Project
Mucociliary differentiation, bronchial epithelial cells, human (Ross 2007)
Navigation
Downloads
Results for KLF16_SP2
Z-value: 2.04
Motif logo
Transcription factors associated with KLF16_SP2
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
KLF16
|
ENSG00000129911.4 | Kruppel like factor 16 |
|
SP2
|
ENSG00000167182.11 | Sp2 transcription factor |
Activity-expression correlation:
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| KLF16 | hg19_v2_chr19_-_1863567_1863586 | -0.54 | 2.1e-03 | Click! |
| SP2 | hg19_v2_chr17_+_45973516_45973618 | -0.03 | 8.9e-01 | Click! |
Activity profile of KLF16_SP2 motif
Sorted Z-values of KLF16_SP2 motif
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr7_-_158380371 | 15.89 |
ENST00000389418.4
ENST00000389416.4 |
PTPRN2
|
protein tyrosine phosphatase, receptor type, N polypeptide 2 |
| chr21_-_43916433 | 13.85 |
ENST00000291536.3
|
RSPH1
|
radial spoke head 1 homolog (Chlamydomonas) |
| chr7_-_158380465 | 13.38 |
ENST00000389413.3
ENST00000409483.1 |
PTPRN2
|
protein tyrosine phosphatase, receptor type, N polypeptide 2 |
| chr16_-_67427389 | 12.35 |
ENST00000562206.1
ENST00000290942.5 ENST00000393957.2 |
TPPP3
|
tubulin polymerization-promoting protein family member 3 |
| chr11_+_2466218 | 12.03 |
ENST00000155840.5
|
KCNQ1
|
potassium voltage-gated channel, KQT-like subfamily, member 1 |
| chr16_+_67465016 | 11.07 |
ENST00000326152.5
|
HSD11B2
|
hydroxysteroid (11-beta) dehydrogenase 2 |
| chr19_-_55672037 | 10.90 |
ENST00000588076.1
|
DNAAF3
|
dynein, axonemal, assembly factor 3 |
| chr7_-_123174610 | 10.51 |
ENST00000324698.6
ENST00000434450.1 |
IQUB
|
IQ motif and ubiquitin domain containing |
| chr19_-_55677999 | 10.33 |
ENST00000532817.1
ENST00000527223.2 ENST00000391720.4 |
DNAAF3
|
dynein, axonemal, assembly factor 3 |
| chr6_+_43612750 | 10.31 |
ENST00000372165.4
ENST00000372163.4 |
RSPH9
|
radial spoke head 9 homolog (Chlamydomonas) |
| chr21_-_43916296 | 10.17 |
ENST00000398352.3
|
RSPH1
|
radial spoke head 1 homolog (Chlamydomonas) |
| chr19_+_4639514 | 10.15 |
ENST00000327473.4
|
TNFAIP8L1
|
tumor necrosis factor, alpha-induced protein 8-like 1 |
| chr11_+_111385497 | 10.08 |
ENST00000375618.4
ENST00000529167.1 ENST00000332814.6 |
C11orf88
|
chromosome 11 open reading frame 88 |
| chr22_-_50970506 | 9.88 |
ENST00000428989.2
ENST00000403326.1 |
ODF3B
|
outer dense fiber of sperm tails 3B |
| chr3_-_19988462 | 9.61 |
ENST00000344838.4
|
EFHB
|
EF-hand domain family, member B |
| chr19_+_55795493 | 9.33 |
ENST00000309383.1
|
BRSK1
|
BR serine/threonine kinase 1 |
| chrX_+_152338301 | 9.31 |
ENST00000453825.2
|
PNMA6A
|
paraneoplastic Ma antigen family member 6A |
| chr9_+_34458771 | 9.29 |
ENST00000437363.1
ENST00000242317.4 |
DNAI1
|
dynein, axonemal, intermediate chain 1 |
| chr17_+_55333876 | 9.06 |
ENST00000284073.2
|
MSI2
|
musashi RNA-binding protein 2 |
| chr13_+_24734844 | 8.99 |
ENST00000382108.3
|
SPATA13
|
spermatogenesis associated 13 |
| chr11_+_61276214 | 8.70 |
ENST00000378075.2
|
LRRC10B
|
leucine rich repeat containing 10B |
| chr20_-_3154162 | 8.68 |
ENST00000360342.3
|
LZTS3
|
Homo sapiens leucine zipper, putative tumor suppressor family member 3 (LZTS3), mRNA. |
| chr19_-_55677920 | 8.59 |
ENST00000524407.2
ENST00000526003.1 ENST00000534170.1 |
DNAAF3
|
dynein, axonemal, assembly factor 3 |
| chr5_-_180018540 | 8.27 |
ENST00000292641.3
|
SCGB3A1
|
secretoglobin, family 3A, member 1 |
| chrX_-_1572629 | 8.20 |
ENST00000534940.1
|
ASMTL
|
acetylserotonin O-methyltransferase-like |
| chr14_+_105953246 | 8.18 |
ENST00000392531.3
|
CRIP1
|
cysteine-rich protein 1 (intestinal) |
| chr19_+_17581253 | 8.05 |
ENST00000252595.7
ENST00000598424.1 |
SLC27A1
|
solute carrier family 27 (fatty acid transporter), member 1 |
| chr13_+_24153488 | 8.03 |
ENST00000382258.4
ENST00000382263.3 |
TNFRSF19
|
tumor necrosis factor receptor superfamily, member 19 |
| chr12_-_25348007 | 8.03 |
ENST00000354189.5
ENST00000545133.1 ENST00000554347.1 ENST00000395987.3 ENST00000320267.9 ENST00000395990.2 ENST00000537577.1 |
CASC1
|
cancer susceptibility candidate 1 |
| chr14_+_105953204 | 8.01 |
ENST00000409393.2
|
CRIP1
|
cysteine-rich protein 1 (intestinal) |
| chr11_+_73358594 | 7.91 |
ENST00000227214.6
ENST00000398494.4 ENST00000543085.1 |
PLEKHB1
|
pleckstrin homology domain containing, family B (evectins) member 1 |
| chr4_-_147867025 | 7.82 |
ENST00000502319.1
ENST00000325106.4 ENST00000504425.1 |
TTC29
|
tetratricopeptide repeat domain 29 |
| chr4_-_147866960 | 7.65 |
ENST00000513335.1
|
TTC29
|
tetratricopeptide repeat domain 29 |
| chr2_+_8822113 | 7.60 |
ENST00000396290.1
ENST00000331129.3 |
ID2
|
inhibitor of DNA binding 2, dominant negative helix-loop-helix protein |
| chr6_-_10838710 | 7.58 |
ENST00000313243.2
|
MAK
|
male germ cell-associated kinase |
| chrX_+_152240819 | 7.57 |
ENST00000421798.3
ENST00000535416.1 |
PNMA6C
PNMA6A
|
paraneoplastic Ma antigen family member 6C paraneoplastic Ma antigen family member 6A |
| chr19_-_3029011 | 7.55 |
ENST00000590536.1
ENST00000587137.1 ENST00000455444.2 ENST00000262953.6 |
TLE2
|
transducin-like enhancer of split 2 (E(sp1) homolog, Drosophila) |
| chr6_-_10838736 | 7.40 |
ENST00000536370.1
ENST00000474039.1 |
MAK
|
male germ cell-associated kinase |
| chr16_-_52580920 | 7.39 |
ENST00000219746.9
|
TOX3
|
TOX high mobility group box family member 3 |
| chr13_+_24734880 | 7.39 |
ENST00000382095.4
|
SPATA13
|
spermatogenesis associated 13 |
| chr2_-_230579185 | 7.20 |
ENST00000341772.4
|
DNER
|
delta/notch-like EGF repeat containing |
| chr16_+_89894875 | 7.19 |
ENST00000393062.2
|
SPIRE2
|
spire-type actin nucleation factor 2 |
| chr1_+_118148556 | 7.15 |
ENST00000369448.3
|
FAM46C
|
family with sequence similarity 46, member C |
| chr16_+_84178874 | 7.10 |
ENST00000378553.5
|
DNAAF1
|
dynein, axonemal, assembly factor 1 |
| chr19_+_11457232 | 7.04 |
ENST00000587531.1
|
CCDC159
|
coiled-coil domain containing 159 |
| chr2_+_11295498 | 6.95 |
ENST00000295083.3
ENST00000441908.2 |
PQLC3
|
PQ loop repeat containing 3 |
| chr11_-_34937858 | 6.91 |
ENST00000278359.5
|
APIP
|
APAF1 interacting protein |
| chr4_-_7044657 | 6.88 |
ENST00000310085.4
|
CCDC96
|
coiled-coil domain containing 96 |
| chr19_-_7990991 | 6.81 |
ENST00000318978.4
|
CTXN1
|
cortexin 1 |
| chr11_-_407103 | 6.79 |
ENST00000526395.1
|
SIGIRR
|
single immunoglobulin and toll-interleukin 1 receptor (TIR) domain |
| chrY_+_22737678 | 6.68 |
ENST00000382772.3
|
EIF1AY
|
eukaryotic translation initiation factor 1A, Y-linked |
| chrX_+_53449887 | 6.65 |
ENST00000375327.3
|
RIBC1
|
RIB43A domain with coiled-coils 1 |
| chr16_-_66959429 | 6.50 |
ENST00000420652.1
ENST00000299759.6 |
RRAD
|
Ras-related associated with diabetes |
| chr2_+_132286754 | 6.50 |
ENST00000434330.1
|
CCDC74A
|
coiled-coil domain containing 74A |
| chr1_-_162838551 | 6.48 |
ENST00000367910.1
ENST00000367912.2 ENST00000367911.2 |
C1orf110
|
chromosome 1 open reading frame 110 |
| chr6_-_29595779 | 6.46 |
ENST00000355973.3
ENST00000377012.4 |
GABBR1
|
gamma-aminobutyric acid (GABA) B receptor, 1 |
| chr1_-_54411240 | 6.46 |
ENST00000371378.2
|
HSPB11
|
heat shock protein family B (small), member 11 |
| chr14_+_96858433 | 6.40 |
ENST00000267584.4
|
AK7
|
adenylate kinase 7 |
| chr2_-_99757876 | 6.34 |
ENST00000539964.1
ENST00000393482.3 |
TSGA10
|
testis specific, 10 |
| chrY_+_22737604 | 6.34 |
ENST00000361365.2
|
EIF1AY
|
eukaryotic translation initiation factor 1A, Y-linked |
| chr16_+_777118 | 6.33 |
ENST00000562141.1
|
HAGHL
|
hydroxyacylglutathione hydrolase-like |
| chr2_-_99757977 | 6.30 |
ENST00000355053.4
|
TSGA10
|
testis specific, 10 |
| chr2_-_160143084 | 6.22 |
ENST00000409990.3
|
WDSUB1
|
WD repeat, sterile alpha motif and U-box domain containing 1 |
| chr1_-_54411255 | 6.20 |
ENST00000371377.3
|
HSPB11
|
heat shock protein family B (small), member 11 |
| chr19_-_55972936 | 6.13 |
ENST00000425675.2
ENST00000589080.1 ENST00000085068.3 |
ISOC2
|
isochorismatase domain containing 2 |
| chr4_-_819901 | 6.13 |
ENST00000304062.6
|
CPLX1
|
complexin 1 |
| chr12_+_7014064 | 6.05 |
ENST00000443597.2
|
LRRC23
|
leucine rich repeat containing 23 |
| chr2_-_160143242 | 6.03 |
ENST00000359774.4
|
WDSUB1
|
WD repeat, sterile alpha motif and U-box domain containing 1 |
| chr14_-_95786200 | 6.01 |
ENST00000298912.4
|
CLMN
|
calmin (calponin-like, transmembrane) |
| chr3_-_50383096 | 5.93 |
ENST00000442887.1
ENST00000360165.3 |
ZMYND10
|
zinc finger, MYND-type containing 10 |
| chr2_-_160143158 | 5.90 |
ENST00000409124.1
ENST00000358147.4 |
WDSUB1
|
WD repeat, sterile alpha motif and U-box domain containing 1 |
| chr1_-_48937838 | 5.85 |
ENST00000371847.3
|
SPATA6
|
spermatogenesis associated 6 |
| chr19_-_291365 | 5.84 |
ENST00000591572.1
ENST00000269812.3 ENST00000434325.2 |
PPAP2C
|
phosphatidic acid phosphatase type 2C |
| chr2_+_120189422 | 5.81 |
ENST00000306406.4
|
TMEM37
|
transmembrane protein 37 |
| chr8_+_27348649 | 5.70 |
ENST00000521780.1
ENST00000380476.3 ENST00000518379.1 ENST00000521684.1 |
EPHX2
|
epoxide hydrolase 2, cytoplasmic |
| chr19_+_41620335 | 5.67 |
ENST00000331105.2
|
CYP2F1
|
cytochrome P450, family 2, subfamily F, polypeptide 1 |
| chr1_+_38022513 | 5.66 |
ENST00000296218.7
|
DNALI1
|
dynein, axonemal, light intermediate chain 1 |
| chr12_+_7013897 | 5.60 |
ENST00000007969.8
ENST00000323702.5 |
LRRC23
|
leucine rich repeat containing 23 |
| chr1_+_151693984 | 5.57 |
ENST00000479191.1
|
RIIAD1
|
regulatory subunit of type II PKA R-subunit (RIIa) domain containing 1 |
| chr1_-_23810664 | 5.54 |
ENST00000336689.3
ENST00000437606.2 |
ASAP3
|
ArfGAP with SH3 domain, ankyrin repeat and PH domain 3 |
| chr16_+_89894911 | 5.50 |
ENST00000378247.3
ENST00000563972.1 |
SPIRE2
|
spire-type actin nucleation factor 2 |
| chr22_-_50970566 | 5.46 |
ENST00000405135.1
ENST00000401779.1 |
ODF3B
|
outer dense fiber of sperm tails 3B |
| chr22_-_39548627 | 5.43 |
ENST00000216133.5
|
CBX7
|
chromobox homolog 7 |
| chr19_-_48673552 | 5.43 |
ENST00000536218.1
ENST00000596549.1 |
LIG1
|
ligase I, DNA, ATP-dependent |
| chr8_+_1711918 | 5.41 |
ENST00000331222.4
|
CLN8
|
ceroid-lipofuscinosis, neuronal 8 (epilepsy, progressive with mental retardation) |
| chrX_-_135056106 | 5.39 |
ENST00000433339.2
|
MMGT1
|
membrane magnesium transporter 1 |
| chr1_-_98510843 | 5.39 |
ENST00000413670.2
ENST00000538428.1 |
MIR137HG
|
MIR137 host gene (non-protein coding) |
| chr18_-_24765248 | 5.38 |
ENST00000580774.1
ENST00000284224.8 |
CHST9
|
carbohydrate (N-acetylgalactosamine 4-0) sulfotransferase 9 |
| chrX_-_44202857 | 5.33 |
ENST00000420999.1
|
EFHC2
|
EF-hand domain (C-terminal) containing 2 |
| chr4_+_1003742 | 5.33 |
ENST00000398484.2
|
FGFRL1
|
fibroblast growth factor receptor-like 1 |
| chr16_-_54320675 | 5.31 |
ENST00000329734.3
|
IRX3
|
iroquois homeobox 3 |
| chr16_+_1383602 | 5.30 |
ENST00000426824.3
ENST00000397488.2 ENST00000562208.1 ENST00000568887.1 |
BAIAP3
|
BAI1-associated protein 3 |
| chr19_-_48673580 | 5.26 |
ENST00000427526.2
|
LIG1
|
ligase I, DNA, ATP-dependent |
| chr16_-_5147743 | 5.26 |
ENST00000587133.1
ENST00000458008.4 ENST00000427587.4 |
FAM86A
|
family with sequence similarity 86, member A |
| chr12_+_7014126 | 5.26 |
ENST00000415834.1
ENST00000436789.1 |
LRRC23
|
leucine rich repeat containing 23 |
| chr9_+_124922171 | 5.23 |
ENST00000373764.3
ENST00000536616.1 |
MORN5
|
MORN repeat containing 5 |
| chrX_-_1571810 | 5.23 |
ENST00000381333.4
|
ASMTL
|
acetylserotonin O-methyltransferase-like |
| chr2_+_219536749 | 5.22 |
ENST00000295709.3
ENST00000392106.2 ENST00000392105.3 ENST00000455724.1 |
STK36
|
serine/threonine kinase 36 |
| chr7_-_102715263 | 5.22 |
ENST00000379305.3
|
FBXL13
|
F-box and leucine-rich repeat protein 13 |
| chr1_+_153940713 | 5.18 |
ENST00000368601.1
ENST00000368603.1 ENST00000368600.3 |
CREB3L4
|
cAMP responsive element binding protein 3-like 4 |
| chr19_-_55791431 | 5.16 |
ENST00000593263.1
ENST00000376343.3 |
HSPBP1
|
HSPA (heat shock 70kDa) binding protein, cytoplasmic cochaperone 1 |
| chr3_-_197686847 | 5.13 |
ENST00000265239.6
|
IQCG
|
IQ motif containing G |
| chr7_-_73184588 | 5.12 |
ENST00000395145.2
|
CLDN3
|
claudin 3 |
| chr17_-_74137374 | 5.12 |
ENST00000322957.6
|
FOXJ1
|
forkhead box J1 |
| chr11_+_71791693 | 5.12 |
ENST00000289488.2
ENST00000447974.1 |
LRTOMT
|
leucine rich transmembrane and O-methyltransferase domain containing |
| chr6_+_52285131 | 5.06 |
ENST00000433625.2
|
EFHC1
|
EF-hand domain (C-terminal) containing 1 |
| chr22_+_29279552 | 5.06 |
ENST00000544604.2
|
ZNRF3
|
zinc and ring finger 3 |
| chr11_+_45907177 | 5.03 |
ENST00000241014.2
|
MAPK8IP1
|
mitogen-activated protein kinase 8 interacting protein 1 |
| chr1_+_38022572 | 5.03 |
ENST00000541606.1
|
DNALI1
|
dynein, axonemal, light intermediate chain 1 |
| chr5_-_137368708 | 5.03 |
ENST00000033079.3
|
FAM13B
|
family with sequence similarity 13, member B |
| chr19_-_821931 | 5.01 |
ENST00000359894.2
ENST00000520876.3 ENST00000519502.1 |
LPPR3
|
hsa-mir-3187 |
| chr20_-_39317868 | 5.00 |
ENST00000373313.2
|
MAFB
|
v-maf avian musculoaponeurotic fibrosarcoma oncogene homolog B |
| chr19_-_56135928 | 4.99 |
ENST00000591479.1
ENST00000325351.4 |
ZNF784
|
zinc finger protein 784 |
| chr18_-_12377283 | 4.96 |
ENST00000269143.3
|
AFG3L2
|
AFG3-like AAA ATPase 2 |
| chr10_+_82116529 | 4.94 |
ENST00000411538.1
ENST00000256039.2 |
DYDC2
|
DPY30 domain containing 2 |
| chr9_-_138393580 | 4.93 |
ENST00000371791.1
|
C9orf116
|
chromosome 9 open reading frame 116 |
| chr16_-_776431 | 4.92 |
ENST00000293889.6
|
CCDC78
|
coiled-coil domain containing 78 |
| chr1_+_11333245 | 4.91 |
ENST00000376810.5
|
UBIAD1
|
UbiA prenyltransferase domain containing 1 |
| chr11_+_71498552 | 4.89 |
ENST00000346333.6
ENST00000359244.4 ENST00000426628.2 |
FAM86C1
|
family with sequence similarity 86, member C1 |
| chrX_-_1571759 | 4.87 |
ENST00000381317.3
ENST00000416733.2 |
ASMTL
|
acetylserotonin O-methyltransferase-like |
| chr22_+_23487513 | 4.83 |
ENST00000263116.2
ENST00000341989.4 |
RAB36
|
RAB36, member RAS oncogene family |
| chr20_+_44098346 | 4.82 |
ENST00000372676.3
|
WFDC2
|
WAP four-disulfide core domain 2 |
| chr18_+_77155856 | 4.82 |
ENST00000253506.5
ENST00000591814.1 |
NFATC1
|
nuclear factor of activated T-cells, cytoplasmic, calcineurin-dependent 1 |
| chr17_+_55334364 | 4.79 |
ENST00000322684.3
ENST00000579590.1 |
MSI2
|
musashi RNA-binding protein 2 |
| chr11_-_66445219 | 4.79 |
ENST00000525754.1
ENST00000531969.1 ENST00000524637.1 ENST00000531036.2 ENST00000310046.4 |
RBM4B
|
RNA binding motif protein 4B |
| chr13_-_114018400 | 4.78 |
ENST00000375430.4
ENST00000375431.4 |
GRTP1
|
growth hormone regulated TBC protein 1 |
| chr17_+_79935418 | 4.78 |
ENST00000306729.7
ENST00000306739.4 |
ASPSCR1
|
alveolar soft part sarcoma chromosome region, candidate 1 |
| chr17_+_7155343 | 4.75 |
ENST00000573513.1
ENST00000354429.2 ENST00000574255.1 ENST00000396627.2 ENST00000356683.2 |
ELP5
|
elongator acetyltransferase complex subunit 5 |
| chr10_+_131265443 | 4.75 |
ENST00000306010.7
|
MGMT
|
O-6-methylguanine-DNA methyltransferase |
| chr16_+_5008290 | 4.75 |
ENST00000251170.7
|
SEC14L5
|
SEC14-like 5 (S. cerevisiae) |
| chr2_-_174828892 | 4.73 |
ENST00000418194.2
|
SP3
|
Sp3 transcription factor |
| chrY_+_15016725 | 4.73 |
ENST00000336079.3
|
DDX3Y
|
DEAD (Asp-Glu-Ala-Asp) box helicase 3, Y-linked |
| chr17_-_30185946 | 4.68 |
ENST00000579741.1
|
COPRS
|
coordinator of PRMT5, differentiation stimulator |
| chr16_-_19896220 | 4.66 |
ENST00000562469.1
ENST00000300571.2 |
GPRC5B
|
G protein-coupled receptor, family C, group 5, member B |
| chr19_+_45504688 | 4.66 |
ENST00000221452.8
ENST00000540120.1 ENST00000505236.1 |
RELB
|
v-rel avian reticuloendotheliosis viral oncogene homolog B |
| chr19_-_3025614 | 4.66 |
ENST00000447365.2
|
TLE2
|
transducin-like enhancer of split 2 (E(sp1) homolog, Drosophila) |
| chr6_+_3000218 | 4.65 |
ENST00000380441.1
ENST00000380455.4 ENST00000380454.4 |
NQO2
|
NAD(P)H dehydrogenase, quinone 2 |
| chr2_-_241497374 | 4.65 |
ENST00000373318.2
ENST00000406958.1 ENST00000391987.1 ENST00000373320.4 |
ANKMY1
|
ankyrin repeat and MYND domain containing 1 |
| chr12_+_49297899 | 4.64 |
ENST00000552942.1
ENST00000320516.4 |
CCDC65
|
coiled-coil domain containing 65 |
| chr1_+_212782012 | 4.64 |
ENST00000341491.4
ENST00000366985.1 |
ATF3
|
activating transcription factor 3 |
| chr3_-_13009168 | 4.63 |
ENST00000273221.4
|
IQSEC1
|
IQ motif and Sec7 domain 1 |
| chr12_-_113658892 | 4.62 |
ENST00000299732.2
ENST00000416617.2 |
IQCD
|
IQ motif containing D |
| chr12_+_56661033 | 4.61 |
ENST00000433805.2
|
COQ10A
|
coenzyme Q10 homolog A (S. cerevisiae) |
| chr16_+_618837 | 4.60 |
ENST00000409439.2
|
PIGQ
|
phosphatidylinositol glycan anchor biosynthesis, class Q |
| chr4_-_819880 | 4.56 |
ENST00000505203.1
|
CPLX1
|
complexin 1 |
| chr9_-_124976154 | 4.56 |
ENST00000482062.1
|
LHX6
|
LIM homeobox 6 |
| chr10_+_70587279 | 4.55 |
ENST00000298596.6
ENST00000399169.4 ENST00000399165.4 ENST00000399162.2 |
STOX1
|
storkhead box 1 |
| chr9_-_124976185 | 4.48 |
ENST00000464484.2
|
LHX6
|
LIM homeobox 6 |
| chr16_+_67840668 | 4.46 |
ENST00000415766.3
|
TSNAXIP1
|
translin-associated factor X interacting protein 1 |
| chr6_+_163148973 | 4.44 |
ENST00000366888.2
|
PACRG
|
PARK2 co-regulated |
| chr6_+_3000057 | 4.44 |
ENST00000397717.2
|
NQO2
|
NAD(P)H dehydrogenase, quinone 2 |
| chr1_+_111888890 | 4.44 |
ENST00000369738.4
|
PIFO
|
primary cilia formation |
| chr8_+_27348626 | 4.44 |
ENST00000517536.1
|
EPHX2
|
epoxide hydrolase 2, cytoplasmic |
| chr3_+_42544084 | 4.43 |
ENST00000543411.1
ENST00000438259.2 ENST00000439731.1 ENST00000325123.4 |
VIPR1
|
vasoactive intestinal peptide receptor 1 |
| chr17_+_79935464 | 4.43 |
ENST00000581647.1
ENST00000580534.1 ENST00000579684.1 |
ASPSCR1
|
alveolar soft part sarcoma chromosome region, candidate 1 |
| chr14_-_65438865 | 4.43 |
ENST00000267512.5
|
RAB15
|
RAB15, member RAS oncogene family |
| chr1_+_183605200 | 4.41 |
ENST00000304685.4
|
RGL1
|
ral guanine nucleotide dissociation stimulator-like 1 |
| chr2_-_160143059 | 4.40 |
ENST00000392796.3
|
WDSUB1
|
WD repeat, sterile alpha motif and U-box domain containing 1 |
| chr11_+_1244288 | 4.39 |
ENST00000529681.1
ENST00000447027.1 |
MUC5B
|
mucin 5B, oligomeric mucus/gel-forming |
| chr19_+_47778119 | 4.38 |
ENST00000552360.2
|
PRR24
|
proline rich 24 |
| chr10_+_76586348 | 4.36 |
ENST00000372724.1
ENST00000287239.4 ENST00000372714.1 |
KAT6B
|
K(lysine) acetyltransferase 6B |
| chr3_-_197676740 | 4.36 |
ENST00000452735.1
ENST00000453254.1 ENST00000455191.1 |
IQCG
|
IQ motif containing G |
| chr19_-_55791540 | 4.34 |
ENST00000433386.2
|
HSPBP1
|
HSPA (heat shock 70kDa) binding protein, cytoplasmic cochaperone 1 |
| chr16_+_810728 | 4.32 |
ENST00000563941.1
ENST00000545450.2 ENST00000566549.1 |
MSLN
|
mesothelin |
| chr1_+_3689325 | 4.30 |
ENST00000444870.2
ENST00000452264.1 |
SMIM1
|
small integral membrane protein 1 (Vel blood group) |
| chr17_-_63557759 | 4.30 |
ENST00000307078.5
|
AXIN2
|
axin 2 |
| chr17_-_17109579 | 4.29 |
ENST00000321560.3
|
PLD6
|
phospholipase D family, member 6 |
| chr1_-_42921915 | 4.27 |
ENST00000372565.3
ENST00000433602.2 |
ZMYND12
|
zinc finger, MYND-type containing 12 |
| chr6_+_3000195 | 4.23 |
ENST00000338130.2
|
NQO2
|
NAD(P)H dehydrogenase, quinone 2 |
| chr11_+_64009072 | 4.20 |
ENST00000535135.1
ENST00000394540.3 |
FKBP2
|
FK506 binding protein 2, 13kDa |
| chrX_-_151999269 | 4.20 |
ENST00000370277.3
|
CETN2
|
centrin, EF-hand protein, 2 |
| chr19_+_8455200 | 4.20 |
ENST00000601897.1
ENST00000594216.1 |
RAB11B
|
RAB11B, member RAS oncogene family |
| chr8_+_17354617 | 4.20 |
ENST00000470360.1
|
SLC7A2
|
solute carrier family 7 (cationic amino acid transporter, y+ system), member 2 |
| chr21_+_42688686 | 4.18 |
ENST00000398652.3
ENST00000398647.3 |
FAM3B
|
family with sequence similarity 3, member B |
| chrX_+_53449805 | 4.14 |
ENST00000414955.2
|
RIBC1
|
RIB43A domain with coiled-coils 1 |
| chr20_-_62462566 | 4.13 |
ENST00000245663.4
ENST00000302995.2 |
ZBTB46
|
zinc finger and BTB domain containing 46 |
| chr8_-_145691031 | 4.13 |
ENST00000424149.2
ENST00000530637.1 ENST00000306145.5 |
CYHR1
|
cysteine/histidine-rich 1 |
| chr1_-_48937821 | 4.11 |
ENST00000396199.3
|
SPATA6
|
spermatogenesis associated 6 |
| chr22_-_50970919 | 4.10 |
ENST00000329363.4
ENST00000437588.1 |
ODF3B
|
outer dense fiber of sperm tails 3B |
| chr12_+_111843749 | 4.10 |
ENST00000341259.2
|
SH2B3
|
SH2B adaptor protein 3 |
| chr17_+_62075703 | 4.08 |
ENST00000577953.1
ENST00000582540.1 ENST00000579184.1 ENST00000425164.3 ENST00000412177.1 ENST00000539996.1 ENST00000583891.1 ENST00000580752.1 |
C17orf72
|
chromosome 17 open reading frame 72 |
| chr16_-_1968231 | 4.08 |
ENST00000443547.1
ENST00000293937.3 ENST00000454677.2 |
HS3ST6
|
heparan sulfate (glucosamine) 3-O-sulfotransferase 6 |
| chr22_-_39190116 | 4.07 |
ENST00000406622.1
ENST00000216068.4 ENST00000406199.3 |
SUN2
DNAL4
|
Sad1 and UNC84 domain containing 2 dynein, axonemal, light chain 4 |
| chr18_-_71814999 | 4.05 |
ENST00000269500.5
|
FBXO15
|
F-box protein 15 |
| chr19_-_6110474 | 4.04 |
ENST00000587181.1
ENST00000587321.1 ENST00000586806.1 ENST00000589742.1 ENST00000592546.1 ENST00000303657.5 |
RFX2
|
regulatory factor X, 2 (influences HLA class II expression) |
| chr15_-_28344439 | 4.03 |
ENST00000431101.1
ENST00000445578.1 ENST00000353809.5 ENST00000382996.2 ENST00000354638.3 |
OCA2
|
oculocutaneous albinism II |
| chrX_-_2418936 | 4.03 |
ENST00000461691.1
ENST00000381223.4 ENST00000381222.2 ENST00000412516.2 ENST00000334651.5 |
ZBED1
DHRSX
|
zinc finger, BED-type containing 1 dehydrogenase/reductase (SDR family) X-linked |
| chr2_+_219537015 | 4.02 |
ENST00000440309.1
ENST00000424080.1 |
STK36
|
serine/threonine kinase 36 |
| chr6_-_43478239 | 4.01 |
ENST00000372441.1
|
LRRC73
|
leucine rich repeat containing 73 |
| chr9_-_138391692 | 4.00 |
ENST00000429260.2
|
C9orf116
|
chromosome 9 open reading frame 116 |
| chr7_+_151038785 | 3.99 |
ENST00000413040.2
ENST00000568733.1 |
NUB1
|
negative regulator of ubiquitin-like proteins 1 |
| chr12_+_50017327 | 3.98 |
ENST00000261897.1
|
PRPF40B
|
PRP40 pre-mRNA processing factor 40 homolog B (S. cerevisiae) |
| chr19_+_14544099 | 3.98 |
ENST00000242783.6
ENST00000586557.1 ENST00000590097.1 |
PKN1
|
protein kinase N1 |
| chr17_+_7788104 | 3.98 |
ENST00000380358.4
|
CHD3
|
chromodomain helicase DNA binding protein 3 |
| chr19_-_18717627 | 3.98 |
ENST00000392386.3
|
CRLF1
|
cytokine receptor-like factor 1 |
| chr14_-_65439132 | 3.95 |
ENST00000533601.2
|
RAB15
|
RAB15, member RAS oncogene family |
| chr13_+_35516390 | 3.95 |
ENST00000540320.1
ENST00000400445.3 ENST00000310336.4 |
NBEA
|
neurobeachin |
| chr13_+_21141270 | 3.94 |
ENST00000319980.6
ENST00000537103.1 ENST00000389373.3 |
IFT88
|
intraflagellar transport 88 homolog (Chlamydomonas) |
| chr3_+_186648307 | 3.93 |
ENST00000457772.2
ENST00000455441.1 ENST00000427315.1 |
ST6GAL1
|
ST6 beta-galactosamide alpha-2,6-sialyltranferase 1 |
| chr10_-_135171510 | 3.92 |
ENST00000278025.4
ENST00000368552.3 |
FUOM
|
fucose mutarotase |
Network of associatons between targets according to the STRING database.
First level regulatory network of KLF16_SP2
Gene Ontology Analysis
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 4.5 | 22.5 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 4.1 | 4.1 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
| 3.8 | 3.8 | GO:0021684 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 2.6 | 10.4 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
| 2.5 | 81.2 | GO:0044458 | motile cilium assembly(GO:0044458) |
| 2.4 | 7.2 | GO:0061461 | lysine import(GO:0034226) L-lysine import(GO:0061461) L-lysine import into cell(GO:1903410) |
| 2.3 | 11.3 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
| 2.1 | 8.5 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 2.0 | 6.1 | GO:0061181 | regulation of chondrocyte development(GO:0061181) |
| 2.0 | 4.0 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
| 1.9 | 5.8 | GO:0032223 | negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 1.9 | 21.0 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 1.9 | 7.6 | GO:0061030 | epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
| 1.9 | 9.3 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
| 1.8 | 1.8 | GO:0030575 | nuclear body organization(GO:0030575) |
| 1.8 | 8.9 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 1.7 | 3.4 | GO:0034144 | negative regulation of toll-like receptor 4 signaling pathway(GO:0034144) |
| 1.7 | 5.0 | GO:0021571 | rhombomere 5 development(GO:0021571) central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| 1.6 | 11.5 | GO:0070649 | polar body extrusion after meiotic divisions(GO:0040038) formin-nucleated actin cable assembly(GO:0070649) |
| 1.6 | 6.6 | GO:2000820 | negative regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000820) |
| 1.5 | 4.6 | GO:0061394 | regulation of transcription from RNA polymerase II promoter in response to arsenic-containing substance(GO:0061394) |
| 1.5 | 4.6 | GO:1904899 | regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 1.5 | 4.6 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 1.5 | 6.1 | GO:0009447 | putrescine catabolic process(GO:0009447) |
| 1.5 | 5.9 | GO:2000980 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 1.5 | 4.4 | GO:0021919 | BMP signaling pathway involved in spinal cord dorsal/ventral patterning(GO:0021919) |
| 1.4 | 7.1 | GO:1901094 | regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
| 1.4 | 4.2 | GO:0061183 | dermatome development(GO:0061054) regulation of dermatome development(GO:0061183) |
| 1.4 | 4.1 | GO:1990108 | protein linear deubiquitination(GO:1990108) |
| 1.4 | 4.1 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 1.4 | 10.9 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 1.4 | 12.2 | GO:1902856 | negative regulation of nonmotile primary cilium assembly(GO:1902856) |
| 1.3 | 10.7 | GO:0018317 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 1.3 | 1.3 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
| 1.3 | 4.0 | GO:0002032 | desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
| 1.3 | 5.3 | GO:0021502 | neural fold elevation formation(GO:0021502) nephrogenic mesenchyme morphogenesis(GO:0072134) allantois development(GO:1905069) |
| 1.3 | 2.6 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) |
| 1.3 | 13.2 | GO:0070269 | pyroptosis(GO:0070269) |
| 1.3 | 3.9 | GO:0061565 | dADP phosphorylation(GO:0006174) dGDP phosphorylation(GO:0006186) AMP phosphorylation(GO:0006756) CDP phosphorylation(GO:0061508) dAMP phosphorylation(GO:0061565) CMP phosphorylation(GO:0061566) dCMP phosphorylation(GO:0061567) GDP phosphorylation(GO:0061568) UDP phosphorylation(GO:0061569) dCDP phosphorylation(GO:0061570) TDP phosphorylation(GO:0061571) |
| 1.3 | 5.2 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 1.2 | 3.7 | GO:0072096 | apoptotic process involved in endocardial cushion morphogenesis(GO:0003277) intermediate mesoderm morphogenesis(GO:0048390) intermediate mesoderm formation(GO:0048391) intermediate mesodermal cell differentiation(GO:0048392) regulation of cardiac muscle fiber development(GO:0055018) positive regulation of cardiac muscle fiber development(GO:0055020) bud dilation involved in lung branching(GO:0060503) BMP signaling pathway involved in ureter morphogenesis(GO:0061149) renal system segmentation(GO:0061150) BMP signaling pathway involved in renal system segmentation(GO:0061151) pulmonary artery endothelial tube morphogenesis(GO:0061155) regulation of transcription from RNA polymerase II promoter involved in mesonephros development(GO:0061216) BMP signaling pathway involved in nephric duct formation(GO:0071893) negative regulation of branch elongation involved in ureteric bud branching(GO:0072096) negative regulation of branch elongation involved in ureteric bud branching by BMP signaling pathway(GO:0072097) anterior/posterior pattern specification involved in ureteric bud development(GO:0072099) specification of ureteric bud anterior/posterior symmetry(GO:0072100) specification of ureteric bud anterior/posterior symmetry by BMP signaling pathway(GO:0072101) ureter epithelial cell differentiation(GO:0072192) negative regulation of mesenchymal cell proliferation involved in ureter development(GO:0072200) positive regulation of cell proliferation involved in outflow tract morphogenesis(GO:1901964) cardiac jelly development(GO:1905072) regulation of metanephric S-shaped body morphogenesis(GO:2000004) negative regulation of metanephric S-shaped body morphogenesis(GO:2000005) regulation of metanephric comma-shaped body morphogenesis(GO:2000006) negative regulation of metanephric comma-shaped body morphogenesis(GO:2000007) |
| 1.2 | 61.0 | GO:0035082 | axoneme assembly(GO:0035082) |
| 1.2 | 4.9 | GO:0072086 | specification of loop of Henle identity(GO:0072086) |
| 1.2 | 3.6 | GO:0061713 | neural crest cell migration involved in heart formation(GO:0003147) anterior neural tube closure(GO:0061713) |
| 1.2 | 3.6 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
| 1.2 | 8.3 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 1.1 | 3.4 | GO:0070602 | regulation of centromeric sister chromatid cohesion(GO:0070602) |
| 1.1 | 3.4 | GO:0042351 | 'de novo' GDP-L-fucose biosynthetic process(GO:0042351) |
| 1.1 | 3.4 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
| 1.1 | 3.3 | GO:0060279 | regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
| 1.1 | 4.4 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 1.1 | 3.3 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
| 1.1 | 7.7 | GO:0071072 | negative regulation of phospholipid biosynthetic process(GO:0071072) |
| 1.1 | 3.2 | GO:1903567 | negative regulation of protein localization to cilium(GO:1903565) regulation of protein localization to ciliary membrane(GO:1903567) negative regulation of protein localization to ciliary membrane(GO:1903568) |
| 1.0 | 3.1 | GO:0072229 | proximal convoluted tubule development(GO:0072019) metanephric proximal convoluted tubule development(GO:0072229) |
| 1.0 | 13.5 | GO:1904936 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 1.0 | 1.0 | GO:0046640 | regulation of alpha-beta T cell proliferation(GO:0046640) |
| 1.0 | 5.1 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 1.0 | 9.2 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
| 1.0 | 3.0 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
| 1.0 | 4.0 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 1.0 | 2.0 | GO:0042733 | embryonic digit morphogenesis(GO:0042733) |
| 1.0 | 3.0 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
| 1.0 | 3.0 | GO:1903860 | negative regulation of dendrite extension(GO:1903860) regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 1.0 | 8.9 | GO:0043570 | maintenance of DNA repeat elements(GO:0043570) |
| 1.0 | 2.9 | GO:0006669 | sphinganine-1-phosphate biosynthetic process(GO:0006669) |
| 1.0 | 13.6 | GO:0060180 | female mating behavior(GO:0060180) |
| 1.0 | 3.9 | GO:1901074 | regulation of engulfment of apoptotic cell(GO:1901074) |
| 1.0 | 6.8 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 1.0 | 3.9 | GO:1901675 | negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 1.0 | 2.9 | GO:0051596 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.9 | 14.2 | GO:0003084 | positive regulation of systemic arterial blood pressure(GO:0003084) |
| 0.9 | 4.7 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
| 0.9 | 2.8 | GO:0061188 | negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 0.9 | 3.7 | GO:0046909 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.9 | 4.6 | GO:0071733 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 0.9 | 2.8 | GO:0015729 | thiosulfate transport(GO:0015709) oxaloacetate transport(GO:0015729) malate transport(GO:0015743) malate transmembrane transport(GO:0071423) oxaloacetate(2-) transmembrane transport(GO:1902356) |
| 0.9 | 0.9 | GO:1902003 | regulation of beta-amyloid formation(GO:1902003) |
| 0.9 | 17.2 | GO:0070986 | left/right axis specification(GO:0070986) |
| 0.9 | 1.8 | GO:0019255 | glucose 1-phosphate metabolic process(GO:0019255) |
| 0.9 | 3.6 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
| 0.9 | 14.4 | GO:0060452 | positive regulation of cardiac muscle contraction(GO:0060452) |
| 0.9 | 8.0 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
| 0.9 | 2.7 | GO:0032053 | ciliary basal body organization(GO:0032053) |
| 0.9 | 3.5 | GO:0006850 | mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
| 0.9 | 11.2 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.9 | 6.0 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.8 | 2.5 | GO:0043012 | regulation of fusion of sperm to egg plasma membrane(GO:0043012) |
| 0.8 | 2.5 | GO:0035604 | fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) |
| 0.8 | 2.5 | GO:0006864 | pyrimidine nucleotide transport(GO:0006864) mitochondrial pyrimidine nucleotide import(GO:1990519) |
| 0.8 | 6.6 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.8 | 3.3 | GO:0035522 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
| 0.8 | 5.7 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
| 0.8 | 0.8 | GO:0060766 | negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.8 | 9.8 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.8 | 3.3 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.8 | 4.8 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.8 | 3.2 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.8 | 3.2 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.8 | 3.2 | GO:0033504 | floor plate development(GO:0033504) |
| 0.8 | 2.4 | GO:0072560 | glandular epithelial cell maturation(GO:0002071) type B pancreatic cell maturation(GO:0072560) |
| 0.8 | 2.3 | GO:0033386 | geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
| 0.8 | 2.3 | GO:0018312 | peptidyl-serine ADP-ribosylation(GO:0018312) |
| 0.8 | 9.9 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.8 | 8.3 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.8 | 0.8 | GO:1904882 | telomerase catalytic core complex assembly(GO:1904868) regulation of telomerase catalytic core complex assembly(GO:1904882) positive regulation of telomerase catalytic core complex assembly(GO:1904884) |
| 0.8 | 2.3 | GO:0015882 | L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
| 0.7 | 2.2 | GO:1902303 | negative regulation of potassium ion export(GO:1902303) |
| 0.7 | 0.7 | GO:1902669 | positive regulation of axon guidance(GO:1902669) |
| 0.7 | 2.2 | GO:0019521 | aldonic acid metabolic process(GO:0019520) D-gluconate metabolic process(GO:0019521) |
| 0.7 | 3.7 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
| 0.7 | 2.2 | GO:0021529 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 0.7 | 1.5 | GO:1902993 | positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
| 0.7 | 2.9 | GO:2000690 | negative regulation of cardioblast differentiation(GO:0051892) regulation of cardiac muscle cell myoblast differentiation(GO:2000690) negative regulation of cardiac muscle cell myoblast differentiation(GO:2000691) |
| 0.7 | 0.7 | GO:0034163 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) |
| 0.7 | 1.4 | GO:0009644 | response to high light intensity(GO:0009644) |
| 0.7 | 1.4 | GO:0010830 | regulation of myotube differentiation(GO:0010830) |
| 0.7 | 4.3 | GO:1902998 | macrophage proliferation(GO:0061517) microglial cell proliferation(GO:0061518) regulation of neuronal signal transduction(GO:1902847) positive regulation of neurofibrillary tangle assembly(GO:1902998) |
| 0.7 | 2.9 | GO:0090034 | regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
| 0.7 | 0.7 | GO:0032570 | response to progesterone(GO:0032570) |
| 0.7 | 5.7 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.7 | 2.8 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
| 0.7 | 4.9 | GO:0071500 | cellular response to nitrosative stress(GO:0071500) |
| 0.7 | 9.8 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.7 | 1.4 | GO:0033861 | negative regulation of NAD(P)H oxidase activity(GO:0033861) |
| 0.7 | 0.7 | GO:0009405 | pathogenesis(GO:0009405) |
| 0.7 | 2.1 | GO:0046210 | nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) |
| 0.7 | 2.1 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.7 | 4.2 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
| 0.7 | 2.7 | GO:0015910 | peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.7 | 6.2 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
| 0.7 | 6.1 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
| 0.7 | 3.4 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
| 0.7 | 2.7 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.7 | 2.0 | GO:0040034 | regulation of development, heterochronic(GO:0040034) regulation of timing of cell differentiation(GO:0048505) |
| 0.6 | 3.2 | GO:0033685 | negative regulation of luteinizing hormone secretion(GO:0033685) |
| 0.6 | 2.6 | GO:0002086 | diaphragm contraction(GO:0002086) |
| 0.6 | 0.6 | GO:0071316 | cellular response to nicotine(GO:0071316) |
| 0.6 | 2.5 | GO:0002503 | peptide antigen assembly with MHC class II protein complex(GO:0002503) |
| 0.6 | 5.7 | GO:2000580 | positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
| 0.6 | 0.6 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
| 0.6 | 1.9 | GO:0010641 | positive regulation of platelet-derived growth factor receptor signaling pathway(GO:0010641) |
| 0.6 | 0.6 | GO:0003192 | mitral valve formation(GO:0003192) |
| 0.6 | 0.6 | GO:2000705 | dense core granule biogenesis(GO:0061110) regulation of dense core granule biogenesis(GO:2000705) |
| 0.6 | 3.1 | GO:2000134 | negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
| 0.6 | 0.6 | GO:2000078 | positive regulation of type B pancreatic cell development(GO:2000078) |
| 0.6 | 3.7 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.6 | 1.8 | GO:0045897 | positive regulation of transcription during mitosis(GO:0045897) |
| 0.6 | 2.4 | GO:0032485 | Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
| 0.6 | 4.3 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
| 0.6 | 1.8 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
| 0.6 | 7.9 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
| 0.6 | 3.7 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.6 | 1.2 | GO:0006338 | chromatin remodeling(GO:0006338) |
| 0.6 | 0.6 | GO:0015880 | coenzyme A transport(GO:0015880) coenzyme A transmembrane transport(GO:0035349) adenosine 3',5'-bisphosphate transmembrane transport(GO:0071106) AMP transport(GO:0080121) |
| 0.6 | 3.6 | GO:0006273 | lagging strand elongation(GO:0006273) |
| 0.6 | 1.8 | GO:0072139 | glomerular parietal epithelial cell differentiation(GO:0072139) |
| 0.6 | 2.3 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.6 | 5.9 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
| 0.6 | 0.6 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
| 0.6 | 1.2 | GO:0060151 | peroxisome localization(GO:0060151) microtubule-based peroxisome localization(GO:0060152) |
| 0.6 | 2.9 | GO:2001076 | regulation of metanephric ureteric bud development(GO:2001074) positive regulation of metanephric ureteric bud development(GO:2001076) |
| 0.6 | 2.3 | GO:0046452 | dihydrofolate metabolic process(GO:0046452) |
| 0.6 | 2.3 | GO:0006726 | eye pigment biosynthetic process(GO:0006726) eye pigment metabolic process(GO:0042441) pigment metabolic process involved in developmental pigmentation(GO:0043324) pigment metabolic process involved in pigmentation(GO:0043474) |
| 0.6 | 1.2 | GO:0014063 | regulation of serotonin secretion(GO:0014062) negative regulation of serotonin secretion(GO:0014063) |
| 0.6 | 2.9 | GO:0051941 | regulation of amino acid uptake involved in synaptic transmission(GO:0051941) regulation of glutamate uptake involved in transmission of nerve impulse(GO:0051946) regulation of L-glutamate import(GO:1900920) |
| 0.6 | 0.6 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.6 | 1.1 | GO:1903052 | positive regulation of proteolysis involved in cellular protein catabolic process(GO:1903052) |
| 0.6 | 2.3 | GO:0009386 | translational attenuation(GO:0009386) |
| 0.6 | 0.6 | GO:0006325 | chromatin organization(GO:0006325) |
| 0.6 | 2.3 | GO:0070426 | positive regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070426) positive regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070434) |
| 0.6 | 1.7 | GO:0032203 | telomere formation via telomerase(GO:0032203) |
| 0.6 | 1.7 | GO:1904048 | regulation of spontaneous neurotransmitter secretion(GO:1904048) |
| 0.6 | 2.8 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.6 | 0.6 | GO:1901674 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
| 0.6 | 0.6 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.6 | 1.7 | GO:2000298 | regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
| 0.6 | 1.1 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.5 | 4.4 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
| 0.5 | 0.5 | GO:0038183 | bile acid signaling pathway(GO:0038183) |
| 0.5 | 3.3 | GO:0045819 | positive regulation of glycogen catabolic process(GO:0045819) |
| 0.5 | 3.3 | GO:1990822 | basic amino acid transmembrane transport(GO:1990822) |
| 0.5 | 6.0 | GO:2000781 | positive regulation of double-strand break repair(GO:2000781) |
| 0.5 | 13.0 | GO:0016254 | preassembly of GPI anchor in ER membrane(GO:0016254) |
| 0.5 | 3.2 | GO:0007352 | zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.5 | 10.7 | GO:0019614 | catechol-containing compound catabolic process(GO:0019614) catecholamine catabolic process(GO:0042424) |
| 0.5 | 5.3 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
| 0.5 | 1.6 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.5 | 3.1 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.5 | 0.5 | GO:0014049 | positive regulation of glutamate secretion(GO:0014049) |
| 0.5 | 1.5 | GO:0046056 | dADP metabolic process(GO:0046056) |
| 0.5 | 1.0 | GO:1990164 | histone H2A phosphorylation(GO:1990164) |
| 0.5 | 1.5 | GO:0045082 | positive regulation of interleukin-10 biosynthetic process(GO:0045082) |
| 0.5 | 1.5 | GO:0034729 | histone H3-K79 methylation(GO:0034729) regulation of histone H3-K79 methylation(GO:2001160) positive regulation of histone H3-K79 methylation(GO:2001162) |
| 0.5 | 1.5 | GO:0070668 | regulation of mast cell proliferation(GO:0070666) positive regulation of mast cell proliferation(GO:0070668) |
| 0.5 | 0.5 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.5 | 2.0 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
| 0.5 | 1.5 | GO:0050760 | negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
| 0.5 | 2.0 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.5 | 4.5 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
| 0.5 | 1.0 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.5 | 2.5 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.5 | 3.0 | GO:0097327 | response to antineoplastic agent(GO:0097327) |
| 0.5 | 5.9 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.5 | 2.0 | GO:0090299 | regulation of neural crest formation(GO:0090299) negative regulation of neural crest formation(GO:0090301) negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
| 0.5 | 3.5 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.5 | 3.9 | GO:1990253 | cellular response to leucine starvation(GO:1990253) |
| 0.5 | 4.4 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 0.5 | 20.5 | GO:0042073 | intraciliary transport(GO:0042073) |
| 0.5 | 1.0 | GO:0034184 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.5 | 3.9 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) |
| 0.5 | 1.4 | GO:0019056 | modulation by virus of host transcription(GO:0019056) positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) modulation by symbiont of host transcription(GO:0052026) |
| 0.5 | 3.4 | GO:0021795 | cerebral cortex cell migration(GO:0021795) |
| 0.5 | 0.5 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
| 0.5 | 9.6 | GO:1903830 | magnesium ion transmembrane transport(GO:1903830) |
| 0.5 | 1.0 | GO:1902725 | negative regulation of satellite cell differentiation(GO:1902725) |
| 0.5 | 1.4 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
| 0.5 | 1.4 | GO:0031990 | mRNA export from nucleus in response to heat stress(GO:0031990) |
| 0.5 | 2.8 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.5 | 1.4 | GO:0006844 | acyl carnitine transport(GO:0006844) acyl carnitine transmembrane transport(GO:1902616) |
| 0.5 | 3.3 | GO:0022412 | cellular process involved in reproduction in multicellular organism(GO:0022412) |
| 0.5 | 1.4 | GO:0021966 | corticospinal neuron axon guidance(GO:0021966) |
| 0.5 | 0.5 | GO:0051445 | regulation of meiotic cell cycle(GO:0051445) |
| 0.5 | 10.8 | GO:1901663 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.5 | 1.9 | GO:0043335 | protein unfolding(GO:0043335) |
| 0.5 | 0.9 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
| 0.5 | 1.4 | GO:0003095 | pressure natriuresis(GO:0003095) |
| 0.5 | 1.9 | GO:0033591 | response to L-ascorbic acid(GO:0033591) |
| 0.5 | 10.2 | GO:0000052 | citrulline metabolic process(GO:0000052) |
| 0.5 | 4.6 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) protein localization to ciliary membrane(GO:1903441) |
| 0.5 | 3.2 | GO:1902047 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
| 0.5 | 5.0 | GO:0006824 | cobalt ion transport(GO:0006824) |
| 0.5 | 1.8 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.5 | 1.8 | GO:0000255 | allantoin metabolic process(GO:0000255) |
| 0.5 | 0.9 | GO:0060406 | positive regulation of penile erection(GO:0060406) |
| 0.5 | 3.2 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.4 | 3.6 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.4 | 0.4 | GO:0001767 | establishment of lymphocyte polarity(GO:0001767) |
| 0.4 | 6.2 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
| 0.4 | 2.2 | GO:0019075 | virus maturation(GO:0019075) |
| 0.4 | 1.3 | GO:1904617 | negative regulation of actin filament binding(GO:1904530) negative regulation of actin binding(GO:1904617) |
| 0.4 | 3.1 | GO:0045007 | depurination(GO:0045007) |
| 0.4 | 0.4 | GO:0060179 | male mating behavior(GO:0060179) |
| 0.4 | 3.1 | GO:0048104 | establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 0.4 | 1.3 | GO:0038193 | thromboxane A2 signaling pathway(GO:0038193) |
| 0.4 | 1.7 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.4 | 0.9 | GO:2000366 | regulation of STAT protein import into nucleus(GO:2000364) positive regulation of STAT protein import into nucleus(GO:2000366) |
| 0.4 | 9.1 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.4 | 0.9 | GO:0036369 | transcription factor catabolic process(GO:0036369) |
| 0.4 | 0.9 | GO:0051097 | negative regulation of helicase activity(GO:0051097) |
| 0.4 | 2.6 | GO:1904381 | Golgi apparatus mannose trimming(GO:1904381) |
| 0.4 | 5.6 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
| 0.4 | 0.4 | GO:0007113 | endomitotic cell cycle(GO:0007113) |
| 0.4 | 1.3 | GO:1900039 | positive regulation of cellular response to hypoxia(GO:1900039) |
| 0.4 | 3.0 | GO:0023021 | termination of signal transduction(GO:0023021) |
| 0.4 | 1.7 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.4 | 4.3 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
| 0.4 | 1.3 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.4 | 4.3 | GO:1904779 | regulation of protein localization to centrosome(GO:1904779) |
| 0.4 | 1.7 | GO:0044805 | late nucleophagy(GO:0044805) |
| 0.4 | 0.9 | GO:2000047 | regulation of cell-cell adhesion mediated by cadherin(GO:2000047) |
| 0.4 | 5.1 | GO:0008595 | tripartite regional subdivision(GO:0007351) anterior/posterior axis specification, embryo(GO:0008595) |
| 0.4 | 2.1 | GO:0042984 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.4 | 5.9 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.4 | 1.3 | GO:1903070 | negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
| 0.4 | 0.4 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
| 0.4 | 1.3 | GO:0097156 | fasciculation of motor neuron axon(GO:0097156) |
| 0.4 | 1.7 | GO:0070445 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.4 | 2.9 | GO:0030242 | pexophagy(GO:0030242) |
| 0.4 | 1.3 | GO:0070105 | positive regulation of interleukin-6-mediated signaling pathway(GO:0070105) |
| 0.4 | 1.3 | GO:0060449 | bud elongation involved in lung branching(GO:0060449) |
| 0.4 | 5.4 | GO:0035864 | response to potassium ion(GO:0035864) |
| 0.4 | 1.7 | GO:0070858 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.4 | 0.4 | GO:1900038 | negative regulation of cellular response to hypoxia(GO:1900038) |
| 0.4 | 0.8 | GO:1900138 | negative regulation of icosanoid secretion(GO:0032304) negative regulation of phospholipase A2 activity(GO:1900138) |
| 0.4 | 0.4 | GO:0071636 | positive regulation of transforming growth factor beta production(GO:0071636) |
| 0.4 | 1.2 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 0.4 | 1.2 | GO:0006679 | glucosylceramide biosynthetic process(GO:0006679) |
| 0.4 | 2.5 | GO:0006014 | D-ribose metabolic process(GO:0006014) |
| 0.4 | 0.4 | GO:1903939 | regulation of TORC2 signaling(GO:1903939) |
| 0.4 | 0.8 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.4 | 1.2 | GO:0007057 | spindle assembly involved in female meiosis I(GO:0007057) |
| 0.4 | 1.2 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.4 | 2.9 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
| 0.4 | 0.4 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
| 0.4 | 4.0 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.4 | 12.1 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.4 | 1.2 | GO:0097195 | pilomotor reflex(GO:0097195) |
| 0.4 | 1.6 | GO:0002296 | T-helper 1 cell lineage commitment(GO:0002296) |
| 0.4 | 0.8 | GO:1902723 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.4 | 2.0 | GO:0006064 | glucuronate catabolic process(GO:0006064) glucuronate catabolic process to xylulose 5-phosphate(GO:0019640) xylulose 5-phosphate metabolic process(GO:0051167) xylulose 5-phosphate biosynthetic process(GO:1901159) |
| 0.4 | 6.8 | GO:0070314 | G1 to G0 transition(GO:0070314) |
| 0.4 | 2.8 | GO:0030917 | midbrain-hindbrain boundary development(GO:0030917) |
| 0.4 | 2.4 | GO:0060235 | lens induction in camera-type eye(GO:0060235) |
| 0.4 | 0.4 | GO:1904397 | negative regulation of neuromuscular junction development(GO:1904397) |
| 0.4 | 1.6 | GO:0010826 | negative regulation of centrosome duplication(GO:0010826) |
| 0.4 | 3.9 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 0.4 | 4.7 | GO:0002115 | store-operated calcium entry(GO:0002115) |
| 0.4 | 0.4 | GO:0019046 | release from viral latency(GO:0019046) |
| 0.4 | 1.9 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.4 | 8.5 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.4 | 3.1 | GO:0006880 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.4 | 0.8 | GO:1900369 | negative regulation of RNA interference(GO:1900369) |
| 0.4 | 1.2 | GO:1902728 | positive regulation of skeletal muscle satellite cell proliferation(GO:1902724) positive regulation of growth factor dependent skeletal muscle satellite cell proliferation(GO:1902728) |
| 0.4 | 1.1 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.4 | 2.3 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.4 | 8.4 | GO:0033617 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.4 | 1.9 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.4 | 0.8 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.4 | 1.1 | GO:0070902 | mitochondrial tRNA pseudouridine synthesis(GO:0070902) |
| 0.4 | 6.4 | GO:0038092 | nodal signaling pathway(GO:0038092) |
| 0.4 | 10.2 | GO:1904707 | positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.4 | 2.3 | GO:0014004 | microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.4 | 0.4 | GO:0071421 | manganese ion transmembrane transport(GO:0071421) |
| 0.4 | 1.1 | GO:0048203 | vesicle targeting, trans-Golgi to endosome(GO:0048203) |
| 0.4 | 1.1 | GO:2000561 | CD4-positive, alpha-beta T cell proliferation(GO:0035739) regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) |
| 0.4 | 1.9 | GO:0000973 | posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
| 0.4 | 1.9 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
| 0.4 | 1.9 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.4 | 4.5 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.4 | 1.9 | GO:0032377 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.4 | 1.1 | GO:0044806 | G-quadruplex DNA unwinding(GO:0044806) |
| 0.4 | 1.1 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.4 | 2.2 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.4 | 0.7 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.4 | 1.1 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.4 | 3.3 | GO:0002480 | antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
| 0.4 | 1.8 | GO:0090669 | telomerase RNA stabilization(GO:0090669) |
| 0.4 | 0.4 | GO:0032240 | negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.4 | 0.4 | GO:0021511 | spinal cord patterning(GO:0021511) |
| 0.4 | 2.5 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.4 | 5.1 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
| 0.4 | 0.7 | GO:0098935 | dendritic transport(GO:0098935) anterograde dendritic transport(GO:0098937) |
| 0.4 | 0.4 | GO:0032634 | interleukin-5 production(GO:0032634) |
| 0.4 | 1.8 | GO:0060736 | prostate gland growth(GO:0060736) |
| 0.4 | 0.4 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.4 | 1.1 | GO:0010718 | positive regulation of epithelial to mesenchymal transition(GO:0010718) |
| 0.4 | 0.4 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
| 0.4 | 2.8 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
| 0.4 | 2.1 | GO:0061084 | regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) |
| 0.4 | 7.0 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.3 | 5.6 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.3 | 7.3 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.3 | 2.1 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
| 0.3 | 0.7 | GO:2000374 | regulation of oxygen metabolic process(GO:2000374) |
| 0.3 | 0.3 | GO:0071874 | response to norepinephrine(GO:0071873) cellular response to norepinephrine stimulus(GO:0071874) |
| 0.3 | 1.4 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
| 0.3 | 2.4 | GO:0016322 | neuron remodeling(GO:0016322) |
| 0.3 | 18.7 | GO:0033173 | calcineurin-NFAT signaling cascade(GO:0033173) |
| 0.3 | 1.0 | GO:0042727 | flavin-containing compound biosynthetic process(GO:0042727) |
| 0.3 | 1.0 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
| 0.3 | 0.7 | GO:1902807 | negative regulation of cell cycle G1/S phase transition(GO:1902807) |
| 0.3 | 3.0 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
| 0.3 | 1.7 | GO:0072396 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) |
| 0.3 | 1.0 | GO:2000564 | CD8-positive, alpha-beta T cell proliferation(GO:0035740) regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000564) |
| 0.3 | 0.7 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
| 0.3 | 1.3 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
| 0.3 | 0.3 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.3 | 3.9 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.3 | 0.3 | GO:0007413 | axonal fasciculation(GO:0007413) |
| 0.3 | 2.9 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.3 | 0.3 | GO:0021896 | forebrain astrocyte differentiation(GO:0021896) forebrain astrocyte development(GO:0021897) |
| 0.3 | 1.0 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
| 0.3 | 1.0 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
| 0.3 | 0.7 | GO:0035902 | response to immobilization stress(GO:0035902) |
| 0.3 | 0.6 | GO:0003011 | involuntary skeletal muscle contraction(GO:0003011) |
| 0.3 | 1.3 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
| 0.3 | 0.3 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.3 | 0.6 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
| 0.3 | 0.3 | GO:1904760 | myofibroblast differentiation(GO:0036446) regulation of myofibroblast differentiation(GO:1904760) |
| 0.3 | 3.2 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.3 | 0.6 | GO:0052151 | positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation of apoptotic process by virus(GO:0060139) |
| 0.3 | 1.0 | GO:0035621 | ER to Golgi ceramide transport(GO:0035621) |
| 0.3 | 0.3 | GO:0033128 | negative regulation of histone phosphorylation(GO:0033128) |
| 0.3 | 0.3 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.3 | 1.0 | GO:1904425 | negative regulation of GTP binding(GO:1904425) |
| 0.3 | 1.3 | GO:0042357 | thiamine diphosphate metabolic process(GO:0042357) |
| 0.3 | 5.1 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.3 | 0.3 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 0.3 | 1.0 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.3 | 0.3 | GO:0070839 | divalent metal ion export(GO:0070839) |
| 0.3 | 0.9 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.3 | 0.9 | GO:0035544 | negative regulation of SNARE complex assembly(GO:0035544) |
| 0.3 | 18.0 | GO:0034260 | negative regulation of GTPase activity(GO:0034260) |
| 0.3 | 0.3 | GO:0030194 | positive regulation of blood coagulation(GO:0030194) positive regulation of coagulation(GO:0050820) positive regulation of hemostasis(GO:1900048) |
| 0.3 | 0.6 | GO:0038162 | erythropoietin-mediated signaling pathway(GO:0038162) |
| 0.3 | 0.9 | GO:0033214 | iron assimilation(GO:0033212) iron assimilation by chelation and transport(GO:0033214) positive regulation of bone mineralization involved in bone maturation(GO:1900159) negative regulation of tumor necrosis factor (ligand) superfamily member 11 production(GO:2000308) |
| 0.3 | 0.3 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
| 0.3 | 0.3 | GO:0018894 | dibenzo-p-dioxin metabolic process(GO:0018894) |
| 0.3 | 0.3 | GO:0072237 | metanephric proximal tubule development(GO:0072237) |
| 0.3 | 3.4 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
| 0.3 | 0.3 | GO:0010958 | regulation of amino acid import(GO:0010958) |
| 0.3 | 9.5 | GO:0032007 | negative regulation of TOR signaling(GO:0032007) |
| 0.3 | 0.3 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
| 0.3 | 0.9 | GO:0060120 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) arterial endothelial cell fate commitment(GO:0060844) blood vessel lumenization(GO:0072554) regulation of ephrin receptor signaling pathway(GO:1901187) positive regulation of ephrin receptor signaling pathway(GO:1901189) positive regulation of canonical Wnt signaling pathway involved in cardiac muscle cell fate commitment(GO:1901297) positive regulation of canonical Wnt signaling pathway involved in heart development(GO:1905068) |
| 0.3 | 0.3 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 0.3 | 0.6 | GO:0010265 | SCF complex assembly(GO:0010265) |
| 0.3 | 6.0 | GO:0000729 | DNA double-strand break processing(GO:0000729) |
| 0.3 | 0.6 | GO:1903233 | regulation of calcium ion-dependent exocytosis of neurotransmitter(GO:1903233) |
| 0.3 | 0.9 | GO:0051311 | meiotic metaphase I plate congression(GO:0043060) meiotic spindle midzone assembly(GO:0051257) meiotic metaphase plate congression(GO:0051311) |
| 0.3 | 0.9 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
| 0.3 | 0.6 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
| 0.3 | 0.9 | GO:0007497 | posterior midgut development(GO:0007497) |
| 0.3 | 1.2 | GO:1901836 | regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901836) positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.3 | 0.3 | GO:0034059 | response to anoxia(GO:0034059) |
| 0.3 | 0.6 | GO:0030505 | inorganic diphosphate transport(GO:0030505) |
| 0.3 | 1.2 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.3 | 7.0 | GO:0007130 | synaptonemal complex assembly(GO:0007130) synaptonemal complex organization(GO:0070193) |
| 0.3 | 0.6 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.3 | 14.7 | GO:0031572 | G2 DNA damage checkpoint(GO:0031572) |
| 0.3 | 0.6 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.3 | 0.9 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
| 0.3 | 0.9 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.3 | 0.6 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
| 0.3 | 1.1 | GO:2000143 | negative regulation of DNA-templated transcription, initiation(GO:2000143) |
| 0.3 | 0.9 | GO:0035408 | histone H3-T6 phosphorylation(GO:0035408) |
| 0.3 | 1.4 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.3 | 1.1 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
| 0.3 | 1.4 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
| 0.3 | 1.7 | GO:1900133 | regulation of renin secretion into blood stream(GO:1900133) |
| 0.3 | 0.3 | GO:0030581 | intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) regulation by virus of viral protein levels in host cell(GO:0046719) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 0.3 | 0.3 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
| 0.3 | 0.6 | GO:0097152 | mesenchymal cell apoptotic process(GO:0097152) |
| 0.3 | 0.6 | GO:0001575 | globoside metabolic process(GO:0001575) |
| 0.3 | 0.8 | GO:0021538 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.3 | 0.3 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.3 | 2.0 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.3 | 0.8 | GO:0045955 | negative regulation of calcium ion-dependent exocytosis(GO:0045955) |
| 0.3 | 0.8 | GO:0000354 | cis assembly of pre-catalytic spliceosome(GO:0000354) |
| 0.3 | 0.6 | GO:1902617 | response to fluoride(GO:1902617) |
| 0.3 | 0.6 | GO:0010956 | negative regulation of calcidiol 1-monooxygenase activity(GO:0010956) |
| 0.3 | 2.5 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.3 | 0.6 | GO:2000546 | positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
| 0.3 | 2.2 | GO:0043967 | histone H4 acetylation(GO:0043967) |
| 0.3 | 3.9 | GO:0021702 | cerebellar Purkinje cell layer formation(GO:0021694) cerebellar Purkinje cell differentiation(GO:0021702) |
| 0.3 | 1.9 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.3 | 1.1 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.3 | 0.5 | GO:0010543 | regulation of platelet activation(GO:0010543) |
| 0.3 | 2.5 | GO:0051415 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.3 | 1.9 | GO:0072734 | response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
| 0.3 | 0.5 | GO:0003402 | planar cell polarity pathway involved in axis elongation(GO:0003402) |
| 0.3 | 1.9 | GO:2000124 | regulation of endocannabinoid signaling pathway(GO:2000124) |
| 0.3 | 0.5 | GO:1903413 | cellular response to bile acid(GO:1903413) |
| 0.3 | 3.0 | GO:0046541 | saliva secretion(GO:0046541) |
| 0.3 | 1.6 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.3 | 0.8 | GO:1903348 | positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.3 | 1.1 | GO:0003016 | respiratory system process(GO:0003016) |
| 0.3 | 2.1 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
| 0.3 | 0.3 | GO:1904954 | canonical Wnt signaling pathway involved in midbrain dopaminergic neuron differentiation(GO:1904954) |
| 0.3 | 1.6 | GO:0006065 | UDP-glucuronate biosynthetic process(GO:0006065) |
| 0.3 | 2.4 | GO:1905216 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
| 0.3 | 0.3 | GO:0021535 | cell migration in hindbrain(GO:0021535) |
| 0.3 | 1.3 | GO:0044240 | multicellular organism lipid catabolic process(GO:0044240) |
| 0.3 | 1.9 | GO:0061141 | lung ciliated cell differentiation(GO:0061141) negative regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000795) |
| 0.3 | 0.3 | GO:0021650 | vestibulocochlear nerve formation(GO:0021650) |
| 0.3 | 2.9 | GO:0052805 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
| 0.3 | 2.1 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.3 | 0.8 | GO:1900114 | positive regulation of histone H3-K9 trimethylation(GO:1900114) |
| 0.3 | 0.3 | GO:0035912 | dorsal aorta morphogenesis(GO:0035912) |
| 0.3 | 0.5 | GO:0048664 | neuron fate determination(GO:0048664) |
| 0.3 | 1.0 | GO:0042126 | nitrate metabolic process(GO:0042126) |
| 0.3 | 2.3 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.3 | 0.5 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.3 | 0.3 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.3 | 0.8 | GO:0070091 | glucagon secretion(GO:0070091) regulation of glucagon secretion(GO:0070092) |
| 0.3 | 0.5 | GO:0002755 | MyD88-dependent toll-like receptor signaling pathway(GO:0002755) |
| 0.3 | 0.8 | GO:1904106 | protein localization to microvillus(GO:1904106) |
| 0.3 | 1.5 | GO:0048630 | skeletal muscle tissue growth(GO:0048630) |
| 0.3 | 8.9 | GO:0060074 | synapse maturation(GO:0060074) |
| 0.3 | 0.3 | GO:0098905 | regulation of bundle of His cell action potential(GO:0098905) |
| 0.3 | 2.3 | GO:0003373 | dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
| 0.3 | 1.0 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.3 | 1.0 | GO:0072658 | maintenance of protein location in membrane(GO:0072658) maintenance of protein location in plasma membrane(GO:0072660) positive regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900827) |
| 0.3 | 1.0 | GO:0060313 | negative regulation of blood vessel remodeling(GO:0060313) |
| 0.3 | 0.5 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.3 | 0.3 | GO:1902732 | positive regulation of chondrocyte proliferation(GO:1902732) |
| 0.2 | 1.2 | GO:1902412 | regulation of mitotic cytokinesis(GO:1902412) |
| 0.2 | 3.2 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.2 | 1.2 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.2 | 10.4 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.2 | 1.7 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
| 0.2 | 4.6 | GO:0009437 | carnitine metabolic process(GO:0009437) |
| 0.2 | 1.9 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.2 | 1.7 | GO:0043435 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.2 | 0.7 | GO:0060168 | positive regulation of adenosine receptor signaling pathway(GO:0060168) |
| 0.2 | 0.5 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
| 0.2 | 2.9 | GO:0035067 | negative regulation of histone acetylation(GO:0035067) |
| 0.2 | 1.0 | GO:0045023 | G0 to G1 transition(GO:0045023) |
| 0.2 | 0.7 | GO:0045829 | negative regulation of isotype switching(GO:0045829) |
| 0.2 | 0.7 | GO:0072675 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.2 | 0.5 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.2 | 0.7 | GO:0093001 | glycolysis from storage polysaccharide through glucose-1-phosphate(GO:0093001) |
| 0.2 | 0.7 | GO:1903750 | regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
| 0.2 | 0.5 | GO:0035494 | SNARE complex disassembly(GO:0035494) |
| 0.2 | 2.1 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.2 | 6.4 | GO:0003341 | cilium movement(GO:0003341) |
| 0.2 | 1.4 | GO:2000568 | memory T cell activation(GO:0035709) regulation of memory T cell activation(GO:2000567) positive regulation of memory T cell activation(GO:2000568) |
| 0.2 | 1.4 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.2 | 0.7 | GO:0016256 | N-glycan processing to lysosome(GO:0016256) |
| 0.2 | 3.5 | GO:2000651 | positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
| 0.2 | 0.7 | GO:0044691 | tooth eruption(GO:0044691) |
| 0.2 | 3.5 | GO:0045008 | depyrimidination(GO:0045008) |
| 0.2 | 0.9 | GO:0007617 | mating behavior(GO:0007617) multi-organism reproductive behavior(GO:0044705) |
| 0.2 | 1.4 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.2 | 1.2 | GO:1904977 | lymphatic endothelial cell migration(GO:1904977) |
| 0.2 | 3.4 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
| 0.2 | 1.6 | GO:1901314 | negative regulation of histone ubiquitination(GO:0033183) negative regulation of protein K63-linked ubiquitination(GO:1900045) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.2 | 2.3 | GO:0051611 | negative regulation of neurotransmitter uptake(GO:0051581) serotonin uptake(GO:0051610) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.2 | 1.6 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.2 | 5.3 | GO:0050655 | dermatan sulfate proteoglycan metabolic process(GO:0050655) |
| 0.2 | 1.1 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.2 | 0.2 | GO:0060599 | lateral sprouting involved in mammary gland duct morphogenesis(GO:0060599) |
| 0.2 | 1.1 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.2 | 0.7 | GO:0097026 | dendritic cell dendrite assembly(GO:0097026) |
| 0.2 | 4.7 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
| 0.2 | 0.7 | GO:0021678 | third ventricle development(GO:0021678) |
| 0.2 | 1.8 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.2 | 0.2 | GO:0042987 | amyloid precursor protein catabolic process(GO:0042987) |
| 0.2 | 0.4 | GO:2000105 | positive regulation of DNA-dependent DNA replication(GO:2000105) |
| 0.2 | 1.6 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.2 | 0.4 | GO:0060263 | regulation of respiratory burst(GO:0060263) |
| 0.2 | 1.3 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
| 0.2 | 3.3 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
| 0.2 | 0.4 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.2 | 0.4 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.2 | 0.6 | GO:0002925 | positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 0.2 | 1.3 | GO:0036111 | very long-chain fatty-acyl-CoA metabolic process(GO:0036111) |
| 0.2 | 1.1 | GO:0006203 | dGTP catabolic process(GO:0006203) |
| 0.2 | 0.2 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
| 0.2 | 1.7 | GO:0007379 | segment specification(GO:0007379) |
| 0.2 | 1.3 | GO:2001044 | regulation of integrin-mediated signaling pathway(GO:2001044) |
| 0.2 | 0.6 | GO:1903697 | negative regulation of microvillus assembly(GO:1903697) |
| 0.2 | 2.5 | GO:1902260 | negative regulation of delayed rectifier potassium channel activity(GO:1902260) |
| 0.2 | 0.6 | GO:0003190 | atrioventricular valve formation(GO:0003190) |
| 0.2 | 2.5 | GO:0006657 | CDP-choline pathway(GO:0006657) |
| 0.2 | 1.0 | GO:0034770 | histone H4-K20 methylation(GO:0034770) |
| 0.2 | 1.7 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.2 | 0.6 | GO:0097032 | respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 0.2 | 0.6 | GO:1904247 | positive regulation of polynucleotide adenylyltransferase activity(GO:1904247) |
| 0.2 | 1.9 | GO:0097647 | calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
| 0.2 | 2.7 | GO:1990845 | adaptive thermogenesis(GO:1990845) |
| 0.2 | 4.1 | GO:0017121 | phospholipid scrambling(GO:0017121) |
| 0.2 | 0.2 | GO:0006566 | threonine metabolic process(GO:0006566) |
| 0.2 | 1.4 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.2 | 0.2 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
| 0.2 | 3.5 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
| 0.2 | 0.2 | GO:0098915 | membrane repolarization during ventricular cardiac muscle cell action potential(GO:0098915) |
| 0.2 | 1.0 | GO:0007595 | lactation(GO:0007595) |
| 0.2 | 3.3 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
| 0.2 | 0.4 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.2 | 0.4 | GO:0044804 | nucleophagy(GO:0044804) |
| 0.2 | 1.2 | GO:0051972 | regulation of telomerase activity(GO:0051972) |
| 0.2 | 1.6 | GO:0016198 | axon choice point recognition(GO:0016198) |
| 0.2 | 0.4 | GO:2000109 | regulation of macrophage apoptotic process(GO:2000109) |
| 0.2 | 0.8 | GO:0048698 | negative regulation of collateral sprouting in absence of injury(GO:0048698) |
| 0.2 | 1.2 | GO:0007549 | dosage compensation(GO:0007549) |
| 0.2 | 4.8 | GO:0009068 | aspartate family amino acid catabolic process(GO:0009068) |
| 0.2 | 7.3 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.2 | 2.2 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
| 0.2 | 1.0 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.2 | 1.4 | GO:0097338 | response to clozapine(GO:0097338) |
| 0.2 | 2.2 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.2 | 0.2 | GO:0051450 | myoblast proliferation(GO:0051450) |
| 0.2 | 0.6 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.2 | 21.2 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.2 | 1.2 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.2 | 0.8 | GO:0015870 | acetylcholine transport(GO:0015870) |
| 0.2 | 0.4 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.2 | 0.8 | GO:0015891 | iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
| 0.2 | 0.4 | GO:0044205 | 'de novo' UMP biosynthetic process(GO:0044205) |
| 0.2 | 2.0 | GO:0042354 | fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
| 0.2 | 0.4 | GO:2000696 | regulation of epithelial cell differentiation involved in kidney development(GO:2000696) |
| 0.2 | 0.8 | GO:0006542 | glutamine biosynthetic process(GO:0006542) |
| 0.2 | 0.2 | GO:0042713 | sperm ejaculation(GO:0042713) |
| 0.2 | 1.0 | GO:1903278 | regulation of sodium ion export(GO:1903273) positive regulation of sodium ion export(GO:1903275) regulation of sodium ion export from cell(GO:1903276) positive regulation of sodium ion export from cell(GO:1903278) |
| 0.2 | 1.0 | GO:0015862 | uridine transport(GO:0015862) |
| 0.2 | 1.4 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.2 | 1.0 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
| 0.2 | 0.4 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
| 0.2 | 1.4 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.2 | 1.2 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
| 0.2 | 3.1 | GO:0007099 | centriole replication(GO:0007099) |
| 0.2 | 1.5 | GO:0072502 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.2 | 0.8 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.2 | 2.3 | GO:0015886 | heme transport(GO:0015886) iron coordination entity transport(GO:1901678) |
| 0.2 | 0.6 | GO:0001956 | positive regulation of neurotransmitter secretion(GO:0001956) |
| 0.2 | 2.9 | GO:0060412 | ventricular septum morphogenesis(GO:0060412) |
| 0.2 | 1.0 | GO:0072177 | mesonephric duct development(GO:0072177) |
| 0.2 | 0.2 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) modulation of inhibitory postsynaptic potential(GO:0098828) |
| 0.2 | 0.4 | GO:0070781 | response to biotin(GO:0070781) |
| 0.2 | 3.3 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.2 | 0.8 | GO:0048557 | embryonic digestive tract morphogenesis(GO:0048557) |
| 0.2 | 0.4 | GO:0002232 | leukocyte chemotaxis involved in inflammatory response(GO:0002232) |
| 0.2 | 0.6 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
| 0.2 | 0.2 | GO:0002693 | positive regulation of cellular extravasation(GO:0002693) |
| 0.2 | 1.3 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.2 | 0.4 | GO:0061055 | myotome development(GO:0061055) |
| 0.2 | 0.6 | GO:1904294 | positive regulation of ERAD pathway(GO:1904294) |
| 0.2 | 1.5 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.2 | 0.4 | GO:0006404 | RNA import into nucleus(GO:0006404) |
| 0.2 | 0.9 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.2 | 0.4 | GO:0045003 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.2 | 1.5 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
| 0.2 | 0.7 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
| 0.2 | 4.1 | GO:0032012 | regulation of ARF protein signal transduction(GO:0032012) |
| 0.2 | 0.4 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
| 0.2 | 0.2 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
| 0.2 | 1.8 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
| 0.2 | 4.2 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
| 0.2 | 5.6 | GO:0043949 | regulation of cAMP-mediated signaling(GO:0043949) |
| 0.2 | 1.5 | GO:1901660 | calcium ion export(GO:1901660) calcium ion export from cell(GO:1990034) |
| 0.2 | 0.5 | GO:0045663 | positive regulation of myoblast differentiation(GO:0045663) |
| 0.2 | 1.1 | GO:0090218 | positive regulation of lipid kinase activity(GO:0090218) |
| 0.2 | 3.6 | GO:0050962 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.2 | 2.7 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.2 | 3.2 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
| 0.2 | 0.7 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
| 0.2 | 0.4 | GO:0002692 | negative regulation of cellular extravasation(GO:0002692) |
| 0.2 | 2.9 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.2 | 0.2 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.2 | 0.9 | GO:1904764 | vacuolar transmembrane transport(GO:0034486) chaperone-mediated protein transport involved in chaperone-mediated autophagy(GO:0061741) negative regulation of fibril organization(GO:1902904) chaperone-mediated autophagy translocation complex disassembly(GO:1904764) |
| 0.2 | 0.2 | GO:0021569 | rhombomere 3 development(GO:0021569) |
| 0.2 | 4.3 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.2 | 1.2 | GO:0045716 | positive regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045716) |
| 0.2 | 1.6 | GO:0032967 | positive regulation of collagen biosynthetic process(GO:0032967) |
| 0.2 | 0.5 | GO:0072334 | UDP-galactose transport(GO:0015785) UDP-galactose transmembrane transport(GO:0072334) |
| 0.2 | 1.6 | GO:0015677 | copper ion import(GO:0015677) |
| 0.2 | 2.3 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.2 | 0.7 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
| 0.2 | 0.7 | GO:1903721 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.2 | 0.5 | GO:0006286 | base-excision repair, base-free sugar-phosphate removal(GO:0006286) |
| 0.2 | 2.3 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
| 0.2 | 0.2 | GO:0002933 | lipid hydroxylation(GO:0002933) |
| 0.2 | 0.5 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.2 | 0.7 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
| 0.2 | 0.2 | GO:0060028 | convergent extension involved in axis elongation(GO:0060028) |
| 0.2 | 0.7 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.2 | 2.4 | GO:0045475 | locomotor rhythm(GO:0045475) |
| 0.2 | 0.5 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.2 | 0.3 | GO:0010452 | histone H3-K36 methylation(GO:0010452) |
| 0.2 | 1.5 | GO:0042048 | olfactory behavior(GO:0042048) |
| 0.2 | 0.5 | GO:2000661 | positive regulation of interleukin-1-mediated signaling pathway(GO:2000661) |
| 0.2 | 1.0 | GO:0097033 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.2 | 0.7 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
| 0.2 | 2.0 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.2 | 1.5 | GO:0038203 | TORC2 signaling(GO:0038203) |
| 0.2 | 0.3 | GO:0006210 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
| 0.2 | 1.3 | GO:1904355 | positive regulation of telomere capping(GO:1904355) |
| 0.2 | 2.5 | GO:0035640 | exploration behavior(GO:0035640) |
| 0.2 | 0.2 | GO:0003032 | detection of oxygen(GO:0003032) |
| 0.2 | 0.5 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
| 0.2 | 2.5 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.2 | 0.7 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.2 | 1.7 | GO:1904886 | beta-catenin destruction complex disassembly(GO:1904886) |
| 0.2 | 0.5 | GO:0097278 | complement-dependent cytotoxicity(GO:0097278) regulation of complement-dependent cytotoxicity(GO:1903659) |
| 0.2 | 0.5 | GO:1902075 | cellular response to salt(GO:1902075) |
| 0.2 | 0.2 | GO:0015942 | formate metabolic process(GO:0015942) |
| 0.2 | 2.0 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.2 | 0.8 | GO:1903976 | negative regulation of glial cell migration(GO:1903976) |
| 0.2 | 0.3 | GO:0034969 | histone arginine methylation(GO:0034969) |
| 0.2 | 0.3 | GO:0007439 | ectodermal digestive tract development(GO:0007439) embryonic ectodermal digestive tract development(GO:0048611) |
| 0.2 | 0.2 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
| 0.2 | 2.1 | GO:0070072 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.2 | 0.3 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
| 0.2 | 0.3 | GO:0071630 | nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
| 0.2 | 0.5 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.2 | 0.8 | GO:0070944 | neutrophil mediated cytotoxicity(GO:0070942) neutrophil mediated killing of symbiont cell(GO:0070943) neutrophil mediated killing of bacterium(GO:0070944) |
| 0.2 | 0.5 | GO:0015791 | polyol transport(GO:0015791) |
| 0.2 | 0.8 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.2 | 1.0 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.2 | 0.2 | GO:0061056 | sclerotome development(GO:0061056) |
| 0.2 | 10.2 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.2 | 0.8 | GO:0002829 | negative regulation of type 2 immune response(GO:0002829) |
| 0.2 | 1.6 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.2 | 0.2 | GO:1901299 | negative regulation of hydrogen peroxide-mediated programmed cell death(GO:1901299) |
| 0.2 | 0.6 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.2 | 0.5 | GO:0042789 | mRNA transcription from RNA polymerase II promoter(GO:0042789) |
| 0.2 | 2.2 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.2 | 0.5 | GO:0070407 | oxidation-dependent protein catabolic process(GO:0070407) |
| 0.2 | 5.3 | GO:1904837 | beta-catenin-TCF complex assembly(GO:1904837) |
| 0.2 | 2.3 | GO:0060044 | negative regulation of cardiac muscle cell proliferation(GO:0060044) |
| 0.2 | 0.8 | GO:0051182 | coenzyme transport(GO:0051182) |
| 0.2 | 0.8 | GO:0035063 | nuclear speck organization(GO:0035063) |
| 0.2 | 0.9 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
| 0.2 | 0.5 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.2 | 0.5 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.2 | 3.2 | GO:0061157 | mRNA destabilization(GO:0061157) |
| 0.2 | 0.2 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.2 | 0.5 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) negative regulation of intracellular transport of viral material(GO:1901253) |
| 0.2 | 2.1 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
| 0.2 | 1.4 | GO:0071798 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
| 0.2 | 0.6 | GO:2001288 | positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.2 | 0.2 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.2 | 0.2 | GO:0061740 | protein targeting to lysosome involved in chaperone-mediated autophagy(GO:0061740) |
| 0.2 | 0.9 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.2 | 0.2 | GO:0071850 | mitotic cell cycle arrest(GO:0071850) |
| 0.2 | 0.2 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
| 0.2 | 0.6 | GO:1990573 | potassium ion import across plasma membrane(GO:1990573) |
| 0.2 | 0.5 | GO:0021904 | dorsal/ventral neural tube patterning(GO:0021904) |
| 0.2 | 0.6 | GO:0050975 | sensory perception of touch(GO:0050975) |
| 0.1 | 2.2 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) |
| 0.1 | 0.3 | GO:2000192 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) negative regulation of fatty acid transport(GO:2000192) |
| 0.1 | 0.7 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.1 | 1.2 | GO:0023035 | CD40 signaling pathway(GO:0023035) |
| 0.1 | 0.6 | GO:0045917 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.1 | 0.1 | GO:0072337 | modified amino acid transport(GO:0072337) |
| 0.1 | 0.6 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.1 | 0.3 | GO:0061762 | CAMKK-AMPK signaling cascade(GO:0061762) |
| 0.1 | 0.9 | GO:0072592 | oxygen metabolic process(GO:0072592) |
| 0.1 | 0.6 | GO:0031116 | positive regulation of microtubule polymerization(GO:0031116) |
| 0.1 | 0.9 | GO:0006983 | ER overload response(GO:0006983) |
| 0.1 | 5.6 | GO:0014047 | glutamate secretion(GO:0014047) |
| 0.1 | 0.1 | GO:0003220 | left ventricular cardiac muscle tissue morphogenesis(GO:0003220) positive regulation of calcium-transporting ATPase activity(GO:1901896) |
| 0.1 | 0.3 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.1 | 0.7 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.1 | 1.8 | GO:0015866 | ADP transport(GO:0015866) |
| 0.1 | 0.1 | GO:0006333 | chromatin assembly or disassembly(GO:0006333) |
| 0.1 | 0.7 | GO:1902896 | terminal web assembly(GO:1902896) |
| 0.1 | 0.6 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
| 0.1 | 1.0 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
| 0.1 | 0.6 | GO:0003157 | endocardium development(GO:0003157) |
| 0.1 | 0.4 | GO:0010286 | heat acclimation(GO:0010286) cellular heat acclimation(GO:0070370) |
| 0.1 | 1.3 | GO:0031054 | pre-miRNA processing(GO:0031054) |
| 0.1 | 6.8 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.1 | 3.3 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
| 0.1 | 1.4 | GO:0042940 | D-amino acid transport(GO:0042940) |
| 0.1 | 0.3 | GO:0043589 | skin morphogenesis(GO:0043589) |
| 0.1 | 2.0 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.1 | 0.3 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
| 0.1 | 0.3 | GO:0032621 | interleukin-18 production(GO:0032621) |
| 0.1 | 1.8 | GO:0060004 | reflex(GO:0060004) |
| 0.1 | 0.1 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.1 | 0.3 | GO:0043551 | regulation of phosphatidylinositol 3-kinase activity(GO:0043551) |
| 0.1 | 0.5 | GO:0007569 | cell aging(GO:0007569) |
| 0.1 | 0.7 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
| 0.1 | 1.2 | GO:0035933 | glucocorticoid secretion(GO:0035933) regulation of glucocorticoid secretion(GO:2000849) |
| 0.1 | 0.4 | GO:1904808 | regulation of protein oxidation(GO:1904806) positive regulation of protein oxidation(GO:1904808) |
| 0.1 | 0.4 | GO:0070676 | intralumenal vesicle formation(GO:0070676) |
| 0.1 | 0.3 | GO:0060931 | sinoatrial node cell development(GO:0060931) |
| 0.1 | 0.4 | GO:1902159 | regulation of cyclic nucleotide-gated ion channel activity(GO:1902159) positive regulation of cyclic nucleotide-gated ion channel activity(GO:1902161) |
| 0.1 | 0.5 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.1 | 4.0 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.1 | 0.1 | GO:0045668 | negative regulation of osteoblast differentiation(GO:0045668) |
| 0.1 | 3.8 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
| 0.1 | 0.4 | GO:0006625 | protein targeting to peroxisome(GO:0006625) peroxisomal transport(GO:0043574) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
| 0.1 | 0.5 | GO:0060025 | regulation of synaptic activity(GO:0060025) |
| 0.1 | 0.8 | GO:2000234 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.1 | 0.4 | GO:1904924 | negative regulation of mitophagy in response to mitochondrial depolarization(GO:1904924) |
| 0.1 | 1.1 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
| 0.1 | 1.9 | GO:1901739 | regulation of myoblast fusion(GO:1901739) positive regulation of myoblast fusion(GO:1901741) |
| 0.1 | 0.3 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
| 0.1 | 0.3 | GO:0015853 | adenine transport(GO:0015853) |
| 0.1 | 2.0 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.1 | 2.4 | GO:0036149 | phosphatidylinositol acyl-chain remodeling(GO:0036149) |
| 0.1 | 0.7 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
| 0.1 | 0.4 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
| 0.1 | 1.2 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
| 0.1 | 2.8 | GO:1900151 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.1 | 1.0 | GO:0032782 | bile acid secretion(GO:0032782) |
| 0.1 | 1.6 | GO:0007585 | respiratory gaseous exchange(GO:0007585) |
| 0.1 | 0.1 | GO:1903630 | regulation of aminoacyl-tRNA ligase activity(GO:1903630) |
| 0.1 | 1.6 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
| 0.1 | 0.4 | GO:1905244 | regulation of modification of synaptic structure(GO:1905244) |
| 0.1 | 4.5 | GO:0014904 | myotube cell development(GO:0014904) |
| 0.1 | 0.3 | GO:0060166 | olfactory pit development(GO:0060166) |
| 0.1 | 0.3 | GO:0043615 | astrocyte cell migration(GO:0043615) |
| 0.1 | 0.4 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
| 0.1 | 0.5 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
| 0.1 | 0.3 | GO:0045343 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
| 0.1 | 0.1 | GO:0002691 | regulation of cellular extravasation(GO:0002691) |
| 0.1 | 0.5 | GO:0045204 | MAPK export from nucleus(GO:0045204) |
| 0.1 | 0.4 | GO:0045196 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
| 0.1 | 3.3 | GO:0051568 | histone H3-K4 methylation(GO:0051568) |
| 0.1 | 0.8 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.1 | 1.1 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
| 0.1 | 0.6 | GO:0034127 | regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034127) negative regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034128) |
| 0.1 | 0.5 | GO:0097056 | selenocysteinyl-tRNA(Sec) biosynthetic process(GO:0097056) |
| 0.1 | 0.4 | GO:0036302 | atrioventricular canal development(GO:0036302) |
| 0.1 | 1.0 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.1 | 0.2 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
| 0.1 | 3.5 | GO:0010664 | negative regulation of striated muscle cell apoptotic process(GO:0010664) |
| 0.1 | 1.6 | GO:0090278 | negative regulation of peptide secretion(GO:0002792) negative regulation of peptide hormone secretion(GO:0090278) |
| 0.1 | 0.5 | GO:0000959 | mitochondrial RNA metabolic process(GO:0000959) |
| 0.1 | 0.2 | GO:0045739 | positive regulation of DNA repair(GO:0045739) |
| 0.1 | 1.1 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.1 | 1.8 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
| 0.1 | 11.7 | GO:0007224 | smoothened signaling pathway(GO:0007224) |
| 0.1 | 0.4 | GO:1902996 | regulation of neurofibrillary tangle assembly(GO:1902996) |
| 0.1 | 4.2 | GO:0043489 | RNA stabilization(GO:0043489) |
| 0.1 | 0.2 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.1 | 1.1 | GO:0032264 | IMP salvage(GO:0032264) |
| 0.1 | 0.7 | GO:1903385 | regulation of homophilic cell adhesion(GO:1903385) |
| 0.1 | 0.4 | GO:0018057 | peptidyl-lysine oxidation(GO:0018057) |
| 0.1 | 0.2 | GO:0010269 | response to selenium ion(GO:0010269) |
| 0.1 | 0.6 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
| 0.1 | 0.2 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.1 | 0.5 | GO:0034587 | piRNA metabolic process(GO:0034587) |
| 0.1 | 0.7 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.1 | 0.7 | GO:0072310 | glomerular epithelial cell development(GO:0072310) |
| 0.1 | 1.2 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.1 | 2.6 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.1 | 0.1 | GO:1903018 | regulation of glycoprotein metabolic process(GO:1903018) |
| 0.1 | 0.8 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.1 | 0.6 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.1 | 0.3 | GO:0034447 | very-low-density lipoprotein particle clearance(GO:0034447) |
| 0.1 | 1.1 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
| 0.1 | 0.7 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.1 | 1.1 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.1 | 0.5 | GO:0043128 | regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043126) positive regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043128) |
| 0.1 | 1.0 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 0.1 | 9.6 | GO:0032436 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032436) |
| 0.1 | 0.2 | GO:0045066 | regulatory T cell differentiation(GO:0045066) regulation of regulatory T cell differentiation(GO:0045589) |
| 0.1 | 0.1 | GO:0061034 | olfactory bulb mitral cell layer development(GO:0061034) |
| 0.1 | 0.4 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 | 10.4 | GO:0007286 | spermatid development(GO:0007286) |
| 0.1 | 0.3 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
| 0.1 | 0.7 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
| 0.1 | 0.4 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
| 0.1 | 0.3 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
| 0.1 | 0.4 | GO:0007320 | insemination(GO:0007320) |
| 0.1 | 0.7 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
| 0.1 | 0.7 | GO:0000077 | DNA damage checkpoint(GO:0000077) |
| 0.1 | 0.6 | GO:0090102 | cochlea development(GO:0090102) |
| 0.1 | 0.9 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
| 0.1 | 0.1 | GO:0097267 | omega-hydroxylase P450 pathway(GO:0097267) |
| 0.1 | 4.8 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
| 0.1 | 1.0 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.1 | 0.7 | GO:0070560 | protein secretion by platelet(GO:0070560) |
| 0.1 | 0.4 | GO:0031296 | B cell costimulation(GO:0031296) |
| 0.1 | 0.7 | GO:0019048 | modulation by virus of host morphology or physiology(GO:0019048) |
| 0.1 | 0.9 | GO:0070862 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.1 | 1.7 | GO:0046069 | cGMP catabolic process(GO:0046069) |
| 0.1 | 1.1 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.1 | 0.4 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
| 0.1 | 9.2 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.1 | 1.7 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.1 | 1.6 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.1 | 0.3 | GO:0016098 | monoterpenoid metabolic process(GO:0016098) |
| 0.1 | 0.4 | GO:0051083 | 'de novo' cotranslational protein folding(GO:0051083) |
| 0.1 | 0.5 | GO:0061760 | antifungal innate immune response(GO:0061760) |
| 0.1 | 0.3 | GO:0048515 | spermatid differentiation(GO:0048515) |
| 0.1 | 0.4 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 0.1 | 0.1 | GO:2000425 | regulation of apoptotic cell clearance(GO:2000425) |
| 0.1 | 0.5 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) positive regulation of metalloendopeptidase activity(GO:1904685) |
| 0.1 | 1.3 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
| 0.1 | 0.3 | GO:0061739 | protein lipidation involved in autophagosome assembly(GO:0061739) |
| 0.1 | 1.0 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.1 | 0.4 | GO:1902037 | negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
| 0.1 | 0.2 | GO:0070541 | response to platinum ion(GO:0070541) |
| 0.1 | 0.2 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.1 | 1.4 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
| 0.1 | 0.1 | GO:0014052 | regulation of gamma-aminobutyric acid secretion(GO:0014052) |
| 0.1 | 0.3 | GO:0090155 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.1 | 0.5 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
| 0.1 | 0.3 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
| 0.1 | 0.5 | GO:1905225 | response to thyrotropin-releasing hormone(GO:1905225) |
| 0.1 | 0.3 | GO:0050822 | peptide stabilization(GO:0050822) peptide antigen stabilization(GO:0050823) |
| 0.1 | 1.0 | GO:0021984 | adenohypophysis development(GO:0021984) |
| 0.1 | 0.4 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.1 | 0.7 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
| 0.1 | 1.7 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.1 | 1.8 | GO:0072348 | sulfur compound transport(GO:0072348) |
| 0.1 | 0.2 | GO:0006780 | uroporphyrinogen III biosynthetic process(GO:0006780) uroporphyrinogen III metabolic process(GO:0046502) |
| 0.1 | 0.5 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.1 | 0.4 | GO:0016559 | peroxisome fission(GO:0016559) |
| 0.1 | 0.2 | GO:0072553 | terminal button organization(GO:0072553) |
| 0.1 | 0.3 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
| 0.1 | 0.2 | GO:0010862 | positive regulation of pathway-restricted SMAD protein phosphorylation(GO:0010862) |
| 0.1 | 0.1 | GO:0045799 | positive regulation of chromatin assembly or disassembly(GO:0045799) |
| 0.1 | 0.1 | GO:0009452 | 7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
| 0.1 | 1.9 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
| 0.1 | 0.4 | GO:0048254 | snoRNA localization(GO:0048254) |
| 0.1 | 0.8 | GO:0071624 | positive regulation of granulocyte chemotaxis(GO:0071624) positive regulation of neutrophil chemotaxis(GO:0090023) |
| 0.1 | 0.1 | GO:0014916 | regulation of lung blood pressure(GO:0014916) |
| 0.1 | 0.9 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
| 0.1 | 0.3 | GO:0044331 | cell-cell adhesion mediated by cadherin(GO:0044331) |
| 0.1 | 4.8 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
| 0.1 | 0.2 | GO:0001878 | response to yeast(GO:0001878) |
| 0.1 | 0.3 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.1 | 0.6 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
| 0.1 | 0.6 | GO:0007625 | grooming behavior(GO:0007625) |
| 0.1 | 0.7 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.1 | 0.6 | GO:0031629 | synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
| 0.1 | 0.1 | GO:0036216 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
| 0.1 | 0.3 | GO:0046338 | phosphatidylethanolamine catabolic process(GO:0046338) |
| 0.1 | 0.2 | GO:0071030 | nuclear mRNA surveillance of spliceosomal pre-mRNA splicing(GO:0071030) nuclear retention of unspliced pre-mRNA at the site of transcription(GO:0071048) |
| 0.1 | 0.7 | GO:0015781 | pyrimidine nucleotide-sugar transport(GO:0015781) |
| 0.1 | 0.2 | GO:0051881 | regulation of mitochondrial membrane potential(GO:0051881) |
| 0.1 | 0.9 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
| 0.1 | 0.1 | GO:2001022 | positive regulation of response to DNA damage stimulus(GO:2001022) |
| 0.1 | 0.2 | GO:0000454 | snoRNA guided rRNA pseudouridine synthesis(GO:0000454) |
| 0.1 | 0.4 | GO:0060157 | urinary bladder development(GO:0060157) |
| 0.1 | 0.5 | GO:0003025 | regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
| 0.1 | 0.2 | GO:0006015 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.1 | 0.7 | GO:0034036 | purine ribonucleoside bisphosphate biosynthetic process(GO:0034036) 3'-phosphoadenosine 5'-phosphosulfate biosynthetic process(GO:0050428) |
| 0.1 | 0.2 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
| 0.1 | 4.4 | GO:0030509 | BMP signaling pathway(GO:0030509) |
| 0.1 | 0.3 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.1 | 0.1 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.1 | 0.4 | GO:1902659 | regulation of glucose mediated signaling pathway(GO:1902659) |
| 0.1 | 0.3 | GO:0006783 | heme biosynthetic process(GO:0006783) |
| 0.1 | 0.8 | GO:0006552 | leucine catabolic process(GO:0006552) |
| 0.1 | 0.2 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.1 | 1.5 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
| 0.1 | 0.3 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
| 0.1 | 0.3 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.1 | 0.9 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.1 | 1.3 | GO:0016075 | rRNA catabolic process(GO:0016075) |
| 0.1 | 0.4 | GO:0015798 | myo-inositol transport(GO:0015798) |
| 0.1 | 0.5 | GO:0052422 | modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.1 | 0.3 | GO:2000678 | negative regulation of transcription regulatory region DNA binding(GO:2000678) |
| 0.1 | 0.2 | GO:0031638 | zymogen activation(GO:0031638) |
| 0.1 | 0.2 | GO:0016476 | regulation of embryonic cell shape(GO:0016476) |
| 0.1 | 5.3 | GO:0046324 | regulation of glucose import(GO:0046324) |
| 0.1 | 0.5 | GO:1901419 | regulation of response to alcohol(GO:1901419) |
| 0.1 | 9.1 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.1 | 0.2 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.1 | 0.2 | GO:1901800 | positive regulation of proteasomal protein catabolic process(GO:1901800) |
| 0.1 | 0.6 | GO:0040031 | snRNA modification(GO:0040031) |
| 0.1 | 0.2 | GO:0072708 | response to sorbitol(GO:0072708) cellular response to sorbitol(GO:0072709) |
| 0.1 | 0.8 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
| 0.1 | 0.7 | GO:0014854 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) |
| 0.1 | 0.6 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.1 | 1.7 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.1 | 0.6 | GO:0060765 | regulation of androgen receptor signaling pathway(GO:0060765) |
| 0.1 | 1.4 | GO:0061512 | protein localization to cilium(GO:0061512) |
| 0.1 | 0.2 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.1 | 0.4 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.1 | 4.1 | GO:0006953 | acute-phase response(GO:0006953) |
| 0.1 | 0.1 | GO:0061365 | positive regulation of triglyceride lipase activity(GO:0061365) |
| 0.1 | 0.2 | GO:1902530 | regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 0.1 | 0.3 | GO:0035743 | CD4-positive, alpha-beta T cell cytokine production(GO:0035743) T-helper 2 cell cytokine production(GO:0035745) |
| 0.1 | 0.2 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
| 0.1 | 0.1 | GO:0051771 | negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
| 0.1 | 0.5 | GO:0006264 | mitochondrial DNA replication(GO:0006264) |
| 0.1 | 0.4 | GO:0045964 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
| 0.1 | 0.2 | GO:0007231 | osmosensory signaling pathway(GO:0007231) |
| 0.1 | 0.5 | GO:0046604 | positive regulation of mitotic centrosome separation(GO:0046604) |
| 0.1 | 0.5 | GO:0008090 | retrograde axonal transport(GO:0008090) |
| 0.1 | 1.1 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.1 | 4.1 | GO:0006413 | translational initiation(GO:0006413) |
| 0.1 | 0.1 | GO:1905154 | negative regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034125) negative regulation of eosinophil activation(GO:1902567) negative regulation of membrane invagination(GO:1905154) negative regulation of eosinophil migration(GO:2000417) |
| 0.1 | 2.2 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.1 | 0.2 | GO:0030070 | insulin processing(GO:0030070) |
| 0.1 | 0.5 | GO:0050774 | negative regulation of dendrite morphogenesis(GO:0050774) |
| 0.1 | 0.6 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
| 0.1 | 0.1 | GO:0071288 | cellular response to mercury ion(GO:0071288) |
| 0.1 | 0.1 | GO:2001187 | positive regulation of CD8-positive, alpha-beta T cell activation(GO:2001187) |
| 0.1 | 0.4 | GO:0048539 | bone marrow development(GO:0048539) |
| 0.1 | 0.2 | GO:0071503 | response to heparin(GO:0071503) |
| 0.1 | 0.9 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.1 | 0.1 | GO:0021577 | hindbrain structural organization(GO:0021577) cerebellum structural organization(GO:0021589) spinal cord motor neuron migration(GO:0097476) |
| 0.1 | 0.2 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
| 0.1 | 0.8 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
| 0.1 | 0.3 | GO:0052651 | monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.1 | 0.6 | GO:0061418 | regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061418) |
| 0.1 | 0.6 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
| 0.1 | 3.6 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.1 | 0.1 | GO:0070142 | synaptic vesicle budding(GO:0070142) |
| 0.1 | 0.8 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.1 | 0.2 | GO:0036309 | protein localization to M-band(GO:0036309) |
| 0.1 | 0.1 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.1 | 0.5 | GO:0046146 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.1 | 1.6 | GO:0072538 | T-helper 17 type immune response(GO:0072538) |
| 0.1 | 0.3 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
| 0.1 | 0.2 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
| 0.1 | 0.1 | GO:1902804 | negative regulation of synaptic vesicle transport(GO:1902804) |
| 0.1 | 0.8 | GO:0006677 | glycosylceramide metabolic process(GO:0006677) |
| 0.1 | 0.3 | GO:0021514 | ventral spinal cord interneuron differentiation(GO:0021514) |
| 0.1 | 0.1 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
| 0.1 | 0.2 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
| 0.1 | 0.1 | GO:0046490 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate metabolic process(GO:0046490) |
| 0.1 | 0.3 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
| 0.1 | 0.2 | GO:0010716 | negative regulation of extracellular matrix disassembly(GO:0010716) |
| 0.1 | 0.1 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
| 0.1 | 1.0 | GO:0022900 | electron transport chain(GO:0022900) |
| 0.1 | 0.1 | GO:0050913 | sensory perception of bitter taste(GO:0050913) |
| 0.1 | 0.1 | GO:0002724 | regulation of T cell cytokine production(GO:0002724) |
| 0.1 | 0.2 | GO:0006004 | fucose metabolic process(GO:0006004) |
| 0.1 | 0.2 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
| 0.1 | 0.1 | GO:0032332 | positive regulation of chondrocyte differentiation(GO:0032332) |
| 0.1 | 0.3 | GO:0051290 | protein heterotetramerization(GO:0051290) |
| 0.1 | 0.1 | GO:0090191 | negative regulation of branching involved in ureteric bud morphogenesis(GO:0090191) |
| 0.1 | 0.3 | GO:1903170 | negative regulation of calcium ion transmembrane transport(GO:1903170) |
| 0.1 | 0.5 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.1 | 0.3 | GO:2001295 | malonyl-CoA biosynthetic process(GO:2001295) |
| 0.1 | 0.3 | GO:0070124 | mitochondrial translational initiation(GO:0070124) |
| 0.1 | 2.0 | GO:0010761 | fibroblast migration(GO:0010761) |
| 0.1 | 1.2 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.1 | 0.2 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
| 0.1 | 0.1 | GO:0071140 | resolution of recombination intermediates(GO:0071139) resolution of mitotic recombination intermediates(GO:0071140) |
| 0.1 | 0.2 | GO:0071675 | mononuclear cell migration(GO:0071674) regulation of mononuclear cell migration(GO:0071675) |
| 0.1 | 0.6 | GO:0086024 | adrenergic receptor signaling pathway involved in positive regulation of heart rate(GO:0086024) |
| 0.1 | 0.2 | GO:0003340 | negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) |
| 0.1 | 0.9 | GO:0007141 | male meiosis I(GO:0007141) |
| 0.1 | 0.2 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.1 | 0.4 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
| 0.1 | 0.1 | GO:0097104 | postsynaptic membrane assembly(GO:0097104) gephyrin clustering involved in postsynaptic density assembly(GO:0097116) neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
| 0.1 | 1.1 | GO:0031643 | positive regulation of myelination(GO:0031643) |
| 0.1 | 0.1 | GO:2000053 | regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) |
| 0.1 | 0.4 | GO:0031123 | RNA 3'-end processing(GO:0031123) |
| 0.1 | 0.1 | GO:0030511 | positive regulation of transforming growth factor beta receptor signaling pathway(GO:0030511) positive regulation of cellular response to transforming growth factor beta stimulus(GO:1903846) |
| 0.1 | 0.7 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.1 | 0.1 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.1 | 0.4 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
| 0.1 | 0.6 | GO:1901642 | nucleoside transmembrane transport(GO:1901642) |
| 0.1 | 0.6 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.1 | 0.6 | GO:0045143 | homologous chromosome segregation(GO:0045143) |
| 0.1 | 0.1 | GO:1904180 | negative regulation of membrane depolarization(GO:1904180) |
| 0.1 | 0.2 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
| 0.1 | 0.1 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.1 | 0.2 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.1 | 0.2 | GO:0046116 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.1 | 0.7 | GO:0017004 | cytochrome complex assembly(GO:0017004) |
| 0.1 | 0.5 | GO:0010898 | positive regulation of triglyceride catabolic process(GO:0010898) |
| 0.1 | 1.7 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.1 | 0.9 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.1 | 0.1 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
| 0.1 | 0.1 | GO:0006258 | UDP-glucose catabolic process(GO:0006258) |
| 0.1 | 0.3 | GO:0033145 | positive regulation of intracellular steroid hormone receptor signaling pathway(GO:0033145) |
| 0.1 | 0.5 | GO:0051150 | regulation of smooth muscle cell differentiation(GO:0051150) |
| 0.1 | 0.1 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
| 0.1 | 0.7 | GO:0050684 | regulation of mRNA processing(GO:0050684) |
| 0.1 | 0.1 | GO:0001916 | positive regulation of T cell mediated cytotoxicity(GO:0001916) |
| 0.1 | 0.2 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.1 | 0.2 | GO:0048617 | foregut morphogenesis(GO:0007440) embryonic foregut morphogenesis(GO:0048617) |
| 0.1 | 0.6 | GO:0019054 | modulation by virus of host process(GO:0019054) |
| 0.1 | 0.9 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.1 | 0.2 | GO:1904152 | regulation of retrograde protein transport, ER to cytosol(GO:1904152) |
| 0.1 | 0.2 | GO:0031247 | actin rod assembly(GO:0031247) |
| 0.1 | 0.7 | GO:0086012 | membrane depolarization during cardiac muscle cell action potential(GO:0086012) |
| 0.1 | 0.2 | GO:0055009 | atrial cardiac muscle tissue development(GO:0003228) atrial cardiac muscle tissue morphogenesis(GO:0055009) |
| 0.1 | 2.2 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
| 0.1 | 0.2 | GO:0006903 | vesicle targeting(GO:0006903) |
| 0.1 | 0.4 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
| 0.1 | 0.2 | GO:0034334 | adherens junction maintenance(GO:0034334) |
| 0.1 | 0.1 | GO:0045763 | regulation of glutamine family amino acid metabolic process(GO:0000820) negative regulation of cellular amino acid metabolic process(GO:0045763) |
| 0.1 | 1.6 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.1 | 0.1 | GO:0021675 | nerve development(GO:0021675) |
| 0.1 | 0.2 | GO:0042701 | progesterone secretion(GO:0042701) |
| 0.1 | 0.1 | GO:0006581 | acetylcholine catabolic process in synaptic cleft(GO:0001507) acetylcholine catabolic process(GO:0006581) |
| 0.1 | 0.3 | GO:0009213 | pyrimidine nucleoside triphosphate catabolic process(GO:0009149) pyrimidine deoxyribonucleoside triphosphate catabolic process(GO:0009213) |
| 0.1 | 2.0 | GO:0001578 | microtubule bundle formation(GO:0001578) |
| 0.1 | 0.6 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.1 | 1.0 | GO:0035456 | response to interferon-beta(GO:0035456) |
| 0.1 | 0.2 | GO:0035549 | positive regulation of interferon-beta secretion(GO:0035549) interferon-alpha secretion(GO:0072642) regulation of interferon-alpha secretion(GO:1902739) positive regulation of interferon-alpha secretion(GO:1902741) |
| 0.1 | 0.4 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.1 | 0.4 | GO:0060033 | anatomical structure regression(GO:0060033) |
| 0.1 | 0.8 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
| 0.1 | 0.1 | GO:0046666 | retinal cell programmed cell death(GO:0046666) regulation of retinal cell programmed cell death(GO:0046668) |
| 0.1 | 0.1 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.1 | 0.2 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.1 | 0.6 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.1 | 0.2 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
| 0.1 | 0.2 | GO:1904970 | brush border assembly(GO:1904970) |
| 0.1 | 0.1 | GO:1904044 | response to aldosterone(GO:1904044) |
| 0.1 | 0.2 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
| 0.0 | 2.0 | GO:0050912 | detection of chemical stimulus involved in sensory perception of taste(GO:0050912) |
| 0.0 | 0.0 | GO:1901984 | negative regulation of protein acetylation(GO:1901984) |
| 0.0 | 1.4 | GO:0043171 | peptide catabolic process(GO:0043171) |
| 0.0 | 1.4 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 | 0.2 | GO:1903748 | negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
| 0.0 | 0.5 | GO:0070914 | UV-damage excision repair(GO:0070914) |
| 0.0 | 0.1 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.0 | 0.1 | GO:2000665 | interleukin-13 secretion(GO:0072611) regulation of interleukin-13 secretion(GO:2000665) |
| 0.0 | 0.4 | GO:0060292 | long term synaptic depression(GO:0060292) |
| 0.0 | 0.8 | GO:0034142 | toll-like receptor 4 signaling pathway(GO:0034142) |
| 0.0 | 0.6 | GO:1903393 | positive regulation of adherens junction organization(GO:1903393) |
| 0.0 | 0.0 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
| 0.0 | 0.1 | GO:1902548 | negative regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902548) |
| 0.0 | 0.2 | GO:0097178 | ruffle assembly(GO:0097178) |
| 0.0 | 0.5 | GO:0097194 | execution phase of apoptosis(GO:0097194) |
| 0.0 | 1.7 | GO:0032608 | interferon-beta production(GO:0032608) |
| 0.0 | 1.6 | GO:0048864 | stem cell development(GO:0048864) |
| 0.0 | 0.1 | GO:0032506 | cytokinetic process(GO:0032506) |
| 0.0 | 1.9 | GO:0002220 | innate immune response activating cell surface receptor signaling pathway(GO:0002220) |
| 0.0 | 0.5 | GO:0090266 | regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
| 0.0 | 0.7 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.0 | 0.4 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
| 0.0 | 0.1 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.0 | 0.2 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) |
| 0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.3 | GO:0033085 | negative regulation of T cell differentiation in thymus(GO:0033085) negative regulation of thymocyte aggregation(GO:2000399) |
| 0.0 | 2.8 | GO:0008033 | tRNA processing(GO:0008033) |
| 0.0 | 0.4 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.0 | 0.1 | GO:0002673 | regulation of acute inflammatory response(GO:0002673) |
| 0.0 | 0.3 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.0 | 0.1 | GO:1903244 | positive regulation of cardiac muscle adaptation(GO:0010615) positive regulation of cardiac muscle hypertrophy in response to stress(GO:1903244) |
| 0.0 | 0.3 | GO:0051547 | regulation of keratinocyte migration(GO:0051547) |
| 0.0 | 0.1 | GO:0045324 | late endosome to vacuole transport(GO:0045324) |
| 0.0 | 0.3 | GO:0071550 | death-inducing signaling complex assembly(GO:0071550) |
| 0.0 | 0.4 | GO:0060149 | negative regulation of posttranscriptional gene silencing(GO:0060149) negative regulation of gene silencing by RNA(GO:0060967) |
| 0.0 | 0.1 | GO:0008628 | hormone-mediated apoptotic signaling pathway(GO:0008628) |
| 0.0 | 0.5 | GO:0042417 | dopamine metabolic process(GO:0042417) |
| 0.0 | 0.0 | GO:0044381 | glucose import in response to insulin stimulus(GO:0044381) |
| 0.0 | 0.1 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
| 0.0 | 0.1 | GO:0046900 | tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.0 | 0.1 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.0 | 0.1 | GO:0060023 | soft palate development(GO:0060023) |
| 0.0 | 0.1 | GO:0036034 | mediator complex assembly(GO:0036034) regulation of mediator complex assembly(GO:2001176) positive regulation of mediator complex assembly(GO:2001178) |
| 0.0 | 0.1 | GO:0050893 | sensory processing(GO:0050893) |
| 0.0 | 0.2 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
| 0.0 | 0.6 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 | 0.2 | GO:0030916 | otic vesicle formation(GO:0030916) |
| 0.0 | 0.1 | GO:0051085 | chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.0 | 0.1 | GO:0090662 | ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
| 0.0 | 0.2 | GO:0048298 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) positive regulation of isotype switching to IgA isotypes(GO:0048298) |
| 0.0 | 0.0 | GO:0018198 | peptidyl-cysteine modification(GO:0018198) |
| 0.0 | 0.0 | GO:0014054 | positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
| 0.0 | 0.1 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
| 0.0 | 0.0 | GO:0060669 | embryonic placenta morphogenesis(GO:0060669) |
| 0.0 | 0.4 | GO:0010818 | T cell chemotaxis(GO:0010818) |
| 0.0 | 0.2 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.0 | 0.1 | GO:0015682 | ferric iron transport(GO:0015682) trivalent inorganic cation transport(GO:0072512) |
| 0.0 | 0.1 | GO:0033864 | positive regulation of NAD(P)H oxidase activity(GO:0033864) |
| 0.0 | 0.3 | GO:0070911 | global genome nucleotide-excision repair(GO:0070911) |
| 0.0 | 0.6 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.0 | 0.1 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.0 | 0.1 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.0 | 0.0 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.0 | 5.3 | GO:0016569 | covalent chromatin modification(GO:0016569) |
| 0.0 | 0.0 | GO:0060974 | cell migration involved in heart formation(GO:0060974) |
| 0.0 | 0.5 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.0 | 0.1 | GO:1904953 | Wnt signaling pathway involved in midbrain dopaminergic neuron differentiation(GO:1904953) |
| 0.0 | 0.0 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
| 0.0 | 0.3 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
| 0.0 | 0.4 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.0 | 0.0 | GO:0046824 | positive regulation of nucleocytoplasmic transport(GO:0046824) |
| 0.0 | 0.2 | GO:0045026 | plasma membrane fusion(GO:0045026) |
| 0.0 | 0.7 | GO:0048536 | spleen development(GO:0048536) |
| 0.0 | 1.1 | GO:0046513 | ceramide biosynthetic process(GO:0046513) |
| 0.0 | 0.2 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
| 0.0 | 0.1 | GO:0046070 | dGTP metabolic process(GO:0046070) |
| 0.0 | 0.2 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
| 0.0 | 0.8 | GO:0031648 | protein destabilization(GO:0031648) |
| 0.0 | 0.1 | GO:1901202 | negative regulation of extracellular matrix assembly(GO:1901202) |
| 0.0 | 0.1 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
| 0.0 | 0.1 | GO:0071816 | tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.0 | 0.2 | GO:0038110 | interleukin-2-mediated signaling pathway(GO:0038110) |
| 0.0 | 0.1 | GO:1904292 | regulation of ERAD pathway(GO:1904292) |
| 0.0 | 0.1 | GO:0010529 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.0 | 0.0 | GO:0036003 | positive regulation of transcription from RNA polymerase II promoter in response to stress(GO:0036003) |
| 0.0 | 0.2 | GO:0046641 | positive regulation of alpha-beta T cell proliferation(GO:0046641) |
| 0.0 | 0.1 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
| 0.0 | 0.2 | GO:0032100 | positive regulation of response to food(GO:0032097) positive regulation of appetite(GO:0032100) |
| 0.0 | 0.2 | GO:0070673 | response to interleukin-18(GO:0070673) |
| 0.0 | 0.1 | GO:0009249 | protein lipoylation(GO:0009249) |
| 0.0 | 0.1 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
| 0.0 | 0.1 | GO:0035513 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.0 | 0.1 | GO:0034356 | NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
| 0.0 | 0.5 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.0 | 0.4 | GO:0097369 | sodium ion import(GO:0097369) |
| 0.0 | 0.1 | GO:0090611 | ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
| 0.0 | 0.2 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.0 | 2.0 | GO:0016925 | protein sumoylation(GO:0016925) |
| 0.0 | 0.1 | GO:0006972 | hyperosmotic response(GO:0006972) |
| 0.0 | 0.3 | GO:0032309 | icosanoid secretion(GO:0032309) |
| 0.0 | 0.2 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.0 | 0.1 | GO:0048485 | sympathetic nervous system development(GO:0048485) |
| 0.0 | 0.3 | GO:2000272 | negative regulation of receptor activity(GO:2000272) |
| 0.0 | 0.1 | GO:0061312 | BMP signaling pathway involved in heart development(GO:0061312) |
| 0.0 | 0.2 | GO:0048484 | enteric nervous system development(GO:0048484) |
| 0.0 | 0.8 | GO:0032922 | circadian regulation of gene expression(GO:0032922) |
| 0.0 | 0.0 | GO:0021578 | hindbrain maturation(GO:0021578) central nervous system maturation(GO:0021626) |
| 0.0 | 0.6 | GO:0042572 | retinol metabolic process(GO:0042572) |
| 0.0 | 0.4 | GO:0030513 | positive regulation of BMP signaling pathway(GO:0030513) |
| 0.0 | 0.1 | GO:0061357 | positive regulation of Wnt protein secretion(GO:0061357) |
| 0.0 | 0.5 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
| 0.0 | 0.3 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
| 0.0 | 0.1 | GO:0030195 | negative regulation of blood coagulation(GO:0030195) negative regulation of hemostasis(GO:1900047) |
| 0.0 | 0.1 | GO:0001955 | blood vessel maturation(GO:0001955) |
| 0.0 | 0.1 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.0 | 0.1 | GO:0002181 | cytoplasmic translation(GO:0002181) |
| 0.0 | 0.2 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.0 | 0.4 | GO:1990001 | inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.0 | 0.5 | GO:0016024 | CDP-diacylglycerol biosynthetic process(GO:0016024) |
| 0.0 | 0.1 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.0 | 0.1 | GO:0009650 | UV protection(GO:0009650) |
| 0.0 | 0.1 | GO:0014744 | positive regulation of muscle adaptation(GO:0014744) |
| 0.0 | 0.2 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.0 | 0.2 | GO:1904037 | positive regulation of epithelial cell apoptotic process(GO:1904037) |
| 0.0 | 0.1 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.0 | 0.1 | GO:2000035 | regulation of stem cell division(GO:2000035) |
| 0.0 | 0.2 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
| 0.0 | 0.1 | GO:0038188 | cholecystokinin signaling pathway(GO:0038188) |
| 0.0 | 0.4 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
| 0.0 | 0.1 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
| 0.0 | 0.3 | GO:1901186 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) positive regulation of ERBB signaling pathway(GO:1901186) |
| 0.0 | 0.1 | GO:0043587 | tongue morphogenesis(GO:0043587) |
| 0.0 | 1.8 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.0 | 0.2 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.0 | 0.4 | GO:0044872 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.0 | 0.1 | GO:0016246 | RNA interference(GO:0016246) |
| 0.0 | 0.5 | GO:0006119 | oxidative phosphorylation(GO:0006119) |
| 0.0 | 0.1 | GO:0046323 | glucose import(GO:0046323) |
| 0.0 | 0.2 | GO:0021563 | glossopharyngeal nerve development(GO:0021563) |
| 0.0 | 0.1 | GO:0001937 | negative regulation of endothelial cell proliferation(GO:0001937) |
| 0.0 | 0.0 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.0 | 0.1 | GO:0006423 | cysteinyl-tRNA aminoacylation(GO:0006423) |
| 0.0 | 0.0 | GO:0015800 | acidic amino acid transport(GO:0015800) |
| 0.0 | 0.5 | GO:0045332 | phospholipid translocation(GO:0045332) |
| 0.0 | 0.1 | GO:0042489 | negative regulation of odontogenesis of dentin-containing tooth(GO:0042489) |
| 0.0 | 0.0 | GO:0060706 | cell differentiation involved in embryonic placenta development(GO:0060706) |
| 0.0 | 0.2 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.0 | 0.5 | GO:0050821 | protein stabilization(GO:0050821) |
| 0.0 | 0.0 | GO:0048867 | ganglion mother cell fate determination(GO:0007402) stem cell fate determination(GO:0048867) |
| 0.0 | 0.1 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
| 0.0 | 0.1 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.0 | 0.2 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
| 0.0 | 0.5 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
| 0.0 | 0.2 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
| 0.0 | 0.3 | GO:0007274 | neuromuscular synaptic transmission(GO:0007274) |
| 0.0 | 0.1 | GO:0045903 | positive regulation of translational fidelity(GO:0045903) |
| 0.0 | 0.1 | GO:0033687 | osteoblast proliferation(GO:0033687) |
| 0.0 | 0.0 | GO:1990523 | bone regeneration(GO:1990523) |
| 0.0 | 0.1 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
| 0.0 | 0.1 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.0 | 5.0 | GO:0000375 | RNA splicing, via transesterification reactions(GO:0000375) |
| 0.0 | 0.0 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
| 0.0 | 0.0 | GO:0018195 | peptidyl-arginine modification(GO:0018195) |
| 0.0 | 0.2 | GO:0035826 | rubidium ion transport(GO:0035826) regulation of rubidium ion transport(GO:2000680) |
| 0.0 | 0.0 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.0 | 2.2 | GO:0030449 | regulation of complement activation(GO:0030449) |
| 0.0 | 1.5 | GO:0006368 | transcription elongation from RNA polymerase II promoter(GO:0006368) |
| 0.0 | 0.0 | GO:0048146 | positive regulation of fibroblast proliferation(GO:0048146) |
| 0.0 | 0.1 | GO:2000848 | positive regulation of corticosteroid hormone secretion(GO:2000848) positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.0 | 0.1 | GO:2000660 | negative regulation of interleukin-1 alpha production(GO:0032690) negative regulation of interleukin-1 alpha secretion(GO:0050712) negative regulation of interleukin-1-mediated signaling pathway(GO:2000660) |
| 0.0 | 0.1 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.0 | 0.1 | GO:0031441 | negative regulation of mRNA 3'-end processing(GO:0031441) |
| 0.0 | 0.1 | GO:0061098 | positive regulation of protein tyrosine kinase activity(GO:0061098) |
| 0.0 | 0.1 | GO:1902893 | regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902893) |
| 0.0 | 0.0 | GO:1902525 | regulation of protein monoubiquitination(GO:1902525) |
| 0.0 | 0.4 | GO:0006099 | tricarboxylic acid cycle(GO:0006099) |
| 0.0 | 0.0 | GO:0071360 | cellular response to exogenous dsRNA(GO:0071360) |
| 0.0 | 0.0 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 | 0.0 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.0 | 0.0 | GO:0032571 | response to vitamin K(GO:0032571) |
| 0.0 | 0.0 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) |
| 0.0 | 0.1 | GO:2000647 | negative regulation of stem cell proliferation(GO:2000647) |
| 0.0 | 0.0 | GO:0051895 | negative regulation of focal adhesion assembly(GO:0051895) |
| 0.0 | 0.1 | GO:0021952 | central nervous system projection neuron axonogenesis(GO:0021952) |
| 0.0 | 0.3 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
| 0.0 | 0.0 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.0 | 0.0 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
| 0.0 | 0.0 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
| 0.0 | 0.1 | GO:0070166 | enamel mineralization(GO:0070166) |
| 0.0 | 1.0 | GO:1990830 | response to leukemia inhibitory factor(GO:1990823) cellular response to leukemia inhibitory factor(GO:1990830) |
| 0.0 | 0.1 | GO:0006574 | valine catabolic process(GO:0006574) |
| 0.0 | 0.2 | GO:0042573 | retinoic acid metabolic process(GO:0042573) |
| 0.0 | 0.1 | GO:0050942 | positive regulation of developmental pigmentation(GO:0048087) positive regulation of pigment cell differentiation(GO:0050942) |
| 0.0 | 0.1 | GO:0032328 | alanine transport(GO:0032328) |
| 0.0 | 0.0 | GO:0035995 | detection of muscle stretch(GO:0035995) |
| 0.0 | 0.0 | GO:0051231 | mitotic spindle elongation(GO:0000022) spindle elongation(GO:0051231) mitotic spindle midzone assembly(GO:0051256) |
| 0.0 | 0.0 | GO:0033137 | negative regulation of peptidyl-serine phosphorylation(GO:0033137) |
| 0.0 | 0.1 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.0 | 0.1 | GO:0001656 | metanephros development(GO:0001656) |
| 0.0 | 0.0 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.0 | 0.1 | GO:0046320 | regulation of fatty acid oxidation(GO:0046320) |
| 0.0 | 0.0 | GO:0090069 | regulation of ribosome biogenesis(GO:0090069) |
| 0.0 | 0.7 | GO:0045454 | cell redox homeostasis(GO:0045454) |
| 0.0 | 3.8 | GO:0007283 | spermatogenesis(GO:0007283) |
| 0.0 | 2.5 | GO:0000209 | protein polyubiquitination(GO:0000209) |
| 0.0 | 0.0 | GO:0010755 | regulation of plasminogen activation(GO:0010755) |
| 0.0 | 0.0 | GO:0010824 | regulation of centrosome duplication(GO:0010824) |
| 0.0 | 0.0 | GO:0018146 | keratan sulfate biosynthetic process(GO:0018146) keratan sulfate metabolic process(GO:0042339) |
| 0.0 | 0.0 | GO:0015732 | prostaglandin transport(GO:0015732) |
| 0.0 | 0.1 | GO:0043555 | regulation of translation in response to stress(GO:0043555) |
| 0.0 | 0.0 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
| 0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.4 | 13.6 | GO:0097224 | sperm connecting piece(GO:0097224) |
| 2.1 | 29.8 | GO:0001520 | outer dense fiber(GO:0001520) |
| 2.1 | 6.2 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
| 1.9 | 7.6 | GO:0031213 | RSF complex(GO:0031213) |
| 1.8 | 7.2 | GO:0005889 | hydrogen:potassium-exchanging ATPase complex(GO:0005889) |
| 1.6 | 11.5 | GO:0002177 | manchette(GO:0002177) |
| 1.6 | 9.8 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 1.5 | 1.5 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 1.5 | 5.8 | GO:0097196 | Shu complex(GO:0097196) |
| 1.3 | 6.7 | GO:1990769 | proximal neuron projection(GO:1990769) |
| 1.3 | 3.8 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 1.3 | 36.3 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
| 1.2 | 4.8 | GO:0060187 | cell pole(GO:0060187) |
| 1.2 | 4.8 | GO:0032301 | MutSalpha complex(GO:0032301) |
| 1.2 | 1.2 | GO:0032302 | MutSbeta complex(GO:0032302) |
| 1.1 | 5.7 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 1.1 | 3.3 | GO:0048179 | activin receptor complex(GO:0048179) |
| 1.1 | 7.8 | GO:0030893 | meiotic cohesin complex(GO:0030893) |
| 1.1 | 3.3 | GO:1990622 | CHOP-ATF3 complex(GO:1990622) |
| 1.1 | 10.7 | GO:0071953 | elastic fiber(GO:0071953) |
| 1.0 | 10.2 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 1.0 | 8.2 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 1.0 | 5.1 | GO:0098536 | deuterosome(GO:0098536) |
| 1.0 | 6.0 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 1.0 | 3.0 | GO:0020003 | symbiont-containing vacuole(GO:0020003) symbiont-containing vacuole membrane(GO:0020005) |
| 1.0 | 18.3 | GO:0036038 | MKS complex(GO:0036038) |
| 0.9 | 12.2 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.9 | 5.5 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.9 | 0.9 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.9 | 8.8 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.9 | 6.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.9 | 1.7 | GO:0060200 | clathrin-sculpted acetylcholine transport vesicle(GO:0060200) clathrin-sculpted acetylcholine transport vesicle membrane(GO:0060201) |
| 0.9 | 9.4 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.8 | 2.5 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.8 | 4.9 | GO:0070369 | beta-catenin-TCF7L2 complex(GO:0070369) |
| 0.8 | 25.9 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
| 0.8 | 8.7 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.8 | 5.5 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.8 | 16.5 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.8 | 5.5 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.8 | 7.7 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.7 | 2.2 | GO:0070195 | growth hormone receptor complex(GO:0070195) |
| 0.7 | 3.5 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.7 | 10.3 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.7 | 3.4 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.7 | 6.1 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.7 | 7.4 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.6 | 1.9 | GO:0043291 | RAVE complex(GO:0043291) |
| 0.6 | 2.4 | GO:0070288 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
| 0.6 | 3.0 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.6 | 5.4 | GO:0034464 | BBSome(GO:0034464) |
| 0.6 | 1.8 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.6 | 1.2 | GO:0034678 | integrin alpha8-beta1 complex(GO:0034678) |
| 0.6 | 1.8 | GO:0001534 | radial spoke(GO:0001534) |
| 0.6 | 5.9 | GO:0097433 | dense body(GO:0097433) |
| 0.6 | 1.1 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
| 0.6 | 50.5 | GO:0097014 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
| 0.6 | 0.6 | GO:0044292 | dendrite terminus(GO:0044292) |
| 0.6 | 0.6 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.6 | 3.9 | GO:0001740 | Barr body(GO:0001740) |
| 0.5 | 6.5 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.5 | 8.2 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.5 | 8.1 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.5 | 2.0 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.5 | 3.0 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.5 | 5.4 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.5 | 0.5 | GO:1902636 | kinociliary basal body(GO:1902636) |
| 0.5 | 5.8 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.5 | 1.0 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
| 0.5 | 2.9 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.5 | 3.7 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.4 | 9.4 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.4 | 2.2 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
| 0.4 | 1.8 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.4 | 0.9 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
| 0.4 | 4.3 | GO:0016013 | syntrophin complex(GO:0016013) |
| 0.4 | 2.2 | GO:0070695 | FHF complex(GO:0070695) |
| 0.4 | 3.0 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.4 | 0.8 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.4 | 0.4 | GO:0009330 | DNA topoisomerase complex (ATP-hydrolyzing)(GO:0009330) |
| 0.4 | 3.7 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.4 | 5.8 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.4 | 12.3 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.4 | 2.0 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
| 0.4 | 2.3 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.4 | 1.5 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
| 0.4 | 1.1 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.4 | 1.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.4 | 1.9 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.4 | 3.0 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.4 | 10.9 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.4 | 1.1 | GO:0019034 | viral replication complex(GO:0019034) |
| 0.4 | 1.8 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.4 | 2.5 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.4 | 8.6 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
| 0.4 | 0.7 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.4 | 5.7 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.4 | 1.1 | GO:0034455 | t-UTP complex(GO:0034455) |
| 0.3 | 2.8 | GO:0034688 | integrin alphaM-beta2 complex(GO:0034688) |
| 0.3 | 8.0 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.3 | 1.0 | GO:0036398 | TCR signalosome(GO:0036398) |
| 0.3 | 2.8 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.3 | 3.1 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.3 | 1.4 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.3 | 1.7 | GO:0044305 | calyx of Held(GO:0044305) |
| 0.3 | 1.3 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
| 0.3 | 1.0 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.3 | 1.7 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.3 | 1.0 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.3 | 3.0 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 0.3 | 0.3 | GO:0044453 | nuclear membrane part(GO:0044453) |
| 0.3 | 0.6 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.3 | 4.5 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.3 | 1.0 | GO:0048269 | methionine adenosyltransferase complex(GO:0048269) |
| 0.3 | 2.2 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
| 0.3 | 5.6 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.3 | 5.0 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.3 | 0.9 | GO:0089701 | U2AF(GO:0089701) |
| 0.3 | 5.6 | GO:0034709 | methylosome(GO:0034709) |
| 0.3 | 5.2 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.3 | 0.9 | GO:1990876 | cytoplasmic side of nuclear pore(GO:1990876) |
| 0.3 | 0.6 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.3 | 0.9 | GO:0005715 | late recombination nodule(GO:0005715) |
| 0.3 | 1.5 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.3 | 18.9 | GO:0036064 | ciliary basal body(GO:0036064) |
| 0.3 | 1.5 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.3 | 1.5 | GO:0032389 | MutLalpha complex(GO:0032389) |
| 0.3 | 4.6 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.3 | 3.2 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.3 | 4.8 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.3 | 0.8 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.3 | 2.2 | GO:0072487 | MSL complex(GO:0072487) |
| 0.3 | 1.7 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.3 | 2.0 | GO:1903440 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
| 0.3 | 0.3 | GO:0031201 | SNARE complex(GO:0031201) |
| 0.3 | 0.3 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.3 | 1.4 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.3 | 1.3 | GO:0005818 | astral microtubule(GO:0000235) aster(GO:0005818) |
| 0.3 | 2.1 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.3 | 0.3 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.3 | 2.7 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.3 | 0.3 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
| 0.3 | 1.3 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.3 | 3.6 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
| 0.3 | 4.9 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.3 | 0.8 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.3 | 5.6 | GO:0090545 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.3 | 1.3 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) |
| 0.3 | 0.5 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.2 | 1.2 | GO:0070826 | paraferritin complex(GO:0070826) |
| 0.2 | 7.1 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.2 | 0.2 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.2 | 0.7 | GO:1990742 | microvesicle(GO:1990742) |
| 0.2 | 1.7 | GO:0033165 | interphotoreceptor matrix(GO:0033165) |
| 0.2 | 0.7 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.2 | 4.0 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.2 | 25.3 | GO:0030672 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
| 0.2 | 2.6 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.2 | 2.8 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.2 | 0.5 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.2 | 2.1 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.2 | 0.9 | GO:1990578 | perinuclear endoplasmic reticulum membrane(GO:1990578) |
| 0.2 | 3.1 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.2 | 13.3 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.2 | 0.7 | GO:0031372 | UBC13-MMS2 complex(GO:0031372) |
| 0.2 | 4.2 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.2 | 1.8 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) |
| 0.2 | 1.3 | GO:1990584 | cardiac Troponin complex(GO:1990584) |
| 0.2 | 1.1 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.2 | 2.8 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.2 | 1.1 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
| 0.2 | 0.9 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.2 | 2.3 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.2 | 2.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.2 | 1.9 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.2 | 0.8 | GO:0055087 | Ski complex(GO:0055087) |
| 0.2 | 35.0 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
| 0.2 | 2.2 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.2 | 0.4 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.2 | 0.8 | GO:0030891 | VCB complex(GO:0030891) |
| 0.2 | 1.0 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
| 0.2 | 1.2 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
| 0.2 | 0.2 | GO:0005608 | laminin-3 complex(GO:0005608) |
| 0.2 | 0.4 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.2 | 2.3 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.2 | 6.5 | GO:0031305 | intrinsic component of mitochondrial inner membrane(GO:0031304) integral component of mitochondrial inner membrane(GO:0031305) |
| 0.2 | 0.7 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.2 | 2.2 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 0.2 | 1.8 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.2 | 3.7 | GO:0032590 | dendrite membrane(GO:0032590) |
| 0.2 | 1.7 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.2 | 0.9 | GO:0043235 | receptor complex(GO:0043235) |
| 0.2 | 0.5 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.2 | 2.4 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.2 | 2.7 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.2 | 1.2 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.2 | 0.7 | GO:0010369 | chromocenter(GO:0010369) |
| 0.2 | 0.8 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.2 | 1.9 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
| 0.2 | 4.6 | GO:0005871 | kinesin complex(GO:0005871) |
| 0.2 | 0.6 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 0.2 | 4.3 | GO:0034706 | sodium channel complex(GO:0034706) |
| 0.2 | 0.5 | GO:0097232 | lamellar body membrane(GO:0097232) alveolar lamellar body membrane(GO:0097233) |
| 0.2 | 0.5 | GO:0035577 | azurophil granule membrane(GO:0035577) |
| 0.2 | 2.0 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
| 0.2 | 0.5 | GO:1990037 | Lewy body core(GO:1990037) |
| 0.2 | 2.8 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.2 | 1.6 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
| 0.2 | 0.9 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.2 | 8.5 | GO:0000786 | nucleosome(GO:0000786) |
| 0.1 | 13.9 | GO:0005814 | centriole(GO:0005814) |
| 0.1 | 0.9 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.1 | 2.3 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.1 | 9.8 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.1 | 0.3 | GO:0098837 | postsynaptic recycling endosome(GO:0098837) |
| 0.1 | 1.0 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.1 | 10.1 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.1 | 0.7 | GO:0000308 | cytoplasmic cyclin-dependent protein kinase holoenzyme complex(GO:0000308) |
| 0.1 | 1.1 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.1 | 2.1 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.1 | 2.8 | GO:0033177 | proton-transporting two-sector ATPase complex, proton-transporting domain(GO:0033177) proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
| 0.1 | 0.7 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.1 | 0.4 | GO:0043159 | acrosomal matrix(GO:0043159) |
| 0.1 | 0.4 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.1 | 0.9 | GO:0044279 | other organism cell membrane(GO:0044218) other organism membrane(GO:0044279) |
| 0.1 | 0.7 | GO:0031095 | platelet dense tubular network membrane(GO:0031095) |
| 0.1 | 4.7 | GO:0009925 | basal plasma membrane(GO:0009925) |
| 0.1 | 1.3 | GO:0032156 | septin cytoskeleton(GO:0032156) |
| 0.1 | 0.1 | GO:0044094 | host cell nucleus(GO:0042025) host cell nuclear part(GO:0044094) |
| 0.1 | 2.2 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.1 | 4.6 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.1 | 0.9 | GO:0098575 | lumenal side of lysosomal membrane(GO:0098575) |
| 0.1 | 0.3 | GO:1990357 | terminal web(GO:1990357) |
| 0.1 | 0.5 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
| 0.1 | 3.9 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.1 | 2.1 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.1 | 0.5 | GO:0001652 | granular component(GO:0001652) |
| 0.1 | 0.5 | GO:1990745 | EARP complex(GO:1990745) |
| 0.1 | 1.9 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
| 0.1 | 0.6 | GO:0070554 | synaptobrevin 2-SNAP-25-syntaxin-3-complexin complex(GO:0070554) |
| 0.1 | 0.7 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.1 | 2.4 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.1 | 1.3 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.1 | 0.1 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.1 | 0.1 | GO:1990923 | PET complex(GO:1990923) |
| 0.1 | 2.6 | GO:0000123 | histone acetyltransferase complex(GO:0000123) |
| 0.1 | 0.5 | GO:0031673 | H zone(GO:0031673) |
| 0.1 | 1.0 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.1 | 7.6 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.1 | 1.3 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.1 | 2.3 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.1 | 0.4 | GO:0097362 | MCM8-MCM9 complex(GO:0097362) |
| 0.1 | 0.9 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.1 | 0.2 | GO:0030684 | preribosome(GO:0030684) |
| 0.1 | 6.7 | GO:0005844 | polysome(GO:0005844) |
| 0.1 | 1.5 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.1 | 0.7 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.1 | 0.6 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
| 0.1 | 0.5 | GO:0097123 | cyclin A1-CDK2 complex(GO:0097123) |
| 0.1 | 0.5 | GO:0045272 | plasma membrane respiratory chain complex I(GO:0045272) |
| 0.1 | 1.0 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.1 | 0.6 | GO:0032807 | DNA ligase IV complex(GO:0032807) |
| 0.1 | 0.6 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
| 0.1 | 7.5 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.1 | 2.8 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.1 | 0.5 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.1 | 0.4 | GO:0000923 | equatorial microtubule organizing center(GO:0000923) |
| 0.1 | 0.2 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.1 | 10.0 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.1 | 2.7 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.1 | 0.8 | GO:0014802 | terminal cisterna(GO:0014802) |
| 0.1 | 6.8 | GO:0015030 | Cajal body(GO:0015030) |
| 0.1 | 0.8 | GO:0019908 | nuclear cyclin-dependent protein kinase holoenzyme complex(GO:0019908) |
| 0.1 | 0.6 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.1 | 0.7 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.1 | 0.7 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
| 0.1 | 1.9 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) |
| 0.1 | 0.3 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.1 | 2.0 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
| 0.1 | 0.4 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.1 | 3.0 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.1 | 3.1 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.1 | 0.3 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.1 | 0.3 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.1 | 2.0 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.1 | 2.8 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.1 | 0.3 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.1 | 0.2 | GO:0002169 | 3-methylcrotonyl-CoA carboxylase complex, mitochondrial(GO:0002169) methylcrotonoyl-CoA carboxylase complex(GO:1905202) |
| 0.1 | 2.8 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.1 | 0.1 | GO:0097450 | astrocyte end-foot(GO:0097450) |
| 0.1 | 0.3 | GO:0036396 | MIS complex(GO:0036396) mRNA editing complex(GO:0045293) |
| 0.1 | 0.2 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
| 0.1 | 0.3 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.1 | 0.3 | GO:1990667 | PCSK9-AnxA2 complex(GO:1990667) |
| 0.1 | 0.7 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 0.1 | 4.8 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.1 | 2.1 | GO:0032040 | small-subunit processome(GO:0032040) |
| 0.1 | 0.5 | GO:0032009 | early phagosome(GO:0032009) |
| 0.1 | 0.2 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.1 | 0.4 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.1 | 3.4 | GO:0016592 | mediator complex(GO:0016592) |
| 0.1 | 0.2 | GO:0005638 | lamin filament(GO:0005638) |
| 0.1 | 1.1 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.1 | 1.1 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.1 | 0.2 | GO:0032002 | interleukin-28 receptor complex(GO:0032002) |
| 0.1 | 2.1 | GO:0030286 | dynein complex(GO:0030286) |
| 0.1 | 0.1 | GO:0000333 | telomerase catalytic core complex(GO:0000333) |
| 0.1 | 0.8 | GO:0045179 | apical cortex(GO:0045179) |
| 0.1 | 0.2 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.1 | 0.5 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.1 | 6.9 | GO:0042579 | peroxisome(GO:0005777) microbody(GO:0042579) |
| 0.1 | 0.4 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.1 | 1.0 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.1 | 1.3 | GO:0042734 | presynaptic membrane(GO:0042734) |
| 0.1 | 10.4 | GO:0042175 | nuclear outer membrane-endoplasmic reticulum membrane network(GO:0042175) |
| 0.1 | 0.1 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
| 0.1 | 0.2 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
| 0.1 | 1.7 | GO:0030904 | retromer complex(GO:0030904) |
| 0.1 | 0.3 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
| 0.1 | 1.5 | GO:0044450 | microtubule organizing center part(GO:0044450) |
| 0.1 | 0.1 | GO:0034687 | integrin alphaL-beta2 complex(GO:0034687) |
| 0.1 | 1.6 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
| 0.1 | 1.2 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.1 | 0.1 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
| 0.1 | 0.8 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.1 | 0.4 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
| 0.1 | 0.1 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
| 0.1 | 0.2 | GO:0030934 | anchoring collagen complex(GO:0030934) |
| 0.1 | 0.8 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.1 | 4.9 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.1 | 7.9 | GO:0005815 | microtubule organizing center(GO:0005815) |
| 0.1 | 0.1 | GO:0000938 | GARP complex(GO:0000938) |
| 0.1 | 0.2 | GO:0016342 | catenin complex(GO:0016342) |
| 0.1 | 2.3 | GO:0000313 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
| 0.1 | 0.9 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.1 | 0.1 | GO:0031906 | late endosome lumen(GO:0031906) |
| 0.1 | 1.9 | GO:0090544 | BAF-type complex(GO:0090544) |
| 0.1 | 0.2 | GO:0005900 | oncostatin-M receptor complex(GO:0005900) |
| 0.1 | 2.0 | GO:0016328 | lateral plasma membrane(GO:0016328) |
| 0.1 | 0.1 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.1 | 0.2 | GO:0000229 | cytoplasmic chromosome(GO:0000229) |
| 0.1 | 1.3 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.1 | 5.0 | GO:0008021 | synaptic vesicle(GO:0008021) |
| 0.1 | 1.2 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.1 | 0.7 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.1 | 0.4 | GO:0097361 | CIA complex(GO:0097361) |
| 0.1 | 0.2 | GO:0071746 | IgA immunoglobulin complex(GO:0071745) IgA immunoglobulin complex, circulating(GO:0071746) monomeric IgA immunoglobulin complex(GO:0071748) polymeric IgA immunoglobulin complex(GO:0071749) secretory IgA immunoglobulin complex(GO:0071751) |
| 0.1 | 1.2 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.0 | 2.5 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.0 | 0.1 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 0.0 | 0.1 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.0 | 1.7 | GO:0016469 | proton-transporting two-sector ATPase complex(GO:0016469) |
| 0.0 | 6.9 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.0 | 0.0 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.0 | 20.9 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
| 0.0 | 0.1 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.0 | 1.6 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 0.2 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.0 | 1.7 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.0 | 0.2 | GO:0097386 | glial cell projection(GO:0097386) |
| 0.0 | 0.4 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 2.7 | GO:0031514 | motile cilium(GO:0031514) |
| 0.0 | 0.2 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.0 | 1.7 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 0.3 | GO:0031312 | extrinsic component of organelle membrane(GO:0031312) |
| 0.0 | 3.0 | GO:0032154 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
| 0.0 | 0.3 | GO:0060091 | kinocilium(GO:0060091) |
| 0.0 | 0.5 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
| 0.0 | 0.1 | GO:0017102 | methionyl glutamyl tRNA synthetase complex(GO:0017102) |
| 0.0 | 0.2 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.0 | 0.1 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
| 0.0 | 0.1 | GO:0034685 | integrin alphav-beta6 complex(GO:0034685) |
| 0.0 | 0.5 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.0 | 0.9 | GO:1902711 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
| 0.0 | 0.2 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.0 | 2.5 | GO:0016324 | apical plasma membrane(GO:0016324) |
| 0.0 | 3.7 | GO:0031225 | anchored component of membrane(GO:0031225) |
| 0.0 | 0.3 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 0.1 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.0 | 0.0 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.0 | 0.2 | GO:1990589 | ATF4-CREB1 transcription factor complex(GO:1990589) |
| 0.0 | 3.3 | GO:0005929 | cilium(GO:0005929) |
| 0.0 | 3.9 | GO:0031965 | nuclear membrane(GO:0031965) |
| 0.0 | 1.1 | GO:0030133 | transport vesicle(GO:0030133) |
| 0.0 | 0.2 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
| 0.0 | 0.2 | GO:0016235 | aggresome(GO:0016235) |
| 0.0 | 0.1 | GO:0097413 | Lewy body(GO:0097413) |
| 0.0 | 0.3 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.0 | 17.0 | GO:0016604 | nuclear body(GO:0016604) |
| 0.0 | 0.1 | GO:0032044 | DSIF complex(GO:0032044) |
| 0.0 | 0.2 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
| 0.0 | 0.2 | GO:0005770 | late endosome(GO:0005770) |
| 0.0 | 0.4 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.0 | 0.2 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.0 | 0.1 | GO:0000974 | Prp19 complex(GO:0000974) |
| 0.0 | 0.2 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.0 | 0.0 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.0 | 0.2 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
| 0.0 | 0.1 | GO:0005953 | CAAX-protein geranylgeranyltransferase complex(GO:0005953) |
| 0.0 | 0.0 | GO:0002139 | stereocilia coupling link(GO:0002139) |
| 0.0 | 0.1 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.0 | 0.3 | GO:0030686 | 90S preribosome(GO:0030686) |
| 0.0 | 0.2 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.0 | 0.1 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.0 | 1.2 | GO:0016459 | myosin complex(GO:0016459) |
| 0.0 | 0.0 | GO:0071821 | FANCM-MHF complex(GO:0071821) |
| 0.0 | 0.1 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
| 0.0 | 0.0 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.0 | 0.4 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.7 | 11.1 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
| 3.3 | 13.3 | GO:0001512 | dihydronicotinamide riboside quinone reductase activity(GO:0001512) melatonin binding(GO:1904408) |
| 2.0 | 12.2 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
| 2.0 | 7.8 | GO:0005287 | high-affinity basic amino acid transmembrane transporter activity(GO:0005287) high-affinity arginine transmembrane transporter activity(GO:0005289) high-affinity lysine transmembrane transporter activity(GO:0005292) |
| 1.9 | 1.9 | GO:0004019 | adenylosuccinate synthase activity(GO:0004019) |
| 1.9 | 5.8 | GO:0052810 | 1-phosphatidylinositol-5-kinase activity(GO:0052810) |
| 1.8 | 7.1 | GO:0004803 | transposase activity(GO:0004803) |
| 1.7 | 7.0 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 1.7 | 6.7 | GO:0035939 | microsatellite binding(GO:0035939) |
| 1.7 | 6.6 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 1.6 | 9.6 | GO:0042806 | fucose binding(GO:0042806) |
| 1.6 | 6.4 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 1.6 | 15.8 | GO:0003910 | DNA ligase (ATP) activity(GO:0003910) |
| 1.6 | 9.5 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 1.6 | 14.0 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
| 1.5 | 7.6 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 1.5 | 8.9 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 1.5 | 4.4 | GO:0016730 | ferredoxin-NADP+ reductase activity(GO:0004324) NADPH-adrenodoxin reductase activity(GO:0015039) oxidoreductase activity, acting on iron-sulfur proteins as donors(GO:0016730) oxidoreductase activity, acting on iron-sulfur proteins as donors, NAD or NADP as acceptor(GO:0016731) |
| 1.4 | 5.8 | GO:0003990 | acetylcholinesterase activity(GO:0003990) |
| 1.4 | 9.8 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
| 1.4 | 5.6 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 1.4 | 9.6 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
| 1.3 | 4.0 | GO:0031859 | platelet activating factor receptor binding(GO:0031859) |
| 1.3 | 3.9 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 1.2 | 6.2 | GO:0052901 | polyamine oxidase activity(GO:0046592) spermine:oxygen oxidoreductase (spermidine-forming) activity(GO:0052901) |
| 1.2 | 6.2 | GO:0004306 | ethanolamine-phosphate cytidylyltransferase activity(GO:0004306) |
| 1.2 | 11.1 | GO:0001225 | RNA polymerase II transcription coactivator binding(GO:0001225) |
| 1.2 | 34.3 | GO:0019198 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
| 1.2 | 8.4 | GO:0016403 | dimethylargininase activity(GO:0016403) |
| 1.2 | 4.8 | GO:0032143 | single thymine insertion binding(GO:0032143) |
| 1.2 | 1.2 | GO:0032181 | heteroduplex DNA loop binding(GO:0000404) double-strand/single-strand DNA junction binding(GO:0000406) dinucleotide repeat insertion binding(GO:0032181) |
| 1.2 | 1.2 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 1.1 | 13.8 | GO:0019826 | oxygen sensor activity(GO:0019826) |
| 1.1 | 24.9 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 1.1 | 3.3 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 1.1 | 3.3 | GO:0031691 | alpha-1A adrenergic receptor binding(GO:0031691) follicle-stimulating hormone receptor binding(GO:0031762) V2 vasopressin receptor binding(GO:0031896) |
| 1.1 | 14.4 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 1.1 | 3.3 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
| 1.1 | 16.4 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 1.1 | 17.3 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
| 1.0 | 6.3 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
| 1.0 | 12.2 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 1.0 | 7.0 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 1.0 | 3.0 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
| 1.0 | 3.0 | GO:0035379 | carbon dioxide transmembrane transporter activity(GO:0035379) |
| 1.0 | 5.9 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
| 1.0 | 5.9 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 1.0 | 3.9 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 1.0 | 5.8 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
| 1.0 | 2.9 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.9 | 0.9 | GO:0008520 | L-ascorbate:sodium symporter activity(GO:0008520) L-ascorbic acid transporter activity(GO:0015229) sodium-dependent L-ascorbate transmembrane transporter activity(GO:0070890) |
| 0.9 | 5.6 | GO:0051870 | methotrexate binding(GO:0051870) |
| 0.9 | 6.5 | GO:0050682 | AF-2 domain binding(GO:0050682) |
| 0.9 | 5.6 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
| 0.9 | 2.8 | GO:0015131 | thiosulfate transmembrane transporter activity(GO:0015117) oxaloacetate transmembrane transporter activity(GO:0015131) |
| 0.9 | 4.6 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 0.9 | 2.7 | GO:0047977 | hepoxilin-epoxide hydrolase activity(GO:0047977) |
| 0.9 | 8.1 | GO:0048039 | ubiquinone binding(GO:0048039) |
| 0.9 | 1.8 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.9 | 0.9 | GO:0001147 | transcription termination site sequence-specific DNA binding(GO:0001147) transcription termination site DNA binding(GO:0001160) |
| 0.9 | 15.5 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.9 | 6.8 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.9 | 2.6 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.8 | 2.5 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
| 0.8 | 5.9 | GO:0004522 | ribonuclease A activity(GO:0004522) |
| 0.8 | 3.3 | GO:0008336 | gamma-butyrobetaine dioxygenase activity(GO:0008336) |
| 0.8 | 2.5 | GO:0015218 | pyrimidine nucleotide transmembrane transporter activity(GO:0015218) |
| 0.8 | 3.2 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
| 0.8 | 8.9 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.8 | 3.9 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
| 0.8 | 3.1 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
| 0.8 | 7.0 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
| 0.8 | 3.1 | GO:0016639 | oxidoreductase activity, acting on the CH-NH2 group of donors, NAD or NADP as acceptor(GO:0016639) |
| 0.8 | 2.3 | GO:0016652 | NAD(P)+ transhydrogenase activity(GO:0008746) oxidoreductase activity, acting on NAD(P)H, NAD(P) as acceptor(GO:0016652) |
| 0.8 | 0.8 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
| 0.7 | 2.2 | GO:0102008 | cytosolic dipeptidase activity(GO:0102008) |
| 0.7 | 2.2 | GO:0032440 | 2-alkenal reductase [NAD(P)] activity(GO:0032440) |
| 0.7 | 2.2 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
| 0.7 | 1.5 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.7 | 16.9 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.7 | 0.7 | GO:0015227 | acyl carnitine transmembrane transporter activity(GO:0015227) |
| 0.7 | 6.6 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.7 | 3.5 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.7 | 2.1 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
| 0.7 | 2.1 | GO:0031862 | prostanoid receptor binding(GO:0031862) |
| 0.7 | 4.9 | GO:0047894 | flavonol 3-sulfotransferase activity(GO:0047894) |
| 0.7 | 2.1 | GO:0008798 | beta-aspartyl-peptidase activity(GO:0008798) |
| 0.7 | 2.1 | GO:0047726 | iron-cytochrome-c reductase activity(GO:0047726) |
| 0.7 | 10.9 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.7 | 2.7 | GO:0097363 | protein O-GlcNAc transferase activity(GO:0097363) |
| 0.7 | 3.4 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
| 0.7 | 6.7 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.7 | 2.6 | GO:0047708 | biotinidase activity(GO:0047708) |
| 0.7 | 3.9 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.7 | 2.0 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.7 | 2.6 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.7 | 2.6 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.6 | 5.2 | GO:0009008 | DNA-methyltransferase activity(GO:0009008) |
| 0.6 | 2.6 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.6 | 2.5 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.6 | 3.1 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 0.6 | 1.2 | GO:0051500 | D-aminoacyl-tRNA deacylase activity(GO:0051499) D-tyrosyl-tRNA(Tyr) deacylase activity(GO:0051500) |
| 0.6 | 2.5 | GO:0015199 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.6 | 2.4 | GO:0003896 | DNA primase activity(GO:0003896) |
| 0.6 | 3.7 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
| 0.6 | 1.8 | GO:0033867 | Fas-activated serine/threonine kinase activity(GO:0033867) |
| 0.6 | 1.8 | GO:0090541 | MIT domain binding(GO:0090541) |
| 0.6 | 3.0 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.6 | 0.6 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
| 0.6 | 0.6 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
| 0.6 | 4.7 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
| 0.6 | 2.3 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.6 | 9.8 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.6 | 4.0 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.6 | 6.7 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.6 | 2.2 | GO:0032408 | MutLbeta complex binding(GO:0032406) MutSbeta complex binding(GO:0032408) |
| 0.5 | 0.5 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.5 | 8.7 | GO:1990459 | transferrin receptor binding(GO:1990459) |
| 0.5 | 3.2 | GO:0044736 | acid-sensing ion channel activity(GO:0044736) |
| 0.5 | 2.7 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
| 0.5 | 2.7 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.5 | 3.7 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
| 0.5 | 1.0 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.5 | 3.1 | GO:0043532 | angiostatin binding(GO:0043532) |
| 0.5 | 1.6 | GO:0047389 | glycerophosphocholine phosphodiesterase activity(GO:0047389) |
| 0.5 | 2.1 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.5 | 1.6 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
| 0.5 | 1.0 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.5 | 2.0 | GO:0043398 | HLH domain binding(GO:0043398) |
| 0.5 | 5.4 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.5 | 13.6 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.5 | 9.6 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.5 | 2.9 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.5 | 1.4 | GO:0070336 | flap-structured DNA binding(GO:0070336) |
| 0.5 | 3.3 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.5 | 2.3 | GO:0052833 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.5 | 1.4 | GO:0004958 | prostaglandin F receptor activity(GO:0004958) |
| 0.5 | 1.4 | GO:0008534 | oxidized purine nucleobase lesion DNA N-glycosylase activity(GO:0008534) |
| 0.5 | 1.8 | GO:0047066 | phospholipid-hydroperoxide glutathione peroxidase activity(GO:0047066) |
| 0.5 | 2.3 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.4 | 6.2 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.4 | 0.9 | GO:0004096 | catalase activity(GO:0004096) |
| 0.4 | 12.4 | GO:0000030 | mannosyltransferase activity(GO:0000030) |
| 0.4 | 1.3 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.4 | 1.3 | GO:0004960 | thromboxane receptor activity(GO:0004960) thromboxane A2 receptor activity(GO:0004961) |
| 0.4 | 0.4 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.4 | 3.5 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.4 | 2.6 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.4 | 5.6 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.4 | 0.9 | GO:0048406 | neurotrophin binding(GO:0043121) nerve growth factor binding(GO:0048406) |
| 0.4 | 4.7 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.4 | 3.0 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.4 | 3.8 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.4 | 8.8 | GO:0008392 | arachidonic acid monooxygenase activity(GO:0008391) arachidonic acid epoxygenase activity(GO:0008392) |
| 0.4 | 2.5 | GO:0070735 | protein-glycine ligase activity(GO:0070735) |
| 0.4 | 1.6 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.4 | 1.2 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.4 | 0.4 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
| 0.4 | 16.3 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.4 | 0.4 | GO:0050659 | N-acetylgalactosamine 4-sulfate 6-O-sulfotransferase activity(GO:0050659) |
| 0.4 | 0.8 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.4 | 1.6 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.4 | 2.0 | GO:1902444 | riboflavin binding(GO:1902444) |
| 0.4 | 0.8 | GO:0043139 | 5'-3' DNA helicase activity(GO:0043139) |
| 0.4 | 3.1 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.4 | 1.9 | GO:0052740 | 1-acyl-2-lysophosphatidylserine acylhydrolase activity(GO:0052740) |
| 0.4 | 1.1 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.4 | 2.7 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 0.4 | 0.4 | GO:0050613 | delta14-sterol reductase activity(GO:0050613) |
| 0.4 | 1.1 | GO:0004730 | pseudouridylate synthase activity(GO:0004730) |
| 0.4 | 3.3 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.4 | 1.8 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.4 | 5.2 | GO:0032395 | MHC class II receptor activity(GO:0032395) |
| 0.4 | 2.2 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.4 | 1.8 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
| 0.4 | 1.5 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.4 | 0.4 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.4 | 2.9 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.4 | 12.5 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.4 | 1.4 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.4 | 1.4 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
| 0.4 | 11.4 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.4 | 0.7 | GO:0015925 | galactosidase activity(GO:0015925) |
| 0.4 | 3.9 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.3 | 0.7 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.3 | 1.4 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.3 | 1.4 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.3 | 3.1 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.3 | 1.7 | GO:0070363 | mitochondrial light strand promoter sense binding(GO:0070363) |
| 0.3 | 1.7 | GO:0004337 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
| 0.3 | 4.7 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.3 | 1.0 | GO:0055102 | phospholipase inhibitor activity(GO:0004859) lipase inhibitor activity(GO:0055102) |
| 0.3 | 5.2 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.3 | 0.3 | GO:0009055 | electron carrier activity(GO:0009055) |
| 0.3 | 1.0 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
| 0.3 | 6.5 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.3 | 3.2 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.3 | 1.3 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
| 0.3 | 1.6 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
| 0.3 | 2.6 | GO:0034603 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.3 | 1.0 | GO:0050405 | [hydroxymethylglutaryl-CoA reductase (NADPH)] kinase activity(GO:0047322) [acetyl-CoA carboxylase] kinase activity(GO:0050405) |
| 0.3 | 0.6 | GO:0051734 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.3 | 0.6 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.3 | 0.9 | GO:0045155 | electron transporter, transferring electrons from CoQH2-cytochrome c reductase complex and cytochrome c oxidase complex activity(GO:0045155) |
| 0.3 | 2.4 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
| 0.3 | 1.5 | GO:0042954 | lipoprotein transporter activity(GO:0042954) |
| 0.3 | 0.9 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
| 0.3 | 3.9 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.3 | 2.1 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.3 | 2.7 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
| 0.3 | 3.3 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.3 | 4.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.3 | 1.8 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
| 0.3 | 0.3 | GO:0019958 | C-X-C chemokine binding(GO:0019958) |
| 0.3 | 2.0 | GO:0046979 | TAP2 binding(GO:0046979) |
| 0.3 | 2.9 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.3 | 2.9 | GO:0030369 | ICAM-3 receptor activity(GO:0030369) |
| 0.3 | 0.9 | GO:0035403 | histone kinase activity (H3-T6 specific)(GO:0035403) |
| 0.3 | 1.4 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.3 | 9.3 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.3 | 2.2 | GO:0043559 | insulin binding(GO:0043559) |
| 0.3 | 0.8 | GO:0035500 | MH2 domain binding(GO:0035500) |
| 0.3 | 2.0 | GO:0097643 | amylin receptor activity(GO:0097643) |
| 0.3 | 0.6 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
| 0.3 | 0.8 | GO:0036361 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
| 0.3 | 2.5 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.3 | 3.0 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.3 | 1.1 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.3 | 3.0 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.3 | 1.6 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.3 | 2.9 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.3 | 19.6 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
| 0.3 | 4.7 | GO:0015923 | mannosidase activity(GO:0015923) |
| 0.3 | 0.8 | GO:0045503 | dynein light chain binding(GO:0045503) |
| 0.3 | 0.5 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.3 | 1.5 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.3 | 0.8 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
| 0.3 | 0.3 | GO:0050693 | LBD domain binding(GO:0050693) |
| 0.3 | 1.5 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
| 0.3 | 1.0 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.3 | 3.0 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.3 | 0.5 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.3 | 1.3 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 0.2 | 1.7 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.2 | 1.2 | GO:0015094 | cadmium ion transmembrane transporter activity(GO:0015086) cobalt ion transmembrane transporter activity(GO:0015087) lead ion transmembrane transporter activity(GO:0015094) ferrous iron uptake transmembrane transporter activity(GO:0015639) |
| 0.2 | 4.0 | GO:0033613 | activating transcription factor binding(GO:0033613) |
| 0.2 | 0.7 | GO:0004119 | cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) |
| 0.2 | 0.7 | GO:0098640 | integrin binding involved in cell-matrix adhesion(GO:0098640) |
| 0.2 | 0.2 | GO:0051990 | (R)-2-hydroxyglutarate dehydrogenase activity(GO:0051990) |
| 0.2 | 10.5 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.2 | 1.5 | GO:0030291 | protein serine/threonine kinase inhibitor activity(GO:0030291) |
| 0.2 | 1.2 | GO:0030151 | molybdenum ion binding(GO:0030151) |
| 0.2 | 17.2 | GO:0033558 | protein deacetylase activity(GO:0033558) |
| 0.2 | 0.7 | GO:0008969 | phosphohistidine phosphatase activity(GO:0008969) |
| 0.2 | 1.9 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
| 0.2 | 4.6 | GO:0019104 | DNA N-glycosylase activity(GO:0019104) |
| 0.2 | 1.0 | GO:0060422 | peptidyl-dipeptidase inhibitor activity(GO:0060422) |
| 0.2 | 1.0 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
| 0.2 | 0.7 | GO:0071077 | coenzyme A transmembrane transporter activity(GO:0015228) adenosine 3',5'-bisphosphate transmembrane transporter activity(GO:0071077) AMP transmembrane transporter activity(GO:0080122) |
| 0.2 | 1.9 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.2 | 0.5 | GO:0015307 | drug:proton antiporter activity(GO:0015307) |
| 0.2 | 1.0 | GO:0005277 | acetylcholine transmembrane transporter activity(GO:0005277) acetate ester transmembrane transporter activity(GO:1901375) |
| 0.2 | 1.4 | GO:0003998 | acylphosphatase activity(GO:0003998) |
| 0.2 | 0.7 | GO:0031531 | thyrotropin-releasing hormone receptor binding(GO:0031531) |
| 0.2 | 1.4 | GO:0023025 | MHC class Ib protein complex binding(GO:0023025) MHC class Ib protein binding, via antigen binding groove(GO:0023030) |
| 0.2 | 3.3 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
| 0.2 | 0.7 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.2 | 0.9 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
| 0.2 | 0.2 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
| 0.2 | 0.7 | GO:0043734 | DNA demethylase activity(GO:0035514) DNA-N1-methyladenine dioxygenase activity(GO:0043734) |
| 0.2 | 9.7 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.2 | 2.5 | GO:0070034 | telomerase RNA binding(GO:0070034) |
| 0.2 | 4.1 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.2 | 1.1 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
| 0.2 | 1.6 | GO:0015501 | glutamate:sodium symporter activity(GO:0015501) |
| 0.2 | 2.5 | GO:0008375 | acetylglucosaminyltransferase activity(GO:0008375) |
| 0.2 | 1.6 | GO:0016618 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.2 | 1.1 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
| 0.2 | 1.6 | GO:0031013 | troponin I binding(GO:0031013) |
| 0.2 | 1.6 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
| 0.2 | 1.1 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) |
| 0.2 | 0.7 | GO:0005169 | neurotrophin TRKB receptor binding(GO:0005169) |
| 0.2 | 0.7 | GO:0050429 | calcium-dependent phospholipase C activity(GO:0050429) |
| 0.2 | 7.8 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.2 | 3.1 | GO:0030618 | transforming growth factor beta receptor, pathway-specific cytoplasmic mediator activity(GO:0030618) |
| 0.2 | 0.4 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
| 0.2 | 7.8 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
| 0.2 | 1.5 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.2 | 0.9 | GO:0004909 | interleukin-1, Type I, activating receptor activity(GO:0004909) |
| 0.2 | 7.4 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.2 | 1.3 | GO:0033989 | 3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-enoyl-CoA hydratase activity(GO:0033989) 17-beta-hydroxysteroid dehydrogenase (NAD+) activity(GO:0044594) |
| 0.2 | 3.6 | GO:0016798 | hydrolase activity, acting on glycosyl bonds(GO:0016798) |
| 0.2 | 2.1 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
| 0.2 | 0.6 | GO:0033858 | N-acetylgalactosamine kinase activity(GO:0033858) |
| 0.2 | 1.3 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.2 | 1.9 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.2 | 0.2 | GO:0016411 | acylglycerol O-acyltransferase activity(GO:0016411) |
| 0.2 | 0.2 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
| 0.2 | 3.3 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.2 | 0.8 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
| 0.2 | 1.0 | GO:0033857 | diphosphoinositol-pentakisphosphate kinase activity(GO:0033857) |
| 0.2 | 0.6 | GO:0004560 | alpha-L-fucosidase activity(GO:0004560) fucosidase activity(GO:0015928) |
| 0.2 | 0.6 | GO:0016433 | rRNA (adenine) methyltransferase activity(GO:0016433) |
| 0.2 | 0.8 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 0.2 | 0.6 | GO:0098625 | methylselenol reductase activity(GO:0098625) methylseleninic acid reductase activity(GO:0098626) |
| 0.2 | 0.6 | GO:0098782 | mechanically-gated potassium channel activity(GO:0098782) |
| 0.2 | 1.0 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 0.2 | 2.8 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.2 | 1.2 | GO:0047685 | amine sulfotransferase activity(GO:0047685) |
| 0.2 | 1.2 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.2 | 1.6 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.2 | 6.2 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.2 | 2.4 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.2 | 0.8 | GO:0016979 | lipoate-protein ligase activity(GO:0016979) |
| 0.2 | 0.6 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.2 | 3.5 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.2 | 1.0 | GO:0004905 | type I interferon receptor activity(GO:0004905) |
| 0.2 | 0.4 | GO:0010861 | thyroid hormone receptor activator activity(GO:0010861) thyroid hormone receptor coactivator activity(GO:0030375) |
| 0.2 | 7.8 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
| 0.2 | 1.4 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.2 | 0.4 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
| 0.2 | 1.2 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.2 | 1.9 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.2 | 2.5 | GO:0015217 | ATP transmembrane transporter activity(GO:0005347) ADP transmembrane transporter activity(GO:0015217) |
| 0.2 | 1.7 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.2 | 0.2 | GO:0004827 | proline-tRNA ligase activity(GO:0004827) |
| 0.2 | 0.6 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.2 | 0.6 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
| 0.2 | 2.1 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.2 | 2.8 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
| 0.2 | 0.6 | GO:0004779 | adenylylsulfate kinase activity(GO:0004020) sulfate adenylyltransferase activity(GO:0004779) sulfate adenylyltransferase (ATP) activity(GO:0004781) |
| 0.2 | 0.6 | GO:0033149 | FFAT motif binding(GO:0033149) |
| 0.2 | 4.8 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
| 0.2 | 2.2 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 0.2 | 1.4 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.2 | 4.3 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.2 | 1.3 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.2 | 0.7 | GO:0000832 | inositol-1,3,4,5,6-pentakisphosphate kinase activity(GO:0000827) inositol hexakisphosphate kinase activity(GO:0000828) inositol heptakisphosphate kinase activity(GO:0000829) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
| 0.2 | 1.6 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.2 | 0.9 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.2 | 0.5 | GO:0005459 | UDP-galactose transmembrane transporter activity(GO:0005459) |
| 0.2 | 1.2 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.2 | 0.7 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
| 0.2 | 0.2 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
| 0.2 | 1.4 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
| 0.2 | 0.2 | GO:0035242 | histone-arginine N-methyltransferase activity(GO:0008469) protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
| 0.2 | 1.6 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.2 | 0.9 | GO:0071936 | coreceptor activity involved in Wnt signaling pathway(GO:0071936) |
| 0.2 | 1.7 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.2 | 4.6 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.2 | 4.2 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.2 | 2.3 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.2 | 1.3 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.2 | 1.8 | GO:0008430 | selenium binding(GO:0008430) |
| 0.2 | 0.7 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 0.2 | 1.3 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.2 | 1.1 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
| 0.2 | 1.5 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.2 | 1.3 | GO:0030020 | extracellular matrix structural constituent conferring tensile strength(GO:0030020) |
| 0.2 | 1.0 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.2 | 2.9 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.2 | 0.6 | GO:0015616 | DNA translocase activity(GO:0015616) |
| 0.2 | 12.0 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.2 | 0.5 | GO:0030366 | molybdopterin synthase activity(GO:0030366) |
| 0.2 | 1.4 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.2 | 0.5 | GO:0102007 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 0.2 | 0.8 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 0.2 | 1.8 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.2 | 1.2 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.2 | 0.2 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 0.2 | 0.6 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.2 | 1.2 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.2 | 2.1 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.2 | 0.3 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.2 | 0.2 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
| 0.1 | 1.3 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
| 0.1 | 0.9 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.1 | 0.1 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
| 0.1 | 0.7 | GO:0047820 | D-glutamate cyclase activity(GO:0047820) |
| 0.1 | 0.7 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
| 0.1 | 0.7 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.1 | 0.9 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
| 0.1 | 0.4 | GO:0032427 | GBD domain binding(GO:0032427) |
| 0.1 | 2.9 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.1 | 3.4 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.1 | 0.4 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
| 0.1 | 0.9 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.1 | 1.9 | GO:0001093 | transcription factor activity, sequence-specific DNA binding, RNA polymerase recruiting(GO:0001011) transcription factor activity, TFIIB-class binding(GO:0001087) TFIIB-class transcription factor binding(GO:0001093) |
| 0.1 | 0.4 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.1 | 1.1 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.1 | 0.4 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 0.1 | 2.4 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 0.1 | 1.4 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.1 | 0.4 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.1 | 1.3 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.1 | 6.4 | GO:0030371 | translation repressor activity(GO:0030371) |
| 0.1 | 0.4 | GO:0005534 | galactose binding(GO:0005534) |
| 0.1 | 1.9 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
| 0.1 | 0.3 | GO:0019200 | carbohydrate kinase activity(GO:0019200) |
| 0.1 | 4.9 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.1 | 0.7 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.1 | 1.9 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.1 | 3.0 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.1 | 0.8 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.1 | 0.4 | GO:0016429 | tRNA (adenine) methyltransferase activity(GO:0016426) tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
| 0.1 | 0.4 | GO:0004040 | amidase activity(GO:0004040) |
| 0.1 | 0.1 | GO:0002134 | pyrimidine nucleoside binding(GO:0001884) UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
| 0.1 | 0.4 | GO:0097677 | STAT family protein binding(GO:0097677) |
| 0.1 | 0.9 | GO:0042978 | ornithine decarboxylase activator activity(GO:0042978) |
| 0.1 | 0.7 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.1 | 1.3 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.1 | 1.3 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.1 | 0.7 | GO:0070324 | thyroid hormone binding(GO:0070324) |
| 0.1 | 0.3 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
| 0.1 | 0.9 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.1 | 2.1 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.1 | 0.1 | GO:0016723 | oxidoreductase activity, oxidizing metal ions, NAD or NADP as acceptor(GO:0016723) |
| 0.1 | 2.2 | GO:0005003 | ephrin receptor activity(GO:0005003) |
| 0.1 | 27.0 | GO:0042393 | histone binding(GO:0042393) |
| 0.1 | 1.7 | GO:0047144 | 2-acylglycerol-3-phosphate O-acyltransferase activity(GO:0047144) |
| 0.1 | 0.3 | GO:0035671 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) steroid dehydrogenase activity, acting on the CH-CH group of donors(GO:0033765) enone reductase activity(GO:0035671) cholestenone 5-alpha-reductase activity(GO:0047751) |
| 0.1 | 1.2 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.1 | 0.8 | GO:0045118 | azole transporter activity(GO:0045118) |
| 0.1 | 3.5 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.1 | 0.5 | GO:0005026 | transforming growth factor beta receptor activity, type II(GO:0005026) |
| 0.1 | 2.2 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
| 0.1 | 3.1 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.1 | 2.2 | GO:0070513 | death domain binding(GO:0070513) |
| 0.1 | 2.2 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.1 | 0.4 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.1 | 0.1 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.1 | 1.2 | GO:0055104 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.1 | 1.4 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
| 0.1 | 8.3 | GO:0004177 | aminopeptidase activity(GO:0004177) |
| 0.1 | 0.4 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.1 | 1.1 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.1 | 2.0 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.1 | 2.6 | GO:0022848 | acetylcholine-gated cation channel activity(GO:0022848) |
| 0.1 | 1.3 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
| 0.1 | 0.6 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.1 | 1.4 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.1 | 0.6 | GO:0016428 | tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
| 0.1 | 1.3 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.1 | 3.0 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
| 0.1 | 0.3 | GO:0050571 | 1,5-anhydro-D-fructose reductase activity(GO:0050571) |
| 0.1 | 1.2 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
| 0.1 | 0.8 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.1 | 0.4 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.1 | 5.1 | GO:0016278 | lysine N-methyltransferase activity(GO:0016278) |
| 0.1 | 0.1 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
| 0.1 | 0.2 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.1 | 5.5 | GO:0008009 | chemokine activity(GO:0008009) |
| 0.1 | 0.3 | GO:0016531 | metallochaperone activity(GO:0016530) copper chaperone activity(GO:0016531) |
| 0.1 | 1.0 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.1 | 1.4 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.1 | 1.6 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.1 | 0.3 | GO:0033695 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
| 0.1 | 0.8 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.1 | 0.5 | GO:0015185 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
| 0.1 | 0.8 | GO:0019863 | IgE binding(GO:0019863) |
| 0.1 | 0.7 | GO:0008048 | calcium sensitive guanylate cyclase activator activity(GO:0008048) |
| 0.1 | 0.1 | GO:0004515 | nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.1 | 0.8 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.1 | 2.4 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.1 | 2.6 | GO:1901682 | sulfur compound transmembrane transporter activity(GO:1901682) |
| 0.1 | 0.9 | GO:0019894 | kinesin binding(GO:0019894) |
| 0.1 | 0.3 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.1 | 1.4 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.1 | 2.1 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.1 | 0.5 | GO:0015254 | glycerol channel activity(GO:0015254) |
| 0.1 | 0.3 | GO:0030626 | U12 snRNA binding(GO:0030626) |
| 0.1 | 0.3 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.1 | 1.3 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.1 | 1.3 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.1 | 0.3 | GO:0016422 | mRNA (2'-O-methyladenosine-N6-)-methyltransferase activity(GO:0016422) |
| 0.1 | 0.8 | GO:0004873 | asialoglycoprotein receptor activity(GO:0004873) |
| 0.1 | 0.1 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
| 0.1 | 0.5 | GO:0042165 | neurotransmitter binding(GO:0042165) |
| 0.1 | 1.1 | GO:0030247 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.1 | 1.8 | GO:0005112 | Notch binding(GO:0005112) |
| 0.1 | 1.1 | GO:0019789 | SUMO transferase activity(GO:0019789) |
| 0.1 | 1.0 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.1 | 2.9 | GO:0051117 | ATPase binding(GO:0051117) |
| 0.1 | 0.9 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.1 | 0.3 | GO:0047223 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase activity(GO:0047223) |
| 0.1 | 0.6 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.1 | 26.8 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
| 0.1 | 1.5 | GO:0008143 | poly(A) binding(GO:0008143) |
| 0.1 | 0.4 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 0.1 | 4.1 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.1 | 1.2 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
| 0.1 | 0.3 | GO:0090556 | apolipoprotein A-I receptor activity(GO:0034188) phosphatidylserine-translocating ATPase activity(GO:0090556) |
| 0.1 | 0.5 | GO:0099529 | neurotransmitter receptor activity involved in regulation of postsynaptic membrane potential(GO:0099529) transmitter-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1904315) |
| 0.1 | 0.7 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
| 0.1 | 0.4 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.1 | 0.8 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.1 | 2.0 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.1 | 1.0 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.1 | 0.9 | GO:0030955 | potassium ion binding(GO:0030955) |
| 0.1 | 3.3 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.1 | 0.5 | GO:0015166 | polyol transmembrane transporter activity(GO:0015166) |
| 0.1 | 1.5 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
| 0.1 | 0.6 | GO:0016167 | glial cell-derived neurotrophic factor receptor activity(GO:0016167) |
| 0.1 | 0.2 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.1 | 0.4 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.1 | 2.1 | GO:0030515 | snoRNA binding(GO:0030515) |
| 0.1 | 0.2 | GO:0008466 | glycogenin glucosyltransferase activity(GO:0008466) |
| 0.1 | 0.6 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.1 | 0.3 | GO:0016891 | endoribonuclease activity, producing 5'-phosphomonoesters(GO:0016891) |
| 0.1 | 0.8 | GO:0015250 | water channel activity(GO:0015250) |
| 0.1 | 0.2 | GO:0004818 | glutamate-tRNA ligase activity(GO:0004818) |
| 0.1 | 0.8 | GO:0016004 | phospholipase activator activity(GO:0016004) |
| 0.1 | 0.5 | GO:0004473 | malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
| 0.1 | 0.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.1 | 1.3 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
| 0.1 | 1.9 | GO:0031005 | filamin binding(GO:0031005) |
| 0.1 | 0.6 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.1 | 0.1 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.1 | 1.9 | GO:0016917 | GABA receptor activity(GO:0016917) |
| 0.1 | 0.1 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.1 | 0.2 | GO:0019211 | phosphatase activator activity(GO:0019211) |
| 0.1 | 0.1 | GO:0015230 | FAD transmembrane transporter activity(GO:0015230) |
| 0.1 | 0.4 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.1 | 5.7 | GO:0003724 | RNA helicase activity(GO:0003724) |
| 0.1 | 0.9 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.1 | 4.5 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
| 0.1 | 0.8 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.1 | 0.1 | GO:0004817 | cysteine-tRNA ligase activity(GO:0004817) |
| 0.1 | 0.8 | GO:0022821 | potassium:proton antiporter activity(GO:0015386) potassium ion antiporter activity(GO:0022821) |
| 0.1 | 0.3 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
| 0.1 | 1.2 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
| 0.1 | 1.4 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.1 | 0.5 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.1 | 0.3 | GO:1904492 | Ac-Asp-Glu binding(GO:1904492) tetrahydrofolyl-poly(glutamate) polymer binding(GO:1904493) |
| 0.1 | 0.3 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
| 0.1 | 0.3 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.1 | 1.4 | GO:0070063 | RNA polymerase binding(GO:0070063) |
| 0.1 | 0.1 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.1 | 0.3 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.1 | 0.4 | GO:0008242 | omega peptidase activity(GO:0008242) |
| 0.1 | 0.7 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.1 | 6.5 | GO:0008168 | methyltransferase activity(GO:0008168) |
| 0.1 | 0.7 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
| 0.1 | 0.2 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
| 0.1 | 2.9 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.1 | 0.2 | GO:0004775 | succinate-CoA ligase (ADP-forming) activity(GO:0004775) |
| 0.1 | 0.2 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
| 0.1 | 0.4 | GO:0031543 | peptidyl-proline dioxygenase activity(GO:0031543) |
| 0.1 | 0.3 | GO:0003989 | acetyl-CoA carboxylase activity(GO:0003989) |
| 0.1 | 0.3 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
| 0.1 | 0.1 | GO:0003875 | ADP-ribosylarginine hydrolase activity(GO:0003875) |
| 0.1 | 5.1 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.1 | 0.6 | GO:0031386 | protein tag(GO:0031386) |
| 0.1 | 0.4 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.1 | 0.1 | GO:0001034 | RNA polymerase III transcription factor activity, sequence-specific DNA binding(GO:0001034) |
| 0.1 | 0.1 | GO:0030272 | 5-formyltetrahydrofolate cyclo-ligase activity(GO:0030272) |
| 0.1 | 0.9 | GO:0031404 | chloride ion binding(GO:0031404) |
| 0.1 | 0.2 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.1 | 0.2 | GO:0010309 | acireductone dioxygenase [iron(II)-requiring] activity(GO:0010309) |
| 0.1 | 0.4 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
| 0.1 | 0.3 | GO:0060175 | brain-derived neurotrophic factor-activated receptor activity(GO:0060175) |
| 0.1 | 0.2 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.1 | 0.2 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
| 0.1 | 0.5 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.1 | 0.2 | GO:0004137 | deoxycytidine kinase activity(GO:0004137) |
| 0.1 | 0.1 | GO:0044390 | ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
| 0.1 | 0.2 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
| 0.1 | 33.7 | GO:0019787 | ubiquitin-like protein transferase activity(GO:0019787) |
| 0.1 | 0.3 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.1 | 0.2 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.1 | 0.1 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
| 0.1 | 0.8 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.1 | 0.2 | GO:0016404 | 15-hydroxyprostaglandin dehydrogenase (NAD+) activity(GO:0016404) |
| 0.1 | 0.6 | GO:0015266 | protein channel activity(GO:0015266) |
| 0.1 | 0.2 | GO:0050664 | oxidoreductase activity, acting on NAD(P)H, oxygen as acceptor(GO:0050664) |
| 0.1 | 1.1 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
| 0.1 | 0.2 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
| 0.1 | 0.1 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.1 | 0.2 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) |
| 0.1 | 0.2 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
| 0.1 | 0.4 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.1 | 1.2 | GO:0005521 | lamin binding(GO:0005521) |
| 0.1 | 0.4 | GO:0004996 | thyroid-stimulating hormone receptor activity(GO:0004996) |
| 0.1 | 0.4 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.1 | 1.2 | GO:0070888 | E-box binding(GO:0070888) |
| 0.1 | 0.2 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.1 | 0.3 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.1 | 0.3 | GO:0047237 | glucuronylgalactosylproteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047237) |
| 0.0 | 0.2 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
| 0.0 | 0.1 | GO:0004117 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) |
| 0.0 | 0.1 | GO:0005462 | UDP-N-acetylglucosamine transmembrane transporter activity(GO:0005462) |
| 0.0 | 0.0 | GO:0098988 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) G-protein coupled glutamate receptor activity(GO:0098988) |
| 0.0 | 1.1 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.0 | 0.1 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
| 0.0 | 6.1 | GO:0051082 | unfolded protein binding(GO:0051082) |
| 0.0 | 0.6 | GO:0000339 | RNA cap binding(GO:0000339) |
| 0.0 | 0.1 | GO:0005503 | all-trans retinal binding(GO:0005503) |
| 0.0 | 0.2 | GO:0004911 | interleukin-2 receptor activity(GO:0004911) interleukin-2 binding(GO:0019976) |
| 0.0 | 0.3 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.0 | 0.4 | GO:0001618 | virus receptor activity(GO:0001618) |
| 0.0 | 1.2 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.0 | 1.7 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.0 | 0.1 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.0 | 1.4 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.0 | 1.5 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.0 | 0.4 | GO:0030883 | lipid antigen binding(GO:0030882) endogenous lipid antigen binding(GO:0030883) exogenous lipid antigen binding(GO:0030884) |
| 0.0 | 0.6 | GO:0031491 | nucleosome binding(GO:0031491) |
| 0.0 | 0.1 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
| 0.0 | 0.2 | GO:0008665 | 2'-phosphotransferase activity(GO:0008665) |
| 0.0 | 1.1 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
| 0.0 | 0.1 | GO:0031711 | angiotensin type I receptor activity(GO:0001596) bradykinin receptor binding(GO:0031711) |
| 0.0 | 0.8 | GO:0046961 | hydrogen-exporting ATPase activity(GO:0036442) proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.0 | 1.6 | GO:0051287 | NAD binding(GO:0051287) |
| 0.0 | 0.2 | GO:0004910 | interleukin-1, Type II, blocking receptor activity(GO:0004910) |
| 0.0 | 0.1 | GO:0004531 | deoxyribonuclease II activity(GO:0004531) |
| 0.0 | 0.2 | GO:0042132 | fructose 1,6-bisphosphate 1-phosphatase activity(GO:0042132) |
| 0.0 | 0.7 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.0 | 2.3 | GO:0060589 | nucleoside-triphosphatase regulator activity(GO:0060589) |
| 0.0 | 0.5 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.0 | 0.3 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
| 0.0 | 0.3 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.0 | 0.4 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 0.0 | 0.1 | GO:0070717 | poly-purine tract binding(GO:0070717) |
| 0.0 | 0.1 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
| 0.0 | 2.3 | GO:0003682 | chromatin binding(GO:0003682) |
| 0.0 | 0.1 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.0 | 0.2 | GO:0015926 | glucosidase activity(GO:0015926) |
| 0.0 | 0.1 | GO:0043812 | phosphatidylinositol-4-phosphate phosphatase activity(GO:0043812) |
| 0.0 | 0.0 | GO:0004951 | cholecystokinin receptor activity(GO:0004951) |
| 0.0 | 0.5 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.0 | 0.1 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.0 | 0.1 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.0 | 73.6 | GO:0003677 | DNA binding(GO:0003677) |
| 0.0 | 0.0 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
| 0.0 | 0.1 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.0 | 0.8 | GO:0008527 | taste receptor activity(GO:0008527) |
| 0.0 | 0.2 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.0 | 1.0 | GO:0051213 | dioxygenase activity(GO:0051213) |
| 0.0 | 0.2 | GO:0097199 | cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097199) |
| 0.0 | 0.2 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
| 0.0 | 0.1 | GO:0004307 | ethanolaminephosphotransferase activity(GO:0004307) |
| 0.0 | 0.6 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.0 | 0.2 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
| 0.0 | 0.1 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
| 0.0 | 0.1 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.0 | 0.2 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.0 | 0.2 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
| 0.0 | 0.2 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.0 | 0.0 | GO:0060002 | plus-end directed microfilament motor activity(GO:0060002) |
| 0.0 | 0.0 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.0 | 0.0 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.0 | 1.2 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.0 | 0.7 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
| 0.0 | 0.1 | GO:0015056 | corticotrophin-releasing factor receptor activity(GO:0015056) |
| 0.0 | 0.1 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.0 | 0.0 | GO:0008047 | enzyme activator activity(GO:0008047) |
| 0.0 | 0.3 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
| 0.0 | 0.0 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
| 0.0 | 0.1 | GO:0005171 | hepatocyte growth factor receptor binding(GO:0005171) |
| 0.0 | 0.1 | GO:0047522 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
| 0.0 | 0.1 | GO:0004082 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 0.0 | 0.0 | GO:0031716 | calcitonin receptor binding(GO:0031716) |
| 0.0 | 0.1 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.0 | 0.9 | GO:0042805 | actinin binding(GO:0042805) |
| 0.0 | 0.1 | GO:0017018 | myosin phosphatase activity(GO:0017018) |
| 0.0 | 0.1 | GO:0004662 | CAAX-protein geranylgeranyltransferase activity(GO:0004662) |
| 0.0 | 0.0 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
| 0.0 | 0.9 | GO:0043130 | ubiquitin binding(GO:0043130) |
| 0.0 | 0.0 | GO:0036137 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
| 0.0 | 0.6 | GO:0051087 | chaperone binding(GO:0051087) |
| 0.0 | 0.0 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.0 | 0.0 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.0 | 0.0 | GO:0046848 | hydroxyapatite binding(GO:0046848) |
| 0.0 | 1.2 | GO:0003714 | transcription corepressor activity(GO:0003714) |
| 0.0 | 0.1 | GO:0086075 | gap junction channel activity involved in cardiac conduction electrical coupling(GO:0086075) |
| 0.0 | 0.3 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
| 0.0 | 0.1 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.0 | 0.1 | GO:0022850 | serotonin-gated cation channel activity(GO:0022850) |
| 0.0 | 0.2 | GO:0001671 | ATPase activator activity(GO:0001671) |
| 0.0 | 0.0 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
| 0.0 | 0.4 | GO:0019201 | nucleotide kinase activity(GO:0019201) |
| 0.0 | 0.1 | GO:0060590 | ATPase regulator activity(GO:0060590) |
| 0.0 | 0.1 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.0 | 0.0 | GO:0050786 | RAGE receptor binding(GO:0050786) |
| 0.0 | 0.2 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
| 0.0 | 0.2 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
| 0.0 | 0.1 | GO:0001846 | opsonin binding(GO:0001846) |
| 0.0 | 0.2 | GO:0004659 | prenyltransferase activity(GO:0004659) |
| 0.0 | 0.1 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.5 | 2.5 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.8 | 0.8 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.5 | 8.8 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.4 | 0.8 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.4 | 3.8 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.4 | 3.2 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.3 | 29.3 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.3 | 19.2 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.3 | 12.2 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.3 | 0.8 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
| 0.3 | 17.1 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.3 | 0.3 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.2 | 13.3 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.2 | 6.1 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.2 | 11.3 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.2 | 10.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.2 | 9.8 | PID MYC PATHWAY | C-MYC pathway |
| 0.2 | 0.8 | ST ADRENERGIC | Adrenergic Pathway |
| 0.2 | 11.0 | PID BMP PATHWAY | BMP receptor signaling |
| 0.2 | 13.3 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.2 | 0.7 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.2 | 0.9 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.2 | 0.7 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.2 | 16.8 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 0.2 | 7.9 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.2 | 5.9 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.2 | 1.4 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.2 | 10.7 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.1 | 2.7 | PID S1P S1P2 PATHWAY | S1P2 pathway |
| 0.1 | 2.5 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
| 0.1 | 7.7 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.1 | 0.4 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.1 | 9.2 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 0.1 | 1.4 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.1 | 0.9 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.1 | 1.3 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.1 | 0.6 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.1 | 0.2 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.1 | 9.1 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.1 | 2.2 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.1 | 1.8 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.1 | 2.3 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.1 | 0.5 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.1 | 0.5 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.1 | 2.7 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.1 | 0.3 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.1 | 0.2 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.1 | 1.3 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.1 | 0.4 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
| 0.1 | 0.5 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.1 | 3.0 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.1 | 0.9 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 0.9 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.0 | 0.3 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.0 | 3.9 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.0 | 0.3 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.0 | 0.5 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.0 | 0.8 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.0 | 1.0 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.0 | 1.3 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 0.1 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.0 | 1.3 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 0.2 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 0.2 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.0 | 1.0 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.0 | 1.3 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.0 | 0.2 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.0 | 0.2 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.0 | 1.1 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.0 | 2.0 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.0 | 0.4 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 1.4 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.0 | 0.5 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.0 | 1.1 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.0 | 0.2 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.0 | 0.4 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.0 | 0.8 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
| 0.0 | 0.4 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.5 | 1.5 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.9 | 0.9 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
| 0.9 | 1.8 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
| 0.6 | 11.7 | REACTOME PROCESSIVE SYNTHESIS ON THE LAGGING STRAND | Genes involved in Processive synthesis on the lagging strand |
| 0.6 | 1.2 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
| 0.6 | 15.0 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.5 | 2.7 | REACTOME G PROTEIN BETA GAMMA SIGNALLING | Genes involved in G-protein beta:gamma signalling |
| 0.5 | 13.2 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.5 | 1.0 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.5 | 10.2 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
| 0.4 | 11.8 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.4 | 5.5 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.3 | 3.7 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
| 0.3 | 25.5 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.3 | 14.1 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.3 | 3.3 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.3 | 8.9 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.3 | 6.6 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.3 | 9.2 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.3 | 0.9 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
| 0.3 | 10.3 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.3 | 27.6 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 0.3 | 2.5 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
| 0.3 | 4.9 | REACTOME RESOLUTION OF AP SITES VIA THE MULTIPLE NUCLEOTIDE PATCH REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the multiple-nucleotide patch replacement pathway |
| 0.3 | 7.8 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.3 | 6.1 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.3 | 8.4 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
| 0.3 | 2.0 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.3 | 2.8 | REACTOME G ALPHA S SIGNALLING EVENTS | Genes involved in G alpha (s) signalling events |
| 0.2 | 4.2 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.2 | 8.8 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
| 0.2 | 13.7 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.2 | 5.3 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
| 0.2 | 17.6 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.2 | 0.7 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 0.2 | 5.5 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.2 | 2.9 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
| 0.2 | 2.3 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.2 | 5.8 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.2 | 1.6 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.2 | 2.7 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.2 | 12.7 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.2 | 0.6 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
| 0.2 | 4.1 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.2 | 0.9 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.2 | 3.7 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
| 0.2 | 4.2 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 0.2 | 9.2 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.2 | 3.1 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
| 0.2 | 2.2 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.2 | 4.6 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.2 | 3.4 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.2 | 3.0 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.2 | 2.6 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
| 0.1 | 1.1 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 0.1 | 3.0 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.1 | 1.7 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
| 0.1 | 3.9 | REACTOME AUTODEGRADATION OF CDH1 BY CDH1 APC C | Genes involved in Autodegradation of Cdh1 by Cdh1:APC/C |
| 0.1 | 1.8 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.1 | 0.7 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 0.1 | 4.1 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.1 | 1.6 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.1 | 1.6 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.1 | 4.5 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.1 | 2.5 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
| 0.1 | 1.0 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.1 | 8.2 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
| 0.1 | 4.0 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
| 0.1 | 0.6 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.1 | 3.4 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.1 | 1.5 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
| 0.1 | 9.9 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
| 0.1 | 0.8 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.1 | 0.8 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.1 | 3.9 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.1 | 2.5 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.1 | 1.6 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
| 0.1 | 5.1 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.1 | 0.6 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.1 | 0.4 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.1 | 1.1 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.1 | 0.5 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.1 | 38.2 | REACTOME GENERIC TRANSCRIPTION PATHWAY | Genes involved in Generic Transcription Pathway |
| 0.1 | 0.4 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.1 | 1.0 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.1 | 2.0 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.1 | 4.9 | REACTOME SPHINGOLIPID METABOLISM | Genes involved in Sphingolipid metabolism |
| 0.1 | 1.8 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
| 0.1 | 0.3 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.1 | 1.4 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
| 0.1 | 0.1 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.1 | 1.0 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.1 | 1.7 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.1 | 1.6 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.1 | 1.3 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.1 | 1.0 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.1 | 0.4 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.1 | 0.9 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.1 | 4.6 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.1 | 3.3 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.0 | 1.6 | REACTOME SIGNALING BY FGFR1 MUTANTS | Genes involved in Signaling by FGFR1 mutants |
| 0.0 | 3.5 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
| 0.0 | 0.6 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.0 | 0.1 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
| 0.0 | 0.2 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
| 0.0 | 1.9 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.0 | 0.6 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
| 0.0 | 0.3 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.0 | 0.6 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.0 | 0.1 | REACTOME CELL DEATH SIGNALLING VIA NRAGE NRIF AND NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
| 0.0 | 0.5 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.0 | 0.9 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.0 | 0.1 | REACTOME BILE ACID AND BILE SALT METABOLISM | Genes involved in Bile acid and bile salt metabolism |
| 0.0 | 0.9 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.0 | 0.8 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
| 0.0 | 2.2 | REACTOME MRNA PROCESSING | Genes involved in mRNA Processing |
| 0.0 | 3.2 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.0 | 0.1 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.0 | 0.5 | REACTOME MYD88 MAL CASCADE INITIATED ON PLASMA MEMBRANE | Genes involved in MyD88:Mal cascade initiated on plasma membrane |
| 0.0 | 0.7 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
| 0.0 | 0.3 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.0 | 0.1 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.0 | 0.3 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.0 | 0.2 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.0 | 0.4 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
| 0.0 | 0.6 | REACTOME MAPK TARGETS NUCLEAR EVENTS MEDIATED BY MAP KINASES | Genes involved in MAPK targets/ Nuclear events mediated by MAP kinases |
| 0.0 | 0.3 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.0 | 0.3 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.0 | 0.2 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
| 0.0 | 0.5 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.0 | 0.1 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |