Project
Illumina Body Map 2
Navigation
Downloads
Results for TFDP1
Z-value: 1.87
Motif logo
Transcription factors associated with TFDP1
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
TFDP1
|
ENSG00000198176.8 | transcription factor Dp-1 |
Activity-expression correlation:
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| TFDP1 | hg19_v2_chr13_+_114239588_114239752 | 0.16 | 3.9e-01 | Click! |
Activity profile of TFDP1 motif
Sorted Z-values of TFDP1 motif
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr5_+_133450365 | 8.01 |
ENST00000342854.5
ENST00000321603.6 ENST00000321584.4 ENST00000378564.1 ENST00000395029.1 |
TCF7
|
transcription factor 7 (T-cell specific, HMG-box) |
| chr1_-_111217603 | 6.73 |
ENST00000369769.2
|
KCNA3
|
potassium voltage-gated channel, shaker-related subfamily, member 3 |
| chrX_-_129244655 | 5.00 |
ENST00000335997.7
|
ELF4
|
E74-like factor 4 (ets domain transcription factor) |
| chr12_+_94542459 | 4.64 |
ENST00000258526.4
|
PLXNC1
|
plexin C1 |
| chr17_+_45810594 | 4.62 |
ENST00000177694.1
|
TBX21
|
T-box 21 |
| chr5_+_133451254 | 4.48 |
ENST00000517851.1
ENST00000521639.1 ENST00000522375.1 ENST00000378560.4 ENST00000432532.2 ENST00000520958.1 ENST00000518915.1 ENST00000395023.1 |
TCF7
|
transcription factor 7 (T-cell specific, HMG-box) |
| chrX_-_129244454 | 4.36 |
ENST00000308167.5
|
ELF4
|
E74-like factor 4 (ets domain transcription factor) |
| chr2_+_74212073 | 4.08 |
ENST00000441217.1
|
AC073046.25
|
AC073046.25 |
| chr1_+_27022839 | 3.91 |
ENST00000457599.2
|
ARID1A
|
AT rich interactive domain 1A (SWI-like) |
| chr17_-_61777459 | 3.87 |
ENST00000578993.1
ENST00000583211.1 ENST00000259006.3 |
LIMD2
|
LIM domain containing 2 |
| chrX_-_129244336 | 3.81 |
ENST00000434609.1
|
ELF4
|
E74-like factor 4 (ets domain transcription factor) |
| chr5_+_176853669 | 3.67 |
ENST00000355472.5
|
GRK6
|
G protein-coupled receptor kinase 6 |
| chr6_+_135502501 | 3.55 |
ENST00000527615.1
ENST00000420123.2 ENST00000525369.1 ENST00000528774.1 ENST00000534121.1 ENST00000534044.1 ENST00000533624.1 |
MYB
|
v-myb avian myeloblastosis viral oncogene homolog |
| chr1_+_27022485 | 3.23 |
ENST00000324856.7
|
ARID1A
|
AT rich interactive domain 1A (SWI-like) |
| chr17_+_37026106 | 3.14 |
ENST00000318008.6
|
LASP1
|
LIM and SH3 protein 1 |
| chr5_+_176853702 | 3.12 |
ENST00000507633.1
ENST00000393576.3 ENST00000355958.5 ENST00000528793.1 ENST00000512684.1 |
GRK6
|
G protein-coupled receptor kinase 6 |
| chr17_+_37026284 | 3.12 |
ENST00000433206.2
ENST00000435347.3 |
LASP1
|
LIM and SH3 protein 1 |
| chr17_-_61777090 | 2.94 |
ENST00000578061.1
|
LIMD2
|
LIM domain containing 2 |
| chr8_-_67525524 | 2.89 |
ENST00000517885.1
|
MYBL1
|
v-myb avian myeloblastosis viral oncogene homolog-like 1 |
| chr11_-_46142948 | 2.88 |
ENST00000257821.4
|
PHF21A
|
PHD finger protein 21A |
| chr17_-_73179046 | 2.85 |
ENST00000314523.7
ENST00000420826.2 |
SUMO2
|
small ubiquitin-like modifier 2 |
| chrY_+_2803322 | 2.81 |
ENST00000383052.1
ENST00000155093.3 ENST00000449237.1 ENST00000443793.1 |
ZFY
|
zinc finger protein, Y-linked |
| chr14_-_91884150 | 2.71 |
ENST00000553403.1
|
CCDC88C
|
coiled-coil domain containing 88C |
| chr9_-_110251836 | 2.70 |
ENST00000374672.4
|
KLF4
|
Kruppel-like factor 4 (gut) |
| chr19_-_10679644 | 2.67 |
ENST00000393599.2
|
CDKN2D
|
cyclin-dependent kinase inhibitor 2D (p19, inhibits CDK4) |
| chr1_+_43148625 | 2.67 |
ENST00000436427.1
|
YBX1
|
Y box binding protein 1 |
| chr17_+_42634844 | 2.62 |
ENST00000315323.3
|
FZD2
|
frizzled family receptor 2 |
| chr5_+_53813536 | 2.57 |
ENST00000343017.6
ENST00000381410.4 ENST00000326277.3 |
SNX18
|
sorting nexin 18 |
| chr9_-_37034028 | 2.56 |
ENST00000520281.1
ENST00000446742.1 ENST00000522003.1 ENST00000523145.1 ENST00000414447.1 ENST00000377847.2 ENST00000377853.2 ENST00000377852.2 ENST00000523241.1 ENST00000520154.1 ENST00000358127.4 |
PAX5
|
paired box 5 |
| chr14_-_99737822 | 2.50 |
ENST00000345514.2
ENST00000443726.2 |
BCL11B
|
B-cell CLL/lymphoma 11B (zinc finger protein) |
| chrX_+_64887512 | 2.48 |
ENST00000360270.5
|
MSN
|
moesin |
| chr17_+_54671047 | 2.47 |
ENST00000332822.4
|
NOG
|
noggin |
| chr17_+_38474489 | 2.45 |
ENST00000394089.2
ENST00000425707.3 |
RARA
|
retinoic acid receptor, alpha |
| chr8_-_67525473 | 2.42 |
ENST00000522677.3
|
MYBL1
|
v-myb avian myeloblastosis viral oncogene homolog-like 1 |
| chr11_-_46142615 | 2.41 |
ENST00000529734.1
ENST00000323180.6 |
PHF21A
|
PHD finger protein 21A |
| chr1_+_100818009 | 2.40 |
ENST00000370125.2
ENST00000361544.6 ENST00000370124.3 |
CDC14A
|
cell division cycle 14A |
| chr6_-_91006461 | 2.39 |
ENST00000257749.4
ENST00000343122.3 ENST00000406998.2 ENST00000453877.1 |
BACH2
|
BTB and CNC homology 1, basic leucine zipper transcription factor 2 |
| chr17_+_43299241 | 2.39 |
ENST00000328118.3
|
FMNL1
|
formin-like 1 |
| chr5_+_133861339 | 2.37 |
ENST00000282605.4
ENST00000361895.2 ENST00000402835.1 |
PHF15
|
jade family PHD finger 2 |
| chr1_-_40367668 | 2.35 |
ENST00000397332.2
ENST00000429311.1 |
MYCL
|
v-myc avian myelocytomatosis viral oncogene lung carcinoma derived homolog |
| chr19_-_10679697 | 2.32 |
ENST00000335766.2
|
CDKN2D
|
cyclin-dependent kinase inhibitor 2D (p19, inhibits CDK4) |
| chr1_-_200992827 | 2.29 |
ENST00000332129.2
ENST00000422435.2 |
KIF21B
|
kinesin family member 21B |
| chr19_+_16435625 | 2.27 |
ENST00000248071.5
ENST00000592003.1 |
KLF2
|
Kruppel-like factor 2 |
| chr2_-_37551846 | 2.27 |
ENST00000443187.1
|
PRKD3
|
protein kinase D3 |
| chrX_-_153363125 | 2.24 |
ENST00000407218.1
ENST00000453960.2 |
MECP2
|
methyl CpG binding protein 2 (Rett syndrome) |
| chr2_+_219264762 | 2.21 |
ENST00000452977.1
|
CTDSP1
|
CTD (carboxy-terminal domain, RNA polymerase II, polypeptide A) small phosphatase 1 |
| chr8_-_37756972 | 2.20 |
ENST00000330843.4
ENST00000522727.1 ENST00000287263.4 |
RAB11FIP1
|
RAB11 family interacting protein 1 (class I) |
| chr6_-_30654977 | 2.19 |
ENST00000399199.3
|
PPP1R18
|
protein phosphatase 1, regulatory subunit 18 |
| chr18_-_48723690 | 2.15 |
ENST00000406189.3
|
MEX3C
|
mex-3 RNA binding family member C |
| chr7_+_129251531 | 2.15 |
ENST00000393232.1
ENST00000353868.4 ENST00000539636.1 ENST00000454688.1 ENST00000223190.4 ENST00000311967.2 |
NRF1
|
nuclear respiratory factor 1 |
| chr4_-_109090106 | 2.15 |
ENST00000379951.2
|
LEF1
|
lymphoid enhancer-binding factor 1 |
| chr3_-_113465065 | 2.14 |
ENST00000497255.1
ENST00000478020.1 ENST00000240922.3 ENST00000493900.1 |
NAA50
|
N(alpha)-acetyltransferase 50, NatE catalytic subunit |
| chr6_-_112194484 | 2.14 |
ENST00000518295.1
ENST00000484067.2 ENST00000229470.5 ENST00000356013.2 ENST00000368678.4 ENST00000523238.1 ENST00000354650.3 |
FYN
|
FYN oncogene related to SRC, FGR, YES |
| chr4_-_174255400 | 2.14 |
ENST00000506267.1
|
HMGB2
|
high mobility group box 2 |
| chr6_+_137243373 | 2.12 |
ENST00000331858.4
|
SLC35D3
|
solute carrier family 35, member D3 |
| chr19_-_14247365 | 2.12 |
ENST00000592798.1
ENST00000474890.1 |
ASF1B
|
anti-silencing function 1B histone chaperone |
| chr5_-_140998616 | 2.10 |
ENST00000389054.3
ENST00000398562.2 ENST00000389057.5 ENST00000398566.3 ENST00000398557.4 ENST00000253811.6 |
DIAPH1
|
diaphanous-related formin 1 |
| chr2_+_232573208 | 2.09 |
ENST00000409115.3
|
PTMA
|
prothymosin, alpha |
| chr6_+_135502466 | 2.04 |
ENST00000367814.4
|
MYB
|
v-myb avian myeloblastosis viral oncogene homolog |
| chr5_+_56111361 | 2.04 |
ENST00000399503.3
|
MAP3K1
|
mitogen-activated protein kinase kinase kinase 1, E3 ubiquitin protein ligase |
| chr5_+_133861790 | 2.03 |
ENST00000395003.1
|
PHF15
|
jade family PHD finger 2 |
| chr1_+_43148059 | 2.02 |
ENST00000321358.7
ENST00000332220.6 |
YBX1
|
Y box binding protein 1 |
| chr15_+_57211318 | 2.01 |
ENST00000557947.1
|
TCF12
|
transcription factor 12 |
| chr5_+_61602236 | 2.01 |
ENST00000514082.1
ENST00000407818.3 |
KIF2A
|
kinesin heavy chain member 2A |
| chr15_-_75743915 | 2.01 |
ENST00000394949.4
|
SIN3A
|
SIN3 transcription regulator family member A |
| chrX_-_46618490 | 2.01 |
ENST00000328306.4
|
SLC9A7
|
solute carrier family 9, subfamily A (NHE7, cation proton antiporter 7), member 7 |
| chr6_+_37137939 | 2.00 |
ENST00000373509.5
|
PIM1
|
pim-1 oncogene |
| chr1_+_110026544 | 2.00 |
ENST00000369870.3
|
ATXN7L2
|
ataxin 7-like 2 |
| chr2_+_149402553 | 2.00 |
ENST00000258484.6
ENST00000409654.1 |
EPC2
|
enhancer of polycomb homolog 2 (Drosophila) |
| chr1_+_100818156 | 2.00 |
ENST00000336454.3
|
CDC14A
|
cell division cycle 14A |
| chr6_+_20403997 | 1.99 |
ENST00000535432.1
|
E2F3
|
E2F transcription factor 3 |
| chr17_-_66287350 | 1.98 |
ENST00000580666.1
ENST00000583477.1 |
SLC16A6
|
solute carrier family 16, member 6 |
| chr3_-_71114066 | 1.98 |
ENST00000485326.2
|
FOXP1
|
forkhead box P1 |
| chr18_-_5296001 | 1.96 |
ENST00000357006.4
|
ZBTB14
|
zinc finger and BTB domain containing 14 |
| chr4_-_18023350 | 1.95 |
ENST00000539056.1
ENST00000382226.5 ENST00000326877.4 |
LCORL
|
ligand dependent nuclear receptor corepressor-like |
| chr16_-_58034357 | 1.95 |
ENST00000562909.1
|
ZNF319
|
zinc finger protein 319 |
| chr1_-_153895377 | 1.94 |
ENST00000368655.4
|
GATAD2B
|
GATA zinc finger domain containing 2B |
| chr3_+_50273625 | 1.93 |
ENST00000536647.1
|
GNAI2
|
guanine nucleotide binding protein (G protein), alpha inhibiting activity polypeptide 2 |
| chr2_+_219264466 | 1.93 |
ENST00000273062.2
|
CTDSP1
|
CTD (carboxy-terminal domain, RNA polymerase II, polypeptide A) small phosphatase 1 |
| chr17_-_4852243 | 1.93 |
ENST00000225655.5
|
PFN1
|
profilin 1 |
| chr4_-_78740511 | 1.91 |
ENST00000504123.1
ENST00000264903.4 ENST00000515441.1 |
CNOT6L
|
CCR4-NOT transcription complex, subunit 6-like |
| chr11_-_2292182 | 1.90 |
ENST00000331289.4
|
ASCL2
|
achaete-scute family bHLH transcription factor 2 |
| chr17_+_43299156 | 1.90 |
ENST00000331495.3
|
FMNL1
|
formin-like 1 |
| chr6_-_91006627 | 1.90 |
ENST00000537989.1
|
BACH2
|
BTB and CNC homology 1, basic leucine zipper transcription factor 2 |
| chr14_-_91884115 | 1.89 |
ENST00000389857.6
|
CCDC88C
|
coiled-coil domain containing 88C |
| chr3_-_13921594 | 1.87 |
ENST00000285018.4
|
WNT7A
|
wingless-type MMTV integration site family, member 7A |
| chr1_+_26798955 | 1.87 |
ENST00000361427.5
|
HMGN2
|
high mobility group nucleosomal binding domain 2 |
| chr3_+_47021168 | 1.86 |
ENST00000450053.3
ENST00000292309.5 ENST00000383740.2 |
NBEAL2
|
neurobeachin-like 2 |
| chr1_+_206680879 | 1.86 |
ENST00000355294.4
ENST00000367117.3 |
RASSF5
|
Ras association (RalGDS/AF-6) domain family member 5 |
| chr1_-_154155595 | 1.85 |
ENST00000328159.4
ENST00000368531.2 ENST00000323144.7 ENST00000368533.3 ENST00000341372.3 |
TPM3
|
tropomyosin 3 |
| chr14_+_75894714 | 1.82 |
ENST00000559060.1
|
JDP2
|
Jun dimerization protein 2 |
| chr6_+_139456226 | 1.81 |
ENST00000367658.2
|
HECA
|
headcase homolog (Drosophila) |
| chr14_-_99737565 | 1.80 |
ENST00000357195.3
|
BCL11B
|
B-cell CLL/lymphoma 11B (zinc finger protein) |
| chr3_-_52090461 | 1.80 |
ENST00000296483.6
ENST00000495880.1 |
DUSP7
|
dual specificity phosphatase 7 |
| chr14_+_64971292 | 1.78 |
ENST00000358738.3
ENST00000394712.2 |
ZBTB1
|
zinc finger and BTB domain containing 1 |
| chr14_-_64971288 | 1.77 |
ENST00000394715.1
|
ZBTB25
|
zinc finger and BTB domain containing 25 |
| chr20_-_20693131 | 1.77 |
ENST00000202677.7
|
RALGAPA2
|
Ral GTPase activating protein, alpha subunit 2 (catalytic) |
| chr16_+_50776021 | 1.76 |
ENST00000566679.2
ENST00000564634.1 ENST00000398568.2 |
CYLD
|
cylindromatosis (turban tumor syndrome) |
| chr6_-_86352982 | 1.75 |
ENST00000369622.3
|
SYNCRIP
|
synaptotagmin binding, cytoplasmic RNA interacting protein |
| chr9_+_130547958 | 1.75 |
ENST00000421939.1
ENST00000373265.2 |
CDK9
|
cyclin-dependent kinase 9 |
| chr3_+_133292759 | 1.74 |
ENST00000431519.2
|
CDV3
|
CDV3 homolog (mouse) |
| chr5_+_179159813 | 1.73 |
ENST00000292599.3
|
MAML1
|
mastermind-like 1 (Drosophila) |
| chr7_-_5463175 | 1.72 |
ENST00000399537.4
ENST00000430969.1 |
TNRC18
|
trinucleotide repeat containing 18 |
| chr19_+_38810447 | 1.71 |
ENST00000263372.3
|
KCNK6
|
potassium channel, subfamily K, member 6 |
| chr1_-_40367530 | 1.71 |
ENST00000372816.2
ENST00000372815.1 |
MYCL
|
v-myc avian myelocytomatosis viral oncogene lung carcinoma derived homolog |
| chr6_+_108881012 | 1.71 |
ENST00000343882.6
|
FOXO3
|
forkhead box O3 |
| chr15_-_70388943 | 1.70 |
ENST00000559048.1
ENST00000560939.1 ENST00000440567.3 ENST00000557907.1 ENST00000558379.1 ENST00000451782.2 ENST00000559929.1 |
TLE3
|
transducin-like enhancer of split 3 (E(sp1) homolog, Drosophila) |
| chr6_-_151712673 | 1.70 |
ENST00000325144.4
|
ZBTB2
|
zinc finger and BTB domain containing 2 |
| chr12_-_129308041 | 1.69 |
ENST00000376740.4
|
SLC15A4
|
solute carrier family 15 (oligopeptide transporter), member 4 |
| chr2_+_48541776 | 1.69 |
ENST00000413569.1
ENST00000340553.3 |
FOXN2
|
forkhead box N2 |
| chr6_+_41514305 | 1.68 |
ENST00000409208.1
ENST00000373057.3 |
FOXP4
|
forkhead box P4 |
| chr5_+_61602055 | 1.67 |
ENST00000381103.2
|
KIF2A
|
kinesin heavy chain member 2A |
| chr12_-_58240470 | 1.67 |
ENST00000548823.1
ENST00000398073.2 |
CTDSP2
|
CTD (carboxy-terminal domain, RNA polymerase II, polypeptide A) small phosphatase 2 |
| chr6_+_34204642 | 1.66 |
ENST00000347617.6
ENST00000401473.3 ENST00000311487.5 ENST00000447654.1 ENST00000395004.3 |
HMGA1
|
high mobility group AT-hook 1 |
| chr10_+_104263743 | 1.66 |
ENST00000369902.3
ENST00000369899.2 ENST00000423559.2 |
SUFU
|
suppressor of fused homolog (Drosophila) |
| chr19_-_47734448 | 1.65 |
ENST00000439096.2
|
BBC3
|
BCL2 binding component 3 |
| chr11_-_62314268 | 1.65 |
ENST00000257247.7
ENST00000531324.1 ENST00000378024.4 |
AHNAK
|
AHNAK nucleoprotein |
| chr7_-_72936608 | 1.64 |
ENST00000404251.1
|
BAZ1B
|
bromodomain adjacent to zinc finger domain, 1B |
| chr17_+_19282064 | 1.64 |
ENST00000603493.1
|
MAPK7
|
mitogen-activated protein kinase 7 |
| chr15_+_44719394 | 1.64 |
ENST00000260327.4
ENST00000396780.1 |
CTDSPL2
|
CTD (carboxy-terminal domain, RNA polymerase II, polypeptide A) small phosphatase like 2 |
| chr15_+_40733387 | 1.64 |
ENST00000416165.1
|
BAHD1
|
bromo adjacent homology domain containing 1 |
| chr17_+_30814707 | 1.63 |
ENST00000584792.1
|
CDK5R1
|
cyclin-dependent kinase 5, regulatory subunit 1 (p35) |
| chr1_+_154297988 | 1.63 |
ENST00000368487.3
|
ATP8B2
|
ATPase, aminophospholipid transporter, class I, type 8B, member 2 |
| chr12_+_122064673 | 1.63 |
ENST00000537188.1
|
ORAI1
|
ORAI calcium release-activated calcium modulator 1 |
| chr16_+_50775971 | 1.63 |
ENST00000311559.9
ENST00000564326.1 ENST00000566206.1 |
CYLD
|
cylindromatosis (turban tumor syndrome) |
| chr12_-_54694807 | 1.61 |
ENST00000435572.2
|
NFE2
|
nuclear factor, erythroid 2 |
| chr7_+_2671663 | 1.61 |
ENST00000407643.1
|
TTYH3
|
tweety family member 3 |
| chr17_-_3867585 | 1.61 |
ENST00000359983.3
ENST00000352011.3 ENST00000397043.3 ENST00000397041.3 ENST00000397035.3 ENST00000397039.1 ENST00000309890.7 |
ATP2A3
|
ATPase, Ca++ transporting, ubiquitous |
| chr22_-_36784035 | 1.60 |
ENST00000216181.5
|
MYH9
|
myosin, heavy chain 9, non-muscle |
| chr21_-_36260980 | 1.60 |
ENST00000344691.4
ENST00000358356.5 |
RUNX1
|
runt-related transcription factor 1 |
| chr5_+_176873789 | 1.58 |
ENST00000323249.3
ENST00000502922.1 |
PRR7
|
proline rich 7 (synaptic) |
| chr16_+_50775948 | 1.57 |
ENST00000569681.1
ENST00000569418.1 ENST00000540145.1 |
CYLD
|
cylindromatosis (turban tumor syndrome) |
| chr17_+_57232690 | 1.57 |
ENST00000262293.4
|
PRR11
|
proline rich 11 |
| chr10_+_8096631 | 1.56 |
ENST00000379328.3
|
GATA3
|
GATA binding protein 3 |
| chr12_-_54694758 | 1.56 |
ENST00000553070.1
|
NFE2
|
nuclear factor, erythroid 2 |
| chr2_+_219081817 | 1.56 |
ENST00000315717.5
ENST00000420104.1 ENST00000295685.10 |
ARPC2
|
actin related protein 2/3 complex, subunit 2, 34kDa |
| chr19_+_18530184 | 1.55 |
ENST00000601357.2
|
SSBP4
|
single stranded DNA binding protein 4 |
| chr9_-_123476612 | 1.55 |
ENST00000426959.1
|
MEGF9
|
multiple EGF-like-domains 9 |
| chr19_+_18530146 | 1.55 |
ENST00000348495.6
ENST00000270061.7 |
SSBP4
|
single stranded DNA binding protein 4 |
| chr2_+_232573222 | 1.54 |
ENST00000341369.7
ENST00000409683.1 |
PTMA
|
prothymosin, alpha |
| chr5_-_140998481 | 1.54 |
ENST00000518047.1
|
DIAPH1
|
diaphanous-related formin 1 |
| chr6_+_135502408 | 1.53 |
ENST00000341911.5
ENST00000442647.2 ENST00000316528.8 |
MYB
|
v-myb avian myeloblastosis viral oncogene homolog |
| chr19_-_41859814 | 1.52 |
ENST00000221930.5
|
TGFB1
|
transforming growth factor, beta 1 |
| chr17_+_66287628 | 1.51 |
ENST00000581639.1
ENST00000452479.2 |
ARSG
|
arylsulfatase G |
| chr17_-_42296855 | 1.50 |
ENST00000436088.1
|
UBTF
|
upstream binding transcription factor, RNA polymerase I |
| chr15_-_73075964 | 1.50 |
ENST00000563907.1
|
ADPGK
|
ADP-dependent glucokinase |
| chr1_-_92351666 | 1.50 |
ENST00000465892.2
ENST00000417833.2 |
TGFBR3
|
transforming growth factor, beta receptor III |
| chrX_-_20284958 | 1.50 |
ENST00000379565.3
|
RPS6KA3
|
ribosomal protein S6 kinase, 90kDa, polypeptide 3 |
| chr12_+_53846594 | 1.50 |
ENST00000550192.1
|
PCBP2
|
poly(rC) binding protein 2 |
| chr1_-_183604794 | 1.49 |
ENST00000367534.1
ENST00000359856.6 ENST00000294742.6 |
ARPC5
|
actin related protein 2/3 complex, subunit 5, 16kDa |
| chr5_+_133859996 | 1.49 |
ENST00000512386.1
|
PHF15
|
jade family PHD finger 2 |
| chr1_+_118148556 | 1.49 |
ENST00000369448.3
|
FAM46C
|
family with sequence similarity 46, member C |
| chr19_-_14117074 | 1.49 |
ENST00000588885.1
ENST00000254325.4 |
RFX1
|
regulatory factor X, 1 (influences HLA class II expression) |
| chr20_-_31172598 | 1.48 |
ENST00000201961.2
|
C20orf112
|
chromosome 20 open reading frame 112 |
| chr12_+_122241928 | 1.48 |
ENST00000604567.1
ENST00000542440.1 |
SETD1B
|
SET domain containing 1B |
| chr2_+_97481974 | 1.48 |
ENST00000377060.3
ENST00000305510.3 |
CNNM3
|
cyclin M3 |
| chr17_-_16395455 | 1.48 |
ENST00000409083.3
|
FAM211A
|
family with sequence similarity 211, member A |
| chr17_-_46507537 | 1.48 |
ENST00000336915.6
|
SKAP1
|
src kinase associated phosphoprotein 1 |
| chr7_+_98972327 | 1.47 |
ENST00000455009.1
|
ARPC1B
|
actin related protein 2/3 complex, subunit 1B, 41kDa |
| chr19_+_17666403 | 1.47 |
ENST00000252599.4
|
COLGALT1
|
collagen beta(1-O)galactosyltransferase 1 |
| chr10_+_8096769 | 1.47 |
ENST00000346208.3
|
GATA3
|
GATA binding protein 3 |
| chr17_+_34901353 | 1.47 |
ENST00000593016.1
|
GGNBP2
|
gametogenetin binding protein 2 |
| chr14_+_64971438 | 1.47 |
ENST00000555321.1
|
ZBTB1
|
zinc finger and BTB domain containing 1 |
| chr7_+_39989946 | 1.47 |
ENST00000340829.5
|
CDK13
|
cyclin-dependent kinase 13 |
| chr17_-_38574169 | 1.47 |
ENST00000423485.1
|
TOP2A
|
topoisomerase (DNA) II alpha 170kDa |
| chr3_+_14444063 | 1.46 |
ENST00000454876.2
ENST00000360861.3 ENST00000416216.2 |
SLC6A6
|
solute carrier family 6 (neurotransmitter transporter), member 6 |
| chr1_+_26856236 | 1.46 |
ENST00000374168.2
ENST00000374166.4 |
RPS6KA1
|
ribosomal protein S6 kinase, 90kDa, polypeptide 1 |
| chr10_+_105253661 | 1.46 |
ENST00000369780.4
|
NEURL
|
neuralized E3 ubiquitin protein ligase 1 |
| chr11_-_129872672 | 1.46 |
ENST00000531431.1
ENST00000527581.1 |
PRDM10
|
PR domain containing 10 |
| chr10_-_106098162 | 1.46 |
ENST00000337478.1
|
ITPRIP
|
inositol 1,4,5-trisphosphate receptor interacting protein |
| chr15_+_75074410 | 1.45 |
ENST00000439220.2
|
CSK
|
c-src tyrosine kinase |
| chr10_+_75757863 | 1.45 |
ENST00000372755.3
ENST00000211998.4 ENST00000417648.2 |
VCL
|
vinculin |
| chr5_+_61601965 | 1.45 |
ENST00000401507.3
|
KIF2A
|
kinesin heavy chain member 2A |
| chr17_-_47865948 | 1.44 |
ENST00000513602.1
|
FAM117A
|
family with sequence similarity 117, member A |
| chr19_+_16222439 | 1.44 |
ENST00000300935.3
|
RAB8A
|
RAB8A, member RAS oncogene family |
| chr14_+_50359773 | 1.44 |
ENST00000298316.5
|
ARF6
|
ADP-ribosylation factor 6 |
| chr1_+_32716857 | 1.44 |
ENST00000482949.1
ENST00000495610.2 |
LCK
|
lymphocyte-specific protein tyrosine kinase |
| chr7_+_50344289 | 1.44 |
ENST00000413698.1
ENST00000359197.5 ENST00000331340.3 ENST00000357364.4 ENST00000343574.5 ENST00000349824.4 ENST00000346667.4 ENST00000440768.2 |
IKZF1
|
IKAROS family zinc finger 1 (Ikaros) |
| chr7_+_98972298 | 1.44 |
ENST00000252725.5
|
ARPC1B
|
actin related protein 2/3 complex, subunit 1B, 41kDa |
| chr17_-_28257080 | 1.44 |
ENST00000579954.1
ENST00000540801.1 ENST00000269033.3 ENST00000590153.1 ENST00000582084.1 |
SSH2
|
slingshot protein phosphatase 2 |
| chr6_+_31540056 | 1.44 |
ENST00000418386.2
|
LTA
|
lymphotoxin alpha |
| chr7_+_143078379 | 1.43 |
ENST00000449630.1
ENST00000457235.1 |
ZYX
|
zyxin |
| chr11_+_67033881 | 1.42 |
ENST00000308595.5
ENST00000526285.1 |
ADRBK1
|
adrenergic, beta, receptor kinase 1 |
| chr9_-_115095851 | 1.42 |
ENST00000343327.2
|
PTBP3
|
polypyrimidine tract binding protein 3 |
| chr15_+_75074385 | 1.42 |
ENST00000220003.9
|
CSK
|
c-src tyrosine kinase |
| chr1_+_32716840 | 1.41 |
ENST00000336890.5
|
LCK
|
lymphocyte-specific protein tyrosine kinase |
| chr11_-_64511789 | 1.41 |
ENST00000419843.1
ENST00000394430.1 |
RASGRP2
|
RAS guanyl releasing protein 2 (calcium and DAG-regulated) |
| chr4_+_129732419 | 1.41 |
ENST00000510308.1
|
PHF17
|
jade family PHD finger 1 |
| chr8_-_66754172 | 1.41 |
ENST00000401827.3
|
PDE7A
|
phosphodiesterase 7A |
| chr4_-_78740769 | 1.41 |
ENST00000512485.1
|
CNOT6L
|
CCR4-NOT transcription complex, subunit 6-like |
| chr6_-_86353510 | 1.40 |
ENST00000444272.1
|
SYNCRIP
|
synaptotagmin binding, cytoplasmic RNA interacting protein |
| chr16_-_67281413 | 1.40 |
ENST00000258201.4
|
FHOD1
|
formin homology 2 domain containing 1 |
| chr18_-_5296138 | 1.40 |
ENST00000400143.3
|
ZBTB14
|
zinc finger and BTB domain containing 14 |
| chr12_-_1703331 | 1.40 |
ENST00000339235.3
|
FBXL14
|
F-box and leucine-rich repeat protein 14 |
| chr9_-_115095883 | 1.39 |
ENST00000450374.1
ENST00000374255.2 ENST00000334318.6 ENST00000374257.1 |
PTBP3
|
polypyrimidine tract binding protein 3 |
| chr7_+_143078652 | 1.39 |
ENST00000354434.4
ENST00000449423.2 |
ZYX
|
zyxin |
| chr17_-_47308128 | 1.38 |
ENST00000413580.1
ENST00000511066.1 |
PHOSPHO1
|
phosphatase, orphan 1 |
| chr6_+_32939964 | 1.38 |
ENST00000607833.1
|
BRD2
|
bromodomain containing 2 |
| chr18_+_3449821 | 1.37 |
ENST00000407501.2
ENST00000405385.3 ENST00000546979.1 |
TGIF1
|
TGFB-induced factor homeobox 1 |
| chr16_-_4323015 | 1.36 |
ENST00000204517.6
|
TFAP4
|
transcription factor AP-4 (activating enhancer binding protein 4) |
Network of associatons between targets according to the STRING database.
First level regulatory network of TFDP1
Gene Ontology Analysis
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.4 | 7.1 | GO:1990922 | regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 1.8 | 12.5 | GO:0048619 | embryonic genitalia morphogenesis(GO:0030538) embryonic hindgut morphogenesis(GO:0048619) |
| 1.7 | 5.0 | GO:1990108 | protein linear deubiquitination(GO:1990108) |
| 1.4 | 4.3 | GO:0097534 | lymphoid lineage cell migration(GO:0097534) lymphoid lineage cell migration into thymus(GO:0097535) |
| 1.4 | 8.3 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
| 1.2 | 5.9 | GO:0071409 | cellular response to cycloheximide(GO:0071409) |
| 1.1 | 1.1 | GO:1901674 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
| 1.1 | 13.2 | GO:0001866 | NK T cell proliferation(GO:0001866) |
| 1.0 | 3.1 | GO:0009405 | pathogenesis(GO:0009405) |
| 1.0 | 7.1 | GO:0003408 | optic cup formation involved in camera-type eye development(GO:0003408) maintenance of chromatin silencing(GO:0006344) |
| 1.0 | 2.0 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.9 | 10.4 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.9 | 0.9 | GO:0009617 | response to bacterium(GO:0009617) |
| 0.8 | 0.8 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.8 | 4.1 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
| 0.8 | 3.2 | GO:1904799 | regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.8 | 2.3 | GO:0048210 | Golgi vesicle fusion to target membrane(GO:0048210) |
| 0.8 | 2.3 | GO:0070376 | regulation of ERK5 cascade(GO:0070376) negative regulation of ERK5 cascade(GO:0070377) |
| 0.7 | 2.2 | GO:0033037 | polysaccharide localization(GO:0033037) |
| 0.7 | 3.6 | GO:0060010 | Sertoli cell fate commitment(GO:0060010) |
| 0.7 | 3.5 | GO:1901675 | negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 0.7 | 5.6 | GO:2000980 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.7 | 8.2 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
| 0.6 | 2.6 | GO:0060054 | positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
| 0.6 | 0.6 | GO:1901655 | cellular response to ketone(GO:1901655) |
| 0.6 | 4.3 | GO:1904688 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.6 | 0.6 | GO:0034770 | histone H4-K20 methylation(GO:0034770) histone H4-K20 trimethylation(GO:0034773) |
| 0.6 | 2.4 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
| 0.6 | 1.8 | GO:0006117 | acetaldehyde metabolic process(GO:0006117) |
| 0.6 | 1.8 | GO:1902396 | protein localization to bicellular tight junction(GO:1902396) |
| 0.6 | 1.8 | GO:0021775 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
| 0.6 | 1.7 | GO:0001544 | initiation of primordial ovarian follicle growth(GO:0001544) |
| 0.6 | 0.6 | GO:0014029 | neural crest formation(GO:0014029) |
| 0.6 | 0.6 | GO:0050653 | chondroitin sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0050653) |
| 0.5 | 1.6 | GO:0021722 | superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
| 0.5 | 2.6 | GO:0002032 | desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
| 0.5 | 1.6 | GO:0072387 | flavin adenine dinucleotide metabolic process(GO:0072387) |
| 0.5 | 2.6 | GO:0003430 | growth plate cartilage chondrocyte growth(GO:0003430) |
| 0.5 | 1.5 | GO:0044416 | induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) |
| 0.5 | 1.9 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.5 | 1.4 | GO:0002874 | regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) |
| 0.5 | 1.4 | GO:1904247 | positive regulation of polynucleotide adenylyltransferase activity(GO:1904247) |
| 0.5 | 2.3 | GO:1904868 | telomerase catalytic core complex assembly(GO:1904868) regulation of telomerase catalytic core complex assembly(GO:1904882) positive regulation of telomerase catalytic core complex assembly(GO:1904884) |
| 0.5 | 0.9 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
| 0.5 | 2.3 | GO:1900224 | positive regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900224) |
| 0.5 | 1.4 | GO:0017186 | peptidyl-pyroglutamic acid biosynthetic process, using glutaminyl-peptide cyclotransferase(GO:0017186) |
| 0.5 | 1.8 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.5 | 1.8 | GO:0010909 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) canonical Wnt signaling pathway involved in positive regulation of epithelial to mesenchymal transition(GO:0044334) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.5 | 1.8 | GO:0000415 | negative regulation of histone H3-K36 methylation(GO:0000415) |
| 0.5 | 5.4 | GO:0048102 | autophagic cell death(GO:0048102) |
| 0.5 | 1.8 | GO:0002268 | follicular dendritic cell differentiation(GO:0002268) |
| 0.4 | 1.3 | GO:0044727 | DNA demethylation of male pronucleus(GO:0044727) |
| 0.4 | 5.8 | GO:1902659 | regulation of glucose mediated signaling pathway(GO:1902659) |
| 0.4 | 0.9 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.4 | 2.2 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.4 | 1.3 | GO:1903461 | Okazaki fragment processing involved in mitotic DNA replication(GO:1903461) |
| 0.4 | 1.7 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.4 | 6.4 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.4 | 1.3 | GO:1902823 | negative regulation of late endosome to lysosome transport(GO:1902823) |
| 0.4 | 0.4 | GO:0035616 | histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.4 | 4.6 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.4 | 1.2 | GO:0045083 | negative regulation of interleukin-12 biosynthetic process(GO:0045083) |
| 0.4 | 2.8 | GO:0022614 | membrane to membrane docking(GO:0022614) |
| 0.4 | 3.6 | GO:1902748 | positive regulation of lens fiber cell differentiation(GO:1902748) |
| 0.4 | 1.2 | GO:1905000 | regulation of membrane repolarization during atrial cardiac muscle cell action potential(GO:1905000) |
| 0.4 | 5.5 | GO:0070601 | centromeric sister chromatid cohesion(GO:0070601) |
| 0.4 | 0.8 | GO:0061145 | bronchus cartilage development(GO:0060532) lung smooth muscle development(GO:0061145) |
| 0.4 | 3.1 | GO:0021861 | forebrain radial glial cell differentiation(GO:0021861) |
| 0.4 | 0.4 | GO:2000777 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process involved in cellular response to hypoxia(GO:2000777) |
| 0.4 | 5.3 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.4 | 3.0 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
| 0.4 | 0.4 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.4 | 1.5 | GO:0036071 | N-glycan fucosylation(GO:0036071) |
| 0.4 | 1.1 | GO:1904772 | hepatocyte homeostasis(GO:0036333) response to tetrachloromethane(GO:1904772) |
| 0.4 | 2.2 | GO:1903438 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 0.4 | 1.4 | GO:0032072 | plasmacytoid dendritic cell activation(GO:0002270) regulation of restriction endodeoxyribonuclease activity(GO:0032072) |
| 0.4 | 1.1 | GO:0021571 | rhombomere 5 development(GO:0021571) central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| 0.4 | 1.4 | GO:1903028 | positive regulation of opsonization(GO:1903028) |
| 0.4 | 1.8 | GO:0090402 | oncogene-induced cell senescence(GO:0090402) |
| 0.4 | 1.1 | GO:0034471 | endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
| 0.4 | 1.1 | GO:0000349 | generation of catalytic spliceosome for first transesterification step(GO:0000349) |
| 0.3 | 2.1 | GO:0021993 | initiation of neural tube closure(GO:0021993) |
| 0.3 | 1.0 | GO:1903450 | regulation of G1 to G0 transition(GO:1903450) positive regulation of G1 to G0 transition(GO:1903452) |
| 0.3 | 1.0 | GO:2000681 | negative regulation of rubidium ion transport(GO:2000681) negative regulation of rubidium ion transmembrane transporter activity(GO:2000687) |
| 0.3 | 3.7 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.3 | 0.3 | GO:1990791 | dorsal root ganglion development(GO:1990791) |
| 0.3 | 1.3 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.3 | 1.7 | GO:0036496 | regulation of translational initiation by eIF2 alpha dephosphorylation(GO:0036496) |
| 0.3 | 1.3 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.3 | 2.0 | GO:0032625 | interleukin-21 production(GO:0032625) interleukin-21 secretion(GO:0072619) |
| 0.3 | 1.0 | GO:1903519 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
| 0.3 | 4.5 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.3 | 0.3 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
| 0.3 | 1.6 | GO:0032796 | uropod organization(GO:0032796) |
| 0.3 | 1.0 | GO:0061110 | dense core granule biogenesis(GO:0061110) regulation of dense core granule biogenesis(GO:2000705) |
| 0.3 | 1.6 | GO:1905167 | positive regulation of lysosomal protein catabolic process(GO:1905167) |
| 0.3 | 1.9 | GO:0071386 | cellular response to corticosterone stimulus(GO:0071386) |
| 0.3 | 1.2 | GO:0060374 | mast cell differentiation(GO:0060374) |
| 0.3 | 2.2 | GO:0070417 | cellular response to cold(GO:0070417) |
| 0.3 | 1.5 | GO:0043987 | histone H3-S10 phosphorylation(GO:0043987) |
| 0.3 | 1.2 | GO:0060623 | pericentric heterochromatin assembly(GO:0031508) regulation of chromosome condensation(GO:0060623) |
| 0.3 | 1.5 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.3 | 1.5 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
| 0.3 | 1.5 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.3 | 5.5 | GO:0051256 | mitotic spindle midzone assembly(GO:0051256) |
| 0.3 | 0.6 | GO:0060435 | bronchiole development(GO:0060435) |
| 0.3 | 4.9 | GO:0051573 | negative regulation of histone H3-K9 methylation(GO:0051573) |
| 0.3 | 2.9 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.3 | 4.0 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.3 | 0.6 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
| 0.3 | 1.1 | GO:0097010 | eukaryotic translation initiation factor 4F complex assembly(GO:0097010) |
| 0.3 | 6.9 | GO:0006337 | nucleosome disassembly(GO:0006337) |
| 0.3 | 1.1 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.3 | 0.5 | GO:0001172 | transcription, RNA-templated(GO:0001172) |
| 0.3 | 0.8 | GO:0072356 | chromosome passenger complex localization to kinetochore(GO:0072356) |
| 0.3 | 2.7 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.3 | 4.0 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.3 | 0.5 | GO:0098727 | maintenance of cell number(GO:0098727) |
| 0.3 | 3.4 | GO:0031507 | heterochromatin assembly(GO:0031507) |
| 0.3 | 1.0 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
| 0.3 | 1.8 | GO:0034670 | chemotaxis to arachidonic acid(GO:0034670) response to arachidonic acid(GO:1904550) |
| 0.3 | 2.6 | GO:2001166 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.3 | 0.8 | GO:1901340 | negative regulation of store-operated calcium channel activity(GO:1901340) |
| 0.3 | 9.3 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
| 0.3 | 0.8 | GO:0044205 | 'de novo' UMP biosynthetic process(GO:0044205) |
| 0.3 | 0.8 | GO:1990828 | response to putrescine(GO:1904585) cellular response to putrescine(GO:1904586) hepatocyte dedifferentiation(GO:1990828) |
| 0.3 | 0.5 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
| 0.3 | 3.0 | GO:0006857 | oligopeptide transport(GO:0006857) |
| 0.2 | 0.5 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.2 | 1.7 | GO:0090625 | mRNA cleavage involved in gene silencing by siRNA(GO:0090625) |
| 0.2 | 1.2 | GO:0031291 | Ran protein signal transduction(GO:0031291) |
| 0.2 | 0.5 | GO:0006258 | UDP-glucose catabolic process(GO:0006258) |
| 0.2 | 2.2 | GO:0009048 | dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.2 | 1.2 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
| 0.2 | 7.1 | GO:0043555 | regulation of translation in response to stress(GO:0043555) |
| 0.2 | 1.7 | GO:0060295 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
| 0.2 | 1.9 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.2 | 0.5 | GO:0019230 | proprioception(GO:0019230) |
| 0.2 | 0.7 | GO:0042270 | antigen processing and presentation of endogenous peptide antigen via MHC class Ib(GO:0002476) protection from natural killer cell mediated cytotoxicity(GO:0042270) |
| 0.2 | 1.9 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.2 | 2.4 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.2 | 3.8 | GO:0021702 | cerebellar Purkinje cell layer formation(GO:0021694) cerebellar Purkinje cell differentiation(GO:0021702) |
| 0.2 | 0.5 | GO:1900369 | negative regulation of RNA interference(GO:1900369) |
| 0.2 | 0.9 | GO:0048733 | sebaceous gland development(GO:0048733) |
| 0.2 | 2.3 | GO:0033183 | negative regulation of histone ubiquitination(GO:0033183) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) |
| 0.2 | 0.7 | GO:0045081 | negative regulation of interleukin-10 biosynthetic process(GO:0045081) |
| 0.2 | 1.4 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.2 | 2.3 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.2 | 0.7 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
| 0.2 | 4.3 | GO:0051014 | actin filament severing(GO:0051014) |
| 0.2 | 1.6 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.2 | 0.7 | GO:0060381 | regulation of single-stranded telomeric DNA binding(GO:0060380) positive regulation of single-stranded telomeric DNA binding(GO:0060381) |
| 0.2 | 2.0 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.2 | 0.7 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.2 | 0.7 | GO:0006679 | glucosylceramide biosynthetic process(GO:0006679) |
| 0.2 | 0.9 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
| 0.2 | 2.7 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.2 | 3.1 | GO:1902951 | negative regulation of dendritic spine maintenance(GO:1902951) |
| 0.2 | 2.4 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
| 0.2 | 2.8 | GO:0060022 | hard palate development(GO:0060022) |
| 0.2 | 0.6 | GO:0033364 | mast cell secretory granule organization(GO:0033364) |
| 0.2 | 3.2 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.2 | 1.5 | GO:0036089 | cleavage furrow formation(GO:0036089) |
| 0.2 | 0.6 | GO:0000961 | negative regulation of mitochondrial RNA catabolic process(GO:0000961) |
| 0.2 | 0.2 | GO:0015813 | acidic amino acid transport(GO:0015800) L-glutamate transport(GO:0015813) |
| 0.2 | 2.3 | GO:0070561 | vitamin D receptor signaling pathway(GO:0070561) |
| 0.2 | 0.6 | GO:0045643 | regulation of eosinophil differentiation(GO:0045643) positive regulation of eosinophil differentiation(GO:0045645) |
| 0.2 | 0.2 | GO:1904975 | response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
| 0.2 | 1.5 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.2 | 1.7 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.2 | 0.8 | GO:0036292 | DNA rewinding(GO:0036292) |
| 0.2 | 0.6 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.2 | 1.0 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.2 | 2.3 | GO:0032264 | IMP salvage(GO:0032264) |
| 0.2 | 0.6 | GO:0002752 | cell surface pattern recognition receptor signaling pathway(GO:0002752) |
| 0.2 | 1.2 | GO:0035900 | response to isolation stress(GO:0035900) |
| 0.2 | 1.2 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.2 | 1.2 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.2 | 2.8 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.2 | 0.4 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.2 | 7.6 | GO:0030033 | microvillus assembly(GO:0030033) |
| 0.2 | 1.6 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
| 0.2 | 1.2 | GO:0044782 | cilium organization(GO:0044782) |
| 0.2 | 0.8 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.2 | 0.6 | GO:1901860 | positive regulation of mitochondrial DNA metabolic process(GO:1901860) |
| 0.2 | 1.0 | GO:0042631 | cellular response to water deprivation(GO:0042631) |
| 0.2 | 0.4 | GO:0014855 | striated muscle cell proliferation(GO:0014855) |
| 0.2 | 1.3 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
| 0.2 | 1.3 | GO:0033484 | nitric oxide homeostasis(GO:0033484) |
| 0.2 | 0.6 | GO:0098507 | polynucleotide 5' dephosphorylation(GO:0098507) |
| 0.2 | 0.6 | GO:0048250 | mitochondrial iron ion transport(GO:0048250) |
| 0.2 | 0.6 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.2 | 4.6 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
| 0.2 | 8.2 | GO:1904837 | beta-catenin-TCF complex assembly(GO:1904837) |
| 0.2 | 0.8 | GO:0006272 | leading strand elongation(GO:0006272) |
| 0.2 | 2.1 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.2 | 3.9 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
| 0.2 | 1.6 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.2 | 1.6 | GO:0089700 | protein kinase D signaling(GO:0089700) |
| 0.2 | 2.7 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.2 | 2.9 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.2 | 0.7 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
| 0.2 | 2.1 | GO:0090481 | pyrimidine nucleotide-sugar transmembrane transport(GO:0090481) |
| 0.2 | 0.5 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
| 0.2 | 1.4 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.2 | 2.3 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.2 | 0.2 | GO:1990785 | response to water-immersion restraint stress(GO:1990785) |
| 0.2 | 0.7 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
| 0.2 | 0.5 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 0.2 | 1.0 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.2 | 1.7 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.2 | 3.2 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
| 0.2 | 1.3 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
| 0.2 | 0.5 | GO:0023016 | signal transduction by trans-phosphorylation(GO:0023016) |
| 0.2 | 7.3 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
| 0.2 | 0.6 | GO:0035522 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
| 0.2 | 1.6 | GO:2001300 | lipoxin metabolic process(GO:2001300) |
| 0.2 | 0.8 | GO:0010157 | response to chlorate(GO:0010157) |
| 0.2 | 1.1 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
| 0.2 | 0.5 | GO:0019858 | cytosine metabolic process(GO:0019858) |
| 0.2 | 0.2 | GO:0070858 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.2 | 0.6 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
| 0.2 | 1.1 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.2 | 0.8 | GO:2000312 | regulation of kainate selective glutamate receptor activity(GO:2000312) |
| 0.2 | 0.5 | GO:1904504 | sphinganine metabolic process(GO:0006667) regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
| 0.1 | 1.0 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.1 | 0.9 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.1 | 3.0 | GO:0031065 | positive regulation of histone deacetylation(GO:0031065) |
| 0.1 | 0.6 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
| 0.1 | 2.1 | GO:0002115 | store-operated calcium entry(GO:0002115) |
| 0.1 | 0.6 | GO:0046462 | monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.1 | 0.7 | GO:2001076 | regulation of metanephric ureteric bud development(GO:2001074) positive regulation of metanephric ureteric bud development(GO:2001076) |
| 0.1 | 0.7 | GO:0046543 | development of secondary sexual characteristics(GO:0045136) development of secondary female sexual characteristics(GO:0046543) |
| 0.1 | 0.6 | GO:0002296 | T-helper 1 cell lineage commitment(GO:0002296) |
| 0.1 | 0.4 | GO:1904875 | regulation of DNA ligase activity(GO:1904875) |
| 0.1 | 0.4 | GO:0035621 | ER to Golgi ceramide transport(GO:0035621) |
| 0.1 | 1.7 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
| 0.1 | 0.4 | GO:0040040 | thermosensory behavior(GO:0040040) |
| 0.1 | 0.3 | GO:0098917 | retrograde trans-synaptic signaling(GO:0098917) |
| 0.1 | 3.3 | GO:0038092 | nodal signaling pathway(GO:0038092) |
| 0.1 | 1.1 | GO:0075713 | establishment of integrated proviral latency(GO:0075713) |
| 0.1 | 1.3 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.1 | 6.7 | GO:0051568 | histone H3-K4 methylation(GO:0051568) |
| 0.1 | 0.7 | GO:0003068 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 0.1 | 1.4 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.1 | 0.4 | GO:1904924 | negative regulation of mitophagy in response to mitochondrial depolarization(GO:1904924) |
| 0.1 | 1.1 | GO:0002328 | pro-B cell differentiation(GO:0002328) |
| 0.1 | 0.3 | GO:1905051 | regulation of base-excision repair(GO:1905051) positive regulation of base-excision repair(GO:1905053) |
| 0.1 | 1.4 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.1 | 1.2 | GO:0006336 | DNA replication-independent nucleosome assembly(GO:0006336) |
| 0.1 | 1.9 | GO:0070070 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.1 | 3.2 | GO:0006266 | DNA ligation(GO:0006266) |
| 0.1 | 0.8 | GO:0060968 | regulation of gene silencing(GO:0060968) |
| 0.1 | 0.3 | GO:0046778 | modification by virus of host mRNA processing(GO:0046778) |
| 0.1 | 0.6 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
| 0.1 | 1.4 | GO:0035583 | sequestering of TGFbeta in extracellular matrix(GO:0035583) |
| 0.1 | 0.7 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
| 0.1 | 2.5 | GO:0070914 | UV-damage excision repair(GO:0070914) |
| 0.1 | 0.7 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
| 0.1 | 0.4 | GO:1903936 | response to sodium arsenite(GO:1903935) cellular response to sodium arsenite(GO:1903936) |
| 0.1 | 0.7 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
| 0.1 | 0.2 | GO:0048385 | regulation of retinoic acid receptor signaling pathway(GO:0048385) negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.1 | 1.6 | GO:1902961 | positive regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902961) positive regulation of aspartic-type peptidase activity(GO:1905247) |
| 0.1 | 0.8 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.1 | 4.7 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
| 0.1 | 0.5 | GO:0014054 | positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
| 0.1 | 0.7 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.1 | 0.2 | GO:0080120 | CAAX-box protein processing(GO:0071586) CAAX-box protein maturation(GO:0080120) |
| 0.1 | 0.6 | GO:0090031 | positive regulation of steroid hormone biosynthetic process(GO:0090031) |
| 0.1 | 1.6 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.1 | 1.0 | GO:0000079 | regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0000079) |
| 0.1 | 0.1 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.1 | 1.0 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 0.1 | 3.5 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.1 | 2.2 | GO:0035066 | positive regulation of histone acetylation(GO:0035066) positive regulation of peptidyl-lysine acetylation(GO:2000758) |
| 0.1 | 0.5 | GO:0044691 | tooth eruption(GO:0044691) |
| 0.1 | 0.3 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
| 0.1 | 0.8 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.1 | 0.4 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.1 | 0.7 | GO:0061083 | regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) |
| 0.1 | 1.4 | GO:2000615 | regulation of histone H3-K9 acetylation(GO:2000615) |
| 0.1 | 0.8 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.1 | 0.9 | GO:0031061 | negative regulation of histone methylation(GO:0031061) |
| 0.1 | 0.5 | GO:0072367 | regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) |
| 0.1 | 0.6 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.1 | 0.4 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) Golgi transport vesicle coating(GO:0048200) COPI coating of Golgi vesicle(GO:0048205) |
| 0.1 | 3.7 | GO:0030220 | platelet formation(GO:0030220) |
| 0.1 | 1.2 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
| 0.1 | 0.7 | GO:1904896 | ESCRT complex disassembly(GO:1904896) ESCRT III complex disassembly(GO:1904903) |
| 0.1 | 2.9 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
| 0.1 | 2.0 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.1 | 0.7 | GO:0070375 | ERK5 cascade(GO:0070375) |
| 0.1 | 0.8 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 | 2.0 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
| 0.1 | 0.4 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.1 | 0.4 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 0.1 | 0.3 | GO:1901536 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
| 0.1 | 0.8 | GO:0043634 | polyadenylation-dependent RNA catabolic process(GO:0043633) polyadenylation-dependent ncRNA catabolic process(GO:0043634) |
| 0.1 | 0.7 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
| 0.1 | 0.9 | GO:0007176 | regulation of epidermal growth factor-activated receptor activity(GO:0007176) |
| 0.1 | 1.5 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
| 0.1 | 1.9 | GO:0030210 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.1 | 0.3 | GO:0090340 | positive regulation of high-density lipoprotein particle assembly(GO:0090108) positive regulation of secretion of lysosomal enzymes(GO:0090340) |
| 0.1 | 1.8 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
| 0.1 | 1.4 | GO:0006198 | cAMP catabolic process(GO:0006198) |
| 0.1 | 1.5 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.1 | 1.4 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.1 | 0.3 | GO:0032618 | interleukin-15 production(GO:0032618) |
| 0.1 | 2.9 | GO:0045332 | phospholipid translocation(GO:0045332) |
| 0.1 | 1.5 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
| 0.1 | 0.3 | GO:1903926 | signal transduction involved in intra-S DNA damage checkpoint(GO:0072428) negative regulation of mitotic cell cycle DNA replication(GO:1903464) response to bisphenol A(GO:1903925) cellular response to bisphenol A(GO:1903926) |
| 0.1 | 0.1 | GO:0031442 | positive regulation of mRNA 3'-end processing(GO:0031442) |
| 0.1 | 0.4 | GO:1905174 | metanephric glomerular mesangial cell development(GO:0072255) reversible differentiation(GO:0090677) cell dedifferentiation involved in phenotypic switching(GO:0090678) positive regulation of phenotypic switching(GO:1900241) regulation of vascular smooth muscle cell dedifferentiation(GO:1905174) positive regulation of vascular smooth muscle cell dedifferentiation(GO:1905176) vascular smooth muscle cell dedifferentiation(GO:1990936) |
| 0.1 | 0.3 | GO:1903527 | positive regulation of membrane tubulation(GO:1903527) |
| 0.1 | 0.6 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.1 | 0.7 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
| 0.1 | 2.2 | GO:0006359 | regulation of transcription from RNA polymerase III promoter(GO:0006359) |
| 0.1 | 1.0 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.1 | 0.6 | GO:0046836 | glycolipid transport(GO:0046836) |
| 0.1 | 1.1 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
| 0.1 | 0.4 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.1 | 0.5 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.1 | 1.1 | GO:0045930 | negative regulation of mitotic cell cycle(GO:0045930) |
| 0.1 | 1.7 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.1 | 1.6 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
| 0.1 | 0.3 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.1 | 1.5 | GO:0034356 | NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
| 0.1 | 1.0 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.1 | 0.4 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.1 | 0.7 | GO:0090205 | positive regulation of cholesterol metabolic process(GO:0090205) |
| 0.1 | 0.4 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.1 | 0.8 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
| 0.1 | 1.8 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.1 | 3.2 | GO:0070911 | global genome nucleotide-excision repair(GO:0070911) |
| 0.1 | 1.9 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
| 0.1 | 0.3 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.1 | 1.4 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
| 0.1 | 0.4 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
| 0.1 | 0.7 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
| 0.1 | 1.2 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
| 0.1 | 1.5 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
| 0.1 | 0.6 | GO:2000035 | regulation of stem cell division(GO:2000035) |
| 0.1 | 0.6 | GO:0045204 | MAPK export from nucleus(GO:0045204) |
| 0.1 | 1.4 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
| 0.1 | 0.7 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.1 | 0.6 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.1 | 0.4 | GO:0072709 | cellular response to sorbitol(GO:0072709) |
| 0.1 | 1.1 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.1 | 0.2 | GO:0007518 | myoblast fate determination(GO:0007518) |
| 0.1 | 0.6 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
| 0.1 | 0.4 | GO:0035280 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) |
| 0.1 | 0.4 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
| 0.1 | 1.4 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
| 0.1 | 0.7 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.1 | 1.0 | GO:0042789 | mRNA transcription from RNA polymerase II promoter(GO:0042789) |
| 0.1 | 0.6 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
| 0.1 | 1.3 | GO:0007100 | mitotic centrosome separation(GO:0007100) |
| 0.1 | 0.7 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
| 0.1 | 0.9 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.1 | 0.8 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
| 0.1 | 1.1 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
| 0.1 | 0.8 | GO:0010993 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
| 0.1 | 1.7 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
| 0.1 | 0.3 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
| 0.1 | 0.4 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.1 | 0.4 | GO:0044208 | 'de novo' AMP biosynthetic process(GO:0044208) |
| 0.1 | 0.8 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.1 | 0.4 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.1 | 1.9 | GO:1904380 | endoplasmic reticulum mannose trimming(GO:1904380) |
| 0.1 | 1.1 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.1 | 0.4 | GO:0045669 | positive regulation of osteoblast differentiation(GO:0045669) |
| 0.1 | 0.6 | GO:0010225 | response to UV-C(GO:0010225) |
| 0.1 | 0.1 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) |
| 0.1 | 0.6 | GO:0038203 | TORC2 signaling(GO:0038203) |
| 0.1 | 1.5 | GO:0035246 | peptidyl-arginine N-methylation(GO:0035246) |
| 0.1 | 0.3 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
| 0.1 | 0.2 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
| 0.1 | 1.4 | GO:0036010 | protein localization to endosome(GO:0036010) |
| 0.1 | 2.2 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
| 0.1 | 0.5 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
| 0.1 | 1.4 | GO:0034380 | high-density lipoprotein particle assembly(GO:0034380) |
| 0.1 | 1.2 | GO:0071158 | positive regulation of cell cycle arrest(GO:0071158) |
| 0.1 | 0.5 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 | 0.9 | GO:0045046 | protein import into peroxisome membrane(GO:0045046) |
| 0.1 | 0.5 | GO:0043418 | homocysteine catabolic process(GO:0043418) |
| 0.1 | 0.1 | GO:0038030 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.1 | 0.1 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.1 | 0.3 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.1 | 4.8 | GO:0000186 | activation of MAPKK activity(GO:0000186) |
| 0.1 | 0.2 | GO:0098501 | polynucleotide dephosphorylation(GO:0098501) DNA dephosphorylation(GO:0098502) |
| 0.1 | 1.0 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.1 | 0.6 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
| 0.1 | 0.1 | GO:0021623 | oculomotor nerve morphogenesis(GO:0021622) oculomotor nerve formation(GO:0021623) |
| 0.1 | 4.8 | GO:0090307 | mitotic spindle assembly(GO:0090307) |
| 0.1 | 1.1 | GO:0016246 | RNA interference(GO:0016246) |
| 0.1 | 0.4 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
| 0.1 | 1.3 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
| 0.1 | 0.1 | GO:0017055 | negative regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0017055) |
| 0.1 | 0.2 | GO:0033385 | geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
| 0.1 | 3.5 | GO:0060976 | coronary vasculature development(GO:0060976) |
| 0.1 | 0.5 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.1 | 0.3 | GO:0046833 | positive regulation of nucleobase-containing compound transport(GO:0032241) positive regulation of RNA export from nucleus(GO:0046833) |
| 0.1 | 0.3 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.1 | 0.7 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 0.1 | 0.5 | GO:0023035 | CD40 signaling pathway(GO:0023035) |
| 0.1 | 0.3 | GO:0009609 | response to symbiont(GO:0009608) response to symbiotic bacterium(GO:0009609) |
| 0.1 | 1.3 | GO:0045589 | regulation of regulatory T cell differentiation(GO:0045589) |
| 0.1 | 0.2 | GO:0030047 | actin modification(GO:0030047) |
| 0.1 | 0.2 | GO:0016260 | selenocysteine biosynthetic process(GO:0016260) |
| 0.1 | 0.2 | GO:1904046 | negative regulation of vascular endothelial growth factor production(GO:1904046) |
| 0.1 | 0.6 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.1 | 0.5 | GO:0000729 | DNA double-strand break processing(GO:0000729) |
| 0.1 | 0.3 | GO:0043686 | co-translational protein modification(GO:0043686) |
| 0.1 | 0.9 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
| 0.1 | 0.8 | GO:0010666 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.1 | 0.2 | GO:0042144 | vacuole fusion, non-autophagic(GO:0042144) |
| 0.1 | 1.6 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.1 | 0.2 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
| 0.1 | 1.5 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.1 | 0.5 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.1 | 0.6 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.1 | 0.2 | GO:0016598 | protein arginylation(GO:0016598) |
| 0.1 | 0.2 | GO:0043105 | regulation of GTP cyclohydrolase I activity(GO:0043095) negative regulation of GTP cyclohydrolase I activity(GO:0043105) |
| 0.1 | 6.7 | GO:0016573 | histone acetylation(GO:0016573) |
| 0.1 | 0.1 | GO:0032915 | positive regulation of transforming growth factor beta2 production(GO:0032915) mediolateral intercalation(GO:0060031) planar cell polarity pathway involved in gastrula mediolateral intercalation(GO:0060775) |
| 0.1 | 0.5 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) |
| 0.1 | 0.7 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.1 | 0.2 | GO:0016267 | O-glycan processing, core 1(GO:0016267) |
| 0.1 | 1.0 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.1 | 0.6 | GO:0070172 | positive regulation of tooth mineralization(GO:0070172) |
| 0.1 | 1.2 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.1 | 0.1 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.1 | 0.6 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.1 | 0.4 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.1 | 0.6 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.1 | 0.7 | GO:0060252 | positive regulation of glial cell proliferation(GO:0060252) |
| 0.1 | 1.3 | GO:0070306 | lens fiber cell differentiation(GO:0070306) |
| 0.1 | 0.5 | GO:0060965 | negative regulation of gene silencing by miRNA(GO:0060965) |
| 0.1 | 0.3 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.1 | 1.0 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.1 | 0.7 | GO:0097201 | negative regulation of transcription from RNA polymerase II promoter in response to stress(GO:0097201) |
| 0.1 | 1.1 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.1 | 0.2 | GO:0046626 | regulation of insulin receptor signaling pathway(GO:0046626) |
| 0.1 | 0.9 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.1 | 0.2 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.1 | 0.8 | GO:0045048 | protein insertion into ER membrane(GO:0045048) |
| 0.1 | 0.4 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
| 0.1 | 0.4 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
| 0.1 | 0.5 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.1 | 1.8 | GO:0045742 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) |
| 0.1 | 2.4 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.1 | 0.4 | GO:1903786 | mycotoxin catabolic process(GO:0043387) aflatoxin catabolic process(GO:0046223) organic heteropentacyclic compound catabolic process(GO:1901377) regulation of glutathione biosynthetic process(GO:1903786) positive regulation of glutathione biosynthetic process(GO:1903788) |
| 0.1 | 2.2 | GO:0031122 | cytoplasmic microtubule organization(GO:0031122) |
| 0.1 | 0.6 | GO:0097240 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.0 | 0.6 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
| 0.0 | 0.6 | GO:2000780 | negative regulation of double-strand break repair(GO:2000780) |
| 0.0 | 0.2 | GO:0042335 | cuticle development(GO:0042335) |
| 0.0 | 1.1 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
| 0.0 | 0.1 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
| 0.0 | 0.1 | GO:0000710 | meiotic mismatch repair(GO:0000710) |
| 0.0 | 0.2 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.0 | 0.5 | GO:0009629 | response to gravity(GO:0009629) |
| 0.0 | 1.4 | GO:0045737 | positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
| 0.0 | 0.2 | GO:0019856 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.0 | 0.3 | GO:0007212 | dopamine receptor signaling pathway(GO:0007212) |
| 0.0 | 0.4 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.0 | 0.4 | GO:0007249 | I-kappaB kinase/NF-kappaB signaling(GO:0007249) |
| 0.0 | 0.3 | GO:0042446 | hormone biosynthetic process(GO:0042446) |
| 0.0 | 0.5 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
| 0.0 | 1.8 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
| 0.0 | 0.4 | GO:0032310 | prostaglandin secretion(GO:0032310) |
| 0.0 | 0.9 | GO:0042177 | negative regulation of protein catabolic process(GO:0042177) |
| 0.0 | 0.1 | GO:0003064 | regulation of heart rate by hormone(GO:0003064) |
| 0.0 | 1.3 | GO:2000178 | negative regulation of neural precursor cell proliferation(GO:2000178) |
| 0.0 | 1.7 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.0 | 1.6 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.0 | 1.4 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.0 | 1.7 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.0 | 1.1 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
| 0.0 | 0.2 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.0 | 1.5 | GO:0007274 | neuromuscular synaptic transmission(GO:0007274) |
| 0.0 | 0.2 | GO:0035358 | regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035358) positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
| 0.0 | 0.2 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
| 0.0 | 1.1 | GO:0006298 | mismatch repair(GO:0006298) |
| 0.0 | 0.1 | GO:0006423 | cysteinyl-tRNA aminoacylation(GO:0006423) |
| 0.0 | 0.2 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.0 | 0.7 | GO:0000732 | strand displacement(GO:0000732) |
| 0.0 | 0.3 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.0 | 3.8 | GO:2000134 | negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
| 0.0 | 0.1 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
| 0.0 | 0.5 | GO:0030952 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) establishment or maintenance of cytoskeleton polarity(GO:0030952) |
| 0.0 | 0.5 | GO:0060056 | mammary gland involution(GO:0060056) |
| 0.0 | 0.6 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.0 | 0.6 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
| 0.0 | 0.2 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.0 | 0.6 | GO:0030091 | protein repair(GO:0030091) |
| 0.0 | 0.5 | GO:2000291 | regulation of myoblast proliferation(GO:2000291) |
| 0.0 | 0.0 | GO:0072553 | terminal button organization(GO:0072553) |
| 0.0 | 0.3 | GO:0002088 | lens development in camera-type eye(GO:0002088) |
| 0.0 | 2.1 | GO:0032508 | DNA duplex unwinding(GO:0032508) |
| 0.0 | 0.4 | GO:0010265 | SCF complex assembly(GO:0010265) |
| 0.0 | 0.1 | GO:0002276 | basophil activation involved in immune response(GO:0002276) |
| 0.0 | 0.1 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
| 0.0 | 0.5 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
| 0.0 | 0.6 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.0 | 0.6 | GO:0045793 | positive regulation of cell size(GO:0045793) |
| 0.0 | 0.2 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
| 0.0 | 0.6 | GO:0014020 | primary neural tube formation(GO:0014020) |
| 0.0 | 0.2 | GO:0003073 | regulation of systemic arterial blood pressure(GO:0003073) |
| 0.0 | 0.1 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
| 0.0 | 0.3 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.0 | 0.2 | GO:0001767 | establishment of lymphocyte polarity(GO:0001767) |
| 0.0 | 1.4 | GO:0015914 | phospholipid transport(GO:0015914) |
| 0.0 | 0.4 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
| 0.0 | 1.5 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
| 0.0 | 1.3 | GO:0036150 | phosphatidylserine acyl-chain remodeling(GO:0036150) |
| 0.0 | 1.4 | GO:0050690 | regulation of defense response to virus by virus(GO:0050690) |
| 0.0 | 0.4 | GO:0052405 | negative regulation by host of symbiont molecular function(GO:0052405) |
| 0.0 | 0.4 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.0 | 0.2 | GO:1904781 | positive regulation of protein localization to centrosome(GO:1904781) |
| 0.0 | 0.7 | GO:0000726 | non-recombinational repair(GO:0000726) |
| 0.0 | 7.3 | GO:0038096 | immune response-regulating cell surface receptor signaling pathway involved in phagocytosis(GO:0002433) Fc-gamma receptor signaling pathway involved in phagocytosis(GO:0038096) |
| 0.0 | 0.8 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
| 0.0 | 0.4 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.0 | 1.4 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
| 0.0 | 0.1 | GO:0032918 | polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
| 0.0 | 0.3 | GO:0072642 | interferon-alpha secretion(GO:0072642) regulation of interferon-alpha secretion(GO:1902739) positive regulation of interferon-alpha secretion(GO:1902741) |
| 0.0 | 1.9 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.0 | 5.2 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
| 0.0 | 0.2 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.0 | 0.1 | GO:0021503 | neural fold bending(GO:0021503) |
| 0.0 | 0.2 | GO:0090669 | telomerase RNA stabilization(GO:0090669) |
| 0.0 | 0.8 | GO:0071277 | cellular response to calcium ion(GO:0071277) |
| 0.0 | 0.2 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
| 0.0 | 1.9 | GO:0031640 | killing of cells of other organism(GO:0031640) disruption of cells of other organism(GO:0044364) |
| 0.0 | 0.1 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.0 | 0.2 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
| 0.0 | 0.2 | GO:0009597 | detection of virus(GO:0009597) |
| 0.0 | 3.0 | GO:0030049 | muscle filament sliding(GO:0030049) actin-myosin filament sliding(GO:0033275) |
| 0.0 | 0.3 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
| 0.0 | 0.5 | GO:0042048 | olfactory behavior(GO:0042048) |
| 0.0 | 0.3 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.0 | 1.0 | GO:1904667 | negative regulation of ubiquitin protein ligase activity(GO:1904667) |
| 0.0 | 0.7 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
| 0.0 | 0.4 | GO:0045724 | positive regulation of cilium assembly(GO:0045724) |
| 0.0 | 2.3 | GO:0006333 | chromatin assembly or disassembly(GO:0006333) |
| 0.0 | 1.1 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
| 0.0 | 0.4 | GO:0035313 | wound healing, spreading of epidermal cells(GO:0035313) |
| 0.0 | 0.5 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
| 0.0 | 1.1 | GO:0006342 | chromatin silencing(GO:0006342) |
| 0.0 | 0.4 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
| 0.0 | 0.5 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
| 0.0 | 0.2 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
| 0.0 | 0.8 | GO:0010508 | positive regulation of autophagy(GO:0010508) |
| 0.0 | 0.3 | GO:0010624 | regulation of Schwann cell proliferation(GO:0010624) negative regulation of Schwann cell proliferation(GO:0010626) Schwann cell proliferation(GO:0014010) |
| 0.0 | 0.7 | GO:0016241 | regulation of macroautophagy(GO:0016241) |
| 0.0 | 1.7 | GO:0051646 | mitochondrion localization(GO:0051646) |
| 0.0 | 0.3 | GO:0032006 | regulation of TOR signaling(GO:0032006) |
| 0.0 | 0.5 | GO:0060065 | uterus development(GO:0060065) |
| 0.0 | 0.4 | GO:0060155 | platelet dense granule organization(GO:0060155) |
| 0.0 | 0.8 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
| 0.0 | 0.1 | GO:1904397 | negative regulation of neuromuscular junction development(GO:1904397) |
| 0.0 | 0.6 | GO:0008340 | determination of adult lifespan(GO:0008340) |
| 0.0 | 1.5 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
| 0.0 | 0.6 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
| 0.0 | 0.1 | GO:0060219 | camera-type eye photoreceptor cell differentiation(GO:0060219) |
| 0.0 | 0.7 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.0 | 1.6 | GO:0042795 | snRNA transcription(GO:0009301) snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.0 | 0.4 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
| 0.0 | 0.7 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
| 0.0 | 0.5 | GO:0000291 | nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
| 0.0 | 1.2 | GO:0007140 | male meiosis(GO:0007140) |
| 0.0 | 0.1 | GO:0001510 | RNA methylation(GO:0001510) |
| 0.0 | 0.1 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.0 | 0.2 | GO:0080009 | mRNA methylation(GO:0080009) |
| 0.0 | 0.2 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
| 0.0 | 0.4 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
| 0.0 | 0.2 | GO:0060969 | negative regulation of gene silencing(GO:0060969) |
| 0.0 | 0.1 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.0 | 0.1 | GO:0045900 | cytoplasmic translational elongation(GO:0002182) negative regulation of translational elongation(GO:0045900) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
| 0.0 | 0.7 | GO:0051895 | negative regulation of focal adhesion assembly(GO:0051895) negative regulation of adherens junction organization(GO:1903392) |
| 0.0 | 0.3 | GO:0015870 | acetylcholine transport(GO:0015870) |
| 0.0 | 0.2 | GO:0030242 | pexophagy(GO:0030242) |
| 0.0 | 0.2 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.0 | 1.2 | GO:0030218 | erythrocyte differentiation(GO:0030218) |
| 0.0 | 0.6 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 | 0.1 | GO:0015012 | heparan sulfate proteoglycan biosynthetic process(GO:0015012) |
| 0.0 | 1.1 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.0 | 0.7 | GO:0006368 | transcription elongation from RNA polymerase II promoter(GO:0006368) |
| 0.0 | 0.0 | GO:0046832 | negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.0 | 0.4 | GO:0042340 | keratan sulfate catabolic process(GO:0042340) |
| 0.0 | 0.3 | GO:0044597 | polyketide metabolic process(GO:0030638) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.0 | 0.2 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
| 0.0 | 0.5 | GO:0010591 | regulation of lamellipodium assembly(GO:0010591) |
| 0.0 | 0.3 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.0 | 0.2 | GO:0003231 | cardiac ventricle development(GO:0003231) |
| 0.0 | 0.1 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
| 0.0 | 1.0 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
| 0.0 | 0.6 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.0 | 0.1 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational elongation(GO:0045901) positive regulation of translational termination(GO:0045905) |
| 0.0 | 0.8 | GO:0006379 | mRNA cleavage(GO:0006379) |
| 0.0 | 0.2 | GO:0000098 | sulfur amino acid catabolic process(GO:0000098) |
| 0.0 | 2.4 | GO:0006338 | chromatin remodeling(GO:0006338) |
| 0.0 | 0.7 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
| 0.0 | 2.2 | GO:0050852 | T cell receptor signaling pathway(GO:0050852) |
| 0.0 | 2.4 | GO:0043484 | regulation of RNA splicing(GO:0043484) |
| 0.0 | 0.1 | GO:0033512 | L-lysine catabolic process to acetyl-CoA via saccharopine(GO:0033512) |
| 0.0 | 0.6 | GO:0044380 | protein localization to cytoskeleton(GO:0044380) |
| 0.0 | 0.2 | GO:0071486 | cellular response to high light intensity(GO:0071486) retinal rod cell apoptotic process(GO:0097473) |
| 0.0 | 0.2 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
| 0.0 | 0.9 | GO:0046039 | GTP metabolic process(GO:0046039) |
| 0.0 | 0.5 | GO:0009157 | deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) |
| 0.0 | 0.2 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.0 | 0.4 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 | 0.1 | GO:0050893 | sensory processing(GO:0050893) |
| 0.0 | 0.4 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.0 | 0.5 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.0 | 0.5 | GO:0060334 | regulation of response to interferon-gamma(GO:0060330) regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
| 0.0 | 0.3 | GO:0039703 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.0 | 0.2 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
| 0.0 | 0.4 | GO:0090168 | Golgi reassembly(GO:0090168) |
| 0.0 | 0.2 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
| 0.0 | 0.3 | GO:1903432 | regulation of TORC1 signaling(GO:1903432) |
| 0.0 | 1.5 | GO:0036498 | IRE1-mediated unfolded protein response(GO:0036498) |
| 0.0 | 0.1 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
| 0.0 | 0.4 | GO:0015874 | norepinephrine transport(GO:0015874) |
| 0.0 | 2.0 | GO:0032436 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032436) |
| 0.0 | 0.2 | GO:0060088 | auditory receptor cell stereocilium organization(GO:0060088) |
| 0.0 | 0.8 | GO:0019835 | cytolysis(GO:0019835) |
| 0.0 | 2.3 | GO:0006687 | glycosphingolipid metabolic process(GO:0006687) |
| 0.0 | 0.3 | GO:0006706 | steroid catabolic process(GO:0006706) |
| 0.0 | 0.5 | GO:2000249 | regulation of actin cytoskeleton reorganization(GO:2000249) |
| 0.0 | 0.6 | GO:0035872 | nucleotide-binding domain, leucine rich repeat containing receptor signaling pathway(GO:0035872) |
| 0.0 | 0.1 | GO:0051029 | rRNA transport(GO:0051029) |
| 0.0 | 0.4 | GO:0051560 | mitochondrial calcium ion homeostasis(GO:0051560) |
| 0.0 | 0.2 | GO:0007020 | microtubule nucleation(GO:0007020) |
| 0.0 | 0.0 | GO:0043335 | protein unfolding(GO:0043335) |
| 0.0 | 0.1 | GO:0016094 | polyprenol biosynthetic process(GO:0016094) |
| 0.0 | 1.1 | GO:0048678 | response to axon injury(GO:0048678) |
| 0.0 | 0.3 | GO:0030520 | intracellular estrogen receptor signaling pathway(GO:0030520) |
| 0.0 | 0.2 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.0 | 0.2 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
| 0.0 | 1.5 | GO:0006879 | cellular iron ion homeostasis(GO:0006879) |
| 0.0 | 0.2 | GO:0035878 | nail development(GO:0035878) |
| 0.0 | 0.1 | GO:0030575 | nuclear body organization(GO:0030575) |
| 0.0 | 0.2 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.0 | 0.2 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
| 0.0 | 0.5 | GO:0035025 | positive regulation of Rho protein signal transduction(GO:0035025) |
| 0.0 | 0.2 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
| 0.0 | 0.7 | GO:0071431 | tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.0 | 0.0 | GO:1990535 | neuron projection maintenance(GO:1990535) |
| 0.0 | 0.2 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
| 0.0 | 0.4 | GO:0008334 | histone mRNA metabolic process(GO:0008334) |
| 0.0 | 0.1 | GO:0036093 | male germ cell proliferation(GO:0002176) germ cell proliferation(GO:0036093) |
| 0.0 | 0.2 | GO:0046085 | adenosine metabolic process(GO:0046085) |
| 0.0 | 0.2 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.0 | 0.2 | GO:0032790 | ribosome disassembly(GO:0032790) |
| 0.0 | 1.4 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.0 | 1.3 | GO:0009311 | oligosaccharide metabolic process(GO:0009311) |
| 0.0 | 0.2 | GO:0044351 | macropinocytosis(GO:0044351) |
| 0.0 | 0.9 | GO:1904893 | negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
| 0.0 | 1.2 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.0 | 1.1 | GO:0000910 | cytokinesis(GO:0000910) |
| 0.0 | 0.5 | GO:0010803 | regulation of tumor necrosis factor-mediated signaling pathway(GO:0010803) |
| 0.0 | 0.2 | GO:0019054 | modulation by virus of host process(GO:0019054) |
| 0.0 | 0.0 | GO:0070781 | response to biotin(GO:0070781) |
| 0.0 | 0.3 | GO:0002931 | response to ischemia(GO:0002931) |
| 0.0 | 1.6 | GO:0051028 | mRNA transport(GO:0051028) |
| 0.0 | 0.1 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.0 | 0.1 | GO:0070254 | mucus secretion(GO:0070254) |
| 0.0 | 0.3 | GO:0051057 | positive regulation of small GTPase mediated signal transduction(GO:0051057) |
| 0.0 | 0.3 | GO:0034656 | nucleobase-containing small molecule catabolic process(GO:0034656) |
| 0.0 | 0.1 | GO:0051083 | 'de novo' cotranslational protein folding(GO:0051083) |
| 0.0 | 0.1 | GO:0061739 | protein lipidation involved in autophagosome assembly(GO:0061739) |
| 0.0 | 0.2 | GO:0043543 | protein acylation(GO:0043543) |
| 0.0 | 0.1 | GO:1903317 | regulation of protein processing(GO:0070613) regulation of protein maturation(GO:1903317) |
| 0.0 | 0.6 | GO:0032204 | regulation of telomere maintenance(GO:0032204) |
| 0.0 | 0.4 | GO:0051225 | spindle assembly(GO:0051225) |
| 0.0 | 0.6 | GO:0030888 | regulation of B cell proliferation(GO:0030888) |
| 0.0 | 1.9 | GO:0090630 | activation of GTPase activity(GO:0090630) |
| 0.0 | 0.4 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
| 0.0 | 0.3 | GO:0070208 | protein heterotrimerization(GO:0070208) |
| 0.0 | 0.1 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
| 0.0 | 0.2 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
| 0.0 | 0.2 | GO:0016197 | endosomal transport(GO:0016197) |
| 0.0 | 0.1 | GO:0006868 | glutamine transport(GO:0006868) L-cystine transport(GO:0015811) |
| 0.0 | 0.1 | GO:0018032 | protein amidation(GO:0018032) |
| 0.0 | 0.6 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
| 0.0 | 0.4 | GO:0097352 | autophagosome maturation(GO:0097352) |
| 0.0 | 0.0 | GO:0042474 | middle ear morphogenesis(GO:0042474) |
| 0.0 | 1.4 | GO:0007286 | spermatid development(GO:0007286) |
| 0.0 | 0.5 | GO:0006446 | regulation of translational initiation(GO:0006446) |
| 0.0 | 0.9 | GO:0045454 | cell redox homeostasis(GO:0045454) |
| 0.0 | 0.0 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
| 0.0 | 0.2 | GO:0030330 | DNA damage response, signal transduction by p53 class mediator(GO:0030330) |
| 0.0 | 0.2 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.0 | 0.5 | GO:1903861 | positive regulation of dendrite extension(GO:1903861) |
| 0.0 | 0.3 | GO:0009303 | rRNA transcription(GO:0009303) |
| 0.0 | 0.0 | GO:0043388 | positive regulation of DNA binding(GO:0043388) |
| 0.0 | 0.4 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
| 0.0 | 0.1 | GO:0019388 | galactose catabolic process(GO:0019388) |
| 0.0 | 0.1 | GO:2000772 | regulation of cellular senescence(GO:2000772) |
| 0.0 | 0.1 | GO:0035825 | reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.0 | 4.1 | GO:0036284 | tubulobulbar complex(GO:0036284) |
| 1.0 | 3.0 | GO:0032173 | septin ring(GO:0005940) septin collar(GO:0032173) |
| 0.9 | 8.6 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.8 | 1.7 | GO:0061673 | mitotic spindle astral microtubule(GO:0061673) |
| 0.7 | 2.0 | GO:0002945 | cyclin K-CDK13 complex(GO:0002945) |
| 0.6 | 5.0 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.6 | 1.8 | GO:0035525 | NF-kappaB p50/p65 complex(GO:0035525) |
| 0.5 | 2.7 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.5 | 1.6 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.5 | 6.2 | GO:0072487 | MSL complex(GO:0072487) |
| 0.5 | 0.5 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.5 | 1.5 | GO:0009330 | DNA topoisomerase complex (ATP-hydrolyzing)(GO:0009330) |
| 0.5 | 3.9 | GO:0031415 | NatA complex(GO:0031415) |
| 0.5 | 5.0 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.5 | 1.8 | GO:0070369 | beta-catenin-TCF7L2 complex(GO:0070369) |
| 0.5 | 1.8 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
| 0.4 | 13.8 | GO:0016514 | SWI/SNF complex(GO:0016514) |
| 0.4 | 1.6 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.4 | 3.1 | GO:0001740 | Barr body(GO:0001740) |
| 0.4 | 4.9 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 0.4 | 2.1 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
| 0.4 | 17.6 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.3 | 1.0 | GO:0075341 | host cell PML body(GO:0075341) |
| 0.3 | 5.4 | GO:0060091 | kinocilium(GO:0060091) |
| 0.3 | 2.3 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.3 | 2.3 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.3 | 2.6 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.3 | 1.6 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.3 | 6.2 | GO:0032059 | bleb(GO:0032059) |
| 0.3 | 2.5 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.3 | 0.9 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.3 | 1.8 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.3 | 1.2 | GO:0031523 | Myb complex(GO:0031523) |
| 0.3 | 4.9 | GO:0090544 | BAF-type complex(GO:0090544) |
| 0.3 | 1.1 | GO:0043291 | RAVE complex(GO:0043291) |
| 0.3 | 2.5 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.3 | 7.8 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.3 | 3.8 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.3 | 1.1 | GO:0044753 | amphisome(GO:0044753) |
| 0.3 | 1.6 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
| 0.3 | 6.3 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.2 | 1.0 | GO:0031251 | PAN complex(GO:0031251) |
| 0.2 | 3.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.2 | 0.7 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.2 | 0.9 | GO:0034676 | integrin alpha6-beta4 complex(GO:0034676) |
| 0.2 | 1.5 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
| 0.2 | 4.5 | GO:0031011 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 0.2 | 2.9 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.2 | 1.3 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.2 | 8.6 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.2 | 2.0 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.2 | 1.6 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.2 | 0.2 | GO:0055087 | Ski complex(GO:0055087) |
| 0.2 | 1.3 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.2 | 0.4 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 0.2 | 0.6 | GO:0031213 | RSF complex(GO:0031213) |
| 0.2 | 0.5 | GO:0030689 | Noc complex(GO:0030689) |
| 0.2 | 6.3 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.2 | 0.4 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.2 | 5.6 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 0.2 | 1.3 | GO:0098536 | deuterosome(GO:0098536) |
| 0.2 | 1.3 | GO:0001652 | granular component(GO:0001652) |
| 0.2 | 2.1 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.2 | 1.2 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
| 0.2 | 6.0 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.2 | 2.4 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.2 | 4.0 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.2 | 1.6 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.2 | 0.8 | GO:0036398 | TCR signalosome(GO:0036398) |
| 0.2 | 29.2 | GO:0016605 | PML body(GO:0016605) |
| 0.2 | 1.5 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 0.2 | 0.8 | GO:0032449 | CBM complex(GO:0032449) |
| 0.2 | 2.7 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.2 | 1.9 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.2 | 0.9 | GO:0070381 | endosome to plasma membrane transport vesicle(GO:0070381) |
| 0.1 | 1.8 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.1 | 10.6 | GO:1990391 | DNA repair complex(GO:1990391) |
| 0.1 | 6.3 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.1 | 0.7 | GO:1990031 | pinceau fiber(GO:1990031) |
| 0.1 | 1.6 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
| 0.1 | 2.4 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.1 | 2.0 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
| 0.1 | 0.5 | GO:1902912 | pyruvate kinase complex(GO:1902912) |
| 0.1 | 0.4 | GO:0043614 | multi-eIF complex(GO:0043614) |
| 0.1 | 0.5 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
| 0.1 | 1.9 | GO:0090543 | Flemming body(GO:0090543) |
| 0.1 | 0.8 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.1 | 0.4 | GO:0097134 | cyclin E1-CDK2 complex(GO:0097134) |
| 0.1 | 0.4 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.1 | 0.5 | GO:0071012 | catalytic step 1 spliceosome(GO:0071012) |
| 0.1 | 0.6 | GO:0034753 | nuclear aryl hydrocarbon receptor complex(GO:0034753) |
| 0.1 | 2.0 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.1 | 43.6 | GO:0000790 | nuclear chromatin(GO:0000790) |
| 0.1 | 0.7 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.1 | 3.8 | GO:0000786 | nucleosome(GO:0000786) |
| 0.1 | 0.9 | GO:0071203 | WASH complex(GO:0071203) |
| 0.1 | 0.5 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.1 | 3.0 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.1 | 0.6 | GO:0000839 | Hrd1p ubiquitin ligase ERAD-L complex(GO:0000839) |
| 0.1 | 0.6 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.1 | 0.9 | GO:0000803 | sex chromosome(GO:0000803) |
| 0.1 | 1.9 | GO:0000785 | chromatin(GO:0000785) |
| 0.1 | 3.8 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.1 | 0.9 | GO:0070435 | Shc-EGFR complex(GO:0070435) |
| 0.1 | 0.4 | GO:1990423 | RZZ complex(GO:1990423) |
| 0.1 | 1.5 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.1 | 2.9 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.1 | 1.9 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.1 | 1.5 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.1 | 1.4 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.1 | 0.4 | GO:0000333 | telomerase catalytic core complex(GO:0000333) |
| 0.1 | 0.7 | GO:0045177 | apical part of cell(GO:0045177) |
| 0.1 | 0.9 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.1 | 1.3 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.1 | 0.5 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.1 | 0.6 | GO:0005818 | astral microtubule(GO:0000235) aster(GO:0005818) |
| 0.1 | 1.9 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.1 | 0.7 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.1 | 7.4 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.1 | 6.7 | GO:0016235 | aggresome(GO:0016235) |
| 0.1 | 0.7 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.1 | 3.4 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.1 | 0.2 | GO:0016589 | NURF complex(GO:0016589) |
| 0.1 | 0.9 | GO:0097413 | Lewy body(GO:0097413) |
| 0.1 | 0.4 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.1 | 0.7 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.1 | 0.2 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) |
| 0.1 | 0.7 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.1 | 0.3 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.1 | 0.2 | GO:0000818 | nuclear MIS12/MIND complex(GO:0000818) |
| 0.1 | 0.6 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.1 | 0.6 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.1 | 0.3 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.1 | 1.2 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 0.1 | 1.2 | GO:0032039 | integrator complex(GO:0032039) |
| 0.1 | 0.4 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.1 | 0.7 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.1 | 0.8 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.1 | 1.4 | GO:0042555 | MCM complex(GO:0042555) |
| 0.1 | 0.4 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.1 | 0.7 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.1 | 1.0 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.1 | 0.5 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.1 | 0.4 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.1 | 0.9 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.1 | 0.5 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.1 | 0.6 | GO:0030897 | HOPS complex(GO:0030897) |
| 0.1 | 1.0 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.1 | 0.8 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
| 0.1 | 0.3 | GO:0097224 | sperm connecting piece(GO:0097224) |
| 0.1 | 1.4 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.1 | 0.7 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.1 | 0.3 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.1 | 3.4 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.1 | 10.6 | GO:0016363 | nuclear matrix(GO:0016363) |
| 0.1 | 0.3 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.1 | 0.9 | GO:0000782 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
| 0.1 | 0.7 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.1 | 4.0 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
| 0.1 | 7.8 | GO:0005905 | clathrin-coated pit(GO:0005905) |
| 0.1 | 0.7 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.1 | 1.4 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.1 | 0.7 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.1 | 0.2 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.1 | 0.3 | GO:0042643 | actomyosin, actin portion(GO:0042643) |
| 0.1 | 1.2 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.1 | 0.2 | GO:0000126 | transcription factor TFIIIB complex(GO:0000126) |
| 0.1 | 0.7 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.1 | 0.3 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.1 | 0.3 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.1 | 5.9 | GO:0035577 | azurophil granule membrane(GO:0035577) |
| 0.1 | 0.8 | GO:0098839 | postsynaptic density membrane(GO:0098839) |
| 0.1 | 0.5 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.1 | 1.2 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.1 | 1.4 | GO:0043205 | microfibril(GO:0001527) fibril(GO:0043205) |
| 0.1 | 0.3 | GO:0032280 | symmetric synapse(GO:0032280) |
| 0.1 | 0.2 | GO:0045293 | MIS complex(GO:0036396) mRNA editing complex(GO:0045293) |
| 0.0 | 0.1 | GO:0005688 | U6 snRNP(GO:0005688) |
| 0.0 | 1.4 | GO:0043596 | nuclear replication fork(GO:0043596) |
| 0.0 | 0.6 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.0 | 0.1 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.0 | 0.3 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.0 | 0.6 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.0 | 0.6 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.0 | 0.6 | GO:0000974 | Prp19 complex(GO:0000974) |
| 0.0 | 5.2 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.0 | 3.3 | GO:0072686 | mitotic spindle(GO:0072686) |
| 0.0 | 2.0 | GO:0030118 | clathrin coat(GO:0030118) |
| 0.0 | 0.3 | GO:0070695 | FHF complex(GO:0070695) |
| 0.0 | 0.3 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.0 | 0.2 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.0 | 1.2 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.0 | 0.2 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.0 | 0.7 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.0 | 0.4 | GO:0051286 | cell tip(GO:0051286) |
| 0.0 | 1.3 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| 0.0 | 2.1 | GO:0097546 | ciliary base(GO:0097546) |
| 0.0 | 3.7 | GO:0035580 | specific granule lumen(GO:0035580) |
| 0.0 | 0.2 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.0 | 0.9 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.0 | 0.2 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.0 | 1.8 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.0 | 1.9 | GO:0016592 | mediator complex(GO:0016592) |
| 0.0 | 0.0 | GO:0035101 | FACT complex(GO:0035101) |
| 0.0 | 0.5 | GO:0005819 | spindle(GO:0005819) |
| 0.0 | 2.1 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.0 | 7.2 | GO:0055037 | recycling endosome(GO:0055037) |
| 0.0 | 0.5 | GO:0017059 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
| 0.0 | 0.2 | GO:0097526 | spliceosomal tri-snRNP complex(GO:0097526) |
| 0.0 | 0.9 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
| 0.0 | 14.5 | GO:0031965 | nuclear membrane(GO:0031965) |
| 0.0 | 0.2 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.0 | 4.4 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.0 | 0.7 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.0 | 3.4 | GO:0005884 | actin filament(GO:0005884) |
| 0.0 | 0.3 | GO:0043196 | varicosity(GO:0043196) |
| 0.0 | 0.2 | GO:0089701 | U2AF(GO:0089701) |
| 0.0 | 3.8 | GO:0000922 | spindle pole(GO:0000922) |
| 0.0 | 3.1 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 0.1 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
| 0.0 | 0.3 | GO:0008091 | spectrin(GO:0008091) |
| 0.0 | 2.1 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.0 | 1.2 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.0 | 0.2 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.0 | 0.1 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.0 | 0.8 | GO:0005798 | Golgi-associated vesicle(GO:0005798) |
| 0.0 | 0.2 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
| 0.0 | 0.5 | GO:0031093 | platelet alpha granule lumen(GO:0031093) |
| 0.0 | 1.6 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.0 | 0.2 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.0 | 0.6 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
| 0.0 | 0.2 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.0 | 3.7 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.0 | 0.2 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.0 | 0.3 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.0 | 0.3 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.0 | 0.9 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.0 | 1.9 | GO:0101003 | ficolin-1-rich granule membrane(GO:0101003) |
| 0.0 | 1.9 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.0 | 4.7 | GO:0005635 | nuclear envelope(GO:0005635) |
| 0.0 | 0.4 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.0 | 1.0 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.0 | 0.2 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.0 | 16.4 | GO:0005925 | focal adhesion(GO:0005925) |
| 0.0 | 1.5 | GO:0005795 | Golgi stack(GO:0005795) |
| 0.0 | 0.2 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.0 | 0.3 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.0 | 0.7 | GO:0031105 | septin complex(GO:0031105) |
| 0.0 | 0.2 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.0 | 0.3 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.0 | 75.9 | GO:0005654 | nucleoplasm(GO:0005654) |
| 0.0 | 0.3 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 0.1 | GO:0031984 | organelle subcompartment(GO:0031984) |
| 0.0 | 0.1 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.0 | 0.4 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.0 | 0.2 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.0 | 0.4 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.0 | 0.1 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.0 | 0.1 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.0 | 1.6 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
| 0.0 | 0.1 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
| 0.0 | 0.1 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.0 | 0.2 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.0 | 0.0 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.0 | 0.5 | GO:0035770 | ribonucleoprotein granule(GO:0035770) |
| 0.0 | 1.4 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
| 0.0 | 1.3 | GO:0005694 | chromosome(GO:0005694) |
| 0.0 | 0.1 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
| 0.0 | 0.2 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.3 | 6.8 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
| 0.9 | 2.7 | GO:0070123 | transforming growth factor beta receptor activity, type III(GO:0070123) |
| 0.9 | 2.6 | GO:0031859 | platelet activating factor receptor binding(GO:0031859) |
| 0.7 | 10.4 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.7 | 5.5 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.7 | 0.7 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.6 | 2.6 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.6 | 2.9 | GO:0044378 | non-sequence-specific DNA binding, bending(GO:0044378) |
| 0.6 | 5.0 | GO:0042610 | CD8 receptor binding(GO:0042610) |
| 0.5 | 1.6 | GO:0016534 | cyclin-dependent protein kinase 5 activator activity(GO:0016534) |
| 0.5 | 1.6 | GO:0016964 | alpha-2 macroglobulin receptor activity(GO:0016964) |
| 0.5 | 1.5 | GO:0047280 | nicotinamide phosphoribosyltransferase activity(GO:0047280) |
| 0.5 | 2.0 | GO:0016404 | 15-hydroxyprostaglandin dehydrogenase (NAD+) activity(GO:0016404) |
| 0.5 | 3.0 | GO:0022897 | peptide:proton symporter activity(GO:0015333) proton-dependent peptide secondary active transmembrane transporter activity(GO:0022897) |
| 0.5 | 3.0 | GO:0001010 | transcription factor activity, sequence-specific DNA binding transcription factor recruiting(GO:0001010) |
| 0.5 | 1.9 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.5 | 1.4 | GO:0016603 | glutaminyl-peptide cyclotransferase activity(GO:0016603) |
| 0.4 | 5.8 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.4 | 3.5 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.4 | 1.8 | GO:0004727 | prenylated protein tyrosine phosphatase activity(GO:0004727) |
| 0.4 | 2.2 | GO:0050659 | N-acetylgalactosamine 4-sulfate 6-O-sulfotransferase activity(GO:0050659) |
| 0.4 | 5.6 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.4 | 2.1 | GO:0042799 | histone methyltransferase activity (H4-K20 specific)(GO:0042799) |
| 0.4 | 1.6 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.4 | 2.4 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
| 0.4 | 1.5 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.4 | 1.5 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.4 | 3.0 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.4 | 1.5 | GO:0050211 | procollagen galactosyltransferase activity(GO:0050211) |
| 0.4 | 1.5 | GO:0008424 | glycoprotein 6-alpha-L-fucosyltransferase activity(GO:0008424) alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
| 0.4 | 1.1 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
| 0.4 | 1.1 | GO:1904713 | beta-catenin destruction complex binding(GO:1904713) |
| 0.4 | 4.2 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.3 | 1.3 | GO:0015157 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.3 | 1.3 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.3 | 1.0 | GO:1902271 | D3 vitamins binding(GO:1902271) |
| 0.3 | 1.0 | GO:0004513 | neolactotetraosylceramide alpha-2,3-sialyltransferase activity(GO:0004513) lactosylceramide alpha-2,3-sialyltransferase activity(GO:0047291) |
| 0.3 | 1.6 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
| 0.3 | 0.9 | GO:0097158 | pre-mRNA intronic pyrimidine-rich binding(GO:0097158) |
| 0.3 | 1.6 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
| 0.3 | 8.7 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.3 | 1.2 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.3 | 3.8 | GO:0031386 | protein tag(GO:0031386) |
| 0.3 | 0.9 | GO:0030395 | lactose binding(GO:0030395) |
| 0.3 | 7.7 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.3 | 8.5 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
| 0.3 | 6.2 | GO:0005522 | profilin binding(GO:0005522) |
| 0.3 | 2.5 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.3 | 1.1 | GO:0034057 | RNA strand-exchange activity(GO:0034057) |
| 0.3 | 2.4 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.3 | 3.1 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
| 0.3 | 3.3 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.2 | 1.0 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.2 | 3.4 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.2 | 4.4 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.2 | 2.2 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
| 0.2 | 2.4 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.2 | 1.9 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.2 | 2.1 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.2 | 2.3 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.2 | 2.3 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.2 | 1.1 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
| 0.2 | 1.1 | GO:0038025 | reelin receptor activity(GO:0038025) |
| 0.2 | 9.5 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.2 | 5.5 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.2 | 8.5 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.2 | 1.9 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 0.2 | 0.9 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.2 | 1.1 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.2 | 10.0 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.2 | 0.6 | GO:0004613 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 0.2 | 1.5 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.2 | 1.0 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.2 | 2.9 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.2 | 7.8 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.2 | 5.9 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.2 | 1.6 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.2 | 1.0 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.2 | 1.0 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
| 0.2 | 1.8 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.2 | 1.4 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
| 0.2 | 0.6 | GO:0004651 | polynucleotide 5'-phosphatase activity(GO:0004651) |
| 0.2 | 0.8 | GO:0004088 | carbamoyl-phosphate synthase (ammonia) activity(GO:0004087) carbamoyl-phosphate synthase (glutamine-hydrolyzing) activity(GO:0004088) |
| 0.2 | 3.8 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.2 | 10.2 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
| 0.2 | 1.3 | GO:0044388 | small protein activating enzyme binding(GO:0044388) |
| 0.2 | 1.3 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.2 | 0.7 | GO:0004802 | transketolase activity(GO:0004802) |
| 0.2 | 0.5 | GO:0003968 | RNA-directed RNA polymerase activity(GO:0003968) |
| 0.2 | 1.8 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.2 | 0.5 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.2 | 0.4 | GO:1904455 | ubiquitin-specific protease activity involved in negative regulation of ERAD pathway(GO:1904455) |
| 0.2 | 6.9 | GO:0008143 | poly(A) binding(GO:0008143) |
| 0.2 | 4.2 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.2 | 0.9 | GO:1990948 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.2 | 3.3 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.2 | 0.7 | GO:0003696 | satellite DNA binding(GO:0003696) |
| 0.2 | 10.5 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.2 | 1.2 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.2 | 1.0 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.2 | 6.0 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.2 | 3.1 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.2 | 2.1 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.2 | 0.6 | GO:0004874 | aryl hydrocarbon receptor activity(GO:0004874) |
| 0.2 | 1.4 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
| 0.2 | 2.3 | GO:0019826 | oxygen sensor activity(GO:0019826) |
| 0.1 | 0.9 | GO:0005330 | dopamine:sodium symporter activity(GO:0005330) |
| 0.1 | 4.1 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
| 0.1 | 2.5 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.1 | 0.9 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.1 | 3.2 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
| 0.1 | 0.7 | GO:0052836 | inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
| 0.1 | 2.1 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.1 | 0.7 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.1 | 7.0 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 0.1 | 0.6 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.1 | 5.0 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.1 | 4.5 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.1 | 0.5 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 0.1 | 0.2 | GO:0001190 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
| 0.1 | 4.6 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.1 | 0.6 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
| 0.1 | 0.4 | GO:0061752 | telomeric repeat-containing RNA binding(GO:0061752) |
| 0.1 | 1.1 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
| 0.1 | 0.6 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
| 0.1 | 0.6 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.1 | 1.0 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.1 | 0.4 | GO:0004019 | adenylosuccinate synthase activity(GO:0004019) |
| 0.1 | 0.6 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.1 | 11.3 | GO:0019003 | GDP binding(GO:0019003) |
| 0.1 | 0.6 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.1 | 4.0 | GO:0033613 | activating transcription factor binding(GO:0033613) |
| 0.1 | 0.7 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.1 | 0.8 | GO:0005119 | smoothened binding(GO:0005119) |
| 0.1 | 7.7 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.1 | 1.2 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.1 | 28.0 | GO:0001047 | core promoter binding(GO:0001047) |
| 0.1 | 1.6 | GO:0003909 | DNA ligase activity(GO:0003909) |
| 0.1 | 0.4 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.1 | 1.8 | GO:0050681 | androgen receptor binding(GO:0050681) |
| 0.1 | 0.5 | GO:0008665 | 2'-phosphotransferase activity(GO:0008665) |
| 0.1 | 2.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.1 | 1.7 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.1 | 0.3 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.1 | 0.7 | GO:0070728 | leucine binding(GO:0070728) |
| 0.1 | 0.7 | GO:0042608 | T cell receptor binding(GO:0042608) |
| 0.1 | 2.4 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.1 | 2.2 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.1 | 0.4 | GO:0003943 | N-acetylgalactosamine-4-sulfatase activity(GO:0003943) |
| 0.1 | 4.5 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.1 | 1.4 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.1 | 0.6 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.1 | 0.2 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
| 0.1 | 1.4 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
| 0.1 | 3.7 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.1 | 0.9 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.1 | 1.2 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.1 | 0.3 | GO:0070984 | SET domain binding(GO:0070984) |
| 0.1 | 0.5 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.1 | 2.1 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.1 | 0.5 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
| 0.1 | 1.2 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.1 | 0.2 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.1 | 1.5 | GO:0016273 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
| 0.1 | 0.5 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 0.1 | 2.7 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.1 | 0.8 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.1 | 1.4 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.1 | 5.5 | GO:0070063 | RNA polymerase binding(GO:0070063) |
| 0.1 | 0.4 | GO:0050509 | N-acetylglucosaminyl-proteoglycan 4-beta-glucuronosyltransferase activity(GO:0050509) |
| 0.1 | 0.9 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.1 | 2.2 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
| 0.1 | 0.3 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.1 | 0.6 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.1 | 4.6 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.1 | 0.6 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.1 | 1.2 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.1 | 0.9 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.1 | 1.5 | GO:0015926 | glucosidase activity(GO:0015926) |
| 0.1 | 10.9 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
| 0.1 | 2.2 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.1 | 17.0 | GO:0042393 | histone binding(GO:0042393) |
| 0.1 | 0.6 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.1 | 0.4 | GO:0047757 | chondroitin-glucuronate 5-epimerase activity(GO:0047757) |
| 0.1 | 0.2 | GO:0052825 | inositol tetrakisphosphate 1-kinase activity(GO:0047325) inositol-1,3,4-trisphosphate 6-kinase activity(GO:0052725) inositol-1,3,4-trisphosphate 5-kinase activity(GO:0052726) inositol-1,3,4,5,6-pentakisphosphate 1-phosphatase activity(GO:0052825) inositol-1,3,4,6-tetrakisphosphate 6-phosphatase activity(GO:0052830) inositol-1,3,4,6-tetrakisphosphate 1-phosphatase activity(GO:0052831) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) |
| 0.1 | 2.3 | GO:0004697 | protein kinase C activity(GO:0004697) |
| 0.1 | 0.5 | GO:0004137 | deoxycytidine kinase activity(GO:0004137) |
| 0.1 | 0.7 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.1 | 0.1 | GO:0080084 | polymerase III regulatory region sequence-specific DNA binding(GO:0000992) RNA polymerase III type 1 promoter sequence-specific DNA binding(GO:0001002) RNA polymerase III type 2 promoter sequence-specific DNA binding(GO:0001003) RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) 5S rDNA binding(GO:0080084) |
| 0.1 | 0.2 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.1 | 1.5 | GO:0005537 | mannose binding(GO:0005537) |
| 0.1 | 3.0 | GO:0005521 | lamin binding(GO:0005521) |
| 0.1 | 1.7 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.1 | 2.0 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.1 | 0.8 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.1 | 2.6 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.1 | 22.6 | GO:0003713 | transcription coactivator activity(GO:0003713) |
| 0.1 | 10.8 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.1 | 3.5 | GO:0043531 | ADP binding(GO:0043531) |
| 0.1 | 0.6 | GO:0046790 | virion binding(GO:0046790) |
| 0.1 | 0.7 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.1 | 1.0 | GO:0030331 | estrogen receptor binding(GO:0030331) |
| 0.1 | 1.5 | GO:0004065 | arylsulfatase activity(GO:0004065) |
| 0.1 | 0.5 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.1 | 1.8 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.1 | 0.3 | GO:0030983 | mismatched DNA binding(GO:0030983) |
| 0.1 | 0.2 | GO:0047389 | glycerophosphocholine phosphodiesterase activity(GO:0047389) |
| 0.1 | 2.0 | GO:0000339 | RNA cap binding(GO:0000339) |
| 0.1 | 1.1 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.1 | 0.3 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.1 | 1.6 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.1 | 0.9 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.1 | 0.1 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
| 0.1 | 2.9 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.1 | 0.2 | GO:0019961 | interferon binding(GO:0019961) |
| 0.1 | 0.3 | GO:1901375 | acetylcholine transmembrane transporter activity(GO:0005277) acetate ester transmembrane transporter activity(GO:1901375) |
| 0.1 | 0.3 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.1 | 0.4 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.1 | 2.1 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.1 | 0.2 | GO:0009041 | uridylate kinase activity(GO:0009041) |
| 0.1 | 0.2 | GO:0004756 | selenide, water dikinase activity(GO:0004756) phosphotransferase activity, paired acceptors(GO:0016781) |
| 0.1 | 1.0 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.1 | 2.8 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
| 0.1 | 2.5 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.1 | 0.7 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
| 0.1 | 2.1 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.1 | 0.2 | GO:0004057 | arginyltransferase activity(GO:0004057) |
| 0.1 | 0.2 | GO:0044549 | GTP cyclohydrolase binding(GO:0044549) |
| 0.1 | 1.1 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
| 0.1 | 15.3 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
| 0.1 | 1.4 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.1 | 0.5 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
| 0.1 | 0.6 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
| 0.1 | 0.2 | GO:0016263 | glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase activity(GO:0016263) |
| 0.1 | 0.4 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.1 | 0.5 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.1 | 1.3 | GO:0035326 | enhancer binding(GO:0035326) |
| 0.1 | 1.2 | GO:0030275 | LRR domain binding(GO:0030275) |
| 0.1 | 0.8 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
| 0.1 | 0.2 | GO:1990698 | palmitoleoyltransferase activity(GO:1990698) |
| 0.1 | 2.7 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.1 | 2.1 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.1 | 0.9 | GO:0031702 | angiotensin receptor binding(GO:0031701) type 1 angiotensin receptor binding(GO:0031702) |
| 0.1 | 0.3 | GO:0010465 | nerve growth factor receptor activity(GO:0010465) |
| 0.1 | 0.2 | GO:0004108 | citrate (Si)-synthase activity(GO:0004108) citrate synthase activity(GO:0036440) |
| 0.1 | 0.6 | GO:0047237 | glucuronylgalactosylproteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047237) |
| 0.1 | 1.5 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.1 | 1.8 | GO:0002039 | p53 binding(GO:0002039) |
| 0.1 | 0.5 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
| 0.0 | 0.4 | GO:0019789 | SUMO transferase activity(GO:0019789) |
| 0.0 | 0.3 | GO:0055077 | gap junction hemi-channel activity(GO:0055077) |
| 0.0 | 3.5 | GO:0030145 | manganese ion binding(GO:0030145) |
| 0.0 | 4.7 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
| 0.0 | 0.2 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.0 | 0.6 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.0 | 2.7 | GO:0061650 | ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
| 0.0 | 1.8 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.0 | 0.3 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
| 0.0 | 0.9 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.0 | 13.4 | GO:0000978 | RNA polymerase II core promoter proximal region sequence-specific DNA binding(GO:0000978) |
| 0.0 | 0.2 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.0 | 1.1 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.0 | 0.8 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.0 | 0.1 | GO:0004817 | cysteine-tRNA ligase activity(GO:0004817) |
| 0.0 | 0.6 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.0 | 0.6 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.0 | 0.1 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.6 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.0 | 3.7 | GO:0008028 | monocarboxylic acid transmembrane transporter activity(GO:0008028) |
| 0.0 | 1.5 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.0 | 0.1 | GO:0003880 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) |
| 0.0 | 2.9 | GO:0003727 | single-stranded RNA binding(GO:0003727) |
| 0.0 | 3.6 | GO:0043021 | ribonucleoprotein complex binding(GO:0043021) |
| 0.0 | 0.3 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.0 | 1.0 | GO:0004659 | prenyltransferase activity(GO:0004659) |
| 0.0 | 1.6 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.0 | 0.2 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.0 | 0.4 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.0 | 0.2 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.0 | 0.2 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.0 | 0.3 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.0 | 0.5 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
| 0.0 | 0.7 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
| 0.0 | 0.1 | GO:0004145 | diamine N-acetyltransferase activity(GO:0004145) |
| 0.0 | 1.4 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.0 | 0.4 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.0 | 0.5 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
| 0.0 | 0.8 | GO:0015929 | hexosaminidase activity(GO:0015929) |
| 0.0 | 0.2 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.0 | 1.4 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
| 0.0 | 0.2 | GO:0000987 | core promoter proximal region sequence-specific DNA binding(GO:0000987) |
| 0.0 | 0.3 | GO:0043422 | protein kinase B binding(GO:0043422) |
| 0.0 | 0.3 | GO:0004064 | arylesterase activity(GO:0004064) |
| 0.0 | 0.7 | GO:0031369 | translation initiation factor binding(GO:0031369) |
| 0.0 | 0.7 | GO:0000175 | 3'-5'-exoribonuclease activity(GO:0000175) |
| 0.0 | 1.3 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
| 0.0 | 2.0 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) |
| 0.0 | 0.3 | GO:0042835 | BRE binding(GO:0042835) |
| 0.0 | 0.1 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
| 0.0 | 0.3 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.0 | 0.8 | GO:0036442 | hydrogen-exporting ATPase activity(GO:0036442) proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.0 | 0.3 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.0 | 0.5 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
| 0.0 | 0.5 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 1.9 | GO:0003725 | double-stranded RNA binding(GO:0003725) |
| 0.0 | 5.3 | GO:0017124 | SH3 domain binding(GO:0017124) |
| 0.0 | 0.1 | GO:0016748 | succinyltransferase activity(GO:0016748) |
| 0.0 | 0.6 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.0 | 0.1 | GO:0004584 | dolichyl-phosphate-mannose-glycolipid alpha-mannosyltransferase activity(GO:0004584) |
| 0.0 | 2.0 | GO:0043130 | ubiquitin binding(GO:0043130) |
| 0.0 | 0.6 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
| 0.0 | 0.2 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.0 | 0.6 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.0 | 0.1 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.0 | 14.5 | GO:0019787 | ubiquitin-like protein transferase activity(GO:0019787) |
| 0.0 | 1.0 | GO:0019956 | chemokine binding(GO:0019956) |
| 0.0 | 0.3 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.0 | 0.4 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.0 | 0.7 | GO:0001191 | transcriptional repressor activity, RNA polymerase II transcription factor binding(GO:0001191) |
| 0.0 | 5.6 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.1 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.0 | 1.7 | GO:0004004 | ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
| 0.0 | 0.2 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.0 | 0.3 | GO:0008408 | 3'-5' exonuclease activity(GO:0008408) |
| 0.0 | 0.4 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.0 | 0.6 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.0 | 0.3 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.0 | 0.2 | GO:0019237 | centromeric DNA binding(GO:0019237) |
| 0.0 | 0.4 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.0 | 0.4 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.0 | 0.3 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 0.4 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.0 | 0.4 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.0 | 0.3 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.0 | 1.0 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
| 0.0 | 0.3 | GO:0031432 | titin binding(GO:0031432) |
| 0.0 | 0.6 | GO:0004197 | cysteine-type endopeptidase activity(GO:0004197) |
| 0.0 | 1.1 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.0 | 2.2 | GO:0008565 | protein transporter activity(GO:0008565) |
| 0.0 | 0.3 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.0 | 0.1 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.0 | 0.4 | GO:0008061 | chitin binding(GO:0008061) |
| 0.0 | 0.0 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.0 | 0.7 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.5 | GO:0004180 | carboxypeptidase activity(GO:0004180) |
| 0.0 | 0.4 | GO:0022848 | acetylcholine-gated cation channel activity(GO:0022848) |
| 0.0 | 1.2 | GO:0008375 | acetylglucosaminyltransferase activity(GO:0008375) |
| 0.0 | 0.4 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.0 | 2.0 | GO:0003712 | transcription cofactor activity(GO:0003712) |
| 0.0 | 0.6 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.0 | 1.1 | GO:0004386 | helicase activity(GO:0004386) |
| 0.0 | 0.6 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
| 0.0 | 0.6 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.1 | GO:0047522 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
| 0.0 | 0.1 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.0 | 0.1 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
| 0.0 | 0.1 | GO:0034597 | phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) |
| 0.0 | 0.1 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.0 | 0.1 | GO:0004504 | peptidylglycine monooxygenase activity(GO:0004504) peptidylamidoglycolate lyase activity(GO:0004598) |
| 0.0 | 0.6 | GO:0004622 | lysophospholipase activity(GO:0004622) |
| 0.0 | 0.4 | GO:0035591 | signaling adaptor activity(GO:0035591) |
| 0.0 | 25.0 | GO:0003677 | DNA binding(GO:0003677) |
| 0.0 | 0.3 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
| 0.0 | 0.1 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.0 | 0.1 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
| 0.0 | 0.2 | GO:0015194 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.0 | 0.2 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
| 0.0 | 0.1 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
Gene overrepresentation in curated gene sets: canonical pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 14.6 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.3 | 4.1 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.2 | 13.3 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.2 | 9.2 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.2 | 30.2 | PID CMYB PATHWAY | C-MYB transcription factor network |
| 0.2 | 13.4 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.2 | 6.3 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.2 | 1.5 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.2 | 0.3 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
| 0.2 | 7.9 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.2 | 4.9 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.1 | 4.5 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.1 | 0.9 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.1 | 9.9 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.1 | 11.0 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
| 0.1 | 5.1 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.1 | 9.5 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.1 | 9.4 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.1 | 11.4 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
| 0.1 | 2.1 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.1 | 3.1 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.1 | 9.5 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.1 | 7.8 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.1 | 12.8 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
| 0.1 | 2.2 | PID BMP PATHWAY | BMP receptor signaling |
| 0.1 | 6.8 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
| 0.1 | 8.8 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 0.1 | 5.2 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.1 | 0.3 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.1 | 1.3 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.1 | 1.0 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.1 | 1.1 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.1 | 6.1 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.1 | 1.0 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.1 | 10.6 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
| 0.1 | 6.6 | PID NOTCH PATHWAY | Notch signaling pathway |
| 0.1 | 1.5 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.1 | 1.4 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.1 | 5.4 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
| 0.1 | 4.5 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.1 | 3.8 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
| 0.1 | 4.2 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.1 | 2.3 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
| 0.1 | 1.9 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.1 | 2.1 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.1 | 0.3 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.1 | 2.4 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.1 | 0.3 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.1 | 2.6 | PID MTOR 4PATHWAY | mTOR signaling pathway |
| 0.0 | 4.1 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
| 0.0 | 0.4 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.0 | 0.2 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.0 | 0.4 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.0 | 2.0 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.0 | 1.1 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.0 | 1.4 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.0 | 0.9 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
| 0.0 | 0.7 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.0 | 0.5 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.0 | 2.3 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.0 | 0.7 | PID FOXO PATHWAY | FoxO family signaling |
| 0.0 | 3.6 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 0.3 | PID EPO PATHWAY | EPO signaling pathway |
| 0.0 | 2.0 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.0 | 0.8 | PID ATM PATHWAY | ATM pathway |
| 0.0 | 2.2 | PID P73PATHWAY | p73 transcription factor network |
| 0.0 | 0.3 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.0 | 0.8 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.0 | 0.9 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.0 | 1.6 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.0 | 0.8 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 0.4 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.0 | 0.4 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.0 | 1.1 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
| 0.0 | 0.2 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 1.3 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.0 | 0.4 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.0 | 0.3 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.0 | 0.2 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.0 | 0.8 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
Gene overrepresentation in curated gene sets: REACTOME pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 2.8 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.3 | 4.4 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
| 0.2 | 1.4 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.2 | 4.6 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 0.2 | 13.3 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.2 | 4.5 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.2 | 5.0 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
| 0.2 | 6.1 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.2 | 9.6 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.2 | 12.0 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.2 | 4.2 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.2 | 6.1 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.2 | 2.8 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.2 | 4.9 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.2 | 10.3 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 0.2 | 6.5 | REACTOME NUCLEAR EVENTS KINASE AND TRANSCRIPTION FACTOR ACTIVATION | Genes involved in Nuclear Events (kinase and transcription factor activation) |
| 0.2 | 1.6 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.2 | 1.5 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.2 | 9.3 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.1 | 7.9 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.1 | 1.2 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
| 0.1 | 2.4 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.1 | 3.4 | REACTOME PROCESSIVE SYNTHESIS ON THE LAGGING STRAND | Genes involved in Processive synthesis on the lagging strand |
| 0.1 | 3.6 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.1 | 2.8 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
| 0.1 | 0.6 | REACTOME AUTODEGRADATION OF THE E3 UBIQUITIN LIGASE COP1 | Genes involved in Autodegradation of the E3 ubiquitin ligase COP1 |
| 0.1 | 3.0 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.1 | 4.6 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.1 | 0.6 | REACTOME RAF MAP KINASE CASCADE | Genes involved in RAF/MAP kinase cascade |
| 0.1 | 1.9 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.1 | 1.5 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
| 0.1 | 6.6 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.1 | 20.0 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.1 | 2.9 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
| 0.1 | 1.8 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.1 | 1.1 | REACTOME TRANSCRIPTIONAL ACTIVITY OF SMAD2 SMAD3 SMAD4 HETEROTRIMER | Genes involved in Transcriptional activity of SMAD2/SMAD3:SMAD4 heterotrimer |
| 0.1 | 4.5 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.1 | 11.1 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.1 | 0.7 | REACTOME ADP SIGNALLING THROUGH P2RY12 | Genes involved in ADP signalling through P2Y purinoceptor 12 |
| 0.1 | 4.3 | REACTOME PIP3 ACTIVATES AKT SIGNALING | Genes involved in PIP3 activates AKT signaling |
| 0.1 | 2.1 | REACTOME INCRETIN SYNTHESIS SECRETION AND INACTIVATION | Genes involved in Incretin Synthesis, Secretion, and Inactivation |
| 0.1 | 1.0 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.1 | 1.7 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.1 | 4.4 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
| 0.1 | 1.7 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.1 | 2.2 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.1 | 5.9 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.1 | 2.2 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.1 | 1.6 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.1 | 0.5 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
| 0.1 | 1.5 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.1 | 13.5 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.1 | 2.4 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
| 0.1 | 2.0 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.1 | 11.2 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.1 | 0.8 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.1 | 1.7 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.1 | 0.4 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.1 | 1.2 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.1 | 0.9 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.1 | 1.9 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.1 | 0.6 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
| 0.1 | 1.2 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.1 | 1.0 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
| 0.1 | 0.5 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
| 0.1 | 1.7 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.1 | 1.8 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
| 0.1 | 1.7 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.0 | 1.5 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
| 0.0 | 4.3 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.0 | 1.1 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.0 | 0.5 | REACTOME TRANSCRIPTION COUPLED NER TC NER | Genes involved in Transcription-coupled NER (TC-NER) |
| 0.0 | 0.5 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.0 | 3.2 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.0 | 1.9 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.0 | 1.2 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.0 | 0.3 | REACTOME PI3K AKT ACTIVATION | Genes involved in PI3K/AKT activation |
| 0.0 | 1.0 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.0 | 1.6 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.0 | 0.6 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.0 | 0.8 | REACTOME NEF MEDIATES DOWN MODULATION OF CELL SURFACE RECEPTORS BY RECRUITING THEM TO CLATHRIN ADAPTERS | Genes involved in Nef-mediates down modulation of cell surface receptors by recruiting them to clathrin adapters |
| 0.0 | 1.1 | REACTOME ACTIVATION OF THE MRNA UPON BINDING OF THE CAP BINDING COMPLEX AND EIFS AND SUBSEQUENT BINDING TO 43S | Genes involved in Activation of the mRNA upon binding of the cap-binding complex and eIFs, and subsequent binding to 43S |
| 0.0 | 0.7 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.0 | 1.1 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.0 | 1.4 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.0 | 0.5 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.0 | 0.7 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.0 | 0.2 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 0.0 | 0.9 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.0 | 0.4 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.0 | 1.4 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
| 0.0 | 0.5 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.0 | 3.5 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.0 | 0.5 | REACTOME OPSINS | Genes involved in Opsins |
| 0.0 | 0.3 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
| 0.0 | 1.6 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
| 0.0 | 2.0 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
| 0.0 | 1.2 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
| 0.0 | 1.1 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.0 | 0.5 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.0 | 0.8 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.0 | 0.6 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.0 | 0.3 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.0 | 0.6 | REACTOME HOST INTERACTIONS OF HIV FACTORS | Genes involved in Host Interactions of HIV factors |
| 0.0 | 0.6 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.0 | 0.7 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.0 | 0.7 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.0 | 0.2 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.0 | 0.2 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
| 0.0 | 0.7 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.0 | 0.5 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
| 0.0 | 3.3 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
| 0.0 | 0.2 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.0 | 0.5 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.0 | 0.4 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.0 | 0.4 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.0 | 1.4 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.0 | 0.2 | REACTOME GLOBAL GENOMIC NER GG NER | Genes involved in Global Genomic NER (GG-NER) |
| 0.0 | 0.4 | REACTOME BASE EXCISION REPAIR | Genes involved in Base Excision Repair |
| 0.0 | 0.3 | REACTOME SIGNALLING TO RAS | Genes involved in Signalling to RAS |
| 0.0 | 0.7 | REACTOME CHONDROITIN SULFATE DERMATAN SULFATE METABOLISM | Genes involved in Chondroitin sulfate/dermatan sulfate metabolism |
| 0.0 | 0.3 | REACTOME MRNA PROCESSING | Genes involved in mRNA Processing |
| 0.0 | 0.8 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
| 0.0 | 0.3 | REACTOME MEIOSIS | Genes involved in Meiosis |
| 0.0 | 0.5 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
| 0.0 | 0.3 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.0 | 0.6 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.0 | 0.3 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.0 | 0.8 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.0 | 0.9 | REACTOME MITOTIC G1 G1 S PHASES | Genes involved in Mitotic G1-G1/S phases |
| 0.0 | 0.4 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.0 | 0.3 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.0 | 0.2 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |