Mucociliary differentiation, bronchial epithelial cells, human (Ross 2007)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
PAX5
|
ENSG00000196092.8 | paired box 5 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| PAX5 | hg19_v2_chr9_-_37034028_37034157 | 0.14 | 4.7e-01 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr14_-_106069247 | 3.19 |
ENST00000479229.1
|
RP11-731F5.1
|
RP11-731F5.1 |
| chr4_-_16085340 | 1.03 |
ENST00000508167.1
|
PROM1
|
prominin 1 |
| chr1_+_47264711 | 1.03 |
ENST00000371923.4
ENST00000271153.4 ENST00000371919.4 |
CYP4B1
|
cytochrome P450, family 4, subfamily B, polypeptide 1 |
| chr2_+_71162995 | 1.01 |
ENST00000234396.4
|
ATP6V1B1
|
ATPase, H+ transporting, lysosomal 56/58kDa, V1 subunit B1 |
| chr4_-_16085314 | 0.98 |
ENST00000510224.1
|
PROM1
|
prominin 1 |
| chr22_+_23046750 | 0.89 |
ENST00000390307.2
|
IGLV3-22
|
immunoglobulin lambda variable 3-22 (gene/pseudogene) |
| chr2_+_71163051 | 0.86 |
ENST00000412314.1
|
ATP6V1B1
|
ATPase, H+ transporting, lysosomal 56/58kDa, V1 subunit B1 |
| chr5_+_131630117 | 0.85 |
ENST00000200652.3
|
SLC22A4
|
solute carrier family 22 (organic cation/zwitterion transporter), member 4 |
| chr2_+_106679690 | 0.77 |
ENST00000409944.1
|
C2orf40
|
chromosome 2 open reading frame 40 |
| chr9_+_139874683 | 0.71 |
ENST00000444903.1
|
PTGDS
|
prostaglandin D2 synthase 21kDa (brain) |
| chr14_-_106642049 | 0.69 |
ENST00000390605.2
|
IGHV1-18
|
immunoglobulin heavy variable 1-18 |
| chr15_-_40600026 | 0.68 |
ENST00000456256.2
ENST00000557821.1 |
PLCB2
|
phospholipase C, beta 2 |
| chrX_-_99665262 | 0.66 |
ENST00000373034.4
ENST00000255531.7 |
PCDH19
|
protocadherin 19 |
| chr7_-_99569468 | 0.66 |
ENST00000419575.1
|
AZGP1
|
alpha-2-glycoprotein 1, zinc-binding |
| chr3_-_58572760 | 0.66 |
ENST00000447756.2
|
FAM107A
|
family with sequence similarity 107, member A |
| chr16_-_776431 | 0.63 |
ENST00000293889.6
|
CCDC78
|
coiled-coil domain containing 78 |
| chr22_+_22930626 | 0.62 |
ENST00000390302.2
|
IGLV2-33
|
immunoglobulin lambda variable 2-33 (non-functional) |
| chr1_+_151682909 | 0.61 |
ENST00000326413.3
ENST00000442233.2 |
RIIAD1
AL589765.1
|
regulatory subunit of type II PKA R-subunit (RIIa) domain containing 1 Uncharacterized protein; cDNA FLJ36032 fis, clone TESTI2017069 |
| chr1_-_152131703 | 0.60 |
ENST00000316073.3
|
RPTN
|
repetin |
| chr11_-_62783303 | 0.60 |
ENST00000336232.2
ENST00000430500.2 |
SLC22A8
|
solute carrier family 22 (organic anion transporter), member 8 |
| chr17_+_26800756 | 0.57 |
ENST00000537681.1
|
SLC13A2
|
solute carrier family 13 (sodium-dependent dicarboxylate transporter), member 2 |
| chr17_-_43487741 | 0.55 |
ENST00000455881.1
|
ARHGAP27
|
Rho GTPase activating protein 27 |
| chr1_-_182641367 | 0.53 |
ENST00000508450.1
|
RGS8
|
regulator of G-protein signaling 8 |
| chr14_-_65438865 | 0.52 |
ENST00000267512.5
|
RAB15
|
RAB15, member RAS oncogene family |
| chr19_+_41620335 | 0.51 |
ENST00000331105.2
|
CYP2F1
|
cytochrome P450, family 2, subfamily F, polypeptide 1 |
| chr1_+_151009054 | 0.51 |
ENST00000295294.7
|
BNIPL
|
BCL2/adenovirus E1B 19kD interacting protein like |
| chr1_+_151009035 | 0.50 |
ENST00000368931.3
|
BNIPL
|
BCL2/adenovirus E1B 19kD interacting protein like |
| chr6_-_150212029 | 0.49 |
ENST00000529948.1
ENST00000357183.4 ENST00000367363.3 |
RAET1E
|
retinoic acid early transcript 1E |
| chr12_+_56075330 | 0.48 |
ENST00000394252.3
|
METTL7B
|
methyltransferase like 7B |
| chr1_-_19186176 | 0.48 |
ENST00000375371.3
|
TAS1R2
|
taste receptor, type 1, member 2 |
| chr22_+_23077065 | 0.46 |
ENST00000390310.2
|
IGLV2-18
|
immunoglobulin lambda variable 2-18 |
| chr1_-_75139397 | 0.46 |
ENST00000326665.5
|
C1orf173
|
chromosome 1 open reading frame 173 |
| chr7_-_122526499 | 0.45 |
ENST00000412584.2
|
CADPS2
|
Ca++-dependent secretion activator 2 |
| chr22_-_42765174 | 0.45 |
ENST00000432473.1
ENST00000412060.1 ENST00000424852.1 |
Z83851.1
|
Z83851.1 |
| chr14_-_65439132 | 0.45 |
ENST00000533601.2
|
RAB15
|
RAB15, member RAS oncogene family |
| chr5_-_180018540 | 0.45 |
ENST00000292641.3
|
SCGB3A1
|
secretoglobin, family 3A, member 1 |
| chr1_+_44584522 | 0.45 |
ENST00000372299.3
|
KLF17
|
Kruppel-like factor 17 |
| chr1_-_146697185 | 0.44 |
ENST00000533174.1
ENST00000254090.4 |
FMO5
|
flavin containing monooxygenase 5 |
| chr4_+_48018781 | 0.44 |
ENST00000295461.5
|
NIPAL1
|
NIPA-like domain containing 1 |
| chr11_-_6440624 | 0.43 |
ENST00000311051.3
|
APBB1
|
amyloid beta (A4) precursor protein-binding, family B, member 1 (Fe65) |
| chr12_-_6740802 | 0.43 |
ENST00000431922.1
|
LPAR5
|
lysophosphatidic acid receptor 5 |
| chr7_-_99573677 | 0.43 |
ENST00000292401.4
|
AZGP1
|
alpha-2-glycoprotein 1, zinc-binding |
| chr15_-_40600111 | 0.43 |
ENST00000543785.2
ENST00000260402.3 |
PLCB2
|
phospholipase C, beta 2 |
| chr7_-_99573640 | 0.42 |
ENST00000411734.1
|
AZGP1
|
alpha-2-glycoprotein 1, zinc-binding |
| chr1_-_146696901 | 0.42 |
ENST00000369272.3
ENST00000441068.2 |
FMO5
|
flavin containing monooxygenase 5 |
| chr4_-_107957454 | 0.42 |
ENST00000285311.3
|
DKK2
|
dickkopf WNT signaling pathway inhibitor 2 |
| chr20_+_13976015 | 0.42 |
ENST00000217246.4
|
MACROD2
|
MACRO domain containing 2 |
| chr10_-_102989551 | 0.42 |
ENST00000370193.2
|
LBX1
|
ladybird homeobox 1 |
| chr22_+_22936998 | 0.41 |
ENST00000390303.2
|
IGLV3-32
|
immunoglobulin lambda variable 3-32 (non-functional) |
| chr3_-_52486841 | 0.41 |
ENST00000496590.1
|
TNNC1
|
troponin C type 1 (slow) |
| chr1_+_152957707 | 0.41 |
ENST00000368762.1
|
SPRR1A
|
small proline-rich protein 1A |
| chr16_-_20681177 | 0.40 |
ENST00000524149.1
|
ACSM1
|
acyl-CoA synthetase medium-chain family member 1 |
| chr9_-_80263220 | 0.40 |
ENST00000341700.6
|
GNA14
|
guanine nucleotide binding protein (G protein), alpha 14 |
| chr3_-_52488048 | 0.40 |
ENST00000232975.3
|
TNNC1
|
troponin C type 1 (slow) |
| chr12_+_40618873 | 0.40 |
ENST00000298910.7
|
LRRK2
|
leucine-rich repeat kinase 2 |
| chr16_-_55867146 | 0.40 |
ENST00000422046.2
|
CES1
|
carboxylesterase 1 |
| chr22_+_23161491 | 0.40 |
ENST00000390316.2
|
IGLV3-9
|
immunoglobulin lambda variable 3-9 (gene/pseudogene) |
| chr3_-_58613323 | 0.40 |
ENST00000474531.1
ENST00000465970.1 |
FAM107A
|
family with sequence similarity 107, member A |
| chr1_+_152881014 | 0.40 |
ENST00000368764.3
ENST00000392667.2 |
IVL
|
involucrin |
| chr14_-_107078851 | 0.40 |
ENST00000390628.2
|
IGHV1-58
|
immunoglobulin heavy variable 1-58 |
| chr11_-_62783276 | 0.40 |
ENST00000535878.1
ENST00000545207.1 |
SLC22A8
|
solute carrier family 22 (organic anion transporter), member 8 |
| chr9_-_139891165 | 0.39 |
ENST00000494426.1
|
CLIC3
|
chloride intracellular channel 3 |
| chr12_+_12223867 | 0.39 |
ENST00000308721.5
|
BCL2L14
|
BCL2-like 14 (apoptosis facilitator) |
| chr22_-_30866564 | 0.39 |
ENST00000435069.1
ENST00000415957.2 ENST00000540910.1 |
SEC14L3
|
SEC14-like 3 (S. cerevisiae) |
| chr16_+_66400533 | 0.39 |
ENST00000341529.3
|
CDH5
|
cadherin 5, type 2 (vascular endothelium) |
| chr1_-_223853348 | 0.39 |
ENST00000366872.5
|
CAPN8
|
calpain 8 |
| chr7_+_100728720 | 0.38 |
ENST00000306085.6
ENST00000412507.1 |
TRIM56
|
tripartite motif containing 56 |
| chr17_-_19619917 | 0.38 |
ENST00000325411.5
ENST00000350657.5 ENST00000433844.2 |
SLC47A2
|
solute carrier family 47 (multidrug and toxin extrusion), member 2 |
| chr17_-_8059638 | 0.38 |
ENST00000584202.1
ENST00000354903.5 ENST00000577253.1 |
PER1
|
period circadian clock 1 |
| chr1_+_152956549 | 0.38 |
ENST00000307122.2
|
SPRR1A
|
small proline-rich protein 1A |
| chr20_+_31619454 | 0.38 |
ENST00000349552.1
|
BPIFB6
|
BPI fold containing family B, member 6 |
| chr3_+_44626446 | 0.38 |
ENST00000441021.1
ENST00000322734.2 |
ZNF660
|
zinc finger protein 660 |
| chr19_-_48823332 | 0.38 |
ENST00000315396.7
|
CCDC114
|
coiled-coil domain containing 114 |
| chr13_-_45992541 | 0.38 |
ENST00000522438.1
|
SLC25A30
|
solute carrier family 25, member 30 |
| chr17_-_3867585 | 0.38 |
ENST00000359983.3
ENST00000352011.3 ENST00000397043.3 ENST00000397041.3 ENST00000397035.3 ENST00000397039.1 ENST00000309890.7 |
ATP2A3
|
ATPase, Ca++ transporting, ubiquitous |
| chr16_-_30125177 | 0.38 |
ENST00000406256.3
|
GDPD3
|
glycerophosphodiester phosphodiesterase domain containing 3 |
| chr16_+_5008290 | 0.38 |
ENST00000251170.7
|
SEC14L5
|
SEC14-like 5 (S. cerevisiae) |
| chr11_+_61276214 | 0.37 |
ENST00000378075.2
|
LRRC10B
|
leucine rich repeat containing 10B |
| chr3_+_169629354 | 0.37 |
ENST00000428432.2
ENST00000335556.3 |
SAMD7
|
sterile alpha motif domain containing 7 |
| chr10_-_98119030 | 0.37 |
ENST00000371172.3
ENST00000393871.1 ENST00000419479.1 |
OPALIN
|
oligodendrocytic myelin paranodal and inner loop protein |
| chr7_-_100239132 | 0.36 |
ENST00000223051.3
ENST00000431692.1 |
TFR2
|
transferrin receptor 2 |
| chr17_+_26800648 | 0.36 |
ENST00000545060.1
|
SLC13A2
|
solute carrier family 13 (sodium-dependent dicarboxylate transporter), member 2 |
| chr1_-_46089639 | 0.36 |
ENST00000445048.2
|
CCDC17
|
coiled-coil domain containing 17 |
| chr22_+_23040274 | 0.36 |
ENST00000390306.2
|
IGLV2-23
|
immunoglobulin lambda variable 2-23 |
| chr16_-_30122717 | 0.36 |
ENST00000566613.1
|
GDPD3
|
glycerophosphodiester phosphodiesterase domain containing 3 |
| chr18_+_34409069 | 0.36 |
ENST00000543923.1
ENST00000280020.5 ENST00000435985.2 ENST00000592521.1 ENST00000587139.1 |
KIAA1328
|
KIAA1328 |
| chr9_+_34458771 | 0.36 |
ENST00000437363.1
ENST00000242317.4 |
DNAI1
|
dynein, axonemal, intermediate chain 1 |
| chr1_-_46089718 | 0.36 |
ENST00000421127.2
ENST00000343901.2 ENST00000528266.1 |
CCDC17
|
coiled-coil domain containing 17 |
| chr5_-_176326333 | 0.36 |
ENST00000292432.5
|
HK3
|
hexokinase 3 (white cell) |
| chr12_+_54943134 | 0.35 |
ENST00000243052.3
|
PDE1B
|
phosphodiesterase 1B, calmodulin-dependent |
| chr20_+_56725952 | 0.35 |
ENST00000371168.3
|
C20orf85
|
chromosome 20 open reading frame 85 |
| chr6_-_109761707 | 0.35 |
ENST00000520723.1
ENST00000518648.1 ENST00000417394.2 |
PPIL6
|
peptidylprolyl isomerase (cyclophilin)-like 6 |
| chr16_-_66959429 | 0.35 |
ENST00000420652.1
ENST00000299759.6 |
RRAD
|
Ras-related associated with diabetes |
| chr17_-_6735035 | 0.35 |
ENST00000338694.2
|
TEKT1
|
tektin 1 |
| chr10_-_79397202 | 0.35 |
ENST00000372437.1
ENST00000372408.2 ENST00000372403.4 |
KCNMA1
|
potassium large conductance calcium-activated channel, subfamily M, alpha member 1 |
| chr13_+_24144796 | 0.35 |
ENST00000403372.2
|
TNFRSF19
|
tumor necrosis factor receptor superfamily, member 19 |
| chr10_-_79397391 | 0.35 |
ENST00000286628.8
ENST00000406533.3 ENST00000354353.5 ENST00000404857.1 |
KCNMA1
|
potassium large conductance calcium-activated channel, subfamily M, alpha member 1 |
| chr1_+_152975488 | 0.34 |
ENST00000542696.1
|
SPRR3
|
small proline-rich protein 3 |
| chr1_+_183441500 | 0.34 |
ENST00000456731.2
|
SMG7
|
SMG7 nonsense mediated mRNA decay factor |
| chr14_+_53019993 | 0.34 |
ENST00000542169.2
ENST00000555622.1 |
GPR137C
|
G protein-coupled receptor 137C |
| chr1_+_78956651 | 0.34 |
ENST00000370757.3
ENST00000370756.3 |
PTGFR
|
prostaglandin F receptor (FP) |
| chr9_-_124976185 | 0.34 |
ENST00000464484.2
|
LHX6
|
LIM homeobox 6 |
| chr17_-_13505219 | 0.34 |
ENST00000284110.1
|
HS3ST3A1
|
heparan sulfate (glucosamine) 3-O-sulfotransferase 3A1 |
| chr11_-_6440283 | 0.34 |
ENST00000299402.6
ENST00000609360.1 ENST00000389906.2 ENST00000532020.2 |
APBB1
|
amyloid beta (A4) precursor protein-binding, family B, member 1 (Fe65) |
| chrX_-_65259914 | 0.34 |
ENST00000374737.4
ENST00000455586.2 |
VSIG4
|
V-set and immunoglobulin domain containing 4 |
| chrX_-_65259900 | 0.34 |
ENST00000412866.2
|
VSIG4
|
V-set and immunoglobulin domain containing 4 |
| chr9_-_130635741 | 0.34 |
ENST00000223836.10
|
AK1
|
adenylate kinase 1 |
| chr17_+_7608511 | 0.33 |
ENST00000226091.2
|
EFNB3
|
ephrin-B3 |
| chr20_-_34117447 | 0.33 |
ENST00000246199.2
ENST00000424444.1 ENST00000374345.4 ENST00000444723.1 |
C20orf173
|
chromosome 20 open reading frame 173 |
| chr4_-_122854193 | 0.33 |
ENST00000513531.1
|
TRPC3
|
transient receptor potential cation channel, subfamily C, member 3 |
| chr1_+_166958497 | 0.33 |
ENST00000367870.2
|
MAEL
|
maelstrom spermatogenic transposon silencer |
| chr14_+_77228532 | 0.33 |
ENST00000167106.4
ENST00000554237.1 |
VASH1
|
vasohibin 1 |
| chr17_+_42977122 | 0.33 |
ENST00000412523.2
ENST00000331733.4 ENST00000417826.2 |
FAM187A
CCDC103
|
family with sequence similarity 187, member A coiled-coil domain containing 103 |
| chr1_+_54359854 | 0.33 |
ENST00000361921.3
ENST00000322679.6 ENST00000532493.1 ENST00000525202.1 ENST00000524406.1 ENST00000388876.3 |
DIO1
|
deiodinase, iodothyronine, type I |
| chr6_-_52774464 | 0.33 |
ENST00000370968.1
ENST00000211122.3 |
GSTA3
|
glutathione S-transferase alpha 3 |
| chr12_+_12224331 | 0.33 |
ENST00000396367.1
ENST00000266434.4 ENST00000396369.1 |
BCL2L14
|
BCL2-like 14 (apoptosis facilitator) |
| chr12_-_56236690 | 0.33 |
ENST00000322569.4
|
MMP19
|
matrix metallopeptidase 19 |
| chr10_-_105992059 | 0.33 |
ENST00000369720.1
ENST00000369719.1 ENST00000357060.3 ENST00000428666.1 ENST00000278064.2 |
WDR96
|
WD repeat domain 96 |
| chr1_+_18807424 | 0.33 |
ENST00000400664.1
|
KLHDC7A
|
kelch domain containing 7A |
| chr22_-_31536480 | 0.33 |
ENST00000215885.3
|
PLA2G3
|
phospholipase A2, group III |
| chr11_-_6426635 | 0.32 |
ENST00000608645.1
ENST00000608394.1 ENST00000529519.1 |
APBB1
|
amyloid beta (A4) precursor protein-binding, family B, member 1 (Fe65) |
| chr7_-_105319536 | 0.32 |
ENST00000477775.1
|
ATXN7L1
|
ataxin 7-like 1 |
| chr13_+_24144509 | 0.32 |
ENST00000248484.4
|
TNFRSF19
|
tumor necrosis factor receptor superfamily, member 19 |
| chr9_+_133274029 | 0.32 |
ENST00000277491.7
|
AL354898.1
|
AL354898.1 |
| chr16_-_67427389 | 0.32 |
ENST00000562206.1
ENST00000290942.5 ENST00000393957.2 |
TPPP3
|
tubulin polymerization-promoting protein family member 3 |
| chr5_-_138718973 | 0.32 |
ENST00000353963.3
ENST00000348729.3 |
SLC23A1
|
solute carrier family 23 (ascorbic acid transporter), member 1 |
| chr10_+_124030819 | 0.32 |
ENST00000260723.4
ENST00000368994.2 |
BTBD16
|
BTB (POZ) domain containing 16 |
| chr3_+_184097836 | 0.32 |
ENST00000204604.1
ENST00000310236.3 |
CHRD
|
chordin |
| chr9_+_126131131 | 0.31 |
ENST00000373629.2
|
CRB2
|
crumbs homolog 2 (Drosophila) |
| chr19_-_51412584 | 0.31 |
ENST00000431178.2
|
KLK4
|
kallikrein-related peptidase 4 |
| chr9_-_34397800 | 0.31 |
ENST00000297623.2
|
C9orf24
|
chromosome 9 open reading frame 24 |
| chr12_-_11175219 | 0.31 |
ENST00000390673.2
|
TAS2R19
|
taste receptor, type 2, member 19 |
| chr19_-_49828438 | 0.31 |
ENST00000454748.3
ENST00000598828.1 ENST00000335875.4 |
SLC6A16
|
solute carrier family 6, member 16 |
| chr5_+_150040403 | 0.31 |
ENST00000517768.1
ENST00000297130.4 |
MYOZ3
|
myozenin 3 |
| chr11_-_65363259 | 0.31 |
ENST00000342202.4
|
KCNK7
|
potassium channel, subfamily K, member 7 |
| chr14_+_101908402 | 0.31 |
ENST00000555725.1
|
RP11-168L7.3
|
RP11-168L7.3 |
| chr3_+_184097905 | 0.31 |
ENST00000450923.1
|
CHRD
|
chordin |
| chr21_+_45879814 | 0.31 |
ENST00000596691.1
|
LRRC3DN
|
LRRC3 downstream neighbor (non-protein coding) |
| chr2_+_120187465 | 0.31 |
ENST00000409826.1
ENST00000417645.1 |
TMEM37
|
transmembrane protein 37 |
| chr6_-_127840336 | 0.31 |
ENST00000525778.1
|
SOGA3
|
SOGA family member 3 |
| chr2_-_107084826 | 0.31 |
ENST00000304514.7
ENST00000409886.3 |
RGPD3
|
RANBP2-like and GRIP domain containing 3 |
| chr11_+_60197069 | 0.31 |
ENST00000528905.1
ENST00000528093.1 |
MS4A5
|
membrane-spanning 4-domains, subfamily A, member 5 |
| chr5_+_53751445 | 0.30 |
ENST00000302005.1
|
HSPB3
|
heat shock 27kDa protein 3 |
| chr15_+_89402148 | 0.30 |
ENST00000560601.1
|
ACAN
|
aggrecan |
| chr12_+_53773944 | 0.30 |
ENST00000551969.1
ENST00000327443.4 |
SP1
|
Sp1 transcription factor |
| chr10_-_79397316 | 0.30 |
ENST00000372421.5
ENST00000457953.1 |
KCNMA1
|
potassium large conductance calcium-activated channel, subfamily M, alpha member 1 |
| chr7_-_37956409 | 0.30 |
ENST00000436072.2
|
SFRP4
|
secreted frizzled-related protein 4 |
| chr1_+_16348497 | 0.30 |
ENST00000439316.2
|
CLCNKA
|
chloride channel, voltage-sensitive Ka |
| chr15_+_60296421 | 0.30 |
ENST00000396057.4
|
FOXB1
|
forkhead box B1 |
| chr22_+_23165153 | 0.30 |
ENST00000390317.2
|
IGLV2-8
|
immunoglobulin lambda variable 2-8 |
| chr8_-_144099795 | 0.30 |
ENST00000522060.1
ENST00000517833.1 ENST00000502167.2 ENST00000518831.1 |
RP11-273G15.2
|
RP11-273G15.2 |
| chrX_-_151999269 | 0.30 |
ENST00000370277.3
|
CETN2
|
centrin, EF-hand protein, 2 |
| chr12_+_50451462 | 0.30 |
ENST00000447966.2
|
ASIC1
|
acid-sensing (proton-gated) ion channel 1 |
| chr11_+_10477733 | 0.30 |
ENST00000528723.1
|
AMPD3
|
adenosine monophosphate deaminase 3 |
| chr2_+_89986318 | 0.30 |
ENST00000491977.1
|
IGKV2D-29
|
immunoglobulin kappa variable 2D-29 |
| chr4_-_147866960 | 0.29 |
ENST00000513335.1
|
TTC29
|
tetratricopeptide repeat domain 29 |
| chrX_+_70435044 | 0.29 |
ENST00000374029.1
ENST00000374022.3 ENST00000447581.1 |
GJB1
|
gap junction protein, beta 1, 32kDa |
| chr1_+_6511651 | 0.29 |
ENST00000434576.1
|
ESPN
|
espin |
| chr2_+_27799389 | 0.29 |
ENST00000408964.2
|
C2orf16
|
chromosome 2 open reading frame 16 |
| chr1_+_16348366 | 0.29 |
ENST00000375692.1
ENST00000420078.1 |
CLCNKA
|
chloride channel, voltage-sensitive Ka |
| chr4_-_147867025 | 0.29 |
ENST00000502319.1
ENST00000325106.4 ENST00000504425.1 |
TTC29
|
tetratricopeptide repeat domain 29 |
| chr10_+_81370689 | 0.29 |
ENST00000372308.3
ENST00000398636.3 ENST00000428376.2 ENST00000372313.5 ENST00000419470.2 ENST00000429958.1 ENST00000439264.1 |
SFTPA1
|
surfactant protein A1 |
| chr12_+_56415100 | 0.29 |
ENST00000547791.1
|
IKZF4
|
IKAROS family zinc finger 4 (Eos) |
| chr11_-_119217365 | 0.29 |
ENST00000360167.4
ENST00000555262.1 ENST00000449574.2 ENST00000445041.2 |
MFRP
C1QTNF5
|
membrane frizzled-related protein C1q and tumor necrosis factor related protein 5 |
| chr10_+_23217006 | 0.29 |
ENST00000376528.4
ENST00000447081.1 |
ARMC3
|
armadillo repeat containing 3 |
| chr9_-_34376851 | 0.29 |
ENST00000297625.7
|
KIAA1161
|
KIAA1161 |
| chr11_+_71791849 | 0.29 |
ENST00000423494.2
ENST00000539587.1 ENST00000538478.1 ENST00000324866.7 ENST00000439209.1 |
LRTOMT
|
leucine rich transmembrane and O-methyltransferase domain containing |
| chr12_-_63328817 | 0.29 |
ENST00000228705.6
|
PPM1H
|
protein phosphatase, Mg2+/Mn2+ dependent, 1H |
| chr22_+_39353527 | 0.28 |
ENST00000249116.2
|
APOBEC3A
|
apolipoprotein B mRNA editing enzyme, catalytic polypeptide-like 3A |
| chr10_+_23216944 | 0.28 |
ENST00000298032.5
ENST00000409983.3 ENST00000409049.3 |
ARMC3
|
armadillo repeat containing 3 |
| chr22_+_23101182 | 0.28 |
ENST00000390312.2
|
IGLV2-14
|
immunoglobulin lambda variable 2-14 |
| chr1_-_117753540 | 0.28 |
ENST00000328189.3
ENST00000369458.3 |
VTCN1
|
V-set domain containing T cell activation inhibitor 1 |
| chr15_-_77712477 | 0.28 |
ENST00000560626.2
|
PEAK1
|
pseudopodium-enriched atypical kinase 1 |
| chr17_+_26800296 | 0.28 |
ENST00000444914.3
ENST00000314669.5 |
SLC13A2
|
solute carrier family 13 (sodium-dependent dicarboxylate transporter), member 2 |
| chr1_+_173837488 | 0.28 |
ENST00000427304.1
ENST00000432989.1 ENST00000367702.1 |
ZBTB37
|
zinc finger and BTB domain containing 37 |
| chr11_+_124055923 | 0.28 |
ENST00000318666.6
|
OR10D3
|
olfactory receptor, family 10, subfamily D, member 3 (non-functional) |
| chr17_-_42907564 | 0.28 |
ENST00000592524.1
|
GJC1
|
gap junction protein, gamma 1, 45kDa |
| chr1_+_16348525 | 0.28 |
ENST00000331433.4
|
CLCNKA
|
chloride channel, voltage-sensitive Ka |
| chr7_-_122635754 | 0.28 |
ENST00000249284.2
|
TAS2R16
|
taste receptor, type 2, member 16 |
| chr2_-_42991257 | 0.28 |
ENST00000378661.2
|
OXER1
|
oxoeicosanoid (OXE) receptor 1 |
| chr10_-_79398250 | 0.28 |
ENST00000286627.5
|
KCNMA1
|
potassium large conductance calcium-activated channel, subfamily M, alpha member 1 |
| chr11_+_1942580 | 0.28 |
ENST00000381558.1
|
TNNT3
|
troponin T type 3 (skeletal, fast) |
| chr16_+_15068916 | 0.27 |
ENST00000455313.2
|
PDXDC1
|
pyridoxal-dependent decarboxylase domain containing 1 |
| chr5_-_135528822 | 0.27 |
ENST00000607574.1
|
AC009014.3
|
AC009014.3 |
| chr19_+_48876300 | 0.27 |
ENST00000600863.1
ENST00000601610.1 ENST00000595322.1 |
SYNGR4
|
synaptogyrin 4 |
| chr9_+_133539981 | 0.27 |
ENST00000253008.2
|
PRDM12
|
PR domain containing 12 |
| chr12_+_119772502 | 0.27 |
ENST00000536742.1
ENST00000327554.2 |
CCDC60
|
coiled-coil domain containing 60 |
| chr11_-_110582773 | 0.27 |
ENST00000524756.1
|
ARHGAP20
|
Rho GTPase activating protein 20 |
| chr15_-_83240507 | 0.27 |
ENST00000564522.1
ENST00000398592.2 |
CPEB1
|
cytoplasmic polyadenylation element binding protein 1 |
| chr7_+_105603683 | 0.27 |
ENST00000317716.9
|
CDHR3
|
cadherin-related family member 3 |
| chr6_+_19837592 | 0.27 |
ENST00000378700.3
|
ID4
|
inhibitor of DNA binding 4, dominant negative helix-loop-helix protein |
| chr16_+_776936 | 0.27 |
ENST00000549114.1
ENST00000341413.4 ENST00000562187.1 ENST00000564537.1 |
HAGHL
|
hydroxyacylglutathione hydrolase-like |
| chr3_-_58563094 | 0.27 |
ENST00000464064.1
|
FAM107A
|
family with sequence similarity 107, member A |
| chr9_+_138606400 | 0.27 |
ENST00000486577.2
|
KCNT1
|
potassium channel, subfamily T, member 1 |
| chr7_+_54610086 | 0.27 |
ENST00000404951.1
|
VSTM2A
|
V-set and transmembrane domain containing 2A |
| chr22_-_38380543 | 0.27 |
ENST00000396884.2
|
SOX10
|
SRY (sex determining region Y)-box 10 |
| chr11_+_71791803 | 0.27 |
ENST00000539271.1
|
LRTOMT
|
leucine rich transmembrane and O-methyltransferase domain containing |
| chr17_-_6735012 | 0.27 |
ENST00000535086.1
|
TEKT1
|
tektin 1 |
| chr2_-_159313214 | 0.26 |
ENST00000409889.1
ENST00000283233.5 ENST00000536771.1 |
CCDC148
|
coiled-coil domain containing 148 |
| chr1_+_173837214 | 0.26 |
ENST00000367704.1
|
ZBTB37
|
zinc finger and BTB domain containing 37 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 2.0 | GO:2000768 | positive regulation of nephron tubule epithelial cell differentiation(GO:2000768) |
| 0.4 | 1.1 | GO:0050760 | negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
| 0.3 | 0.8 | GO:0021919 | BMP signaling pathway involved in spinal cord dorsal/ventral patterning(GO:0021919) |
| 0.2 | 0.9 | GO:0032972 | regulation of muscle filament sliding speed(GO:0032972) |
| 0.2 | 0.2 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
| 0.2 | 0.5 | GO:0018874 | benzoate metabolic process(GO:0018874) |
| 0.2 | 0.2 | GO:0019605 | butyrate metabolic process(GO:0019605) |
| 0.1 | 0.9 | GO:0040009 | regulation of growth rate(GO:0040009) |
| 0.1 | 0.1 | GO:1902214 | regulation of interleukin-4-mediated signaling pathway(GO:1902214) |
| 0.1 | 1.6 | GO:0034465 | response to carbon monoxide(GO:0034465) |
| 0.1 | 0.4 | GO:0015882 | L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
| 0.1 | 0.7 | GO:0002415 | immunoglobulin transcytosis in epithelial cells mediated by polymeric immunoglobulin receptor(GO:0002415) |
| 0.1 | 0.5 | GO:0003366 | cell-matrix adhesion involved in ameboidal cell migration(GO:0003366) |
| 0.1 | 0.9 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
| 0.1 | 0.4 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
| 0.1 | 0.3 | GO:0072579 | molybdenum incorporation into molybdenum-molybdopterin complex(GO:0018315) metal incorporation into metallo-molybdopterin complex(GO:0042040) glycine receptor clustering(GO:0072579) |
| 0.1 | 0.4 | GO:1900827 | maintenance of protein location in membrane(GO:0072658) maintenance of protein location in plasma membrane(GO:0072660) positive regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900827) |
| 0.1 | 0.3 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
| 0.1 | 0.8 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.1 | 0.3 | GO:0001983 | regulation of systemic arterial blood pressure by carotid sinus baroreceptor feedback(GO:0001978) baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
| 0.1 | 0.4 | GO:0090119 | vesicle-mediated cholesterol transport(GO:0090119) |
| 0.1 | 0.1 | GO:0021826 | substrate-independent telencephalic tangential migration(GO:0021826) substrate-independent telencephalic tangential interneuron migration(GO:0021843) |
| 0.1 | 0.4 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.1 | 0.4 | GO:1902499 | positive regulation of protein autoubiquitination(GO:1902499) |
| 0.1 | 0.1 | GO:1902669 | positive regulation of axon guidance(GO:1902669) |
| 0.1 | 0.3 | GO:0021558 | trochlear nerve development(GO:0021558) |
| 0.1 | 0.3 | GO:0035284 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| 0.1 | 0.3 | GO:1900111 | positive regulation of histone H3-K9 dimethylation(GO:1900111) |
| 0.1 | 0.3 | GO:0007412 | axon target recognition(GO:0007412) |
| 0.1 | 0.4 | GO:0097089 | methyl-branched fatty acid metabolic process(GO:0097089) |
| 0.1 | 0.3 | GO:1904204 | regulation of skeletal muscle hypertrophy(GO:1904204) |
| 0.1 | 0.1 | GO:0060661 | submandibular salivary gland formation(GO:0060661) hair follicle cell proliferation(GO:0071335) regulation of hair follicle cell proliferation(GO:0071336) positive regulation of hair follicle cell proliferation(GO:0071338) |
| 0.1 | 0.2 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
| 0.1 | 0.3 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.1 | 0.3 | GO:0086021 | SA node cell to atrial cardiac muscle cell communication by electrical coupling(GO:0086021) |
| 0.1 | 0.3 | GO:0051758 | homologous chromosome movement towards spindle pole involved in homologous chromosome segregation(GO:0051758) |
| 0.1 | 0.3 | GO:0009107 | lipoate biosynthetic process(GO:0009107) |
| 0.1 | 0.3 | GO:2000824 | negative regulation of androgen receptor activity(GO:2000824) |
| 0.1 | 0.3 | GO:0014839 | myoblast migration involved in skeletal muscle regeneration(GO:0014839) |
| 0.1 | 0.4 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.1 | 0.3 | GO:2000364 | regulation of STAT protein import into nucleus(GO:2000364) positive regulation of STAT protein import into nucleus(GO:2000366) |
| 0.1 | 0.5 | GO:0098707 | ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
| 0.1 | 0.6 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.1 | 0.5 | GO:2000323 | negative regulation of glucocorticoid receptor signaling pathway(GO:2000323) |
| 0.1 | 0.4 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
| 0.1 | 0.5 | GO:0010133 | proline catabolic process to glutamate(GO:0010133) |
| 0.1 | 0.2 | GO:2000974 | negative regulation of pro-B cell differentiation(GO:2000974) |
| 0.1 | 0.3 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.1 | 0.5 | GO:0070560 | protein secretion by platelet(GO:0070560) |
| 0.1 | 0.2 | GO:0090675 | intermicrovillar adhesion(GO:0090675) |
| 0.1 | 0.1 | GO:1990770 | regulation of small intestine smooth muscle contraction(GO:1904347) positive regulation of small intestine smooth muscle contraction(GO:1904349) small intestine smooth muscle contraction(GO:1990770) |
| 0.1 | 0.4 | GO:0006203 | dGTP catabolic process(GO:0006203) |
| 0.1 | 0.6 | GO:0071926 | endocannabinoid signaling pathway(GO:0071926) |
| 0.1 | 0.5 | GO:0002005 | angiotensin catabolic process in blood(GO:0002005) |
| 0.1 | 3.2 | GO:0015991 | ATP hydrolysis coupled proton transport(GO:0015991) |
| 0.1 | 0.2 | GO:1900365 | positive regulation of mRNA polyadenylation(GO:1900365) |
| 0.1 | 2.8 | GO:0050913 | sensory perception of bitter taste(GO:0050913) |
| 0.1 | 0.4 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
| 0.1 | 0.1 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
| 0.1 | 0.3 | GO:0042851 | L-alanine metabolic process(GO:0042851) L-alanine catabolic process(GO:0042853) |
| 0.1 | 0.2 | GO:2000870 | regulation of progesterone secretion(GO:2000870) |
| 0.1 | 0.5 | GO:1900239 | phenotypic switching(GO:0036166) regulation of phenotypic switching(GO:1900239) |
| 0.1 | 1.4 | GO:0042424 | catechol-containing compound catabolic process(GO:0019614) catecholamine catabolic process(GO:0042424) |
| 0.1 | 0.2 | GO:0043400 | cortisol secretion(GO:0043400) regulation of cortisol secretion(GO:0051462) |
| 0.1 | 0.5 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.1 | 0.2 | GO:0000294 | nuclear-transcribed mRNA catabolic process, endonucleolytic cleavage-dependent decay(GO:0000294) |
| 0.1 | 0.1 | GO:0080154 | regulation of fertilization(GO:0080154) |
| 0.1 | 0.1 | GO:0046619 | optic placode formation involved in camera-type eye formation(GO:0046619) |
| 0.1 | 0.3 | GO:0010902 | positive regulation of very-low-density lipoprotein particle remodeling(GO:0010902) |
| 0.1 | 0.5 | GO:0048664 | neuron fate determination(GO:0048664) |
| 0.1 | 1.4 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 0.1 | 0.2 | GO:2000566 | positive regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000566) |
| 0.1 | 0.1 | GO:0060697 | positive regulation of phospholipid catabolic process(GO:0060697) |
| 0.1 | 0.1 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.1 | 0.6 | GO:0001554 | luteolysis(GO:0001554) |
| 0.1 | 0.4 | GO:0070383 | DNA cytosine deamination(GO:0070383) |
| 0.1 | 0.1 | GO:0050720 | interleukin-1 beta biosynthetic process(GO:0050720) |
| 0.1 | 0.2 | GO:1903567 | negative regulation of protein localization to cilium(GO:1903565) regulation of protein localization to ciliary membrane(GO:1903567) negative regulation of protein localization to ciliary membrane(GO:1903568) |
| 0.1 | 0.2 | GO:1900180 | regulation of protein localization to nucleus(GO:1900180) |
| 0.1 | 0.3 | GO:0090264 | immune complex clearance(GO:0002434) immune complex clearance by monocytes and macrophages(GO:0002436) regulation of immune complex clearance by monocytes and macrophages(GO:0090264) |
| 0.1 | 0.2 | GO:0036446 | myofibroblast differentiation(GO:0036446) regulation of myofibroblast differentiation(GO:1904760) |
| 0.1 | 0.3 | GO:0014028 | notochord formation(GO:0014028) |
| 0.1 | 0.2 | GO:0090294 | nitrogen catabolite regulation of transcription from RNA polymerase II promoter(GO:0001079) nitrogen catabolite activation of transcription from RNA polymerase II promoter(GO:0001080) regulation of urea metabolic process(GO:0034255) intracellular bile acid receptor signaling pathway(GO:0038185) interleukin-17 secretion(GO:0072615) nitrogen catabolite regulation of transcription(GO:0090293) nitrogen catabolite activation of transcription(GO:0090294) regulation of nitrogen cycle metabolic process(GO:1903314) positive regulation of glutamate metabolic process(GO:2000213) regulation of ammonia assimilation cycle(GO:2001248) positive regulation of ammonia assimilation cycle(GO:2001250) |
| 0.1 | 0.4 | GO:0015798 | myo-inositol transport(GO:0015798) |
| 0.1 | 0.2 | GO:0006267 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 0.1 | 0.2 | GO:0060931 | sinoatrial node cell development(GO:0060931) |
| 0.1 | 0.1 | GO:1902623 | negative regulation of granulocyte chemotaxis(GO:0071623) negative regulation of neutrophil chemotaxis(GO:0090024) negative regulation of neutrophil migration(GO:1902623) |
| 0.1 | 1.8 | GO:0021895 | cerebral cortex neuron differentiation(GO:0021895) |
| 0.1 | 0.1 | GO:0038183 | bile acid signaling pathway(GO:0038183) |
| 0.1 | 0.4 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
| 0.1 | 0.2 | GO:0030185 | nitric oxide transport(GO:0030185) |
| 0.1 | 0.4 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.1 | 0.2 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
| 0.1 | 0.2 | GO:0070105 | positive regulation of interleukin-6-mediated signaling pathway(GO:0070105) |
| 0.1 | 0.4 | GO:1990504 | dense core granule exocytosis(GO:1990504) |
| 0.1 | 0.2 | GO:0002522 | leukocyte migration involved in immune response(GO:0002522) |
| 0.1 | 0.1 | GO:1902954 | regulation of early endosome to recycling endosome transport(GO:1902954) |
| 0.1 | 0.2 | GO:0070460 | thyroid-stimulating hormone secretion(GO:0070460) regulation of thyroid-stimulating hormone secretion(GO:2000612) |
| 0.1 | 0.3 | GO:1903244 | positive regulation of cardiac muscle adaptation(GO:0010615) positive regulation of cardiac muscle hypertrophy in response to stress(GO:1903244) |
| 0.1 | 0.2 | GO:0045210 | negative regulation of dendritic cell cytokine production(GO:0002731) FasL biosynthetic process(GO:0045210) |
| 0.1 | 0.2 | GO:0070741 | response to interleukin-6(GO:0070741) cellular response to interleukin-6(GO:0071354) |
| 0.1 | 0.2 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
| 0.1 | 0.1 | GO:0015917 | aminophospholipid transport(GO:0015917) |
| 0.1 | 0.2 | GO:0071393 | cellular response to progesterone stimulus(GO:0071393) |
| 0.1 | 0.6 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.1 | 0.2 | GO:1903445 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.1 | 0.2 | GO:1904562 | phosphatidylinositol 5-phosphate metabolic process(GO:1904562) |
| 0.1 | 0.1 | GO:0008211 | glucocorticoid metabolic process(GO:0008211) |
| 0.1 | 0.1 | GO:0060031 | mediolateral intercalation(GO:0060031) planar cell polarity pathway involved in gastrula mediolateral intercalation(GO:0060775) |
| 0.1 | 0.8 | GO:0036005 | response to macrophage colony-stimulating factor(GO:0036005) cellular response to macrophage colony-stimulating factor stimulus(GO:0036006) |
| 0.1 | 0.6 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.1 | 0.2 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.1 | 0.2 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
| 0.1 | 0.3 | GO:1903575 | cornified envelope assembly(GO:1903575) |
| 0.1 | 0.2 | GO:0018057 | peptidyl-lysine oxidation(GO:0018057) |
| 0.1 | 0.3 | GO:2000313 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
| 0.1 | 0.1 | GO:0045141 | meiotic telomere clustering(GO:0045141) |
| 0.1 | 0.3 | GO:0006311 | meiotic gene conversion(GO:0006311) |
| 0.1 | 0.3 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
| 0.1 | 0.7 | GO:0015747 | urate transport(GO:0015747) |
| 0.1 | 0.2 | GO:1903233 | regulation of calcium ion-dependent exocytosis of neurotransmitter(GO:1903233) |
| 0.0 | 0.2 | GO:0035720 | intraciliary anterograde transport(GO:0035720) |
| 0.0 | 0.1 | GO:0097154 | GABAergic neuron differentiation(GO:0097154) |
| 0.0 | 0.0 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
| 0.0 | 0.1 | GO:0033861 | negative regulation of NAD(P)H oxidase activity(GO:0033861) |
| 0.0 | 0.3 | GO:0006196 | AMP catabolic process(GO:0006196) |
| 0.0 | 0.1 | GO:0030186 | melatonin metabolic process(GO:0030186) melatonin biosynthetic process(GO:0030187) |
| 0.0 | 0.9 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) modulation of inhibitory postsynaptic potential(GO:0098828) |
| 0.0 | 0.2 | GO:0072674 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.0 | 0.5 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
| 0.0 | 0.2 | GO:1990502 | dense core granule maturation(GO:1990502) |
| 0.0 | 0.0 | GO:0042488 | positive regulation of odontogenesis of dentin-containing tooth(GO:0042488) |
| 0.0 | 0.0 | GO:1904862 | inhibitory synapse assembly(GO:1904862) |
| 0.0 | 0.1 | GO:1904924 | negative regulation of mitophagy in response to mitochondrial depolarization(GO:1904924) |
| 0.0 | 0.3 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.0 | 0.1 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
| 0.0 | 0.0 | GO:0018307 | enzyme active site formation(GO:0018307) |
| 0.0 | 0.2 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) |
| 0.0 | 0.2 | GO:0002503 | peptide antigen assembly with MHC class II protein complex(GO:0002503) |
| 0.0 | 0.4 | GO:0034371 | chylomicron remodeling(GO:0034371) |
| 0.0 | 0.5 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.0 | 0.3 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
| 0.0 | 0.1 | GO:0003051 | angiotensin-mediated drinking behavior(GO:0003051) |
| 0.0 | 1.0 | GO:0009437 | carnitine metabolic process(GO:0009437) |
| 0.0 | 0.2 | GO:0006051 | mannosamine metabolic process(GO:0006050) N-acetylmannosamine metabolic process(GO:0006051) |
| 0.0 | 0.4 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.0 | 0.3 | GO:0070346 | positive regulation of fat cell proliferation(GO:0070346) |
| 0.0 | 0.2 | GO:0032053 | ciliary basal body organization(GO:0032053) |
| 0.0 | 0.1 | GO:0042489 | negative regulation of odontogenesis of dentin-containing tooth(GO:0042489) |
| 0.0 | 0.2 | GO:1902990 | mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
| 0.0 | 0.0 | GO:0032079 | positive regulation of endodeoxyribonuclease activity(GO:0032079) |
| 0.0 | 0.9 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
| 0.0 | 0.3 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.0 | 0.1 | GO:0046832 | negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.0 | 0.0 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
| 0.0 | 0.1 | GO:0038193 | thromboxane A2 signaling pathway(GO:0038193) |
| 0.0 | 0.1 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.0 | 0.0 | GO:0044872 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.0 | 0.9 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.0 | 0.1 | GO:0021831 | embryonic olfactory bulb interneuron precursor migration(GO:0021831) chemorepulsion involved in embryonic olfactory bulb interneuron precursor migration(GO:0021834) |
| 0.0 | 0.1 | GO:0035698 | CD8-positive, alpha-beta T cell extravasation(GO:0035697) CD8-positive, alpha-beta cytotoxic T cell extravasation(GO:0035698) positive regulation of necroptotic process(GO:0060545) regulation of T cell extravasation(GO:2000407) regulation of CD8-positive, alpha-beta T cell extravasation(GO:2000449) regulation of CD8-positive, alpha-beta cytotoxic T cell extravasation(GO:2000452) |
| 0.0 | 0.3 | GO:0035624 | receptor transactivation(GO:0035624) |
| 0.0 | 0.0 | GO:0003256 | regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003256) |
| 0.0 | 0.0 | GO:0042116 | macrophage activation(GO:0042116) |
| 0.0 | 0.1 | GO:0042701 | progesterone secretion(GO:0042701) |
| 0.0 | 0.1 | GO:0036100 | leukotriene catabolic process(GO:0036100) leukotriene B4 catabolic process(GO:0036101) leukotriene B4 metabolic process(GO:0036102) icosanoid catabolic process(GO:1901523) fatty acid derivative catabolic process(GO:1901569) |
| 0.0 | 0.1 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.0 | 0.1 | GO:0060455 | negative regulation of gastric acid secretion(GO:0060455) |
| 0.0 | 0.0 | GO:0002625 | regulation of T cell antigen processing and presentation(GO:0002625) |
| 0.0 | 0.0 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.0 | 0.6 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
| 0.0 | 0.2 | GO:0009236 | cobalamin biosynthetic process(GO:0009236) |
| 0.0 | 0.1 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
| 0.0 | 0.1 | GO:0021577 | hindbrain structural organization(GO:0021577) cerebellum structural organization(GO:0021589) lateral motor column neuron migration(GO:0097477) |
| 0.0 | 0.1 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
| 0.0 | 0.1 | GO:0014744 | positive regulation of muscle adaptation(GO:0014744) |
| 0.0 | 0.4 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
| 0.0 | 0.1 | GO:0016340 | calcium-dependent cell-matrix adhesion(GO:0016340) |
| 0.0 | 0.1 | GO:0044861 | protein transport into plasma membrane raft(GO:0044861) |
| 0.0 | 0.1 | GO:0009443 | pyridoxal 5'-phosphate salvage(GO:0009443) |
| 0.0 | 0.1 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.0 | 0.1 | GO:0042822 | pyridoxal phosphate metabolic process(GO:0042822) |
| 0.0 | 0.2 | GO:0010700 | negative regulation of norepinephrine secretion(GO:0010700) |
| 0.0 | 0.6 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 0.0 | 0.8 | GO:0036149 | phosphatidylinositol acyl-chain remodeling(GO:0036149) |
| 0.0 | 0.2 | GO:2000620 | positive regulation of histone H4-K16 acetylation(GO:2000620) |
| 0.0 | 0.1 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 0.0 | 0.2 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
| 0.0 | 0.3 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
| 0.0 | 0.2 | GO:0021633 | optic nerve structural organization(GO:0021633) |
| 0.0 | 0.2 | GO:0010446 | response to alkaline pH(GO:0010446) |
| 0.0 | 0.2 | GO:0032377 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.0 | 0.3 | GO:1903750 | regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
| 0.0 | 0.1 | GO:0045925 | female courtship behavior(GO:0008050) positive regulation of female receptivity(GO:0045925) |
| 0.0 | 0.1 | GO:0021849 | neuroblast division in subventricular zone(GO:0021849) |
| 0.0 | 0.1 | GO:0006533 | aspartate catabolic process(GO:0006533) |
| 0.0 | 0.1 | GO:0044278 | cell wall disruption in other organism(GO:0044278) |
| 0.0 | 0.6 | GO:0060088 | auditory receptor cell stereocilium organization(GO:0060088) |
| 0.0 | 0.1 | GO:0046707 | IDP metabolic process(GO:0046707) IDP catabolic process(GO:0046709) |
| 0.0 | 0.6 | GO:0070314 | G1 to G0 transition(GO:0070314) |
| 0.0 | 0.0 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
| 0.0 | 0.4 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.0 | 0.1 | GO:1900238 | positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
| 0.0 | 0.1 | GO:0098759 | response to interleukin-8(GO:0098758) cellular response to interleukin-8(GO:0098759) |
| 0.0 | 0.2 | GO:0000821 | regulation of arginine metabolic process(GO:0000821) |
| 0.0 | 0.0 | GO:0009106 | lipoate metabolic process(GO:0009106) |
| 0.0 | 0.2 | GO:1904764 | negative regulation of fibril organization(GO:1902904) chaperone-mediated autophagy translocation complex disassembly(GO:1904764) |
| 0.0 | 0.1 | GO:0042335 | cuticle development(GO:0042335) |
| 0.0 | 0.2 | GO:0001712 | ectoderm formation(GO:0001705) ectodermal cell fate commitment(GO:0001712) |
| 0.0 | 0.2 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.0 | 0.1 | GO:2000053 | regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) |
| 0.0 | 0.2 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.0 | 0.2 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
| 0.0 | 0.3 | GO:0046618 | drug export(GO:0046618) |
| 0.0 | 0.1 | GO:1990869 | response to chemokine(GO:1990868) cellular response to chemokine(GO:1990869) |
| 0.0 | 0.1 | GO:0071453 | cellular response to decreased oxygen levels(GO:0036294) cellular response to oxygen levels(GO:0071453) cellular response to hypoxia(GO:0071456) |
| 0.0 | 0.1 | GO:0042713 | sperm ejaculation(GO:0042713) |
| 0.0 | 0.1 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
| 0.0 | 0.2 | GO:0034165 | positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
| 0.0 | 0.2 | GO:2000490 | negative regulation of hepatic stellate cell activation(GO:2000490) |
| 0.0 | 0.0 | GO:1902159 | regulation of cyclic nucleotide-gated ion channel activity(GO:1902159) |
| 0.0 | 0.1 | GO:1900155 | regulation of bone trabecula formation(GO:1900154) negative regulation of bone trabecula formation(GO:1900155) |
| 0.0 | 0.6 | GO:0007021 | tubulin complex assembly(GO:0007021) |
| 0.0 | 0.1 | GO:0010157 | response to chlorate(GO:0010157) |
| 0.0 | 1.0 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
| 0.0 | 0.1 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.0 | 0.3 | GO:0071799 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
| 0.0 | 0.5 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
| 0.0 | 0.1 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
| 0.0 | 0.1 | GO:0003218 | cardiac left ventricle formation(GO:0003218) |
| 0.0 | 0.1 | GO:0050975 | sensory perception of touch(GO:0050975) |
| 0.0 | 0.1 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
| 0.0 | 0.2 | GO:0042756 | drinking behavior(GO:0042756) |
| 0.0 | 0.1 | GO:2000777 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process involved in cellular response to hypoxia(GO:2000777) |
| 0.0 | 0.1 | GO:0043314 | negative regulation of neutrophil degranulation(GO:0043314) |
| 0.0 | 0.1 | GO:1902396 | protein localization to bicellular tight junction(GO:1902396) |
| 0.0 | 0.1 | GO:0021799 | cerebral cortex radially oriented cell migration(GO:0021799) |
| 0.0 | 0.0 | GO:0061317 | canonical Wnt signaling pathway involved in cardiac muscle cell fate commitment(GO:0061317) |
| 0.0 | 0.2 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.0 | 0.5 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.0 | 0.1 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
| 0.0 | 0.2 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.0 | 0.8 | GO:0045187 | regulation of circadian sleep/wake cycle, sleep(GO:0045187) |
| 0.0 | 0.1 | GO:0042704 | detection of oxygen(GO:0003032) uterine wall breakdown(GO:0042704) |
| 0.0 | 0.1 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.0 | 0.2 | GO:0015864 | pyrimidine nucleoside transport(GO:0015864) |
| 0.0 | 0.2 | GO:2001038 | regulation of cellular response to drug(GO:2001038) |
| 0.0 | 0.2 | GO:0006308 | DNA catabolic process(GO:0006308) |
| 0.0 | 0.1 | GO:0014049 | positive regulation of glutamate secretion(GO:0014049) |
| 0.0 | 0.0 | GO:0061092 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.0 | 0.7 | GO:0016254 | preassembly of GPI anchor in ER membrane(GO:0016254) |
| 0.0 | 0.2 | GO:0060125 | negative regulation of growth hormone secretion(GO:0060125) |
| 0.0 | 0.1 | GO:1904978 | regulation of endosome organization(GO:1904978) |
| 0.0 | 0.1 | GO:0072554 | blood vessel lumenization(GO:0072554) |
| 0.0 | 0.1 | GO:0038179 | neurotrophin signaling pathway(GO:0038179) |
| 0.0 | 0.1 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.0 | 0.5 | GO:0055075 | potassium ion homeostasis(GO:0055075) |
| 0.0 | 0.2 | GO:0060235 | lens induction in camera-type eye(GO:0060235) |
| 0.0 | 0.1 | GO:0007422 | peripheral nervous system development(GO:0007422) |
| 0.0 | 0.1 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
| 0.0 | 0.1 | GO:0071233 | cellular response to leucine(GO:0071233) |
| 0.0 | 0.1 | GO:0061031 | endodermal digestive tract morphogenesis(GO:0061031) |
| 0.0 | 0.1 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
| 0.0 | 0.1 | GO:0052805 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
| 0.0 | 0.0 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.0 | 0.0 | GO:0032707 | negative regulation of interleukin-23 production(GO:0032707) |
| 0.0 | 0.1 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
| 0.0 | 0.3 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.0 | 0.6 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
| 0.0 | 0.5 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.0 | 0.1 | GO:0002925 | positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 0.0 | 0.1 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.0 | 0.2 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
| 0.0 | 0.1 | GO:0006579 | amino-acid betaine catabolic process(GO:0006579) |
| 0.0 | 0.5 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.0 | 0.2 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
| 0.0 | 0.2 | GO:0002578 | negative regulation of antigen processing and presentation(GO:0002578) |
| 0.0 | 0.1 | GO:0016185 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
| 0.0 | 0.1 | GO:0072023 | thick ascending limb development(GO:0072023) metanephric thick ascending limb development(GO:0072233) |
| 0.0 | 0.0 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
| 0.0 | 0.1 | GO:0070676 | intralumenal vesicle formation(GO:0070676) |
| 0.0 | 0.6 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
| 0.0 | 0.4 | GO:0003351 | epithelial cilium movement(GO:0003351) |
| 0.0 | 0.1 | GO:0032804 | negative regulation of low-density lipoprotein particle receptor catabolic process(GO:0032804) |
| 0.0 | 0.2 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
| 0.0 | 0.4 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.0 | 0.1 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
| 0.0 | 0.0 | GO:0009146 | purine nucleoside triphosphate catabolic process(GO:0009146) |
| 0.0 | 0.1 | GO:0000255 | allantoin metabolic process(GO:0000255) |
| 0.0 | 0.2 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.0 | 0.0 | GO:0035329 | hippo signaling(GO:0035329) |
| 0.0 | 0.1 | GO:0033504 | floor plate development(GO:0033504) |
| 0.0 | 0.2 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.0 | 0.1 | GO:0072237 | ascending thin limb development(GO:0072021) metanephric ascending thin limb development(GO:0072218) metanephric proximal tubule development(GO:0072237) |
| 0.0 | 0.1 | GO:0051138 | positive regulation of NK T cell differentiation(GO:0051138) |
| 0.0 | 0.1 | GO:0070781 | response to biotin(GO:0070781) |
| 0.0 | 0.1 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.0 | 0.1 | GO:0010966 | regulation of phosphate transport(GO:0010966) |
| 0.0 | 0.1 | GO:0060214 | endocardium morphogenesis(GO:0003160) endocardium formation(GO:0060214) |
| 0.0 | 0.5 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
| 0.0 | 0.2 | GO:1903830 | magnesium ion transmembrane transport(GO:1903830) |
| 0.0 | 0.1 | GO:0006742 | NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
| 0.0 | 0.1 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
| 0.0 | 0.1 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.0 | 0.6 | GO:0034587 | piRNA metabolic process(GO:0034587) |
| 0.0 | 0.3 | GO:0016198 | axon choice point recognition(GO:0016198) |
| 0.0 | 0.2 | GO:0009624 | response to nematode(GO:0009624) |
| 0.0 | 0.1 | GO:2000249 | regulation of actin cytoskeleton reorganization(GO:2000249) positive regulation of actin cytoskeleton reorganization(GO:2000251) |
| 0.0 | 0.1 | GO:0010897 | negative regulation of triglyceride catabolic process(GO:0010897) |
| 0.0 | 0.1 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
| 0.0 | 0.1 | GO:0016598 | protein arginylation(GO:0016598) |
| 0.0 | 0.2 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
| 0.0 | 0.1 | GO:0070305 | response to cGMP(GO:0070305) |
| 0.0 | 0.1 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
| 0.0 | 0.1 | GO:0006207 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.0 | 0.1 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.0 | 0.2 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
| 0.0 | 0.1 | GO:0045730 | respiratory burst(GO:0045730) |
| 0.0 | 0.1 | GO:0061582 | intestinal epithelial cell migration(GO:0061582) |
| 0.0 | 0.1 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.0 | 0.1 | GO:1903412 | response to bile acid(GO:1903412) |
| 0.0 | 0.1 | GO:0035544 | negative regulation of SNARE complex assembly(GO:0035544) |
| 0.0 | 0.2 | GO:0003190 | atrioventricular valve formation(GO:0003190) |
| 0.0 | 0.1 | GO:0071230 | cellular response to amino acid stimulus(GO:0071230) |
| 0.0 | 0.8 | GO:0035338 | long-chain fatty-acyl-CoA biosynthetic process(GO:0035338) |
| 0.0 | 0.1 | GO:0043606 | histidine catabolic process to glutamate and formamide(GO:0019556) histidine catabolic process to glutamate and formate(GO:0019557) formamide metabolic process(GO:0043606) |
| 0.0 | 0.1 | GO:0048203 | vesicle targeting, trans-Golgi to endosome(GO:0048203) |
| 0.0 | 0.1 | GO:0030070 | insulin processing(GO:0030070) |
| 0.0 | 0.1 | GO:0038110 | interleukin-2-mediated signaling pathway(GO:0038110) |
| 0.0 | 0.1 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
| 0.0 | 0.1 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.0 | 0.1 | GO:0000706 | meiotic DNA double-strand break processing(GO:0000706) double-strand break repair involved in meiotic recombination(GO:1990918) |
| 0.0 | 0.0 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
| 0.0 | 0.3 | GO:0060211 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
| 0.0 | 0.2 | GO:0045007 | depurination(GO:0045007) |
| 0.0 | 0.1 | GO:0019827 | stem cell population maintenance(GO:0019827) maintenance of cell number(GO:0098727) |
| 0.0 | 0.5 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
| 0.0 | 0.1 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.0 | 0.1 | GO:0071493 | cellular response to UV-B(GO:0071493) |
| 0.0 | 0.1 | GO:0098914 | membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
| 0.0 | 0.1 | GO:1904579 | response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) response to hypobaric hypoxia(GO:1990910) |
| 0.0 | 0.1 | GO:0017198 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.0 | 0.1 | GO:0098886 | modification of dendritic spine(GO:0098886) |
| 0.0 | 0.2 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.1 | GO:0048635 | negative regulation of muscle organ development(GO:0048635) |
| 0.0 | 0.1 | GO:0019417 | sulfur oxidation(GO:0019417) |
| 0.0 | 0.1 | GO:0007497 | posterior midgut development(GO:0007497) positive regulation of metanephric glomerulus development(GO:0072300) |
| 0.0 | 0.1 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
| 0.0 | 0.1 | GO:0006788 | heme oxidation(GO:0006788) |
| 0.0 | 0.2 | GO:1905150 | regulation of voltage-gated sodium channel activity(GO:1905150) |
| 0.0 | 0.1 | GO:0071630 | nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
| 0.0 | 0.2 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.0 | 0.1 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.0 | 0.1 | GO:0035425 | autocrine signaling(GO:0035425) |
| 0.0 | 0.0 | GO:0033292 | T-tubule organization(GO:0033292) |
| 0.0 | 0.3 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
| 0.0 | 0.1 | GO:0098746 | fast, calcium ion-dependent exocytosis of neurotransmitter(GO:0098746) |
| 0.0 | 0.0 | GO:0070370 | heat acclimation(GO:0010286) cellular heat acclimation(GO:0070370) |
| 0.0 | 0.0 | GO:0070585 | protein localization to mitochondrion(GO:0070585) |
| 0.0 | 0.1 | GO:0006850 | mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
| 0.0 | 0.1 | GO:0070197 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.0 | 0.1 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.0 | 0.1 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.0 | 0.1 | GO:1902304 | positive regulation of potassium ion export(GO:1902304) |
| 0.0 | 0.1 | GO:0035865 | cellular response to potassium ion(GO:0035865) |
| 0.0 | 0.0 | GO:0003064 | regulation of heart rate by hormone(GO:0003064) |
| 0.0 | 0.0 | GO:0060143 | positive regulation of myotube differentiation(GO:0010831) positive regulation of syncytium formation by plasma membrane fusion(GO:0060143) positive regulation of myoblast fusion(GO:1901741) |
| 0.0 | 0.0 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
| 0.0 | 0.4 | GO:0016998 | cell wall macromolecule catabolic process(GO:0016998) |
| 0.0 | 0.0 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.0 | 0.1 | GO:0046223 | mycotoxin catabolic process(GO:0043387) aflatoxin catabolic process(GO:0046223) organic heteropentacyclic compound catabolic process(GO:1901377) regulation of glutathione biosynthetic process(GO:1903786) positive regulation of glutathione biosynthetic process(GO:1903788) |
| 0.0 | 0.9 | GO:0046710 | GDP metabolic process(GO:0046710) |
| 0.0 | 0.3 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
| 0.0 | 0.9 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.0 | 0.2 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 0.0 | 0.0 | GO:0009405 | pathogenesis(GO:0009405) |
| 0.0 | 0.1 | GO:0090493 | dopamine uptake involved in synaptic transmission(GO:0051583) catecholamine uptake involved in synaptic transmission(GO:0051934) catecholamine uptake(GO:0090493) dopamine uptake(GO:0090494) |
| 0.0 | 0.1 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.0 | 0.1 | GO:0006014 | D-ribose metabolic process(GO:0006014) |
| 0.0 | 0.0 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
| 0.0 | 0.7 | GO:1901381 | positive regulation of potassium ion transmembrane transport(GO:1901381) |
| 0.0 | 0.0 | GO:0035912 | dorsal aorta development(GO:0035907) dorsal aorta morphogenesis(GO:0035912) |
| 0.0 | 0.0 | GO:0090427 | activation of meiosis(GO:0090427) |
| 0.0 | 0.0 | GO:0072014 | proximal tubule development(GO:0072014) |
| 0.0 | 0.2 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.0 | 0.1 | GO:0038155 | interleukin-23-mediated signaling pathway(GO:0038155) |
| 0.0 | 0.0 | GO:1901727 | regulation of histone deacetylase activity(GO:1901725) positive regulation of histone deacetylase activity(GO:1901727) |
| 0.0 | 0.6 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.0 | 0.1 | GO:0045744 | negative regulation of G-protein coupled receptor protein signaling pathway(GO:0045744) |
| 0.0 | 0.0 | GO:0003284 | septum primum development(GO:0003284) |
| 0.0 | 0.2 | GO:0090650 | response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
| 0.0 | 0.1 | GO:0070874 | negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 0.0 | 0.0 | GO:0034398 | telomere tethering at nuclear periphery(GO:0034398) |
| 0.0 | 0.0 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
| 0.0 | 0.3 | GO:0060070 | canonical Wnt signaling pathway(GO:0060070) |
| 0.0 | 0.2 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.0 | 0.3 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.0 | 0.1 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
| 0.0 | 0.1 | GO:0043932 | ossification involved in bone remodeling(GO:0043932) |
| 0.0 | 0.1 | GO:0048749 | compound eye development(GO:0048749) |
| 0.0 | 0.1 | GO:0019046 | release from viral latency(GO:0019046) |
| 0.0 | 0.0 | GO:0045082 | positive regulation of interleukin-10 biosynthetic process(GO:0045082) |
| 0.0 | 0.1 | GO:1990523 | bone regeneration(GO:1990523) |
| 0.0 | 0.1 | GO:0003408 | optic cup formation involved in camera-type eye development(GO:0003408) |
| 0.0 | 0.1 | GO:2000399 | negative regulation of T cell differentiation in thymus(GO:0033085) negative regulation of thymocyte aggregation(GO:2000399) |
| 0.0 | 0.3 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.0 | 0.1 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.0 | 0.1 | GO:0031959 | mineralocorticoid receptor signaling pathway(GO:0031959) |
| 0.0 | 0.2 | GO:0090292 | nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.0 | 0.5 | GO:0097186 | amelogenesis(GO:0097186) |
| 0.0 | 0.0 | GO:2001168 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.0 | 0.0 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
| 0.0 | 0.1 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.0 | 0.0 | GO:0035815 | positive regulation of renal sodium excretion(GO:0035815) |
| 0.0 | 0.1 | GO:0072600 | establishment of protein localization to Golgi(GO:0072600) |
| 0.0 | 0.4 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.0 | 0.1 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.0 | 0.0 | GO:0045409 | negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
| 0.0 | 0.1 | GO:0035774 | positive regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0035774) |
| 0.0 | 0.1 | GO:0007439 | ectodermal digestive tract development(GO:0007439) embryonic ectodermal digestive tract development(GO:0048611) |
| 0.0 | 0.1 | GO:0045229 | cell envelope organization(GO:0043163) external encapsulating structure organization(GO:0045229) |
| 0.0 | 0.1 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
| 0.0 | 0.1 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
| 0.0 | 0.1 | GO:2000343 | positive regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000343) |
| 0.0 | 0.1 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.0 | 0.1 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.0 | 0.1 | GO:0035105 | sterol regulatory element binding protein import into nucleus(GO:0035105) |
| 0.0 | 0.2 | GO:0016191 | synaptic vesicle uncoating(GO:0016191) |
| 0.0 | 0.1 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
| 0.0 | 0.3 | GO:0046459 | short-chain fatty acid metabolic process(GO:0046459) |
| 0.0 | 0.1 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
| 0.0 | 0.1 | GO:0061101 | neuroendocrine cell differentiation(GO:0061101) |
| 0.0 | 0.2 | GO:0042996 | regulation of Golgi to plasma membrane protein transport(GO:0042996) |
| 0.0 | 0.1 | GO:0048690 | regulation of sprouting of injured axon(GO:0048686) regulation of axon extension involved in regeneration(GO:0048690) |
| 0.0 | 0.2 | GO:0008228 | opsonization(GO:0008228) |
| 0.0 | 0.1 | GO:0071409 | cellular response to cycloheximide(GO:0071409) |
| 0.0 | 0.0 | GO:1904954 | canonical Wnt signaling pathway involved in midbrain dopaminergic neuron differentiation(GO:1904954) |
| 0.0 | 0.0 | GO:0034505 | tooth mineralization(GO:0034505) |
| 0.0 | 0.0 | GO:0072312 | metanephric glomerular epithelium development(GO:0072244) metanephric glomerular visceral epithelial cell differentiation(GO:0072248) metanephric glomerular visceral epithelial cell development(GO:0072249) metanephric glomerular epithelial cell differentiation(GO:0072312) metanephric glomerular epithelial cell development(GO:0072313) |
| 0.0 | 0.2 | GO:0090083 | regulation of inclusion body assembly(GO:0090083) |
| 0.0 | 0.0 | GO:0097476 | spinal cord motor neuron migration(GO:0097476) |
| 0.0 | 0.0 | GO:1902811 | tongue muscle cell differentiation(GO:0035981) positive regulation of skeletal muscle fiber differentiation(GO:1902811) regulation of tongue muscle cell differentiation(GO:2001035) positive regulation of tongue muscle cell differentiation(GO:2001037) |
| 0.0 | 0.1 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) Golgi transport vesicle coating(GO:0048200) COPI coating of Golgi vesicle(GO:0048205) |
| 0.0 | 0.3 | GO:0042340 | keratan sulfate catabolic process(GO:0042340) |
| 0.0 | 0.0 | GO:1900106 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.0 | 2.5 | GO:0070268 | cornification(GO:0070268) |
| 0.0 | 0.2 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.0 | 0.5 | GO:0001562 | response to protozoan(GO:0001562) |
| 0.0 | 0.1 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
| 0.0 | 0.1 | GO:0006710 | androgen catabolic process(GO:0006710) |
| 0.0 | 0.1 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
| 0.0 | 0.0 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.0 | 0.1 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.0 | 0.1 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
| 0.0 | 0.1 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.0 | 0.1 | GO:0002636 | positive regulation of germinal center formation(GO:0002636) |
| 0.0 | 0.2 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
| 0.0 | 0.0 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
| 0.0 | 0.1 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 0.0 | 0.0 | GO:0034239 | macrophage fusion(GO:0034238) regulation of macrophage fusion(GO:0034239) positive regulation of macrophage fusion(GO:0034241) |
| 0.0 | 0.1 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.0 | 0.1 | GO:0001880 | Mullerian duct regression(GO:0001880) |
| 0.0 | 0.1 | GO:0050712 | negative regulation of interleukin-1 alpha production(GO:0032690) negative regulation of interleukin-1 alpha secretion(GO:0050712) |
| 0.0 | 0.1 | GO:1901094 | regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
| 0.0 | 0.1 | GO:0034184 | regulation of maintenance of sister chromatid cohesion(GO:0034091) positive regulation of maintenance of sister chromatid cohesion(GO:0034093) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.0 | 0.7 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.0 | 0.1 | GO:0072092 | ureteric bud invasion(GO:0072092) metanephric renal vesicle formation(GO:0072093) |
| 0.0 | 0.2 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
| 0.0 | 0.0 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
| 0.0 | 0.1 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.0 | 0.2 | GO:1903943 | regulation of hepatocyte apoptotic process(GO:1903943) negative regulation of hepatocyte apoptotic process(GO:1903944) |
| 0.0 | 0.6 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
| 0.0 | 0.0 | GO:1900673 | cellular alkene metabolic process(GO:0043449) olefin metabolic process(GO:1900673) |
| 0.0 | 0.0 | GO:0048708 | astrocyte differentiation(GO:0048708) |
| 0.0 | 0.1 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.0 | 0.1 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.0 | 0.1 | GO:0061743 | motor learning(GO:0061743) |
| 0.0 | 0.1 | GO:0021984 | adenohypophysis development(GO:0021984) |
| 0.0 | 0.2 | GO:0046520 | sphingoid biosynthetic process(GO:0046520) |
| 0.0 | 0.2 | GO:1990403 | embryonic brain development(GO:1990403) |
| 0.0 | 0.1 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
| 0.0 | 0.1 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.0 | 0.1 | GO:0042738 | exogenous drug catabolic process(GO:0042738) |
| 0.0 | 0.0 | GO:1904031 | positive regulation of cyclin-dependent protein kinase activity(GO:1904031) |
| 0.0 | 0.1 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
| 0.0 | 0.1 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.0 | 0.1 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.0 | 0.0 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.0 | 0.1 | GO:0055064 | chloride ion homeostasis(GO:0055064) |
| 0.0 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.0 | 0.3 | GO:0001771 | immunological synapse formation(GO:0001771) |
| 0.0 | 0.3 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
| 0.0 | 0.1 | GO:0046085 | adenosine metabolic process(GO:0046085) |
| 0.0 | 0.0 | GO:0060022 | hard palate development(GO:0060022) |
| 0.0 | 0.1 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.0 | 0.1 | GO:0019236 | response to pheromone(GO:0019236) |
| 0.0 | 0.1 | GO:0071400 | cellular response to oleic acid(GO:0071400) |
| 0.0 | 0.1 | GO:1902932 | positive regulation of alcohol biosynthetic process(GO:1902932) |
| 0.0 | 0.0 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
| 0.0 | 0.1 | GO:1902714 | negative regulation of interferon-gamma secretion(GO:1902714) |
| 0.0 | 0.2 | GO:0036152 | phosphatidylethanolamine acyl-chain remodeling(GO:0036152) |
| 0.0 | 0.2 | GO:0051150 | regulation of smooth muscle cell differentiation(GO:0051150) |
| 0.0 | 0.2 | GO:0034374 | low-density lipoprotein particle remodeling(GO:0034374) |
| 0.0 | 2.6 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
| 0.0 | 0.0 | GO:0072683 | T cell extravasation(GO:0072683) |
| 0.0 | 0.1 | GO:0043393 | regulation of protein binding(GO:0043393) |
| 0.0 | 0.1 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
| 0.0 | 0.1 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.0 | 0.3 | GO:0046785 | microtubule polymerization(GO:0046785) |
| 0.0 | 0.1 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
| 0.0 | 0.1 | GO:1905232 | cellular response to L-glutamate(GO:1905232) |
| 0.0 | 0.1 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.0 | 0.0 | GO:0006959 | humoral immune response(GO:0006959) |
| 0.0 | 0.1 | GO:0035995 | skeletal muscle myosin thick filament assembly(GO:0030241) detection of muscle stretch(GO:0035995) |
| 0.0 | 0.1 | GO:0030311 | poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.0 | 0.1 | GO:0035936 | androgen secretion(GO:0035935) testosterone secretion(GO:0035936) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) regulation of testosterone secretion(GO:2000843) positive regulation of testosterone secretion(GO:2000845) |
| 0.0 | 0.0 | GO:0061010 | gall bladder development(GO:0061010) |
| 0.0 | 0.0 | GO:0000820 | regulation of glutamine family amino acid metabolic process(GO:0000820) |
| 0.0 | 0.0 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.0 | 0.0 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
| 0.0 | 0.0 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.0 | 0.1 | GO:0060013 | righting reflex(GO:0060013) |
| 0.0 | 0.1 | GO:0045836 | positive regulation of meiotic nuclear division(GO:0045836) |
| 0.0 | 0.6 | GO:0042572 | retinol metabolic process(GO:0042572) |
| 0.0 | 0.1 | GO:0000076 | DNA replication checkpoint(GO:0000076) |
| 0.0 | 0.1 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
| 0.0 | 0.2 | GO:1902659 | regulation of glucose mediated signaling pathway(GO:1902659) |
| 0.0 | 0.4 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
| 0.0 | 0.0 | GO:0010763 | positive regulation of fibroblast migration(GO:0010763) |
| 0.0 | 0.1 | GO:0006924 | activation-induced cell death of T cells(GO:0006924) |
| 0.0 | 0.1 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
| 0.0 | 0.0 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.0 | 0.1 | GO:0015705 | iodide transport(GO:0015705) |
| 0.0 | 0.0 | GO:0035408 | histone H3-T6 phosphorylation(GO:0035408) |
| 0.0 | 0.0 | GO:0002881 | negative regulation of chronic inflammatory response to non-antigenic stimulus(GO:0002881) |
| 0.0 | 0.0 | GO:0021896 | forebrain astrocyte differentiation(GO:0021896) forebrain astrocyte development(GO:0021897) |
| 0.0 | 0.1 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) |
| 0.0 | 0.1 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.0 | 0.1 | GO:1903975 | regulation of glial cell migration(GO:1903975) |
| 0.0 | 0.1 | GO:0098887 | neurotransmitter receptor transport, endosome to postsynaptic membrane(GO:0098887) |
| 0.0 | 0.1 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
| 0.0 | 0.0 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.0 | 0.1 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
| 0.0 | 0.1 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
| 0.0 | 0.1 | GO:1901315 | negative regulation of histone ubiquitination(GO:0033183) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) |
| 0.0 | 0.1 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
| 0.0 | 0.1 | GO:0042357 | thiamine diphosphate metabolic process(GO:0042357) |
| 0.0 | 0.0 | GO:0090467 | L-arginine import(GO:0043091) arginine import(GO:0090467) |
| 0.0 | 0.0 | GO:0034694 | response to prostaglandin(GO:0034694) |
| 0.0 | 0.6 | GO:1903959 | regulation of anion transmembrane transport(GO:1903959) |
| 0.0 | 0.0 | GO:0060687 | regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
| 0.0 | 0.1 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
| 0.0 | 0.0 | GO:0032203 | telomere formation via telomerase(GO:0032203) |
| 0.0 | 0.1 | GO:0035548 | gamma-delta T cell activation involved in immune response(GO:0002290) negative regulation of interferon-beta secretion(GO:0035548) negative regulation of CD8-positive, alpha-beta T cell activation(GO:2001186) regulation of gamma-delta T cell activation involved in immune response(GO:2001191) positive regulation of gamma-delta T cell activation involved in immune response(GO:2001193) |
| 0.0 | 0.1 | GO:0070458 | cellular detoxification of nitrogen compound(GO:0070458) |
| 0.0 | 0.4 | GO:0030207 | chondroitin sulfate catabolic process(GO:0030207) |
| 0.0 | 0.0 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
| 0.0 | 0.1 | GO:1903906 | plasma membrane raft distribution(GO:0044855) plasma membrane raft localization(GO:0044856) plasma membrane raft polarization(GO:0044858) regulation of plasma membrane raft polarization(GO:1903906) |
| 0.0 | 0.1 | GO:2000860 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.0 | 0.1 | GO:0050773 | regulation of dendrite development(GO:0050773) |
| 0.0 | 0.0 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.0 | 0.1 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.0 | 0.0 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
| 0.0 | 0.1 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) |
| 0.0 | 0.1 | GO:0070296 | sarcoplasmic reticulum calcium ion transport(GO:0070296) |
| 0.0 | 0.0 | GO:0051142 | regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
| 0.0 | 0.1 | GO:0045059 | positive thymic T cell selection(GO:0045059) |
| 0.0 | 0.1 | GO:0006940 | regulation of smooth muscle contraction(GO:0006940) |
| 0.0 | 0.1 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.0 | 0.0 | GO:1902490 | regulation of sperm capacitation(GO:1902490) |
| 0.0 | 0.1 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.0 | 0.2 | GO:0045475 | locomotor rhythm(GO:0045475) |
| 0.0 | 0.0 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
| 0.0 | 0.0 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
| 0.0 | 0.1 | GO:1902236 | negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
| 0.0 | 0.0 | GO:0097049 | motor neuron apoptotic process(GO:0097049) |
| 0.0 | 0.0 | GO:0071139 | resolution of recombination intermediates(GO:0071139) resolution of mitotic recombination intermediates(GO:0071140) |
| 0.0 | 0.2 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
| 0.0 | 0.1 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
| 0.0 | 0.1 | GO:0009125 | nucleoside monophosphate catabolic process(GO:0009125) |
| 0.0 | 0.1 | GO:0051026 | chiasma assembly(GO:0051026) |
| 0.0 | 0.0 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
| 0.0 | 0.2 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
| 0.0 | 0.1 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.0 | 0.1 | GO:0070233 | negative regulation of T cell apoptotic process(GO:0070233) |
| 0.0 | 0.2 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 0.0 | 0.1 | GO:0009597 | detection of virus(GO:0009597) |
| 0.0 | 0.1 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
| 0.0 | 0.1 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
| 0.0 | 0.1 | GO:0015811 | L-cystine transport(GO:0015811) |
| 0.0 | 0.0 | GO:0010644 | cell communication by electrical coupling(GO:0010644) |
| 0.0 | 0.0 | GO:0061713 | neural crest cell migration involved in heart formation(GO:0003147) anterior neural tube closure(GO:0061713) |
| 0.0 | 0.0 | GO:0007500 | mesodermal cell fate determination(GO:0007500) regulation of intracellular transport of viral material(GO:1901252) negative regulation of intracellular transport of viral material(GO:1901253) |
| 0.0 | 0.2 | GO:0048168 | regulation of neuronal synaptic plasticity(GO:0048168) |
| 0.0 | 0.1 | GO:0031081 | nuclear pore distribution(GO:0031081) nuclear pore localization(GO:0051664) |
| 0.0 | 0.0 | GO:1903644 | regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.0 | 0.1 | GO:0051122 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.0 | 0.1 | GO:0035522 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
| 0.0 | 0.3 | GO:0032098 | regulation of appetite(GO:0032098) |
| 0.0 | 0.1 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
| 0.0 | 0.0 | GO:0046080 | dUTP metabolic process(GO:0046080) dUTP catabolic process(GO:0046081) |
| 0.0 | 0.1 | GO:0006563 | L-serine metabolic process(GO:0006563) |
| 0.0 | 0.1 | GO:0060560 | developmental growth involved in morphogenesis(GO:0060560) |
| 0.0 | 2.0 | GO:0002377 | immunoglobulin production(GO:0002377) |
| 0.0 | 0.0 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
| 0.0 | 0.1 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) negative regulation of actin nucleation(GO:0051126) |
| 0.0 | 0.0 | GO:0046889 | positive regulation of lipid biosynthetic process(GO:0046889) |
| 0.0 | 0.1 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
| 0.0 | 0.8 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
| 0.0 | 0.2 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.0 | 0.1 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.0 | 0.0 | GO:0060573 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 0.0 | 0.0 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
| 0.0 | 0.0 | GO:0015729 | thiosulfate transport(GO:0015709) oxaloacetate transport(GO:0015729) malate transport(GO:0015743) malate transmembrane transport(GO:0071423) oxaloacetate(2-) transmembrane transport(GO:1902356) |
| 0.0 | 0.0 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
| 0.0 | 0.1 | GO:0072050 | S-shaped body morphogenesis(GO:0072050) metanephric S-shaped body morphogenesis(GO:0072284) |
| 0.0 | 0.2 | GO:0021794 | thalamus development(GO:0021794) |
| 0.0 | 0.1 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.0 | 0.0 | GO:0046877 | regulation of saliva secretion(GO:0046877) |
| 0.0 | 0.1 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
| 0.0 | 0.1 | GO:0006983 | ER overload response(GO:0006983) |
| 0.0 | 0.2 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.0 | 0.0 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.0 | 0.0 | GO:0070541 | response to platinum ion(GO:0070541) |
| 0.0 | 0.1 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
| 0.0 | 0.1 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.0 | 0.1 | GO:0071816 | tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.0 | 0.1 | GO:0060332 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
| 0.0 | 0.1 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
| 0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 | 0.0 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
| 0.0 | 0.3 | GO:0050908 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.0 | 0.0 | GO:0044028 | DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
| 0.0 | 0.1 | GO:0006560 | proline metabolic process(GO:0006560) |
| 0.0 | 0.0 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.0 | 0.1 | GO:0030517 | negative regulation of axon extension(GO:0030517) |
| 0.0 | 0.0 | GO:0033687 | osteoblast proliferation(GO:0033687) |
| 0.0 | 0.1 | GO:2001300 | lipoxin metabolic process(GO:2001300) |
| 0.0 | 0.3 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.0 | 0.0 | GO:0090260 | filtration diaphragm assembly(GO:0036058) slit diaphragm assembly(GO:0036060) negative regulation of retinal ganglion cell axon guidance(GO:0090260) |
| 0.0 | 0.1 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.0 | 0.0 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
| 0.0 | 0.1 | GO:0030157 | pancreatic juice secretion(GO:0030157) |
| 0.0 | 0.1 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.0 | 0.0 | GO:0035404 | histone-serine phosphorylation(GO:0035404) |
| 0.0 | 0.0 | GO:0003402 | planar cell polarity pathway involved in axis elongation(GO:0003402) |
| 0.0 | 0.0 | GO:0035745 | CD4-positive, alpha-beta T cell cytokine production(GO:0035743) T-helper 2 cell cytokine production(GO:0035745) |
| 0.0 | 0.0 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) |
| 0.0 | 0.2 | GO:0006449 | regulation of translational termination(GO:0006449) |
| 0.0 | 0.1 | GO:0016129 | phytosteroid metabolic process(GO:0016128) phytosteroid biosynthetic process(GO:0016129) |
| 0.0 | 0.1 | GO:0050951 | sensory perception of temperature stimulus(GO:0050951) |
| 0.0 | 0.0 | GO:0000354 | cis assembly of pre-catalytic spliceosome(GO:0000354) |
| 0.0 | 0.0 | GO:0007623 | circadian rhythm(GO:0007623) |
| 0.0 | 0.0 | GO:1902065 | response to L-glutamate(GO:1902065) |
| 0.0 | 0.1 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
| 0.0 | 0.0 | GO:0032808 | lacrimal gland development(GO:0032808) |
| 0.0 | 0.0 | GO:0090035 | regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
| 0.0 | 0.1 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
| 0.0 | 0.0 | GO:0048073 | regulation of eye pigmentation(GO:0048073) |
| 0.0 | 0.1 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
| 0.0 | 0.0 | GO:0061760 | antifungal innate immune response(GO:0061760) |
| 0.0 | 0.0 | GO:0045342 | MHC class II biosynthetic process(GO:0045342) regulation of MHC class II biosynthetic process(GO:0045346) |
| 0.0 | 0.1 | GO:0001696 | gastric acid secretion(GO:0001696) |
| 0.0 | 0.0 | GO:0033087 | negative regulation of immature T cell proliferation(GO:0033087) |
| 0.0 | 0.1 | GO:0090625 | mRNA cleavage involved in gene silencing by siRNA(GO:0090625) |
| 0.0 | 0.1 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.0 | 0.1 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.0 | 0.1 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.0 | 0.0 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
| 0.0 | 0.1 | GO:0044245 | polysaccharide digestion(GO:0044245) |
| 0.0 | 0.0 | GO:1901876 | regulation of calcium ion binding(GO:1901876) negative regulation of calcium ion binding(GO:1901877) |
| 0.0 | 0.0 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
| 0.0 | 0.0 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.0 | 0.1 | GO:0030299 | intestinal cholesterol absorption(GO:0030299) intestinal lipid absorption(GO:0098856) |
| 0.0 | 0.1 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.0 | 0.1 | GO:0002021 | response to dietary excess(GO:0002021) |
| 0.0 | 0.1 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.0 | 0.0 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.0 | 0.2 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.0 | 0.0 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.0 | 0.0 | GO:0097195 | pilomotor reflex(GO:0097195) |
| 0.0 | 0.0 | GO:1990180 | mitochondrial tRNA 3'-end processing(GO:1990180) |
| 0.0 | 0.1 | GO:0042048 | olfactory behavior(GO:0042048) |
| 0.0 | 0.1 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.0 | 0.3 | GO:1901685 | glutathione derivative metabolic process(GO:1901685) glutathione derivative biosynthetic process(GO:1901687) |
| 0.0 | 0.0 | GO:2001015 | negative regulation of skeletal muscle cell differentiation(GO:2001015) |
| 0.0 | 0.0 | GO:0033182 | regulation of histone ubiquitination(GO:0033182) |
| 0.0 | 0.0 | GO:0034378 | chylomicron assembly(GO:0034378) |
| 0.0 | 0.0 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.0 | 0.0 | GO:0006428 | isoleucyl-tRNA aminoacylation(GO:0006428) |
| 0.0 | 0.0 | GO:0045356 | positive regulation of interferon-alpha biosynthetic process(GO:0045356) |
| 0.0 | 0.1 | GO:0019388 | galactose catabolic process(GO:0019388) |
| 0.0 | 0.1 | GO:0042148 | strand invasion(GO:0042148) |
| 0.0 | 0.1 | GO:0003341 | cilium movement(GO:0003341) |
| 0.0 | 0.1 | GO:0000066 | mitochondrial ornithine transport(GO:0000066) ornithine transport(GO:0015822) |
| 0.0 | 0.0 | GO:2001183 | negative regulation of interleukin-12 secretion(GO:2001183) |
| 0.0 | 0.1 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
| 0.0 | 0.0 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
| 0.0 | 0.0 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
| 0.0 | 0.1 | GO:0071830 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 0.0 | 0.0 | GO:0007343 | egg activation(GO:0007343) |
| 0.0 | 0.5 | GO:0045540 | regulation of cholesterol biosynthetic process(GO:0045540) |
| 0.0 | 0.0 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.0 | 0.0 | GO:0007135 | meiosis II(GO:0007135) meiotic sister chromatid segregation(GO:0045144) |
| 0.0 | 0.0 | GO:0060999 | regulation of dendritic spine development(GO:0060998) positive regulation of dendritic spine development(GO:0060999) |
| 0.0 | 0.0 | GO:0032887 | regulation of spindle elongation(GO:0032887) regulation of mitotic spindle elongation(GO:0032888) anastral spindle assembly(GO:0055048) protein localization to spindle pole body(GO:0071988) regulation of protein localization to spindle pole body(GO:1902363) positive regulation of protein localization to spindle pole body(GO:1902365) positive regulation of mitotic spindle elongation(GO:1902846) |
| 0.0 | 0.1 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.5 | GO:0030849 | autosome(GO:0030849) |
| 0.1 | 0.9 | GO:1990584 | cardiac Troponin complex(GO:1990584) |
| 0.1 | 0.4 | GO:0044753 | amphisome(GO:0044753) |
| 0.1 | 0.5 | GO:0034669 | integrin alpha4-beta7 complex(GO:0034669) |
| 0.1 | 2.3 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.1 | 1.9 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.1 | 1.1 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 0.1 | 0.1 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.1 | 0.5 | GO:0098536 | deuterosome(GO:0098536) |
| 0.1 | 0.4 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 0.1 | 0.9 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.1 | 0.4 | GO:0001652 | granular component(GO:0001652) |
| 0.1 | 0.2 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.1 | 0.2 | GO:0036387 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
| 0.1 | 0.1 | GO:0033150 | cytoskeletal calyx(GO:0033150) |
| 0.1 | 0.2 | GO:0020003 | symbiont-containing vacuole(GO:0020003) symbiont-containing vacuole membrane(GO:0020005) |
| 0.1 | 1.3 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.1 | 3.6 | GO:0001533 | cornified envelope(GO:0001533) |
| 0.1 | 0.4 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 0.1 | 0.2 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.1 | 0.2 | GO:0032302 | MutSbeta complex(GO:0032302) |
| 0.1 | 0.2 | GO:0001534 | radial spoke(GO:0001534) |
| 0.1 | 0.7 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.0 | 0.1 | GO:0097232 | lamellar body membrane(GO:0097232) alveolar lamellar body membrane(GO:0097233) |
| 0.0 | 0.0 | GO:0097134 | cyclin E1-CDK2 complex(GO:0097134) |
| 0.0 | 0.1 | GO:0043159 | acrosomal matrix(GO:0043159) |
| 0.0 | 0.1 | GO:1990876 | cytoplasmic side of nuclear pore(GO:1990876) |
| 0.0 | 0.2 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.0 | 0.2 | GO:0032144 | 4-aminobutyrate transaminase complex(GO:0032144) |
| 0.0 | 0.2 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.0 | 0.2 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 0.0 | 0.6 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.0 | 0.3 | GO:0033165 | interphotoreceptor matrix(GO:0033165) |
| 0.0 | 0.2 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.0 | 0.9 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.0 | 0.2 | GO:0005602 | complement component C1 complex(GO:0005602) |
| 0.0 | 0.2 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.0 | 0.1 | GO:0034657 | GID complex(GO:0034657) |
| 0.0 | 0.2 | GO:0071547 | piP-body(GO:0071547) |
| 0.0 | 0.1 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
| 0.0 | 0.2 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.0 | 0.0 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.0 | 0.1 | GO:0042022 | interleukin-12 receptor complex(GO:0042022) |
| 0.0 | 0.7 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
| 0.0 | 0.5 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.0 | 0.2 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.0 | 0.3 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.0 | 0.3 | GO:0034688 | integrin alphaM-beta2 complex(GO:0034688) |
| 0.0 | 0.5 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.0 | 0.0 | GO:1990742 | microvesicle(GO:1990742) |
| 0.0 | 0.3 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.0 | 0.1 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.0 | 0.2 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.0 | 0.1 | GO:0097444 | spine apparatus(GO:0097444) |
| 0.0 | 0.1 | GO:0030936 | collagen type XIII trimer(GO:0005600) transmembrane collagen trimer(GO:0030936) |
| 0.0 | 0.5 | GO:0033010 | paranodal junction(GO:0033010) |
| 0.0 | 0.1 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
| 0.0 | 0.3 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.0 | 0.1 | GO:0098592 | cytoplasmic side of apical plasma membrane(GO:0098592) |
| 0.0 | 0.5 | GO:0042555 | MCM complex(GO:0042555) |
| 0.0 | 0.4 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.0 | 0.1 | GO:0098855 | HCN channel complex(GO:0098855) |
| 0.0 | 0.2 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.0 | 0.3 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 0.1 | GO:1990667 | PCSK9-AnxA2 complex(GO:1990667) |
| 0.0 | 0.2 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.0 | 0.5 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.0 | 0.1 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
| 0.0 | 0.1 | GO:0032798 | Swi5-Sfr1 complex(GO:0032798) |
| 0.0 | 0.2 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.0 | 0.2 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.0 | 0.2 | GO:0098575 | lumenal side of lysosomal membrane(GO:0098575) |
| 0.0 | 0.3 | GO:0000801 | central element(GO:0000801) |
| 0.0 | 0.3 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.0 | 0.1 | GO:0000308 | cytoplasmic cyclin-dependent protein kinase holoenzyme complex(GO:0000308) |
| 0.0 | 0.6 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.0 | 0.7 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.0 | 0.5 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.0 | 0.4 | GO:0031095 | platelet dense tubular network membrane(GO:0031095) |
| 0.0 | 0.1 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.0 | 0.0 | GO:0044308 | axonal spine(GO:0044308) |
| 0.0 | 0.2 | GO:0097013 | phagocytic vesicle lumen(GO:0097013) |
| 0.0 | 0.3 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.0 | 0.0 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
| 0.0 | 0.3 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.0 | 0.1 | GO:0060203 | clathrin-sculpted glutamate transport vesicle(GO:0060199) clathrin-sculpted glutamate transport vesicle membrane(GO:0060203) |
| 0.0 | 0.0 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
| 0.0 | 3.1 | GO:0034705 | potassium channel complex(GO:0034705) |
| 0.0 | 0.4 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.0 | 0.1 | GO:0097224 | sperm connecting piece(GO:0097224) |
| 0.0 | 0.8 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.0 | 0.3 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.0 | 0.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.0 | 0.5 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.1 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.0 | 0.1 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.0 | 0.5 | GO:0044298 | neuronal cell body membrane(GO:0032809) cell body membrane(GO:0044298) |
| 0.0 | 0.1 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.0 | 0.0 | GO:0033011 | perinuclear theca(GO:0033011) |
| 0.0 | 1.0 | GO:0042571 | immunoglobulin complex, circulating(GO:0042571) |
| 0.0 | 0.1 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
| 0.0 | 0.2 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
| 0.0 | 0.1 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.0 | 0.2 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.0 | 0.0 | GO:0031045 | dense core granule(GO:0031045) |
| 0.0 | 0.2 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.0 | 0.1 | GO:0071565 | nBAF complex(GO:0071565) |
| 0.0 | 0.1 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 0.0 | 0.1 | GO:0005900 | oncostatin-M receptor complex(GO:0005900) |
| 0.0 | 0.1 | GO:0036021 | endolysosome lumen(GO:0036021) |
| 0.0 | 0.1 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
| 0.0 | 0.4 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.0 | 0.1 | GO:0030891 | VCB complex(GO:0030891) |
| 0.0 | 0.6 | GO:0009925 | basal plasma membrane(GO:0009925) |
| 0.0 | 0.1 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
| 0.0 | 0.2 | GO:0034464 | BBSome(GO:0034464) |
| 0.0 | 0.0 | GO:0000939 | condensed chromosome inner kinetochore(GO:0000939) |
| 0.0 | 0.2 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
| 0.0 | 1.4 | GO:0016328 | lateral plasma membrane(GO:0016328) |
| 0.0 | 0.3 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.0 | 0.1 | GO:0031436 | BRCA1-BARD1 complex(GO:0031436) |
| 0.0 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.0 | 0.5 | GO:0097228 | sperm principal piece(GO:0097228) |
| 0.0 | 0.2 | GO:0098647 | collagen type VI trimer(GO:0005589) collagen beaded filament(GO:0098647) |
| 0.0 | 0.0 | GO:0098800 | inner mitochondrial membrane protein complex(GO:0098800) |
| 0.0 | 0.4 | GO:0043034 | costamere(GO:0043034) |
| 0.0 | 0.1 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.0 | 0.3 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.0 | 0.0 | GO:0060187 | cell pole(GO:0060187) |
| 0.0 | 0.0 | GO:0005688 | U6 snRNP(GO:0005688) |
| 0.0 | 0.1 | GO:0045272 | plasma membrane respiratory chain complex I(GO:0045272) |
| 0.0 | 0.2 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
| 0.0 | 0.1 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.0 | 0.0 | GO:0034681 | integrin alpha11-beta1 complex(GO:0034681) |
| 0.0 | 0.8 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.0 | 0.0 | GO:0044301 | climbing fiber(GO:0044301) |
| 0.0 | 0.2 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.0 | 0.1 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.0 | 1.5 | GO:0034707 | chloride channel complex(GO:0034707) |
| 0.0 | 0.1 | GO:1905202 | 3-methylcrotonyl-CoA carboxylase complex, mitochondrial(GO:0002169) methylcrotonoyl-CoA carboxylase complex(GO:1905202) |
| 0.0 | 0.1 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.0 | 0.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.0 | 0.4 | GO:0097381 | photoreceptor disc membrane(GO:0097381) |
| 0.0 | 0.2 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.0 | 0.3 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.0 | 0.3 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.0 | 0.4 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.0 | 0.1 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
| 0.0 | 0.6 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.0 | 0.0 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.0 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
| 0.0 | 0.0 | GO:0071062 | alphav-beta3 integrin-vitronectin complex(GO:0071062) |
| 0.0 | 0.1 | GO:0035370 | UBC13-UEV1A complex(GO:0035370) |
| 0.0 | 0.0 | GO:0000229 | cytoplasmic chromosome(GO:0000229) |
| 0.0 | 0.3 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.0 | 0.4 | GO:0034706 | sodium channel complex(GO:0034706) |
| 0.0 | 0.3 | GO:0097342 | ripoptosome(GO:0097342) |
| 0.0 | 0.1 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.0 | 0.1 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.0 | 0.1 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.0 | 0.1 | GO:0031415 | NatA complex(GO:0031415) |
| 0.0 | 0.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.0 | 0.2 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.0 | 0.2 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.0 | 0.1 | GO:0031905 | early endosome lumen(GO:0031905) |
| 0.0 | 0.1 | GO:0097386 | glial cell projection(GO:0097386) |
| 0.0 | 0.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.0 | 0.1 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.0 | 0.2 | GO:0071682 | endocytic vesicle lumen(GO:0071682) |
| 0.0 | 0.1 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
| 0.0 | 0.1 | GO:0030681 | multimeric ribonuclease P complex(GO:0030681) |
| 0.0 | 0.1 | GO:1902560 | GMP reductase complex(GO:1902560) |
| 0.0 | 0.1 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.0 | 1.5 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.0 | 0.2 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.0 | 0.1 | GO:0030673 | axolemma(GO:0030673) |
| 0.0 | 0.2 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.0 | 0.3 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.0 | 0.1 | GO:0017059 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
| 0.0 | 0.1 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.0 | 0.1 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.0 | 0.0 | GO:0000438 | core TFIIH complex portion of holo TFIIH complex(GO:0000438) |
| 0.0 | 0.0 | GO:0034680 | integrin alpha10-beta1 complex(GO:0034680) |
| 0.0 | 0.1 | GO:0005638 | lamin filament(GO:0005638) |
| 0.0 | 0.6 | GO:0060170 | ciliary membrane(GO:0060170) |
| 0.0 | 0.1 | GO:0097227 | sperm annulus(GO:0097227) |
| 0.0 | 0.1 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.0 | 0.2 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
| 0.0 | 0.3 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.0 | 0.0 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.0 | 0.0 | GO:0019031 | viral envelope(GO:0019031) viral membrane(GO:0036338) |
| 0.0 | 0.0 | GO:0070821 | tertiary granule membrane(GO:0070821) |
| 0.0 | 0.1 | GO:0043196 | varicosity(GO:0043196) |
| 0.0 | 0.0 | GO:0000306 | extrinsic component of vacuolar membrane(GO:0000306) extrinsic component of endosome membrane(GO:0031313) |
| 0.0 | 0.3 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.0 | 0.0 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.0 | 0.0 | GO:0032009 | early phagosome(GO:0032009) |
| 0.0 | 0.4 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.0 | 0.0 | GO:0002139 | stereocilia coupling link(GO:0002139) |
| 0.0 | 0.1 | GO:0008328 | ionotropic glutamate receptor complex(GO:0008328) neurotransmitter receptor complex(GO:0098878) |
| 0.0 | 0.0 | GO:0000126 | transcription factor TFIIIB complex(GO:0000126) |
| 0.0 | 0.9 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
| 0.0 | 0.1 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
| 0.0 | 0.3 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.0 | 1.6 | GO:0042175 | nuclear outer membrane-endoplasmic reticulum membrane network(GO:0042175) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.2 | GO:0015361 | low-affinity sodium:dicarboxylate symporter activity(GO:0015361) |
| 0.3 | 1.0 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 0.2 | 1.7 | GO:0060072 | large conductance calcium-activated potassium channel activity(GO:0060072) |
| 0.2 | 0.8 | GO:0008513 | secondary active organic cation transmembrane transporter activity(GO:0008513) |
| 0.1 | 0.3 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
| 0.1 | 0.4 | GO:0015229 | L-ascorbate:sodium symporter activity(GO:0008520) L-ascorbic acid transporter activity(GO:0015229) sodium-dependent L-ascorbate transmembrane transporter activity(GO:0070890) |
| 0.1 | 0.4 | GO:0052810 | 1-phosphatidylinositol-5-kinase activity(GO:0052810) |
| 0.1 | 0.5 | GO:0004657 | proline dehydrogenase activity(GO:0004657) |
| 0.1 | 0.5 | GO:0004998 | transferrin receptor activity(GO:0004998) |
| 0.1 | 0.4 | GO:0047389 | glycerophosphocholine phosphodiesterase activity(GO:0047389) |
| 0.1 | 1.3 | GO:0031013 | troponin I binding(GO:0031013) |
| 0.1 | 0.1 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
| 0.1 | 0.3 | GO:0052726 | inositol tetrakisphosphate 1-kinase activity(GO:0047325) inositol-1,3,4-trisphosphate 6-kinase activity(GO:0052725) inositol-1,3,4-trisphosphate 5-kinase activity(GO:0052726) inositol-1,3,4,5,6-pentakisphosphate 1-phosphatase activity(GO:0052825) inositol-1,3,4,6-tetrakisphosphate 6-phosphatase activity(GO:0052830) inositol-1,3,4,6-tetrakisphosphate 1-phosphatase activity(GO:0052831) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) |
| 0.1 | 0.3 | GO:0061599 | molybdopterin adenylyltransferase activity(GO:0061598) molybdopterin molybdotransferase activity(GO:0061599) |
| 0.1 | 0.6 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.1 | 1.0 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
| 0.1 | 0.1 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.1 | 0.6 | GO:0044736 | acid-sensing ion channel activity(GO:0044736) |
| 0.1 | 0.3 | GO:0004958 | prostaglandin F receptor activity(GO:0004958) |
| 0.1 | 1.7 | GO:0008320 | protein transmembrane transporter activity(GO:0008320) |
| 0.1 | 0.9 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.1 | 0.3 | GO:0086020 | gap junction channel activity involved in SA node cell-atrial cardiac muscle cell electrical coupling(GO:0086020) |
| 0.1 | 0.3 | GO:0070283 | lipoate synthase activity(GO:0016992) radical SAM enzyme activity(GO:0070283) |
| 0.1 | 0.5 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.1 | 0.2 | GO:0004119 | cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) |
| 0.1 | 0.4 | GO:0047374 | methylumbelliferyl-acetate deacetylase activity(GO:0047374) |
| 0.1 | 0.4 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 0.1 | 0.1 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.1 | 0.2 | GO:0008798 | beta-aspartyl-peptidase activity(GO:0008798) |
| 0.1 | 0.4 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
| 0.1 | 0.2 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.1 | 0.8 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.1 | 0.3 | GO:1902444 | riboflavin binding(GO:1902444) |
| 0.1 | 0.3 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
| 0.1 | 1.3 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.1 | 0.5 | GO:0008865 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.1 | 0.4 | GO:0042610 | CD8 receptor binding(GO:0042610) |
| 0.1 | 0.7 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.1 | 0.5 | GO:0047894 | flavonol 3-sulfotransferase activity(GO:0047894) |
| 0.1 | 0.4 | GO:0035473 | lipase binding(GO:0035473) |
| 0.1 | 0.3 | GO:0047820 | D-glutamate cyclase activity(GO:0047820) |
| 0.1 | 1.4 | GO:0070330 | aromatase activity(GO:0070330) |
| 0.1 | 0.2 | GO:1902122 | chenodeoxycholic acid binding(GO:1902122) |
| 0.1 | 0.4 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
| 0.1 | 0.4 | GO:0008241 | peptidyl-dipeptidase activity(GO:0008241) |
| 0.1 | 0.1 | GO:0005333 | norepinephrine transmembrane transporter activity(GO:0005333) |
| 0.1 | 0.1 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.1 | 1.1 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.1 | 0.2 | GO:0031783 | corticotropin hormone receptor binding(GO:0031780) type 5 melanocortin receptor binding(GO:0031783) |
| 0.1 | 0.2 | GO:0035379 | carbon dioxide transmembrane transporter activity(GO:0035379) |
| 0.1 | 0.5 | GO:0050694 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.1 | 0.2 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 0.1 | 0.2 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
| 0.1 | 0.5 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.1 | 0.3 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 0.1 | 1.0 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.1 | 0.1 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.1 | 0.5 | GO:0004321 | fatty-acyl-CoA synthase activity(GO:0004321) |
| 0.1 | 0.2 | GO:0000406 | heteroduplex DNA loop binding(GO:0000404) double-strand/single-strand DNA junction binding(GO:0000406) dinucleotide repeat insertion binding(GO:0032181) |
| 0.1 | 0.2 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 0.1 | 0.8 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.1 | 0.3 | GO:0047685 | amine sulfotransferase activity(GO:0047685) |
| 0.1 | 0.2 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.1 | 1.7 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.1 | 0.2 | GO:0070052 | collagen V binding(GO:0070052) |
| 0.1 | 0.1 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.1 | 0.2 | GO:0047783 | steroid 11-beta-monooxygenase activity(GO:0004507) corticosterone 18-monooxygenase activity(GO:0047783) |
| 0.0 | 0.2 | GO:0001855 | complement component C4b binding(GO:0001855) |
| 0.0 | 0.4 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.0 | 0.1 | GO:0005136 | interleukin-4 receptor binding(GO:0005136) |
| 0.0 | 0.1 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.0 | 0.2 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
| 0.0 | 0.3 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.0 | 0.1 | GO:0042903 | tubulin deacetylase activity(GO:0042903) |
| 0.0 | 0.3 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.0 | 0.2 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
| 0.0 | 0.6 | GO:0019215 | intermediate filament binding(GO:0019215) |
| 0.0 | 0.1 | GO:0047322 | [hydroxymethylglutaryl-CoA reductase (NADPH)] kinase activity(GO:0047322) [acetyl-CoA carboxylase] kinase activity(GO:0050405) |
| 0.0 | 0.2 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.0 | 0.2 | GO:0051916 | granulocyte colony-stimulating factor binding(GO:0051916) |
| 0.0 | 0.3 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
| 0.0 | 0.1 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
| 0.0 | 0.3 | GO:0070735 | protein-glycine ligase activity(GO:0070735) |
| 0.0 | 0.8 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.0 | 0.2 | GO:0003867 | 4-aminobutyrate transaminase activity(GO:0003867) succinate-semialdehyde dehydrogenase binding(GO:0032145) (S)-3-amino-2-methylpropionate transaminase activity(GO:0047298) |
| 0.0 | 0.1 | GO:0004960 | thromboxane receptor activity(GO:0004960) thromboxane A2 receptor activity(GO:0004961) |
| 0.0 | 0.4 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.0 | 0.3 | GO:0004873 | asialoglycoprotein receptor activity(GO:0004873) |
| 0.0 | 0.1 | GO:0008386 | cholesterol monooxygenase (side-chain-cleaving) activity(GO:0008386) |
| 0.0 | 1.1 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
| 0.0 | 0.1 | GO:0005171 | hepatocyte growth factor receptor binding(GO:0005171) |
| 0.0 | 0.4 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
| 0.0 | 0.2 | GO:0022850 | serotonin-gated cation channel activity(GO:0022850) |
| 0.0 | 0.2 | GO:0015307 | drug:proton antiporter activity(GO:0015307) |
| 0.0 | 0.1 | GO:0031403 | pyridoxal kinase activity(GO:0008478) lithium ion binding(GO:0031403) |
| 0.0 | 0.1 | GO:0050613 | delta14-sterol reductase activity(GO:0050613) |
| 0.0 | 0.2 | GO:0000285 | 1-phosphatidylinositol-3-phosphate 5-kinase activity(GO:0000285) |
| 0.0 | 0.4 | GO:0001851 | complement component C3b binding(GO:0001851) |
| 0.0 | 0.1 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.0 | 0.8 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.0 | 0.8 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.0 | 0.1 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 0.0 | 0.1 | GO:0016517 | interleukin-12 receptor activity(GO:0016517) |
| 0.0 | 0.1 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.0 | 0.1 | GO:0031716 | calcitonin receptor binding(GO:0031716) |
| 0.0 | 0.1 | GO:0019959 | interleukin-8 binding(GO:0019959) |
| 0.0 | 0.1 | GO:0050659 | N-acetylgalactosamine 4-sulfate 6-O-sulfotransferase activity(GO:0050659) |
| 0.0 | 0.2 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
| 0.0 | 0.1 | GO:0004040 | amidase activity(GO:0004040) |
| 0.0 | 0.1 | GO:0036487 | nitric-oxide synthase inhibitor activity(GO:0036487) |
| 0.0 | 0.2 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.0 | 0.2 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.0 | 0.2 | GO:0052740 | 1-acyl-2-lysophosphatidylserine acylhydrolase activity(GO:0052740) |
| 0.0 | 0.3 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.0 | 0.4 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
| 0.0 | 0.1 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.0 | 0.1 | GO:0004878 | complement component C5a receptor activity(GO:0004878) |
| 0.0 | 0.1 | GO:0004917 | interleukin-7 receptor activity(GO:0004917) |
| 0.0 | 0.3 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.0 | 0.1 | GO:0008336 | gamma-butyrobetaine dioxygenase activity(GO:0008336) |
| 0.0 | 0.1 | GO:0016731 | ferredoxin-NADP+ reductase activity(GO:0004324) NADPH-adrenodoxin reductase activity(GO:0015039) oxidoreductase activity, acting on iron-sulfur proteins as donors(GO:0016730) oxidoreductase activity, acting on iron-sulfur proteins as donors, NAD or NADP as acceptor(GO:0016731) |
| 0.0 | 0.6 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.0 | 0.1 | GO:0071253 | connexin binding(GO:0071253) |
| 0.0 | 1.4 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.0 | 0.1 | GO:0051380 | beta-adrenergic receptor activity(GO:0004939) norepinephrine binding(GO:0051380) |
| 0.0 | 0.1 | GO:0032090 | Pyrin domain binding(GO:0032090) |
| 0.0 | 0.4 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.0 | 0.1 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
| 0.0 | 0.2 | GO:0005113 | patched binding(GO:0005113) |
| 0.0 | 0.1 | GO:0015389 | pyrimidine- and adenine-specific:sodium symporter activity(GO:0015389) |
| 0.0 | 0.1 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
| 0.0 | 0.0 | GO:0019829 | cation-transporting ATPase activity(GO:0019829) |
| 0.0 | 0.3 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.0 | 0.1 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.0 | 0.1 | GO:0052871 | tocopherol omega-hydroxylase activity(GO:0052870) alpha-tocopherol omega-hydroxylase activity(GO:0052871) 20-hydroxy-leukotriene B4 omega oxidase activity(GO:0097258) 20-aldehyde-leukotriene B4 20-monooxygenase activity(GO:0097259) |
| 0.0 | 0.2 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
| 0.0 | 0.1 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.0 | 0.1 | GO:0045145 | single-stranded DNA 5'-3' exodeoxyribonuclease activity(GO:0045145) |
| 0.0 | 0.1 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
| 0.0 | 0.1 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.0 | 0.2 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.0 | 0.2 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.0 | 0.1 | GO:0099609 | microtubule lateral binding(GO:0099609) |
| 0.0 | 0.1 | GO:0098782 | mechanically-gated potassium channel activity(GO:0098782) |
| 0.0 | 1.1 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.0 | 0.2 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.0 | 0.1 | GO:0000701 | purine-specific mismatch base pair DNA N-glycosylase activity(GO:0000701) MutLbeta complex binding(GO:0032406) MutSbeta complex binding(GO:0032408) |
| 0.0 | 0.2 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.0 | 0.2 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
| 0.0 | 0.1 | GO:0016428 | tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
| 0.0 | 0.1 | GO:0016534 | cyclin-dependent protein kinase 5 activator activity(GO:0016534) |
| 0.0 | 0.0 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
| 0.0 | 0.3 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
| 0.0 | 0.1 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.0 | 0.4 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
| 0.0 | 0.3 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
| 0.0 | 0.1 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.0 | 0.4 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 0.0 | 0.2 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.0 | 0.5 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.0 | 0.4 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.0 | 0.1 | GO:0004925 | prolactin receptor activity(GO:0004925) |
| 0.0 | 0.3 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.0 | 0.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.0 | 0.3 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.0 | 0.3 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.0 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.0 | 0.2 | GO:0004118 | cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) |
| 0.0 | 0.1 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.0 | 0.1 | GO:0008941 | nitric oxide dioxygenase activity(GO:0008941) oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of two atoms of oxygen into one donor(GO:0016708) iron-cytochrome-c reductase activity(GO:0047726) |
| 0.0 | 0.1 | GO:0031728 | CCR3 chemokine receptor binding(GO:0031728) |
| 0.0 | 0.1 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.0 | 0.1 | GO:0005026 | transforming growth factor beta receptor activity, type II(GO:0005026) |
| 0.0 | 0.1 | GO:0004057 | arginyltransferase activity(GO:0004057) |
| 0.0 | 0.1 | GO:0052794 | exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
| 0.0 | 0.2 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.0 | 0.1 | GO:0010348 | lithium:proton antiporter activity(GO:0010348) |
| 0.0 | 0.1 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
| 0.0 | 0.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.0 | 0.1 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 0.0 | 0.1 | GO:0016639 | oxidoreductase activity, acting on the CH-NH2 group of donors, NAD or NADP as acceptor(GO:0016639) |
| 0.0 | 0.5 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.0 | 0.7 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
| 0.0 | 1.8 | GO:0042805 | actinin binding(GO:0042805) |
| 0.0 | 0.6 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 0.0 | 0.1 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.0 | 0.1 | GO:0003720 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
| 0.0 | 0.2 | GO:0016167 | glial cell-derived neurotrophic factor receptor activity(GO:0016167) |
| 0.0 | 0.2 | GO:0019863 | IgE binding(GO:0019863) |
| 0.0 | 0.2 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.0 | 0.1 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.0 | 0.2 | GO:0004996 | thyroid-stimulating hormone receptor activity(GO:0004996) |
| 0.0 | 0.1 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
| 0.0 | 0.1 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.0 | 0.7 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.0 | 0.0 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
| 0.0 | 0.1 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.0 | 0.0 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
| 0.0 | 0.3 | GO:0019864 | IgG binding(GO:0019864) |
| 0.0 | 0.1 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 0.0 | 0.1 | GO:0005119 | smoothened binding(GO:0005119) |
| 0.0 | 0.1 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.0 | 0.2 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.0 | 0.1 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.0 | 0.2 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.0 | 0.0 | GO:0070699 | type II activin receptor binding(GO:0070699) |
| 0.0 | 0.1 | GO:0004815 | aspartate-tRNA ligase activity(GO:0004815) |
| 0.0 | 0.2 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.0 | 0.2 | GO:0050542 | icosanoid binding(GO:0050542) fatty acid derivative binding(GO:1901567) |
| 0.0 | 0.0 | GO:0004536 | deoxyribonuclease activity(GO:0004536) |
| 0.0 | 0.1 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
| 0.0 | 0.1 | GO:0051022 | GDP-dissociation inhibitor binding(GO:0051021) Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.0 | 0.3 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.0 | 0.1 | GO:0004530 | deoxyribonuclease I activity(GO:0004530) |
| 0.0 | 0.1 | GO:0031177 | S-acetyltransferase activity(GO:0016418) phosphopantetheine binding(GO:0031177) |
| 0.0 | 0.1 | GO:0008410 | CoA-transferase activity(GO:0008410) |
| 0.0 | 0.2 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.0 | 0.1 | GO:0003896 | DNA primase activity(GO:0003896) |
| 0.0 | 0.1 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
| 0.0 | 0.1 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.0 | 0.2 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 0.0 | 0.4 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.0 | 0.3 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.0 | 0.2 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.0 | 0.1 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.0 | 2.2 | GO:0015078 | hydrogen ion transmembrane transporter activity(GO:0015078) |
| 0.0 | 0.0 | GO:0004464 | leukotriene-C4 synthase activity(GO:0004464) |
| 0.0 | 0.1 | GO:1990404 | protein ADP-ribosylase activity(GO:1990404) |
| 0.0 | 0.3 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.0 | 0.7 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.0 | 0.1 | GO:0042799 | histone methyltransferase activity (H4-K20 specific)(GO:0042799) |
| 0.0 | 0.9 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.0 | 0.1 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
| 0.0 | 0.2 | GO:0032396 | inhibitory MHC class I receptor activity(GO:0032396) |
| 0.0 | 0.1 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
| 0.0 | 0.2 | GO:0048039 | ubiquinone binding(GO:0048039) |
| 0.0 | 0.1 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.0 | 0.3 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.0 | 0.1 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.0 | 0.3 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.0 | 0.5 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.0 | 0.1 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.0 | 0.1 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
| 0.0 | 0.5 | GO:0008527 | taste receptor activity(GO:0008527) |
| 0.0 | 0.1 | GO:0004522 | ribonuclease A activity(GO:0004522) |
| 0.0 | 0.1 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.0 | 0.1 | GO:0004982 | N-formyl peptide receptor activity(GO:0004982) |
| 0.0 | 0.3 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.0 | 0.1 | GO:0033857 | diphosphoinositol-pentakisphosphate kinase activity(GO:0033857) |
| 0.0 | 0.1 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.0 | 0.0 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
| 0.0 | 0.3 | GO:0019841 | retinol binding(GO:0019841) |
| 0.0 | 0.1 | GO:0017082 | mineralocorticoid receptor activity(GO:0017082) |
| 0.0 | 0.6 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 0.0 | 0.3 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.0 | 0.1 | GO:0051120 | hepoxilin A3 synthase activity(GO:0051120) |
| 0.0 | 0.2 | GO:0086083 | cell adhesive protein binding involved in bundle of His cell-Purkinje myocyte communication(GO:0086083) |
| 0.0 | 0.1 | GO:0016422 | mRNA (2'-O-methyladenosine-N6-)-methyltransferase activity(GO:0016422) |
| 0.0 | 0.1 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
| 0.0 | 0.1 | GO:0008534 | oxidized purine nucleobase lesion DNA N-glycosylase activity(GO:0008534) |
| 0.0 | 0.1 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.0 | 0.0 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.0 | 0.0 | GO:0034185 | apolipoprotein binding(GO:0034185) |
| 0.0 | 0.1 | GO:0016454 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
| 0.0 | 0.3 | GO:0015217 | ATP transmembrane transporter activity(GO:0005347) ADP transmembrane transporter activity(GO:0015217) |
| 0.0 | 0.1 | GO:0001181 | transcription factor activity, core RNA polymerase I binding(GO:0001181) |
| 0.0 | 0.1 | GO:0017130 | poly(C) RNA binding(GO:0017130) |
| 0.0 | 0.6 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
| 0.0 | 0.1 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.0 | 0.1 | GO:0099580 | ion antiporter activity involved in regulation of postsynaptic membrane potential(GO:0099580) |
| 0.0 | 0.1 | GO:0004356 | glutamate-ammonia ligase activity(GO:0004356) ammonia ligase activity(GO:0016211) acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.0 | 1.0 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.0 | 0.6 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.0 | 0.0 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.0 | 0.1 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) acyl-CoA desaturase activity(GO:0016215) |
| 0.0 | 0.1 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
| 0.0 | 0.9 | GO:0030507 | spectrin binding(GO:0030507) |
| 0.0 | 0.0 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
| 0.0 | 0.2 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.0 | 0.6 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
| 0.0 | 0.1 | GO:0043559 | insulin binding(GO:0043559) |
| 0.0 | 0.1 | GO:0046997 | oxidoreductase activity, acting on the CH-NH group of donors, flavin as acceptor(GO:0046997) |
| 0.0 | 0.1 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
| 0.0 | 0.1 | GO:0004105 | choline-phosphate cytidylyltransferase activity(GO:0004105) |
| 0.0 | 0.1 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 0.0 | 0.0 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.0 | 0.1 | GO:0003943 | N-acetylgalactosamine-4-sulfatase activity(GO:0003943) |
| 0.0 | 0.1 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
| 0.0 | 0.1 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.0 | 0.9 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.0 | 0.1 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.0 | 0.1 | GO:0016435 | rRNA (guanine) methyltransferase activity(GO:0016435) |
| 0.0 | 0.1 | GO:0003947 | (N-acetylneuraminyl)-galactosylglucosylceramide N-acetylgalactosaminyltransferase activity(GO:0003947) |
| 0.0 | 0.1 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
| 0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.0 | 0.1 | GO:0060175 | brain-derived neurotrophic factor-activated receptor activity(GO:0060175) |
| 0.0 | 0.0 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.0 | 0.0 | GO:0019865 | immunoglobulin binding(GO:0019865) |
| 0.0 | 0.4 | GO:0022829 | wide pore channel activity(GO:0022829) |
| 0.0 | 0.9 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.0 | 0.0 | GO:0034353 | RNA pyrophosphohydrolase activity(GO:0034353) |
| 0.0 | 0.1 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
| 0.0 | 0.1 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.0 | 0.1 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.0 | 0.0 | GO:0035403 | histone kinase activity (H3-T6 specific)(GO:0035403) |
| 0.0 | 0.0 | GO:0001026 | TFIIIB-type transcription factor activity(GO:0001026) |
| 0.0 | 0.1 | GO:0004485 | methylcrotonoyl-CoA carboxylase activity(GO:0004485) |
| 0.0 | 0.0 | GO:0016495 | C-X3-C chemokine receptor activity(GO:0016495) |
| 0.0 | 0.2 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
| 0.0 | 0.3 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.0 | 0.1 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.0 | 2.3 | GO:0003823 | antigen binding(GO:0003823) |
| 0.0 | 0.1 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.0 | 0.1 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.0 | 0.1 | GO:0005221 | intracellular cyclic nucleotide activated cation channel activity(GO:0005221) cyclic nucleotide-gated ion channel activity(GO:0043855) |
| 0.0 | 0.4 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.0 | 0.4 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.0 | 0.1 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.0 | 0.1 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.0 | 0.7 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.0 | 0.1 | GO:0046870 | cadmium ion binding(GO:0046870) |
| 0.0 | 0.1 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
| 0.0 | 0.0 | GO:0050528 | acyloxyacyl hydrolase activity(GO:0050528) |
| 0.0 | 0.0 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.0 | 0.0 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.0 | 0.1 | GO:0046790 | virion binding(GO:0046790) |
| 0.0 | 0.1 | GO:0052591 | sn-glycerol-3-phosphate:ubiquinone oxidoreductase activity(GO:0052590) sn-glycerol-3-phosphate:ubiquinone-8 oxidoreductase activity(GO:0052591) |
| 0.0 | 0.0 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
| 0.0 | 0.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.0 | 0.0 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
| 0.0 | 0.4 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.0 | 0.3 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.0 | 0.2 | GO:0016594 | glycine binding(GO:0016594) |
| 0.0 | 0.4 | GO:0045503 | dynein light chain binding(GO:0045503) |
| 0.0 | 0.0 | GO:0005150 | interleukin-1, Type I receptor binding(GO:0005150) |
| 0.0 | 0.0 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
| 0.0 | 0.2 | GO:0044213 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) intronic transcription regulatory region DNA binding(GO:0044213) |
| 0.0 | 0.0 | GO:0004170 | dUTP diphosphatase activity(GO:0004170) |
| 0.0 | 0.1 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.0 | 0.0 | GO:0005330 | dopamine:sodium symporter activity(GO:0005330) |
| 0.0 | 0.0 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.0 | 0.1 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.0 | 0.0 | GO:0015131 | thiosulfate transmembrane transporter activity(GO:0015117) oxaloacetate transmembrane transporter activity(GO:0015131) |
| 0.0 | 0.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.0 | 0.1 | GO:0019862 | IgA binding(GO:0019862) |
| 0.0 | 0.3 | GO:0071949 | FAD binding(GO:0071949) |
| 0.0 | 0.0 | GO:0038025 | reelin receptor activity(GO:0038025) |
| 0.0 | 0.1 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.0 | 0.1 | GO:0004910 | interleukin-1, Type II, blocking receptor activity(GO:0004910) |
| 0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.0 | 0.2 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.0 | 0.0 | GO:0048365 | Rac GTPase binding(GO:0048365) |
| 0.0 | 0.1 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.0 | 0.1 | GO:0016657 | GMP reductase activity(GO:0003920) oxidoreductase activity, acting on NAD(P)H, nitrogenous group as acceptor(GO:0016657) |
| 0.0 | 0.1 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 0.0 | 0.0 | GO:0033858 | N-acetylgalactosamine kinase activity(GO:0033858) |
| 0.0 | 0.1 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
| 0.0 | 0.1 | GO:0043426 | MRF binding(GO:0043426) |
| 0.0 | 0.0 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.0 | 0.0 | GO:0032093 | SAM domain binding(GO:0032093) |
| 0.0 | 0.0 | GO:0017129 | triglyceride binding(GO:0017129) |
| 0.0 | 0.1 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.0 | 0.3 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
| 0.0 | 0.2 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
| 0.0 | 0.0 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
| 0.0 | 0.3 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.0 | 0.0 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
| 0.0 | 0.0 | GO:0050254 | rhodopsin kinase activity(GO:0050254) |
| 0.0 | 0.0 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
| 0.0 | 0.0 | GO:0004362 | glutathione-disulfide reductase activity(GO:0004362) |
| 0.0 | 0.1 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
| 0.0 | 0.0 | GO:0030366 | molybdopterin synthase activity(GO:0030366) |
| 0.0 | 0.1 | GO:0050682 | AF-2 domain binding(GO:0050682) |
| 0.0 | 0.1 | GO:0039552 | RIG-I binding(GO:0039552) |
| 0.0 | 0.3 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.0 | 0.0 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.0 | 0.3 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.0 | 0.3 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.0 | 0.1 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
| 0.0 | 0.0 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
| 0.0 | 0.0 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.0 | 0.1 | GO:0004991 | parathyroid hormone receptor activity(GO:0004991) |
| 0.0 | 0.1 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.0 | 0.1 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
| 0.0 | 0.1 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
| 0.0 | 0.1 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.1 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
| 0.0 | 0.0 | GO:0004822 | isoleucine-tRNA ligase activity(GO:0004822) |
| 0.0 | 0.2 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.0 | 0.3 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.0 | 0.1 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.0 | 0.1 | GO:0005497 | androgen binding(GO:0005497) |
| 0.0 | 0.0 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.0 | 0.0 | GO:0043139 | 5'-3' DNA helicase activity(GO:0043139) |
| 0.0 | 0.3 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.0 | 0.0 | GO:0008413 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) 8-oxo-7,8-dihydrodeoxyguanosine triphosphate pyrophosphatase activity(GO:0035539) |
| 0.0 | 0.1 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 0.0 | 0.1 | GO:0008408 | 3'-5' exonuclease activity(GO:0008408) |
| 0.0 | 0.0 | GO:0051870 | methotrexate binding(GO:0051870) folic acid receptor activity(GO:0061714) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 1.6 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.0 | 0.4 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.0 | 0.0 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.0 | 0.3 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.0 | 0.0 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.0 | 0.8 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.0 | 0.1 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
| 0.0 | 0.1 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
| 0.0 | 0.1 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.0 | 0.9 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
| 0.0 | 1.7 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.0 | 0.1 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.0 | 0.9 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.0 | 0.0 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.0 | 0.1 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.0 | 0.1 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.0 | 0.3 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.0 | 0.4 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.0 | 0.4 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.0 | 0.1 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.0 | 0.0 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.0 | 0.5 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.0 | 0.4 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.0 | 0.1 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.0 | 0.5 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.0 | 0.1 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
| 0.0 | 0.1 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.0 | 0.7 | PID BMP PATHWAY | BMP receptor signaling |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 1.6 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.1 | 2.1 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.1 | 0.2 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.1 | 2.3 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
| 0.1 | 1.2 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.1 | 0.3 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
| 0.0 | 0.5 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.0 | 0.5 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
| 0.0 | 0.7 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
| 0.0 | 0.4 | REACTOME ACYL CHAIN REMODELLING OF PE | Genes involved in Acyl chain remodelling of PE |
| 0.0 | 0.8 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.0 | 0.8 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.0 | 1.0 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.0 | 1.3 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.0 | 0.1 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
| 0.0 | 0.6 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.0 | 0.5 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.0 | 0.7 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.0 | 1.8 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
| 0.0 | 0.8 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.0 | 0.7 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.0 | 0.6 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.0 | 0.7 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.0 | 0.1 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.0 | 0.8 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.0 | 0.4 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.0 | 0.3 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 0.0 | 0.0 | REACTOME IMMUNE SYSTEM | Genes involved in Immune System |
| 0.0 | 0.9 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.0 | 0.4 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 0.0 | 0.3 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.0 | 0.3 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.0 | 0.3 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.0 | 0.0 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.0 | 0.4 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.0 | 0.1 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
| 0.0 | 0.2 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.0 | 0.3 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.0 | 0.5 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 0.4 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
| 0.0 | 0.5 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.0 | 0.1 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.0 | 0.1 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
| 0.0 | 0.2 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 0.0 | 0.5 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.0 | 0.2 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 0.0 | 0.5 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.0 | 0.1 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.0 | 0.4 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.0 | 0.5 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.0 | 0.2 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
| 0.0 | 0.3 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.0 | 0.1 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.0 | 0.2 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.0 | 0.8 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.0 | 0.6 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.0 | 0.9 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 0.3 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.0 | 0.0 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
| 0.0 | 0.3 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.0 | 0.2 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.0 | 0.2 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.0 | 0.3 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
| 0.0 | 1.1 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.0 | 0.0 | REACTOME DNA STRAND ELONGATION | Genes involved in DNA strand elongation |