Project
Inflammatory response time course, HUVEC (Wada et al., 2009)
Navigation
Downloads
Results for SP3
Z-value: 1.40
Motif logo
Transcription factors associated with SP3
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
SP3
|
ENSG00000172845.9 | Sp3 transcription factor |
Activity-expression correlation:
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| SP3 | hg19_v2_chr2_-_174830430_174830563 | 0.31 | 1.3e-01 | Click! |
Activity profile of SP3 motif
Sorted Z-values of SP3 motif
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr6_-_29595779 | 9.13 |
ENST00000355973.3
ENST00000377012.4 |
GABBR1
|
gamma-aminobutyric acid (GABA) B receptor, 1 |
| chr21_-_45660723 | 8.92 |
ENST00000344330.4
ENST00000407780.3 ENST00000400379.3 |
ICOSLG
|
inducible T-cell co-stimulator ligand |
| chr16_+_66638685 | 8.69 |
ENST00000565003.1
|
CMTM3
|
CKLF-like MARVEL transmembrane domain containing 3 |
| chr9_-_123691439 | 8.47 |
ENST00000540010.1
|
TRAF1
|
TNF receptor-associated factor 1 |
| chr9_-_123691047 | 7.94 |
ENST00000373887.3
|
TRAF1
|
TNF receptor-associated factor 1 |
| chr19_+_45504688 | 7.60 |
ENST00000221452.8
ENST00000540120.1 ENST00000505236.1 |
RELB
|
v-rel avian reticuloendotheliosis viral oncogene homolog B |
| chr16_+_2039946 | 7.37 |
ENST00000248121.2
ENST00000568896.1 |
SYNGR3
|
synaptogyrin 3 |
| chr3_-_127541679 | 7.09 |
ENST00000265052.5
|
MGLL
|
monoglyceride lipase |
| chr6_-_160147925 | 6.97 |
ENST00000535561.1
|
SOD2
|
superoxide dismutase 2, mitochondrial |
| chr2_-_225907150 | 6.94 |
ENST00000258390.7
|
DOCK10
|
dedicator of cytokinesis 10 |
| chr8_-_141645645 | 6.83 |
ENST00000519980.1
ENST00000220592.5 |
AGO2
|
argonaute RISC catalytic component 2 |
| chr6_+_37137939 | 6.82 |
ENST00000373509.5
|
PIM1
|
pim-1 oncogene |
| chr6_-_160148356 | 6.74 |
ENST00000401980.3
ENST00000545162.1 |
SOD2
|
superoxide dismutase 2, mitochondrial |
| chr1_+_65613340 | 6.44 |
ENST00000546702.1
|
AK4
|
adenylate kinase 4 |
| chr6_+_4776580 | 6.35 |
ENST00000397588.3
|
CDYL
|
chromodomain protein, Y-like |
| chr5_-_131826457 | 6.30 |
ENST00000437654.1
ENST00000245414.4 |
IRF1
|
interferon regulatory factor 1 |
| chr6_-_32821599 | 6.28 |
ENST00000354258.4
|
TAP1
|
transporter 1, ATP-binding cassette, sub-family B (MDR/TAP) |
| chr3_-_158450475 | 6.28 |
ENST00000237696.5
|
RARRES1
|
retinoic acid receptor responder (tazarotene induced) 1 |
| chr7_-_25019760 | 6.24 |
ENST00000352860.1
ENST00000353930.1 ENST00000431825.2 ENST00000313367.2 |
OSBPL3
|
oxysterol binding protein-like 3 |
| chr17_+_77020325 | 6.22 |
ENST00000311661.4
|
C1QTNF1
|
C1q and tumor necrosis factor related protein 1 |
| chr6_-_160114293 | 6.22 |
ENST00000337404.4
ENST00000538183.2 |
SOD2
|
superoxide dismutase 2, mitochondrial |
| chr3_+_122283064 | 6.16 |
ENST00000296161.4
|
DTX3L
|
deltex 3-like (Drosophila) |
| chr19_+_18284477 | 6.15 |
ENST00000407280.3
|
IFI30
|
interferon, gamma-inducible protein 30 |
| chr10_-_49812997 | 6.14 |
ENST00000417912.2
|
ARHGAP22
|
Rho GTPase activating protein 22 |
| chr21_-_45660840 | 5.94 |
ENST00000400377.3
|
ICOSLG
|
inducible T-cell co-stimulator ligand |
| chr5_-_179780312 | 5.94 |
ENST00000253778.8
|
GFPT2
|
glutamine-fructose-6-phosphate transaminase 2 |
| chr6_+_32821924 | 5.91 |
ENST00000374859.2
ENST00000453265.2 |
PSMB9
|
proteasome (prosome, macropain) subunit, beta type, 9 |
| chr2_-_220252603 | 5.88 |
ENST00000322176.7
ENST00000273075.4 |
DNPEP
|
aspartyl aminopeptidase |
| chr4_-_177713788 | 5.78 |
ENST00000280193.2
|
VEGFC
|
vascular endothelial growth factor C |
| chr1_+_169075554 | 5.75 |
ENST00000367815.4
|
ATP1B1
|
ATPase, Na+/K+ transporting, beta 1 polypeptide |
| chr3_-_122283079 | 5.70 |
ENST00000471785.1
ENST00000466126.1 |
PARP9
|
poly (ADP-ribose) polymerase family, member 9 |
| chr14_+_21538517 | 5.67 |
ENST00000298693.3
|
ARHGEF40
|
Rho guanine nucleotide exchange factor (GEF) 40 |
| chr3_+_53195136 | 5.61 |
ENST00000394729.2
ENST00000330452.3 |
PRKCD
|
protein kinase C, delta |
| chr11_-_72353451 | 5.58 |
ENST00000376450.3
|
PDE2A
|
phosphodiesterase 2A, cGMP-stimulated |
| chr17_-_74497432 | 5.54 |
ENST00000590288.1
ENST00000313080.4 ENST00000592123.1 ENST00000591255.1 ENST00000585989.1 ENST00000591697.1 ENST00000389760.4 |
RHBDF2
|
rhomboid 5 homolog 2 (Drosophila) |
| chr11_-_67981046 | 5.35 |
ENST00000402789.1
ENST00000402185.2 ENST00000458496.1 |
SUV420H1
|
suppressor of variegation 4-20 homolog 1 (Drosophila) |
| chr9_-_38069208 | 5.32 |
ENST00000377707.3
ENST00000377700.4 |
SHB
|
Src homology 2 domain containing adaptor protein B |
| chr6_+_14117872 | 5.30 |
ENST00000379153.3
|
CD83
|
CD83 molecule |
| chr21_+_43639211 | 5.25 |
ENST00000450121.1
ENST00000398449.3 ENST00000361802.2 |
ABCG1
|
ATP-binding cassette, sub-family G (WHITE), member 1 |
| chr1_-_205782304 | 5.22 |
ENST00000367137.3
|
SLC41A1
|
solute carrier family 41 (magnesium transporter), member 1 |
| chr16_-_67969888 | 5.21 |
ENST00000574576.2
|
PSMB10
|
proteasome (prosome, macropain) subunit, beta type, 10 |
| chr19_+_10197463 | 5.17 |
ENST00000590378.1
ENST00000397881.3 |
C19orf66
|
chromosome 19 open reading frame 66 |
| chr11_+_19798964 | 5.17 |
ENST00000527559.2
|
NAV2
|
neuron navigator 2 |
| chr16_+_11762270 | 5.08 |
ENST00000329565.5
|
SNN
|
stannin |
| chr1_-_41328018 | 5.07 |
ENST00000372638.2
|
CITED4
|
Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 4 |
| chr4_-_2758015 | 5.06 |
ENST00000510267.1
ENST00000503235.1 ENST00000315423.7 |
TNIP2
|
TNFAIP3 interacting protein 2 |
| chr7_-_139477500 | 5.06 |
ENST00000406875.3
ENST00000428878.2 |
HIPK2
|
homeodomain interacting protein kinase 2 |
| chr5_-_16936340 | 5.05 |
ENST00000507288.1
ENST00000513610.1 |
MYO10
|
myosin X |
| chr6_-_160114260 | 5.02 |
ENST00000367054.2
ENST00000367055.4 ENST00000444946.2 ENST00000452684.2 |
SOD2
|
superoxide dismutase 2, mitochondrial |
| chr5_-_150460914 | 4.99 |
ENST00000389378.2
|
TNIP1
|
TNFAIP3 interacting protein 1 |
| chr8_+_54793425 | 4.97 |
ENST00000522225.1
|
RGS20
|
regulator of G-protein signaling 20 |
| chr21_+_27011899 | 4.95 |
ENST00000425221.2
|
JAM2
|
junctional adhesion molecule 2 |
| chr14_+_21538429 | 4.91 |
ENST00000298694.4
ENST00000555038.1 |
ARHGEF40
|
Rho guanine nucleotide exchange factor (GEF) 40 |
| chr5_+_127419449 | 4.85 |
ENST00000262461.2
ENST00000343225.4 |
SLC12A2
|
solute carrier family 12 (sodium/potassium/chloride transporter), member 2 |
| chr16_-_11680759 | 4.84 |
ENST00000571459.1
ENST00000570798.1 ENST00000572255.1 ENST00000574763.1 ENST00000574703.1 ENST00000571277.1 ENST00000381810.3 |
LITAF
|
lipopolysaccharide-induced TNF factor |
| chr1_+_65613513 | 4.75 |
ENST00000395334.2
|
AK4
|
adenylate kinase 4 |
| chr21_+_42792442 | 4.72 |
ENST00000398600.2
|
MX1
|
myxovirus (influenza virus) resistance 1, interferon-inducible protein p78 (mouse) |
| chr7_+_73703728 | 4.68 |
ENST00000361545.5
ENST00000223398.6 |
CLIP2
|
CAP-GLY domain containing linker protein 2 |
| chr1_-_184943610 | 4.58 |
ENST00000367511.3
|
FAM129A
|
family with sequence similarity 129, member A |
| chr20_+_55966444 | 4.52 |
ENST00000356208.5
ENST00000440234.2 |
RBM38
|
RNA binding motif protein 38 |
| chr16_-_11681023 | 4.42 |
ENST00000570904.1
ENST00000574701.1 |
LITAF
|
lipopolysaccharide-induced TNF factor |
| chr7_-_77045617 | 4.41 |
ENST00000257626.7
|
GSAP
|
gamma-secretase activating protein |
| chr21_+_44073916 | 4.39 |
ENST00000349112.3
ENST00000398224.3 |
PDE9A
|
phosphodiesterase 9A |
| chr16_+_50776021 | 4.38 |
ENST00000566679.2
ENST00000564634.1 ENST00000398568.2 |
CYLD
|
cylindromatosis (turban tumor syndrome) |
| chrX_+_9433048 | 4.38 |
ENST00000217964.7
|
TBL1X
|
transducin (beta)-like 1X-linked |
| chr9_-_95896550 | 4.32 |
ENST00000375446.4
|
NINJ1
|
ninjurin 1 |
| chr16_-_75590114 | 4.29 |
ENST00000568377.1
ENST00000565067.1 ENST00000258173.6 |
TMEM231
|
transmembrane protein 231 |
| chr3_-_122283424 | 4.28 |
ENST00000477522.2
ENST00000360356.2 |
PARP9
|
poly (ADP-ribose) polymerase family, member 9 |
| chr1_+_65613217 | 4.24 |
ENST00000545314.1
|
AK4
|
adenylate kinase 4 |
| chr8_+_17354617 | 4.19 |
ENST00000470360.1
|
SLC7A2
|
solute carrier family 7 (cationic amino acid transporter, y+ system), member 2 |
| chr1_-_212873267 | 4.19 |
ENST00000243440.1
|
BATF3
|
basic leucine zipper transcription factor, ATF-like 3 |
| chr17_+_77020224 | 4.17 |
ENST00000339142.2
|
C1QTNF1
|
C1q and tumor necrosis factor related protein 1 |
| chr22_-_50964558 | 4.15 |
ENST00000535425.1
ENST00000439934.1 |
SCO2
|
SCO2 cytochrome c oxidase assembly protein |
| chr10_-_49813090 | 4.15 |
ENST00000249601.4
|
ARHGAP22
|
Rho GTPase activating protein 22 |
| chr1_+_227058264 | 4.14 |
ENST00000366783.3
ENST00000340188.4 ENST00000495488.1 ENST00000422240.2 |
PSEN2
|
presenilin 2 (Alzheimer disease 4) |
| chr22_-_50964849 | 4.11 |
ENST00000543927.1
ENST00000423348.1 |
SCO2
|
SCO2 cytochrome c oxidase assembly protein |
| chr21_+_44073860 | 4.10 |
ENST00000335512.4
ENST00000539837.1 ENST00000291539.6 ENST00000380328.2 ENST00000398232.3 ENST00000398234.3 ENST00000398236.3 ENST00000328862.6 ENST00000335440.6 ENST00000398225.3 ENST00000398229.3 ENST00000398227.3 |
PDE9A
|
phosphodiesterase 9A |
| chr8_+_54793454 | 4.02 |
ENST00000276500.4
|
RGS20
|
regulator of G-protein signaling 20 |
| chr9_-_136344197 | 4.02 |
ENST00000414172.1
ENST00000371897.4 |
SLC2A6
|
solute carrier family 2 (facilitated glucose transporter), member 6 |
| chr7_+_55086794 | 4.01 |
ENST00000275493.2
ENST00000442591.1 |
EGFR
|
epidermal growth factor receptor |
| chr17_-_48207157 | 3.99 |
ENST00000330175.4
ENST00000503131.1 |
SAMD14
|
sterile alpha motif domain containing 14 |
| chr11_-_72492878 | 3.98 |
ENST00000535054.1
ENST00000545082.1 |
STARD10
|
StAR-related lipid transfer (START) domain containing 10 |
| chr21_+_27011584 | 3.98 |
ENST00000400532.1
ENST00000480456.1 ENST00000312957.5 |
JAM2
|
junctional adhesion molecule 2 |
| chr11_-_72492903 | 3.95 |
ENST00000537947.1
|
STARD10
|
StAR-related lipid transfer (START) domain containing 10 |
| chr5_-_150460539 | 3.92 |
ENST00000520931.1
ENST00000520695.1 ENST00000521591.1 ENST00000518977.1 |
TNIP1
|
TNFAIP3 interacting protein 1 |
| chr6_-_44233361 | 3.91 |
ENST00000275015.5
|
NFKBIE
|
nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, epsilon |
| chr17_-_53499310 | 3.91 |
ENST00000262065.3
|
MMD
|
monocyte to macrophage differentiation-associated |
| chr12_-_133338426 | 3.91 |
ENST00000337516.5
ENST00000357997.5 |
ANKLE2
|
ankyrin repeat and LEM domain containing 2 |
| chr1_+_2518202 | 3.91 |
ENST00000419916.2
ENST00000378424.4 ENST00000537325.1 ENST00000378427.1 ENST00000378425.5 ENST00000444521.2 ENST00000465233.1 ENST00000498083.1 |
FAM213B
|
family with sequence similarity 213, member B |
| chr8_-_142011036 | 3.90 |
ENST00000520892.1
|
PTK2
|
protein tyrosine kinase 2 |
| chr15_+_67358163 | 3.89 |
ENST00000327367.4
|
SMAD3
|
SMAD family member 3 |
| chr6_+_83073952 | 3.88 |
ENST00000543496.1
|
TPBG
|
trophoblast glycoprotein |
| chr6_+_32812568 | 3.87 |
ENST00000414474.1
|
PSMB9
|
proteasome (prosome, macropain) subunit, beta type, 9 |
| chr8_-_494824 | 3.87 |
ENST00000427263.2
ENST00000324079.6 |
TDRP
|
testis development related protein |
| chr8_+_17354587 | 3.87 |
ENST00000494857.1
ENST00000522656.1 |
SLC7A2
|
solute carrier family 7 (cationic amino acid transporter, y+ system), member 2 |
| chr19_+_676385 | 3.85 |
ENST00000166139.4
|
FSTL3
|
follistatin-like 3 (secreted glycoprotein) |
| chr3_-_45267760 | 3.78 |
ENST00000503771.1
|
TMEM158
|
transmembrane protein 158 (gene/pseudogene) |
| chr3_-_107809816 | 3.76 |
ENST00000361309.5
ENST00000355354.7 |
CD47
|
CD47 molecule |
| chr5_+_118691706 | 3.72 |
ENST00000415806.2
|
TNFAIP8
|
tumor necrosis factor, alpha-induced protein 8 |
| chr3_-_158450231 | 3.72 |
ENST00000479756.1
|
RARRES1
|
retinoic acid receptor responder (tazarotene induced) 1 |
| chr14_-_104313824 | 3.71 |
ENST00000553739.1
ENST00000202556.9 |
PPP1R13B
|
protein phosphatase 1, regulatory subunit 13B |
| chr4_+_142557717 | 3.68 |
ENST00000320650.4
ENST00000296545.7 |
IL15
|
interleukin 15 |
| chr16_-_84651673 | 3.68 |
ENST00000262428.4
|
COTL1
|
coactosin-like 1 (Dictyostelium) |
| chr3_-_79068594 | 3.68 |
ENST00000436010.2
|
ROBO1
|
roundabout, axon guidance receptor, homolog 1 (Drosophila) |
| chr7_+_151038850 | 3.68 |
ENST00000355851.4
ENST00000566856.1 ENST00000470229.1 |
NUB1
|
negative regulator of ubiquitin-like proteins 1 |
| chr1_+_955448 | 3.67 |
ENST00000379370.2
|
AGRN
|
agrin |
| chr16_+_50775971 | 3.64 |
ENST00000311559.9
ENST00000564326.1 ENST00000566206.1 |
CYLD
|
cylindromatosis (turban tumor syndrome) |
| chr9_+_140500087 | 3.62 |
ENST00000371421.4
|
ARRDC1
|
arrestin domain containing 1 |
| chr9_-_136344237 | 3.61 |
ENST00000432868.1
ENST00000371899.4 |
SLC2A6
|
solute carrier family 2 (facilitated glucose transporter), member 6 |
| chr11_+_64008525 | 3.60 |
ENST00000449942.2
|
FKBP2
|
FK506 binding protein 2, 13kDa |
| chr10_-_105615164 | 3.60 |
ENST00000355946.2
ENST00000369774.4 |
SH3PXD2A
|
SH3 and PX domains 2A |
| chr8_+_90770008 | 3.59 |
ENST00000540020.1
|
RIPK2
|
receptor-interacting serine-threonine kinase 2 |
| chr16_-_84651647 | 3.58 |
ENST00000564057.1
|
COTL1
|
coactosin-like 1 (Dictyostelium) |
| chr10_+_104155450 | 3.57 |
ENST00000471698.1
ENST00000189444.6 |
NFKB2
|
nuclear factor of kappa light polypeptide gene enhancer in B-cells 2 (p49/p100) |
| chr22_+_38302285 | 3.57 |
ENST00000215957.6
|
MICALL1
|
MICAL-like 1 |
| chr6_+_18155560 | 3.56 |
ENST00000546309.2
ENST00000388870.2 ENST00000397244.1 |
KDM1B
|
lysine (K)-specific demethylase 1B |
| chr12_+_102271129 | 3.55 |
ENST00000258534.8
|
DRAM1
|
DNA-damage regulated autophagy modulator 1 |
| chr6_-_101329157 | 3.54 |
ENST00000369143.2
|
ASCC3
|
activating signal cointegrator 1 complex subunit 3 |
| chr11_+_73087309 | 3.54 |
ENST00000064780.2
ENST00000545687.1 |
RELT
|
RELT tumor necrosis factor receptor |
| chr17_+_74380683 | 3.53 |
ENST00000592299.1
ENST00000590959.1 ENST00000323374.4 |
SPHK1
|
sphingosine kinase 1 |
| chr12_-_50101165 | 3.49 |
ENST00000352151.5
ENST00000335154.5 ENST00000293590.5 |
FMNL3
|
formin-like 3 |
| chr6_+_160148593 | 3.49 |
ENST00000337387.4
|
WTAP
|
Wilms tumor 1 associated protein |
| chr3_-_27525865 | 3.48 |
ENST00000445684.1
|
SLC4A7
|
solute carrier family 4, sodium bicarbonate cotransporter, member 7 |
| chr11_-_60719213 | 3.47 |
ENST00000227880.3
|
SLC15A3
|
solute carrier family 15 (oligopeptide transporter), member 3 |
| chr6_+_44095347 | 3.44 |
ENST00000323267.6
|
TMEM63B
|
transmembrane protein 63B |
| chr12_-_133338379 | 3.43 |
ENST00000539605.1
|
ANKLE2
|
ankyrin repeat and LEM domain containing 2 |
| chr16_-_11680791 | 3.42 |
ENST00000571976.1
ENST00000413364.2 |
LITAF
|
lipopolysaccharide-induced TNF factor |
| chr6_-_32820529 | 3.41 |
ENST00000425148.2
|
TAP1
|
transporter 1, ATP-binding cassette, sub-family B (MDR/TAP) |
| chr14_+_103589789 | 3.40 |
ENST00000558056.1
ENST00000560869.1 |
TNFAIP2
|
tumor necrosis factor, alpha-induced protein 2 |
| chr10_+_72575643 | 3.40 |
ENST00000373202.3
|
SGPL1
|
sphingosine-1-phosphate lyase 1 |
| chr11_-_67981295 | 3.39 |
ENST00000405515.1
|
SUV420H1
|
suppressor of variegation 4-20 homolog 1 (Drosophila) |
| chr3_+_72937182 | 3.39 |
ENST00000389617.4
|
GXYLT2
|
glucoside xylosyltransferase 2 |
| chr5_-_1112141 | 3.39 |
ENST00000264930.5
|
SLC12A7
|
solute carrier family 12 (potassium/chloride transporter), member 7 |
| chr3_+_105085734 | 3.37 |
ENST00000306107.5
|
ALCAM
|
activated leukocyte cell adhesion molecule |
| chr2_-_106810783 | 3.37 |
ENST00000283148.7
|
UXS1
|
UDP-glucuronate decarboxylase 1 |
| chr11_-_441964 | 3.36 |
ENST00000332826.6
|
ANO9
|
anoctamin 9 |
| chr8_-_145582118 | 3.36 |
ENST00000455319.2
ENST00000331890.5 |
FBXL6
|
F-box and leucine-rich repeat protein 6 |
| chr16_+_57406368 | 3.35 |
ENST00000006053.6
ENST00000563383.1 |
CX3CL1
|
chemokine (C-X3-C motif) ligand 1 |
| chr4_+_142557771 | 3.35 |
ENST00000514653.1
|
IL15
|
interleukin 15 |
| chr7_+_151038785 | 3.34 |
ENST00000413040.2
ENST00000568733.1 |
NUB1
|
negative regulator of ubiquitin-like proteins 1 |
| chr10_+_111767720 | 3.34 |
ENST00000356080.4
ENST00000277900.8 |
ADD3
|
adducin 3 (gamma) |
| chr16_+_50775948 | 3.34 |
ENST00000569681.1
ENST00000569418.1 ENST00000540145.1 |
CYLD
|
cylindromatosis (turban tumor syndrome) |
| chr2_-_203736150 | 3.32 |
ENST00000457524.1
ENST00000421334.1 |
ICA1L
|
islet cell autoantigen 1,69kDa-like |
| chr19_-_10464570 | 3.30 |
ENST00000529739.1
|
TYK2
|
tyrosine kinase 2 |
| chr3_-_127542051 | 3.30 |
ENST00000398104.1
|
MGLL
|
monoglyceride lipase |
| chr8_-_37756972 | 3.28 |
ENST00000330843.4
ENST00000522727.1 ENST00000287263.4 |
RAB11FIP1
|
RAB11 family interacting protein 1 (class I) |
| chr3_+_10206545 | 3.27 |
ENST00000256458.4
|
IRAK2
|
interleukin-1 receptor-associated kinase 2 |
| chr14_-_91720224 | 3.25 |
ENST00000238699.3
ENST00000531499.2 |
GPR68
|
G protein-coupled receptor 68 |
| chr12_-_57522813 | 3.24 |
ENST00000556155.1
|
STAT6
|
signal transducer and activator of transcription 6, interleukin-4 induced |
| chr15_-_55581954 | 3.24 |
ENST00000336787.1
|
RAB27A
|
RAB27A, member RAS oncogene family |
| chr11_-_57092381 | 3.24 |
ENST00000358252.3
|
TNKS1BP1
|
tankyrase 1 binding protein 1, 182kDa |
| chr19_-_55658687 | 3.22 |
ENST00000593046.1
|
TNNT1
|
troponin T type 1 (skeletal, slow) |
| chr7_-_108096765 | 3.22 |
ENST00000379024.4
ENST00000351718.4 |
NRCAM
|
neuronal cell adhesion molecule |
| chr11_+_19799327 | 3.21 |
ENST00000540292.1
|
NAV2
|
neuron navigator 2 |
| chr7_+_65670186 | 3.21 |
ENST00000304842.5
ENST00000442120.1 |
TPST1
|
tyrosylprotein sulfotransferase 1 |
| chr11_-_128392085 | 3.20 |
ENST00000526145.2
ENST00000531611.1 ENST00000319397.6 ENST00000345075.4 ENST00000535549.1 |
ETS1
|
v-ets avian erythroblastosis virus E26 oncogene homolog 1 |
| chr7_-_108096822 | 3.19 |
ENST00000379028.3
ENST00000413765.2 ENST00000379022.4 |
NRCAM
|
neuronal cell adhesion molecule |
| chr3_+_23244780 | 3.19 |
ENST00000396703.1
|
UBE2E2
|
ubiquitin-conjugating enzyme E2E 2 |
| chr6_-_143266297 | 3.18 |
ENST00000367603.2
|
HIVEP2
|
human immunodeficiency virus type I enhancer binding protein 2 |
| chr1_+_212782012 | 3.16 |
ENST00000341491.4
ENST00000366985.1 |
ATF3
|
activating transcription factor 3 |
| chr8_+_145064233 | 3.16 |
ENST00000529301.1
ENST00000395068.4 |
GRINA
|
glutamate receptor, ionotropic, N-methyl D-aspartate-associated protein 1 (glutamate binding) |
| chr2_-_106810742 | 3.15 |
ENST00000409501.3
ENST00000428048.2 ENST00000441952.1 ENST00000457835.1 ENST00000540130.1 |
UXS1
|
UDP-glucuronate decarboxylase 1 |
| chr5_+_131409476 | 3.12 |
ENST00000296871.2
|
CSF2
|
colony stimulating factor 2 (granulocyte-macrophage) |
| chr4_-_120550146 | 3.11 |
ENST00000354960.3
|
PDE5A
|
phosphodiesterase 5A, cGMP-specific |
| chr4_+_142558078 | 3.11 |
ENST00000529613.1
|
IL15
|
interleukin 15 |
| chr16_-_84538218 | 3.11 |
ENST00000562447.1
ENST00000565765.1 ENST00000535580.1 ENST00000343629.6 |
TLDC1
|
TBC/LysM-associated domain containing 1 |
| chr6_+_18155632 | 3.10 |
ENST00000297792.5
|
KDM1B
|
lysine (K)-specific demethylase 1B |
| chr4_+_39046615 | 3.09 |
ENST00000261425.3
ENST00000508137.2 |
KLHL5
|
kelch-like family member 5 |
| chr19_+_10381769 | 3.09 |
ENST00000423829.2
ENST00000588645.1 |
ICAM1
|
intercellular adhesion molecule 1 |
| chr17_-_1083078 | 3.09 |
ENST00000574266.1
ENST00000302538.5 |
ABR
|
active BCR-related |
| chr16_-_54962704 | 3.08 |
ENST00000502066.2
ENST00000560912.1 ENST00000558952.1 |
CRNDE
|
colorectal neoplasia differentially expressed (non-protein coding) |
| chr3_-_127542021 | 3.07 |
ENST00000434178.2
|
MGLL
|
monoglyceride lipase |
| chr19_+_6739662 | 3.06 |
ENST00000313285.8
ENST00000313244.9 ENST00000596758.1 |
TRIP10
|
thyroid hormone receptor interactor 10 |
| chr9_+_103189405 | 3.06 |
ENST00000395067.2
|
MSANTD3
|
Myb/SANT-like DNA-binding domain containing 3 |
| chr10_-_6019984 | 3.06 |
ENST00000525219.2
|
IL15RA
|
interleukin 15 receptor, alpha |
| chr11_+_64009072 | 3.06 |
ENST00000535135.1
ENST00000394540.3 |
FKBP2
|
FK506 binding protein 2, 13kDa |
| chr21_+_40177755 | 3.05 |
ENST00000360938.3
ENST00000432278.1 |
ETS2
|
v-ets avian erythroblastosis virus E26 oncogene homolog 2 |
| chr1_-_156023580 | 3.05 |
ENST00000368309.3
|
UBQLN4
|
ubiquilin 4 |
| chr2_+_102972363 | 3.04 |
ENST00000409599.1
|
IL18R1
|
interleukin 18 receptor 1 |
| chr3_-_27525826 | 3.02 |
ENST00000454389.1
ENST00000440156.1 ENST00000437179.1 ENST00000446700.1 ENST00000455077.1 ENST00000435667.2 ENST00000388777.4 ENST00000425128.2 |
SLC4A7
|
solute carrier family 4, sodium bicarbonate cotransporter, member 7 |
| chr3_+_133292759 | 3.02 |
ENST00000431519.2
|
CDV3
|
CDV3 homolog (mouse) |
| chr10_+_12391481 | 3.01 |
ENST00000378847.3
|
CAMK1D
|
calcium/calmodulin-dependent protein kinase ID |
| chr1_+_166808692 | 3.01 |
ENST00000367876.4
|
POGK
|
pogo transposable element with KRAB domain |
| chr3_+_11196206 | 3.01 |
ENST00000431010.2
|
HRH1
|
histamine receptor H1 |
| chr19_+_4229495 | 3.00 |
ENST00000221847.5
|
EBI3
|
Epstein-Barr virus induced 3 |
| chr15_+_45926919 | 3.00 |
ENST00000561735.1
ENST00000260324.7 |
SQRDL
|
sulfide quinone reductase-like (yeast) |
| chr19_-_51893827 | 2.98 |
ENST00000574814.1
|
CTD-2616J11.4
|
chromosome 19 open reading frame 84 |
| chr5_-_54830784 | 2.98 |
ENST00000264775.5
|
PPAP2A
|
phosphatidic acid phosphatase type 2A |
| chr8_+_23386557 | 2.97 |
ENST00000523930.1
|
SLC25A37
|
solute carrier family 25 (mitochondrial iron transporter), member 37 |
| chr2_+_234263120 | 2.96 |
ENST00000264057.2
ENST00000427930.1 |
DGKD
|
diacylglycerol kinase, delta 130kDa |
| chr18_-_71959159 | 2.96 |
ENST00000494131.2
ENST00000397914.4 ENST00000340533.4 |
CYB5A
|
cytochrome b5 type A (microsomal) |
| chr16_-_11681316 | 2.95 |
ENST00000571688.1
|
LITAF
|
lipopolysaccharide-induced TNF factor |
| chr15_+_80987617 | 2.95 |
ENST00000258884.4
ENST00000558464.1 |
ABHD17C
|
abhydrolase domain containing 17C |
| chr2_-_37899323 | 2.94 |
ENST00000295324.3
ENST00000457889.1 |
CDC42EP3
|
CDC42 effector protein (Rho GTPase binding) 3 |
| chr8_+_86089460 | 2.94 |
ENST00000418930.2
|
E2F5
|
E2F transcription factor 5, p130-binding |
| chr16_+_56642489 | 2.93 |
ENST00000561491.1
|
MT2A
|
metallothionein 2A |
| chr15_-_64338521 | 2.93 |
ENST00000457488.1
ENST00000558069.1 |
DAPK2
|
death-associated protein kinase 2 |
| chr1_+_17866290 | 2.91 |
ENST00000361221.3
ENST00000452522.1 ENST00000434513.1 |
ARHGEF10L
|
Rho guanine nucleotide exchange factor (GEF) 10-like |
| chr1_-_153521597 | 2.88 |
ENST00000368712.1
|
S100A3
|
S100 calcium binding protein A3 |
| chr10_-_49732281 | 2.87 |
ENST00000374170.1
|
ARHGAP22
|
Rho GTPase activating protein 22 |
Network of associatons between targets according to the STRING database.
First level regulatory network of SP3
Gene Ontology Analysis
Gene overrepresentation in biological process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 5.0 | 24.9 | GO:0001306 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 3.8 | 11.4 | GO:1990108 | protein linear deubiquitination(GO:1990108) |
| 3.4 | 10.1 | GO:0045062 | extrathymic T cell selection(GO:0045062) |
| 3.0 | 11.8 | GO:0046967 | cytosol to ER transport(GO:0046967) |
| 2.7 | 8.1 | GO:0061461 | lysine import(GO:0034226) L-lysine import(GO:0061461) L-lysine import into cell(GO:1903410) |
| 2.7 | 8.0 | GO:0048250 | mitochondrial iron ion transport(GO:0048250) |
| 2.6 | 10.4 | GO:0052027 | modulation of signal transduction in other organism(GO:0044501) modulation by symbiont of host signal transduction pathway(GO:0052027) modulation of signal transduction in other organism involved in symbiotic interaction(GO:0052250) modulation by symbiont of host I-kappaB kinase/NF-kappaB cascade(GO:0085032) |
| 2.4 | 9.8 | GO:0070982 | L-asparagine biosynthetic process(GO:0070981) L-asparagine metabolic process(GO:0070982) |
| 1.8 | 18.2 | GO:0046940 | nucleoside monophosphate phosphorylation(GO:0046940) |
| 1.8 | 12.7 | GO:2000124 | regulation of endocannabinoid signaling pathway(GO:2000124) |
| 1.8 | 7.3 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 1.8 | 14.2 | GO:2000860 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 1.8 | 5.3 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 1.7 | 5.2 | GO:0046521 | sphingoid catabolic process(GO:0046521) |
| 1.7 | 6.8 | GO:0035740 | CD8-positive, alpha-beta T cell proliferation(GO:0035740) regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000564) |
| 1.6 | 4.8 | GO:0061394 | regulation of transcription from RNA polymerase II promoter in response to arsenic-containing substance(GO:0061394) |
| 1.6 | 4.8 | GO:0021827 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) chemorepulsion involved in postnatal olfactory bulb interneuron migration(GO:0021836) |
| 1.6 | 6.4 | GO:0060697 | positive regulation of phospholipid catabolic process(GO:0060697) |
| 1.6 | 14.2 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
| 1.6 | 6.3 | GO:0002296 | T-helper 1 cell lineage commitment(GO:0002296) |
| 1.5 | 4.6 | GO:0070902 | mitochondrial tRNA pseudouridine synthesis(GO:0070902) |
| 1.5 | 4.6 | GO:0043311 | positive regulation of eosinophil degranulation(GO:0043311) positive regulation of eosinophil activation(GO:1902568) |
| 1.5 | 6.0 | GO:0071224 | cellular response to peptidoglycan(GO:0071224) |
| 1.5 | 1.5 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
| 1.5 | 4.5 | GO:2001226 | negative regulation of chloride transport(GO:2001226) |
| 1.5 | 4.4 | GO:0046210 | nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) |
| 1.5 | 5.8 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
| 1.5 | 10.2 | GO:0033590 | response to cobalamin(GO:0033590) |
| 1.4 | 7.1 | GO:0061767 | negative regulation of lung blood pressure(GO:0061767) |
| 1.4 | 4.3 | GO:1902534 | single-organism membrane invagination(GO:1902534) |
| 1.4 | 5.5 | GO:0002268 | follicular dendritic cell differentiation(GO:0002268) |
| 1.4 | 8.2 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
| 1.4 | 6.8 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
| 1.3 | 3.9 | GO:0006535 | cysteine biosynthetic process from serine(GO:0006535) |
| 1.3 | 5.2 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 1.2 | 10.0 | GO:0030578 | PML body organization(GO:0030578) |
| 1.2 | 4.9 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
| 1.2 | 6.1 | GO:1903281 | positive regulation of calcium:sodium antiporter activity(GO:1903281) |
| 1.2 | 3.6 | GO:0060129 | thyroid-stimulating hormone-secreting cell differentiation(GO:0060129) |
| 1.2 | 5.9 | GO:2000630 | positive regulation of miRNA metabolic process(GO:2000630) |
| 1.2 | 3.5 | GO:0060381 | regulation of single-stranded telomeric DNA binding(GO:0060380) positive regulation of single-stranded telomeric DNA binding(GO:0060381) |
| 1.2 | 4.7 | GO:1903644 | regulation of chaperone-mediated protein folding(GO:1903644) |
| 1.2 | 8.1 | GO:0023035 | CD40 signaling pathway(GO:0023035) |
| 1.1 | 6.9 | GO:0036015 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
| 1.1 | 3.4 | GO:0050902 | leukocyte adhesive activation(GO:0050902) |
| 1.1 | 3.4 | GO:2000276 | negative regulation of oxidative phosphorylation uncoupler activity(GO:2000276) |
| 1.1 | 2.3 | GO:0003420 | regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
| 1.1 | 5.6 | GO:0035617 | stress granule disassembly(GO:0035617) |
| 1.1 | 1.1 | GO:0045659 | regulation of neutrophil differentiation(GO:0045658) negative regulation of neutrophil differentiation(GO:0045659) |
| 1.1 | 6.6 | GO:1901674 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
| 1.1 | 4.3 | GO:1903721 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 1.1 | 7.5 | GO:0090625 | mRNA cleavage involved in gene silencing by siRNA(GO:0090625) |
| 1.1 | 9.6 | GO:0003025 | regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
| 1.1 | 1.1 | GO:0036466 | synaptic vesicle recycling via endosome(GO:0036466) |
| 1.1 | 3.2 | GO:0009443 | pyridoxal 5'-phosphate salvage(GO:0009443) |
| 1.0 | 5.2 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 1.0 | 4.2 | GO:0006238 | CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) CMP metabolic process(GO:0046035) |
| 1.0 | 5.2 | GO:0071733 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 1.0 | 8.3 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 1.0 | 1.0 | GO:0045634 | regulation of melanocyte differentiation(GO:0045634) |
| 1.0 | 3.1 | GO:0006422 | aspartyl-tRNA aminoacylation(GO:0006422) |
| 1.0 | 5.1 | GO:1902228 | mammary gland fat development(GO:0060611) positive regulation of macrophage colony-stimulating factor signaling pathway(GO:1902228) positive regulation of response to macrophage colony-stimulating factor(GO:1903971) positive regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903974) positive regulation of microglial cell migration(GO:1904141) |
| 1.0 | 8.2 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
| 1.0 | 6.0 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 1.0 | 1.0 | GO:0046958 | nonassociative learning(GO:0046958) |
| 1.0 | 16.0 | GO:0046069 | cGMP catabolic process(GO:0046069) |
| 1.0 | 3.9 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
| 1.0 | 2.9 | GO:1902214 | regulation of interleukin-4-mediated signaling pathway(GO:1902214) |
| 1.0 | 2.9 | GO:0032223 | negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 1.0 | 5.8 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
| 1.0 | 4.8 | GO:1901490 | regulation of lymphangiogenesis(GO:1901490) |
| 1.0 | 1.0 | GO:0001743 | optic placode formation(GO:0001743) |
| 1.0 | 2.9 | GO:1901899 | positive regulation of relaxation of cardiac muscle(GO:1901899) |
| 0.9 | 0.9 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
| 0.9 | 2.8 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 0.9 | 4.6 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
| 0.9 | 6.5 | GO:0021840 | directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) |
| 0.9 | 2.7 | GO:0021919 | BMP signaling pathway involved in spinal cord dorsal/ventral patterning(GO:0021919) |
| 0.9 | 1.8 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.9 | 2.7 | GO:2000681 | negative regulation of rubidium ion transport(GO:2000681) negative regulation of rubidium ion transmembrane transporter activity(GO:2000687) |
| 0.9 | 9.8 | GO:0003374 | dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
| 0.9 | 2.7 | GO:0035544 | negative regulation of SNARE complex assembly(GO:0035544) |
| 0.9 | 0.9 | GO:0010512 | negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
| 0.9 | 4.4 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.9 | 3.5 | GO:1904398 | positive regulation of neuromuscular junction development(GO:1904398) |
| 0.9 | 2.6 | GO:1901656 | glycoside transport(GO:1901656) |
| 0.8 | 4.2 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
| 0.8 | 3.4 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.8 | 5.1 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
| 0.8 | 2.5 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 0.8 | 7.4 | GO:0061734 | parkin-mediated mitophagy in response to mitochondrial depolarization(GO:0061734) |
| 0.8 | 9.1 | GO:0032782 | bile acid secretion(GO:0032782) |
| 0.8 | 2.5 | GO:0043314 | negative regulation of neutrophil degranulation(GO:0043314) |
| 0.8 | 3.3 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
| 0.8 | 4.1 | GO:0032218 | riboflavin transport(GO:0032218) |
| 0.8 | 7.4 | GO:0002480 | antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
| 0.8 | 8.2 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.8 | 3.3 | GO:0019322 | pentose biosynthetic process(GO:0019322) |
| 0.8 | 1.6 | GO:0060661 | submandibular salivary gland formation(GO:0060661) hair follicle cell proliferation(GO:0071335) regulation of hair follicle cell proliferation(GO:0071336) positive regulation of hair follicle cell proliferation(GO:0071338) |
| 0.8 | 2.4 | GO:0035350 | FAD transport(GO:0015883) FAD transmembrane transport(GO:0035350) |
| 0.8 | 0.8 | GO:0060313 | negative regulation of blood vessel remodeling(GO:0060313) |
| 0.8 | 3.1 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.8 | 0.8 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
| 0.8 | 2.4 | GO:0008355 | olfactory learning(GO:0008355) |
| 0.8 | 4.6 | GO:1903435 | positive regulation of constitutive secretory pathway(GO:1903435) |
| 0.8 | 3.0 | GO:0045918 | negative regulation of cytolysis(GO:0045918) |
| 0.8 | 2.3 | GO:0070407 | oxidation-dependent protein catabolic process(GO:0070407) |
| 0.8 | 2.3 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.8 | 5.3 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.8 | 4.5 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.7 | 2.2 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.7 | 4.5 | GO:0035935 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
| 0.7 | 4.5 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
| 0.7 | 2.2 | GO:0045994 | positive regulation of translational initiation by iron(GO:0045994) |
| 0.7 | 4.5 | GO:0086098 | angiotensin-activated signaling pathway involved in heart process(GO:0086098) |
| 0.7 | 3.7 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
| 0.7 | 5.9 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
| 0.7 | 2.2 | GO:0046900 | tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.7 | 6.6 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
| 0.7 | 3.6 | GO:2001074 | regulation of metanephric ureteric bud development(GO:2001074) positive regulation of metanephric ureteric bud development(GO:2001076) |
| 0.7 | 2.9 | GO:2000820 | negative regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000820) |
| 0.7 | 2.9 | GO:0034344 | type III interferon production(GO:0034343) regulation of type III interferon production(GO:0034344) |
| 0.7 | 1.4 | GO:0050925 | negative regulation of negative chemotaxis(GO:0050925) |
| 0.7 | 2.1 | GO:0060458 | right lung development(GO:0060458) |
| 0.7 | 0.7 | GO:1904924 | negative regulation of mitophagy in response to mitochondrial depolarization(GO:1904924) |
| 0.7 | 3.5 | GO:0097527 | necroptotic signaling pathway(GO:0097527) |
| 0.7 | 1.4 | GO:0032829 | regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) positive regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032831) |
| 0.7 | 1.4 | GO:0000479 | endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
| 0.7 | 2.1 | GO:1902396 | protein localization to bicellular tight junction(GO:1902396) |
| 0.7 | 1.4 | GO:0060434 | bronchus morphogenesis(GO:0060434) |
| 0.7 | 2.8 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.7 | 2.1 | GO:2000374 | regulation of oxygen metabolic process(GO:2000374) |
| 0.7 | 2.8 | GO:0007185 | transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
| 0.7 | 2.8 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.7 | 1.4 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 0.7 | 4.1 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.7 | 5.4 | GO:0072734 | response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
| 0.7 | 2.0 | GO:0070842 | aggresome assembly(GO:0070842) |
| 0.7 | 2.7 | GO:0003342 | proepicardium development(GO:0003342) septum transversum development(GO:0003343) |
| 0.7 | 2.0 | GO:0006433 | prolyl-tRNA aminoacylation(GO:0006433) |
| 0.7 | 0.7 | GO:0031125 | rRNA 3'-end processing(GO:0031125) |
| 0.7 | 2.0 | GO:0060721 | spongiotrophoblast cell proliferation(GO:0060720) regulation of spongiotrophoblast cell proliferation(GO:0060721) cell proliferation involved in embryonic placenta development(GO:0060722) regulation of cell proliferation involved in embryonic placenta development(GO:0060723) |
| 0.7 | 2.0 | GO:0061534 | gamma-aminobutyric acid secretion, neurotransmission(GO:0061534) |
| 0.7 | 2.0 | GO:0034239 | macrophage fusion(GO:0034238) regulation of macrophage fusion(GO:0034239) positive regulation of macrophage fusion(GO:0034241) |
| 0.6 | 1.9 | GO:0060166 | olfactory pit development(GO:0060166) |
| 0.6 | 0.6 | GO:2000364 | regulation of STAT protein import into nucleus(GO:2000364) positive regulation of STAT protein import into nucleus(GO:2000366) |
| 0.6 | 3.8 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
| 0.6 | 2.6 | GO:0035521 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
| 0.6 | 2.6 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
| 0.6 | 8.3 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
| 0.6 | 1.9 | GO:0046103 | adenosine catabolic process(GO:0006154) inosine biosynthetic process(GO:0046103) |
| 0.6 | 4.4 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.6 | 3.2 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.6 | 6.9 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
| 0.6 | 1.3 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.6 | 0.6 | GO:2001183 | negative regulation of interleukin-12 secretion(GO:2001183) |
| 0.6 | 3.1 | GO:0010813 | neuropeptide catabolic process(GO:0010813) |
| 0.6 | 19.8 | GO:0006972 | hyperosmotic response(GO:0006972) |
| 0.6 | 2.5 | GO:1901355 | response to rapamycin(GO:1901355) |
| 0.6 | 0.6 | GO:0016199 | axon midline choice point recognition(GO:0016199) |
| 0.6 | 2.5 | GO:2001288 | positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.6 | 1.8 | GO:0046586 | regulation of calcium-dependent cell-cell adhesion(GO:0046586) |
| 0.6 | 0.6 | GO:0048382 | mesendoderm development(GO:0048382) |
| 0.6 | 0.6 | GO:0019417 | sulfur oxidation(GO:0019417) |
| 0.6 | 0.6 | GO:0070858 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.6 | 2.4 | GO:0072086 | specification of loop of Henle identity(GO:0072086) |
| 0.6 | 1.8 | GO:0098968 | neurotransmitter receptor transport postsynaptic membrane to endosome(GO:0098968) |
| 0.6 | 1.8 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.6 | 1.2 | GO:0060715 | syncytiotrophoblast cell differentiation involved in labyrinthine layer development(GO:0060715) |
| 0.6 | 1.2 | GO:1903070 | negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
| 0.6 | 1.2 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.6 | 2.3 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
| 0.6 | 8.2 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
| 0.6 | 0.6 | GO:0061054 | dermatome development(GO:0061054) regulation of dermatome development(GO:0061183) |
| 0.6 | 4.0 | GO:0007506 | gonadal mesoderm development(GO:0007506) |
| 0.6 | 1.7 | GO:1903436 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 0.6 | 1.7 | GO:0000967 | endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
| 0.6 | 1.7 | GO:1905224 | clathrin-coated pit assembly(GO:1905224) |
| 0.6 | 0.6 | GO:0071649 | regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) positive regulation of chemokine (C-C motif) ligand 5 production(GO:0071651) |
| 0.6 | 2.2 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
| 0.6 | 0.6 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.6 | 1.7 | GO:0002541 | activation of plasma proteins involved in acute inflammatory response(GO:0002541) |
| 0.6 | 1.7 | GO:0006478 | peptidyl-tyrosine sulfation(GO:0006478) |
| 0.6 | 2.2 | GO:0006218 | uridine catabolic process(GO:0006218) |
| 0.6 | 2.8 | GO:0015692 | lead ion transport(GO:0015692) |
| 0.5 | 3.3 | GO:0010836 | negative regulation of protein ADP-ribosylation(GO:0010836) |
| 0.5 | 1.6 | GO:0098976 | excitatory chemical synaptic transmission(GO:0098976) regulation of AMPA glutamate receptor clustering(GO:1904717) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
| 0.5 | 2.2 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
| 0.5 | 3.2 | GO:0032468 | Golgi calcium ion homeostasis(GO:0032468) |
| 0.5 | 2.7 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.5 | 1.1 | GO:1903422 | negative regulation of synaptic vesicle recycling(GO:1903422) |
| 0.5 | 4.3 | GO:0035897 | proteolysis in other organism(GO:0035897) |
| 0.5 | 0.5 | GO:0061339 | establishment of monopolar cell polarity(GO:0061162) establishment or maintenance of monopolar cell polarity(GO:0061339) |
| 0.5 | 1.6 | GO:0032707 | negative regulation of interleukin-23 production(GO:0032707) |
| 0.5 | 3.2 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
| 0.5 | 2.7 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
| 0.5 | 1.6 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
| 0.5 | 2.1 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
| 0.5 | 1.6 | GO:2000661 | positive regulation of interleukin-1-mediated signaling pathway(GO:2000661) |
| 0.5 | 17.5 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.5 | 1.1 | GO:0044752 | response to human chorionic gonadotropin(GO:0044752) |
| 0.5 | 2.6 | GO:0010609 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
| 0.5 | 3.2 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.5 | 5.7 | GO:0002934 | desmosome organization(GO:0002934) |
| 0.5 | 0.5 | GO:0071393 | cellular response to progesterone stimulus(GO:0071393) |
| 0.5 | 3.1 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.5 | 1.6 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.5 | 1.6 | GO:0019364 | NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
| 0.5 | 1.5 | GO:0002731 | regulation of dendritic cell cytokine production(GO:0002730) negative regulation of dendritic cell cytokine production(GO:0002731) |
| 0.5 | 4.1 | GO:0034465 | response to carbon monoxide(GO:0034465) |
| 0.5 | 0.5 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.5 | 13.3 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
| 0.5 | 2.6 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.5 | 1.0 | GO:0051795 | positive regulation of catagen(GO:0051795) |
| 0.5 | 3.6 | GO:1903573 | negative regulation of response to endoplasmic reticulum stress(GO:1903573) |
| 0.5 | 0.5 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
| 0.5 | 0.5 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
| 0.5 | 10.1 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.5 | 1.0 | GO:1990481 | mRNA pseudouridine synthesis(GO:1990481) |
| 0.5 | 4.5 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
| 0.5 | 2.0 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
| 0.5 | 3.5 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
| 0.5 | 5.9 | GO:0060180 | female mating behavior(GO:0060180) |
| 0.5 | 6.4 | GO:0010614 | negative regulation of cardiac muscle hypertrophy(GO:0010614) |
| 0.5 | 1.5 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
| 0.5 | 2.0 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.5 | 3.9 | GO:0006868 | glutamine transport(GO:0006868) |
| 0.5 | 2.4 | GO:0001866 | NK T cell proliferation(GO:0001866) |
| 0.5 | 3.4 | GO:0021683 | cerebellar granular layer morphogenesis(GO:0021683) |
| 0.5 | 1.5 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.5 | 2.4 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.5 | 3.9 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 0.5 | 2.4 | GO:0060356 | leucine import(GO:0060356) |
| 0.5 | 3.4 | GO:2000035 | regulation of stem cell division(GO:2000035) |
| 0.5 | 5.3 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.5 | 1.4 | GO:0071301 | cellular response to vitamin B1(GO:0071301) response to formaldehyde(GO:1904404) |
| 0.5 | 1.9 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.5 | 7.2 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) |
| 0.5 | 5.8 | GO:0098780 | response to mitochondrial depolarisation(GO:0098780) |
| 0.5 | 0.5 | GO:0050653 | chondroitin sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0050653) |
| 0.5 | 1.0 | GO:0060139 | positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation of apoptotic process by virus(GO:0060139) |
| 0.5 | 7.2 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
| 0.5 | 1.4 | GO:0042450 | arginine biosynthetic process via ornithine(GO:0042450) |
| 0.5 | 2.9 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
| 0.5 | 1.0 | GO:1904172 | regulation of bleb assembly(GO:1904170) positive regulation of bleb assembly(GO:1904172) |
| 0.5 | 1.9 | GO:1901662 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.5 | 1.4 | GO:0046066 | dGDP metabolic process(GO:0046066) |
| 0.5 | 0.5 | GO:0045354 | interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) |
| 0.5 | 2.8 | GO:1903527 | positive regulation of membrane tubulation(GO:1903527) |
| 0.5 | 0.5 | GO:0046108 | uridine metabolic process(GO:0046108) |
| 0.5 | 1.9 | GO:1900224 | positive regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900224) |
| 0.5 | 1.4 | GO:1903572 | regulation of protein kinase D signaling(GO:1903570) positive regulation of protein kinase D signaling(GO:1903572) |
| 0.5 | 0.9 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
| 0.5 | 2.3 | GO:0038110 | interleukin-2-mediated signaling pathway(GO:0038110) |
| 0.5 | 6.4 | GO:0000212 | meiotic spindle organization(GO:0000212) |
| 0.5 | 1.8 | GO:0072369 | regulation of lipid transport by positive regulation of transcription from RNA polymerase II promoter(GO:0072369) |
| 0.5 | 5.9 | GO:0038007 | netrin-activated signaling pathway(GO:0038007) |
| 0.5 | 2.7 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.5 | 2.3 | GO:0046449 | creatinine metabolic process(GO:0046449) |
| 0.4 | 4.9 | GO:0070561 | vitamin D receptor signaling pathway(GO:0070561) |
| 0.4 | 3.1 | GO:1902661 | positive regulation of glucose mediated signaling pathway(GO:1902661) |
| 0.4 | 2.7 | GO:2000152 | regulation of ubiquitin-specific protease activity(GO:2000152) positive regulation of ubiquitin-specific protease activity(GO:2000158) |
| 0.4 | 45.8 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.4 | 1.3 | GO:0032771 | regulation of monophenol monooxygenase activity(GO:0032771) positive regulation of monophenol monooxygenase activity(GO:0032773) negative regulation of transforming growth factor beta2 production(GO:0032912) negative regulation of catagen(GO:0051796) regulation of hair cycle by canonical Wnt signaling pathway(GO:0060901) positive regulation of melanosome transport(GO:1902910) |
| 0.4 | 0.4 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 0.4 | 11.0 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
| 0.4 | 2.6 | GO:2001023 | regulation of response to drug(GO:2001023) |
| 0.4 | 2.6 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.4 | 1.3 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.4 | 5.2 | GO:0001553 | luteinization(GO:0001553) |
| 0.4 | 2.6 | GO:0070424 | regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) |
| 0.4 | 3.0 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) |
| 0.4 | 2.6 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.4 | 0.9 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.4 | 2.1 | GO:0060574 | intestinal epithelial cell maturation(GO:0060574) |
| 0.4 | 0.8 | GO:2000196 | positive regulation of female gonad development(GO:2000196) |
| 0.4 | 2.5 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.4 | 0.4 | GO:0042746 | regulation of circadian sleep/wake cycle, wakefulness(GO:0010840) circadian sleep/wake cycle, wakefulness(GO:0042746) |
| 0.4 | 7.6 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
| 0.4 | 1.7 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.4 | 1.3 | GO:0002352 | B cell negative selection(GO:0002352) post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 0.4 | 0.8 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.4 | 2.1 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
| 0.4 | 3.3 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
| 0.4 | 1.2 | GO:1904328 | regulation of myofibroblast contraction(GO:1904328) myofibroblast contraction(GO:1990764) |
| 0.4 | 1.2 | GO:0017186 | peptidyl-pyroglutamic acid biosynthetic process, using glutaminyl-peptide cyclotransferase(GO:0017186) |
| 0.4 | 1.2 | GO:0006579 | amino-acid betaine catabolic process(GO:0006579) |
| 0.4 | 1.7 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.4 | 1.2 | GO:0006423 | cysteinyl-tRNA aminoacylation(GO:0006423) |
| 0.4 | 0.4 | GO:0090402 | oncogene-induced cell senescence(GO:0090402) |
| 0.4 | 1.6 | GO:1901631 | positive regulation of presynaptic membrane organization(GO:1901631) positive regulation of synaptic vesicle clustering(GO:2000809) |
| 0.4 | 2.5 | GO:0043932 | ossification involved in bone remodeling(GO:0043932) |
| 0.4 | 4.5 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
| 0.4 | 0.8 | GO:0046166 | glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 0.4 | 1.2 | GO:0045200 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
| 0.4 | 0.4 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.4 | 1.2 | GO:0051066 | dihydrobiopterin metabolic process(GO:0051066) |
| 0.4 | 0.4 | GO:0043103 | hypoxanthine salvage(GO:0043103) |
| 0.4 | 1.6 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.4 | 1.2 | GO:0007518 | myoblast fate determination(GO:0007518) |
| 0.4 | 1.2 | GO:0090296 | regulation of mitochondrial DNA replication(GO:0090296) negative regulation of mitochondrial DNA replication(GO:0090298) negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
| 0.4 | 4.4 | GO:0045779 | negative regulation of bone resorption(GO:0045779) |
| 0.4 | 0.4 | GO:0060738 | epithelial-mesenchymal signaling involved in prostate gland development(GO:0060738) |
| 0.4 | 2.4 | GO:0060028 | convergent extension involved in axis elongation(GO:0060028) |
| 0.4 | 3.6 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.4 | 1.2 | GO:0048318 | axial mesoderm development(GO:0048318) |
| 0.4 | 1.6 | GO:0003409 | optic cup structural organization(GO:0003409) |
| 0.4 | 1.2 | GO:0090156 | cellular sphingolipid homeostasis(GO:0090156) |
| 0.4 | 0.4 | GO:0051595 | response to methylglyoxal(GO:0051595) |
| 0.4 | 3.2 | GO:0006880 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.4 | 1.2 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) positive regulation of histone H3-K9 dimethylation(GO:1900111) |
| 0.4 | 2.0 | GO:0022614 | membrane to membrane docking(GO:0022614) |
| 0.4 | 1.9 | GO:0038172 | interleukin-33-mediated signaling pathway(GO:0038172) |
| 0.4 | 0.4 | GO:1903413 | cellular response to bile acid(GO:1903413) |
| 0.4 | 1.2 | GO:0033504 | floor plate development(GO:0033504) |
| 0.4 | 0.4 | GO:0071926 | endocannabinoid signaling pathway(GO:0071926) |
| 0.4 | 0.8 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
| 0.4 | 1.1 | GO:0038098 | sequestering of BMP from receptor via BMP binding(GO:0038098) |
| 0.4 | 1.5 | GO:0043128 | regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043126) positive regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043128) |
| 0.4 | 1.1 | GO:0001544 | initiation of primordial ovarian follicle growth(GO:0001544) |
| 0.4 | 1.9 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.4 | 1.1 | GO:0060279 | regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
| 0.4 | 1.5 | GO:0009257 | 10-formyltetrahydrofolate biosynthetic process(GO:0009257) |
| 0.4 | 0.4 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
| 0.4 | 7.1 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.4 | 4.5 | GO:2000172 | regulation of branching morphogenesis of a nerve(GO:2000172) |
| 0.4 | 4.1 | GO:0071351 | interleukin-18-mediated signaling pathway(GO:0035655) cellular response to interleukin-18(GO:0071351) |
| 0.4 | 1.1 | GO:0006427 | histidyl-tRNA aminoacylation(GO:0006427) |
| 0.4 | 2.2 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
| 0.4 | 0.7 | GO:0021623 | oculomotor nerve morphogenesis(GO:0021622) oculomotor nerve formation(GO:0021623) |
| 0.4 | 3.3 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.4 | 1.5 | GO:0002326 | B cell lineage commitment(GO:0002326) |
| 0.4 | 1.5 | GO:0010908 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) canonical Wnt signaling pathway involved in positive regulation of epithelial to mesenchymal transition(GO:0044334) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.4 | 2.9 | GO:0017185 | peptidyl-lysine hydroxylation(GO:0017185) |
| 0.4 | 3.3 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
| 0.4 | 1.5 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
| 0.4 | 0.4 | GO:1904933 | regulation of cell proliferation in midbrain(GO:1904933) |
| 0.4 | 1.1 | GO:0019072 | viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
| 0.4 | 1.1 | GO:0021764 | amygdala development(GO:0021764) |
| 0.4 | 2.9 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.4 | 1.1 | GO:0070898 | RNA polymerase III transcriptional preinitiation complex assembly(GO:0070898) |
| 0.4 | 3.6 | GO:0042940 | D-amino acid transport(GO:0042940) |
| 0.4 | 2.1 | GO:0051012 | microtubule sliding(GO:0051012) |
| 0.4 | 1.1 | GO:0035281 | pre-miRNA export from nucleus(GO:0035281) |
| 0.4 | 0.4 | GO:0042090 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
| 0.4 | 3.9 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.4 | 2.5 | GO:0080009 | mRNA methylation(GO:0080009) |
| 0.4 | 1.1 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
| 0.3 | 0.3 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.3 | 1.0 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.3 | 1.4 | GO:0001188 | RNA polymerase I transcriptional preinitiation complex assembly(GO:0001188) RNA polymerase I transcriptional preinitiation complex assembly at the promoter for the nuclear large rRNA transcript(GO:0001189) |
| 0.3 | 1.0 | GO:0060370 | susceptibility to T cell mediated cytotoxicity(GO:0060370) |
| 0.3 | 0.7 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
| 0.3 | 1.0 | GO:0052026 | modulation by virus of host transcription(GO:0019056) positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) modulation by symbiont of host transcription(GO:0052026) |
| 0.3 | 6.9 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
| 0.3 | 1.0 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.3 | 1.4 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
| 0.3 | 14.1 | GO:0032456 | endocytic recycling(GO:0032456) |
| 0.3 | 0.3 | GO:1901079 | positive regulation of relaxation of muscle(GO:1901079) |
| 0.3 | 5.1 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
| 0.3 | 0.7 | GO:0009227 | nucleotide-sugar catabolic process(GO:0009227) |
| 0.3 | 0.3 | GO:1903433 | regulation of constitutive secretory pathway(GO:1903433) |
| 0.3 | 1.4 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
| 0.3 | 5.1 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) |
| 0.3 | 0.7 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.3 | 0.3 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.3 | 0.3 | GO:0051754 | meiotic sister chromatid cohesion, centromeric(GO:0051754) |
| 0.3 | 0.7 | GO:1902219 | regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 0.3 | 1.3 | GO:0034334 | adherens junction maintenance(GO:0034334) |
| 0.3 | 2.0 | GO:1903949 | positive regulation of atrial cardiac muscle cell action potential(GO:1903949) |
| 0.3 | 1.3 | GO:0035425 | autocrine signaling(GO:0035425) |
| 0.3 | 2.0 | GO:0072592 | oxygen metabolic process(GO:0072592) |
| 0.3 | 1.0 | GO:2000298 | regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
| 0.3 | 1.0 | GO:0016094 | polyprenol biosynthetic process(GO:0016094) |
| 0.3 | 1.3 | GO:0019249 | lactate biosynthetic process(GO:0019249) |
| 0.3 | 0.3 | GO:0021937 | cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
| 0.3 | 1.3 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.3 | 1.6 | GO:0032808 | lacrimal gland development(GO:0032808) |
| 0.3 | 1.3 | GO:0015966 | diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
| 0.3 | 0.6 | GO:0045819 | positive regulation of glycogen catabolic process(GO:0045819) |
| 0.3 | 0.3 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.3 | 1.0 | GO:0044805 | late nucleophagy(GO:0044805) |
| 0.3 | 1.0 | GO:1904616 | regulation of actin filament binding(GO:1904529) negative regulation of actin filament binding(GO:1904530) regulation of actin binding(GO:1904616) negative regulation of actin binding(GO:1904617) |
| 0.3 | 0.3 | GO:0046102 | inosine metabolic process(GO:0046102) |
| 0.3 | 0.6 | GO:0070836 | caveola assembly(GO:0070836) |
| 0.3 | 0.3 | GO:0014806 | smooth muscle hyperplasia(GO:0014806) |
| 0.3 | 5.1 | GO:1903204 | negative regulation of oxidative stress-induced neuron death(GO:1903204) |
| 0.3 | 3.5 | GO:0042904 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.3 | 1.9 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
| 0.3 | 7.6 | GO:0090023 | positive regulation of neutrophil chemotaxis(GO:0090023) |
| 0.3 | 1.3 | GO:1904647 | response to rotenone(GO:1904647) |
| 0.3 | 1.9 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
| 0.3 | 1.6 | GO:0000012 | single strand break repair(GO:0000012) |
| 0.3 | 0.9 | GO:0019242 | methylglyoxal biosynthetic process(GO:0019242) |
| 0.3 | 2.2 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
| 0.3 | 0.6 | GO:1904798 | regulation of core promoter binding(GO:1904796) positive regulation of core promoter binding(GO:1904798) |
| 0.3 | 2.8 | GO:1904783 | positive regulation of NMDA glutamate receptor activity(GO:1904783) |
| 0.3 | 0.3 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
| 0.3 | 1.5 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.3 | 0.3 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.3 | 3.0 | GO:1990573 | potassium ion import across plasma membrane(GO:1990573) |
| 0.3 | 4.8 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.3 | 0.9 | GO:0006566 | threonine metabolic process(GO:0006566) |
| 0.3 | 4.2 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.3 | 0.6 | GO:0060019 | radial glial cell differentiation(GO:0060019) |
| 0.3 | 0.6 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
| 0.3 | 2.4 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.3 | 0.6 | GO:0071922 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.3 | 0.6 | GO:0060061 | Spemann organizer formation(GO:0060061) |
| 0.3 | 3.0 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.3 | 1.2 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 0.3 | 0.3 | GO:1903935 | response to sodium arsenite(GO:1903935) cellular response to sodium arsenite(GO:1903936) |
| 0.3 | 3.5 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.3 | 0.9 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.3 | 1.2 | GO:0009386 | translational attenuation(GO:0009386) |
| 0.3 | 4.1 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
| 0.3 | 0.6 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
| 0.3 | 2.9 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.3 | 0.3 | GO:1900746 | regulation of vascular endothelial growth factor signaling pathway(GO:1900746) |
| 0.3 | 1.4 | GO:0003357 | noradrenergic neuron differentiation(GO:0003357) |
| 0.3 | 1.4 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
| 0.3 | 0.9 | GO:0045013 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 0.3 | 2.3 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.3 | 7.7 | GO:0042753 | positive regulation of circadian rhythm(GO:0042753) |
| 0.3 | 12.2 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.3 | 0.9 | GO:0003050 | regulation of systemic arterial blood pressure by atrial natriuretic peptide(GO:0003050) |
| 0.3 | 1.1 | GO:1902544 | regulation of DNA N-glycosylase activity(GO:1902544) |
| 0.3 | 0.3 | GO:0072053 | renal inner medulla development(GO:0072053) renal outer medulla development(GO:0072054) |
| 0.3 | 2.3 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) |
| 0.3 | 1.4 | GO:0072023 | thick ascending limb development(GO:0072023) metanephric thick ascending limb development(GO:0072233) |
| 0.3 | 1.1 | GO:0000101 | sulfur amino acid transport(GO:0000101) L-cystine transport(GO:0015811) |
| 0.3 | 0.8 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.3 | 1.1 | GO:1990262 | regulation of anti-Mullerian hormone signaling pathway(GO:1902612) negative regulation of anti-Mullerian hormone signaling pathway(GO:1902613) anti-Mullerian hormone signaling pathway(GO:1990262) |
| 0.3 | 1.4 | GO:0070445 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.3 | 0.3 | GO:0009946 | proximal/distal axis specification(GO:0009946) |
| 0.3 | 1.7 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
| 0.3 | 1.1 | GO:1904046 | negative regulation of vascular endothelial growth factor production(GO:1904046) |
| 0.3 | 1.1 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.3 | 0.6 | GO:0034093 | regulation of maintenance of sister chromatid cohesion(GO:0034091) positive regulation of maintenance of sister chromatid cohesion(GO:0034093) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.3 | 0.8 | GO:0071362 | cellular response to ether(GO:0071362) |
| 0.3 | 1.1 | GO:0036116 | medium-chain fatty-acyl-CoA catabolic process(GO:0036114) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
| 0.3 | 0.5 | GO:0021529 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 0.3 | 2.2 | GO:0098914 | membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
| 0.3 | 2.5 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
| 0.3 | 1.9 | GO:0051024 | positive regulation of immunoglobulin secretion(GO:0051024) |
| 0.3 | 0.8 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.3 | 1.4 | GO:0001550 | ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.3 | 0.5 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.3 | 1.6 | GO:0036493 | positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
| 0.3 | 1.9 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.3 | 0.8 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.3 | 2.9 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 0.3 | 0.3 | GO:0060157 | urinary bladder development(GO:0060157) |
| 0.3 | 1.3 | GO:0006203 | dGTP catabolic process(GO:0006203) |
| 0.3 | 1.3 | GO:1904995 | negative regulation of leukocyte tethering or rolling(GO:1903237) negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
| 0.3 | 0.8 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.3 | 6.7 | GO:0035666 | TRIF-dependent toll-like receptor signaling pathway(GO:0035666) |
| 0.3 | 0.3 | GO:0070672 | response to interleukin-15(GO:0070672) |
| 0.3 | 1.9 | GO:1900625 | regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
| 0.3 | 0.5 | GO:0038109 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
| 0.3 | 1.1 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.3 | 0.3 | GO:1901419 | regulation of response to alcohol(GO:1901419) |
| 0.3 | 0.8 | GO:0071550 | death-inducing signaling complex assembly(GO:0071550) |
| 0.3 | 0.3 | GO:0036491 | regulation of translation initiation in response to endoplasmic reticulum stress(GO:0036491) eiF2alpha phosphorylation in response to endoplasmic reticulum stress(GO:0036492) negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
| 0.3 | 1.3 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.3 | 0.5 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
| 0.3 | 2.1 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.3 | 4.1 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.3 | 0.5 | GO:2000015 | regulation of determination of dorsal identity(GO:2000015) |
| 0.3 | 2.1 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.3 | 3.6 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.3 | 3.1 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.3 | 0.8 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
| 0.3 | 2.6 | GO:0001542 | ovulation from ovarian follicle(GO:0001542) |
| 0.3 | 1.5 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.3 | 1.8 | GO:0043691 | reverse cholesterol transport(GO:0043691) |
| 0.3 | 1.8 | GO:0048820 | hair follicle maturation(GO:0048820) |
| 0.3 | 3.0 | GO:0097296 | activation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097296) |
| 0.3 | 0.8 | GO:0090290 | positive regulation of osteoclast proliferation(GO:0090290) |
| 0.3 | 6.3 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
| 0.3 | 0.8 | GO:0018011 | N-terminal protein amino acid methylation(GO:0006480) N-terminal peptidyl-alanine methylation(GO:0018011) N-terminal peptidyl-alanine trimethylation(GO:0018012) N-terminal peptidyl-glycine methylation(GO:0018013) N-terminal peptidyl-proline dimethylation(GO:0018016) peptidyl-alanine modification(GO:0018194) N-terminal peptidyl-proline methylation(GO:0035568) N-terminal peptidyl-serine methylation(GO:0035570) N-terminal peptidyl-serine dimethylation(GO:0035572) N-terminal peptidyl-serine trimethylation(GO:0035573) |
| 0.3 | 0.8 | GO:0044691 | tooth eruption(GO:0044691) |
| 0.3 | 2.3 | GO:1904251 | regulation of bile acid metabolic process(GO:1904251) |
| 0.3 | 4.8 | GO:1903830 | magnesium ion transmembrane transport(GO:1903830) |
| 0.3 | 2.3 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
| 0.3 | 0.8 | GO:0032581 | ER-dependent peroxisome organization(GO:0032581) |
| 0.2 | 1.5 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.2 | 0.7 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.2 | 0.7 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
| 0.2 | 2.0 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.2 | 1.2 | GO:0019060 | intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 0.2 | 0.7 | GO:0030859 | polarized epithelial cell differentiation(GO:0030859) |
| 0.2 | 1.7 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.2 | 1.5 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
| 0.2 | 2.2 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
| 0.2 | 23.7 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
| 0.2 | 1.7 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.2 | 1.0 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
| 0.2 | 1.7 | GO:0006477 | protein sulfation(GO:0006477) |
| 0.2 | 1.2 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
| 0.2 | 0.7 | GO:0002184 | cytoplasmic translational termination(GO:0002184) |
| 0.2 | 1.0 | GO:0090085 | regulation of protein deubiquitination(GO:0090085) |
| 0.2 | 1.9 | GO:0042256 | mature ribosome assembly(GO:0042256) |
| 0.2 | 1.2 | GO:0009609 | response to symbiont(GO:0009608) response to symbiotic bacterium(GO:0009609) |
| 0.2 | 0.7 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) neurofibrillary tangle assembly(GO:1902988) |
| 0.2 | 0.7 | GO:0048311 | mitochondrion distribution(GO:0048311) |
| 0.2 | 0.2 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
| 0.2 | 1.0 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) positive regulation of natural killer cell degranulation(GO:0043323) |
| 0.2 | 4.8 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.2 | 0.7 | GO:0038163 | thrombopoietin-mediated signaling pathway(GO:0038163) |
| 0.2 | 0.2 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.2 | 0.2 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
| 0.2 | 4.5 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.2 | 0.2 | GO:1903298 | regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) |
| 0.2 | 0.5 | GO:0003285 | septum secundum development(GO:0003285) |
| 0.2 | 1.2 | GO:0036506 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.2 | 0.5 | GO:1900107 | regulation of nodal signaling pathway(GO:1900107) |
| 0.2 | 0.7 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
| 0.2 | 1.4 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.2 | 0.2 | GO:0042713 | sperm ejaculation(GO:0042713) |
| 0.2 | 1.4 | GO:0035524 | proline transmembrane transport(GO:0035524) |
| 0.2 | 2.1 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.2 | 2.1 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 0.2 | 2.3 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
| 0.2 | 0.9 | GO:0014010 | regulation of Schwann cell proliferation(GO:0010624) negative regulation of Schwann cell proliferation(GO:0010626) Schwann cell proliferation(GO:0014010) |
| 0.2 | 3.9 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.2 | 0.7 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
| 0.2 | 1.8 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
| 0.2 | 10.3 | GO:0008542 | visual learning(GO:0008542) |
| 0.2 | 1.1 | GO:0042078 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.2 | 0.9 | GO:0048254 | snoRNA localization(GO:0048254) |
| 0.2 | 0.9 | GO:0002158 | osteoclast proliferation(GO:0002158) |
| 0.2 | 1.6 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.2 | 2.7 | GO:1901070 | guanosine-containing compound biosynthetic process(GO:1901070) |
| 0.2 | 1.1 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.2 | 0.5 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.2 | 0.2 | GO:1901205 | retrograde trans-synaptic signaling(GO:0098917) retrograde trans-synaptic signaling by soluble gas(GO:0098923) trans-synaptic signaling by soluble gas(GO:0099543) regulation of adrenergic receptor signaling pathway involved in heart process(GO:1901204) negative regulation of adrenergic receptor signaling pathway involved in heart process(GO:1901205) |
| 0.2 | 0.7 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.2 | 13.9 | GO:0010803 | regulation of tumor necrosis factor-mediated signaling pathway(GO:0010803) |
| 0.2 | 0.4 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.2 | 0.2 | GO:1902595 | regulation of DNA replication origin binding(GO:1902595) |
| 0.2 | 1.6 | GO:0060033 | anatomical structure regression(GO:0060033) |
| 0.2 | 0.7 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
| 0.2 | 0.4 | GO:0034436 | glycoprotein transport(GO:0034436) |
| 0.2 | 1.6 | GO:0002691 | regulation of cellular extravasation(GO:0002691) |
| 0.2 | 1.1 | GO:2001171 | positive regulation of ATP biosynthetic process(GO:2001171) |
| 0.2 | 2.2 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
| 0.2 | 6.0 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
| 0.2 | 1.3 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
| 0.2 | 0.4 | GO:0048262 | determination of dorsal/ventral asymmetry(GO:0048262) |
| 0.2 | 0.9 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
| 0.2 | 0.9 | GO:0035616 | histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.2 | 0.2 | GO:0090427 | activation of meiosis(GO:0090427) |
| 0.2 | 0.4 | GO:0014034 | neural crest cell fate commitment(GO:0014034) |
| 0.2 | 0.7 | GO:1903542 | negative regulation of exosomal secretion(GO:1903542) |
| 0.2 | 0.7 | GO:0042747 | circadian sleep/wake cycle, REM sleep(GO:0042747) |
| 0.2 | 0.4 | GO:2000395 | regulation of ubiquitin-dependent endocytosis(GO:2000395) positive regulation of ubiquitin-dependent endocytosis(GO:2000397) |
| 0.2 | 0.4 | GO:2000729 | positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
| 0.2 | 4.4 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.2 | 3.3 | GO:0010529 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.2 | 1.1 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
| 0.2 | 1.1 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.2 | 5.4 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
| 0.2 | 0.9 | GO:0014041 | regulation of neuron maturation(GO:0014041) |
| 0.2 | 0.2 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.2 | 1.9 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
| 0.2 | 0.6 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 0.2 | 0.8 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
| 0.2 | 1.9 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
| 0.2 | 0.8 | GO:0072660 | maintenance of protein location in membrane(GO:0072658) maintenance of protein location in plasma membrane(GO:0072660) positive regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900827) |
| 0.2 | 0.4 | GO:1901660 | calcium ion export(GO:1901660) calcium ion export from cell(GO:1990034) |
| 0.2 | 0.4 | GO:0002154 | thyroid hormone mediated signaling pathway(GO:0002154) regulation of thyroid hormone mediated signaling pathway(GO:0002155) kinin cascade(GO:0002254) plasma kallikrein-kinin cascade(GO:0002353) |
| 0.2 | 1.7 | GO:2000406 | positive regulation of T cell migration(GO:2000406) |
| 0.2 | 1.7 | GO:0051571 | positive regulation of histone H3-K4 methylation(GO:0051571) |
| 0.2 | 3.3 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
| 0.2 | 1.2 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.2 | 2.7 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.2 | 0.2 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
| 0.2 | 0.4 | GO:0009146 | purine nucleoside triphosphate catabolic process(GO:0009146) |
| 0.2 | 0.8 | GO:0019885 | antigen processing and presentation of endogenous peptide antigen via MHC class I(GO:0019885) |
| 0.2 | 0.4 | GO:0090234 | regulation of kinetochore assembly(GO:0090234) |
| 0.2 | 2.0 | GO:0038166 | angiotensin-activated signaling pathway(GO:0038166) |
| 0.2 | 1.2 | GO:0071105 | response to interleukin-11(GO:0071105) |
| 0.2 | 0.4 | GO:0032304 | negative regulation of icosanoid secretion(GO:0032304) negative regulation of phospholipase A2 activity(GO:1900138) |
| 0.2 | 0.4 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 0.2 | 2.2 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.2 | 1.4 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.2 | 2.2 | GO:0034356 | NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
| 0.2 | 0.8 | GO:0046116 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.2 | 0.6 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
| 0.2 | 0.2 | GO:0006235 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) |
| 0.2 | 0.4 | GO:1990737 | response to manganese-induced endoplasmic reticulum stress(GO:1990737) |
| 0.2 | 0.6 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.2 | 2.8 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.2 | 4.2 | GO:0051923 | sulfation(GO:0051923) |
| 0.2 | 1.4 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.2 | 0.6 | GO:0021849 | neuroblast division in subventricular zone(GO:0021849) |
| 0.2 | 0.8 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.2 | 0.4 | GO:1903348 | positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.2 | 1.6 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.2 | 1.0 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
| 0.2 | 3.6 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
| 0.2 | 1.4 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
| 0.2 | 1.8 | GO:1903206 | negative regulation of hydrogen peroxide-induced cell death(GO:1903206) |
| 0.2 | 2.2 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.2 | 0.2 | GO:0046882 | negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
| 0.2 | 0.2 | GO:0002554 | serotonin production involved in inflammatory response(GO:0002351) serotonin secretion involved in inflammatory response(GO:0002442) serotonin secretion by platelet(GO:0002554) |
| 0.2 | 0.2 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
| 0.2 | 1.4 | GO:1903011 | negative regulation of bone development(GO:1903011) negative regulation of osteoclast development(GO:2001205) |
| 0.2 | 0.4 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
| 0.2 | 4.7 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
| 0.2 | 1.7 | GO:0052805 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
| 0.2 | 0.2 | GO:1990535 | neuron projection maintenance(GO:1990535) |
| 0.2 | 0.2 | GO:1902037 | negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
| 0.2 | 0.4 | GO:0070638 | nicotinamide riboside catabolic process(GO:0006738) nicotinamide riboside metabolic process(GO:0046495) pyridine nucleoside metabolic process(GO:0070637) pyridine nucleoside catabolic process(GO:0070638) |
| 0.2 | 1.0 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
| 0.2 | 1.3 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.2 | 0.2 | GO:0003220 | left ventricular cardiac muscle tissue morphogenesis(GO:0003220) |
| 0.2 | 0.2 | GO:0035962 | response to interleukin-13(GO:0035962) |
| 0.2 | 0.2 | GO:0002590 | regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) negative regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002590) |
| 0.2 | 2.6 | GO:0007398 | ectoderm development(GO:0007398) |
| 0.2 | 2.6 | GO:0034656 | nucleobase-containing small molecule catabolic process(GO:0034656) |
| 0.2 | 1.3 | GO:0060371 | regulation of atrial cardiac muscle cell membrane depolarization(GO:0060371) |
| 0.2 | 0.6 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
| 0.2 | 0.2 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.2 | 0.2 | GO:1904862 | inhibitory synapse assembly(GO:1904862) |
| 0.2 | 3.5 | GO:0019054 | modulation by virus of host process(GO:0019054) |
| 0.2 | 0.4 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
| 0.2 | 1.3 | GO:0051122 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.2 | 1.8 | GO:1903943 | regulation of hepatocyte apoptotic process(GO:1903943) negative regulation of hepatocyte apoptotic process(GO:1903944) |
| 0.2 | 0.6 | GO:0098911 | regulation of ventricular cardiac muscle cell action potential(GO:0098911) |
| 0.2 | 2.4 | GO:1903541 | regulation of exosomal secretion(GO:1903541) |
| 0.2 | 0.9 | GO:0048102 | autophagic cell death(GO:0048102) |
| 0.2 | 5.3 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.2 | 0.9 | GO:0072014 | proximal tubule development(GO:0072014) |
| 0.2 | 0.9 | GO:2000639 | regulation of SREBP signaling pathway(GO:2000638) negative regulation of SREBP signaling pathway(GO:2000639) |
| 0.2 | 0.7 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.2 | 1.8 | GO:2000484 | positive regulation of interleukin-8 secretion(GO:2000484) |
| 0.2 | 1.6 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
| 0.2 | 0.9 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.2 | 2.5 | GO:0033015 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.2 | 3.3 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
| 0.2 | 1.1 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
| 0.2 | 1.1 | GO:0032776 | DNA methylation on cytosine(GO:0032776) |
| 0.2 | 0.4 | GO:0001781 | neutrophil apoptotic process(GO:0001781) |
| 0.2 | 2.0 | GO:0090292 | nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.2 | 2.3 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.2 | 0.5 | GO:0019563 | glycerol catabolic process(GO:0019563) glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.2 | 9.5 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
| 0.2 | 0.2 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.2 | 0.4 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
| 0.2 | 0.7 | GO:0071043 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
| 0.2 | 0.5 | GO:0031296 | B cell costimulation(GO:0031296) |
| 0.2 | 0.2 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) |
| 0.2 | 1.4 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.2 | 0.9 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
| 0.2 | 0.5 | GO:0007206 | phospholipase C-activating G-protein coupled glutamate receptor signaling pathway(GO:0007206) |
| 0.2 | 0.4 | GO:0032439 | endosome localization(GO:0032439) |
| 0.2 | 0.7 | GO:0042262 | DNA protection(GO:0042262) |
| 0.2 | 0.7 | GO:0010957 | negative regulation of vitamin D biosynthetic process(GO:0010957) |
| 0.2 | 0.4 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.2 | 0.3 | GO:0005985 | sucrose metabolic process(GO:0005985) |
| 0.2 | 0.5 | GO:0035803 | egg coat formation(GO:0035803) |
| 0.2 | 0.2 | GO:2000674 | regulation of type B pancreatic cell apoptotic process(GO:2000674) |
| 0.2 | 0.5 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.2 | 0.5 | GO:0019230 | proprioception(GO:0019230) |
| 0.2 | 1.9 | GO:0086103 | G-protein coupled receptor signaling pathway involved in heart process(GO:0086103) |
| 0.2 | 0.7 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.2 | 0.3 | GO:1903059 | regulation of protein lipidation(GO:1903059) |
| 0.2 | 0.5 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.2 | 0.5 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.2 | 0.5 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) |
| 0.2 | 0.3 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.2 | 0.7 | GO:1902222 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
| 0.2 | 1.0 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
| 0.2 | 0.5 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 0.2 | 2.2 | GO:1904869 | regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) |
| 0.2 | 0.5 | GO:1903630 | regulation of aminoacyl-tRNA ligase activity(GO:1903630) |
| 0.2 | 0.7 | GO:0021633 | optic nerve structural organization(GO:0021633) |
| 0.2 | 0.2 | GO:0002678 | positive regulation of chronic inflammatory response(GO:0002678) |
| 0.2 | 2.2 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.2 | 0.3 | GO:0090170 | regulation of Golgi inheritance(GO:0090170) |
| 0.2 | 1.0 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
| 0.2 | 0.7 | GO:0042357 | thiamine diphosphate metabolic process(GO:0042357) |
| 0.2 | 0.3 | GO:1902741 | interferon-alpha secretion(GO:0072642) regulation of interferon-alpha secretion(GO:1902739) positive regulation of interferon-alpha secretion(GO:1902741) |
| 0.2 | 1.5 | GO:0060056 | mammary gland involution(GO:0060056) |
| 0.2 | 0.7 | GO:0015870 | acetylcholine transport(GO:0015870) |
| 0.2 | 0.3 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
| 0.2 | 0.7 | GO:0016333 | morphogenesis of follicular epithelium(GO:0016333) establishment or maintenance of polarity of follicular epithelium(GO:0016334) establishment of planar polarity of follicular epithelium(GO:0042247) |
| 0.2 | 0.3 | GO:0060613 | fat pad development(GO:0060613) |
| 0.2 | 1.2 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.2 | 0.5 | GO:0042816 | vitamin B6 metabolic process(GO:0042816) |
| 0.2 | 0.5 | GO:0035915 | pore formation in membrane of other organism(GO:0035915) |
| 0.2 | 1.1 | GO:0030913 | paranodal junction assembly(GO:0030913) |
| 0.2 | 0.3 | GO:0043308 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
| 0.2 | 0.5 | GO:1904579 | response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) |
| 0.2 | 0.5 | GO:0061590 | calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylserine scrambling(GO:0061589) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) |
| 0.2 | 0.5 | GO:2000587 | negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.2 | 0.5 | GO:0014063 | regulation of serotonin secretion(GO:0014062) negative regulation of serotonin secretion(GO:0014063) |
| 0.2 | 0.3 | GO:1900118 | negative regulation of execution phase of apoptosis(GO:1900118) |
| 0.2 | 1.9 | GO:0044351 | macropinocytosis(GO:0044351) |
| 0.2 | 0.5 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
| 0.2 | 0.2 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
| 0.2 | 0.2 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.2 | 6.4 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
| 0.2 | 1.4 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.2 | 5.7 | GO:0050832 | defense response to fungus(GO:0050832) |
| 0.2 | 3.3 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
| 0.2 | 0.6 | GO:0036269 | swimming behavior(GO:0036269) |
| 0.2 | 0.8 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.2 | 0.5 | GO:0015785 | UDP-galactose transport(GO:0015785) UDP-galactose transmembrane transport(GO:0072334) |
| 0.2 | 0.5 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
| 0.2 | 0.6 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
| 0.2 | 0.9 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.2 | 0.3 | GO:0030885 | regulation of myeloid dendritic cell activation(GO:0030885) |
| 0.2 | 1.4 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
| 0.2 | 0.8 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.2 | 0.6 | GO:2001178 | mediator complex assembly(GO:0036034) regulation of mediator complex assembly(GO:2001176) positive regulation of mediator complex assembly(GO:2001178) |
| 0.2 | 0.5 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
| 0.2 | 0.8 | GO:0000973 | posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
| 0.2 | 1.1 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
| 0.2 | 0.5 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.2 | 0.5 | GO:0000960 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.2 | 1.4 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
| 0.2 | 10.4 | GO:0015701 | bicarbonate transport(GO:0015701) |
| 0.2 | 0.5 | GO:0014724 | regulation of twitch skeletal muscle contraction(GO:0014724) regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) |
| 0.2 | 0.5 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
| 0.2 | 0.9 | GO:0003383 | apical constriction(GO:0003383) |
| 0.2 | 0.3 | GO:0080154 | regulation of fertilization(GO:0080154) |
| 0.2 | 2.4 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
| 0.2 | 0.3 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.2 | 0.3 | GO:0086021 | SA node cell to atrial cardiac muscle cell communication by electrical coupling(GO:0086021) |
| 0.2 | 0.6 | GO:0044111 | development involved in symbiotic interaction(GO:0044111) |
| 0.2 | 0.3 | GO:0045651 | positive regulation of macrophage differentiation(GO:0045651) |
| 0.2 | 0.5 | GO:0032667 | interleukin-23 production(GO:0032627) regulation of interleukin-23 production(GO:0032667) |
| 0.2 | 0.8 | GO:0045988 | negative regulation of striated muscle contraction(GO:0045988) |
| 0.2 | 2.3 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.2 | 0.6 | GO:0042631 | cellular response to water deprivation(GO:0042631) |
| 0.2 | 0.3 | GO:1990927 | calcium ion regulated lysosome exocytosis(GO:1990927) |
| 0.1 | 2.5 | GO:2001222 | regulation of neuron migration(GO:2001222) |
| 0.1 | 1.2 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.1 | 0.1 | GO:0051436 | negative regulation of ubiquitin-protein ligase activity involved in mitotic cell cycle(GO:0051436) regulation of ubiquitin-protein ligase activity involved in mitotic cell cycle(GO:0051439) |
| 0.1 | 0.6 | GO:0044359 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.1 | 0.1 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
| 0.1 | 0.3 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
| 0.1 | 0.7 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
| 0.1 | 2.8 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
| 0.1 | 0.7 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.1 | 1.9 | GO:1904152 | regulation of retrograde protein transport, ER to cytosol(GO:1904152) |
| 0.1 | 0.4 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.1 | 0.7 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.1 | 0.6 | GO:0003350 | pulmonary myocardium development(GO:0003350) |
| 0.1 | 1.9 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.1 | 0.9 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
| 0.1 | 3.5 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.1 | 0.3 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.1 | 1.0 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
| 0.1 | 0.1 | GO:1902896 | terminal web assembly(GO:1902896) |
| 0.1 | 0.3 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
| 0.1 | 2.1 | GO:0010664 | negative regulation of striated muscle cell apoptotic process(GO:0010664) |
| 0.1 | 3.7 | GO:0048240 | sperm capacitation(GO:0048240) |
| 0.1 | 0.3 | GO:0032494 | response to peptidoglycan(GO:0032494) |
| 0.1 | 1.3 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.1 | 0.1 | GO:0043313 | regulation of neutrophil degranulation(GO:0043313) |
| 0.1 | 1.1 | GO:0019375 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.1 | 0.4 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
| 0.1 | 0.4 | GO:1904640 | response to methionine(GO:1904640) |
| 0.1 | 2.0 | GO:0036035 | osteoclast development(GO:0036035) |
| 0.1 | 0.3 | GO:0060298 | positive regulation of sarcomere organization(GO:0060298) |
| 0.1 | 0.4 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.1 | 0.6 | GO:1904386 | response to thyroxine(GO:0097068) response to L-phenylalanine derivative(GO:1904386) |
| 0.1 | 0.3 | GO:0031427 | response to methotrexate(GO:0031427) |
| 0.1 | 1.0 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.1 | 0.1 | GO:1902908 | regulation of melanosome transport(GO:1902908) |
| 0.1 | 0.7 | GO:0051182 | coenzyme transport(GO:0051182) |
| 0.1 | 0.7 | GO:0006824 | cobalt ion transport(GO:0006824) |
| 0.1 | 0.4 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.1 | 0.8 | GO:1903332 | regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) regulation of protein folding(GO:1903332) negative regulation of protein folding(GO:1903333) |
| 0.1 | 2.2 | GO:0008228 | opsonization(GO:0008228) |
| 0.1 | 0.7 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.1 | 2.3 | GO:0048757 | endosome to melanosome transport(GO:0035646) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
| 0.1 | 0.3 | GO:1900154 | regulation of bone trabecula formation(GO:1900154) negative regulation of bone trabecula formation(GO:1900155) |
| 0.1 | 2.7 | GO:0097034 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.1 | 1.4 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
| 0.1 | 0.4 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.1 | 0.7 | GO:0072675 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.1 | 0.5 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.1 | 0.4 | GO:0015824 | proline transport(GO:0015824) |
| 0.1 | 0.3 | GO:0033153 | somatic diversification of T cell receptor genes(GO:0002568) somatic recombination of T cell receptor gene segments(GO:0002681) T cell receptor V(D)J recombination(GO:0033153) |
| 0.1 | 2.4 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
| 0.1 | 0.7 | GO:1903069 | regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903069) |
| 0.1 | 0.5 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
| 0.1 | 0.5 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.1 | 0.1 | GO:0048818 | positive regulation of hair follicle maturation(GO:0048818) |
| 0.1 | 0.5 | GO:1990416 | cellular response to brain-derived neurotrophic factor stimulus(GO:1990416) |
| 0.1 | 0.1 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
| 0.1 | 1.8 | GO:0006828 | manganese ion transport(GO:0006828) |
| 0.1 | 0.1 | GO:1904393 | regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) negative regulation of neuromuscular junction development(GO:1904397) |
| 0.1 | 0.5 | GO:1902869 | regulation of amacrine cell differentiation(GO:1902869) |
| 0.1 | 3.5 | GO:0035338 | long-chain fatty-acyl-CoA biosynthetic process(GO:0035338) |
| 0.1 | 0.5 | GO:0061743 | motor learning(GO:0061743) |
| 0.1 | 1.9 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
| 0.1 | 0.5 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 0.1 | 0.3 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
| 0.1 | 0.6 | GO:1902412 | regulation of mitotic cytokinesis(GO:1902412) |
| 0.1 | 0.6 | GO:0010731 | protein glutathionylation(GO:0010731) regulation of protein glutathionylation(GO:0010732) negative regulation of protein glutathionylation(GO:0010734) |
| 0.1 | 0.8 | GO:1904874 | positive regulation of telomerase RNA localization to Cajal body(GO:1904874) |
| 0.1 | 0.9 | GO:0001976 | neurological system process involved in regulation of systemic arterial blood pressure(GO:0001976) |
| 0.1 | 0.4 | GO:0001207 | histone displacement(GO:0001207) positive regulation of transcription involved in meiotic cell cycle(GO:0051039) |
| 0.1 | 0.4 | GO:0035624 | receptor transactivation(GO:0035624) |
| 0.1 | 0.3 | GO:0090070 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.1 | 1.9 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.1 | 0.3 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.1 | 0.1 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
| 0.1 | 0.4 | GO:0098501 | polynucleotide dephosphorylation(GO:0098501) |
| 0.1 | 0.4 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
| 0.1 | 0.9 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.1 | 0.7 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.1 | 0.1 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
| 0.1 | 1.1 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.1 | 0.5 | GO:0045836 | positive regulation of meiotic nuclear division(GO:0045836) |
| 0.1 | 0.4 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.1 | 5.4 | GO:1900739 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 0.1 | 1.2 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.1 | 2.8 | GO:0001516 | prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
| 0.1 | 0.2 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
| 0.1 | 0.4 | GO:0051608 | histamine transport(GO:0051608) |
| 0.1 | 0.4 | GO:0015886 | heme transport(GO:0015886) |
| 0.1 | 0.6 | GO:0090131 | mesenchyme migration(GO:0090131) |
| 0.1 | 0.5 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
| 0.1 | 0.5 | GO:0002118 | aggressive behavior(GO:0002118) |
| 0.1 | 3.1 | GO:0015012 | heparan sulfate proteoglycan biosynthetic process(GO:0015012) |
| 0.1 | 1.4 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
| 0.1 | 1.5 | GO:0006086 | acetyl-CoA biosynthetic process from pyruvate(GO:0006086) |
| 0.1 | 3.5 | GO:0090004 | positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
| 0.1 | 0.1 | GO:0061101 | neuroendocrine cell differentiation(GO:0061101) |
| 0.1 | 0.2 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
| 0.1 | 0.2 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.1 | 3.7 | GO:0018146 | keratan sulfate biosynthetic process(GO:0018146) |
| 0.1 | 3.0 | GO:1903146 | regulation of mitophagy(GO:1903146) |
| 0.1 | 0.3 | GO:0003218 | cardiac left ventricle formation(GO:0003218) |
| 0.1 | 0.6 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
| 0.1 | 0.7 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.1 | 0.2 | GO:0044126 | regulation of growth of symbiont in host(GO:0044126) |
| 0.1 | 0.6 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.1 | 3.6 | GO:0035428 | hexose transmembrane transport(GO:0035428) glucose transmembrane transport(GO:1904659) |
| 0.1 | 0.7 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
| 0.1 | 1.2 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
| 0.1 | 0.3 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
| 0.1 | 1.0 | GO:0015816 | glycine transport(GO:0015816) |
| 0.1 | 0.4 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
| 0.1 | 0.2 | GO:0000294 | nuclear-transcribed mRNA catabolic process, endonucleolytic cleavage-dependent decay(GO:0000294) |
| 0.1 | 0.3 | GO:0030450 | regulation of complement activation, classical pathway(GO:0030450) negative regulation of complement activation, classical pathway(GO:0045959) |
| 0.1 | 0.4 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
| 0.1 | 0.4 | GO:0051547 | regulation of keratinocyte migration(GO:0051547) |
| 0.1 | 0.2 | GO:0044028 | DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
| 0.1 | 0.3 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.1 | 1.2 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
| 0.1 | 1.3 | GO:0034434 | steroid esterification(GO:0034433) sterol esterification(GO:0034434) cholesterol esterification(GO:0034435) |
| 0.1 | 0.3 | GO:0002522 | leukocyte migration involved in immune response(GO:0002522) |
| 0.1 | 0.2 | GO:0019243 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.1 | 0.3 | GO:1900112 | regulation of histone H3-K9 trimethylation(GO:1900112) |
| 0.1 | 0.2 | GO:1905244 | regulation of modification of synaptic structure(GO:1905244) |
| 0.1 | 1.1 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
| 0.1 | 0.8 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.1 | 0.1 | GO:0051771 | negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
| 0.1 | 1.6 | GO:0051386 | regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
| 0.1 | 1.0 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.1 | 0.2 | GO:1902732 | positive regulation of chondrocyte proliferation(GO:1902732) |
| 0.1 | 5.1 | GO:0051058 | negative regulation of small GTPase mediated signal transduction(GO:0051058) |
| 0.1 | 0.4 | GO:1904814 | regulation of protein localization to chromosome, telomeric region(GO:1904814) |
| 0.1 | 0.1 | GO:1990834 | response to odorant(GO:1990834) |
| 0.1 | 0.4 | GO:0045408 | regulation of interleukin-6 biosynthetic process(GO:0045408) |
| 0.1 | 0.5 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.1 | 0.5 | GO:0098722 | asymmetric stem cell division(GO:0098722) |
| 0.1 | 0.8 | GO:0007191 | adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
| 0.1 | 0.1 | GO:0015688 | iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
| 0.1 | 3.8 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.1 | 6.7 | GO:0042147 | retrograde transport, endosome to Golgi(GO:0042147) |
| 0.1 | 1.1 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.1 | 0.1 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
| 0.1 | 3.5 | GO:0019835 | cytolysis(GO:0019835) |
| 0.1 | 0.7 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.1 | 0.1 | GO:1901858 | regulation of mitochondrial DNA metabolic process(GO:1901858) |
| 0.1 | 0.3 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.1 | 1.8 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.1 | 5.6 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.1 | 0.7 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.1 | 0.7 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.1 | 1.9 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.1 | 0.4 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.1 | 0.2 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
| 0.1 | 4.0 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.1 | 0.3 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
| 0.1 | 0.6 | GO:0071025 | RNA surveillance(GO:0071025) |
| 0.1 | 0.6 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
| 0.1 | 0.4 | GO:0046833 | positive regulation of nucleobase-containing compound transport(GO:0032241) positive regulation of RNA export from nucleus(GO:0046833) |
| 0.1 | 0.3 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.1 | 1.4 | GO:0044030 | regulation of DNA methylation(GO:0044030) |
| 0.1 | 0.5 | GO:0003322 | pancreatic A cell development(GO:0003322) |
| 0.1 | 1.8 | GO:0050435 | beta-amyloid metabolic process(GO:0050435) |
| 0.1 | 0.3 | GO:0070541 | response to platinum ion(GO:0070541) |
| 0.1 | 0.1 | GO:0021831 | embryonic olfactory bulb interneuron precursor migration(GO:0021831) |
| 0.1 | 0.1 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
| 0.1 | 3.8 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.1 | 0.6 | GO:1903748 | negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
| 0.1 | 2.6 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
| 0.1 | 0.4 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.1 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.1 | 0.3 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
| 0.1 | 0.7 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.1 | 0.5 | GO:0071436 | sodium ion export(GO:0071436) |
| 0.1 | 0.6 | GO:0002786 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antimicrobial humoral response(GO:0002760) regulation of antimicrobial peptide production(GO:0002784) regulation of antibacterial peptide production(GO:0002786) positive regulation of antibacterial peptide production(GO:0002803) |
| 0.1 | 0.2 | GO:0034378 | chylomicron assembly(GO:0034378) |
| 0.1 | 0.1 | GO:0090149 | mitochondrial membrane fission(GO:0090149) |
| 0.1 | 0.1 | GO:0000393 | spliceosomal conformational changes to generate catalytic conformation(GO:0000393) |
| 0.1 | 1.3 | GO:0006882 | cellular zinc ion homeostasis(GO:0006882) |
| 0.1 | 0.8 | GO:0071493 | cellular response to UV-B(GO:0071493) |
| 0.1 | 1.0 | GO:0060155 | platelet dense granule organization(GO:0060155) |
| 0.1 | 0.3 | GO:0050760 | negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
| 0.1 | 0.4 | GO:2000678 | negative regulation of transcription regulatory region DNA binding(GO:2000678) |
| 0.1 | 3.9 | GO:0006400 | tRNA modification(GO:0006400) |
| 0.1 | 0.2 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
| 0.1 | 0.1 | GO:0010269 | response to selenium ion(GO:0010269) |
| 0.1 | 0.5 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.1 | 1.2 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
| 0.1 | 1.6 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
| 0.1 | 0.2 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.1 | 0.3 | GO:0060168 | positive regulation of adenosine receptor signaling pathway(GO:0060168) |
| 0.1 | 0.7 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.1 | 0.1 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
| 0.1 | 0.3 | GO:0006047 | UDP-N-acetylglucosamine metabolic process(GO:0006047) |
| 0.1 | 0.3 | GO:1903010 | regulation of bone development(GO:1903010) |
| 0.1 | 0.8 | GO:0051451 | myoblast migration(GO:0051451) |
| 0.1 | 0.7 | GO:0097116 | gephyrin clustering involved in postsynaptic density assembly(GO:0097116) |
| 0.1 | 11.6 | GO:0002433 | immune response-regulating cell surface receptor signaling pathway involved in phagocytosis(GO:0002433) Fc-gamma receptor signaling pathway involved in phagocytosis(GO:0038096) |
| 0.1 | 0.2 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.1 | 0.5 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.1 | 6.3 | GO:0009301 | snRNA transcription(GO:0009301) snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.1 | 0.2 | GO:2000259 | type IIa hypersensitivity(GO:0001794) regulation of type IIa hypersensitivity(GO:0001796) positive regulation of type IIa hypersensitivity(GO:0001798) positive regulation of activation of membrane attack complex(GO:0001970) type II hypersensitivity(GO:0002445) regulation of type II hypersensitivity(GO:0002892) positive regulation of type II hypersensitivity(GO:0002894) positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.1 | 0.7 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
| 0.1 | 1.0 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.1 | 0.7 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
| 0.1 | 0.3 | GO:0018101 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
| 0.1 | 0.4 | GO:0090382 | phagosome maturation(GO:0090382) |
| 0.1 | 0.5 | GO:0006999 | nuclear pore organization(GO:0006999) |
| 0.1 | 0.9 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.1 | 0.7 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.1 | 2.9 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
| 0.1 | 0.3 | GO:1905225 | cellular response to glycoprotein(GO:1904588) response to thyrotropin-releasing hormone(GO:1905225) cellular response to thyrotropin-releasing hormone(GO:1905229) |
| 0.1 | 0.2 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.1 | 0.1 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
| 0.1 | 0.3 | GO:0042161 | plasma lipoprotein particle oxidation(GO:0034441) lipoprotein modification(GO:0042160) lipoprotein oxidation(GO:0042161) |
| 0.1 | 0.2 | GO:2000823 | regulation of androgen receptor activity(GO:2000823) positive regulation of androgen receptor activity(GO:2000825) |
| 0.1 | 0.8 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.1 | 0.6 | GO:0061737 | leukotriene signaling pathway(GO:0061737) |
| 0.1 | 0.7 | GO:0051256 | mitotic spindle midzone assembly(GO:0051256) |
| 0.1 | 0.3 | GO:1903580 | positive regulation of nucleoside metabolic process(GO:0045979) positive regulation of ATP metabolic process(GO:1903580) |
| 0.1 | 0.8 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
| 0.1 | 0.3 | GO:0071934 | thiamine transmembrane transport(GO:0071934) |
| 0.1 | 0.4 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.1 | 6.2 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
| 0.1 | 0.6 | GO:0019236 | response to pheromone(GO:0019236) |
| 0.1 | 0.1 | GO:1904684 | regulation of metalloendopeptidase activity(GO:1904683) negative regulation of metalloendopeptidase activity(GO:1904684) |
| 0.1 | 0.5 | GO:0071799 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
| 0.1 | 3.7 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
| 0.1 | 0.4 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.1 | 0.2 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.1 | 1.0 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.1 | 0.3 | GO:0071344 | diphosphate metabolic process(GO:0071344) |
| 0.1 | 0.1 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
| 0.1 | 0.5 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
| 0.1 | 0.4 | GO:0097396 | response to interleukin-17(GO:0097396) cellular response to interleukin-17(GO:0097398) |
| 0.1 | 0.2 | GO:0021554 | optic nerve development(GO:0021554) |
| 0.1 | 1.1 | GO:0007021 | tubulin complex assembly(GO:0007021) |
| 0.1 | 0.2 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
| 0.1 | 0.2 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.1 | 0.1 | GO:0048627 | myoblast development(GO:0048627) |
| 0.1 | 0.7 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 | 0.4 | GO:0021759 | globus pallidus development(GO:0021759) |
| 0.1 | 0.3 | GO:0034776 | response to histamine(GO:0034776) cellular response to histamine(GO:0071420) |
| 0.1 | 0.2 | GO:0038188 | cholecystokinin signaling pathway(GO:0038188) |
| 0.1 | 0.4 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 0.1 | 1.0 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.1 | 0.4 | GO:1901970 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
| 0.1 | 0.1 | GO:2000570 | T-helper 2 cell activation(GO:0035712) regulation of T-helper 2 cell activation(GO:2000569) positive regulation of T-helper 2 cell activation(GO:2000570) |
| 0.1 | 1.0 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.1 | 1.5 | GO:0097341 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) |
| 0.1 | 0.5 | GO:0033572 | transferrin transport(GO:0033572) |
| 0.1 | 0.2 | GO:0046203 | spermidine catabolic process(GO:0046203) |
| 0.1 | 0.5 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
| 0.1 | 0.1 | GO:0003308 | negative regulation of Wnt signaling pathway involved in heart development(GO:0003308) |
| 0.1 | 1.7 | GO:0007616 | long-term memory(GO:0007616) |
| 0.1 | 0.4 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.1 | 1.2 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.1 | 0.1 | GO:1905150 | regulation of voltage-gated sodium channel activity(GO:1905150) |
| 0.1 | 0.1 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
| 0.1 | 0.9 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
| 0.1 | 0.4 | GO:1904526 | regulation of microtubule binding(GO:1904526) |
| 0.1 | 0.1 | GO:0072338 | cellular lactam metabolic process(GO:0072338) |
| 0.1 | 0.2 | GO:0003366 | cell-matrix adhesion involved in ameboidal cell migration(GO:0003366) |
| 0.1 | 0.4 | GO:0060134 | prepulse inhibition(GO:0060134) |
| 0.1 | 0.5 | GO:0035930 | corticosteroid hormone secretion(GO:0035930) regulation of corticosteroid hormone secretion(GO:2000846) |
| 0.1 | 0.2 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.1 | 0.4 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.1 | 0.9 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
| 0.1 | 0.2 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.1 | 0.3 | GO:0097052 | L-kynurenine metabolic process(GO:0097052) |
| 0.1 | 0.1 | GO:0044205 | 'de novo' UMP biosynthetic process(GO:0044205) |
| 0.1 | 0.5 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
| 0.1 | 0.7 | GO:0032332 | positive regulation of chondrocyte differentiation(GO:0032332) |
| 0.1 | 0.3 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.1 | 0.1 | GO:0044266 | angiotensin catabolic process in blood(GO:0002005) multicellular organismal protein catabolic process(GO:0044254) protein digestion(GO:0044256) multicellular organismal macromolecule catabolic process(GO:0044266) |
| 0.1 | 26.2 | GO:0008380 | RNA splicing(GO:0008380) |
| 0.1 | 0.1 | GO:0097676 | histone H3-K36 dimethylation(GO:0097676) |
| 0.1 | 0.1 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
| 0.1 | 1.2 | GO:0030815 | negative regulation of cAMP metabolic process(GO:0030815) |
| 0.1 | 0.5 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.1 | 1.0 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
| 0.1 | 0.3 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.1 | 0.3 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.1 | 0.1 | GO:0009624 | response to nematode(GO:0009624) |
| 0.1 | 0.1 | GO:0044146 | negative regulation of growth of symbiont involved in interaction with host(GO:0044146) |
| 0.1 | 1.5 | GO:0031670 | cellular response to nutrient(GO:0031670) |
| 0.1 | 0.2 | GO:0070173 | regulation of enamel mineralization(GO:0070173) |
| 0.1 | 0.2 | GO:0043686 | co-translational protein modification(GO:0043686) |
| 0.1 | 0.5 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
| 0.1 | 0.4 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.1 | 1.8 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
| 0.1 | 0.1 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.1 | 0.2 | GO:1904806 | regulation of protein oxidation(GO:1904806) positive regulation of protein oxidation(GO:1904808) |
| 0.1 | 9.0 | GO:0035023 | regulation of Rho protein signal transduction(GO:0035023) |
| 0.1 | 0.2 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
| 0.1 | 0.1 | GO:0042668 | auditory receptor cell fate determination(GO:0042668) |
| 0.1 | 0.1 | GO:0071073 | regulation of phosphatidylinositol biosynthetic process(GO:0010511) positive regulation of phospholipid biosynthetic process(GO:0071073) |
| 0.1 | 0.4 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 | 0.2 | GO:0070141 | response to UV-A(GO:0070141) |
| 0.1 | 1.1 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
| 0.1 | 0.6 | GO:0031507 | heterochromatin assembly(GO:0031507) |
| 0.1 | 0.2 | GO:0030920 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.1 | 0.3 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.1 | 0.5 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.1 | 0.1 | GO:0042700 | luteinizing hormone signaling pathway(GO:0042700) |
| 0.1 | 0.2 | GO:2000543 | positive regulation of gastrulation(GO:2000543) |
| 0.1 | 0.2 | GO:0060482 | lobar bronchus development(GO:0060482) |
| 0.1 | 0.9 | GO:0050427 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 0.1 | 0.1 | GO:0071461 | cellular response to redox state(GO:0071461) |
| 0.1 | 0.3 | GO:0044804 | nucleophagy(GO:0044804) |
| 0.1 | 0.2 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.1 | 0.3 | GO:0007000 | nucleolus organization(GO:0007000) |
| 0.1 | 0.1 | GO:0021781 | glial cell fate commitment(GO:0021781) |
| 0.1 | 0.3 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
| 0.1 | 0.2 | GO:0039533 | regulation of MDA-5 signaling pathway(GO:0039533) |
| 0.1 | 4.1 | GO:0090630 | activation of GTPase activity(GO:0090630) |
| 0.1 | 0.1 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.1 | 0.6 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.1 | 0.4 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.1 | 0.5 | GO:0048596 | embryonic camera-type eye morphogenesis(GO:0048596) |
| 0.1 | 0.1 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
| 0.1 | 2.1 | GO:0007189 | adenylate cyclase-activating G-protein coupled receptor signaling pathway(GO:0007189) |
| 0.1 | 0.1 | GO:0000023 | maltose metabolic process(GO:0000023) |
| 0.0 | 0.1 | GO:0048664 | neuron fate determination(GO:0048664) |
| 0.0 | 0.0 | GO:0071873 | response to norepinephrine(GO:0071873) cellular response to norepinephrine stimulus(GO:0071874) |
| 0.0 | 0.3 | GO:0036155 | acylglycerol acyl-chain remodeling(GO:0036155) |
| 0.0 | 0.4 | GO:0032264 | IMP salvage(GO:0032264) |
| 0.0 | 0.2 | GO:0016264 | gap junction assembly(GO:0016264) |
| 0.0 | 1.2 | GO:0007212 | dopamine receptor signaling pathway(GO:0007212) |
| 0.0 | 0.6 | GO:0042355 | fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
| 0.0 | 0.1 | GO:0034088 | maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
| 0.0 | 1.0 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 | 0.4 | GO:0051642 | centrosome localization(GO:0051642) |
| 0.0 | 0.4 | GO:0003301 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 | 0.0 | GO:0051792 | medium-chain fatty acid biosynthetic process(GO:0051792) |
| 0.0 | 5.1 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.0 | 1.5 | GO:0030261 | chromosome condensation(GO:0030261) |
| 0.0 | 0.8 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
| 0.0 | 0.2 | GO:2000781 | positive regulation of double-strand break repair(GO:2000781) |
| 0.0 | 0.1 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.0 | 0.0 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.0 | 0.1 | GO:0036022 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
| 0.0 | 1.1 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.0 | 0.3 | GO:0008218 | bioluminescence(GO:0008218) |
| 0.0 | 0.3 | GO:0002347 | response to tumor cell(GO:0002347) |
| 0.0 | 0.2 | GO:0072092 | ureteric bud invasion(GO:0072092) metanephric renal vesicle formation(GO:0072093) |
| 0.0 | 0.5 | GO:0048665 | neuron fate specification(GO:0048665) |
| 0.0 | 1.2 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.0 | 0.1 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
| 0.0 | 0.1 | GO:0042418 | epinephrine biosynthetic process(GO:0042418) |
| 0.0 | 0.2 | GO:2000490 | negative regulation of hepatic stellate cell activation(GO:2000490) |
| 0.0 | 0.1 | GO:0006428 | isoleucyl-tRNA aminoacylation(GO:0006428) |
| 0.0 | 0.3 | GO:0002191 | cap-dependent translational initiation(GO:0002191) |
| 0.0 | 0.1 | GO:0007343 | egg activation(GO:0007343) |
| 0.0 | 0.4 | GO:0070307 | lens fiber cell development(GO:0070307) |
| 0.0 | 0.2 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.0 | 0.0 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.0 | 0.3 | GO:0032342 | aldosterone metabolic process(GO:0032341) aldosterone biosynthetic process(GO:0032342) |
| 0.0 | 0.0 | GO:0072716 | response to actinomycin D(GO:0072716) cellular response to actinomycin D(GO:0072717) |
| 0.0 | 2.9 | GO:0071426 | ribonucleoprotein complex export from nucleus(GO:0071426) |
| 0.0 | 3.6 | GO:0006501 | C-terminal protein lipidation(GO:0006501) |
| 0.0 | 0.1 | GO:0002638 | negative regulation of immunoglobulin production(GO:0002638) |
| 0.0 | 0.2 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.0 | 0.1 | GO:0002767 | immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
| 0.0 | 0.7 | GO:0051450 | myoblast proliferation(GO:0051450) |
| 0.0 | 0.8 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.0 | 0.6 | GO:0010390 | histone monoubiquitination(GO:0010390) |
| 0.0 | 0.1 | GO:1904690 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.0 | 0.2 | GO:0046325 | negative regulation of glucose import(GO:0046325) |
| 0.0 | 0.3 | GO:0042908 | xenobiotic transport(GO:0042908) |
| 0.0 | 0.2 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.0 | 0.2 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.0 | 0.3 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.0 | 0.1 | GO:0061300 | cerebellum vasculature development(GO:0061300) |
| 0.0 | 2.7 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
| 0.0 | 1.9 | GO:0036498 | IRE1-mediated unfolded protein response(GO:0036498) |
| 0.0 | 0.1 | GO:0009822 | alkaloid catabolic process(GO:0009822) |
| 0.0 | 0.1 | GO:0090154 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.0 | 0.1 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
| 0.0 | 0.2 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.0 | 1.5 | GO:0006879 | cellular iron ion homeostasis(GO:0006879) |
| 0.0 | 0.1 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.0 | 0.2 | GO:0099625 | ventricular cardiac muscle cell membrane repolarization(GO:0099625) |
| 0.0 | 0.1 | GO:0051352 | negative regulation of ligase activity(GO:0051352) negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
| 0.0 | 0.1 | GO:0042346 | positive regulation of NF-kappaB import into nucleus(GO:0042346) |
| 0.0 | 0.2 | GO:0097056 | selenocysteinyl-tRNA(Sec) biosynthetic process(GO:0097056) |
| 0.0 | 0.1 | GO:0044376 | RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
| 0.0 | 0.0 | GO:0015888 | thiamine transport(GO:0015888) |
| 0.0 | 0.1 | GO:0006772 | thiamine metabolic process(GO:0006772) |
| 0.0 | 0.3 | GO:0015988 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) |
| 0.0 | 0.0 | GO:0010193 | response to ozone(GO:0010193) |
| 0.0 | 0.1 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.0 | 0.0 | GO:0032425 | positive regulation of mismatch repair(GO:0032425) |
| 0.0 | 0.4 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.0 | 0.3 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.0 | 0.5 | GO:0051014 | actin filament severing(GO:0051014) |
| 0.0 | 0.0 | GO:0090199 | regulation of release of cytochrome c from mitochondria(GO:0090199) |
| 0.0 | 0.1 | GO:0060926 | cardiac pacemaker cell differentiation(GO:0060920) cardiac pacemaker cell development(GO:0060926) |
| 0.0 | 0.9 | GO:0000045 | autophagosome assembly(GO:0000045) |
| 0.0 | 0.0 | GO:0006679 | glucosylceramide biosynthetic process(GO:0006679) |
| 0.0 | 0.1 | GO:0055093 | response to hyperoxia(GO:0055093) |
| 0.0 | 0.3 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.0 | 0.2 | GO:0032757 | positive regulation of interleukin-8 production(GO:0032757) |
| 0.0 | 0.4 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.0 | 0.0 | GO:0030311 | poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.0 | 0.1 | GO:0097104 | postsynaptic membrane assembly(GO:0097104) |
| 0.0 | 0.1 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.0 | 0.3 | GO:1902170 | cellular response to reactive nitrogen species(GO:1902170) |
| 0.0 | 0.3 | GO:2000401 | regulation of lymphocyte migration(GO:2000401) |
| 0.0 | 0.1 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.0 | 0.3 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
| 0.0 | 0.1 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
| 0.0 | 0.1 | GO:0009452 | 7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
| 0.0 | 0.3 | GO:0098781 | ncRNA transcription(GO:0098781) |
| 0.0 | 0.0 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
| 0.0 | 0.2 | GO:0044245 | polysaccharide digestion(GO:0044245) |
| 0.0 | 0.1 | GO:0002877 | acute inflammatory response to non-antigenic stimulus(GO:0002525) regulation of acute inflammatory response to non-antigenic stimulus(GO:0002877) positive regulation of acute inflammatory response to non-antigenic stimulus(GO:0002879) |
| 0.0 | 0.3 | GO:0021696 | cerebellar cortex morphogenesis(GO:0021696) |
| 0.0 | 4.3 | GO:0042787 | protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0042787) |
| 0.0 | 0.1 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
| 0.0 | 0.1 | GO:0009804 | coumarin metabolic process(GO:0009804) |
| 0.0 | 0.0 | GO:0046338 | phosphatidylethanolamine catabolic process(GO:0046338) |
| 0.0 | 0.1 | GO:0032057 | negative regulation of translational initiation in response to stress(GO:0032057) |
| 0.0 | 0.2 | GO:0046604 | positive regulation of mitotic centrosome separation(GO:0046604) |
| 0.0 | 0.1 | GO:0072584 | caveolin-mediated endocytosis(GO:0072584) |
| 0.0 | 0.1 | GO:0006089 | lactate metabolic process(GO:0006089) |
| 0.0 | 0.0 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.0 | 0.4 | GO:0003334 | keratinocyte development(GO:0003334) |
| 0.0 | 0.1 | GO:1901052 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
| 0.0 | 0.0 | GO:0030223 | neutrophil differentiation(GO:0030223) |
| 0.0 | 0.0 | GO:2001267 | regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001267) |
| 0.0 | 0.0 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
| 0.0 | 0.2 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
| 0.0 | 0.1 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
| 0.0 | 0.1 | GO:0048749 | compound eye development(GO:0048749) |
| 0.0 | 0.1 | GO:0048104 | establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 0.0 | 1.0 | GO:0032392 | DNA geometric change(GO:0032392) |
| 0.0 | 0.4 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.0 | 0.0 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
| 0.0 | 0.2 | GO:0006568 | tryptophan metabolic process(GO:0006568) |
| 0.0 | 0.2 | GO:0060088 | auditory receptor cell stereocilium organization(GO:0060088) |
| 0.0 | 0.1 | GO:0070676 | intralumenal vesicle formation(GO:0070676) |
| 0.0 | 0.1 | GO:2000568 | memory T cell activation(GO:0035709) regulation of memory T cell activation(GO:2000567) positive regulation of memory T cell activation(GO:2000568) |
| 0.0 | 0.0 | GO:0007632 | visual behavior(GO:0007632) |
| 0.0 | 0.1 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
| 0.0 | 0.3 | GO:0006783 | heme biosynthetic process(GO:0006783) |
| 0.0 | 0.0 | GO:0006591 | ornithine metabolic process(GO:0006591) |
| 0.0 | 0.1 | GO:0060022 | hard palate development(GO:0060022) |
| 0.0 | 0.1 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
| 0.0 | 0.0 | GO:0089718 | amino acid import across plasma membrane(GO:0089718) |
| 0.0 | 0.2 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.0 | 0.1 | GO:0032455 | nerve growth factor processing(GO:0032455) |
| 0.0 | 0.1 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.0 | 0.1 | GO:0016256 | N-glycan processing to lysosome(GO:0016256) |
| 0.0 | 0.0 | GO:0043267 | negative regulation of potassium ion transport(GO:0043267) |
| 0.0 | 0.1 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) |
| 0.0 | 0.0 | GO:0071104 | response to interleukin-9(GO:0071104) |
| 0.0 | 0.0 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.0 | 0.0 | GO:1902310 | positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.0 | 0.3 | GO:0045066 | regulatory T cell differentiation(GO:0045066) |
| 0.0 | 0.3 | GO:0050690 | regulation of defense response to virus by virus(GO:0050690) |
| 0.0 | 0.0 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) |
| 0.0 | 0.0 | GO:0032372 | negative regulation of sterol transport(GO:0032372) negative regulation of cholesterol transport(GO:0032375) |
| 0.0 | 0.0 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
| 0.0 | 2.2 | GO:0051056 | regulation of small GTPase mediated signal transduction(GO:0051056) |
| 0.0 | 0.0 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
| 0.0 | 0.0 | GO:0097498 | endothelial tube lumen extension(GO:0097498) |
| 0.0 | 0.5 | GO:0050913 | sensory perception of bitter taste(GO:0050913) |
| 0.0 | 0.3 | GO:0030317 | sperm motility(GO:0030317) |
| 0.0 | 0.2 | GO:0042438 | melanin biosynthetic process(GO:0042438) |
| 0.0 | 0.1 | GO:0017004 | cytochrome complex assembly(GO:0017004) |
| 0.0 | 0.0 | GO:0019605 | butyrate metabolic process(GO:0019605) |
Gene overrepresentation in cellular component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.2 | 9.7 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
| 2.4 | 21.3 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 2.0 | 15.9 | GO:0098559 | cytoplasmic side of early endosome membrane(GO:0098559) |
| 1.9 | 5.7 | GO:0097489 | multivesicular body, internal vesicle lumen(GO:0097489) |
| 1.8 | 12.4 | GO:0042825 | TAP complex(GO:0042825) |
| 1.5 | 4.6 | GO:0044753 | amphisome(GO:0044753) |
| 1.5 | 4.5 | GO:1990622 | CHOP-ATF3 complex(GO:1990622) |
| 1.5 | 17.5 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 1.4 | 8.4 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 1.3 | 5.0 | GO:0045160 | myosin I complex(GO:0045160) |
| 1.1 | 9.1 | GO:0071144 | SMAD2-SMAD3 protein complex(GO:0071144) |
| 1.1 | 3.2 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.9 | 4.7 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.9 | 11.9 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.9 | 9.9 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.8 | 5.1 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 0.8 | 3.4 | GO:0045293 | MIS complex(GO:0036396) mRNA editing complex(GO:0045293) |
| 0.8 | 2.4 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.8 | 2.4 | GO:0030689 | Noc complex(GO:0030689) |
| 0.7 | 0.7 | GO:0060201 | clathrin-sculpted acetylcholine transport vesicle(GO:0060200) clathrin-sculpted acetylcholine transport vesicle membrane(GO:0060201) |
| 0.7 | 3.4 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.7 | 7.3 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.6 | 1.9 | GO:0097450 | astrocyte end-foot(GO:0097450) |
| 0.6 | 3.2 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.6 | 0.6 | GO:0097449 | astrocyte projection(GO:0097449) |
| 0.6 | 1.9 | GO:0016938 | kinesin I complex(GO:0016938) |
| 0.6 | 3.7 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.6 | 12.8 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.6 | 1.8 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
| 0.6 | 8.0 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.6 | 1.7 | GO:0005668 | RNA polymerase transcription factor SL1 complex(GO:0005668) |
| 0.6 | 4.0 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
| 0.6 | 2.8 | GO:0070826 | paraferritin complex(GO:0070826) |
| 0.5 | 2.2 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.5 | 2.7 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.5 | 2.1 | GO:0016939 | kinesin II complex(GO:0016939) |
| 0.5 | 0.5 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.5 | 1.6 | GO:0097441 | basilar dendrite(GO:0097441) |
| 0.5 | 2.6 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
| 0.5 | 0.5 | GO:0034681 | integrin alpha11-beta1 complex(GO:0034681) |
| 0.5 | 2.5 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.5 | 1.5 | GO:0034686 | integrin alphav-beta8 complex(GO:0034686) |
| 0.5 | 2.0 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.5 | 4.0 | GO:0070187 | telosome(GO:0070187) |
| 0.5 | 2.9 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 0.5 | 1.9 | GO:0008043 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
| 0.5 | 4.7 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) |
| 0.5 | 0.5 | GO:0030849 | autosome(GO:0030849) |
| 0.5 | 2.3 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.5 | 0.5 | GO:0042565 | RNA nuclear export complex(GO:0042565) |
| 0.5 | 1.4 | GO:0031523 | Myb complex(GO:0031523) |
| 0.5 | 3.2 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.5 | 4.1 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.5 | 4.1 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.4 | 4.4 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.4 | 3.0 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.4 | 7.3 | GO:0032059 | bleb(GO:0032059) |
| 0.4 | 0.4 | GO:0034665 | integrin alpha1-beta1 complex(GO:0034665) |
| 0.4 | 0.8 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.4 | 1.6 | GO:1990742 | microvesicle(GO:1990742) |
| 0.4 | 9.4 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.4 | 5.4 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.4 | 3.1 | GO:0000783 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
| 0.4 | 1.9 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.4 | 3.4 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.4 | 6.4 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.4 | 2.3 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.4 | 10.2 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.4 | 1.5 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.4 | 1.5 | GO:0031905 | early endosome lumen(GO:0031905) |
| 0.4 | 8.6 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.4 | 1.5 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.4 | 1.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.4 | 3.7 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.4 | 1.5 | GO:0070369 | beta-catenin-TCF7L2 complex(GO:0070369) |
| 0.4 | 4.4 | GO:0043219 | lateral loop(GO:0043219) |
| 0.4 | 3.3 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.3 | 2.1 | GO:1990037 | Lewy body core(GO:1990037) |
| 0.3 | 3.1 | GO:0005638 | lamin filament(GO:0005638) |
| 0.3 | 4.1 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.3 | 0.7 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.3 | 1.0 | GO:0002945 | cyclin K-CDK13 complex(GO:0002945) |
| 0.3 | 8.0 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.3 | 0.7 | GO:0032127 | dense core granule membrane(GO:0032127) |
| 0.3 | 1.3 | GO:1990578 | perinuclear endoplasmic reticulum membrane(GO:1990578) |
| 0.3 | 1.3 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.3 | 3.5 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.3 | 9.2 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.3 | 2.5 | GO:0072487 | MSL complex(GO:0072487) |
| 0.3 | 0.9 | GO:1903349 | omegasome membrane(GO:1903349) |
| 0.3 | 1.5 | GO:0032021 | NELF complex(GO:0032021) |
| 0.3 | 2.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.3 | 0.9 | GO:0033565 | ESCRT-0 complex(GO:0033565) |
| 0.3 | 0.9 | GO:0030895 | apolipoprotein B mRNA editing enzyme complex(GO:0030895) |
| 0.3 | 5.6 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.3 | 0.9 | GO:0036398 | TCR signalosome(GO:0036398) |
| 0.3 | 2.1 | GO:0089701 | U2AF(GO:0089701) |
| 0.3 | 3.5 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.3 | 7.4 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
| 0.3 | 2.9 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.3 | 2.9 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.3 | 1.7 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.3 | 3.2 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.3 | 1.4 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.3 | 1.7 | GO:0072589 | box H/ACA scaRNP complex(GO:0072589) box H/ACA telomerase RNP complex(GO:0090661) |
| 0.3 | 2.0 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.3 | 0.6 | GO:0008278 | cohesin complex(GO:0008278) |
| 0.3 | 0.8 | GO:0043159 | acrosomal matrix(GO:0043159) |
| 0.3 | 2.5 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.3 | 1.3 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.3 | 0.8 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.3 | 0.8 | GO:0098855 | HCN channel complex(GO:0098855) |
| 0.3 | 1.1 | GO:0060187 | cell pole(GO:0060187) |
| 0.3 | 2.1 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.3 | 0.8 | GO:0043260 | laminin-11 complex(GO:0043260) |
| 0.3 | 0.3 | GO:0044301 | climbing fiber(GO:0044301) |
| 0.3 | 5.4 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.3 | 5.1 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.3 | 1.5 | GO:0001652 | granular component(GO:0001652) |
| 0.2 | 0.5 | GO:0042585 | germinal vesicle(GO:0042585) |
| 0.2 | 3.0 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.2 | 2.5 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.2 | 5.7 | GO:0005861 | troponin complex(GO:0005861) |
| 0.2 | 0.7 | GO:0044326 | dendritic spine neck(GO:0044326) |
| 0.2 | 2.9 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.2 | 0.5 | GO:0000229 | cytoplasmic chromosome(GO:0000229) |
| 0.2 | 1.7 | GO:0035692 | macrophage migration inhibitory factor receptor complex(GO:0035692) |
| 0.2 | 0.7 | GO:0018444 | translation release factor complex(GO:0018444) |
| 0.2 | 1.0 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.2 | 2.4 | GO:1902562 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
| 0.2 | 1.9 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.2 | 1.2 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.2 | 0.5 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.2 | 4.5 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
| 0.2 | 0.9 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
| 0.2 | 2.1 | GO:0001939 | female pronucleus(GO:0001939) |
| 0.2 | 1.4 | GO:0070381 | endosome to plasma membrane transport vesicle(GO:0070381) |
| 0.2 | 1.2 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.2 | 1.4 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
| 0.2 | 0.9 | GO:0032044 | DSIF complex(GO:0032044) |
| 0.2 | 4.8 | GO:0005685 | U1 snRNP(GO:0005685) |
| 0.2 | 2.1 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.2 | 2.8 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.2 | 2.3 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.2 | 1.1 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 0.2 | 16.9 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.2 | 1.1 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.2 | 1.6 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.2 | 9.1 | GO:0030673 | axolemma(GO:0030673) |
| 0.2 | 1.1 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.2 | 0.9 | GO:0036338 | viral envelope(GO:0019031) viral membrane(GO:0036338) |
| 0.2 | 0.4 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.2 | 1.5 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.2 | 1.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.2 | 1.9 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.2 | 22.2 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.2 | 0.8 | GO:0031417 | NatC complex(GO:0031417) |
| 0.2 | 1.5 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.2 | 0.6 | GO:1902636 | kinociliary basal body(GO:1902636) |
| 0.2 | 7.0 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.2 | 1.2 | GO:0034448 | EGO complex(GO:0034448) |
| 0.2 | 0.8 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.2 | 1.0 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.2 | 1.6 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.2 | 4.8 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.2 | 0.4 | GO:0070695 | FHF complex(GO:0070695) |
| 0.2 | 2.9 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.2 | 1.2 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 0.2 | 1.4 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.2 | 0.6 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
| 0.2 | 2.1 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.2 | 2.1 | GO:0033018 | sarcoplasmic reticulum lumen(GO:0033018) |
| 0.2 | 1.7 | GO:1904724 | tertiary granule lumen(GO:1904724) |
| 0.2 | 0.6 | GO:0097444 | spine apparatus(GO:0097444) |
| 0.2 | 2.3 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.2 | 1.1 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.2 | 0.7 | GO:1990031 | pinceau fiber(GO:1990031) |
| 0.2 | 1.9 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.2 | 1.5 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.2 | 0.9 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.2 | 1.3 | GO:0098839 | postsynaptic density membrane(GO:0098839) |
| 0.2 | 1.3 | GO:0036021 | endolysosome lumen(GO:0036021) |
| 0.2 | 1.1 | GO:0070470 | plasma membrane respiratory chain(GO:0070470) |
| 0.2 | 0.9 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.2 | 0.2 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.2 | 11.2 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
| 0.2 | 3.4 | GO:0036038 | MKS complex(GO:0036038) |
| 0.2 | 2.0 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 0.2 | 1.8 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.2 | 4.4 | GO:0071437 | invadopodium(GO:0071437) |
| 0.2 | 2.4 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.2 | 0.7 | GO:0005600 | collagen type XIII trimer(GO:0005600) transmembrane collagen trimer(GO:0030936) |
| 0.2 | 1.2 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.2 | 5.1 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.2 | 0.5 | GO:0000818 | nuclear MIS12/MIND complex(GO:0000818) |
| 0.2 | 0.8 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
| 0.2 | 0.8 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.2 | 2.3 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.2 | 0.2 | GO:0044308 | axonal spine(GO:0044308) |
| 0.2 | 1.4 | GO:0034706 | sodium channel complex(GO:0034706) |
| 0.2 | 10.4 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
| 0.2 | 31.6 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
| 0.2 | 1.3 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.2 | 0.5 | GO:1990298 | mitotic checkpoint complex(GO:0033597) bub1-bub3 complex(GO:1990298) |
| 0.2 | 1.7 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.2 | 0.6 | GO:0097413 | Lewy body(GO:0097413) |
| 0.2 | 0.6 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.2 | 0.8 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.2 | 0.8 | GO:0060091 | kinocilium(GO:0060091) |
| 0.2 | 1.2 | GO:0005587 | collagen type IV trimer(GO:0005587) |
| 0.2 | 0.9 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.2 | 2.9 | GO:0001741 | XY body(GO:0001741) |
| 0.2 | 0.6 | GO:0031085 | BLOC-3 complex(GO:0031085) |
| 0.2 | 0.8 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.2 | 2.0 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.1 | 1.0 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.1 | 1.2 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.1 | 9.6 | GO:0015030 | Cajal body(GO:0015030) |
| 0.1 | 0.7 | GO:0030891 | VCB complex(GO:0030891) |
| 0.1 | 1.8 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.1 | 1.2 | GO:0031415 | NatA complex(GO:0031415) |
| 0.1 | 0.6 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
| 0.1 | 7.8 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.1 | 0.7 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.1 | 1.1 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.1 | 8.0 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.1 | 1.0 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.1 | 0.4 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.1 | 0.7 | GO:0042643 | actomyosin, actin portion(GO:0042643) |
| 0.1 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
| 0.1 | 4.2 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.1 | 0.5 | GO:0032437 | cuticular plate(GO:0032437) |
| 0.1 | 0.4 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
| 0.1 | 1.1 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
| 0.1 | 4.2 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.1 | 0.5 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
| 0.1 | 0.5 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.1 | 1.4 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.1 | 0.9 | GO:0071203 | WASH complex(GO:0071203) |
| 0.1 | 1.9 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.1 | 1.3 | GO:0044292 | dendrite terminus(GO:0044292) |
| 0.1 | 1.5 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.1 | 0.5 | GO:0005889 | hydrogen:potassium-exchanging ATPase complex(GO:0005889) |
| 0.1 | 2.4 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.1 | 0.4 | GO:0097447 | dendritic tree(GO:0097447) |
| 0.1 | 0.9 | GO:0044754 | autolysosome(GO:0044754) |
| 0.1 | 3.2 | GO:0097346 | INO80-type complex(GO:0097346) |
| 0.1 | 0.5 | GO:0009368 | endopeptidase Clp complex(GO:0009368) |
| 0.1 | 13.4 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.1 | 0.4 | GO:0034455 | t-UTP complex(GO:0034455) |
| 0.1 | 0.1 | GO:0044453 | nuclear membrane part(GO:0044453) |
| 0.1 | 0.2 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| 0.1 | 2.4 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.1 | 1.5 | GO:0090543 | Flemming body(GO:0090543) |
| 0.1 | 2.4 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.1 | 0.4 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
| 0.1 | 0.1 | GO:0019034 | viral replication complex(GO:0019034) |
| 0.1 | 4.4 | GO:0000791 | euchromatin(GO:0000791) |
| 0.1 | 0.7 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.1 | 0.7 | GO:0032807 | DNA ligase IV complex(GO:0032807) |
| 0.1 | 2.0 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.1 | 62.2 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.1 | 0.8 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.1 | 2.5 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.1 | 5.5 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.1 | 2.9 | GO:0042627 | chylomicron(GO:0042627) |
| 0.1 | 1.7 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.1 | 0.4 | GO:0032010 | phagolysosome(GO:0032010) |
| 0.1 | 1.5 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.1 | 0.3 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.1 | 1.2 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.1 | 1.2 | GO:0030904 | retromer complex(GO:0030904) |
| 0.1 | 0.6 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.1 | 0.5 | GO:0061202 | clathrin-sculpted gamma-aminobutyric acid transport vesicle(GO:0061200) clathrin-sculpted gamma-aminobutyric acid transport vesicle membrane(GO:0061202) |
| 0.1 | 1.0 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
| 0.1 | 0.3 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
| 0.1 | 5.1 | GO:0032420 | stereocilium(GO:0032420) |
| 0.1 | 15.3 | GO:0019898 | extrinsic component of membrane(GO:0019898) |
| 0.1 | 2.8 | GO:0030684 | preribosome(GO:0030684) |
| 0.1 | 0.1 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.1 | 1.4 | GO:0042599 | lamellar body(GO:0042599) |
| 0.1 | 0.3 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.1 | 0.6 | GO:0098845 | postsynaptic endosome(GO:0098845) |
| 0.1 | 1.0 | GO:0044327 | dendritic spine head(GO:0044327) |
| 0.1 | 1.7 | GO:0030897 | HOPS complex(GO:0030897) |
| 0.1 | 3.7 | GO:1902711 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
| 0.1 | 0.5 | GO:1990425 | ryanodine receptor complex(GO:1990425) |
| 0.1 | 2.7 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.1 | 0.2 | GO:1990423 | RZZ complex(GO:1990423) |
| 0.1 | 1.2 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.1 | 0.3 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.1 | 5.6 | GO:0031594 | neuromuscular junction(GO:0031594) |
| 0.1 | 1.3 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
| 0.1 | 0.7 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.1 | 0.9 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.1 | 2.5 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.1 | 3.2 | GO:1990752 | microtubule end(GO:1990752) |
| 0.1 | 0.9 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) |
| 0.1 | 0.8 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.1 | 0.4 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
| 0.1 | 0.9 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.1 | 9.0 | GO:0035578 | azurophil granule lumen(GO:0035578) |
| 0.1 | 0.7 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.1 | 0.5 | GO:0098984 | neuron to neuron synapse(GO:0098984) |
| 0.1 | 0.3 | GO:0043203 | axon hillock(GO:0043203) |
| 0.1 | 0.8 | GO:0034709 | methylosome(GO:0034709) |
| 0.1 | 2.4 | GO:0031941 | filamentous actin(GO:0031941) |
| 0.1 | 7.8 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.1 | 0.3 | GO:1990761 | growth cone lamellipodium(GO:1990761) growth cone filopodium(GO:1990812) |
| 0.1 | 0.4 | GO:0000938 | GARP complex(GO:0000938) |
| 0.1 | 2.4 | GO:0031231 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
| 0.1 | 1.1 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.1 | 0.8 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.1 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.1 | 1.1 | GO:0032156 | septin cytoskeleton(GO:0032156) |
| 0.1 | 1.0 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.1 | 0.1 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
| 0.1 | 0.9 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.1 | 0.3 | GO:0034669 | integrin alpha4-beta7 complex(GO:0034669) |
| 0.1 | 0.4 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.1 | 1.1 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.1 | 0.5 | GO:0097486 | multivesicular body lumen(GO:0097486) |
| 0.1 | 1.2 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.1 | 0.1 | GO:0097134 | cyclin E1-CDK2 complex(GO:0097134) |
| 0.1 | 0.4 | GO:0044305 | calyx of Held(GO:0044305) |
| 0.1 | 1.9 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.1 | 1.1 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
| 0.1 | 6.2 | GO:0001725 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
| 0.1 | 0.1 | GO:0098573 | intrinsic component of mitochondrial membrane(GO:0098573) |
| 0.1 | 1.0 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.1 | 0.6 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.1 | 0.2 | GO:0031372 | UBC13-MMS2 complex(GO:0031372) |
| 0.1 | 1.0 | GO:0042555 | MCM complex(GO:0042555) |
| 0.1 | 1.1 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
| 0.1 | 0.2 | GO:0043511 | inhibin complex(GO:0043511) inhibin A complex(GO:0043512) |
| 0.1 | 0.5 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.1 | 0.6 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.1 | 1.2 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.1 | 0.2 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.1 | 0.7 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.1 | 0.4 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.1 | 2.1 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.1 | 1.4 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.1 | 0.1 | GO:0044094 | host cell nucleus(GO:0042025) host cell nuclear part(GO:0044094) |
| 0.1 | 5.3 | GO:0000794 | condensed nuclear chromosome(GO:0000794) |
| 0.1 | 0.2 | GO:0005953 | CAAX-protein geranylgeranyltransferase complex(GO:0005953) |
| 0.1 | 0.2 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.1 | 8.9 | GO:0101002 | ficolin-1-rich granule(GO:0101002) ficolin-1-rich granule lumen(GO:1904813) |
| 0.1 | 10.1 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
| 0.1 | 0.2 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.1 | 0.2 | GO:0005674 | transcription factor TFIIF complex(GO:0005674) |
| 0.1 | 0.7 | GO:0036379 | myofilament(GO:0036379) |
| 0.1 | 0.1 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
| 0.1 | 0.7 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.1 | 0.4 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.1 | 0.1 | GO:0060203 | clathrin-sculpted glutamate transport vesicle(GO:0060199) clathrin-sculpted glutamate transport vesicle membrane(GO:0060203) |
| 0.1 | 0.2 | GO:0000974 | Prp19 complex(GO:0000974) |
| 0.1 | 0.4 | GO:0005854 | nascent polypeptide-associated complex(GO:0005854) |
| 0.1 | 0.8 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.1 | 0.2 | GO:0005684 | U2-type spliceosomal complex(GO:0005684) |
| 0.1 | 1.0 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.1 | 0.4 | GO:0048500 | signal recognition particle(GO:0048500) |
| 0.1 | 0.2 | GO:0038038 | G-protein coupled receptor homodimeric complex(GO:0038038) |
| 0.1 | 0.8 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.0 | 3.9 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 1.4 | GO:0005844 | polysome(GO:0005844) |
| 0.0 | 1.5 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.0 | 0.3 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.0 | 0.4 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.0 | 0.1 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
| 0.0 | 1.1 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.0 | 0.6 | GO:0033177 | proton-transporting two-sector ATPase complex, proton-transporting domain(GO:0033177) |
| 0.0 | 4.0 | GO:0043204 | perikaryon(GO:0043204) |
| 0.0 | 2.3 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.0 | 0.1 | GO:0033011 | perinuclear theca(GO:0033011) |
| 0.0 | 4.3 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.0 | 0.3 | GO:0034688 | integrin alphaM-beta2 complex(GO:0034688) |
| 0.0 | 0.1 | GO:0032009 | early phagosome(GO:0032009) |
| 0.0 | 0.5 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.0 | 0.1 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.0 | 0.4 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.0 | 4.1 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
| 0.0 | 0.7 | GO:0031095 | platelet dense tubular network membrane(GO:0031095) |
| 0.0 | 0.1 | GO:0001534 | radial spoke(GO:0001534) |
| 0.0 | 0.1 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.0 | 0.0 | GO:0005608 | laminin-3 complex(GO:0005608) |
| 0.0 | 0.1 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
| 0.0 | 0.5 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.0 | 1.6 | GO:0035580 | specific granule lumen(GO:0035580) |
| 0.0 | 0.4 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.0 | 1.7 | GO:0000786 | nucleosome(GO:0000786) |
| 0.0 | 0.2 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.0 | 0.1 | GO:0098843 | postsynaptic endocytic zone(GO:0098843) |
| 0.0 | 0.1 | GO:0005873 | plus-end kinesin complex(GO:0005873) |
| 0.0 | 5.2 | GO:0035770 | ribonucleoprotein granule(GO:0035770) |
| 0.0 | 0.7 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
| 0.0 | 0.2 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 0.0 | 0.3 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.0 | 0.3 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.0 | 0.1 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
| 0.0 | 0.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.0 | 0.4 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.0 | 0.1 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 2.0 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.0 | 1.3 | GO:0000779 | condensed chromosome, centromeric region(GO:0000779) |
| 0.0 | 0.2 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 0.0 | 0.5 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.0 | 1.1 | GO:0005643 | nuclear pore(GO:0005643) |
| 0.0 | 0.9 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 0.0 | GO:0032421 | stereocilium bundle(GO:0032421) |
| 0.0 | 0.1 | GO:0008091 | spectrin(GO:0008091) |
| 0.0 | 0.1 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.0 | 0.6 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 0.8 | GO:0016235 | aggresome(GO:0016235) |
| 0.0 | 0.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.0 | 0.4 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.0 | 0.1 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.0 | 0.0 | GO:0044423 | virion(GO:0019012) virion part(GO:0044423) |
| 0.0 | 0.1 | GO:0005839 | proteasome core complex(GO:0005839) |
| 0.0 | 0.2 | GO:0033176 | proton-transporting V-type ATPase complex(GO:0033176) |
| 0.0 | 0.0 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
| 0.0 | 0.0 | GO:0035838 | growing cell tip(GO:0035838) cell tip(GO:0051286) |
Gene overrepresentation in molecular function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.4 | 17.2 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
| 2.8 | 25.0 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 2.3 | 7.0 | GO:0098808 | mRNA cap binding(GO:0098808) |
| 2.3 | 9.3 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 2.2 | 6.7 | GO:0008859 | exoribonuclease II activity(GO:0008859) |
| 2.0 | 13.7 | GO:0046979 | TAP2 binding(GO:0046979) |
| 2.0 | 9.8 | GO:0004066 | asparagine synthase (glutamine-hydrolyzing) activity(GO:0004066) |
| 1.7 | 27.5 | GO:0031996 | thioesterase binding(GO:0031996) |
| 1.6 | 4.9 | GO:0034041 | sterol-transporting ATPase activity(GO:0034041) |
| 1.5 | 4.6 | GO:0004730 | pseudouridylate synthase activity(GO:0004730) |
| 1.5 | 4.4 | GO:0047726 | iron-cytochrome-c reductase activity(GO:0047726) |
| 1.4 | 7.1 | GO:0031962 | mineralocorticoid receptor binding(GO:0031962) |
| 1.4 | 11.1 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 1.3 | 3.9 | GO:0004122 | cystathionine beta-synthase activity(GO:0004122) oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) nitrite reductase (NO-forming) activity(GO:0050421) carbon monoxide binding(GO:0070025) nitrite reductase activity(GO:0098809) |
| 1.3 | 5.2 | GO:0005292 | high-affinity basic amino acid transmembrane transporter activity(GO:0005287) high-affinity arginine transmembrane transporter activity(GO:0005289) high-affinity lysine transmembrane transporter activity(GO:0005292) |
| 1.3 | 3.8 | GO:0045155 | electron transporter, transferring electrons from CoQH2-cytochrome c reductase complex and cytochrome c oxidase complex activity(GO:0045155) |
| 1.2 | 7.3 | GO:0004118 | cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) |
| 1.2 | 6.0 | GO:0047757 | chondroitin-glucuronate 5-epimerase activity(GO:0047757) |
| 1.1 | 5.7 | GO:0004906 | interferon-gamma receptor activity(GO:0004906) |
| 1.1 | 5.6 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
| 1.1 | 6.5 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
| 1.1 | 6.5 | GO:0042806 | fucose binding(GO:0042806) |
| 1.1 | 2.1 | GO:0015433 | peptide antigen-transporting ATPase activity(GO:0015433) |
| 1.1 | 8.4 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 1.1 | 3.2 | GO:0031403 | pyridoxal kinase activity(GO:0008478) lithium ion binding(GO:0031403) |
| 1.0 | 3.1 | GO:0031896 | V2 vasopressin receptor binding(GO:0031896) |
| 1.0 | 1.0 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
| 1.0 | 5.1 | GO:0004905 | type I interferon receptor activity(GO:0004905) |
| 1.0 | 6.1 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 1.0 | 6.0 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
| 1.0 | 10.9 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 1.0 | 2.9 | GO:0102008 | cytosolic dipeptidase activity(GO:0102008) |
| 0.9 | 2.8 | GO:0003947 | (N-acetylneuraminyl)-galactosylglucosylceramide N-acetylgalactosaminyltransferase activity(GO:0003947) |
| 0.9 | 2.8 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.9 | 12.2 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.9 | 3.7 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.9 | 2.7 | GO:0098640 | integrin binding involved in cell-matrix adhesion(GO:0098640) |
| 0.9 | 2.7 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.9 | 2.7 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
| 0.9 | 3.5 | GO:0051733 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.8 | 4.1 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
| 0.8 | 5.7 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.8 | 2.4 | GO:0004382 | guanosine-diphosphatase activity(GO:0004382) |
| 0.8 | 2.4 | GO:0015230 | FAD transmembrane transporter activity(GO:0015230) |
| 0.8 | 1.6 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
| 0.8 | 3.9 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.8 | 24.1 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.8 | 3.1 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 0.8 | 2.3 | GO:0070362 | mitochondrial light strand promoter anti-sense binding(GO:0070361) mitochondrial heavy strand promoter anti-sense binding(GO:0070362) mitochondrial heavy strand promoter sense binding(GO:0070364) |
| 0.7 | 13.4 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.7 | 3.0 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.7 | 9.5 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.7 | 2.9 | GO:0003990 | acetylcholinesterase activity(GO:0003990) |
| 0.7 | 2.2 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
| 0.7 | 6.5 | GO:0060002 | plus-end directed microfilament motor activity(GO:0060002) |
| 0.7 | 2.2 | GO:0070320 | inward rectifier potassium channel inhibitor activity(GO:0070320) |
| 0.7 | 2.9 | GO:0015333 | peptide:proton symporter activity(GO:0015333) proton-dependent peptide secondary active transmembrane transporter activity(GO:0022897) |
| 0.7 | 0.7 | GO:1901375 | acetylcholine transmembrane transporter activity(GO:0005277) acetate ester transmembrane transporter activity(GO:1901375) |
| 0.7 | 2.8 | GO:0097677 | STAT family protein binding(GO:0097677) |
| 0.7 | 4.2 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
| 0.7 | 2.1 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.7 | 6.3 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.7 | 2.1 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
| 0.7 | 2.8 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.7 | 8.9 | GO:0046870 | cadmium ion binding(GO:0046870) |
| 0.7 | 2.1 | GO:0016730 | ferredoxin-NADP+ reductase activity(GO:0004324) NADPH-adrenodoxin reductase activity(GO:0015039) oxidoreductase activity, acting on iron-sulfur proteins as donors(GO:0016730) oxidoreductase activity, acting on iron-sulfur proteins as donors, NAD or NADP as acceptor(GO:0016731) |
| 0.7 | 3.4 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
| 0.7 | 6.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.7 | 3.4 | GO:0052901 | polyamine oxidase activity(GO:0046592) spermine:oxygen oxidoreductase (spermidine-forming) activity(GO:0052901) |
| 0.7 | 2.7 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
| 0.7 | 5.4 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.7 | 2.0 | GO:0004827 | proline-tRNA ligase activity(GO:0004827) |
| 0.7 | 0.7 | GO:1903136 | cuprous ion binding(GO:1903136) |
| 0.7 | 5.2 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.7 | 3.3 | GO:0004815 | aspartate-tRNA ligase activity(GO:0004815) |
| 0.7 | 7.2 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.7 | 2.6 | GO:0004331 | 6-phosphofructo-2-kinase activity(GO:0003873) fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.6 | 3.2 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.6 | 17.5 | GO:0070403 | NAD+ binding(GO:0070403) |
| 0.6 | 3.2 | GO:0001010 | transcription factor activity, sequence-specific DNA binding transcription factor recruiting(GO:0001010) |
| 0.6 | 4.4 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.6 | 3.1 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.6 | 6.2 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.6 | 3.1 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.6 | 3.1 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
| 0.6 | 1.9 | GO:0004766 | spermidine synthase activity(GO:0004766) |
| 0.6 | 1.8 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.6 | 3.1 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
| 0.6 | 1.8 | GO:0005330 | dopamine:sodium symporter activity(GO:0005330) |
| 0.6 | 6.6 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.6 | 3.6 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.6 | 0.6 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
| 0.6 | 1.8 | GO:0030377 | urokinase plasminogen activator receptor activity(GO:0030377) |
| 0.6 | 5.8 | GO:0003910 | DNA ligase (ATP) activity(GO:0003910) |
| 0.6 | 4.6 | GO:0060072 | large conductance calcium-activated potassium channel activity(GO:0060072) |
| 0.6 | 3.4 | GO:0038049 | transcription factor activity, ligand-activated RNA polymerase II transcription factor binding(GO:0038049) |
| 0.6 | 8.0 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
| 0.6 | 3.4 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.6 | 2.3 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 0.6 | 1.7 | GO:0008476 | protein-tyrosine sulfotransferase activity(GO:0008476) |
| 0.6 | 3.9 | GO:0015186 | L-glutamine transmembrane transporter activity(GO:0015186) |
| 0.5 | 29.7 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.5 | 1.6 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.5 | 3.8 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
| 0.5 | 2.7 | GO:0004850 | uridine phosphorylase activity(GO:0004850) |
| 0.5 | 1.6 | GO:0000994 | RNA polymerase III core binding(GO:0000994) |
| 0.5 | 2.1 | GO:0033906 | hyaluronoglucuronidase activity(GO:0033906) |
| 0.5 | 1.6 | GO:0098770 | FBXO family protein binding(GO:0098770) |
| 0.5 | 1.6 | GO:0004613 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 0.5 | 5.3 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.5 | 0.5 | GO:0032427 | GBD domain binding(GO:0032427) |
| 0.5 | 3.1 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.5 | 2.6 | GO:0048030 | disaccharide binding(GO:0048030) |
| 0.5 | 4.6 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
| 0.5 | 3.5 | GO:0047894 | flavonol 3-sulfotransferase activity(GO:0047894) |
| 0.5 | 1.0 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.5 | 12.0 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
| 0.5 | 2.0 | GO:0004082 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 0.5 | 10.0 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.5 | 6.5 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.5 | 10.3 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.5 | 4.4 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.5 | 4.9 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.5 | 1.5 | GO:0070984 | SET domain binding(GO:0070984) |
| 0.5 | 1.5 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
| 0.5 | 2.9 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.5 | 1.4 | GO:0061663 | NEDD8 ligase activity(GO:0061663) |
| 0.5 | 1.9 | GO:0004909 | interleukin-1, Type I, activating receptor activity(GO:0004909) |
| 0.5 | 2.3 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
| 0.5 | 1.4 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.5 | 1.4 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.5 | 2.7 | GO:0004471 | malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
| 0.5 | 1.4 | GO:0004117 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) |
| 0.5 | 1.4 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
| 0.5 | 8.6 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
| 0.5 | 2.3 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.5 | 1.8 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 0.5 | 4.5 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.4 | 1.8 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 0.4 | 2.7 | GO:0035800 | deubiquitinase activator activity(GO:0035800) |
| 0.4 | 1.8 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
| 0.4 | 1.8 | GO:0004102 | choline O-acetyltransferase activity(GO:0004102) |
| 0.4 | 1.3 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.4 | 1.7 | GO:0008431 | vitamin E binding(GO:0008431) |
| 0.4 | 5.2 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
| 0.4 | 1.3 | GO:0042007 | interleukin-18 binding(GO:0042007) |
| 0.4 | 1.7 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) |
| 0.4 | 2.6 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.4 | 1.3 | GO:0035403 | histone kinase activity (H3-T6 specific)(GO:0035403) |
| 0.4 | 2.1 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
| 0.4 | 5.0 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
| 0.4 | 1.2 | GO:0016603 | glutaminyl-peptide cyclotransferase activity(GO:0016603) |
| 0.4 | 3.3 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
| 0.4 | 1.2 | GO:0004817 | cysteine-tRNA ligase activity(GO:0004817) |
| 0.4 | 1.2 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.4 | 6.9 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.4 | 2.4 | GO:0010859 | calcium-dependent cysteine-type endopeptidase inhibitor activity(GO:0010859) |
| 0.4 | 2.4 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.4 | 2.4 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.4 | 2.0 | GO:0031208 | POZ domain binding(GO:0031208) |
| 0.4 | 4.4 | GO:0046790 | virion binding(GO:0046790) |
| 0.4 | 4.4 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.4 | 3.2 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.4 | 1.6 | GO:0035501 | MH1 domain binding(GO:0035501) |
| 0.4 | 2.8 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.4 | 2.4 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.4 | 3.5 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.4 | 5.5 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.4 | 5.3 | GO:0089720 | caspase binding(GO:0089720) |
| 0.4 | 1.5 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
| 0.4 | 1.1 | GO:0043739 | G/U mismatch-specific uracil-DNA glycosylase activity(GO:0043739) |
| 0.4 | 0.8 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.4 | 1.5 | GO:0004329 | formate-tetrahydrofolate ligase activity(GO:0004329) |
| 0.4 | 1.1 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
| 0.4 | 1.9 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.4 | 1.5 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.4 | 1.1 | GO:0004821 | histidine-tRNA ligase activity(GO:0004821) |
| 0.4 | 1.5 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.4 | 7.0 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.4 | 1.8 | GO:0055077 | gap junction hemi-channel activity(GO:0055077) |
| 0.4 | 2.2 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
| 0.4 | 1.5 | GO:0004803 | transposase activity(GO:0004803) |
| 0.4 | 5.4 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.4 | 8.3 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
| 0.4 | 6.8 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.4 | 3.6 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.4 | 1.1 | GO:0090631 | pre-miRNA transporter activity(GO:0090631) |
| 0.4 | 7.4 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
| 0.3 | 4.1 | GO:0005536 | glucose binding(GO:0005536) |
| 0.3 | 5.3 | GO:0031701 | angiotensin receptor binding(GO:0031701) |
| 0.3 | 6.0 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.3 | 2.0 | GO:0071253 | connexin binding(GO:0071253) |
| 0.3 | 2.3 | GO:0019798 | procollagen-proline 4-dioxygenase activity(GO:0004656) procollagen-proline dioxygenase activity(GO:0019798) |
| 0.3 | 0.3 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.3 | 0.3 | GO:1990239 | steroid hormone binding(GO:1990239) |
| 0.3 | 9.3 | GO:0005123 | death receptor binding(GO:0005123) |
| 0.3 | 0.9 | GO:0004914 | interleukin-5 receptor activity(GO:0004914) |
| 0.3 | 12.3 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
| 0.3 | 0.3 | GO:0005150 | interleukin-1, Type I receptor binding(GO:0005150) |
| 0.3 | 1.3 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
| 0.3 | 0.9 | GO:0004347 | glucose-6-phosphate isomerase activity(GO:0004347) |
| 0.3 | 5.3 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.3 | 1.2 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.3 | 3.4 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
| 0.3 | 3.1 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.3 | 0.9 | GO:0050211 | procollagen galactosyltransferase activity(GO:0050211) |
| 0.3 | 1.8 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
| 0.3 | 0.9 | GO:0004913 | interleukin-4 receptor activity(GO:0004913) |
| 0.3 | 2.1 | GO:0001595 | angiotensin receptor activity(GO:0001595) angiotensin type II receptor activity(GO:0004945) |
| 0.3 | 1.5 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.3 | 1.8 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.3 | 2.1 | GO:0070324 | thyroid hormone binding(GO:0070324) |
| 0.3 | 2.1 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.3 | 2.1 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
| 0.3 | 0.9 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
| 0.3 | 4.4 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.3 | 1.2 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.3 | 2.6 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.3 | 6.6 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.3 | 2.6 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.3 | 6.0 | GO:0031005 | filamin binding(GO:0031005) |
| 0.3 | 2.8 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.3 | 1.4 | GO:0002046 | opsin binding(GO:0002046) |
| 0.3 | 1.1 | GO:0015184 | L-cystine transmembrane transporter activity(GO:0015184) |
| 0.3 | 0.3 | GO:0016530 | metallochaperone activity(GO:0016530) copper chaperone activity(GO:0016531) copper-dependent protein binding(GO:0032767) |
| 0.3 | 1.1 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.3 | 3.6 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.3 | 1.9 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
| 0.3 | 5.1 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.3 | 3.5 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.3 | 0.3 | GO:0051731 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) |
| 0.3 | 2.1 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.3 | 4.8 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.3 | 2.4 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.3 | 1.6 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.3 | 3.2 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) |
| 0.3 | 1.6 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.3 | 1.0 | GO:0008513 | secondary active organic cation transmembrane transporter activity(GO:0008513) |
| 0.3 | 0.3 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
| 0.3 | 0.8 | GO:0030627 | pre-mRNA 5'-splice site binding(GO:0030627) |
| 0.3 | 2.1 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.3 | 1.6 | GO:0031705 | bombesin receptor binding(GO:0031705) |
| 0.3 | 1.0 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.3 | 4.6 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.3 | 0.5 | GO:0016165 | linoleate 13S-lipoxygenase activity(GO:0016165) |
| 0.3 | 2.8 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
| 0.3 | 6.1 | GO:0022840 | leak channel activity(GO:0022840) narrow pore channel activity(GO:0022842) |
| 0.3 | 14.0 | GO:0050699 | WW domain binding(GO:0050699) |
| 0.3 | 3.6 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
| 0.3 | 1.8 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.3 | 1.0 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 0.3 | 0.8 | GO:0071885 | N-terminal protein N-methyltransferase activity(GO:0071885) |
| 0.3 | 0.8 | GO:0005298 | proline:sodium symporter activity(GO:0005298) |
| 0.2 | 0.7 | GO:0004608 | phosphatidyl-N-methylethanolamine N-methyltransferase activity(GO:0000773) phosphatidylethanolamine N-methyltransferase activity(GO:0004608) phosphatidyl-N-dimethylethanolamine N-methyltransferase activity(GO:0080101) |
| 0.2 | 0.7 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
| 0.2 | 1.2 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
| 0.2 | 2.0 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.2 | 0.2 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.2 | 1.2 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.2 | 1.5 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.2 | 1.2 | GO:0016428 | tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
| 0.2 | 0.7 | GO:0047150 | betaine-homocysteine S-methyltransferase activity(GO:0047150) |
| 0.2 | 0.5 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
| 0.2 | 0.7 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) |
| 0.2 | 0.9 | GO:0050509 | N-acetylglucosaminyl-proteoglycan 4-beta-glucuronosyltransferase activity(GO:0050509) |
| 0.2 | 17.0 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 0.2 | 1.4 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.2 | 0.7 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
| 0.2 | 0.2 | GO:0051538 | 3 iron, 4 sulfur cluster binding(GO:0051538) |
| 0.2 | 3.9 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.2 | 2.1 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.2 | 3.9 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.2 | 1.1 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.2 | 3.0 | GO:0042608 | T cell receptor binding(GO:0042608) |
| 0.2 | 2.5 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.2 | 0.4 | GO:0034437 | glycoprotein transporter activity(GO:0034437) |
| 0.2 | 1.1 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
| 0.2 | 1.6 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.2 | 0.7 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.2 | 4.7 | GO:0001163 | RNA polymerase I regulatory region DNA binding(GO:0001013) RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
| 0.2 | 0.9 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.2 | 0.9 | GO:0009383 | rRNA (cytosine-C5-)-methyltransferase activity(GO:0009383) |
| 0.2 | 3.3 | GO:0046972 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.2 | 2.8 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.2 | 2.8 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.2 | 5.0 | GO:0005326 | neurotransmitter transporter activity(GO:0005326) |
| 0.2 | 5.2 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.2 | 0.6 | GO:0022858 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
| 0.2 | 0.6 | GO:0036317 | tyrosyl-RNA phosphodiesterase activity(GO:0036317) 5'-tyrosyl-DNA phosphodiesterase activity(GO:0070260) |
| 0.2 | 1.5 | GO:0042978 | ornithine decarboxylase activator activity(GO:0042978) |
| 0.2 | 1.5 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.2 | 1.1 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
| 0.2 | 0.6 | GO:0008808 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) CDP-diacylglycerol-phosphatidylglycerol phosphatidyltransferase activity(GO:0043337) |
| 0.2 | 1.9 | GO:0004630 | phospholipase D activity(GO:0004630) |
| 0.2 | 3.8 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.2 | 0.6 | GO:0047256 | beta-galactosyl-N-acetylglucosaminylgalactosylglucosyl-ceramide beta-1,3-acetylglucosaminyltransferase activity(GO:0008457) lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase activity(GO:0047256) |
| 0.2 | 1.0 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
| 0.2 | 0.4 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.2 | 0.6 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
| 0.2 | 8.8 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.2 | 1.2 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.2 | 0.8 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
| 0.2 | 6.3 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
| 0.2 | 1.4 | GO:0030911 | TPR domain binding(GO:0030911) |
| 0.2 | 2.2 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.2 | 0.8 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
| 0.2 | 3.2 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.2 | 0.8 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.2 | 1.0 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.2 | 1.2 | GO:0047685 | amine sulfotransferase activity(GO:0047685) |
| 0.2 | 1.6 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.2 | 1.6 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
| 0.2 | 0.8 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
| 0.2 | 1.8 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.2 | 0.8 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.2 | 0.6 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.2 | 1.2 | GO:0032813 | tumor necrosis factor receptor binding(GO:0005164) tumor necrosis factor receptor superfamily binding(GO:0032813) |
| 0.2 | 0.6 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.2 | 0.8 | GO:0004727 | prenylated protein tyrosine phosphatase activity(GO:0004727) |
| 0.2 | 1.9 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
| 0.2 | 1.2 | GO:0045569 | TRAIL binding(GO:0045569) |
| 0.2 | 1.3 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.2 | 0.4 | GO:0008410 | CoA-transferase activity(GO:0008410) |
| 0.2 | 0.8 | GO:0016748 | succinyltransferase activity(GO:0016748) |
| 0.2 | 1.9 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
| 0.2 | 1.7 | GO:0070739 | protein-glutamic acid ligase activity(GO:0070739) |
| 0.2 | 1.9 | GO:0019211 | phosphatase activator activity(GO:0019211) |
| 0.2 | 0.6 | GO:0016212 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
| 0.2 | 0.6 | GO:0008969 | phosphohistidine phosphatase activity(GO:0008969) |
| 0.2 | 0.7 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
| 0.2 | 0.2 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
| 0.2 | 0.6 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.2 | 3.1 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.2 | 2.2 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.2 | 11.9 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.2 | 8.0 | GO:0005080 | protein kinase C binding(GO:0005080) |
| 0.2 | 5.5 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.2 | 0.9 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
| 0.2 | 0.7 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
| 0.2 | 0.9 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.2 | 0.4 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
| 0.2 | 0.2 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.2 | 0.5 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.2 | 2.9 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.2 | 17.3 | GO:0008080 | N-acetyltransferase activity(GO:0008080) |
| 0.2 | 2.7 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
| 0.2 | 2.1 | GO:0030284 | estrogen receptor activity(GO:0030284) |
| 0.2 | 1.8 | GO:0015288 | porin activity(GO:0015288) |
| 0.2 | 0.4 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.2 | 0.7 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
| 0.2 | 2.5 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.2 | 2.8 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.2 | 0.2 | GO:0019239 | deaminase activity(GO:0019239) |
| 0.2 | 5.2 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.2 | 3.4 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.2 | 0.9 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
| 0.2 | 1.7 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
| 0.2 | 1.2 | GO:0035473 | lipase binding(GO:0035473) |
| 0.2 | 6.6 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.2 | 0.5 | GO:0000035 | acyl binding(GO:0000035) |
| 0.2 | 0.7 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 0.2 | 1.8 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.2 | 9.0 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
| 0.2 | 0.5 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.2 | 4.7 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.2 | 1.1 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.2 | 0.8 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.2 | 1.1 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
| 0.2 | 0.6 | GO:1904929 | coreceptor activity involved in Wnt signaling pathway, planar cell polarity pathway(GO:1904929) |
| 0.2 | 1.0 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.2 | 0.5 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.2 | 0.5 | GO:0005459 | UDP-galactose transmembrane transporter activity(GO:0005459) |
| 0.2 | 0.6 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
| 0.2 | 1.7 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.2 | 0.8 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
| 0.2 | 0.5 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
| 0.2 | 0.5 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.2 | 0.5 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.2 | 7.7 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 0.2 | 0.5 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.2 | 0.8 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.2 | 0.3 | GO:0086020 | gap junction channel activity involved in SA node cell-atrial cardiac muscle cell electrical coupling(GO:0086020) |
| 0.2 | 0.6 | GO:0010348 | lithium:proton antiporter activity(GO:0010348) |
| 0.1 | 9.4 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.1 | 1.3 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.1 | 0.4 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
| 0.1 | 0.1 | GO:0015229 | L-ascorbate:sodium symporter activity(GO:0008520) L-ascorbic acid transporter activity(GO:0015229) sodium-dependent L-ascorbate transmembrane transporter activity(GO:0070890) |
| 0.1 | 1.2 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.1 | 0.4 | GO:0017130 | poly(C) RNA binding(GO:0017130) |
| 0.1 | 0.9 | GO:0042835 | BRE binding(GO:0042835) |
| 0.1 | 4.0 | GO:0030371 | translation repressor activity(GO:0030371) |
| 0.1 | 5.7 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.1 | 0.3 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.1 | 0.4 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.1 | 0.4 | GO:0005260 | channel-conductance-controlling ATPase activity(GO:0005260) |
| 0.1 | 2.6 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.1 | 0.6 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.1 | 0.1 | GO:0051139 | metal ion:proton antiporter activity(GO:0051139) |
| 0.1 | 0.1 | GO:0031531 | thyrotropin-releasing hormone receptor binding(GO:0031531) |
| 0.1 | 0.8 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
| 0.1 | 0.6 | GO:0001632 | leukotriene B4 receptor activity(GO:0001632) |
| 0.1 | 1.0 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) G-protein coupled glutamate receptor activity(GO:0098988) |
| 0.1 | 0.7 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.1 | 0.6 | GO:0004307 | ethanolaminephosphotransferase activity(GO:0004307) |
| 0.1 | 1.4 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
| 0.1 | 3.3 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.1 | 0.4 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.1 | 3.7 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.1 | 0.4 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
| 0.1 | 3.4 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.1 | 2.4 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.1 | 0.4 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.1 | 0.3 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.1 | 0.5 | GO:0004738 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.1 | 0.4 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
| 0.1 | 0.4 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
| 0.1 | 1.3 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.1 | 0.3 | GO:0034618 | arginine binding(GO:0034618) |
| 0.1 | 0.9 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 0.1 | 0.7 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.1 | 18.0 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.1 | 4.1 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
| 0.1 | 1.3 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.1 | 1.0 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.1 | 1.5 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.1 | 0.1 | GO:0070697 | activin receptor binding(GO:0070697) type II activin receptor binding(GO:0070699) |
| 0.1 | 16.8 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.1 | 0.1 | GO:0033149 | FFAT motif binding(GO:0033149) |
| 0.1 | 0.5 | GO:0003865 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) steroid dehydrogenase activity, acting on the CH-CH group of donors(GO:0033765) enone reductase activity(GO:0035671) cholestenone 5-alpha-reductase activity(GO:0047751) |
| 0.1 | 5.2 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 0.1 | 0.5 | GO:0004132 | dCMP deaminase activity(GO:0004132) |
| 0.1 | 0.3 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
| 0.1 | 0.6 | GO:0005152 | interleukin-1 receptor antagonist activity(GO:0005152) |
| 0.1 | 0.4 | GO:0030619 | U1 snRNA binding(GO:0030619) |
| 0.1 | 5.8 | GO:0061650 | ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
| 0.1 | 3.3 | GO:0042605 | peptide antigen binding(GO:0042605) |
| 0.1 | 0.4 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.1 | 1.1 | GO:0102337 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.1 | 5.2 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.1 | 2.4 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.1 | 0.7 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.1 | 0.4 | GO:0050571 | 1,5-anhydro-D-fructose reductase activity(GO:0050571) |
| 0.1 | 0.4 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.1 | 0.6 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
| 0.1 | 45.7 | GO:0005096 | GTPase activator activity(GO:0005096) |
| 0.1 | 0.9 | GO:0003916 | DNA topoisomerase activity(GO:0003916) DNA topoisomerase type I activity(GO:0003917) |
| 0.1 | 3.3 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.1 | 0.2 | GO:0005136 | interleukin-4 receptor binding(GO:0005136) |
| 0.1 | 0.4 | GO:0004958 | prostaglandin F receptor activity(GO:0004958) |
| 0.1 | 7.7 | GO:0002039 | p53 binding(GO:0002039) |
| 0.1 | 0.1 | GO:0001016 | RNA polymerase III regulatory region DNA binding(GO:0001016) |
| 0.1 | 0.3 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
| 0.1 | 0.8 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.1 | 0.5 | GO:0008112 | nicotinamide N-methyltransferase activity(GO:0008112) pyridine N-methyltransferase activity(GO:0030760) |
| 0.1 | 2.0 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
| 0.1 | 2.9 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
| 0.1 | 41.1 | GO:0003924 | GTPase activity(GO:0003924) |
| 0.1 | 2.0 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
| 0.1 | 0.8 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
| 0.1 | 0.2 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
| 0.1 | 1.3 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.1 | 1.1 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.1 | 2.0 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.1 | 0.8 | GO:0008048 | calcium sensitive guanylate cyclase activator activity(GO:0008048) |
| 0.1 | 0.2 | GO:0016435 | rRNA (guanine) methyltransferase activity(GO:0016435) |
| 0.1 | 0.4 | GO:0001855 | complement component C4b binding(GO:0001855) |
| 0.1 | 0.4 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.1 | 0.4 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.1 | 0.1 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
| 0.1 | 1.9 | GO:0016638 | oxidoreductase activity, acting on the CH-NH2 group of donors(GO:0016638) |
| 0.1 | 0.4 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.1 | 0.2 | GO:0061628 | H3K27me3 modified histone binding(GO:0061628) |
| 0.1 | 0.1 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
| 0.1 | 1.4 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.1 | 0.4 | GO:0030197 | extracellular matrix constituent, lubricant activity(GO:0030197) |
| 0.1 | 0.3 | GO:0008386 | cholesterol monooxygenase (side-chain-cleaving) activity(GO:0008386) |
| 0.1 | 0.1 | GO:0004661 | protein geranylgeranyltransferase activity(GO:0004661) |
| 0.1 | 0.2 | GO:0032296 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
| 0.1 | 0.6 | GO:0045029 | UDP-activated nucleotide receptor activity(GO:0045029) |
| 0.1 | 3.8 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.1 | 2.0 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.1 | 1.3 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.1 | 1.4 | GO:0070513 | death domain binding(GO:0070513) |
| 0.1 | 15.1 | GO:0004386 | helicase activity(GO:0004386) |
| 0.1 | 3.5 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
| 0.1 | 1.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.1 | 0.3 | GO:0004992 | platelet activating factor receptor activity(GO:0004992) |
| 0.1 | 0.4 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.1 | 0.3 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.1 | 0.3 | GO:0005471 | ATP:ADP antiporter activity(GO:0005471) adenine transmembrane transporter activity(GO:0015207) |
| 0.1 | 1.3 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
| 0.1 | 0.6 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
| 0.1 | 1.7 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
| 0.1 | 0.3 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.1 | 0.3 | GO:0050254 | rhodopsin kinase activity(GO:0050254) |
| 0.1 | 10.1 | GO:0017137 | Rab GTPase binding(GO:0017137) |
| 0.1 | 1.1 | GO:0030553 | cGMP binding(GO:0030553) |
| 0.1 | 3.2 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.1 | 2.9 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.1 | 0.4 | GO:0047066 | phospholipid-hydroperoxide glutathione peroxidase activity(GO:0047066) |
| 0.1 | 0.7 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.1 | 0.2 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.1 | 0.7 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
| 0.1 | 0.4 | GO:0032408 | MutLbeta complex binding(GO:0032406) MutSbeta complex binding(GO:0032408) |
| 0.1 | 2.4 | GO:0042165 | neurotransmitter binding(GO:0042165) |
| 0.1 | 0.2 | GO:0003968 | RNA-directed RNA polymerase activity(GO:0003968) |
| 0.1 | 0.4 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
| 0.1 | 0.2 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.1 | 0.6 | GO:0010181 | FMN binding(GO:0010181) |
| 0.1 | 0.1 | GO:0002060 | purine nucleobase binding(GO:0002060) |
| 0.1 | 0.7 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.1 | 0.9 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.1 | 1.5 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.1 | 1.2 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.1 | 17.7 | GO:0005125 | cytokine activity(GO:0005125) |
| 0.1 | 0.4 | GO:0033981 | D-dopachrome decarboxylase activity(GO:0033981) |
| 0.1 | 3.0 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.1 | 0.4 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.1 | 0.3 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.1 | 2.5 | GO:0019707 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.1 | 0.1 | GO:0008556 | potassium-transporting ATPase activity(GO:0008556) |
| 0.1 | 0.3 | GO:0008281 | sulfonylurea receptor activity(GO:0008281) |
| 0.1 | 0.8 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.1 | 4.6 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
| 0.1 | 0.2 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.1 | 0.5 | GO:0003951 | NAD+ kinase activity(GO:0003951) |
| 0.1 | 0.2 | GO:1904315 | neurotransmitter receptor activity involved in regulation of postsynaptic membrane potential(GO:0099529) transmitter-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1904315) |
| 0.1 | 0.3 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
| 0.1 | 0.6 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.1 | 2.1 | GO:0004114 | 3',5'-cyclic-nucleotide phosphodiesterase activity(GO:0004114) |
| 0.1 | 0.3 | GO:0004996 | thyroid-stimulating hormone receptor activity(GO:0004996) |
| 0.1 | 0.5 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
| 0.1 | 0.3 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.1 | 0.3 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
| 0.1 | 1.3 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.1 | 0.6 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.1 | 1.0 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.1 | 0.2 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.1 | 0.2 | GO:0030226 | apolipoprotein receptor activity(GO:0030226) |
| 0.1 | 0.4 | GO:0070728 | leucine binding(GO:0070728) |
| 0.1 | 0.3 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.1 | 0.5 | GO:0003696 | satellite DNA binding(GO:0003696) |
| 0.1 | 6.0 | GO:0005518 | collagen binding(GO:0005518) |
| 0.1 | 0.2 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
| 0.1 | 0.3 | GO:0051916 | granulocyte colony-stimulating factor binding(GO:0051916) |
| 0.1 | 0.2 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.1 | 0.3 | GO:0036080 | GDP-fucose transmembrane transporter activity(GO:0005457) purine nucleotide-sugar transmembrane transporter activity(GO:0036080) |
| 0.1 | 0.1 | GO:0016433 | rRNA (adenine) methyltransferase activity(GO:0016433) |
| 0.1 | 1.6 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.1 | 0.8 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.1 | 0.5 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.1 | 0.4 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.1 | 0.4 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.1 | 0.2 | GO:0004951 | cholecystokinin receptor activity(GO:0004951) |
| 0.1 | 0.1 | GO:0097604 | temperature-gated cation channel activity(GO:0097604) |
| 0.1 | 0.4 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.1 | 4.1 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.1 | 0.2 | GO:0034038 | deoxyhypusine synthase activity(GO:0034038) |
| 0.1 | 0.3 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.1 | 0.6 | GO:0030020 | extracellular matrix structural constituent conferring tensile strength(GO:0030020) |
| 0.1 | 2.7 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.1 | 0.1 | GO:0015925 | galactosidase activity(GO:0015925) |
| 0.1 | 0.6 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.1 | 0.1 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.1 | 2.0 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.1 | 1.1 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.1 | 0.3 | GO:0048256 | flap endonuclease activity(GO:0048256) |
| 0.1 | 0.3 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.1 | 0.1 | GO:0005462 | UDP-N-acetylglucosamine transmembrane transporter activity(GO:0005462) |
| 0.1 | 1.6 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
| 0.1 | 1.1 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.1 | 1.7 | GO:0070412 | R-SMAD binding(GO:0070412) |
| 0.1 | 0.2 | GO:0098625 | methylselenol reductase activity(GO:0098625) methylseleninic acid reductase activity(GO:0098626) |
| 0.1 | 0.3 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.1 | 0.7 | GO:0032183 | SUMO binding(GO:0032183) |
| 0.1 | 0.6 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
| 0.1 | 0.1 | GO:0001147 | transcription termination site sequence-specific DNA binding(GO:0001147) transcription termination site DNA binding(GO:0001160) |
| 0.1 | 0.8 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.1 | 0.2 | GO:0035514 | DNA demethylase activity(GO:0035514) DNA-N1-methyladenine dioxygenase activity(GO:0043734) |
| 0.1 | 0.3 | GO:0005017 | platelet-derived growth factor-activated receptor activity(GO:0005017) |
| 0.1 | 0.1 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.1 | 0.7 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.1 | 0.2 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.1 | 0.2 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.1 | 0.2 | GO:0005026 | transforming growth factor beta receptor activity, type II(GO:0005026) |
| 0.1 | 0.2 | GO:0008336 | gamma-butyrobetaine dioxygenase activity(GO:0008336) |
| 0.1 | 0.2 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.1 | 0.4 | GO:0030614 | oxidoreductase activity, acting on a sulfur group of donors, quinone or similar compound as acceptor(GO:0016672) oxidoreductase activity, acting on phosphorus or arsenic in donors(GO:0030613) oxidoreductase activity, acting on phosphorus or arsenic in donors, disulfide as acceptor(GO:0030614) glutathione dehydrogenase (ascorbate) activity(GO:0045174) methylarsonate reductase activity(GO:0050610) |
| 0.1 | 0.2 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.1 | 2.0 | GO:0030695 | GTPase regulator activity(GO:0030695) |
| 0.1 | 1.7 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.1 | 0.1 | GO:0008177 | succinate dehydrogenase (ubiquinone) activity(GO:0008177) |
| 0.1 | 9.9 | GO:0042393 | histone binding(GO:0042393) |
| 0.1 | 0.4 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.1 | 0.9 | GO:0008061 | chitin binding(GO:0008061) |
| 0.1 | 0.7 | GO:0031543 | peptidyl-proline dioxygenase activity(GO:0031543) |
| 0.1 | 0.3 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) |
| 0.1 | 0.3 | GO:0047237 | glucuronylgalactosylproteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047237) |
| 0.1 | 0.3 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.1 | 0.2 | GO:0004507 | steroid 11-beta-monooxygenase activity(GO:0004507) corticosterone 18-monooxygenase activity(GO:0047783) |
| 0.1 | 0.3 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.1 | 0.2 | GO:0034353 | RNA pyrophosphohydrolase activity(GO:0034353) |
| 0.1 | 0.2 | GO:0015361 | low-affinity sodium:dicarboxylate symporter activity(GO:0015361) |
| 0.1 | 0.2 | GO:0046997 | oxidoreductase activity, acting on the CH-NH group of donors, flavin as acceptor(GO:0046997) |
| 0.1 | 0.9 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 0.1 | 0.2 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
| 0.1 | 0.4 | GO:0015119 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.1 | 0.7 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.1 | 0.2 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.1 | 0.2 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.0 | 0.4 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.0 | 0.1 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.0 | 0.1 | GO:0070363 | mitochondrial light strand promoter sense binding(GO:0070363) |
| 0.0 | 0.7 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
| 0.0 | 0.9 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.0 | 0.0 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
| 0.0 | 0.5 | GO:0008517 | folic acid transporter activity(GO:0008517) |
| 0.0 | 0.4 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.0 | 0.2 | GO:0047374 | methylumbelliferyl-acetate deacetylase activity(GO:0047374) |
| 0.0 | 0.0 | GO:0098847 | sequence-specific single stranded DNA binding(GO:0098847) |
| 0.0 | 0.8 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
| 0.0 | 0.5 | GO:0001851 | complement component C3b binding(GO:0001851) |
| 0.0 | 0.8 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.0 | 0.3 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
| 0.0 | 6.7 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
| 0.0 | 0.1 | GO:0004794 | L-threonine ammonia-lyase activity(GO:0004794) |
| 0.0 | 0.1 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
| 0.0 | 0.7 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
| 0.0 | 0.4 | GO:0000146 | microfilament motor activity(GO:0000146) |
| 0.0 | 0.2 | GO:0060422 | peptidyl-dipeptidase inhibitor activity(GO:0060422) |
| 0.0 | 0.2 | GO:0060175 | brain-derived neurotrophic factor-activated receptor activity(GO:0060175) |
| 0.0 | 0.2 | GO:0099583 | postsynaptic neurotransmitter receptor activity(GO:0098960) neurotransmitter receptor activity involved in regulation of postsynaptic cytosolic calcium ion concentration(GO:0099583) |
| 0.0 | 0.2 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.0 | 0.1 | GO:0004603 | phenylethanolamine N-methyltransferase activity(GO:0004603) |
| 0.0 | 0.2 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.0 | 0.1 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.0 | 0.2 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.0 | 0.1 | GO:0003943 | N-acetylgalactosamine-4-sulfatase activity(GO:0003943) |
| 0.0 | 0.3 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.0 | 0.2 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
| 0.0 | 0.2 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
| 0.0 | 1.2 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
| 0.0 | 0.0 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
| 0.0 | 0.1 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.0 | 6.4 | GO:0001047 | core promoter binding(GO:0001047) |
| 0.0 | 1.9 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.0 | GO:0030250 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
| 0.0 | 0.7 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.0 | 1.7 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
| 0.0 | 0.1 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.0 | 0.9 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
| 0.0 | 0.1 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
| 0.0 | 0.3 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
| 0.0 | 0.2 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
| 0.0 | 0.3 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
| 0.0 | 0.2 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
| 0.0 | 0.2 | GO:0017161 | phosphatidylinositol-3,4-bisphosphate 4-phosphatase activity(GO:0016316) inositol-1,3,4-trisphosphate 4-phosphatase activity(GO:0017161) inositol-3,4-bisphosphate 4-phosphatase activity(GO:0052828) |
| 0.0 | 1.4 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
| 0.0 | 0.2 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.0 | 0.5 | GO:0043295 | glutathione binding(GO:0043295) |
| 0.0 | 0.2 | GO:0050682 | AF-2 domain binding(GO:0050682) |
| 0.0 | 0.2 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 0.0 | 0.4 | GO:0019215 | intermediate filament binding(GO:0019215) |
| 0.0 | 0.3 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
| 0.0 | 0.1 | GO:0016426 | tRNA (adenine) methyltransferase activity(GO:0016426) tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
| 0.0 | 0.2 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.0 | 0.8 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.0 | 0.2 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.0 | 0.3 | GO:0004673 | phosphorelay sensor kinase activity(GO:0000155) protein histidine kinase activity(GO:0004673) |
| 0.0 | 0.3 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.0 | 0.2 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.0 | 0.1 | GO:0004963 | follicle-stimulating hormone receptor activity(GO:0004963) |
| 0.0 | 0.2 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.0 | 0.1 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.0 | 0.1 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.0 | 0.0 | GO:0044388 | small protein activating enzyme binding(GO:0044388) |
| 0.0 | 0.0 | GO:0004618 | phosphoglycerate kinase activity(GO:0004618) |
| 0.0 | 0.1 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
| 0.0 | 0.0 | GO:0008426 | protein kinase C inhibitor activity(GO:0008426) |
| 0.0 | 0.3 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.0 | 0.5 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.3 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.0 | 0.1 | GO:0022848 | acetylcholine-gated cation channel activity(GO:0022848) |
| 0.0 | 2.1 | GO:0051087 | chaperone binding(GO:0051087) |
| 0.0 | 1.7 | GO:0016209 | antioxidant activity(GO:0016209) |
| 0.0 | 0.1 | GO:0015117 | thiosulfate transmembrane transporter activity(GO:0015117) oxaloacetate transmembrane transporter activity(GO:0015131) |
| 0.0 | 0.2 | GO:0016814 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amidines(GO:0016814) |
| 0.0 | 1.2 | GO:0032182 | ubiquitin-like protein binding(GO:0032182) |
| 0.0 | 6.5 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.0 | 0.1 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.0 | 0.1 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
| 0.0 | 0.1 | GO:0003960 | NADPH:quinone reductase activity(GO:0003960) |
| 0.0 | 0.1 | GO:0031862 | prostanoid receptor binding(GO:0031862) |
| 0.0 | 0.1 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.3 | GO:0030515 | snoRNA binding(GO:0030515) |
| 0.0 | 33.0 | GO:0003723 | RNA binding(GO:0003723) |
| 0.0 | 0.1 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
| 0.0 | 0.1 | GO:0033695 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
| 0.0 | 0.1 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
| 0.0 | 0.1 | GO:0019003 | GDP binding(GO:0019003) |
| 0.0 | 0.5 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.0 | 0.0 | GO:0030109 | HLA-B specific inhibitory MHC class I receptor activity(GO:0030109) |
| 0.0 | 0.2 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
| 0.0 | 0.3 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.0 | 0.1 | GO:0052590 | sn-glycerol-3-phosphate:ubiquinone oxidoreductase activity(GO:0052590) sn-glycerol-3-phosphate:ubiquinone-8 oxidoreductase activity(GO:0052591) |
| 0.0 | 0.1 | GO:0032450 | alpha-1,4-glucosidase activity(GO:0004558) maltose alpha-glucosidase activity(GO:0032450) |
| 0.0 | 0.5 | GO:0005234 | extracellular-glutamate-gated ion channel activity(GO:0005234) |
| 0.0 | 0.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.0 | 0.0 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.0 | 0.1 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.1 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
| 0.0 | 0.1 | GO:0050694 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.0 | 0.2 | GO:0031432 | titin binding(GO:0031432) |
| 0.0 | 0.1 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.0 | 0.1 | GO:0023025 | MHC class Ib protein complex binding(GO:0023025) MHC class Ib protein binding, via antigen binding groove(GO:0023030) |
| 0.0 | 0.1 | GO:0008175 | tRNA methyltransferase activity(GO:0008175) |
| 0.0 | 0.2 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.0 | 0.0 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
| 0.0 | 0.0 | GO:0019862 | IgA binding(GO:0019862) |
| 0.0 | 0.2 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.0 | 0.1 | GO:0030548 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
Gene overrepresentation in curated gene sets: canonical pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.9 | 4.3 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.7 | 44.0 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.6 | 0.6 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.6 | 20.6 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.6 | 0.6 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.6 | 8.0 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.6 | 6.1 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
| 0.5 | 9.9 | ST GAQ PATHWAY | G alpha q Pathway |
| 0.5 | 4.2 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.5 | 7.4 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.4 | 16.9 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
| 0.4 | 2.6 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.4 | 1.6 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.4 | 5.3 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.4 | 18.8 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.4 | 5.5 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.4 | 0.7 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
| 0.4 | 1.8 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.4 | 2.5 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.3 | 4.9 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.3 | 18.9 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.3 | 8.0 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.3 | 11.9 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.3 | 7.8 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.3 | 32.6 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.3 | 1.2 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.3 | 1.5 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.3 | 8.8 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.3 | 2.0 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.3 | 5.8 | PID MYC PATHWAY | C-MYC pathway |
| 0.3 | 10.3 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.3 | 16.4 | PID FOXO PATHWAY | FoxO family signaling |
| 0.3 | 0.5 | PID S1P S1P2 PATHWAY | S1P2 pathway |
| 0.3 | 1.5 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
| 0.3 | 4.0 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.3 | 4.5 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.2 | 9.7 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.2 | 1.0 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.2 | 12.5 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.2 | 16.5 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.2 | 5.6 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.2 | 1.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.2 | 15.8 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.2 | 13.2 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.2 | 6.8 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.2 | 5.2 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.2 | 9.7 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.2 | 0.8 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.2 | 4.3 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.2 | 3.8 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.2 | 3.8 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.2 | 11.4 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.2 | 16.4 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
| 0.2 | 9.9 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.2 | 0.7 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.2 | 3.2 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.2 | 8.0 | PID RAS PATHWAY | Regulation of Ras family activation |
| 0.2 | 0.7 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.2 | 6.3 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.2 | 3.0 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.2 | 7.6 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.2 | 3.3 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.2 | 1.3 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.2 | 4.9 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.2 | 2.7 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.2 | 1.6 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.2 | 1.8 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.2 | 22.4 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
| 0.1 | 4.6 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.1 | 3.0 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.1 | 0.6 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.1 | 2.3 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.1 | 0.2 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.1 | 6.2 | PID P73PATHWAY | p73 transcription factor network |
| 0.1 | 4.7 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.1 | 2.1 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
| 0.1 | 5.5 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.1 | 0.2 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.1 | 2.9 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.1 | 2.5 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.1 | 4.6 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.1 | 5.0 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.1 | 22.5 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.1 | 0.1 | ST ADRENERGIC | Adrenergic Pathway |
| 0.1 | 0.6 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.1 | 3.5 | PID ATR PATHWAY | ATR signaling pathway |
| 0.1 | 2.7 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.1 | 1.7 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
| 0.1 | 0.9 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.1 | 5.4 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.1 | 0.7 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
| 0.1 | 2.9 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.1 | 0.7 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.1 | 2.1 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.1 | 0.5 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.1 | 0.1 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.1 | 4.4 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
| 0.1 | 3.9 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.1 | 1.2 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| 0.1 | 0.2 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.1 | 0.5 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.1 | 1.6 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.1 | 2.2 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.1 | 0.7 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.1 | 1.3 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
| 0.1 | 0.1 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.1 | 3.9 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.1 | 0.1 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.0 | 1.8 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.0 | 0.2 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
| 0.0 | 16.8 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
| 0.0 | 1.7 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.0 | 9.7 | NABA MATRISOME ASSOCIATED | Ensemble of genes encoding ECM-associated proteins including ECM-affilaited proteins, ECM regulators and secreted factors |
| 0.0 | 0.3 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.0 | 0.9 | PID CDC42 PATHWAY | CDC42 signaling events |
| 0.0 | 0.3 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
| 0.0 | 1.6 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.0 | 1.1 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 0.1 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.0 | 0.1 | PID IL3 PATHWAY | IL3-mediated signaling events |
Gene overrepresentation in curated gene sets: REACTOME pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.0 | 15.5 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.7 | 7.4 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.7 | 7.9 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.7 | 11.7 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
| 0.7 | 2.1 | REACTOME P75NTR SIGNALS VIA NFKB | Genes involved in p75NTR signals via NF-kB |
| 0.6 | 19.1 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.6 | 4.7 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.6 | 47.6 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
| 0.6 | 0.6 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.6 | 1.7 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 0.6 | 24.8 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
| 0.5 | 14.0 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.5 | 7.3 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.5 | 27.1 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 0.5 | 9.9 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.5 | 3.7 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.4 | 12.0 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.4 | 11.0 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
| 0.4 | 16.2 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
| 0.4 | 11.8 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.4 | 19.8 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.4 | 28.3 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
| 0.4 | 4.3 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.4 | 3.9 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.4 | 4.5 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 0.4 | 14.9 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.4 | 19.3 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.3 | 3.7 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.3 | 7.1 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.3 | 1.9 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.3 | 12.3 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.3 | 15.9 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.3 | 3.7 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
| 0.3 | 11.3 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 0.3 | 9.5 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.3 | 0.6 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.3 | 17.0 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.3 | 5.3 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.3 | 8.0 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.3 | 11.8 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.3 | 6.6 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.3 | 7.6 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.2 | 2.2 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.2 | 6.6 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.2 | 8.7 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.2 | 6.3 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
| 0.2 | 2.0 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
| 0.2 | 3.8 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.2 | 4.0 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.2 | 2.1 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.2 | 1.1 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
| 0.2 | 0.8 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
| 0.2 | 5.5 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
| 0.2 | 1.5 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.2 | 3.3 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.2 | 6.0 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.2 | 14.0 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.2 | 5.3 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.2 | 0.2 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.2 | 2.3 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
| 0.2 | 7.2 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
| 0.2 | 0.7 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.2 | 4.0 | REACTOME RIG I MDA5 MEDIATED INDUCTION OF IFN ALPHA BETA PATHWAYS | Genes involved in RIG-I/MDA5 mediated induction of IFN-alpha/beta pathways |
| 0.2 | 0.7 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
| 0.2 | 3.7 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.2 | 2.0 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.2 | 0.9 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.2 | 0.5 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
| 0.2 | 1.4 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 0.2 | 3.3 | REACTOME PROCESSIVE SYNTHESIS ON THE LAGGING STRAND | Genes involved in Processive synthesis on the lagging strand |
| 0.2 | 0.3 | REACTOME CELL CELL COMMUNICATION | Genes involved in Cell-Cell communication |
| 0.2 | 11.4 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
| 0.2 | 1.0 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.2 | 2.2 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.2 | 1.8 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.2 | 11.2 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.2 | 3.8 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.2 | 2.5 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.2 | 16.4 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 0.2 | 0.5 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
| 0.2 | 0.2 | REACTOME NEF MEDIATES DOWN MODULATION OF CELL SURFACE RECEPTORS BY RECRUITING THEM TO CLATHRIN ADAPTERS | Genes involved in Nef-mediates down modulation of cell surface receptors by recruiting them to clathrin adapters |
| 0.2 | 6.7 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.2 | 0.6 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
| 0.2 | 3.9 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.2 | 1.1 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
| 0.1 | 1.5 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.1 | 7.1 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
| 0.1 | 1.2 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.1 | 4.8 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.1 | 3.9 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.1 | 1.1 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.1 | 8.9 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.1 | 1.6 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.1 | 2.6 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.1 | 2.3 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.1 | 4.6 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.1 | 2.5 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.1 | 0.6 | REACTOME INHIBITION OF THE PROTEOLYTIC ACTIVITY OF APC C REQUIRED FOR THE ONSET OF ANAPHASE BY MITOTIC SPINDLE CHECKPOINT COMPONENTS | Genes involved in Inhibition of the proteolytic activity of APC/C required for the onset of anaphase by mitotic spindle checkpoint components |
| 0.1 | 25.2 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.1 | 3.7 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.1 | 7.5 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
| 0.1 | 1.6 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.1 | 4.3 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
| 0.1 | 0.1 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.1 | 2.7 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
| 0.1 | 3.3 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
| 0.1 | 9.9 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.1 | 0.2 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
| 0.1 | 15.3 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.1 | 2.8 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
| 0.1 | 1.1 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
| 0.1 | 3.7 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
| 0.1 | 9.8 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
| 0.1 | 0.4 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
| 0.1 | 4.5 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
| 0.1 | 1.7 | REACTOME REVERSIBLE HYDRATION OF CARBON DIOXIDE | Genes involved in Reversible Hydration of Carbon Dioxide |
| 0.1 | 3.2 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
| 0.1 | 1.5 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.1 | 0.5 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
| 0.1 | 0.8 | REACTOME REGULATION OF INSULIN SECRETION | Genes involved in Regulation of Insulin Secretion |
| 0.1 | 6.2 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.1 | 11.5 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
| 0.1 | 2.6 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.1 | 2.5 | REACTOME INTERFERON SIGNALING | Genes involved in Interferon Signaling |
| 0.1 | 1.8 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.1 | 1.1 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
| 0.1 | 0.7 | REACTOME IL 3 5 AND GM CSF SIGNALING | Genes involved in Interleukin-3, 5 and GM-CSF signaling |
| 0.1 | 1.6 | REACTOME PEPTIDE HORMONE BIOSYNTHESIS | Genes involved in Peptide hormone biosynthesis |
| 0.1 | 1.1 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.1 | 0.5 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.1 | 5.2 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.1 | 6.9 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
| 0.1 | 0.7 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.1 | 0.1 | REACTOME SCFSKP2 MEDIATED DEGRADATION OF P27 P21 | Genes involved in SCF(Skp2)-mediated degradation of p27/p21 |
| 0.1 | 1.9 | REACTOME DEADENYLATION DEPENDENT MRNA DECAY | Genes involved in Deadenylation-dependent mRNA decay |
| 0.1 | 0.9 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 0.1 | 2.1 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.1 | 0.8 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.1 | 1.8 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
| 0.1 | 10.1 | REACTOME G ALPHA Q SIGNALLING EVENTS | Genes involved in G alpha (q) signalling events |
| 0.1 | 1.0 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.1 | 1.2 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.1 | 4.5 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
| 0.1 | 1.0 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.1 | 1.0 | REACTOME EARLY PHASE OF HIV LIFE CYCLE | Genes involved in Early Phase of HIV Life Cycle |
| 0.1 | 0.4 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.1 | 0.9 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.1 | 1.4 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.1 | 0.8 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.1 | 1.3 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.1 | 0.4 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.1 | 1.2 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.1 | 3.7 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.0 | 0.4 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.0 | 3.0 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 0.9 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.0 | 0.1 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
| 0.0 | 1.0 | REACTOME CHONDROITIN SULFATE DERMATAN SULFATE METABOLISM | Genes involved in Chondroitin sulfate/dermatan sulfate metabolism |
| 0.0 | 0.8 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
| 0.0 | 0.4 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.0 | 0.5 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.0 | 0.2 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
| 0.0 | 0.1 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.0 | 0.5 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.0 | 0.0 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |
| 0.0 | 0.2 | REACTOME CHROMOSOME MAINTENANCE | Genes involved in Chromosome Maintenance |
| 0.0 | 1.0 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.0 | 0.4 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.0 | 0.6 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.0 | 0.2 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
| 0.0 | 0.1 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.0 | 0.1 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
| 0.0 | 0.1 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
| 0.0 | 3.1 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.0 | 0.2 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.0 | 0.2 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.0 | 0.1 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.0 | 0.0 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |