Inflammatory response time course, HUVEC (Wada et al., 2009)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
TFDP1
|
ENSG00000198176.8 | transcription factor Dp-1 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| TFDP1 | hg19_v2_chr13_+_114239588_114239752 | -0.72 | 5.8e-05 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr11_-_72353451 | 6.83 |
ENST00000376450.3
|
PDE2A
|
phosphodiesterase 2A, cGMP-stimulated |
| chr1_-_184943610 | 5.17 |
ENST00000367511.3
|
FAM129A
|
family with sequence similarity 129, member A |
| chr11_-_72492878 | 3.40 |
ENST00000535054.1
ENST00000545082.1 |
STARD10
|
StAR-related lipid transfer (START) domain containing 10 |
| chr11_-_72492903 | 3.08 |
ENST00000537947.1
|
STARD10
|
StAR-related lipid transfer (START) domain containing 10 |
| chr5_+_113697983 | 2.99 |
ENST00000264773.3
|
KCNN2
|
potassium intermediate/small conductance calcium-activated channel, subfamily N, member 2 |
| chr10_-_101380121 | 2.94 |
ENST00000370495.4
|
SLC25A28
|
solute carrier family 25 (mitochondrial iron transporter), member 28 |
| chr6_+_37137939 | 2.69 |
ENST00000373509.5
|
PIM1
|
pim-1 oncogene |
| chr1_+_169075554 | 2.55 |
ENST00000367815.4
|
ATP1B1
|
ATPase, Na+/K+ transporting, beta 1 polypeptide |
| chr12_+_52626898 | 2.53 |
ENST00000331817.5
|
KRT7
|
keratin 7 |
| chr19_-_41196458 | 2.50 |
ENST00000598779.1
|
NUMBL
|
numb homolog (Drosophila)-like |
| chr6_-_160148356 | 2.50 |
ENST00000401980.3
ENST00000545162.1 |
SOD2
|
superoxide dismutase 2, mitochondrial |
| chr8_-_37756972 | 2.42 |
ENST00000330843.4
ENST00000522727.1 ENST00000287263.4 |
RAB11FIP1
|
RAB11 family interacting protein 1 (class I) |
| chr13_-_44361025 | 2.33 |
ENST00000261488.6
|
ENOX1
|
ecto-NOX disulfide-thiol exchanger 1 |
| chr16_+_56623433 | 2.31 |
ENST00000570176.1
|
MT3
|
metallothionein 3 |
| chr9_+_35732312 | 2.28 |
ENST00000353704.2
|
CREB3
|
cAMP responsive element binding protein 3 |
| chr1_-_33430286 | 2.27 |
ENST00000373456.7
ENST00000356990.5 ENST00000235150.4 |
RNF19B
|
ring finger protein 19B |
| chr2_-_225907150 | 2.23 |
ENST00000258390.7
|
DOCK10
|
dedicator of cytokinesis 10 |
| chr6_-_137113604 | 2.10 |
ENST00000359015.4
|
MAP3K5
|
mitogen-activated protein kinase kinase kinase 5 |
| chr16_+_50776021 | 2.03 |
ENST00000566679.2
ENST00000564634.1 ENST00000398568.2 |
CYLD
|
cylindromatosis (turban tumor syndrome) |
| chr9_+_116917807 | 2.02 |
ENST00000356083.3
|
COL27A1
|
collagen, type XXVII, alpha 1 |
| chr5_-_59189545 | 1.98 |
ENST00000340635.6
|
PDE4D
|
phosphodiesterase 4D, cAMP-specific |
| chr6_-_128841503 | 1.90 |
ENST00000368215.3
ENST00000532331.1 ENST00000368213.5 ENST00000368207.3 ENST00000525459.1 ENST00000368210.3 ENST00000368226.4 ENST00000368227.3 |
PTPRK
|
protein tyrosine phosphatase, receptor type, K |
| chr1_-_6240183 | 1.87 |
ENST00000262450.3
ENST00000378021.1 |
CHD5
|
chromodomain helicase DNA binding protein 5 |
| chr5_+_133450365 | 1.84 |
ENST00000342854.5
ENST00000321603.6 ENST00000321584.4 ENST00000378564.1 ENST00000395029.1 |
TCF7
|
transcription factor 7 (T-cell specific, HMG-box) |
| chr17_-_41623075 | 1.80 |
ENST00000545089.1
|
ETV4
|
ets variant 4 |
| chr1_+_154193325 | 1.79 |
ENST00000428931.1
ENST00000441890.1 ENST00000271877.7 ENST00000412596.1 ENST00000368504.1 ENST00000437652.1 |
UBAP2L
|
ubiquitin associated protein 2-like |
| chr17_-_41623009 | 1.75 |
ENST00000393664.2
|
ETV4
|
ets variant 4 |
| chr17_-_41623259 | 1.74 |
ENST00000538265.1
ENST00000591713.1 |
ETV4
|
ets variant 4 |
| chr16_+_50775971 | 1.73 |
ENST00000311559.9
ENST00000564326.1 ENST00000566206.1 |
CYLD
|
cylindromatosis (turban tumor syndrome) |
| chr3_-_45267760 | 1.70 |
ENST00000503771.1
|
TMEM158
|
transmembrane protein 158 (gene/pseudogene) |
| chr1_+_6845384 | 1.68 |
ENST00000303635.7
|
CAMTA1
|
calmodulin binding transcription activator 1 |
| chr1_-_6321035 | 1.64 |
ENST00000377893.2
|
GPR153
|
G protein-coupled receptor 153 |
| chr12_-_6798410 | 1.63 |
ENST00000361959.3
ENST00000436774.2 ENST00000544482.1 |
ZNF384
|
zinc finger protein 384 |
| chr3_-_52090461 | 1.61 |
ENST00000296483.6
ENST00000495880.1 |
DUSP7
|
dual specificity phosphatase 7 |
| chr2_+_223725652 | 1.61 |
ENST00000357430.3
ENST00000392066.3 |
ACSL3
|
acyl-CoA synthetase long-chain family member 3 |
| chr17_-_36831156 | 1.61 |
ENST00000325814.5
|
C17orf96
|
chromosome 17 open reading frame 96 |
| chr19_+_38810447 | 1.57 |
ENST00000263372.3
|
KCNK6
|
potassium channel, subfamily K, member 6 |
| chr11_+_85955787 | 1.56 |
ENST00000528180.1
|
EED
|
embryonic ectoderm development |
| chr9_-_123691047 | 1.56 |
ENST00000373887.3
|
TRAF1
|
TNF receptor-associated factor 1 |
| chr16_-_87903079 | 1.55 |
ENST00000261622.4
|
SLC7A5
|
solute carrier family 7 (amino acid transporter light chain, L system), member 5 |
| chr12_-_6798523 | 1.54 |
ENST00000319770.3
|
ZNF384
|
zinc finger protein 384 |
| chr19_-_41196534 | 1.50 |
ENST00000252891.4
|
NUMBL
|
numb homolog (Drosophila)-like |
| chr11_-_19262486 | 1.47 |
ENST00000250024.4
|
E2F8
|
E2F transcription factor 8 |
| chr6_-_134495992 | 1.44 |
ENST00000475719.2
ENST00000367857.5 ENST00000237305.7 |
SGK1
|
serum/glucocorticoid regulated kinase 1 |
| chr1_+_184356188 | 1.44 |
ENST00000235307.6
|
C1orf21
|
chromosome 1 open reading frame 21 |
| chr19_-_50432782 | 1.41 |
ENST00000413454.1
ENST00000596437.1 ENST00000341114.3 ENST00000595948.1 |
NUP62
IL4I1
|
nucleoporin 62kDa interleukin 4 induced 1 |
| chr16_+_50775948 | 1.39 |
ENST00000569681.1
ENST00000569418.1 ENST00000540145.1 |
CYLD
|
cylindromatosis (turban tumor syndrome) |
| chrX_+_30671476 | 1.38 |
ENST00000378946.3
ENST00000378943.3 ENST00000378945.3 ENST00000427190.1 ENST00000378941.3 |
GK
|
glycerol kinase |
| chr16_+_54964740 | 1.38 |
ENST00000394636.4
|
IRX5
|
iroquois homeobox 5 |
| chr11_-_3862059 | 1.37 |
ENST00000396978.1
|
RHOG
|
ras homolog family member G |
| chr17_+_36861735 | 1.36 |
ENST00000378137.5
ENST00000325718.7 |
MLLT6
|
myeloid/lymphoid or mixed-lineage leukemia (trithorax homolog, Drosophila); translocated to, 6 |
| chr7_-_130418888 | 1.35 |
ENST00000310992.4
|
KLF14
|
Kruppel-like factor 14 |
| chr11_+_118307179 | 1.34 |
ENST00000534358.1
ENST00000531904.2 ENST00000389506.5 ENST00000354520.4 |
KMT2A
|
lysine (K)-specific methyltransferase 2A |
| chr15_+_92937144 | 1.33 |
ENST00000539113.1
ENST00000555434.1 |
ST8SIA2
|
ST8 alpha-N-acetyl-neuraminide alpha-2,8-sialyltransferase 2 |
| chr6_+_117996621 | 1.33 |
ENST00000368494.3
|
NUS1
|
nuclear undecaprenyl pyrophosphate synthase 1 homolog (S. cerevisiae) |
| chr19_-_47734448 | 1.33 |
ENST00000439096.2
|
BBC3
|
BCL2 binding component 3 |
| chr5_+_133451254 | 1.33 |
ENST00000517851.1
ENST00000521639.1 ENST00000522375.1 ENST00000378560.4 ENST00000432532.2 ENST00000520958.1 ENST00000518915.1 ENST00000395023.1 |
TCF7
|
transcription factor 7 (T-cell specific, HMG-box) |
| chr3_+_133292759 | 1.32 |
ENST00000431519.2
|
CDV3
|
CDV3 homolog (mouse) |
| chr12_-_6798616 | 1.32 |
ENST00000355772.4
ENST00000417772.3 ENST00000396801.3 ENST00000396799.2 |
ZNF384
|
zinc finger protein 384 |
| chr17_+_45810594 | 1.31 |
ENST00000177694.1
|
TBX21
|
T-box 21 |
| chr15_+_75074410 | 1.30 |
ENST00000439220.2
|
CSK
|
c-src tyrosine kinase |
| chr2_-_224903995 | 1.29 |
ENST00000409304.1
ENST00000454956.1 ENST00000258405.4 |
SERPINE2
|
serpin peptidase inhibitor, clade E (nexin, plasminogen activator inhibitor type 1), member 2 |
| chr1_+_151584544 | 1.28 |
ENST00000458013.2
ENST00000368843.3 |
SNX27
|
sorting nexin family member 27 |
| chr5_+_179105615 | 1.28 |
ENST00000514383.1
|
CANX
|
calnexin |
| chr11_-_46142615 | 1.27 |
ENST00000529734.1
ENST00000323180.6 |
PHF21A
|
PHD finger protein 21A |
| chr21_-_36260980 | 1.27 |
ENST00000344691.4
ENST00000358356.5 |
RUNX1
|
runt-related transcription factor 1 |
| chr6_+_34204642 | 1.27 |
ENST00000347617.6
ENST00000401473.3 ENST00000311487.5 ENST00000447654.1 ENST00000395004.3 |
HMGA1
|
high mobility group AT-hook 1 |
| chr17_+_28256874 | 1.27 |
ENST00000541045.1
ENST00000536908.2 |
EFCAB5
|
EF-hand calcium binding domain 5 |
| chr1_+_4714792 | 1.25 |
ENST00000378190.3
|
AJAP1
|
adherens junctions associated protein 1 |
| chr11_+_58346584 | 1.25 |
ENST00000316059.6
|
ZFP91
|
ZFP91 zinc finger protein |
| chr2_+_47168313 | 1.25 |
ENST00000319190.5
ENST00000394850.2 ENST00000536057.1 |
TTC7A
|
tetratricopeptide repeat domain 7A |
| chr11_-_3862206 | 1.25 |
ENST00000351018.4
|
RHOG
|
ras homolog family member G |
| chr3_+_23244511 | 1.25 |
ENST00000425792.1
|
UBE2E2
|
ubiquitin-conjugating enzyme E2E 2 |
| chr5_-_159546396 | 1.24 |
ENST00000523662.1
ENST00000456329.3 ENST00000307063.7 |
PWWP2A
|
PWWP domain containing 2A |
| chr1_-_150208320 | 1.24 |
ENST00000534220.1
|
ANP32E
|
acidic (leucine-rich) nuclear phosphoprotein 32 family, member E |
| chr14_-_77279153 | 1.23 |
ENST00000251089.2
|
ANGEL1
|
angel homolog 1 (Drosophila) |
| chr12_+_121078355 | 1.23 |
ENST00000316803.3
|
CABP1
|
calcium binding protein 1 |
| chr17_-_28257080 | 1.22 |
ENST00000579954.1
ENST00000540801.1 ENST00000269033.3 ENST00000590153.1 ENST00000582084.1 |
SSH2
|
slingshot protein phosphatase 2 |
| chr12_-_50101003 | 1.22 |
ENST00000550488.1
|
FMNL3
|
formin-like 3 |
| chr19_+_35521616 | 1.19 |
ENST00000595652.1
|
SCN1B
|
sodium channel, voltage-gated, type I, beta subunit |
| chr11_+_13299186 | 1.18 |
ENST00000527998.1
ENST00000396441.3 ENST00000533520.1 ENST00000529825.1 ENST00000389707.4 ENST00000401424.1 ENST00000529388.1 ENST00000530357.1 ENST00000403290.1 ENST00000361003.4 ENST00000389708.3 ENST00000403510.3 ENST00000482049.1 |
ARNTL
|
aryl hydrocarbon receptor nuclear translocator-like |
| chr12_+_122459757 | 1.18 |
ENST00000261822.4
|
BCL7A
|
B-cell CLL/lymphoma 7A |
| chr1_+_89150245 | 1.18 |
ENST00000370513.5
|
PKN2
|
protein kinase N2 |
| chr16_+_2039946 | 1.18 |
ENST00000248121.2
ENST00000568896.1 |
SYNGR3
|
synaptogyrin 3 |
| chr10_+_74451883 | 1.17 |
ENST00000373053.3
ENST00000357157.6 |
MCU
|
mitochondrial calcium uniporter |
| chr6_+_99282570 | 1.17 |
ENST00000328345.5
|
POU3F2
|
POU class 3 homeobox 2 |
| chr11_+_85956182 | 1.17 |
ENST00000327320.4
ENST00000351625.6 ENST00000534595.1 |
EED
|
embryonic ectoderm development |
| chr9_+_17579084 | 1.17 |
ENST00000380607.4
|
SH3GL2
|
SH3-domain GRB2-like 2 |
| chr19_+_50145328 | 1.15 |
ENST00000360565.3
|
SCAF1
|
SR-related CTD-associated factor 1 |
| chr2_+_26256938 | 1.15 |
ENST00000264710.4
|
RAB10
|
RAB10, member RAS oncogene family |
| chr10_+_103892787 | 1.14 |
ENST00000278070.2
ENST00000413464.2 |
PPRC1
|
peroxisome proliferator-activated receptor gamma, coactivator-related 1 |
| chr17_-_56595196 | 1.14 |
ENST00000579921.1
ENST00000579925.1 ENST00000323456.5 |
MTMR4
|
myotubularin related protein 4 |
| chrX_+_64887512 | 1.14 |
ENST00000360270.5
|
MSN
|
moesin |
| chr17_+_17942684 | 1.13 |
ENST00000376345.3
|
GID4
|
GID complex subunit 4 |
| chr6_+_31588478 | 1.12 |
ENST00000376007.4
ENST00000376033.2 |
PRRC2A
|
proline-rich coiled-coil 2A |
| chr5_+_34656569 | 1.11 |
ENST00000428746.2
|
RAI14
|
retinoic acid induced 14 |
| chr16_+_75600247 | 1.10 |
ENST00000037243.2
ENST00000565057.1 ENST00000563744.1 |
GABARAPL2
|
GABA(A) receptor-associated protein-like 2 |
| chr12_-_57522813 | 1.10 |
ENST00000556155.1
|
STAT6
|
signal transducer and activator of transcription 6, interleukin-4 induced |
| chr19_+_14544099 | 1.10 |
ENST00000242783.6
ENST00000586557.1 ENST00000590097.1 |
PKN1
|
protein kinase N1 |
| chr15_+_75074385 | 1.10 |
ENST00000220003.9
|
CSK
|
c-src tyrosine kinase |
| chr1_-_6662919 | 1.10 |
ENST00000377658.4
ENST00000377663.3 |
KLHL21
|
kelch-like family member 21 |
| chr12_-_123849374 | 1.09 |
ENST00000602398.1
ENST00000602750.1 |
SBNO1
|
strawberry notch homolog 1 (Drosophila) |
| chr1_-_144932014 | 1.09 |
ENST00000529945.1
|
PDE4DIP
|
phosphodiesterase 4D interacting protein |
| chr16_+_50187556 | 1.09 |
ENST00000561678.1
ENST00000357464.3 |
PAPD5
|
PAP associated domain containing 5 |
| chrX_-_129244655 | 1.09 |
ENST00000335997.7
|
ELF4
|
E74-like factor 4 (ets domain transcription factor) |
| chr1_+_26438289 | 1.09 |
ENST00000374271.4
ENST00000374269.1 |
PDIK1L
|
PDLIM1 interacting kinase 1 like |
| chr11_-_46142948 | 1.08 |
ENST00000257821.4
|
PHF21A
|
PHD finger protein 21A |
| chr1_-_23670752 | 1.08 |
ENST00000302271.6
ENST00000426846.2 ENST00000427764.2 ENST00000606561.1 ENST00000374616.3 |
HNRNPR
|
heterogeneous nuclear ribonucleoprotein R |
| chr10_+_104678102 | 1.08 |
ENST00000433628.2
|
CNNM2
|
cyclin M2 |
| chr18_-_72265035 | 1.07 |
ENST00000585279.1
ENST00000580048.1 |
LINC00909
|
long intergenic non-protein coding RNA 909 |
| chr6_-_134639180 | 1.07 |
ENST00000367858.5
|
SGK1
|
serum/glucocorticoid regulated kinase 1 |
| chr13_-_33780133 | 1.07 |
ENST00000399365.3
|
STARD13
|
StAR-related lipid transfer (START) domain containing 13 |
| chr19_+_45504688 | 1.06 |
ENST00000221452.8
ENST00000540120.1 ENST00000505236.1 |
RELB
|
v-rel avian reticuloendotheliosis viral oncogene homolog B |
| chr12_+_121570631 | 1.06 |
ENST00000546057.1
ENST00000377162.2 ENST00000328963.5 ENST00000535250.1 ENST00000541446.1 |
P2RX7
|
purinergic receptor P2X, ligand-gated ion channel, 7 |
| chr19_-_40724246 | 1.05 |
ENST00000311308.6
|
TTC9B
|
tetratricopeptide repeat domain 9B |
| chr8_-_125740730 | 1.05 |
ENST00000354184.4
|
MTSS1
|
metastasis suppressor 1 |
| chr17_-_79849438 | 1.05 |
ENST00000331204.4
ENST00000505490.2 |
ALYREF
|
Aly/REF export factor |
| chr15_+_80987617 | 1.05 |
ENST00000258884.4
ENST00000558464.1 |
ABHD17C
|
abhydrolase domain containing 17C |
| chr17_-_72869086 | 1.05 |
ENST00000581530.1
ENST00000420580.2 ENST00000455107.2 ENST00000413947.2 ENST00000581219.1 ENST00000582944.1 |
FDXR
|
ferredoxin reductase |
| chr19_+_17666403 | 1.04 |
ENST00000252599.4
|
COLGALT1
|
collagen beta(1-O)galactosyltransferase 1 |
| chr2_-_74692473 | 1.04 |
ENST00000535045.1
ENST00000409065.1 ENST00000414701.1 ENST00000448666.1 ENST00000233616.4 ENST00000452063.2 |
MOGS
|
mannosyl-oligosaccharide glucosidase |
| chr6_+_116692102 | 1.03 |
ENST00000359564.2
|
DSE
|
dermatan sulfate epimerase |
| chr19_-_14117074 | 1.03 |
ENST00000588885.1
ENST00000254325.4 |
RFX1
|
regulatory factor X, 1 (influences HLA class II expression) |
| chr20_-_31071239 | 1.03 |
ENST00000359676.5
|
C20orf112
|
chromosome 20 open reading frame 112 |
| chr1_-_200992827 | 1.03 |
ENST00000332129.2
ENST00000422435.2 |
KIF21B
|
kinesin family member 21B |
| chr3_-_113415441 | 1.03 |
ENST00000491165.1
ENST00000316407.4 |
KIAA2018
|
KIAA2018 |
| chr17_+_7210898 | 1.02 |
ENST00000572815.1
|
EIF5A
|
eukaryotic translation initiation factor 5A |
| chr8_-_125740514 | 1.02 |
ENST00000325064.5
ENST00000518547.1 |
MTSS1
|
metastasis suppressor 1 |
| chr1_+_28586006 | 1.02 |
ENST00000253063.3
|
SESN2
|
sestrin 2 |
| chr10_+_111767720 | 1.02 |
ENST00000356080.4
ENST00000277900.8 |
ADD3
|
adducin 3 (gamma) |
| chr8_+_27632083 | 1.01 |
ENST00000519637.1
|
ESCO2
|
establishment of sister chromatid cohesion N-acetyltransferase 2 |
| chr3_-_167813132 | 1.00 |
ENST00000309027.4
|
GOLIM4
|
golgi integral membrane protein 4 |
| chr15_+_41245160 | 1.00 |
ENST00000444189.2
ENST00000446533.3 |
CHAC1
|
ChaC, cation transport regulator homolog 1 (E. coli) |
| chr18_+_43914159 | 1.00 |
ENST00000588679.1
ENST00000269439.7 ENST00000543885.1 |
RNF165
|
ring finger protein 165 |
| chr5_-_140998481 | 1.00 |
ENST00000518047.1
|
DIAPH1
|
diaphanous-related formin 1 |
| chr5_-_172662303 | 1.00 |
ENST00000517440.1
ENST00000329198.4 |
NKX2-5
|
NK2 homeobox 5 |
| chr2_+_65216462 | 1.00 |
ENST00000234256.3
|
SLC1A4
|
solute carrier family 1 (glutamate/neutral amino acid transporter), member 4 |
| chr5_+_52776228 | 1.00 |
ENST00000256759.3
|
FST
|
follistatin |
| chr1_-_144932316 | 1.00 |
ENST00000313431.9
|
PDE4DIP
|
phosphodiesterase 4D interacting protein |
| chr15_-_72523454 | 0.99 |
ENST00000565154.1
ENST00000565184.1 ENST00000389093.3 ENST00000449901.2 ENST00000335181.5 ENST00000319622.6 |
PKM
|
pyruvate kinase, muscle |
| chr17_-_4852243 | 0.99 |
ENST00000225655.5
|
PFN1
|
profilin 1 |
| chr1_-_226496772 | 0.99 |
ENST00000359525.2
ENST00000460719.1 |
LIN9
|
lin-9 homolog (C. elegans) |
| chr12_-_53473136 | 0.98 |
ENST00000547837.1
ENST00000301463.4 |
SPRYD3
|
SPRY domain containing 3 |
| chr4_+_140222609 | 0.98 |
ENST00000296543.5
ENST00000398947.1 |
NAA15
|
N(alpha)-acetyltransferase 15, NatA auxiliary subunit |
| chr17_-_72869140 | 0.98 |
ENST00000583917.1
ENST00000293195.5 ENST00000442102.2 |
FDXR
|
ferredoxin reductase |
| chr10_+_70587279 | 0.97 |
ENST00000298596.6
ENST00000399169.4 ENST00000399165.4 ENST00000399162.2 |
STOX1
|
storkhead box 1 |
| chr1_-_110613276 | 0.97 |
ENST00000369792.4
|
ALX3
|
ALX homeobox 3 |
| chr2_+_85981008 | 0.97 |
ENST00000306279.3
|
ATOH8
|
atonal homolog 8 (Drosophila) |
| chr2_-_233352531 | 0.97 |
ENST00000304546.1
|
ECEL1
|
endothelin converting enzyme-like 1 |
| chr1_-_156721502 | 0.95 |
ENST00000357325.5
|
HDGF
|
hepatoma-derived growth factor |
| chr19_-_1863567 | 0.94 |
ENST00000250916.4
|
KLF16
|
Kruppel-like factor 16 |
| chr1_-_23670813 | 0.94 |
ENST00000374612.1
|
HNRNPR
|
heterogeneous nuclear ribonucleoprotein R |
| chr18_+_43913919 | 0.93 |
ENST00000587853.1
|
RNF165
|
ring finger protein 165 |
| chr6_-_86352982 | 0.93 |
ENST00000369622.3
|
SYNCRIP
|
synaptotagmin binding, cytoplasmic RNA interacting protein |
| chr5_-_118324200 | 0.93 |
ENST00000515439.3
ENST00000510708.1 |
DTWD2
|
DTW domain containing 2 |
| chrX_-_129244454 | 0.93 |
ENST00000308167.5
|
ELF4
|
E74-like factor 4 (ets domain transcription factor) |
| chr5_+_52776449 | 0.92 |
ENST00000396947.3
|
FST
|
follistatin |
| chr17_+_1958388 | 0.91 |
ENST00000399849.3
|
HIC1
|
hypermethylated in cancer 1 |
| chr4_-_2758015 | 0.91 |
ENST00000510267.1
ENST00000503235.1 ENST00000315423.7 |
TNIP2
|
TNFAIP3 interacting protein 2 |
| chr17_-_38574169 | 0.91 |
ENST00000423485.1
|
TOP2A
|
topoisomerase (DNA) II alpha 170kDa |
| chr11_-_9113093 | 0.91 |
ENST00000450649.2
|
SCUBE2
|
signal peptide, CUB domain, EGF-like 2 |
| chr2_-_113522177 | 0.91 |
ENST00000541405.1
|
CKAP2L
|
cytoskeleton associated protein 2-like |
| chr20_-_44540686 | 0.90 |
ENST00000477313.1
ENST00000542937.1 ENST00000372431.3 ENST00000354050.4 ENST00000420868.2 |
PLTP
|
phospholipid transfer protein |
| chr6_-_3227877 | 0.90 |
ENST00000259818.7
|
TUBB2B
|
tubulin, beta 2B class IIb |
| chr7_+_44788146 | 0.90 |
ENST00000413916.1
|
ZMIZ2
|
zinc finger, MIZ-type containing 2 |
| chr2_-_113522248 | 0.90 |
ENST00000302450.6
|
CKAP2L
|
cytoskeleton associated protein 2-like |
| chrX_+_154114635 | 0.90 |
ENST00000369446.2
|
F8A1
|
coagulation factor VIII-associated 1 |
| chr15_-_58357866 | 0.90 |
ENST00000537372.1
|
ALDH1A2
|
aldehyde dehydrogenase 1 family, member A2 |
| chr19_+_42788172 | 0.90 |
ENST00000160740.3
|
CIC
|
capicua transcriptional repressor |
| chr1_-_226496898 | 0.90 |
ENST00000481685.1
|
LIN9
|
lin-9 homolog (C. elegans) |
| chr5_+_34656331 | 0.89 |
ENST00000265109.3
|
RAI14
|
retinoic acid induced 14 |
| chrX_-_154688276 | 0.89 |
ENST00000369445.2
|
F8A3
|
coagulation factor VIII-associated 3 |
| chr13_+_95254085 | 0.89 |
ENST00000376958.4
|
GPR180
|
G protein-coupled receptor 180 |
| chr2_-_30144432 | 0.89 |
ENST00000389048.3
|
ALK
|
anaplastic lymphoma receptor tyrosine kinase |
| chr6_+_44095347 | 0.89 |
ENST00000323267.6
|
TMEM63B
|
transmembrane protein 63B |
| chr12_-_57472522 | 0.88 |
ENST00000379391.3
ENST00000300128.4 |
TMEM194A
|
transmembrane protein 194A |
| chr16_-_67281413 | 0.88 |
ENST00000258201.4
|
FHOD1
|
formin homology 2 domain containing 1 |
| chr4_-_5894777 | 0.88 |
ENST00000324989.7
|
CRMP1
|
collapsin response mediator protein 1 |
| chr11_-_9113137 | 0.88 |
ENST00000520467.1
ENST00000309263.3 ENST00000457346.2 |
SCUBE2
|
signal peptide, CUB domain, EGF-like 2 |
| chr17_+_7211280 | 0.88 |
ENST00000419711.2
ENST00000571955.1 ENST00000573714.1 |
EIF5A
|
eukaryotic translation initiation factor 5A |
| chr17_+_7210921 | 0.87 |
ENST00000573542.1
|
EIF5A
|
eukaryotic translation initiation factor 5A |
| chr16_-_79634595 | 0.87 |
ENST00000326043.4
ENST00000393350.1 |
MAF
|
v-maf avian musculoaponeurotic fibrosarcoma oncogene homolog |
| chr17_+_27717415 | 0.87 |
ENST00000583121.1
ENST00000261716.3 |
TAOK1
|
TAO kinase 1 |
| chr5_+_156693091 | 0.87 |
ENST00000318218.6
ENST00000442283.2 ENST00000522463.1 ENST00000521420.1 |
CYFIP2
|
cytoplasmic FMR1 interacting protein 2 |
| chr7_-_27170352 | 0.87 |
ENST00000428284.2
ENST00000360046.5 |
HOXA4
|
homeobox A4 |
| chr12_+_107349497 | 0.87 |
ENST00000548125.1
ENST00000280756.4 |
C12orf23
|
chromosome 12 open reading frame 23 |
| chr15_+_67358163 | 0.87 |
ENST00000327367.4
|
SMAD3
|
SMAD family member 3 |
| chr12_+_107168418 | 0.86 |
ENST00000392839.2
ENST00000548914.1 ENST00000355478.2 ENST00000552619.1 ENST00000549643.1 |
RIC8B
|
RIC8 guanine nucleotide exchange factor B |
| chr19_+_10765003 | 0.86 |
ENST00000407004.3
ENST00000589998.1 ENST00000589600.1 |
ILF3
|
interleukin enhancer binding factor 3, 90kDa |
| chr14_+_32546274 | 0.86 |
ENST00000396582.2
|
ARHGAP5
|
Rho GTPase activating protein 5 |
| chr4_+_94750014 | 0.86 |
ENST00000306011.3
|
ATOH1
|
atonal homolog 1 (Drosophila) |
| chr6_-_86352642 | 0.86 |
ENST00000355238.6
|
SYNCRIP
|
synaptotagmin binding, cytoplasmic RNA interacting protein |
| chr17_-_48133054 | 0.86 |
ENST00000499842.1
|
RP11-1094H24.4
|
RP11-1094H24.4 |
| chr3_-_142166796 | 0.85 |
ENST00000392981.2
|
XRN1
|
5'-3' exoribonuclease 1 |
| chr17_+_79650962 | 0.85 |
ENST00000329138.4
|
HGS
|
hepatocyte growth factor-regulated tyrosine kinase substrate |
| chr5_+_61602055 | 0.84 |
ENST00000381103.2
|
KIF2A
|
kinesin heavy chain member 2A |
| chr3_-_113465065 | 0.84 |
ENST00000497255.1
ENST00000478020.1 ENST00000240922.3 ENST00000493900.1 |
NAA50
|
N(alpha)-acetyltransferase 50, NatE catalytic subunit |
| chr4_-_120549163 | 0.84 |
ENST00000394439.1
ENST00000420633.1 |
PDE5A
|
phosphodiesterase 5A, cGMP-specific |
| chr2_-_174828892 | 0.84 |
ENST00000418194.2
|
SP3
|
Sp3 transcription factor |
| chr9_+_126773880 | 0.84 |
ENST00000373615.4
|
LHX2
|
LIM homeobox 2 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.7 | 5.2 | GO:1990108 | protein linear deubiquitination(GO:1990108) |
| 1.7 | 6.8 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 1.3 | 4.0 | GO:0021849 | neuroblast division in subventricular zone(GO:0021849) |
| 1.0 | 2.9 | GO:0048250 | mitochondrial iron ion transport(GO:0048250) |
| 0.9 | 2.6 | GO:2000374 | regulation of oxygen metabolic process(GO:2000374) |
| 0.7 | 1.3 | GO:2001038 | regulation of cellular response to drug(GO:2001038) |
| 0.6 | 1.9 | GO:0021966 | corticospinal neuron axon guidance(GO:0021966) |
| 0.6 | 3.2 | GO:0048619 | embryonic genitalia morphogenesis(GO:0030538) embryonic hindgut morphogenesis(GO:0048619) |
| 0.6 | 1.3 | GO:0030860 | regulation of polarized epithelial cell differentiation(GO:0030860) |
| 0.6 | 2.3 | GO:1903436 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 0.6 | 1.8 | GO:0045200 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
| 0.6 | 1.7 | GO:0032773 | regulation of monophenol monooxygenase activity(GO:0032771) positive regulation of monophenol monooxygenase activity(GO:0032773) negative regulation of catagen(GO:0051796) regulation of hair cycle by canonical Wnt signaling pathway(GO:0060901) positive regulation of melanosome transport(GO:1902910) |
| 0.5 | 6.5 | GO:0032782 | bile acid secretion(GO:0032782) |
| 0.5 | 1.6 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 0.5 | 2.7 | GO:0044861 | protein transport into plasma membrane raft(GO:0044861) |
| 0.5 | 2.5 | GO:0003070 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 0.5 | 1.4 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 0.5 | 1.9 | GO:0072086 | specification of loop of Henle identity(GO:0072086) |
| 0.5 | 1.4 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.5 | 2.3 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.4 | 1.3 | GO:0016094 | polyprenol biosynthetic process(GO:0016094) |
| 0.4 | 1.7 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.4 | 2.6 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.4 | 3.0 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.4 | 2.1 | GO:0090402 | oncogene-induced cell senescence(GO:0090402) |
| 0.4 | 3.4 | GO:0045905 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.4 | 1.6 | GO:0031291 | Ran protein signal transduction(GO:0031291) |
| 0.4 | 4.1 | GO:0070561 | vitamin D receptor signaling pathway(GO:0070561) |
| 0.4 | 1.1 | GO:0070407 | oxidation-dependent protein catabolic process(GO:0070407) |
| 0.4 | 3.2 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.4 | 1.1 | GO:1904170 | NAD transport(GO:0043132) regulation of bleb assembly(GO:1904170) positive regulation of bleb assembly(GO:1904172) |
| 0.4 | 2.5 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.4 | 1.1 | GO:1904799 | negative regulation of dendrite extension(GO:1903860) regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.3 | 2.1 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.3 | 2.1 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.3 | 2.4 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.3 | 3.1 | GO:0098914 | membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
| 0.3 | 1.2 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.3 | 1.2 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
| 0.3 | 1.2 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.3 | 0.9 | GO:1904616 | regulation of actin filament binding(GO:1904529) negative regulation of actin filament binding(GO:1904530) regulation of actin binding(GO:1904616) negative regulation of actin binding(GO:1904617) |
| 0.3 | 0.9 | GO:1902396 | protein localization to bicellular tight junction(GO:1902396) |
| 0.3 | 1.1 | GO:0002296 | T-helper 1 cell lineage commitment(GO:0002296) |
| 0.3 | 1.1 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
| 0.3 | 0.5 | GO:0006258 | UDP-glucose catabolic process(GO:0006258) |
| 0.3 | 0.8 | GO:0032707 | negative regulation of interleukin-23 production(GO:0032707) |
| 0.3 | 2.7 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.3 | 1.3 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
| 0.3 | 0.8 | GO:0000967 | endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
| 0.3 | 1.3 | GO:0061107 | seminal vesicle development(GO:0061107) |
| 0.3 | 1.6 | GO:0010836 | negative regulation of protein ADP-ribosylation(GO:0010836) |
| 0.3 | 2.3 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.3 | 1.0 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.3 | 0.8 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.2 | 0.5 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.2 | 0.7 | GO:0017186 | peptidyl-pyroglutamic acid biosynthetic process, using glutaminyl-peptide cyclotransferase(GO:0017186) |
| 0.2 | 1.0 | GO:0014040 | positive regulation of Schwann cell differentiation(GO:0014040) |
| 0.2 | 1.2 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.2 | 1.4 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.2 | 0.5 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
| 0.2 | 0.7 | GO:0016185 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
| 0.2 | 1.2 | GO:2001168 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.2 | 1.4 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.2 | 0.7 | GO:0032877 | positive regulation of DNA endoreduplication(GO:0032877) |
| 0.2 | 1.4 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.2 | 0.7 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.2 | 0.9 | GO:0036269 | swimming behavior(GO:0036269) |
| 0.2 | 0.7 | GO:2000681 | negative regulation of rubidium ion transport(GO:2000681) negative regulation of rubidium ion transmembrane transporter activity(GO:2000687) |
| 0.2 | 1.1 | GO:2000639 | regulation of SREBP signaling pathway(GO:2000638) negative regulation of SREBP signaling pathway(GO:2000639) |
| 0.2 | 1.1 | GO:0071409 | cellular response to cycloheximide(GO:0071409) |
| 0.2 | 2.0 | GO:0086024 | adrenergic receptor signaling pathway involved in positive regulation of heart rate(GO:0086024) |
| 0.2 | 1.7 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.2 | 0.4 | GO:0071921 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.2 | 1.3 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.2 | 1.9 | GO:0043634 | polyadenylation-dependent ncRNA catabolic process(GO:0043634) |
| 0.2 | 0.6 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.2 | 0.8 | GO:0044837 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 0.2 | 1.4 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) embryonic process involved in female pregnancy(GO:0060136) |
| 0.2 | 0.6 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.2 | 0.6 | GO:0060380 | regulation of single-stranded telomeric DNA binding(GO:0060380) positive regulation of single-stranded telomeric DNA binding(GO:0060381) |
| 0.2 | 0.4 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.2 | 2.5 | GO:0060453 | regulation of gastric acid secretion(GO:0060453) |
| 0.2 | 1.0 | GO:0007290 | spermatid nucleus elongation(GO:0007290) formaldehyde metabolic process(GO:0046292) |
| 0.2 | 1.5 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.2 | 0.4 | GO:0002268 | follicular dendritic cell differentiation(GO:0002268) |
| 0.2 | 0.8 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
| 0.2 | 1.5 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
| 0.2 | 0.6 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
| 0.2 | 1.1 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
| 0.2 | 0.8 | GO:0033512 | L-lysine catabolic process to acetyl-CoA via saccharopine(GO:0033512) |
| 0.2 | 0.7 | GO:1904862 | inhibitory synapse assembly(GO:1904862) |
| 0.2 | 0.6 | GO:0034970 | histone H3-R2 methylation(GO:0034970) |
| 0.2 | 0.7 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
| 0.2 | 0.9 | GO:0099551 | synaptic signaling via neuropeptide(GO:0099538) trans-synaptic signaling by neuropeptide(GO:0099540) trans-synaptic signaling by neuropeptide, modulating synaptic transmission(GO:0099551) |
| 0.2 | 2.0 | GO:0001866 | NK T cell proliferation(GO:0001866) |
| 0.2 | 0.9 | GO:0048133 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.2 | 1.6 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.2 | 0.9 | GO:1900920 | regulation of amino acid uptake involved in synaptic transmission(GO:0051941) regulation of glutamate uptake involved in transmission of nerve impulse(GO:0051946) regulation of L-glutamate import(GO:1900920) |
| 0.2 | 0.9 | GO:0030859 | polarized epithelial cell differentiation(GO:0030859) |
| 0.2 | 0.5 | GO:0061300 | cerebellum vasculature development(GO:0061300) |
| 0.2 | 0.7 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
| 0.2 | 0.5 | GO:2000705 | dense core granule biogenesis(GO:0061110) regulation of dense core granule biogenesis(GO:2000705) |
| 0.2 | 0.7 | GO:0021592 | fourth ventricle development(GO:0021592) |
| 0.2 | 0.9 | GO:0061767 | negative regulation of lung blood pressure(GO:0061767) |
| 0.2 | 0.7 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.2 | 1.5 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) |
| 0.2 | 1.0 | GO:0015811 | L-alanine transport(GO:0015808) L-cystine transport(GO:0015811) |
| 0.2 | 2.5 | GO:0009629 | response to gravity(GO:0009629) |
| 0.2 | 0.8 | GO:0014050 | negative regulation of glutamate secretion(GO:0014050) |
| 0.2 | 0.8 | GO:0099541 | trans-synaptic signaling by lipid(GO:0099541) trans-synaptic signaling by endocannabinoid(GO:0099542) |
| 0.2 | 0.3 | GO:0046601 | positive regulation of centriole replication(GO:0046601) |
| 0.2 | 0.5 | GO:1904636 | response to ionomycin(GO:1904636) cellular response to ionomycin(GO:1904637) |
| 0.2 | 1.7 | GO:0042904 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.2 | 1.6 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.2 | 0.3 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.2 | 0.5 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.2 | 1.2 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
| 0.1 | 0.3 | GO:0003162 | atrioventricular node development(GO:0003162) |
| 0.1 | 1.2 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.1 | 0.3 | GO:1900114 | positive regulation of histone H3-K9 trimethylation(GO:1900114) |
| 0.1 | 0.4 | GO:0060066 | oviduct development(GO:0060066) |
| 0.1 | 0.1 | GO:0051582 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.1 | 0.9 | GO:0033504 | floor plate development(GO:0033504) |
| 0.1 | 0.7 | GO:2001074 | regulation of metanephric ureteric bud development(GO:2001074) positive regulation of metanephric ureteric bud development(GO:2001076) |
| 0.1 | 1.9 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.1 | 1.6 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
| 0.1 | 1.7 | GO:0055118 | negative regulation of striated muscle contraction(GO:0045988) negative regulation of cardiac muscle contraction(GO:0055118) |
| 0.1 | 0.4 | GO:0071139 | resolution of recombination intermediates(GO:0071139) resolution of mitotic recombination intermediates(GO:0071140) |
| 0.1 | 0.4 | GO:1903233 | regulation of calcium ion-dependent exocytosis of neurotransmitter(GO:1903233) |
| 0.1 | 0.4 | GO:0019072 | viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
| 0.1 | 0.4 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
| 0.1 | 1.0 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.1 | 0.8 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
| 0.1 | 1.7 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.1 | 0.6 | GO:1900104 | hyaluranon cable assembly(GO:0036118) nephrogenic mesenchyme morphogenesis(GO:0072134) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) allantois development(GO:1905069) |
| 0.1 | 0.8 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.1 | 0.8 | GO:0030202 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.1 | 0.8 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
| 0.1 | 2.5 | GO:0010960 | magnesium ion homeostasis(GO:0010960) |
| 0.1 | 0.7 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.1 | 0.4 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.4 | GO:0072386 | plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.1 | 0.5 | GO:0019046 | release from viral latency(GO:0019046) |
| 0.1 | 0.7 | GO:1905075 | occluding junction disassembly(GO:1905071) regulation of occluding junction disassembly(GO:1905073) positive regulation of occluding junction disassembly(GO:1905075) |
| 0.1 | 0.6 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
| 0.1 | 0.4 | GO:0021530 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 0.1 | 2.0 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
| 0.1 | 0.4 | GO:1901207 | regulation of heart looping(GO:1901207) |
| 0.1 | 0.4 | GO:0090611 | ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
| 0.1 | 0.3 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
| 0.1 | 0.9 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.1 | 1.2 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.1 | 0.5 | GO:0050653 | chondroitin sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0050653) |
| 0.1 | 1.2 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.1 | 0.4 | GO:0007057 | spindle assembly involved in female meiosis I(GO:0007057) |
| 0.1 | 0.6 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
| 0.1 | 0.5 | GO:0042418 | epinephrine biosynthetic process(GO:0042418) |
| 0.1 | 1.1 | GO:0061734 | parkin-mediated mitophagy in response to mitochondrial depolarization(GO:0061734) |
| 0.1 | 0.4 | GO:0000960 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.1 | 0.5 | GO:1901355 | response to rapamycin(GO:1901355) |
| 0.1 | 0.7 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.1 | 1.6 | GO:0001767 | establishment of lymphocyte polarity(GO:0001767) |
| 0.1 | 0.1 | GO:2000793 | cell proliferation involved in heart valve development(GO:2000793) |
| 0.1 | 0.8 | GO:1902963 | regulation of metalloendopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902962) negative regulation of metalloendopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902963) |
| 0.1 | 0.1 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.1 | 0.9 | GO:1901858 | regulation of mitochondrial DNA metabolic process(GO:1901858) |
| 0.1 | 0.5 | GO:0072092 | ureteric bud invasion(GO:0072092) |
| 0.1 | 1.0 | GO:0046549 | retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
| 0.1 | 0.2 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) |
| 0.1 | 0.8 | GO:0006207 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.1 | 0.8 | GO:0080009 | mRNA methylation(GO:0080009) |
| 0.1 | 1.6 | GO:1902669 | positive regulation of axon guidance(GO:1902669) |
| 0.1 | 1.0 | GO:0042048 | olfactory behavior(GO:0042048) |
| 0.1 | 0.4 | GO:0019605 | butyrate metabolic process(GO:0019605) |
| 0.1 | 0.8 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.1 | 0.5 | GO:0046108 | uridine metabolic process(GO:0046108) |
| 0.1 | 1.4 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.1 | 0.2 | GO:0010513 | positive regulation of phosphatidylinositol biosynthetic process(GO:0010513) |
| 0.1 | 0.3 | GO:0006423 | cysteinyl-tRNA aminoacylation(GO:0006423) |
| 0.1 | 0.6 | GO:0045631 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.1 | 1.3 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
| 0.1 | 0.7 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.1 | 0.6 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.1 | 0.4 | GO:0009386 | translational attenuation(GO:0009386) |
| 0.1 | 1.6 | GO:0001711 | endodermal cell fate commitment(GO:0001711) |
| 0.1 | 0.4 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
| 0.1 | 1.0 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.1 | 1.4 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
| 0.1 | 0.6 | GO:0097498 | endothelial tube lumen extension(GO:0097498) |
| 0.1 | 0.5 | GO:0071873 | response to norepinephrine(GO:0071873) cellular response to norepinephrine stimulus(GO:0071874) |
| 0.1 | 0.2 | GO:0060166 | olfactory pit development(GO:0060166) |
| 0.1 | 0.7 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.1 | 0.9 | GO:0023035 | CD40 signaling pathway(GO:0023035) |
| 0.1 | 0.2 | GO:0090291 | negative regulation of osteoclast proliferation(GO:0090291) |
| 0.1 | 0.4 | GO:1903691 | positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
| 0.1 | 0.4 | GO:0097676 | histone H3-K36 dimethylation(GO:0097676) |
| 0.1 | 0.8 | GO:0019236 | response to pheromone(GO:0019236) |
| 0.1 | 1.2 | GO:0001967 | suckling behavior(GO:0001967) |
| 0.1 | 2.4 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.1 | 0.6 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.1 | 1.5 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.1 | 0.6 | GO:0035803 | egg coat formation(GO:0035803) |
| 0.1 | 0.5 | GO:2000301 | negative regulation of long term synaptic depression(GO:1900453) regulation of intracellular transport of viral material(GO:1901252) negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.1 | 0.4 | GO:1900248 | cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
| 0.1 | 0.6 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.1 | 0.5 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.1 | 0.5 | GO:2000312 | regulation of kainate selective glutamate receptor activity(GO:2000312) |
| 0.1 | 0.7 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.1 | 0.3 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) cerebral cortex GABAergic interneuron fate commitment(GO:0021893) commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) positive regulation of neural retina development(GO:0061075) positive regulation of retina development in camera-type eye(GO:1902868) positive regulation of amacrine cell differentiation(GO:1902871) |
| 0.1 | 0.7 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
| 0.1 | 0.3 | GO:0046166 | glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 0.1 | 1.1 | GO:0021670 | lateral ventricle development(GO:0021670) |
| 0.1 | 0.9 | GO:0034465 | response to carbon monoxide(GO:0034465) |
| 0.1 | 0.5 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 0.1 | 0.4 | GO:0021684 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.1 | 0.7 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.1 | 0.4 | GO:0042090 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
| 0.1 | 0.5 | GO:0061084 | regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) |
| 0.1 | 1.4 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
| 0.1 | 0.5 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.1 | 0.4 | GO:0035105 | sterol regulatory element binding protein import into nucleus(GO:0035105) |
| 0.1 | 0.8 | GO:0002328 | pro-B cell differentiation(GO:0002328) |
| 0.1 | 0.3 | GO:0043587 | tongue morphogenesis(GO:0043587) |
| 0.1 | 0.3 | GO:0035669 | TRAM-dependent toll-like receptor signaling pathway(GO:0035668) TRAM-dependent toll-like receptor 4 signaling pathway(GO:0035669) |
| 0.1 | 0.3 | GO:0051083 | 'de novo' cotranslational protein folding(GO:0051083) |
| 0.1 | 0.3 | GO:1990926 | short-term synaptic potentiation(GO:1990926) calcium ion regulated lysosome exocytosis(GO:1990927) |
| 0.1 | 0.3 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
| 0.1 | 0.4 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
| 0.1 | 0.2 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
| 0.1 | 0.9 | GO:0010994 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
| 0.1 | 0.2 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
| 0.1 | 0.3 | GO:0009258 | 10-formyltetrahydrofolate catabolic process(GO:0009258) |
| 0.1 | 0.3 | GO:0072237 | distal tubule morphogenesis(GO:0072156) metanephric proximal tubule development(GO:0072237) |
| 0.1 | 0.3 | GO:0033023 | mast cell homeostasis(GO:0033023) mast cell apoptotic process(GO:0033024) regulation of mast cell apoptotic process(GO:0033025) |
| 0.1 | 0.8 | GO:0016191 | synaptic vesicle uncoating(GO:0016191) |
| 0.1 | 1.0 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
| 0.1 | 0.2 | GO:0061743 | motor learning(GO:0061743) |
| 0.1 | 2.1 | GO:1900027 | regulation of ruffle assembly(GO:1900027) |
| 0.1 | 0.7 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
| 0.1 | 0.6 | GO:0006857 | oligopeptide transport(GO:0006857) |
| 0.1 | 0.1 | GO:1903416 | response to glycoside(GO:1903416) |
| 0.1 | 0.3 | GO:0060168 | positive regulation of adenosine receptor signaling pathway(GO:0060168) |
| 0.1 | 0.2 | GO:0030910 | olfactory placode formation(GO:0030910) cranial ganglion development(GO:0061550) trigeminal ganglion development(GO:0061551) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
| 0.1 | 1.1 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
| 0.1 | 0.2 | GO:0007206 | phospholipase C-activating G-protein coupled glutamate receptor signaling pathway(GO:0007206) |
| 0.1 | 1.0 | GO:0042711 | maternal behavior(GO:0042711) parental behavior(GO:0060746) |
| 0.1 | 0.2 | GO:1900154 | regulation of bone trabecula formation(GO:1900154) negative regulation of bone trabecula formation(GO:1900155) |
| 0.1 | 0.2 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
| 0.1 | 0.3 | GO:0007070 | negative regulation of transcription during mitosis(GO:0007068) negative regulation of transcription from RNA polymerase II promoter during mitosis(GO:0007070) |
| 0.1 | 1.1 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.1 | 0.3 | GO:0072369 | regulation of lipid transport by positive regulation of transcription from RNA polymerase II promoter(GO:0072369) |
| 0.1 | 0.2 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.1 | 1.1 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.1 | 0.3 | GO:0060424 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) |
| 0.1 | 0.2 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
| 0.1 | 0.6 | GO:1903593 | regulation of histamine secretion by mast cell(GO:1903593) |
| 0.1 | 0.8 | GO:0009414 | response to water deprivation(GO:0009414) |
| 0.1 | 0.7 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.1 | 1.0 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.1 | 0.2 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
| 0.1 | 1.2 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.1 | 0.7 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.1 | 0.4 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
| 0.1 | 0.3 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.1 | 0.1 | GO:0060372 | regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) |
| 0.1 | 0.6 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 0.1 | 0.2 | GO:0023016 | signal transduction by trans-phosphorylation(GO:0023016) |
| 0.1 | 1.3 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.1 | 0.7 | GO:0090481 | pyrimidine nucleotide-sugar transmembrane transport(GO:0090481) |
| 0.1 | 0.2 | GO:0042137 | sequestering of neurotransmitter(GO:0042137) |
| 0.1 | 1.0 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 0.1 | 0.5 | GO:0097068 | response to thyroxine(GO:0097068) response to L-phenylalanine derivative(GO:1904386) |
| 0.1 | 0.6 | GO:0006477 | protein sulfation(GO:0006477) |
| 0.1 | 0.1 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.1 | 0.6 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.1 | 0.5 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 0.1 | 0.4 | GO:0060371 | regulation of atrial cardiac muscle cell membrane depolarization(GO:0060371) |
| 0.1 | 1.1 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
| 0.1 | 0.6 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
| 0.1 | 0.1 | GO:0002874 | regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) |
| 0.1 | 0.6 | GO:1990573 | potassium ion import across plasma membrane(GO:1990573) |
| 0.1 | 0.1 | GO:0060823 | canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060823) |
| 0.1 | 0.7 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
| 0.1 | 0.1 | GO:0060775 | mediolateral intercalation(GO:0060031) planar cell polarity pathway involved in gastrula mediolateral intercalation(GO:0060775) |
| 0.1 | 0.2 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
| 0.1 | 0.3 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) potassium ion export across plasma membrane(GO:0097623) |
| 0.1 | 0.9 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
| 0.1 | 0.6 | GO:0000056 | ribosomal large subunit export from nucleus(GO:0000055) ribosomal small subunit export from nucleus(GO:0000056) |
| 0.1 | 0.8 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.1 | 0.1 | GO:0032849 | positive regulation of cellular pH reduction(GO:0032849) |
| 0.1 | 0.5 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.1 | 0.2 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.1 | 0.2 | GO:0002188 | formation of cytoplasmic translation initiation complex(GO:0001732) translation reinitiation(GO:0002188) |
| 0.1 | 0.2 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.1 | 0.5 | GO:0002118 | aggressive behavior(GO:0002118) |
| 0.1 | 0.2 | GO:0036124 | histone H3-K9 dimethylation(GO:0036123) histone H3-K9 trimethylation(GO:0036124) |
| 0.1 | 0.6 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
| 0.1 | 1.8 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.1 | 0.5 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.1 | 0.3 | GO:0032241 | positive regulation of nucleobase-containing compound transport(GO:0032241) positive regulation of RNA export from nucleus(GO:0046833) |
| 0.1 | 0.1 | GO:0009608 | response to symbiont(GO:0009608) response to symbiotic bacterium(GO:0009609) |
| 0.1 | 0.5 | GO:0061669 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
| 0.1 | 0.3 | GO:0010624 | regulation of Schwann cell proliferation(GO:0010624) negative regulation of Schwann cell proliferation(GO:0010626) |
| 0.1 | 0.1 | GO:1902299 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 0.1 | 0.1 | GO:0003285 | septum secundum development(GO:0003285) |
| 0.1 | 0.5 | GO:0061298 | retina vasculature development in camera-type eye(GO:0061298) |
| 0.1 | 1.2 | GO:0006828 | manganese ion transport(GO:0006828) |
| 0.1 | 0.3 | GO:0071428 | rRNA transport(GO:0051029) rRNA-containing ribonucleoprotein complex export from nucleus(GO:0071428) |
| 0.1 | 1.2 | GO:0034063 | stress granule assembly(GO:0034063) |
| 0.1 | 0.7 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 | 0.5 | GO:0032057 | negative regulation of translational initiation in response to stress(GO:0032057) |
| 0.1 | 0.3 | GO:0045204 | MAPK export from nucleus(GO:0045204) |
| 0.1 | 1.1 | GO:0070914 | UV-damage excision repair(GO:0070914) |
| 0.1 | 0.2 | GO:1904252 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.1 | 2.2 | GO:0060384 | innervation(GO:0060384) |
| 0.1 | 0.1 | GO:0002265 | astrocyte activation involved in immune response(GO:0002265) |
| 0.1 | 0.4 | GO:1903748 | negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
| 0.1 | 0.2 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.1 | 0.1 | GO:0022614 | membrane to membrane docking(GO:0022614) |
| 0.1 | 0.6 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
| 0.1 | 1.5 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.1 | 0.1 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
| 0.1 | 1.2 | GO:0006751 | glutathione catabolic process(GO:0006751) |
| 0.1 | 0.1 | GO:0014010 | Schwann cell proliferation(GO:0014010) |
| 0.1 | 0.2 | GO:0044209 | AMP salvage(GO:0044209) |
| 0.1 | 0.6 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
| 0.1 | 0.2 | GO:0072592 | oxygen metabolic process(GO:0072592) |
| 0.1 | 0.6 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.1 | 0.1 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
| 0.1 | 0.2 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
| 0.1 | 0.6 | GO:1902369 | negative regulation of RNA catabolic process(GO:1902369) |
| 0.1 | 0.4 | GO:1901836 | regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901836) |
| 0.1 | 0.7 | GO:0045634 | regulation of melanocyte differentiation(GO:0045634) |
| 0.1 | 0.8 | GO:1903543 | positive regulation of exosomal secretion(GO:1903543) |
| 0.1 | 0.7 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.1 | 0.4 | GO:0035864 | response to potassium ion(GO:0035864) |
| 0.1 | 0.3 | GO:0021633 | optic nerve structural organization(GO:0021633) |
| 0.1 | 1.0 | GO:2000171 | negative regulation of dendrite development(GO:2000171) |
| 0.1 | 0.4 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.1 | 0.6 | GO:0045793 | positive regulation of cell size(GO:0045793) |
| 0.1 | 0.3 | GO:0051012 | microtubule sliding(GO:0051012) |
| 0.1 | 0.6 | GO:0045046 | protein import into peroxisome membrane(GO:0045046) |
| 0.1 | 0.7 | GO:0090005 | negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
| 0.1 | 0.2 | GO:0007518 | myoblast fate determination(GO:0007518) |
| 0.1 | 0.6 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.0 | 0.3 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.0 | 1.2 | GO:0051450 | myoblast proliferation(GO:0051450) |
| 0.0 | 0.4 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
| 0.0 | 0.6 | GO:0071420 | cellular response to histamine(GO:0071420) |
| 0.0 | 1.5 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.0 | 0.7 | GO:0051014 | actin filament severing(GO:0051014) |
| 0.0 | 0.7 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.0 | 5.9 | GO:0045727 | positive regulation of translation(GO:0045727) |
| 0.0 | 0.5 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.0 | 0.2 | GO:0036506 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.0 | 0.1 | GO:0060214 | endocardium formation(GO:0060214) |
| 0.0 | 0.3 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.0 | 0.3 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.0 | 0.7 | GO:1903861 | positive regulation of dendrite extension(GO:1903861) |
| 0.0 | 1.4 | GO:0045070 | positive regulation of viral genome replication(GO:0045070) |
| 0.0 | 1.4 | GO:0044380 | protein localization to cytoskeleton(GO:0044380) |
| 0.0 | 0.2 | GO:0032627 | interleukin-23 production(GO:0032627) regulation of interleukin-23 production(GO:0032667) |
| 0.0 | 0.1 | GO:0021503 | neural fold bending(GO:0021503) |
| 0.0 | 1.3 | GO:0050855 | regulation of B cell receptor signaling pathway(GO:0050855) |
| 0.0 | 0.1 | GO:0070874 | negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 0.0 | 0.3 | GO:0061042 | vascular wound healing(GO:0061042) |
| 0.0 | 0.3 | GO:0042335 | cuticle development(GO:0042335) |
| 0.0 | 0.3 | GO:2000825 | positive regulation of androgen receptor activity(GO:2000825) |
| 0.0 | 0.2 | GO:1904046 | negative regulation of vascular endothelial growth factor production(GO:1904046) |
| 0.0 | 0.4 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
| 0.0 | 3.5 | GO:0035722 | interleukin-12-mediated signaling pathway(GO:0035722) cellular response to interleukin-12(GO:0071349) |
| 0.0 | 0.3 | GO:1903504 | regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
| 0.0 | 0.3 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
| 0.0 | 0.4 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
| 0.0 | 0.2 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.0 | 0.4 | GO:0034214 | protein hexamerization(GO:0034214) |
| 0.0 | 1.1 | GO:0032288 | myelin assembly(GO:0032288) |
| 0.0 | 0.9 | GO:0030201 | heparan sulfate proteoglycan metabolic process(GO:0030201) |
| 0.0 | 0.5 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.0 | 0.5 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
| 0.0 | 1.9 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 | 0.1 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.0 | 0.9 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.0 | 0.1 | GO:0006014 | D-ribose metabolic process(GO:0006014) |
| 0.0 | 0.3 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.0 | 0.3 | GO:0071455 | cellular response to hyperoxia(GO:0071455) |
| 0.0 | 0.1 | GO:0050893 | sensory processing(GO:0050893) |
| 0.0 | 0.1 | GO:0006424 | glutamyl-tRNA aminoacylation(GO:0006424) |
| 0.0 | 0.7 | GO:0007100 | mitotic centrosome separation(GO:0007100) |
| 0.0 | 0.2 | GO:2000035 | regulation of stem cell division(GO:2000035) |
| 0.0 | 0.3 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.0 | 1.4 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.0 | 0.5 | GO:0051383 | kinetochore organization(GO:0051383) |
| 0.0 | 0.7 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
| 0.0 | 0.2 | GO:0046465 | dolichyl diphosphate biosynthetic process(GO:0006489) dolichyl diphosphate metabolic process(GO:0046465) |
| 0.0 | 0.4 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.0 | 0.1 | GO:2000824 | proximal tubule development(GO:0072014) regulation of androgen receptor activity(GO:2000823) negative regulation of androgen receptor activity(GO:2000824) |
| 0.0 | 0.1 | GO:2000977 | regulation of forebrain neuron differentiation(GO:2000977) |
| 0.0 | 0.3 | GO:0051561 | positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
| 0.0 | 1.2 | GO:0010591 | regulation of lamellipodium assembly(GO:0010591) |
| 0.0 | 0.4 | GO:0060088 | auditory receptor cell morphogenesis(GO:0002093) auditory receptor cell stereocilium organization(GO:0060088) |
| 0.0 | 0.8 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.0 | 3.4 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
| 0.0 | 0.3 | GO:0006264 | mitochondrial DNA replication(GO:0006264) |
| 0.0 | 0.2 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.0 | 0.5 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.0 | 0.4 | GO:0098779 | mitophagy in response to mitochondrial depolarization(GO:0098779) |
| 0.0 | 0.3 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
| 0.0 | 0.4 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
| 0.0 | 0.4 | GO:0097178 | ruffle assembly(GO:0097178) |
| 0.0 | 0.1 | GO:0009447 | putrescine catabolic process(GO:0009447) |
| 0.0 | 0.4 | GO:0036010 | protein localization to endosome(GO:0036010) |
| 0.0 | 0.5 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.0 | 0.1 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.0 | 0.3 | GO:0015074 | DNA integration(GO:0015074) |
| 0.0 | 0.2 | GO:0031953 | negative regulation of protein autophosphorylation(GO:0031953) |
| 0.0 | 0.5 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
| 0.0 | 1.7 | GO:0035666 | TRIF-dependent toll-like receptor signaling pathway(GO:0035666) |
| 0.0 | 0.6 | GO:1990001 | inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.0 | 0.4 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
| 0.0 | 0.2 | GO:1903575 | cornified envelope assembly(GO:1903575) |
| 0.0 | 0.1 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
| 0.0 | 0.4 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 0.0 | 0.2 | GO:0000076 | DNA replication checkpoint(GO:0000076) |
| 0.0 | 0.2 | GO:1902019 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
| 0.0 | 0.2 | GO:0051549 | positive regulation of keratinocyte migration(GO:0051549) |
| 0.0 | 0.4 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
| 0.0 | 1.4 | GO:0043486 | histone exchange(GO:0043486) |
| 0.0 | 0.1 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
| 0.0 | 0.2 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.0 | 0.1 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
| 0.0 | 0.4 | GO:0098877 | neurotransmitter receptor transport to plasma membrane(GO:0098877) neurotransmitter receptor transport to postsynaptic membrane(GO:0098969) establishment of protein localization to postsynaptic membrane(GO:1903540) |
| 0.0 | 0.1 | GO:0021897 | forebrain astrocyte differentiation(GO:0021896) forebrain astrocyte development(GO:0021897) |
| 0.0 | 0.4 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.0 | 0.1 | GO:0070898 | RNA polymerase III transcriptional preinitiation complex assembly(GO:0070898) |
| 0.0 | 0.1 | GO:0097089 | methyl-branched fatty acid metabolic process(GO:0097089) |
| 0.0 | 0.1 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.0 | 1.7 | GO:0045071 | negative regulation of viral genome replication(GO:0045071) |
| 0.0 | 0.3 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.0 | 0.3 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.0 | 0.1 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.0 | 0.2 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
| 0.0 | 0.7 | GO:1903392 | negative regulation of focal adhesion assembly(GO:0051895) negative regulation of adherens junction organization(GO:1903392) |
| 0.0 | 0.6 | GO:0010762 | regulation of fibroblast migration(GO:0010762) |
| 0.0 | 0.2 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.0 | 0.3 | GO:0050862 | positive regulation of antigen receptor-mediated signaling pathway(GO:0050857) positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.0 | 0.1 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
| 0.0 | 0.1 | GO:0003160 | endocardium morphogenesis(GO:0003160) regulation of Wnt signaling pathway involved in heart development(GO:0003307) arterial endothelial cell fate commitment(GO:0060844) blood vessel endothelial cell fate commitment(GO:0060846) endothelial cell fate specification(GO:0060847) blood vessel endothelial cell fate specification(GO:0097101) positive regulation of ephrin receptor signaling pathway(GO:1901189) regulation of canonical Wnt signaling pathway involved in cardiac muscle cell fate commitment(GO:1901295) positive regulation of canonical Wnt signaling pathway involved in cardiac muscle cell fate commitment(GO:1901297) regulation of canonical Wnt signaling pathway involved in heart development(GO:1905066) positive regulation of canonical Wnt signaling pathway involved in heart development(GO:1905068) |
| 0.0 | 1.3 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.0 | 0.4 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.0 | 0.1 | GO:0033634 | positive regulation of integrin activation(GO:0033625) positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.0 | 0.2 | GO:0000717 | nucleotide-excision repair, DNA duplex unwinding(GO:0000717) |
| 0.0 | 0.4 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
| 0.0 | 0.4 | GO:0031507 | heterochromatin assembly(GO:0031507) |
| 0.0 | 0.4 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
| 0.0 | 0.1 | GO:0044821 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.0 | 0.2 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.0 | 1.3 | GO:0010803 | regulation of tumor necrosis factor-mediated signaling pathway(GO:0010803) |
| 0.0 | 0.3 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.0 | 0.3 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
| 0.0 | 0.0 | GO:0035544 | negative regulation of SNARE complex assembly(GO:0035544) |
| 0.0 | 0.1 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
| 0.0 | 0.1 | GO:0032484 | Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
| 0.0 | 0.2 | GO:0001878 | response to yeast(GO:0001878) |
| 0.0 | 0.1 | GO:0044691 | tooth eruption(GO:0044691) |
| 0.0 | 0.1 | GO:0043686 | co-translational protein modification(GO:0043686) |
| 0.0 | 0.1 | GO:0031272 | pseudopodium assembly(GO:0031269) regulation of pseudopodium assembly(GO:0031272) positive regulation of pseudopodium assembly(GO:0031274) |
| 0.0 | 0.2 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
| 0.0 | 0.2 | GO:0045822 | negative regulation of heart contraction(GO:0045822) |
| 0.0 | 1.0 | GO:0034394 | protein localization to cell surface(GO:0034394) |
| 0.0 | 0.0 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
| 0.0 | 0.4 | GO:0048665 | neuron fate specification(GO:0048665) |
| 0.0 | 0.2 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.0 | 0.8 | GO:0030199 | collagen fibril organization(GO:0030199) |
| 0.0 | 1.0 | GO:0030032 | lamellipodium assembly(GO:0030032) |
| 0.0 | 0.2 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.0 | 0.7 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.0 | 0.2 | GO:0023041 | neuronal signal transduction(GO:0023041) |
| 0.0 | 0.3 | GO:0060155 | platelet dense granule organization(GO:0060155) |
| 0.0 | 0.5 | GO:2001222 | regulation of neuron migration(GO:2001222) |
| 0.0 | 0.3 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
| 0.0 | 0.3 | GO:0097354 | protein prenylation(GO:0018342) prenylation(GO:0097354) |
| 0.0 | 0.2 | GO:1904903 | ESCRT complex disassembly(GO:1904896) ESCRT III complex disassembly(GO:1904903) |
| 0.0 | 0.1 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.0 | 0.4 | GO:0034656 | nucleobase-containing small molecule catabolic process(GO:0034656) |
| 0.0 | 0.4 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
| 0.0 | 0.4 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
| 0.0 | 0.0 | GO:1903332 | regulation of protein folding(GO:1903332) regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.0 | 0.4 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 | 1.9 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
| 0.0 | 0.3 | GO:0060087 | relaxation of vascular smooth muscle(GO:0060087) |
| 0.0 | 0.0 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) |
| 0.0 | 0.4 | GO:1902751 | positive regulation of cell cycle G2/M phase transition(GO:1902751) |
| 0.0 | 0.3 | GO:0051583 | dopamine uptake involved in synaptic transmission(GO:0051583) catecholamine uptake involved in synaptic transmission(GO:0051934) catecholamine uptake(GO:0090493) dopamine uptake(GO:0090494) |
| 0.0 | 0.5 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.0 | 0.1 | GO:0007512 | adult heart development(GO:0007512) |
| 0.0 | 0.0 | GO:0014809 | regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014809) |
| 0.0 | 0.2 | GO:0010265 | SCF complex assembly(GO:0010265) |
| 0.0 | 0.5 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
| 0.0 | 0.2 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.0 | 0.3 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.0 | 0.3 | GO:0046621 | negative regulation of organ growth(GO:0046621) |
| 0.0 | 0.1 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.0 | 0.1 | GO:0036115 | fatty-acyl-CoA catabolic process(GO:0036115) |
| 0.0 | 0.4 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.0 | 0.5 | GO:0045022 | early endosome to late endosome transport(GO:0045022) |
| 0.0 | 0.1 | GO:0030242 | pexophagy(GO:0030242) |
| 0.0 | 0.1 | GO:0098780 | response to mitochondrial depolarisation(GO:0098780) |
| 0.0 | 0.1 | GO:0006449 | regulation of translational termination(GO:0006449) |
| 0.0 | 0.0 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 0.0 | 0.2 | GO:1900364 | negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.0 | 0.2 | GO:0043666 | regulation of phosphoprotein phosphatase activity(GO:0043666) |
| 0.0 | 0.3 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.0 | 0.1 | GO:1900738 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.0 | 0.1 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.0 | 0.2 | GO:1904152 | regulation of retrograde protein transport, ER to cytosol(GO:1904152) |
| 0.0 | 0.3 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.0 | 1.6 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
| 0.0 | 0.2 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.0 | 0.9 | GO:0032465 | regulation of cytokinesis(GO:0032465) |
| 0.0 | 0.2 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
| 0.0 | 0.3 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
| 0.0 | 2.3 | GO:0070268 | cornification(GO:0070268) |
| 0.0 | 0.1 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
| 0.0 | 1.0 | GO:0006879 | cellular iron ion homeostasis(GO:0006879) |
| 0.0 | 0.3 | GO:0035067 | negative regulation of histone acetylation(GO:0035067) |
| 0.0 | 0.1 | GO:0070072 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.0 | 0.1 | GO:0032472 | Golgi calcium ion transport(GO:0032472) |
| 0.0 | 0.2 | GO:0060736 | prostate gland growth(GO:0060736) |
| 0.0 | 0.3 | GO:0016264 | gap junction assembly(GO:0016264) |
| 0.0 | 0.1 | GO:0003310 | pancreatic A cell differentiation(GO:0003310) |
| 0.0 | 0.8 | GO:0007212 | dopamine receptor signaling pathway(GO:0007212) |
| 0.0 | 0.2 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
| 0.0 | 0.2 | GO:0021854 | hypothalamus development(GO:0021854) |
| 0.0 | 0.5 | GO:0035115 | embryonic forelimb morphogenesis(GO:0035115) |
| 0.0 | 0.1 | GO:0060219 | camera-type eye photoreceptor cell differentiation(GO:0060219) |
| 0.0 | 0.1 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.0 | 1.1 | GO:0038096 | immune response-regulating cell surface receptor signaling pathway involved in phagocytosis(GO:0002433) Fc-gamma receptor signaling pathway involved in phagocytosis(GO:0038096) |
| 0.0 | 0.8 | GO:1902475 | L-alpha-amino acid transmembrane transport(GO:1902475) |
| 0.0 | 0.2 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.0 | 0.3 | GO:0070306 | lens fiber cell differentiation(GO:0070306) |
| 0.0 | 0.0 | GO:0046103 | adenosine catabolic process(GO:0006154) inosine biosynthetic process(GO:0046103) |
| 0.0 | 0.3 | GO:0007021 | tubulin complex assembly(GO:0007021) |
| 0.0 | 0.1 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
| 0.0 | 1.3 | GO:0042795 | snRNA transcription(GO:0009301) snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.0 | 0.1 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.0 | 0.3 | GO:0003351 | epithelial cilium movement(GO:0003351) |
| 0.0 | 0.5 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
| 0.0 | 0.2 | GO:1904816 | positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
| 0.0 | 0.1 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.0 | 0.2 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 | 0.1 | GO:0060213 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
| 0.0 | 0.3 | GO:0048240 | sperm capacitation(GO:0048240) |
| 0.0 | 0.2 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.0 | 0.7 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.0 | 0.1 | GO:2000678 | negative regulation of transcription regulatory region DNA binding(GO:2000678) |
| 0.0 | 0.1 | GO:0032261 | purine nucleotide salvage(GO:0032261) |
| 0.0 | 0.2 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
| 0.0 | 1.2 | GO:0030049 | muscle filament sliding(GO:0030049) actin-myosin filament sliding(GO:0033275) |
| 0.0 | 0.1 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
| 0.0 | 3.4 | GO:0042787 | protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0042787) |
| 0.0 | 0.2 | GO:0050812 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) regulation of acyl-CoA biosynthetic process(GO:0050812) |
| 0.0 | 0.4 | GO:0019228 | neuronal action potential(GO:0019228) |
| 0.0 | 0.8 | GO:0030317 | sperm motility(GO:0030317) |
| 0.0 | 0.1 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.0 | 1.7 | GO:0030449 | regulation of complement activation(GO:0030449) |
| 0.0 | 0.1 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
| 0.0 | 0.2 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
| 0.0 | 0.1 | GO:2001169 | negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) regulation of ATP biosynthetic process(GO:2001169) positive regulation of ATP biosynthetic process(GO:2001171) |
| 0.0 | 0.1 | GO:0044126 | regulation of growth of symbiont in host(GO:0044126) modulation of growth of symbiont involved in interaction with host(GO:0044144) |
| 0.0 | 0.6 | GO:0019835 | cytolysis(GO:0019835) |
| 0.0 | 0.5 | GO:0050690 | regulation of defense response to virus by virus(GO:0050690) |
| 0.0 | 0.1 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.0 | 0.1 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
| 0.0 | 0.6 | GO:0021762 | substantia nigra development(GO:0021762) |
| 0.0 | 0.1 | GO:0046085 | adenosine metabolic process(GO:0046085) |
| 0.0 | 0.2 | GO:0072348 | sulfur compound transport(GO:0072348) |
| 0.0 | 0.3 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.0 | 0.0 | GO:0033386 | geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
| 0.0 | 0.2 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.0 | 0.0 | GO:0042247 | morphogenesis of follicular epithelium(GO:0016333) establishment or maintenance of polarity of follicular epithelium(GO:0016334) establishment of planar polarity of follicular epithelium(GO:0042247) |
| 0.0 | 0.3 | GO:0035025 | positive regulation of Rho protein signal transduction(GO:0035025) |
| 0.0 | 0.6 | GO:0015701 | bicarbonate transport(GO:0015701) |
| 0.0 | 0.2 | GO:0070208 | protein heterotrimerization(GO:0070208) |
| 0.0 | 0.1 | GO:1903671 | negative regulation of sprouting angiogenesis(GO:1903671) |
| 0.0 | 0.1 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
| 0.0 | 0.1 | GO:1902775 | mitochondrial ribosome assembly(GO:0061668) mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.0 | 0.3 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 | 0.2 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.0 | 0.4 | GO:0030488 | tRNA methylation(GO:0030488) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.8 | 2.3 | GO:0097450 | astrocyte end-foot(GO:0097450) |
| 0.6 | 6.6 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.5 | 6.3 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.4 | 2.1 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.3 | 1.3 | GO:0016939 | kinesin II complex(GO:0016939) |
| 0.3 | 1.0 | GO:0071159 | NF-kappaB complex(GO:0071159) |
| 0.3 | 1.0 | GO:0002945 | cyclin K-CDK13 complex(GO:0002945) |
| 0.3 | 2.7 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.3 | 0.9 | GO:0009330 | DNA topoisomerase complex (ATP-hydrolyzing)(GO:0009330) |
| 0.3 | 2.9 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.3 | 0.8 | GO:0033565 | ESCRT-0 complex(GO:0033565) |
| 0.3 | 0.8 | GO:0044609 | DBIRD complex(GO:0044609) |
| 0.3 | 1.4 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.3 | 0.5 | GO:0070695 | FHF complex(GO:0070695) |
| 0.3 | 2.3 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.3 | 0.8 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.3 | 1.3 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.2 | 1.9 | GO:0031415 | NatA complex(GO:0031415) |
| 0.2 | 1.2 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.2 | 0.7 | GO:0030689 | Noc complex(GO:0030689) |
| 0.2 | 0.8 | GO:0032279 | asymmetric synapse(GO:0032279) |
| 0.2 | 1.0 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 0.2 | 0.6 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.2 | 1.6 | GO:0071203 | WASH complex(GO:0071203) |
| 0.2 | 1.4 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
| 0.2 | 0.8 | GO:0045293 | MIS complex(GO:0036396) mRNA editing complex(GO:0045293) |
| 0.2 | 0.5 | GO:0016938 | kinesin I complex(GO:0016938) |
| 0.2 | 2.1 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.2 | 0.9 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.2 | 0.5 | GO:0097059 | CNTFR-CLCF1 complex(GO:0097059) |
| 0.2 | 0.7 | GO:0045160 | myosin I complex(GO:0045160) |
| 0.2 | 2.3 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.2 | 0.7 | GO:0043259 | laminin-10 complex(GO:0043259) laminin-11 complex(GO:0043260) |
| 0.2 | 0.8 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.2 | 0.8 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.2 | 1.3 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.2 | 3.1 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.2 | 1.2 | GO:0072487 | MSL complex(GO:0072487) |
| 0.2 | 0.9 | GO:0070381 | endosome to plasma membrane transport vesicle(GO:0070381) |
| 0.1 | 3.1 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.1 | 0.7 | GO:0098536 | deuterosome(GO:0098536) |
| 0.1 | 1.2 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.1 | 1.0 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.1 | 2.7 | GO:0032059 | bleb(GO:0032059) |
| 0.1 | 0.4 | GO:0098855 | HCN channel complex(GO:0098855) |
| 0.1 | 0.5 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.1 | 2.3 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.1 | 0.6 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.1 | 0.7 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.1 | 0.4 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.1 | 0.7 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.1 | 0.6 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.1 | 0.6 | GO:0051286 | cell tip(GO:0051286) |
| 0.1 | 2.5 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.1 | 3.5 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.1 | 1.2 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 0.1 | 3.8 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.1 | 1.0 | GO:0005638 | lamin filament(GO:0005638) |
| 0.1 | 0.5 | GO:0036398 | TCR signalosome(GO:0036398) |
| 0.1 | 1.4 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.1 | 1.4 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.1 | 0.4 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.1 | 0.4 | GO:1990742 | microvesicle(GO:1990742) |
| 0.1 | 0.3 | GO:0000818 | nuclear MIS12/MIND complex(GO:0000818) |
| 0.1 | 0.3 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.1 | 0.3 | GO:0048269 | methionine adenosyltransferase complex(GO:0048269) |
| 0.1 | 1.7 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.1 | 1.4 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.1 | 0.6 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.1 | 0.8 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.1 | 2.6 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.1 | 7.1 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
| 0.1 | 0.8 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.1 | 0.3 | GO:1990031 | pinceau fiber(GO:1990031) |
| 0.1 | 2.6 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.1 | 0.7 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.1 | 0.9 | GO:0008278 | cohesin complex(GO:0008278) |
| 0.1 | 1.4 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.1 | 1.2 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.1 | 0.6 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.1 | 0.5 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
| 0.1 | 0.6 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.1 | 0.7 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.1 | 0.4 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.1 | 0.1 | GO:0042025 | host cell nucleus(GO:0042025) host cell nuclear part(GO:0044094) |
| 0.1 | 1.8 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
| 0.1 | 0.4 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.1 | 0.3 | GO:0031251 | PAN complex(GO:0031251) |
| 0.1 | 0.4 | GO:0001652 | granular component(GO:0001652) |
| 0.1 | 1.4 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.1 | 0.5 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.1 | 0.4 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.1 | 0.8 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.1 | 0.3 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.1 | 0.7 | GO:0034464 | BBSome(GO:0034464) |
| 0.1 | 1.5 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.1 | 0.3 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.1 | 0.9 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.1 | 0.7 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.1 | 0.3 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.1 | 0.2 | GO:0044301 | climbing fiber(GO:0044301) |
| 0.1 | 0.2 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
| 0.1 | 1.3 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.1 | 0.5 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.1 | 0.3 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.1 | 0.3 | GO:0060199 | clathrin-sculpted glutamate transport vesicle(GO:0060199) clathrin-sculpted glutamate transport vesicle membrane(GO:0060203) |
| 0.1 | 0.2 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.1 | 0.4 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.1 | 0.6 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.1 | 0.5 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.1 | 0.4 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
| 0.1 | 0.3 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.1 | 0.4 | GO:0043196 | varicosity(GO:0043196) |
| 0.1 | 1.0 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.1 | 0.4 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.1 | 1.8 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.1 | 0.3 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.1 | 0.8 | GO:0030897 | HOPS complex(GO:0030897) |
| 0.1 | 1.2 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.0 | 0.0 | GO:0060201 | clathrin-sculpted acetylcholine transport vesicle(GO:0060200) clathrin-sculpted acetylcholine transport vesicle membrane(GO:0060201) |
| 0.0 | 6.1 | GO:0042734 | presynaptic membrane(GO:0042734) |
| 0.0 | 0.8 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.0 | 0.4 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
| 0.0 | 0.3 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.0 | 3.0 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 0.1 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.0 | 0.3 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.0 | 0.3 | GO:0005687 | U4 snRNP(GO:0005687) |
| 0.0 | 0.2 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.0 | 0.5 | GO:0098839 | postsynaptic density membrane(GO:0098839) |
| 0.0 | 3.0 | GO:0043198 | dendritic shaft(GO:0043198) |
| 0.0 | 0.3 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.0 | 0.5 | GO:0070187 | telosome(GO:0070187) |
| 0.0 | 0.4 | GO:0031010 | ISWI-type complex(GO:0031010) |
| 0.0 | 1.8 | GO:0043679 | axon terminus(GO:0043679) |
| 0.0 | 0.2 | GO:0032021 | NELF complex(GO:0032021) |
| 0.0 | 0.6 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.0 | 0.6 | GO:0044306 | neuron projection terminus(GO:0044306) |
| 0.0 | 2.2 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.0 | 2.2 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.0 | 0.1 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.0 | 0.3 | GO:0000782 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
| 0.0 | 5.7 | GO:0043197 | dendritic spine(GO:0043197) |
| 0.0 | 4.3 | GO:0016605 | PML body(GO:0016605) |
| 0.0 | 0.7 | GO:0097346 | INO80-type complex(GO:0097346) |
| 0.0 | 3.5 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
| 0.0 | 2.6 | GO:0045095 | keratin filament(GO:0045095) |
| 0.0 | 0.2 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.0 | 2.3 | GO:0043195 | terminal bouton(GO:0043195) |
| 0.0 | 0.3 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.0 | 0.2 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.0 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.0 | 0.4 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.0 | 0.7 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) |
| 0.0 | 1.2 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.0 | 0.6 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.0 | 0.2 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.0 | 0.4 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.0 | 0.1 | GO:0000126 | transcription factor TFIIIB complex(GO:0000126) |
| 0.0 | 0.3 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.0 | 0.4 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.0 | 0.1 | GO:0030934 | anchoring collagen complex(GO:0030934) |
| 0.0 | 1.3 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.0 | 0.3 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.0 | 3.1 | GO:0001669 | acrosomal vesicle(GO:0001669) |
| 0.0 | 1.5 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 0.4 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.0 | 0.4 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 0.0 | 0.1 | GO:0097413 | Lewy body(GO:0097413) |
| 0.0 | 2.4 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 1.8 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
| 0.0 | 0.3 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.0 | 0.8 | GO:1902711 | GABA-A receptor complex(GO:1902711) |
| 0.0 | 0.3 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.0 | 0.2 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
| 0.0 | 0.2 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.0 | 1.5 | GO:0005871 | kinesin complex(GO:0005871) |
| 0.0 | 0.2 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 0.1 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.0 | 0.2 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.0 | 0.5 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 0.5 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.0 | 0.6 | GO:0005922 | connexon complex(GO:0005922) |
| 0.0 | 2.0 | GO:0099501 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
| 0.0 | 0.1 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.0 | 0.4 | GO:0031095 | platelet dense tubular network membrane(GO:0031095) |
| 0.0 | 0.1 | GO:0030906 | retromer, cargo-selective complex(GO:0030906) |
| 0.0 | 0.2 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 0.2 | GO:0000796 | condensin complex(GO:0000796) |
| 0.0 | 0.1 | GO:0032807 | DNA ligase IV complex(GO:0032807) |
| 0.0 | 4.1 | GO:0031256 | leading edge membrane(GO:0031256) |
| 0.0 | 0.8 | GO:0005844 | polysome(GO:0005844) |
| 0.0 | 0.3 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.0 | 0.4 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.0 | 0.3 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.0 | 3.9 | GO:0043209 | myelin sheath(GO:0043209) |
| 0.0 | 1.1 | GO:0008021 | synaptic vesicle(GO:0008021) |
| 0.0 | 0.1 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.0 | 0.5 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.0 | 0.7 | GO:0002102 | podosome(GO:0002102) |
| 0.0 | 0.2 | GO:0090543 | Flemming body(GO:0090543) |
| 0.0 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
| 0.0 | 1.0 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.0 | 0.2 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.0 | 0.3 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.0 | 0.1 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.0 | 1.3 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.0 | 0.3 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.0 | 0.5 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.0 | 1.1 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.0 | 1.0 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.0 | 0.4 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.0 | 2.2 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.0 | 6.3 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.0 | 1.0 | GO:0000794 | condensed nuclear chromosome(GO:0000794) |
| 0.0 | 0.4 | GO:0030686 | 90S preribosome(GO:0030686) |
| 0.0 | 0.6 | GO:0032420 | stereocilium(GO:0032420) |
| 0.0 | 0.1 | GO:0071144 | SMAD2-SMAD3 protein complex(GO:0071144) |
| 0.0 | 0.2 | GO:0005921 | gap junction(GO:0005921) |
| 0.0 | 0.7 | GO:0034707 | chloride channel complex(GO:0034707) |
| 0.0 | 0.1 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.0 | 0.1 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| 0.0 | 0.1 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.0 | 0.7 | GO:0031672 | A band(GO:0031672) |
| 0.0 | 0.1 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.0 | 0.3 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.0 | 0.5 | GO:0016328 | lateral plasma membrane(GO:0016328) |
| 0.0 | 0.2 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.1 | 6.8 | GO:0004118 | cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) |
| 0.7 | 2.0 | GO:0004324 | ferredoxin-NADP+ reductase activity(GO:0004324) NADPH-adrenodoxin reductase activity(GO:0015039) oxidoreductase activity, acting on iron-sulfur proteins as donors(GO:0016730) oxidoreductase activity, acting on iron-sulfur proteins as donors, NAD or NADP as acceptor(GO:0016731) |
| 0.7 | 2.0 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.6 | 3.0 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.5 | 1.5 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 0.5 | 1.9 | GO:0061628 | H3K27me3 modified histone binding(GO:0061628) |
| 0.5 | 1.4 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.4 | 1.3 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.4 | 1.5 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 0.4 | 4.8 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.4 | 1.1 | GO:0070361 | mitochondrial light strand promoter anti-sense binding(GO:0070361) mitochondrial heavy strand promoter anti-sense binding(GO:0070362) mitochondrial heavy strand promoter sense binding(GO:0070364) |
| 0.3 | 1.0 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
| 0.3 | 1.2 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
| 0.3 | 0.9 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.3 | 1.7 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.3 | 2.5 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.3 | 0.8 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
| 0.3 | 0.8 | GO:0031862 | prostanoid receptor binding(GO:0031862) |
| 0.3 | 1.0 | GO:0050211 | procollagen galactosyltransferase activity(GO:0050211) |
| 0.3 | 2.1 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.2 | 1.0 | GO:0004727 | prenylated protein tyrosine phosphatase activity(GO:0004727) |
| 0.2 | 0.7 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.2 | 0.7 | GO:0016603 | glutaminyl-peptide cyclotransferase activity(GO:0016603) |
| 0.2 | 1.0 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
| 0.2 | 2.1 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.2 | 0.9 | GO:0009041 | uridylate kinase activity(GO:0009041) |
| 0.2 | 1.5 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.2 | 0.7 | GO:0032427 | GBD domain binding(GO:0032427) |
| 0.2 | 0.9 | GO:0035501 | MH1 domain binding(GO:0035501) |
| 0.2 | 2.8 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.2 | 1.5 | GO:0098988 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) G-protein coupled glutamate receptor activity(GO:0098988) |
| 0.2 | 1.5 | GO:0070728 | leucine binding(GO:0070728) |
| 0.2 | 1.0 | GO:0047757 | chondroitin-glucuronate 5-epimerase activity(GO:0047757) |
| 0.2 | 1.0 | GO:0004883 | glucocorticoid receptor activity(GO:0004883) glucocorticoid-activated RNA polymerase II transcription factor binding transcription factor activity(GO:0038051) |
| 0.2 | 1.1 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.2 | 0.8 | GO:0016748 | succinyltransferase activity(GO:0016748) |
| 0.2 | 0.7 | GO:0038025 | reelin receptor activity(GO:0038025) |
| 0.2 | 0.9 | GO:0060175 | brain-derived neurotrophic factor-activated receptor activity(GO:0060175) |
| 0.2 | 0.7 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.2 | 1.6 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.2 | 2.3 | GO:0046870 | cadmium ion binding(GO:0046870) |
| 0.2 | 0.7 | GO:0050509 | N-acetylglucosaminyl-proteoglycan 4-beta-glucuronosyltransferase activity(GO:0050509) |
| 0.2 | 1.4 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.2 | 0.9 | GO:0031962 | mineralocorticoid receptor binding(GO:0031962) |
| 0.2 | 0.5 | GO:0030572 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) CDP-diacylglycerol-phosphatidylglycerol phosphatidyltransferase activity(GO:0043337) |
| 0.2 | 1.8 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.2 | 1.0 | GO:0022858 | L-alanine transmembrane transporter activity(GO:0015180) L-cystine transmembrane transporter activity(GO:0015184) alanine transmembrane transporter activity(GO:0022858) |
| 0.2 | 0.8 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.2 | 2.3 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.2 | 2.0 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.2 | 0.5 | GO:0004603 | phenylethanolamine N-methyltransferase activity(GO:0004603) |
| 0.2 | 2.9 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.2 | 3.1 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.2 | 1.9 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
| 0.2 | 0.8 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.2 | 0.5 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.2 | 1.2 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.2 | 0.6 | GO:0030395 | lactose binding(GO:0030395) |
| 0.2 | 1.4 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.1 | 0.4 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
| 0.1 | 0.6 | GO:0022897 | peptide:proton symporter activity(GO:0015333) proton-dependent peptide secondary active transmembrane transporter activity(GO:0022897) |
| 0.1 | 0.6 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
| 0.1 | 1.1 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.1 | 1.5 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.1 | 2.5 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
| 0.1 | 1.2 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.1 | 0.5 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
| 0.1 | 0.8 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.1 | 0.5 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.1 | 2.6 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.1 | 0.6 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.1 | 0.4 | GO:0017130 | poly(C) RNA binding(GO:0017130) |
| 0.1 | 2.7 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.1 | 0.7 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.1 | 3.1 | GO:0008143 | poly(A) binding(GO:0008143) |
| 0.1 | 0.1 | GO:0016404 | 15-hydroxyprostaglandin dehydrogenase (NAD+) activity(GO:0016404) |
| 0.1 | 0.4 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.1 | 2.1 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.1 | 1.7 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.1 | 0.7 | GO:0042835 | BRE binding(GO:0042835) |
| 0.1 | 0.6 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
| 0.1 | 1.1 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.1 | 0.3 | GO:0004379 | glycylpeptide N-tetradecanoyltransferase activity(GO:0004379) myristoyltransferase activity(GO:0019107) |
| 0.1 | 0.6 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.1 | 1.2 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.1 | 2.9 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
| 0.1 | 0.5 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.1 | 1.7 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
| 0.1 | 0.5 | GO:0004850 | uridine phosphorylase activity(GO:0004850) |
| 0.1 | 2.2 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.1 | 0.3 | GO:0004817 | cysteine-tRNA ligase activity(GO:0004817) |
| 0.1 | 1.3 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.1 | 1.0 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.1 | 1.5 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.1 | 0.4 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.1 | 0.8 | GO:0060072 | large conductance calcium-activated potassium channel activity(GO:0060072) |
| 0.1 | 0.8 | GO:0008079 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
| 0.1 | 0.8 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.1 | 0.4 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.1 | 0.7 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.1 | 0.4 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
| 0.1 | 1.8 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.1 | 2.5 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
| 0.1 | 0.4 | GO:0099609 | microtubule lateral binding(GO:0099609) |
| 0.1 | 2.2 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.1 | 1.4 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.1 | 0.5 | GO:0047237 | glucuronylgalactosylproteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047237) |
| 0.1 | 0.3 | GO:0005330 | dopamine:sodium symporter activity(GO:0005330) |
| 0.1 | 1.1 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.1 | 1.4 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.1 | 1.3 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.1 | 0.7 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.1 | 0.3 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.1 | 3.6 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.1 | 0.5 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.1 | 0.9 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.1 | 0.9 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.1 | 1.1 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.1 | 1.2 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.1 | 0.7 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.1 | 0.3 | GO:0016155 | formyltetrahydrofolate dehydrogenase activity(GO:0016155) |
| 0.1 | 1.1 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.1 | 0.6 | GO:0099580 | ion antiporter activity involved in regulation of postsynaptic membrane potential(GO:0099580) |
| 0.1 | 2.0 | GO:0004659 | prenyltransferase activity(GO:0004659) |
| 0.1 | 1.1 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 0.1 | 0.6 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.1 | 1.9 | GO:0030553 | cGMP binding(GO:0030553) |
| 0.1 | 0.8 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.1 | 0.3 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
| 0.1 | 0.4 | GO:0055077 | gap junction hemi-channel activity(GO:0055077) |
| 0.1 | 0.2 | GO:0050405 | [hydroxymethylglutaryl-CoA reductase (NADPH)] kinase activity(GO:0047322) [acetyl-CoA carboxylase] kinase activity(GO:0050405) |
| 0.1 | 0.4 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.1 | 0.7 | GO:0070739 | protein-glutamic acid ligase activity(GO:0070739) |
| 0.1 | 0.5 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 0.1 | 1.5 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.1 | 0.3 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
| 0.1 | 0.5 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
| 0.1 | 0.6 | GO:0099529 | neurotransmitter receptor activity involved in regulation of postsynaptic membrane potential(GO:0099529) transmitter-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1904315) |
| 0.1 | 0.9 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.1 | 0.3 | GO:0004802 | transketolase activity(GO:0004802) |
| 0.1 | 1.7 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
| 0.1 | 5.0 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
| 0.1 | 0.3 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.1 | 0.7 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.1 | 0.5 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
| 0.1 | 0.7 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.1 | 2.3 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.1 | 0.7 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.1 | 0.4 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
| 0.1 | 0.3 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
| 0.1 | 0.4 | GO:0050682 | AF-2 domain binding(GO:0050682) |
| 0.1 | 0.1 | GO:0015275 | stretch-activated, cation-selective, calcium channel activity(GO:0015275) |
| 0.1 | 0.2 | GO:0070984 | SET domain binding(GO:0070984) |
| 0.1 | 1.0 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 0.1 | 1.9 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.1 | 1.0 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.1 | 1.4 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
| 0.1 | 1.5 | GO:0031005 | filamin binding(GO:0031005) |
| 0.1 | 0.4 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.1 | 0.6 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.1 | 0.8 | GO:0015926 | glucosidase activity(GO:0015926) |
| 0.1 | 0.2 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.1 | 1.3 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.1 | 0.6 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.1 | 0.4 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
| 0.1 | 1.4 | GO:0004697 | protein kinase C activity(GO:0004697) |
| 0.1 | 0.7 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.1 | 0.9 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.1 | 2.7 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.1 | 0.7 | GO:0019826 | oxygen sensor activity(GO:0019826) |
| 0.1 | 0.5 | GO:0004673 | phosphorelay sensor kinase activity(GO:0000155) protein histidine kinase activity(GO:0004673) |
| 0.1 | 0.2 | GO:0051139 | metal ion:proton antiporter activity(GO:0051139) |
| 0.1 | 1.4 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.1 | 0.3 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
| 0.1 | 0.2 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.0 | 2.3 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.0 | 0.3 | GO:0045174 | oxidoreductase activity, acting on a sulfur group of donors, quinone or similar compound as acceptor(GO:0016672) glutathione dehydrogenase (ascorbate) activity(GO:0045174) methylarsonate reductase activity(GO:0050610) |
| 0.0 | 0.1 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.0 | 1.8 | GO:0042605 | peptide antigen binding(GO:0042605) |
| 0.0 | 0.1 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
| 0.0 | 0.4 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.0 | 2.8 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.0 | 0.1 | GO:1990404 | protein ADP-ribosylase activity(GO:1990404) |
| 0.0 | 0.1 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.0 | 1.3 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.0 | 0.9 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.0 | 0.1 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.0 | 0.2 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
| 0.0 | 1.9 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.0 | 0.7 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.0 | 0.3 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.0 | 2.0 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
| 0.0 | 0.5 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.0 | 0.4 | GO:0030911 | TPR domain binding(GO:0030911) |
| 0.0 | 0.2 | GO:0003964 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) prostaglandin-E synthase activity(GO:0050220) |
| 0.0 | 1.0 | GO:0070403 | NAD+ binding(GO:0070403) |
| 0.0 | 0.8 | GO:0048018 | receptor agonist activity(GO:0048018) |
| 0.0 | 1.1 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.0 | 1.1 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
| 0.0 | 0.1 | GO:0050254 | G-protein coupled receptor kinase activity(GO:0004703) rhodopsin kinase activity(GO:0050254) |
| 0.0 | 0.4 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.0 | 0.2 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
| 0.0 | 0.1 | GO:0004818 | glutamate-tRNA ligase activity(GO:0004818) |
| 0.0 | 0.7 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.0 | 0.6 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.0 | 1.7 | GO:0019894 | kinesin binding(GO:0019894) |
| 0.0 | 0.8 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
| 0.0 | 0.2 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.0 | 0.2 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.0 | 0.2 | GO:0019215 | intermediate filament binding(GO:0019215) |
| 0.0 | 0.4 | GO:1990948 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.0 | 0.4 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.0 | 0.7 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.0 | 0.2 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.0 | 0.5 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.0 | 0.1 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.0 | 2.9 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.0 | 0.1 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.0 | 0.2 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.0 | 0.2 | GO:0016167 | glial cell-derived neurotrophic factor receptor activity(GO:0016167) |
| 0.0 | 0.6 | GO:0019789 | SUMO transferase activity(GO:0019789) |
| 0.0 | 0.2 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.0 | 0.7 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
| 0.0 | 0.2 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
| 0.0 | 0.3 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.0 | 0.3 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
| 0.0 | 0.7 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.0 | 2.5 | GO:0008013 | beta-catenin binding(GO:0008013) |
| 0.0 | 0.2 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.0 | 0.2 | GO:0004473 | malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
| 0.0 | 0.1 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
| 0.0 | 0.4 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
| 0.0 | 0.6 | GO:0030275 | LRR domain binding(GO:0030275) |
| 0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.0 | 0.1 | GO:0001026 | TFIIIB-type transcription factor activity(GO:0001026) |
| 0.0 | 0.1 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.0 | 1.0 | GO:0008378 | galactosyltransferase activity(GO:0008378) |
| 0.0 | 0.3 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.0 | 0.3 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.0 | 0.1 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.0 | 3.5 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.3 | GO:0005522 | profilin binding(GO:0005522) |
| 0.0 | 0.5 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.0 | 0.3 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.0 | 0.2 | GO:0030345 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
| 0.0 | 1.2 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
| 0.0 | 0.4 | GO:0008061 | chitin binding(GO:0008061) |
| 0.0 | 0.7 | GO:0019707 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.0 | 0.5 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.4 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.0 | 1.5 | GO:0035064 | methylated histone binding(GO:0035064) |
| 0.0 | 0.2 | GO:1903136 | cuprous ion binding(GO:1903136) |
| 0.0 | 0.2 | GO:0001733 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.0 | 6.3 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) |
| 0.0 | 0.2 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.0 | 5.2 | GO:0051015 | actin filament binding(GO:0051015) |
| 0.0 | 0.3 | GO:0043394 | proteoglycan binding(GO:0043394) |
| 0.0 | 0.5 | GO:0046961 | hydrogen-exporting ATPase activity(GO:0036442) proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.0 | 0.5 | GO:0005234 | extracellular-glutamate-gated ion channel activity(GO:0005234) |
| 0.0 | 0.4 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.0 | 1.4 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.0 | 0.1 | GO:1904047 | S-adenosyl-L-methionine binding(GO:1904047) |
| 0.0 | 0.1 | GO:0047238 | glucuronosyl-N-acetylgalactosaminyl-proteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047238) |
| 0.0 | 0.1 | GO:0052836 | inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
| 0.0 | 0.1 | GO:0008665 | 2'-phosphotransferase activity(GO:0008665) |
| 0.0 | 0.1 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.0 | 0.1 | GO:0016728 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.0 | 0.2 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.0 | 0.3 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.0 | 0.1 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.0 | 0.1 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.0 | 0.1 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.0 | 0.1 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.0 | 0.1 | GO:0005231 | excitatory extracellular ligand-gated ion channel activity(GO:0005231) |
| 0.0 | 0.1 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
| 0.0 | 0.7 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.0 | 0.2 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.0 | 0.1 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.0 | 0.4 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.0 | 0.0 | GO:0019961 | interferon binding(GO:0019961) |
| 0.0 | 0.1 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) histone methyltransferase activity (H4-R3 specific)(GO:0044020) mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.0 | 0.8 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.0 | 0.2 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.0 | 0.1 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
| 0.0 | 0.2 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
| 0.0 | 0.7 | GO:0003774 | motor activity(GO:0003774) |
| 0.0 | 0.2 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.0 | 0.5 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.0 | 0.3 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
| 0.0 | 0.1 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.0 | 0.3 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 1.3 | GO:0019903 | protein phosphatase binding(GO:0019903) |
| 0.0 | 1.0 | GO:0004004 | ATP-dependent RNA helicase activity(GO:0004004) |
| 0.0 | 1.7 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
| 0.0 | 0.2 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.0 | 0.4 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.0 | 0.2 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.0 | 0.0 | GO:0005277 | acetylcholine transmembrane transporter activity(GO:0005277) acetate ester transmembrane transporter activity(GO:1901375) |
| 0.0 | 0.3 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.0 | 0.1 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.0 | 0.0 | GO:0004137 | deoxycytidine kinase activity(GO:0004137) |
| 0.0 | 0.1 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.0 | 0.2 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.0 | 0.0 | GO:0047888 | nitric oxide dioxygenase activity(GO:0008941) oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of two atoms of oxygen into one donor(GO:0016708) fatty acid peroxidase activity(GO:0047888) |
| 0.0 | 0.0 | GO:0033149 | FFAT motif binding(GO:0033149) |
| 0.0 | 0.1 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.0 | 0.1 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
| 0.0 | 0.2 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.0 | 0.7 | GO:0004407 | histone deacetylase activity(GO:0004407) protein deacetylase activity(GO:0033558) |
| 0.0 | 0.2 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.0 | 0.3 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.0 | 0.4 | GO:0008175 | tRNA methyltransferase activity(GO:0008175) |
| 0.0 | 0.1 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.0 | 2.1 | GO:0008017 | microtubule binding(GO:0008017) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.8 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.1 | 5.9 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.1 | 0.6 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.1 | 2.6 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.1 | 0.9 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.1 | 0.4 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.1 | 1.1 | PID MYC PATHWAY | C-MYC pathway |
| 0.1 | 8.3 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.1 | 0.2 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.1 | 2.0 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.1 | 2.1 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.1 | 2.3 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.1 | 1.8 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.1 | 1.4 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.1 | 5.9 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.1 | 1.5 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.1 | 3.4 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.1 | 8.1 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.1 | 0.5 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.1 | 3.6 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.1 | 3.0 | PID FOXO PATHWAY | FoxO family signaling |
| 0.1 | 1.3 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.1 | 3.9 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.1 | 1.7 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
| 0.1 | 0.6 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
| 0.0 | 2.6 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.0 | 0.2 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.0 | 3.2 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
| 0.0 | 2.9 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 0.3 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.0 | 3.8 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
| 0.0 | 0.2 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.0 | 1.7 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.0 | 0.6 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.0 | 1.1 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
| 0.0 | 1.5 | PID RAS PATHWAY | Regulation of Ras family activation |
| 0.0 | 0.5 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 1.7 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.0 | 1.3 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
| 0.0 | 0.6 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 1.1 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 2.0 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.0 | 0.5 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.0 | 0.9 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.0 | 0.5 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.0 | 0.9 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
| 0.0 | 1.2 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 0.0 | 1.5 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.0 | 0.6 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.0 | 0.9 | PID ATR PATHWAY | ATR signaling pathway |
| 0.0 | 0.6 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.0 | 0.5 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.0 | 0.3 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.0 | 0.9 | PID CDC42 PATHWAY | CDC42 signaling events |
| 0.0 | 0.2 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.0 | 0.4 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.0 | 0.0 | PID S1P S1P2 PATHWAY | S1P2 pathway |
| 0.0 | 0.9 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
| 0.0 | 0.3 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.0 | 0.9 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.0 | 0.3 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
| 0.0 | 0.1 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.0 | 0.2 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.0 | 0.5 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.0 | 0.8 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.0 | 0.1 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.0 | 0.4 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 0.4 | PID ATM PATHWAY | ATM pathway |
| 0.0 | 0.3 | PID ALK1 PATHWAY | ALK1 signaling events |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 2.1 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
| 0.3 | 0.6 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.2 | 0.4 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.2 | 2.2 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.2 | 7.0 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.1 | 2.3 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.1 | 0.8 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
| 0.1 | 8.1 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 0.1 | 0.9 | REACTOME NGF SIGNALLING VIA TRKA FROM THE PLASMA MEMBRANE | Genes involved in NGF signalling via TRKA from the plasma membrane |
| 0.1 | 1.8 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 0.1 | 2.7 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.1 | 3.7 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.1 | 1.8 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.1 | 0.8 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.1 | 4.0 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
| 0.1 | 1.4 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.1 | 2.3 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.1 | 2.0 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.1 | 1.2 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
| 0.1 | 3.1 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.1 | 3.5 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
| 0.1 | 1.8 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.1 | 1.3 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 0.1 | 1.0 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 0.1 | 1.7 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
| 0.1 | 2.0 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.1 | 1.2 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.1 | 1.4 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
| 0.1 | 2.7 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.1 | 0.4 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.1 | 2.5 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.1 | 0.2 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 0.1 | 1.7 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.1 | 7.4 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
| 0.1 | 1.3 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.1 | 0.7 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.1 | 1.4 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.1 | 1.0 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.1 | 3.0 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.1 | 1.4 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.1 | 0.3 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.1 | 2.3 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
| 0.0 | 1.5 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.0 | 0.9 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.0 | 0.8 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.0 | 0.2 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.0 | 0.9 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.0 | 0.5 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 0.0 | 2.0 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.0 | 0.2 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.0 | 1.1 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.0 | 0.8 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
| 0.0 | 2.9 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.0 | 0.9 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.0 | 5.1 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.0 | 0.5 | REACTOME DOWNSTREAM SIGNAL TRANSDUCTION | Genes involved in Downstream signal transduction |
| 0.0 | 0.7 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.0 | 0.3 | REACTOME TRAF6 MEDIATED INDUCTION OF TAK1 COMPLEX | Genes involved in TRAF6 mediated induction of TAK1 complex |
| 0.0 | 0.8 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.0 | 1.1 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.0 | 0.5 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.0 | 0.1 | REACTOME ACTIVATION OF THE MRNA UPON BINDING OF THE CAP BINDING COMPLEX AND EIFS AND SUBSEQUENT BINDING TO 43S | Genes involved in Activation of the mRNA upon binding of the cap-binding complex and eIFs, and subsequent binding to 43S |
| 0.0 | 1.0 | REACTOME ENERGY DEPENDENT REGULATION OF MTOR BY LKB1 AMPK | Genes involved in Energy dependent regulation of mTOR by LKB1-AMPK |
| 0.0 | 0.7 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.0 | 1.0 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.0 | 0.5 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.0 | 0.8 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.0 | 0.6 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.0 | 0.5 | REACTOME MEIOSIS | Genes involved in Meiosis |
| 0.0 | 0.5 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.0 | 0.1 | REACTOME AUTODEGRADATION OF THE E3 UBIQUITIN LIGASE COP1 | Genes involved in Autodegradation of the E3 ubiquitin ligase COP1 |
| 0.0 | 1.0 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.0 | 0.6 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.0 | 1.1 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.0 | 0.9 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
| 0.0 | 0.7 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.0 | 0.6 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.0 | 1.4 | REACTOME CHONDROITIN SULFATE DERMATAN SULFATE METABOLISM | Genes involved in Chondroitin sulfate/dermatan sulfate metabolism |
| 0.0 | 0.5 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.0 | 0.7 | REACTOME MRNA PROCESSING | Genes involved in mRNA Processing |
| 0.0 | 0.8 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
| 0.0 | 1.9 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
| 0.0 | 0.2 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
| 0.0 | 0.6 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.0 | 1.5 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.0 | 4.2 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.0 | 0.5 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.0 | 0.3 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.0 | 0.7 | REACTOME CELL CELL JUNCTION ORGANIZATION | Genes involved in Cell-cell junction organization |
| 0.0 | 0.4 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
| 0.0 | 0.2 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.0 | 0.3 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.0 | 0.6 | REACTOME LATE PHASE OF HIV LIFE CYCLE | Genes involved in Late Phase of HIV Life Cycle |
| 0.0 | 0.3 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.0 | 0.6 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.0 | 0.1 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.0 | 1.2 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.0 | 0.4 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.0 | 0.1 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.0 | 1.1 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 0.4 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.0 | 0.3 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.0 | 0.2 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.0 | 0.1 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.0 | 0.3 | REACTOME PURINE METABOLISM | Genes involved in Purine metabolism |
| 0.0 | 0.1 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
| 0.0 | 0.4 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.0 | 0.3 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.0 | 0.1 | REACTOME GRB2 EVENTS IN ERBB2 SIGNALING | Genes involved in GRB2 events in ERBB2 signaling |
| 0.0 | 0.1 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
| 0.0 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.0 | 0.2 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.0 | 0.1 | REACTOME REGULATION OF APOPTOSIS | Genes involved in Regulation of Apoptosis |
| 0.0 | 0.1 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |