Inflammatory response time course, HUVEC (Wada et al., 2009)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
TAL1
|
ENSG00000162367.7 | TAL bHLH transcription factor 1, erythroid differentiation factor |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| TAL1 | hg19_v2_chr1_-_47697387_47697457 | -0.42 | 3.5e-02 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr12_+_113344755 | 2.36 |
ENST00000550883.1
|
OAS1
|
2'-5'-oligoadenylate synthetase 1, 40/46kDa |
| chr12_-_56236734 | 2.15 |
ENST00000548629.1
|
MMP19
|
matrix metallopeptidase 19 |
| chr2_-_7005785 | 1.91 |
ENST00000256722.5
ENST00000404168.1 ENST00000458098.1 |
CMPK2
|
cytidine monophosphate (UMP-CMP) kinase 2, mitochondrial |
| chr17_-_39306054 | 1.90 |
ENST00000343246.4
|
KRTAP4-5
|
keratin associated protein 4-5 |
| chr1_-_8000872 | 1.76 |
ENST00000377507.3
|
TNFRSF9
|
tumor necrosis factor receptor superfamily, member 9 |
| chr17_-_39280419 | 1.73 |
ENST00000394014.1
|
KRTAP4-12
|
keratin associated protein 4-12 |
| chr21_+_42798094 | 1.72 |
ENST00000398598.3
ENST00000455164.2 ENST00000424365.1 |
MX1
|
myxovirus (influenza virus) resistance 1, interferon-inducible protein p78 (mouse) |
| chr2_-_202562774 | 1.72 |
ENST00000396886.3
ENST00000409143.1 |
MPP4
|
membrane protein, palmitoylated 4 (MAGUK p55 subfamily member 4) |
| chr3_-_127455200 | 1.68 |
ENST00000398101.3
|
MGLL
|
monoglyceride lipase |
| chr15_+_84908573 | 1.66 |
ENST00000424966.1
ENST00000422563.2 |
GOLGA6L4
|
golgin A6 family-like 4 |
| chr15_+_89182156 | 1.62 |
ENST00000379224.5
|
ISG20
|
interferon stimulated exonuclease gene 20kDa |
| chr11_-_102668879 | 1.61 |
ENST00000315274.6
|
MMP1
|
matrix metallopeptidase 1 (interstitial collagenase) |
| chr12_+_117348742 | 1.56 |
ENST00000309909.5
ENST00000455858.2 |
FBXW8
|
F-box and WD repeat domain containing 8 |
| chr17_-_34207295 | 1.46 |
ENST00000463941.1
ENST00000293272.3 |
CCL5
|
chemokine (C-C motif) ligand 5 |
| chr4_-_80994210 | 1.44 |
ENST00000403729.2
|
ANTXR2
|
anthrax toxin receptor 2 |
| chr7_-_108096765 | 1.42 |
ENST00000379024.4
ENST00000351718.4 |
NRCAM
|
neuronal cell adhesion molecule |
| chr17_+_39388700 | 1.36 |
ENST00000411528.2
|
KRTAP9-3
|
keratin associated protein 9-3 |
| chr10_+_91152303 | 1.36 |
ENST00000371804.3
|
IFIT1
|
interferon-induced protein with tetratricopeptide repeats 1 |
| chr15_+_89181974 | 1.36 |
ENST00000306072.5
|
ISG20
|
interferon stimulated exonuclease gene 20kDa |
| chr12_-_56236690 | 1.31 |
ENST00000322569.4
|
MMP19
|
matrix metallopeptidase 19 |
| chr15_+_89182178 | 1.29 |
ENST00000559876.1
|
ISG20
|
interferon stimulated exonuclease gene 20kDa |
| chr12_+_113344582 | 1.26 |
ENST00000202917.5
ENST00000445409.2 ENST00000452357.2 |
OAS1
|
2'-5'-oligoadenylate synthetase 1, 40/46kDa |
| chr2_-_202562716 | 1.26 |
ENST00000428900.2
|
MPP4
|
membrane protein, palmitoylated 4 (MAGUK p55 subfamily member 4) |
| chr7_-_108096822 | 1.24 |
ENST00000379028.3
ENST00000413765.2 ENST00000379022.4 |
NRCAM
|
neuronal cell adhesion molecule |
| chr12_+_113416191 | 1.22 |
ENST00000342315.4
ENST00000392583.2 |
OAS2
|
2'-5'-oligoadenylate synthetase 2, 69/71kDa |
| chr17_-_39296739 | 1.20 |
ENST00000345847.4
|
KRTAP4-6
|
keratin associated protein 4-6 |
| chr17_-_77925806 | 1.19 |
ENST00000574241.2
|
TBC1D16
|
TBC1 domain family, member 16 |
| chrX_+_46937745 | 1.19 |
ENST00000397180.1
ENST00000457380.1 ENST00000352078.4 |
RGN
|
regucalcin |
| chr2_+_47168313 | 1.18 |
ENST00000319190.5
ENST00000394850.2 ENST00000536057.1 |
TTC7A
|
tetratricopeptide repeat domain 7A |
| chr5_+_135364584 | 1.14 |
ENST00000442011.2
ENST00000305126.8 |
TGFBI
|
transforming growth factor, beta-induced, 68kDa |
| chr6_+_31554636 | 1.10 |
ENST00000433492.1
|
LST1
|
leukocyte specific transcript 1 |
| chr13_-_33859819 | 1.10 |
ENST00000336934.5
|
STARD13
|
StAR-related lipid transfer (START) domain containing 13 |
| chr1_+_65613217 | 1.10 |
ENST00000545314.1
|
AK4
|
adenylate kinase 4 |
| chr9_-_100881466 | 1.09 |
ENST00000341469.2
ENST00000342043.3 ENST00000375098.3 |
TRIM14
|
tripartite motif containing 14 |
| chr4_+_48018781 | 1.09 |
ENST00000295461.5
|
NIPAL1
|
NIPA-like domain containing 1 |
| chr6_+_31554779 | 1.08 |
ENST00000376090.2
|
LST1
|
leukocyte specific transcript 1 |
| chr1_-_201438282 | 1.08 |
ENST00000367311.3
ENST00000367309.1 |
PHLDA3
|
pleckstrin homology-like domain, family A, member 3 |
| chr12_+_113354341 | 1.08 |
ENST00000553152.1
|
OAS1
|
2'-5'-oligoadenylate synthetase 1, 40/46kDa |
| chr6_+_31554826 | 1.07 |
ENST00000376089.2
ENST00000396112.2 |
LST1
|
leukocyte specific transcript 1 |
| chr4_+_89299885 | 1.06 |
ENST00000380265.5
ENST00000273960.3 |
HERC6
|
HECT and RLD domain containing E3 ubiquitin protein ligase family member 6 |
| chr11_+_44587141 | 1.05 |
ENST00000227155.4
ENST00000342935.3 ENST00000532544.1 |
CD82
|
CD82 molecule |
| chr1_-_151778630 | 1.04 |
ENST00000368820.3
|
LINGO4
|
leucine rich repeat and Ig domain containing 4 |
| chr19_+_35521616 | 1.01 |
ENST00000595652.1
|
SCN1B
|
sodium channel, voltage-gated, type I, beta subunit |
| chr17_-_7991021 | 1.01 |
ENST00000319144.4
|
ALOX12B
|
arachidonate 12-lipoxygenase, 12R type |
| chr19_-_43690674 | 1.01 |
ENST00000342951.6
ENST00000366175.3 |
PSG5
|
pregnancy specific beta-1-glycoprotein 5 |
| chr11_+_69455855 | 1.00 |
ENST00000227507.2
ENST00000536559.1 |
CCND1
|
cyclin D1 |
| chr11_-_72385437 | 1.00 |
ENST00000418754.2
ENST00000542969.2 ENST00000334456.5 |
PDE2A
|
phosphodiesterase 2A, cGMP-stimulated |
| chr1_+_158985457 | 0.96 |
ENST00000567661.1
ENST00000474473.1 |
IFI16
|
interferon, gamma-inducible protein 16 |
| chr19_+_18496957 | 0.95 |
ENST00000252809.3
|
GDF15
|
growth differentiation factor 15 |
| chr16_+_57023406 | 0.95 |
ENST00000262510.6
ENST00000308149.7 ENST00000436936.1 |
NLRC5
|
NLR family, CARD domain containing 5 |
| chr14_+_24630465 | 0.94 |
ENST00000557894.1
ENST00000559284.1 ENST00000560275.1 |
IRF9
|
interferon regulatory factor 9 |
| chr1_-_205782304 | 0.94 |
ENST00000367137.3
|
SLC41A1
|
solute carrier family 41 (magnesium transporter), member 1 |
| chr17_-_39334460 | 0.94 |
ENST00000377726.2
|
KRTAP4-2
|
keratin associated protein 4-2 |
| chr17_+_6659153 | 0.94 |
ENST00000441631.1
ENST00000438512.1 ENST00000346752.4 ENST00000361842.3 |
XAF1
|
XIAP associated factor 1 |
| chr19_-_39368887 | 0.94 |
ENST00000340740.3
ENST00000591812.1 |
RINL
|
Ras and Rab interactor-like |
| chr17_-_39254391 | 0.94 |
ENST00000333822.4
|
KRTAP4-8
|
keratin associated protein 4-8 |
| chr6_+_32812568 | 0.93 |
ENST00000414474.1
|
PSMB9
|
proteasome (prosome, macropain) subunit, beta type, 9 |
| chr6_-_160147925 | 0.93 |
ENST00000535561.1
|
SOD2
|
superoxide dismutase 2, mitochondrial |
| chr11_-_46142948 | 0.93 |
ENST00000257821.4
|
PHF21A
|
PHD finger protein 21A |
| chr3_-_79068594 | 0.93 |
ENST00000436010.2
|
ROBO1
|
roundabout, axon guidance receptor, homolog 1 (Drosophila) |
| chr21_+_27011899 | 0.92 |
ENST00000425221.2
|
JAM2
|
junctional adhesion molecule 2 |
| chr8_+_54764346 | 0.91 |
ENST00000297313.3
ENST00000344277.6 |
RGS20
|
regulator of G-protein signaling 20 |
| chr4_+_89299994 | 0.91 |
ENST00000264346.7
|
HERC6
|
HECT and RLD domain containing E3 ubiquitin protein ligase family member 6 |
| chr18_+_3449330 | 0.90 |
ENST00000549253.1
|
TGIF1
|
TGFB-induced factor homeobox 1 |
| chr2_+_47168630 | 0.88 |
ENST00000263737.6
|
TTC7A
|
tetratricopeptide repeat domain 7A |
| chr17_+_77030267 | 0.87 |
ENST00000581774.1
|
C1QTNF1
|
C1q and tumor necrosis factor related protein 1 |
| chr3_-_178790057 | 0.86 |
ENST00000311417.2
|
ZMAT3
|
zinc finger, matrin-type 3 |
| chr1_+_183155373 | 0.86 |
ENST00000493293.1
ENST00000264144.4 |
LAMC2
|
laminin, gamma 2 |
| chr22_+_21133469 | 0.86 |
ENST00000406799.1
|
SERPIND1
|
serpin peptidase inhibitor, clade D (heparin cofactor), member 1 |
| chr17_+_39405939 | 0.85 |
ENST00000334109.2
|
KRTAP9-4
|
keratin associated protein 9-4 |
| chr22_-_37823468 | 0.85 |
ENST00000402918.2
|
ELFN2
|
extracellular leucine-rich repeat and fibronectin type III domain containing 2 |
| chr2_+_7017796 | 0.84 |
ENST00000382040.3
|
RSAD2
|
radical S-adenosyl methionine domain containing 2 |
| chr11_+_35198118 | 0.83 |
ENST00000525211.1
ENST00000526000.1 ENST00000279452.6 ENST00000527889.1 |
CD44
|
CD44 molecule (Indian blood group) |
| chr19_-_4302375 | 0.82 |
ENST00000600114.1
ENST00000600349.1 ENST00000595645.1 ENST00000301272.2 |
TMIGD2
|
transmembrane and immunoglobulin domain containing 2 |
| chr5_+_131409476 | 0.80 |
ENST00000296871.2
|
CSF2
|
colony stimulating factor 2 (granulocyte-macrophage) |
| chr11_-_117698765 | 0.80 |
ENST00000532119.1
|
FXYD2
|
FXYD domain containing ion transport regulator 2 |
| chr1_-_33430286 | 0.80 |
ENST00000373456.7
ENST00000356990.5 ENST00000235150.4 |
RNF19B
|
ring finger protein 19B |
| chr10_-_90712520 | 0.79 |
ENST00000224784.6
|
ACTA2
|
actin, alpha 2, smooth muscle, aorta |
| chr18_+_33877654 | 0.79 |
ENST00000257209.4
ENST00000445677.1 ENST00000590592.1 ENST00000359247.4 |
FHOD3
|
formin homology 2 domain containing 3 |
| chrX_+_152082969 | 0.78 |
ENST00000535861.1
ENST00000539731.1 ENST00000449285.2 ENST00000318504.7 ENST00000324823.6 ENST00000370268.4 ENST00000370270.2 |
ZNF185
|
zinc finger protein 185 (LIM domain) |
| chr17_+_56270084 | 0.78 |
ENST00000225371.5
|
EPX
|
eosinophil peroxidase |
| chr6_+_31554962 | 0.78 |
ENST00000376092.3
ENST00000376086.3 ENST00000303757.8 ENST00000376093.2 ENST00000376102.3 |
LST1
|
leukocyte specific transcript 1 |
| chr6_-_29595779 | 0.78 |
ENST00000355973.3
ENST00000377012.4 |
GABBR1
|
gamma-aminobutyric acid (GABA) B receptor, 1 |
| chr3_-_107809816 | 0.77 |
ENST00000361309.5
ENST00000355354.7 |
CD47
|
CD47 molecule |
| chr11_-_104905840 | 0.77 |
ENST00000526568.1
ENST00000393136.4 ENST00000531166.1 ENST00000534497.1 ENST00000527979.1 ENST00000446369.1 ENST00000353247.5 ENST00000528974.1 ENST00000533400.1 ENST00000525825.1 ENST00000436863.3 |
CASP1
|
caspase 1, apoptosis-related cysteine peptidase |
| chr20_+_58515417 | 0.77 |
ENST00000360816.3
|
FAM217B
|
family with sequence similarity 217, member B |
| chr20_+_17680587 | 0.77 |
ENST00000427254.1
ENST00000377805.3 |
BANF2
|
barrier to autointegration factor 2 |
| chr16_-_67970990 | 0.77 |
ENST00000358514.4
|
PSMB10
|
proteasome (prosome, macropain) subunit, beta type, 10 |
| chr5_+_115298165 | 0.76 |
ENST00000357872.4
|
AQPEP
|
Aminopeptidase Q |
| chr17_-_79623597 | 0.76 |
ENST00000574024.1
ENST00000331056.5 |
PDE6G
|
phosphodiesterase 6G, cGMP-specific, rod, gamma |
| chr22_-_36556821 | 0.76 |
ENST00000531095.1
ENST00000397293.2 ENST00000349314.2 |
APOL3
|
apolipoprotein L, 3 |
| chr4_-_76944621 | 0.74 |
ENST00000306602.1
|
CXCL10
|
chemokine (C-X-C motif) ligand 10 |
| chr12_+_131438443 | 0.74 |
ENST00000261654.5
|
GPR133
|
G protein-coupled receptor 133 |
| chr16_+_2880369 | 0.74 |
ENST00000572863.1
|
ZG16B
|
zymogen granule protein 16B |
| chr11_-_117695449 | 0.74 |
ENST00000292079.2
|
FXYD2
|
FXYD domain containing ion transport regulator 2 |
| chr6_+_31554456 | 0.74 |
ENST00000339530.4
|
LST1
|
leukocyte specific transcript 1 |
| chr12_+_121570631 | 0.74 |
ENST00000546057.1
ENST00000377162.2 ENST00000328963.5 ENST00000535250.1 ENST00000541446.1 |
P2RX7
|
purinergic receptor P2X, ligand-gated ion channel, 7 |
| chr21_+_27011584 | 0.74 |
ENST00000400532.1
ENST00000480456.1 ENST00000312957.5 |
JAM2
|
junctional adhesion molecule 2 |
| chr2_+_191045562 | 0.73 |
ENST00000340623.4
|
C2orf88
|
chromosome 2 open reading frame 88 |
| chr7_-_47579188 | 0.73 |
ENST00000398879.1
ENST00000355730.3 ENST00000442536.2 ENST00000458317.2 |
TNS3
|
tensin 3 |
| chr8_-_119964434 | 0.73 |
ENST00000297350.4
|
TNFRSF11B
|
tumor necrosis factor receptor superfamily, member 11b |
| chr12_+_52626898 | 0.72 |
ENST00000331817.5
|
KRT7
|
keratin 7 |
| chr17_+_77019030 | 0.71 |
ENST00000580454.1
|
C1QTNF1
|
C1q and tumor necrosis factor related protein 1 |
| chr19_+_10197463 | 0.71 |
ENST00000590378.1
ENST00000397881.3 |
C19orf66
|
chromosome 19 open reading frame 66 |
| chr14_-_107283278 | 0.70 |
ENST00000390639.2
|
IGHV7-81
|
immunoglobulin heavy variable 7-81 (non-functional) |
| chr16_-_1275257 | 0.70 |
ENST00000234798.4
|
TPSG1
|
tryptase gamma 1 |
| chr15_+_75640068 | 0.70 |
ENST00000565051.1
ENST00000564257.1 ENST00000567005.1 |
NEIL1
|
nei endonuclease VIII-like 1 (E. coli) |
| chr1_+_192778161 | 0.70 |
ENST00000235382.5
|
RGS2
|
regulator of G-protein signaling 2, 24kDa |
| chr10_-_49701686 | 0.70 |
ENST00000417247.2
|
ARHGAP22
|
Rho GTPase activating protein 22 |
| chr1_-_150738261 | 0.69 |
ENST00000448301.2
ENST00000368985.3 |
CTSS
|
cathepsin S |
| chr12_+_113416265 | 0.69 |
ENST00000449768.2
|
OAS2
|
2'-5'-oligoadenylate synthetase 2, 69/71kDa |
| chr3_-_193272588 | 0.69 |
ENST00000295548.3
|
ATP13A4
|
ATPase type 13A4 |
| chr12_+_52643077 | 0.69 |
ENST00000553310.2
ENST00000544024.1 |
KRT86
|
keratin 86 |
| chr17_-_39646116 | 0.69 |
ENST00000328119.6
|
KRT36
|
keratin 36 |
| chr18_-_19997878 | 0.68 |
ENST00000391403.2
|
CTAGE1
|
cutaneous T-cell lymphoma-associated antigen 1 |
| chr12_+_113344811 | 0.68 |
ENST00000551241.1
ENST00000553185.1 ENST00000550689.1 |
OAS1
|
2'-5'-oligoadenylate synthetase 1, 40/46kDa |
| chr9_+_72658490 | 0.68 |
ENST00000377182.4
|
MAMDC2
|
MAM domain containing 2 |
| chr1_+_169079823 | 0.68 |
ENST00000367813.3
|
ATP1B1
|
ATPase, Na+/K+ transporting, beta 1 polypeptide |
| chr6_-_44281043 | 0.68 |
ENST00000244571.4
|
AARS2
|
alanyl-tRNA synthetase 2, mitochondrial |
| chr20_+_17680599 | 0.67 |
ENST00000246090.5
|
BANF2
|
barrier to autointegration factor 2 |
| chr1_-_238054094 | 0.67 |
ENST00000366570.4
|
ZP4
|
zona pellucida glycoprotein 4 |
| chr5_-_59189545 | 0.67 |
ENST00000340635.6
|
PDE4D
|
phosphodiesterase 4D, cAMP-specific |
| chr11_-_117698787 | 0.67 |
ENST00000260287.2
|
FXYD2
|
FXYD domain containing ion transport regulator 2 |
| chr22_-_50964849 | 0.67 |
ENST00000543927.1
ENST00000423348.1 |
SCO2
|
SCO2 cytochrome c oxidase assembly protein |
| chr4_-_80994619 | 0.67 |
ENST00000404191.1
|
ANTXR2
|
anthrax toxin receptor 2 |
| chrX_-_154688276 | 0.66 |
ENST00000369445.2
|
F8A3
|
coagulation factor VIII-associated 3 |
| chr9_+_72873837 | 0.66 |
ENST00000361138.5
|
SMC5
|
structural maintenance of chromosomes 5 |
| chr2_-_89513402 | 0.66 |
ENST00000498435.1
|
IGKV1-27
|
immunoglobulin kappa variable 1-27 |
| chrX_-_152939252 | 0.66 |
ENST00000340888.3
|
PNCK
|
pregnancy up-regulated nonubiquitous CaM kinase |
| chr6_-_41122063 | 0.66 |
ENST00000426005.2
ENST00000437044.2 ENST00000373127.4 |
TREML1
|
triggering receptor expressed on myeloid cells-like 1 |
| chr5_-_169816638 | 0.66 |
ENST00000521859.1
ENST00000274629.4 |
KCNMB1
|
potassium large conductance calcium-activated channel, subfamily M, beta member 1 |
| chrX_+_154114635 | 0.65 |
ENST00000369446.2
|
F8A1
|
coagulation factor VIII-associated 1 |
| chr6_-_128841503 | 0.65 |
ENST00000368215.3
ENST00000532331.1 ENST00000368213.5 ENST00000368207.3 ENST00000525459.1 ENST00000368210.3 ENST00000368226.4 ENST00000368227.3 |
PTPRK
|
protein tyrosine phosphatase, receptor type, K |
| chrX_+_152086373 | 0.65 |
ENST00000318529.8
|
ZNF185
|
zinc finger protein 185 (LIM domain) |
| chr3_-_46904918 | 0.65 |
ENST00000395869.1
|
MYL3
|
myosin, light chain 3, alkali; ventricular, skeletal, slow |
| chr8_+_31497271 | 0.64 |
ENST00000520407.1
|
NRG1
|
neuregulin 1 |
| chr21_+_43919710 | 0.64 |
ENST00000398341.3
|
SLC37A1
|
solute carrier family 37 (glucose-6-phosphate transporter), member 1 |
| chr6_+_31554612 | 0.64 |
ENST00000211921.7
|
LST1
|
leukocyte specific transcript 1 |
| chr3_-_46904946 | 0.64 |
ENST00000292327.4
|
MYL3
|
myosin, light chain 3, alkali; ventricular, skeletal, slow |
| chr17_+_77021702 | 0.64 |
ENST00000392445.2
ENST00000354124.3 |
C1QTNF1
|
C1q and tumor necrosis factor related protein 1 |
| chr13_-_43566301 | 0.64 |
ENST00000398762.3
ENST00000313640.7 ENST00000313624.7 |
EPSTI1
|
epithelial stromal interaction 1 (breast) |
| chr1_+_25071848 | 0.63 |
ENST00000374379.4
|
CLIC4
|
chloride intracellular channel 4 |
| chr8_+_56014949 | 0.63 |
ENST00000327381.6
|
XKR4
|
XK, Kell blood group complex subunit-related family, member 4 |
| chr12_+_69201923 | 0.63 |
ENST00000462284.1
ENST00000258149.5 ENST00000356290.4 ENST00000540827.1 ENST00000428863.2 ENST00000393412.3 |
MDM2
|
MDM2 oncogene, E3 ubiquitin protein ligase |
| chr2_-_224903995 | 0.63 |
ENST00000409304.1
ENST00000454956.1 ENST00000258405.4 |
SERPINE2
|
serpin peptidase inhibitor, clade E (nexin, plasminogen activator inhibitor type 1), member 2 |
| chr7_+_142636440 | 0.63 |
ENST00000458732.1
|
C7orf34
|
chromosome 7 open reading frame 34 |
| chrX_+_153455547 | 0.62 |
ENST00000430054.1
|
OPN1MW
|
opsin 1 (cone pigments), medium-wave-sensitive |
| chr11_-_117747434 | 0.62 |
ENST00000529335.2
ENST00000530956.1 ENST00000260282.4 |
FXYD6
|
FXYD domain containing ion transport regulator 6 |
| chr2_+_231280908 | 0.62 |
ENST00000427101.2
ENST00000432979.1 |
SP100
|
SP100 nuclear antigen |
| chr16_+_318638 | 0.62 |
ENST00000412541.1
ENST00000435035.1 |
ARHGDIG
|
Rho GDP dissociation inhibitor (GDI) gamma |
| chr3_-_167813132 | 0.61 |
ENST00000309027.4
|
GOLIM4
|
golgi integral membrane protein 4 |
| chr10_-_49812997 | 0.61 |
ENST00000417912.2
|
ARHGAP22
|
Rho GTPase activating protein 22 |
| chr1_+_65613340 | 0.61 |
ENST00000546702.1
|
AK4
|
adenylate kinase 4 |
| chr2_-_26864228 | 0.61 |
ENST00000288861.4
|
CIB4
|
calcium and integrin binding family member 4 |
| chr20_+_58179582 | 0.61 |
ENST00000371015.1
ENST00000395639.4 |
PHACTR3
|
phosphatase and actin regulator 3 |
| chr6_-_134639180 | 0.61 |
ENST00000367858.5
|
SGK1
|
serum/glucocorticoid regulated kinase 1 |
| chr16_+_2880157 | 0.61 |
ENST00000382280.3
|
ZG16B
|
zymogen granule protein 16B |
| chr18_-_19994830 | 0.61 |
ENST00000525417.1
|
CTAGE1
|
cutaneous T-cell lymphoma-associated antigen 1 |
| chr8_+_17354617 | 0.61 |
ENST00000470360.1
|
SLC7A2
|
solute carrier family 7 (cationic amino acid transporter, y+ system), member 2 |
| chr20_+_23471727 | 0.61 |
ENST00000449810.1
ENST00000246012.1 |
CST8
|
cystatin 8 (cystatin-related epididymal specific) |
| chr14_+_95078714 | 0.61 |
ENST00000393078.3
ENST00000393080.4 ENST00000467132.1 |
SERPINA3
|
serpin peptidase inhibitor, clade A (alpha-1 antiproteinase, antitrypsin), member 3 |
| chr11_+_86667117 | 0.60 |
ENST00000531827.1
|
RP11-736K20.6
|
RP11-736K20.6 |
| chr6_-_24877490 | 0.60 |
ENST00000540914.1
ENST00000378023.4 |
FAM65B
|
family with sequence similarity 65, member B |
| chr11_-_441964 | 0.60 |
ENST00000332826.6
|
ANO9
|
anoctamin 9 |
| chr8_+_117950422 | 0.60 |
ENST00000378279.3
|
AARD
|
alanine and arginine rich domain containing protein |
| chr1_+_15479021 | 0.60 |
ENST00000428417.1
|
TMEM51
|
transmembrane protein 51 |
| chr3_-_127541679 | 0.59 |
ENST00000265052.5
|
MGLL
|
monoglyceride lipase |
| chr13_+_50070077 | 0.59 |
ENST00000378319.3
ENST00000426879.1 |
PHF11
|
PHD finger protein 11 |
| chr22_+_23029188 | 0.59 |
ENST00000390305.2
|
IGLV3-25
|
immunoglobulin lambda variable 3-25 |
| chr9_-_138591341 | 0.59 |
ENST00000298466.5
ENST00000425225.1 |
SOHLH1
|
spermatogenesis and oogenesis specific basic helix-loop-helix 1 |
| chr11_+_75428857 | 0.59 |
ENST00000198801.5
|
MOGAT2
|
monoacylglycerol O-acyltransferase 2 |
| chr11_-_79151695 | 0.59 |
ENST00000278550.7
|
TENM4
|
teneurin transmembrane protein 4 |
| chr19_+_38794797 | 0.59 |
ENST00000301246.5
ENST00000588605.1 |
C19orf33
|
chromosome 19 open reading frame 33 |
| chr3_-_127541194 | 0.58 |
ENST00000453507.2
|
MGLL
|
monoglyceride lipase |
| chr17_+_53828333 | 0.57 |
ENST00000268896.5
|
PCTP
|
phosphatidylcholine transfer protein |
| chr11_+_74862032 | 0.57 |
ENST00000289575.5
ENST00000341411.4 |
SLCO2B1
|
solute carrier organic anion transporter family, member 2B1 |
| chr12_+_27485785 | 0.57 |
ENST00000544915.1
|
ARNTL2
|
aryl hydrocarbon receptor nuclear translocator-like 2 |
| chr3_-_123512688 | 0.57 |
ENST00000475616.1
|
MYLK
|
myosin light chain kinase |
| chr19_+_56687374 | 0.57 |
ENST00000357330.2
ENST00000440823.1 |
GALP
|
galanin-like peptide |
| chr6_+_31553978 | 0.57 |
ENST00000376096.1
ENST00000376099.1 ENST00000376110.3 |
LST1
|
leukocyte specific transcript 1 |
| chr1_-_209824643 | 0.57 |
ENST00000391911.1
ENST00000415782.1 |
LAMB3
|
laminin, beta 3 |
| chr7_-_41742697 | 0.57 |
ENST00000242208.4
|
INHBA
|
inhibin, beta A |
| chr16_+_31213206 | 0.56 |
ENST00000561916.2
|
C16orf98
|
chromosome 16 open reading frame 98 |
| chr18_+_56806701 | 0.56 |
ENST00000587834.1
|
SEC11C
|
SEC11 homolog C (S. cerevisiae) |
| chr6_-_28411241 | 0.56 |
ENST00000289788.4
|
ZSCAN23
|
zinc finger and SCAN domain containing 23 |
| chr3_+_128779610 | 0.56 |
ENST00000307395.4
|
GP9
|
glycoprotein IX (platelet) |
| chr11_-_117747607 | 0.56 |
ENST00000540359.1
ENST00000539526.1 |
FXYD6
|
FXYD domain containing ion transport regulator 6 |
| chr6_-_11779174 | 0.56 |
ENST00000379413.2
|
ADTRP
|
androgen-dependent TFPI-regulating protein |
| chr19_-_10464570 | 0.56 |
ENST00000529739.1
|
TYK2
|
tyrosine kinase 2 |
| chr6_-_11779014 | 0.56 |
ENST00000229583.5
|
ADTRP
|
androgen-dependent TFPI-regulating protein |
| chr1_-_147232669 | 0.56 |
ENST00000369237.1
|
GJA5
|
gap junction protein, alpha 5, 40kDa |
| chr2_-_231090344 | 0.56 |
ENST00000540870.1
ENST00000416610.1 |
SP110
|
SP110 nuclear body protein |
| chr3_-_178789993 | 0.55 |
ENST00000432729.1
|
ZMAT3
|
zinc finger, matrin-type 3 |
| chr15_+_89346699 | 0.55 |
ENST00000558207.1
|
ACAN
|
aggrecan |
| chr17_-_79895097 | 0.55 |
ENST00000402252.2
ENST00000583564.1 ENST00000585244.1 ENST00000337943.5 ENST00000579698.1 |
PYCR1
|
pyrroline-5-carboxylate reductase 1 |
| chr1_-_230513367 | 0.55 |
ENST00000321327.2
ENST00000525115.1 |
PGBD5
|
piggyBac transposable element derived 5 |
| chr12_+_110906169 | 0.55 |
ENST00000377673.5
|
FAM216A
|
family with sequence similarity 216, member A |
| chr15_+_31196080 | 0.55 |
ENST00000561607.1
ENST00000565466.1 |
FAN1
|
FANCD2/FANCI-associated nuclease 1 |
| chr22_+_21128167 | 0.54 |
ENST00000215727.5
|
SERPIND1
|
serpin peptidase inhibitor, clade D (heparin cofactor), member 1 |
| chr16_+_56623433 | 0.54 |
ENST00000570176.1
|
MT3
|
metallothionein 3 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.8 | 4.2 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
| 0.6 | 1.2 | GO:0021966 | corticospinal neuron axon guidance(GO:0021966) |
| 0.6 | 2.4 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
| 0.6 | 1.7 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 0.5 | 4.1 | GO:0001554 | luteolysis(GO:0001554) |
| 0.5 | 1.4 | GO:0051097 | negative regulation of helicase activity(GO:0051097) |
| 0.4 | 1.2 | GO:1903625 | negative regulation of DNA catabolic process(GO:1903625) |
| 0.4 | 2.8 | GO:2000124 | regulation of endocannabinoid signaling pathway(GO:2000124) |
| 0.4 | 1.6 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.4 | 1.4 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
| 0.4 | 3.2 | GO:0046940 | nucleoside monophosphate phosphorylation(GO:0046940) |
| 0.3 | 3.1 | GO:0098870 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.3 | 1.0 | GO:0071301 | cellular response to vitamin B1(GO:0071301) response to formaldehyde(GO:1904404) |
| 0.3 | 1.0 | GO:0045062 | extrathymic T cell selection(GO:0045062) |
| 0.3 | 0.9 | GO:0051941 | regulation of amino acid uptake involved in synaptic transmission(GO:0051941) regulation of glutamate uptake involved in transmission of nerve impulse(GO:0051946) regulation of L-glutamate import(GO:1900920) |
| 0.3 | 0.9 | GO:0046900 | tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.3 | 1.4 | GO:0007571 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 0.3 | 1.1 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 0.3 | 0.8 | GO:0032499 | detection of peptidoglycan(GO:0032499) |
| 0.3 | 0.5 | GO:0090024 | negative regulation of granulocyte chemotaxis(GO:0071623) negative regulation of neutrophil chemotaxis(GO:0090024) negative regulation of neutrophil migration(GO:1902623) |
| 0.3 | 2.1 | GO:2000860 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.3 | 1.3 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
| 0.3 | 1.3 | GO:1903281 | positive regulation of calcium:sodium antiporter activity(GO:1903281) |
| 0.2 | 1.0 | GO:0052250 | modulation of signal transduction in other organism(GO:0044501) modulation by symbiont of host signal transduction pathway(GO:0052027) modulation of signal transduction in other organism involved in symbiotic interaction(GO:0052250) modulation by symbiont of host I-kappaB kinase/NF-kappaB cascade(GO:0085032) |
| 0.2 | 0.7 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.2 | 1.0 | GO:1902044 | regulation of Fas signaling pathway(GO:1902044) |
| 0.2 | 0.7 | GO:0042489 | negative regulation of odontogenesis of dentin-containing tooth(GO:0042489) |
| 0.2 | 1.4 | GO:0097498 | endothelial tube lumen extension(GO:0097498) |
| 0.2 | 1.9 | GO:0018377 | protein myristoylation(GO:0018377) |
| 0.2 | 0.2 | GO:0019249 | lactate biosynthetic process(GO:0019249) |
| 0.2 | 0.7 | GO:1990764 | regulation of myofibroblast contraction(GO:1904328) myofibroblast contraction(GO:1990764) |
| 0.2 | 0.9 | GO:0072139 | glomerular parietal epithelial cell differentiation(GO:0072139) |
| 0.2 | 0.6 | GO:2001190 | positive regulation of T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:2001190) |
| 0.2 | 1.3 | GO:2001183 | negative regulation of interleukin-12 secretion(GO:2001183) |
| 0.2 | 2.8 | GO:1990573 | potassium ion import across plasma membrane(GO:1990573) |
| 0.2 | 0.6 | GO:0034226 | lysine import(GO:0034226) L-lysine import(GO:0061461) L-lysine import into cell(GO:1903410) |
| 0.2 | 0.2 | GO:0019858 | cytosine metabolic process(GO:0019858) |
| 0.2 | 0.6 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.2 | 1.2 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 0.2 | 0.6 | GO:2001226 | negative regulation of anion channel activity(GO:0010360) negative regulation of chloride transport(GO:2001226) |
| 0.2 | 0.8 | GO:0072658 | maintenance of protein location in membrane(GO:0072658) maintenance of protein location in plasma membrane(GO:0072660) positive regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900827) |
| 0.2 | 0.6 | GO:1904298 | positive regulation of neutrophil degranulation(GO:0043315) cellular response to gravity(GO:0071258) positive regulation of neutrophil activation(GO:1902565) regulation of transcytosis(GO:1904298) positive regulation of transcytosis(GO:1904300) regulation of maternal process involved in parturition(GO:1904301) positive regulation of maternal process involved in parturition(GO:1904303) response to 2-O-acetyl-1-O-hexadecyl-sn-glycero-3-phosphocholine(GO:1904316) cellular response to 2-O-acetyl-1-O-hexadecyl-sn-glycero-3-phosphocholine(GO:1904317) |
| 0.2 | 0.6 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.2 | 1.2 | GO:0060332 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
| 0.2 | 0.6 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
| 0.2 | 0.6 | GO:0060279 | regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
| 0.2 | 0.7 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
| 0.2 | 0.6 | GO:1903413 | cellular response to bile acid(GO:1903413) |
| 0.2 | 0.6 | GO:0098905 | pulmonary valve formation(GO:0003193) regulation of cell communication by chemical coupling(GO:0010645) positive regulation of cell communication by chemical coupling(GO:0010652) foramen ovale closure(GO:0035922) regulation of bundle of His cell action potential(GO:0098905) |
| 0.2 | 0.5 | GO:0055073 | cadmium ion homeostasis(GO:0055073) lysosomal membrane organization(GO:0097212) regulation of oxygen metabolic process(GO:2000374) |
| 0.2 | 1.4 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.2 | 0.2 | GO:1904815 | negative regulation of protein localization to chromosome, telomeric region(GO:1904815) |
| 0.2 | 1.6 | GO:0086024 | adrenergic receptor signaling pathway involved in positive regulation of heart rate(GO:0086024) |
| 0.2 | 0.7 | GO:2000360 | negative regulation of binding of sperm to zona pellucida(GO:2000360) |
| 0.2 | 0.3 | GO:0036337 | Fas signaling pathway(GO:0036337) |
| 0.2 | 0.7 | GO:0034184 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.2 | 1.8 | GO:0003373 | dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
| 0.2 | 1.1 | GO:0051121 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.2 | 0.5 | GO:0044537 | regulation of circulating fibrinogen levels(GO:0044537) |
| 0.2 | 0.3 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
| 0.2 | 0.2 | GO:0046882 | negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
| 0.2 | 0.5 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
| 0.2 | 0.2 | GO:2000523 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.2 | 0.2 | GO:0042986 | positive regulation of amyloid precursor protein biosynthetic process(GO:0042986) |
| 0.2 | 0.5 | GO:0070407 | oxidation-dependent protein catabolic process(GO:0070407) |
| 0.2 | 1.1 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
| 0.2 | 0.5 | GO:1903697 | negative regulation of microvillus assembly(GO:1903697) |
| 0.2 | 0.8 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
| 0.2 | 0.6 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
| 0.1 | 1.2 | GO:1900625 | regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
| 0.1 | 0.4 | GO:0035408 | histone H3-T6 phosphorylation(GO:0035408) |
| 0.1 | 0.4 | GO:0099543 | retrograde trans-synaptic signaling by soluble gas(GO:0098923) trans-synaptic signaling by soluble gas(GO:0099543) |
| 0.1 | 0.7 | GO:0034165 | positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
| 0.1 | 1.6 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.1 | 0.4 | GO:0061300 | cerebellum vasculature development(GO:0061300) |
| 0.1 | 0.4 | GO:0042668 | auditory receptor cell fate determination(GO:0042668) negative regulation of pro-B cell differentiation(GO:2000974) |
| 0.1 | 0.8 | GO:0090131 | mesenchyme migration(GO:0090131) |
| 0.1 | 0.6 | GO:0001970 | positive regulation of activation of membrane attack complex(GO:0001970) |
| 0.1 | 0.7 | GO:0061760 | antifungal innate immune response(GO:0061760) |
| 0.1 | 0.7 | GO:0071073 | positive regulation of phospholipid biosynthetic process(GO:0071073) |
| 0.1 | 0.4 | GO:0046946 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.1 | 0.3 | GO:0043396 | corticotropin-releasing hormone secretion(GO:0043396) regulation of corticotropin-releasing hormone secretion(GO:0043397) |
| 0.1 | 0.8 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.1 | 1.4 | GO:0006477 | protein sulfation(GO:0006477) |
| 0.1 | 0.3 | GO:0015788 | UDP-N-acetylglucosamine transport(GO:0015788) UDP-N-acetylglucosamine transmembrane transport(GO:1990569) |
| 0.1 | 0.4 | GO:0002352 | B cell negative selection(GO:0002352) post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 0.1 | 0.7 | GO:0045354 | interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) |
| 0.1 | 0.4 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.1 | 0.3 | GO:1904170 | regulation of bleb assembly(GO:1904170) positive regulation of bleb assembly(GO:1904172) |
| 0.1 | 0.4 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
| 0.1 | 1.0 | GO:0038129 | ERBB3 signaling pathway(GO:0038129) |
| 0.1 | 0.8 | GO:0034436 | glycoprotein transport(GO:0034436) |
| 0.1 | 0.4 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.1 | 0.5 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.1 | 0.6 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.1 | 0.5 | GO:0002296 | T-helper 1 cell lineage commitment(GO:0002296) |
| 0.1 | 0.4 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.1 | 0.5 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.1 | 0.7 | GO:0014900 | muscle hyperplasia(GO:0014900) |
| 0.1 | 0.7 | GO:0007079 | mitotic chromosome movement towards spindle pole(GO:0007079) |
| 0.1 | 1.6 | GO:0030913 | paranodal junction assembly(GO:0030913) |
| 0.1 | 0.6 | GO:0034443 | negative regulation of lipoprotein oxidation(GO:0034443) |
| 0.1 | 0.2 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
| 0.1 | 0.2 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
| 0.1 | 0.3 | GO:0006738 | nicotinamide riboside catabolic process(GO:0006738) nicotinamide riboside metabolic process(GO:0046495) pyridine nucleoside metabolic process(GO:0070637) pyridine nucleoside catabolic process(GO:0070638) |
| 0.1 | 0.3 | GO:0090290 | positive regulation of osteoclast proliferation(GO:0090290) |
| 0.1 | 0.1 | GO:0038178 | complement component C5a signaling pathway(GO:0038178) |
| 0.1 | 0.4 | GO:0036414 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
| 0.1 | 1.2 | GO:0070141 | response to UV-A(GO:0070141) |
| 0.1 | 0.2 | GO:1900158 | negative regulation of bone mineralization involved in bone maturation(GO:1900158) |
| 0.1 | 0.5 | GO:0010902 | positive regulation of very-low-density lipoprotein particle remodeling(GO:0010902) |
| 0.1 | 0.3 | GO:0098968 | neurotransmitter receptor transport postsynaptic membrane to endosome(GO:0098968) |
| 0.1 | 0.3 | GO:0016094 | polyprenol biosynthetic process(GO:0016094) |
| 0.1 | 0.4 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 0.1 | 0.3 | GO:0006433 | glutamyl-tRNA aminoacylation(GO:0006424) prolyl-tRNA aminoacylation(GO:0006433) |
| 0.1 | 0.5 | GO:0001550 | ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.1 | 0.2 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.1 | 0.3 | GO:0035281 | pre-miRNA export from nucleus(GO:0035281) |
| 0.1 | 0.5 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
| 0.1 | 0.3 | GO:0040010 | positive regulation of growth rate(GO:0040010) regulation of gastric mucosal blood circulation(GO:1904344) positive regulation of gastric mucosal blood circulation(GO:1904346) gastric mucosal blood circulation(GO:1990768) |
| 0.1 | 0.3 | GO:2000276 | negative regulation of oxidative phosphorylation uncoupler activity(GO:2000276) |
| 0.1 | 2.4 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
| 0.1 | 0.4 | GO:0086097 | phospholipase C-activating angiotensin-activated signaling pathway(GO:0086097) |
| 0.1 | 0.4 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
| 0.1 | 0.9 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.1 | 0.5 | GO:1901091 | regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
| 0.1 | 0.3 | GO:0033364 | mast cell secretory granule organization(GO:0033364) |
| 0.1 | 0.3 | GO:0032877 | positive regulation of DNA endoreduplication(GO:0032877) |
| 0.1 | 0.4 | GO:0043126 | regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043126) positive regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043128) |
| 0.1 | 0.4 | GO:0015783 | GDP-fucose transport(GO:0015783) purine nucleotide-sugar transport(GO:0036079) |
| 0.1 | 0.5 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.1 | 0.4 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.1 | 0.2 | GO:0002666 | positive regulation of T cell tolerance induction(GO:0002666) |
| 0.1 | 1.0 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
| 0.1 | 0.5 | GO:0072023 | thick ascending limb development(GO:0072023) metanephric thick ascending limb development(GO:0072233) |
| 0.1 | 0.2 | GO:0010621 | negative regulation of transcription by transcription factor localization(GO:0010621) |
| 0.1 | 1.1 | GO:0010819 | regulation of T cell chemotaxis(GO:0010819) |
| 0.1 | 0.3 | GO:0002384 | hepatic immune response(GO:0002384) |
| 0.1 | 0.5 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.1 | 0.3 | GO:0017186 | peptidyl-pyroglutamic acid biosynthetic process, using glutaminyl-peptide cyclotransferase(GO:0017186) |
| 0.1 | 0.3 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
| 0.1 | 0.3 | GO:0045626 | negative regulation of dendritic cell cytokine production(GO:0002731) FasL biosynthetic process(GO:0045210) negative regulation of T-helper 1 cell differentiation(GO:0045626) |
| 0.1 | 0.8 | GO:0015820 | leucine transport(GO:0015820) |
| 0.1 | 0.4 | GO:0009224 | CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) CMP metabolic process(GO:0046035) |
| 0.1 | 0.2 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.1 | 0.5 | GO:0021633 | optic nerve structural organization(GO:0021633) |
| 0.1 | 0.4 | GO:0015960 | diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
| 0.1 | 0.1 | GO:0002339 | B cell selection(GO:0002339) |
| 0.1 | 0.3 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.1 | 0.5 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.1 | 1.0 | GO:2000111 | positive regulation of macrophage apoptotic process(GO:2000111) |
| 0.1 | 0.1 | GO:2000364 | regulation of STAT protein import into nucleus(GO:2000364) positive regulation of STAT protein import into nucleus(GO:2000366) |
| 0.1 | 0.3 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
| 0.1 | 0.4 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.1 | 0.4 | GO:0051754 | meiotic sister chromatid cohesion, centromeric(GO:0051754) |
| 0.1 | 0.3 | GO:0070173 | regulation of enamel mineralization(GO:0070173) |
| 0.1 | 0.3 | GO:1903691 | positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
| 0.1 | 0.3 | GO:0072268 | pattern specification involved in metanephros development(GO:0072268) |
| 0.1 | 0.1 | GO:1904674 | positive regulation of somatic stem cell population maintenance(GO:1904674) |
| 0.1 | 0.5 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
| 0.1 | 0.1 | GO:0060369 | positive regulation of Fc receptor mediated stimulatory signaling pathway(GO:0060369) |
| 0.1 | 0.4 | GO:2001293 | malonyl-CoA metabolic process(GO:2001293) |
| 0.1 | 0.9 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.1 | 0.1 | GO:0016098 | monoterpenoid metabolic process(GO:0016098) |
| 0.1 | 0.3 | GO:0008355 | olfactory learning(GO:0008355) |
| 0.1 | 0.4 | GO:0061107 | seminal vesicle development(GO:0061107) |
| 0.1 | 0.2 | GO:0003162 | atrioventricular node development(GO:0003162) |
| 0.1 | 8.6 | GO:0071357 | type I interferon signaling pathway(GO:0060337) cellular response to type I interferon(GO:0071357) |
| 0.1 | 0.3 | GO:0035603 | fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) |
| 0.1 | 0.9 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
| 0.1 | 0.3 | GO:0002879 | positive regulation of acute inflammatory response to non-antigenic stimulus(GO:0002879) |
| 0.1 | 0.2 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
| 0.1 | 0.5 | GO:0072180 | mesonephric duct morphogenesis(GO:0072180) |
| 0.1 | 0.2 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.1 | 0.2 | GO:0098935 | dendritic transport(GO:0098935) anterograde dendritic transport(GO:0098937) |
| 0.1 | 0.2 | GO:0072054 | negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) renal inner medulla development(GO:0072053) renal outer medulla development(GO:0072054) |
| 0.1 | 0.2 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
| 0.1 | 0.2 | GO:0035910 | ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
| 0.1 | 0.3 | GO:0038110 | interleukin-2-mediated signaling pathway(GO:0038110) |
| 0.1 | 1.0 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 0.1 | 0.4 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.1 | 0.8 | GO:0071415 | cellular response to purine-containing compound(GO:0071415) |
| 0.1 | 0.2 | GO:0038163 | thrombopoietin-mediated signaling pathway(GO:0038163) |
| 0.1 | 0.8 | GO:0010519 | negative regulation of phospholipase activity(GO:0010519) |
| 0.1 | 0.2 | GO:2001027 | negative regulation of endothelial cell chemotaxis(GO:2001027) |
| 0.1 | 0.2 | GO:0031660 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031660) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031662) response to DDT(GO:0046680) histone H3-S10 phosphorylation involved in chromosome condensation(GO:2000775) |
| 0.1 | 0.3 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
| 0.1 | 0.3 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
| 0.1 | 0.2 | GO:0021521 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 0.1 | 0.4 | GO:0061365 | positive regulation of triglyceride lipase activity(GO:0061365) |
| 0.1 | 0.2 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.1 | 0.2 | GO:0019056 | modulation by virus of host transcription(GO:0019056) positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) modulation by symbiont of host transcription(GO:0052026) |
| 0.1 | 3.7 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.1 | 0.1 | GO:0090170 | regulation of Golgi inheritance(GO:0090170) |
| 0.1 | 0.4 | GO:0019255 | glucose 1-phosphate metabolic process(GO:0019255) |
| 0.1 | 0.3 | GO:0046110 | xanthine metabolic process(GO:0046110) |
| 0.1 | 0.3 | GO:0009386 | translational attenuation(GO:0009386) |
| 0.1 | 0.3 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.1 | 0.1 | GO:0002232 | leukocyte chemotaxis involved in inflammatory response(GO:0002232) |
| 0.1 | 0.1 | GO:0060823 | canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060823) |
| 0.1 | 0.2 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) positive regulation of renal sodium excretion(GO:0035815) |
| 0.1 | 0.6 | GO:0032439 | endosome localization(GO:0032439) |
| 0.1 | 0.2 | GO:1900075 | regulation of neuromuscular synaptic transmission(GO:1900073) positive regulation of neuromuscular synaptic transmission(GO:1900075) |
| 0.1 | 0.4 | GO:1904995 | negative regulation of leukocyte tethering or rolling(GO:1903237) negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
| 0.1 | 0.3 | GO:0071863 | regulation of cell proliferation in bone marrow(GO:0071863) positive regulation of cell proliferation in bone marrow(GO:0071864) regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
| 0.1 | 0.3 | GO:0007538 | primary sex determination(GO:0007538) |
| 0.1 | 0.6 | GO:0034625 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.1 | 0.2 | GO:0045091 | regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) |
| 0.1 | 0.5 | GO:0043932 | ossification involved in bone remodeling(GO:0043932) |
| 0.1 | 0.2 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.1 | 0.3 | GO:0036269 | swimming behavior(GO:0036269) |
| 0.1 | 0.2 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.1 | 0.2 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.1 | 0.2 | GO:0010752 | regulation of cGMP-mediated signaling(GO:0010752) |
| 0.1 | 0.1 | GO:0009608 | response to symbiont(GO:0009608) response to symbiotic bacterium(GO:0009609) |
| 0.1 | 0.3 | GO:0050705 | negative regulation of interleukin-1 alpha production(GO:0032690) regulation of interleukin-1 alpha secretion(GO:0050705) negative regulation of interleukin-1 alpha secretion(GO:0050712) |
| 0.1 | 0.2 | GO:0070093 | negative regulation of glucagon secretion(GO:0070093) |
| 0.1 | 0.4 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
| 0.1 | 0.2 | GO:0031448 | regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) maintenance of mitochondrion location(GO:0051659) relaxation of skeletal muscle(GO:0090076) |
| 0.1 | 0.2 | GO:0043012 | regulation of fusion of sperm to egg plasma membrane(GO:0043012) |
| 0.1 | 0.2 | GO:0038043 | interleukin-5-mediated signaling pathway(GO:0038043) |
| 0.1 | 0.3 | GO:0035617 | stress granule disassembly(GO:0035617) |
| 0.1 | 0.3 | GO:0097021 | lymphocyte migration into lymphoid organs(GO:0097021) |
| 0.1 | 0.1 | GO:0043318 | regulation of cytotoxic T cell degranulation(GO:0043317) negative regulation of cytotoxic T cell degranulation(GO:0043318) |
| 0.1 | 0.3 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
| 0.1 | 0.5 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.1 | 0.1 | GO:0060913 | cardiac cell fate determination(GO:0060913) |
| 0.1 | 0.4 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.1 | 0.3 | GO:0006581 | acetylcholine catabolic process in synaptic cleft(GO:0001507) acetylcholine catabolic process(GO:0006581) |
| 0.1 | 0.5 | GO:0050962 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.1 | 0.1 | GO:2000705 | dense core granule biogenesis(GO:0061110) regulation of dense core granule biogenesis(GO:2000705) |
| 0.1 | 0.2 | GO:0021577 | hindbrain structural organization(GO:0021577) cerebellum structural organization(GO:0021589) |
| 0.1 | 0.3 | GO:1904217 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.1 | 0.5 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.1 | 0.3 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.1 | 0.5 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
| 0.1 | 0.2 | GO:2000298 | regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
| 0.1 | 0.3 | GO:0061032 | visceral serous pericardium development(GO:0061032) |
| 0.1 | 0.3 | GO:0033590 | response to cobalamin(GO:0033590) |
| 0.1 | 1.9 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.1 | 0.3 | GO:1903826 | arginine transmembrane transport(GO:1903826) |
| 0.1 | 0.2 | GO:0038193 | thromboxane A2 signaling pathway(GO:0038193) |
| 0.1 | 0.3 | GO:0032972 | regulation of muscle filament sliding speed(GO:0032972) |
| 0.1 | 1.7 | GO:0006590 | thyroid hormone generation(GO:0006590) |
| 0.1 | 0.3 | GO:0006050 | mannosamine metabolic process(GO:0006050) N-acetylmannosamine metabolic process(GO:0006051) |
| 0.1 | 0.6 | GO:0045408 | regulation of interleukin-6 biosynthetic process(GO:0045408) |
| 0.1 | 0.3 | GO:0018352 | protein-pyridoxal-5-phosphate linkage(GO:0018352) |
| 0.1 | 0.2 | GO:0046521 | sphingoid catabolic process(GO:0046521) |
| 0.1 | 0.3 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
| 0.1 | 0.5 | GO:0045964 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
| 0.1 | 1.9 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
| 0.1 | 1.9 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
| 0.1 | 0.2 | GO:0021849 | neuroblast division in subventricular zone(GO:0021849) |
| 0.1 | 0.1 | GO:0008291 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
| 0.1 | 0.4 | GO:0008218 | bioluminescence(GO:0008218) |
| 0.1 | 0.5 | GO:0016191 | synaptic vesicle uncoating(GO:0016191) |
| 0.1 | 0.4 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.1 | 0.2 | GO:0016999 | antibiotic metabolic process(GO:0016999) |
| 0.1 | 0.7 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
| 0.1 | 0.1 | GO:0042938 | dipeptide transport(GO:0042938) |
| 0.1 | 0.2 | GO:0050894 | determination of affect(GO:0050894) |
| 0.1 | 0.1 | GO:0006561 | proline biosynthetic process(GO:0006561) |
| 0.1 | 0.4 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.1 | 0.2 | GO:0051037 | regulation of transcription involved in meiotic cell cycle(GO:0051037) |
| 0.1 | 0.2 | GO:0010903 | negative regulation of very-low-density lipoprotein particle remodeling(GO:0010903) |
| 0.1 | 0.2 | GO:0006428 | isoleucyl-tRNA aminoacylation(GO:0006428) |
| 0.1 | 0.3 | GO:0035624 | receptor transactivation(GO:0035624) |
| 0.1 | 0.2 | GO:0002143 | tRNA wobble position uridine thiolation(GO:0002143) |
| 0.1 | 0.2 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.1 | 0.5 | GO:1990034 | calcium ion export from cell(GO:1990034) |
| 0.1 | 0.1 | GO:1903352 | L-ornithine transmembrane transport(GO:1903352) |
| 0.1 | 0.1 | GO:0003218 | cardiac left ventricle formation(GO:0003218) |
| 0.1 | 0.5 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.1 | 0.2 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
| 0.1 | 0.2 | GO:1904046 | negative regulation of vascular endothelial growth factor production(GO:1904046) |
| 0.1 | 0.2 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.1 | 0.3 | GO:0002692 | negative regulation of cellular extravasation(GO:0002692) |
| 0.1 | 0.5 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.1 | 0.3 | GO:0032218 | riboflavin transport(GO:0032218) |
| 0.1 | 0.3 | GO:0000430 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
| 0.1 | 0.2 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
| 0.1 | 0.3 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.1 | 0.2 | GO:0010666 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.1 | 0.3 | GO:2001288 | positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.1 | 0.4 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
| 0.1 | 0.3 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.1 | 0.2 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) positive regulation of interleukin-6-mediated signaling pathway(GO:0070105) |
| 0.1 | 0.5 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
| 0.1 | 0.2 | GO:0009212 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) |
| 0.1 | 0.2 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.1 | 0.3 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.1 | 0.7 | GO:0060088 | auditory receptor cell stereocilium organization(GO:0060088) |
| 0.1 | 0.1 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
| 0.1 | 0.2 | GO:2000660 | negative regulation of interleukin-1-mediated signaling pathway(GO:2000660) |
| 0.1 | 0.1 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
| 0.1 | 0.2 | GO:0006579 | amino-acid betaine catabolic process(GO:0006579) |
| 0.1 | 2.7 | GO:1901998 | toxin transport(GO:1901998) |
| 0.1 | 0.3 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.1 | 0.3 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.1 | 0.3 | GO:2000312 | regulation of kainate selective glutamate receptor activity(GO:2000312) |
| 0.1 | 0.2 | GO:0072592 | oxygen metabolic process(GO:0072592) |
| 0.1 | 0.6 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
| 0.1 | 0.3 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.1 | 0.3 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.1 | 0.2 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
| 0.1 | 0.3 | GO:0035105 | sterol regulatory element binding protein import into nucleus(GO:0035105) |
| 0.1 | 0.1 | GO:0033625 | positive regulation of integrin activation(GO:0033625) |
| 0.1 | 0.2 | GO:0003147 | neural crest cell migration involved in heart formation(GO:0003147) cell migration involved in heart formation(GO:0060974) anterior neural tube closure(GO:0061713) |
| 0.1 | 0.2 | GO:0006742 | NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
| 0.1 | 0.2 | GO:0044771 | meiotic cell cycle phase transition(GO:0044771) regulation of meiotic cell cycle phase transition(GO:1901993) negative regulation of meiotic cell cycle phase transition(GO:1901994) |
| 0.1 | 0.2 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.1 | 0.8 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.1 | 0.8 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.1 | 1.4 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.1 | 0.2 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.1 | 0.6 | GO:0035864 | response to potassium ion(GO:0035864) |
| 0.1 | 0.3 | GO:0010609 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
| 0.1 | 0.4 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.1 | 0.2 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.1 | 0.4 | GO:0046618 | drug export(GO:0046618) |
| 0.1 | 0.4 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
| 0.0 | 0.2 | GO:0043032 | positive regulation of macrophage activation(GO:0043032) |
| 0.0 | 0.6 | GO:0031272 | regulation of pseudopodium assembly(GO:0031272) |
| 0.0 | 0.4 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
| 0.0 | 0.1 | GO:0097460 | ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
| 0.0 | 0.6 | GO:0002934 | desmosome organization(GO:0002934) |
| 0.0 | 0.6 | GO:0006032 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.0 | 0.2 | GO:0048631 | regulation of skeletal muscle tissue growth(GO:0048631) |
| 0.0 | 0.1 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
| 0.0 | 0.3 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.0 | 0.4 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.0 | 0.3 | GO:1901374 | acetate ester transport(GO:1901374) |
| 0.0 | 0.3 | GO:0060157 | urinary bladder development(GO:0060157) |
| 0.0 | 0.5 | GO:0061088 | regulation of sequestering of zinc ion(GO:0061088) |
| 0.0 | 0.2 | GO:0070829 | response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.0 | 0.6 | GO:0060453 | regulation of gastric acid secretion(GO:0060453) |
| 0.0 | 0.2 | GO:0030223 | neutrophil differentiation(GO:0030223) |
| 0.0 | 0.2 | GO:0044806 | G-quadruplex DNA unwinding(GO:0044806) |
| 0.0 | 0.2 | GO:0010269 | response to selenium ion(GO:0010269) |
| 0.0 | 0.1 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.0 | 0.3 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) |
| 0.0 | 0.2 | GO:0010446 | response to alkaline pH(GO:0010446) |
| 0.0 | 0.5 | GO:0014832 | urinary bladder smooth muscle contraction(GO:0014832) urinary tract smooth muscle contraction(GO:0014848) |
| 0.0 | 0.1 | GO:0002034 | regulation of blood vessel size by renin-angiotensin(GO:0002034) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) |
| 0.0 | 0.4 | GO:0070445 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.0 | 0.5 | GO:0014820 | tonic smooth muscle contraction(GO:0014820) |
| 0.0 | 0.3 | GO:0021759 | globus pallidus development(GO:0021759) |
| 0.0 | 0.4 | GO:0031069 | hair follicle morphogenesis(GO:0031069) |
| 0.0 | 0.1 | GO:0038188 | cholecystokinin signaling pathway(GO:0038188) |
| 0.0 | 0.2 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.0 | 0.4 | GO:0009253 | peptidoglycan metabolic process(GO:0000270) peptidoglycan catabolic process(GO:0009253) |
| 0.0 | 0.4 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.0 | 0.2 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
| 0.0 | 0.6 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
| 0.0 | 0.2 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) |
| 0.0 | 0.4 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 0.0 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.2 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
| 0.0 | 0.2 | GO:0001545 | primary ovarian follicle growth(GO:0001545) |
| 0.0 | 0.1 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
| 0.0 | 0.5 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
| 0.0 | 0.6 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
| 0.0 | 1.4 | GO:0022400 | regulation of rhodopsin mediated signaling pathway(GO:0022400) |
| 0.0 | 0.6 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
| 0.0 | 0.1 | GO:0046166 | glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 0.0 | 0.3 | GO:0034340 | response to type I interferon(GO:0034340) |
| 0.0 | 0.3 | GO:0045060 | negative thymic T cell selection(GO:0045060) |
| 0.0 | 0.0 | GO:1903764 | regulation of potassium ion export across plasma membrane(GO:1903764) |
| 0.0 | 0.1 | GO:0072526 | pyridine-containing compound catabolic process(GO:0072526) |
| 0.0 | 0.3 | GO:0001542 | ovulation from ovarian follicle(GO:0001542) |
| 0.0 | 0.6 | GO:0070070 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.0 | 0.2 | GO:0016240 | autophagosome docking(GO:0016240) |
| 0.0 | 0.2 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.0 | 0.1 | GO:0034471 | endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
| 0.0 | 0.3 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
| 0.0 | 0.2 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
| 0.0 | 0.5 | GO:0002775 | antimicrobial peptide production(GO:0002775) antibacterial peptide production(GO:0002778) |
| 0.0 | 0.1 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.0 | 0.1 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
| 0.0 | 0.1 | GO:0009258 | 10-formyltetrahydrofolate catabolic process(GO:0009258) |
| 0.0 | 0.1 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
| 0.0 | 0.1 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.0 | 3.6 | GO:0050672 | negative regulation of mononuclear cell proliferation(GO:0032945) negative regulation of lymphocyte proliferation(GO:0050672) |
| 0.0 | 0.1 | GO:0048075 | positive regulation of eye pigmentation(GO:0048075) |
| 0.0 | 0.9 | GO:0032098 | regulation of appetite(GO:0032098) |
| 0.0 | 0.2 | GO:0003366 | cell-matrix adhesion involved in ameboidal cell migration(GO:0003366) |
| 0.0 | 0.1 | GO:0042441 | eye pigment biosynthetic process(GO:0006726) eye pigment metabolic process(GO:0042441) pigment metabolic process involved in developmental pigmentation(GO:0043324) pigment metabolic process involved in pigmentation(GO:0043474) |
| 0.0 | 0.9 | GO:0051450 | myoblast proliferation(GO:0051450) |
| 0.0 | 0.9 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
| 0.0 | 0.1 | GO:0010286 | heat acclimation(GO:0010286) cellular heat acclimation(GO:0070370) |
| 0.0 | 0.2 | GO:2001176 | mediator complex assembly(GO:0036034) regulation of mediator complex assembly(GO:2001176) positive regulation of mediator complex assembly(GO:2001178) |
| 0.0 | 0.4 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 0.0 | 0.4 | GO:0034392 | negative regulation of smooth muscle cell apoptotic process(GO:0034392) |
| 0.0 | 0.3 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.0 | 0.3 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.0 | 0.4 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.0 | 0.0 | GO:0097360 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
| 0.0 | 0.5 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
| 0.0 | 0.2 | GO:0032621 | interleukin-18 production(GO:0032621) |
| 0.0 | 0.3 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.0 | 0.5 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.0 | 0.1 | GO:0015808 | L-alanine transport(GO:0015808) |
| 0.0 | 0.1 | GO:0043163 | cell envelope organization(GO:0043163) external encapsulating structure organization(GO:0045229) |
| 0.0 | 0.8 | GO:0010447 | response to acidic pH(GO:0010447) |
| 0.0 | 0.1 | GO:0042137 | sequestering of neurotransmitter(GO:0042137) |
| 0.0 | 0.2 | GO:2001300 | lipoxin metabolic process(GO:2001300) |
| 0.0 | 0.1 | GO:0002265 | astrocyte activation involved in immune response(GO:0002265) |
| 0.0 | 0.5 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.0 | 0.1 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
| 0.0 | 1.2 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 | 0.2 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.0 | 0.2 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.0 | 0.5 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.0 | 0.4 | GO:0006548 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
| 0.0 | 0.5 | GO:0006657 | CDP-choline pathway(GO:0006657) |
| 0.0 | 0.0 | GO:0070432 | regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070432) |
| 0.0 | 0.4 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.0 | 0.5 | GO:0015816 | glycine transport(GO:0015816) |
| 0.0 | 0.3 | GO:0098912 | membrane depolarization during atrial cardiac muscle cell action potential(GO:0098912) |
| 0.0 | 0.1 | GO:0014859 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.0 | 0.3 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.0 | 0.1 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.0 | 0.0 | GO:1902938 | regulation of intracellular calcium activated chloride channel activity(GO:1902938) |
| 0.0 | 0.2 | GO:0000912 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 0.0 | 0.1 | GO:0032849 | positive regulation of cellular pH reduction(GO:0032849) |
| 0.0 | 0.2 | GO:0060180 | female mating behavior(GO:0060180) |
| 0.0 | 0.2 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.0 | 0.2 | GO:0032808 | lacrimal gland development(GO:0032808) |
| 0.0 | 0.3 | GO:0097577 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.0 | 0.1 | GO:1903960 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) negative regulation of anion transmembrane transport(GO:1903960) |
| 0.0 | 0.1 | GO:0014040 | regulation of Schwann cell differentiation(GO:0014038) positive regulation of Schwann cell differentiation(GO:0014040) |
| 0.0 | 0.1 | GO:0035669 | TRAM-dependent toll-like receptor signaling pathway(GO:0035668) TRAM-dependent toll-like receptor 4 signaling pathway(GO:0035669) |
| 0.0 | 0.0 | GO:0002901 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 0.0 | 0.8 | GO:0042753 | positive regulation of circadian rhythm(GO:0042753) |
| 0.0 | 0.0 | GO:0006844 | acyl carnitine transport(GO:0006844) acyl carnitine transmembrane transport(GO:1902616) |
| 0.0 | 0.7 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.0 | 0.1 | GO:0006498 | N-terminal protein lipidation(GO:0006498) N-terminal protein palmitoylation(GO:0006500) |
| 0.0 | 0.8 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
| 0.0 | 0.5 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.0 | 0.3 | GO:1900045 | negative regulation of histone ubiquitination(GO:0033183) negative regulation of protein K63-linked ubiquitination(GO:1900045) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.0 | 0.2 | GO:0030578 | PML body organization(GO:0030578) |
| 0.0 | 0.1 | GO:0051685 | maintenance of ER location(GO:0051685) |
| 0.0 | 0.1 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
| 0.0 | 0.1 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.0 | 0.2 | GO:0071918 | urea transmembrane transport(GO:0071918) |
| 0.0 | 0.1 | GO:0046452 | dihydrofolate metabolic process(GO:0046452) |
| 0.0 | 0.2 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.0 | 0.5 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
| 0.0 | 0.1 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
| 0.0 | 0.6 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.0 | 0.2 | GO:0051012 | microtubule sliding(GO:0051012) |
| 0.0 | 0.0 | GO:0060664 | epithelial cell proliferation involved in salivary gland morphogenesis(GO:0060664) |
| 0.0 | 0.5 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
| 0.0 | 0.1 | GO:0071503 | response to heparin(GO:0071503) |
| 0.0 | 0.3 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.0 | 0.1 | GO:0039692 | single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) |
| 0.0 | 0.7 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
| 0.0 | 0.2 | GO:0060681 | branch elongation involved in ureteric bud branching(GO:0060681) |
| 0.0 | 0.1 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.0 | 0.2 | GO:0030242 | pexophagy(GO:0030242) |
| 0.0 | 0.5 | GO:0007021 | tubulin complex assembly(GO:0007021) |
| 0.0 | 0.1 | GO:2000691 | negative regulation of cardioblast differentiation(GO:0051892) regulation of cardiac muscle cell myoblast differentiation(GO:2000690) negative regulation of cardiac muscle cell myoblast differentiation(GO:2000691) |
| 0.0 | 0.2 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.0 | 0.3 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.0 | 0.2 | GO:0014028 | notochord formation(GO:0014028) |
| 0.0 | 0.5 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.0 | 0.2 | GO:0061737 | leukotriene signaling pathway(GO:0061737) |
| 0.0 | 0.4 | GO:1902260 | negative regulation of delayed rectifier potassium channel activity(GO:1902260) |
| 0.0 | 0.2 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.0 | 0.4 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.0 | 0.1 | GO:0046851 | negative regulation of bone remodeling(GO:0046851) |
| 0.0 | 0.5 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
| 0.0 | 0.5 | GO:0016540 | protein autoprocessing(GO:0016540) |
| 0.0 | 0.1 | GO:0042756 | drinking behavior(GO:0042756) |
| 0.0 | 0.2 | GO:0030202 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.0 | 0.1 | GO:0006258 | UDP-glucose catabolic process(GO:0006258) |
| 0.0 | 0.1 | GO:0061534 | gamma-aminobutyric acid secretion, neurotransmission(GO:0061534) |
| 0.0 | 0.1 | GO:0042148 | strand invasion(GO:0042148) |
| 0.0 | 0.5 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.0 | 0.1 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
| 0.0 | 0.1 | GO:1904729 | regulation of intestinal cholesterol absorption(GO:0030300) regulation of intestinal lipid absorption(GO:1904729) |
| 0.0 | 0.0 | GO:0045976 | negative regulation of mitotic cell cycle, embryonic(GO:0045976) |
| 0.0 | 0.2 | GO:1902572 | negative regulation of serine-type endopeptidase activity(GO:1900004) negative regulation of serine-type peptidase activity(GO:1902572) |
| 0.0 | 0.1 | GO:1903551 | extracellular exosome assembly(GO:0071971) regulation of extracellular exosome assembly(GO:1903551) |
| 0.0 | 0.3 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
| 0.0 | 0.1 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) nucleotide-sugar catabolic process(GO:0009227) |
| 0.0 | 0.2 | GO:2000020 | positive regulation of male gonad development(GO:2000020) |
| 0.0 | 0.1 | GO:0048382 | mesendoderm development(GO:0048382) |
| 0.0 | 1.4 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
| 0.0 | 0.1 | GO:0035803 | egg coat formation(GO:0035803) |
| 0.0 | 0.1 | GO:0021586 | pons maturation(GO:0021586) superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
| 0.0 | 0.3 | GO:0003190 | atrioventricular valve formation(GO:0003190) |
| 0.0 | 0.1 | GO:0002517 | T cell tolerance induction(GO:0002517) |
| 0.0 | 0.3 | GO:0032310 | prostaglandin transport(GO:0015732) prostaglandin secretion(GO:0032310) |
| 0.0 | 0.0 | GO:0030432 | peristalsis(GO:0030432) |
| 0.0 | 0.0 | GO:0070662 | mast cell proliferation(GO:0070662) regulation of mast cell proliferation(GO:0070666) positive regulation of mast cell proliferation(GO:0070668) |
| 0.0 | 0.2 | GO:0014050 | negative regulation of glutamate secretion(GO:0014050) |
| 0.0 | 0.1 | GO:0060174 | limb bud formation(GO:0060174) |
| 0.0 | 0.1 | GO:1902766 | skeletal muscle satellite cell migration(GO:1902766) |
| 0.0 | 0.1 | GO:0048550 | negative regulation of pinocytosis(GO:0048550) |
| 0.0 | 0.1 | GO:0032305 | positive regulation of icosanoid secretion(GO:0032305) positive regulation of fatty acid transport(GO:2000193) |
| 0.0 | 0.1 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.0 | 0.3 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
| 0.0 | 0.2 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
| 0.0 | 0.1 | GO:0090656 | t-circle formation(GO:0090656) |
| 0.0 | 0.6 | GO:0008228 | opsonization(GO:0008228) |
| 0.0 | 0.2 | GO:0048875 | chemical homeostasis within a tissue(GO:0048875) |
| 0.0 | 0.6 | GO:0070168 | negative regulation of biomineral tissue development(GO:0070168) |
| 0.0 | 0.1 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.0 | 0.1 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.0 | 0.2 | GO:0045046 | protein import into peroxisome membrane(GO:0045046) |
| 0.0 | 0.2 | GO:0038166 | angiotensin-activated signaling pathway(GO:0038166) |
| 0.0 | 0.5 | GO:2000272 | negative regulation of receptor activity(GO:2000272) |
| 0.0 | 0.4 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.0 | 0.1 | GO:0009804 | coumarin metabolic process(GO:0009804) |
| 0.0 | 0.2 | GO:0070365 | hepatocyte differentiation(GO:0070365) |
| 0.0 | 0.1 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.0 | 0.1 | GO:0045919 | positive regulation of cytolysis(GO:0045919) |
| 0.0 | 0.8 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
| 0.0 | 0.1 | GO:0019242 | methylglyoxal biosynthetic process(GO:0019242) |
| 0.0 | 0.1 | GO:0021684 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.0 | 0.2 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.0 | 0.1 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 0.0 | 0.3 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.0 | 0.1 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.0 | 0.3 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.0 | 0.7 | GO:0046856 | phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.0 | 0.1 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.0 | 0.1 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.0 | 0.1 | GO:2000252 | negative regulation of feeding behavior(GO:2000252) |
| 0.0 | 0.1 | GO:0002118 | aggressive behavior(GO:0002118) |
| 0.0 | 0.5 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
| 0.0 | 0.4 | GO:0042737 | drug catabolic process(GO:0042737) |
| 0.0 | 0.9 | GO:0045824 | negative regulation of innate immune response(GO:0045824) |
| 0.0 | 0.3 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
| 0.0 | 0.1 | GO:1902612 | regulation of anti-Mullerian hormone signaling pathway(GO:1902612) negative regulation of anti-Mullerian hormone signaling pathway(GO:1902613) anti-Mullerian hormone signaling pathway(GO:1990262) |
| 0.0 | 0.3 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
| 0.0 | 0.0 | GO:0052405 | negative regulation by host of symbiont molecular function(GO:0052405) |
| 0.0 | 0.3 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.0 | 2.9 | GO:0050911 | detection of chemical stimulus involved in sensory perception of smell(GO:0050911) |
| 0.0 | 0.4 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
| 0.0 | 0.2 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.0 | 0.5 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
| 0.0 | 0.2 | GO:0051415 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.0 | 0.1 | GO:0045950 | regulation of mitotic recombination(GO:0000019) negative regulation of mitotic recombination(GO:0045950) |
| 0.0 | 0.1 | GO:0014858 | positive regulation of skeletal muscle cell proliferation(GO:0014858) positive regulation of skeletal muscle satellite cell proliferation(GO:1902724) positive regulation of growth factor dependent skeletal muscle satellite cell proliferation(GO:1902728) |
| 0.0 | 0.3 | GO:0021681 | cerebellar granular layer development(GO:0021681) |
| 0.0 | 0.1 | GO:0006532 | fumarate metabolic process(GO:0006106) aspartate biosynthetic process(GO:0006532) |
| 0.0 | 0.3 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.0 | 0.2 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.0 | 0.1 | GO:0017185 | peptidyl-lysine hydroxylation(GO:0017185) |
| 0.0 | 0.2 | GO:0032202 | telomere assembly(GO:0032202) |
| 0.0 | 0.1 | GO:0016598 | protein arginylation(GO:0016598) |
| 0.0 | 0.2 | GO:0032966 | negative regulation of collagen biosynthetic process(GO:0032966) |
| 0.0 | 0.3 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
| 0.0 | 0.0 | GO:0050976 | detection of mechanical stimulus involved in sensory perception of touch(GO:0050976) |
| 0.0 | 0.5 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
| 0.0 | 0.7 | GO:0048286 | lung alveolus development(GO:0048286) |
| 0.0 | 0.1 | GO:0042816 | vitamin B6 metabolic process(GO:0042816) |
| 0.0 | 0.1 | GO:0042415 | norepinephrine metabolic process(GO:0042415) |
| 0.0 | 0.0 | GO:1904938 | dopaminergic neuron axon guidance(GO:0036514) serotonergic neuron axon guidance(GO:0036515) planar cell polarity pathway involved in axon guidance(GO:1904938) |
| 0.0 | 0.0 | GO:0030885 | regulation of myeloid dendritic cell activation(GO:0030885) |
| 0.0 | 0.5 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
| 0.0 | 0.1 | GO:0003050 | regulation of systemic arterial blood pressure by atrial natriuretic peptide(GO:0003050) |
| 0.0 | 0.1 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
| 0.0 | 2.5 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
| 0.0 | 0.1 | GO:0048842 | positive regulation of axon extension involved in axon guidance(GO:0048842) |
| 0.0 | 0.1 | GO:0033512 | L-lysine catabolic process to acetyl-CoA via saccharopine(GO:0033512) |
| 0.0 | 0.5 | GO:0045776 | negative regulation of blood pressure(GO:0045776) |
| 0.0 | 0.2 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.0 | 0.1 | GO:0060235 | lens induction in camera-type eye(GO:0060235) |
| 0.0 | 0.1 | GO:0060295 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
| 0.0 | 0.1 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.0 | 0.1 | GO:0007057 | spindle assembly involved in female meiosis I(GO:0007057) |
| 0.0 | 0.3 | GO:0019885 | antigen processing and presentation of endogenous peptide antigen(GO:0002483) antigen processing and presentation of endogenous peptide antigen via MHC class I(GO:0019885) |
| 0.0 | 0.4 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.0 | 0.0 | GO:0033076 | isoquinoline alkaloid metabolic process(GO:0033076) phytoalexin metabolic process(GO:0052314) |
| 0.0 | 0.1 | GO:0051177 | meiotic sister chromatid cohesion(GO:0051177) |
| 0.0 | 0.3 | GO:0042269 | regulation of natural killer cell mediated cytotoxicity(GO:0042269) |
| 0.0 | 0.0 | GO:0010700 | negative regulation of norepinephrine secretion(GO:0010700) |
| 0.0 | 0.1 | GO:0060789 | hair follicle placode formation(GO:0060789) |
| 0.0 | 0.0 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.0 | 0.1 | GO:0043335 | protein unfolding(GO:0043335) |
| 0.0 | 0.1 | GO:0010002 | cardioblast differentiation(GO:0010002) |
| 0.0 | 3.0 | GO:0061418 | regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061418) |
| 0.0 | 0.1 | GO:0015822 | mitochondrial ornithine transport(GO:0000066) ornithine transport(GO:0015822) |
| 0.0 | 0.1 | GO:1903490 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 0.0 | 0.6 | GO:0051898 | negative regulation of protein kinase B signaling(GO:0051898) |
| 0.0 | 0.9 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
| 0.0 | 0.1 | GO:0034224 | cellular response to zinc ion starvation(GO:0034224) |
| 0.0 | 0.1 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.0 | 0.5 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.0 | 0.2 | GO:0046874 | quinolinate biosynthetic process(GO:0019805) quinolinate metabolic process(GO:0046874) |
| 0.0 | 0.1 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 0.0 | 0.9 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.0 | 0.1 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.0 | 0.1 | GO:0008343 | adult feeding behavior(GO:0008343) |
| 0.0 | 0.3 | GO:0008595 | tripartite regional subdivision(GO:0007351) anterior/posterior axis specification, embryo(GO:0008595) |
| 0.0 | 0.4 | GO:0035338 | long-chain fatty-acyl-CoA biosynthetic process(GO:0035338) |
| 0.0 | 0.3 | GO:0006704 | glucocorticoid biosynthetic process(GO:0006704) |
| 0.0 | 0.1 | GO:0071934 | thiamine transmembrane transport(GO:0071934) |
| 0.0 | 0.3 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
| 0.0 | 0.1 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.0 | 0.1 | GO:0006196 | AMP catabolic process(GO:0006196) |
| 0.0 | 0.3 | GO:0001771 | immunological synapse formation(GO:0001771) |
| 0.0 | 0.3 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.0 | 0.1 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
| 0.0 | 0.3 | GO:0051156 | glucose 6-phosphate metabolic process(GO:0051156) |
| 0.0 | 0.2 | GO:0061669 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
| 0.0 | 0.1 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.0 | 0.0 | GO:0036102 | leukotriene catabolic process(GO:0036100) leukotriene B4 catabolic process(GO:0036101) leukotriene B4 metabolic process(GO:0036102) icosanoid catabolic process(GO:1901523) fatty acid derivative catabolic process(GO:1901569) |
| 0.0 | 0.1 | GO:0003339 | regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003339) |
| 0.0 | 0.1 | GO:0030238 | male sex determination(GO:0030238) |
| 0.0 | 0.2 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.0 | 0.3 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
| 0.0 | 0.2 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.0 | 0.1 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.0 | 0.0 | GO:1903895 | negative regulation of IRE1-mediated unfolded protein response(GO:1903895) |
| 0.0 | 0.1 | GO:0048213 | Golgi vesicle prefusion complex stabilization(GO:0048213) |
| 0.0 | 0.0 | GO:0048769 | sarcomerogenesis(GO:0048769) |
| 0.0 | 1.1 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
| 0.0 | 0.1 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
| 0.0 | 0.2 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.0 | 0.2 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
| 0.0 | 0.2 | GO:0000012 | single strand break repair(GO:0000012) |
| 0.0 | 0.4 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.0 | 0.1 | GO:1990564 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.0 | 0.2 | GO:1903543 | positive regulation of exosomal secretion(GO:1903543) |
| 0.0 | 0.1 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.0 | 0.3 | GO:0042755 | eating behavior(GO:0042755) |
| 0.0 | 0.2 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
| 0.0 | 0.1 | GO:0021578 | hindbrain maturation(GO:0021578) central nervous system maturation(GO:0021626) |
| 0.0 | 0.9 | GO:0060395 | SMAD protein signal transduction(GO:0060395) |
| 0.0 | 0.1 | GO:0033504 | floor plate development(GO:0033504) |
| 0.0 | 0.1 | GO:0007191 | adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
| 0.0 | 0.1 | GO:0060283 | negative regulation of oocyte development(GO:0060283) regulation of oocyte maturation(GO:1900193) negative regulation of oocyte maturation(GO:1900194) |
| 0.0 | 0.0 | GO:0042701 | progesterone secretion(GO:0042701) |
| 0.0 | 0.1 | GO:1990167 | protein K27-linked deubiquitination(GO:1990167) |
| 0.0 | 0.1 | GO:0072178 | nephric duct morphogenesis(GO:0072178) |
| 0.0 | 0.4 | GO:0035640 | exploration behavior(GO:0035640) |
| 0.0 | 0.2 | GO:0048793 | pronephros development(GO:0048793) |
| 0.0 | 0.1 | GO:0003310 | pancreatic A cell differentiation(GO:0003310) |
| 0.0 | 0.1 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.0 | 0.2 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.0 | 0.1 | GO:0003056 | regulation of vascular smooth muscle contraction(GO:0003056) |
| 0.0 | 0.1 | GO:0046813 | receptor-mediated virion attachment to host cell(GO:0046813) |
| 0.0 | 0.3 | GO:0071379 | cellular response to prostaglandin stimulus(GO:0071379) |
| 0.0 | 0.2 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.0 | 0.3 | GO:0048311 | mitochondrion distribution(GO:0048311) |
| 0.0 | 0.1 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
| 0.0 | 1.5 | GO:0030049 | muscle filament sliding(GO:0030049) actin-myosin filament sliding(GO:0033275) |
| 0.0 | 0.1 | GO:0016198 | axon choice point recognition(GO:0016198) |
| 0.0 | 0.2 | GO:0060742 | epithelial cell differentiation involved in prostate gland development(GO:0060742) |
| 0.0 | 0.1 | GO:0007343 | egg activation(GO:0007343) |
| 0.0 | 0.6 | GO:0051482 | positive regulation of cytosolic calcium ion concentration involved in phospholipase C-activating G-protein coupled signaling pathway(GO:0051482) |
| 0.0 | 0.5 | GO:0032570 | response to progesterone(GO:0032570) |
| 0.0 | 0.1 | GO:0035521 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
| 0.0 | 0.3 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
| 0.0 | 0.8 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.0 | 0.2 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.0 | 0.2 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.0 | 1.7 | GO:0042303 | molting cycle(GO:0042303) hair cycle(GO:0042633) |
| 0.0 | 0.6 | GO:0035428 | hexose transmembrane transport(GO:0035428) glucose transmembrane transport(GO:1904659) |
| 0.0 | 0.0 | GO:0071035 | nuclear ncRNA surveillance(GO:0071029) nuclear polyadenylation-dependent rRNA catabolic process(GO:0071035) nuclear polyadenylation-dependent ncRNA catabolic process(GO:0071046) |
| 0.0 | 0.1 | GO:0021854 | hypothalamus development(GO:0021854) |
| 0.0 | 0.0 | GO:0071907 | determination of digestive tract left/right asymmetry(GO:0071907) |
| 0.0 | 0.6 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
| 0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 | 0.1 | GO:0097398 | response to interleukin-17(GO:0097396) cellular response to interleukin-17(GO:0097398) |
| 0.0 | 0.1 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.0 | 0.1 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.0 | 0.1 | GO:0098886 | modification of dendritic spine(GO:0098886) |
| 0.0 | 2.2 | GO:0070268 | cornification(GO:0070268) |
| 0.0 | 0.0 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
| 0.0 | 0.1 | GO:0048696 | collateral sprouting in absence of injury(GO:0048669) regulation of collateral sprouting in absence of injury(GO:0048696) negative regulation of collateral sprouting in absence of injury(GO:0048698) |
| 0.0 | 0.1 | GO:0043418 | homocysteine catabolic process(GO:0043418) |
| 0.0 | 0.1 | GO:0007000 | nucleolus organization(GO:0007000) |
| 0.0 | 0.2 | GO:0006570 | tyrosine metabolic process(GO:0006570) |
| 0.0 | 0.1 | GO:0003266 | regulation of secondary heart field cardioblast proliferation(GO:0003266) |
| 0.0 | 0.2 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.0 | 0.2 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
| 0.0 | 0.1 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.0 | 0.2 | GO:0006828 | manganese ion transport(GO:0006828) |
| 0.0 | 0.2 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.0 | 0.0 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.0 | 0.1 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
| 0.0 | 0.1 | GO:0045872 | positive regulation of rhodopsin gene expression(GO:0045872) |
| 0.0 | 0.1 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.0 | 0.1 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.0 | 0.1 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.0 | 0.0 | GO:0003418 | growth plate cartilage chondrocyte differentiation(GO:0003418) |
| 0.0 | 0.1 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
| 0.0 | 0.9 | GO:0007029 | endoplasmic reticulum organization(GO:0007029) |
| 0.0 | 0.1 | GO:1904874 | positive regulation of telomerase RNA localization to Cajal body(GO:1904874) |
| 0.0 | 0.1 | GO:1902415 | regulation of mRNA binding(GO:1902415) |
| 0.0 | 0.1 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
| 0.0 | 0.0 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
| 0.0 | 0.1 | GO:0072679 | thymocyte migration(GO:0072679) |
| 0.0 | 0.3 | GO:0010107 | potassium ion import(GO:0010107) |
| 0.0 | 0.2 | GO:0019532 | oxalate transport(GO:0019532) |
| 0.0 | 0.1 | GO:0061436 | establishment of skin barrier(GO:0061436) |
| 0.0 | 0.1 | GO:1900112 | regulation of histone H3-K9 trimethylation(GO:1900112) |
| 0.0 | 0.2 | GO:0086065 | cell communication involved in cardiac conduction(GO:0086065) |
| 0.0 | 0.2 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.0 | 0.1 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
| 0.0 | 0.0 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.0 | 0.1 | GO:0070346 | positive regulation of fat cell proliferation(GO:0070346) |
| 0.0 | 0.1 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
| 0.0 | 0.0 | GO:0006857 | oligopeptide transport(GO:0006857) |
| 0.0 | 0.2 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.0 | 1.3 | GO:1903955 | positive regulation of protein targeting to mitochondrion(GO:1903955) |
| 0.0 | 0.1 | GO:1904685 | maintenance of blood-brain barrier(GO:0035633) positive regulation of metalloendopeptidase activity(GO:1904685) |
| 0.0 | 0.1 | GO:0046476 | glycosylceramide biosynthetic process(GO:0046476) |
| 0.0 | 0.0 | GO:0010637 | regulation of mitochondrial fusion(GO:0010635) negative regulation of mitochondrial fusion(GO:0010637) |
| 0.0 | 0.1 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) |
| 0.0 | 0.0 | GO:1902544 | regulation of DNA N-glycosylase activity(GO:1902544) |
| 0.0 | 0.1 | GO:0071233 | cellular response to leucine(GO:0071233) |
| 0.0 | 0.0 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.0 | 0.1 | GO:0039694 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.0 | 0.0 | GO:0000469 | cleavage involved in rRNA processing(GO:0000469) |
| 0.0 | 0.1 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
| 0.0 | 0.1 | GO:0032484 | Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
| 0.0 | 0.0 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
| 0.0 | 0.1 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.0 | 0.0 | GO:0060600 | dichotomous subdivision of an epithelial terminal unit(GO:0060600) |
| 0.0 | 0.1 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
| 0.0 | 0.2 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.0 | 0.1 | GO:1904352 | positive regulation of protein catabolic process in the vacuole(GO:1904352) |
| 0.0 | 0.2 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.0 | 0.3 | GO:0030501 | positive regulation of bone mineralization(GO:0030501) |
| 0.0 | 0.1 | GO:0060314 | regulation of ryanodine-sensitive calcium-release channel activity(GO:0060314) |
| 0.0 | 0.1 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.0 | 0.0 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.0 | 0.2 | GO:0036149 | phosphatidylinositol acyl-chain remodeling(GO:0036149) |
| 0.0 | 0.1 | GO:0000479 | endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
| 0.0 | 0.1 | GO:0016998 | cell wall macromolecule catabolic process(GO:0016998) cell wall macromolecule metabolic process(GO:0044036) cell wall organization or biogenesis(GO:0071554) |
| 0.0 | 0.1 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.0 | 0.1 | GO:0046549 | retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
| 0.0 | 0.2 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
| 0.0 | 0.0 | GO:0043686 | co-translational protein modification(GO:0043686) |
| 0.0 | 0.0 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
| 0.0 | 0.0 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.0 | 0.2 | GO:0060292 | long term synaptic depression(GO:0060292) |
| 0.0 | 0.1 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) |
| 0.0 | 0.0 | GO:0046543 | development of secondary sexual characteristics(GO:0045136) development of secondary female sexual characteristics(GO:0046543) |
| 0.0 | 0.0 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.0 | 0.1 | GO:0016078 | tRNA catabolic process(GO:0016078) |
| 0.0 | 0.1 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
| 0.0 | 0.3 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
| 0.0 | 0.2 | GO:0033750 | ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
| 0.0 | 0.1 | GO:0051673 | membrane disruption in other organism(GO:0051673) |
| 0.0 | 0.1 | GO:0016188 | synaptic vesicle maturation(GO:0016188) |
| 0.0 | 0.1 | GO:0043045 | DNA methylation involved in embryo development(GO:0043045) changes to DNA methylation involved in embryo development(GO:1901538) |
| 0.0 | 0.1 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
| 0.0 | 0.2 | GO:0035493 | SNARE complex assembly(GO:0035493) |
| 0.0 | 0.4 | GO:0042531 | positive regulation of tyrosine phosphorylation of STAT protein(GO:0042531) |
| 0.0 | 0.1 | GO:0045072 | interferon-gamma biosynthetic process(GO:0042095) regulation of interferon-gamma biosynthetic process(GO:0045072) |
| 0.0 | 0.2 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
| 0.0 | 0.1 | GO:1903275 | regulation of sodium ion export(GO:1903273) positive regulation of sodium ion export(GO:1903275) regulation of sodium ion export from cell(GO:1903276) positive regulation of sodium ion export from cell(GO:1903278) |
| 0.0 | 0.1 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
| 0.0 | 0.1 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.0 | 0.4 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
| 0.0 | 0.2 | GO:0060236 | regulation of mitotic spindle organization(GO:0060236) |
| 0.0 | 0.0 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) |
| 0.0 | 0.0 | GO:0090119 | vesicle-mediated cholesterol transport(GO:0090119) |
| 0.0 | 0.1 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 0.0 | 0.1 | GO:0021678 | third ventricle development(GO:0021678) |
| 0.0 | 0.6 | GO:0051865 | protein autoubiquitination(GO:0051865) |
| 0.0 | 0.0 | GO:0071459 | protein localization to chromosome, centromeric region(GO:0071459) |
| 0.0 | 0.0 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.0 | 0.1 | GO:0071493 | cellular response to UV-B(GO:0071493) |
| 0.0 | 0.1 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.0 | 0.3 | GO:0051290 | protein heterotetramerization(GO:0051290) |
| 0.0 | 0.2 | GO:0030261 | chromosome condensation(GO:0030261) |
| 0.0 | 0.0 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.0 | 0.1 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.0 | 1.0 | GO:0090630 | activation of GTPase activity(GO:0090630) |
| 0.0 | 0.3 | GO:0006337 | nucleosome disassembly(GO:0006337) |
| 0.0 | 0.3 | GO:0045071 | negative regulation of viral genome replication(GO:0045071) |
| 0.0 | 0.7 | GO:0001895 | retina homeostasis(GO:0001895) |
| 0.0 | 0.2 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
| 0.0 | 0.4 | GO:0051250 | negative regulation of lymphocyte activation(GO:0051250) |
| 0.0 | 0.2 | GO:0007608 | sensory perception of smell(GO:0007608) |
| 0.0 | 0.1 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
| 0.0 | 0.1 | GO:0017121 | phospholipid scrambling(GO:0017121) |
| 0.0 | 0.1 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
| 0.0 | 1.7 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
| 0.0 | 0.2 | GO:0046329 | negative regulation of JNK cascade(GO:0046329) |
| 0.0 | 0.0 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
| 0.0 | 0.1 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.0 | 0.5 | GO:0030317 | sperm motility(GO:0030317) |
| 0.0 | 0.1 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.0 | 0.0 | GO:0019470 | 4-hydroxyproline catabolic process(GO:0019470) |
| 0.0 | 0.4 | GO:0061337 | cardiac conduction(GO:0061337) |
| 0.0 | 0.0 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
| 0.0 | 0.2 | GO:0032108 | negative regulation of response to extracellular stimulus(GO:0032105) negative regulation of response to nutrient levels(GO:0032108) |
| 0.0 | 0.2 | GO:0097034 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.0 | 0.0 | GO:1901355 | response to rapamycin(GO:1901355) |
| 0.0 | 0.1 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.0 | 0.0 | GO:0045196 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
| 0.0 | 1.3 | GO:0008037 | cell recognition(GO:0008037) |
| 0.0 | 0.3 | GO:0050982 | detection of mechanical stimulus(GO:0050982) |
| 0.0 | 0.0 | GO:0061047 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) regulation of branching involved in lung morphogenesis(GO:0061046) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
| 0.0 | 0.0 | GO:0035063 | nuclear speck organization(GO:0035063) |
| 0.0 | 0.2 | GO:0051973 | positive regulation of telomerase activity(GO:0051973) |
| 0.0 | 0.1 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
| 0.0 | 0.8 | GO:0042147 | retrograde transport, endosome to Golgi(GO:0042147) |
| 0.0 | 0.2 | GO:0060285 | cilium-dependent cell motility(GO:0060285) |
| 0.0 | 0.2 | GO:0002076 | osteoblast development(GO:0002076) |
| 0.0 | 0.6 | GO:0032006 | regulation of TOR signaling(GO:0032006) |
| 0.0 | 0.0 | GO:0061762 | CAMKK-AMPK signaling cascade(GO:0061762) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 0.9 | GO:0005607 | laminin-2 complex(GO:0005607) |
| 0.3 | 2.6 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.2 | 0.7 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
| 0.2 | 0.7 | GO:0043511 | inhibin complex(GO:0043511) inhibin A complex(GO:0043512) |
| 0.2 | 0.7 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.2 | 0.6 | GO:0097450 | astrocyte end-foot(GO:0097450) |
| 0.2 | 1.3 | GO:0035692 | macrophage migration inhibitory factor receptor complex(GO:0035692) |
| 0.2 | 4.3 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.2 | 4.2 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.2 | 1.6 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
| 0.2 | 1.4 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.2 | 0.5 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.1 | 1.1 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.1 | 0.8 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.1 | 0.4 | GO:0097489 | multivesicular body, internal vesicle lumen(GO:0097489) |
| 0.1 | 1.1 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 0.1 | 0.9 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.1 | 0.6 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.1 | 1.2 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
| 0.1 | 1.7 | GO:0033268 | node of Ranvier(GO:0033268) |
| 0.1 | 0.3 | GO:0042565 | RNA nuclear export complex(GO:0042565) |
| 0.1 | 0.3 | GO:0097598 | sperm cytoplasmic droplet(GO:0097598) |
| 0.1 | 0.5 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
| 0.1 | 0.4 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.1 | 0.8 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.1 | 0.4 | GO:0030891 | VCB complex(GO:0030891) |
| 0.1 | 0.3 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
| 0.1 | 0.7 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.1 | 0.4 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.1 | 1.0 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.1 | 2.2 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.1 | 0.3 | GO:0031417 | NatC complex(GO:0031417) |
| 0.1 | 0.2 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.1 | 0.4 | GO:1990425 | ryanodine receptor complex(GO:1990425) |
| 0.1 | 1.2 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.1 | 0.3 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.1 | 0.7 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.1 | 0.3 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
| 0.1 | 0.3 | GO:0008043 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
| 0.1 | 0.2 | GO:0002139 | stereocilia coupling link(GO:0002139) |
| 0.1 | 0.4 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
| 0.1 | 0.2 | GO:0009330 | DNA topoisomerase complex (ATP-hydrolyzing)(GO:0009330) |
| 0.1 | 0.3 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.1 | 0.3 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.1 | 0.2 | GO:0033565 | ESCRT-0 complex(GO:0033565) |
| 0.1 | 2.1 | GO:0097381 | photoreceptor disc membrane(GO:0097381) |
| 0.1 | 1.6 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.1 | 0.2 | GO:1990923 | PET complex(GO:1990923) |
| 0.1 | 0.2 | GO:0071159 | NF-kappaB complex(GO:0071159) |
| 0.1 | 0.2 | GO:0032144 | 4-aminobutyrate transaminase complex(GO:0032144) |
| 0.1 | 0.2 | GO:0005889 | hydrogen:potassium-exchanging ATPase complex(GO:0005889) |
| 0.1 | 1.0 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.1 | 0.2 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.1 | 0.5 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.1 | 0.2 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.1 | 0.2 | GO:0030689 | Noc complex(GO:0030689) |
| 0.1 | 0.2 | GO:0071821 | FANCM-MHF complex(GO:0071821) |
| 0.1 | 1.2 | GO:0005861 | troponin complex(GO:0005861) |
| 0.1 | 0.5 | GO:0098642 | network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) |
| 0.1 | 0.2 | GO:0033597 | mitotic checkpoint complex(GO:0033597) bub1-bub3 complex(GO:1990298) |
| 0.1 | 0.4 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.1 | 4.1 | GO:0015030 | Cajal body(GO:0015030) |
| 0.1 | 0.6 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.1 | 0.2 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.1 | 0.2 | GO:0043159 | acrosomal matrix(GO:0043159) |
| 0.1 | 0.2 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.1 | 0.2 | GO:0005960 | glycine cleavage complex(GO:0005960) |
| 0.0 | 0.4 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.0 | 0.5 | GO:0099634 | postsynaptic specialization membrane(GO:0099634) |
| 0.0 | 0.1 | GO:0072588 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) |
| 0.0 | 0.8 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.0 | 0.4 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.0 | 0.5 | GO:0000801 | central element(GO:0000801) |
| 0.0 | 0.1 | GO:0036398 | TCR signalosome(GO:0036398) |
| 0.0 | 1.3 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
| 0.0 | 0.4 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.0 | 0.2 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.0 | 0.3 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.0 | 0.3 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.0 | 0.2 | GO:1990578 | perinuclear endoplasmic reticulum membrane(GO:1990578) |
| 0.0 | 1.5 | GO:0030673 | axolemma(GO:0030673) |
| 0.0 | 1.1 | GO:0042627 | chylomicron(GO:0042627) |
| 0.0 | 0.1 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
| 0.0 | 0.3 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.0 | 1.0 | GO:0005922 | connexon complex(GO:0005922) |
| 0.0 | 0.6 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.0 | 0.2 | GO:0034669 | integrin alpha4-beta7 complex(GO:0034669) |
| 0.0 | 0.2 | GO:0000811 | GINS complex(GO:0000811) |
| 0.0 | 0.4 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.0 | 0.4 | GO:0016589 | NURF complex(GO:0016589) |
| 0.0 | 0.5 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.0 | 0.2 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.0 | 0.4 | GO:0005638 | lamin filament(GO:0005638) |
| 0.0 | 0.2 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.0 | 0.2 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.0 | 1.2 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.0 | 0.3 | GO:0070187 | telosome(GO:0070187) |
| 0.0 | 0.3 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.0 | 1.7 | GO:0019814 | immunoglobulin complex(GO:0019814) immunoglobulin complex, circulating(GO:0042571) |
| 0.0 | 0.2 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.0 | 0.1 | GO:0000438 | core TFIIH complex portion of holo TFIIH complex(GO:0000438) |
| 0.0 | 0.1 | GO:0005873 | plus-end kinesin complex(GO:0005873) kinesin II complex(GO:0016939) |
| 0.0 | 0.1 | GO:0031436 | BRCA1-BARD1 complex(GO:0031436) |
| 0.0 | 0.4 | GO:0016342 | catenin complex(GO:0016342) |
| 0.0 | 0.1 | GO:0031523 | Myb complex(GO:0031523) |
| 0.0 | 0.2 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.0 | 0.9 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.0 | 0.1 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
| 0.0 | 0.4 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.0 | 0.2 | GO:0034448 | EGO complex(GO:0034448) |
| 0.0 | 0.2 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.0 | 0.3 | GO:0034688 | integrin alphaM-beta2 complex(GO:0034688) |
| 0.0 | 0.1 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.0 | 0.2 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.0 | 0.3 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.0 | 0.2 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
| 0.0 | 0.1 | GO:0031085 | BLOC-3 complex(GO:0031085) |
| 0.0 | 0.3 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.0 | 0.9 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
| 0.0 | 0.2 | GO:0032279 | asymmetric synapse(GO:0032279) |
| 0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
| 0.0 | 0.1 | GO:0045160 | myosin I complex(GO:0045160) |
| 0.0 | 0.0 | GO:0098592 | cytoplasmic side of apical plasma membrane(GO:0098592) |
| 0.0 | 0.2 | GO:0036021 | endolysosome lumen(GO:0036021) |
| 0.0 | 0.7 | GO:0046930 | pore complex(GO:0046930) |
| 0.0 | 0.3 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 0.1 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.0 | 0.2 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.0 | 1.6 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 0.2 | GO:0000923 | equatorial microtubule organizing center(GO:0000923) |
| 0.0 | 0.1 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.0 | 0.2 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.0 | 0.4 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.0 | 0.8 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.0 | 0.2 | GO:0031010 | ISWI-type complex(GO:0031010) |
| 0.0 | 0.2 | GO:0098559 | cytoplasmic side of early endosome membrane(GO:0098559) cytoplasmic side of late endosome membrane(GO:0098560) |
| 0.0 | 0.2 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.0 | 0.1 | GO:0061673 | mitotic spindle astral microtubule(GO:0061673) |
| 0.0 | 1.0 | GO:0005859 | muscle myosin complex(GO:0005859) |
| 0.0 | 0.3 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 0.2 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.0 | 0.4 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.0 | 1.5 | GO:0001533 | cornified envelope(GO:0001533) |
| 0.0 | 0.5 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.0 | 0.2 | GO:0070522 | nucleotide-excision repair factor 1 complex(GO:0000110) ERCC4-ERCC1 complex(GO:0070522) |
| 0.0 | 1.9 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.0 | 0.6 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.0 | 0.2 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.0 | 0.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.0 | 0.1 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.0 | 0.2 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.0 | 0.8 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.0 | 0.2 | GO:0097413 | Lewy body(GO:0097413) |
| 0.0 | 0.4 | GO:0090543 | Flemming body(GO:0090543) |
| 0.0 | 0.1 | GO:0017102 | methionyl glutamyl tRNA synthetase complex(GO:0017102) |
| 0.0 | 2.2 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 0.1 | GO:0098574 | cytoplasmic side of lysosomal membrane(GO:0098574) |
| 0.0 | 0.3 | GO:0031089 | platelet dense granule lumen(GO:0031089) |
| 0.0 | 0.4 | GO:0005858 | axonemal dynein complex(GO:0005858) |
| 0.0 | 1.5 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
| 0.0 | 0.1 | GO:1990423 | RZZ complex(GO:1990423) |
| 0.0 | 0.2 | GO:0016942 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) |
| 0.0 | 0.1 | GO:0032044 | DSIF complex(GO:0032044) |
| 0.0 | 0.3 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.0 | 2.5 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
| 0.0 | 0.1 | GO:0032010 | phagolysosome(GO:0032010) |
| 0.0 | 0.4 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.0 | 0.7 | GO:0032420 | stereocilium(GO:0032420) |
| 0.0 | 0.1 | GO:0033165 | interphotoreceptor matrix(GO:0033165) |
| 0.0 | 0.3 | GO:0044292 | dendrite terminus(GO:0044292) |
| 0.0 | 0.0 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.0 | 0.1 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.0 | 0.6 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.0 | 0.1 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
| 0.0 | 1.1 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 0.2 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.0 | 0.2 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.0 | 0.2 | GO:0071438 | invadopodium membrane(GO:0071438) |
| 0.0 | 0.3 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.0 | 0.3 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.0 | 0.0 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.0 | 0.1 | GO:0097444 | spine apparatus(GO:0097444) |
| 0.0 | 0.0 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.0 | 0.1 | GO:0042643 | actomyosin, actin portion(GO:0042643) |
| 0.0 | 0.1 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.0 | 0.3 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.0 | 0.4 | GO:0036019 | endolysosome(GO:0036019) |
| 0.0 | 0.2 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.0 | 0.2 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.0 | 0.3 | GO:0042827 | platelet dense granule membrane(GO:0031088) platelet dense granule(GO:0042827) |
| 0.0 | 0.1 | GO:0000836 | Hrd1p ubiquitin ligase complex(GO:0000836) |
| 0.0 | 1.1 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.0 | 0.4 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
| 0.0 | 0.1 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 0.1 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.0 | 0.1 | GO:1990745 | EARP complex(GO:1990745) |
| 0.0 | 0.3 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.0 | 0.5 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.0 | 0.2 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.0 | 0.1 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.0 | 0.3 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.0 | 0.0 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.0 | 1.9 | GO:0035579 | specific granule membrane(GO:0035579) |
| 0.0 | 0.1 | GO:0031673 | H zone(GO:0031673) |
| 0.0 | 3.7 | GO:0009897 | external side of plasma membrane(GO:0009897) |
| 0.0 | 0.2 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.0 | 0.5 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.0 | 0.1 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.0 | 0.1 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
| 0.0 | 1.4 | GO:0034707 | chloride channel complex(GO:0034707) |
| 0.0 | 0.2 | GO:0044295 | axonal growth cone(GO:0044295) |
| 0.0 | 0.1 | GO:0089701 | U2AF(GO:0089701) |
| 0.0 | 0.1 | GO:0034464 | BBSome(GO:0034464) |
| 0.0 | 0.9 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.0 | 0.3 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.0 | 0.8 | GO:0000786 | nucleosome(GO:0000786) |
| 0.0 | 0.1 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.0 | 0.1 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.0 | 4.3 | GO:0019898 | extrinsic component of membrane(GO:0019898) |
| 0.0 | 0.2 | GO:0044298 | neuronal cell body membrane(GO:0032809) cell body membrane(GO:0044298) |
| 0.0 | 0.1 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.0 | 0.4 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.0 | 0.5 | GO:0000791 | euchromatin(GO:0000791) |
| 0.0 | 0.2 | GO:0001741 | XY body(GO:0001741) |
| 0.0 | 0.2 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.0 | 0.2 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.0 | 0.0 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.0 | 1.4 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.0 | 0.2 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.0 | 0.3 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
| 0.0 | 0.1 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.0 | 0.4 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.0 | 0.1 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.0 | 0.5 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.0 | 0.1 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.0 | 0.4 | GO:0070821 | tertiary granule membrane(GO:0070821) |
| 0.0 | 0.0 | GO:0009368 | endopeptidase Clp complex(GO:0009368) |
| 0.0 | 0.2 | GO:0000800 | lateral element(GO:0000800) |
| 0.0 | 0.2 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.0 | 0.2 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.0 | 0.2 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.4 | 4.3 | GO:0008859 | exoribonuclease II activity(GO:0008859) |
| 0.8 | 9.0 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.6 | 2.8 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
| 0.5 | 2.1 | GO:0009041 | uridylate kinase activity(GO:0009041) |
| 0.4 | 1.3 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
| 0.3 | 1.0 | GO:0061663 | NEDD8 ligase activity(GO:0061663) |
| 0.3 | 1.3 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 0.3 | 1.0 | GO:0032038 | myosin II heavy chain binding(GO:0032038) |
| 0.3 | 1.0 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.2 | 0.7 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.2 | 0.7 | GO:0070336 | flap-structured DNA binding(GO:0070336) |
| 0.2 | 1.6 | GO:0047894 | flavonol 3-sulfotransferase activity(GO:0047894) |
| 0.2 | 4.5 | GO:0008556 | potassium-transporting ATPase activity(GO:0008556) |
| 0.2 | 0.2 | GO:0097604 | temperature-gated cation channel activity(GO:0097604) |
| 0.2 | 0.6 | GO:0004878 | complement component C5a receptor activity(GO:0004878) |
| 0.2 | 1.7 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.2 | 0.2 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.2 | 1.1 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.2 | 0.6 | GO:0070699 | type II activin receptor binding(GO:0070699) |
| 0.2 | 0.7 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 0.2 | 1.8 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.2 | 0.7 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.2 | 1.0 | GO:0004118 | cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) |
| 0.2 | 0.5 | GO:0033878 | hormone-sensitive lipase activity(GO:0033878) |
| 0.2 | 1.5 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.2 | 0.5 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.2 | 3.1 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.2 | 0.8 | GO:0048030 | disaccharide binding(GO:0048030) |
| 0.2 | 0.9 | GO:0004447 | iodide peroxidase activity(GO:0004447) |
| 0.2 | 0.8 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
| 0.2 | 0.5 | GO:0070364 | mitochondrial light strand promoter anti-sense binding(GO:0070361) mitochondrial heavy strand promoter anti-sense binding(GO:0070362) mitochondrial heavy strand promoter sense binding(GO:0070364) |
| 0.2 | 1.7 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.2 | 0.6 | GO:0005289 | high-affinity basic amino acid transmembrane transporter activity(GO:0005287) high-affinity arginine transmembrane transporter activity(GO:0005289) high-affinity lysine transmembrane transporter activity(GO:0005292) |
| 0.1 | 0.4 | GO:0050528 | acyloxyacyl hydrolase activity(GO:0050528) |
| 0.1 | 0.4 | GO:0035403 | histone kinase activity (H3-T6 specific)(GO:0035403) |
| 0.1 | 0.4 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.1 | 0.1 | GO:0051120 | hepoxilin A3 synthase activity(GO:0051120) |
| 0.1 | 0.4 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.1 | 0.4 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.1 | 0.4 | GO:0004040 | amidase activity(GO:0004040) |
| 0.1 | 0.7 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 0.1 | 0.7 | GO:0004991 | parathyroid hormone receptor activity(GO:0004991) |
| 0.1 | 0.6 | GO:0086020 | gap junction channel activity involved in SA node cell-atrial cardiac muscle cell electrical coupling(GO:0086020) |
| 0.1 | 0.4 | GO:0001596 | angiotensin type I receptor activity(GO:0001596) |
| 0.1 | 0.5 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
| 0.1 | 0.4 | GO:0033823 | procollagen-lysine 5-dioxygenase activity(GO:0008475) procollagen glucosyltransferase activity(GO:0033823) |
| 0.1 | 0.3 | GO:0005462 | UDP-N-acetylglucosamine transmembrane transporter activity(GO:0005462) |
| 0.1 | 1.5 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.1 | 0.5 | GO:0003875 | ADP-ribosylarginine hydrolase activity(GO:0003875) |
| 0.1 | 1.1 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.1 | 0.9 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.1 | 0.5 | GO:0034437 | glycoprotein transporter activity(GO:0034437) |
| 0.1 | 0.4 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.1 | 0.9 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
| 0.1 | 0.6 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
| 0.1 | 0.5 | GO:0060422 | peptidyl-dipeptidase inhibitor activity(GO:0060422) |
| 0.1 | 0.5 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.1 | 0.6 | GO:0004910 | interleukin-1, Type II, blocking receptor activity(GO:0004910) |
| 0.1 | 0.4 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.1 | 0.4 | GO:0003983 | UTP:glucose-1-phosphate uridylyltransferase activity(GO:0003983) UTP-monosaccharide-1-phosphate uridylyltransferase activity(GO:0051748) |
| 0.1 | 2.2 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.1 | 0.8 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 0.1 | 0.4 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.1 | 0.9 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.1 | 0.5 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 0.1 | 0.7 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.1 | 0.9 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.1 | 0.6 | GO:0004992 | platelet activating factor receptor activity(GO:0004992) |
| 0.1 | 0.1 | GO:0001855 | complement component C4b binding(GO:0001855) |
| 0.1 | 0.3 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 0.1 | 0.7 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.1 | 0.3 | GO:0004766 | spermidine synthase activity(GO:0004766) |
| 0.1 | 0.3 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.1 | 1.0 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
| 0.1 | 0.7 | GO:0099580 | ion antiporter activity involved in regulation of postsynaptic membrane potential(GO:0099580) |
| 0.1 | 0.3 | GO:0086075 | gap junction channel activity involved in cardiac conduction electrical coupling(GO:0086075) |
| 0.1 | 0.3 | GO:0004818 | glutamate-tRNA ligase activity(GO:0004818) proline-tRNA ligase activity(GO:0004827) |
| 0.1 | 0.3 | GO:0090631 | pre-miRNA transporter activity(GO:0090631) |
| 0.1 | 0.3 | GO:0031768 | ghrelin receptor binding(GO:0031768) |
| 0.1 | 2.0 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.1 | 0.3 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
| 0.1 | 0.4 | GO:0005457 | GDP-fucose transmembrane transporter activity(GO:0005457) purine nucleotide-sugar transmembrane transporter activity(GO:0036080) |
| 0.1 | 0.3 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.1 | 1.9 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
| 0.1 | 0.6 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.1 | 0.6 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.1 | 0.3 | GO:0008476 | protein-tyrosine sulfotransferase activity(GO:0008476) |
| 0.1 | 0.9 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.1 | 0.3 | GO:0004915 | interleukin-6 receptor activity(GO:0004915) interleukin-6 binding(GO:0019981) |
| 0.1 | 0.3 | GO:0016603 | glutaminyl-peptide cyclotransferase activity(GO:0016603) |
| 0.1 | 0.7 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.1 | 0.4 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.1 | 0.1 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
| 0.1 | 0.3 | GO:0033906 | hyaluronoglucuronidase activity(GO:0033906) |
| 0.1 | 0.2 | GO:0010851 | cyclase regulator activity(GO:0010851) |
| 0.1 | 0.2 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
| 0.1 | 0.5 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
| 0.1 | 0.4 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.1 | 0.5 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
| 0.1 | 0.4 | GO:0005503 | all-trans retinal binding(GO:0005503) |
| 0.1 | 0.4 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
| 0.1 | 0.3 | GO:0045155 | electron transporter, transferring electrons from CoQH2-cytochrome c reductase complex and cytochrome c oxidase complex activity(GO:0045155) |
| 0.1 | 0.3 | GO:1901375 | acetylcholine transmembrane transporter activity(GO:0005277) acetate ester transmembrane transporter activity(GO:1901375) |
| 0.1 | 2.6 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.1 | 0.4 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.1 | 0.4 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.1 | 0.3 | GO:0019976 | interleukin-2 receptor activity(GO:0004911) interleukin-2 binding(GO:0019976) |
| 0.1 | 0.3 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) |
| 0.1 | 1.0 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.1 | 0.4 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.1 | 0.2 | GO:0017130 | poly(C) RNA binding(GO:0017130) |
| 0.1 | 0.8 | GO:0046870 | cadmium ion binding(GO:0046870) |
| 0.1 | 0.2 | GO:0046573 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 0.1 | 0.4 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
| 0.1 | 0.4 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
| 0.1 | 2.8 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.1 | 1.3 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.1 | 0.2 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.1 | 0.4 | GO:0004117 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) |
| 0.1 | 2.8 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.1 | 0.3 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
| 0.1 | 1.2 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.1 | 1.5 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.1 | 0.6 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.1 | 0.7 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.1 | 0.4 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.1 | 1.1 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.1 | 0.6 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
| 0.1 | 0.6 | GO:0102337 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.1 | 0.8 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.1 | 1.3 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.1 | 0.6 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.1 | 0.2 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.1 | 0.2 | GO:0004914 | interleukin-5 receptor activity(GO:0004914) |
| 0.1 | 0.1 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
| 0.1 | 0.5 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.1 | 1.1 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.1 | 2.1 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.1 | 0.5 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.1 | 0.3 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.1 | 0.5 | GO:0042608 | T cell receptor binding(GO:0042608) |
| 0.1 | 0.9 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.1 | 0.2 | GO:0050135 | NAD(P)+ nucleosidase activity(GO:0050135) |
| 0.1 | 0.2 | GO:0004464 | leukotriene-C4 synthase activity(GO:0004464) |
| 0.1 | 0.6 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.1 | 0.3 | GO:0008410 | CoA-transferase activity(GO:0008410) |
| 0.1 | 0.2 | GO:0050211 | procollagen galactosyltransferase activity(GO:0050211) |
| 0.1 | 0.2 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
| 0.1 | 0.2 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
| 0.1 | 1.3 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.1 | 0.2 | GO:0004960 | thromboxane receptor activity(GO:0004960) thromboxane A2 receptor activity(GO:0004961) |
| 0.1 | 0.8 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
| 0.1 | 0.2 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
| 0.1 | 0.3 | GO:0005152 | interleukin-1 receptor antagonist activity(GO:0005152) |
| 0.1 | 0.6 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.1 | 0.3 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.1 | 0.1 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.1 | 0.2 | GO:0070259 | tyrosyl-DNA phosphodiesterase activity(GO:0070259) |
| 0.1 | 0.4 | GO:0015307 | drug:proton antiporter activity(GO:0015307) |
| 0.1 | 0.2 | GO:0003867 | 4-aminobutyrate transaminase activity(GO:0003867) succinate-semialdehyde dehydrogenase binding(GO:0032145) (S)-3-amino-2-methylpropionate transaminase activity(GO:0047298) |
| 0.1 | 0.2 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.1 | 1.3 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.1 | 0.1 | GO:0034618 | arginine binding(GO:0034618) |
| 0.1 | 0.4 | GO:0010859 | calcium-dependent cysteine-type endopeptidase inhibitor activity(GO:0010859) |
| 0.1 | 0.6 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.1 | 0.6 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.1 | 1.1 | GO:0005549 | odorant binding(GO:0005549) |
| 0.1 | 0.3 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.1 | 0.2 | GO:0004822 | isoleucine-tRNA ligase activity(GO:0004822) |
| 0.1 | 0.1 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
| 0.1 | 0.2 | GO:0034584 | piRNA binding(GO:0034584) |
| 0.1 | 1.0 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.1 | 0.2 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.1 | 0.8 | GO:0016918 | retinal binding(GO:0016918) |
| 0.1 | 0.3 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
| 0.1 | 0.2 | GO:0004362 | glutathione-disulfide reductase activity(GO:0004362) |
| 0.1 | 0.1 | GO:0016404 | 15-hydroxyprostaglandin dehydrogenase (NAD+) activity(GO:0016404) |
| 0.1 | 0.5 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
| 0.1 | 0.2 | GO:0008426 | protein kinase C inhibitor activity(GO:0008426) |
| 0.1 | 0.2 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
| 0.1 | 1.2 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.1 | 0.7 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.1 | 0.7 | GO:0008517 | folic acid transporter activity(GO:0008517) |
| 0.1 | 0.2 | GO:0008336 | gamma-butyrobetaine dioxygenase activity(GO:0008336) |
| 0.1 | 0.3 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.1 | 0.2 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 0.1 | 0.2 | GO:0030377 | urokinase plasminogen activator receptor activity(GO:0030377) |
| 0.1 | 0.2 | GO:0004597 | peptide-aspartate beta-dioxygenase activity(GO:0004597) |
| 0.0 | 0.1 | GO:0047275 | glucosaminylgalactosylglucosylceramide beta-galactosyltransferase activity(GO:0047275) |
| 0.0 | 0.4 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.0 | 0.2 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.0 | 0.5 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.0 | 0.6 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.0 | 0.6 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.0 | 0.2 | GO:0004031 | aldehyde oxidase activity(GO:0004031) |
| 0.0 | 0.2 | GO:0070513 | death domain binding(GO:0070513) |
| 0.0 | 0.1 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
| 0.0 | 0.2 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
| 0.0 | 0.1 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
| 0.0 | 0.3 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.0 | 0.1 | GO:0070320 | inward rectifier potassium channel inhibitor activity(GO:0070320) |
| 0.0 | 0.3 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 0.0 | 0.2 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
| 0.0 | 0.2 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
| 0.0 | 0.3 | GO:0015185 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
| 0.0 | 0.5 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.0 | 0.2 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.0 | 0.4 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
| 0.0 | 0.1 | GO:0016639 | oxidoreductase activity, acting on the CH-NH2 group of donors, NAD or NADP as acceptor(GO:0016639) |
| 0.0 | 0.2 | GO:0004945 | angiotensin receptor activity(GO:0001595) angiotensin type II receptor activity(GO:0004945) |
| 0.0 | 0.2 | GO:0042806 | fucose binding(GO:0042806) |
| 0.0 | 0.6 | GO:0004568 | chitinase activity(GO:0004568) |
| 0.0 | 0.2 | GO:0035473 | lipase binding(GO:0035473) |
| 0.0 | 0.2 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.0 | 0.2 | GO:0004963 | follicle-stimulating hormone receptor activity(GO:0004963) |
| 0.0 | 0.9 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.0 | 6.1 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.2 | GO:0022897 | peptide:proton symporter activity(GO:0015333) proton-dependent peptide secondary active transmembrane transporter activity(GO:0022897) |
| 0.0 | 0.3 | GO:0050682 | AF-2 domain binding(GO:0050682) |
| 0.0 | 0.5 | GO:0004875 | complement receptor activity(GO:0004875) |
| 0.0 | 1.1 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.0 | 0.1 | GO:0008124 | 4-alpha-hydroxytetrahydrobiopterin dehydratase activity(GO:0008124) |
| 0.0 | 0.2 | GO:0047237 | glucuronylgalactosylproteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047237) |
| 0.0 | 0.3 | GO:0042835 | BRE binding(GO:0042835) |
| 0.0 | 0.2 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
| 0.0 | 0.3 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
| 0.0 | 0.1 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
| 0.0 | 0.1 | GO:0016155 | formyltetrahydrofolate dehydrogenase activity(GO:0016155) |
| 0.0 | 0.3 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 0.0 | 0.3 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
| 0.0 | 0.3 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
| 0.0 | 0.2 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
| 0.0 | 0.4 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.0 | 0.4 | GO:0034485 | phosphatidylinositol-3,4,5-trisphosphate 5-phosphatase activity(GO:0034485) |
| 0.0 | 0.4 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
| 0.0 | 0.2 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
| 0.0 | 1.3 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.0 | 0.2 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.0 | 0.2 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
| 0.0 | 0.6 | GO:0016653 | oxidoreductase activity, acting on NAD(P)H, heme protein as acceptor(GO:0016653) |
| 0.0 | 2.1 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.0 | 0.1 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.0 | 0.1 | GO:0022858 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
| 0.0 | 0.2 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
| 0.0 | 0.2 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
| 0.0 | 0.2 | GO:0047685 | amine sulfotransferase activity(GO:0047685) |
| 0.0 | 0.4 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.0 | 0.2 | GO:0015056 | corticotrophin-releasing factor receptor activity(GO:0015056) |
| 0.0 | 2.0 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.0 | 0.2 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.0 | 0.1 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.0 | 0.1 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.0 | 1.3 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.0 | 0.3 | GO:0060002 | plus-end directed microfilament motor activity(GO:0060002) |
| 0.0 | 0.3 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
| 0.0 | 0.2 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 0.0 | 0.2 | GO:0008466 | glycogenin glucosyltransferase activity(GO:0008466) |
| 0.0 | 0.3 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.0 | 1.2 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
| 0.0 | 0.4 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
| 0.0 | 0.2 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.0 | 0.1 | GO:0004998 | transferrin receptor activity(GO:0004998) |
| 0.0 | 0.3 | GO:0019158 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.0 | 0.4 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.0 | 1.9 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
| 0.0 | 0.7 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.0 | 0.1 | GO:0098770 | FBXO family protein binding(GO:0098770) |
| 0.0 | 0.1 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.0 | 0.1 | GO:0031896 | alpha-1A adrenergic receptor binding(GO:0031691) follicle-stimulating hormone receptor binding(GO:0031762) V2 vasopressin receptor binding(GO:0031896) |
| 0.0 | 0.2 | GO:1902444 | riboflavin binding(GO:1902444) |
| 0.0 | 0.4 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.0 | 0.0 | GO:0015227 | acyl carnitine transmembrane transporter activity(GO:0015227) |
| 0.0 | 0.7 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) |
| 0.0 | 0.1 | GO:0004775 | succinate-CoA ligase (ADP-forming) activity(GO:0004775) |
| 0.0 | 0.2 | GO:0004815 | aspartate-tRNA ligase activity(GO:0004815) |
| 0.0 | 0.3 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
| 0.0 | 0.2 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
| 0.0 | 0.1 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
| 0.0 | 0.2 | GO:0016167 | glial cell-derived neurotrophic factor receptor activity(GO:0016167) |
| 0.0 | 0.9 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.0 | 1.9 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
| 0.0 | 1.1 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.0 | 0.6 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.0 | 0.4 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.0 | 0.1 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.0 | 0.2 | GO:0004473 | malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
| 0.0 | 0.1 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.0 | 0.2 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.0 | 0.2 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.0 | 1.2 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.0 | 0.1 | GO:0016708 | nitric oxide dioxygenase activity(GO:0008941) oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of two atoms of oxygen into one donor(GO:0016708) fatty acid peroxidase activity(GO:0047888) |
| 0.0 | 0.2 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.0 | 0.6 | GO:0019864 | IgG binding(GO:0019864) |
| 0.0 | 0.2 | GO:0047374 | methylumbelliferyl-acetate deacetylase activity(GO:0047374) |
| 0.0 | 0.2 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.0 | 1.1 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.0 | 0.1 | GO:0045499 | chemorepellent activity(GO:0045499) |
| 0.0 | 0.4 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 0.0 | 0.5 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
| 0.0 | 3.4 | GO:0005518 | collagen binding(GO:0005518) |
| 0.0 | 0.1 | GO:0031493 | nucleosomal histone binding(GO:0031493) SAM domain binding(GO:0032093) |
| 0.0 | 0.1 | GO:0008296 | 3'-5'-exodeoxyribonuclease activity(GO:0008296) |
| 0.0 | 0.0 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
| 0.0 | 0.2 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.0 | 0.2 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.0 | 0.2 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.0 | 0.1 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
| 0.0 | 0.1 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.0 | 0.8 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
| 0.0 | 0.1 | GO:0016534 | cyclin-dependent protein kinase 5 activator activity(GO:0016534) |
| 0.0 | 0.2 | GO:0070728 | leucine binding(GO:0070728) |
| 0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.0 | 0.1 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) |
| 0.0 | 1.1 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.0 | 1.5 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
| 0.0 | 0.3 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
| 0.0 | 0.1 | GO:0031531 | thyrotropin-releasing hormone receptor binding(GO:0031531) |
| 0.0 | 0.9 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.0 | 0.8 | GO:0030553 | cGMP binding(GO:0030553) |
| 0.0 | 0.1 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
| 0.0 | 0.1 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
| 0.0 | 0.3 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
| 0.0 | 0.2 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.1 | GO:0004347 | glucose-6-phosphate isomerase activity(GO:0004347) |
| 0.0 | 0.2 | GO:0015119 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.0 | 1.3 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
| 0.0 | 0.1 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
| 0.0 | 0.3 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.0 | 1.6 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.0 | 0.1 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
| 0.0 | 0.7 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.0 | 0.4 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
| 0.0 | 0.6 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.0 | 0.3 | GO:0030369 | ICAM-3 receptor activity(GO:0030369) |
| 0.0 | 0.1 | GO:0004047 | aminomethyltransferase activity(GO:0004047) |
| 0.0 | 0.1 | GO:0070546 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.0 | 0.4 | GO:0016004 | phospholipase activator activity(GO:0016004) |
| 0.0 | 0.2 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.0 | 0.4 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.0 | 0.1 | GO:0004057 | arginyltransferase activity(GO:0004057) |
| 0.0 | 0.4 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
| 0.0 | 0.3 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.0 | 0.3 | GO:0005542 | folic acid binding(GO:0005542) |
| 0.0 | 0.1 | GO:0051731 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) |
| 0.0 | 0.2 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
| 0.0 | 0.2 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.0 | 0.1 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
| 0.0 | 0.4 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.0 | 0.1 | GO:0016748 | succinyltransferase activity(GO:0016748) |
| 0.0 | 0.4 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.0 | 0.1 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.0 | 0.1 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
| 0.0 | 0.1 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
| 0.0 | 0.1 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.0 | 0.2 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 0.0 | 0.3 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.0 | 0.0 | GO:0002060 | purine nucleobase binding(GO:0002060) |
| 0.0 | 0.1 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
| 0.0 | 1.8 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.0 | 0.1 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.0 | 0.2 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.0 | 0.1 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.0 | 0.1 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
| 0.0 | 0.2 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.0 | 0.6 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.0 | 0.1 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.0 | 0.2 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.0 | 0.3 | GO:0005314 | high-affinity glutamate transmembrane transporter activity(GO:0005314) |
| 0.0 | 0.4 | GO:0005328 | neurotransmitter:sodium symporter activity(GO:0005328) |
| 0.0 | 1.0 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.8 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.0 | 0.3 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
| 0.0 | 0.1 | GO:0030626 | U12 snRNA binding(GO:0030626) |
| 0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.0 | 0.2 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.0 | 0.1 | GO:0052895 | norspermine:oxygen oxidoreductase activity(GO:0052894) N1-acetylspermine:oxygen oxidoreductase (N1-acetylspermidine-forming) activity(GO:0052895) |
| 0.0 | 0.7 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
| 0.0 | 0.2 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.0 | 0.0 | GO:0050051 | leukotriene-B4 20-monooxygenase activity(GO:0050051) tocopherol omega-hydroxylase activity(GO:0052870) alpha-tocopherol omega-hydroxylase activity(GO:0052871) 20-hydroxy-leukotriene B4 omega oxidase activity(GO:0097258) 20-aldehyde-leukotriene B4 20-monooxygenase activity(GO:0097259) |
| 0.0 | 0.4 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.0 | 0.1 | GO:0000384 | first spliceosomal transesterification activity(GO:0000384) |
| 0.0 | 0.1 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.0 | 0.1 | GO:0099609 | microtubule lateral binding(GO:0099609) |
| 0.0 | 0.4 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
| 0.0 | 0.6 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
| 0.0 | 0.1 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
| 0.0 | 0.2 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.0 | 0.3 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.0 | 0.1 | GO:0047150 | betaine-homocysteine S-methyltransferase activity(GO:0047150) |
| 0.0 | 0.1 | GO:0051500 | D-aminoacyl-tRNA deacylase activity(GO:0051499) D-tyrosyl-tRNA(Tyr) deacylase activity(GO:0051500) |
| 0.0 | 0.8 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.0 | 0.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.0 | 0.5 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
| 0.0 | 0.3 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.0 | 1.1 | GO:0004407 | histone deacetylase activity(GO:0004407) protein deacetylase activity(GO:0033558) |
| 0.0 | 3.3 | GO:0001047 | core promoter binding(GO:0001047) |
| 0.0 | 1.7 | GO:0002039 | p53 binding(GO:0002039) |
| 0.0 | 0.1 | GO:0033858 | N-acetylgalactosamine kinase activity(GO:0033858) |
| 0.0 | 2.1 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.0 | 0.1 | GO:0004613 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 0.0 | 0.2 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 0.0 | 1.6 | GO:0004984 | olfactory receptor activity(GO:0004984) |
| 0.0 | 0.0 | GO:0035673 | oligopeptide transporter activity(GO:0015198) oligopeptide transmembrane transporter activity(GO:0035673) |
| 0.0 | 0.0 | GO:0008177 | succinate dehydrogenase (ubiquinone) activity(GO:0008177) |
| 0.0 | 0.3 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.0 | 0.7 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.0 | 0.1 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.0 | 0.1 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.0 | 0.1 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
| 0.0 | 0.5 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
| 0.0 | 0.1 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
| 0.0 | 0.2 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.0 | 0.1 | GO:0047322 | [hydroxymethylglutaryl-CoA reductase (NADPH)] kinase activity(GO:0047322) [acetyl-CoA carboxylase] kinase activity(GO:0050405) |
| 0.0 | 0.2 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.0 | 0.2 | GO:0023029 | MHC class Ib protein binding(GO:0023029) |
| 0.0 | 0.1 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.0 | 0.1 | GO:0002046 | opsin binding(GO:0002046) |
| 0.0 | 0.6 | GO:0005080 | protein kinase C binding(GO:0005080) |
| 0.0 | 0.2 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.0 | 0.1 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
| 0.0 | 0.0 | GO:0016433 | rRNA (adenine) methyltransferase activity(GO:0016433) |
| 0.0 | 0.1 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.0 | 0.1 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.1 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
| 0.0 | 0.0 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.0 | 0.1 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.0 | 0.1 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.0 | 0.1 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.0 | 0.2 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
| 0.0 | 0.3 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.0 | 0.3 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.0 | 0.1 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.0 | 0.0 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.0 | 0.2 | GO:0008483 | transaminase activity(GO:0008483) |
| 0.0 | 0.0 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.0 | 0.2 | GO:0043225 | anion transmembrane-transporting ATPase activity(GO:0043225) |
| 0.0 | 0.1 | GO:0004666 | prostaglandin-endoperoxide synthase activity(GO:0004666) |
| 0.0 | 0.2 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.0 | 2.8 | GO:0022832 | voltage-gated ion channel activity(GO:0005244) voltage-gated channel activity(GO:0022832) |
| 0.0 | 0.1 | GO:0001641 | group II metabotropic glutamate receptor activity(GO:0001641) |
| 0.0 | 0.4 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
| 0.0 | 0.3 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.0 | 0.5 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.0 | 0.1 | GO:0031781 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
| 0.0 | 0.1 | GO:0015288 | porin activity(GO:0015288) |
| 0.0 | 0.3 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.0 | 0.7 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.0 | 0.1 | GO:0043495 | protein anchor(GO:0043495) |
| 0.0 | 0.1 | GO:0045174 | oxidoreductase activity, acting on a sulfur group of donors, quinone or similar compound as acceptor(GO:0016672) oxidoreductase activity, acting on phosphorus or arsenic in donors(GO:0030613) oxidoreductase activity, acting on phosphorus or arsenic in donors, disulfide as acceptor(GO:0030614) glutathione dehydrogenase (ascorbate) activity(GO:0045174) methylarsonate reductase activity(GO:0050610) |
| 0.0 | 0.3 | GO:0005272 | sodium channel activity(GO:0005272) |
| 0.0 | 0.1 | GO:0005026 | transforming growth factor beta receptor activity, type II(GO:0005026) |
| 0.0 | 0.1 | GO:0017018 | myosin phosphatase activity(GO:0017018) |
| 0.0 | 0.1 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.0 | 0.0 | GO:0015218 | pyrimidine nucleotide transmembrane transporter activity(GO:0015218) |
| 0.0 | 0.1 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
| 0.0 | 0.2 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
| 0.0 | 0.1 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
| 0.0 | 0.1 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.0 | 0.0 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
| 0.0 | 0.1 | GO:0015266 | protein channel activity(GO:0015266) |
| 0.0 | 0.2 | GO:0031005 | filamin binding(GO:0031005) |
| 0.0 | 0.1 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.0 | 0.2 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.0 | 0.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.0 | 0.1 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.0 | 0.0 | GO:0004951 | cholecystokinin receptor activity(GO:0004951) |
| 0.0 | 0.0 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
| 0.0 | 0.1 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.0 | 0.3 | GO:0005521 | lamin binding(GO:0005521) |
| 0.0 | 0.0 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.0 | 0.2 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
| 0.0 | 0.1 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
| 0.0 | 0.3 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.0 | 0.6 | GO:0016684 | oxidoreductase activity, acting on peroxide as acceptor(GO:0016684) |
| 0.0 | 0.1 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
| 0.0 | 0.1 | GO:0034597 | phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) |
| 0.0 | 0.2 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.0 | 0.0 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
| 0.0 | 0.0 | GO:0005536 | glucose binding(GO:0005536) |
| 0.0 | 2.3 | GO:0017137 | Rab GTPase binding(GO:0017137) |
| 0.0 | 0.0 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.0 | 0.0 | GO:0030627 | pre-mRNA 5'-splice site binding(GO:0030627) |
| 0.0 | 0.1 | GO:0016594 | glycine binding(GO:0016594) |
| 0.0 | 0.1 | GO:0030020 | extracellular matrix structural constituent conferring tensile strength(GO:0030020) |
| 0.0 | 0.0 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.0 | 0.2 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.0 | 0.4 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.0 | 0.0 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.0 | 0.3 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.0 | 2.9 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.0 | 0.1 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.0 | 0.1 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
| 0.0 | 0.3 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.0 | 0.0 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.0 | 0.0 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
| 0.0 | 0.1 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.0 | 0.2 | GO:0008376 | acetylgalactosaminyltransferase activity(GO:0008376) |
| 0.0 | 0.0 | GO:0005326 | neurotransmitter transporter activity(GO:0005326) |
| 0.0 | 0.1 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.0 | 1.0 | GO:0008080 | N-acetyltransferase activity(GO:0008080) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.6 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.1 | 0.4 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.1 | 1.6 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.1 | 2.5 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.1 | 0.8 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.1 | 0.9 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.1 | 0.3 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.1 | 0.3 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.1 | 1.2 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.1 | 1.4 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.1 | 0.8 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.1 | 0.2 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.1 | 3.2 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
| 0.1 | 1.7 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.0 | 1.5 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
| 0.0 | 1.4 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.0 | 0.7 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.0 | 0.3 | ST STAT3 PATHWAY | STAT3 Pathway |
| 0.0 | 1.2 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.0 | 0.8 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.0 | 0.1 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.0 | 0.4 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.0 | 0.8 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 1.5 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.0 | 2.4 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.0 | 1.1 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
| 0.0 | 0.6 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.0 | 3.2 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
| 0.0 | 2.5 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.0 | 0.9 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.0 | 1.4 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.0 | 0.9 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.0 | 0.6 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.0 | 0.5 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 1.0 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
| 0.0 | 1.2 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.0 | 0.7 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 1.9 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.0 | 1.7 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.0 | 0.9 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.0 | 0.2 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.0 | 0.4 | ST ADRENERGIC | Adrenergic Pathway |
| 0.0 | 0.5 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.0 | 0.1 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.0 | 0.2 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.0 | 1.4 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.0 | 0.3 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
| 0.0 | 0.6 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| 0.0 | 0.4 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.0 | 0.4 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 0.5 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
| 0.0 | 0.7 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.0 | 0.3 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.0 | 4.5 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.0 | 0.1 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.0 | 0.3 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 0.1 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.0 | 4.7 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.0 | 0.4 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.0 | 0.6 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 0.3 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.0 | 0.3 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.0 | 0.3 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.0 | 0.9 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 0.3 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.0 | 1.0 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
| 0.0 | 0.3 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.0 | 0.2 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.0 | 0.2 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.0 | 0.2 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.0 | 0.3 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.0 | 0.3 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.0 | 0.6 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
| 0.0 | 0.7 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
| 0.0 | 0.3 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
| 0.0 | 0.2 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 18.2 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.1 | 5.2 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.1 | 0.5 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.1 | 2.2 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.1 | 0.3 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.1 | 2.9 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.1 | 0.3 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.1 | 1.4 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.1 | 4.8 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.1 | 0.2 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
| 0.1 | 0.1 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 0.1 | 0.3 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
| 0.1 | 1.0 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
| 0.1 | 1.0 | REACTOME REVERSIBLE HYDRATION OF CARBON DIOXIDE | Genes involved in Reversible Hydration of Carbon Dioxide |
| 0.1 | 1.5 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.1 | 1.6 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
| 0.1 | 0.1 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
| 0.1 | 1.5 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.1 | 0.8 | REACTOME OPSINS | Genes involved in Opsins |
| 0.1 | 1.1 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.1 | 0.6 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
| 0.1 | 1.8 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.1 | 1.0 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.0 | 0.0 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
| 0.0 | 2.0 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.0 | 1.2 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.0 | 0.8 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
| 0.0 | 1.0 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.0 | 1.2 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.0 | 0.3 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
| 0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
| 0.0 | 1.0 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.0 | 0.6 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.0 | 0.3 | REACTOME ADAPTIVE IMMUNE SYSTEM | Genes involved in Adaptive Immune System |
| 0.0 | 2.1 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
| 0.0 | 0.2 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.0 | 2.1 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.0 | 2.7 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.0 | 0.9 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.0 | 0.8 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.0 | 0.8 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
| 0.0 | 0.1 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
| 0.0 | 1.4 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.0 | 0.1 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.0 | 0.2 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.0 | 1.5 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.0 | 0.3 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.0 | 1.3 | REACTOME INHIBITION OF THE PROTEOLYTIC ACTIVITY OF APC C REQUIRED FOR THE ONSET OF ANAPHASE BY MITOTIC SPINDLE CHECKPOINT COMPONENTS | Genes involved in Inhibition of the proteolytic activity of APC/C required for the onset of anaphase by mitotic spindle checkpoint components |
| 0.0 | 0.7 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.0 | 0.4 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.0 | 1.7 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.0 | 1.3 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 0.0 | 0.9 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.0 | 0.4 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
| 0.0 | 0.3 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
| 0.0 | 0.1 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.0 | 0.7 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.0 | 0.5 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.0 | 1.5 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
| 0.0 | 0.5 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.0 | 1.4 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.0 | 0.2 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 0.0 | 0.8 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
| 0.0 | 1.7 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 0.0 | 2.0 | REACTOME AUTODEGRADATION OF CDH1 BY CDH1 APC C | Genes involved in Autodegradation of Cdh1 by Cdh1:APC/C |
| 0.0 | 0.7 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.0 | 0.6 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
| 0.0 | 1.1 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
| 0.0 | 0.0 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.0 | 1.0 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.0 | 0.9 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.0 | 0.3 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.0 | 0.2 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.0 | 0.3 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.0 | 2.2 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.0 | 2.4 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
| 0.0 | 0.8 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.0 | 0.3 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.0 | 0.2 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.0 | 0.5 | REACTOME ACTIVATED POINT MUTANTS OF FGFR2 | Genes involved in Activated point mutants of FGFR2 |
| 0.0 | 0.3 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.0 | 0.2 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 0.0 | 0.3 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 0.0 | 1.0 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
| 0.0 | 0.2 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
| 0.0 | 0.5 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.0 | 0.1 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.0 | 0.3 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
| 0.0 | 0.6 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.0 | 0.4 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
| 0.0 | 0.7 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.0 | 0.4 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.0 | 0.7 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.0 | 1.2 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.0 | 0.4 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.0 | 0.2 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.0 | 0.2 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.0 | 0.4 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.0 | 0.2 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.0 | 0.8 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
| 0.0 | 0.3 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
| 0.0 | 0.4 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.0 | 0.5 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.0 | 0.3 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
| 0.0 | 0.3 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.0 | 0.5 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
| 0.0 | 0.7 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.0 | 0.3 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.0 | 0.3 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.0 | 0.4 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.0 | 0.4 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
| 0.0 | 5.9 | REACTOME GPCR DOWNSTREAM SIGNALING | Genes involved in GPCR downstream signaling |
| 0.0 | 0.3 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
| 0.0 | 0.4 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 0.5 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
| 0.0 | 0.2 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 0.1 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
| 0.0 | 2.5 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.0 | 0.4 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.0 | 0.5 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.2 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.0 | 0.1 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
| 0.0 | 0.8 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.0 | 0.2 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.0 | 0.2 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.0 | 0.7 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
| 0.0 | 0.1 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.0 | 0.1 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |