Inflammatory response time course, HUVEC (Wada et al., 2009)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
EBF1
|
ENSG00000164330.12 | EBF transcription factor 1 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| EBF1 | hg19_v2_chr5_-_158526693_158526706 | 0.24 | 2.6e-01 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr6_-_31550192 | 7.34 |
ENST00000429299.2
ENST00000446745.2 |
LTB
|
lymphotoxin beta (TNF superfamily, member 3) |
| chr14_+_103592636 | 4.99 |
ENST00000333007.1
|
TNFAIP2
|
tumor necrosis factor, alpha-induced protein 2 |
| chr14_+_24630465 | 3.87 |
ENST00000557894.1
ENST00000559284.1 ENST00000560275.1 |
IRF9
|
interferon regulatory factor 9 |
| chr19_+_4229495 | 3.71 |
ENST00000221847.5
|
EBI3
|
Epstein-Barr virus induced 3 |
| chr8_+_23386557 | 3.38 |
ENST00000523930.1
|
SLC25A37
|
solute carrier family 25 (mitochondrial iron transporter), member 37 |
| chr11_+_19798964 | 2.92 |
ENST00000527559.2
|
NAV2
|
neuron navigator 2 |
| chr12_-_49259643 | 2.91 |
ENST00000309739.5
|
RND1
|
Rho family GTPase 1 |
| chr2_+_150187020 | 2.70 |
ENST00000334166.4
|
LYPD6
|
LY6/PLAUR domain containing 6 |
| chr8_+_23386305 | 2.63 |
ENST00000519973.1
|
SLC25A37
|
solute carrier family 25 (mitochondrial iron transporter), member 37 |
| chr1_-_184943610 | 2.61 |
ENST00000367511.3
|
FAM129A
|
family with sequence similarity 129, member A |
| chr6_-_160147925 | 2.58 |
ENST00000535561.1
|
SOD2
|
superoxide dismutase 2, mitochondrial |
| chr6_-_32820529 | 2.44 |
ENST00000425148.2
|
TAP1
|
transporter 1, ATP-binding cassette, sub-family B (MDR/TAP) |
| chr4_+_74702214 | 2.31 |
ENST00000226317.5
ENST00000515050.1 |
CXCL6
|
chemokine (C-X-C motif) ligand 6 |
| chr11_+_19799327 | 2.29 |
ENST00000540292.1
|
NAV2
|
neuron navigator 2 |
| chr14_+_22984601 | 2.26 |
ENST00000390509.1
|
TRAJ28
|
T cell receptor alpha joining 28 |
| chr11_-_72432950 | 2.23 |
ENST00000426523.1
ENST00000429686.1 |
ARAP1
|
ArfGAP with RhoGAP domain, ankyrin repeat and PH domain 1 |
| chr17_+_80332153 | 2.16 |
ENST00000313135.2
|
UTS2R
|
urotensin 2 receptor |
| chr11_-_72504681 | 2.11 |
ENST00000538536.1
ENST00000543304.1 ENST00000540587.1 ENST00000334805.6 |
STARD10
|
StAR-related lipid transfer (START) domain containing 10 |
| chr11_+_20044600 | 2.07 |
ENST00000311043.8
|
NAV2
|
neuron navigator 2 |
| chr3_-_79816965 | 2.06 |
ENST00000464233.1
|
ROBO1
|
roundabout, axon guidance receptor, homolog 1 (Drosophila) |
| chr1_-_149908710 | 2.05 |
ENST00000439741.2
ENST00000361405.6 ENST00000406732.3 |
MTMR11
|
myotubularin related protein 11 |
| chr9_+_116917807 | 1.97 |
ENST00000356083.3
|
COL27A1
|
collagen, type XXVII, alpha 1 |
| chr16_-_67969888 | 1.96 |
ENST00000574576.2
|
PSMB10
|
proteasome (prosome, macropain) subunit, beta type, 10 |
| chr4_-_120549163 | 1.81 |
ENST00000394439.1
ENST00000420633.1 |
PDE5A
|
phosphodiesterase 5A, cGMP-specific |
| chr11_-_3663212 | 1.75 |
ENST00000397067.3
|
ART5
|
ADP-ribosyltransferase 5 |
| chr16_-_65155833 | 1.73 |
ENST00000566827.1
ENST00000394156.3 ENST00000562998.1 |
CDH11
|
cadherin 11, type 2, OB-cadherin (osteoblast) |
| chr19_+_49622646 | 1.72 |
ENST00000334186.4
|
PPFIA3
|
protein tyrosine phosphatase, receptor type, f polypeptide (PTPRF), interacting protein (liprin), alpha 3 |
| chr6_+_32812568 | 1.72 |
ENST00000414474.1
|
PSMB9
|
proteasome (prosome, macropain) subunit, beta type, 9 |
| chr11_-_102668879 | 1.65 |
ENST00000315274.6
|
MMP1
|
matrix metallopeptidase 1 (interstitial collagenase) |
| chr15_+_67418047 | 1.62 |
ENST00000540846.2
|
SMAD3
|
SMAD family member 3 |
| chr19_-_38720354 | 1.60 |
ENST00000416611.1
|
DPF1
|
D4, zinc and double PHD fingers family 1 |
| chr7_-_98467489 | 1.59 |
ENST00000416379.2
|
TMEM130
|
transmembrane protein 130 |
| chr16_+_57662138 | 1.58 |
ENST00000562414.1
ENST00000561969.1 ENST00000562631.1 ENST00000563445.1 ENST00000565338.1 ENST00000567702.1 |
GPR56
|
G protein-coupled receptor 56 |
| chr14_+_21538429 | 1.58 |
ENST00000298694.4
ENST00000555038.1 |
ARHGEF40
|
Rho guanine nucleotide exchange factor (GEF) 40 |
| chr14_+_21538517 | 1.56 |
ENST00000298693.3
|
ARHGEF40
|
Rho guanine nucleotide exchange factor (GEF) 40 |
| chr1_-_173176452 | 1.53 |
ENST00000281834.3
|
TNFSF4
|
tumor necrosis factor (ligand) superfamily, member 4 |
| chr16_-_28621353 | 1.51 |
ENST00000567512.1
|
SULT1A1
|
sulfotransferase family, cytosolic, 1A, phenol-preferring, member 1 |
| chr7_-_25019760 | 1.49 |
ENST00000352860.1
ENST00000353930.1 ENST00000431825.2 ENST00000313367.2 |
OSBPL3
|
oxysterol binding protein-like 3 |
| chr10_+_73724123 | 1.48 |
ENST00000373115.4
|
CHST3
|
carbohydrate (chondroitin 6) sulfotransferase 3 |
| chr16_-_65155979 | 1.46 |
ENST00000562325.1
ENST00000268603.4 |
CDH11
|
cadherin 11, type 2, OB-cadherin (osteoblast) |
| chr11_+_20044096 | 1.44 |
ENST00000533917.1
|
NAV2
|
neuron navigator 2 |
| chr8_-_80680078 | 1.44 |
ENST00000337919.5
ENST00000354724.3 |
HEY1
|
hes-related family bHLH transcription factor with YRPW motif 1 |
| chr3_-_127541679 | 1.41 |
ENST00000265052.5
|
MGLL
|
monoglyceride lipase |
| chr1_+_16010779 | 1.37 |
ENST00000375799.3
ENST00000375793.2 |
PLEKHM2
|
pleckstrin homology domain containing, family M (with RUN domain) member 2 |
| chr11_-_113577052 | 1.37 |
ENST00000540540.1
ENST00000545579.1 ENST00000538955.1 ENST00000299882.5 |
TMPRSS5
|
transmembrane protease, serine 5 |
| chr10_-_24770632 | 1.35 |
ENST00000596413.1
|
AL353583.1
|
AL353583.1 |
| chr15_+_67430339 | 1.34 |
ENST00000439724.3
|
SMAD3
|
SMAD family member 3 |
| chr1_+_110453109 | 1.34 |
ENST00000525659.1
|
CSF1
|
colony stimulating factor 1 (macrophage) |
| chr19_+_44081344 | 1.31 |
ENST00000599207.1
|
PINLYP
|
phospholipase A2 inhibitor and LY6/PLAUR domain containing |
| chr12_-_50290839 | 1.31 |
ENST00000552863.1
|
FAIM2
|
Fas apoptotic inhibitory molecule 2 |
| chr11_-_117748138 | 1.28 |
ENST00000527717.1
|
FXYD6
|
FXYD domain containing ion transport regulator 6 |
| chr12_-_71182695 | 1.27 |
ENST00000342084.4
|
PTPRR
|
protein tyrosine phosphatase, receptor type, R |
| chr19_+_44037546 | 1.26 |
ENST00000601282.1
|
ZNF575
|
zinc finger protein 575 |
| chr5_+_15500280 | 1.23 |
ENST00000504595.1
|
FBXL7
|
F-box and leucine-rich repeat protein 7 |
| chr14_+_96671016 | 1.22 |
ENST00000542454.2
ENST00000554311.1 ENST00000306005.3 ENST00000539359.1 ENST00000553811.1 |
BDKRB2
RP11-404P21.8
|
bradykinin receptor B2 Uncharacterized protein |
| chr14_+_70078303 | 1.22 |
ENST00000342745.4
|
KIAA0247
|
KIAA0247 |
| chr1_+_110453203 | 1.22 |
ENST00000357302.4
ENST00000344188.5 ENST00000329608.6 |
CSF1
|
colony stimulating factor 1 (macrophage) |
| chr15_+_75640068 | 1.21 |
ENST00000565051.1
ENST00000564257.1 ENST00000567005.1 |
NEIL1
|
nei endonuclease VIII-like 1 (E. coli) |
| chr19_-_38720294 | 1.20 |
ENST00000412732.1
ENST00000456296.1 |
DPF1
|
D4, zinc and double PHD fingers family 1 |
| chr11_-_57089671 | 1.20 |
ENST00000532437.1
|
TNKS1BP1
|
tankyrase 1 binding protein 1, 182kDa |
| chr6_-_43596899 | 1.20 |
ENST00000307126.5
ENST00000452781.1 |
GTPBP2
|
GTP binding protein 2 |
| chr16_+_56598961 | 1.19 |
ENST00000219162.3
|
MT4
|
metallothionein 4 |
| chr4_+_74735102 | 1.19 |
ENST00000395761.3
|
CXCL1
|
chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha) |
| chr10_-_100027943 | 1.16 |
ENST00000260702.3
|
LOXL4
|
lysyl oxidase-like 4 |
| chr10_+_48355024 | 1.16 |
ENST00000395702.2
ENST00000442001.1 ENST00000433077.1 ENST00000436850.1 ENST00000494156.1 ENST00000586537.1 |
ZNF488
|
zinc finger protein 488 |
| chr12_-_56236734 | 1.16 |
ENST00000548629.1
|
MMP19
|
matrix metallopeptidase 19 |
| chr1_-_1051455 | 1.15 |
ENST00000379339.1
ENST00000480643.1 ENST00000434641.1 ENST00000421241.2 |
C1orf159
|
chromosome 1 open reading frame 159 |
| chr12_-_89919965 | 1.15 |
ENST00000548729.1
|
POC1B-GALNT4
|
POC1B-GALNT4 readthrough |
| chr1_-_153521714 | 1.14 |
ENST00000368713.3
|
S100A3
|
S100 calcium binding protein A3 |
| chr12_-_89918522 | 1.14 |
ENST00000529983.2
|
GALNT4
|
UDP-N-acetyl-alpha-D-galactosamine:polypeptide N-acetylgalactosaminyltransferase 4 (GalNAc-T4) |
| chr6_+_31895467 | 1.13 |
ENST00000556679.1
ENST00000456570.1 |
CFB
CFB
|
complement factor B Complement factor B; Uncharacterized protein; cDNA FLJ55673, highly similar to Complement factor B |
| chr1_+_110453462 | 1.12 |
ENST00000488198.1
|
CSF1
|
colony stimulating factor 1 (macrophage) |
| chr6_+_32811885 | 1.11 |
ENST00000458296.1
ENST00000413039.1 ENST00000429600.1 ENST00000412095.1 ENST00000415067.1 ENST00000395330.1 |
TAPSAR1
PSMB9
|
TAP1 and PSMB8 antisense RNA 1 proteasome (prosome, macropain) subunit, beta type, 9 |
| chr1_-_201096312 | 1.11 |
ENST00000449188.2
|
ASCL5
|
achaete-scute family bHLH transcription factor 5 |
| chr4_-_681114 | 1.10 |
ENST00000503156.1
|
MFSD7
|
major facilitator superfamily domain containing 7 |
| chr1_+_169079823 | 1.09 |
ENST00000367813.3
|
ATP1B1
|
ATPase, Na+/K+ transporting, beta 1 polypeptide |
| chr7_-_98467543 | 1.08 |
ENST00000345589.4
|
TMEM130
|
transmembrane protein 130 |
| chr17_+_43238438 | 1.07 |
ENST00000593138.1
ENST00000586681.1 |
HEXIM2
|
hexamethylene bis-acetamide inducible 2 |
| chr12_-_50298000 | 1.06 |
ENST00000550635.2
|
FAIM2
|
Fas apoptotic inhibitory molecule 2 |
| chr12_-_57522813 | 1.06 |
ENST00000556155.1
|
STAT6
|
signal transducer and activator of transcription 6, interleukin-4 induced |
| chr7_-_98467629 | 1.05 |
ENST00000339375.4
|
TMEM130
|
transmembrane protein 130 |
| chr2_+_127413481 | 1.05 |
ENST00000259254.4
|
GYPC
|
glycophorin C (Gerbich blood group) |
| chr6_+_44095347 | 1.05 |
ENST00000323267.6
|
TMEM63B
|
transmembrane protein 63B |
| chr12_-_57504069 | 1.05 |
ENST00000543873.2
ENST00000554663.1 ENST00000557635.1 |
STAT6
|
signal transducer and activator of transcription 6, interleukin-4 induced |
| chr6_+_36646435 | 1.03 |
ENST00000244741.5
ENST00000405375.1 ENST00000373711.2 |
CDKN1A
|
cyclin-dependent kinase inhibitor 1A (p21, Cip1) |
| chr16_-_70472946 | 1.01 |
ENST00000342907.2
|
ST3GAL2
|
ST3 beta-galactoside alpha-2,3-sialyltransferase 2 |
| chr6_-_3227877 | 1.00 |
ENST00000259818.7
|
TUBB2B
|
tubulin, beta 2B class IIb |
| chr4_+_139936905 | 0.98 |
ENST00000280614.2
|
CCRN4L
|
CCR4 carbon catabolite repression 4-like (S. cerevisiae) |
| chr2_+_201997595 | 0.98 |
ENST00000470178.2
|
CFLAR
|
CASP8 and FADD-like apoptosis regulator |
| chr16_+_30662360 | 0.98 |
ENST00000542965.2
|
PRR14
|
proline rich 14 |
| chr20_+_44746939 | 0.97 |
ENST00000372276.3
|
CD40
|
CD40 molecule, TNF receptor superfamily member 5 |
| chr1_-_150208320 | 0.96 |
ENST00000534220.1
|
ANP32E
|
acidic (leucine-rich) nuclear phosphoprotein 32 family, member E |
| chr11_-_75017734 | 0.96 |
ENST00000532525.1
|
ARRB1
|
arrestin, beta 1 |
| chr18_-_71959159 | 0.95 |
ENST00000494131.2
ENST00000397914.4 ENST00000340533.4 |
CYB5A
|
cytochrome b5 type A (microsomal) |
| chr15_-_43910998 | 0.93 |
ENST00000450892.2
|
STRC
|
stereocilin |
| chr11_+_35160709 | 0.93 |
ENST00000415148.2
ENST00000433354.2 ENST00000449691.2 ENST00000437706.2 ENST00000360158.4 ENST00000428726.2 ENST00000526669.2 ENST00000433892.2 ENST00000278386.6 ENST00000434472.2 ENST00000352818.4 ENST00000442151.2 |
CD44
|
CD44 molecule (Indian blood group) |
| chr17_-_73874654 | 0.91 |
ENST00000254816.2
|
TRIM47
|
tripartite motif containing 47 |
| chr2_+_102721023 | 0.91 |
ENST00000409589.1
ENST00000409329.1 |
IL1R1
|
interleukin 1 receptor, type I |
| chr2_+_201997492 | 0.90 |
ENST00000494258.1
|
CFLAR
|
CASP8 and FADD-like apoptosis regulator |
| chr11_+_122526383 | 0.90 |
ENST00000284273.5
|
UBASH3B
|
ubiquitin associated and SH3 domain containing B |
| chrX_+_150869023 | 0.89 |
ENST00000448324.1
|
PRRG3
|
proline rich Gla (G-carboxyglutamic acid) 3 (transmembrane) |
| chr3_+_38347427 | 0.88 |
ENST00000273173.4
|
SLC22A14
|
solute carrier family 22, member 14 |
| chr7_+_151038785 | 0.88 |
ENST00000413040.2
ENST00000568733.1 |
NUB1
|
negative regulator of ubiquitin-like proteins 1 |
| chr4_-_5891918 | 0.88 |
ENST00000512574.1
|
CRMP1
|
collapsin response mediator protein 1 |
| chr19_+_19496728 | 0.88 |
ENST00000537887.1
ENST00000417582.2 |
GATAD2A
|
GATA zinc finger domain containing 2A |
| chr17_-_48207157 | 0.88 |
ENST00000330175.4
ENST00000503131.1 |
SAMD14
|
sterile alpha motif domain containing 14 |
| chr2_+_127413677 | 0.87 |
ENST00000356887.7
|
GYPC
|
glycophorin C (Gerbich blood group) |
| chr22_+_23229960 | 0.87 |
ENST00000526893.1
ENST00000532223.2 ENST00000531372.1 |
IGLL5
|
immunoglobulin lambda-like polypeptide 5 |
| chr20_-_62199427 | 0.87 |
ENST00000427522.2
|
HELZ2
|
helicase with zinc finger 2, transcriptional coactivator |
| chr12_-_89920030 | 0.86 |
ENST00000413530.1
ENST00000547474.1 |
GALNT4
POC1B-GALNT4
|
UDP-N-acetyl-alpha-D-galactosamine:polypeptide N-acetylgalactosaminyltransferase 4 (GalNAc-T4) POC1B-GALNT4 readthrough |
| chr3_-_122283424 | 0.86 |
ENST00000477522.2
ENST00000360356.2 |
PARP9
|
poly (ADP-ribose) polymerase family, member 9 |
| chr14_+_59655369 | 0.85 |
ENST00000360909.3
ENST00000351081.1 ENST00000556135.1 |
DAAM1
|
dishevelled associated activator of morphogenesis 1 |
| chr11_-_3862059 | 0.85 |
ENST00000396978.1
|
RHOG
|
ras homolog family member G |
| chr20_+_61436146 | 0.85 |
ENST00000290291.6
|
OGFR
|
opioid growth factor receptor |
| chr11_-_3663502 | 0.85 |
ENST00000359918.4
|
ART5
|
ADP-ribosyltransferase 5 |
| chr10_-_135171510 | 0.85 |
ENST00000278025.4
ENST00000368552.3 |
FUOM
|
fucose mutarotase |
| chr13_+_96743093 | 0.84 |
ENST00000376705.2
|
HS6ST3
|
heparan sulfate 6-O-sulfotransferase 3 |
| chr22_-_18507279 | 0.84 |
ENST00000441493.2
ENST00000444520.1 ENST00000207726.7 ENST00000429452.1 |
MICAL3
|
microtubule associated monooxygenase, calponin and LIM domain containing 3 |
| chr1_-_226129083 | 0.84 |
ENST00000420304.2
|
LEFTY2
|
left-right determination factor 2 |
| chr11_-_113577014 | 0.83 |
ENST00000544634.1
ENST00000539732.1 ENST00000538770.1 ENST00000536856.1 ENST00000544476.1 |
TMPRSS5
|
transmembrane protease, serine 5 |
| chr14_+_23305760 | 0.82 |
ENST00000311852.6
|
MMP14
|
matrix metallopeptidase 14 (membrane-inserted) |
| chr8_+_120428546 | 0.82 |
ENST00000259526.3
|
NOV
|
nephroblastoma overexpressed |
| chr7_+_86274145 | 0.82 |
ENST00000439827.1
ENST00000394720.2 ENST00000421579.1 |
GRM3
|
glutamate receptor, metabotropic 3 |
| chr8_+_104310661 | 0.81 |
ENST00000522566.1
|
FZD6
|
frizzled family receptor 6 |
| chr17_-_58499766 | 0.81 |
ENST00000588898.1
|
USP32
|
ubiquitin specific peptidase 32 |
| chr6_-_46459099 | 0.81 |
ENST00000371374.1
|
RCAN2
|
regulator of calcineurin 2 |
| chr2_+_127413704 | 0.81 |
ENST00000409836.3
|
GYPC
|
glycophorin C (Gerbich blood group) |
| chr2_+_27071045 | 0.81 |
ENST00000401478.1
|
DPYSL5
|
dihydropyrimidinase-like 5 |
| chr8_+_145582231 | 0.80 |
ENST00000526338.1
ENST00000402965.1 ENST00000534725.1 ENST00000532887.1 ENST00000329994.2 |
SLC52A2
|
solute carrier family 52 (riboflavin transporter), member 2 |
| chr22_+_37309662 | 0.80 |
ENST00000403662.3
ENST00000262825.5 |
CSF2RB
|
colony stimulating factor 2 receptor, beta, low-affinity (granulocyte-macrophage) |
| chr1_-_161519682 | 0.80 |
ENST00000367969.3
ENST00000443193.1 |
FCGR3A
|
Fc fragment of IgG, low affinity IIIa, receptor (CD16a) |
| chr19_+_36132631 | 0.79 |
ENST00000379026.2
ENST00000379023.4 ENST00000402764.2 ENST00000479824.1 |
ETV2
|
ets variant 2 |
| chr12_+_50144381 | 0.79 |
ENST00000552370.1
|
TMBIM6
|
transmembrane BAX inhibitor motif containing 6 |
| chr9_-_134585221 | 0.79 |
ENST00000372190.3
ENST00000427994.1 |
RAPGEF1
|
Rap guanine nucleotide exchange factor (GEF) 1 |
| chr11_-_3862206 | 0.79 |
ENST00000351018.4
|
RHOG
|
ras homolog family member G |
| chr10_-_75401500 | 0.79 |
ENST00000359322.4
|
MYOZ1
|
myozenin 1 |
| chr18_-_19748331 | 0.79 |
ENST00000584201.1
|
GATA6-AS1
|
GATA6 antisense RNA 1 (head to head) |
| chr19_-_54872556 | 0.78 |
ENST00000444687.1
|
LAIR1
|
leukocyte-associated immunoglobulin-like receptor 1 |
| chr19_+_44085189 | 0.77 |
ENST00000562365.2
|
PINLYP
|
phospholipase A2 inhibitor and LY6/PLAUR domain containing |
| chr6_+_34204642 | 0.77 |
ENST00000347617.6
ENST00000401473.3 ENST00000311487.5 ENST00000447654.1 ENST00000395004.3 |
HMGA1
|
high mobility group AT-hook 1 |
| chr11_+_65337901 | 0.77 |
ENST00000309328.3
ENST00000531405.1 ENST00000527920.1 ENST00000526877.1 ENST00000533115.1 ENST00000526433.1 |
SSSCA1
|
Sjogren syndrome/scleroderma autoantigen 1 |
| chr18_+_21718924 | 0.77 |
ENST00000399496.3
|
CABYR
|
calcium binding tyrosine-(Y)-phosphorylation regulated |
| chr17_+_37784749 | 0.77 |
ENST00000394265.1
ENST00000394267.2 |
PPP1R1B
|
protein phosphatase 1, regulatory (inhibitor) subunit 1B |
| chr8_+_145582217 | 0.77 |
ENST00000530047.1
ENST00000527078.1 |
SLC52A2
|
solute carrier family 52 (riboflavin transporter), member 2 |
| chr10_-_105615164 | 0.76 |
ENST00000355946.2
ENST00000369774.4 |
SH3PXD2A
|
SH3 and PX domains 2A |
| chr4_-_74964904 | 0.76 |
ENST00000508487.2
|
CXCL2
|
chemokine (C-X-C motif) ligand 2 |
| chr4_+_20255123 | 0.76 |
ENST00000504154.1
ENST00000273739.5 |
SLIT2
|
slit homolog 2 (Drosophila) |
| chr18_+_21719018 | 0.76 |
ENST00000585037.1
ENST00000415309.2 ENST00000399481.2 ENST00000577705.1 ENST00000327201.6 |
CABYR
|
calcium binding tyrosine-(Y)-phosphorylation regulated |
| chr19_-_10491234 | 0.76 |
ENST00000524462.1
ENST00000531836.1 ENST00000525621.1 |
TYK2
|
tyrosine kinase 2 |
| chr11_+_17741111 | 0.76 |
ENST00000250003.3
|
MYOD1
|
myogenic differentiation 1 |
| chr7_-_100493482 | 0.76 |
ENST00000411582.1
ENST00000419336.2 ENST00000241069.5 ENST00000302913.4 |
ACHE
|
acetylcholinesterase (Yt blood group) |
| chr19_-_51456198 | 0.75 |
ENST00000594846.1
|
KLK5
|
kallikrein-related peptidase 5 |
| chr1_-_161519579 | 0.75 |
ENST00000426740.1
|
FCGR3A
|
Fc fragment of IgG, low affinity IIIa, receptor (CD16a) |
| chr3_+_9691117 | 0.75 |
ENST00000353332.5
ENST00000420925.1 ENST00000296003.4 ENST00000351233.5 |
MTMR14
|
myotubularin related protein 14 |
| chr20_+_53092232 | 0.75 |
ENST00000395939.1
|
DOK5
|
docking protein 5 |
| chr3_-_190040223 | 0.75 |
ENST00000295522.3
|
CLDN1
|
claudin 1 |
| chr1_+_165864821 | 0.75 |
ENST00000470820.1
|
UCK2
|
uridine-cytidine kinase 2 |
| chr12_-_52911718 | 0.75 |
ENST00000548409.1
|
KRT5
|
keratin 5 |
| chr17_+_7341586 | 0.74 |
ENST00000575235.1
|
FGF11
|
fibroblast growth factor 11 |
| chr19_+_12902289 | 0.74 |
ENST00000302754.4
|
JUNB
|
jun B proto-oncogene |
| chr9_-_100881466 | 0.74 |
ENST00000341469.2
ENST00000342043.3 ENST00000375098.3 |
TRIM14
|
tripartite motif containing 14 |
| chr7_-_100491854 | 0.74 |
ENST00000426415.1
ENST00000430554.1 ENST00000412389.1 |
ACHE
|
acetylcholinesterase (Yt blood group) |
| chr20_-_43977055 | 0.74 |
ENST00000372733.3
ENST00000537976.1 |
SDC4
|
syndecan 4 |
| chr9_+_126131131 | 0.73 |
ENST00000373629.2
|
CRB2
|
crumbs homolog 2 (Drosophila) |
| chr15_+_90118685 | 0.73 |
ENST00000268138.7
|
TICRR
|
TOPBP1-interacting checkpoint and replication regulator |
| chr1_-_226129189 | 0.73 |
ENST00000366820.5
|
LEFTY2
|
left-right determination factor 2 |
| chr6_-_17987694 | 0.73 |
ENST00000378814.5
ENST00000378843.2 ENST00000378826.2 ENST00000378816.5 ENST00000259711.6 ENST00000502704.1 |
KIF13A
|
kinesin family member 13A |
| chr9_+_72658490 | 0.73 |
ENST00000377182.4
|
MAMDC2
|
MAM domain containing 2 |
| chr12_-_322504 | 0.72 |
ENST00000424061.2
|
SLC6A12
|
solute carrier family 6 (neurotransmitter transporter), member 12 |
| chr9_-_130487143 | 0.72 |
ENST00000419060.1
|
PTRH1
|
peptidyl-tRNA hydrolase 1 homolog (S. cerevisiae) |
| chr19_-_39108568 | 0.72 |
ENST00000586296.1
|
MAP4K1
|
mitogen-activated protein kinase kinase kinase kinase 1 |
| chr1_-_9714644 | 0.72 |
ENST00000377320.3
|
C1orf200
|
chromosome 1 open reading frame 200 |
| chr1_+_35225339 | 0.71 |
ENST00000339480.1
|
GJB4
|
gap junction protein, beta 4, 30.3kDa |
| chr6_-_57086200 | 0.71 |
ENST00000468148.1
|
RAB23
|
RAB23, member RAS oncogene family |
| chr5_-_146833222 | 0.71 |
ENST00000534907.1
|
DPYSL3
|
dihydropyrimidinase-like 3 |
| chr19_+_48949030 | 0.71 |
ENST00000253237.5
|
GRWD1
|
glutamate-rich WD repeat containing 1 |
| chrX_-_48056199 | 0.70 |
ENST00000311798.1
ENST00000347757.1 |
SSX5
|
synovial sarcoma, X breakpoint 5 |
| chr1_-_111148969 | 0.70 |
ENST00000316361.4
|
KCNA2
|
potassium voltage-gated channel, shaker-related subfamily, member 2 |
| chr2_-_100759037 | 0.70 |
ENST00000317233.4
ENST00000423966.1 ENST00000416492.1 |
AFF3
|
AF4/FMR2 family, member 3 |
| chr12_-_55042140 | 0.70 |
ENST00000293371.6
ENST00000456047.2 |
DCD
|
dermcidin |
| chr9_+_35673853 | 0.69 |
ENST00000378357.4
|
CA9
|
carbonic anhydrase IX |
| chr5_-_95297534 | 0.69 |
ENST00000513343.1
ENST00000431061.2 |
ELL2
|
elongation factor, RNA polymerase II, 2 |
| chr22_-_37640456 | 0.69 |
ENST00000405484.1
ENST00000441619.1 ENST00000406508.1 |
RAC2
|
ras-related C3 botulinum toxin substrate 2 (rho family, small GTP binding protein Rac2) |
| chr6_+_44094627 | 0.69 |
ENST00000259746.9
|
TMEM63B
|
transmembrane protein 63B |
| chr12_-_49504623 | 0.68 |
ENST00000550137.1
ENST00000547382.1 |
LMBR1L
|
limb development membrane protein 1-like |
| chr20_+_44746885 | 0.68 |
ENST00000372285.3
|
CD40
|
CD40 molecule, TNF receptor superfamily member 5 |
| chr16_+_28889703 | 0.68 |
ENST00000357084.3
|
ATP2A1
|
ATPase, Ca++ transporting, cardiac muscle, fast twitch 1 |
| chr6_-_24877490 | 0.68 |
ENST00000540914.1
ENST00000378023.4 |
FAM65B
|
family with sequence similarity 65, member B |
| chr20_+_43211149 | 0.68 |
ENST00000372886.1
|
PKIG
|
protein kinase (cAMP-dependent, catalytic) inhibitor gamma |
| chr16_+_3115611 | 0.68 |
ENST00000530890.1
ENST00000444393.3 ENST00000533097.2 ENST00000008180.9 ENST00000396890.2 ENST00000525228.1 ENST00000548652.1 ENST00000525377.2 ENST00000530538.2 ENST00000549213.1 ENST00000552936.1 ENST00000548476.1 ENST00000552664.1 ENST00000552356.1 ENST00000551513.1 ENST00000382213.3 ENST00000548246.1 |
IL32
|
interleukin 32 |
| chr22_-_37505588 | 0.67 |
ENST00000406856.1
|
TMPRSS6
|
transmembrane protease, serine 6 |
| chrX_-_68385274 | 0.67 |
ENST00000374584.3
ENST00000590146.1 |
PJA1
|
praja ring finger 1, E3 ubiquitin protein ligase |
| chr17_+_7258442 | 0.67 |
ENST00000389982.4
ENST00000576060.1 ENST00000330767.4 |
TMEM95
|
transmembrane protein 95 |
| chr10_+_115439282 | 0.67 |
ENST00000369321.2
ENST00000345633.4 |
CASP7
|
caspase 7, apoptosis-related cysteine peptidase |
| chr16_+_30662050 | 0.67 |
ENST00000568754.1
|
PRR14
|
proline rich 14 |
| chr4_+_15704573 | 0.67 |
ENST00000265016.4
|
BST1
|
bone marrow stromal cell antigen 1 |
| chr6_-_32811771 | 0.66 |
ENST00000395339.3
ENST00000374882.3 |
PSMB8
|
proteasome (prosome, macropain) subunit, beta type, 8 |
| chrX_-_68385354 | 0.66 |
ENST00000361478.1
|
PJA1
|
praja ring finger 1, E3 ubiquitin protein ligase |
| chr15_+_90118723 | 0.66 |
ENST00000560985.1
|
TICRR
|
TOPBP1-interacting checkpoint and replication regulator |
| chr19_-_47734448 | 0.66 |
ENST00000439096.2
|
BBC3
|
BCL2 binding component 3 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.0 | 6.0 | GO:0048250 | mitochondrial iron ion transport(GO:0048250) |
| 1.1 | 9.6 | GO:0003025 | regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
| 0.9 | 2.8 | GO:0021836 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) chemorepulsion involved in postnatal olfactory bulb interneuron migration(GO:0021836) |
| 0.9 | 7.3 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.8 | 4.0 | GO:1903971 | mammary gland fat development(GO:0060611) positive regulation of macrophage colony-stimulating factor signaling pathway(GO:1902228) positive regulation of response to macrophage colony-stimulating factor(GO:1903971) positive regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903974) positive regulation of microglial cell migration(GO:1904141) |
| 0.7 | 2.9 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.7 | 2.2 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
| 0.6 | 2.4 | GO:0046967 | cytosol to ER transport(GO:0046967) |
| 0.6 | 3.0 | GO:0061767 | negative regulation of lung blood pressure(GO:0061767) |
| 0.6 | 2.2 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.5 | 2.1 | GO:0002296 | T-helper 1 cell lineage commitment(GO:0002296) |
| 0.5 | 2.6 | GO:0003069 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 0.5 | 1.5 | GO:0043602 | nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) |
| 0.5 | 1.5 | GO:0045212 | negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 0.4 | 1.9 | GO:0032218 | riboflavin transport(GO:0032218) |
| 0.4 | 1.4 | GO:2000820 | negative regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000820) |
| 0.3 | 1.6 | GO:0033590 | response to cobalamin(GO:0033590) |
| 0.3 | 0.3 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.3 | 1.6 | GO:1903281 | positive regulation of calcium:sodium antiporter activity(GO:1903281) |
| 0.3 | 0.9 | GO:0007518 | myoblast fate determination(GO:0007518) |
| 0.3 | 0.9 | GO:2000661 | positive regulation of interleukin-1-mediated signaling pathway(GO:2000661) |
| 0.3 | 3.6 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
| 0.3 | 3.9 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.3 | 0.9 | GO:1904530 | negative regulation of actin filament binding(GO:1904530) negative regulation of actin binding(GO:1904617) |
| 0.3 | 0.9 | GO:0031448 | regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) |
| 0.3 | 5.2 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.3 | 1.1 | GO:0072658 | maintenance of protein location in membrane(GO:0072658) maintenance of protein location in plasma membrane(GO:0072660) positive regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900827) |
| 0.3 | 2.0 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.3 | 0.8 | GO:0016185 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
| 0.3 | 0.8 | GO:0038043 | interleukin-5-mediated signaling pathway(GO:0038043) |
| 0.3 | 1.8 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
| 0.3 | 0.5 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.2 | 0.7 | GO:0071284 | cellular response to lead ion(GO:0071284) |
| 0.2 | 2.3 | GO:1903943 | regulation of hepatocyte apoptotic process(GO:1903943) negative regulation of hepatocyte apoptotic process(GO:1903944) |
| 0.2 | 1.1 | GO:0003343 | proepicardium development(GO:0003342) septum transversum development(GO:0003343) |
| 0.2 | 1.8 | GO:0001554 | luteolysis(GO:0001554) |
| 0.2 | 0.6 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
| 0.2 | 1.7 | GO:0072734 | response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
| 0.2 | 1.0 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
| 0.2 | 1.0 | GO:0060574 | intestinal epithelial cell maturation(GO:0060574) |
| 0.2 | 0.6 | GO:0042489 | negative regulation of odontogenesis of dentin-containing tooth(GO:0042489) |
| 0.2 | 1.4 | GO:2000124 | regulation of endocannabinoid signaling pathway(GO:2000124) |
| 0.2 | 0.8 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
| 0.2 | 1.4 | GO:1903385 | regulation of homophilic cell adhesion(GO:1903385) |
| 0.2 | 3.1 | GO:0016322 | neuron remodeling(GO:0016322) |
| 0.2 | 2.1 | GO:0032782 | bile acid secretion(GO:0032782) |
| 0.2 | 0.8 | GO:1904398 | positive regulation of neuromuscular junction development(GO:1904398) |
| 0.2 | 1.1 | GO:0072675 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.2 | 1.5 | GO:1900623 | regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
| 0.2 | 0.7 | GO:0006238 | CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) CMP metabolic process(GO:0046035) |
| 0.2 | 1.1 | GO:1903527 | positive regulation of membrane tubulation(GO:1903527) |
| 0.2 | 0.9 | GO:0035106 | operant conditioning(GO:0035106) |
| 0.2 | 0.6 | GO:0042137 | sequestering of neurotransmitter(GO:0042137) |
| 0.2 | 0.6 | GO:0000472 | endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
| 0.2 | 0.9 | GO:0071603 | endothelial cell-cell adhesion(GO:0071603) |
| 0.2 | 0.5 | GO:0060370 | susceptibility to T cell mediated cytotoxicity(GO:0060370) |
| 0.2 | 0.5 | GO:0006422 | aspartyl-tRNA aminoacylation(GO:0006422) |
| 0.2 | 5.2 | GO:0090023 | positive regulation of neutrophil chemotaxis(GO:0090023) |
| 0.2 | 0.7 | GO:0010585 | glutamine secretion(GO:0010585) L-glutamine import(GO:0036229) L-glutamine import into cell(GO:1903803) |
| 0.2 | 0.5 | GO:1901837 | negative regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901837) |
| 0.2 | 0.5 | GO:1902568 | positive regulation of eosinophil degranulation(GO:0043311) positive regulation of eosinophil activation(GO:1902568) |
| 0.2 | 0.7 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
| 0.2 | 0.5 | GO:0017186 | peptidyl-pyroglutamic acid biosynthetic process, using glutaminyl-peptide cyclotransferase(GO:0017186) |
| 0.2 | 1.0 | GO:0002760 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antimicrobial humoral response(GO:0002760) positive regulation of antibacterial peptide production(GO:0002803) |
| 0.2 | 1.0 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.2 | 0.8 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.2 | 0.5 | GO:1902080 | positive regulation of relaxation of cardiac muscle(GO:1901899) regulation of calcium ion import into sarcoplasmic reticulum(GO:1902080) negative regulation of calcium ion import into sarcoplasmic reticulum(GO:1902081) |
| 0.2 | 1.2 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
| 0.2 | 0.2 | GO:0003064 | regulation of heart rate by hormone(GO:0003064) |
| 0.2 | 2.3 | GO:0021702 | cerebellar Purkinje cell layer formation(GO:0021694) cerebellar Purkinje cell differentiation(GO:0021702) |
| 0.2 | 0.8 | GO:1990834 | response to odorant(GO:1990834) |
| 0.2 | 0.7 | GO:0009644 | response to high light intensity(GO:0009644) |
| 0.2 | 0.8 | GO:0051941 | regulation of amino acid uptake involved in synaptic transmission(GO:0051941) regulation of glutamate uptake involved in transmission of nerve impulse(GO:0051946) regulation of L-glutamate import(GO:1900920) |
| 0.2 | 1.9 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
| 0.2 | 0.6 | GO:0090107 | regulation of high-density lipoprotein particle assembly(GO:0090107) |
| 0.2 | 0.5 | GO:0044210 | 'de novo' CTP biosynthetic process(GO:0044210) |
| 0.2 | 0.5 | GO:1905224 | clathrin-coated pit assembly(GO:1905224) |
| 0.2 | 0.5 | GO:0048213 | Golgi vesicle prefusion complex stabilization(GO:0048213) |
| 0.2 | 0.8 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.2 | 0.8 | GO:0090402 | oncogene-induced cell senescence(GO:0090402) |
| 0.2 | 1.4 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.2 | 0.8 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.2 | 0.9 | GO:0010734 | protein glutathionylation(GO:0010731) regulation of protein glutathionylation(GO:0010732) negative regulation of protein glutathionylation(GO:0010734) |
| 0.2 | 0.3 | GO:0006258 | UDP-glucose catabolic process(GO:0006258) |
| 0.1 | 0.4 | GO:0070676 | intralumenal vesicle formation(GO:0070676) |
| 0.1 | 0.9 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.1 | 0.6 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.1 | 0.4 | GO:0009443 | pyridoxal 5'-phosphate salvage(GO:0009443) |
| 0.1 | 0.7 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.1 | 0.3 | GO:1902512 | positive regulation of apoptotic DNA fragmentation(GO:1902512) |
| 0.1 | 1.1 | GO:0070777 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
| 0.1 | 0.7 | GO:0021633 | optic nerve structural organization(GO:0021633) |
| 0.1 | 0.7 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
| 0.1 | 1.4 | GO:0098914 | membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
| 0.1 | 0.4 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.1 | 2.2 | GO:0060088 | auditory receptor cell stereocilium organization(GO:0060088) |
| 0.1 | 1.2 | GO:1902219 | negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 0.1 | 0.8 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
| 0.1 | 0.8 | GO:0010836 | negative regulation of protein ADP-ribosylation(GO:0010836) |
| 0.1 | 0.4 | GO:1904172 | regulation of bleb assembly(GO:1904170) positive regulation of bleb assembly(GO:1904172) |
| 0.1 | 2.1 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.1 | 0.8 | GO:1901631 | positive regulation of presynaptic membrane organization(GO:1901631) positive regulation of synaptic vesicle clustering(GO:2000809) |
| 0.1 | 0.3 | GO:1901876 | regulation of calcium ion binding(GO:1901876) negative regulation of calcium ion binding(GO:1901877) |
| 0.1 | 0.4 | GO:1902310 | regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:0060734) positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.1 | 0.4 | GO:0032773 | regulation of monophenol monooxygenase activity(GO:0032771) positive regulation of monophenol monooxygenase activity(GO:0032773) negative regulation of catagen(GO:0051796) regulation of hair cycle by canonical Wnt signaling pathway(GO:0060901) positive regulation of melanosome transport(GO:1902910) |
| 0.1 | 0.5 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
| 0.1 | 0.2 | GO:1900378 | positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
| 0.1 | 0.4 | GO:0032242 | regulation of nucleoside transport(GO:0032242) negative regulation of neurotrophin production(GO:0032900) |
| 0.1 | 0.7 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.1 | 0.9 | GO:0003383 | apical constriction(GO:0003383) |
| 0.1 | 0.7 | GO:0014028 | notochord formation(GO:0014028) |
| 0.1 | 0.7 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.1 | 0.4 | GO:1903697 | negative regulation of microvillus assembly(GO:1903697) |
| 0.1 | 2.1 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
| 0.1 | 0.4 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.1 | 0.5 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
| 0.1 | 0.9 | GO:0090022 | regulation of neutrophil chemotaxis(GO:0090022) |
| 0.1 | 0.3 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
| 0.1 | 1.6 | GO:0060180 | female mating behavior(GO:0060180) |
| 0.1 | 0.7 | GO:0001712 | ectoderm formation(GO:0001705) ectodermal cell fate commitment(GO:0001712) |
| 0.1 | 0.3 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.1 | 1.3 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
| 0.1 | 0.1 | GO:0071306 | cellular response to vitamin E(GO:0071306) |
| 0.1 | 0.1 | GO:0060066 | oviduct development(GO:0060066) |
| 0.1 | 0.4 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.1 | 0.3 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
| 0.1 | 0.7 | GO:0035935 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
| 0.1 | 1.6 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
| 0.1 | 0.8 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.1 | 0.5 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
| 0.1 | 0.4 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
| 0.1 | 0.4 | GO:0009386 | translational attenuation(GO:0009386) |
| 0.1 | 0.6 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
| 0.1 | 0.7 | GO:0060481 | lobar bronchus epithelium development(GO:0060481) |
| 0.1 | 0.4 | GO:0032667 | interleukin-23 production(GO:0032627) regulation of interleukin-23 production(GO:0032667) positive regulation of interleukin-23 production(GO:0032747) |
| 0.1 | 0.8 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.1 | 0.4 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.1 | 0.2 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.1 | 0.3 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.2 | GO:0006532 | fumarate metabolic process(GO:0006106) aspartate biosynthetic process(GO:0006532) |
| 0.1 | 3.7 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
| 0.1 | 0.5 | GO:0061762 | CAMKK-AMPK signaling cascade(GO:0061762) |
| 0.1 | 0.4 | GO:0003409 | optic cup structural organization(GO:0003409) |
| 0.1 | 0.3 | GO:0050902 | leukocyte adhesive activation(GO:0050902) |
| 0.1 | 0.3 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.1 | 0.9 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
| 0.1 | 0.7 | GO:2000543 | positive regulation of gastrulation(GO:2000543) |
| 0.1 | 0.9 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.1 | 0.3 | GO:0033341 | regulation of collagen binding(GO:0033341) |
| 0.1 | 0.3 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
| 0.1 | 0.2 | GO:0003186 | tricuspid valve morphogenesis(GO:0003186) mesendoderm development(GO:0048382) |
| 0.1 | 0.5 | GO:0090131 | mesenchyme migration(GO:0090131) |
| 0.1 | 0.3 | GO:0070383 | DNA cytosine deamination(GO:0070383) |
| 0.1 | 0.4 | GO:0033512 | L-lysine catabolic process to acetyl-CoA via saccharopine(GO:0033512) |
| 0.1 | 2.5 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.1 | 0.2 | GO:0070093 | negative regulation of glucagon secretion(GO:0070093) |
| 0.1 | 0.3 | GO:1903525 | regulation of membrane tubulation(GO:1903525) negative regulation of membrane tubulation(GO:1903526) |
| 0.1 | 1.2 | GO:0072386 | plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.1 | 0.3 | GO:0035349 | coenzyme A transport(GO:0015880) coenzyme A transmembrane transport(GO:0035349) adenosine 3',5'-bisphosphate transmembrane transport(GO:0071106) AMP transport(GO:0080121) |
| 0.1 | 0.6 | GO:0033504 | floor plate development(GO:0033504) |
| 0.1 | 0.3 | GO:0072268 | pattern specification involved in metanephros development(GO:0072268) |
| 0.1 | 0.3 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
| 0.1 | 1.4 | GO:0016540 | protein autoprocessing(GO:0016540) |
| 0.1 | 0.4 | GO:2001288 | positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.1 | 0.2 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.1 | 0.5 | GO:1902766 | skeletal muscle satellite cell migration(GO:1902766) |
| 0.1 | 0.7 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 0.1 | 0.2 | GO:1990481 | mRNA pseudouridine synthesis(GO:1990481) |
| 0.1 | 0.3 | GO:0046947 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.1 | 0.3 | GO:0007439 | ectodermal digestive tract development(GO:0007439) embryonic ectodermal digestive tract development(GO:0048611) |
| 0.1 | 0.2 | GO:0034125 | negative regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034125) |
| 0.1 | 0.6 | GO:2000254 | regulation of male germ cell proliferation(GO:2000254) |
| 0.1 | 0.3 | GO:0002265 | astrocyte activation involved in immune response(GO:0002265) |
| 0.1 | 0.2 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
| 0.1 | 1.1 | GO:0039692 | single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) |
| 0.1 | 0.1 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.1 | 0.3 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.1 | 0.2 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
| 0.1 | 0.2 | GO:0002752 | cell surface pattern recognition receptor signaling pathway(GO:0002752) |
| 0.1 | 0.6 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.1 | 1.6 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
| 0.1 | 0.2 | GO:0071393 | cellular response to progesterone stimulus(GO:0071393) |
| 0.1 | 0.2 | GO:0042450 | arginine biosynthetic process via ornithine(GO:0042450) |
| 0.1 | 0.8 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.1 | 0.6 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
| 0.1 | 0.5 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.1 | 1.5 | GO:0003351 | epithelial cilium movement(GO:0003351) |
| 0.1 | 0.7 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.1 | 0.4 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.1 | 0.8 | GO:0035878 | nail development(GO:0035878) |
| 0.1 | 0.2 | GO:0048867 | ganglion mother cell fate determination(GO:0007402) stem cell fate determination(GO:0048867) |
| 0.1 | 0.5 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
| 0.1 | 1.2 | GO:0060716 | labyrinthine layer blood vessel development(GO:0060716) |
| 0.1 | 0.7 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.1 | 0.5 | GO:0071440 | regulation of histone H3-K14 acetylation(GO:0071440) positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.1 | 0.9 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
| 0.1 | 0.7 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.1 | 1.8 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.1 | 0.4 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.1 | 0.2 | GO:0043315 | positive regulation of neutrophil degranulation(GO:0043315) cellular response to gravity(GO:0071258) positive regulation of neutrophil activation(GO:1902565) regulation of transcytosis(GO:1904298) positive regulation of transcytosis(GO:1904300) regulation of maternal process involved in parturition(GO:1904301) positive regulation of maternal process involved in parturition(GO:1904303) response to 2-O-acetyl-1-O-hexadecyl-sn-glycero-3-phosphocholine(GO:1904316) cellular response to 2-O-acetyl-1-O-hexadecyl-sn-glycero-3-phosphocholine(GO:1904317) |
| 0.1 | 0.4 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.1 | 0.3 | GO:0016334 | morphogenesis of follicular epithelium(GO:0016333) establishment or maintenance of polarity of follicular epithelium(GO:0016334) establishment of planar polarity of follicular epithelium(GO:0042247) |
| 0.1 | 0.5 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.1 | 0.5 | GO:0045007 | depurination(GO:0045007) |
| 0.1 | 0.8 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
| 0.1 | 0.2 | GO:0021650 | vestibulocochlear nerve formation(GO:0021650) |
| 0.1 | 0.1 | GO:0097252 | oligodendrocyte apoptotic process(GO:0097252) |
| 0.1 | 0.2 | GO:0090156 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.1 | 0.3 | GO:0030920 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.1 | 0.7 | GO:0060019 | radial glial cell differentiation(GO:0060019) |
| 0.1 | 1.8 | GO:0044458 | motile cilium assembly(GO:0044458) |
| 0.1 | 0.3 | GO:0048619 | embryonic genitalia morphogenesis(GO:0030538) embryonic hindgut morphogenesis(GO:0048619) |
| 0.1 | 0.3 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.1 | 0.1 | GO:1903551 | regulation of extracellular exosome assembly(GO:1903551) |
| 0.1 | 0.1 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.1 | 0.4 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.1 | 0.3 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.1 | 0.5 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.1 | 0.3 | GO:1904796 | regulation of core promoter binding(GO:1904796) positive regulation of core promoter binding(GO:1904798) |
| 0.1 | 0.3 | GO:0018101 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
| 0.1 | 0.2 | GO:0080154 | regulation of fertilization(GO:0080154) |
| 0.1 | 0.6 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
| 0.1 | 0.1 | GO:0003249 | cell proliferation involved in heart valve morphogenesis(GO:0003249) regulation of cell proliferation involved in heart valve morphogenesis(GO:0003250) |
| 0.1 | 0.4 | GO:1903301 | fructose 2,6-bisphosphate metabolic process(GO:0006003) positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
| 0.1 | 0.2 | GO:2001226 | negative regulation of chloride transport(GO:2001226) |
| 0.1 | 0.5 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
| 0.1 | 0.4 | GO:0032808 | lacrimal gland development(GO:0032808) |
| 0.1 | 0.2 | GO:0070898 | RNA polymerase III transcriptional preinitiation complex assembly(GO:0070898) |
| 0.1 | 1.2 | GO:0036315 | cellular response to sterol(GO:0036315) |
| 0.1 | 0.6 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.1 | 0.2 | GO:0042631 | cellular response to water deprivation(GO:0042631) |
| 0.1 | 0.2 | GO:0072366 | regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) regulation of lipid transport by positive regulation of transcription from RNA polymerase II promoter(GO:0072369) |
| 0.1 | 0.1 | GO:0032899 | regulation of neurotrophin production(GO:0032899) |
| 0.1 | 0.2 | GO:1902896 | terminal web assembly(GO:1902896) |
| 0.1 | 6.3 | GO:0002479 | antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-dependent(GO:0002479) |
| 0.1 | 0.2 | GO:0030860 | neuroblast division in subventricular zone(GO:0021849) regulation of polarized epithelial cell differentiation(GO:0030860) |
| 0.1 | 4.6 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.1 | 0.3 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
| 0.1 | 0.2 | GO:1900114 | positive regulation of histone H3-K9 dimethylation(GO:1900111) positive regulation of histone H3-K9 trimethylation(GO:1900114) |
| 0.1 | 0.2 | GO:0002326 | B cell lineage commitment(GO:0002326) |
| 0.1 | 0.4 | GO:0097012 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
| 0.1 | 0.2 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
| 0.1 | 0.5 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
| 0.1 | 0.2 | GO:2000395 | regulation of ubiquitin-dependent endocytosis(GO:2000395) positive regulation of ubiquitin-dependent endocytosis(GO:2000397) |
| 0.1 | 0.2 | GO:1901053 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
| 0.1 | 0.5 | GO:0038042 | dimeric G-protein coupled receptor signaling pathway(GO:0038042) calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
| 0.1 | 0.6 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.1 | 0.3 | GO:0006857 | oligopeptide transport(GO:0006857) |
| 0.1 | 0.2 | GO:0060369 | positive regulation of Fc receptor mediated stimulatory signaling pathway(GO:0060369) |
| 0.1 | 0.5 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
| 0.1 | 0.4 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.1 | 0.1 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
| 0.1 | 0.9 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
| 0.1 | 0.6 | GO:0090168 | Golgi reassembly(GO:0090168) |
| 0.1 | 1.4 | GO:0031498 | chromatin disassembly(GO:0031498) |
| 0.1 | 1.0 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
| 0.1 | 0.5 | GO:0086024 | adrenergic receptor signaling pathway involved in positive regulation of heart rate(GO:0086024) |
| 0.1 | 0.4 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
| 0.1 | 0.4 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
| 0.1 | 2.8 | GO:0043486 | histone exchange(GO:0043486) |
| 0.1 | 0.2 | GO:0021893 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) cerebral cortex GABAergic interneuron fate commitment(GO:0021893) positive regulation of neural retina development(GO:0061075) positive regulation of retina development in camera-type eye(GO:1902868) positive regulation of amacrine cell differentiation(GO:1902871) |
| 0.1 | 0.2 | GO:0071321 | cellular response to cGMP(GO:0071321) |
| 0.1 | 0.3 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) |
| 0.0 | 0.2 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.0 | 0.1 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
| 0.0 | 0.1 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.0 | 0.5 | GO:0010265 | SCF complex assembly(GO:0010265) |
| 0.0 | 1.6 | GO:0051491 | positive regulation of filopodium assembly(GO:0051491) |
| 0.0 | 0.1 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.0 | 0.2 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.0 | 0.1 | GO:0032804 | negative regulation of low-density lipoprotein particle receptor catabolic process(GO:0032804) |
| 0.0 | 0.1 | GO:0034392 | negative regulation of smooth muscle cell apoptotic process(GO:0034392) |
| 0.0 | 0.5 | GO:0048262 | determination of dorsal/ventral asymmetry(GO:0048262) |
| 0.0 | 0.6 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
| 0.0 | 0.7 | GO:1903818 | positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.0 | 1.0 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.0 | 0.3 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
| 0.0 | 0.1 | GO:0021764 | amygdala development(GO:0021764) |
| 0.0 | 0.3 | GO:1903826 | arginine transmembrane transport(GO:1903826) |
| 0.0 | 0.1 | GO:0003050 | regulation of systemic arterial blood pressure by atrial natriuretic peptide(GO:0003050) |
| 0.0 | 0.3 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.0 | 0.2 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
| 0.0 | 0.1 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
| 0.0 | 0.4 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.0 | 0.1 | GO:0006424 | glutamyl-tRNA aminoacylation(GO:0006424) |
| 0.0 | 0.5 | GO:0048298 | positive regulation of isotype switching to IgA isotypes(GO:0048298) |
| 0.0 | 0.1 | GO:1990926 | short-term synaptic potentiation(GO:1990926) calcium ion regulated lysosome exocytosis(GO:1990927) |
| 0.0 | 0.2 | GO:0010902 | positive regulation of very-low-density lipoprotein particle remodeling(GO:0010902) |
| 0.0 | 0.2 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
| 0.0 | 0.1 | GO:0070105 | positive regulation of interleukin-6-mediated signaling pathway(GO:0070105) |
| 0.0 | 1.2 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.0 | 0.3 | GO:2000158 | positive regulation of ubiquitin-specific protease activity(GO:2000158) |
| 0.0 | 1.0 | GO:0048714 | positive regulation of oligodendrocyte differentiation(GO:0048714) |
| 0.0 | 0.3 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
| 0.0 | 0.6 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
| 0.0 | 0.2 | GO:1904823 | pyrimidine nucleobase transport(GO:0015855) purine nucleobase transmembrane transport(GO:1904823) |
| 0.0 | 0.2 | GO:0010536 | positive regulation of activation of Janus kinase activity(GO:0010536) |
| 0.0 | 0.3 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.0 | 0.3 | GO:0032468 | Golgi calcium ion homeostasis(GO:0032468) |
| 0.0 | 0.1 | GO:0032571 | response to vitamin K(GO:0032571) |
| 0.0 | 1.3 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
| 0.0 | 1.2 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
| 0.0 | 0.1 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.0 | 0.2 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.0 | 0.2 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
| 0.0 | 0.1 | GO:0071109 | superior temporal gyrus development(GO:0071109) |
| 0.0 | 0.2 | GO:0043366 | beta selection(GO:0043366) |
| 0.0 | 0.0 | GO:1903094 | regulation of protein K48-linked deubiquitination(GO:1903093) negative regulation of protein K48-linked deubiquitination(GO:1903094) negative regulation of ubiquitin-specific protease activity(GO:2000157) |
| 0.0 | 0.2 | GO:0043950 | positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.0 | 0.5 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.0 | 0.4 | GO:0098887 | neurotransmitter receptor transport, endosome to postsynaptic membrane(GO:0098887) |
| 0.0 | 0.4 | GO:0006548 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
| 0.0 | 0.3 | GO:0030643 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.0 | 0.7 | GO:0002523 | leukocyte migration involved in inflammatory response(GO:0002523) |
| 0.0 | 0.2 | GO:1990502 | dense core granule maturation(GO:1990502) |
| 0.0 | 0.4 | GO:0001976 | neurological system process involved in regulation of systemic arterial blood pressure(GO:0001976) |
| 0.0 | 0.4 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.0 | 0.2 | GO:0034382 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 0.0 | 0.4 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
| 0.0 | 0.1 | GO:0035947 | regulation of gluconeogenesis by regulation of transcription from RNA polymerase II promoter(GO:0035947) |
| 0.0 | 3.0 | GO:0030574 | collagen catabolic process(GO:0030574) |
| 0.0 | 0.6 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
| 0.0 | 0.1 | GO:2000824 | negative regulation of androgen receptor activity(GO:2000824) |
| 0.0 | 1.8 | GO:1903146 | regulation of mitophagy(GO:1903146) |
| 0.0 | 0.2 | GO:0048102 | autophagic cell death(GO:0048102) |
| 0.0 | 0.0 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
| 0.0 | 0.1 | GO:0044571 | [2Fe-2S] cluster assembly(GO:0044571) |
| 0.0 | 0.3 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.0 | 0.4 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.0 | 0.7 | GO:0098780 | response to mitochondrial depolarisation(GO:0098780) |
| 0.0 | 0.5 | GO:0030836 | positive regulation of actin filament depolymerization(GO:0030836) |
| 0.0 | 0.5 | GO:0098915 | membrane repolarization during ventricular cardiac muscle cell action potential(GO:0098915) |
| 0.0 | 0.1 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
| 0.0 | 1.1 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
| 0.0 | 0.1 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.0 | 0.2 | GO:0071034 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
| 0.0 | 0.2 | GO:1904352 | positive regulation of protein catabolic process in the vacuole(GO:1904352) |
| 0.0 | 0.1 | GO:1904247 | regulation of polynucleotide adenylyltransferase activity(GO:1904245) positive regulation of polynucleotide adenylyltransferase activity(GO:1904247) |
| 0.0 | 0.6 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.0 | 0.1 | GO:0072302 | posterior mesonephric tubule development(GO:0072166) negative regulation of metanephric glomerulus development(GO:0072299) negative regulation of metanephric glomerular mesangial cell proliferation(GO:0072302) |
| 0.0 | 0.1 | GO:0044334 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) canonical Wnt signaling pathway involved in positive regulation of epithelial to mesenchymal transition(GO:0044334) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.0 | 0.4 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.0 | 0.2 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
| 0.0 | 0.2 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.0 | 0.5 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.0 | 0.1 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.0 | 0.5 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.0 | 0.2 | GO:0048105 | establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 0.0 | 0.2 | GO:1902162 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) positive regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902164) |
| 0.0 | 0.3 | GO:0003056 | regulation of vascular smooth muscle contraction(GO:0003056) |
| 0.0 | 0.1 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
| 0.0 | 0.7 | GO:0090331 | negative regulation of platelet aggregation(GO:0090331) |
| 0.0 | 0.2 | GO:2000825 | positive regulation of androgen receptor activity(GO:2000825) |
| 0.0 | 0.1 | GO:0032203 | telomere formation via telomerase(GO:0032203) |
| 0.0 | 0.6 | GO:0007021 | tubulin complex assembly(GO:0007021) |
| 0.0 | 0.0 | GO:0060557 | positive regulation of vitamin metabolic process(GO:0046136) positive regulation of vitamin D biosynthetic process(GO:0060557) positive regulation of calcidiol 1-monooxygenase activity(GO:0060559) |
| 0.0 | 0.1 | GO:0045542 | positive regulation of cholesterol biosynthetic process(GO:0045542) |
| 0.0 | 0.2 | GO:0019264 | glycine biosynthetic process from serine(GO:0019264) |
| 0.0 | 0.1 | GO:0006788 | heme oxidation(GO:0006788) |
| 0.0 | 0.1 | GO:0061056 | sclerotome development(GO:0061056) |
| 0.0 | 0.1 | GO:0060054 | positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
| 0.0 | 0.2 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
| 0.0 | 0.3 | GO:0042256 | mature ribosome assembly(GO:0042256) |
| 0.0 | 0.3 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.0 | 0.3 | GO:0006621 | protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.0 | 1.2 | GO:0016601 | Rac protein signal transduction(GO:0016601) |
| 0.0 | 0.2 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
| 0.0 | 0.3 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
| 0.0 | 0.3 | GO:0014041 | regulation of neuron maturation(GO:0014041) |
| 0.0 | 0.2 | GO:1904751 | positive regulation of protein localization to nucleolus(GO:1904751) |
| 0.0 | 1.6 | GO:0099601 | regulation of neurotransmitter receptor activity(GO:0099601) |
| 0.0 | 0.3 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.0 | 0.1 | GO:0051549 | positive regulation of keratinocyte migration(GO:0051549) |
| 0.0 | 0.1 | GO:0072709 | cellular response to sorbitol(GO:0072709) |
| 0.0 | 1.0 | GO:1901687 | glutathione derivative metabolic process(GO:1901685) glutathione derivative biosynthetic process(GO:1901687) |
| 0.0 | 0.3 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.0 | 0.2 | GO:0015811 | L-cystine transport(GO:0015811) |
| 0.0 | 0.6 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.0 | 0.0 | GO:0045588 | positive regulation of gamma-delta T cell differentiation(GO:0045588) |
| 0.0 | 0.3 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.0 | 0.2 | GO:0010624 | regulation of Schwann cell proliferation(GO:0010624) negative regulation of Schwann cell proliferation(GO:0010626) |
| 0.0 | 0.7 | GO:0099517 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
| 0.0 | 0.3 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
| 0.0 | 3.0 | GO:0060333 | interferon-gamma-mediated signaling pathway(GO:0060333) |
| 0.0 | 0.2 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.0 | 0.7 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
| 0.0 | 0.9 | GO:0070306 | lens fiber cell differentiation(GO:0070306) |
| 0.0 | 0.2 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
| 0.0 | 0.2 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.0 | 0.1 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
| 0.0 | 0.3 | GO:0032703 | negative regulation of interleukin-2 production(GO:0032703) |
| 0.0 | 0.2 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
| 0.0 | 0.2 | GO:0031017 | exocrine pancreas development(GO:0031017) |
| 0.0 | 0.2 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
| 0.0 | 0.2 | GO:0045836 | positive regulation of meiotic nuclear division(GO:0045836) |
| 0.0 | 0.2 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.0 | 0.2 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
| 0.0 | 0.3 | GO:0038166 | angiotensin-activated signaling pathway(GO:0038166) |
| 0.0 | 0.1 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.0 | 0.2 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.0 | 1.1 | GO:0046039 | GTP metabolic process(GO:0046039) |
| 0.0 | 1.0 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.0 | 0.5 | GO:1900115 | extracellular regulation of signal transduction(GO:1900115) extracellular negative regulation of signal transduction(GO:1900116) |
| 0.0 | 0.6 | GO:0035640 | exploration behavior(GO:0035640) |
| 0.0 | 0.3 | GO:0006030 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.0 | 0.1 | GO:2000234 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.0 | 0.2 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.0 | 0.3 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
| 0.0 | 0.5 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.0 | 0.1 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.0 | 0.1 | GO:0000189 | MAPK import into nucleus(GO:0000189) |
| 0.0 | 0.2 | GO:0006477 | protein sulfation(GO:0006477) |
| 0.0 | 0.1 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.0 | 1.2 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.0 | 0.3 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.0 | 0.3 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 0.0 | 0.8 | GO:0046580 | negative regulation of Ras protein signal transduction(GO:0046580) negative regulation of small GTPase mediated signal transduction(GO:0051058) |
| 0.0 | 0.2 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.0 | 0.0 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.0 | 0.1 | GO:0042418 | epinephrine metabolic process(GO:0042414) epinephrine biosynthetic process(GO:0042418) |
| 0.0 | 0.1 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.0 | 0.4 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
| 0.0 | 0.1 | GO:0043449 | cellular alkene metabolic process(GO:0043449) |
| 0.0 | 0.2 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.0 | 0.4 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
| 0.0 | 0.1 | GO:0014859 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.0 | 0.2 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) regulation of heart rate by chemical signal(GO:0003062) positive regulation of heart rate by epinephrine(GO:0003065) |
| 0.0 | 0.1 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
| 0.0 | 0.6 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
| 0.0 | 0.7 | GO:0045736 | negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
| 0.0 | 0.1 | GO:2000587 | negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.0 | 0.5 | GO:0070262 | peptidyl-serine dephosphorylation(GO:0070262) |
| 0.0 | 0.3 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.0 | 0.3 | GO:0010460 | positive regulation of heart rate(GO:0010460) |
| 0.0 | 0.1 | GO:0019060 | intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 0.0 | 1.9 | GO:0042147 | retrograde transport, endosome to Golgi(GO:0042147) |
| 0.0 | 0.5 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
| 0.0 | 0.4 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.0 | 0.2 | GO:0098704 | fructose transport(GO:0015755) fructose import(GO:0032445) carbohydrate import into cell(GO:0097319) carbohydrate import across plasma membrane(GO:0098704) fructose import across plasma membrane(GO:1990539) |
| 0.0 | 0.2 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
| 0.0 | 0.4 | GO:0048741 | skeletal muscle fiber development(GO:0048741) |
| 0.0 | 0.3 | GO:0043485 | endosome to melanosome transport(GO:0035646) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
| 0.0 | 0.8 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.0 | 0.0 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
| 0.0 | 0.1 | GO:0006489 | dolichyl diphosphate biosynthetic process(GO:0006489) dolichyl diphosphate metabolic process(GO:0046465) |
| 0.0 | 0.1 | GO:0010814 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.0 | 0.1 | GO:0006566 | threonine metabolic process(GO:0006566) |
| 0.0 | 0.3 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.0 | 0.2 | GO:0072592 | oxygen metabolic process(GO:0072592) |
| 0.0 | 0.1 | GO:0002501 | MHC protein complex assembly(GO:0002396) peptide antigen assembly with MHC protein complex(GO:0002501) |
| 0.0 | 0.6 | GO:0002639 | positive regulation of immunoglobulin production(GO:0002639) |
| 0.0 | 0.4 | GO:1903012 | positive regulation of bone development(GO:1903012) |
| 0.0 | 0.7 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.0 | 0.3 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
| 0.0 | 0.3 | GO:0045745 | positive regulation of G-protein coupled receptor protein signaling pathway(GO:0045745) |
| 0.0 | 0.6 | GO:0050832 | defense response to fungus(GO:0050832) |
| 0.0 | 0.3 | GO:0006702 | androgen biosynthetic process(GO:0006702) |
| 0.0 | 0.1 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.0 | 0.5 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
| 0.0 | 0.1 | GO:0044791 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
| 0.0 | 0.0 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.0 | 1.1 | GO:0061418 | regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061418) |
| 0.0 | 0.2 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.0 | 0.2 | GO:0001711 | endodermal cell fate commitment(GO:0001711) |
| 0.0 | 0.4 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
| 0.0 | 0.4 | GO:0035455 | response to interferon-alpha(GO:0035455) |
| 0.0 | 0.4 | GO:0070193 | synaptonemal complex assembly(GO:0007130) synaptonemal complex organization(GO:0070193) |
| 0.0 | 0.1 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
| 0.0 | 0.3 | GO:0021772 | olfactory bulb development(GO:0021772) olfactory lobe development(GO:0021988) |
| 0.0 | 0.2 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
| 0.0 | 0.1 | GO:0002084 | protein depalmitoylation(GO:0002084) |
| 0.0 | 0.3 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.0 | 0.4 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.0 | 0.8 | GO:0043550 | regulation of lipid kinase activity(GO:0043550) |
| 0.0 | 0.1 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.0 | 0.3 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 0.0 | 0.1 | GO:0003352 | regulation of cilium movement(GO:0003352) |
| 0.0 | 0.1 | GO:0046968 | peptide antigen transport(GO:0046968) |
| 0.0 | 0.3 | GO:0030502 | negative regulation of bone mineralization(GO:0030502) |
| 0.0 | 0.1 | GO:0051712 | positive regulation of killing of cells of other organism(GO:0051712) |
| 0.0 | 0.3 | GO:0036148 | phosphatidylglycerol acyl-chain remodeling(GO:0036148) |
| 0.0 | 0.1 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.0 | 0.1 | GO:0006207 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.0 | 0.1 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.0 | 0.1 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.0 | 0.8 | GO:0030593 | neutrophil chemotaxis(GO:0030593) |
| 0.0 | 0.2 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
| 0.0 | 0.2 | GO:0015889 | cobalamin transport(GO:0015889) |
| 0.0 | 0.1 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
| 0.0 | 0.3 | GO:0070498 | interleukin-1-mediated signaling pathway(GO:0070498) |
| 0.0 | 0.1 | GO:0000052 | citrulline metabolic process(GO:0000052) |
| 0.0 | 0.1 | GO:0006600 | creatine metabolic process(GO:0006600) |
| 0.0 | 0.1 | GO:0046645 | gamma-delta T cell activation involved in immune response(GO:0002290) negative regulation of interferon-beta secretion(GO:0035548) positive regulation of gamma-delta T cell activation(GO:0046645) negative regulation of dendritic cell apoptotic process(GO:2000669) negative regulation of T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:2001189) regulation of gamma-delta T cell activation involved in immune response(GO:2001191) positive regulation of gamma-delta T cell activation involved in immune response(GO:2001193) |
| 0.0 | 0.3 | GO:0006700 | C21-steroid hormone biosynthetic process(GO:0006700) |
| 0.0 | 0.3 | GO:0002755 | MyD88-dependent toll-like receptor signaling pathway(GO:0002755) |
| 0.0 | 0.1 | GO:0033033 | negative regulation of myeloid cell apoptotic process(GO:0033033) |
| 0.0 | 0.4 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.0 | 0.4 | GO:0016486 | peptide hormone processing(GO:0016486) |
| 0.0 | 0.1 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.0 | 0.1 | GO:0030890 | positive regulation of B cell proliferation(GO:0030890) |
| 0.0 | 0.1 | GO:0001865 | NK T cell differentiation(GO:0001865) |
| 0.0 | 1.2 | GO:0006501 | C-terminal protein lipidation(GO:0006501) |
| 0.0 | 0.1 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.0 | 0.1 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
| 0.0 | 0.2 | GO:0060149 | negative regulation of posttranscriptional gene silencing(GO:0060149) negative regulation of gene silencing by miRNA(GO:0060965) negative regulation of gene silencing by RNA(GO:0060967) |
| 0.0 | 0.3 | GO:0030947 | regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030947) |
| 0.0 | 0.6 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
| 0.0 | 0.6 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.0 | 0.1 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.0 | 0.1 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
| 0.0 | 0.5 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.0 | 0.2 | GO:0019532 | oxalate transport(GO:0019532) |
| 0.0 | 0.2 | GO:0007618 | mating(GO:0007618) |
| 0.0 | 0.1 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.0 | 0.1 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
| 0.0 | 0.1 | GO:1904321 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.0 | 0.2 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
| 0.0 | 0.1 | GO:0090116 | C-5 methylation of cytosine(GO:0090116) |
| 0.0 | 2.2 | GO:0035023 | regulation of Rho protein signal transduction(GO:0035023) |
| 0.0 | 0.1 | GO:0061055 | myotome development(GO:0061055) |
| 0.0 | 0.1 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.0 | 0.3 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.0 | 0.1 | GO:0071025 | RNA surveillance(GO:0071025) nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
| 0.0 | 0.1 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
| 0.0 | 0.3 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
| 0.0 | 0.1 | GO:0051798 | positive regulation of hair cycle(GO:0042635) positive regulation of hair follicle development(GO:0051798) |
| 0.0 | 0.1 | GO:0045329 | carnitine biosynthetic process(GO:0045329) |
| 0.0 | 0.1 | GO:0034447 | very-low-density lipoprotein particle clearance(GO:0034447) |
| 0.0 | 0.1 | GO:0014741 | negative regulation of cardiac muscle hypertrophy(GO:0010614) negative regulation of muscle hypertrophy(GO:0014741) |
| 0.0 | 0.1 | GO:0003322 | pancreatic A cell development(GO:0003322) |
| 0.0 | 0.1 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.0 | 0.1 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.0 | 0.2 | GO:0009223 | pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
| 0.0 | 0.3 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.0 | 0.1 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 0.0 | 0.4 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.0 | 0.1 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
| 0.0 | 0.2 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.7 | 6.1 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.7 | 4.0 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 0.5 | 2.0 | GO:1990742 | microvesicle(GO:1990742) |
| 0.4 | 3.0 | GO:0071144 | SMAD2-SMAD3 protein complex(GO:0071144) |
| 0.4 | 8.8 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.3 | 2.4 | GO:0042825 | TAP complex(GO:0042825) |
| 0.3 | 1.0 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
| 0.3 | 1.2 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.3 | 0.9 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.3 | 1.1 | GO:0032044 | DSIF complex(GO:0032044) |
| 0.3 | 1.0 | GO:0045160 | myosin I complex(GO:0045160) |
| 0.2 | 2.4 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.2 | 1.4 | GO:0035692 | macrophage migration inhibitory factor receptor complex(GO:0035692) |
| 0.2 | 0.6 | GO:0030689 | Noc complex(GO:0030689) |
| 0.2 | 1.4 | GO:0043196 | varicosity(GO:0043196) |
| 0.2 | 2.1 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.1 | 1.0 | GO:0097209 | epidermal lamellar body(GO:0097209) |
| 0.1 | 0.4 | GO:0044753 | amphisome(GO:0044753) |
| 0.1 | 5.2 | GO:0000145 | exocyst(GO:0000145) |
| 0.1 | 1.8 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.1 | 0.3 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
| 0.1 | 0.5 | GO:0044301 | climbing fiber(GO:0044301) |
| 0.1 | 3.5 | GO:0071565 | nBAF complex(GO:0071565) |
| 0.1 | 1.4 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.1 | 0.9 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.1 | 2.7 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.1 | 0.5 | GO:1990031 | pinceau fiber(GO:1990031) |
| 0.1 | 3.6 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
| 0.1 | 0.6 | GO:0010370 | perinucleolar chromocenter(GO:0010370) |
| 0.1 | 2.4 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.1 | 0.6 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.1 | 2.3 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
| 0.1 | 0.8 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.1 | 0.4 | GO:0016013 | syntrophin complex(GO:0016013) |
| 0.1 | 1.0 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 0.1 | 0.5 | GO:1990425 | ryanodine receptor complex(GO:1990425) |
| 0.1 | 0.4 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.1 | 0.4 | GO:0030934 | anchoring collagen complex(GO:0030934) |
| 0.1 | 0.6 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.1 | 0.4 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
| 0.1 | 0.7 | GO:0035976 | AP1 complex(GO:0035976) |
| 0.1 | 0.7 | GO:0034688 | integrin alphaM-beta2 complex(GO:0034688) |
| 0.1 | 0.2 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.1 | 0.5 | GO:0001740 | Barr body(GO:0001740) |
| 0.1 | 0.5 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.1 | 2.2 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.1 | 0.4 | GO:0031515 | tRNA (m1A) methyltransferase complex(GO:0031515) |
| 0.1 | 0.5 | GO:1903439 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
| 0.1 | 0.9 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.1 | 1.2 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.1 | 0.2 | GO:0070195 | growth hormone receptor complex(GO:0070195) |
| 0.1 | 1.2 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.1 | 0.7 | GO:0033010 | paranodal junction(GO:0033010) |
| 0.1 | 0.1 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
| 0.1 | 0.9 | GO:0044292 | dendrite terminus(GO:0044292) |
| 0.1 | 0.2 | GO:0098855 | HCN channel complex(GO:0098855) |
| 0.1 | 0.4 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.1 | 2.3 | GO:0030673 | axolemma(GO:0030673) |
| 0.1 | 0.3 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.1 | 0.8 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.1 | 1.4 | GO:0031095 | platelet dense tubular network membrane(GO:0031095) |
| 0.1 | 0.3 | GO:1990745 | EARP complex(GO:1990745) |
| 0.1 | 0.4 | GO:0089701 | U2AF(GO:0089701) |
| 0.1 | 0.5 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.1 | 0.2 | GO:0016938 | kinesin I complex(GO:0016938) |
| 0.1 | 0.7 | GO:0043219 | lateral loop(GO:0043219) |
| 0.1 | 0.5 | GO:0005587 | collagen type IV trimer(GO:0005587) |
| 0.1 | 0.8 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.1 | 1.5 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.1 | 0.3 | GO:0032280 | symmetric synapse(GO:0032280) |
| 0.1 | 0.3 | GO:0042643 | actomyosin, actin portion(GO:0042643) |
| 0.1 | 0.2 | GO:0071821 | FANCM-MHF complex(GO:0071821) |
| 0.1 | 0.2 | GO:0000229 | cytoplasmic chromosome(GO:0000229) |
| 0.1 | 0.2 | GO:0043159 | acrosomal matrix(GO:0043159) |
| 0.1 | 1.1 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.1 | 1.2 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.1 | 0.5 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.1 | 1.1 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.1 | 0.2 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.1 | 0.2 | GO:0060187 | cell pole(GO:0060187) |
| 0.0 | 0.1 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.0 | 0.2 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.0 | 0.4 | GO:0030893 | meiotic cohesin complex(GO:0030893) |
| 0.0 | 4.2 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
| 0.0 | 0.5 | GO:0033018 | sarcoplasmic reticulum lumen(GO:0033018) |
| 0.0 | 0.2 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.0 | 0.2 | GO:0017102 | methionyl glutamyl tRNA synthetase complex(GO:0017102) |
| 0.0 | 0.3 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.0 | 0.6 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.0 | 0.1 | GO:1990298 | mitotic checkpoint complex(GO:0033597) bub1-bub3 complex(GO:1990298) |
| 0.0 | 0.1 | GO:0032010 | phagolysosome(GO:0032010) |
| 0.0 | 1.1 | GO:0046930 | pore complex(GO:0046930) |
| 0.0 | 0.3 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
| 0.0 | 0.1 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.0 | 0.4 | GO:0016589 | NURF complex(GO:0016589) |
| 0.0 | 0.2 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.0 | 0.4 | GO:0098845 | postsynaptic endosome(GO:0098845) |
| 0.0 | 0.6 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
| 0.0 | 4.6 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
| 0.0 | 0.2 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.0 | 0.3 | GO:0072487 | MSL complex(GO:0072487) |
| 0.0 | 0.7 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 0.0 | 0.7 | GO:0031089 | platelet dense granule lumen(GO:0031089) |
| 0.0 | 0.3 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.0 | 0.1 | GO:0097441 | basilar dendrite(GO:0097441) |
| 0.0 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
| 0.0 | 0.4 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.0 | 0.2 | GO:1990584 | cardiac Troponin complex(GO:1990584) |
| 0.0 | 1.4 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.2 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 0.1 | GO:0001534 | radial spoke(GO:0001534) |
| 0.0 | 0.4 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.0 | 0.4 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.0 | 0.2 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
| 0.0 | 0.2 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.0 | 0.2 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.0 | 0.7 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
| 0.0 | 0.2 | GO:0036021 | endolysosome lumen(GO:0036021) |
| 0.0 | 0.5 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.0 | 1.0 | GO:1902711 | GABA-A receptor complex(GO:1902711) |
| 0.0 | 0.8 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.0 | 0.2 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.0 | 2.1 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.0 | 0.2 | GO:0090661 | box H/ACA scaRNP complex(GO:0072589) box H/ACA telomerase RNP complex(GO:0090661) |
| 0.0 | 0.3 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.0 | 0.5 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.0 | 1.7 | GO:0002102 | podosome(GO:0002102) |
| 0.0 | 0.5 | GO:0005861 | troponin complex(GO:0005861) |
| 0.0 | 0.3 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.0 | 1.1 | GO:0000791 | euchromatin(GO:0000791) |
| 0.0 | 0.3 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
| 0.0 | 0.3 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.0 | 5.5 | GO:0031225 | anchored component of membrane(GO:0031225) |
| 0.0 | 0.5 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.0 | 0.2 | GO:0032009 | early phagosome(GO:0032009) |
| 0.0 | 0.1 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.0 | 2.5 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.0 | 0.7 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.0 | 1.0 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.0 | 0.6 | GO:0044453 | nuclear membrane part(GO:0044453) |
| 0.0 | 0.1 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.0 | 0.1 | GO:0034669 | integrin alpha4-beta7 complex(GO:0034669) |
| 0.0 | 0.4 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.0 | 0.8 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
| 0.0 | 1.3 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.0 | 0.2 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.0 | 0.3 | GO:0042555 | MCM complex(GO:0042555) |
| 0.0 | 0.1 | GO:0070435 | Shc-EGFR complex(GO:0070435) |
| 0.0 | 0.3 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.0 | 0.1 | GO:0033565 | ESCRT-0 complex(GO:0033565) |
| 0.0 | 0.2 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.0 | 0.1 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
| 0.0 | 0.5 | GO:0097346 | INO80-type complex(GO:0097346) |
| 0.0 | 0.1 | GO:1990769 | proximal neuron projection(GO:1990769) |
| 0.0 | 0.1 | GO:0071546 | pi-body(GO:0071546) |
| 0.0 | 0.1 | GO:0031302 | intrinsic component of endosome membrane(GO:0031302) |
| 0.0 | 0.2 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.0 | 1.0 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.0 | 0.6 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
| 0.0 | 0.2 | GO:0034464 | BBSome(GO:0034464) |
| 0.0 | 0.1 | GO:0033165 | interphotoreceptor matrix(GO:0033165) |
| 0.0 | 0.3 | GO:0042627 | chylomicron(GO:0042627) |
| 0.0 | 0.4 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.0 | 0.2 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.0 | 0.4 | GO:0097381 | photoreceptor disc membrane(GO:0097381) |
| 0.0 | 3.5 | GO:0019897 | extrinsic component of plasma membrane(GO:0019897) |
| 0.0 | 0.3 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.0 | 0.1 | GO:0000799 | nuclear condensin complex(GO:0000799) |
| 0.0 | 0.2 | GO:0097486 | multivesicular body lumen(GO:0097486) |
| 0.0 | 0.1 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.0 | 0.9 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 0.1 | GO:0031417 | NatC complex(GO:0031417) |
| 0.0 | 2.6 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
| 0.0 | 0.2 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
| 0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.0 | 0.2 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
| 0.0 | 0.5 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.0 | 0.1 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.0 | 0.3 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.0 | 0.1 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.0 | 0.3 | GO:0043034 | costamere(GO:0043034) |
| 0.0 | 0.3 | GO:0005684 | U2-type spliceosomal complex(GO:0005684) |
| 0.0 | 0.8 | GO:1990391 | DNA repair complex(GO:1990391) |
| 0.0 | 0.4 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.0 | 0.2 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.0 | 0.1 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.0 | 0.8 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.0 | 0.0 | GO:0031523 | Myb complex(GO:0031523) |
| 0.0 | 0.2 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.0 | 0.2 | GO:0033268 | node of Ranvier(GO:0033268) |
| 0.0 | 0.1 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.0 | 1.2 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.0 | 0.3 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
| 0.0 | 0.2 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.0 | 0.2 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.0 | 0.1 | GO:0061617 | MICOS complex(GO:0061617) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.9 | 2.7 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.7 | 4.1 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
| 0.6 | 3.0 | GO:0031962 | mineralocorticoid receptor binding(GO:0031962) |
| 0.5 | 1.5 | GO:0047726 | iron-cytochrome-c reductase activity(GO:0047726) |
| 0.5 | 4.0 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.4 | 1.3 | GO:0031896 | V2 vasopressin receptor binding(GO:0031896) |
| 0.4 | 1.2 | GO:0004947 | bradykinin receptor activity(GO:0004947) |
| 0.4 | 1.6 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.4 | 1.9 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
| 0.4 | 2.1 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
| 0.3 | 2.4 | GO:0046979 | TAP2 binding(GO:0046979) |
| 0.3 | 1.0 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.3 | 6.0 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.3 | 1.5 | GO:0001641 | group II metabotropic glutamate receptor activity(GO:0001641) |
| 0.3 | 4.7 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.3 | 1.2 | GO:0004909 | interleukin-1, Type I, activating receptor activity(GO:0004909) |
| 0.3 | 2.6 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.3 | 1.7 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.3 | 0.8 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
| 0.3 | 1.9 | GO:0050294 | flavonol 3-sulfotransferase activity(GO:0047894) steroid sulfotransferase activity(GO:0050294) |
| 0.3 | 0.8 | GO:0004914 | interleukin-5 receptor activity(GO:0004914) |
| 0.3 | 1.8 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.3 | 0.8 | GO:0031751 | D4 dopamine receptor binding(GO:0031751) |
| 0.2 | 1.0 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.2 | 0.7 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.2 | 0.9 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.2 | 1.3 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
| 0.2 | 1.1 | GO:0002046 | opsin binding(GO:0002046) |
| 0.2 | 10.5 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.2 | 6.0 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.2 | 0.9 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
| 0.2 | 3.3 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.2 | 1.1 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
| 0.2 | 0.5 | GO:0016603 | glutaminyl-peptide cyclotransferase activity(GO:0016603) |
| 0.2 | 0.5 | GO:0016730 | ferredoxin-NADP+ reductase activity(GO:0004324) NADPH-adrenodoxin reductase activity(GO:0015039) oxidoreductase activity, acting on iron-sulfur proteins as donors(GO:0016730) oxidoreductase activity, acting on iron-sulfur proteins as donors, NAD or NADP as acceptor(GO:0016731) |
| 0.2 | 1.0 | GO:0042806 | fucose binding(GO:0042806) |
| 0.2 | 0.5 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.2 | 1.6 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
| 0.2 | 0.6 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.2 | 0.3 | GO:0030226 | apolipoprotein receptor activity(GO:0030226) |
| 0.2 | 0.5 | GO:0003883 | CTP synthase activity(GO:0003883) |
| 0.2 | 1.2 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.2 | 4.4 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.1 | 0.6 | GO:0050211 | procollagen galactosyltransferase activity(GO:0050211) |
| 0.1 | 0.4 | GO:0031403 | pyridoxal kinase activity(GO:0008478) lithium ion binding(GO:0031403) |
| 0.1 | 0.7 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.1 | 0.4 | GO:0004613 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 0.1 | 1.3 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.1 | 0.4 | GO:0004117 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) |
| 0.1 | 0.8 | GO:0044736 | acid-sensing ion channel activity(GO:0044736) |
| 0.1 | 1.1 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.1 | 0.8 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.1 | 0.3 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
| 0.1 | 0.5 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 0.1 | 0.8 | GO:0060698 | endoribonuclease inhibitor activity(GO:0060698) |
| 0.1 | 0.5 | GO:0099609 | microtubule lateral binding(GO:0099609) |
| 0.1 | 0.5 | GO:0052836 | inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
| 0.1 | 3.2 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.1 | 0.5 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
| 0.1 | 0.3 | GO:0033823 | procollagen-lysine 5-dioxygenase activity(GO:0008475) procollagen glucosyltransferase activity(GO:0033823) |
| 0.1 | 1.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.1 | 0.5 | GO:0032408 | MutLbeta complex binding(GO:0032406) MutSbeta complex binding(GO:0032408) |
| 0.1 | 0.7 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.1 | 0.5 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
| 0.1 | 0.5 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 0.1 | 0.3 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
| 0.1 | 0.5 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.1 | 0.8 | GO:0015501 | glutamate:sodium symporter activity(GO:0015501) |
| 0.1 | 0.3 | GO:0070984 | SET domain binding(GO:0070984) |
| 0.1 | 0.4 | GO:0004102 | choline O-acetyltransferase activity(GO:0004102) |
| 0.1 | 1.3 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.1 | 0.5 | GO:0004815 | aspartate-tRNA ligase activity(GO:0004815) |
| 0.1 | 0.1 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.1 | 0.4 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.1 | 0.7 | GO:0015186 | L-glutamine transmembrane transporter activity(GO:0015186) |
| 0.1 | 0.4 | GO:0051916 | granulocyte colony-stimulating factor binding(GO:0051916) |
| 0.1 | 0.6 | GO:0005119 | smoothened binding(GO:0005119) |
| 0.1 | 0.3 | GO:0070052 | collagen V binding(GO:0070052) |
| 0.1 | 0.3 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.1 | 1.7 | GO:0019864 | IgG binding(GO:0019864) |
| 0.1 | 0.3 | GO:0052895 | norspermine:oxygen oxidoreductase activity(GO:0052894) N1-acetylspermine:oxygen oxidoreductase (N1-acetylspermidine-forming) activity(GO:0052895) |
| 0.1 | 0.3 | GO:0017130 | poly(C) RNA binding(GO:0017130) |
| 0.1 | 0.4 | GO:0016426 | tRNA (adenine) methyltransferase activity(GO:0016426) tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
| 0.1 | 0.4 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.1 | 0.5 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.1 | 0.4 | GO:0016748 | succinyltransferase activity(GO:0016748) |
| 0.1 | 0.8 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.1 | 0.3 | GO:0080122 | coenzyme A transmembrane transporter activity(GO:0015228) adenosine 3',5'-bisphosphate transmembrane transporter activity(GO:0071077) AMP transmembrane transporter activity(GO:0080122) |
| 0.1 | 0.4 | GO:0005046 | KDEL sequence binding(GO:0005046) |
| 0.1 | 1.1 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.1 | 0.3 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.1 | 0.8 | GO:0043426 | MRF binding(GO:0043426) |
| 0.1 | 0.6 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
| 0.1 | 1.4 | GO:0030284 | estrogen receptor activity(GO:0030284) |
| 0.1 | 0.3 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.1 | 1.2 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.1 | 0.8 | GO:0048495 | laminin-1 binding(GO:0043237) Roundabout binding(GO:0048495) |
| 0.1 | 0.5 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.1 | 0.3 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 0.1 | 0.6 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.1 | 1.4 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.1 | 0.4 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.1 | 2.4 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
| 0.1 | 0.3 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.1 | 0.9 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.1 | 0.7 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.1 | 0.3 | GO:0003990 | acetylcholinesterase activity(GO:0003990) |
| 0.1 | 1.2 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
| 0.1 | 0.7 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.1 | 0.5 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.1 | 0.4 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.1 | 0.9 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.1 | 0.9 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.1 | 2.8 | GO:0001848 | complement binding(GO:0001848) |
| 0.1 | 0.7 | GO:0019237 | centromeric DNA binding(GO:0019237) |
| 0.1 | 0.2 | GO:0005148 | prolactin receptor binding(GO:0005148) |
| 0.1 | 0.3 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
| 0.1 | 0.7 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.1 | 0.3 | GO:0050309 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.1 | 1.4 | GO:0015101 | organic cation transmembrane transporter activity(GO:0015101) |
| 0.1 | 1.0 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.1 | 0.3 | GO:0022897 | peptide:proton symporter activity(GO:0015333) proton-dependent peptide secondary active transmembrane transporter activity(GO:0022897) |
| 0.1 | 0.3 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.1 | 0.6 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.1 | 0.2 | GO:0004796 | thromboxane-A synthase activity(GO:0004796) 12-hydroxyheptadecatrienoic acid synthase activity(GO:0036134) |
| 0.1 | 0.2 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.1 | 0.8 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.1 | 0.2 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.1 | 2.5 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.1 | 1.2 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.1 | 0.3 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.1 | 0.9 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.1 | 0.6 | GO:0060002 | plus-end directed microfilament motor activity(GO:0060002) |
| 0.1 | 0.9 | GO:0005436 | sodium:phosphate symporter activity(GO:0005436) |
| 0.1 | 0.4 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.1 | 0.1 | GO:0070905 | serine binding(GO:0070905) |
| 0.1 | 0.3 | GO:0009383 | rRNA (cytosine-C5-)-methyltransferase activity(GO:0009383) |
| 0.1 | 0.6 | GO:0015288 | porin activity(GO:0015288) |
| 0.1 | 0.3 | GO:0004991 | parathyroid hormone receptor activity(GO:0004991) |
| 0.1 | 0.2 | GO:0016639 | oxidoreductase activity, acting on the CH-NH2 group of donors, NAD or NADP as acceptor(GO:0016639) |
| 0.1 | 0.2 | GO:0001002 | polymerase III regulatory region sequence-specific DNA binding(GO:0000992) RNA polymerase III type 1 promoter sequence-specific DNA binding(GO:0001002) RNA polymerase III type 2 promoter sequence-specific DNA binding(GO:0001003) RNA polymerase III transcription factor activity, sequence-specific DNA binding(GO:0001034) |
| 0.1 | 1.7 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.1 | 0.5 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.1 | 0.8 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.1 | 0.3 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 0.1 | 3.7 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
| 0.1 | 0.5 | GO:0031628 | opioid receptor binding(GO:0031628) |
| 0.1 | 1.2 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.1 | 0.5 | GO:0086083 | cell adhesive protein binding involved in bundle of His cell-Purkinje myocyte communication(GO:0086083) |
| 0.1 | 0.2 | GO:0008480 | sarcosine dehydrogenase activity(GO:0008480) |
| 0.1 | 0.9 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.1 | 0.3 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
| 0.1 | 0.3 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) |
| 0.1 | 0.2 | GO:0050571 | 1,5-anhydro-D-fructose reductase activity(GO:0050571) |
| 0.1 | 0.4 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.1 | 0.2 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
| 0.1 | 1.6 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.1 | 0.4 | GO:0004630 | phospholipase D activity(GO:0004630) |
| 0.1 | 0.8 | GO:0008061 | chitin binding(GO:0008061) |
| 0.1 | 0.3 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
| 0.1 | 3.4 | GO:0005044 | scavenger receptor activity(GO:0005044) |
| 0.1 | 3.5 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
| 0.0 | 1.5 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.0 | 0.2 | GO:0051734 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) polynucleotide phosphatase activity(GO:0098518) |
| 0.0 | 0.3 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.0 | 0.1 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.0 | 0.1 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.0 | 0.6 | GO:0051434 | BH3 domain binding(GO:0051434) |
| 0.0 | 0.3 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 0.0 | 0.3 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.0 | 0.6 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.0 | 1.2 | GO:0019104 | DNA N-glycosylase activity(GO:0019104) |
| 0.0 | 0.1 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
| 0.0 | 0.1 | GO:0047223 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase activity(GO:0047223) |
| 0.0 | 10.8 | GO:0004386 | helicase activity(GO:0004386) |
| 0.0 | 1.3 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.0 | 1.4 | GO:0004622 | lysophospholipase activity(GO:0004622) |
| 0.0 | 0.1 | GO:0098988 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) G-protein coupled glutamate receptor activity(GO:0098988) |
| 0.0 | 0.5 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
| 0.0 | 0.1 | GO:0098808 | mRNA cap binding(GO:0098808) |
| 0.0 | 0.2 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
| 0.0 | 0.2 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.0 | 0.1 | GO:0004818 | glutamate-tRNA ligase activity(GO:0004818) |
| 0.0 | 0.6 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.0 | 0.3 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.0 | 0.7 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.0 | 0.2 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.0 | 0.6 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.0 | 0.3 | GO:0035800 | deubiquitinase activator activity(GO:0035800) |
| 0.0 | 0.2 | GO:0015184 | L-cystine transmembrane transporter activity(GO:0015184) |
| 0.0 | 0.6 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
| 0.0 | 0.2 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.0 | 0.2 | GO:0004905 | type I interferon receptor activity(GO:0004905) |
| 0.0 | 0.2 | GO:0005350 | pyrimidine nucleobase transmembrane transporter activity(GO:0005350) pyrimidine- and adenine-specific:sodium symporter activity(GO:0015389) |
| 0.0 | 0.3 | GO:0001595 | angiotensin receptor activity(GO:0001595) angiotensin type II receptor activity(GO:0004945) |
| 0.0 | 0.2 | GO:0047718 | indanol dehydrogenase activity(GO:0047718) |
| 0.0 | 0.2 | GO:0004992 | platelet activating factor receptor activity(GO:0004992) |
| 0.0 | 0.4 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.0 | 0.2 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.0 | 0.9 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.0 | 0.5 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.0 | 0.3 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
| 0.0 | 0.4 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.0 | 0.4 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.0 | 0.1 | GO:0034353 | RNA pyrophosphohydrolase activity(GO:0034353) |
| 0.0 | 3.9 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.0 | 0.5 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.0 | 0.2 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
| 0.0 | 0.1 | GO:0033265 | choline binding(GO:0033265) |
| 0.0 | 0.4 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.0 | 5.3 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.2 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.0 | 2.7 | GO:0019208 | phosphatase regulator activity(GO:0019208) |
| 0.0 | 0.1 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.0 | 0.4 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.0 | 0.1 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.0 | 0.9 | GO:0070403 | NAD+ binding(GO:0070403) |
| 0.0 | 0.4 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.0 | 0.2 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.0 | 0.3 | GO:0009374 | biotin binding(GO:0009374) |
| 0.0 | 0.9 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
| 0.0 | 0.1 | GO:0004603 | phenylethanolamine N-methyltransferase activity(GO:0004603) |
| 0.0 | 0.2 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.0 | 0.2 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.0 | 0.0 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.0 | 0.5 | GO:0031005 | filamin binding(GO:0031005) |
| 0.0 | 0.2 | GO:0004372 | glycine hydroxymethyltransferase activity(GO:0004372) threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.0 | 1.0 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.0 | 0.2 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
| 0.0 | 4.9 | GO:0001047 | core promoter binding(GO:0001047) |
| 0.0 | 0.2 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.0 | 0.3 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.0 | 0.1 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.0 | 1.1 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.0 | 0.2 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
| 0.0 | 0.2 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.0 | 12.0 | GO:0003924 | GTPase activity(GO:0003924) |
| 0.0 | 0.1 | GO:0008426 | protein kinase C inhibitor activity(GO:0008426) |
| 0.0 | 0.2 | GO:0004471 | malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
| 0.0 | 4.0 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.0 | 0.1 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 0.0 | 0.5 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
| 0.0 | 0.6 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.0 | 0.2 | GO:0016672 | oxidoreductase activity, acting on a sulfur group of donors, quinone or similar compound as acceptor(GO:0016672) glutathione dehydrogenase (ascorbate) activity(GO:0045174) methylarsonate reductase activity(GO:0050610) |
| 0.0 | 0.3 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
| 0.0 | 0.1 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.0 | 0.8 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 0.0 | 0.1 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.0 | 1.3 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.0 | 0.3 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
| 0.0 | 0.2 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.0 | 1.0 | GO:0004890 | GABA-A receptor activity(GO:0004890) GABA receptor activity(GO:0016917) |
| 0.0 | 0.2 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.0 | 0.1 | GO:1902444 | riboflavin binding(GO:1902444) |
| 0.0 | 0.3 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.0 | 0.4 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
| 0.0 | 0.1 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
| 0.0 | 0.1 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
| 0.0 | 0.2 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.0 | 0.3 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.0 | 0.1 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.0 | 0.2 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
| 0.0 | 0.5 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.0 | 0.6 | GO:0043495 | protein anchor(GO:0043495) |
| 0.0 | 0.1 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
| 0.0 | 0.1 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.0 | 1.5 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.0 | 0.2 | GO:0005353 | fructose transmembrane transporter activity(GO:0005353) |
| 0.0 | 1.1 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.0 | 0.1 | GO:0043199 | sulfate binding(GO:0043199) |
| 0.0 | 0.1 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.0 | 1.0 | GO:0005080 | protein kinase C binding(GO:0005080) |
| 0.0 | 0.2 | GO:0030247 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.0 | 0.9 | GO:0030507 | spectrin binding(GO:0030507) |
| 0.0 | 1.3 | GO:0098811 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
| 0.0 | 0.1 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.0 | 1.2 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.0 | 0.3 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.0 | 0.3 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.0 | 0.3 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.0 | 0.1 | GO:0008336 | gamma-butyrobetaine dioxygenase activity(GO:0008336) |
| 0.0 | 0.1 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 0.0 | 0.6 | GO:0071949 | FAD binding(GO:0071949) |
| 0.0 | 0.1 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.0 | 0.4 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.0 | 0.1 | GO:0005497 | androgen binding(GO:0005497) |
| 0.0 | 0.3 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 0.0 | 0.3 | GO:0005123 | death receptor binding(GO:0005123) |
| 0.0 | 0.2 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
| 0.0 | 0.6 | GO:0030515 | snoRNA binding(GO:0030515) |
| 0.0 | 0.2 | GO:0038187 | signaling pattern recognition receptor activity(GO:0008329) pattern recognition receptor activity(GO:0038187) |
| 0.0 | 0.3 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.0 | 2.3 | GO:0004896 | cytokine receptor activity(GO:0004896) |
| 0.0 | 0.2 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.0 | 0.3 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.0 | 1.3 | GO:0051117 | ATPase binding(GO:0051117) |
| 0.0 | 0.2 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.0 | 0.1 | GO:1904929 | coreceptor activity involved in Wnt signaling pathway, planar cell polarity pathway(GO:1904929) |
| 0.0 | 0.3 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.0 | 0.4 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
| 0.0 | 0.1 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.0 | 0.1 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 0.0 | 0.4 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.0 | 0.1 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.0 | 0.3 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.0 | 0.2 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.0 | 0.1 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
| 0.0 | 0.1 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.0 | 0.3 | GO:0046961 | hydrogen-exporting ATPase activity(GO:0036442) proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.0 | 0.2 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.0 | 0.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.0 | 0.3 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
| 0.0 | 0.1 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.0 | 0.7 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.0 | 0.2 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.0 | 0.1 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.0 | 0.1 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.0 | 0.2 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
| 0.0 | 0.7 | GO:0015485 | cholesterol binding(GO:0015485) |
| 0.0 | 0.2 | GO:0019841 | retinol binding(GO:0019841) |
| 0.0 | 0.4 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
| 0.0 | 0.1 | GO:0052794 | exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
| 0.0 | 0.1 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.0 | 0.1 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.0 | 0.0 | GO:0033149 | FFAT motif binding(GO:0033149) |
| 0.0 | 0.0 | GO:0043398 | HLH domain binding(GO:0043398) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
| 0.0 | 0.2 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.0 | 2.0 | GO:0000149 | SNARE binding(GO:0000149) |
| 0.0 | 0.5 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.0 | 0.2 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.0 | 0.2 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.0 | 0.2 | GO:0043394 | proteoglycan binding(GO:0043394) |
| 0.0 | 0.2 | GO:0005522 | profilin binding(GO:0005522) |
| 0.0 | 0.0 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.0 | 0.1 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.2 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.0 | 1.8 | GO:0017137 | Rab GTPase binding(GO:0017137) |
| 0.0 | 0.1 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.0 | 0.1 | GO:0070576 | vitamin D 24-hydroxylase activity(GO:0070576) |
| 0.0 | 0.1 | GO:0032395 | MHC class II receptor activity(GO:0032395) |
| 0.0 | 0.8 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
| 0.0 | 0.2 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.0 | 0.1 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 4.2 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.2 | 6.9 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.2 | 0.8 | ST ADRENERGIC | Adrenergic Pathway |
| 0.1 | 3.3 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.1 | 0.1 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.1 | 4.4 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.1 | 2.4 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.1 | 0.8 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.1 | 0.3 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.1 | 0.3 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.1 | 3.1 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.1 | 2.0 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.1 | 4.0 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.1 | 0.8 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.1 | 0.9 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.1 | 0.4 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.1 | 1.8 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.1 | 0.8 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.1 | 1.7 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.1 | 1.4 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.1 | 1.5 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.1 | 1.3 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.1 | 3.3 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.1 | 0.7 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.1 | 2.2 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.1 | 0.6 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.0 | 1.5 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 1.3 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.0 | 2.2 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.0 | 1.8 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.0 | 2.2 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.0 | 1.2 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.0 | 0.4 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 6.1 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
| 0.0 | 2.7 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.0 | 3.5 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.0 | 2.4 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.0 | 1.2 | PID MYC PATHWAY | C-MYC pathway |
| 0.0 | 0.7 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.0 | 0.1 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.0 | 1.1 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.0 | 1.5 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.0 | 1.8 | PID FOXO PATHWAY | FoxO family signaling |
| 0.0 | 0.9 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 1.5 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.0 | 0.9 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.0 | 0.4 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.0 | 1.9 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 0.6 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 1.3 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.0 | 0.7 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.0 | 0.9 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.0 | 0.6 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.0 | 0.5 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.0 | 0.3 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 8.7 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
| 0.0 | 0.6 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| 0.0 | 1.2 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.0 | 0.2 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.0 | 0.5 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 1.2 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
| 0.0 | 1.0 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
| 0.0 | 0.9 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.0 | 2.2 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
| 0.0 | 0.5 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.0 | 0.6 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
| 0.0 | 0.6 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
| 0.0 | 0.1 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.0 | 0.9 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.0 | 0.7 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.0 | 0.4 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.0 | 0.5 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.0 | 0.2 | ST GA13 PATHWAY | G alpha 13 Pathway |
| 0.0 | 0.2 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.0 | 0.2 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.0 | 0.4 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
| 0.0 | 0.2 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
| 0.0 | 0.6 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.0 | 0.6 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.0 | 0.5 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
| 0.0 | 0.2 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.0 | 0.0 | PID IL3 PATHWAY | IL3-mediated signaling events |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 5.1 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.1 | 2.8 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.1 | 0.1 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 0.1 | 4.0 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.1 | 2.6 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.1 | 2.0 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 0.1 | 4.2 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.1 | 8.7 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
| 0.1 | 0.8 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.1 | 2.3 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.1 | 2.0 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.1 | 2.2 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.1 | 1.2 | REACTOME REVERSIBLE HYDRATION OF CARBON DIOXIDE | Genes involved in Reversible Hydration of Carbon Dioxide |
| 0.1 | 4.7 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.1 | 2.9 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.1 | 0.1 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.1 | 0.8 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.1 | 3.9 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.1 | 3.0 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.1 | 0.8 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
| 0.1 | 1.2 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.1 | 1.0 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
| 0.1 | 1.3 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.1 | 0.3 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.1 | 1.9 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.1 | 0.2 | REACTOME ACTIVATION OF NMDA RECEPTOR UPON GLUTAMATE BINDING AND POSTSYNAPTIC EVENTS | Genes involved in Activation of NMDA receptor upon glutamate binding and postsynaptic events |
| 0.1 | 1.7 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.1 | 5.3 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.1 | 1.2 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.1 | 1.3 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.1 | 1.8 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
| 0.1 | 1.4 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
| 0.0 | 1.3 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
| 0.0 | 1.0 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.0 | 1.7 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.0 | 1.0 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.0 | 0.3 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.0 | 0.9 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.0 | 2.1 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.0 | 2.5 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.0 | 1.1 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
| 0.0 | 3.2 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.0 | 1.4 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.0 | 0.2 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
| 0.0 | 1.2 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.0 | 1.3 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
| 0.0 | 2.5 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.0 | 0.3 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.0 | 0.5 | REACTOME PRE NOTCH EXPRESSION AND PROCESSING | Genes involved in Pre-NOTCH Expression and Processing |
| 0.0 | 0.7 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.0 | 0.9 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.0 | 1.1 | REACTOME DOWNSTREAM SIGNAL TRANSDUCTION | Genes involved in Downstream signal transduction |
| 0.0 | 0.5 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.0 | 1.2 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.0 | 0.4 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.0 | 0.5 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.0 | 0.1 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.0 | 0.7 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.0 | 0.8 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.0 | 1.5 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.0 | 0.1 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.0 | 0.4 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.0 | 0.3 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.0 | 0.5 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.0 | 1.0 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.0 | 1.0 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.0 | 0.5 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.0 | 0.2 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.0 | 0.8 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.0 | 0.3 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.0 | 1.0 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.0 | 0.6 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
| 0.0 | 0.2 | REACTOME TRANSCRIPTIONAL ACTIVITY OF SMAD2 SMAD3 SMAD4 HETEROTRIMER | Genes involved in Transcriptional activity of SMAD2/SMAD3:SMAD4 heterotrimer |
| 0.0 | 1.9 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.0 | 0.2 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
| 0.0 | 0.3 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.0 | 0.2 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.0 | 0.6 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.0 | 1.0 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.8 | REACTOME ION CHANNEL TRANSPORT | Genes involved in Ion channel transport |
| 0.0 | 0.4 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.0 | 0.6 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
| 0.0 | 0.7 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 0.0 | 0.4 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.0 | 2.8 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
| 0.0 | 0.5 | REACTOME ASSEMBLY OF THE PRE REPLICATIVE COMPLEX | Genes involved in Assembly of the pre-replicative complex |
| 0.0 | 0.6 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.0 | 0.7 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.0 | 1.3 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 0.3 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.0 | 0.6 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.0 | 0.2 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.0 | 0.1 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 0.0 | 0.3 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.0 | 0.1 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.0 | 0.6 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.0 | 0.0 | REACTOME IL 3 5 AND GM CSF SIGNALING | Genes involved in Interleukin-3, 5 and GM-CSF signaling |
| 0.0 | 0.2 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.0 | 0.5 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.0 | 0.2 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.0 | 0.2 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.0 | 0.2 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.0 | 0.8 | REACTOME TRANS GOLGI NETWORK VESICLE BUDDING | Genes involved in trans-Golgi Network Vesicle Budding |
| 0.0 | 0.1 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.0 | 0.4 | REACTOME GAB1 SIGNALOSOME | Genes involved in GAB1 signalosome |
| 0.0 | 0.3 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.0 | 0.2 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.0 | 0.8 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 0.6 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.0 | 0.1 | REACTOME DEFENSINS | Genes involved in Defensins |
| 0.0 | 0.3 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |