protein C inhibitor-TMPRSS11E complex(GO:0036025) protein C inhibitor-PLAT complex(GO:0036026) protein C inhibitor-PLAU complex(GO:0036027) protein C inhibitor-thrombin complex(GO:0036028) protein C inhibitor-KLK3 complex(GO:0036029) protein C inhibitor-plasma kallikrein complex(GO:0036030) serine protease inhibitor complex(GO:0097180) protein C inhibitor-coagulation factor V complex(GO:0097181) protein C inhibitor-coagulation factor Xa complex(GO:0097182) protein C inhibitor-coagulation factor XI complex(GO:0097183) |
| 0.3 | 0.8 | GO:0005940 | septin ring(GO:0005940) septin collar(GO:0032173) |
| 0.3 | 3.6 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 0.3 | 4.1 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.3 | 4.1 | GO:0005883 | neurofilament(GO:0005883) |
| 0.3 | 3.5 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.3 | 12.8 | GO:0032809 | neuronal cell body membrane(GO:0032809) cell body membrane(GO:0044298) |
| 0.2 | 0.7 | GO:0034455 | t-UTP complex(GO:0034455) |
| 0.2 | 1.7 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
| 0.2 | 2.4 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.2 | 8.0 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.2 | 6.2 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.2 | 3.8 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.2 | 1.4 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
| 0.2 | 13.5 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.2 | 1.2 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.2 | 3.3 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.2 | 9.7 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.2 | 2.6 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.2 | 0.9 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
| 0.2 | 1.2 | GO:0032144 | 4-aminobutyrate transaminase complex(GO:0032144) |
| 0.2 | 3.5 | GO:0000795 | synaptonemal complex(GO:0000795) |
| 0.2 | 0.7 | GO:0043219 | lateral loop(GO:0043219) |
| 0.2 | 4.5 | GO:0001741 | XY body(GO:0001741) |
| 0.2 | 1.1 | GO:0016600 | flotillin complex(GO:0016600) |
| 0.2 | 3.5 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.2 | 1.1 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.2 | 16.1 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.2 | 1.5 | GO:0032420 | stereocilium(GO:0032420) |
| 0.2 | 2.8 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.2 | 6.5 | GO:0033268 | node of Ranvier(GO:0033268) |
| 0.2 | 0.9 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.2 | 0.8 | GO:0043291 | RAVE complex(GO:0043291) |
| 0.2 | 2.3 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.2 | 0.4 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.2 | 0.8 | GO:0070985 | TFIIK complex(GO:0070985) |
| 0.2 | 1.5 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.2 | 2.3 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.2 | 4.3 | GO:0032156 | septin cytoskeleton(GO:0032156) |
| 0.2 | 0.2 | GO:0005608 | laminin-3 complex(GO:0005608) |
| 0.2 | 5.3 | GO:0031045 | dense core granule(GO:0031045) |
| 0.2 | 0.4 | GO:0002944 | cyclin K-CDK12 complex(GO:0002944) |
| 0.2 | 4.5 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.2 | 1.0 | GO:0097362 | MCM8-MCM9 complex(GO:0097362) |
| 0.2 | 0.8 | GO:0036019 | endolysosome(GO:0036019) |
| 0.2 | 2.6 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.2 | 6.5 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 0.2 | 0.2 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.2 | 2.6 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.2 | 2.1 | GO:1990904 | ribonucleoprotein complex(GO:1990904) |
| 0.2 | 2.5 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.2 | 0.8 | GO:0097196 | Shu complex(GO:0097196) |
| 0.2 | 5.3 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.2 | 0.9 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.2 | 0.4 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.2 | 5.6 | GO:0070160 | occluding junction(GO:0070160) |
| 0.2 | 4.9 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.2 | 4.7 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.2 | 0.5 | GO:0032783 | ELL-EAF complex(GO:0032783) |
| 0.2 | 3.2 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.2 | 1.1 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.2 | 0.7 | GO:0038038 | G-protein coupled receptor homodimeric complex(GO:0038038) |
| 0.2 | 7.6 | GO:0030673 | axolemma(GO:0030673) |
| 0.2 | 0.9 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.2 | 1.2 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.2 | 0.5 | GO:0001534 | radial spoke(GO:0001534) |
| 0.2 | 0.8 | GO:1990876 | cytoplasmic side of nuclear pore(GO:1990876) |
| 0.2 | 1.3 | GO:0002177 | manchette(GO:0002177) |
| 0.2 | 0.7 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.2 | 9.6 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.2 | 5.2 | GO:1902711 | GABA-A receptor complex(GO:1902711) |
| 0.2 | 1.5 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.2 | 25.1 | GO:0001669 | acrosomal vesicle(GO:0001669) |
| 0.2 | 0.8 | GO:0032301 | MutSalpha complex(GO:0032301) |
| 0.2 | 1.3 | GO:0097361 | CIA complex(GO:0097361) |
| 0.2 | 0.5 | GO:0034515 | proteasome storage granule(GO:0034515) |
| 0.2 | 1.1 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 0.2 | 1.3 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
| 0.2 | 0.8 | GO:0032279 | asymmetric synapse(GO:0032279) |
| 0.2 | 2.3 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.2 | 0.8 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.2 | 1.2 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.2 | 2.4 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.2 | 1.5 | GO:0043186 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
| 0.2 | 1.1 | GO:0008278 | cohesin complex(GO:0008278) |
| 0.2 | 0.8 | GO:0044393 | microspike(GO:0044393) |
| 0.2 | 2.3 | GO:0031594 | neuromuscular junction(GO:0031594) |
| 0.1 | 0.4 | GO:0031379 | RNA-directed RNA polymerase complex(GO:0031379) |
| 0.1 | 0.3 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 0.1 | 1.7 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.1 | 1.0 | GO:0097209 | epidermal lamellar body(GO:0097209) |
| 0.1 | 7.6 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.1 | 0.3 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.1 | 12.0 | GO:0005871 | kinesin complex(GO:0005871) |
| 0.1 | 0.1 | GO:0000939 | condensed chromosome inner kinetochore(GO:0000939) |
| 0.1 | 0.8 | GO:0000308 | cytoplasmic cyclin-dependent protein kinase holoenzyme complex(GO:0000308) |
| 0.1 | 0.7 | GO:0036156 | inner dynein arm(GO:0036156) |
| 0.1 | 1.4 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) |
| 0.1 | 0.8 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.1 | 1.4 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.1 | 23.8 | GO:0043204 | perikaryon(GO:0043204) |
| 0.1 | 1.1 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.1 | 1.6 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.1 | 0.1 | GO:1902710 | GABA receptor complex(GO:1902710) |
| 0.1 | 13.0 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.1 | 10.0 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
| 0.1 | 1.3 | GO:0034464 | BBSome(GO:0034464) |
| 0.1 | 0.8 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.1 | 0.4 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.1 | 1.3 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.1 | 2.8 | GO:0070822 | Sin3-type complex(GO:0070822) |
| 0.1 | 1.5 | GO:0030425 | dendrite(GO:0030425) |
| 0.1 | 3.8 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.1 | 0.9 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.1 | 0.9 | GO:0090568 | nuclear transcriptional repressor complex(GO:0090568) |
| 0.1 | 1.8 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.1 | 1.1 | GO:0030905 | retromer, tubulation complex(GO:0030905) |
| 0.1 | 1.4 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
| 0.1 | 0.9 | GO:1904949 | ATPase complex(GO:1904949) |
| 0.1 | 3.1 | GO:0033202 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 0.1 | 0.7 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.1 | 3.1 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
| 0.1 | 0.4 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.1 | 3.9 | GO:0031304 | intrinsic component of mitochondrial inner membrane(GO:0031304) integral component of mitochondrial inner membrane(GO:0031305) |
| 0.1 | 6.0 | GO:0000794 | condensed nuclear chromosome(GO:0000794) |
| 0.1 | 4.4 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.1 | 0.8 | GO:0005694 | chromosome(GO:0005694) |
| 0.1 | 1.3 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.1 | 4.1 | GO:0019898 | extrinsic component of membrane(GO:0019898) |
| 0.1 | 12.1 | GO:0099501 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
| 0.1 | 4.0 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.1 | 1.3 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.1 | 1.9 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.1 | 2.1 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.1 | 0.7 | GO:0005846 | nuclear cap binding complex(GO:0005846) |
| 0.1 | 0.9 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.1 | 0.2 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
| 0.1 | 1.0 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.1 | 0.9 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.1 | 0.7 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.1 | 10.2 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.1 | 0.5 | GO:0032449 | CBM complex(GO:0032449) |
| 0.1 | 2.7 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.1 | 2.2 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
| 0.1 | 0.7 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.1 | 0.6 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.1 | 1.1 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.1 | 1.8 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.1 | 2.2 | GO:0030658 | transport vesicle membrane(GO:0030658) |
| 0.1 | 0.2 | GO:0030135 | coated vesicle(GO:0030135) |
| 0.1 | 0.7 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.1 | 0.7 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.1 | 0.5 | GO:0016234 | inclusion body(GO:0016234) |
| 0.1 | 0.5 | GO:0000153 | cytoplasmic ubiquitin ligase complex(GO:0000153) |
| 0.1 | 0.5 | GO:0031417 | NatC complex(GO:0031417) |
| 0.1 | 1.8 | GO:0048500 | signal recognition particle(GO:0048500) |
| 0.1 | 0.3 | GO:0048269 | methionine adenosyltransferase complex(GO:0048269) |
| 0.1 | 0.2 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.1 | 3.6 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.1 | 1.3 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.1 | 0.5 | GO:0035370 | UBC13-UEV1A complex(GO:0035370) |
| 0.1 | 5.4 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.1 | 2.6 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.1 | 1.1 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.1 | 0.3 | GO:0009346 | citrate lyase complex(GO:0009346) |
| 0.1 | 1.2 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.1 | 4.8 | GO:0000786 | nucleosome(GO:0000786) |
| 0.1 | 0.9 | GO:0060091 | kinocilium(GO:0060091) |
| 0.1 | 4.5 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.1 | 0.4 | GO:0034361 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
| 0.1 | 1.1 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.1 | 0.6 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.1 | 0.3 | GO:0072563 | endothelial microparticle(GO:0072563) |
| 0.1 | 0.4 | GO:0032389 | MutLalpha complex(GO:0032389) |
| 0.1 | 0.6 | GO:0090661 | box H/ACA scaRNP complex(GO:0072589) box H/ACA telomerase RNP complex(GO:0090661) |
| 0.1 | 1.1 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.1 | 1.1 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.1 | 0.5 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.1 | 3.4 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.1 | 0.5 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.1 | 6.2 | GO:0044439 | microbody part(GO:0044438) peroxisomal part(GO:0044439) |
| 0.1 | 2.2 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.1 | 2.1 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.1 | 0.2 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
| 0.1 | 7.5 | GO:1903293 | protein serine/threonine phosphatase complex(GO:0008287) phosphatase complex(GO:1903293) |
| 0.1 | 0.6 | GO:0030891 | VCB complex(GO:0030891) |
| 0.1 | 0.3 | GO:0070931 | Golgi-associated vesicle lumen(GO:0070931) |
| 0.1 | 0.9 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.1 | 1.6 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
| 0.1 | 0.3 | GO:0071942 | XPC complex(GO:0071942) |
| 0.1 | 0.2 | GO:0034657 | GID complex(GO:0034657) |
| 0.1 | 2.4 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.1 | 1.3 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.1 | 0.2 | GO:0097134 | cyclin E1-CDK2 complex(GO:0097134) |
| 0.1 | 1.2 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.1 | 0.3 | GO:0016514 | SWI/SNF complex(GO:0016514) |
| 0.1 | 0.5 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.1 | 1.9 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.1 | 1.1 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.1 | 0.1 | GO:0030689 | Noc complex(GO:0030689) |
| 0.1 | 0.7 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.1 | 14.1 | GO:0098793 | presynapse(GO:0098793) |
| 0.1 | 1.6 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.1 | 0.9 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.1 | 0.9 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.1 | 0.8 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.1 | 0.6 | GO:0036020 | endolysosome membrane(GO:0036020) |
| 0.1 | 0.1 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
| 0.1 | 14.5 | GO:0000922 | spindle pole(GO:0000922) |
| 0.1 | 2.4 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.1 | 0.1 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.1 | 0.1 | GO:0005889 | hydrogen:potassium-exchanging ATPase complex(GO:0005889) |
| 0.1 | 0.2 | GO:0097637 | intrinsic component of autophagosome membrane(GO:0097636) integral component of autophagosome membrane(GO:0097637) |
| 0.1 | 8.6 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.1 | 4.5 | GO:0005844 | polysome(GO:0005844) |
| 0.1 | 0.6 | GO:0042589 | zymogen granule membrane(GO:0042589) |
| 0.1 | 0.1 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
| 0.1 | 5.4 | GO:0005761 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
| 0.1 | 8.8 | GO:0008021 | synaptic vesicle(GO:0008021) |
| 0.1 | 3.3 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
| 0.1 | 1.3 | GO:0036038 | MKS complex(GO:0036038) |
| 0.1 | 0.2 | GO:0042588 | zymogen granule(GO:0042588) |
| 0.1 | 0.4 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.1 | 6.9 | GO:0048475 | membrane coat(GO:0030117) coated membrane(GO:0048475) |
| 0.1 | 6.3 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.1 | 0.7 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
| 0.1 | 6.1 | GO:0031514 | motile cilium(GO:0031514) |
| 0.1 | 1.2 | GO:0033177 | proton-transporting two-sector ATPase complex, proton-transporting domain(GO:0033177) proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
| 0.1 | 2.0 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.1 | 0.4 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.1 | 1.0 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.1 | 1.7 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
| 0.1 | 0.2 | GO:0045272 | plasma membrane respiratory chain complex I(GO:0045272) |
| 0.1 | 0.1 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.1 | 0.1 | GO:0044308 | axonal spine(GO:0044308) |
| 0.1 | 3.6 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.1 | 0.2 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
| 0.1 | 0.4 | GO:1990393 | 3M complex(GO:1990393) |
| 0.1 | 32.2 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.1 | 1.0 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.1 | 0.9 | GO:0030904 | retromer complex(GO:0030904) |
| 0.1 | 0.9 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.1 | 0.6 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
| 0.1 | 1.0 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.1 | 0.6 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
| 0.1 | 2.9 | GO:0000151 | ubiquitin ligase complex(GO:0000151) |
| 0.1 | 0.2 | GO:0070695 | FHF complex(GO:0070695) |
| 0.1 | 0.4 | GO:0001652 | granular component(GO:0001652) |
| 0.1 | 5.0 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.1 | 0.4 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.1 | 1.0 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.1 | 2.1 | GO:0030286 | dynein complex(GO:0030286) |
| 0.1 | 0.3 | GO:0032044 | DSIF complex(GO:0032044) |
| 0.1 | 0.2 | GO:0070939 | Dsl1p complex(GO:0070939) |
| 0.1 | 5.1 | GO:0000776 | kinetochore(GO:0000776) |
| 0.1 | 2.1 | GO:0005859 | muscle myosin complex(GO:0005859) |
| 0.0 | 0.1 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.0 | 0.5 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 0.9 | GO:0016324 | apical plasma membrane(GO:0016324) |
| 0.0 | 0.3 | GO:0030426 | growth cone(GO:0030426) |
| 0.0 | 0.3 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.0 | 0.6 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 0.4 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.0 | 1.7 | GO:0005815 | microtubule organizing center(GO:0005815) |
| 0.0 | 1.4 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.0 | 2.8 | GO:0015030 | Cajal body(GO:0015030) |
| 0.0 | 3.9 | GO:0032155 | cell division site(GO:0032153) cell division site part(GO:0032155) |
| 0.0 | 0.6 | GO:0030686 | 90S preribosome(GO:0030686) |
| 0.0 | 0.5 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.0 | 2.2 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.0 | 0.1 | GO:0030895 | apolipoprotein B mRNA editing enzyme complex(GO:0030895) |
| 0.0 | 0.4 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.0 | 0.0 | GO:0016328 | lateral plasma membrane(GO:0016328) |
| 0.0 | 1.9 | GO:0036064 | ciliary basal body(GO:0036064) |
| 0.0 | 2.1 | GO:0031901 | early endosome membrane(GO:0031901) |
| 0.0 | 0.1 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
| 0.0 | 0.2 | GO:0000938 | GARP complex(GO:0000938) |
| 0.0 | 0.4 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.0 | 0.5 | GO:0060170 | ciliary membrane(GO:0060170) |
| 0.0 | 0.9 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
| 0.0 | 0.1 | GO:0032002 | interleukin-28 receptor complex(GO:0032002) |
| 0.0 | 0.1 | GO:1902494 | catalytic complex(GO:1902494) |
| 0.0 | 0.3 | GO:0031941 | filamentous actin(GO:0031941) |
| 0.0 | 0.8 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.0 | 0.3 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.0 | 1.1 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 0.1 | GO:0000974 | Prp19 complex(GO:0000974) |
| 0.0 | 1.1 | GO:0005769 | early endosome(GO:0005769) |
| 0.0 | 0.2 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
| 0.0 | 0.5 | GO:0031201 | SNARE complex(GO:0031201) |
| 0.0 | 0.1 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.0 | 0.2 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.0 | 0.5 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.0 | 5.6 | GO:0031227 | intrinsic component of endoplasmic reticulum membrane(GO:0031227) |
| 0.0 | 0.0 | GO:0098592 | cytoplasmic side of apical plasma membrane(GO:0098592) |
| 0.0 | 0.6 | GO:0098562 | cytoplasmic side of membrane(GO:0098562) |
| 0.0 | 0.5 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.0 | 0.1 | GO:0031082 | BLOC complex(GO:0031082) |
| 0.0 | 0.5 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
| 0.0 | 0.3 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.0 | 0.8 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.0 | 0.2 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| 0.0 | 0.1 | GO:1990357 | terminal web(GO:1990357) |
| 0.0 | 0.7 | GO:0044450 | microtubule organizing center part(GO:0044450) |
| 0.0 | 0.2 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.3 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.0 | 0.4 | GO:0098878 | ionotropic glutamate receptor complex(GO:0008328) neurotransmitter receptor complex(GO:0098878) |
| 0.0 | 0.1 | GO:0031527 | filopodium membrane(GO:0031527) |
| 0.0 | 0.1 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.0 | 0.4 | GO:0042599 | lamellar body(GO:0042599) |
| 0.0 | 9.0 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
| 0.0 | 0.1 | GO:0034669 | integrin alpha4-beta7 complex(GO:0034669) |
| 0.0 | 0.3 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.0 | 0.0 | GO:0009330 | DNA topoisomerase complex (ATP-hydrolyzing)(GO:0009330) |
| 0.0 | 0.1 | GO:0005900 | oncostatin-M receptor complex(GO:0005900) |
| 0.0 | 24.4 | GO:0005789 | endoplasmic reticulum membrane(GO:0005789) |
| 0.0 | 0.1 | GO:1903095 | microprocessor complex(GO:0070877) ribonuclease III complex(GO:1903095) |
| 0.0 | 0.1 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
| 0.0 | 0.3 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.0 | 1.3 | GO:0005929 | cilium(GO:0005929) |
| 0.0 | 0.9 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.0 | 0.1 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
| 0.0 | 0.5 | GO:0005930 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
| 0.0 | 0.3 | GO:0030496 | midbody(GO:0030496) |
| 0.0 | 0.2 | GO:0097433 | dense body(GO:0097433) |
| 0.0 | 0.3 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 0.0 | GO:0042022 | interleukin-12 receptor complex(GO:0042022) |
| 0.0 | 1.3 | GO:0045095 | keratin filament(GO:0045095) |
| 0.0 | 0.0 | GO:0070993 | translation preinitiation complex(GO:0070993) |
| 0.0 | 0.0 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.0 | 0.9 | GO:0034707 | chloride channel complex(GO:0034707) |
| 0.0 | 0.1 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.0 | 1.1 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.0 | 0.1 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.0 | 1.0 | GO:0055037 | recycling endosome(GO:0055037) |
| 0.0 | 0.0 | GO:0043657 | host(GO:0018995) host cell(GO:0043657) |
| 0.0 | 0.6 | GO:0019866 | organelle inner membrane(GO:0019866) |
| 0.0 | 0.0 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.0 | 1.2 | GO:0005813 | centrosome(GO:0005813) |
| 0.0 | 0.2 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.0 | 0.1 | GO:0071203 | WASH complex(GO:0071203) |
| 0.0 | 0.8 | GO:0019897 | extrinsic component of plasma membrane(GO:0019897) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.5 | 10.2 | GO:0004998 | transferrin receptor activity(GO:0004998) |
| 2.3 | 9.1 | GO:0050421 | cystathionine beta-synthase activity(GO:0004122) oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) nitrite reductase (NO-forming) activity(GO:0050421) carbon monoxide binding(GO:0070025) nitrite reductase activity(GO:0098809) |
| 2.2 | 11.0 | GO:0034584 | piRNA binding(GO:0034584) |
| 2.0 | 17.9 | GO:0004873 | asialoglycoprotein receptor activity(GO:0004873) |
| 1.9 | 1.9 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
| 1.7 | 6.8 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 1.6 | 7.9 | GO:0004306 | ethanolamine-phosphate cytidylyltransferase activity(GO:0004306) |
| 1.6 | 6.2 | GO:0035403 | histone kinase activity (H3-T6 specific)(GO:0035403) |
| 1.5 | 10.6 | GO:0042806 | fucose binding(GO:0042806) |
| 1.4 | 4.3 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 1.4 | 6.8 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 1.3 | 4.0 | GO:0008480 | sarcosine dehydrogenase activity(GO:0008480) |
| 1.3 | 4.0 | GO:0016730 | ferredoxin-NADP+ reductase activity(GO:0004324) NADPH-adrenodoxin reductase activity(GO:0015039) oxidoreductase activity, acting on iron-sulfur proteins as donors(GO:0016730) oxidoreductase activity, acting on iron-sulfur proteins as donors, NAD or NADP as acceptor(GO:0016731) |
| 1.3 | 4.0 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 1.3 | 3.8 | GO:0004794 | L-threonine ammonia-lyase activity(GO:0004794) |
| 1.2 | 10.0 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
| 1.2 | 17.3 | GO:0031014 | troponin T binding(GO:0031014) |
| 1.2 | 3.6 | GO:0015117 | thiosulfate transmembrane transporter activity(GO:0015117) oxaloacetate transmembrane transporter activity(GO:0015131) |
| 1.2 | 9.4 | GO:0004359 | glutaminase activity(GO:0004359) |
| 1.2 | 3.5 | GO:1990699 | palmitoleyl hydrolase activity(GO:1990699) |
| 1.2 | 6.9 | GO:0015307 | drug:proton antiporter activity(GO:0015307) |
| 1.1 | 3.3 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
| 1.1 | 6.5 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 1.1 | 3.2 | GO:0031877 | somatostatin receptor binding(GO:0031877) |
| 1.0 | 3.0 | GO:0052870 | tocopherol omega-hydroxylase activity(GO:0052870) alpha-tocopherol omega-hydroxylase activity(GO:0052871) 20-hydroxy-leukotriene B4 omega oxidase activity(GO:0097258) 20-aldehyde-leukotriene B4 20-monooxygenase activity(GO:0097259) |
| 1.0 | 4.0 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 1.0 | 4.9 | GO:0046592 | polyamine oxidase activity(GO:0046592) spermine:oxygen oxidoreductase (spermidine-forming) activity(GO:0052901) |
| 1.0 | 2.9 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 1.0 | 2.9 | GO:0071077 | coenzyme A transmembrane transporter activity(GO:0015228) adenosine 3',5'-bisphosphate transmembrane transporter activity(GO:0071077) AMP transmembrane transporter activity(GO:0080122) |
| 0.9 | 3.8 | GO:0008431 | vitamin E binding(GO:0008431) |
| 0.9 | 2.8 | GO:0047726 | iron-cytochrome-c reductase activity(GO:0047726) |
| 0.9 | 5.4 | GO:0052847 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) inositol diphosphate tetrakisphosphate diphosphatase activity(GO:0052840) inositol bisdiphosphate tetrakisphosphate diphosphatase activity(GO:0052841) inositol diphosphate pentakisphosphate diphosphatase activity(GO:0052842) inositol-1-diphosphate-2,3,4,5,6-pentakisphosphate diphosphatase activity(GO:0052843) inositol-3-diphosphate-1,2,4,5,6-pentakisphosphate diphosphatase activity(GO:0052844) inositol-5-diphosphate-1,2,3,4,6-pentakisphosphate diphosphatase activity(GO:0052845) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 1-diphosphatase activity(GO:0052846) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052847) inositol-3,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052848) |
| 0.9 | 2.7 | GO:0038131 | neuregulin receptor activity(GO:0038131) |
| 0.9 | 7.0 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
| 0.9 | 7.0 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
| 0.9 | 2.6 | GO:0008398 | sterol 14-demethylase activity(GO:0008398) |
| 0.8 | 4.1 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
| 0.8 | 8.7 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
| 0.8 | 2.4 | GO:0000224 | peptide-N4-(N-acetyl-beta-glucosaminyl)asparagine amidase activity(GO:0000224) |
| 0.8 | 3.1 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) leukotriene-B4 20-monooxygenase activity(GO:0050051) |
| 0.8 | 3.9 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 0.8 | 2.3 | GO:0004019 | adenylosuccinate synthase activity(GO:0004019) |
| 0.8 | 3.1 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
| 0.8 | 2.3 | GO:0047150 | betaine-homocysteine S-methyltransferase activity(GO:0047150) |
| 0.8 | 2.3 | GO:0055077 | gap junction hemi-channel activity(GO:0055077) |
| 0.7 | 2.2 | GO:0005365 | myo-inositol transmembrane transporter activity(GO:0005365) |
| 0.7 | 3.0 | GO:0015157 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.7 | 2.2 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 0.7 | 2.2 | GO:0004584 | dolichyl-phosphate-mannose-glycolipid alpha-mannosyltransferase activity(GO:0004584) |
| 0.7 | 2.9 | GO:0004047 | aminomethyltransferase activity(GO:0004047) |
| 0.7 | 2.9 | GO:0004802 | transketolase activity(GO:0004802) |
| 0.7 | 2.1 | GO:0033149 | FFAT motif binding(GO:0033149) |
| 0.7 | 2.8 | GO:0008336 | gamma-butyrobetaine dioxygenase activity(GO:0008336) |
| 0.7 | 4.1 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.7 | 5.5 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.7 | 8.9 | GO:0003910 | DNA ligase (ATP) activity(GO:0003910) |
| 0.7 | 2.1 | GO:0008478 | pyridoxal kinase activity(GO:0008478) |
| 0.7 | 2.7 | GO:0050698 | proteoglycan sulfotransferase activity(GO:0050698) |
| 0.7 | 0.7 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
| 0.7 | 2.7 | GO:0003865 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) steroid dehydrogenase activity, acting on the CH-CH group of donors(GO:0033765) cholestenone 5-alpha-reductase activity(GO:0047751) |
| 0.7 | 3.9 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.6 | 3.8 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 0.6 | 1.9 | GO:0016534 | cyclin-dependent protein kinase 5 activator activity(GO:0016534) |
| 0.6 | 2.5 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.6 | 1.9 | GO:0035643 | L-DOPA receptor activity(GO:0035643) L-DOPA binding(GO:0072544) |
| 0.6 | 3.1 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.6 | 3.0 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.6 | 1.8 | GO:0004421 | hydroxymethylglutaryl-CoA synthase activity(GO:0004421) |
| 0.6 | 7.1 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.6 | 5.9 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.6 | 0.6 | GO:0072510 | ferric iron transmembrane transporter activity(GO:0015091) trivalent inorganic cation transmembrane transporter activity(GO:0072510) |
| 0.6 | 2.3 | GO:0003974 | UDP-N-acetylglucosamine 4-epimerase activity(GO:0003974) UDP-glucose 4-epimerase activity(GO:0003978) |
| 0.6 | 4.1 | GO:0008481 | sphinganine kinase activity(GO:0008481) D-erythro-sphingosine kinase activity(GO:0017050) |
| 0.6 | 2.8 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.6 | 4.5 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
| 0.6 | 1.7 | GO:0046573 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 0.6 | 5.0 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.6 | 14.5 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.5 | 2.2 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.5 | 1.6 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.5 | 6.0 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 0.5 | 2.2 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
| 0.5 | 1.6 | GO:0098640 | integrin binding involved in cell-matrix adhesion(GO:0098640) |
| 0.5 | 2.1 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 0.5 | 6.7 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.5 | 6.1 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.5 | 1.5 | GO:0050693 | LBD domain binding(GO:0050693) |
| 0.5 | 1.5 | GO:0051500 | D-aminoacyl-tRNA deacylase activity(GO:0051499) D-tyrosyl-tRNA(Tyr) deacylase activity(GO:0051500) |
| 0.5 | 2.0 | GO:0047946 | glutamine N-acyltransferase activity(GO:0047946) |
| 0.5 | 2.5 | GO:0031208 | POZ domain binding(GO:0031208) |
| 0.5 | 1.0 | GO:0015180 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
| 0.5 | 5.4 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.5 | 2.9 | GO:0005497 | androgen binding(GO:0005497) |
| 0.5 | 2.4 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.5 | 5.8 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.5 | 1.4 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.5 | 1.9 | GO:0070643 | vitamin D3 25-hydroxylase activity(GO:0030343) vitamin D 25-hydroxylase activity(GO:0070643) |
| 0.5 | 2.4 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 0.5 | 3.3 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.5 | 1.9 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.5 | 2.3 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 0.5 | 5.6 | GO:0009922 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.5 | 0.9 | GO:0019003 | GDP binding(GO:0019003) |
| 0.5 | 2.3 | GO:0004104 | acetylcholinesterase activity(GO:0003990) cholinesterase activity(GO:0004104) |
| 0.5 | 1.8 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.5 | 7.8 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.5 | 3.2 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
| 0.5 | 1.4 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 0.5 | 4.1 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) acyl-CoA desaturase activity(GO:0016215) |
| 0.5 | 5.9 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.5 | 3.6 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
| 0.5 | 1.4 | GO:0050577 | GDP-4-dehydro-D-rhamnose reductase activity(GO:0042356) GDP-L-fucose synthase activity(GO:0050577) |
| 0.5 | 10.4 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.4 | 1.3 | GO:0030272 | 5-formyltetrahydrofolate cyclo-ligase activity(GO:0030272) |
| 0.4 | 1.3 | GO:0080101 | phosphatidyl-N-methylethanolamine N-methyltransferase activity(GO:0000773) phosphatidylethanolamine N-methyltransferase activity(GO:0004608) phosphatidyl-N-dimethylethanolamine N-methyltransferase activity(GO:0080101) |
| 0.4 | 3.5 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.4 | 1.7 | GO:0008518 | reduced folate carrier activity(GO:0008518) |
| 0.4 | 0.4 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.4 | 2.6 | GO:0070905 | serine binding(GO:0070905) |
| 0.4 | 1.3 | GO:0008476 | protein-tyrosine sulfotransferase activity(GO:0008476) |
| 0.4 | 8.9 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
| 0.4 | 1.7 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.4 | 5.9 | GO:0036310 | annealing helicase activity(GO:0036310) |
| 0.4 | 8.4 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.4 | 1.3 | GO:0005150 | interleukin-1, Type I receptor binding(GO:0005150) |
| 0.4 | 2.5 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
| 0.4 | 1.2 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
| 0.4 | 1.2 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
| 0.4 | 2.9 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.4 | 1.6 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
| 0.4 | 2.0 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.4 | 0.8 | GO:0001223 | transcription coactivator binding(GO:0001223) |
| 0.4 | 3.2 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.4 | 3.5 | GO:0032810 | sterol response element binding(GO:0032810) |
| 0.4 | 2.3 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
| 0.4 | 0.4 | GO:0047017 | prostaglandin-F synthase activity(GO:0047017) |
| 0.4 | 2.3 | GO:0001641 | group II metabotropic glutamate receptor activity(GO:0001641) |
| 0.4 | 0.8 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.4 | 1.1 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
| 0.4 | 1.1 | GO:0030984 | kininogen binding(GO:0030984) |
| 0.4 | 11.6 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.4 | 1.5 | GO:0035575 | histone demethylase activity (H4-K20 specific)(GO:0035575) |
| 0.4 | 1.5 | GO:0051733 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.4 | 1.8 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.4 | 3.7 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.4 | 1.1 | GO:0008746 | NAD(P)+ transhydrogenase activity(GO:0008746) oxidoreductase activity, acting on NAD(P)H, NAD(P) as acceptor(GO:0016652) |
| 0.4 | 2.2 | GO:1902444 | riboflavin binding(GO:1902444) |
| 0.4 | 1.1 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.4 | 1.4 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
| 0.4 | 1.8 | GO:0016428 | tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
| 0.3 | 1.7 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
| 0.3 | 1.4 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.3 | 1.0 | GO:0098782 | mechanically-gated potassium channel activity(GO:0098782) |
| 0.3 | 1.7 | GO:1990450 | linear polyubiquitin binding(GO:1990450) |
| 0.3 | 1.0 | GO:0032090 | Pyrin domain binding(GO:0032090) |
| 0.3 | 1.0 | GO:0015928 | alpha-L-fucosidase activity(GO:0004560) fucosidase activity(GO:0015928) |
| 0.3 | 0.7 | GO:0031403 | lithium ion binding(GO:0031403) |
| 0.3 | 4.3 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.3 | 4.3 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.3 | 0.3 | GO:0043139 | 5'-3' DNA helicase activity(GO:0043139) |
| 0.3 | 2.6 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.3 | 1.3 | GO:0004102 | choline O-acetyltransferase activity(GO:0004102) |
| 0.3 | 2.2 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.3 | 0.6 | GO:0003989 | acetyl-CoA carboxylase activity(GO:0003989) |
| 0.3 | 2.8 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.3 | 2.2 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
| 0.3 | 2.2 | GO:0042954 | lipoprotein transporter activity(GO:0042954) |
| 0.3 | 1.6 | GO:0035671 | enone reductase activity(GO:0035671) |
| 0.3 | 0.9 | GO:0048040 | UDP-glucuronate decarboxylase activity(GO:0048040) |
| 0.3 | 0.6 | GO:0047661 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
| 0.3 | 2.8 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.3 | 10.1 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
| 0.3 | 2.1 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
| 0.3 | 0.6 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.3 | 3.9 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.3 | 5.6 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.3 | 0.9 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.3 | 2.7 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.3 | 1.2 | GO:0004452 | isopentenyl-diphosphate delta-isomerase activity(GO:0004452) |
| 0.3 | 0.9 | GO:0033867 | Fas-activated serine/threonine kinase activity(GO:0033867) |
| 0.3 | 0.9 | GO:1904854 | proteasome core complex binding(GO:1904854) |
| 0.3 | 1.5 | GO:0102008 | cytosolic dipeptidase activity(GO:0102008) |
| 0.3 | 0.9 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
| 0.3 | 2.3 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.3 | 2.3 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.3 | 2.0 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.3 | 2.6 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.3 | 7.4 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.3 | 1.7 | GO:0051870 | methotrexate binding(GO:0051870) |
| 0.3 | 2.0 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.3 | 2.3 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
| 0.3 | 9.0 | GO:0005326 | neurotransmitter transporter activity(GO:0005326) |
| 0.3 | 3.3 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.3 | 3.3 | GO:0071253 | connexin binding(GO:0071253) |
| 0.3 | 4.6 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.3 | 4.9 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
| 0.3 | 0.3 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
| 0.3 | 0.8 | GO:0032143 | single thymine insertion binding(GO:0032143) |
| 0.3 | 3.8 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.3 | 2.4 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.3 | 1.1 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
| 0.3 | 1.9 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
| 0.3 | 2.4 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
| 0.3 | 0.8 | GO:0003863 | alpha-ketoacid dehydrogenase activity(GO:0003826) 3-methyl-2-oxobutanoate dehydrogenase (2-methylpropanoyl-transferring) activity(GO:0003863) |
| 0.3 | 0.3 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.3 | 3.5 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.3 | 2.9 | GO:0019237 | centromeric DNA binding(GO:0019237) |
| 0.3 | 1.3 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
| 0.3 | 4.5 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.3 | 1.6 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.3 | 0.8 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
| 0.3 | 10.9 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
| 0.3 | 1.0 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.3 | 5.7 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
| 0.3 | 2.1 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
| 0.3 | 1.3 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.3 | 2.0 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.3 | 0.3 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.3 | 0.8 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) |
| 0.3 | 1.3 | GO:0015056 | corticotrophin-releasing factor receptor activity(GO:0015056) |
| 0.3 | 3.5 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
| 0.3 | 0.3 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
| 0.2 | 12.0 | GO:0001972 | retinoic acid binding(GO:0001972) |
| 0.2 | 0.5 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
| 0.2 | 8.5 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.2 | 1.2 | GO:0002054 | nucleobase binding(GO:0002054) |
| 0.2 | 1.0 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
| 0.2 | 2.2 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.2 | 2.4 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
| 0.2 | 4.9 | GO:0015385 | sodium:proton antiporter activity(GO:0015385) |
| 0.2 | 6.3 | GO:0042165 | neurotransmitter binding(GO:0042165) |
| 0.2 | 1.7 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
| 0.2 | 1.2 | GO:0030375 | thyroid hormone receptor activator activity(GO:0010861) thyroid hormone receptor coactivator activity(GO:0030375) |
| 0.2 | 4.6 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.2 | 4.1 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.2 | 2.4 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 0.2 | 1.7 | GO:0042903 | tubulin deacetylase activity(GO:0042903) |
| 0.2 | 1.4 | GO:0016672 | oxidoreductase activity, acting on a sulfur group of donors, quinone or similar compound as acceptor(GO:0016672) glutathione dehydrogenase (ascorbate) activity(GO:0045174) methylarsonate reductase activity(GO:0050610) |
| 0.2 | 1.4 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
| 0.2 | 17.7 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.2 | 0.7 | GO:0001147 | transcription termination site sequence-specific DNA binding(GO:0001147) transcription termination site DNA binding(GO:0001160) |
| 0.2 | 2.1 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.2 | 1.2 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.2 | 0.9 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
| 0.2 | 2.6 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.2 | 1.4 | GO:0043532 | angiostatin binding(GO:0043532) |
| 0.2 | 1.2 | GO:0032145 | 4-aminobutyrate transaminase activity(GO:0003867) succinate-semialdehyde dehydrogenase binding(GO:0032145) (S)-3-amino-2-methylpropionate transaminase activity(GO:0047298) |
| 0.2 | 3.9 | GO:0016594 | glycine binding(GO:0016594) |
| 0.2 | 2.8 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.2 | 2.3 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.2 | 0.7 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.2 | 1.6 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.2 | 4.3 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.2 | 0.7 | GO:0015633 | zinc transporting ATPase activity(GO:0015633) |
| 0.2 | 0.7 | GO:0019781 | NEDD8 activating enzyme activity(GO:0019781) |
| 0.2 | 2.5 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
| 0.2 | 2.2 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
| 0.2 | 0.9 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
| 0.2 | 2.0 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
| 0.2 | 0.9 | GO:0016005 | phospholipase A2 activator activity(GO:0016005) |
| 0.2 | 0.2 | GO:0004031 | aldehyde oxidase activity(GO:0004031) |
| 0.2 | 2.2 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.2 | 2.7 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.2 | 1.3 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.2 | 2.2 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.2 | 3.1 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.2 | 0.9 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.2 | 2.4 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.2 | 3.5 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.2 | 0.9 | GO:0005026 | transforming growth factor beta receptor activity, type II(GO:0005026) |
| 0.2 | 3.8 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.2 | 0.6 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.2 | 0.8 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.2 | 0.6 | GO:0004155 | 6,7-dihydropteridine reductase activity(GO:0004155) |
| 0.2 | 1.1 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.2 | 1.3 | GO:0015189 | L-lysine transmembrane transporter activity(GO:0015189) |
| 0.2 | 0.8 | GO:0042132 | fructose 1,6-bisphosphate 1-phosphatase activity(GO:0042132) |
| 0.2 | 0.8 | GO:0004657 | proline dehydrogenase activity(GO:0004657) |
| 0.2 | 0.6 | GO:0015439 | heme-transporting ATPase activity(GO:0015439) |
| 0.2 | 0.2 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
| 0.2 | 0.8 | GO:0070404 | NADH binding(GO:0070404) |
| 0.2 | 2.1 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.2 | 0.2 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.2 | 0.8 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.2 | 1.0 | GO:0042799 | histone methyltransferase activity (H4-K20 specific)(GO:0042799) |
| 0.2 | 0.6 | GO:0061599 | molybdopterin adenylyltransferase activity(GO:0061598) molybdopterin molybdotransferase activity(GO:0061599) |
| 0.2 | 1.0 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
| 0.2 | 0.8 | GO:0004803 | transposase activity(GO:0004803) |
| 0.2 | 2.7 | GO:0004321 | fatty-acyl-CoA synthase activity(GO:0004321) |
| 0.2 | 2.9 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.2 | 0.6 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.2 | 2.0 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.2 | 6.1 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.2 | 2.4 | GO:0043531 | ADP binding(GO:0043531) |
| 0.2 | 1.0 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.2 | 1.0 | GO:0036080 | GDP-fucose transmembrane transporter activity(GO:0005457) purine nucleotide-sugar transmembrane transporter activity(GO:0036080) |
| 0.2 | 0.8 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
| 0.2 | 1.0 | GO:0052839 | inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
| 0.2 | 0.8 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.2 | 1.0 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
| 0.2 | 0.6 | GO:0030366 | molybdopterin synthase activity(GO:0030366) |
| 0.2 | 1.0 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
| 0.2 | 8.1 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.2 | 0.6 | GO:0098770 | FBXO family protein binding(GO:0098770) |
| 0.2 | 0.8 | GO:0008410 | CoA-transferase activity(GO:0008410) |
| 0.2 | 5.3 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.2 | 3.3 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.2 | 5.7 | GO:0090079 | translation regulator activity, nucleic acid binding(GO:0090079) |
| 0.2 | 0.2 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.2 | 1.2 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
| 0.2 | 1.9 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.2 | 4.5 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.2 | 0.8 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.2 | 3.1 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
| 0.2 | 0.8 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.2 | 0.6 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.2 | 2.5 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.2 | 1.1 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.2 | 0.8 | GO:0000035 | acyl binding(GO:0000035) |
| 0.2 | 1.7 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.2 | 0.9 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.2 | 0.6 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.2 | 3.3 | GO:0019841 | retinol binding(GO:0019841) |
| 0.2 | 0.6 | GO:0004315 | 3-oxoacyl-[acyl-carrier-protein] synthase activity(GO:0004315) |
| 0.2 | 1.3 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) intronic transcription regulatory region DNA binding(GO:0044213) |
| 0.2 | 1.8 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.2 | 0.9 | GO:1904408 | dihydronicotinamide riboside quinone reductase activity(GO:0001512) melatonin binding(GO:1904408) |
| 0.2 | 0.7 | GO:0008534 | oxidized purine nucleobase lesion DNA N-glycosylase activity(GO:0008534) |
| 0.2 | 0.5 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.2 | 1.3 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.2 | 0.5 | GO:0008969 | phosphohistidine phosphatase activity(GO:0008969) |
| 0.2 | 0.7 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.2 | 1.2 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
| 0.2 | 0.5 | GO:0047536 | 2-aminoadipate transaminase activity(GO:0047536) |
| 0.2 | 0.5 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.2 | 21.2 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.2 | 0.9 | GO:0003883 | CTP synthase activity(GO:0003883) |
| 0.2 | 0.5 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
| 0.2 | 0.5 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.2 | 2.2 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.2 | 2.1 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.2 | 0.7 | GO:0035501 | MH1 domain binding(GO:0035501) |
| 0.2 | 0.5 | GO:0031531 | thyrotropin-releasing hormone receptor binding(GO:0031531) |
| 0.2 | 6.1 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.2 | 3.2 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.2 | 1.4 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.2 | 3.9 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.2 | 0.8 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.2 | 1.7 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.2 | 3.7 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
| 0.2 | 0.5 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 0.2 | 0.5 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.2 | 2.1 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
| 0.2 | 1.0 | GO:0044594 | 3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-enoyl-CoA hydratase activity(GO:0033989) 17-beta-hydroxysteroid dehydrogenase (NAD+) activity(GO:0044594) |
| 0.2 | 1.3 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.2 | 0.5 | GO:0004827 | proline-tRNA ligase activity(GO:0004827) |
| 0.2 | 2.3 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) RNA polymerase activity(GO:0034062) |
| 0.2 | 1.0 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.2 | 1.8 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
| 0.2 | 1.8 | GO:0030348 | syntaxin-3 binding(GO:0030348) |
| 0.2 | 1.8 | GO:0008242 | omega peptidase activity(GO:0008242) |
| 0.2 | 0.6 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
| 0.2 | 0.5 | GO:1904713 | beta-catenin destruction complex binding(GO:1904713) |
| 0.2 | 0.5 | GO:0017082 | mineralocorticoid receptor activity(GO:0017082) |
| 0.2 | 4.2 | GO:0001046 | core promoter sequence-specific DNA binding(GO:0001046) |
| 0.2 | 0.6 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
| 0.2 | 3.3 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) potassium-transporting ATPase activity(GO:0008556) |
| 0.2 | 2.1 | GO:0071949 | FAD binding(GO:0071949) |
| 0.2 | 1.6 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.2 | 1.7 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.2 | 2.0 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
| 0.2 | 0.9 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.2 | 0.8 | GO:0004850 | uridine phosphorylase activity(GO:0004850) |
| 0.2 | 0.6 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.2 | 2.2 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
| 0.2 | 0.2 | GO:0019808 | polyamine binding(GO:0019808) |
| 0.2 | 0.6 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
| 0.2 | 4.3 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.2 | 0.6 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
| 0.2 | 0.5 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.2 | 0.2 | GO:0019826 | oxygen sensor activity(GO:0019826) |
| 0.2 | 0.5 | GO:0001099 | basal transcription machinery binding(GO:0001098) basal RNA polymerase II transcription machinery binding(GO:0001099) |
| 0.2 | 1.1 | GO:0016835 | carbon-oxygen lyase activity(GO:0016835) |
| 0.2 | 0.8 | GO:0005113 | patched binding(GO:0005113) |
| 0.2 | 0.6 | GO:0004113 | 2',3'-cyclic-nucleotide 3'-phosphodiesterase activity(GO:0004113) |
| 0.2 | 2.9 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.2 | 1.1 | GO:0005353 | fructose transmembrane transporter activity(GO:0005353) |
| 0.2 | 5.4 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.1 | 5.1 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.1 | 24.3 | GO:0019905 | syntaxin binding(GO:0019905) |
| 0.1 | 1.9 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
| 0.1 | 1.2 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
| 0.1 | 0.7 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.1 | 0.4 | GO:0004040 | amidase activity(GO:0004040) |
| 0.1 | 0.7 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.1 | 0.7 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 0.1 | 1.2 | GO:0004844 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
| 0.1 | 5.3 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
| 0.1 | 2.8 | GO:0005003 | ephrin receptor activity(GO:0005003) |
| 0.1 | 1.8 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.1 | 0.3 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
| 0.1 | 3.6 | GO:0016278 | lysine N-methyltransferase activity(GO:0016278) |
| 0.1 | 1.5 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.1 | 0.7 | GO:0004991 | parathyroid hormone receptor activity(GO:0004991) |
| 0.1 | 5.2 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.1 | 0.9 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.1 | 0.3 | GO:0051990 | (R)-2-hydroxyglutarate dehydrogenase activity(GO:0051990) |
| 0.1 | 0.4 | GO:0016495 | C-X3-C chemokine receptor activity(GO:0016495) |
| 0.1 | 0.4 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.1 | 0.3 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.1 | 0.6 | GO:0043813 | phosphatidylinositol-3,5-bisphosphate 5-phosphatase activity(GO:0043813) |
| 0.1 | 0.4 | GO:0004823 | leucine-tRNA ligase activity(GO:0004823) |
| 0.1 | 3.1 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
| 0.1 | 0.4 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.1 | 0.7 | GO:0004337 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
| 0.1 | 1.0 | GO:0023025 | MHC class Ib protein complex binding(GO:0023025) MHC class Ib protein binding, via antigen binding groove(GO:0023030) |
| 0.1 | 0.7 | GO:0004441 | inositol-1,4-bisphosphate 1-phosphatase activity(GO:0004441) inositol-1,3,4-trisphosphate 1-phosphatase activity(GO:0052829) |
| 0.1 | 2.1 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.1 | 0.4 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
| 0.1 | 0.8 | GO:0008732 | glycine hydroxymethyltransferase activity(GO:0004372) threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.1 | 1.0 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.1 | 1.2 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
| 0.1 | 0.5 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 0.1 | 0.7 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 0.1 | 3.3 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.1 | 1.5 | GO:0030020 | extracellular matrix structural constituent conferring tensile strength(GO:0030020) |
| 0.1 | 6.9 | GO:0019894 | kinesin binding(GO:0019894) |
| 0.1 | 0.7 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.1 | 0.5 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
| 0.1 | 1.1 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.1 | 0.9 | GO:0004996 | thyroid-stimulating hormone receptor activity(GO:0004996) |
| 0.1 | 0.5 | GO:0004335 | galactokinase activity(GO:0004335) |
| 0.1 | 0.5 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.1 | 1.0 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
| 0.1 | 0.1 | GO:0016898 | D-lactate dehydrogenase (cytochrome) activity(GO:0004458) oxidoreductase activity, acting on the CH-OH group of donors, cytochrome as acceptor(GO:0016898) |
| 0.1 | 3.5 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
| 0.1 | 0.3 | GO:0015616 | DNA translocase activity(GO:0015616) |
| 0.1 | 1.2 | GO:0090599 | alpha-glucosidase activity(GO:0090599) |
| 0.1 | 0.5 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.1 | 0.6 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
| 0.1 | 0.3 | GO:0003996 | acyl-CoA ligase activity(GO:0003996) |
| 0.1 | 1.3 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.1 | 0.5 | GO:0009383 | rRNA (cytosine-C5-)-methyltransferase activity(GO:0009383) |
| 0.1 | 1.1 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.1 | 0.4 | GO:0050429 | calcium-dependent phospholipase C activity(GO:0050429) |
| 0.1 | 0.1 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
| 0.1 | 1.0 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.1 | 3.0 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
| 0.1 | 0.5 | GO:0000248 | C-5 sterol desaturase activity(GO:0000248) sterol desaturase activity(GO:0070704) |
| 0.1 | 1.0 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
| 0.1 | 0.5 | GO:0030337 | DNA polymerase processivity factor activity(GO:0030337) |
| 0.1 | 2.1 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.1 | 0.5 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
| 0.1 | 1.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.1 | 1.5 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.1 | 2.0 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.1 | 0.7 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.1 | 0.1 | GO:0004818 | glutamate-tRNA ligase activity(GO:0004818) |
| 0.1 | 1.6 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.1 | 1.0 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.1 | 1.0 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.1 | 0.5 | GO:0008761 | UDP-N-acetylglucosamine 2-epimerase activity(GO:0008761) N-acylmannosamine kinase activity(GO:0009384) |
| 0.1 | 0.4 | GO:0016426 | tRNA (adenine) methyltransferase activity(GO:0016426) tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
| 0.1 | 0.5 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.1 | 0.4 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.1 | 0.8 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.1 | 0.6 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
| 0.1 | 3.0 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.1 | 0.3 | GO:0016768 | spermine synthase activity(GO:0016768) |
| 0.1 | 31.7 | GO:0042393 | histone binding(GO:0042393) |
| 0.1 | 0.6 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.1 | 2.3 | GO:0004659 | prenyltransferase activity(GO:0004659) |
| 0.1 | 0.1 | GO:0004817 | cysteine-tRNA ligase activity(GO:0004817) |
| 0.1 | 10.5 | GO:0008080 | N-acetyltransferase activity(GO:0008080) |
| 0.1 | 0.8 | GO:0050542 | icosanoid binding(GO:0050542) fatty acid derivative binding(GO:1901567) |
| 0.1 | 5.0 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.1 | 1.3 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.1 | 0.5 | GO:0097363 | protein O-GlcNAc transferase activity(GO:0097363) |
| 0.1 | 0.5 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 0.1 | 0.2 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.1 | 0.7 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.1 | 1.2 | GO:0060002 | plus-end directed microfilament motor activity(GO:0060002) |
| 0.1 | 12.3 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.1 | 0.3 | GO:0033906 | hyaluronoglucuronidase activity(GO:0033906) |
| 0.1 | 1.3 | GO:0009374 | biotin binding(GO:0009374) |
| 0.1 | 0.5 | GO:0016979 | lipoate-protein ligase activity(GO:0016979) |
| 0.1 | 0.3 | GO:0003842 | 1-pyrroline-5-carboxylate dehydrogenase activity(GO:0003842) |
| 0.1 | 0.5 | GO:0030151 | molybdenum ion binding(GO:0030151) |
| 0.1 | 0.5 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
| 0.1 | 3.0 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
| 0.1 | 2.5 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
| 0.1 | 11.5 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
| 0.1 | 3.4 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.1 | 4.2 | GO:0031369 | translation initiation factor binding(GO:0031369) |
| 0.1 | 1.3 | GO:0030548 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
| 0.1 | 0.5 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
| 0.1 | 0.4 | GO:0005115 | receptor tyrosine kinase-like orphan receptor binding(GO:0005115) chemoattractant activity involved in axon guidance(GO:1902379) |
| 0.1 | 2.0 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
| 0.1 | 0.2 | GO:0000403 | Y-form DNA binding(GO:0000403) |
| 0.1 | 2.5 | GO:0000339 | RNA cap binding(GO:0000339) |
| 0.1 | 0.2 | GO:0035242 | histone-arginine N-methyltransferase activity(GO:0008469) protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
| 0.1 | 0.5 | GO:0044736 | acid-sensing ion channel activity(GO:0044736) |
| 0.1 | 3.1 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.1 | 0.3 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
| 0.1 | 1.5 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.1 | 0.3 | GO:0034041 | sterol-transporting ATPase activity(GO:0034041) |
| 0.1 | 0.3 | GO:0070119 | ciliary neurotrophic factor binding(GO:0070119) |
| 0.1 | 0.8 | GO:0052794 | exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
| 0.1 | 2.5 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.1 | 0.3 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.1 | 0.3 | GO:0003968 | RNA-directed RNA polymerase activity(GO:0003968) |
| 0.1 | 0.9 | GO:0016167 | glial cell-derived neurotrophic factor receptor activity(GO:0016167) |
| 0.1 | 0.4 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.1 | 1.0 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.1 | 1.5 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.1 | 0.1 | GO:0008169 | C-methyltransferase activity(GO:0008169) |
| 0.1 | 18.4 | GO:0004386 | helicase activity(GO:0004386) |
| 0.1 | 1.7 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
| 0.1 | 0.3 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.1 | 3.2 | GO:0008066 | glutamate receptor activity(GO:0008066) |
| 0.1 | 1.7 | GO:0005402 | sugar:proton symporter activity(GO:0005351) cation:sugar symporter activity(GO:0005402) |
| 0.1 | 0.2 | GO:0016453 | C-acetyltransferase activity(GO:0016453) |
| 0.1 | 0.9 | GO:0015501 | glutamate:sodium symporter activity(GO:0015501) |
| 0.1 | 0.4 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.1 | 0.3 | GO:0050254 | rhodopsin kinase activity(GO:0050254) |
| 0.1 | 2.7 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.1 | 1.2 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.1 | 1.6 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.1 | 1.8 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
| 0.1 | 0.3 | GO:0003878 | ATP citrate synthase activity(GO:0003878) |
| 0.1 | 1.0 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.1 | 1.9 | GO:0008061 | chitin binding(GO:0008061) |
| 0.1 | 1.1 | GO:0016840 | carbon-nitrogen lyase activity(GO:0016840) |
| 0.1 | 0.6 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.1 | 2.2 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
| 0.1 | 2.6 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.1 | 1.1 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.1 | 2.4 | GO:0000030 | mannosyltransferase activity(GO:0000030) |
| 0.1 | 2.0 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.1 | 0.4 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.1 | 1.4 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.1 | 0.7 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.1 | 1.1 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.1 | 0.4 | GO:0008094 | DNA-dependent ATPase activity(GO:0008094) |
| 0.1 | 0.3 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
| 0.1 | 0.4 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
| 0.1 | 0.3 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 0.1 | 0.7 | GO:1903136 | cuprous ion binding(GO:1903136) |
| 0.1 | 0.3 | GO:0061663 | NEDD8 ligase activity(GO:0061663) |
| 0.1 | 0.3 | GO:0005171 | hepatocyte growth factor receptor binding(GO:0005171) |
| 0.1 | 0.7 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.1 | 0.4 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.1 | 0.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.1 | 0.3 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 0.1 | 0.3 | GO:0031862 | prostanoid receptor binding(GO:0031862) |
| 0.1 | 0.8 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
| 0.1 | 1.5 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.1 | 0.1 | GO:0038049 | transcription factor activity, ligand-activated RNA polymerase II transcription factor binding(GO:0038049) |
| 0.1 | 7.8 | GO:0019213 | deacetylase activity(GO:0019213) |
| 0.1 | 0.2 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.1 | 0.3 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.1 | 1.2 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
| 0.1 | 1.6 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.1 | 0.2 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.1 | 0.7 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
| 0.1 | 1.1 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.1 | 0.5 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.1 | 0.2 | GO:0090541 | MIT domain binding(GO:0090541) |
| 0.1 | 1.7 | GO:0008143 | poly(A) binding(GO:0008143) |
| 0.1 | 0.8 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.1 | 0.8 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
| 0.1 | 0.3 | GO:0005459 | UDP-galactose transmembrane transporter activity(GO:0005459) |
| 0.1 | 0.5 | GO:0015101 | organic cation transmembrane transporter activity(GO:0015101) |
| 0.1 | 1.5 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
| 0.1 | 0.2 | GO:0050253 | retinyl-palmitate esterase activity(GO:0050253) |
| 0.1 | 0.7 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.1 | 0.2 | GO:0004960 | thromboxane receptor activity(GO:0004960) thromboxane A2 receptor activity(GO:0004961) |
| 0.1 | 0.8 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.1 | 0.6 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
| 0.1 | 1.9 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.1 | 0.2 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
| 0.1 | 0.1 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
| 0.1 | 0.3 | GO:0032296 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
| 0.1 | 0.6 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.1 | 0.2 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.1 | 54.7 | GO:0004842 | ubiquitin-protein transferase activity(GO:0004842) |
| 0.1 | 0.4 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.1 | 1.3 | GO:0030515 | snoRNA binding(GO:0030515) |
| 0.1 | 3.5 | GO:0050661 | NADP binding(GO:0050661) |
| 0.1 | 2.0 | GO:0070034 | telomerase RNA binding(GO:0070034) |
| 0.1 | 6.3 | GO:0048365 | Rac GTPase binding(GO:0048365) |
| 0.1 | 1.6 | GO:0036442 | hydrogen-exporting ATPase activity(GO:0036442) proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.1 | 1.7 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.1 | 2.0 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.1 | 0.7 | GO:0004527 | exonuclease activity(GO:0004527) 3'-5' exonuclease activity(GO:0008408) |
| 0.1 | 0.2 | GO:0004951 | cholecystokinin receptor activity(GO:0004951) |
| 0.1 | 0.7 | GO:0031628 | opioid receptor binding(GO:0031628) |
| 0.1 | 0.4 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.1 | 0.2 | GO:0004483 | mRNA (nucleoside-2'-O-)-methyltransferase activity(GO:0004483) |
| 0.1 | 0.2 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.1 | 0.2 | GO:0004467 | long-chain fatty acid-CoA ligase activity(GO:0004467) |
| 0.1 | 1.2 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.1 | 0.2 | GO:0015275 | stretch-activated, cation-selective, calcium channel activity(GO:0015275) |
| 0.1 | 0.3 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.1 | 1.2 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.1 | 1.7 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 0.1 | 0.3 | GO:0022865 | transmembrane electron transfer carrier(GO:0022865) |
| 0.1 | 0.5 | GO:0001733 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.1 | 1.1 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.1 | 2.4 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.1 | 0.3 | GO:0004572 | mannosyl-oligosaccharide 1,3-1,6-alpha-mannosidase activity(GO:0004572) |
| 0.1 | 4.3 | GO:0030145 | manganese ion binding(GO:0030145) |
| 0.1 | 1.0 | GO:0008392 | arachidonic acid monooxygenase activity(GO:0008391) arachidonic acid epoxygenase activity(GO:0008392) |
| 0.1 | 0.7 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.1 | 0.5 | GO:0060698 | endoribonuclease inhibitor activity(GO:0060698) |
| 0.1 | 0.2 | GO:0019150 | D-ribulokinase activity(GO:0019150) |
| 0.1 | 0.3 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.1 | 0.4 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.1 | 1.3 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.1 | 0.3 | GO:0052642 | lysophosphatidic acid phosphatase activity(GO:0052642) |
| 0.1 | 3.4 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
| 0.1 | 0.6 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.1 | 0.2 | GO:0047708 | biotinidase activity(GO:0047708) |
| 0.1 | 0.1 | GO:0050659 | N-acetylgalactosamine 4-sulfate 6-O-sulfotransferase activity(GO:0050659) |
| 0.1 | 0.6 | GO:0030882 | lipid antigen binding(GO:0030882) endogenous lipid antigen binding(GO:0030883) exogenous lipid antigen binding(GO:0030884) |
| 0.1 | 0.4 | GO:0004137 | deoxycytidine kinase activity(GO:0004137) |
| 0.1 | 0.1 | GO:0015350 | methotrexate transporter activity(GO:0015350) |
| 0.1 | 0.3 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) protein histidine kinase activity(GO:0004673) |
| 0.1 | 0.5 | GO:0050682 | AF-2 domain binding(GO:0050682) |
| 0.1 | 1.9 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
| 0.1 | 2.1 | GO:0015301 | anion:anion antiporter activity(GO:0015301) |
| 0.1 | 0.2 | GO:0052744 | phosphatidylinositol-3-phosphatase activity(GO:0004438) phosphatidylinositol monophosphate phosphatase activity(GO:0052744) |
| 0.1 | 2.7 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
| 0.1 | 0.7 | GO:0033691 | sialic acid binding(GO:0033691) |
| 0.1 | 0.2 | GO:0046625 | sphingolipid binding(GO:0046625) |
| 0.1 | 0.4 | GO:0047894 | flavonol 3-sulfotransferase activity(GO:0047894) |
| 0.1 | 0.5 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
| 0.1 | 0.8 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
| 0.1 | 0.2 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
| 0.1 | 1.7 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.1 | 0.2 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.1 | 0.8 | GO:0015924 | mannosyl-oligosaccharide mannosidase activity(GO:0015924) |
| 0.1 | 0.5 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
| 0.1 | 4.1 | GO:0030971 | receptor tyrosine kinase binding(GO:0030971) |
| 0.1 | 0.2 | GO:0035243 | protein-arginine omega-N symmetric methyltransferase activity(GO:0035243) |
| 0.1 | 0.7 | GO:1990782 | protein tyrosine kinase binding(GO:1990782) |
| 0.1 | 2.4 | GO:0016763 | transferase activity, transferring pentosyl groups(GO:0016763) |
| 0.1 | 0.1 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
| 0.1 | 2.0 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.1 | 0.3 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.1 | 0.2 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
| 0.1 | 0.3 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.1 | 2.5 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.1 | 0.2 | GO:0015218 | pyrimidine nucleotide transmembrane transporter activity(GO:0015218) |
| 0.1 | 0.6 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.1 | 0.9 | GO:0016289 | CoA hydrolase activity(GO:0016289) |
| 0.1 | 0.3 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.0 | 0.3 | GO:0004882 | androgen receptor activity(GO:0004882) |
| 0.0 | 0.6 | GO:0043225 | anion transmembrane-transporting ATPase activity(GO:0043225) |
| 0.0 | 0.1 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.0 | 0.1 | GO:0016639 | oxidoreductase activity, acting on the CH-NH2 group of donors, NAD or NADP as acceptor(GO:0016639) |
| 0.0 | 0.1 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) |
| 0.0 | 0.1 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.0 | 0.1 | GO:0050146 | nucleoside phosphotransferase activity(GO:0050146) |
| 0.0 | 0.2 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
| 0.0 | 0.2 | GO:0003943 | N-acetylgalactosamine-4-sulfatase activity(GO:0003943) |
| 0.0 | 0.2 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.0 | 0.3 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 0.0 | 0.2 | GO:0004132 | dCMP deaminase activity(GO:0004132) |
| 0.0 | 0.5 | GO:0031433 | telethonin binding(GO:0031433) |
| 0.0 | 0.3 | GO:0001225 | RNA polymerase II transcription coactivator binding(GO:0001225) |
| 0.0 | 0.4 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.0 | 0.3 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
| 0.0 | 0.3 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.0 | 1.6 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.0 | 0.1 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.0 | 2.1 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 0.0 | 0.2 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.0 | 4.3 | GO:0008168 | methyltransferase activity(GO:0008168) |
| 0.0 | 0.1 | GO:0004513 | neolactotetraosylceramide alpha-2,3-sialyltransferase activity(GO:0004513) lactosylceramide alpha-2,3-sialyltransferase activity(GO:0047291) |
| 0.0 | 0.2 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.0 | 0.1 | GO:0050571 | 1,5-anhydro-D-fructose reductase activity(GO:0050571) |
| 0.0 | 0.1 | GO:0004766 | spermidine synthase activity(GO:0004766) |
| 0.0 | 1.3 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
| 0.0 | 0.2 | GO:0032135 | DNA insertion or deletion binding(GO:0032135) |
| 0.0 | 0.3 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.0 | 0.3 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.0 | 2.1 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.0 | 0.8 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.0 | 0.5 | GO:0045125 | bioactive lipid receptor activity(GO:0045125) |
| 0.0 | 0.6 | GO:0047144 | 2-acylglycerol-3-phosphate O-acyltransferase activity(GO:0047144) |
| 0.0 | 2.1 | GO:0015485 | cholesterol binding(GO:0015485) |
| 0.0 | 0.1 | GO:0052856 | NADHX epimerase activity(GO:0052856) NADPHX epimerase activity(GO:0052857) |
| 0.0 | 18.4 | GO:0003682 | chromatin binding(GO:0003682) |
| 0.0 | 0.4 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
| 0.0 | 0.0 | GO:0009041 | uridylate kinase activity(GO:0009041) |
| 0.0 | 0.3 | GO:0097199 | cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097199) |
| 0.0 | 1.3 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.0 | 0.1 | GO:0046964 | 3'-phosphoadenosine 5'-phosphosulfate transmembrane transporter activity(GO:0046964) |
| 0.0 | 3.4 | GO:0003713 | transcription coactivator activity(GO:0003713) |
| 0.0 | 0.2 | GO:0001601 | peptide YY receptor activity(GO:0001601) |
| 0.0 | 0.5 | GO:0019787 | ubiquitin-like protein transferase activity(GO:0019787) |
| 0.0 | 0.1 | GO:0008511 | sodium:potassium:chloride symporter activity(GO:0008511) |
| 0.0 | 0.7 | GO:0043495 | protein anchor(GO:0043495) |
| 0.0 | 1.2 | GO:0015175 | neutral amino acid transmembrane transporter activity(GO:0015175) |
| 0.0 | 0.2 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.0 | 0.4 | GO:0015464 | acetylcholine receptor activity(GO:0015464) |
| 0.0 | 0.2 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
| 0.0 | 0.2 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.0 | 1.2 | GO:0003951 | NAD+ kinase activity(GO:0003951) |
| 0.0 | 0.1 | GO:0004530 | deoxyribonuclease I activity(GO:0004530) |
| 0.0 | 0.0 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.0 | 0.1 | GO:0030626 | U12 snRNA binding(GO:0030626) |
| 0.0 | 0.1 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
| 0.0 | 0.1 | GO:0046870 | cadmium ion binding(GO:0046870) |
| 0.0 | 0.4 | GO:0089720 | caspase binding(GO:0089720) |
| 0.0 | 0.3 | GO:0008430 | selenium binding(GO:0008430) |
| 0.0 | 1.9 | GO:0008028 | monocarboxylic acid transmembrane transporter activity(GO:0008028) |
| 0.0 | 0.1 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.0 | 0.6 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.0 | 0.2 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.0 | 1.3 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
| 0.0 | 0.0 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.0 | 0.5 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.0 | 0.1 | GO:0061711 | N(6)-L-threonylcarbamoyladenine synthase(GO:0061711) |
| 0.0 | 0.8 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.0 | 0.1 | GO:0008234 | cysteine-type peptidase activity(GO:0008234) |
| 0.0 | 0.2 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
| 0.0 | 0.5 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 0.1 | GO:0004379 | glycylpeptide N-tetradecanoyltransferase activity(GO:0004379) myristoyltransferase activity(GO:0019107) |
| 0.0 | 0.3 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
| 0.0 | 0.1 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
| 0.0 | 0.3 | GO:0043176 | amine binding(GO:0043176) serotonin binding(GO:0051378) |
| 0.0 | 0.2 | GO:0046556 | alpha-L-arabinofuranosidase activity(GO:0046556) |
| 0.0 | 0.4 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.0 | 0.8 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.0 | 0.1 | GO:0060001 | minus-end directed microfilament motor activity(GO:0060001) |
| 0.0 | 0.1 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.0 | 0.2 | GO:0010181 | FMN binding(GO:0010181) |
| 0.0 | 0.1 | GO:0090409 | malonyl-CoA synthetase activity(GO:0090409) |
| 0.0 | 1.0 | GO:0019783 | ubiquitin-like protein-specific protease activity(GO:0019783) |
| 0.0 | 0.1 | GO:0031071 | cysteine desulfurase activity(GO:0031071) |
| 0.0 | 0.0 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
| 0.0 | 0.3 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
| 0.0 | 0.4 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.0 | 0.3 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 0.0 | 0.1 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
| 0.0 | 0.1 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
| 0.0 | 0.1 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
| 0.0 | 0.8 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.0 | 0.0 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
| 0.0 | 0.1 | GO:0016499 | orexin receptor activity(GO:0016499) |
| 0.0 | 0.3 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
| 0.0 | 0.1 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.0 | 59.7 | GO:0003677 | DNA binding(GO:0003677) |
| 0.0 | 0.1 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
| 0.0 | 0.1 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
| 0.0 | 1.3 | GO:0004175 | endopeptidase activity(GO:0004175) |
| 0.0 | 0.4 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.0 | 0.0 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.0 | 0.1 | GO:0016409 | palmitoyltransferase activity(GO:0016409) |
| 0.0 | 0.4 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
| 0.0 | 0.0 | GO:0015229 | L-ascorbate:sodium symporter activity(GO:0008520) L-ascorbic acid transporter activity(GO:0015229) sodium-dependent L-ascorbate transmembrane transporter activity(GO:0070890) |
| 0.0 | 0.2 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.0 | 0.3 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.0 | 0.2 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.0 | 0.0 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
| 0.0 | 0.2 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.0 | 0.8 | GO:0005549 | odorant binding(GO:0005549) |
| 0.0 | 0.7 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.0 | 0.1 | GO:0008441 | 3'(2'),5'-bisphosphate nucleotidase activity(GO:0008441) |
| 0.0 | 0.1 | GO:0022821 | potassium ion antiporter activity(GO:0022821) |
| 0.0 | 0.4 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.0 | 3.3 | GO:0017137 | Rab GTPase binding(GO:0017137) |
| 0.0 | 0.1 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
| 0.0 | 1.5 | GO:0051082 | unfolded protein binding(GO:0051082) |
| 0.0 | 0.2 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
| 0.0 | 0.2 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.0 | 0.1 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.0 | 0.5 | GO:0019707 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.0 | 0.2 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.0 | 0.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.0 | 0.0 | GO:1904493 | Ac-Asp-Glu binding(GO:1904492) tetrahydrofolyl-poly(glutamate) polymer binding(GO:1904493) |
| 0.0 | 0.2 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.0 | 0.0 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.0 | 1.7 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.0 | 0.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.0 | 0.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.0 | 0.1 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
| 0.0 | 0.0 | GO:0034483 | heparan sulfate sulfotransferase activity(GO:0034483) |
Gene overrepresentation in curated gene sets: canonical pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.8 | 1.6 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.2 | 0.7 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.2 | 6.6 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.2 | 8.0 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.2 | 14.8 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
| 0.2 | 14.0 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.2 | 3.4 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.2 | 6.2 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.2 | 5.3 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.1 | 1.2 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.1 | 0.7 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.1 | 0.3 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.1 | 9.3 | PID ATR PATHWAY | ATR signaling pathway |
| 0.1 | 0.2 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.1 | 1.3 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.1 | 4.4 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
| 0.1 | 1.7 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.1 | 0.5 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
| 0.1 | 3.3 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.1 | 4.3 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.1 | 1.5 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.1 | 2.1 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.1 | 2.0 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.1 | 5.9 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.1 | 3.7 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.1 | 1.1 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.1 | 0.2 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.1 | 0.1 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.1 | 6.2 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.1 | 5.9 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.1 | 0.7 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.1 | 3.0 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.1 | 2.1 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.1 | 2.7 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.1 | 4.2 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.1 | 0.8 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.1 | 0.5 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.1 | 0.4 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
| 0.1 | 1.2 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.0 | 2.2 | PID MYC PATHWAY | C-MYC pathway |
| 0.0 | 0.3 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.0 | 1.8 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
| 0.0 | 0.3 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.0 | 1.4 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.0 | 3.3 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
| 0.0 | 0.3 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.0 | 1.9 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.0 | 2.1 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
| 0.0 | 0.6 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.0 | 2.0 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
| 0.0 | 0.4 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.0 | 1.0 | ST ADRENERGIC | Adrenergic Pathway |
| 0.0 | 0.9 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.0 | 1.8 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.0 | 1.6 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.0 | 0.6 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 0.4 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.0 | 0.2 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.0 | 0.9 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.0 | 0.8 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.0 | 0.6 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.0 | 0.1 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
| 0.0 | 0.4 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.0 | 0.4 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 0.7 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 0.0 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.0 | 0.1 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
Gene overrepresentation in curated gene sets: REACTOME pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.7 | 18.7 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.6 | 9.4 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.6 | 1.8 | REACTOME CELL DEATH SIGNALLING VIA NRAGE NRIF AND NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
| 0.6 | 1.2 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
| 0.6 | 1.7 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
| 0.5 | 11.7 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.5 | 0.9 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |
| 0.4 | 14.7 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.4 | 20.3 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.4 | 7.2 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.4 | 16.3 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.3 | 10.3 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.3 | 5.8 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
| 0.3 | 10.3 | REACTOME RESOLUTION OF AP SITES VIA THE MULTIPLE NUCLEOTIDE PATCH REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the multiple-nucleotide patch replacement pathway |
| 0.3 | 12.2 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.3 | 1.3 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
| 0.3 | 13.3 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.3 | 1.3 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.3 | 4.8 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 0.3 | 14.4 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.3 | 5.0 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.3 | 6.4 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.3 | 0.3 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
| 0.3 | 0.9 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 0.3 | 1.7 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
| 0.3 | 1.7 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.3 | 1.4 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.3 | 7.4 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.3 | 10.1 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.3 | 1.6 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
| 0.3 | 9.6 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.3 | 11.7 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.3 | 0.8 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.3 | 4.5 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
| 0.2 | 3.7 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.2 | 7.2 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.2 | 6.3 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.2 | 1.0 | REACTOME AUTODEGRADATION OF THE E3 UBIQUITIN LIGASE COP1 | Genes involved in Autodegradation of the E3 ubiquitin ligase COP1 |
| 0.2 | 2.4 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
| 0.2 | 6.8 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.2 | 15.4 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.2 | 1.2 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.2 | 3.6 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.2 | 0.4 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.2 | 0.9 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
| 0.2 | 4.6 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.2 | 4.4 | REACTOME ACETYLCHOLINE BINDING AND DOWNSTREAM EVENTS | Genes involved in Acetylcholine Binding And Downstream Events |
| 0.2 | 10.0 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.2 | 3.3 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.2 | 7.3 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.2 | 5.6 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.2 | 5.1 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.2 | 3.1 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
| 0.2 | 4.1 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.2 | 8.9 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
| 0.2 | 2.7 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.2 | 0.6 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
| 0.2 | 6.9 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
| 0.2 | 1.1 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
| 0.1 | 3.4 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
| 0.1 | 4.9 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.1 | 1.7 | REACTOME E2F MEDIATED REGULATION OF DNA REPLICATION | Genes involved in E2F mediated regulation of DNA replication |
| 0.1 | 3.0 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.1 | 7.4 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.1 | 2.5 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.1 | 3.8 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.1 | 1.9 | REACTOME OPSINS | Genes involved in Opsins |
| 0.1 | 5.1 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
| 0.1 | 6.3 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.1 | 1.3 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
| 0.1 | 4.4 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
| 0.1 | 2.9 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.1 | 2.3 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.1 | 6.8 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.1 | 31.6 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.1 | 2.1 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.1 | 0.1 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
| 0.1 | 0.7 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.1 | 0.4 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.1 | 4.9 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
| 0.1 | 0.2 | REACTOME IL 3 5 AND GM CSF SIGNALING | Genes involved in Interleukin-3, 5 and GM-CSF signaling |
| 0.1 | 0.9 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.1 | 1.9 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
| 0.1 | 16.5 | REACTOME CHROMOSOME MAINTENANCE | Genes involved in Chromosome Maintenance |
| 0.1 | 1.4 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.1 | 2.5 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
| 0.1 | 1.5 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.1 | 3.9 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
| 0.1 | 7.4 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.1 | 1.4 | REACTOME PROCESSING OF CAPPED INTRONLESS PRE MRNA | Genes involved in Processing of Capped Intronless Pre-mRNA |
| 0.1 | 1.7 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.1 | 1.0 | REACTOME ACTIVATION OF KAINATE RECEPTORS UPON GLUTAMATE BINDING | Genes involved in Activation of Kainate Receptors upon glutamate binding |
| 0.1 | 1.6 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.1 | 0.1 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.1 | 0.8 | REACTOME NEURONAL SYSTEM | Genes involved in Neuronal System |
| 0.1 | 3.7 | REACTOME GLUCAGON SIGNALING IN METABOLIC REGULATION | Genes involved in Glucagon signaling in metabolic regulation |
| 0.1 | 1.1 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.1 | 2.1 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.1 | 2.2 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.1 | 2.8 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.1 | 0.7 | REACTOME SIGNALING BY WNT | Genes involved in Signaling by Wnt |
| 0.1 | 1.6 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.1 | 2.5 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.1 | 2.4 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
| 0.1 | 0.9 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
| 0.1 | 1.4 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.1 | 1.4 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.1 | 2.7 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
| 0.1 | 3.3 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.1 | 1.1 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.1 | 19.4 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.1 | 0.3 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.1 | 0.8 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
| 0.1 | 0.5 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.1 | 1.1 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.1 | 2.5 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
| 0.1 | 0.6 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.1 | 5.3 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.1 | 0.2 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.1 | 1.3 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.1 | 0.3 | REACTOME G2 M CHECKPOINTS | Genes involved in G2/M Checkpoints |
| 0.1 | 0.1 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
| 0.1 | 1.7 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.1 | 1.2 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.1 | 0.9 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 0.1 | 1.8 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.1 | 1.1 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.1 | 1.7 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.1 | 3.6 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.1 | 0.7 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.1 | 0.8 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 0.1 | 1.1 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.1 | 0.9 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.0 | 1.4 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.0 | 2.0 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.0 | 0.3 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
| 0.0 | 0.5 | REACTOME ION CHANNEL TRANSPORT | Genes involved in Ion channel transport |
| 0.0 | 3.3 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
| 0.0 | 0.4 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 0.0 | 0.9 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 3.3 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 0.0 | 2.9 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
| 0.0 | 2.8 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.0 | 8.2 | REACTOME G ALPHA I SIGNALLING EVENTS | Genes involved in G alpha (i) signalling events |
| 0.0 | 0.1 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 0.0 | 0.6 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.0 | 3.8 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 0.0 | 0.6 | REACTOME FORMATION OF THE HIV1 EARLY ELONGATION COMPLEX | Genes involved in Formation of the HIV-1 Early Elongation Complex |
| 0.0 | 1.2 | REACTOME FRS2 MEDIATED CASCADE | Genes involved in FRS2-mediated cascade |
| 0.0 | 0.5 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.0 | 1.0 | REACTOME TRANSPORT OF GLUCOSE AND OTHER SUGARS BILE SALTS AND ORGANIC ACIDS METAL IONS AND AMINE COMPOUNDS | Genes involved in Transport of glucose and other sugars, bile salts and organic acids, metal ions and amine compounds |
| 0.0 | 0.2 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.0 | 0.7 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
| 0.0 | 0.3 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
| 0.0 | 0.7 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.0 | 0.2 | REACTOME EARLY PHASE OF HIV LIFE CYCLE | Genes involved in Early Phase of HIV Life Cycle |
| 0.0 | 0.7 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.0 | 1.1 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 0.3 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
| 0.0 | 0.9 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
| 0.0 | 0.5 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.0 | 0.1 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
| 0.0 | 0.3 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
| 0.0 | 0.4 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
| 0.0 | 0.3 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |