Project
Inflammatory response time course, HUVEC (Wada et al., 2009)
Navigation
Downloads
Results for KLF16_SP2
Z-value: 1.75
Motif logo
Transcription factors associated with KLF16_SP2
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
KLF16
|
ENSG00000129911.4 | Kruppel like factor 16 |
|
SP2
|
ENSG00000167182.11 | Sp2 transcription factor |
Activity-expression correlation:
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| SP2 | hg19_v2_chr17_+_45973516_45973618 | -0.28 | 1.7e-01 | Click! |
| KLF16 | hg19_v2_chr19_-_1863567_1863586 | -0.08 | 7.0e-01 | Click! |
Activity profile of KLF16_SP2 motif
Sorted Z-values of KLF16_SP2 motif
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr8_+_22457100 | 8.32 |
ENST00000409586.3
|
C8orf58
|
chromosome 8 open reading frame 58 |
| chr8_+_22457127 | 8.19 |
ENST00000289989.5
|
C8orf58
|
chromosome 8 open reading frame 58 |
| chr2_+_11295624 | 6.53 |
ENST00000402361.1
ENST00000428481.1 |
PQLC3
|
PQ loop repeat containing 3 |
| chr17_-_79008373 | 6.40 |
ENST00000577066.1
ENST00000573167.1 |
BAIAP2-AS1
|
BAIAP2 antisense RNA 1 (head to head) |
| chr17_-_48943706 | 6.29 |
ENST00000499247.2
|
TOB1
|
transducer of ERBB2, 1 |
| chr22_+_51112800 | 5.49 |
ENST00000414786.2
|
SHANK3
|
SH3 and multiple ankyrin repeat domains 3 |
| chr10_-_15210666 | 4.74 |
ENST00000378165.4
|
NMT2
|
N-myristoyltransferase 2 |
| chr2_+_112812778 | 4.69 |
ENST00000283206.4
|
TMEM87B
|
transmembrane protein 87B |
| chr19_-_11308190 | 4.61 |
ENST00000586659.1
ENST00000592903.1 ENST00000589359.1 ENST00000588724.1 ENST00000432929.2 |
KANK2
|
KN motif and ankyrin repeat domains 2 |
| chr3_-_132441209 | 4.59 |
ENST00000383282.2
ENST00000326682.8 ENST00000343113.4 ENST00000337331.5 |
NPHP3
|
nephronophthisis 3 (adolescent) |
| chr11_+_7534999 | 4.37 |
ENST00000528947.1
ENST00000299492.4 |
PPFIBP2
|
PTPRF interacting protein, binding protein 2 (liprin beta 2) |
| chr8_-_57123815 | 4.30 |
ENST00000316981.3
ENST00000423799.2 ENST00000429357.2 |
PLAG1
|
pleiomorphic adenoma gene 1 |
| chr19_+_46000479 | 4.27 |
ENST00000456399.2
|
PPM1N
|
protein phosphatase, Mg2+/Mn2+ dependent, 1N (putative) |
| chr12_-_42983478 | 4.26 |
ENST00000345127.3
ENST00000547113.1 |
PRICKLE1
|
prickle homolog 1 (Drosophila) |
| chr2_+_112656048 | 4.24 |
ENST00000295408.4
|
MERTK
|
c-mer proto-oncogene tyrosine kinase |
| chr2_+_112656176 | 4.13 |
ENST00000421804.2
ENST00000409780.1 |
MERTK
|
c-mer proto-oncogene tyrosine kinase |
| chr19_+_46000506 | 4.06 |
ENST00000396737.2
|
PPM1N
|
protein phosphatase, Mg2+/Mn2+ dependent, 1N (putative) |
| chr2_+_8822113 | 3.96 |
ENST00000396290.1
ENST00000331129.3 |
ID2
|
inhibitor of DNA binding 2, dominant negative helix-loop-helix protein |
| chr16_+_89894875 | 3.80 |
ENST00000393062.2
|
SPIRE2
|
spire-type actin nucleation factor 2 |
| chr20_+_30193083 | 3.78 |
ENST00000376112.3
ENST00000376105.3 |
ID1
|
inhibitor of DNA binding 1, dominant negative helix-loop-helix protein |
| chr17_-_72869086 | 3.74 |
ENST00000581530.1
ENST00000420580.2 ENST00000455107.2 ENST00000413947.2 ENST00000581219.1 ENST00000582944.1 |
FDXR
|
ferredoxin reductase |
| chr2_-_7005785 | 3.70 |
ENST00000256722.5
ENST00000404168.1 ENST00000458098.1 |
CMPK2
|
cytidine monophosphate (UMP-CMP) kinase 2, mitochondrial |
| chr7_-_27213893 | 3.69 |
ENST00000283921.4
|
HOXA10
|
homeobox A10 |
| chr20_+_58508817 | 3.66 |
ENST00000358293.3
|
FAM217B
|
family with sequence similarity 217, member B |
| chr1_+_26438289 | 3.64 |
ENST00000374271.4
ENST00000374269.1 |
PDIK1L
|
PDLIM1 interacting kinase 1 like |
| chr13_-_52027134 | 3.57 |
ENST00000311234.4
ENST00000425000.1 ENST00000463928.1 ENST00000442263.3 ENST00000398119.2 |
INTS6
|
integrator complex subunit 6 |
| chr3_+_37903432 | 3.50 |
ENST00000443503.2
|
CTDSPL
|
CTD (carboxy-terminal domain, RNA polymerase II, polypeptide A) small phosphatase-like |
| chr9_+_91150016 | 3.49 |
ENST00000375854.3
ENST00000375855.3 |
NXNL2
|
nucleoredoxin-like 2 |
| chr17_-_72869140 | 3.47 |
ENST00000583917.1
ENST00000293195.5 ENST00000442102.2 |
FDXR
|
ferredoxin reductase |
| chr6_+_35420091 | 3.31 |
ENST00000229769.2
|
FANCE
|
Fanconi anemia, complementation group E |
| chr19_-_17356697 | 3.18 |
ENST00000291442.3
|
NR2F6
|
nuclear receptor subfamily 2, group F, member 6 |
| chr19_-_7936344 | 3.12 |
ENST00000599142.1
|
CTD-3193O13.9
|
Protein FLJ22184 |
| chr4_-_819901 | 3.05 |
ENST00000304062.6
|
CPLX1
|
complexin 1 |
| chr5_-_171881362 | 3.00 |
ENST00000519643.1
|
SH3PXD2B
|
SH3 and PX domains 2B |
| chr10_-_15210615 | 3.00 |
ENST00000378150.1
|
NMT2
|
N-myristoyltransferase 2 |
| chr19_+_1249869 | 2.98 |
ENST00000591446.2
|
MIDN
|
midnolin |
| chr10_+_94608218 | 2.97 |
ENST00000371543.1
|
EXOC6
|
exocyst complex component 6 |
| chrX_+_153237740 | 2.93 |
ENST00000369982.4
|
TMEM187
|
transmembrane protein 187 |
| chr1_-_9189229 | 2.92 |
ENST00000377411.4
|
GPR157
|
G protein-coupled receptor 157 |
| chr10_-_75634219 | 2.92 |
ENST00000305762.7
|
CAMK2G
|
calcium/calmodulin-dependent protein kinase II gamma |
| chr10_-_75634260 | 2.92 |
ENST00000372765.1
ENST00000351293.3 |
CAMK2G
|
calcium/calmodulin-dependent protein kinase II gamma |
| chr9_-_124976154 | 2.91 |
ENST00000482062.1
|
LHX6
|
LIM homeobox 6 |
| chr2_+_238600788 | 2.91 |
ENST00000289175.6
ENST00000244815.5 |
LRRFIP1
|
leucine rich repeat (in FLII) interacting protein 1 |
| chr10_-_75634326 | 2.82 |
ENST00000322635.3
ENST00000444854.2 ENST00000423381.1 ENST00000322680.3 ENST00000394762.2 |
CAMK2G
|
calcium/calmodulin-dependent protein kinase II gamma |
| chr4_-_819880 | 2.75 |
ENST00000505203.1
|
CPLX1
|
complexin 1 |
| chr20_-_61493115 | 2.73 |
ENST00000335351.3
ENST00000217162.5 |
TCFL5
|
transcription factor-like 5 (basic helix-loop-helix) |
| chr12_+_122064673 | 2.71 |
ENST00000537188.1
|
ORAI1
|
ORAI calcium release-activated calcium modulator 1 |
| chr9_-_124976185 | 2.70 |
ENST00000464484.2
|
LHX6
|
LIM homeobox 6 |
| chr16_-_89268070 | 2.67 |
ENST00000562855.2
|
SLC22A31
|
solute carrier family 22, member 31 |
| chr8_+_1711918 | 2.65 |
ENST00000331222.4
|
CLN8
|
ceroid-lipofuscinosis, neuronal 8 (epilepsy, progressive with mental retardation) |
| chr19_+_30302805 | 2.64 |
ENST00000262643.3
ENST00000575243.1 ENST00000357943.5 |
CCNE1
|
cyclin E1 |
| chr1_+_6845578 | 2.63 |
ENST00000467404.2
ENST00000439411.2 |
CAMTA1
|
calmodulin binding transcription activator 1 |
| chr5_-_89770582 | 2.62 |
ENST00000316610.6
|
MBLAC2
|
metallo-beta-lactamase domain containing 2 |
| chrX_-_62571187 | 2.61 |
ENST00000335144.3
|
SPIN4
|
spindlin family, member 4 |
| chr2_+_48757278 | 2.58 |
ENST00000404752.1
ENST00000406226.1 |
STON1
|
stonin 1 |
| chr3_+_20081515 | 2.58 |
ENST00000263754.4
|
KAT2B
|
K(lysine) acetyltransferase 2B |
| chr2_-_215674374 | 2.57 |
ENST00000449967.2
ENST00000421162.1 ENST00000260947.4 |
BARD1
|
BRCA1 associated RING domain 1 |
| chr1_-_41131106 | 2.55 |
ENST00000372683.1
|
RIMS3
|
regulating synaptic membrane exocytosis 3 |
| chr8_-_124286735 | 2.53 |
ENST00000395571.3
|
ZHX1
|
zinc fingers and homeoboxes 1 |
| chr11_-_105948129 | 2.50 |
ENST00000526793.1
|
KBTBD3
|
kelch repeat and BTB (POZ) domain containing 3 |
| chr2_+_238600933 | 2.44 |
ENST00000420665.1
ENST00000392000.4 |
LRRFIP1
|
leucine rich repeat (in FLII) interacting protein 1 |
| chr8_-_103251274 | 2.43 |
ENST00000251810.3
|
RRM2B
|
ribonucleotide reductase M2 B (TP53 inducible) |
| chr3_-_160117301 | 2.43 |
ENST00000326448.7
ENST00000498409.1 ENST00000475677.1 ENST00000478536.1 |
IFT80
|
intraflagellar transport 80 homolog (Chlamydomonas) |
| chr22_-_50746027 | 2.43 |
ENST00000425954.1
ENST00000449103.1 |
PLXNB2
|
plexin B2 |
| chr9_+_139377947 | 2.43 |
ENST00000354376.1
|
C9orf163
|
chromosome 9 open reading frame 163 |
| chr12_-_42877726 | 2.42 |
ENST00000548696.1
|
PRICKLE1
|
prickle homolog 1 (Drosophila) |
| chr3_+_49711777 | 2.41 |
ENST00000442186.1
ENST00000438011.1 ENST00000457042.1 |
APEH
|
acylaminoacyl-peptide hydrolase |
| chr11_-_19263145 | 2.41 |
ENST00000532666.1
ENST00000527884.1 |
E2F8
|
E2F transcription factor 8 |
| chr22_+_31523734 | 2.39 |
ENST00000402238.1
ENST00000404453.1 ENST00000401755.1 |
INPP5J
|
inositol polyphosphate-5-phosphatase J |
| chr16_+_50186811 | 2.39 |
ENST00000436909.3
|
PAPD5
|
PAP associated domain containing 5 |
| chr22_-_37915247 | 2.37 |
ENST00000251973.5
|
CARD10
|
caspase recruitment domain family, member 10 |
| chr22_-_43583079 | 2.37 |
ENST00000216129.6
|
TTLL12
|
tubulin tyrosine ligase-like family, member 12 |
| chr8_-_127570603 | 2.36 |
ENST00000304916.3
|
FAM84B
|
family with sequence similarity 84, member B |
| chr2_-_128785688 | 2.35 |
ENST00000259234.6
|
SAP130
|
Sin3A-associated protein, 130kDa |
| chr10_+_23728198 | 2.35 |
ENST00000376495.3
|
OTUD1
|
OTU domain containing 1 |
| chr9_+_138371618 | 2.35 |
ENST00000356818.2
|
PPP1R26
|
protein phosphatase 1, regulatory subunit 26 |
| chr9_+_71320557 | 2.33 |
ENST00000541509.1
|
PIP5K1B
|
phosphatidylinositol-4-phosphate 5-kinase, type I, beta |
| chr2_+_235860616 | 2.30 |
ENST00000392011.2
|
SH3BP4
|
SH3-domain binding protein 4 |
| chr2_+_148778570 | 2.29 |
ENST00000407073.1
|
MBD5
|
methyl-CpG binding domain protein 5 |
| chr19_+_18747775 | 2.29 |
ENST00000300976.4
ENST00000595182.1 ENST00000599006.1 |
KLHL26
|
kelch-like family member 26 |
| chrX_-_62571220 | 2.28 |
ENST00000374884.2
|
SPIN4
|
spindlin family, member 4 |
| chr14_+_24867992 | 2.26 |
ENST00000382554.3
|
NYNRIN
|
NYN domain and retroviral integrase containing |
| chr8_-_145691031 | 2.26 |
ENST00000424149.2
ENST00000530637.1 ENST00000306145.5 |
CYHR1
|
cysteine/histidine-rich 1 |
| chr2_+_241375069 | 2.26 |
ENST00000264039.2
|
GPC1
|
glypican 1 |
| chrX_+_15756382 | 2.26 |
ENST00000318636.3
|
CA5B
|
carbonic anhydrase VB, mitochondrial |
| chr8_-_30891078 | 2.24 |
ENST00000339382.2
ENST00000475541.1 |
PURG
|
purine-rich element binding protein G |
| chr22_-_50746001 | 2.23 |
ENST00000359337.4
|
PLXNB2
|
plexin B2 |
| chr1_-_15850839 | 2.21 |
ENST00000348549.5
ENST00000546424.1 |
CASP9
|
caspase 9, apoptosis-related cysteine peptidase |
| chr8_+_26149007 | 2.20 |
ENST00000380737.3
ENST00000524169.1 |
PPP2R2A
|
protein phosphatase 2, regulatory subunit B, alpha |
| chr19_-_13213662 | 2.20 |
ENST00000264824.4
|
LYL1
|
lymphoblastic leukemia derived sequence 1 |
| chr9_-_35115836 | 2.19 |
ENST00000378566.1
ENST00000378554.2 ENST00000322813.5 |
FAM214B
|
family with sequence similarity 214, member B |
| chrX_-_152939133 | 2.19 |
ENST00000370150.1
|
PNCK
|
pregnancy up-regulated nonubiquitous CaM kinase |
| chr8_-_124286495 | 2.16 |
ENST00000297857.2
|
ZHX1
|
zinc fingers and homeoboxes 1 |
| chr11_-_68518910 | 2.15 |
ENST00000544963.1
ENST00000443940.2 |
MTL5
|
metallothionein-like 5, testis-specific (tesmin) |
| chr1_+_151512775 | 2.15 |
ENST00000368849.3
ENST00000392712.3 ENST00000353024.3 ENST00000368848.2 ENST00000538902.1 |
TUFT1
|
tuftelin 1 |
| chr4_+_25915822 | 2.13 |
ENST00000506197.2
|
SMIM20
|
small integral membrane protein 20 |
| chr9_+_128509624 | 2.13 |
ENST00000342287.5
ENST00000373487.4 |
PBX3
|
pre-B-cell leukemia homeobox 3 |
| chr20_-_39317868 | 2.12 |
ENST00000373313.2
|
MAFB
|
v-maf avian musculoaponeurotic fibrosarcoma oncogene homolog B |
| chr3_-_18466026 | 2.11 |
ENST00000417717.2
|
SATB1
|
SATB homeobox 1 |
| chr11_-_105948040 | 2.11 |
ENST00000534815.1
|
KBTBD3
|
kelch repeat and BTB (POZ) domain containing 3 |
| chr1_+_15250596 | 2.11 |
ENST00000361144.5
|
KAZN
|
kazrin, periplakin interacting protein |
| chr11_-_19262486 | 2.09 |
ENST00000250024.4
|
E2F8
|
E2F transcription factor 8 |
| chr19_+_2476116 | 2.08 |
ENST00000215631.4
ENST00000587345.1 |
GADD45B
|
growth arrest and DNA-damage-inducible, beta |
| chr3_+_170075436 | 2.07 |
ENST00000476188.1
ENST00000259119.4 ENST00000426052.2 |
SKIL
|
SKI-like oncogene |
| chr1_+_6845497 | 2.06 |
ENST00000473578.1
ENST00000557126.1 |
CAMTA1
|
calmodulin binding transcription activator 1 |
| chr5_+_52285144 | 2.05 |
ENST00000296585.5
|
ITGA2
|
integrin, alpha 2 (CD49B, alpha 2 subunit of VLA-2 receptor) |
| chr4_+_25915896 | 2.05 |
ENST00000514384.1
|
SMIM20
|
small integral membrane protein 20 |
| chr2_-_174828892 | 2.05 |
ENST00000418194.2
|
SP3
|
Sp3 transcription factor |
| chr3_-_47619623 | 2.04 |
ENST00000456150.1
|
CSPG5
|
chondroitin sulfate proteoglycan 5 (neuroglycan C) |
| chr19_-_55574538 | 2.04 |
ENST00000415061.3
|
RDH13
|
retinol dehydrogenase 13 (all-trans/9-cis) |
| chr16_+_68119440 | 2.03 |
ENST00000346183.3
ENST00000329524.4 |
NFATC3
|
nuclear factor of activated T-cells, cytoplasmic, calcineurin-dependent 3 |
| chr14_-_21566731 | 2.03 |
ENST00000360947.3
|
ZNF219
|
zinc finger protein 219 |
| chr2_-_86116093 | 2.03 |
ENST00000377332.3
|
ST3GAL5
|
ST3 beta-galactoside alpha-2,3-sialyltransferase 5 |
| chr19_+_41869894 | 2.03 |
ENST00000413014.2
|
TMEM91
|
transmembrane protein 91 |
| chr8_-_144651024 | 2.03 |
ENST00000524906.1
ENST00000532862.1 ENST00000534459.1 |
MROH6
|
maestro heat-like repeat family member 6 |
| chr3_-_129612394 | 2.02 |
ENST00000505616.1
ENST00000426664.2 |
TMCC1
|
transmembrane and coiled-coil domain family 1 |
| chr19_-_56135928 | 2.02 |
ENST00000591479.1
ENST00000325351.4 |
ZNF784
|
zinc finger protein 784 |
| chr19_-_45908292 | 2.01 |
ENST00000360957.5
ENST00000592134.1 |
PPP1R13L
|
protein phosphatase 1, regulatory subunit 13 like |
| chr10_-_131762105 | 2.00 |
ENST00000368648.3
ENST00000355311.5 |
EBF3
|
early B-cell factor 3 |
| chr12_+_113344755 | 2.00 |
ENST00000550883.1
|
OAS1
|
2'-5'-oligoadenylate synthetase 1, 40/46kDa |
| chr19_-_52598958 | 2.00 |
ENST00000594440.1
ENST00000426391.2 ENST00000389534.4 |
ZNF841
|
zinc finger protein 841 |
| chr2_+_241564655 | 2.00 |
ENST00000407714.1
|
GPR35
|
G protein-coupled receptor 35 |
| chr13_-_28194541 | 2.00 |
ENST00000316334.3
|
LNX2
|
ligand of numb-protein X 2 |
| chr2_-_240322643 | 1.99 |
ENST00000345617.3
|
HDAC4
|
histone deacetylase 4 |
| chr12_-_6982442 | 1.99 |
ENST00000523102.1
ENST00000524270.1 ENST00000519357.1 |
SPSB2
|
splA/ryanodine receptor domain and SOCS box containing 2 |
| chr19_-_38878632 | 1.99 |
ENST00000586599.1
ENST00000334928.6 ENST00000587676.1 |
GGN
|
gametogenetin |
| chr16_+_50187556 | 1.99 |
ENST00000561678.1
ENST00000357464.3 |
PAPD5
|
PAP associated domain containing 5 |
| chr7_+_2559399 | 1.99 |
ENST00000222725.5
ENST00000359574.3 |
LFNG
|
LFNG O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase |
| chr12_+_14518598 | 1.99 |
ENST00000261168.4
ENST00000538511.1 ENST00000545723.1 ENST00000543189.1 ENST00000536444.1 |
ATF7IP
|
activating transcription factor 7 interacting protein |
| chr19_-_40931891 | 1.97 |
ENST00000357949.4
|
SERTAD1
|
SERTA domain containing 1 |
| chr21_-_44496441 | 1.96 |
ENST00000359624.3
ENST00000352178.5 |
CBS
|
cystathionine-beta-synthase |
| chr6_-_99395787 | 1.95 |
ENST00000369244.2
ENST00000229971.1 |
FBXL4
|
F-box and leucine-rich repeat protein 4 |
| chr9_+_128509663 | 1.95 |
ENST00000373489.5
ENST00000373483.2 |
PBX3
|
pre-B-cell leukemia homeobox 3 |
| chr12_+_111843749 | 1.95 |
ENST00000341259.2
|
SH2B3
|
SH2B adaptor protein 3 |
| chr17_-_79196799 | 1.94 |
ENST00000269392.4
|
AZI1
|
5-azacytidine induced 1 |
| chr12_+_51632666 | 1.93 |
ENST00000604900.1
|
DAZAP2
|
DAZ associated protein 2 |
| chr3_-_139396560 | 1.93 |
ENST00000514703.1
ENST00000511444.1 |
NMNAT3
|
nicotinamide nucleotide adenylyltransferase 3 |
| chr19_+_17581253 | 1.92 |
ENST00000252595.7
ENST00000598424.1 |
SLC27A1
|
solute carrier family 27 (fatty acid transporter), member 1 |
| chr9_+_139873264 | 1.92 |
ENST00000446677.1
|
PTGDS
|
prostaglandin D2 synthase 21kDa (brain) |
| chr6_-_111804905 | 1.90 |
ENST00000358835.3
ENST00000435970.1 |
REV3L
|
REV3-like, polymerase (DNA directed), zeta, catalytic subunit |
| chr4_+_1340986 | 1.90 |
ENST00000511216.1
ENST00000389851.4 |
UVSSA
|
UV-stimulated scaffold protein A |
| chr1_+_36789335 | 1.90 |
ENST00000373137.2
|
RP11-268J15.5
|
RP11-268J15.5 |
| chr1_+_65775204 | 1.89 |
ENST00000371069.4
|
DNAJC6
|
DnaJ (Hsp40) homolog, subfamily C, member 6 |
| chr22_-_37915535 | 1.88 |
ENST00000403299.1
|
CARD10
|
caspase recruitment domain family, member 10 |
| chr20_-_31071239 | 1.88 |
ENST00000359676.5
|
C20orf112
|
chromosome 20 open reading frame 112 |
| chr18_+_60190226 | 1.88 |
ENST00000269499.5
|
ZCCHC2
|
zinc finger, CCHC domain containing 2 |
| chr9_+_131452239 | 1.87 |
ENST00000372688.4
ENST00000372686.5 |
SET
|
SET nuclear oncogene |
| chr9_-_35111570 | 1.86 |
ENST00000378561.1
ENST00000603301.1 |
FAM214B
|
family with sequence similarity 214, member B |
| chr12_+_27396901 | 1.85 |
ENST00000541191.1
ENST00000389032.3 |
STK38L
|
serine/threonine kinase 38 like |
| chr12_-_57824739 | 1.85 |
ENST00000347140.3
ENST00000402412.1 |
R3HDM2
|
R3H domain containing 2 |
| chr8_-_145690724 | 1.85 |
ENST00000526887.1
ENST00000533764.1 ENST00000403000.2 |
CYHR1
|
cysteine/histidine-rich 1 |
| chr7_-_149470540 | 1.84 |
ENST00000302017.3
|
ZNF467
|
zinc finger protein 467 |
| chr12_-_42877764 | 1.84 |
ENST00000455697.1
|
PRICKLE1
|
prickle homolog 1 (Drosophila) |
| chr1_-_143913143 | 1.83 |
ENST00000400889.1
|
FAM72D
|
family with sequence similarity 72, member D |
| chr14_-_95786200 | 1.83 |
ENST00000298912.4
|
CLMN
|
calmin (calponin-like, transmembrane) |
| chr1_-_241803649 | 1.82 |
ENST00000366554.2
|
OPN3
|
opsin 3 |
| chr7_-_24797032 | 1.82 |
ENST00000409970.1
ENST00000409775.3 |
DFNA5
|
deafness, autosomal dominant 5 |
| chr9_+_138371503 | 1.81 |
ENST00000604351.1
|
PPP1R26
|
protein phosphatase 1, regulatory subunit 26 |
| chr17_+_81037473 | 1.81 |
ENST00000320095.7
|
METRNL
|
meteorin, glial cell differentiation regulator-like |
| chr10_+_74033672 | 1.81 |
ENST00000307365.3
|
DDIT4
|
DNA-damage-inducible transcript 4 |
| chr9_-_35111420 | 1.80 |
ENST00000378557.1
|
FAM214B
|
family with sequence similarity 214, member B |
| chr17_+_79008940 | 1.80 |
ENST00000392411.3
ENST00000575989.1 ENST00000321280.7 ENST00000428708.2 ENST00000575712.1 ENST00000575245.1 ENST00000435091.3 ENST00000321300.6 |
BAIAP2
|
BAI1-associated protein 2 |
| chr19_-_51143075 | 1.79 |
ENST00000600079.1
ENST00000593901.1 |
SYT3
|
synaptotagmin III |
| chr19_-_40971643 | 1.78 |
ENST00000595483.1
|
BLVRB
|
biliverdin reductase B (flavin reductase (NADPH)) |
| chr7_+_102715573 | 1.78 |
ENST00000434153.1
|
ARMC10
|
armadillo repeat containing 10 |
| chr3_+_143690640 | 1.78 |
ENST00000315691.3
|
C3orf58
|
chromosome 3 open reading frame 58 |
| chr7_+_8008418 | 1.77 |
ENST00000223145.5
|
GLCCI1
|
glucocorticoid induced transcript 1 |
| chr19_-_47137942 | 1.77 |
ENST00000300873.4
|
GNG8
|
guanine nucleotide binding protein (G protein), gamma 8 |
| chr19_+_4472230 | 1.76 |
ENST00000301284.4
ENST00000586684.1 |
HDGFRP2
|
Hepatoma-derived growth factor-related protein 2 |
| chr1_-_45672221 | 1.76 |
ENST00000359600.5
|
ZSWIM5
|
zinc finger, SWIM-type containing 5 |
| chr1_-_200992827 | 1.76 |
ENST00000332129.2
ENST00000422435.2 |
KIF21B
|
kinesin family member 21B |
| chr15_-_57210769 | 1.76 |
ENST00000559000.1
|
ZNF280D
|
zinc finger protein 280D |
| chr13_-_52980263 | 1.76 |
ENST00000258613.4
ENST00000544466.1 |
THSD1
|
thrombospondin, type I, domain containing 1 |
| chr19_-_35454953 | 1.76 |
ENST00000404801.1
|
ZNF792
|
zinc finger protein 792 |
| chr1_-_15850676 | 1.76 |
ENST00000440484.1
ENST00000333868.5 |
CASP9
|
caspase 9, apoptosis-related cysteine peptidase |
| chr20_+_34742650 | 1.75 |
ENST00000373945.1
ENST00000338074.2 |
EPB41L1
|
erythrocyte membrane protein band 4.1-like 1 |
| chr15_+_80445113 | 1.75 |
ENST00000407106.1
ENST00000261755.5 |
FAH
|
fumarylacetoacetate hydrolase (fumarylacetoacetase) |
| chr1_-_11714700 | 1.74 |
ENST00000354287.4
|
FBXO2
|
F-box protein 2 |
| chr10_-_81205373 | 1.73 |
ENST00000372336.3
|
ZCCHC24
|
zinc finger, CCHC domain containing 24 |
| chr13_-_111567353 | 1.73 |
ENST00000310847.4
ENST00000267339.2 ENST00000375758.5 |
ANKRD10
|
ankyrin repeat domain 10 |
| chr20_+_48599506 | 1.73 |
ENST00000244050.2
|
SNAI1
|
snail family zinc finger 1 |
| chr4_-_68411275 | 1.73 |
ENST00000273853.6
|
CENPC
|
centromere protein C |
| chr14_+_100150622 | 1.73 |
ENST00000261835.3
|
CYP46A1
|
cytochrome P450, family 46, subfamily A, polypeptide 1 |
| chr6_+_1610681 | 1.72 |
ENST00000380874.2
|
FOXC1
|
forkhead box C1 |
| chr19_+_35521616 | 1.71 |
ENST00000595652.1
|
SCN1B
|
sodium channel, voltage-gated, type I, beta subunit |
| chr18_-_12377283 | 1.70 |
ENST00000269143.3
|
AFG3L2
|
AFG3-like AAA ATPase 2 |
| chr8_-_22550815 | 1.69 |
ENST00000317216.2
|
EGR3
|
early growth response 3 |
| chr14_-_105635090 | 1.69 |
ENST00000331782.3
ENST00000347004.2 |
JAG2
|
jagged 2 |
| chr11_+_44587141 | 1.69 |
ENST00000227155.4
ENST00000342935.3 ENST00000532544.1 |
CD82
|
CD82 molecule |
| chr19_+_2900896 | 1.68 |
ENST00000306908.5
|
ZNF57
|
zinc finger protein 57 |
| chr6_-_84419101 | 1.68 |
ENST00000520302.1
ENST00000520213.1 ENST00000439399.2 ENST00000428679.2 ENST00000437520.1 |
SNAP91
|
synaptosomal-associated protein, 91kDa |
| chr14_+_93651358 | 1.67 |
ENST00000415050.2
|
TMEM251
|
transmembrane protein 251 |
| chr16_+_68119324 | 1.67 |
ENST00000349223.5
|
NFATC3
|
nuclear factor of activated T-cells, cytoplasmic, calcineurin-dependent 3 |
| chrX_-_152939252 | 1.67 |
ENST00000340888.3
|
PNCK
|
pregnancy up-regulated nonubiquitous CaM kinase |
| chr9_+_4490394 | 1.67 |
ENST00000262352.3
|
SLC1A1
|
solute carrier family 1 (neuronal/epithelial high affinity glutamate transporter, system Xag), member 1 |
| chr2_+_86668464 | 1.66 |
ENST00000409064.1
|
KDM3A
|
lysine (K)-specific demethylase 3A |
| chr5_-_180288248 | 1.66 |
ENST00000512132.1
ENST00000506439.1 ENST00000502412.1 ENST00000359141.6 |
ZFP62
|
ZFP62 zinc finger protein |
| chr12_+_122064398 | 1.66 |
ENST00000330079.7
|
ORAI1
|
ORAI calcium release-activated calcium modulator 1 |
| chr7_+_89841024 | 1.66 |
ENST00000394626.1
|
STEAP2
|
STEAP family member 2, metalloreductase |
| chr9_-_130533615 | 1.65 |
ENST00000373277.4
|
SH2D3C
|
SH2 domain containing 3C |
Network of associatons between targets according to the STRING database.
First level regulatory network of KLF16_SP2
Gene Ontology Analysis
Gene overrepresentation in biological process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.6 | 7.7 | GO:0018008 | N-terminal peptidyl-glycine N-myristoylation(GO:0018008) |
| 2.5 | 9.9 | GO:2000691 | negative regulation of cardioblast differentiation(GO:0051892) regulation of cardiac muscle cell myoblast differentiation(GO:2000690) negative regulation of cardiac muscle cell myoblast differentiation(GO:2000691) |
| 1.5 | 4.6 | GO:0070563 | negative regulation of vitamin D receptor signaling pathway(GO:0070563) |
| 1.5 | 4.6 | GO:0006535 | cysteine biosynthetic process from serine(GO:0006535) |
| 1.5 | 4.4 | GO:0032877 | positive regulation of DNA endoreduplication(GO:0032877) |
| 1.3 | 5.4 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
| 1.2 | 3.7 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 1.1 | 5.7 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 1.1 | 11.0 | GO:0097350 | neutrophil clearance(GO:0097350) |
| 1.1 | 3.2 | GO:0010621 | negative regulation of transcription by transcription factor localization(GO:0010621) |
| 1.0 | 4.0 | GO:0061030 | epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
| 1.0 | 1.0 | GO:0086047 | membrane depolarization during Purkinje myocyte cell action potential(GO:0086047) |
| 1.0 | 2.9 | GO:0071072 | negative regulation of phospholipid biosynthetic process(GO:0071072) |
| 0.9 | 6.6 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.9 | 3.7 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.8 | 2.5 | GO:2000393 | negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.8 | 0.8 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.8 | 2.4 | GO:0021966 | corticospinal neuron axon guidance(GO:0021966) |
| 0.8 | 3.1 | GO:1903691 | positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
| 0.8 | 2.3 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.8 | 0.8 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
| 0.8 | 1.5 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
| 0.8 | 2.3 | GO:0021503 | neural fold bending(GO:0021503) |
| 0.7 | 4.4 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.7 | 3.6 | GO:0070829 | response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.7 | 2.1 | GO:0035284 | rhombomere 5 development(GO:0021571) central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| 0.7 | 9.2 | GO:0021853 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 0.7 | 3.5 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
| 0.7 | 0.7 | GO:0045608 | negative regulation of auditory receptor cell differentiation(GO:0045608) |
| 0.7 | 2.6 | GO:0070124 | mitochondrial translational initiation(GO:0070124) |
| 0.7 | 2.6 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
| 0.7 | 2.6 | GO:0009644 | response to high light intensity(GO:0009644) |
| 0.6 | 0.6 | GO:0032416 | negative regulation of sodium:proton antiporter activity(GO:0032416) |
| 0.6 | 10.3 | GO:0002115 | store-operated calcium entry(GO:0002115) |
| 0.6 | 3.2 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.6 | 4.5 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.6 | 3.2 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.6 | 1.9 | GO:0060151 | peroxisome localization(GO:0060151) microtubule-based peroxisome localization(GO:0060152) |
| 0.6 | 2.4 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.6 | 1.2 | GO:0003192 | mitral valve formation(GO:0003192) |
| 0.6 | 2.4 | GO:0042662 | negative regulation of mesodermal cell fate specification(GO:0042662) |
| 0.6 | 1.8 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.6 | 2.3 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
| 0.6 | 1.7 | GO:0006669 | sphinganine-1-phosphate biosynthetic process(GO:0006669) |
| 0.6 | 1.7 | GO:1904760 | myofibroblast differentiation(GO:0036446) regulation of myofibroblast differentiation(GO:1904760) |
| 0.6 | 1.7 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
| 0.6 | 1.1 | GO:0051573 | negative regulation of histone H3-K9 methylation(GO:0051573) |
| 0.6 | 1.7 | GO:0006500 | N-terminal protein palmitoylation(GO:0006500) |
| 0.6 | 4.5 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.6 | 2.2 | GO:0031291 | Ran protein signal transduction(GO:0031291) |
| 0.6 | 1.1 | GO:0036292 | DNA rewinding(GO:0036292) |
| 0.5 | 2.1 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
| 0.5 | 1.6 | GO:0044205 | 'de novo' UMP biosynthetic process(GO:0044205) |
| 0.5 | 7.4 | GO:1902373 | negative regulation of mRNA catabolic process(GO:1902373) |
| 0.5 | 3.7 | GO:0070649 | polar body extrusion after meiotic divisions(GO:0040038) formin-nucleated actin cable assembly(GO:0070649) |
| 0.5 | 2.6 | GO:0042078 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.5 | 1.5 | GO:0036333 | hepatocyte homeostasis(GO:0036333) response to tetrachloromethane(GO:1904772) |
| 0.5 | 1.5 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
| 0.5 | 1.5 | GO:0033341 | regulation of collagen binding(GO:0033341) |
| 0.5 | 1.0 | GO:0051097 | negative regulation of helicase activity(GO:0051097) |
| 0.5 | 1.5 | GO:1904020 | regulation of G-protein coupled receptor internalization(GO:1904020) |
| 0.5 | 2.0 | GO:0001189 | RNA polymerase I transcriptional preinitiation complex assembly(GO:0001188) RNA polymerase I transcriptional preinitiation complex assembly at the promoter for the nuclear large rRNA transcript(GO:0001189) |
| 0.5 | 4.0 | GO:0098706 | ferric iron import into cell(GO:0097461) ferric iron import across plasma membrane(GO:0098706) |
| 0.5 | 1.0 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.5 | 1.5 | GO:0033386 | geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
| 0.5 | 2.0 | GO:0009912 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
| 0.5 | 4.4 | GO:0043634 | polyadenylation-dependent ncRNA catabolic process(GO:0043634) |
| 0.5 | 11.6 | GO:1901663 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.5 | 0.5 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.5 | 1.4 | GO:0031630 | regulation of synaptic vesicle fusion to presynaptic membrane(GO:0031630) |
| 0.5 | 1.4 | GO:0043012 | regulation of fusion of sperm to egg plasma membrane(GO:0043012) |
| 0.5 | 1.4 | GO:0048203 | vesicle targeting, trans-Golgi to endosome(GO:0048203) |
| 0.5 | 1.4 | GO:0031548 | regulation of brain-derived neurotrophic factor receptor signaling pathway(GO:0031548) |
| 0.5 | 1.4 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
| 0.5 | 1.4 | GO:1902811 | tongue muscle cell differentiation(GO:0035981) positive regulation of skeletal muscle fiber differentiation(GO:1902811) regulation of tongue muscle cell differentiation(GO:2001035) positive regulation of tongue muscle cell differentiation(GO:2001037) |
| 0.5 | 3.2 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.4 | 1.3 | GO:1901993 | meiotic cell cycle phase transition(GO:0044771) regulation of meiotic cell cycle phase transition(GO:1901993) negative regulation of meiotic cell cycle phase transition(GO:1901994) |
| 0.4 | 1.3 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
| 0.4 | 10.3 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
| 0.4 | 1.8 | GO:0045631 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.4 | 3.6 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 0.4 | 3.1 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.4 | 1.3 | GO:0060599 | lateral sprouting involved in mammary gland duct morphogenesis(GO:0060599) |
| 0.4 | 1.7 | GO:0003185 | primary heart field specification(GO:0003138) sinoatrial valve development(GO:0003172) sinoatrial valve morphogenesis(GO:0003185) |
| 0.4 | 3.0 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) |
| 0.4 | 1.7 | GO:0032803 | regulation of low-density lipoprotein particle receptor catabolic process(GO:0032803) |
| 0.4 | 1.3 | GO:0021919 | BMP signaling pathway involved in spinal cord dorsal/ventral patterning(GO:0021919) |
| 0.4 | 2.5 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.4 | 0.4 | GO:0071505 | response to mycophenolic acid(GO:0071505) cellular response to mycophenolic acid(GO:0071506) |
| 0.4 | 2.9 | GO:0035795 | negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 0.4 | 1.6 | GO:0046452 | dihydrofolate metabolic process(GO:0046452) |
| 0.4 | 1.2 | GO:0033364 | mast cell secretory granule organization(GO:0033364) |
| 0.4 | 0.4 | GO:0043000 | Golgi to plasma membrane CFTR protein transport(GO:0043000) |
| 0.4 | 3.6 | GO:1904179 | positive regulation of adipose tissue development(GO:1904179) |
| 0.4 | 3.6 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.4 | 1.6 | GO:0005986 | sucrose biosynthetic process(GO:0005986) |
| 0.4 | 0.4 | GO:1904582 | regulation of intracellular mRNA localization(GO:1904580) positive regulation of intracellular mRNA localization(GO:1904582) |
| 0.4 | 1.6 | GO:0044806 | G-quadruplex DNA unwinding(GO:0044806) |
| 0.4 | 2.0 | GO:1901091 | regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
| 0.4 | 2.7 | GO:0014050 | negative regulation of glutamate secretion(GO:0014050) |
| 0.4 | 3.1 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.4 | 2.3 | GO:0034628 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.4 | 3.1 | GO:2000664 | positive regulation of interleukin-5 secretion(GO:2000664) |
| 0.4 | 1.9 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.4 | 1.5 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
| 0.4 | 1.1 | GO:2000298 | regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
| 0.4 | 3.0 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
| 0.4 | 1.5 | GO:0036228 | protein targeting to nuclear inner membrane(GO:0036228) |
| 0.4 | 1.1 | GO:0021722 | superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
| 0.4 | 1.5 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.4 | 0.4 | GO:0098881 | exocytic insertion of neurotransmitter receptor to plasma membrane(GO:0098881) exocytic insertion of neurotransmitter receptor to postsynaptic membrane(GO:0098967) |
| 0.4 | 2.6 | GO:0043585 | nose morphogenesis(GO:0043585) |
| 0.4 | 1.5 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
| 0.4 | 1.4 | GO:0071163 | DNA replication preinitiation complex assembly(GO:0071163) |
| 0.4 | 1.4 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.4 | 0.4 | GO:0035621 | ER to Golgi ceramide transport(GO:0035621) |
| 0.4 | 0.4 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
| 0.4 | 0.4 | GO:1900106 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.4 | 4.3 | GO:0006264 | mitochondrial DNA replication(GO:0006264) |
| 0.4 | 0.7 | GO:0018377 | protein myristoylation(GO:0018377) |
| 0.4 | 1.4 | GO:0022007 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 0.4 | 1.4 | GO:0035616 | histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.4 | 0.4 | GO:0010726 | positive regulation of hydrogen peroxide metabolic process(GO:0010726) |
| 0.4 | 1.8 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
| 0.4 | 2.5 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
| 0.3 | 4.2 | GO:0060736 | prostate gland growth(GO:0060736) |
| 0.3 | 1.0 | GO:0044209 | AMP salvage(GO:0044209) |
| 0.3 | 1.4 | GO:0006272 | leading strand elongation(GO:0006272) |
| 0.3 | 1.0 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
| 0.3 | 1.4 | GO:0035026 | leading edge cell differentiation(GO:0035026) |
| 0.3 | 1.0 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
| 0.3 | 1.4 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.3 | 1.4 | GO:1902361 | mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
| 0.3 | 1.7 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.3 | 0.7 | GO:0038162 | erythropoietin-mediated signaling pathway(GO:0038162) |
| 0.3 | 7.8 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.3 | 0.7 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.3 | 0.7 | GO:0090035 | regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
| 0.3 | 1.3 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.3 | 1.7 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.3 | 1.3 | GO:0043987 | histone H3-S10 phosphorylation(GO:0043987) |
| 0.3 | 0.7 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
| 0.3 | 2.0 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
| 0.3 | 1.0 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.3 | 0.3 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.3 | 2.0 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
| 0.3 | 2.0 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
| 0.3 | 1.0 | GO:2000705 | dense core granule biogenesis(GO:0061110) regulation of dense core granule biogenesis(GO:2000705) |
| 0.3 | 4.6 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.3 | 1.6 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
| 0.3 | 1.0 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
| 0.3 | 1.3 | GO:0010746 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) |
| 0.3 | 3.2 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
| 0.3 | 1.0 | GO:0046586 | regulation of calcium-dependent cell-cell adhesion(GO:0046586) |
| 0.3 | 1.6 | GO:0098502 | DNA dephosphorylation(GO:0098502) |
| 0.3 | 1.9 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.3 | 1.0 | GO:1903960 | negative regulation of anion channel activity(GO:0010360) negative regulation of anion transmembrane transport(GO:1903960) |
| 0.3 | 1.3 | GO:0000432 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) positive regulation of transcription by glucose(GO:0046016) |
| 0.3 | 1.3 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.3 | 1.6 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.3 | 1.3 | GO:0007070 | negative regulation of transcription during mitosis(GO:0007068) negative regulation of transcription from RNA polymerase II promoter during mitosis(GO:0007070) |
| 0.3 | 0.3 | GO:0007521 | muscle cell fate determination(GO:0007521) |
| 0.3 | 0.3 | GO:0003149 | membranous septum morphogenesis(GO:0003149) |
| 0.3 | 0.6 | GO:0016340 | calcium-dependent cell-matrix adhesion(GO:0016340) |
| 0.3 | 1.2 | GO:0009956 | radial pattern formation(GO:0009956) |
| 0.3 | 1.8 | GO:0050893 | sensory processing(GO:0050893) |
| 0.3 | 5.8 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.3 | 1.5 | GO:0051941 | regulation of amino acid uptake involved in synaptic transmission(GO:0051941) regulation of glutamate uptake involved in transmission of nerve impulse(GO:0051946) regulation of L-glutamate import(GO:1900920) |
| 0.3 | 0.6 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.3 | 2.4 | GO:0051182 | coenzyme transport(GO:0051182) |
| 0.3 | 1.5 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
| 0.3 | 0.3 | GO:0002661 | B cell tolerance induction(GO:0002514) regulation of B cell tolerance induction(GO:0002661) positive regulation of B cell tolerance induction(GO:0002663) |
| 0.3 | 0.9 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
| 0.3 | 0.9 | GO:1902616 | acyl carnitine transport(GO:0006844) acyl carnitine transmembrane transport(GO:1902616) |
| 0.3 | 2.6 | GO:0016191 | synaptic vesicle uncoating(GO:0016191) |
| 0.3 | 0.9 | GO:0019086 | early viral transcription(GO:0019085) late viral transcription(GO:0019086) |
| 0.3 | 0.9 | GO:0060369 | positive regulation of Fc receptor mediated stimulatory signaling pathway(GO:0060369) |
| 0.3 | 2.3 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.3 | 0.9 | GO:0042713 | sperm ejaculation(GO:0042713) |
| 0.3 | 0.9 | GO:0045212 | negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 0.3 | 0.3 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
| 0.3 | 0.3 | GO:0002513 | tolerance induction to self antigen(GO:0002513) |
| 0.3 | 0.6 | GO:0045994 | positive regulation of translational initiation by iron(GO:0045994) |
| 0.3 | 2.9 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.3 | 0.9 | GO:0061181 | regulation of chondrocyte development(GO:0061181) |
| 0.3 | 1.1 | GO:0060010 | Sertoli cell fate commitment(GO:0060010) |
| 0.3 | 1.1 | GO:0021812 | neuronal-glial interaction involved in cerebral cortex radial glia guided migration(GO:0021812) |
| 0.3 | 2.0 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.3 | 8.3 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
| 0.3 | 3.7 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.3 | 0.9 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) regulation of kinetochore assembly(GO:0090234) |
| 0.3 | 1.1 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.3 | 2.6 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
| 0.3 | 0.6 | GO:0031133 | regulation of axon diameter(GO:0031133) |
| 0.3 | 0.9 | GO:2001162 | regulation of histone H3-K79 methylation(GO:2001160) positive regulation of histone H3-K79 methylation(GO:2001162) |
| 0.3 | 1.4 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
| 0.3 | 1.1 | GO:0030920 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.3 | 0.8 | GO:0044376 | RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
| 0.3 | 1.4 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
| 0.3 | 0.8 | GO:1903697 | negative regulation of microvillus assembly(GO:1903697) |
| 0.3 | 1.4 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
| 0.3 | 0.8 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
| 0.3 | 1.4 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.3 | 1.1 | GO:0072237 | metanephric proximal tubule development(GO:0072237) |
| 0.3 | 2.4 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.3 | 2.7 | GO:0001955 | blood vessel maturation(GO:0001955) |
| 0.3 | 0.5 | GO:2000620 | positive regulation of histone H4-K16 acetylation(GO:2000620) |
| 0.3 | 0.3 | GO:0006288 | base-excision repair, DNA ligation(GO:0006288) |
| 0.3 | 2.1 | GO:0032264 | IMP salvage(GO:0032264) |
| 0.3 | 1.1 | GO:0045409 | negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
| 0.3 | 5.8 | GO:0060065 | uterus development(GO:0060065) |
| 0.3 | 0.8 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.3 | 0.5 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.3 | 0.5 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
| 0.3 | 0.8 | GO:0009405 | pathogenesis(GO:0009405) |
| 0.3 | 0.3 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.3 | 2.3 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.3 | 0.5 | GO:0060462 | lung lobe development(GO:0060462) lung lobe morphogenesis(GO:0060463) |
| 0.3 | 0.8 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
| 0.3 | 2.1 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
| 0.3 | 0.8 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.3 | 3.6 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.3 | 0.5 | GO:0021938 | ventral midline development(GO:0007418) smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) |
| 0.3 | 1.6 | GO:0031022 | nuclear migration along microfilament(GO:0031022) |
| 0.3 | 0.5 | GO:0030473 | nucleokinesis involved in cell motility in cerebral cortex radial glia guided migration(GO:0021817) nuclear migration along microtubule(GO:0030473) |
| 0.3 | 0.3 | GO:0015817 | histidine transport(GO:0015817) L-histidine transmembrane transport(GO:0089709) L-histidine transport(GO:1902024) |
| 0.3 | 1.3 | GO:0019075 | virus maturation(GO:0019075) |
| 0.3 | 0.8 | GO:0048627 | myoblast development(GO:0048627) |
| 0.3 | 0.8 | GO:0044313 | protein K6-linked deubiquitination(GO:0044313) |
| 0.3 | 0.8 | GO:0061536 | glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.3 | 0.5 | GO:0090598 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
| 0.3 | 1.0 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
| 0.3 | 0.8 | GO:0006428 | isoleucyl-tRNA aminoacylation(GO:0006428) |
| 0.3 | 1.3 | GO:0003084 | positive regulation of systemic arterial blood pressure(GO:0003084) |
| 0.3 | 1.8 | GO:0060296 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
| 0.3 | 2.0 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 0.3 | 1.3 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
| 0.3 | 0.8 | GO:1990519 | pyrimidine nucleotide transport(GO:0006864) mitochondrial pyrimidine nucleotide import(GO:1990519) |
| 0.3 | 0.3 | GO:0032898 | neurotrophin production(GO:0032898) |
| 0.3 | 0.3 | GO:0036482 | neuron death in response to hydrogen peroxide(GO:0036476) neuron intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036482) positive regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902958) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903383) negative regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903384) |
| 0.3 | 0.8 | GO:0000412 | histone peptidyl-prolyl isomerization(GO:0000412) |
| 0.3 | 1.3 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 0.3 | 0.5 | GO:0060750 | epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) |
| 0.2 | 1.0 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.2 | 1.5 | GO:0046940 | nucleoside monophosphate phosphorylation(GO:0046940) |
| 0.2 | 0.5 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.2 | 1.2 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 0.2 | 1.5 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
| 0.2 | 1.7 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.2 | 0.2 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) type B pancreatic cell maturation(GO:0072560) |
| 0.2 | 1.0 | GO:0072144 | glomerular mesangial cell development(GO:0072144) |
| 0.2 | 0.7 | GO:0050760 | negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
| 0.2 | 0.7 | GO:1904617 | negative regulation of actin filament binding(GO:1904530) negative regulation of actin binding(GO:1904617) |
| 0.2 | 0.7 | GO:0032661 | regulation of interleukin-18 production(GO:0032661) |
| 0.2 | 1.2 | GO:1903412 | response to bile acid(GO:1903412) |
| 0.2 | 2.4 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.2 | 1.9 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.2 | 0.9 | GO:0097498 | endothelial tube lumen extension(GO:0097498) |
| 0.2 | 0.7 | GO:0097156 | fasciculation of motor neuron axon(GO:0097156) |
| 0.2 | 1.2 | GO:0016240 | autophagosome docking(GO:0016240) |
| 0.2 | 1.2 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.2 | 3.5 | GO:1901160 | primary amino compound metabolic process(GO:1901160) |
| 0.2 | 0.7 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.2 | 0.5 | GO:0018312 | peptidyl-serine ADP-ribosylation(GO:0018312) |
| 0.2 | 1.2 | GO:0048382 | mesendoderm development(GO:0048382) |
| 0.2 | 0.7 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 0.2 | 0.7 | GO:0042137 | sequestering of neurotransmitter(GO:0042137) |
| 0.2 | 0.2 | GO:0006668 | sphinganine-1-phosphate metabolic process(GO:0006668) |
| 0.2 | 9.2 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
| 0.2 | 1.6 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.2 | 0.2 | GO:0036510 | trimming of terminal mannose on B branch(GO:0036509) trimming of terminal mannose on C branch(GO:0036510) trimming of first mannose on A branch(GO:0036511) trimming of second mannose on A branch(GO:0036512) |
| 0.2 | 2.1 | GO:0042048 | olfactory behavior(GO:0042048) |
| 0.2 | 0.5 | GO:0043686 | co-translational protein modification(GO:0043686) |
| 0.2 | 0.9 | GO:0003072 | regulation of blood vessel size by renin-angiotensin(GO:0002034) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) |
| 0.2 | 3.4 | GO:0045003 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.2 | 1.4 | GO:0060013 | righting reflex(GO:0060013) |
| 0.2 | 2.2 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
| 0.2 | 0.9 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.2 | 1.3 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.2 | 1.1 | GO:0046066 | dGDP metabolic process(GO:0046066) |
| 0.2 | 5.4 | GO:0016254 | preassembly of GPI anchor in ER membrane(GO:0016254) |
| 0.2 | 2.2 | GO:0051096 | regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
| 0.2 | 0.2 | GO:0072434 | signal transduction involved in G2 DNA damage checkpoint(GO:0072425) signal transduction involved in mitotic G2 DNA damage checkpoint(GO:0072434) |
| 0.2 | 1.3 | GO:1903756 | regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903756) negative regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903758) |
| 0.2 | 0.7 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.2 | 1.6 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
| 0.2 | 1.5 | GO:0010635 | regulation of mitochondrial fusion(GO:0010635) |
| 0.2 | 0.2 | GO:0072197 | ureter morphogenesis(GO:0072197) |
| 0.2 | 0.9 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.2 | 1.1 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.2 | 0.9 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
| 0.2 | 0.9 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.2 | 1.1 | GO:0051611 | negative regulation of neurotransmitter uptake(GO:0051581) serotonin uptake(GO:0051610) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.2 | 1.5 | GO:0060368 | regulation of Fc receptor mediated stimulatory signaling pathway(GO:0060368) |
| 0.2 | 2.4 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.2 | 1.3 | GO:0006065 | UDP-glucuronate biosynthetic process(GO:0006065) |
| 0.2 | 0.7 | GO:0061300 | cerebellum vasculature development(GO:0061300) |
| 0.2 | 0.4 | GO:0061739 | protein lipidation involved in autophagosome assembly(GO:0061739) |
| 0.2 | 0.4 | GO:0051582 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.2 | 3.5 | GO:0060004 | reflex(GO:0060004) |
| 0.2 | 1.7 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.2 | 1.3 | GO:0032185 | septin cytoskeleton organization(GO:0032185) |
| 0.2 | 1.5 | GO:0060372 | regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) |
| 0.2 | 0.9 | GO:0032484 | Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
| 0.2 | 1.9 | GO:0046618 | drug export(GO:0046618) |
| 0.2 | 1.3 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.2 | 0.6 | GO:0002188 | translation reinitiation(GO:0002188) |
| 0.2 | 1.3 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.2 | 11.6 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.2 | 0.9 | GO:1903367 | positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
| 0.2 | 4.9 | GO:0006337 | nucleosome disassembly(GO:0006337) |
| 0.2 | 0.6 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.2 | 1.7 | GO:0046836 | glycolipid transport(GO:0046836) |
| 0.2 | 1.3 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.2 | 1.7 | GO:0019236 | response to pheromone(GO:0019236) |
| 0.2 | 1.7 | GO:0071941 | nitrogen cycle metabolic process(GO:0071941) |
| 0.2 | 1.1 | GO:0035063 | nuclear speck organization(GO:0035063) |
| 0.2 | 0.4 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.2 | 0.2 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
| 0.2 | 1.0 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
| 0.2 | 1.2 | GO:0048505 | regulation of development, heterochronic(GO:0040034) regulation of timing of cell differentiation(GO:0048505) |
| 0.2 | 0.6 | GO:0007538 | primary sex determination(GO:0007538) |
| 0.2 | 0.8 | GO:1905232 | cellular response to L-glutamate(GO:1905232) |
| 0.2 | 1.0 | GO:0060214 | endocardium formation(GO:0060214) |
| 0.2 | 0.8 | GO:0060265 | positive regulation of respiratory burst involved in inflammatory response(GO:0060265) |
| 0.2 | 0.2 | GO:0006563 | L-serine metabolic process(GO:0006563) |
| 0.2 | 0.2 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.2 | 1.2 | GO:0070272 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 0.2 | 0.2 | GO:0060025 | regulation of synaptic activity(GO:0060025) |
| 0.2 | 0.6 | GO:0045226 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
| 0.2 | 0.6 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.2 | 0.8 | GO:0090402 | mesodermal-endodermal cell signaling(GO:0003131) programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) histone H2A-S139 phosphorylation(GO:0035978) oncogene-induced cell senescence(GO:0090402) histone H2A phosphorylation(GO:1990164) positive regulation of cellular response to X-ray(GO:2000685) |
| 0.2 | 2.6 | GO:0051383 | kinetochore organization(GO:0051383) |
| 0.2 | 1.4 | GO:0035268 | protein mannosylation(GO:0035268) |
| 0.2 | 1.4 | GO:0075044 | autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
| 0.2 | 1.2 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.2 | 1.0 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.2 | 0.6 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.2 | 2.0 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
| 0.2 | 2.8 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
| 0.2 | 1.0 | GO:0006203 | dGTP catabolic process(GO:0006203) |
| 0.2 | 0.4 | GO:0032765 | positive regulation of mast cell cytokine production(GO:0032765) |
| 0.2 | 0.6 | GO:1902303 | negative regulation of potassium ion export(GO:1902303) |
| 0.2 | 1.4 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
| 0.2 | 2.0 | GO:0010265 | SCF complex assembly(GO:0010265) |
| 0.2 | 0.8 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
| 0.2 | 0.6 | GO:2000342 | negative regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000342) |
| 0.2 | 1.2 | GO:1904381 | Golgi apparatus mannose trimming(GO:1904381) |
| 0.2 | 0.4 | GO:0072338 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
| 0.2 | 1.0 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
| 0.2 | 0.6 | GO:0016999 | antibiotic metabolic process(GO:0016999) |
| 0.2 | 0.4 | GO:0035494 | SNARE complex disassembly(GO:0035494) |
| 0.2 | 0.4 | GO:0044878 | mitotic cytokinesis checkpoint(GO:0044878) |
| 0.2 | 2.3 | GO:0060453 | regulation of gastric acid secretion(GO:0060453) |
| 0.2 | 1.5 | GO:0032510 | endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
| 0.2 | 0.4 | GO:0071922 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.2 | 1.5 | GO:0070779 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
| 0.2 | 0.4 | GO:1902723 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.2 | 0.6 | GO:1904106 | protein localization to microvillus(GO:1904106) |
| 0.2 | 0.2 | GO:0070495 | regulation of thrombin receptor signaling pathway(GO:0070494) negative regulation of thrombin receptor signaling pathway(GO:0070495) |
| 0.2 | 0.2 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
| 0.2 | 1.1 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.2 | 1.1 | GO:0006574 | valine catabolic process(GO:0006574) |
| 0.2 | 0.8 | GO:1902162 | regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) positive regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902164) |
| 0.2 | 0.8 | GO:0090579 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 0.2 | 0.2 | GO:0022010 | central nervous system myelination(GO:0022010) axon ensheathment in central nervous system(GO:0032291) |
| 0.2 | 1.1 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.2 | 0.4 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
| 0.2 | 3.2 | GO:0072189 | ureter development(GO:0072189) |
| 0.2 | 1.5 | GO:0098722 | asymmetric stem cell division(GO:0098722) |
| 0.2 | 0.6 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.2 | 2.2 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.2 | 0.7 | GO:0042414 | epinephrine metabolic process(GO:0042414) epinephrine biosynthetic process(GO:0042418) |
| 0.2 | 0.7 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
| 0.2 | 1.1 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) |
| 0.2 | 0.2 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 0.2 | 0.7 | GO:0070982 | L-asparagine biosynthetic process(GO:0070981) L-asparagine metabolic process(GO:0070982) |
| 0.2 | 4.0 | GO:0033617 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.2 | 0.9 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
| 0.2 | 0.6 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.2 | 1.8 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
| 0.2 | 0.4 | GO:1904338 | regulation of dopaminergic neuron differentiation(GO:1904338) |
| 0.2 | 1.6 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
| 0.2 | 0.7 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
| 0.2 | 5.6 | GO:2000300 | regulation of synaptic vesicle exocytosis(GO:2000300) |
| 0.2 | 1.3 | GO:0045007 | depurination(GO:0045007) |
| 0.2 | 0.9 | GO:0002415 | immunoglobulin transcytosis in epithelial cells mediated by polymeric immunoglobulin receptor(GO:0002415) |
| 0.2 | 0.2 | GO:1903939 | regulation of TORC2 signaling(GO:1903939) |
| 0.2 | 0.5 | GO:0098838 | reduced folate transmembrane transport(GO:0098838) |
| 0.2 | 0.2 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.2 | 1.8 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.2 | 0.4 | GO:0007113 | endomitotic cell cycle(GO:0007113) |
| 0.2 | 0.4 | GO:0044240 | multicellular organism lipid catabolic process(GO:0044240) |
| 0.2 | 0.4 | GO:0071335 | submandibular salivary gland formation(GO:0060661) hair follicle cell proliferation(GO:0071335) regulation of hair follicle cell proliferation(GO:0071336) positive regulation of hair follicle cell proliferation(GO:0071338) |
| 0.2 | 0.5 | GO:0031247 | actin rod assembly(GO:0031247) |
| 0.2 | 0.5 | GO:0042727 | flavin-containing compound biosynthetic process(GO:0042727) |
| 0.2 | 0.7 | GO:0030807 | positive regulation of cyclic nucleotide catabolic process(GO:0030807) positive regulation of cAMP catabolic process(GO:0030822) positive regulation of purine nucleotide catabolic process(GO:0033123) |
| 0.2 | 0.4 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.2 | 0.5 | GO:0002384 | hepatic immune response(GO:0002384) |
| 0.2 | 4.0 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
| 0.2 | 0.5 | GO:2001014 | regulation of skeletal muscle cell differentiation(GO:2001014) |
| 0.2 | 2.8 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.2 | 1.2 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) |
| 0.2 | 1.0 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
| 0.2 | 1.9 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.2 | 0.5 | GO:1902075 | cellular response to salt(GO:1902075) |
| 0.2 | 0.3 | GO:0061669 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
| 0.2 | 1.2 | GO:0097056 | selenocysteinyl-tRNA(Sec) biosynthetic process(GO:0097056) |
| 0.2 | 0.7 | GO:0060449 | bud elongation involved in lung branching(GO:0060449) |
| 0.2 | 1.0 | GO:0044821 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.2 | 1.7 | GO:0021759 | globus pallidus development(GO:0021759) |
| 0.2 | 1.5 | GO:0060019 | radial glial cell differentiation(GO:0060019) |
| 0.2 | 0.7 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.2 | 1.4 | GO:0045048 | protein insertion into ER membrane(GO:0045048) |
| 0.2 | 1.4 | GO:0051195 | negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
| 0.2 | 0.5 | GO:0060823 | canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060823) |
| 0.2 | 2.5 | GO:0042167 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.2 | 0.3 | GO:0098758 | response to interleukin-8(GO:0098758) cellular response to interleukin-8(GO:0098759) |
| 0.2 | 0.5 | GO:1903070 | negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
| 0.2 | 1.0 | GO:2000490 | negative regulation of hepatic stellate cell activation(GO:2000490) |
| 0.2 | 0.5 | GO:0098968 | neurotransmitter receptor transport postsynaptic membrane to endosome(GO:0098968) |
| 0.2 | 0.8 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.2 | 3.5 | GO:0036148 | phosphatidylglycerol acyl-chain remodeling(GO:0036148) |
| 0.2 | 0.5 | GO:1904253 | positive regulation of bile acid biosynthetic process(GO:0070859) positive regulation of bile acid metabolic process(GO:1904253) |
| 0.2 | 0.5 | GO:0019242 | methylglyoxal biosynthetic process(GO:0019242) |
| 0.2 | 1.7 | GO:1900112 | regulation of histone H3-K9 trimethylation(GO:1900112) |
| 0.2 | 0.3 | GO:0042214 | terpene metabolic process(GO:0042214) |
| 0.2 | 2.2 | GO:0015866 | ADP transport(GO:0015866) |
| 0.2 | 0.8 | GO:0045091 | regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) |
| 0.2 | 0.5 | GO:2000537 | regulation of cGMP-mediated signaling(GO:0010752) regulation of B cell chemotaxis(GO:2000537) positive regulation of B cell chemotaxis(GO:2000538) |
| 0.2 | 0.3 | GO:0098937 | dendritic transport(GO:0098935) anterograde dendritic transport(GO:0098937) |
| 0.2 | 1.2 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.2 | 1.2 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.2 | 2.6 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
| 0.2 | 0.3 | GO:0006550 | isoleucine catabolic process(GO:0006550) |
| 0.2 | 0.2 | GO:1900039 | positive regulation of cellular response to hypoxia(GO:1900039) |
| 0.2 | 0.7 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.2 | 1.8 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.2 | 0.8 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
| 0.2 | 0.3 | GO:0022615 | protein to membrane docking(GO:0022615) |
| 0.2 | 0.3 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.2 | 0.2 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) |
| 0.2 | 1.3 | GO:1902572 | negative regulation of serine-type endopeptidase activity(GO:1900004) negative regulation of serine-type peptidase activity(GO:1902572) |
| 0.2 | 1.3 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.2 | 1.6 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.2 | 0.3 | GO:0016476 | regulation of embryonic cell shape(GO:0016476) |
| 0.2 | 1.0 | GO:0032230 | positive regulation of synaptic transmission, GABAergic(GO:0032230) |
| 0.2 | 3.7 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.2 | 0.6 | GO:0032053 | ciliary basal body organization(GO:0032053) |
| 0.2 | 4.6 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.2 | 1.6 | GO:0019388 | galactose catabolic process(GO:0019388) |
| 0.2 | 2.1 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.2 | 1.3 | GO:0061744 | motor behavior(GO:0061744) |
| 0.2 | 0.5 | GO:0006235 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) |
| 0.2 | 0.3 | GO:0016103 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
| 0.2 | 1.9 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.2 | 1.9 | GO:0070070 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.2 | 0.8 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.2 | 3.9 | GO:2001222 | regulation of neuron migration(GO:2001222) |
| 0.2 | 0.6 | GO:0048698 | negative regulation of collateral sprouting in absence of injury(GO:0048698) |
| 0.2 | 1.9 | GO:0032025 | response to cobalt ion(GO:0032025) |
| 0.2 | 0.2 | GO:0060157 | urinary bladder development(GO:0060157) |
| 0.2 | 0.8 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
| 0.2 | 0.5 | GO:2001033 | negative regulation of double-strand break repair via nonhomologous end joining(GO:2001033) |
| 0.2 | 0.5 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
| 0.2 | 0.5 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.2 | 3.7 | GO:0033540 | fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
| 0.2 | 1.4 | GO:0042659 | regulation of cell fate specification(GO:0042659) |
| 0.2 | 2.4 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.2 | 0.2 | GO:0097338 | response to clozapine(GO:0097338) |
| 0.2 | 0.9 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.2 | 0.2 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.2 | 0.5 | GO:0070407 | oxidation-dependent protein catabolic process(GO:0070407) |
| 0.2 | 0.2 | GO:1901526 | positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
| 0.2 | 0.9 | GO:0015798 | myo-inositol transport(GO:0015798) |
| 0.1 | 0.4 | GO:0051503 | adenine nucleotide transport(GO:0051503) |
| 0.1 | 0.4 | GO:0007057 | spindle assembly involved in female meiosis I(GO:0007057) |
| 0.1 | 0.4 | GO:0023016 | signal transduction by trans-phosphorylation(GO:0023016) |
| 0.1 | 0.6 | GO:0060687 | regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
| 0.1 | 1.2 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) |
| 0.1 | 2.8 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
| 0.1 | 3.6 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
| 0.1 | 4.2 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
| 0.1 | 1.8 | GO:0015074 | DNA integration(GO:0015074) |
| 0.1 | 2.5 | GO:0050961 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
| 0.1 | 0.9 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
| 0.1 | 0.7 | GO:0046116 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.1 | 0.3 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
| 0.1 | 0.4 | GO:0009258 | 10-formyltetrahydrofolate catabolic process(GO:0009258) |
| 0.1 | 1.0 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.1 | 0.1 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
| 0.1 | 0.4 | GO:0007231 | osmosensory signaling pathway(GO:0007231) |
| 0.1 | 0.9 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.1 | 2.3 | GO:0031643 | positive regulation of myelination(GO:0031643) |
| 0.1 | 0.4 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
| 0.1 | 0.4 | GO:0042097 | interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) |
| 0.1 | 2.2 | GO:0070571 | negative regulation of neuron projection regeneration(GO:0070571) |
| 0.1 | 0.9 | GO:1904879 | positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.1 | 1.4 | GO:0042670 | retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
| 0.1 | 0.1 | GO:0051933 | amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
| 0.1 | 0.4 | GO:0035564 | regulation of kidney size(GO:0035564) regulation of pronephros size(GO:0035565) renal glucose absorption(GO:0035623) |
| 0.1 | 0.6 | GO:1902617 | response to fluoride(GO:1902617) |
| 0.1 | 0.6 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 0.1 | 0.4 | GO:0006566 | threonine metabolic process(GO:0006566) |
| 0.1 | 0.6 | GO:0036079 | GDP-fucose transport(GO:0015783) purine nucleotide-sugar transport(GO:0036079) |
| 0.1 | 0.7 | GO:0044565 | dendritic cell proliferation(GO:0044565) |
| 0.1 | 0.3 | GO:0006425 | glutaminyl-tRNA aminoacylation(GO:0006425) |
| 0.1 | 0.4 | GO:0019417 | sulfur oxidation(GO:0019417) |
| 0.1 | 1.1 | GO:0098734 | macromolecule depalmitoylation(GO:0098734) |
| 0.1 | 0.6 | GO:0051029 | rRNA transport(GO:0051029) |
| 0.1 | 0.7 | GO:0001661 | conditioned taste aversion(GO:0001661) |
| 0.1 | 0.4 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
| 0.1 | 0.3 | GO:0033504 | floor plate development(GO:0033504) |
| 0.1 | 0.3 | GO:0006196 | AMP catabolic process(GO:0006196) |
| 0.1 | 1.4 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.1 | 1.5 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
| 0.1 | 1.4 | GO:0016446 | somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.1 | 0.4 | GO:0001845 | phagolysosome assembly(GO:0001845) |
| 0.1 | 0.1 | GO:0051142 | regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
| 0.1 | 0.5 | GO:0015688 | iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
| 0.1 | 0.7 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.1 | 1.1 | GO:0043435 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.1 | 4.6 | GO:0045737 | positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
| 0.1 | 0.1 | GO:1900063 | regulation of peroxisome organization(GO:1900063) |
| 0.1 | 0.7 | GO:0046877 | regulation of saliva secretion(GO:0046877) |
| 0.1 | 0.3 | GO:2000793 | cell proliferation involved in heart valve development(GO:2000793) |
| 0.1 | 0.9 | GO:1904885 | beta-catenin destruction complex assembly(GO:1904885) |
| 0.1 | 0.4 | GO:0072428 | signal transduction involved in intra-S DNA damage checkpoint(GO:0072428) regulation of mitotic cell cycle DNA replication(GO:1903463) negative regulation of mitotic cell cycle DNA replication(GO:1903464) response to bisphenol A(GO:1903925) cellular response to bisphenol A(GO:1903926) |
| 0.1 | 0.5 | GO:1900619 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
| 0.1 | 0.7 | GO:1902659 | regulation of glucose mediated signaling pathway(GO:1902659) |
| 0.1 | 0.3 | GO:0014034 | neural crest cell fate commitment(GO:0014034) |
| 0.1 | 0.4 | GO:0060979 | vasculogenesis involved in coronary vascular morphogenesis(GO:0060979) |
| 0.1 | 0.4 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 0.1 | 0.4 | GO:0006423 | cysteinyl-tRNA aminoacylation(GO:0006423) |
| 0.1 | 1.2 | GO:0031297 | replication fork processing(GO:0031297) |
| 0.1 | 0.7 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 0.1 | 1.7 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
| 0.1 | 0.5 | GO:0055014 | atrial cardiac muscle cell differentiation(GO:0055011) atrial cardiac muscle cell development(GO:0055014) |
| 0.1 | 1.5 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.1 | 0.4 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
| 0.1 | 0.9 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.1 | 1.0 | GO:0070459 | prolactin secretion(GO:0070459) |
| 0.1 | 0.8 | GO:0051012 | microtubule sliding(GO:0051012) |
| 0.1 | 0.6 | GO:0001880 | Mullerian duct regression(GO:0001880) |
| 0.1 | 0.8 | GO:0097033 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.1 | 1.3 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.1 | 0.4 | GO:0033129 | positive regulation of histone phosphorylation(GO:0033129) |
| 0.1 | 0.8 | GO:2000568 | memory T cell activation(GO:0035709) regulation of memory T cell activation(GO:2000567) positive regulation of memory T cell activation(GO:2000568) |
| 0.1 | 3.1 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.1 | 0.5 | GO:0042756 | drinking behavior(GO:0042756) |
| 0.1 | 0.8 | GO:0051030 | snRNA transport(GO:0051030) |
| 0.1 | 0.9 | GO:0030242 | pexophagy(GO:0030242) |
| 0.1 | 1.0 | GO:0035865 | cellular response to potassium ion(GO:0035865) |
| 0.1 | 0.5 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
| 0.1 | 0.8 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.1 | 0.4 | GO:0072205 | metanephric collecting duct development(GO:0072205) |
| 0.1 | 1.7 | GO:0006625 | protein targeting to peroxisome(GO:0006625) peroxisomal transport(GO:0043574) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
| 0.1 | 1.4 | GO:0030091 | protein repair(GO:0030091) |
| 0.1 | 0.5 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.1 | 0.6 | GO:0030070 | insulin processing(GO:0030070) |
| 0.1 | 0.4 | GO:0003032 | detection of oxygen(GO:0003032) |
| 0.1 | 0.5 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.1 | 0.5 | GO:0036089 | cleavage furrow formation(GO:0036089) |
| 0.1 | 1.0 | GO:0007135 | meiosis II(GO:0007135) |
| 0.1 | 0.7 | GO:0071630 | nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
| 0.1 | 0.4 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
| 0.1 | 0.6 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.1 | 0.7 | GO:0097460 | ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
| 0.1 | 1.8 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
| 0.1 | 1.1 | GO:0006552 | leucine catabolic process(GO:0006552) |
| 0.1 | 0.6 | GO:0071409 | cellular response to cycloheximide(GO:0071409) |
| 0.1 | 1.4 | GO:0030202 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.1 | 1.8 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
| 0.1 | 0.4 | GO:0032455 | nerve growth factor processing(GO:0032455) |
| 0.1 | 0.4 | GO:0006188 | IMP biosynthetic process(GO:0006188) |
| 0.1 | 0.1 | GO:1902804 | negative regulation of synaptic vesicle transport(GO:1902804) |
| 0.1 | 3.7 | GO:0014047 | glutamate secretion(GO:0014047) |
| 0.1 | 0.1 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) modulation of inhibitory postsynaptic potential(GO:0098828) |
| 0.1 | 0.2 | GO:0042938 | dipeptide transport(GO:0042938) |
| 0.1 | 0.2 | GO:0002894 | positive regulation of type IIa hypersensitivity(GO:0001798) positive regulation of type II hypersensitivity(GO:0002894) |
| 0.1 | 0.5 | GO:0019918 | peptidyl-arginine methylation, to symmetrical-dimethyl arginine(GO:0019918) |
| 0.1 | 0.2 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
| 0.1 | 0.2 | GO:0034182 | regulation of maintenance of sister chromatid cohesion(GO:0034091) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) |
| 0.1 | 0.8 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
| 0.1 | 1.0 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
| 0.1 | 0.1 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.1 | 3.2 | GO:0034453 | microtubule anchoring(GO:0034453) |
| 0.1 | 1.0 | GO:0060346 | bone trabecula formation(GO:0060346) |
| 0.1 | 0.3 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.1 | 4.1 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) termination of RNA polymerase I transcription(GO:0006363) |
| 0.1 | 2.2 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.1 | 0.7 | GO:0060452 | positive regulation of cardiac muscle contraction(GO:0060452) |
| 0.1 | 0.6 | GO:0044208 | 'de novo' AMP biosynthetic process(GO:0044208) |
| 0.1 | 0.6 | GO:1904219 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.1 | 0.2 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
| 0.1 | 0.4 | GO:0070901 | mitochondrial tRNA methylation(GO:0070901) |
| 0.1 | 1.7 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 0.1 | 0.1 | GO:1903721 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.1 | 0.3 | GO:0003095 | pressure natriuresis(GO:0003095) |
| 0.1 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.3 | GO:0046080 | dUTP metabolic process(GO:0046080) dUTP catabolic process(GO:0046081) |
| 0.1 | 0.1 | GO:0038195 | urokinase plasminogen activator signaling pathway(GO:0038195) |
| 0.1 | 0.7 | GO:0090128 | regulation of synapse maturation(GO:0090128) |
| 0.1 | 0.3 | GO:1903625 | negative regulation of DNA catabolic process(GO:1903625) |
| 0.1 | 0.3 | GO:0072156 | distal tubule morphogenesis(GO:0072156) |
| 0.1 | 0.2 | GO:0002371 | dendritic cell cytokine production(GO:0002371) |
| 0.1 | 0.5 | GO:0045915 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
| 0.1 | 0.8 | GO:2000124 | regulation of endocannabinoid signaling pathway(GO:2000124) |
| 0.1 | 0.7 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 | 0.3 | GO:0034553 | respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 0.1 | 0.9 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 0.1 | 1.1 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.1 | 0.4 | GO:0010157 | response to chlorate(GO:0010157) |
| 0.1 | 0.2 | GO:2000002 | negative regulation of DNA damage checkpoint(GO:2000002) |
| 0.1 | 0.3 | GO:1902997 | regulation of choline O-acetyltransferase activity(GO:1902769) positive regulation of choline O-acetyltransferase activity(GO:1902771) negative regulation of tau-protein kinase activity(GO:1902948) positive regulation of early endosome to recycling endosome transport(GO:1902955) negative regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902960) negative regulation of neurofibrillary tangle assembly(GO:1902997) negative regulation of aspartic-type peptidase activity(GO:1905246) |
| 0.1 | 0.1 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
| 0.1 | 0.5 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
| 0.1 | 0.3 | GO:0060023 | soft palate development(GO:0060023) |
| 0.1 | 0.5 | GO:0061760 | antifungal innate immune response(GO:0061760) |
| 0.1 | 0.3 | GO:0030505 | inorganic diphosphate transport(GO:0030505) |
| 0.1 | 0.4 | GO:0046104 | thymidine metabolic process(GO:0046104) pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.1 | 0.5 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.1 | 0.6 | GO:0032790 | ribosome disassembly(GO:0032790) |
| 0.1 | 1.2 | GO:1990118 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.1 | 0.2 | GO:2001027 | negative regulation of endothelial cell chemotaxis(GO:2001027) |
| 0.1 | 0.3 | GO:0044805 | late nucleophagy(GO:0044805) |
| 0.1 | 1.1 | GO:0032228 | regulation of synaptic transmission, GABAergic(GO:0032228) |
| 0.1 | 0.3 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.1 | 2.6 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.1 | 0.3 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.1 | 0.1 | GO:0017055 | negative regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0017055) |
| 0.1 | 1.6 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
| 0.1 | 0.4 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.1 | 0.2 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.1 | 0.2 | GO:0046021 | regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) |
| 0.1 | 0.2 | GO:0005997 | xylulose metabolic process(GO:0005997) |
| 0.1 | 0.6 | GO:0009753 | response to jasmonic acid(GO:0009753) cellular response to jasmonic acid stimulus(GO:0071395) |
| 0.1 | 0.2 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
| 0.1 | 0.2 | GO:0060488 | orthogonal dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060488) planar dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060489) lateral sprouting involved in lung morphogenesis(GO:0060490) |
| 0.1 | 1.8 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.1 | 0.6 | GO:2000234 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.1 | 0.6 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.1 | 4.2 | GO:0005978 | glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
| 0.1 | 0.4 | GO:0048733 | sebaceous gland development(GO:0048733) |
| 0.1 | 0.8 | GO:0016075 | rRNA catabolic process(GO:0016075) |
| 0.1 | 0.5 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
| 0.1 | 0.7 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.1 | 1.7 | GO:0035176 | social behavior(GO:0035176) intraspecies interaction between organisms(GO:0051703) |
| 0.1 | 4.4 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
| 0.1 | 0.7 | GO:0042420 | dopamine catabolic process(GO:0042420) |
| 0.1 | 0.6 | GO:0051036 | regulation of multivesicular body size(GO:0010796) regulation of endosome size(GO:0051036) |
| 0.1 | 3.0 | GO:0045494 | photoreceptor cell maintenance(GO:0045494) |
| 0.1 | 0.1 | GO:0021830 | interneuron migration from the subpallium to the cortex(GO:0021830) |
| 0.1 | 1.2 | GO:0042711 | maternal behavior(GO:0042711) parental behavior(GO:0060746) |
| 0.1 | 0.8 | GO:0040031 | snRNA modification(GO:0040031) |
| 0.1 | 0.7 | GO:0007379 | segment specification(GO:0007379) |
| 0.1 | 0.9 | GO:0009128 | purine nucleoside monophosphate catabolic process(GO:0009128) |
| 0.1 | 0.5 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
| 0.1 | 1.0 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.1 | 0.2 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
| 0.1 | 1.3 | GO:0042355 | fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
| 0.1 | 1.7 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.1 | 0.1 | GO:0016078 | tRNA catabolic process(GO:0016078) |
| 0.1 | 0.3 | GO:0035606 | peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 0.1 | 0.4 | GO:0071459 | protein localization to kinetochore(GO:0034501) protein localization to chromosome, centromeric region(GO:0071459) |
| 0.1 | 0.4 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
| 0.1 | 0.6 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.1 | 0.2 | GO:0060965 | negative regulation of gene silencing by miRNA(GO:0060965) |
| 0.1 | 1.6 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.1 | 0.7 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.1 | 0.3 | GO:0002731 | negative regulation of dendritic cell cytokine production(GO:0002731) |
| 0.1 | 0.3 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 0.1 | 0.1 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
| 0.1 | 0.8 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
| 0.1 | 0.9 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.1 | 0.3 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.1 | 0.3 | GO:0001956 | positive regulation of neurotransmitter secretion(GO:0001956) |
| 0.1 | 0.6 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
| 0.1 | 0.6 | GO:0090178 | regulation of establishment of planar polarity involved in neural tube closure(GO:0090178) |
| 0.1 | 0.7 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.1 | 0.6 | GO:0045617 | negative regulation of keratinocyte differentiation(GO:0045617) |
| 0.1 | 2.3 | GO:1900078 | positive regulation of cellular response to insulin stimulus(GO:1900078) |
| 0.1 | 0.9 | GO:0051187 | cofactor catabolic process(GO:0051187) |
| 0.1 | 0.9 | GO:0071313 | cellular response to caffeine(GO:0071313) |
| 0.1 | 0.1 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
| 0.1 | 0.4 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
| 0.1 | 0.4 | GO:0060179 | male mating behavior(GO:0060179) |
| 0.1 | 0.5 | GO:0010481 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.1 | 0.1 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
| 0.1 | 4.2 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.1 | 0.2 | GO:1990569 | UDP-N-acetylglucosamine transport(GO:0015788) UDP-N-acetylglucosamine transmembrane transport(GO:1990569) |
| 0.1 | 0.8 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.1 | 0.2 | GO:1990262 | regulation of anti-Mullerian hormone signaling pathway(GO:1902612) negative regulation of anti-Mullerian hormone signaling pathway(GO:1902613) anti-Mullerian hormone signaling pathway(GO:1990262) |
| 0.1 | 1.0 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.1 | 0.2 | GO:0061386 | closure of optic fissure(GO:0061386) |
| 0.1 | 1.4 | GO:0071625 | vocalization behavior(GO:0071625) |
| 0.1 | 1.4 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.1 | 1.9 | GO:0010259 | multicellular organism aging(GO:0010259) |
| 0.1 | 0.4 | GO:0042851 | L-alanine metabolic process(GO:0042851) L-alanine catabolic process(GO:0042853) |
| 0.1 | 2.0 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.1 | 0.4 | GO:1902416 | positive regulation of mRNA binding(GO:1902416) |
| 0.1 | 0.3 | GO:0072402 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) |
| 0.1 | 0.2 | GO:0071139 | resolution of recombination intermediates(GO:0071139) resolution of mitotic recombination intermediates(GO:0071140) |
| 0.1 | 0.4 | GO:0003335 | corneocyte development(GO:0003335) |
| 0.1 | 0.3 | GO:0048075 | positive regulation of eye pigmentation(GO:0048075) |
| 0.1 | 0.2 | GO:0048484 | enteric nervous system development(GO:0048484) |
| 0.1 | 0.3 | GO:0072502 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.1 | 0.9 | GO:0051189 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.1 | 0.3 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
| 0.1 | 0.6 | GO:0010533 | regulation of activation of Janus kinase activity(GO:0010533) |
| 0.1 | 0.5 | GO:0051451 | myoblast migration(GO:0051451) |
| 0.1 | 0.8 | GO:0001778 | plasma membrane repair(GO:0001778) |
| 0.1 | 0.4 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
| 0.1 | 1.4 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
| 0.1 | 0.3 | GO:0099590 | neurotransmitter receptor internalization(GO:0099590) |
| 0.1 | 0.7 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 0.1 | 0.9 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.1 | 1.5 | GO:0007638 | mechanosensory behavior(GO:0007638) |
| 0.1 | 1.0 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
| 0.1 | 0.1 | GO:2000969 | positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
| 0.1 | 1.6 | GO:0050908 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.1 | 0.5 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
| 0.1 | 0.4 | GO:0048254 | snoRNA localization(GO:0048254) |
| 0.1 | 0.3 | GO:0032377 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.1 | 0.8 | GO:0010459 | negative regulation of heart rate(GO:0010459) |
| 0.1 | 0.2 | GO:0002024 | diet induced thermogenesis(GO:0002024) |
| 0.1 | 0.6 | GO:0036486 | trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) |
| 0.1 | 0.2 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
| 0.1 | 0.1 | GO:2000809 | positive regulation of synaptic vesicle clustering(GO:2000809) |
| 0.1 | 0.2 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
| 0.1 | 0.3 | GO:2001106 | regulation of Rho guanyl-nucleotide exchange factor activity(GO:2001106) |
| 0.1 | 0.2 | GO:0015853 | adenine transport(GO:0015853) |
| 0.1 | 1.2 | GO:0009067 | aspartate family amino acid biosynthetic process(GO:0009067) |
| 0.1 | 0.1 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.1 | 1.1 | GO:0035640 | exploration behavior(GO:0035640) |
| 0.1 | 1.4 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
| 0.1 | 0.6 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 0.1 | 0.5 | GO:0034036 | purine ribonucleoside bisphosphate biosynthetic process(GO:0034036) 3'-phosphoadenosine 5'-phosphosulfate biosynthetic process(GO:0050428) |
| 0.1 | 0.3 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.1 | 0.4 | GO:0070914 | UV-damage excision repair(GO:0070914) |
| 0.1 | 0.3 | GO:0070987 | error-free translesion synthesis(GO:0070987) |
| 0.1 | 1.0 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
| 0.1 | 0.3 | GO:0045760 | positive regulation of action potential(GO:0045760) |
| 0.1 | 2.8 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
| 0.1 | 1.3 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
| 0.1 | 1.1 | GO:0030517 | negative regulation of axon extension(GO:0030517) |
| 0.1 | 0.1 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.1 | 0.3 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.1 | 0.2 | GO:0009125 | nucleoside monophosphate catabolic process(GO:0009125) |
| 0.1 | 1.9 | GO:0090314 | positive regulation of protein targeting to membrane(GO:0090314) |
| 0.1 | 0.1 | GO:1904861 | excitatory synapse assembly(GO:1904861) |
| 0.1 | 0.3 | GO:0002097 | tRNA wobble base modification(GO:0002097) |
| 0.1 | 0.5 | GO:0086069 | bundle of His cell to Purkinje myocyte communication(GO:0086069) |
| 0.1 | 0.5 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
| 0.1 | 1.4 | GO:0050667 | homocysteine metabolic process(GO:0050667) |
| 0.1 | 0.2 | GO:0032203 | telomere formation via telomerase(GO:0032203) |
| 0.1 | 0.9 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
| 0.1 | 0.3 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
| 0.1 | 0.5 | GO:1990504 | dense core granule exocytosis(GO:1990504) |
| 0.1 | 0.5 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
| 0.1 | 0.1 | GO:0019249 | lactate biosynthetic process(GO:0019249) |
| 0.1 | 0.5 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
| 0.1 | 0.4 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.1 | 0.1 | GO:0014052 | regulation of gamma-aminobutyric acid secretion(GO:0014052) |
| 0.1 | 0.2 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.1 | 1.2 | GO:0009954 | proximal/distal pattern formation(GO:0009954) |
| 0.1 | 0.2 | GO:0000117 | regulation of transcription involved in G2/M transition of mitotic cell cycle(GO:0000117) |
| 0.1 | 0.7 | GO:0031497 | chromatin assembly(GO:0031497) |
| 0.1 | 0.4 | GO:0090669 | telomerase RNA stabilization(GO:0090669) |
| 0.1 | 0.4 | GO:0003360 | brainstem development(GO:0003360) |
| 0.1 | 0.1 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.1 | 0.3 | GO:0009447 | putrescine catabolic process(GO:0009447) |
| 0.1 | 0.7 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.1 | 0.5 | GO:0003374 | dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
| 0.1 | 0.9 | GO:0033227 | dsRNA transport(GO:0033227) |
| 0.1 | 0.1 | GO:0060022 | hard palate development(GO:0060022) |
| 0.1 | 0.2 | GO:0048867 | ganglion mother cell fate determination(GO:0007402) stem cell fate determination(GO:0048867) |
| 0.1 | 3.4 | GO:0034260 | negative regulation of GTPase activity(GO:0034260) |
| 0.1 | 0.3 | GO:0046320 | regulation of fatty acid oxidation(GO:0046320) |
| 0.1 | 0.3 | GO:0043335 | protein unfolding(GO:0043335) |
| 0.1 | 0.9 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
| 0.1 | 0.6 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.1 | 0.7 | GO:0006105 | succinate metabolic process(GO:0006105) |
| 0.1 | 1.9 | GO:0051281 | positive regulation of release of sequestered calcium ion into cytosol(GO:0051281) |
| 0.1 | 0.2 | GO:0043328 | protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.1 | 0.6 | GO:1990034 | calcium ion export from cell(GO:1990034) |
| 0.1 | 0.2 | GO:0017186 | peptidyl-pyroglutamic acid biosynthetic process, using glutaminyl-peptide cyclotransferase(GO:0017186) |
| 0.1 | 1.1 | GO:0005980 | glycogen catabolic process(GO:0005980) |
| 0.1 | 0.1 | GO:0036324 | vascular endothelial growth factor receptor-2 signaling pathway(GO:0036324) |
| 0.1 | 0.2 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
| 0.1 | 1.1 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
| 0.1 | 0.4 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.1 | 0.2 | GO:0034970 | histone H3-R2 methylation(GO:0034970) |
| 0.1 | 0.1 | GO:0032222 | regulation of synaptic transmission, cholinergic(GO:0032222) |
| 0.1 | 0.5 | GO:1903895 | negative regulation of IRE1-mediated unfolded protein response(GO:1903895) |
| 0.1 | 1.2 | GO:0035278 | miRNA mediated inhibition of translation(GO:0035278) negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
| 0.1 | 0.1 | GO:0000706 | meiotic DNA double-strand break processing(GO:0000706) double-strand break repair involved in meiotic recombination(GO:1990918) |
| 0.1 | 0.5 | GO:0097319 | fructose transport(GO:0015755) fructose import(GO:0032445) carbohydrate import into cell(GO:0097319) carbohydrate import across plasma membrane(GO:0098704) fructose import across plasma membrane(GO:1990539) |
| 0.1 | 1.2 | GO:1904707 | positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.1 | 0.5 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.1 | 0.5 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.1 | 0.3 | GO:0046668 | regulation of retinal cell programmed cell death(GO:0046668) |
| 0.1 | 1.6 | GO:0007019 | microtubule depolymerization(GO:0007019) |
| 0.1 | 0.7 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.1 | 0.8 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.1 | 0.3 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.1 | 0.8 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.1 | 0.2 | GO:0038155 | interleukin-23-mediated signaling pathway(GO:0038155) positive regulation of T-helper 17 cell lineage commitment(GO:2000330) |
| 0.1 | 0.5 | GO:0043584 | nose development(GO:0043584) |
| 0.1 | 1.0 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.1 | 0.3 | GO:2000435 | regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
| 0.1 | 0.1 | GO:0006533 | aspartate catabolic process(GO:0006533) |
| 0.1 | 0.1 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
| 0.1 | 0.1 | GO:0042636 | negative regulation of hair cycle(GO:0042636) |
| 0.1 | 0.5 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
| 0.1 | 0.5 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.1 | 0.1 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
| 0.1 | 0.1 | GO:0009111 | vitamin catabolic process(GO:0009111) fat-soluble vitamin catabolic process(GO:0042363) |
| 0.1 | 0.3 | GO:0042073 | intraciliary transport(GO:0042073) |
| 0.1 | 0.1 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.1 | 0.3 | GO:0009972 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
| 0.1 | 1.7 | GO:0000266 | mitochondrial fission(GO:0000266) |
| 0.1 | 0.1 | GO:0045005 | DNA-dependent DNA replication maintenance of fidelity(GO:0045005) |
| 0.1 | 0.2 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
| 0.1 | 0.6 | GO:0030238 | male sex determination(GO:0030238) |
| 0.1 | 0.2 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) |
| 0.1 | 0.3 | GO:0010960 | magnesium ion homeostasis(GO:0010960) |
| 0.1 | 0.1 | GO:0050720 | interleukin-1 beta biosynthetic process(GO:0050720) |
| 0.1 | 0.3 | GO:0015888 | thiamine transport(GO:0015888) |
| 0.1 | 0.3 | GO:0034224 | cellular response to zinc ion starvation(GO:0034224) |
| 0.1 | 2.5 | GO:0042407 | cristae formation(GO:0042407) |
| 0.1 | 0.9 | GO:0032463 | negative regulation of protein homooligomerization(GO:0032463) |
| 0.1 | 0.7 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
| 0.1 | 0.4 | GO:0045903 | positive regulation of translational fidelity(GO:0045903) |
| 0.1 | 0.1 | GO:1904526 | regulation of microtubule binding(GO:1904526) |
| 0.1 | 0.1 | GO:1902369 | negative regulation of RNA catabolic process(GO:1902369) |
| 0.1 | 0.2 | GO:0071306 | regulation of cholesterol transporter activity(GO:0060694) cellular response to vitamin E(GO:0071306) pancreatic stellate cell proliferation(GO:0072343) response to metformin(GO:1901558) regulation of pancreatic stellate cell proliferation(GO:2000229) negative regulation of pancreatic stellate cell proliferation(GO:2000230) |
| 0.1 | 0.2 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
| 0.1 | 0.1 | GO:0007079 | mitotic chromosome movement towards spindle pole(GO:0007079) |
| 0.1 | 0.5 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.1 | 0.2 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.1 | 0.5 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.1 | 0.1 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 0.1 | 0.4 | GO:2000679 | positive regulation of transcription regulatory region DNA binding(GO:2000679) |
| 0.1 | 1.8 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.1 | 0.2 | GO:0000354 | cis assembly of pre-catalytic spliceosome(GO:0000354) |
| 0.1 | 0.1 | GO:0035608 | protein deglutamylation(GO:0035608) |
| 0.1 | 0.8 | GO:0046596 | regulation of viral entry into host cell(GO:0046596) negative regulation of viral entry into host cell(GO:0046597) |
| 0.1 | 0.1 | GO:0051955 | regulation of amino acid transport(GO:0051955) |
| 0.1 | 0.4 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
| 0.1 | 0.4 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.1 | 0.2 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.1 | 0.2 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.1 | 0.1 | GO:0014010 | Schwann cell proliferation(GO:0014010) |
| 0.1 | 0.2 | GO:0072369 | regulation of lipid transport by positive regulation of transcription from RNA polymerase II promoter(GO:0072369) |
| 0.1 | 0.1 | GO:1904379 | protein localization to cytosolic proteasome complex(GO:1904327) protein localization to cytosolic proteasome complex involved in ERAD pathway(GO:1904379) |
| 0.1 | 0.4 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.1 | 0.1 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
| 0.1 | 0.5 | GO:0002192 | IRES-dependent translational initiation(GO:0002192) |
| 0.1 | 0.1 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.1 | 0.1 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
| 0.1 | 0.5 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
| 0.1 | 1.4 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.1 | 0.2 | GO:0052422 | modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.1 | 0.1 | GO:0033594 | response to hydroxyisoflavone(GO:0033594) |
| 0.1 | 0.3 | GO:0006312 | mitotic recombination(GO:0006312) |
| 0.1 | 0.5 | GO:0010837 | regulation of keratinocyte proliferation(GO:0010837) |
| 0.1 | 0.2 | GO:2001300 | lipoxin metabolic process(GO:2001300) |
| 0.1 | 0.1 | GO:0035634 | response to stilbenoid(GO:0035634) |
| 0.1 | 0.2 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.1 | 0.1 | GO:0060406 | positive regulation of penile erection(GO:0060406) |
| 0.1 | 0.1 | GO:0002525 | acute inflammatory response to non-antigenic stimulus(GO:0002525) regulation of acute inflammatory response to non-antigenic stimulus(GO:0002877) positive regulation of acute inflammatory response to non-antigenic stimulus(GO:0002879) |
| 0.1 | 0.2 | GO:0097026 | dendritic cell dendrite assembly(GO:0097026) |
| 0.1 | 0.3 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.1 | 5.2 | GO:0006334 | nucleosome assembly(GO:0006334) |
| 0.1 | 0.7 | GO:0090343 | positive regulation of cell aging(GO:0090343) |
| 0.1 | 0.3 | GO:0045408 | regulation of interleukin-6 biosynthetic process(GO:0045408) |
| 0.1 | 0.2 | GO:0072180 | mesonephric duct morphogenesis(GO:0072180) |
| 0.1 | 0.9 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.1 | 0.1 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
| 0.1 | 0.2 | GO:2000313 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
| 0.1 | 0.2 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.1 | 0.9 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.1 | 0.3 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.1 | 0.5 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
| 0.1 | 0.3 | GO:0071474 | cellular hyperosmotic response(GO:0071474) |
| 0.1 | 0.8 | GO:0006506 | GPI anchor metabolic process(GO:0006505) GPI anchor biosynthetic process(GO:0006506) |
| 0.1 | 0.2 | GO:0072719 | cellular response to cisplatin(GO:0072719) |
| 0.1 | 0.2 | GO:0030860 | regulation of polarized epithelial cell differentiation(GO:0030860) |
| 0.1 | 0.1 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
| 0.1 | 0.2 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
| 0.1 | 0.5 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 0.1 | 0.8 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
| 0.1 | 1.6 | GO:0050779 | RNA destabilization(GO:0050779) |
| 0.1 | 0.4 | GO:0052696 | flavonoid glucuronidation(GO:0052696) xenobiotic glucuronidation(GO:0052697) |
| 0.1 | 1.1 | GO:1904659 | hexose transmembrane transport(GO:0035428) glucose transmembrane transport(GO:1904659) |
| 0.1 | 0.2 | GO:1900225 | regulation of NLRP3 inflammasome complex assembly(GO:1900225) |
| 0.1 | 0.2 | GO:1903803 | glutamine secretion(GO:0010585) L-glutamine import(GO:0036229) L-glutamine import into cell(GO:1903803) |
| 0.1 | 0.4 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
| 0.1 | 0.1 | GO:0061056 | sclerotome development(GO:0061056) |
| 0.1 | 0.1 | GO:0072038 | mesenchymal stem cell maintenance involved in nephron morphogenesis(GO:0072038) |
| 0.1 | 0.4 | GO:0006600 | creatine metabolic process(GO:0006600) |
| 0.1 | 0.3 | GO:0001692 | histamine metabolic process(GO:0001692) |
| 0.1 | 0.3 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.1 | 0.2 | GO:0060332 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
| 0.0 | 0.0 | GO:0021936 | regulation of cerebellar granule cell precursor proliferation(GO:0021936) |
| 0.0 | 0.2 | GO:2000254 | regulation of male germ cell proliferation(GO:2000254) |
| 0.0 | 0.6 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
| 0.0 | 0.2 | GO:1902101 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
| 0.0 | 0.5 | GO:0023041 | neuronal signal transduction(GO:0023041) |
| 0.0 | 0.1 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
| 0.0 | 0.2 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
| 0.0 | 0.2 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
| 0.0 | 0.0 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
| 0.0 | 0.3 | GO:0006657 | CDP-choline pathway(GO:0006657) |
| 0.0 | 6.2 | GO:0070268 | cornification(GO:0070268) |
| 0.0 | 0.1 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.0 | 0.7 | GO:0060285 | cilium-dependent cell motility(GO:0060285) |
| 0.0 | 0.3 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.0 | 0.1 | GO:1904730 | negative regulation of intestinal phytosterol absorption(GO:0010949) negative regulation of intestinal cholesterol absorption(GO:0045796) intestinal phytosterol absorption(GO:0060752) negative regulation of intestinal lipid absorption(GO:1904730) |
| 0.0 | 0.7 | GO:2000772 | regulation of cellular senescence(GO:2000772) |
| 0.0 | 0.3 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
| 0.0 | 0.1 | GO:0033127 | regulation of histone phosphorylation(GO:0033127) |
| 0.0 | 0.4 | GO:0034625 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.0 | 0.1 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
| 0.0 | 1.7 | GO:0006383 | transcription from RNA polymerase III promoter(GO:0006383) |
| 0.0 | 0.1 | GO:0044537 | regulation of circulating fibrinogen levels(GO:0044537) |
| 0.0 | 0.5 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.0 | 0.3 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.0 | 0.2 | GO:0035553 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.0 | 0.4 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
| 0.0 | 0.0 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
| 0.0 | 0.5 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
| 0.0 | 0.2 | GO:0045002 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) double-strand break repair via single-strand annealing(GO:0045002) |
| 0.0 | 0.3 | GO:0002778 | antimicrobial peptide production(GO:0002775) antibacterial peptide production(GO:0002778) |
| 0.0 | 2.6 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
| 0.0 | 0.0 | GO:0046684 | response to pyrethroid(GO:0046684) |
| 0.0 | 0.0 | GO:0060584 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
| 0.0 | 0.1 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
| 0.0 | 0.2 | GO:0046909 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.0 | 0.3 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.0 | 0.1 | GO:0071415 | cellular response to purine-containing compound(GO:0071415) |
| 0.0 | 0.2 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.0 | 0.4 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.0 | 0.1 | GO:0001807 | regulation of type IV hypersensitivity(GO:0001807) |
| 0.0 | 0.1 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
| 0.0 | 0.6 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.0 | 1.2 | GO:0045879 | negative regulation of smoothened signaling pathway(GO:0045879) |
| 0.0 | 0.1 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
| 0.0 | 0.1 | GO:0097577 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.0 | 0.4 | GO:0045724 | positive regulation of cilium assembly(GO:0045724) |
| 0.0 | 0.1 | GO:2000374 | regulation of oxygen metabolic process(GO:2000374) |
| 0.0 | 0.0 | GO:0002232 | leukocyte chemotaxis involved in inflammatory response(GO:0002232) |
| 0.0 | 0.2 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 0.0 | 0.0 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.0 | 0.6 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
| 0.0 | 1.7 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.0 | 0.2 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.0 | 1.4 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.0 | 0.4 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
| 0.0 | 0.1 | GO:0061047 | regulation of branching involved in lung morphogenesis(GO:0061046) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
| 0.0 | 0.0 | GO:0043697 | dedifferentiation(GO:0043696) cell dedifferentiation(GO:0043697) |
| 0.0 | 0.4 | GO:0051026 | chiasma assembly(GO:0051026) |
| 0.0 | 0.1 | GO:0010044 | response to aluminum ion(GO:0010044) |
| 0.0 | 0.2 | GO:0030047 | actin modification(GO:0030047) |
| 0.0 | 0.1 | GO:0070839 | divalent metal ion export(GO:0070839) |
| 0.0 | 0.1 | GO:2001168 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.0 | 0.2 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.0 | 0.8 | GO:0050901 | leukocyte tethering or rolling(GO:0050901) |
| 0.0 | 0.3 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
| 0.0 | 0.2 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.0 | 0.2 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.0 | 0.2 | GO:0045060 | negative thymic T cell selection(GO:0045060) |
| 0.0 | 0.4 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
| 0.0 | 0.1 | GO:0015860 | purine nucleoside transmembrane transport(GO:0015860) |
| 0.0 | 0.2 | GO:1901387 | positive regulation of voltage-gated calcium channel activity(GO:1901387) |
| 0.0 | 0.1 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
| 0.0 | 0.1 | GO:0032487 | regulation of Rap protein signal transduction(GO:0032487) |
| 0.0 | 1.3 | GO:0050775 | positive regulation of dendrite morphogenesis(GO:0050775) |
| 0.0 | 0.1 | GO:0090290 | positive regulation of osteoclast proliferation(GO:0090290) |
| 0.0 | 0.0 | GO:0021546 | rhombomere development(GO:0021546) |
| 0.0 | 0.1 | GO:0035915 | pore formation in membrane of other organism(GO:0035915) |
| 0.0 | 1.0 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.0 | 0.1 | GO:0051039 | histone displacement(GO:0001207) positive regulation of transcription involved in meiotic cell cycle(GO:0051039) |
| 0.0 | 0.2 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
| 0.0 | 0.6 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.0 | 0.2 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.0 | 0.2 | GO:0097237 | cellular response to toxic substance(GO:0097237) |
| 0.0 | 0.3 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.0 | 0.2 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.0 | 0.2 | GO:0007512 | adult heart development(GO:0007512) |
| 0.0 | 0.1 | GO:0019563 | glycerol catabolic process(GO:0019563) |
| 0.0 | 0.4 | GO:0070673 | response to interleukin-18(GO:0070673) |
| 0.0 | 0.1 | GO:0034127 | regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034127) negative regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034128) |
| 0.0 | 0.0 | GO:0048818 | positive regulation of hair follicle maturation(GO:0048818) positive regulation of catagen(GO:0051795) |
| 0.0 | 0.3 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
| 0.0 | 0.3 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.0 | 0.2 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.0 | 0.2 | GO:0010868 | negative regulation of triglyceride biosynthetic process(GO:0010868) regulation of SREBP signaling pathway(GO:2000638) negative regulation of SREBP signaling pathway(GO:2000639) |
| 0.0 | 0.9 | GO:0006414 | translational elongation(GO:0006414) |
| 0.0 | 0.0 | GO:0046040 | IMP metabolic process(GO:0046040) |
| 0.0 | 0.0 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
| 0.0 | 0.1 | GO:0002725 | negative regulation of T cell cytokine production(GO:0002725) |
| 0.0 | 0.4 | GO:2001259 | positive regulation of cation channel activity(GO:2001259) |
| 0.0 | 0.1 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
| 0.0 | 0.5 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
| 0.0 | 0.0 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
| 0.0 | 0.0 | GO:0060374 | mast cell differentiation(GO:0060374) |
| 0.0 | 0.2 | GO:0030913 | paranodal junction assembly(GO:0030913) |
| 0.0 | 0.0 | GO:0046833 | positive regulation of nucleobase-containing compound transport(GO:0032241) positive regulation of RNA export from nucleus(GO:0046833) |
| 0.0 | 1.2 | GO:0086010 | membrane depolarization during action potential(GO:0086010) |
| 0.0 | 1.2 | GO:0046037 | GMP metabolic process(GO:0046037) |
| 0.0 | 0.1 | GO:0019521 | aldonic acid metabolic process(GO:0019520) D-gluconate metabolic process(GO:0019521) |
| 0.0 | 0.1 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
| 0.0 | 0.1 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
| 0.0 | 0.1 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 0.0 | 0.4 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
| 0.0 | 0.3 | GO:0003215 | cardiac right ventricle morphogenesis(GO:0003215) |
| 0.0 | 0.2 | GO:0006562 | proline catabolic process(GO:0006562) proline catabolic process to glutamate(GO:0010133) |
| 0.0 | 0.4 | GO:0006782 | protoporphyrinogen IX biosynthetic process(GO:0006782) |
| 0.0 | 0.2 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
| 0.0 | 0.2 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 0.0 | 0.1 | GO:0036518 | chemorepulsion of dopaminergic neuron axon(GO:0036518) |
| 0.0 | 0.0 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.0 | 0.1 | GO:0070316 | regulation of G0 to G1 transition(GO:0070316) |
| 0.0 | 0.2 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.0 | 0.1 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
| 0.0 | 0.4 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
| 0.0 | 0.1 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.0 | 0.1 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
| 0.0 | 0.5 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.0 | 0.4 | GO:0002710 | negative regulation of T cell mediated immunity(GO:0002710) |
| 0.0 | 0.4 | GO:1902165 | regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902165) |
| 0.0 | 0.2 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
| 0.0 | 0.1 | GO:0010269 | response to selenium ion(GO:0010269) |
| 0.0 | 0.1 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
| 0.0 | 2.4 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.0 | 0.1 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.0 | 0.1 | GO:0033131 | regulation of glucokinase activity(GO:0033131) regulation of hexokinase activity(GO:1903299) |
| 0.0 | 0.9 | GO:0009409 | response to cold(GO:0009409) |
| 0.0 | 0.2 | GO:0032100 | positive regulation of response to food(GO:0032097) positive regulation of appetite(GO:0032100) |
| 0.0 | 0.1 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.0 | 1.2 | GO:0035329 | hippo signaling(GO:0035329) |
| 0.0 | 0.1 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.0 | 0.4 | GO:0031034 | myosin filament assembly(GO:0031034) |
| 0.0 | 0.3 | GO:1900746 | regulation of vascular endothelial growth factor signaling pathway(GO:1900746) |
| 0.0 | 0.7 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
| 0.0 | 0.8 | GO:0050982 | detection of mechanical stimulus(GO:0050982) |
| 0.0 | 0.2 | GO:0072592 | oxygen metabolic process(GO:0072592) |
| 0.0 | 0.7 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.0 | 0.4 | GO:0051665 | membrane raft localization(GO:0051665) |
| 0.0 | 0.1 | GO:0043396 | corticotropin-releasing hormone secretion(GO:0043396) regulation of corticotropin-releasing hormone secretion(GO:0043397) |
| 0.0 | 0.1 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
| 0.0 | 3.3 | GO:0006415 | translational termination(GO:0006415) |
| 0.0 | 0.1 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
| 0.0 | 0.1 | GO:0090024 | negative regulation of granulocyte chemotaxis(GO:0071623) negative regulation of neutrophil chemotaxis(GO:0090024) negative regulation of neutrophil migration(GO:1902623) |
| 0.0 | 0.1 | GO:1904729 | regulation of intestinal cholesterol absorption(GO:0030300) regulation of intestinal lipid absorption(GO:1904729) |
| 0.0 | 0.1 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
| 0.0 | 0.1 | GO:0048291 | isotype switching to IgG isotypes(GO:0048291) regulation of isotype switching to IgG isotypes(GO:0048302) |
| 0.0 | 0.1 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
| 0.0 | 0.2 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
| 0.0 | 0.1 | GO:0036269 | swimming behavior(GO:0036269) |
| 0.0 | 0.0 | GO:0072178 | nephric duct morphogenesis(GO:0072178) |
| 0.0 | 0.1 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
| 0.0 | 0.1 | GO:0035754 | B cell chemotaxis(GO:0035754) |
| 0.0 | 1.0 | GO:0021762 | substantia nigra development(GO:0021762) |
| 0.0 | 0.1 | GO:0070269 | pyroptosis(GO:0070269) |
| 0.0 | 0.3 | GO:0002251 | organ or tissue specific immune response(GO:0002251) |
| 0.0 | 0.1 | GO:0090292 | nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.0 | 0.2 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.0 | 0.1 | GO:0008628 | hormone-mediated apoptotic signaling pathway(GO:0008628) |
| 0.0 | 0.2 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.0 | 0.0 | GO:0042996 | regulation of Golgi to plasma membrane protein transport(GO:0042996) |
| 0.0 | 0.2 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.0 | 0.0 | GO:0061055 | myotome development(GO:0061055) |
| 0.0 | 0.2 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
| 0.0 | 1.0 | GO:0051306 | regulation of mitotic sister chromatid separation(GO:0010965) mitotic sister chromatid separation(GO:0051306) |
| 0.0 | 0.3 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.0 | 0.4 | GO:0010596 | negative regulation of endothelial cell migration(GO:0010596) |
| 0.0 | 0.0 | GO:0045141 | meiotic telomere clustering(GO:0045141) |
| 0.0 | 0.1 | GO:0000098 | sulfur amino acid catabolic process(GO:0000098) |
| 0.0 | 0.1 | GO:1903899 | positive regulation of PERK-mediated unfolded protein response(GO:1903899) |
| 0.0 | 0.1 | GO:0072235 | metanephric distal tubule development(GO:0072235) |
| 0.0 | 0.1 | GO:0016137 | glycoside metabolic process(GO:0016137) |
| 0.0 | 0.1 | GO:2000104 | negative regulation of DNA-dependent DNA replication(GO:2000104) |
| 0.0 | 0.3 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
| 0.0 | 0.1 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
| 0.0 | 0.1 | GO:0021952 | central nervous system projection neuron axonogenesis(GO:0021952) |
| 0.0 | 0.2 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.0 | 0.1 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
| 0.0 | 0.1 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.0 | 0.0 | GO:0003097 | renal water transport(GO:0003097) |
| 0.0 | 0.1 | GO:0055083 | monovalent inorganic anion homeostasis(GO:0055083) |
| 0.0 | 0.1 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
| 0.0 | 0.1 | GO:0042346 | positive regulation of NF-kappaB import into nucleus(GO:0042346) |
| 0.0 | 2.2 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.0 | 0.1 | GO:0003356 | regulation of cilium beat frequency(GO:0003356) |
| 0.0 | 0.2 | GO:0097066 | response to thyroid hormone(GO:0097066) |
| 0.0 | 0.4 | GO:0044872 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.0 | 0.1 | GO:1903564 | regulation of protein localization to cilium(GO:1903564) |
| 0.0 | 0.2 | GO:0048853 | forebrain morphogenesis(GO:0048853) |
| 0.0 | 0.1 | GO:0002093 | auditory receptor cell morphogenesis(GO:0002093) auditory receptor cell stereocilium organization(GO:0060088) |
| 0.0 | 0.2 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
| 0.0 | 0.2 | GO:0051290 | protein heterotetramerization(GO:0051290) |
| 0.0 | 0.6 | GO:0009062 | fatty acid catabolic process(GO:0009062) |
| 0.0 | 0.3 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
| 0.0 | 0.0 | GO:2001287 | negative regulation of caveolin-mediated endocytosis(GO:2001287) |
| 0.0 | 0.1 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.0 | 0.0 | GO:0080154 | regulation of fertilization(GO:0080154) |
| 0.0 | 0.1 | GO:1904587 | response to glycoprotein(GO:1904587) |
| 0.0 | 0.0 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.0 | 0.0 | GO:0030916 | otic vesicle formation(GO:0030916) |
| 0.0 | 0.0 | GO:0007619 | courtship behavior(GO:0007619) female courtship behavior(GO:0008050) |
| 0.0 | 0.1 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.0 | 0.3 | GO:0032754 | positive regulation of interleukin-5 production(GO:0032754) |
| 0.0 | 0.1 | GO:0036060 | filtration diaphragm assembly(GO:0036058) slit diaphragm assembly(GO:0036060) negative regulation of retinal ganglion cell axon guidance(GO:0090260) |
| 0.0 | 0.1 | GO:0060441 | epithelial tube branching involved in lung morphogenesis(GO:0060441) |
| 0.0 | 1.6 | GO:0018410 | C-terminal protein amino acid modification(GO:0018410) |
| 0.0 | 0.1 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
| 0.0 | 0.2 | GO:0051898 | negative regulation of protein kinase B signaling(GO:0051898) |
| 0.0 | 0.1 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
| 0.0 | 0.1 | GO:0045023 | G0 to G1 transition(GO:0045023) |
| 0.0 | 0.0 | GO:0061582 | intestinal epithelial cell migration(GO:0061582) |
| 0.0 | 0.1 | GO:0021511 | spinal cord patterning(GO:0021511) |
| 0.0 | 0.1 | GO:2000312 | regulation of kainate selective glutamate receptor activity(GO:2000312) |
| 0.0 | 0.1 | GO:0070508 | sterol import(GO:0035376) cholesterol import(GO:0070508) |
| 0.0 | 0.0 | GO:0010889 | regulation of sequestering of triglyceride(GO:0010889) |
| 0.0 | 0.2 | GO:1903830 | magnesium ion transmembrane transport(GO:1903830) |
| 0.0 | 0.0 | GO:0038183 | bile acid signaling pathway(GO:0038183) |
| 0.0 | 0.1 | GO:2000580 | positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
| 0.0 | 0.3 | GO:0051923 | sulfation(GO:0051923) |
| 0.0 | 0.1 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.0 | 0.5 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
| 0.0 | 0.1 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
| 0.0 | 0.1 | GO:0035879 | plasma membrane lactate transport(GO:0035879) |
| 0.0 | 0.1 | GO:0006108 | malate metabolic process(GO:0006108) |
| 0.0 | 0.1 | GO:0042574 | retinal metabolic process(GO:0042574) |
| 0.0 | 0.1 | GO:0061577 | calcium ion transmembrane transport via high voltage-gated calcium channel(GO:0061577) |
| 0.0 | 0.2 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.0 | 0.8 | GO:0031424 | keratinization(GO:0031424) |
| 0.0 | 0.1 | GO:0045204 | MAPK export from nucleus(GO:0045204) |
| 0.0 | 0.2 | GO:0072539 | T-helper 17 cell differentiation(GO:0072539) |
| 0.0 | 0.1 | GO:0030432 | peristalsis(GO:0030432) |
| 0.0 | 0.0 | GO:0061626 | pharyngeal arch artery morphogenesis(GO:0061626) |
| 0.0 | 0.1 | GO:0031441 | negative regulation of mRNA 3'-end processing(GO:0031441) |
| 0.0 | 0.1 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.0 | 0.1 | GO:0042262 | DNA protection(GO:0042262) |
| 0.0 | 0.0 | GO:2000157 | negative regulation of protein deubiquitination(GO:0090086) regulation of protein K48-linked deubiquitination(GO:1903093) negative regulation of protein K48-linked deubiquitination(GO:1903094) negative regulation of ubiquitin-specific protease activity(GO:2000157) |
| 0.0 | 0.0 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) |
| 0.0 | 0.1 | GO:0042984 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.0 | 0.0 | GO:1904044 | response to aldosterone(GO:1904044) |
| 0.0 | 0.1 | GO:0015705 | iodide transport(GO:0015705) |
| 0.0 | 0.0 | GO:0060467 | negative regulation of fertilization(GO:0060467) |
| 0.0 | 0.0 | GO:2000825 | positive regulation of androgen receptor activity(GO:2000825) |
| 0.0 | 0.2 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.0 | 0.1 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
| 0.0 | 0.1 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
| 0.0 | 0.1 | GO:0048087 | positive regulation of developmental pigmentation(GO:0048087) |
| 0.0 | 0.1 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.0 | 0.0 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
| 0.0 | 0.0 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.0 | 1.4 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
| 0.0 | 0.1 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.0 | 0.1 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
| 0.0 | 0.1 | GO:0048147 | negative regulation of fibroblast proliferation(GO:0048147) |
| 0.0 | 0.1 | GO:0036150 | phosphatidylserine acyl-chain remodeling(GO:0036150) |
Gene overrepresentation in cellular component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.1 | 1.1 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 1.1 | 4.5 | GO:0043293 | apoptosome(GO:0043293) |
| 1.1 | 5.4 | GO:0032449 | CBM complex(GO:0032449) |
| 0.9 | 5.5 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 0.7 | 3.3 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.6 | 2.6 | GO:0032798 | Swi5-Sfr1 complex(GO:0032798) |
| 0.6 | 2.6 | GO:0031436 | BRCA1-BARD1 complex(GO:0031436) |
| 0.6 | 0.6 | GO:0098592 | cytoplasmic side of apical plasma membrane(GO:0098592) |
| 0.6 | 2.8 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.5 | 1.6 | GO:0097134 | cyclin E1-CDK2 complex(GO:0097134) |
| 0.5 | 2.7 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.5 | 1.6 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.5 | 3.0 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.5 | 2.5 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.5 | 1.5 | GO:0005960 | glycine cleavage complex(GO:0005960) |
| 0.5 | 5.8 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.4 | 1.3 | GO:0000126 | transcription factor TFIIIB complex(GO:0000126) |
| 0.4 | 4.4 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.4 | 1.3 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.4 | 1.3 | GO:0036398 | TCR signalosome(GO:0036398) |
| 0.4 | 5.5 | GO:0032039 | integrator complex(GO:0032039) |
| 0.4 | 1.2 | GO:0032302 | MutSbeta complex(GO:0032302) |
| 0.4 | 0.8 | GO:0032301 | MutSalpha complex(GO:0032301) |
| 0.4 | 3.8 | GO:0000796 | condensin complex(GO:0000796) |
| 0.4 | 3.8 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.4 | 1.5 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.3 | 1.0 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.3 | 0.7 | GO:0000939 | condensed chromosome inner kinetochore(GO:0000939) |
| 0.3 | 1.4 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
| 0.3 | 1.7 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
| 0.3 | 1.3 | GO:0000333 | telomerase catalytic core complex(GO:0000333) |
| 0.3 | 0.3 | GO:0034667 | integrin alpha3-beta1 complex(GO:0034667) |
| 0.3 | 1.3 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.3 | 1.3 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.3 | 9.3 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
| 0.3 | 2.5 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.3 | 1.5 | GO:0009368 | endopeptidase Clp complex(GO:0009368) |
| 0.3 | 0.9 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.3 | 3.7 | GO:0034464 | BBSome(GO:0034464) |
| 0.3 | 1.1 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
| 0.3 | 0.9 | GO:0019034 | viral replication complex(GO:0019034) |
| 0.3 | 0.3 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
| 0.3 | 1.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.3 | 2.2 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.3 | 2.4 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.3 | 1.1 | GO:0031417 | NatC complex(GO:0031417) |
| 0.3 | 0.8 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
| 0.3 | 1.9 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.3 | 1.6 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.3 | 0.8 | GO:0098855 | HCN channel complex(GO:0098855) |
| 0.3 | 1.9 | GO:1990393 | 3M complex(GO:1990393) |
| 0.3 | 0.8 | GO:0043291 | RAVE complex(GO:0043291) |
| 0.3 | 1.3 | GO:0071458 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) |
| 0.3 | 4.2 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.3 | 2.3 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.3 | 0.8 | GO:0097059 | CNTFR-CLCF1 complex(GO:0097059) |
| 0.3 | 1.0 | GO:0045160 | myosin I complex(GO:0045160) |
| 0.3 | 1.3 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.3 | 0.5 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
| 0.2 | 3.5 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.2 | 0.7 | GO:0009330 | DNA topoisomerase complex (ATP-hydrolyzing)(GO:0009330) |
| 0.2 | 2.5 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.2 | 0.2 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.2 | 0.2 | GO:0000806 | Y chromosome(GO:0000806) |
| 0.2 | 3.0 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.2 | 0.9 | GO:1990578 | perinuclear endoplasmic reticulum membrane(GO:1990578) |
| 0.2 | 1.1 | GO:0032389 | MutLalpha complex(GO:0032389) |
| 0.2 | 4.0 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.2 | 0.9 | GO:0055087 | Ski complex(GO:0055087) |
| 0.2 | 4.4 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.2 | 1.1 | GO:0097125 | cyclin B1-CDK1 complex(GO:0097125) |
| 0.2 | 1.3 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.2 | 3.0 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.2 | 2.1 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.2 | 0.6 | GO:0005607 | laminin-2 complex(GO:0005607) |
| 0.2 | 1.7 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.2 | 1.5 | GO:0000805 | X chromosome(GO:0000805) |
| 0.2 | 0.6 | GO:0019008 | molybdopterin synthase complex(GO:0019008) |
| 0.2 | 1.0 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.2 | 0.4 | GO:0032300 | mismatch repair complex(GO:0032300) |
| 0.2 | 4.8 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.2 | 3.1 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 0.2 | 1.0 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.2 | 0.6 | GO:1990876 | cytoplasmic side of nuclear pore(GO:1990876) |
| 0.2 | 1.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.2 | 0.6 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.2 | 2.4 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.2 | 2.4 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.2 | 1.5 | GO:0043196 | varicosity(GO:0043196) |
| 0.2 | 0.5 | GO:0097123 | cyclin A1-CDK2 complex(GO:0097123) |
| 0.2 | 2.2 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.2 | 3.1 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 0.2 | 4.9 | GO:0044295 | axonal growth cone(GO:0044295) |
| 0.2 | 0.2 | GO:1902636 | kinociliary basal body(GO:1902636) |
| 0.2 | 0.3 | GO:0034657 | GID complex(GO:0034657) |
| 0.2 | 0.7 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
| 0.2 | 0.5 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.2 | 0.7 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.2 | 1.7 | GO:0000109 | nucleotide-excision repair complex(GO:0000109) |
| 0.2 | 0.5 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
| 0.2 | 10.3 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.2 | 3.2 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.2 | 1.5 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.2 | 5.1 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.2 | 0.2 | GO:0044305 | calyx of Held(GO:0044305) |
| 0.2 | 1.5 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.2 | 2.9 | GO:0010369 | chromocenter(GO:0010369) |
| 0.2 | 2.0 | GO:0045179 | apical cortex(GO:0045179) |
| 0.2 | 2.8 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.2 | 0.8 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.2 | 2.0 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.2 | 1.7 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.1 | 4.5 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
| 0.1 | 1.3 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.1 | 1.0 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
| 0.1 | 1.0 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.1 | 5.1 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.1 | 0.4 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.1 | 1.9 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.1 | 0.7 | GO:0070695 | FHF complex(GO:0070695) |
| 0.1 | 1.6 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.1 | 0.7 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.1 | 0.7 | GO:0000308 | cytoplasmic cyclin-dependent protein kinase holoenzyme complex(GO:0000308) |
| 0.1 | 0.9 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
| 0.1 | 1.4 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.1 | 1.1 | GO:0030905 | retromer, tubulation complex(GO:0030905) |
| 0.1 | 0.8 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
| 0.1 | 0.9 | GO:0030990 | intraciliary transport particle(GO:0030990) |
| 0.1 | 1.7 | GO:0070938 | contractile ring(GO:0070938) |
| 0.1 | 0.4 | GO:0071751 | IgA immunoglobulin complex(GO:0071745) IgA immunoglobulin complex, circulating(GO:0071746) monomeric IgA immunoglobulin complex(GO:0071748) polymeric IgA immunoglobulin complex(GO:0071749) secretory IgA immunoglobulin complex(GO:0071751) |
| 0.1 | 0.4 | GO:0097450 | astrocyte end-foot(GO:0097450) |
| 0.1 | 0.4 | GO:0070195 | growth hormone receptor complex(GO:0070195) |
| 0.1 | 0.8 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
| 0.1 | 5.1 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.1 | 9.7 | GO:0005871 | kinesin complex(GO:0005871) |
| 0.1 | 0.6 | GO:0032021 | NELF complex(GO:0032021) |
| 0.1 | 0.4 | GO:0031523 | Myb complex(GO:0031523) |
| 0.1 | 0.5 | GO:0032279 | asymmetric synapse(GO:0032279) |
| 0.1 | 3.9 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.1 | 6.7 | GO:0043596 | nuclear replication fork(GO:0043596) |
| 0.1 | 0.4 | GO:0020005 | symbiont-containing vacuole(GO:0020003) symbiont-containing vacuole membrane(GO:0020005) |
| 0.1 | 0.2 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
| 0.1 | 1.1 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.1 | 0.2 | GO:0043159 | acrosomal matrix(GO:0043159) |
| 0.1 | 0.2 | GO:0005675 | holo TFIIH complex(GO:0005675) |
| 0.1 | 0.1 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.1 | 6.2 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.1 | 0.6 | GO:0005602 | complement component C1 complex(GO:0005602) |
| 0.1 | 0.5 | GO:0097513 | myosin II filament(GO:0097513) |
| 0.1 | 0.8 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.1 | 1.9 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.1 | 6.5 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.1 | 0.8 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
| 0.1 | 2.0 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.1 | 0.3 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 0.1 | 1.0 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.1 | 2.1 | GO:0035859 | Seh1-associated complex(GO:0035859) |
| 0.1 | 1.2 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.1 | 0.9 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.1 | 0.4 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.1 | 0.2 | GO:0070939 | Dsl1p complex(GO:0070939) |
| 0.1 | 3.3 | GO:0097546 | ciliary base(GO:0097546) |
| 0.1 | 0.2 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.1 | 0.2 | GO:0044308 | axonal spine(GO:0044308) |
| 0.1 | 0.4 | GO:0045281 | mitochondrial respiratory chain complex II, succinate dehydrogenase complex (ubiquinone)(GO:0005749) succinate dehydrogenase complex (ubiquinone)(GO:0045257) respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) fumarate reductase complex(GO:0045283) |
| 0.1 | 0.1 | GO:0000306 | extrinsic component of vacuolar membrane(GO:0000306) |
| 0.1 | 6.0 | GO:0060170 | ciliary membrane(GO:0060170) |
| 0.1 | 0.4 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.1 | 0.9 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
| 0.1 | 1.5 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.1 | 1.4 | GO:0045120 | pronucleus(GO:0045120) |
| 0.1 | 0.2 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
| 0.1 | 0.8 | GO:0031415 | NatA complex(GO:0031415) |
| 0.1 | 6.5 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.1 | 1.0 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.1 | 1.1 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.1 | 1.2 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.1 | 0.6 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.1 | 0.1 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
| 0.1 | 3.2 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.1 | 0.9 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.1 | 0.6 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.1 | 0.8 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 0.1 | 0.5 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.1 | 0.5 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.1 | 1.0 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.1 | 1.0 | GO:0005883 | neurofilament(GO:0005883) |
| 0.1 | 0.8 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.1 | 0.6 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.1 | 6.7 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.1 | 0.4 | GO:0032144 | 4-aminobutyrate transaminase complex(GO:0032144) |
| 0.1 | 1.8 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
| 0.1 | 0.4 | GO:0097362 | MCM8-MCM9 complex(GO:0097362) |
| 0.1 | 0.3 | GO:0031166 | integral component of vacuolar membrane(GO:0031166) |
| 0.1 | 0.4 | GO:0097224 | sperm connecting piece(GO:0097224) |
| 0.1 | 0.1 | GO:0098843 | postsynaptic endocytic zone(GO:0098843) |
| 0.1 | 0.4 | GO:0030891 | VCB complex(GO:0030891) |
| 0.1 | 0.4 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.1 | 0.6 | GO:0033165 | interphotoreceptor matrix(GO:0033165) |
| 0.1 | 0.3 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.1 | 1.2 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.1 | 1.0 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.1 | 0.8 | GO:0005638 | lamin filament(GO:0005638) |
| 0.1 | 4.6 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.1 | 1.6 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.1 | 0.6 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.1 | 0.8 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.1 | 0.4 | GO:0031515 | tRNA (m1A) methyltransferase complex(GO:0031515) |
| 0.1 | 0.7 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
| 0.1 | 2.9 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
| 0.1 | 0.7 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.1 | 0.4 | GO:0098536 | deuterosome(GO:0098536) |
| 0.1 | 0.5 | GO:1902560 | GMP reductase complex(GO:1902560) |
| 0.1 | 0.9 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.1 | 0.2 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.1 | 0.3 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.1 | 8.5 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
| 0.1 | 2.1 | GO:0016514 | SWI/SNF complex(GO:0016514) |
| 0.1 | 0.9 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.1 | 0.5 | GO:0005854 | nascent polypeptide-associated complex(GO:0005854) |
| 0.1 | 0.6 | GO:0071203 | WASH complex(GO:0071203) |
| 0.1 | 0.2 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.1 | 1.3 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
| 0.1 | 0.4 | GO:0061673 | mitotic spindle astral microtubule(GO:0061673) |
| 0.1 | 0.8 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
| 0.1 | 0.7 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 0.1 | 1.2 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.1 | 1.3 | GO:0032585 | multivesicular body membrane(GO:0032585) |
| 0.1 | 0.4 | GO:0008091 | spectrin(GO:0008091) |
| 0.1 | 0.1 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
| 0.1 | 0.3 | GO:0071062 | alphav-beta3 integrin-vitronectin complex(GO:0071062) |
| 0.1 | 0.4 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.1 | 0.4 | GO:1990357 | terminal web(GO:1990357) |
| 0.1 | 0.9 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.1 | 0.4 | GO:0030906 | retromer, cargo-selective complex(GO:0030906) |
| 0.1 | 0.3 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
| 0.1 | 0.4 | GO:0017102 | methionyl glutamyl tRNA synthetase complex(GO:0017102) |
| 0.1 | 0.3 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.1 | 1.7 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.1 | 0.5 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.1 | 1.8 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.1 | 0.2 | GO:0030895 | apolipoprotein B mRNA editing enzyme complex(GO:0030895) |
| 0.1 | 1.0 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.1 | 0.2 | GO:0042022 | interleukin-12 receptor complex(GO:0042022) |
| 0.1 | 0.2 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
| 0.1 | 0.1 | GO:0002139 | stereocilia coupling link(GO:0002139) |
| 0.1 | 8.3 | GO:0005814 | centriole(GO:0005814) |
| 0.1 | 0.4 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.1 | 1.2 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.1 | 0.3 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.1 | 0.2 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.1 | 1.3 | GO:0099738 | cell cortex region(GO:0099738) |
| 0.1 | 2.2 | GO:0030057 | desmosome(GO:0030057) |
| 0.1 | 1.4 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.1 | 0.7 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.1 | 2.1 | GO:0031304 | intrinsic component of mitochondrial inner membrane(GO:0031304) integral component of mitochondrial inner membrane(GO:0031305) |
| 0.1 | 0.4 | GO:0032009 | early phagosome(GO:0032009) |
| 0.1 | 0.9 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.1 | 2.4 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.1 | 5.6 | GO:0043195 | terminal bouton(GO:0043195) |
| 0.1 | 1.3 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
| 0.1 | 4.2 | GO:0030672 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
| 0.1 | 0.3 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.1 | 0.4 | GO:0001652 | granular component(GO:0001652) |
| 0.1 | 0.2 | GO:0031251 | PAN complex(GO:0031251) |
| 0.1 | 0.2 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.1 | 0.9 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.1 | 0.2 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 0.1 | 1.6 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.1 | 1.7 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.1 | 0.3 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.1 | 1.4 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.1 | 4.3 | GO:0045095 | keratin filament(GO:0045095) |
| 0.1 | 1.0 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.1 | 0.2 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.1 | 0.2 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.1 | 0.5 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.1 | 0.6 | GO:0000800 | lateral element(GO:0000800) |
| 0.1 | 0.6 | GO:0033643 | host cell part(GO:0033643) |
| 0.1 | 0.4 | GO:0035692 | macrophage migration inhibitory factor receptor complex(GO:0035692) |
| 0.1 | 0.4 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.1 | 0.7 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.1 | 0.4 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.1 | 0.5 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.1 | 0.4 | GO:0071547 | piP-body(GO:0071547) |
| 0.0 | 0.9 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.0 | 0.4 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.0 | 0.6 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.0 | 0.4 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 0.0 | 0.9 | GO:0032590 | dendrite membrane(GO:0032590) |
| 0.0 | 0.2 | GO:0071565 | nBAF complex(GO:0071565) |
| 0.0 | 0.3 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 0.7 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.0 | 5.2 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.0 | 0.1 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
| 0.0 | 0.3 | GO:0030678 | mitochondrial ribonuclease P complex(GO:0030678) |
| 0.0 | 0.3 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
| 0.0 | 0.3 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.0 | 1.1 | GO:0031011 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 0.0 | 3.6 | GO:0031672 | A band(GO:0031672) |
| 0.0 | 0.8 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.0 | 0.1 | GO:0097232 | lamellar body membrane(GO:0097232) alveolar lamellar body membrane(GO:0097233) |
| 0.0 | 0.4 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
| 0.0 | 0.2 | GO:0031085 | BLOC-3 complex(GO:0031085) |
| 0.0 | 0.3 | GO:0000221 | vacuolar proton-transporting V-type ATPase, V1 domain(GO:0000221) |
| 0.0 | 0.0 | GO:0034681 | integrin alpha11-beta1 complex(GO:0034681) |
| 0.0 | 0.2 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.0 | 0.4 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.0 | 3.2 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 7.7 | GO:0031225 | anchored component of membrane(GO:0031225) |
| 0.0 | 0.0 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.0 | 0.2 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.0 | 0.2 | GO:0000938 | GARP complex(GO:0000938) |
| 0.0 | 0.3 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) |
| 0.0 | 2.5 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
| 0.0 | 0.2 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
| 0.0 | 0.7 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.0 | 0.2 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.0 | 0.1 | GO:0032002 | interleukin-28 receptor complex(GO:0032002) |
| 0.0 | 0.2 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) proton-transporting ATP synthase complex(GO:0045259) |
| 0.0 | 0.4 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.0 | 0.3 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.0 | 0.1 | GO:0031905 | early endosome lumen(GO:0031905) |
| 0.0 | 0.2 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.0 | 2.0 | GO:0030964 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.0 | 0.1 | GO:0044609 | DBIRD complex(GO:0044609) |
| 0.0 | 0.2 | GO:0030681 | multimeric ribonuclease P complex(GO:0030681) |
| 0.0 | 1.0 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
| 0.0 | 0.2 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.0 | 0.6 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.0 | 0.3 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.0 | 3.2 | GO:0005905 | clathrin-coated pit(GO:0005905) |
| 0.0 | 0.1 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.0 | 0.2 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.0 | 0.3 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.0 | 0.6 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.0 | 0.3 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 0.1 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.0 | 0.4 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 1.3 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 0.3 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.0 | 0.6 | GO:0031105 | septin complex(GO:0031105) |
| 0.0 | 0.2 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 0.0 | 0.3 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
| 0.0 | 1.2 | GO:0030315 | T-tubule(GO:0030315) |
| 0.0 | 0.2 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.0 | 0.1 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.0 | 0.2 | GO:0033270 | paranode region of axon(GO:0033270) |
| 0.0 | 0.0 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.0 | 0.1 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
| 0.0 | 1.1 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.0 | 0.1 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
| 0.0 | 0.2 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.0 | 0.8 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
| 0.0 | 1.4 | GO:0005882 | intermediate filament(GO:0005882) |
| 0.0 | 0.3 | GO:0032982 | myosin filament(GO:0032982) |
| 0.0 | 0.4 | GO:0046930 | pore complex(GO:0046930) |
| 0.0 | 0.3 | GO:0042588 | zymogen granule(GO:0042588) |
| 0.0 | 1.1 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.0 | 0.8 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.0 | 0.7 | GO:1902710 | GABA receptor complex(GO:1902710) |
| 0.0 | 0.1 | GO:0036020 | endolysosome membrane(GO:0036020) |
| 0.0 | 12.4 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.0 | 7.4 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
| 0.0 | 0.3 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.0 | 0.1 | GO:0061200 | clathrin-sculpted gamma-aminobutyric acid transport vesicle(GO:0061200) clathrin-sculpted gamma-aminobutyric acid transport vesicle membrane(GO:0061202) |
| 0.0 | 0.1 | GO:0097196 | Shu complex(GO:0097196) |
| 0.0 | 1.1 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.0 | 0.0 | GO:0071020 | post-spliceosomal complex(GO:0071020) |
| 0.0 | 0.1 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
| 0.0 | 0.3 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.0 | 0.7 | GO:0043198 | dendritic shaft(GO:0043198) |
| 0.0 | 2.0 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
| 0.0 | 0.1 | GO:0098839 | postsynaptic density membrane(GO:0098839) |
| 0.0 | 0.2 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.0 | 0.0 | GO:0005889 | hydrogen:potassium-exchanging ATPase complex(GO:0005889) |
| 0.0 | 1.1 | GO:0005778 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.0 | 0.0 | GO:0071438 | invadopodium membrane(GO:0071438) |
| 0.0 | 0.6 | GO:0000786 | nucleosome(GO:0000786) |
| 0.0 | 0.1 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
| 0.0 | 0.0 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.0 | 0.1 | GO:0002177 | manchette(GO:0002177) |
| 0.0 | 0.3 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.0 | 0.0 | GO:0072536 | interleukin-23 receptor complex(GO:0072536) |
| 0.0 | 0.1 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.0 | 0.7 | GO:0035577 | azurophil granule membrane(GO:0035577) |
| 0.0 | 0.3 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.0 | 0.0 | GO:0034665 | integrin alpha1-beta1 complex(GO:0034665) |
| 0.0 | 0.0 | GO:0030936 | collagen type XIII trimer(GO:0005600) transmembrane collagen trimer(GO:0030936) |
| 0.0 | 0.5 | GO:0042571 | immunoglobulin complex, circulating(GO:0042571) |
| 0.0 | 0.2 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.0 | 0.1 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
Gene overrepresentation in molecular function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.6 | 7.7 | GO:0004379 | glycylpeptide N-tetradecanoyltransferase activity(GO:0004379) myristoyltransferase activity(GO:0019107) |
| 2.4 | 7.2 | GO:0016731 | ferredoxin-NADP+ reductase activity(GO:0004324) NADPH-adrenodoxin reductase activity(GO:0015039) oxidoreductase activity, acting on iron-sulfur proteins as donors(GO:0016730) oxidoreductase activity, acting on iron-sulfur proteins as donors, NAD or NADP as acceptor(GO:0016731) |
| 1.5 | 4.6 | GO:0098809 | cystathionine beta-synthase activity(GO:0004122) oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) nitrite reductase (NO-forming) activity(GO:0050421) carbon monoxide binding(GO:0070025) nitrite reductase activity(GO:0098809) |
| 1.1 | 3.4 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
| 1.1 | 4.5 | GO:0038025 | reelin receptor activity(GO:0038025) |
| 1.1 | 3.3 | GO:0052810 | 1-phosphatidylinositol-5-kinase activity(GO:0052810) |
| 1.0 | 3.9 | GO:0009041 | uridylate kinase activity(GO:0009041) |
| 0.8 | 3.3 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
| 0.8 | 10.8 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
| 0.8 | 6.0 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.7 | 3.6 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
| 0.7 | 0.7 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.7 | 2.1 | GO:0005169 | neurotrophin TRKB receptor binding(GO:0005169) |
| 0.7 | 3.4 | GO:0004306 | ethanolamine-phosphate cytidylyltransferase activity(GO:0004306) |
| 0.7 | 2.7 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
| 0.6 | 2.5 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.6 | 4.4 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
| 0.6 | 1.2 | GO:0004882 | androgen receptor activity(GO:0004882) |
| 0.6 | 2.4 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.6 | 1.8 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 0.6 | 2.4 | GO:0097363 | protein O-GlcNAc transferase activity(GO:0097363) |
| 0.6 | 9.7 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.6 | 2.2 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
| 0.5 | 2.1 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.5 | 2.0 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 0.5 | 1.5 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.5 | 3.1 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.5 | 4.6 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
| 0.5 | 1.5 | GO:0004103 | choline kinase activity(GO:0004103) |
| 0.5 | 2.5 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.5 | 4.4 | GO:0048039 | ubiquinone binding(GO:0048039) |
| 0.5 | 1.5 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.5 | 4.8 | GO:0034485 | phosphatidylinositol-3,4,5-trisphosphate 5-phosphatase activity(GO:0034485) |
| 0.5 | 1.9 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.5 | 5.2 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.5 | 1.9 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.5 | 1.8 | GO:0003896 | DNA primase activity(GO:0003896) |
| 0.4 | 1.3 | GO:0001026 | TFIIIB-type transcription factor activity(GO:0001026) |
| 0.4 | 2.6 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.4 | 3.0 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.4 | 1.3 | GO:0070336 | flap-structured DNA binding(GO:0070336) |
| 0.4 | 0.9 | GO:0070905 | serine binding(GO:0070905) |
| 0.4 | 0.4 | GO:0008169 | C-methyltransferase activity(GO:0008169) |
| 0.4 | 6.7 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.4 | 0.4 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 0.4 | 1.7 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
| 0.4 | 4.9 | GO:0036310 | annealing helicase activity(GO:0036310) |
| 0.4 | 4.5 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.4 | 1.6 | GO:0042132 | fructose 1,6-bisphosphate 1-phosphatase activity(GO:0042132) |
| 0.4 | 1.2 | GO:0000406 | heteroduplex DNA loop binding(GO:0000404) double-strand/single-strand DNA junction binding(GO:0000406) dinucleotide repeat insertion binding(GO:0032181) |
| 0.4 | 0.8 | GO:0032142 | single guanine insertion binding(GO:0032142) single thymine insertion binding(GO:0032143) |
| 0.4 | 1.2 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
| 0.4 | 1.2 | GO:0047389 | glycerophosphocholine phosphodiesterase activity(GO:0047389) |
| 0.4 | 2.3 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) |
| 0.4 | 1.1 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.4 | 1.1 | GO:0051499 | D-aminoacyl-tRNA deacylase activity(GO:0051499) D-tyrosyl-tRNA(Tyr) deacylase activity(GO:0051500) |
| 0.4 | 1.1 | GO:0016534 | cyclin-dependent protein kinase 5 activator activity(GO:0016534) |
| 0.4 | 1.9 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) |
| 0.4 | 0.7 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
| 0.4 | 1.5 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
| 0.4 | 1.1 | GO:0036361 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
| 0.4 | 1.5 | GO:0001512 | dihydronicotinamide riboside quinone reductase activity(GO:0001512) melatonin binding(GO:1904408) |
| 0.4 | 0.4 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
| 0.4 | 1.1 | GO:0042799 | histone methyltransferase activity (H4-K20 specific)(GO:0042799) |
| 0.4 | 2.1 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
| 0.4 | 1.4 | GO:0003978 | UDP-N-acetylglucosamine 4-epimerase activity(GO:0003974) UDP-glucose 4-epimerase activity(GO:0003978) |
| 0.4 | 1.4 | GO:0050698 | proteoglycan sulfotransferase activity(GO:0050698) |
| 0.3 | 1.0 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
| 0.3 | 4.9 | GO:0019826 | oxygen sensor activity(GO:0019826) |
| 0.3 | 1.4 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 0.3 | 2.0 | GO:0015307 | drug:proton antiporter activity(GO:0015307) |
| 0.3 | 1.4 | GO:0004047 | aminomethyltransferase activity(GO:0004047) |
| 0.3 | 1.0 | GO:0004137 | deoxycytidine kinase activity(GO:0004137) |
| 0.3 | 1.0 | GO:0008534 | oxidized purine nucleobase lesion DNA N-glycosylase activity(GO:0008534) |
| 0.3 | 1.3 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.3 | 1.0 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
| 0.3 | 1.0 | GO:0035539 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) 8-oxo-7,8-dihydrodeoxyguanosine triphosphate pyrophosphatase activity(GO:0035539) |
| 0.3 | 1.7 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.3 | 2.3 | GO:0030267 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.3 | 1.3 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
| 0.3 | 1.0 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.3 | 10.8 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.3 | 1.0 | GO:0030626 | U12 snRNA binding(GO:0030626) |
| 0.3 | 1.6 | GO:0052832 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.3 | 0.3 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
| 0.3 | 1.6 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
| 0.3 | 2.9 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.3 | 1.3 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.3 | 1.9 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.3 | 0.6 | GO:0004307 | ethanolaminephosphotransferase activity(GO:0004307) |
| 0.3 | 1.0 | GO:0051748 | UTP:glucose-1-phosphate uridylyltransferase activity(GO:0003983) UTP-monosaccharide-1-phosphate uridylyltransferase activity(GO:0051748) |
| 0.3 | 2.5 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.3 | 1.8 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.3 | 1.5 | GO:0030151 | molybdenum ion binding(GO:0030151) |
| 0.3 | 1.2 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
| 0.3 | 1.2 | GO:0015616 | DNA translocase activity(GO:0015616) |
| 0.3 | 1.8 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.3 | 1.5 | GO:0015199 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.3 | 1.8 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
| 0.3 | 0.9 | GO:0003947 | (N-acetylneuraminyl)-galactosylglucosylceramide N-acetylgalactosaminyltransferase activity(GO:0003947) |
| 0.3 | 0.3 | GO:0016312 | inositol bisphosphate phosphatase activity(GO:0016312) |
| 0.3 | 1.2 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.3 | 3.2 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.3 | 1.7 | GO:0017050 | sphinganine kinase activity(GO:0008481) D-erythro-sphingosine kinase activity(GO:0017050) |
| 0.3 | 1.1 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
| 0.3 | 1.4 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
| 0.3 | 2.5 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.3 | 1.1 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.3 | 4.4 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.3 | 1.4 | GO:0004991 | parathyroid hormone receptor activity(GO:0004991) |
| 0.3 | 1.1 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
| 0.3 | 1.9 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.3 | 2.1 | GO:0030345 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
| 0.3 | 0.3 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
| 0.3 | 2.1 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.3 | 2.1 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
| 0.3 | 1.9 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.3 | 2.4 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.3 | 1.3 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
| 0.3 | 0.8 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.3 | 0.3 | GO:0035403 | histone kinase activity (H3-T6 specific)(GO:0035403) |
| 0.3 | 1.0 | GO:0004335 | galactokinase activity(GO:0004335) |
| 0.3 | 1.0 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
| 0.3 | 1.3 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 0.3 | 2.9 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.3 | 1.5 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.3 | 0.8 | GO:0004822 | isoleucine-tRNA ligase activity(GO:0004822) |
| 0.3 | 2.8 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.3 | 5.4 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.3 | 3.0 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.3 | 0.8 | GO:0015218 | pyrimidine nucleotide transmembrane transporter activity(GO:0015218) |
| 0.3 | 3.5 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
| 0.2 | 1.0 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
| 0.2 | 0.7 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
| 0.2 | 0.7 | GO:0038131 | neuregulin receptor activity(GO:0038131) |
| 0.2 | 2.2 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
| 0.2 | 1.2 | GO:0004337 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
| 0.2 | 1.5 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.2 | 0.7 | GO:0016434 | rRNA (cytosine) methyltransferase activity(GO:0016434) |
| 0.2 | 1.0 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.2 | 0.7 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
| 0.2 | 1.0 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
| 0.2 | 0.7 | GO:1990404 | protein ADP-ribosylase activity(GO:1990404) |
| 0.2 | 0.5 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.2 | 0.7 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.2 | 3.5 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.2 | 0.9 | GO:0043426 | MRF binding(GO:0043426) |
| 0.2 | 1.9 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.2 | 0.9 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
| 0.2 | 1.6 | GO:0015501 | glutamate:sodium symporter activity(GO:0015501) |
| 0.2 | 0.7 | GO:0008515 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.2 | 1.8 | GO:0004873 | asialoglycoprotein receptor activity(GO:0004873) |
| 0.2 | 0.7 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.2 | 0.7 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) |
| 0.2 | 8.7 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
| 0.2 | 0.7 | GO:0005171 | hepatocyte growth factor receptor binding(GO:0005171) |
| 0.2 | 4.4 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.2 | 0.9 | GO:0004104 | acetylcholinesterase activity(GO:0003990) cholinesterase activity(GO:0004104) |
| 0.2 | 0.7 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.2 | 1.5 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.2 | 1.3 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.2 | 0.6 | GO:0004603 | phenylethanolamine N-methyltransferase activity(GO:0004603) |
| 0.2 | 1.7 | GO:0019237 | centromeric DNA binding(GO:0019237) |
| 0.2 | 4.0 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.2 | 3.7 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.2 | 2.3 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.2 | 0.2 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.2 | 0.6 | GO:0004794 | L-serine ammonia-lyase activity(GO:0003941) L-threonine ammonia-lyase activity(GO:0004794) |
| 0.2 | 0.8 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.2 | 0.8 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.2 | 7.4 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
| 0.2 | 0.4 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.2 | 0.8 | GO:0003865 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) steroid dehydrogenase activity, acting on the CH-CH group of donors(GO:0033765) enone reductase activity(GO:0035671) cholestenone 5-alpha-reductase activity(GO:0047751) |
| 0.2 | 0.6 | GO:0030366 | molybdopterin synthase activity(GO:0030366) |
| 0.2 | 7.1 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.2 | 3.7 | GO:0015923 | mannosidase activity(GO:0015923) |
| 0.2 | 0.8 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.2 | 2.7 | GO:0005536 | glucose binding(GO:0005536) |
| 0.2 | 0.6 | GO:0004119 | cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) |
| 0.2 | 2.0 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.2 | 0.6 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
| 0.2 | 3.9 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.2 | 0.8 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
| 0.2 | 0.8 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.2 | 0.8 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.2 | 0.9 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
| 0.2 | 4.5 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.2 | 2.4 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.2 | 3.0 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
| 0.2 | 0.6 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 0.2 | 0.6 | GO:0004019 | adenylosuccinate synthase activity(GO:0004019) |
| 0.2 | 2.8 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.2 | 0.6 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
| 0.2 | 3.3 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.2 | 0.5 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.2 | 0.9 | GO:0047493 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
| 0.2 | 0.7 | GO:0008466 | glycogenin glucosyltransferase activity(GO:0008466) |
| 0.2 | 0.4 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.2 | 1.4 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.2 | 0.5 | GO:0008518 | reduced folate carrier activity(GO:0008518) |
| 0.2 | 0.7 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
| 0.2 | 4.5 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.2 | 1.2 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
| 0.2 | 0.7 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.2 | 0.5 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
| 0.2 | 1.0 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.2 | 2.6 | GO:0000295 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) |
| 0.2 | 1.4 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.2 | 0.7 | GO:0047888 | fatty acid peroxidase activity(GO:0047888) |
| 0.2 | 0.5 | GO:0032427 | GBD domain binding(GO:0032427) |
| 0.2 | 2.9 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.2 | 0.7 | GO:0032038 | myosin II heavy chain binding(GO:0032038) |
| 0.2 | 3.2 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.2 | 1.7 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.2 | 0.8 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.2 | 0.5 | GO:0004347 | glucose-6-phosphate isomerase activity(GO:0004347) |
| 0.2 | 0.2 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.2 | 0.3 | GO:0042903 | tubulin deacetylase activity(GO:0042903) |
| 0.2 | 0.5 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.2 | 2.0 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.2 | 0.5 | GO:0031812 | G-protein coupled nucleotide receptor binding(GO:0031811) P2Y1 nucleotide receptor binding(GO:0031812) |
| 0.2 | 2.3 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.2 | 1.2 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.2 | 1.2 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
| 0.2 | 0.5 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
| 0.2 | 0.8 | GO:0047374 | methylumbelliferyl-acetate deacetylase activity(GO:0047374) |
| 0.2 | 0.5 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.2 | 0.5 | GO:0003863 | alpha-ketoacid dehydrogenase activity(GO:0003826) 3-methyl-2-oxobutanoate dehydrogenase (2-methylpropanoyl-transferring) activity(GO:0003863) |
| 0.2 | 0.5 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.2 | 0.5 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.2 | 0.5 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.2 | 1.3 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.2 | 1.1 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.2 | 0.9 | GO:0045118 | azole transporter activity(GO:0045118) |
| 0.2 | 0.9 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.2 | 1.1 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
| 0.2 | 0.5 | GO:0042007 | interleukin-18 binding(GO:0042007) |
| 0.2 | 3.2 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.2 | 0.3 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
| 0.2 | 0.9 | GO:0044594 | 3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-enoyl-CoA hydratase activity(GO:0033989) 17-beta-hydroxysteroid dehydrogenase (NAD+) activity(GO:0044594) |
| 0.2 | 0.5 | GO:0070364 | mitochondrial light strand promoter anti-sense binding(GO:0070361) mitochondrial heavy strand promoter anti-sense binding(GO:0070362) mitochondrial heavy strand promoter sense binding(GO:0070364) |
| 0.2 | 0.8 | GO:0035243 | protein-arginine omega-N symmetric methyltransferase activity(GO:0035243) |
| 0.1 | 0.4 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
| 0.1 | 0.9 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 0.1 | 6.1 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.1 | 0.4 | GO:0016155 | formyltetrahydrofolate dehydrogenase activity(GO:0016155) |
| 0.1 | 2.5 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.1 | 4.4 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.1 | 0.9 | GO:1903136 | cuprous ion binding(GO:1903136) |
| 0.1 | 1.4 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.1 | 0.6 | GO:0005457 | GDP-fucose transmembrane transporter activity(GO:0005457) purine nucleotide-sugar transmembrane transporter activity(GO:0036080) |
| 0.1 | 0.3 | GO:0004819 | glutamine-tRNA ligase activity(GO:0004819) |
| 0.1 | 2.1 | GO:0019215 | intermediate filament binding(GO:0019215) |
| 0.1 | 0.4 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.1 | 1.0 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
| 0.1 | 0.6 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
| 0.1 | 3.7 | GO:0005521 | lamin binding(GO:0005521) |
| 0.1 | 0.4 | GO:0001003 | polymerase III regulatory region sequence-specific DNA binding(GO:0000992) RNA polymerase III type 1 promoter sequence-specific DNA binding(GO:0001002) RNA polymerase III type 2 promoter sequence-specific DNA binding(GO:0001003) |
| 0.1 | 1.5 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.1 | 3.6 | GO:0008242 | omega peptidase activity(GO:0008242) |
| 0.1 | 0.7 | GO:1902444 | riboflavin binding(GO:1902444) |
| 0.1 | 1.1 | GO:0043559 | insulin binding(GO:0043559) |
| 0.1 | 1.6 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.1 | 0.5 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 0.1 | 0.3 | GO:0000026 | alpha-1,2-mannosyltransferase activity(GO:0000026) |
| 0.1 | 0.4 | GO:0004817 | cysteine-tRNA ligase activity(GO:0004817) |
| 0.1 | 0.3 | GO:0004040 | amidase activity(GO:0004040) |
| 0.1 | 1.1 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.1 | 0.4 | GO:0000403 | Y-form DNA binding(GO:0000403) |
| 0.1 | 0.4 | GO:0004157 | dihydropyrimidinase activity(GO:0004157) |
| 0.1 | 0.5 | GO:0043812 | phosphatidylinositol-4-phosphate phosphatase activity(GO:0043812) |
| 0.1 | 0.8 | GO:0023030 | MHC class Ib protein complex binding(GO:0023025) MHC class Ib protein binding, via antigen binding groove(GO:0023030) |
| 0.1 | 0.6 | GO:0031208 | POZ domain binding(GO:0031208) |
| 0.1 | 0.3 | GO:0032090 | Pyrin domain binding(GO:0032090) |
| 0.1 | 0.6 | GO:0052740 | 1-acyl-2-lysophosphatidylserine acylhydrolase activity(GO:0052740) |
| 0.1 | 0.5 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.1 | 4.6 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
| 0.1 | 0.8 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.1 | 2.9 | GO:0031005 | filamin binding(GO:0031005) |
| 0.1 | 0.4 | GO:0070698 | type I activin receptor binding(GO:0070698) |
| 0.1 | 0.4 | GO:0035379 | carbon dioxide transmembrane transporter activity(GO:0035379) |
| 0.1 | 1.1 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.1 | 0.6 | GO:0018636 | phenanthrene 9,10-monooxygenase activity(GO:0018636) ketosteroid monooxygenase activity(GO:0047086) |
| 0.1 | 0.7 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.1 | 0.4 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.1 | 0.1 | GO:0047115 | trans-1,2-dihydrobenzene-1,2-diol dehydrogenase activity(GO:0047115) |
| 0.1 | 9.7 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.1 | 1.2 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
| 0.1 | 3.5 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
| 0.1 | 0.5 | GO:0004802 | transketolase activity(GO:0004802) |
| 0.1 | 3.3 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.1 | 0.2 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.1 | 0.2 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.1 | 0.5 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
| 0.1 | 0.6 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.1 | 0.9 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.1 | 0.3 | GO:0008969 | phosphohistidine phosphatase activity(GO:0008969) |
| 0.1 | 0.3 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
| 0.1 | 0.6 | GO:0042954 | lipoprotein transporter activity(GO:0042954) |
| 0.1 | 0.3 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
| 0.1 | 2.2 | GO:0034979 | NAD-dependent protein deacetylase activity(GO:0034979) |
| 0.1 | 1.6 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.1 | 0.6 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.1 | 1.5 | GO:0089720 | caspase binding(GO:0089720) |
| 0.1 | 1.6 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.1 | 0.7 | GO:0043532 | angiostatin binding(GO:0043532) |
| 0.1 | 0.8 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.1 | 0.6 | GO:0043139 | 5'-3' DNA helicase activity(GO:0043139) |
| 0.1 | 11.3 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
| 0.1 | 1.1 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
| 0.1 | 0.3 | GO:0004170 | dUTP diphosphatase activity(GO:0004170) |
| 0.1 | 3.2 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.1 | 0.4 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
| 0.1 | 0.2 | GO:0008665 | 2'-phosphotransferase activity(GO:0008665) |
| 0.1 | 2.6 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.1 | 1.2 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.1 | 2.7 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
| 0.1 | 0.7 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.1 | 0.3 | GO:0033878 | hormone-sensitive lipase activity(GO:0033878) |
| 0.1 | 1.4 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.1 | 0.5 | GO:0004419 | hydroxymethylglutaryl-CoA lyase activity(GO:0004419) |
| 0.1 | 0.4 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.1 | 0.6 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.1 | 0.8 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.1 | 0.6 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.1 | 1.3 | GO:0048019 | receptor antagonist activity(GO:0048019) |
| 0.1 | 1.2 | GO:0015166 | polyol transmembrane transporter activity(GO:0015166) |
| 0.1 | 0.3 | GO:0052827 | inositol tetrakisphosphate 1-kinase activity(GO:0047325) inositol-1,3,4-trisphosphate 6-kinase activity(GO:0052725) inositol-1,3,4-trisphosphate 5-kinase activity(GO:0052726) inositol-1,3,4,5,6-pentakisphosphate 1-phosphatase activity(GO:0052825) inositol pentakisphosphate phosphatase activity(GO:0052827) inositol-1,3,4,6-tetrakisphosphate 6-phosphatase activity(GO:0052830) inositol-1,3,4,6-tetrakisphosphate 1-phosphatase activity(GO:0052831) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) |
| 0.1 | 1.8 | GO:0005522 | profilin binding(GO:0005522) |
| 0.1 | 0.6 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.1 | 0.7 | GO:0070728 | leucine binding(GO:0070728) |
| 0.1 | 0.7 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 0.1 | 0.4 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.1 | 1.3 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
| 0.1 | 0.5 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.1 | 0.4 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.1 | 0.3 | GO:0004775 | succinate-CoA ligase (ADP-forming) activity(GO:0004775) |
| 0.1 | 0.5 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.1 | 0.3 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
| 0.1 | 0.3 | GO:0015439 | heme-transporting ATPase activity(GO:0015439) |
| 0.1 | 0.7 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 0.1 | 0.5 | GO:0015056 | corticotrophin-releasing factor receptor activity(GO:0015056) |
| 0.1 | 7.6 | GO:0004714 | transmembrane receptor protein tyrosine kinase activity(GO:0004714) |
| 0.1 | 0.5 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
| 0.1 | 0.7 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.1 | 0.4 | GO:0003867 | 4-aminobutyrate transaminase activity(GO:0003867) succinate-semialdehyde dehydrogenase binding(GO:0032145) (S)-3-amino-2-methylpropionate transaminase activity(GO:0047298) |
| 0.1 | 4.3 | GO:0018024 | histone-lysine N-methyltransferase activity(GO:0018024) |
| 0.1 | 0.6 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
| 0.1 | 0.6 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
| 0.1 | 3.4 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.1 | 0.3 | GO:0031862 | prostanoid receptor binding(GO:0031862) |
| 0.1 | 0.5 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.1 | 0.2 | GO:0005462 | UDP-N-acetylglucosamine transmembrane transporter activity(GO:0005462) |
| 0.1 | 0.4 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.1 | 0.5 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.1 | 0.8 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 0.1 | 0.3 | GO:0015333 | peptide:proton symporter activity(GO:0015333) proton-dependent peptide secondary active transmembrane transporter activity(GO:0022897) |
| 0.1 | 0.4 | GO:0003989 | acetyl-CoA carboxylase activity(GO:0003989) |
| 0.1 | 1.9 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.1 | 0.2 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
| 0.1 | 0.4 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.1 | 0.7 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.1 | 0.1 | GO:0016979 | lipoate-protein ligase activity(GO:0016979) |
| 0.1 | 0.5 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.1 | 0.2 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.1 | 0.5 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.1 | 0.4 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 0.1 | 2.3 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
| 0.1 | 0.2 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.1 | 0.4 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.1 | 0.5 | GO:0050051 | leukotriene-B4 20-monooxygenase activity(GO:0050051) |
| 0.1 | 1.3 | GO:0044213 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) intronic transcription regulatory region DNA binding(GO:0044213) |
| 0.1 | 0.5 | GO:0004447 | iodide peroxidase activity(GO:0004447) |
| 0.1 | 0.2 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.1 | 0.2 | GO:0051431 | corticotropin-releasing hormone receptor 2 binding(GO:0051431) |
| 0.1 | 0.5 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.1 | 0.5 | GO:0003920 | GMP reductase activity(GO:0003920) oxidoreductase activity, acting on NAD(P)H, nitrogenous group as acceptor(GO:0016657) |
| 0.1 | 5.5 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
| 0.1 | 1.7 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.1 | 0.2 | GO:0010857 | calcium-dependent protein kinase activity(GO:0010857) |
| 0.1 | 0.3 | GO:0000285 | 1-phosphatidylinositol-3-phosphate 5-kinase activity(GO:0000285) |
| 0.1 | 0.5 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
| 0.1 | 0.6 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
| 0.1 | 0.8 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.1 | 0.5 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.1 | 0.5 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
| 0.1 | 0.2 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.1 | 0.6 | GO:0034597 | phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) |
| 0.1 | 0.3 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
| 0.1 | 0.4 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.1 | 14.4 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
| 0.1 | 0.3 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
| 0.1 | 0.7 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.1 | 0.6 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
| 0.1 | 0.4 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.1 | 0.7 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
| 0.1 | 1.4 | GO:0019841 | retinol binding(GO:0019841) |
| 0.1 | 1.5 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.1 | 0.7 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) protein histidine kinase activity(GO:0004673) |
| 0.1 | 0.5 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
| 0.1 | 1.2 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.1 | 0.3 | GO:0061769 | ribosylnicotinamide kinase activity(GO:0050262) ribosylnicotinate kinase activity(GO:0061769) |
| 0.1 | 0.2 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.1 | 0.7 | GO:0055104 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.1 | 0.2 | GO:0016603 | glutaminyl-peptide cyclotransferase activity(GO:0016603) |
| 0.1 | 0.3 | GO:0004998 | transferrin receptor activity(GO:0004998) |
| 0.1 | 0.3 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 0.1 | 2.8 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 0.1 | 0.8 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.1 | 2.5 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.1 | 0.5 | GO:0005353 | fructose transmembrane transporter activity(GO:0005353) |
| 0.1 | 0.3 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.1 | 1.4 | GO:0000030 | mannosyltransferase activity(GO:0000030) |
| 0.1 | 0.4 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.1 | 1.9 | GO:0001972 | retinoic acid binding(GO:0001972) |
| 0.1 | 0.2 | GO:0016517 | interleukin-12 receptor activity(GO:0016517) |
| 0.1 | 1.5 | GO:0005112 | Notch binding(GO:0005112) |
| 0.1 | 0.1 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
| 0.1 | 0.3 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.1 | 0.3 | GO:0004102 | choline O-acetyltransferase activity(GO:0004102) |
| 0.1 | 0.7 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.1 | 0.7 | GO:0043225 | anion transmembrane-transporting ATPase activity(GO:0043225) |
| 0.1 | 0.2 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.1 | 0.2 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.1 | 0.5 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
| 0.1 | 0.8 | GO:0016594 | glycine binding(GO:0016594) |
| 0.1 | 0.3 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.1 | 1.0 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.1 | 2.3 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
| 0.1 | 0.6 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.1 | 0.1 | GO:0004549 | tRNA-specific ribonuclease activity(GO:0004549) |
| 0.1 | 0.3 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.1 | 1.0 | GO:0016279 | protein-lysine N-methyltransferase activity(GO:0016279) |
| 0.1 | 0.5 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.1 | 0.4 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
| 0.1 | 1.8 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.1 | 0.5 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.1 | 7.8 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.1 | 2.1 | GO:0051536 | iron-sulfur cluster binding(GO:0051536) metal cluster binding(GO:0051540) |
| 0.1 | 0.1 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.1 | 0.7 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.1 | 0.4 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.1 | 0.2 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.1 | 0.8 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.1 | 0.1 | GO:0061628 | H3K27me3 modified histone binding(GO:0061628) |
| 0.1 | 0.1 | GO:0098808 | mRNA cap binding(GO:0098808) |
| 0.1 | 0.4 | GO:0047894 | flavonol 3-sulfotransferase activity(GO:0047894) |
| 0.1 | 0.4 | GO:0097199 | cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097199) |
| 0.1 | 0.2 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 0.1 | 0.4 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.1 | 0.3 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
| 0.1 | 1.2 | GO:0001871 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.1 | 0.3 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.1 | 0.3 | GO:0005314 | high-affinity glutamate transmembrane transporter activity(GO:0005314) |
| 0.1 | 0.2 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
| 0.1 | 0.7 | GO:0022821 | potassium:proton antiporter activity(GO:0015386) potassium ion antiporter activity(GO:0022821) |
| 0.1 | 0.1 | GO:0015227 | acyl carnitine transmembrane transporter activity(GO:0015227) |
| 0.1 | 0.2 | GO:0032558 | adenyl deoxyribonucleotide binding(GO:0032558) dATP binding(GO:0032564) |
| 0.1 | 0.3 | GO:0052841 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) inositol diphosphate tetrakisphosphate diphosphatase activity(GO:0052840) inositol bisdiphosphate tetrakisphosphate diphosphatase activity(GO:0052841) inositol diphosphate pentakisphosphate diphosphatase activity(GO:0052842) inositol-1-diphosphate-2,3,4,5,6-pentakisphosphate diphosphatase activity(GO:0052843) inositol-3-diphosphate-1,2,4,5,6-pentakisphosphate diphosphatase activity(GO:0052844) inositol-5-diphosphate-1,2,3,4,6-pentakisphosphate diphosphatase activity(GO:0052845) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 1-diphosphatase activity(GO:0052846) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052847) inositol-3,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052848) |
| 0.1 | 0.2 | GO:0004796 | thromboxane-A synthase activity(GO:0004796) 12-hydroxyheptadecatrienoic acid synthase activity(GO:0036134) |
| 0.1 | 0.2 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.1 | 0.2 | GO:0035034 | histone acetyltransferase regulator activity(GO:0035034) |
| 0.1 | 1.5 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.1 | 0.1 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.1 | 0.2 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
| 0.1 | 0.4 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
| 0.1 | 0.2 | GO:0060422 | peptidyl-dipeptidase inhibitor activity(GO:0060422) |
| 0.1 | 1.1 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.1 | 0.7 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 0.1 | 1.0 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.1 | 1.2 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.1 | 0.5 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.1 | 0.3 | GO:0033857 | diphosphoinositol-pentakisphosphate kinase activity(GO:0033857) |
| 0.1 | 0.4 | GO:0071253 | connexin binding(GO:0071253) |
| 0.1 | 3.3 | GO:0003684 | damaged DNA binding(GO:0003684) |
| 0.1 | 0.4 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.1 | 1.3 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.1 | 1.2 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
| 0.1 | 0.4 | GO:0071936 | coreceptor activity involved in Wnt signaling pathway(GO:0071936) |
| 0.1 | 0.5 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.1 | 0.6 | GO:0003996 | acyl-CoA ligase activity(GO:0003996) |
| 0.1 | 0.3 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.0 | 0.2 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.0 | 0.6 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.1 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
| 0.0 | 0.4 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.0 | 0.2 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.0 | 1.0 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.0 | 0.6 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
| 0.0 | 2.0 | GO:0015175 | neutral amino acid transmembrane transporter activity(GO:0015175) |
| 0.0 | 0.4 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
| 0.0 | 0.1 | GO:0008392 | arachidonic acid monooxygenase activity(GO:0008391) arachidonic acid epoxygenase activity(GO:0008392) |
| 0.0 | 0.1 | GO:0033867 | Fas-activated serine/threonine kinase activity(GO:0033867) |
| 0.0 | 0.1 | GO:0016429 | tRNA (adenine) methyltransferase activity(GO:0016426) tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
| 0.0 | 0.5 | GO:1990459 | transferrin receptor binding(GO:1990459) |
| 0.0 | 1.0 | GO:0008198 | ferrous iron binding(GO:0008198) |
| 0.0 | 2.3 | GO:0031491 | nucleosome binding(GO:0031491) |
| 0.0 | 0.1 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
| 0.0 | 0.1 | GO:0033149 | FFAT motif binding(GO:0033149) |
| 0.0 | 0.4 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.0 | 0.4 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.0 | 1.8 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
| 0.0 | 0.8 | GO:1905030 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
| 0.0 | 0.5 | GO:0045499 | chemorepellent activity(GO:0045499) |
| 0.0 | 0.5 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.0 | 1.5 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) |
| 0.0 | 1.8 | GO:0016836 | hydro-lyase activity(GO:0016836) |
| 0.0 | 0.2 | GO:0004692 | cGMP-dependent protein kinase activity(GO:0004692) |
| 0.0 | 0.1 | GO:0030984 | kininogen binding(GO:0030984) |
| 0.0 | 0.1 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
| 0.0 | 0.1 | GO:0009008 | DNA-methyltransferase activity(GO:0009008) |
| 0.0 | 0.3 | GO:0047685 | amine sulfotransferase activity(GO:0047685) |
| 0.0 | 0.1 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.0 | 0.4 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.0 | 0.3 | GO:0036132 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
| 0.0 | 0.3 | GO:0016167 | glial cell-derived neurotrophic factor receptor activity(GO:0016167) |
| 0.0 | 0.3 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
| 0.0 | 0.1 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
| 0.0 | 0.9 | GO:0019789 | SUMO transferase activity(GO:0019789) |
| 0.0 | 0.1 | GO:0008670 | 2,4-dienoyl-CoA reductase (NADPH) activity(GO:0008670) |
| 0.0 | 0.2 | GO:0070404 | NADH binding(GO:0070404) |
| 0.0 | 0.1 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
| 0.0 | 0.2 | GO:0016402 | pristanoyl-CoA oxidase activity(GO:0016402) |
| 0.0 | 0.2 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
| 0.0 | 0.2 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.0 | 1.0 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.0 | 0.4 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
| 0.0 | 0.4 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.0 | 0.7 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
| 0.0 | 0.2 | GO:0052656 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
| 0.0 | 0.2 | GO:0043047 | single-stranded telomeric DNA binding(GO:0043047) G-rich strand telomeric DNA binding(GO:0098505) |
| 0.0 | 0.2 | GO:0070735 | protein-glycine ligase activity(GO:0070735) |
| 0.0 | 0.2 | GO:0050694 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.0 | 0.1 | GO:0015211 | purine nucleoside transmembrane transporter activity(GO:0015211) |
| 0.0 | 0.2 | GO:0070892 | lipoteichoic acid receptor activity(GO:0070892) |
| 0.0 | 0.1 | GO:0010340 | carboxyl-O-methyltransferase activity(GO:0010340) protein carboxyl O-methyltransferase activity(GO:0051998) |
| 0.0 | 0.1 | GO:0015235 | cobalamin transporter activity(GO:0015235) |
| 0.0 | 0.2 | GO:0031013 | troponin I binding(GO:0031013) |
| 0.0 | 0.1 | GO:0017130 | poly(C) RNA binding(GO:0017130) |
| 0.0 | 0.9 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.0 | 0.6 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.0 | 0.3 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.0 | 0.6 | GO:0045125 | bioactive lipid receptor activity(GO:0045125) |
| 0.0 | 0.2 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.0 | 0.1 | GO:0004487 | methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
| 0.0 | 0.6 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.0 | 1.8 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.0 | 0.1 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.0 | 0.0 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
| 0.0 | 0.2 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 0.0 | 0.3 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.0 | 0.7 | GO:0016289 | CoA hydrolase activity(GO:0016289) |
| 0.0 | 0.2 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.0 | 0.0 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.0 | 0.1 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
| 0.0 | 1.0 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.0 | 0.7 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
| 0.0 | 0.1 | GO:0035673 | oligopeptide transporter activity(GO:0015198) oligopeptide transmembrane transporter activity(GO:0035673) |
| 0.0 | 0.1 | GO:0004958 | prostaglandin F receptor activity(GO:0004958) |
| 0.0 | 0.4 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.0 | 0.2 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.0 | 0.1 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
| 0.0 | 0.2 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.0 | 0.2 | GO:0032296 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
| 0.0 | 0.1 | GO:0070052 | collagen V binding(GO:0070052) |
| 0.0 | 1.8 | GO:0019843 | rRNA binding(GO:0019843) |
| 0.0 | 0.2 | GO:0034595 | phosphatidylinositol phosphate 5-phosphatase activity(GO:0034595) |
| 0.0 | 0.1 | GO:0004657 | proline dehydrogenase activity(GO:0004657) |
| 0.0 | 0.0 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
| 0.0 | 0.1 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
| 0.0 | 0.5 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.0 | 0.2 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
| 0.0 | 0.1 | GO:0004666 | prostaglandin-endoperoxide synthase activity(GO:0004666) |
| 0.0 | 0.7 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
| 0.0 | 0.1 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
| 0.0 | 0.4 | GO:0043548 | phosphatidylinositol 3-kinase binding(GO:0043548) |
| 0.0 | 0.1 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.0 | 0.2 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
| 0.0 | 1.0 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.0 | 0.1 | GO:0031531 | thyrotropin-releasing hormone receptor binding(GO:0031531) |
| 0.0 | 0.8 | GO:0008527 | taste receptor activity(GO:0008527) |
| 0.0 | 0.3 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.0 | 0.2 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 0.0 | 0.1 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
| 0.0 | 0.1 | GO:0004992 | platelet activating factor receptor activity(GO:0004992) |
| 0.0 | 0.3 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.0 | 0.2 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
| 0.0 | 0.2 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.0 | 0.7 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.0 | 0.7 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.0 | 1.0 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.0 | 0.2 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
| 0.0 | 1.0 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
| 0.0 | 0.3 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
| 0.0 | 0.1 | GO:0010861 | thyroid hormone receptor activator activity(GO:0010861) thyroid hormone receptor coactivator activity(GO:0030375) |
| 0.0 | 0.2 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
| 0.0 | 0.2 | GO:0030020 | extracellular matrix structural constituent conferring tensile strength(GO:0030020) |
| 0.0 | 0.1 | GO:0004630 | phospholipase D activity(GO:0004630) |
| 0.0 | 1.2 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.0 | 0.0 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.0 | 2.1 | GO:0042826 | histone deacetylase binding(GO:0042826) |
| 0.0 | 0.7 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.0 | 0.1 | GO:0080130 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.0 | 0.1 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.0 | 0.2 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.0 | 0.0 | GO:0052857 | NADHX epimerase activity(GO:0052856) NADPHX epimerase activity(GO:0052857) |
| 0.0 | 1.0 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
| 0.0 | 0.2 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
| 0.0 | 1.5 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.0 | 0.2 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.0 | 0.9 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.9 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.0 | 12.5 | GO:0019787 | ubiquitin-like protein transferase activity(GO:0019787) |
| 0.0 | 0.2 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
| 0.0 | 0.8 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
| 0.0 | 0.1 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
| 0.0 | 0.0 | GO:0019961 | interferon binding(GO:0019961) |
| 0.0 | 0.1 | GO:0050253 | retinyl-palmitate esterase activity(GO:0050253) |
| 0.0 | 0.1 | GO:0004560 | alpha-L-fucosidase activity(GO:0004560) fucosidase activity(GO:0015928) |
| 0.0 | 0.5 | GO:0004970 | ionotropic glutamate receptor activity(GO:0004970) |
| 0.0 | 0.0 | GO:0000217 | DNA secondary structure binding(GO:0000217) |
| 0.0 | 0.1 | GO:0022850 | serotonin-gated cation channel activity(GO:0022850) |
| 0.0 | 0.0 | GO:0008410 | CoA-transferase activity(GO:0008410) |
| 0.0 | 0.2 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.0 | 0.3 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.0 | 0.1 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.0 | 0.1 | GO:0003916 | DNA topoisomerase activity(GO:0003916) |
| 0.0 | 0.1 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) procollagen glucosyltransferase activity(GO:0033823) |
| 0.0 | 0.1 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.0 | 0.2 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.0 | 0.2 | GO:0004659 | prenyltransferase activity(GO:0004659) |
| 0.0 | 0.1 | GO:0004878 | complement component C5a receptor activity(GO:0004878) |
| 0.0 | 0.1 | GO:0004470 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) oxaloacetate decarboxylase activity(GO:0008948) |
| 0.0 | 0.3 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.0 | 0.0 | GO:0030305 | heparanase activity(GO:0030305) |
| 0.0 | 0.0 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.0 | 0.6 | GO:0004177 | aminopeptidase activity(GO:0004177) |
| 0.0 | 0.2 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
| 0.0 | 0.5 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.0 | 0.1 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.0 | 0.1 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.0 | 0.1 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 0.0 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.0 | 0.1 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.1 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
| 0.0 | 0.1 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
| 0.0 | 0.2 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.0 | 0.0 | GO:0005026 | transforming growth factor beta receptor activity, type II(GO:0005026) |
| 0.0 | 0.3 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
| 0.0 | 0.0 | GO:0042020 | interleukin-23 binding(GO:0042019) interleukin-23 receptor activity(GO:0042020) |
| 0.0 | 0.5 | GO:0044769 | ATPase activity, coupled to transmembrane movement of ions, rotational mechanism(GO:0044769) |
| 0.0 | 0.9 | GO:0005253 | anion channel activity(GO:0005253) |
| 0.0 | 0.5 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
| 0.0 | 0.1 | GO:0004996 | thyroid-stimulating hormone receptor activity(GO:0004996) |
| 0.0 | 0.1 | GO:0032395 | MHC class II receptor activity(GO:0032395) |
| 0.0 | 1.2 | GO:0008168 | methyltransferase activity(GO:0008168) |
| 0.0 | 0.0 | GO:0051870 | methotrexate binding(GO:0051870) |
| 0.0 | 0.1 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.0 | 0.1 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
Gene overrepresentation in curated gene sets: canonical pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.7 | 2.0 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.6 | 1.1 | PID IGF1 PATHWAY | IGF1 pathway |
| 0.3 | 0.7 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.3 | 1.6 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.3 | 10.1 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.2 | 0.2 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.2 | 7.9 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.2 | 3.1 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.2 | 0.5 | ST STAT3 PATHWAY | STAT3 Pathway |
| 0.2 | 2.1 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.2 | 1.4 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.2 | 0.2 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
| 0.2 | 0.3 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.2 | 1.2 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.2 | 1.3 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.1 | 10.9 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.1 | 11.4 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.1 | 2.7 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.1 | 0.4 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.1 | 0.5 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.1 | 7.6 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.1 | 8.8 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.1 | 2.9 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.1 | 10.9 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
| 0.1 | 0.7 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
| 0.1 | 0.2 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.1 | 1.3 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.1 | 1.8 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.1 | 3.0 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.1 | 1.6 | PID ATR PATHWAY | ATR signaling pathway |
| 0.1 | 2.4 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.1 | 6.2 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.1 | 0.9 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
| 0.1 | 2.3 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.1 | 0.1 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.1 | 1.4 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.1 | 2.6 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.1 | 0.9 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
| 0.1 | 3.6 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.1 | 0.7 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.1 | 0.3 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.1 | 0.4 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.1 | 1.4 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
| 0.1 | 2.1 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
| 0.1 | 1.8 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.0 | 1.3 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 1.5 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.0 | 0.4 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.0 | 2.3 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.0 | 0.1 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.0 | 0.2 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.0 | 1.1 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.0 | 1.0 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.0 | 0.3 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.0 | 1.6 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 0.2 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.0 | 0.1 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.0 | 0.8 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 0.4 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.0 | 0.3 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.0 | 0.3 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.0 | 6.7 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.0 | 0.2 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
| 0.0 | 1.3 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.0 | 0.2 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.0 | 0.3 | ST ADRENERGIC | Adrenergic Pathway |
| 0.0 | 0.7 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 2.2 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 0.0 | 0.8 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.0 | 0.4 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 1.8 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
| 0.0 | 0.1 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.0 | 0.3 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.0 | 0.0 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.0 | 0.8 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.0 | 0.1 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.0 | 0.1 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.0 | 0.2 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.0 | 0.1 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
Gene overrepresentation in curated gene sets: REACTOME pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 1.8 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
| 0.5 | 5.4 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.4 | 0.4 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.4 | 0.8 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.4 | 4.6 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.3 | 0.6 | REACTOME DAG AND IP3 SIGNALING | Genes involved in DAG and IP3 signaling |
| 0.3 | 0.3 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
| 0.3 | 5.1 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.3 | 7.5 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.2 | 2.0 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.2 | 5.3 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.2 | 1.4 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
| 0.2 | 6.0 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.2 | 0.4 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
| 0.2 | 5.9 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.2 | 8.6 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.2 | 0.6 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.2 | 2.9 | REACTOME OPSINS | Genes involved in Opsins |
| 0.2 | 2.5 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 0.2 | 5.3 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.2 | 7.8 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.2 | 6.8 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.2 | 4.8 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.2 | 5.1 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.2 | 7.1 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.2 | 4.9 | REACTOME PHOSPHORYLATION OF THE APC C | Genes involved in Phosphorylation of the APC/C |
| 0.2 | 2.4 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.2 | 1.4 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.2 | 2.6 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.2 | 3.1 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.1 | 2.2 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.1 | 1.9 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.1 | 3.4 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.1 | 4.3 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
| 0.1 | 3.4 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.1 | 1.1 | REACTOME RAF MAP KINASE CASCADE | Genes involved in RAF/MAP kinase cascade |
| 0.1 | 2.3 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
| 0.1 | 1.7 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.1 | 2.0 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.1 | 6.2 | REACTOME RNA POL III TRANSCRIPTION | Genes involved in RNA Polymerase III Transcription |
| 0.1 | 2.6 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.1 | 1.1 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.1 | 2.5 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.1 | 4.6 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.1 | 3.2 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.1 | 4.5 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.1 | 5.4 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.1 | 2.8 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
| 0.1 | 1.4 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.1 | 4.1 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.1 | 2.4 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
| 0.1 | 0.7 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.1 | 3.9 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.1 | 1.9 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.1 | 0.3 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.1 | 0.7 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
| 0.1 | 1.1 | REACTOME FATTY ACID TRIACYLGLYCEROL AND KETONE BODY METABOLISM | Genes involved in Fatty acid, triacylglycerol, and ketone body metabolism |
| 0.1 | 0.4 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.1 | 3.4 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.1 | 1.8 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.1 | 1.5 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.1 | 5.5 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
| 0.1 | 0.4 | REACTOME POL SWITCHING | Genes involved in Polymerase switching |
| 0.1 | 0.4 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
| 0.1 | 1.4 | REACTOME REVERSIBLE HYDRATION OF CARBON DIOXIDE | Genes involved in Reversible Hydration of Carbon Dioxide |
| 0.1 | 2.1 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.1 | 1.7 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.1 | 1.0 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.1 | 2.4 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.1 | 1.9 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.1 | 0.3 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
| 0.1 | 7.9 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 0.1 | 2.1 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.1 | 2.3 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.1 | 1.9 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.1 | 2.7 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.1 | 4.7 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.1 | 1.6 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.1 | 0.8 | REACTOME ACTIVATION OF ATR IN RESPONSE TO REPLICATION STRESS | Genes involved in Activation of ATR in response to replication stress |
| 0.1 | 1.4 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.1 | 0.1 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
| 0.1 | 1.6 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.1 | 0.5 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.1 | 0.8 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 0.1 | 0.7 | REACTOME ACTIVATION OF THE MRNA UPON BINDING OF THE CAP BINDING COMPLEX AND EIFS AND SUBSEQUENT BINDING TO 43S | Genes involved in Activation of the mRNA upon binding of the cap-binding complex and eIFs, and subsequent binding to 43S |
| 0.1 | 1.3 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.1 | 2.2 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.1 | 1.6 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
| 0.1 | 0.1 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
| 0.1 | 3.3 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.1 | 1.0 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.1 | 0.6 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
| 0.1 | 1.5 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.1 | 1.6 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.1 | 1.8 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.1 | 0.7 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 0.1 | 1.2 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
| 0.1 | 0.5 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
| 0.1 | 2.2 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.1 | 0.1 | REACTOME OPIOID SIGNALLING | Genes involved in Opioid Signalling |
| 0.1 | 0.8 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.1 | 1.0 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.1 | 2.4 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
| 0.1 | 0.1 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF CYCLIN B | Genes involved in APC/C:Cdc20 mediated degradation of Cyclin B |
| 0.1 | 0.9 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
| 0.1 | 0.4 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.1 | 8.9 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.1 | 1.1 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.1 | 1.2 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.1 | 0.8 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.1 | 1.5 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.1 | 0.6 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.1 | 0.7 | REACTOME PURINE METABOLISM | Genes involved in Purine metabolism |
| 0.0 | 1.6 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.0 | 1.2 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.0 | 0.5 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
| 0.0 | 0.1 | REACTOME AUTODEGRADATION OF THE E3 UBIQUITIN LIGASE COP1 | Genes involved in Autodegradation of the E3 ubiquitin ligase COP1 |
| 0.0 | 1.5 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.0 | 1.2 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.0 | 1.7 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.0 | 0.7 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.0 | 3.2 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 0.7 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.0 | 0.9 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.0 | 2.4 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.0 | 0.1 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 0.0 | 0.6 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.0 | 0.3 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.0 | 1.6 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.0 | 0.3 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.0 | 0.1 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.0 | 0.1 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.0 | 1.9 | REACTOME TRANSPORT OF GLUCOSE AND OTHER SUGARS BILE SALTS AND ORGANIC ACIDS METAL IONS AND AMINE COMPOUNDS | Genes involved in Transport of glucose and other sugars, bile salts and organic acids, metal ions and amine compounds |
| 0.0 | 2.8 | REACTOME CELL SURFACE INTERACTIONS AT THE VASCULAR WALL | Genes involved in Cell surface interactions at the vascular wall |
| 0.0 | 0.6 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.0 | 0.2 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.0 | 0.3 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.0 | 1.0 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
| 0.0 | 0.1 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 0.0 | 1.0 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.0 | 0.6 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.0 | 1.8 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 2.3 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.0 | 0.1 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.0 | 0.1 | REACTOME BILE ACID AND BILE SALT METABOLISM | Genes involved in Bile acid and bile salt metabolism |
| 0.0 | 0.2 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.0 | 0.3 | REACTOME ACTIVATION OF KAINATE RECEPTORS UPON GLUTAMATE BINDING | Genes involved in Activation of Kainate Receptors upon glutamate binding |
| 0.0 | 0.9 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
| 0.0 | 0.8 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
| 0.0 | 0.5 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
| 0.0 | 0.2 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
| 0.0 | 0.1 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
| 0.0 | 1.0 | REACTOME HEPARAN SULFATE HEPARIN HS GAG METABOLISM | Genes involved in Heparan sulfate/heparin (HS-GAG) metabolism |
| 0.0 | 0.0 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
| 0.0 | 0.5 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.0 | 0.2 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.0 | 0.2 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
| 0.0 | 0.2 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.0 | 4.9 | REACTOME GENERIC TRANSCRIPTION PATHWAY | Genes involved in Generic Transcription Pathway |
| 0.0 | 0.0 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
| 0.0 | 0.2 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.0 | 0.2 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
| 0.0 | 0.1 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |