Project
Mucociliary differentiation, bronchial epithelial cells, human (Ross 2007)
Navigation
Downloads
Results for RCOR1_MTA3
Z-value: 0.88
Motif logo
Transcription factors associated with RCOR1_MTA3
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
RCOR1
|
ENSG00000089902.8 | REST corepressor 1 |
|
MTA3
|
ENSG00000057935.9 | metastasis associated 1 family member 3 |
Activity-expression correlation:
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| RCOR1 | hg19_v2_chr14_+_103058948_103059005 | -0.30 | 1.0e-01 | Click! |
| MTA3 | hg19_v2_chr2_+_42795839_42795887, hg19_v2_chr2_+_42795745_42795824, hg19_v2_chr2_+_42795651_42795676 | -0.20 | 3.0e-01 | Click! |
Activity profile of RCOR1_MTA3 motif
Sorted Z-values of RCOR1_MTA3 motif
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr6_-_33048483 | 2.07 |
ENST00000419277.1
|
HLA-DPA1
|
major histocompatibility complex, class II, DP alpha 1 |
| chr19_-_55677999 | 1.96 |
ENST00000532817.1
ENST00000527223.2 ENST00000391720.4 |
DNAAF3
|
dynein, axonemal, assembly factor 3 |
| chr1_+_111889212 | 1.95 |
ENST00000369737.4
|
PIFO
|
primary cilia formation |
| chr7_-_123174610 | 1.86 |
ENST00000324698.6
ENST00000434450.1 |
IQUB
|
IQ motif and ubiquitin domain containing |
| chr2_+_102608306 | 1.83 |
ENST00000332549.3
|
IL1R2
|
interleukin 1 receptor, type II |
| chr19_-_55677920 | 1.77 |
ENST00000524407.2
ENST00000526003.1 ENST00000534170.1 |
DNAAF3
|
dynein, axonemal, assembly factor 3 |
| chr14_-_21994525 | 1.75 |
ENST00000538754.1
|
SALL2
|
spalt-like transcription factor 2 |
| chr1_+_111888890 | 1.62 |
ENST00000369738.4
|
PIFO
|
primary cilia formation |
| chr9_-_34381511 | 1.57 |
ENST00000379124.1
|
C9orf24
|
chromosome 9 open reading frame 24 |
| chr5_+_148651409 | 1.57 |
ENST00000296721.4
|
AFAP1L1
|
actin filament associated protein 1-like 1 |
| chr19_-_55691472 | 1.55 |
ENST00000537500.1
|
SYT5
|
synaptotagmin V |
| chr10_+_35415851 | 1.54 |
ENST00000374726.3
|
CREM
|
cAMP responsive element modulator |
| chr6_+_116937636 | 1.53 |
ENST00000368581.4
ENST00000229554.5 ENST00000368580.4 |
RSPH4A
|
radial spoke head 4 homolog A (Chlamydomonas) |
| chr4_-_7044657 | 1.50 |
ENST00000310085.4
|
CCDC96
|
coiled-coil domain containing 96 |
| chr4_-_168155730 | 1.50 |
ENST00000502330.1
ENST00000357154.3 |
SPOCK3
|
sparc/osteonectin, cwcv and kazal-like domains proteoglycan (testican) 3 |
| chr19_+_55795493 | 1.49 |
ENST00000309383.1
|
BRSK1
|
BR serine/threonine kinase 1 |
| chr8_+_26371763 | 1.48 |
ENST00000521913.1
|
DPYSL2
|
dihydropyrimidinase-like 2 |
| chr9_-_34381536 | 1.47 |
ENST00000379126.3
ENST00000379127.1 ENST00000379133.3 |
C9orf24
|
chromosome 9 open reading frame 24 |
| chr4_-_16085314 | 1.47 |
ENST00000510224.1
|
PROM1
|
prominin 1 |
| chr1_-_202679535 | 1.47 |
ENST00000367268.4
|
SYT2
|
synaptotagmin II |
| chr14_+_105953246 | 1.46 |
ENST00000392531.3
|
CRIP1
|
cysteine-rich protein 1 (intestinal) |
| chr19_+_4639514 | 1.44 |
ENST00000327473.4
|
TNFAIP8L1
|
tumor necrosis factor, alpha-induced protein 8-like 1 |
| chr6_+_52285131 | 1.42 |
ENST00000433625.2
|
EFHC1
|
EF-hand domain (C-terminal) containing 1 |
| chr14_+_105953204 | 1.42 |
ENST00000409393.2
|
CRIP1
|
cysteine-rich protein 1 (intestinal) |
| chr2_+_132287237 | 1.41 |
ENST00000467992.2
|
CCDC74A
|
coiled-coil domain containing 74A |
| chr3_-_19975665 | 1.40 |
ENST00000295824.9
ENST00000389256.4 |
EFHB
|
EF-hand domain family, member B |
| chr9_-_124991124 | 1.39 |
ENST00000394319.4
ENST00000340587.3 |
LHX6
|
LIM homeobox 6 |
| chr16_+_811073 | 1.39 |
ENST00000382862.3
ENST00000563651.1 |
MSLN
|
mesothelin |
| chr4_+_74702214 | 1.38 |
ENST00000226317.5
ENST00000515050.1 |
CXCL6
|
chemokine (C-X-C motif) ligand 6 |
| chr1_+_38022572 | 1.37 |
ENST00000541606.1
|
DNALI1
|
dynein, axonemal, light intermediate chain 1 |
| chr4_-_168155700 | 1.37 |
ENST00000357545.4
ENST00000512648.1 |
SPOCK3
|
sparc/osteonectin, cwcv and kazal-like domains proteoglycan (testican) 3 |
| chr3_-_158450475 | 1.36 |
ENST00000237696.5
|
RARRES1
|
retinoic acid receptor responder (tazarotene induced) 1 |
| chr1_+_38022513 | 1.36 |
ENST00000296218.7
|
DNALI1
|
dynein, axonemal, light intermediate chain 1 |
| chr4_-_16085340 | 1.35 |
ENST00000508167.1
|
PROM1
|
prominin 1 |
| chr14_+_105952648 | 1.35 |
ENST00000330233.7
|
CRIP1
|
cysteine-rich protein 1 (intestinal) |
| chr4_-_168155417 | 1.35 |
ENST00000511269.1
ENST00000506697.1 ENST00000512042.1 |
SPOCK3
|
sparc/osteonectin, cwcv and kazal-like domains proteoglycan (testican) 3 |
| chr19_+_35630628 | 1.33 |
ENST00000588715.1
ENST00000588607.1 |
FXYD1
|
FXYD domain containing ion transport regulator 1 |
| chr4_-_168155169 | 1.33 |
ENST00000534949.1
ENST00000535728.1 |
SPOCK3
|
sparc/osteonectin, cwcv and kazal-like domains proteoglycan (testican) 3 |
| chr19_-_55691614 | 1.32 |
ENST00000592470.1
ENST00000354308.3 |
SYT5
|
synaptotagmin V |
| chr19_+_35630926 | 1.31 |
ENST00000588081.1
ENST00000589121.1 |
FXYD1
|
FXYD domain containing ion transport regulator 1 |
| chr5_-_1524015 | 1.31 |
ENST00000283415.3
|
LPCAT1
|
lysophosphatidylcholine acyltransferase 1 |
| chr3_-_195538728 | 1.30 |
ENST00000349607.4
ENST00000346145.4 |
MUC4
|
mucin 4, cell surface associated |
| chr7_-_93519471 | 1.30 |
ENST00000451238.1
|
TFPI2
|
tissue factor pathway inhibitor 2 |
| chr6_-_29595779 | 1.29 |
ENST00000355973.3
ENST00000377012.4 |
GABBR1
|
gamma-aminobutyric acid (GABA) B receptor, 1 |
| chr9_-_124976154 | 1.29 |
ENST00000482062.1
|
LHX6
|
LIM homeobox 6 |
| chr2_+_219187871 | 1.28 |
ENST00000258362.3
|
PNKD
|
paroxysmal nonkinesigenic dyskinesia |
| chr5_-_146833485 | 1.28 |
ENST00000398514.3
|
DPYSL3
|
dihydropyrimidinase-like 3 |
| chr17_+_4853442 | 1.27 |
ENST00000522301.1
|
ENO3
|
enolase 3 (beta, muscle) |
| chr2_+_219536749 | 1.27 |
ENST00000295709.3
ENST00000392106.2 ENST00000392105.3 ENST00000455724.1 |
STK36
|
serine/threonine kinase 36 |
| chr1_+_156117149 | 1.26 |
ENST00000435124.1
|
SEMA4A
|
sema domain, immunoglobulin domain (Ig), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 4A |
| chr9_+_127615733 | 1.25 |
ENST00000373574.1
|
WDR38
|
WD repeat domain 38 |
| chr5_-_96143796 | 1.25 |
ENST00000296754.3
|
ERAP1
|
endoplasmic reticulum aminopeptidase 1 |
| chr9_-_34397800 | 1.24 |
ENST00000297623.2
|
C9orf24
|
chromosome 9 open reading frame 24 |
| chr12_+_21590549 | 1.23 |
ENST00000545178.1
ENST00000240651.9 |
PYROXD1
|
pyridine nucleotide-disulphide oxidoreductase domain 1 |
| chr2_+_39893043 | 1.22 |
ENST00000281961.2
|
TMEM178A
|
transmembrane protein 178A |
| chr17_-_19281203 | 1.22 |
ENST00000487415.2
|
B9D1
|
B9 protein domain 1 |
| chr21_-_43916433 | 1.21 |
ENST00000291536.3
|
RSPH1
|
radial spoke head 1 homolog (Chlamydomonas) |
| chr22_-_22090043 | 1.20 |
ENST00000403503.1
|
YPEL1
|
yippee-like 1 (Drosophila) |
| chr3_-_50383096 | 1.20 |
ENST00000442887.1
ENST00000360165.3 |
ZMYND10
|
zinc finger, MYND-type containing 10 |
| chr3_-_195538760 | 1.20 |
ENST00000475231.1
|
MUC4
|
mucin 4, cell surface associated |
| chr9_+_72435709 | 1.19 |
ENST00000377197.3
ENST00000527647.1 |
C9orf135
|
chromosome 9 open reading frame 135 |
| chr22_-_50970506 | 1.19 |
ENST00000428989.2
ENST00000403326.1 |
ODF3B
|
outer dense fiber of sperm tails 3B |
| chr19_-_14201776 | 1.18 |
ENST00000269724.5
|
SAMD1
|
sterile alpha motif domain containing 1 |
| chr21_-_43916296 | 1.17 |
ENST00000398352.3
|
RSPH1
|
radial spoke head 1 homolog (Chlamydomonas) |
| chr5_-_79950371 | 1.17 |
ENST00000511032.1
ENST00000504396.1 ENST00000505337.1 |
DHFR
|
dihydrofolate reductase |
| chr21_-_46330545 | 1.17 |
ENST00000320216.6
ENST00000397852.1 |
ITGB2
|
integrin, beta 2 (complement component 3 receptor 3 and 4 subunit) |
| chr4_-_74864386 | 1.16 |
ENST00000296027.4
|
CXCL5
|
chemokine (C-X-C motif) ligand 5 |
| chr4_-_168155300 | 1.14 |
ENST00000541637.1
|
SPOCK3
|
sparc/osteonectin, cwcv and kazal-like domains proteoglycan (testican) 3 |
| chr2_-_130902567 | 1.14 |
ENST00000457413.1
ENST00000392984.3 ENST00000409128.1 ENST00000441670.1 ENST00000409943.3 ENST00000409234.3 ENST00000310463.6 |
CCDC74B
|
coiled-coil domain containing 74B |
| chr12_-_50298000 | 1.14 |
ENST00000550635.2
|
FAIM2
|
Fas apoptotic inhibitory molecule 2 |
| chr3_-_46506358 | 1.14 |
ENST00000417439.1
ENST00000431944.1 |
LTF
|
lactotransferrin |
| chr19_+_41620335 | 1.13 |
ENST00000331105.2
|
CYP2F1
|
cytochrome P450, family 2, subfamily F, polypeptide 1 |
| chr11_-_111944895 | 1.13 |
ENST00000431456.1
ENST00000280350.4 ENST00000530641.1 |
PIH1D2
|
PIH1 domain containing 2 |
| chr4_+_15480828 | 1.13 |
ENST00000389652.5
|
CC2D2A
|
coiled-coil and C2 domain containing 2A |
| chr3_+_133465228 | 1.12 |
ENST00000482271.1
ENST00000264998.3 |
TF
|
transferrin |
| chr11_-_108369101 | 1.12 |
ENST00000323468.5
|
KDELC2
|
KDEL (Lys-Asp-Glu-Leu) containing 2 |
| chr15_+_71145578 | 1.12 |
ENST00000544974.2
ENST00000558546.1 |
LRRC49
|
leucine rich repeat containing 49 |
| chr13_+_96204961 | 1.11 |
ENST00000299339.2
|
CLDN10
|
claudin 10 |
| chr2_-_234763147 | 1.10 |
ENST00000411486.2
ENST00000432087.1 ENST00000441687.1 ENST00000414924.1 |
HJURP
|
Holliday junction recognition protein |
| chr10_-_82116505 | 1.10 |
ENST00000372202.1
ENST00000421924.2 ENST00000453477.1 |
DYDC1
|
DPY30 domain containing 1 |
| chr2_-_111435610 | 1.10 |
ENST00000447014.1
ENST00000420328.1 ENST00000535254.1 ENST00000409311.1 ENST00000302759.6 |
BUB1
|
BUB1 mitotic checkpoint serine/threonine kinase |
| chr8_-_42065187 | 1.10 |
ENST00000270189.6
ENST00000352041.3 ENST00000220809.4 |
PLAT
|
plasminogen activator, tissue |
| chr19_+_859654 | 1.10 |
ENST00000592860.1
|
CFD
|
complement factor D (adipsin) |
| chr4_-_74964904 | 1.10 |
ENST00000508487.2
|
CXCL2
|
chemokine (C-X-C motif) ligand 2 |
| chr9_-_124990680 | 1.09 |
ENST00000541397.2
ENST00000560485.1 |
LHX6
|
LIM homeobox 6 |
| chr16_+_58283814 | 1.08 |
ENST00000443128.2
ENST00000219299.4 |
CCDC113
|
coiled-coil domain containing 113 |
| chr12_+_49297899 | 1.08 |
ENST00000552942.1
ENST00000320516.4 |
CCDC65
|
coiled-coil domain containing 65 |
| chr6_+_17393888 | 1.08 |
ENST00000493172.1
ENST00000465994.1 |
CAP2
|
CAP, adenylate cyclase-associated protein, 2 (yeast) |
| chr9_-_112970436 | 1.07 |
ENST00000400613.4
|
C9orf152
|
chromosome 9 open reading frame 152 |
| chr2_+_201390843 | 1.07 |
ENST00000357799.4
ENST00000409203.3 |
SGOL2
|
shugoshin-like 2 (S. pombe) |
| chr3_-_197676740 | 1.07 |
ENST00000452735.1
ENST00000453254.1 ENST00000455191.1 |
IQCG
|
IQ motif containing G |
| chr9_-_124989804 | 1.07 |
ENST00000373755.2
ENST00000373754.2 |
LHX6
|
LIM homeobox 6 |
| chr6_+_80714318 | 1.06 |
ENST00000369798.2
|
TTK
|
TTK protein kinase |
| chr2_+_132286754 | 1.06 |
ENST00000434330.1
|
CCDC74A
|
coiled-coil domain containing 74A |
| chr1_+_120839005 | 1.06 |
ENST00000369390.3
ENST00000452190.1 |
FAM72B
|
family with sequence similarity 72, member B |
| chr22_+_45809560 | 1.05 |
ENST00000342894.3
ENST00000538017.1 |
RIBC2
|
RIB43A domain with coiled-coils 2 |
| chr19_+_5914213 | 1.05 |
ENST00000222125.5
ENST00000452990.2 ENST00000588865.1 |
CAPS
|
calcyphosine |
| chr4_-_11430221 | 1.04 |
ENST00000514690.1
|
HS3ST1
|
heparan sulfate (glucosamine) 3-O-sulfotransferase 1 |
| chr1_+_43824577 | 1.04 |
ENST00000310955.6
|
CDC20
|
cell division cycle 20 |
| chr6_+_33048222 | 1.03 |
ENST00000428835.1
|
HLA-DPB1
|
major histocompatibility complex, class II, DP beta 1 |
| chr7_+_54610124 | 1.03 |
ENST00000402026.2
|
VSTM2A
|
V-set and transmembrane domain containing 2A |
| chr16_-_52580920 | 1.02 |
ENST00000219746.9
|
TOX3
|
TOX high mobility group box family member 3 |
| chr10_+_104178946 | 1.02 |
ENST00000432590.1
|
FBXL15
|
F-box and leucine-rich repeat protein 15 |
| chr2_+_228736321 | 1.02 |
ENST00000309931.2
|
DAW1
|
dynein assembly factor with WDR repeat domains 1 |
| chr1_-_32801825 | 1.01 |
ENST00000329421.7
|
MARCKSL1
|
MARCKS-like 1 |
| chr17_+_45908974 | 1.01 |
ENST00000269025.4
|
LRRC46
|
leucine rich repeat containing 46 |
| chr18_-_24765248 | 1.01 |
ENST00000580774.1
ENST00000284224.8 |
CHST9
|
carbohydrate (N-acetylgalactosamine 4-0) sulfotransferase 9 |
| chr9_-_124976185 | 1.01 |
ENST00000464484.2
|
LHX6
|
LIM homeobox 6 |
| chr7_+_102105370 | 1.01 |
ENST00000292616.5
|
LRWD1
|
leucine-rich repeats and WD repeat domain containing 1 |
| chr3_-_158450231 | 1.01 |
ENST00000479756.1
|
RARRES1
|
retinoic acid receptor responder (tazarotene induced) 1 |
| chr16_-_67427389 | 1.01 |
ENST00000562206.1
ENST00000290942.5 ENST00000393957.2 |
TPPP3
|
tubulin polymerization-promoting protein family member 3 |
| chr16_+_80574854 | 1.01 |
ENST00000305904.6
ENST00000568035.1 |
DYNLRB2
|
dynein, light chain, roadblock-type 2 |
| chr7_+_100612904 | 1.01 |
ENST00000379442.3
ENST00000536621.1 |
MUC12
|
mucin 12, cell surface associated |
| chr16_+_810728 | 1.00 |
ENST00000563941.1
ENST00000545450.2 ENST00000566549.1 |
MSLN
|
mesothelin |
| chr11_+_124543694 | 1.00 |
ENST00000227135.2
ENST00000532692.1 |
SPA17
|
sperm autoantigenic protein 17 |
| chr16_+_777118 | 1.00 |
ENST00000562141.1
|
HAGHL
|
hydroxyacylglutathione hydrolase-like |
| chr21_-_35831880 | 1.00 |
ENST00000399289.3
ENST00000432085.1 |
KCNE1
|
potassium voltage-gated channel, Isk-related family, member 1 |
| chr19_-_48673580 | 1.00 |
ENST00000427526.2
|
LIG1
|
ligase I, DNA, ATP-dependent |
| chr6_-_32634425 | 1.00 |
ENST00000399082.3
ENST00000399079.3 ENST00000374943.4 ENST00000434651.2 |
HLA-DQB1
|
major histocompatibility complex, class II, DQ beta 1 |
| chr1_-_211848899 | 1.00 |
ENST00000366998.3
ENST00000540251.1 ENST00000366999.4 |
NEK2
|
NIMA-related kinase 2 |
| chr17_-_6735035 | 0.99 |
ENST00000338694.2
|
TEKT1
|
tektin 1 |
| chr10_-_82116497 | 0.99 |
ENST00000372204.3
|
DYDC1
|
DPY30 domain containing 1 |
| chr7_-_111846435 | 0.99 |
ENST00000437633.1
ENST00000428084.1 |
DOCK4
|
dedicator of cytokinesis 4 |
| chr12_-_123215306 | 0.98 |
ENST00000356987.2
ENST00000436083.2 |
HCAR1
|
hydroxycarboxylic acid receptor 1 |
| chr1_+_120839412 | 0.98 |
ENST00000355228.4
|
FAM72B
|
family with sequence similarity 72, member B |
| chr19_-_48673552 | 0.98 |
ENST00000536218.1
ENST00000596549.1 |
LIG1
|
ligase I, DNA, ATP-dependent |
| chr5_-_54468974 | 0.98 |
ENST00000381375.2
ENST00000296733.1 ENST00000322374.6 ENST00000334206.5 ENST00000331730.3 |
CDC20B
|
cell division cycle 20B |
| chr19_-_7990991 | 0.97 |
ENST00000318978.4
|
CTXN1
|
cortexin 1 |
| chr4_-_114900831 | 0.97 |
ENST00000315366.7
|
ARSJ
|
arylsulfatase family, member J |
| chr14_+_96858433 | 0.96 |
ENST00000267584.4
|
AK7
|
adenylate kinase 7 |
| chr17_+_76227391 | 0.96 |
ENST00000586400.1
ENST00000421688.1 ENST00000374946.3 |
TMEM235
|
transmembrane protein 235 |
| chr6_-_42946947 | 0.96 |
ENST00000304611.8
|
PEX6
|
peroxisomal biogenesis factor 6 |
| chr8_+_22457127 | 0.96 |
ENST00000289989.5
|
C8orf58
|
chromosome 8 open reading frame 58 |
| chr16_-_776431 | 0.96 |
ENST00000293889.6
|
CCDC78
|
coiled-coil domain containing 78 |
| chr7_+_48075108 | 0.96 |
ENST00000420324.1
ENST00000435376.1 ENST00000430738.1 ENST00000348904.3 ENST00000539619.1 |
C7orf57
|
chromosome 7 open reading frame 57 |
| chr2_+_132285406 | 0.96 |
ENST00000295171.6
ENST00000409856.3 |
CCDC74A
|
coiled-coil domain containing 74A |
| chr18_-_5895954 | 0.96 |
ENST00000581347.2
|
TMEM200C
|
transmembrane protein 200C |
| chr16_+_29466426 | 0.96 |
ENST00000567248.1
|
SLX1B
|
SLX1 structure-specific endonuclease subunit homolog B (S. cerevisiae) |
| chr21_+_36041688 | 0.95 |
ENST00000360731.3
ENST00000349499.2 |
CLIC6
|
chloride intracellular channel 6 |
| chr10_+_35416223 | 0.95 |
ENST00000489321.1
ENST00000427847.2 ENST00000345491.3 ENST00000395895.2 ENST00000374728.3 ENST00000487132.1 |
CREM
|
cAMP responsive element modulator |
| chr6_+_17393839 | 0.95 |
ENST00000489374.1
ENST00000378990.2 |
CAP2
|
CAP, adenylate cyclase-associated protein, 2 (yeast) |
| chr4_-_11431188 | 0.94 |
ENST00000510712.1
|
HS3ST1
|
heparan sulfate (glucosamine) 3-O-sulfotransferase 1 |
| chr6_-_42946888 | 0.94 |
ENST00000244546.4
|
PEX6
|
peroxisomal biogenesis factor 6 |
| chr4_+_106816592 | 0.94 |
ENST00000379987.2
ENST00000453617.2 ENST00000427316.2 ENST00000514622.1 ENST00000305572.8 |
NPNT
|
nephronectin |
| chr3_+_3841108 | 0.93 |
ENST00000319331.3
|
LRRN1
|
leucine rich repeat neuronal 1 |
| chrX_-_34675391 | 0.92 |
ENST00000275954.3
|
TMEM47
|
transmembrane protein 47 |
| chr16_+_30759700 | 0.92 |
ENST00000328273.7
|
PHKG2
|
phosphorylase kinase, gamma 2 (testis) |
| chr20_+_56725952 | 0.92 |
ENST00000371168.3
|
C20orf85
|
chromosome 20 open reading frame 85 |
| chr5_-_35938674 | 0.92 |
ENST00000397366.1
ENST00000513623.1 ENST00000514524.1 ENST00000397367.2 |
CAPSL
|
calcyphosine-like |
| chr16_-_66959429 | 0.92 |
ENST00000420652.1
ENST00000299759.6 |
RRAD
|
Ras-related associated with diabetes |
| chr16_+_3115298 | 0.91 |
ENST00000325568.5
ENST00000534507.1 |
IL32
|
interleukin 32 |
| chr12_+_7014126 | 0.90 |
ENST00000415834.1
ENST00000436789.1 |
LRRC23
|
leucine rich repeat containing 23 |
| chr11_+_111385497 | 0.90 |
ENST00000375618.4
ENST00000529167.1 ENST00000332814.6 |
C11orf88
|
chromosome 11 open reading frame 88 |
| chr8_+_75896731 | 0.90 |
ENST00000262207.4
|
CRISPLD1
|
cysteine-rich secretory protein LCCL domain containing 1 |
| chr17_-_6735012 | 0.90 |
ENST00000535086.1
|
TEKT1
|
tektin 1 |
| chr11_-_118901559 | 0.90 |
ENST00000330775.7
ENST00000545985.1 ENST00000357590.5 ENST00000538950.1 |
SLC37A4
|
solute carrier family 37 (glucose-6-phosphate transporter), member 4 |
| chr11_-_72432950 | 0.90 |
ENST00000426523.1
ENST00000429686.1 |
ARAP1
|
ArfGAP with RhoGAP domain, ankyrin repeat and PH domain 1 |
| chr6_+_130686856 | 0.90 |
ENST00000296978.3
|
TMEM200A
|
transmembrane protein 200A |
| chr1_+_91966656 | 0.90 |
ENST00000428239.1
ENST00000426137.1 |
CDC7
|
cell division cycle 7 |
| chr3_-_49941042 | 0.89 |
ENST00000344206.4
ENST00000296474.3 |
MST1R
|
macrophage stimulating 1 receptor (c-met-related tyrosine kinase) |
| chr1_+_213031570 | 0.89 |
ENST00000366971.4
|
FLVCR1
|
feline leukemia virus subgroup C cellular receptor 1 |
| chr1_+_151693984 | 0.89 |
ENST00000479191.1
|
RIIAD1
|
regulatory subunit of type II PKA R-subunit (RIIa) domain containing 1 |
| chr1_-_115632035 | 0.89 |
ENST00000433172.1
ENST00000369514.2 ENST00000369516.2 ENST00000369515.2 |
TSPAN2
|
tetraspanin 2 |
| chr16_+_84209539 | 0.89 |
ENST00000569735.1
|
DNAAF1
|
dynein, axonemal, assembly factor 1 |
| chr12_+_26111823 | 0.89 |
ENST00000381352.3
ENST00000535907.1 ENST00000405154.2 |
RASSF8
|
Ras association (RalGDS/AF-6) domain family (N-terminal) member 8 |
| chr19_-_50990785 | 0.89 |
ENST00000595005.1
|
CTD-2545M3.8
|
CTD-2545M3.8 |
| chr5_+_148521136 | 0.89 |
ENST00000506113.1
|
ABLIM3
|
actin binding LIM protein family, member 3 |
| chr1_+_156119466 | 0.89 |
ENST00000414683.1
|
SEMA4A
|
sema domain, immunoglobulin domain (Ig), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 4A |
| chr2_+_186603355 | 0.89 |
ENST00000343098.5
|
FSIP2
|
fibrous sheath interacting protein 2 |
| chr5_-_159739532 | 0.88 |
ENST00000520748.1
ENST00000393977.3 ENST00000257536.7 |
CCNJL
|
cyclin J-like |
| chr17_+_62075703 | 0.88 |
ENST00000577953.1
ENST00000582540.1 ENST00000579184.1 ENST00000425164.3 ENST00000412177.1 ENST00000539996.1 ENST00000583891.1 ENST00000580752.1 |
C17orf72
|
chromosome 17 open reading frame 72 |
| chr16_-_88772670 | 0.88 |
ENST00000562544.1
|
RNF166
|
ring finger protein 166 |
| chr3_-_19988462 | 0.88 |
ENST00000344838.4
|
EFHB
|
EF-hand domain family, member B |
| chr17_+_7591747 | 0.87 |
ENST00000534050.1
|
WRAP53
|
WD repeat containing, antisense to TP53 |
| chr11_+_125757556 | 0.87 |
ENST00000526028.1
|
HYLS1
|
hydrolethalus syndrome 1 |
| chr12_-_107487604 | 0.87 |
ENST00000008527.5
|
CRY1
|
cryptochrome 1 (photolyase-like) |
| chr8_+_22457100 | 0.87 |
ENST00000409586.3
|
C8orf58
|
chromosome 8 open reading frame 58 |
| chr8_+_37594103 | 0.87 |
ENST00000397228.2
|
ERLIN2
|
ER lipid raft associated 2 |
| chr1_-_38273840 | 0.87 |
ENST00000373044.2
|
YRDC
|
yrdC N(6)-threonylcarbamoyltransferase domain containing |
| chr19_+_57742431 | 0.87 |
ENST00000302804.7
|
AURKC
|
aurora kinase C |
| chr11_-_64851496 | 0.87 |
ENST00000404147.3
ENST00000275517.3 |
CDCA5
|
cell division cycle associated 5 |
| chr16_+_3115378 | 0.86 |
ENST00000529550.1
ENST00000551122.1 ENST00000525643.2 ENST00000548807.1 ENST00000528163.2 |
IL32
|
interleukin 32 |
| chr15_-_56757329 | 0.86 |
ENST00000260453.3
|
MNS1
|
meiosis-specific nuclear structural 1 |
| chr16_+_30996502 | 0.86 |
ENST00000353250.5
ENST00000262520.6 ENST00000297679.5 ENST00000562932.1 ENST00000574447.1 |
HSD3B7
|
hydroxy-delta-5-steroid dehydrogenase, 3 beta- and steroid delta-isomerase 7 |
| chr6_+_52285046 | 0.86 |
ENST00000371068.5
|
EFHC1
|
EF-hand domain (C-terminal) containing 1 |
| chr6_-_24911195 | 0.86 |
ENST00000259698.4
|
FAM65B
|
family with sequence similarity 65, member B |
| chr1_+_91966384 | 0.86 |
ENST00000430031.2
ENST00000234626.6 |
CDC7
|
cell division cycle 7 |
| chr2_-_120124383 | 0.85 |
ENST00000334816.7
|
C2orf76
|
chromosome 2 open reading frame 76 |
| chr19_-_45927097 | 0.85 |
ENST00000340192.7
|
ERCC1
|
excision repair cross-complementing rodent repair deficiency, complementation group 1 (includes overlapping antisense sequence) |
| chr16_-_1020849 | 0.85 |
ENST00000568897.1
|
LMF1
|
lipase maturation factor 1 |
| chr1_-_114302086 | 0.85 |
ENST00000369604.1
ENST00000357783.2 |
PHTF1
|
putative homeodomain transcription factor 1 |
| chr3_-_169530574 | 0.85 |
ENST00000316515.7
ENST00000522830.1 ENST00000522526.2 |
LRRC34
|
leucine rich repeat containing 34 |
| chrX_+_53449887 | 0.85 |
ENST00000375327.3
|
RIBC1
|
RIB43A domain with coiled-coils 1 |
| chr4_+_74735102 | 0.85 |
ENST00000395761.3
|
CXCL1
|
chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha) |
| chr10_-_28287968 | 0.85 |
ENST00000305242.5
|
ARMC4
|
armadillo repeat containing 4 |
| chr6_-_111804905 | 0.85 |
ENST00000358835.3
ENST00000435970.1 |
REV3L
|
REV3-like, polymerase (DNA directed), zeta, catalytic subunit |
| chr2_+_228736335 | 0.85 |
ENST00000440997.1
ENST00000545118.1 |
DAW1
|
dynein assembly factor with WDR repeat domains 1 |
| chr3_+_97483572 | 0.84 |
ENST00000335979.2
ENST00000394206.1 |
ARL6
|
ADP-ribosylation factor-like 6 |
| chr19_+_57831829 | 0.84 |
ENST00000321545.4
|
ZNF543
|
zinc finger protein 543 |
| chr11_-_111944704 | 0.84 |
ENST00000532211.1
|
PIH1D2
|
PIH1 domain containing 2 |
Network of associatons between targets according to the STRING database.
First level regulatory network of RCOR1_MTA3
Gene Ontology Analysis
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.1 | 4.3 | GO:0072139 | glomerular parietal epithelial cell differentiation(GO:0072139) |
| 1.0 | 4.8 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.7 | 2.2 | GO:2000308 | iron assimilation(GO:0033212) iron assimilation by chelation and transport(GO:0033214) positive regulation of bone mineralization involved in bone maturation(GO:1900159) negative regulation of tumor necrosis factor (ligand) superfamily member 11 production(GO:2000308) |
| 0.7 | 4.1 | GO:0010734 | protein glutathionylation(GO:0010731) regulation of protein glutathionylation(GO:0010732) negative regulation of protein glutathionylation(GO:0010734) |
| 0.7 | 2.0 | GO:0032203 | telomere formation via telomerase(GO:0032203) |
| 0.6 | 1.9 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.6 | 2.5 | GO:0046452 | dihydrofolate metabolic process(GO:0046452) |
| 0.6 | 2.3 | GO:0032690 | negative regulation of interleukin-1 alpha production(GO:0032690) negative regulation of interleukin-1 alpha secretion(GO:0050712) |
| 0.5 | 1.6 | GO:1904172 | regulation of bleb assembly(GO:1904170) positive regulation of bleb assembly(GO:1904172) |
| 0.5 | 1.6 | GO:0007057 | spindle assembly involved in female meiosis I(GO:0007057) |
| 0.5 | 2.6 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
| 0.5 | 1.5 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 0.5 | 1.5 | GO:0051596 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.5 | 0.5 | GO:0070444 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.5 | 1.9 | GO:0036228 | protein targeting to nuclear inner membrane(GO:0036228) |
| 0.5 | 1.9 | GO:0097195 | pilomotor reflex(GO:0097195) |
| 0.5 | 1.8 | GO:0070981 | L-asparagine biosynthetic process(GO:0070981) L-asparagine metabolic process(GO:0070982) |
| 0.5 | 1.8 | GO:0051892 | negative regulation of cardioblast differentiation(GO:0051892) regulation of cardiac muscle cell myoblast differentiation(GO:2000690) negative regulation of cardiac muscle cell myoblast differentiation(GO:2000691) |
| 0.4 | 1.3 | GO:0031662 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031660) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031662) response to DDT(GO:0046680) histone H3-S10 phosphorylation involved in chromosome condensation(GO:2000775) |
| 0.4 | 0.4 | GO:0034447 | very-low-density lipoprotein particle clearance(GO:0034447) |
| 0.4 | 0.4 | GO:0010609 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
| 0.4 | 1.3 | GO:0045360 | regulation of interleukin-1 biosynthetic process(GO:0045360) positive regulation of interleukin-1 biosynthetic process(GO:0045362) |
| 0.4 | 3.5 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.4 | 2.2 | GO:0016321 | female meiosis chromosome segregation(GO:0016321) |
| 0.4 | 1.3 | GO:1903568 | negative regulation of protein localization to cilium(GO:1903565) regulation of protein localization to ciliary membrane(GO:1903567) negative regulation of protein localization to ciliary membrane(GO:1903568) |
| 0.4 | 1.3 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.4 | 1.7 | GO:0000915 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 0.4 | 5.5 | GO:0021853 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 0.4 | 13.4 | GO:0044458 | motile cilium assembly(GO:0044458) |
| 0.4 | 2.1 | GO:0006235 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) |
| 0.4 | 1.2 | GO:2000276 | negative regulation of oxidative phosphorylation uncoupler activity(GO:2000276) |
| 0.4 | 2.8 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) |
| 0.4 | 0.8 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.4 | 1.2 | GO:2000298 | regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
| 0.4 | 1.2 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 0.4 | 0.4 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
| 0.4 | 0.8 | GO:2000563 | positive regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000563) |
| 0.4 | 1.1 | GO:0036333 | hepatocyte homeostasis(GO:0036333) response to tetrachloromethane(GO:1904772) |
| 0.4 | 1.5 | GO:0070662 | mast cell proliferation(GO:0070662) |
| 0.4 | 1.1 | GO:0071922 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.4 | 1.1 | GO:1904897 | regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 0.4 | 1.4 | GO:0072086 | specification of loop of Henle identity(GO:0072086) |
| 0.3 | 1.4 | GO:0051754 | meiotic sister chromatid cohesion, centromeric(GO:0051754) |
| 0.3 | 2.1 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.3 | 1.0 | GO:2000412 | positive regulation of thymocyte migration(GO:2000412) |
| 0.3 | 1.7 | GO:0002032 | desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
| 0.3 | 1.3 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.3 | 0.3 | GO:0030575 | nuclear body organization(GO:0030575) |
| 0.3 | 1.3 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.3 | 2.0 | GO:0045819 | positive regulation of glycogen catabolic process(GO:0045819) |
| 0.3 | 2.0 | GO:0098707 | ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
| 0.3 | 1.6 | GO:0090202 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 0.3 | 1.3 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.3 | 1.6 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
| 0.3 | 1.3 | GO:0032053 | ciliary basal body organization(GO:0032053) |
| 0.3 | 1.3 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.3 | 0.9 | GO:0036071 | N-glycan fucosylation(GO:0036071) |
| 0.3 | 0.3 | GO:0046642 | negative regulation of alpha-beta T cell proliferation(GO:0046642) |
| 0.3 | 1.8 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.3 | 0.3 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.3 | 1.5 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
| 0.3 | 0.9 | GO:0045930 | negative regulation of mitotic cell cycle(GO:0045930) |
| 0.3 | 1.2 | GO:0046909 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.3 | 7.1 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.3 | 0.9 | GO:0044210 | 'de novo' CTP biosynthetic process(GO:0044210) |
| 0.3 | 1.2 | GO:0046086 | adenosine biosynthetic process(GO:0046086) |
| 0.3 | 0.3 | GO:0002544 | chronic inflammatory response(GO:0002544) |
| 0.3 | 1.7 | GO:0007079 | mitotic chromosome movement towards spindle pole(GO:0007079) |
| 0.3 | 0.6 | GO:0042733 | embryonic digit morphogenesis(GO:0042733) |
| 0.3 | 1.1 | GO:0060434 | bronchus morphogenesis(GO:0060434) |
| 0.3 | 3.1 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 0.3 | 1.4 | GO:0031016 | pancreas development(GO:0031016) |
| 0.3 | 0.8 | GO:1902595 | regulation of DNA replication origin binding(GO:1902595) |
| 0.3 | 1.4 | GO:0055011 | atrial cardiac muscle cell differentiation(GO:0055011) atrial cardiac muscle cell development(GO:0055014) |
| 0.3 | 2.2 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 0.3 | 0.8 | GO:0070510 | regulation of histone H4-K20 methylation(GO:0070510) positive regulation of histone H4-K20 methylation(GO:0070512) |
| 0.3 | 0.8 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
| 0.3 | 1.1 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
| 0.3 | 1.1 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
| 0.3 | 0.3 | GO:0071316 | cellular response to nicotine(GO:0071316) |
| 0.3 | 0.8 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
| 0.3 | 0.3 | GO:0033085 | negative regulation of T cell differentiation in thymus(GO:0033085) negative regulation of thymocyte aggregation(GO:2000399) |
| 0.3 | 0.5 | GO:0032972 | regulation of muscle filament sliding speed(GO:0032972) |
| 0.3 | 0.5 | GO:0046075 | dTTP metabolic process(GO:0046075) |
| 0.3 | 1.1 | GO:0072134 | nephrogenic mesenchyme morphogenesis(GO:0072134) |
| 0.3 | 0.8 | GO:0035350 | FAD transport(GO:0015883) FAD transmembrane transport(GO:0035350) |
| 0.3 | 0.8 | GO:0070352 | positive regulation of white fat cell proliferation(GO:0070352) |
| 0.3 | 0.8 | GO:0060734 | regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:0060734) |
| 0.3 | 1.3 | GO:0002399 | MHC class II protein complex assembly(GO:0002399) |
| 0.3 | 0.3 | GO:0045736 | negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) |
| 0.3 | 0.8 | GO:0002894 | positive regulation of type IIa hypersensitivity(GO:0001798) positive regulation of type II hypersensitivity(GO:0002894) |
| 0.3 | 1.3 | GO:0019303 | D-ribose catabolic process(GO:0019303) |
| 0.3 | 1.0 | GO:0034224 | cellular response to zinc ion starvation(GO:0034224) |
| 0.3 | 0.5 | GO:0046984 | regulation of hemoglobin biosynthetic process(GO:0046984) |
| 0.3 | 1.3 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
| 0.3 | 0.3 | GO:0038162 | erythropoietin-mediated signaling pathway(GO:0038162) |
| 0.3 | 0.8 | GO:1901253 | negative regulation of intracellular transport of viral material(GO:1901253) |
| 0.3 | 12.1 | GO:0035082 | axoneme assembly(GO:0035082) |
| 0.3 | 2.8 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
| 0.3 | 3.3 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.2 | 0.7 | GO:0002476 | antigen processing and presentation of endogenous peptide antigen via MHC class Ib(GO:0002476) |
| 0.2 | 3.0 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.2 | 1.0 | GO:0009224 | CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) CMP metabolic process(GO:0046035) |
| 0.2 | 0.2 | GO:0002011 | morphogenesis of an epithelial sheet(GO:0002011) |
| 0.2 | 0.7 | GO:0061188 | negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 0.2 | 0.5 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.2 | 0.2 | GO:1904693 | midbrain morphogenesis(GO:1904693) |
| 0.2 | 0.7 | GO:2001301 | lipoxin biosynthetic process(GO:2001301) lipoxin A4 metabolic process(GO:2001302) lipoxin A4 biosynthetic process(GO:2001303) |
| 0.2 | 0.7 | GO:0072709 | cellular response to sorbitol(GO:0072709) |
| 0.2 | 0.9 | GO:0042986 | positive regulation of amyloid precursor protein biosynthetic process(GO:0042986) |
| 0.2 | 0.7 | GO:0018312 | peptidyl-serine ADP-ribosylation(GO:0018312) |
| 0.2 | 0.2 | GO:0048754 | branching morphogenesis of an epithelial tube(GO:0048754) |
| 0.2 | 1.2 | GO:0000973 | posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
| 0.2 | 1.2 | GO:0046599 | regulation of centriole replication(GO:0046599) |
| 0.2 | 0.9 | GO:0010025 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.2 | 0.7 | GO:0042351 | 'de novo' GDP-L-fucose biosynthetic process(GO:0042351) |
| 0.2 | 1.4 | GO:1902998 | macrophage proliferation(GO:0061517) microglial cell proliferation(GO:0061518) regulation of neuronal signal transduction(GO:1902847) positive regulation of neurofibrillary tangle assembly(GO:1902998) |
| 0.2 | 0.9 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.2 | 0.9 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
| 0.2 | 1.1 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
| 0.2 | 1.3 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
| 0.2 | 0.7 | GO:0061713 | neural crest cell migration involved in heart formation(GO:0003147) anterior neural tube closure(GO:0061713) |
| 0.2 | 0.9 | GO:0097045 | phosphatidylserine exposure on blood platelet(GO:0097045) |
| 0.2 | 0.4 | GO:0035712 | T-helper 2 cell activation(GO:0035712) regulation of T-helper 2 cell activation(GO:2000569) positive regulation of T-helper 2 cell activation(GO:2000570) |
| 0.2 | 1.3 | GO:0014038 | regulation of Schwann cell differentiation(GO:0014038) |
| 0.2 | 1.3 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
| 0.2 | 0.2 | GO:0043313 | regulation of neutrophil degranulation(GO:0043313) |
| 0.2 | 2.8 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.2 | 0.6 | GO:0031548 | regulation of brain-derived neurotrophic factor receptor signaling pathway(GO:0031548) |
| 0.2 | 0.2 | GO:0030185 | nitric oxide transport(GO:0030185) |
| 0.2 | 1.5 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.2 | 0.2 | GO:0015807 | L-amino acid transport(GO:0015807) |
| 0.2 | 1.1 | GO:0035087 | siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.2 | 0.2 | GO:0001569 | patterning of blood vessels(GO:0001569) |
| 0.2 | 0.2 | GO:0072202 | cell differentiation involved in metanephros development(GO:0072202) |
| 0.2 | 1.7 | GO:0018211 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.2 | 0.2 | GO:1903490 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 0.2 | 0.8 | GO:0006218 | uridine catabolic process(GO:0006218) |
| 0.2 | 7.9 | GO:0090022 | regulation of neutrophil chemotaxis(GO:0090022) |
| 0.2 | 0.8 | GO:0000255 | allantoin metabolic process(GO:0000255) |
| 0.2 | 0.2 | GO:1904798 | regulation of core promoter binding(GO:1904796) positive regulation of core promoter binding(GO:1904798) |
| 0.2 | 11.9 | GO:0042073 | intraciliary transport(GO:0042073) |
| 0.2 | 0.2 | GO:2000179 | positive regulation of neural precursor cell proliferation(GO:2000179) |
| 0.2 | 0.8 | GO:0035752 | lysosomal lumen pH elevation(GO:0035752) |
| 0.2 | 0.2 | GO:0060742 | epithelial cell differentiation involved in prostate gland development(GO:0060742) |
| 0.2 | 1.0 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.2 | 1.0 | GO:0019255 | glucose 1-phosphate metabolic process(GO:0019255) |
| 0.2 | 0.6 | GO:0060915 | fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) fibroblast growth factor receptor signaling pathway involved in mammary gland specification(GO:0060595) mammary gland bud formation(GO:0060615) branch elongation involved in salivary gland morphogenesis(GO:0060667) mesenchymal cell differentiation involved in lung development(GO:0060915) |
| 0.2 | 0.8 | GO:0001189 | RNA polymerase I transcriptional preinitiation complex assembly(GO:0001188) RNA polymerase I transcriptional preinitiation complex assembly at the promoter for the nuclear large rRNA transcript(GO:0001189) |
| 0.2 | 1.4 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.2 | 2.0 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) |
| 0.2 | 1.0 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.2 | 1.2 | GO:0014004 | microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.2 | 0.6 | GO:0006679 | glucosylceramide biosynthetic process(GO:0006679) |
| 0.2 | 0.2 | GO:0031990 | mRNA export from nucleus in response to heat stress(GO:0031990) |
| 0.2 | 0.6 | GO:0006258 | UDP-glucose catabolic process(GO:0006258) |
| 0.2 | 0.2 | GO:0042159 | lipoprotein catabolic process(GO:0042159) |
| 0.2 | 1.6 | GO:0072734 | response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
| 0.2 | 0.6 | GO:0045631 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.2 | 1.0 | GO:0098502 | DNA dephosphorylation(GO:0098502) |
| 0.2 | 0.2 | GO:1900110 | negative regulation of histone H3-K9 dimethylation(GO:1900110) |
| 0.2 | 0.4 | GO:0006288 | base-excision repair, DNA ligation(GO:0006288) |
| 0.2 | 0.4 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
| 0.2 | 0.2 | GO:0072047 | proximal/distal pattern formation involved in nephron development(GO:0072047) specification of nephron tubule identity(GO:0072081) |
| 0.2 | 1.0 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
| 0.2 | 1.6 | GO:2000860 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.2 | 1.2 | GO:0030421 | defecation(GO:0030421) |
| 0.2 | 1.2 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.2 | 0.4 | GO:0038109 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
| 0.2 | 0.6 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
| 0.2 | 0.8 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
| 0.2 | 0.8 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
| 0.2 | 0.6 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.2 | 1.1 | GO:0035803 | egg coat formation(GO:0035803) |
| 0.2 | 0.6 | GO:0006669 | sphinganine-1-phosphate biosynthetic process(GO:0006669) |
| 0.2 | 0.9 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
| 0.2 | 0.6 | GO:0060139 | positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation of apoptotic process by virus(GO:0060139) |
| 0.2 | 1.3 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.2 | 1.7 | GO:0003351 | epithelial cilium movement(GO:0003351) |
| 0.2 | 0.6 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.2 | 0.9 | GO:0015891 | iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
| 0.2 | 0.6 | GO:0050823 | peptide stabilization(GO:0050822) peptide antigen stabilization(GO:0050823) |
| 0.2 | 0.2 | GO:0000012 | single strand break repair(GO:0000012) |
| 0.2 | 1.1 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
| 0.2 | 1.7 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
| 0.2 | 1.1 | GO:1903401 | L-lysine transmembrane transport(GO:1903401) |
| 0.2 | 0.2 | GO:0098751 | bone cell development(GO:0098751) |
| 0.2 | 1.3 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.2 | 1.6 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.2 | 0.2 | GO:0010446 | response to alkaline pH(GO:0010446) cellular response to alkaline pH(GO:0071469) |
| 0.2 | 0.2 | GO:1904751 | positive regulation of protein localization to nucleolus(GO:1904751) |
| 0.2 | 0.5 | GO:0051102 | DNA ligation involved in DNA recombination(GO:0051102) |
| 0.2 | 1.8 | GO:0015677 | copper ion import(GO:0015677) |
| 0.2 | 0.2 | GO:1903903 | regulation of establishment of T cell polarity(GO:1903903) |
| 0.2 | 0.9 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.2 | 0.2 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
| 0.2 | 0.5 | GO:1904204 | regulation of skeletal muscle hypertrophy(GO:1904204) |
| 0.2 | 2.3 | GO:0051256 | mitotic spindle midzone assembly(GO:0051256) |
| 0.2 | 5.9 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.2 | 0.7 | GO:0007402 | ganglion mother cell fate determination(GO:0007402) |
| 0.2 | 0.9 | GO:0070842 | aggresome assembly(GO:0070842) |
| 0.2 | 1.4 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
| 0.2 | 0.5 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.2 | 1.8 | GO:0035608 | protein deglutamylation(GO:0035608) |
| 0.2 | 0.2 | GO:0032656 | regulation of interleukin-13 production(GO:0032656) |
| 0.2 | 1.2 | GO:0023021 | termination of signal transduction(GO:0023021) |
| 0.2 | 0.2 | GO:0051231 | mitotic spindle elongation(GO:0000022) spindle elongation(GO:0051231) |
| 0.2 | 0.7 | GO:1904222 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.2 | 0.5 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
| 0.2 | 0.2 | GO:0051832 | evasion or tolerance of host defenses by virus(GO:0019049) avoidance of host defenses(GO:0044413) evasion or tolerance of host defenses(GO:0044415) avoidance of defenses of other organism involved in symbiotic interaction(GO:0051832) evasion or tolerance of defenses of other organism involved in symbiotic interaction(GO:0051834) |
| 0.2 | 1.2 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.2 | 0.3 | GO:0060151 | peroxisome localization(GO:0060151) microtubule-based peroxisome localization(GO:0060152) |
| 0.2 | 0.2 | GO:1902473 | regulation of protein localization to synapse(GO:1902473) positive regulation of protein localization to synapse(GO:1902474) |
| 0.2 | 0.3 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.2 | 0.5 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
| 0.2 | 0.7 | GO:0071409 | cellular response to cycloheximide(GO:0071409) |
| 0.2 | 0.3 | GO:0015670 | carbon dioxide transport(GO:0015670) |
| 0.2 | 1.7 | GO:0021702 | cerebellar Purkinje cell layer formation(GO:0021694) cerebellar Purkinje cell differentiation(GO:0021702) |
| 0.2 | 0.5 | GO:1901207 | regulation of heart looping(GO:1901207) |
| 0.2 | 0.5 | GO:0046080 | dUTP metabolic process(GO:0046080) dUTP catabolic process(GO:0046081) |
| 0.2 | 0.2 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.2 | 0.7 | GO:0035522 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
| 0.2 | 2.2 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 0.2 | 0.3 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
| 0.2 | 0.5 | GO:0034552 | respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 0.2 | 0.8 | GO:0034334 | adherens junction maintenance(GO:0034334) |
| 0.2 | 0.8 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.2 | 0.5 | GO:2000661 | positive regulation of interleukin-1-mediated signaling pathway(GO:2000661) |
| 0.2 | 0.5 | GO:0045897 | positive regulation of transcription during mitosis(GO:0045897) |
| 0.2 | 0.2 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.2 | 0.2 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
| 0.2 | 1.5 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.2 | 1.0 | GO:1905007 | positive regulation of epithelial to mesenchymal transition involved in endocardial cushion formation(GO:1905007) |
| 0.2 | 1.9 | GO:0010826 | negative regulation of centrosome duplication(GO:0010826) |
| 0.2 | 0.5 | GO:1902990 | mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
| 0.2 | 0.3 | GO:0034982 | mitochondrial protein processing(GO:0034982) |
| 0.2 | 0.5 | GO:0042040 | molybdenum incorporation into molybdenum-molybdopterin complex(GO:0018315) metal incorporation into metallo-molybdopterin complex(GO:0042040) glycine receptor clustering(GO:0072579) |
| 0.2 | 0.2 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 0.2 | 0.5 | GO:0021986 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.2 | 0.6 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.2 | 0.5 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
| 0.2 | 0.3 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.2 | 1.1 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.2 | 0.5 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 0.2 | 0.2 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
| 0.2 | 0.5 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
| 0.2 | 0.8 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.2 | 0.8 | GO:0070295 | renal water absorption(GO:0070295) |
| 0.2 | 0.6 | GO:0044805 | late nucleophagy(GO:0044805) |
| 0.2 | 0.6 | GO:1901091 | regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
| 0.2 | 1.6 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.2 | 0.2 | GO:0072268 | pattern specification involved in metanephros development(GO:0072268) |
| 0.2 | 0.3 | GO:0098700 | neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.2 | 3.7 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.2 | 0.3 | GO:0002302 | CD8-positive, alpha-beta T cell differentiation involved in immune response(GO:0002302) |
| 0.2 | 0.5 | GO:0009216 | purine deoxyribonucleoside triphosphate biosynthetic process(GO:0009216) |
| 0.2 | 0.3 | GO:0015709 | thiosulfate transport(GO:0015709) oxaloacetate transport(GO:0015729) malate transport(GO:0015743) malate transmembrane transport(GO:0071423) oxaloacetate(2-) transmembrane transport(GO:1902356) |
| 0.2 | 0.8 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
| 0.2 | 0.2 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.2 | 0.8 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) |
| 0.2 | 0.6 | GO:0042414 | epinephrine metabolic process(GO:0042414) epinephrine biosynthetic process(GO:0042418) |
| 0.2 | 0.9 | GO:0007185 | transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
| 0.2 | 0.3 | GO:0034340 | response to type I interferon(GO:0034340) |
| 0.2 | 0.6 | GO:0036116 | medium-chain fatty-acyl-CoA catabolic process(GO:0036114) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
| 0.2 | 0.2 | GO:0043366 | beta selection(GO:0043366) |
| 0.2 | 0.3 | GO:0071630 | nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
| 0.2 | 0.2 | GO:1902751 | positive regulation of cell cycle G2/M phase transition(GO:1902751) |
| 0.2 | 0.5 | GO:0015785 | UDP-galactose transport(GO:0015785) UDP-galactose transmembrane transport(GO:0072334) |
| 0.2 | 0.9 | GO:0035709 | memory T cell activation(GO:0035709) regulation of memory T cell activation(GO:2000567) positive regulation of memory T cell activation(GO:2000568) |
| 0.2 | 0.2 | GO:0042249 | establishment of planar polarity of embryonic epithelium(GO:0042249) |
| 0.1 | 0.1 | GO:0060746 | maternal behavior(GO:0042711) parental behavior(GO:0060746) |
| 0.1 | 2.5 | GO:1902260 | negative regulation of delayed rectifier potassium channel activity(GO:1902260) |
| 0.1 | 0.4 | GO:1903348 | positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.1 | 0.6 | GO:0039507 | modulation by virus of host molecular function(GO:0039506) suppression by virus of host molecular function(GO:0039507) suppression by virus of host catalytic activity(GO:0039513) modulation by virus of host catalytic activity(GO:0039516) suppression by virus of host cysteine-type endopeptidase activity involved in apoptotic process(GO:0039650) negative regulation by symbiont of host catalytic activity(GO:0052053) negative regulation by symbiont of host molecular function(GO:0052056) modulation by symbiont of host catalytic activity(GO:0052148) |
| 0.1 | 0.6 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.1 | 0.6 | GO:0090362 | positive regulation of platelet-derived growth factor production(GO:0090362) |
| 0.1 | 0.1 | GO:0032071 | regulation of endodeoxyribonuclease activity(GO:0032071) |
| 0.1 | 1.8 | GO:0038203 | TORC2 signaling(GO:0038203) |
| 0.1 | 0.4 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
| 0.1 | 1.8 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.1 | 0.3 | GO:0031133 | regulation of axon diameter(GO:0031133) |
| 0.1 | 0.4 | GO:0060381 | regulation of single-stranded telomeric DNA binding(GO:0060380) positive regulation of single-stranded telomeric DNA binding(GO:0060381) |
| 0.1 | 0.6 | GO:0060010 | Sertoli cell fate commitment(GO:0060010) |
| 0.1 | 0.4 | GO:0034059 | response to anoxia(GO:0034059) |
| 0.1 | 0.1 | GO:0003099 | positive regulation of the force of heart contraction by chemical signal(GO:0003099) |
| 0.1 | 0.4 | GO:0002352 | B cell negative selection(GO:0002352) post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 0.1 | 0.7 | GO:1902412 | regulation of mitotic cytokinesis(GO:1902412) |
| 0.1 | 2.5 | GO:0007080 | mitotic metaphase plate congression(GO:0007080) |
| 0.1 | 0.6 | GO:0036079 | GDP-fucose transport(GO:0015783) purine nucleotide-sugar transport(GO:0036079) |
| 0.1 | 0.4 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
| 0.1 | 0.6 | GO:0033512 | L-lysine catabolic process to acetyl-CoA via saccharopine(GO:0033512) |
| 0.1 | 0.4 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.1 | 0.4 | GO:0021692 | cerebellar Purkinje cell layer morphogenesis(GO:0021692) |
| 0.1 | 1.0 | GO:1903679 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.1 | 0.6 | GO:1903976 | negative regulation of glial cell migration(GO:1903976) |
| 0.1 | 0.7 | GO:0002415 | immunoglobulin transcytosis in epithelial cells mediated by polymeric immunoglobulin receptor(GO:0002415) |
| 0.1 | 0.1 | GO:0031291 | Ran protein signal transduction(GO:0031291) |
| 0.1 | 2.3 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
| 0.1 | 0.6 | GO:0031296 | B cell costimulation(GO:0031296) |
| 0.1 | 1.8 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.1 | 0.6 | GO:0052250 | modulation of signal transduction in other organism(GO:0044501) modulation by symbiont of host signal transduction pathway(GO:0052027) modulation of signal transduction in other organism involved in symbiotic interaction(GO:0052250) modulation by symbiont of host I-kappaB kinase/NF-kappaB cascade(GO:0085032) |
| 0.1 | 0.1 | GO:0098935 | dendritic transport(GO:0098935) anterograde dendritic transport(GO:0098937) |
| 0.1 | 3.9 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.1 | 0.7 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.1 | 0.1 | GO:2000312 | regulation of kainate selective glutamate receptor activity(GO:2000312) |
| 0.1 | 0.1 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.1 | 0.1 | GO:0015908 | fatty acid transport(GO:0015908) |
| 0.1 | 0.3 | GO:0033484 | nitric oxide homeostasis(GO:0033484) |
| 0.1 | 0.8 | GO:0034670 | chemotaxis to arachidonic acid(GO:0034670) response to arachidonic acid(GO:1904550) |
| 0.1 | 1.2 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
| 0.1 | 0.4 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.1 | 0.1 | GO:0086100 | endothelin receptor signaling pathway(GO:0086100) |
| 0.1 | 0.1 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
| 0.1 | 0.1 | GO:0006801 | superoxide metabolic process(GO:0006801) |
| 0.1 | 0.5 | GO:1902262 | apoptotic process involved in patterning of blood vessels(GO:1902262) |
| 0.1 | 0.3 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.1 | 0.4 | GO:0043634 | polyadenylation-dependent ncRNA catabolic process(GO:0043634) |
| 0.1 | 0.1 | GO:0072711 | cellular response to hydroxyurea(GO:0072711) |
| 0.1 | 1.1 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.1 | 0.1 | GO:0003032 | detection of oxygen(GO:0003032) |
| 0.1 | 0.7 | GO:1904845 | response to L-glutamine(GO:1904844) cellular response to L-glutamine(GO:1904845) |
| 0.1 | 0.5 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
| 0.1 | 0.3 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
| 0.1 | 1.1 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
| 0.1 | 2.0 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
| 0.1 | 0.1 | GO:0014839 | myoblast migration involved in skeletal muscle regeneration(GO:0014839) |
| 0.1 | 0.3 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
| 0.1 | 0.4 | GO:0035408 | histone H3-T6 phosphorylation(GO:0035408) |
| 0.1 | 0.4 | GO:0045212 | negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 0.1 | 0.9 | GO:0090175 | regulation of establishment of planar polarity(GO:0090175) |
| 0.1 | 1.1 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.1 | 0.5 | GO:0009257 | 10-formyltetrahydrofolate biosynthetic process(GO:0009257) |
| 0.1 | 0.1 | GO:1900190 | biofilm formation(GO:0042710) single-species biofilm formation(GO:0044010) single-species biofilm formation in or on host organism(GO:0044407) regulation of single-species biofilm formation(GO:1900190) negative regulation of single-species biofilm formation(GO:1900191) regulation of single-species biofilm formation in or on host organism(GO:1900228) negative regulation of single-species biofilm formation in or on host organism(GO:1900229) |
| 0.1 | 2.4 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.1 | 0.8 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
| 0.1 | 2.9 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.1 | 0.5 | GO:1900133 | regulation of renin secretion into blood stream(GO:1900133) |
| 0.1 | 0.9 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 | 1.2 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
| 0.1 | 3.7 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
| 0.1 | 0.9 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.1 | 0.3 | GO:1904729 | regulation of intestinal cholesterol absorption(GO:0030300) regulation of intestinal absorption(GO:1904478) regulation of intestinal lipid absorption(GO:1904729) |
| 0.1 | 1.2 | GO:0090232 | positive regulation of spindle checkpoint(GO:0090232) |
| 0.1 | 0.1 | GO:0043628 | ncRNA 3'-end processing(GO:0043628) |
| 0.1 | 0.8 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
| 0.1 | 0.5 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
| 0.1 | 0.4 | GO:1905205 | positive regulation of connective tissue replacement(GO:1905205) |
| 0.1 | 2.2 | GO:0045008 | depyrimidination(GO:0045008) |
| 0.1 | 0.1 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.1 | 1.0 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
| 0.1 | 2.7 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
| 0.1 | 0.9 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
| 0.1 | 0.1 | GO:1903527 | positive regulation of membrane tubulation(GO:1903527) |
| 0.1 | 0.3 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.1 | 2.2 | GO:0002523 | leukocyte migration involved in inflammatory response(GO:0002523) |
| 0.1 | 0.1 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
| 0.1 | 0.3 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
| 0.1 | 3.8 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.1 | 0.4 | GO:0005976 | polysaccharide metabolic process(GO:0005976) |
| 0.1 | 0.3 | GO:0021823 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) chemorepulsion involved in postnatal olfactory bulb interneuron migration(GO:0021836) |
| 0.1 | 1.1 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
| 0.1 | 0.3 | GO:0031627 | telomeric loop formation(GO:0031627) |
| 0.1 | 1.3 | GO:0051612 | negative regulation of neurotransmitter uptake(GO:0051581) serotonin uptake(GO:0051610) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.1 | 0.5 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.1 | 0.4 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.1 | 0.4 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
| 0.1 | 0.4 | GO:1904868 | telomerase catalytic core complex assembly(GO:1904868) regulation of telomerase catalytic core complex assembly(GO:1904882) positive regulation of telomerase catalytic core complex assembly(GO:1904884) |
| 0.1 | 0.9 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) |
| 0.1 | 2.2 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.1 | 0.5 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
| 0.1 | 0.2 | GO:0006203 | dGTP catabolic process(GO:0006203) |
| 0.1 | 0.4 | GO:0044205 | 'de novo' UMP biosynthetic process(GO:0044205) |
| 0.1 | 0.2 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.1 | 0.4 | GO:1902824 | positive regulation of late endosome to lysosome transport(GO:1902824) |
| 0.1 | 1.2 | GO:0019043 | establishment of viral latency(GO:0019043) |
| 0.1 | 2.6 | GO:0007094 | mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
| 0.1 | 0.1 | GO:0032886 | regulation of microtubule-based process(GO:0032886) |
| 0.1 | 0.1 | GO:0006114 | glycerol biosynthetic process(GO:0006114) alditol biosynthetic process(GO:0019401) |
| 0.1 | 0.9 | GO:0048105 | establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 0.1 | 1.1 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
| 0.1 | 0.6 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
| 0.1 | 0.1 | GO:0003016 | respiratory system process(GO:0003016) |
| 0.1 | 0.1 | GO:1903431 | positive regulation of neuron maturation(GO:0014042) positive regulation of cell maturation(GO:1903431) |
| 0.1 | 1.2 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
| 0.1 | 1.6 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.1 | 1.0 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.1 | 0.4 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
| 0.1 | 0.8 | GO:0032226 | positive regulation of synaptic transmission, dopaminergic(GO:0032226) |
| 0.1 | 0.4 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
| 0.1 | 0.4 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
| 0.1 | 0.4 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.1 | 0.1 | GO:0060278 | regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
| 0.1 | 0.5 | GO:0061626 | pharyngeal arch artery morphogenesis(GO:0061626) |
| 0.1 | 0.5 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.1 | 0.1 | GO:0002590 | regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) negative regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002590) |
| 0.1 | 0.4 | GO:1902159 | regulation of cyclic nucleotide-gated ion channel activity(GO:1902159) |
| 0.1 | 0.4 | GO:0070898 | RNA polymerase III transcriptional preinitiation complex assembly(GO:0070898) |
| 0.1 | 0.4 | GO:0046900 | tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.1 | 0.2 | GO:2000371 | regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
| 0.1 | 0.4 | GO:0045333 | cellular respiration(GO:0045333) |
| 0.1 | 0.8 | GO:0016078 | tRNA catabolic process(GO:0016078) |
| 0.1 | 0.6 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
| 0.1 | 1.1 | GO:0060449 | bud elongation involved in lung branching(GO:0060449) |
| 0.1 | 0.2 | GO:0070541 | response to platinum ion(GO:0070541) |
| 0.1 | 0.6 | GO:0071027 | nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
| 0.1 | 0.5 | GO:0089700 | protein kinase D signaling(GO:0089700) |
| 0.1 | 0.7 | GO:0035754 | B cell chemotaxis(GO:0035754) |
| 0.1 | 0.7 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
| 0.1 | 0.2 | GO:0010956 | negative regulation of calcidiol 1-monooxygenase activity(GO:0010956) |
| 0.1 | 0.3 | GO:0042450 | arginine biosynthetic process via ornithine(GO:0042450) |
| 0.1 | 0.3 | GO:0007113 | endomitotic cell cycle(GO:0007113) |
| 0.1 | 0.8 | GO:0000436 | carbon catabolite regulation of transcription from RNA polymerase II promoter(GO:0000429) carbon catabolite activation of transcription from RNA polymerase II promoter(GO:0000436) |
| 0.1 | 1.0 | GO:0071798 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
| 0.1 | 0.9 | GO:0003341 | cilium movement(GO:0003341) |
| 0.1 | 0.3 | GO:0000967 | endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
| 0.1 | 0.7 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.1 | 0.3 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
| 0.1 | 1.2 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.1 | 0.2 | GO:0032679 | TRAIL production(GO:0032639) regulation of TRAIL production(GO:0032679) positive regulation of TRAIL production(GO:0032759) |
| 0.1 | 0.2 | GO:0098501 | polynucleotide dephosphorylation(GO:0098501) |
| 0.1 | 0.5 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.1 | 0.1 | GO:0070987 | error-free translesion synthesis(GO:0070987) |
| 0.1 | 0.9 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
| 0.1 | 0.5 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.1 | 0.3 | GO:0006065 | UDP-glucuronate biosynthetic process(GO:0006065) |
| 0.1 | 0.5 | GO:0061358 | negative regulation of Wnt protein secretion(GO:0061358) |
| 0.1 | 0.5 | GO:0044240 | multicellular organism lipid catabolic process(GO:0044240) |
| 0.1 | 1.1 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.1 | 2.3 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
| 0.1 | 0.3 | GO:0043012 | regulation of fusion of sperm to egg plasma membrane(GO:0043012) |
| 0.1 | 0.1 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.1 | 0.2 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.1 | 0.8 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
| 0.1 | 0.8 | GO:0034312 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
| 0.1 | 0.1 | GO:1902732 | positive regulation of chondrocyte proliferation(GO:1902732) |
| 0.1 | 0.1 | GO:0032618 | interleukin-15 production(GO:0032618) |
| 0.1 | 1.1 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.1 | 0.2 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
| 0.1 | 1.0 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
| 0.1 | 0.3 | GO:1901053 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
| 0.1 | 0.3 | GO:0002678 | positive regulation of chronic inflammatory response(GO:0002678) |
| 0.1 | 0.9 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.1 | 0.6 | GO:0006015 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.1 | 0.9 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.1 | 1.0 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
| 0.1 | 0.7 | GO:0061084 | regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) |
| 0.1 | 1.8 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.1 | 0.8 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.1 | 0.8 | GO:0018200 | peptidyl-glutamic acid modification(GO:0018200) |
| 0.1 | 1.1 | GO:0048296 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) |
| 0.1 | 0.2 | GO:0071025 | RNA surveillance(GO:0071025) |
| 0.1 | 0.2 | GO:0034093 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.1 | 0.1 | GO:0044839 | cell cycle G2/M phase transition(GO:0044839) |
| 0.1 | 0.2 | GO:0060763 | mammary duct terminal end bud growth(GO:0060763) |
| 0.1 | 0.5 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.1 | 1.1 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.1 | 0.5 | GO:0003199 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
| 0.1 | 0.2 | GO:0060994 | regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 0.1 | 0.3 | GO:0003149 | membranous septum morphogenesis(GO:0003149) |
| 0.1 | 1.4 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) |
| 0.1 | 0.3 | GO:0007206 | phospholipase C-activating G-protein coupled glutamate receptor signaling pathway(GO:0007206) |
| 0.1 | 0.1 | GO:0035404 | histone-serine phosphorylation(GO:0035404) |
| 0.1 | 0.5 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
| 0.1 | 0.4 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.1 | 0.1 | GO:0003162 | atrioventricular node development(GO:0003162) |
| 0.1 | 0.4 | GO:0002826 | negative regulation of T-helper 1 type immune response(GO:0002826) |
| 0.1 | 0.4 | GO:0060633 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) |
| 0.1 | 0.1 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.1 | 0.2 | GO:0070781 | response to biotin(GO:0070781) |
| 0.1 | 0.4 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.1 | 0.1 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.1 | 0.9 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.1 | 0.4 | GO:1904565 | response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 0.1 | 0.1 | GO:2000630 | positive regulation of miRNA metabolic process(GO:2000630) |
| 0.1 | 0.3 | GO:1904799 | negative regulation of dendrite extension(GO:1903860) regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.1 | 0.6 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.1 | 0.8 | GO:0034551 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.1 | 0.6 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.1 | 0.2 | GO:1904253 | positive regulation of bile acid biosynthetic process(GO:0070859) positive regulation of bile acid metabolic process(GO:1904253) |
| 0.1 | 0.1 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) negative regulation of establishment of blood-brain barrier(GO:0090212) |
| 0.1 | 0.6 | GO:0071543 | diadenosine polyphosphate catabolic process(GO:0015961) diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
| 0.1 | 0.1 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
| 0.1 | 0.2 | GO:0015788 | UDP-N-acetylglucosamine transport(GO:0015788) UDP-N-acetylglucosamine transmembrane transport(GO:1990569) |
| 0.1 | 0.6 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.1 | 1.6 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
| 0.1 | 0.2 | GO:0031116 | positive regulation of microtubule polymerization(GO:0031116) |
| 0.1 | 0.1 | GO:1901382 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
| 0.1 | 0.9 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.1 | 0.6 | GO:0015870 | acetylcholine transport(GO:0015870) |
| 0.1 | 0.7 | GO:0033183 | negative regulation of histone ubiquitination(GO:0033183) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) |
| 0.1 | 4.9 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
| 0.1 | 0.8 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
| 0.1 | 0.1 | GO:0042350 | GDP-L-fucose biosynthetic process(GO:0042350) |
| 0.1 | 0.2 | GO:0000491 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) |
| 0.1 | 0.4 | GO:0002442 | serotonin production involved in inflammatory response(GO:0002351) serotonin secretion involved in inflammatory response(GO:0002442) serotonin secretion by platelet(GO:0002554) |
| 0.1 | 0.3 | GO:0060715 | syncytiotrophoblast cell differentiation involved in labyrinthine layer development(GO:0060715) |
| 0.1 | 1.0 | GO:0072189 | ureter development(GO:0072189) |
| 0.1 | 1.7 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
| 0.1 | 0.3 | GO:0070375 | ERK5 cascade(GO:0070375) |
| 0.1 | 0.4 | GO:0016103 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
| 0.1 | 0.4 | GO:0002925 | positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 0.1 | 0.1 | GO:1900045 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.1 | 2.9 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.1 | 0.3 | GO:0070632 | spindle pole body duplication(GO:0030474) nuclear pore distribution(GO:0031081) spindle pole body organization(GO:0051300) nuclear pore localization(GO:0051664) spindle pole body localization(GO:0070631) establishment of spindle pole body localization(GO:0070632) spindle pole body localization to nuclear envelope(GO:0071789) establishment of spindle pole body localization to nuclear envelope(GO:0071790) |
| 0.1 | 0.6 | GO:0048050 | post-embryonic eye morphogenesis(GO:0048050) |
| 0.1 | 0.2 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
| 0.1 | 0.5 | GO:0051941 | regulation of amino acid uptake involved in synaptic transmission(GO:0051941) regulation of glutamate uptake involved in transmission of nerve impulse(GO:0051946) regulation of L-glutamate import(GO:1900920) |
| 0.1 | 0.3 | GO:1902525 | regulation of protein monoubiquitination(GO:1902525) |
| 0.1 | 1.8 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.1 | 2.7 | GO:0071431 | tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.1 | 0.2 | GO:0090398 | cellular senescence(GO:0090398) |
| 0.1 | 0.5 | GO:0030047 | actin modification(GO:0030047) |
| 0.1 | 0.5 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) |
| 0.1 | 0.5 | GO:0050668 | cellular response to phosphate starvation(GO:0016036) positive regulation of sulfur amino acid metabolic process(GO:0031337) negative regulation of catecholamine metabolic process(GO:0045914) negative regulation of dopamine metabolic process(GO:0045963) positive regulation of homocysteine metabolic process(GO:0050668) |
| 0.1 | 2.8 | GO:0051298 | centrosome duplication(GO:0051298) |
| 0.1 | 1.3 | GO:0038007 | netrin-activated signaling pathway(GO:0038007) |
| 0.1 | 0.1 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
| 0.1 | 0.4 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.1 | 1.0 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.1 | 0.7 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) regulation of store-operated calcium channel activity(GO:1901339) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.1 | 0.3 | GO:0043686 | co-translational protein modification(GO:0043686) |
| 0.1 | 0.2 | GO:0048820 | hair follicle maturation(GO:0048820) |
| 0.1 | 1.4 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
| 0.1 | 0.9 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.1 | 1.0 | GO:0010759 | positive regulation of macrophage chemotaxis(GO:0010759) |
| 0.1 | 1.4 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
| 0.1 | 0.6 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
| 0.1 | 0.1 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
| 0.1 | 1.6 | GO:0007368 | determination of left/right symmetry(GO:0007368) |
| 0.1 | 0.9 | GO:0045023 | G0 to G1 transition(GO:0045023) |
| 0.1 | 0.4 | GO:0015911 | plasma membrane long-chain fatty acid transport(GO:0015911) |
| 0.1 | 0.1 | GO:0090116 | C-5 methylation of cytosine(GO:0090116) |
| 0.1 | 1.2 | GO:0071455 | cellular response to hyperoxia(GO:0071455) |
| 0.1 | 0.3 | GO:0002184 | cytoplasmic translational termination(GO:0002184) |
| 0.1 | 0.1 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
| 0.1 | 0.5 | GO:0043328 | protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.1 | 0.3 | GO:0019858 | cytosine metabolic process(GO:0019858) |
| 0.1 | 0.3 | GO:0015732 | prostaglandin transport(GO:0015732) |
| 0.1 | 0.3 | GO:0045659 | regulation of neutrophil differentiation(GO:0045658) negative regulation of neutrophil differentiation(GO:0045659) |
| 0.1 | 0.1 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
| 0.1 | 0.1 | GO:0061030 | epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
| 0.1 | 0.3 | GO:0035621 | ER to Golgi ceramide transport(GO:0035621) |
| 0.1 | 0.6 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.1 | 0.1 | GO:1902908 | regulation of melanosome transport(GO:1902908) |
| 0.1 | 0.2 | GO:0006581 | acetylcholine catabolic process in synaptic cleft(GO:0001507) acetylcholine catabolic process(GO:0006581) |
| 0.1 | 0.5 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.1 | 0.1 | GO:0003192 | mitral valve formation(GO:0003192) |
| 0.1 | 0.2 | GO:0007231 | osmosensory signaling pathway(GO:0007231) |
| 0.1 | 0.7 | GO:0032933 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
| 0.1 | 0.2 | GO:0072198 | mesenchymal cell proliferation involved in ureter development(GO:0072198) regulation of mesenchymal cell proliferation involved in ureter development(GO:0072199) positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
| 0.1 | 0.3 | GO:0071529 | cementum mineralization(GO:0071529) |
| 0.1 | 0.5 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
| 0.1 | 1.0 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.1 | 0.1 | GO:2001267 | regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001267) |
| 0.1 | 0.5 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.1 | 0.4 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
| 0.1 | 0.2 | GO:0036022 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
| 0.1 | 0.1 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.1 | 0.5 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.1 | 0.1 | GO:0045210 | FasL biosynthetic process(GO:0045210) |
| 0.1 | 0.3 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.1 | 0.1 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
| 0.1 | 0.3 | GO:0044806 | G-quadruplex DNA unwinding(GO:0044806) |
| 0.1 | 1.2 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.1 | 0.2 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
| 0.1 | 0.2 | GO:2001176 | mediator complex assembly(GO:0036034) regulation of mediator complex assembly(GO:2001176) positive regulation of mediator complex assembly(GO:2001178) |
| 0.1 | 1.4 | GO:0019336 | phenol-containing compound catabolic process(GO:0019336) |
| 0.1 | 0.1 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
| 0.1 | 0.5 | GO:0008090 | retrograde axonal transport(GO:0008090) |
| 0.1 | 0.2 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
| 0.1 | 0.3 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.1 | 0.3 | GO:0033152 | immunoglobulin V(D)J recombination(GO:0033152) |
| 0.1 | 0.3 | GO:0022007 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 0.1 | 1.7 | GO:0033683 | nucleotide-excision repair, DNA incision(GO:0033683) |
| 0.1 | 0.3 | GO:0044537 | regulation of circulating fibrinogen levels(GO:0044537) |
| 0.1 | 0.3 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.1 | 1.1 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.1 | 0.8 | GO:0006266 | DNA ligation(GO:0006266) |
| 0.1 | 0.1 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.1 | 0.2 | GO:0051054 | positive regulation of DNA metabolic process(GO:0051054) |
| 0.1 | 3.5 | GO:0006506 | GPI anchor metabolic process(GO:0006505) GPI anchor biosynthetic process(GO:0006506) |
| 0.1 | 0.1 | GO:0015698 | inorganic anion transport(GO:0015698) |
| 0.1 | 0.5 | GO:0008218 | bioluminescence(GO:0008218) |
| 0.1 | 0.3 | GO:1904617 | negative regulation of actin filament binding(GO:1904530) negative regulation of actin binding(GO:1904617) |
| 0.1 | 0.5 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
| 0.1 | 0.4 | GO:0019075 | virus maturation(GO:0019075) |
| 0.1 | 0.6 | GO:0002084 | protein depalmitoylation(GO:0002084) |
| 0.1 | 0.5 | GO:0071104 | response to interleukin-9(GO:0071104) |
| 0.1 | 0.3 | GO:0016598 | protein arginylation(GO:0016598) |
| 0.1 | 0.7 | GO:0044782 | cilium organization(GO:0044782) |
| 0.1 | 0.3 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.1 | 0.1 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
| 0.1 | 0.1 | GO:0045921 | positive regulation of exocytosis(GO:0045921) |
| 0.1 | 0.3 | GO:1901031 | regulation of response to reactive oxygen species(GO:1901031) |
| 0.1 | 0.3 | GO:0002371 | dendritic cell cytokine production(GO:0002371) |
| 0.1 | 0.4 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.1 | 0.1 | GO:0042048 | olfactory behavior(GO:0042048) |
| 0.1 | 0.3 | GO:0032650 | regulation of interleukin-1 alpha production(GO:0032650) |
| 0.1 | 0.3 | GO:0003190 | atrioventricular valve formation(GO:0003190) |
| 0.1 | 0.3 | GO:0043335 | protein unfolding(GO:0043335) |
| 0.1 | 1.7 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.1 | 0.1 | GO:0016199 | axon midline choice point recognition(GO:0016199) |
| 0.1 | 0.2 | GO:1902949 | positive regulation of tau-protein kinase activity(GO:1902949) |
| 0.1 | 0.4 | GO:0098728 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.1 | 0.7 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
| 0.1 | 0.1 | GO:2001022 | positive regulation of response to DNA damage stimulus(GO:2001022) |
| 0.1 | 0.5 | GO:2000490 | negative regulation of hepatic stellate cell activation(GO:2000490) |
| 0.1 | 0.4 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
| 0.1 | 0.2 | GO:0000710 | meiotic mismatch repair(GO:0000710) |
| 0.1 | 0.7 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.1 | 0.2 | GO:0006012 | galactose metabolic process(GO:0006012) |
| 0.1 | 0.1 | GO:0071314 | cellular response to cocaine(GO:0071314) |
| 0.1 | 0.2 | GO:0022616 | DNA strand elongation(GO:0022616) |
| 0.1 | 0.5 | GO:1901620 | regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901620) |
| 0.1 | 0.2 | GO:1900275 | negative regulation of phospholipase C activity(GO:1900275) |
| 0.1 | 0.5 | GO:0032621 | interleukin-18 production(GO:0032621) |
| 0.1 | 1.5 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.1 | 0.1 | GO:0035510 | DNA dealkylation(GO:0035510) |
| 0.1 | 0.4 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
| 0.1 | 0.6 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
| 0.1 | 0.5 | GO:0015853 | adenine transport(GO:0015853) |
| 0.1 | 0.6 | GO:0043570 | maintenance of DNA repeat elements(GO:0043570) |
| 0.1 | 0.3 | GO:2001288 | positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.1 | 0.3 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
| 0.1 | 0.2 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.1 | 0.3 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
| 0.1 | 0.2 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.1 | 1.6 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
| 0.1 | 0.2 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
| 0.1 | 0.6 | GO:0001302 | replicative cell aging(GO:0001302) |
| 0.1 | 0.6 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
| 0.1 | 0.6 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 0.1 | 0.5 | GO:0070092 | regulation of glucagon secretion(GO:0070092) |
| 0.1 | 0.1 | GO:0006738 | nicotinamide riboside catabolic process(GO:0006738) nicotinamide riboside metabolic process(GO:0046495) pyridine nucleoside metabolic process(GO:0070637) pyridine nucleoside catabolic process(GO:0070638) |
| 0.1 | 0.2 | GO:0071539 | protein localization to centrosome(GO:0071539) |
| 0.1 | 0.7 | GO:0035865 | cellular response to potassium ion(GO:0035865) |
| 0.1 | 0.1 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
| 0.1 | 0.6 | GO:1990504 | dense core granule exocytosis(GO:1990504) |
| 0.1 | 0.3 | GO:2000781 | positive regulation of double-strand break repair(GO:2000781) |
| 0.1 | 0.5 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.1 | 0.5 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.1 | 0.5 | GO:2000152 | regulation of ubiquitin-specific protease activity(GO:2000152) positive regulation of ubiquitin-specific protease activity(GO:2000158) |
| 0.1 | 0.2 | GO:0050868 | negative regulation of T cell activation(GO:0050868) |
| 0.1 | 0.5 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
| 0.1 | 0.2 | GO:0060850 | regulation of transcription involved in cell fate commitment(GO:0060850) |
| 0.1 | 0.3 | GO:0034616 | response to laminar fluid shear stress(GO:0034616) |
| 0.1 | 0.2 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.1 | 0.3 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.1 | 0.2 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
| 0.1 | 0.5 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
| 0.1 | 1.1 | GO:0060236 | regulation of mitotic spindle organization(GO:0060236) |
| 0.1 | 0.1 | GO:0046520 | sphingoid biosynthetic process(GO:0046520) |
| 0.1 | 0.5 | GO:1990253 | cellular response to leucine starvation(GO:1990253) |
| 0.1 | 0.6 | GO:0050748 | negative regulation of lipoprotein metabolic process(GO:0050748) |
| 0.1 | 0.2 | GO:0016260 | selenocysteine biosynthetic process(GO:0016260) |
| 0.1 | 0.2 | GO:0006404 | RNA import into nucleus(GO:0006404) |
| 0.1 | 0.1 | GO:1904220 | regulation of serine C-palmitoyltransferase activity(GO:1904220) |
| 0.1 | 0.4 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.1 | 0.8 | GO:0010265 | SCF complex assembly(GO:0010265) |
| 0.1 | 0.3 | GO:0090102 | cochlea development(GO:0090102) |
| 0.1 | 0.1 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.1 | 0.2 | GO:0046677 | response to antibiotic(GO:0046677) |
| 0.1 | 0.3 | GO:0071934 | thiamine transmembrane transport(GO:0071934) |
| 0.1 | 0.1 | GO:2000791 | regulation of mesenchymal cell proliferation involved in lung development(GO:2000790) negative regulation of mesenchymal cell proliferation involved in lung development(GO:2000791) |
| 0.1 | 0.8 | GO:0070911 | global genome nucleotide-excision repair(GO:0070911) |
| 0.1 | 0.8 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.1 | 0.5 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.1 | 1.3 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.1 | 0.4 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
| 0.1 | 0.7 | GO:0040031 | snRNA modification(GO:0040031) |
| 0.1 | 0.2 | GO:0042541 | hemoglobin biosynthetic process(GO:0042541) |
| 0.1 | 1.3 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.1 | 0.4 | GO:1902669 | positive regulation of axon guidance(GO:1902669) |
| 0.1 | 0.3 | GO:0051083 | 'de novo' cotranslational protein folding(GO:0051083) |
| 0.1 | 0.5 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
| 0.1 | 7.2 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.1 | 0.8 | GO:0060605 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
| 0.1 | 0.1 | GO:0030860 | regulation of polarized epithelial cell differentiation(GO:0030860) |
| 0.1 | 0.4 | GO:0010269 | response to selenium ion(GO:0010269) |
| 0.1 | 0.5 | GO:0097338 | response to clozapine(GO:0097338) |
| 0.1 | 0.4 | GO:1903786 | mycotoxin catabolic process(GO:0043387) aflatoxin catabolic process(GO:0046223) organic heteropentacyclic compound catabolic process(GO:1901377) regulation of glutathione biosynthetic process(GO:1903786) positive regulation of glutathione biosynthetic process(GO:1903788) |
| 0.1 | 0.1 | GO:0060263 | regulation of respiratory burst(GO:0060263) |
| 0.1 | 0.1 | GO:2000836 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
| 0.1 | 0.4 | GO:2000234 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.1 | 0.6 | GO:0001554 | luteolysis(GO:0001554) |
| 0.1 | 0.1 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.1 | 0.1 | GO:1901143 | insulin catabolic process(GO:1901143) |
| 0.1 | 0.7 | GO:0042921 | glucocorticoid receptor signaling pathway(GO:0042921) |
| 0.1 | 0.6 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.1 | 0.1 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.1 | 0.3 | GO:0030920 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.1 | 0.2 | GO:0033385 | geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
| 0.1 | 0.1 | GO:1903978 | regulation of microglial cell activation(GO:1903978) |
| 0.1 | 0.4 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
| 0.1 | 0.2 | GO:0060148 | positive regulation of posttranscriptional gene silencing(GO:0060148) |
| 0.1 | 0.1 | GO:0086016 | AV node cell action potential(GO:0086016) AV node cell to bundle of His cell signaling(GO:0086027) AV node cell to bundle of His cell communication(GO:0086067) |
| 0.1 | 0.3 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.1 | 0.4 | GO:0015798 | myo-inositol transport(GO:0015798) |
| 0.1 | 0.4 | GO:0030638 | glycoside metabolic process(GO:0016137) polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.1 | 0.2 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.1 | 0.2 | GO:1901858 | regulation of mitochondrial DNA metabolic process(GO:1901858) |
| 0.1 | 0.4 | GO:1904879 | positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.1 | 0.3 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
| 0.1 | 0.6 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.1 | 0.1 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.1 | 0.3 | GO:0033489 | cholesterol biosynthetic process via desmosterol(GO:0033489) cholesterol biosynthetic process via lathosterol(GO:0033490) |
| 0.1 | 0.4 | GO:0031022 | nuclear migration along microfilament(GO:0031022) |
| 0.1 | 0.2 | GO:0007352 | zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.1 | 0.1 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) |
| 0.1 | 0.1 | GO:0097056 | selenocysteinyl-tRNA(Sec) biosynthetic process(GO:0097056) |
| 0.1 | 0.4 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.1 | 0.2 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.1 | 0.3 | GO:0010993 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
| 0.1 | 0.3 | GO:0099590 | neurotransmitter receptor internalization(GO:0099590) |
| 0.1 | 0.6 | GO:0032439 | endosome localization(GO:0032439) |
| 0.1 | 0.2 | GO:1903595 | positive regulation of histamine secretion by mast cell(GO:1903595) |
| 0.1 | 0.3 | GO:0090131 | mesenchyme migration(GO:0090131) |
| 0.1 | 0.8 | GO:0046498 | S-adenosylhomocysteine metabolic process(GO:0046498) |
| 0.1 | 1.0 | GO:0031282 | regulation of guanylate cyclase activity(GO:0031282) |
| 0.1 | 0.2 | GO:0070901 | mitochondrial tRNA methylation(GO:0070901) |
| 0.1 | 0.1 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 0.1 | 0.5 | GO:0006108 | malate metabolic process(GO:0006108) |
| 0.1 | 0.3 | GO:1902775 | mitochondrial ribosome assembly(GO:0061668) mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.1 | 0.1 | GO:0030473 | nucleokinesis involved in cell motility in cerebral cortex radial glia guided migration(GO:0021817) nuclear migration along microtubule(GO:0030473) |
| 0.1 | 0.5 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.1 | 1.1 | GO:0036315 | cellular response to sterol(GO:0036315) |
| 0.1 | 0.1 | GO:0048538 | thymus development(GO:0048538) |
| 0.1 | 13.7 | GO:0060271 | cilium morphogenesis(GO:0060271) |
| 0.1 | 0.3 | GO:1901977 | negative regulation of cell cycle checkpoint(GO:1901977) negative regulation of DNA damage checkpoint(GO:2000002) |
| 0.1 | 8.3 | GO:0010389 | regulation of G2/M transition of mitotic cell cycle(GO:0010389) |
| 0.1 | 0.8 | GO:0036481 | intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036481) |
| 0.1 | 0.1 | GO:1902957 | negative regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902957) |
| 0.1 | 1.6 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.1 | 0.3 | GO:0021633 | optic nerve structural organization(GO:0021633) |
| 0.1 | 0.3 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.1 | 0.3 | GO:0097350 | neutrophil clearance(GO:0097350) |
| 0.1 | 1.4 | GO:0031639 | plasminogen activation(GO:0031639) |
| 0.1 | 0.5 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.1 | 2.0 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
| 0.1 | 0.3 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
| 0.1 | 0.2 | GO:0038033 | positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) |
| 0.1 | 0.5 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
| 0.1 | 0.1 | GO:0010833 | telomere maintenance via telomere lengthening(GO:0010833) |
| 0.1 | 0.2 | GO:0009443 | pyridoxal 5'-phosphate salvage(GO:0009443) |
| 0.1 | 0.7 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
| 0.1 | 1.4 | GO:0000729 | DNA double-strand break processing(GO:0000729) |
| 0.1 | 0.3 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.1 | 0.2 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.1 | 0.8 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.1 | 0.2 | GO:1904247 | positive regulation of polynucleotide adenylyltransferase activity(GO:1904247) |
| 0.1 | 0.1 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
| 0.1 | 0.1 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
| 0.1 | 0.3 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.1 | 0.1 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
| 0.1 | 2.2 | GO:0043403 | skeletal muscle tissue regeneration(GO:0043403) |
| 0.1 | 0.4 | GO:0042797 | 5S class rRNA transcription from RNA polymerase III type 1 promoter(GO:0042791) tRNA transcription from RNA polymerase III promoter(GO:0042797) |
| 0.1 | 0.3 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.1 | 0.3 | GO:1902962 | regulation of metalloendopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902962) negative regulation of metalloendopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902963) |
| 0.1 | 7.5 | GO:0019886 | antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
| 0.1 | 0.3 | GO:0046439 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
| 0.1 | 0.4 | GO:0021542 | dentate gyrus development(GO:0021542) |
| 0.1 | 0.1 | GO:0051255 | spindle midzone assembly(GO:0051255) |
| 0.1 | 2.0 | GO:0035456 | response to interferon-beta(GO:0035456) |
| 0.1 | 0.7 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.1 | 0.4 | GO:0006294 | nucleotide-excision repair, preincision complex assembly(GO:0006294) |
| 0.1 | 0.3 | GO:0048625 | myoblast fate commitment(GO:0048625) |
| 0.1 | 1.0 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
| 0.1 | 0.3 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
| 0.1 | 0.9 | GO:1903204 | negative regulation of oxidative stress-induced neuron death(GO:1903204) |
| 0.1 | 0.2 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
| 0.1 | 0.2 | GO:0017186 | peptidyl-pyroglutamic acid biosynthetic process, using glutaminyl-peptide cyclotransferase(GO:0017186) |
| 0.1 | 0.1 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
| 0.1 | 0.1 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
| 0.1 | 0.3 | GO:0000070 | mitotic sister chromatid segregation(GO:0000070) |
| 0.1 | 0.4 | GO:0033138 | positive regulation of peptidyl-serine phosphorylation(GO:0033138) |
| 0.1 | 0.1 | GO:0000469 | cleavage involved in rRNA processing(GO:0000469) |
| 0.1 | 0.3 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.1 | 0.3 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.1 | 0.3 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.1 | 0.1 | GO:0090135 | actin filament branching(GO:0090135) |
| 0.1 | 1.0 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.1 | 0.6 | GO:0046676 | negative regulation of insulin secretion(GO:0046676) |
| 0.1 | 0.1 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 0.1 | 1.9 | GO:0032007 | negative regulation of TOR signaling(GO:0032007) |
| 0.1 | 0.6 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.1 | 0.1 | GO:1902023 | L-arginine transport(GO:1902023) |
| 0.1 | 0.1 | GO:0006338 | chromatin remodeling(GO:0006338) |
| 0.1 | 0.1 | GO:0010765 | positive regulation of sodium ion transport(GO:0010765) |
| 0.1 | 0.5 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.1 | 0.5 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.1 | 0.2 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.1 | 1.2 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.1 | 0.5 | GO:0070970 | interleukin-2 secretion(GO:0070970) |
| 0.1 | 0.1 | GO:0071214 | cellular response to abiotic stimulus(GO:0071214) |
| 0.1 | 0.4 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.1 | 0.2 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
| 0.1 | 0.7 | GO:1904424 | regulation of GTP binding(GO:1904424) |
| 0.1 | 0.5 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.1 | 0.2 | GO:0016925 | protein sumoylation(GO:0016925) |
| 0.1 | 0.2 | GO:0035573 | N-terminal protein amino acid methylation(GO:0006480) N-terminal peptidyl-alanine methylation(GO:0018011) N-terminal peptidyl-alanine trimethylation(GO:0018012) N-terminal peptidyl-glycine methylation(GO:0018013) N-terminal peptidyl-proline dimethylation(GO:0018016) peptidyl-alanine modification(GO:0018194) N-terminal peptidyl-proline methylation(GO:0035568) N-terminal peptidyl-serine methylation(GO:0035570) N-terminal peptidyl-serine dimethylation(GO:0035572) N-terminal peptidyl-serine trimethylation(GO:0035573) |
| 0.1 | 0.1 | GO:0035872 | nucleotide-binding domain, leucine rich repeat containing receptor signaling pathway(GO:0035872) |
| 0.1 | 0.4 | GO:0048630 | skeletal muscle tissue growth(GO:0048630) |
| 0.1 | 0.3 | GO:0032099 | negative regulation of response to food(GO:0032096) negative regulation of appetite(GO:0032099) |
| 0.1 | 0.2 | GO:0006740 | NADPH regeneration(GO:0006740) |
| 0.1 | 0.3 | GO:0070269 | pyroptosis(GO:0070269) |
| 0.1 | 0.1 | GO:0002042 | cell migration involved in sprouting angiogenesis(GO:0002042) |
| 0.1 | 1.1 | GO:0045663 | positive regulation of myoblast differentiation(GO:0045663) |
| 0.1 | 0.1 | GO:0006221 | pyrimidine nucleotide biosynthetic process(GO:0006221) |
| 0.1 | 0.1 | GO:0036496 | regulation of translational initiation by eIF2 alpha dephosphorylation(GO:0036496) |
| 0.1 | 0.2 | GO:0048254 | snoRNA localization(GO:0048254) |
| 0.1 | 0.2 | GO:1990441 | negative regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990441) |
| 0.1 | 0.3 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.1 | 0.2 | GO:0086053 | AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
| 0.1 | 0.3 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
| 0.1 | 1.9 | GO:0007052 | mitotic spindle organization(GO:0007052) |
| 0.1 | 0.1 | GO:0048749 | compound eye development(GO:0048749) |
| 0.1 | 0.1 | GO:0010665 | regulation of cardiac muscle cell apoptotic process(GO:0010665) |
| 0.1 | 0.2 | GO:0061624 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) |
| 0.1 | 0.1 | GO:0070671 | response to interleukin-12(GO:0070671) |
| 0.1 | 0.6 | GO:0031087 | deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.1 | 1.9 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.1 | 0.1 | GO:0035494 | SNARE complex disassembly(GO:0035494) |
| 0.1 | 0.1 | GO:0001755 | neural crest cell migration(GO:0001755) |
| 0.1 | 0.2 | GO:0046946 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.1 | 0.3 | GO:0071426 | ribonucleoprotein complex export from nucleus(GO:0071426) |
| 0.1 | 0.3 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
| 0.1 | 0.2 | GO:2001295 | malonyl-CoA biosynthetic process(GO:2001295) |
| 0.1 | 0.2 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
| 0.1 | 0.6 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
| 0.1 | 0.2 | GO:0060752 | negative regulation of intestinal phytosterol absorption(GO:0010949) negative regulation of intestinal cholesterol absorption(GO:0045796) intestinal phytosterol absorption(GO:0060752) negative regulation of intestinal lipid absorption(GO:1904730) |
| 0.1 | 1.0 | GO:0051973 | positive regulation of telomerase activity(GO:0051973) |
| 0.1 | 0.2 | GO:0070914 | UV-damage excision repair(GO:0070914) |
| 0.1 | 0.4 | GO:0038092 | nodal signaling pathway(GO:0038092) |
| 0.1 | 0.3 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 0.1 | 0.1 | GO:2001027 | negative regulation of endothelial cell chemotaxis(GO:2001027) |
| 0.1 | 0.6 | GO:0008655 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
| 0.1 | 0.2 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 0.1 | 0.4 | GO:0032264 | IMP salvage(GO:0032264) |
| 0.1 | 1.6 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.1 | 0.6 | GO:1903206 | negative regulation of hydrogen peroxide-induced cell death(GO:1903206) |
| 0.1 | 0.1 | GO:0034113 | heterotypic cell-cell adhesion(GO:0034113) |
| 0.1 | 0.1 | GO:0015993 | molecular hydrogen transport(GO:0015993) |
| 0.1 | 0.3 | GO:1904886 | beta-catenin destruction complex disassembly(GO:1904886) |
| 0.1 | 0.7 | GO:0016024 | CDP-diacylglycerol biosynthetic process(GO:0016024) |
| 0.1 | 0.2 | GO:0034379 | very-low-density lipoprotein particle assembly(GO:0034379) |
| 0.1 | 2.3 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
| 0.1 | 0.2 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) |
| 0.1 | 0.1 | GO:0051290 | protein heterotetramerization(GO:0051290) |
| 0.1 | 0.7 | GO:0070203 | regulation of establishment of protein localization to telomere(GO:0070203) |
| 0.1 | 0.1 | GO:0018307 | enzyme active site formation(GO:0018307) |
| 0.1 | 0.6 | GO:0043555 | regulation of translation in response to stress(GO:0043555) |
| 0.1 | 0.2 | GO:2000437 | monocyte extravasation(GO:0035696) regulation of monocyte extravasation(GO:2000437) positive regulation of monocyte extravasation(GO:2000439) |
| 0.1 | 0.1 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 0.1 | 0.5 | GO:0021759 | globus pallidus development(GO:0021759) |
| 0.1 | 0.7 | GO:0019184 | glutathione biosynthetic process(GO:0006750) nonribosomal peptide biosynthetic process(GO:0019184) |
| 0.1 | 0.7 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.1 | 0.9 | GO:0044036 | cell wall macromolecule metabolic process(GO:0044036) cell wall organization or biogenesis(GO:0071554) |
| 0.1 | 0.2 | GO:0052422 | modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.1 | 0.1 | GO:1900154 | regulation of bone trabecula formation(GO:1900154) negative regulation of bone trabecula formation(GO:1900155) |
| 0.1 | 1.0 | GO:0046329 | negative regulation of JNK cascade(GO:0046329) |
| 0.1 | 0.5 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.1 | 0.2 | GO:1903899 | positive regulation of PERK-mediated unfolded protein response(GO:1903899) |
| 0.1 | 0.2 | GO:0051085 | chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.1 | 0.2 | GO:0036093 | male germ cell proliferation(GO:0002176) germ cell proliferation(GO:0036093) |
| 0.1 | 0.5 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.1 | 0.2 | GO:0009236 | cobalamin biosynthetic process(GO:0009236) |
| 0.1 | 0.2 | GO:0001777 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.1 | 0.2 | GO:0070902 | mitochondrial tRNA pseudouridine synthesis(GO:0070902) |
| 0.1 | 5.9 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.1 | 0.3 | GO:1901419 | regulation of response to alcohol(GO:1901419) |
| 0.1 | 0.1 | GO:0071360 | cellular response to exogenous dsRNA(GO:0071360) |
| 0.1 | 0.2 | GO:1904526 | regulation of microtubule binding(GO:1904526) |
| 0.1 | 0.7 | GO:0016574 | histone ubiquitination(GO:0016574) |
| 0.1 | 0.3 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
| 0.1 | 0.3 | GO:1902895 | positive regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902895) |
| 0.1 | 0.1 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.1 | 0.5 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.1 | 0.2 | GO:0032762 | mast cell cytokine production(GO:0032762) |
| 0.1 | 0.1 | GO:0010831 | positive regulation of myotube differentiation(GO:0010831) |
| 0.1 | 0.3 | GO:0045046 | protein import into peroxisome membrane(GO:0045046) |
| 0.1 | 0.1 | GO:0021626 | hindbrain maturation(GO:0021578) central nervous system maturation(GO:0021626) |
| 0.1 | 0.1 | GO:0070417 | cellular response to cold(GO:0070417) |
| 0.1 | 0.1 | GO:0021766 | hippocampus development(GO:0021766) |
| 0.1 | 0.1 | GO:0002541 | activation of plasma proteins involved in acute inflammatory response(GO:0002541) |
| 0.1 | 1.2 | GO:0021591 | ventricular system development(GO:0021591) |
| 0.1 | 0.3 | GO:0072141 | renal interstitial fibroblast development(GO:0072141) |
| 0.1 | 0.5 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.1 | 0.1 | GO:0097343 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
| 0.1 | 0.5 | GO:0035067 | negative regulation of histone acetylation(GO:0035067) |
| 0.1 | 0.2 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
| 0.1 | 0.2 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.1 | 0.6 | GO:0045329 | carnitine biosynthetic process(GO:0045329) |
| 0.1 | 0.1 | GO:1901550 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
| 0.1 | 0.3 | GO:1904977 | lymphatic endothelial cell migration(GO:1904977) |
| 0.1 | 0.1 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
| 0.1 | 0.2 | GO:0035246 | peptidyl-arginine N-methylation(GO:0035246) |
| 0.1 | 0.1 | GO:0001738 | morphogenesis of a polarized epithelium(GO:0001738) |
| 0.1 | 0.2 | GO:0038043 | interleukin-5-mediated signaling pathway(GO:0038043) |
| 0.1 | 0.2 | GO:0002829 | negative regulation of type 2 immune response(GO:0002829) |
| 0.1 | 0.5 | GO:0045793 | positive regulation of cell size(GO:0045793) |
| 0.1 | 0.1 | GO:0061180 | mammary gland epithelium development(GO:0061180) |
| 0.1 | 0.1 | GO:0072674 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.1 | 0.1 | GO:0034205 | beta-amyloid formation(GO:0034205) |
| 0.1 | 0.1 | GO:0022038 | corpus callosum development(GO:0022038) |
| 0.0 | 0.1 | GO:0003363 | lamellipodium assembly involved in ameboidal cell migration(GO:0003363) extension of a leading process involved in cell motility in cerebral cortex radial glia guided migration(GO:0021816) |
| 0.0 | 0.4 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
| 0.0 | 0.1 | GO:2001160 | histone H3-K79 methylation(GO:0034729) regulation of histone H3-K79 methylation(GO:2001160) positive regulation of histone H3-K79 methylation(GO:2001162) |
| 0.0 | 0.1 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.0 | 0.4 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
| 0.0 | 0.2 | GO:0032218 | riboflavin transport(GO:0032218) |
| 0.0 | 0.3 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.0 | 0.0 | GO:0040001 | establishment of mitotic spindle localization(GO:0040001) |
| 0.0 | 0.3 | GO:0043276 | anoikis(GO:0043276) |
| 0.0 | 0.0 | GO:0070350 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
| 0.0 | 0.1 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.0 | 0.0 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
| 0.0 | 0.8 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.0 | 0.0 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.0 | 0.1 | GO:1905244 | regulation of modification of synaptic structure(GO:1905244) |
| 0.0 | 0.2 | GO:0051205 | protein insertion into membrane(GO:0051205) |
| 0.0 | 0.6 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.0 | 0.4 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
| 0.0 | 0.0 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 0.0 | 0.0 | GO:0097026 | dendritic cell dendrite assembly(GO:0097026) |
| 0.0 | 2.4 | GO:0035329 | hippo signaling(GO:0035329) |
| 0.0 | 0.5 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
| 0.0 | 0.1 | GO:1904684 | negative regulation of metalloendopeptidase activity(GO:1904684) |
| 0.0 | 0.0 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) regulation of respiratory system process(GO:0044065) |
| 0.0 | 0.3 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 0.0 | 0.9 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.0 | 0.0 | GO:0015919 | peroxisomal membrane transport(GO:0015919) |
| 0.0 | 0.3 | GO:0090043 | tubulin deacetylation(GO:0090042) regulation of tubulin deacetylation(GO:0090043) |
| 0.0 | 0.0 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.0 | 1.0 | GO:0032012 | regulation of ARF protein signal transduction(GO:0032012) |
| 0.0 | 0.1 | GO:0048703 | embryonic viscerocranium morphogenesis(GO:0048703) |
| 0.0 | 0.2 | GO:0045646 | regulation of erythrocyte differentiation(GO:0045646) |
| 0.0 | 0.2 | GO:0014028 | notochord formation(GO:0014028) |
| 0.0 | 1.1 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.0 | 0.2 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.0 | 0.1 | GO:0044827 | modulation by host of viral genome replication(GO:0044827) positive regulation by host of viral genome replication(GO:0044829) |
| 0.0 | 0.0 | GO:0021896 | forebrain astrocyte differentiation(GO:0021896) forebrain astrocyte development(GO:0021897) |
| 0.0 | 0.2 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.0 | 0.0 | GO:0043144 | snoRNA processing(GO:0043144) |
| 0.0 | 0.5 | GO:1900038 | negative regulation of cellular response to hypoxia(GO:1900038) |
| 0.0 | 0.0 | GO:2000779 | regulation of double-strand break repair(GO:2000779) |
| 0.0 | 0.1 | GO:0046620 | regulation of organ growth(GO:0046620) |
| 0.0 | 0.2 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) |
| 0.0 | 0.2 | GO:0061741 | vacuolar transmembrane transport(GO:0034486) chaperone-mediated protein transport involved in chaperone-mediated autophagy(GO:0061741) |
| 0.0 | 0.3 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
| 0.0 | 0.4 | GO:0019827 | stem cell population maintenance(GO:0019827) |
| 0.0 | 0.4 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
| 0.0 | 2.3 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
| 0.0 | 0.1 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.0 | 0.3 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.0 | 0.1 | GO:0001180 | transcription initiation from RNA polymerase I promoter for nuclear large rRNA transcript(GO:0001180) |
| 0.0 | 0.5 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.0 | 0.1 | GO:0003150 | muscular septum morphogenesis(GO:0003150) cardiac fibroblast cell differentiation(GO:0060935) cardiac fibroblast cell development(GO:0060936) epicardium-derived cardiac fibroblast cell differentiation(GO:0060938) epicardium-derived cardiac fibroblast cell development(GO:0060939) |
| 0.0 | 0.0 | GO:0051414 | response to cortisol(GO:0051414) |
| 0.0 | 0.4 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
| 0.0 | 0.0 | GO:0071106 | coenzyme A transport(GO:0015880) coenzyme A transmembrane transport(GO:0035349) adenosine 3',5'-bisphosphate transmembrane transport(GO:0071106) AMP transport(GO:0080121) |
| 0.0 | 1.2 | GO:0032392 | DNA geometric change(GO:0032392) |
| 0.0 | 0.0 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
| 0.0 | 0.0 | GO:0060964 | regulation of gene silencing by miRNA(GO:0060964) |
| 0.0 | 0.2 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
| 0.0 | 0.3 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.0 | 0.1 | GO:0034144 | negative regulation of toll-like receptor 4 signaling pathway(GO:0034144) |
| 0.0 | 1.9 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.0 | 0.3 | GO:1901739 | regulation of myoblast fusion(GO:1901739) |
| 0.0 | 0.0 | GO:0090036 | regulation of protein kinase C signaling(GO:0090036) |
| 0.0 | 0.4 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.0 | 0.2 | GO:0046321 | positive regulation of fatty acid oxidation(GO:0046321) |
| 0.0 | 0.2 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.0 | 0.3 | GO:0035306 | positive regulation of dephosphorylation(GO:0035306) positive regulation of protein dephosphorylation(GO:0035307) |
| 0.0 | 0.2 | GO:1903432 | regulation of TORC1 signaling(GO:1903432) |
| 0.0 | 0.1 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
| 0.0 | 0.2 | GO:0048569 | post-embryonic organ development(GO:0048569) |
| 0.0 | 0.3 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.0 | 0.0 | GO:0030223 | neutrophil differentiation(GO:0030223) |
| 0.0 | 0.1 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
| 0.0 | 0.2 | GO:0009048 | dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.0 | 0.2 | GO:0010730 | negative regulation of hydrogen peroxide biosynthetic process(GO:0010730) |
| 0.0 | 0.0 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.0 | 0.2 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
| 0.0 | 1.2 | GO:1904837 | beta-catenin-TCF complex assembly(GO:1904837) |
| 0.0 | 0.0 | GO:0097485 | neuron projection guidance(GO:0097485) |
| 0.0 | 0.5 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.0 | 0.0 | GO:0010621 | negative regulation of transcription by transcription factor localization(GO:0010621) |
| 0.0 | 0.1 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
| 0.0 | 0.2 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
| 0.0 | 0.6 | GO:0070734 | histone H3-K27 methylation(GO:0070734) |
| 0.0 | 0.1 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.0 | 0.1 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.0 | 0.5 | GO:0036376 | sodium ion export from cell(GO:0036376) |
| 0.0 | 0.3 | GO:0010259 | multicellular organism aging(GO:0010259) |
| 0.0 | 0.1 | GO:0071449 | cellular response to lipid hydroperoxide(GO:0071449) |
| 0.0 | 0.1 | GO:1901202 | negative regulation of extracellular matrix assembly(GO:1901202) |
| 0.0 | 0.0 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.0 | 0.4 | GO:0002181 | cytoplasmic translation(GO:0002181) |
| 0.0 | 0.0 | GO:0042994 | cytoplasmic sequestering of transcription factor(GO:0042994) |
| 0.0 | 0.7 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
| 0.0 | 0.3 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.0 | 0.2 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.0 | 0.1 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
| 0.0 | 0.2 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 0.0 | 0.0 | GO:0046087 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
| 0.0 | 0.9 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.0 | 0.1 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.0 | 0.3 | GO:0030210 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.0 | 0.0 | GO:0045950 | negative regulation of mitotic recombination(GO:0045950) |
| 0.0 | 0.5 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.0 | 0.1 | GO:0019085 | early viral transcription(GO:0019085) |
| 0.0 | 0.5 | GO:0031441 | negative regulation of mRNA 3'-end processing(GO:0031441) |
| 0.0 | 0.1 | GO:0061289 | cell-cell signaling involved in kidney development(GO:0060995) Wnt signaling pathway involved in kidney development(GO:0061289) canonical Wnt signaling pathway involved in metanephric kidney development(GO:0061290) cell-cell signaling involved in metanephros development(GO:0072204) |
| 0.0 | 0.2 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.0 | 0.1 | GO:0002638 | negative regulation of immunoglobulin production(GO:0002638) |
| 0.0 | 0.9 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 0.0 | 0.2 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.0 | 0.1 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.0 | 0.1 | GO:0044849 | estrous cycle(GO:0044849) |
| 0.0 | 0.1 | GO:1904046 | negative regulation of vascular endothelial growth factor production(GO:1904046) |
| 0.0 | 0.4 | GO:0060155 | platelet dense granule organization(GO:0060155) |
| 0.0 | 0.0 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.0 | 0.2 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.0 | 0.7 | GO:2000144 | positive regulation of DNA-templated transcription, initiation(GO:2000144) |
| 0.0 | 0.2 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
| 0.0 | 0.5 | GO:0006782 | protoporphyrinogen IX biosynthetic process(GO:0006782) |
| 0.0 | 0.1 | GO:0051541 | elastin metabolic process(GO:0051541) |
| 0.0 | 0.0 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.0 | 0.1 | GO:0090224 | regulation of spindle organization(GO:0090224) |
| 0.0 | 0.3 | GO:0032472 | Golgi calcium ion transport(GO:0032472) |
| 0.0 | 0.2 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.0 | 1.4 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.0 | 0.2 | GO:0042357 | thiamine diphosphate metabolic process(GO:0042357) |
| 0.0 | 0.2 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.0 | 0.7 | GO:0043476 | pigment accumulation(GO:0043476) cellular pigment accumulation(GO:0043482) |
| 0.0 | 0.1 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
| 0.0 | 0.1 | GO:0071467 | cellular response to pH(GO:0071467) |
| 0.0 | 0.8 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
| 0.0 | 0.6 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
| 0.0 | 0.2 | GO:0048817 | negative regulation of hair follicle maturation(GO:0048817) |
| 0.0 | 0.0 | GO:0046519 | sphingoid metabolic process(GO:0046519) |
| 0.0 | 0.1 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.0 | 0.0 | GO:0038183 | bile acid signaling pathway(GO:0038183) |
| 0.0 | 0.3 | GO:0007207 | phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 0.0 | 0.1 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.0 | 0.3 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.0 | 0.2 | GO:2000855 | mineralocorticoid secretion(GO:0035931) aldosterone secretion(GO:0035932) regulation of mineralocorticoid secretion(GO:2000855) regulation of aldosterone secretion(GO:2000858) |
| 0.0 | 2.5 | GO:0008033 | tRNA processing(GO:0008033) |
| 0.0 | 0.1 | GO:0010002 | cardioblast differentiation(GO:0010002) |
| 0.0 | 0.6 | GO:0003334 | keratinocyte development(GO:0003334) |
| 0.0 | 0.2 | GO:0001550 | ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.0 | 0.1 | GO:0032610 | interleukin-1 alpha production(GO:0032610) |
| 0.0 | 0.4 | GO:0035437 | maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.0 | 1.6 | GO:0043966 | histone H3 acetylation(GO:0043966) |
| 0.0 | 0.3 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.0 | 0.1 | GO:1903352 | L-ornithine transmembrane transport(GO:1903352) |
| 0.0 | 0.0 | GO:0006529 | asparagine biosynthetic process(GO:0006529) |
| 0.0 | 2.7 | GO:0002223 | stimulatory C-type lectin receptor signaling pathway(GO:0002223) |
| 0.0 | 0.1 | GO:0033121 | regulation of cyclic nucleotide catabolic process(GO:0030805) regulation of cAMP catabolic process(GO:0030820) regulation of purine nucleotide catabolic process(GO:0033121) |
| 0.0 | 0.1 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.0 | 0.6 | GO:0046825 | regulation of protein export from nucleus(GO:0046825) |
| 0.0 | 0.4 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.0 | 0.1 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) |
| 0.0 | 0.1 | GO:1905229 | cellular response to glycoprotein(GO:1904588) cellular response to thyrotropin-releasing hormone(GO:1905229) |
| 0.0 | 0.7 | GO:0051260 | protein homooligomerization(GO:0051260) |
| 0.0 | 0.0 | GO:0051792 | medium-chain fatty acid biosynthetic process(GO:0051792) |
| 0.0 | 0.1 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.0 | 0.1 | GO:0070861 | regulation of protein exit from endoplasmic reticulum(GO:0070861) positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
| 0.0 | 0.3 | GO:0086024 | adrenergic receptor signaling pathway involved in positive regulation of heart rate(GO:0086024) |
| 0.0 | 0.2 | GO:0031179 | peptide amidation(GO:0001519) peptide modification(GO:0031179) |
| 0.0 | 0.0 | GO:1901798 | positive regulation of signal transduction by p53 class mediator(GO:1901798) |
| 0.0 | 0.0 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.0 | 0.6 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.0 | 0.0 | GO:0048664 | neuron fate determination(GO:0048664) |
| 0.0 | 0.0 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.0 | 0.0 | GO:0032755 | positive regulation of interleukin-6 production(GO:0032755) |
| 0.0 | 0.0 | GO:0050787 | detoxification of mercury ion(GO:0050787) |
| 0.0 | 0.1 | GO:0002528 | regulation of vascular permeability involved in acute inflammatory response(GO:0002528) sarcomerogenesis(GO:0048769) |
| 0.0 | 0.1 | GO:0009956 | radial pattern formation(GO:0009956) |
| 0.0 | 0.1 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
| 0.0 | 0.0 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
| 0.0 | 0.1 | GO:0002578 | negative regulation of antigen processing and presentation(GO:0002578) |
| 0.0 | 0.4 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.0 | 0.2 | GO:1902267 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
| 0.0 | 0.2 | GO:2000425 | regulation of apoptotic cell clearance(GO:2000425) positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.0 | 0.1 | GO:0007343 | egg activation(GO:0007343) |
| 0.0 | 0.1 | GO:0019566 | arabinose metabolic process(GO:0019566) L-arabinose metabolic process(GO:0046373) |
| 0.0 | 0.6 | GO:1902603 | carnitine transmembrane transport(GO:1902603) |
| 0.0 | 0.0 | GO:0000098 | sulfur amino acid catabolic process(GO:0000098) |
| 0.0 | 0.0 | GO:0098905 | regulation of bundle of His cell action potential(GO:0098905) |
| 0.0 | 1.1 | GO:1902807 | negative regulation of cell cycle G1/S phase transition(GO:1902807) |
| 0.0 | 1.4 | GO:0007062 | sister chromatid cohesion(GO:0007062) |
| 0.0 | 0.1 | GO:0006711 | estrogen catabolic process(GO:0006711) |
| 0.0 | 2.9 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.0 | 0.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.0 | 0.5 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
| 0.0 | 0.3 | GO:0097577 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.0 | 0.1 | GO:0006743 | ubiquinone metabolic process(GO:0006743) |
| 0.0 | 0.6 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
| 0.0 | 0.0 | GO:0060038 | cardiac muscle cell proliferation(GO:0060038) |
| 0.0 | 0.2 | GO:0002385 | mucosal immune response(GO:0002385) |
| 0.0 | 0.2 | GO:0002088 | lens development in camera-type eye(GO:0002088) |
| 0.0 | 0.3 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.0 | 0.0 | GO:1903170 | negative regulation of calcium ion transmembrane transport(GO:1903170) |
| 0.0 | 0.0 | GO:0021764 | amygdala development(GO:0021764) |
| 0.0 | 0.2 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
| 0.0 | 0.1 | GO:0000278 | mitotic cell cycle(GO:0000278) |
| 0.0 | 0.3 | GO:0002480 | antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
| 0.0 | 0.0 | GO:0014719 | skeletal muscle satellite cell activation(GO:0014719) |
| 0.0 | 0.1 | GO:0032495 | response to muramyl dipeptide(GO:0032495) |
| 0.0 | 0.1 | GO:1990418 | response to insulin-like growth factor stimulus(GO:1990418) |
| 0.0 | 0.5 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
| 0.0 | 0.0 | GO:1904395 | positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
| 0.0 | 0.3 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) |
| 0.0 | 0.8 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
| 0.0 | 0.3 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
| 0.0 | 0.1 | GO:0046833 | positive regulation of RNA export from nucleus(GO:0046833) |
| 0.0 | 0.1 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
| 0.0 | 0.1 | GO:0002268 | follicular dendritic cell differentiation(GO:0002268) |
| 0.0 | 0.6 | GO:0045671 | negative regulation of osteoclast differentiation(GO:0045671) |
| 0.0 | 0.2 | GO:0032925 | regulation of activin receptor signaling pathway(GO:0032925) |
| 0.0 | 0.2 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.0 | 0.2 | GO:1903412 | response to bile acid(GO:1903412) |
| 0.0 | 0.2 | GO:1901318 | negative regulation of sperm motility(GO:1901318) |
| 0.0 | 0.3 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
| 0.0 | 0.1 | GO:0042822 | pyridoxal phosphate metabolic process(GO:0042822) |
| 0.0 | 0.1 | GO:0044854 | plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) |
| 0.0 | 0.1 | GO:0006780 | uroporphyrinogen III biosynthetic process(GO:0006780) uroporphyrinogen III metabolic process(GO:0046502) |
| 0.0 | 0.2 | GO:0032230 | positive regulation of synaptic transmission, GABAergic(GO:0032230) |
| 0.0 | 0.6 | GO:0008228 | opsonization(GO:0008228) |
| 0.0 | 0.2 | GO:1900025 | negative regulation of substrate adhesion-dependent cell spreading(GO:1900025) |
| 0.0 | 0.1 | GO:0035493 | SNARE complex assembly(GO:0035493) |
| 0.0 | 0.5 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.0 | 0.2 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
| 0.0 | 0.0 | GO:1900449 | regulation of glutamate receptor signaling pathway(GO:1900449) |
| 0.0 | 0.0 | GO:0035150 | regulation of tube size(GO:0035150) regulation of blood vessel size(GO:0050880) |
| 0.0 | 0.1 | GO:0033119 | negative regulation of RNA splicing(GO:0033119) |
| 0.0 | 0.2 | GO:0006289 | nucleotide-excision repair(GO:0006289) |
| 0.0 | 0.1 | GO:0071850 | mitotic cell cycle arrest(GO:0071850) |
| 0.0 | 0.5 | GO:0071498 | cellular response to fluid shear stress(GO:0071498) |
| 0.0 | 0.4 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
| 0.0 | 0.0 | GO:0046040 | IMP metabolic process(GO:0046040) |
| 0.0 | 0.0 | GO:0010916 | regulation of very-low-density lipoprotein particle clearance(GO:0010915) negative regulation of very-low-density lipoprotein particle clearance(GO:0010916) |
| 0.0 | 1.4 | GO:0009060 | aerobic respiration(GO:0009060) |
| 0.0 | 0.0 | GO:0010159 | specification of organ position(GO:0010159) |
| 0.0 | 0.1 | GO:0040023 | establishment of nucleus localization(GO:0040023) |
| 0.0 | 0.4 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
| 0.0 | 0.3 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
| 0.0 | 0.2 | GO:0072502 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.0 | 0.0 | GO:0072604 | interleukin-6 secretion(GO:0072604) |
| 0.0 | 0.1 | GO:0032470 | positive regulation of endoplasmic reticulum calcium ion concentration(GO:0032470) |
| 0.0 | 0.0 | GO:0050653 | chondroitin sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0050653) |
| 0.0 | 0.4 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
| 0.0 | 0.0 | GO:0051409 | response to nitrosative stress(GO:0051409) |
| 0.0 | 0.1 | GO:0046689 | response to mercury ion(GO:0046689) |
| 0.0 | 0.6 | GO:0032434 | regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032434) |
| 0.0 | 0.1 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.0 | 0.1 | GO:0097475 | motor neuron migration(GO:0097475) |
| 0.0 | 2.0 | GO:0032436 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032436) |
| 0.0 | 0.0 | GO:0000454 | snoRNA guided rRNA pseudouridine synthesis(GO:0000454) |
| 0.0 | 0.1 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.0 | 0.0 | GO:0051097 | negative regulation of helicase activity(GO:0051097) |
| 0.0 | 0.0 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
| 0.0 | 0.3 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.0 | 0.1 | GO:0052472 | modulation by host of viral transcription(GO:0043921) modulation by host of symbiont transcription(GO:0052472) |
| 0.0 | 0.1 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
| 0.0 | 1.4 | GO:0030521 | androgen receptor signaling pathway(GO:0030521) |
| 0.0 | 0.1 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
| 0.0 | 0.3 | GO:0018202 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) peptidyl-histidine modification(GO:0018202) |
| 0.0 | 0.2 | GO:0046618 | drug export(GO:0046618) |
| 0.0 | 0.0 | GO:0032922 | circadian regulation of gene expression(GO:0032922) |
| 0.0 | 0.0 | GO:0016240 | autophagosome docking(GO:0016240) |
| 0.0 | 0.1 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.0 | 0.0 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
| 0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
| 0.0 | 0.1 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) |
| 0.0 | 0.2 | GO:0045579 | positive regulation of B cell differentiation(GO:0045579) |
| 0.0 | 0.2 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.0 | 0.2 | GO:0038202 | TORC1 signaling(GO:0038202) |
| 0.0 | 0.1 | GO:0042264 | peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.0 | 0.0 | GO:0006014 | D-ribose metabolic process(GO:0006014) |
| 0.0 | 0.1 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
| 0.0 | 0.1 | GO:0009452 | 7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
| 0.0 | 0.1 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.0 | 0.2 | GO:0071569 | protein ufmylation(GO:0071569) |
| 0.0 | 0.1 | GO:0006226 | dUMP biosynthetic process(GO:0006226) |
| 0.0 | 0.1 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.0 | 0.4 | GO:0031629 | synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
| 0.0 | 0.3 | GO:0009642 | response to light intensity(GO:0009642) |
| 0.0 | 0.3 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
| 0.0 | 0.3 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.0 | 0.1 | GO:0016334 | morphogenesis of follicular epithelium(GO:0016333) establishment or maintenance of polarity of follicular epithelium(GO:0016334) establishment of planar polarity of follicular epithelium(GO:0042247) |
| 0.0 | 0.1 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
| 0.0 | 1.8 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.0 | 0.3 | GO:0009303 | rRNA transcription(GO:0009303) |
| 0.0 | 0.6 | GO:0000281 | mitotic cytokinesis(GO:0000281) |
| 0.0 | 0.2 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.0 | 0.2 | GO:0015811 | L-cystine transport(GO:0015811) |
| 0.0 | 0.0 | GO:0048840 | otolith development(GO:0048840) |
| 0.0 | 0.1 | GO:0009886 | post-embryonic morphogenesis(GO:0009886) |
| 0.0 | 0.5 | GO:0001510 | RNA methylation(GO:0001510) |
| 0.0 | 0.1 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
| 0.0 | 0.1 | GO:0071679 | commissural neuron axon guidance(GO:0071679) |
| 0.0 | 0.0 | GO:0040020 | regulation of meiotic nuclear division(GO:0040020) |
| 0.0 | 0.1 | GO:0002276 | basophil activation involved in immune response(GO:0002276) |
| 0.0 | 0.1 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
| 0.0 | 0.1 | GO:0090662 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
| 0.0 | 0.0 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
| 0.0 | 0.0 | GO:1903727 | positive regulation of phospholipid metabolic process(GO:1903727) |
| 0.0 | 0.1 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.0 | 0.1 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
| 0.0 | 0.0 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.0 | 0.1 | GO:1903385 | regulation of homophilic cell adhesion(GO:1903385) |
| 0.0 | 0.1 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
| 0.0 | 0.2 | GO:1990034 | calcium ion export from cell(GO:1990034) |
| 0.0 | 0.1 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.0 | 0.0 | GO:1904996 | positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 0.0 | 0.1 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
| 0.0 | 0.7 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
| 0.0 | 0.1 | GO:0030219 | megakaryocyte differentiation(GO:0030219) |
| 0.0 | 0.2 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.0 | 0.2 | GO:2000786 | positive regulation of vacuole organization(GO:0044090) positive regulation of autophagosome assembly(GO:2000786) |
| 0.0 | 0.1 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) |
| 0.0 | 0.0 | GO:0021514 | ventral spinal cord interneuron differentiation(GO:0021514) ventral spinal cord interneuron fate commitment(GO:0060579) cell fate commitment involved in pattern specification(GO:0060581) |
| 0.0 | 0.1 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.0 | 0.2 | GO:0033046 | negative regulation of sister chromatid segregation(GO:0033046) |
| 0.0 | 0.4 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 0.0 | 0.1 | GO:0014854 | response to inactivity(GO:0014854) |
| 0.0 | 0.0 | GO:0060967 | negative regulation of posttranscriptional gene silencing(GO:0060149) negative regulation of gene silencing by RNA(GO:0060967) |
| 0.0 | 0.1 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
| 0.0 | 0.0 | GO:1901536 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
| 0.0 | 0.1 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) glycosylceramide biosynthetic process(GO:0046476) |
| 0.0 | 0.1 | GO:0019427 | acetate biosynthetic process(GO:0019413) acetyl-CoA biosynthetic process from acetate(GO:0019427) propionate metabolic process(GO:0019541) propionate biosynthetic process(GO:0019542) |
| 0.0 | 0.2 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
| 0.0 | 0.0 | GO:0030505 | inorganic diphosphate transport(GO:0030505) |
| 0.0 | 0.1 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
| 0.0 | 0.0 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
| 0.0 | 0.1 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
| 0.0 | 0.0 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
| 0.0 | 0.0 | GO:0030262 | apoptotic nuclear changes(GO:0030262) |
| 0.0 | 0.7 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.0 | 0.2 | GO:0006972 | hyperosmotic response(GO:0006972) |
| 0.0 | 0.1 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.0 | 0.0 | GO:0051653 | spindle localization(GO:0051653) |
| 0.0 | 0.1 | GO:0036010 | protein localization to endosome(GO:0036010) |
| 0.0 | 0.2 | GO:2000300 | regulation of synaptic vesicle exocytosis(GO:2000300) |
| 0.0 | 0.0 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
| 0.0 | 0.2 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
| 0.0 | 0.1 | GO:0060313 | negative regulation of neutrophil degranulation(GO:0043314) negative regulation of blood vessel remodeling(GO:0060313) |
| 0.0 | 0.1 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.0 | 0.3 | GO:0015682 | ferric iron transport(GO:0015682) trivalent inorganic cation transport(GO:0072512) |
| 0.0 | 0.0 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.0 | 0.0 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
| 0.0 | 0.0 | GO:0035066 | positive regulation of histone acetylation(GO:0035066) |
| 0.0 | 0.4 | GO:0048246 | macrophage chemotaxis(GO:0048246) |
| 0.0 | 0.4 | GO:0014904 | myotube cell development(GO:0014904) |
| 0.0 | 0.2 | GO:0070293 | renal absorption(GO:0070293) |
| 0.0 | 0.0 | GO:0051866 | general adaptation syndrome(GO:0051866) |
| 0.0 | 0.0 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
| 0.0 | 0.0 | GO:1904139 | microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) |
| 0.0 | 0.1 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.0 | 0.3 | GO:0045634 | regulation of melanocyte differentiation(GO:0045634) regulation of pigment cell differentiation(GO:0050932) |
| 0.0 | 0.1 | GO:0032785 | negative regulation of DNA-templated transcription, elongation(GO:0032785) |
| 0.0 | 0.0 | GO:0030432 | peristalsis(GO:0030432) |
| 0.0 | 0.1 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
| 0.0 | 0.0 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
| 0.0 | 0.3 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.0 | 0.8 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
| 0.0 | 0.3 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
| 0.0 | 0.0 | GO:0016049 | cell growth(GO:0016049) |
| 0.0 | 0.8 | GO:0001580 | detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
| 0.0 | 0.1 | GO:0060390 | regulation of SMAD protein import into nucleus(GO:0060390) |
| 0.0 | 0.1 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.0 | 0.1 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
| 0.0 | 1.0 | GO:0030032 | lamellipodium assembly(GO:0030032) |
| 0.0 | 0.6 | GO:0006699 | bile acid biosynthetic process(GO:0006699) |
| 0.0 | 0.1 | GO:1901142 | insulin metabolic process(GO:1901142) |
| 0.0 | 0.1 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
| 0.0 | 0.2 | GO:0045048 | protein insertion into ER membrane(GO:0045048) |
| 0.0 | 0.4 | GO:1904031 | positive regulation of cyclin-dependent protein kinase activity(GO:1904031) |
| 0.0 | 0.4 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
| 0.0 | 0.4 | GO:0006359 | regulation of transcription from RNA polymerase III promoter(GO:0006359) |
| 0.0 | 1.3 | GO:1903749 | positive regulation of establishment of protein localization to mitochondrion(GO:1903749) |
| 0.0 | 0.2 | GO:0050711 | negative regulation of interleukin-1 secretion(GO:0050711) |
| 0.0 | 0.0 | GO:0034033 | nucleoside bisphosphate biosynthetic process(GO:0033866) ribonucleoside bisphosphate biosynthetic process(GO:0034030) purine nucleoside bisphosphate biosynthetic process(GO:0034033) |
| 0.0 | 0.0 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.0 | 0.1 | GO:0046462 | monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.0 | 0.3 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
| 0.0 | 0.0 | GO:0010508 | positive regulation of autophagy(GO:0010508) |
| 0.0 | 0.0 | GO:0006561 | proline biosynthetic process(GO:0006561) |
| 0.0 | 0.1 | GO:0048706 | embryonic skeletal system development(GO:0048706) |
| 0.0 | 0.4 | GO:0010803 | regulation of tumor necrosis factor-mediated signaling pathway(GO:0010803) |
| 0.0 | 0.1 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.0 | 0.1 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.0 | 0.1 | GO:0070307 | lens fiber cell development(GO:0070307) |
| 0.0 | 0.1 | GO:0044728 | DNA methylation or demethylation(GO:0044728) |
| 0.0 | 0.1 | GO:0045835 | negative regulation of meiotic nuclear division(GO:0045835) |
| 0.0 | 0.1 | GO:0001315 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 0.0 | 0.0 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.0 | 0.1 | GO:0048845 | venous blood vessel morphogenesis(GO:0048845) |
| 0.0 | 0.1 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.0 | 0.0 | GO:0002024 | diet induced thermogenesis(GO:0002024) |
| 0.0 | 1.0 | GO:0042787 | protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0042787) |
| 0.0 | 0.1 | GO:0034138 | toll-like receptor 3 signaling pathway(GO:0034138) |
| 0.0 | 0.1 | GO:0042492 | gamma-delta T cell differentiation(GO:0042492) |
| 0.0 | 0.0 | GO:0034135 | regulation of toll-like receptor 2 signaling pathway(GO:0034135) |
| 0.0 | 0.4 | GO:0006986 | response to unfolded protein(GO:0006986) |
| 0.0 | 0.1 | GO:0019054 | modulation by virus of host process(GO:0019054) |
| 0.0 | 0.0 | GO:0022615 | protein to membrane docking(GO:0022615) |
| 0.0 | 0.1 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.0 | 0.4 | GO:0001578 | microtubule bundle formation(GO:0001578) |
| 0.0 | 0.1 | GO:0090156 | cellular sphingolipid homeostasis(GO:0090156) |
| 0.0 | 0.0 | GO:0060736 | prostate gland growth(GO:0060736) |
| 0.0 | 0.1 | GO:0035547 | interferon-beta secretion(GO:0035546) regulation of interferon-beta secretion(GO:0035547) |
| 0.0 | 0.1 | GO:0080171 | lysosome organization(GO:0007040) lytic vacuole organization(GO:0080171) |
| 0.0 | 0.1 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
| 0.0 | 0.1 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
| 0.0 | 0.0 | GO:1901656 | glycoside transport(GO:1901656) |
| 0.0 | 0.1 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
| 0.0 | 0.1 | GO:1903018 | regulation of glycoprotein metabolic process(GO:1903018) |
| 0.0 | 0.1 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.0 | 0.1 | GO:0098927 | vesicle-mediated transport between endosomal compartments(GO:0098927) |
| 0.0 | 0.1 | GO:0061092 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.0 | 0.0 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
| 0.0 | 0.2 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
| 0.0 | 0.1 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.0 | 0.1 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.0 | 0.1 | GO:0060347 | heart trabecula formation(GO:0060347) |
| 0.0 | 0.3 | GO:0002076 | osteoblast development(GO:0002076) |
| 0.0 | 0.2 | GO:0031935 | regulation of chromatin silencing(GO:0031935) |
| 0.0 | 0.1 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.0 | 0.1 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
| 0.0 | 0.0 | GO:0051598 | meiotic recombination checkpoint(GO:0051598) |
| 0.0 | 0.1 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.0 | 0.0 | GO:0009405 | pathogenesis(GO:0009405) |
| 0.0 | 0.0 | GO:0051547 | regulation of keratinocyte migration(GO:0051547) |
| 0.0 | 0.0 | GO:0000730 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.0 | 0.0 | GO:0035674 | tricarboxylic acid transmembrane transport(GO:0035674) |
| 0.0 | 0.0 | GO:0007588 | excretion(GO:0007588) |
| 0.0 | 0.0 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.0 | 0.4 | GO:0034389 | lipid particle organization(GO:0034389) |
| 0.0 | 0.1 | GO:0051560 | mitochondrial calcium ion homeostasis(GO:0051560) |
| 0.0 | 0.1 | GO:0009125 | nucleoside monophosphate catabolic process(GO:0009125) |
| 0.0 | 0.2 | GO:0043631 | mRNA polyadenylation(GO:0006378) RNA polyadenylation(GO:0043631) |
| 0.0 | 0.0 | GO:0043105 | regulation of GTP cyclohydrolase I activity(GO:0043095) negative regulation of GTP cyclohydrolase I activity(GO:0043105) |
| 0.0 | 0.1 | GO:2000811 | negative regulation of anoikis(GO:2000811) |
| 0.0 | 0.2 | GO:0022029 | telencephalon cell migration(GO:0022029) |
| 0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.0 | GO:0002062 | chondrocyte differentiation(GO:0002062) |
| 0.0 | 0.1 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
| 0.0 | 0.0 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
| 0.0 | 0.0 | GO:0006542 | glutamine biosynthetic process(GO:0006542) |
| 0.0 | 0.0 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
| 0.0 | 0.2 | GO:0071222 | cellular response to lipopolysaccharide(GO:0071222) |
| 0.0 | 2.5 | GO:0000209 | protein polyubiquitination(GO:0000209) |
| 0.0 | 0.1 | GO:0031122 | cytoplasmic microtubule organization(GO:0031122) |
| 0.0 | 0.4 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.0 | 0.0 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
| 0.0 | 0.1 | GO:0060180 | female mating behavior(GO:0060180) |
| 0.0 | 0.0 | GO:0042532 | negative regulation of tyrosine phosphorylation of STAT protein(GO:0042532) |
| 0.0 | 0.1 | GO:0048305 | immunoglobulin secretion(GO:0048305) |
| 0.0 | 0.0 | GO:1903236 | regulation of leukocyte tethering or rolling(GO:1903236) regulation of leukocyte adhesion to vascular endothelial cell(GO:1904994) |
| 0.0 | 0.2 | GO:0051443 | positive regulation of ubiquitin-protein transferase activity(GO:0051443) |
| 0.0 | 0.2 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.0 | 0.2 | GO:0060600 | dichotomous subdivision of an epithelial terminal unit(GO:0060600) |
| 0.0 | 0.0 | GO:0043524 | negative regulation of neuron apoptotic process(GO:0043524) |
| 0.0 | 0.1 | GO:1902766 | skeletal muscle satellite cell migration(GO:1902766) |
| 0.0 | 1.5 | GO:0046834 | lipid phosphorylation(GO:0046834) |
| 0.0 | 0.6 | GO:0032465 | regulation of cytokinesis(GO:0032465) |
| 0.0 | 0.1 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.0 | 0.2 | GO:0048011 | neurotrophin TRK receptor signaling pathway(GO:0048011) |
| 0.0 | 0.2 | GO:0010862 | positive regulation of pathway-restricted SMAD protein phosphorylation(GO:0010862) |
| 0.0 | 0.3 | GO:0043123 | positive regulation of I-kappaB kinase/NF-kappaB signaling(GO:0043123) |
| 0.0 | 0.1 | GO:0016098 | monoterpenoid metabolic process(GO:0016098) |
| 0.0 | 0.0 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
| 0.0 | 0.0 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.0 | 0.0 | GO:0036152 | phosphatidylethanolamine acyl-chain remodeling(GO:0036152) |
| 0.0 | 0.1 | GO:0010816 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.0 | 0.0 | GO:0071105 | response to interleukin-11(GO:0071105) |
| 0.0 | 0.0 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
| 0.0 | 0.0 | GO:0035553 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.0 | 0.1 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.0 | 0.0 | GO:0045591 | positive regulation of regulatory T cell differentiation(GO:0045591) |
| 0.0 | 0.1 | GO:0016233 | telomere capping(GO:0016233) |
| 0.0 | 0.0 | GO:0014034 | neural crest cell fate commitment(GO:0014034) |
| 0.0 | 0.1 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.0 | 0.6 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.0 | 0.1 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 0.0 | 0.0 | GO:0033031 | neutrophil apoptotic process(GO:0001781) regulation of neutrophil apoptotic process(GO:0033029) positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.0 | 0.1 | GO:0031929 | TOR signaling(GO:0031929) |
| 0.0 | 0.0 | GO:0051569 | regulation of histone H3-K4 methylation(GO:0051569) |
| 0.0 | 0.0 | GO:0007602 | phototransduction(GO:0007602) |
| 0.0 | 0.1 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
| 0.0 | 0.0 | GO:0038163 | thrombopoietin-mediated signaling pathway(GO:0038163) |
| 0.0 | 0.0 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.0 | 0.0 | GO:0032222 | regulation of synaptic transmission, cholinergic(GO:0032222) |
| 0.0 | 0.1 | GO:0046627 | negative regulation of insulin receptor signaling pathway(GO:0046627) |
| 0.0 | 0.1 | GO:0010560 | positive regulation of glycoprotein biosynthetic process(GO:0010560) |
| 0.0 | 0.0 | GO:0045191 | regulation of isotype switching(GO:0045191) |
| 0.0 | 0.0 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
| 0.0 | 0.0 | GO:0015793 | glycerol transport(GO:0015793) |
| 0.0 | 0.0 | GO:0046549 | retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
| 0.0 | 0.1 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.0 | 0.0 | GO:0071344 | diphosphate metabolic process(GO:0071344) |
| 0.0 | 0.0 | GO:0008628 | hormone-mediated apoptotic signaling pathway(GO:0008628) |
| 0.0 | 0.3 | GO:0043044 | ATP-dependent chromatin remodeling(GO:0043044) |
| 0.0 | 0.0 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.0 | 0.0 | GO:0070831 | basement membrane assembly(GO:0070831) |
| 0.0 | 0.0 | GO:0009219 | pyrimidine deoxyribonucleotide metabolic process(GO:0009219) |
| 0.0 | 0.0 | GO:0032731 | positive regulation of interleukin-1 beta production(GO:0032731) |
| 0.0 | 0.0 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
| 0.0 | 0.0 | GO:0046135 | pyrimidine nucleoside catabolic process(GO:0046135) |
| 0.0 | 0.0 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 0.0 | 0.0 | GO:0002468 | dendritic cell antigen processing and presentation(GO:0002468) regulation of dendritic cell antigen processing and presentation(GO:0002604) positive regulation of dendritic cell antigen processing and presentation(GO:0002606) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.8 | 3.9 | GO:1990769 | proximal neuron projection(GO:1990769) |
| 0.7 | 2.2 | GO:0001534 | radial spoke(GO:0001534) |
| 0.5 | 1.1 | GO:0097125 | cyclin B1-CDK1 complex(GO:0097125) |
| 0.5 | 3.0 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
| 0.5 | 2.0 | GO:0097224 | sperm connecting piece(GO:0097224) |
| 0.5 | 9.7 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.5 | 2.3 | GO:0098536 | deuterosome(GO:0098536) |
| 0.5 | 2.3 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 0.4 | 2.2 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.4 | 1.3 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
| 0.4 | 1.9 | GO:0097123 | cyclin A1-CDK2 complex(GO:0097123) |
| 0.4 | 0.4 | GO:0097598 | sperm cytoplasmic droplet(GO:0097598) |
| 0.4 | 5.2 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.4 | 6.9 | GO:0036038 | MKS complex(GO:0036038) |
| 0.3 | 2.4 | GO:0002177 | manchette(GO:0002177) |
| 0.3 | 1.7 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.3 | 1.0 | GO:0005940 | septin ring(GO:0005940) septin collar(GO:0032173) |
| 0.3 | 3.4 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.3 | 2.7 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.3 | 1.3 | GO:0000811 | GINS complex(GO:0000811) |
| 0.3 | 3.3 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.3 | 1.0 | GO:0032127 | dense core granule membrane(GO:0032127) |
| 0.3 | 0.6 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
| 0.3 | 1.9 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.3 | 1.5 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.3 | 1.2 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.3 | 0.9 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.3 | 1.2 | GO:0016939 | kinesin II complex(GO:0016939) |
| 0.3 | 0.9 | GO:0005715 | late recombination nodule(GO:0005715) |
| 0.3 | 1.8 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.3 | 0.9 | GO:0005668 | RNA polymerase transcription factor SL1 complex(GO:0005668) |
| 0.3 | 2.0 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
| 0.3 | 1.1 | GO:1990423 | RZZ complex(GO:1990423) |
| 0.3 | 3.0 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.3 | 1.9 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.3 | 1.1 | GO:0031436 | BRCA1-BARD1 complex(GO:0031436) |
| 0.3 | 0.8 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.3 | 2.1 | GO:0034688 | integrin alphaM-beta2 complex(GO:0034688) |
| 0.3 | 1.8 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.3 | 1.0 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.3 | 2.6 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.3 | 0.8 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
| 0.2 | 0.7 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.2 | 2.5 | GO:0000796 | condensin complex(GO:0000796) |
| 0.2 | 1.7 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.2 | 2.2 | GO:0044279 | other organism cell membrane(GO:0044218) other organism membrane(GO:0044279) |
| 0.2 | 0.7 | GO:0031261 | DNA replication preinitiation complex(GO:0031261) |
| 0.2 | 1.6 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.2 | 0.7 | GO:0030689 | Noc complex(GO:0030689) |
| 0.2 | 1.8 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.2 | 5.0 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.2 | 6.1 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
| 0.2 | 0.2 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
| 0.2 | 0.9 | GO:0036396 | MIS complex(GO:0036396) mRNA editing complex(GO:0045293) |
| 0.2 | 0.2 | GO:0044453 | nuclear membrane part(GO:0044453) |
| 0.2 | 1.0 | GO:0032449 | CBM complex(GO:0032449) |
| 0.2 | 0.6 | GO:0070195 | growth hormone receptor complex(GO:0070195) |
| 0.2 | 1.4 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.2 | 0.8 | GO:0032798 | Swi5-Sfr1 complex(GO:0032798) |
| 0.2 | 3.3 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.2 | 1.1 | GO:0032807 | DNA ligase IV complex(GO:0032807) |
| 0.2 | 1.7 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.2 | 4.1 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.2 | 0.8 | GO:0060187 | cell pole(GO:0060187) |
| 0.2 | 0.2 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.2 | 0.4 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.2 | 3.0 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.2 | 1.6 | GO:0016012 | sarcoglycan complex(GO:0016012) |
| 0.2 | 1.6 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.2 | 0.5 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
| 0.2 | 1.5 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.2 | 0.5 | GO:0043291 | RAVE complex(GO:0043291) |
| 0.2 | 1.0 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.2 | 3.5 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.2 | 1.2 | GO:0000923 | equatorial microtubule organizing center(GO:0000923) |
| 0.2 | 0.2 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.2 | 1.8 | GO:0034464 | BBSome(GO:0034464) |
| 0.2 | 1.1 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.2 | 0.5 | GO:0005900 | oncostatin-M receptor complex(GO:0005900) |
| 0.2 | 0.8 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
| 0.2 | 0.5 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.2 | 0.2 | GO:0030990 | intraciliary transport particle(GO:0030990) |
| 0.2 | 0.5 | GO:0033565 | ESCRT-0 complex(GO:0033565) |
| 0.2 | 2.2 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.2 | 0.6 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
| 0.2 | 0.8 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.2 | 0.2 | GO:0034665 | integrin alpha1-beta1 complex(GO:0034665) |
| 0.2 | 0.6 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.2 | 1.1 | GO:0042825 | TAP complex(GO:0042825) |
| 0.1 | 1.0 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
| 0.1 | 1.6 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.1 | 1.8 | GO:0000109 | nucleotide-excision repair complex(GO:0000109) |
| 0.1 | 0.9 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 0.1 | 1.3 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.1 | 0.9 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
| 0.1 | 14.1 | GO:0005930 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
| 0.1 | 0.6 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.1 | 1.7 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.1 | 1.3 | GO:0044292 | dendrite terminus(GO:0044292) |
| 0.1 | 1.0 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.1 | 0.1 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
| 0.1 | 1.6 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.1 | 2.2 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.1 | 0.1 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.1 | 0.4 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.1 | 0.8 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.1 | 0.3 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.1 | 0.9 | GO:1903439 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
| 0.1 | 0.3 | GO:0005873 | plus-end kinesin complex(GO:0005873) |
| 0.1 | 0.3 | GO:0000783 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
| 0.1 | 1.7 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.1 | 0.3 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.1 | 0.9 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
| 0.1 | 0.6 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.1 | 0.4 | GO:0072563 | endothelial microparticle(GO:0072563) |
| 0.1 | 10.4 | GO:0036064 | ciliary basal body(GO:0036064) |
| 0.1 | 0.1 | GO:0097525 | spliceosomal snRNP complex(GO:0097525) |
| 0.1 | 0.3 | GO:0000780 | condensed nuclear chromosome, centromeric region(GO:0000780) |
| 0.1 | 0.6 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.1 | 1.0 | GO:0035976 | AP1 complex(GO:0035976) |
| 0.1 | 0.7 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.1 | 0.9 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.1 | 1.3 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.1 | 0.4 | GO:0031523 | Myb complex(GO:0031523) |
| 0.1 | 0.4 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
| 0.1 | 1.6 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.1 | 0.8 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.1 | 0.5 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.1 | 1.0 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.1 | 0.4 | GO:0009330 | DNA topoisomerase complex (ATP-hydrolyzing)(GO:0009330) |
| 0.1 | 1.6 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.1 | 0.8 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
| 0.1 | 0.7 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 0.1 | 0.9 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.1 | 0.5 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
| 0.1 | 0.1 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
| 0.1 | 0.8 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
| 0.1 | 0.6 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.1 | 1.8 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.1 | 0.8 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.1 | 1.1 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.1 | 0.3 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.1 | 3.3 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.1 | 0.4 | GO:0070369 | beta-catenin-TCF7L2 complex(GO:0070369) |
| 0.1 | 2.0 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.1 | 1.0 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.1 | 0.1 | GO:0061695 | transferase complex, transferring phosphorus-containing groups(GO:0061695) |
| 0.1 | 2.7 | GO:1902562 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
| 0.1 | 0.5 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.1 | 0.9 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.1 | 1.9 | GO:0010369 | chromocenter(GO:0010369) |
| 0.1 | 4.0 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.1 | 0.4 | GO:0032301 | MutSalpha complex(GO:0032301) |
| 0.1 | 0.5 | GO:0000308 | cytoplasmic cyclin-dependent protein kinase holoenzyme complex(GO:0000308) |
| 0.1 | 0.2 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.1 | 0.8 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
| 0.1 | 0.8 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.1 | 0.4 | GO:0031673 | H zone(GO:0031673) |
| 0.1 | 0.4 | GO:0044094 | host cell nucleus(GO:0042025) host cell nuclear part(GO:0044094) |
| 0.1 | 9.7 | GO:0000779 | condensed chromosome, centromeric region(GO:0000779) |
| 0.1 | 0.4 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.1 | 1.2 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.1 | 0.7 | GO:1990589 | ATF4-CREB1 transcription factor complex(GO:1990589) |
| 0.1 | 0.2 | GO:0032587 | ruffle membrane(GO:0032587) |
| 0.1 | 0.5 | GO:0070695 | FHF complex(GO:0070695) |
| 0.1 | 0.4 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.1 | 0.8 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.1 | 0.3 | GO:0070762 | nuclear pore transmembrane ring(GO:0070762) |
| 0.1 | 0.7 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.1 | 0.5 | GO:0005602 | complement component C1 complex(GO:0005602) |
| 0.1 | 1.1 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
| 0.1 | 1.8 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.1 | 0.1 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.1 | 1.7 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.1 | 0.3 | GO:0018444 | translation release factor complex(GO:0018444) |
| 0.1 | 1.0 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.1 | 0.2 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.1 | 0.1 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 0.1 | 0.5 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.1 | 0.4 | GO:0031085 | BLOC-3 complex(GO:0031085) |
| 0.1 | 0.3 | GO:0070985 | TFIIK complex(GO:0070985) |
| 0.1 | 0.3 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.1 | 1.1 | GO:0042555 | MCM complex(GO:0042555) |
| 0.1 | 0.3 | GO:0072487 | MSL complex(GO:0072487) |
| 0.1 | 0.3 | GO:0005687 | U4 snRNP(GO:0005687) |
| 0.1 | 0.4 | GO:0032021 | NELF complex(GO:0032021) |
| 0.1 | 1.6 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.1 | 3.0 | GO:0016592 | mediator complex(GO:0016592) |
| 0.1 | 0.9 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.1 | 0.6 | GO:0071546 | pi-body(GO:0071546) |
| 0.1 | 0.2 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.1 | 1.9 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.1 | 0.4 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.1 | 0.5 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.1 | 0.4 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.1 | 0.1 | GO:0097124 | cyclin A2-CDK2 complex(GO:0097124) |
| 0.1 | 2.5 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.1 | 0.2 | GO:0072517 | viral factory(GO:0039713) cytoplasmic viral factory(GO:0039714) host cell viral assembly compartment(GO:0072517) |
| 0.1 | 0.3 | GO:0045495 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
| 0.1 | 0.7 | GO:0005875 | microtubule associated complex(GO:0005875) |
| 0.1 | 0.3 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
| 0.1 | 0.9 | GO:0097433 | dense body(GO:0097433) |
| 0.1 | 0.1 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
| 0.1 | 0.4 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.1 | 0.5 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.1 | 0.3 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
| 0.1 | 1.5 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.1 | 5.8 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.1 | 0.4 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.1 | 1.9 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
| 0.1 | 0.7 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
| 0.1 | 0.1 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
| 0.1 | 0.4 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.1 | 0.2 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
| 0.1 | 0.3 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 0.1 | 0.8 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.1 | 0.4 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.1 | 0.8 | GO:0045120 | pronucleus(GO:0045120) |
| 0.1 | 0.1 | GO:0060200 | clathrin-sculpted acetylcholine transport vesicle(GO:0060200) clathrin-sculpted acetylcholine transport vesicle membrane(GO:0060201) |
| 0.1 | 5.1 | GO:0015030 | Cajal body(GO:0015030) |
| 0.1 | 1.3 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.1 | 0.6 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.1 | 0.9 | GO:0032039 | integrator complex(GO:0032039) |
| 0.1 | 0.2 | GO:0097232 | lamellar body membrane(GO:0097232) alveolar lamellar body membrane(GO:0097233) |
| 0.1 | 0.3 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) |
| 0.1 | 0.3 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.1 | 0.7 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.1 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.1 | 0.3 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.1 | 0.9 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 0.1 | 0.5 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.1 | 0.3 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.1 | 0.2 | GO:0044753 | amphisome(GO:0044753) |
| 0.1 | 0.2 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
| 0.1 | 1.1 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.1 | 0.2 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 0.1 | 0.2 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
| 0.1 | 0.8 | GO:0070822 | Sin3-type complex(GO:0070822) |
| 0.1 | 0.7 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.1 | 0.8 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.1 | 0.4 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 0.1 | 0.3 | GO:0016589 | NURF complex(GO:0016589) |
| 0.1 | 2.1 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.1 | 0.1 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
| 0.1 | 0.4 | GO:0032009 | early phagosome(GO:0032009) |
| 0.1 | 0.1 | GO:0045177 | apical part of cell(GO:0045177) |
| 0.1 | 0.9 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.1 | 0.2 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.1 | 0.3 | GO:0009368 | endopeptidase Clp complex(GO:0009368) |
| 0.1 | 0.2 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.1 | 1.5 | GO:0005685 | U1 snRNP(GO:0005685) |
| 0.1 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.1 | 0.4 | GO:0030905 | retromer, tubulation complex(GO:0030905) |
| 0.1 | 2.8 | GO:0005657 | replication fork(GO:0005657) |
| 0.1 | 0.2 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
| 0.1 | 0.5 | GO:0070187 | telosome(GO:0070187) |
| 0.1 | 0.5 | GO:0031415 | NatA complex(GO:0031415) |
| 0.1 | 0.2 | GO:0005694 | chromosome(GO:0005694) |
| 0.1 | 0.1 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.1 | 4.4 | GO:0000313 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
| 0.1 | 0.2 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
| 0.1 | 0.2 | GO:0005846 | nuclear cap binding complex(GO:0005846) |
| 0.1 | 1.0 | GO:0034709 | methylosome(GO:0034709) |
| 0.1 | 0.1 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.1 | 0.2 | GO:0033011 | perinuclear theca(GO:0033011) |
| 0.1 | 0.2 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.1 | 0.2 | GO:0016935 | glycine-gated chloride channel complex(GO:0016935) |
| 0.1 | 0.2 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.1 | 0.1 | GO:1990462 | omegasome(GO:1990462) |
| 0.1 | 0.1 | GO:0071062 | alphav-beta3 integrin-vitronectin complex(GO:0071062) |
| 0.1 | 0.3 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.1 | 1.5 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.1 | 0.2 | GO:1990037 | Lewy body core(GO:1990037) |
| 0.1 | 0.1 | GO:0000938 | GARP complex(GO:0000938) |
| 0.1 | 0.4 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
| 0.1 | 0.3 | GO:0017102 | methionyl glutamyl tRNA synthetase complex(GO:0017102) |
| 0.1 | 0.2 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.1 | 0.2 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.1 | 0.6 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.1 | 0.1 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
| 0.1 | 0.4 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
| 0.1 | 0.6 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.1 | 0.6 | GO:0005819 | spindle(GO:0005819) |
| 0.1 | 0.4 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.1 | 1.4 | GO:0009925 | basal plasma membrane(GO:0009925) |
| 0.1 | 0.3 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.1 | 0.2 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.1 | 0.2 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.1 | 0.3 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
| 0.0 | 0.2 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.0 | 0.1 | GO:0034455 | t-UTP complex(GO:0034455) |
| 0.0 | 0.3 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
| 0.0 | 0.1 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.0 | 0.3 | GO:0001740 | Barr body(GO:0001740) |
| 0.0 | 0.2 | GO:0019031 | viral envelope(GO:0019031) viral membrane(GO:0036338) |
| 0.0 | 0.4 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) |
| 0.0 | 0.4 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.0 | 0.6 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) |
| 0.0 | 0.4 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.0 | 0.7 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.0 | 0.6 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
| 0.0 | 0.2 | GO:1990357 | terminal web(GO:1990357) |
| 0.0 | 0.4 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
| 0.0 | 0.7 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.0 | 0.9 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.0 | 0.5 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
| 0.0 | 0.0 | GO:0005684 | U2-type spliceosomal complex(GO:0005684) |
| 0.0 | 0.4 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.0 | 0.9 | GO:0033202 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 0.0 | 0.2 | GO:0001652 | granular component(GO:0001652) |
| 0.0 | 0.2 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.0 | 0.1 | GO:0005675 | holo TFIIH complex(GO:0005675) |
| 0.0 | 3.7 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.0 | 1.9 | GO:0005871 | kinesin complex(GO:0005871) |
| 0.0 | 0.0 | GO:0034680 | integrin alpha10-beta1 complex(GO:0034680) |
| 0.0 | 0.4 | GO:0042611 | MHC protein complex(GO:0042611) |
| 0.0 | 0.1 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.0 | 0.2 | GO:0045272 | plasma membrane respiratory chain complex I(GO:0045272) |
| 0.0 | 2.5 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.0 | 1.1 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.0 | 0.1 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
| 0.0 | 0.2 | GO:0071148 | TEAD-1-YAP complex(GO:0071148) |
| 0.0 | 0.6 | GO:0034399 | nuclear periphery(GO:0034399) |
| 0.0 | 0.6 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.0 | 0.6 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.0 | 2.5 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.0 | 1.5 | GO:0005859 | muscle myosin complex(GO:0005859) |
| 0.0 | 0.1 | GO:0031010 | ISWI-type complex(GO:0031010) |
| 0.0 | 0.2 | GO:0090543 | Flemming body(GO:0090543) |
| 0.0 | 0.2 | GO:0035859 | Seh1-associated complex(GO:0035859) |
| 0.0 | 1.0 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 0.5 | GO:1902555 | endoribonuclease complex(GO:1902555) |
| 0.0 | 0.2 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.0 | 3.0 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.0 | 1.0 | GO:0005929 | cilium(GO:0005929) |
| 0.0 | 0.2 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.0 | 1.4 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.0 | 0.2 | GO:0043293 | apoptosome(GO:0043293) |
| 0.0 | 1.0 | GO:0071437 | invadopodium(GO:0071437) |
| 0.0 | 0.6 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.0 | 0.6 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.0 | 0.0 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.0 | 1.4 | GO:0045259 | proton-transporting ATP synthase complex(GO:0045259) |
| 0.0 | 5.2 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.0 | 0.0 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
| 0.0 | 0.3 | GO:0008287 | protein serine/threonine phosphatase complex(GO:0008287) phosphatase complex(GO:1903293) |
| 0.0 | 0.1 | GO:0000229 | cytoplasmic chromosome(GO:0000229) |
| 0.0 | 0.9 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.0 | 2.7 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.0 | 0.0 | GO:0030891 | VCB complex(GO:0030891) |
| 0.0 | 0.0 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
| 0.0 | 0.3 | GO:0033643 | host cell part(GO:0033643) |
| 0.0 | 3.5 | GO:0031514 | motile cilium(GO:0031514) |
| 0.0 | 0.6 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
| 0.0 | 0.6 | GO:0098576 | lumenal side of membrane(GO:0098576) |
| 0.0 | 1.6 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.0 | 0.0 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.0 | 0.3 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.0 | 0.2 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.0 | 5.2 | GO:0005795 | Golgi stack(GO:0005795) |
| 0.0 | 0.1 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 0.2 | GO:0000784 | nuclear chromosome, telomeric region(GO:0000784) |
| 0.0 | 0.3 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.0 | 3.3 | GO:0030672 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
| 0.0 | 0.3 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.0 | 0.2 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.0 | 0.4 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.0 | 0.5 | GO:0005844 | polysome(GO:0005844) |
| 0.0 | 0.8 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
| 0.0 | 0.1 | GO:0042565 | RNA nuclear export complex(GO:0042565) |
| 0.0 | 0.7 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.0 | 0.3 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
| 0.0 | 0.1 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.0 | 0.7 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.0 | 0.5 | GO:0030904 | retromer complex(GO:0030904) |
| 0.0 | 0.4 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.0 | 2.0 | GO:0005814 | centriole(GO:0005814) |
| 0.0 | 0.1 | GO:0016011 | dystroglycan complex(GO:0016011) |
| 0.0 | 0.1 | GO:0043034 | costamere(GO:0043034) |
| 0.0 | 4.1 | GO:0044438 | microbody part(GO:0044438) peroxisomal part(GO:0044439) |
| 0.0 | 0.1 | GO:0036452 | ESCRT complex(GO:0036452) |
| 0.0 | 0.1 | GO:0048269 | methionine adenosyltransferase complex(GO:0048269) |
| 0.0 | 0.5 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.0 | 0.3 | GO:0031672 | A band(GO:0031672) |
| 0.0 | 0.2 | GO:0017059 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
| 0.0 | 0.1 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.0 | 0.4 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.0 | 0.1 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
| 0.0 | 0.0 | GO:0032156 | septin cytoskeleton(GO:0032156) |
| 0.0 | 1.4 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.0 | 0.9 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
| 0.0 | 0.0 | GO:0034681 | integrin alpha11-beta1 complex(GO:0034681) |
| 0.0 | 0.1 | GO:0071565 | nBAF complex(GO:0071565) |
| 0.0 | 0.0 | GO:0005608 | laminin-3 complex(GO:0005608) |
| 0.0 | 1.6 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
| 0.0 | 0.5 | GO:0044216 | other organism(GO:0044215) other organism cell(GO:0044216) other organism part(GO:0044217) |
| 0.0 | 0.6 | GO:0042581 | specific granule(GO:0042581) |
| 0.0 | 0.1 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
| 0.0 | 0.1 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.0 | 0.0 | GO:0014802 | terminal cisterna(GO:0014802) |
| 0.0 | 0.2 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.0 | 0.0 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.0 | 0.0 | GO:0032302 | MutSbeta complex(GO:0032302) |
| 0.0 | 0.1 | GO:0034676 | integrin alpha6-beta4 complex(GO:0034676) |
| 0.0 | 0.1 | GO:0044327 | dendritic spine head(GO:0044327) |
| 0.0 | 1.0 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.1 | GO:0032002 | interleukin-28 receptor complex(GO:0032002) |
| 0.0 | 0.1 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.0 | 0.1 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.0 | 1.0 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.0 | 0.1 | GO:0016600 | flotillin complex(GO:0016600) |
| 0.0 | 0.1 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.0 | 0.1 | GO:0097447 | dendritic tree(GO:0097447) |
| 0.0 | 0.2 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 0.7 | GO:1902710 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
| 0.0 | 0.0 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.0 | 0.1 | GO:0070381 | endosome to plasma membrane transport vesicle(GO:0070381) |
| 0.0 | 0.3 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.0 | 0.4 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
| 0.0 | 2.0 | GO:0000922 | spindle pole(GO:0000922) |
| 0.0 | 0.1 | GO:0032389 | MutLalpha complex(GO:0032389) |
| 0.0 | 0.1 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.0 | 0.2 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.0 | 0.0 | GO:0043159 | acrosomal matrix(GO:0043159) |
| 0.0 | 0.1 | GO:0042643 | actomyosin, actin portion(GO:0042643) |
| 0.0 | 0.2 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.0 | 0.3 | GO:0032040 | small-subunit processome(GO:0032040) |
| 0.0 | 0.1 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.0 | 0.1 | GO:0035354 | Toll-like receptor 1-Toll-like receptor 2 protein complex(GO:0035354) |
| 0.0 | 0.8 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 0.1 | GO:0030425 | dendrite(GO:0030425) |
| 0.0 | 0.0 | GO:0030128 | clathrin coat of endocytic vesicle(GO:0030128) |
| 0.0 | 0.2 | GO:0042588 | zymogen granule(GO:0042588) |
| 0.0 | 0.1 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.0 | 0.1 | GO:0032044 | DSIF complex(GO:0032044) |
| 0.0 | 7.5 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
| 0.0 | 0.1 | GO:0098862 | cluster of actin-based cell projections(GO:0098862) |
| 0.0 | 0.3 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 0.2 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
| 0.0 | 0.8 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
| 0.0 | 0.2 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.0 | 0.5 | GO:0032154 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
| 0.0 | 0.0 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
| 0.0 | 0.1 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.0 | 0.3 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 0.0 | 0.8 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 0.5 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.0 | 0.0 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.0 | 0.0 | GO:0098855 | HCN channel complex(GO:0098855) |
| 0.0 | 0.0 | GO:0030175 | filopodium(GO:0030175) |
| 0.0 | 0.2 | GO:0097486 | multivesicular body lumen(GO:0097486) |
| 0.0 | 0.2 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.0 | 1.9 | GO:0030496 | midbody(GO:0030496) |
| 0.0 | 0.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.0 | 0.1 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
| 0.0 | 1.4 | GO:0055037 | recycling endosome(GO:0055037) |
| 0.0 | 0.2 | GO:0019867 | outer membrane(GO:0019867) |
| 0.0 | 0.7 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
| 0.0 | 0.4 | GO:0005815 | microtubule organizing center(GO:0005815) |
| 0.0 | 1.3 | GO:0035579 | specific granule membrane(GO:0035579) |
| 0.0 | 0.0 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.0 | 0.1 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.0 | 0.1 | GO:1990584 | cardiac Troponin complex(GO:1990584) |
| 0.0 | 0.3 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.0 | 0.0 | GO:0019012 | virion(GO:0019012) virion part(GO:0044423) |
| 0.0 | 0.1 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.0 | 0.2 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.0 | 0.0 | GO:0001533 | cornified envelope(GO:0001533) |
| 0.0 | 0.0 | GO:0034358 | plasma lipoprotein particle(GO:0034358) lipoprotein particle(GO:1990777) |
| 0.0 | 0.1 | GO:0031302 | intrinsic component of endosome membrane(GO:0031302) |
| 0.0 | 0.2 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.0 | 0.0 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.0 | 1.1 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
| 0.0 | 1.1 | GO:0005905 | clathrin-coated pit(GO:0005905) |
| 0.0 | 0.7 | GO:0035577 | azurophil granule membrane(GO:0035577) |
| 0.0 | 2.8 | GO:0031965 | nuclear membrane(GO:0031965) |
| 0.0 | 0.1 | GO:0030663 | COPI-coated vesicle membrane(GO:0030663) |
| 0.0 | 0.1 | GO:0071203 | WASH complex(GO:0071203) |
| 0.0 | 0.3 | GO:0030666 | endocytic vesicle membrane(GO:0030666) |
| 0.0 | 3.8 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.0 | 0.2 | GO:0005839 | proteasome core complex(GO:0005839) |
| 0.0 | 2.9 | GO:0005813 | centrosome(GO:0005813) |
| 0.0 | 0.0 | GO:0032797 | SMN complex(GO:0032797) |
| 0.0 | 1.3 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
| 0.0 | 0.4 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 0.0 | GO:0031379 | RNA-directed RNA polymerase complex(GO:0031379) |
| 0.0 | 0.0 | GO:0005607 | laminin-2 complex(GO:0005607) |
| 0.0 | 0.0 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.0 | 0.0 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.0 | 0.9 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.0 | 0.0 | GO:0097179 | protease inhibitor complex(GO:0097179) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.8 | 0.8 | GO:0009041 | uridylate kinase activity(GO:0009041) |
| 0.7 | 2.0 | GO:0004157 | dihydropyrimidinase activity(GO:0004157) |
| 0.6 | 1.9 | GO:0050135 | NAD(P)+ nucleosidase activity(GO:0050135) |
| 0.6 | 1.8 | GO:0031859 | platelet activating factor receptor binding(GO:0031859) |
| 0.6 | 2.8 | GO:0004910 | interleukin-1, Type II, blocking receptor activity(GO:0004910) |
| 0.5 | 0.5 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.5 | 1.5 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.4 | 0.9 | GO:0004998 | transferrin receptor activity(GO:0004998) |
| 0.4 | 1.7 | GO:0003896 | DNA primase activity(GO:0003896) |
| 0.4 | 1.3 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.4 | 2.5 | GO:0051870 | methotrexate binding(GO:0051870) |
| 0.4 | 2.5 | GO:0030197 | extracellular matrix constituent, lubricant activity(GO:0030197) |
| 0.4 | 5.6 | GO:0032395 | MHC class II receptor activity(GO:0032395) |
| 0.4 | 1.1 | GO:0015091 | ferric iron transmembrane transporter activity(GO:0015091) trivalent inorganic cation transmembrane transporter activity(GO:0072510) |
| 0.4 | 1.1 | GO:0052810 | 1-phosphatidylinositol-5-kinase activity(GO:0052810) |
| 0.4 | 1.9 | GO:0004066 | asparagine synthase (glutamine-hydrolyzing) activity(GO:0004066) |
| 0.4 | 2.9 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
| 0.4 | 1.1 | GO:0004613 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 0.4 | 2.2 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 0.4 | 1.4 | GO:0051733 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.4 | 3.6 | GO:0003910 | DNA ligase (ATP) activity(GO:0003910) |
| 0.3 | 2.6 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.3 | 1.0 | GO:0008859 | exoribonuclease II activity(GO:0008859) |
| 0.3 | 2.3 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
| 0.3 | 0.3 | GO:0034595 | phosphatidylinositol phosphate 5-phosphatase activity(GO:0034595) |
| 0.3 | 1.0 | GO:0052894 | norspermine:oxygen oxidoreductase activity(GO:0052894) N1-acetylspermine:oxygen oxidoreductase (N1-acetylspermidine-forming) activity(GO:0052895) |
| 0.3 | 2.8 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 0.3 | 5.0 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.3 | 0.9 | GO:0008424 | glycoprotein 6-alpha-L-fucosyltransferase activity(GO:0008424) alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
| 0.3 | 1.2 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.3 | 0.9 | GO:0004958 | prostaglandin F receptor activity(GO:0004958) |
| 0.3 | 1.2 | GO:0032038 | myosin II heavy chain binding(GO:0032038) |
| 0.3 | 1.2 | GO:0008336 | gamma-butyrobetaine dioxygenase activity(GO:0008336) |
| 0.3 | 2.7 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
| 0.3 | 0.3 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.3 | 0.9 | GO:0003883 | CTP synthase activity(GO:0003883) |
| 0.3 | 0.9 | GO:0051500 | D-aminoacyl-tRNA deacylase activity(GO:0051499) D-tyrosyl-tRNA(Tyr) deacylase activity(GO:0051500) |
| 0.3 | 0.9 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.3 | 0.9 | GO:0031751 | D4 dopamine receptor binding(GO:0031751) |
| 0.3 | 0.8 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.3 | 1.9 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.3 | 1.1 | GO:0030337 | DNA polymerase processivity factor activity(GO:0030337) |
| 0.3 | 7.4 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.3 | 1.3 | GO:0015433 | peptide antigen-transporting ATPase activity(GO:0015433) |
| 0.3 | 0.8 | GO:0015230 | FAD transmembrane transporter activity(GO:0015230) |
| 0.3 | 1.8 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
| 0.3 | 2.4 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.3 | 0.3 | GO:0015923 | mannosidase activity(GO:0015923) |
| 0.3 | 1.0 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.2 | 0.2 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 0.2 | 5.3 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.2 | 9.9 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.2 | 0.7 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
| 0.2 | 0.7 | GO:0047977 | hepoxilin-epoxide hydrolase activity(GO:0047977) |
| 0.2 | 4.2 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.2 | 0.7 | GO:0016422 | mRNA (2'-O-methyladenosine-N6-)-methyltransferase activity(GO:0016422) |
| 0.2 | 0.2 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.2 | 0.9 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 0.2 | 0.9 | GO:0004102 | choline O-acetyltransferase activity(GO:0004102) |
| 0.2 | 1.4 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.2 | 0.7 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.2 | 0.7 | GO:0002113 | interleukin-33 binding(GO:0002113) |
| 0.2 | 0.6 | GO:0034353 | RNA pyrophosphohydrolase activity(GO:0034353) |
| 0.2 | 0.6 | GO:0032427 | GBD domain binding(GO:0032427) |
| 0.2 | 0.6 | GO:0030627 | pre-mRNA 5'-splice site binding(GO:0030627) |
| 0.2 | 0.4 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
| 0.2 | 2.7 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.2 | 1.4 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.2 | 1.0 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
| 0.2 | 2.0 | GO:0030369 | ICAM-3 receptor activity(GO:0030369) |
| 0.2 | 1.0 | GO:0004905 | type I interferon receptor activity(GO:0004905) |
| 0.2 | 0.8 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.2 | 3.4 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.2 | 0.4 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
| 0.2 | 0.6 | GO:0031862 | prostanoid receptor binding(GO:0031862) |
| 0.2 | 0.2 | GO:0050659 | N-acetylgalactosamine 4-sulfate 6-O-sulfotransferase activity(GO:0050659) |
| 0.2 | 0.6 | GO:0033867 | Fas-activated serine/threonine kinase activity(GO:0033867) |
| 0.2 | 0.6 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.2 | 0.2 | GO:0004103 | choline kinase activity(GO:0004103) |
| 0.2 | 1.9 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.2 | 1.7 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.2 | 0.6 | GO:0036137 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
| 0.2 | 0.5 | GO:0008969 | phosphohistidine phosphatase activity(GO:0008969) |
| 0.2 | 1.3 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
| 0.2 | 0.2 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
| 0.2 | 1.3 | GO:0052851 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
| 0.2 | 0.2 | GO:0019239 | deaminase activity(GO:0019239) |
| 0.2 | 0.5 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
| 0.2 | 0.9 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 0.2 | 0.9 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.2 | 1.6 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.2 | 0.5 | GO:0004603 | phenylethanolamine N-methyltransferase activity(GO:0004603) |
| 0.2 | 1.6 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
| 0.2 | 1.2 | GO:0015189 | L-lysine transmembrane transporter activity(GO:0015189) |
| 0.2 | 1.1 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
| 0.2 | 1.0 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.2 | 0.7 | GO:0009383 | rRNA (cytosine-C5-)-methyltransferase activity(GO:0009383) |
| 0.2 | 1.0 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
| 0.2 | 1.9 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.2 | 0.9 | GO:0004850 | uridine phosphorylase activity(GO:0004850) |
| 0.2 | 0.5 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
| 0.2 | 1.4 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
| 0.2 | 3.1 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.2 | 0.8 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 0.2 | 0.5 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
| 0.2 | 0.5 | GO:0036361 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
| 0.2 | 1.0 | GO:0030291 | protein serine/threonine kinase inhibitor activity(GO:0030291) |
| 0.2 | 0.5 | GO:0004170 | dUTP diphosphatase activity(GO:0004170) |
| 0.2 | 0.5 | GO:0035500 | MH2 domain binding(GO:0035500) |
| 0.2 | 1.5 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.2 | 0.7 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.2 | 0.3 | GO:0070336 | flap-structured DNA binding(GO:0070336) |
| 0.2 | 0.3 | GO:0015925 | galactosidase activity(GO:0015925) |
| 0.2 | 0.5 | GO:0001002 | polymerase III regulatory region sequence-specific DNA binding(GO:0000992) RNA polymerase III type 1 promoter sequence-specific DNA binding(GO:0001002) RNA polymerase III type 2 promoter sequence-specific DNA binding(GO:0001003) |
| 0.2 | 1.1 | GO:0004522 | ribonuclease A activity(GO:0004522) |
| 0.2 | 0.6 | GO:0005151 | interleukin-1, Type II receptor binding(GO:0005151) |
| 0.2 | 0.5 | GO:0061598 | molybdopterin adenylyltransferase activity(GO:0061598) molybdopterin molybdotransferase activity(GO:0061599) |
| 0.2 | 1.6 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.2 | 1.4 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.2 | 1.1 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.2 | 0.6 | GO:0043812 | phosphatidylinositol-4-phosphate phosphatase activity(GO:0043812) |
| 0.2 | 1.0 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 0.2 | 1.0 | GO:0023030 | MHC class Ib protein complex binding(GO:0023025) MHC class Ib protein binding, via antigen binding groove(GO:0023030) |
| 0.2 | 1.3 | GO:0004844 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
| 0.2 | 4.0 | GO:0031005 | filamin binding(GO:0031005) |
| 0.2 | 1.9 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.2 | 0.8 | GO:0004306 | ethanolamine-phosphate cytidylyltransferase activity(GO:0004306) |
| 0.2 | 3.6 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.2 | 1.2 | GO:0019237 | centromeric DNA binding(GO:0019237) |
| 0.2 | 3.1 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.2 | 0.3 | GO:0051213 | dioxygenase activity(GO:0051213) |
| 0.2 | 0.6 | GO:1904493 | Ac-Asp-Glu binding(GO:1904492) tetrahydrofolyl-poly(glutamate) polymer binding(GO:1904493) |
| 0.2 | 0.6 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
| 0.2 | 0.3 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.2 | 0.6 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.2 | 0.5 | GO:0005459 | UDP-galactose transmembrane transporter activity(GO:0005459) |
| 0.2 | 0.9 | GO:0003998 | acylphosphatase activity(GO:0003998) |
| 0.2 | 0.5 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.2 | 0.6 | GO:0022865 | transmembrane electron transfer carrier(GO:0022865) |
| 0.2 | 0.5 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
| 0.2 | 0.5 | GO:0030377 | urokinase plasminogen activator receptor activity(GO:0030377) |
| 0.2 | 1.1 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
| 0.1 | 0.4 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.1 | 3.4 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
| 0.1 | 2.2 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
| 0.1 | 0.1 | GO:0004797 | thymidine kinase activity(GO:0004797) |
| 0.1 | 0.9 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.1 | 0.4 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.1 | 0.7 | GO:0004467 | long-chain fatty acid-CoA ligase activity(GO:0004467) |
| 0.1 | 0.1 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.1 | 0.4 | GO:0045155 | electron transporter, transferring electrons from CoQH2-cytochrome c reductase complex and cytochrome c oxidase complex activity(GO:0045155) |
| 0.1 | 0.7 | GO:0016900 | oxidoreductase activity, acting on the CH-OH group of donors, disulfide as acceptor(GO:0016900) vitamin-K-epoxide reductase (warfarin-sensitive) activity(GO:0047057) |
| 0.1 | 1.9 | GO:0031433 | telethonin binding(GO:0031433) |
| 0.1 | 0.6 | GO:0005457 | GDP-fucose transmembrane transporter activity(GO:0005457) purine nucleotide-sugar transmembrane transporter activity(GO:0036080) |
| 0.1 | 1.6 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.1 | 0.6 | GO:0043398 | HLH domain binding(GO:0043398) |
| 0.1 | 0.1 | GO:0051731 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) |
| 0.1 | 1.8 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 0.1 | 0.3 | GO:0043139 | 5'-3' DNA helicase activity(GO:0043139) |
| 0.1 | 0.6 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
| 0.1 | 0.4 | GO:0008124 | 4-alpha-hydroxytetrahydrobiopterin dehydratase activity(GO:0008124) |
| 0.1 | 1.0 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.1 | 0.4 | GO:0003863 | alpha-ketoacid dehydrogenase activity(GO:0003826) 3-methyl-2-oxobutanoate dehydrogenase (2-methylpropanoyl-transferring) activity(GO:0003863) |
| 0.1 | 1.0 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.1 | 0.3 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.1 | 2.3 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.1 | 0.7 | GO:0017018 | myosin phosphatase activity(GO:0017018) |
| 0.1 | 0.7 | GO:0052740 | 1-acyl-2-lysophosphatidylserine acylhydrolase activity(GO:0052740) |
| 0.1 | 0.6 | GO:1904047 | S-adenosyl-L-methionine binding(GO:1904047) |
| 0.1 | 0.6 | GO:0047888 | fatty acid peroxidase activity(GO:0047888) |
| 0.1 | 1.3 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.1 | 0.6 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.1 | 1.1 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
| 0.1 | 1.0 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.1 | 2.5 | GO:0035173 | histone kinase activity(GO:0035173) |
| 0.1 | 0.1 | GO:0004962 | endothelin receptor activity(GO:0004962) |
| 0.1 | 0.8 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.1 | 1.2 | GO:0036310 | annealing helicase activity(GO:0036310) |
| 0.1 | 0.4 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.1 | 0.4 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.1 | 0.1 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.1 | 0.3 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
| 0.1 | 0.5 | GO:0004329 | formate-tetrahydrofolate ligase activity(GO:0004329) |
| 0.1 | 3.0 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.1 | 1.2 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.1 | 0.9 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.1 | 0.9 | GO:0097643 | amylin receptor activity(GO:0097643) |
| 0.1 | 0.8 | GO:0004882 | androgen receptor activity(GO:0004882) |
| 0.1 | 0.3 | GO:0004040 | amidase activity(GO:0004040) |
| 0.1 | 0.4 | GO:0048185 | activin binding(GO:0048185) |
| 0.1 | 1.6 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.1 | 0.5 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.1 | 1.0 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.1 | 0.5 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.1 | 0.4 | GO:0004608 | phosphatidyl-N-methylethanolamine N-methyltransferase activity(GO:0000773) phosphatidylethanolamine N-methyltransferase activity(GO:0004608) phosphatidyl-N-dimethylethanolamine N-methyltransferase activity(GO:0080101) |
| 0.1 | 0.9 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.1 | 0.4 | GO:0001147 | transcription termination site sequence-specific DNA binding(GO:0001147) transcription termination site DNA binding(GO:0001160) |
| 0.1 | 0.6 | GO:0047237 | glucuronylgalactosylproteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047237) |
| 0.1 | 1.0 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.1 | 1.6 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.1 | 1.6 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.1 | 0.4 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.1 | 0.2 | GO:0032090 | Pyrin domain binding(GO:0032090) |
| 0.1 | 0.7 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.1 | 1.2 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.1 | 0.2 | GO:0070363 | mitochondrial light strand promoter sense binding(GO:0070363) |
| 0.1 | 0.6 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
| 0.1 | 0.2 | GO:0004096 | catalase activity(GO:0004096) |
| 0.1 | 0.6 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
| 0.1 | 1.4 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.1 | 0.7 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.1 | 0.7 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
| 0.1 | 0.2 | GO:0008263 | pyrimidine-specific mismatch base pair DNA N-glycosylase activity(GO:0008263) |
| 0.1 | 0.4 | GO:0005260 | channel-conductance-controlling ATPase activity(GO:0005260) |
| 0.1 | 0.4 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.1 | 0.7 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
| 0.1 | 0.4 | GO:0070699 | type II activin receptor binding(GO:0070699) |
| 0.1 | 0.4 | GO:0010309 | acireductone dioxygenase [iron(II)-requiring] activity(GO:0010309) |
| 0.1 | 0.3 | GO:0004137 | deoxycytidine kinase activity(GO:0004137) |
| 0.1 | 0.3 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
| 0.1 | 0.2 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
| 0.1 | 0.7 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.1 | 0.7 | GO:0008235 | metalloexopeptidase activity(GO:0008235) |
| 0.1 | 0.3 | GO:0097158 | pre-mRNA intronic pyrimidine-rich binding(GO:0097158) |
| 0.1 | 1.2 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
| 0.1 | 0.2 | GO:0030545 | receptor regulator activity(GO:0030545) |
| 0.1 | 0.9 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.1 | 0.5 | GO:0004909 | interleukin-1, Type I, activating receptor activity(GO:0004909) |
| 0.1 | 0.6 | GO:0033857 | diphosphoinositol-pentakisphosphate kinase activity(GO:0033857) |
| 0.1 | 0.3 | GO:0102007 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 0.1 | 0.3 | GO:0008480 | sarcosine dehydrogenase activity(GO:0008480) |
| 0.1 | 1.6 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.1 | 1.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.1 | 0.1 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.1 | 0.1 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.1 | 1.4 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.1 | 2.6 | GO:0000030 | mannosyltransferase activity(GO:0000030) |
| 0.1 | 0.8 | GO:0050682 | AF-2 domain binding(GO:0050682) |
| 0.1 | 0.4 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.1 | 0.7 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.1 | 1.0 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 0.1 | 0.3 | GO:0001225 | RNA polymerase II transcription coactivator binding(GO:0001225) |
| 0.1 | 1.2 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
| 0.1 | 1.7 | GO:0046527 | glucosyltransferase activity(GO:0046527) |
| 0.1 | 0.7 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.1 | 3.5 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.1 | 0.5 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.1 | 0.3 | GO:1904455 | ubiquitin-specific protease activity involved in negative regulation of ERAD pathway(GO:1904455) |
| 0.1 | 0.1 | GO:0016530 | metallochaperone activity(GO:0016530) copper chaperone activity(GO:0016531) |
| 0.1 | 0.4 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
| 0.1 | 0.3 | GO:0004917 | interleukin-7 receptor activity(GO:0004917) |
| 0.1 | 0.5 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
| 0.1 | 0.2 | GO:0015616 | DNA translocase activity(GO:0015616) |
| 0.1 | 0.6 | GO:0000298 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) inositol diphosphate tetrakisphosphate diphosphatase activity(GO:0052840) inositol bisdiphosphate tetrakisphosphate diphosphatase activity(GO:0052841) inositol diphosphate pentakisphosphate diphosphatase activity(GO:0052842) inositol-1-diphosphate-2,3,4,5,6-pentakisphosphate diphosphatase activity(GO:0052843) inositol-3-diphosphate-1,2,4,5,6-pentakisphosphate diphosphatase activity(GO:0052844) inositol-5-diphosphate-1,2,3,4,6-pentakisphosphate diphosphatase activity(GO:0052845) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 1-diphosphatase activity(GO:0052846) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052847) inositol-3,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052848) |
| 0.1 | 0.5 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
| 0.1 | 1.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.1 | 0.3 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.1 | 1.2 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 0.1 | 0.6 | GO:0097199 | cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097199) |
| 0.1 | 0.2 | GO:0005462 | UDP-N-acetylglucosamine transmembrane transporter activity(GO:0005462) |
| 0.1 | 0.1 | GO:0004536 | deoxyribonuclease activity(GO:0004536) |
| 0.1 | 0.4 | GO:0016723 | oxidoreductase activity, oxidizing metal ions, NAD or NADP as acceptor(GO:0016723) |
| 0.1 | 0.6 | GO:0045029 | UDP-activated nucleotide receptor activity(GO:0045029) |
| 0.1 | 1.1 | GO:0034596 | phosphatidylinositol phosphate 4-phosphatase activity(GO:0034596) |
| 0.1 | 1.1 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.1 | 1.2 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.1 | 0.4 | GO:0097363 | protein O-GlcNAc transferase activity(GO:0097363) |
| 0.1 | 1.0 | GO:0030249 | guanylate cyclase regulator activity(GO:0030249) |
| 0.1 | 0.3 | GO:0098626 | methylselenol reductase activity(GO:0098625) methylseleninic acid reductase activity(GO:0098626) |
| 0.1 | 3.1 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.1 | 0.5 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) |
| 0.1 | 0.7 | GO:0015119 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.1 | 1.9 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.1 | 1.3 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
| 0.1 | 0.3 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.1 | 0.5 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
| 0.1 | 3.0 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.1 | 0.4 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.1 | 0.7 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.1 | 0.2 | GO:0044390 | ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
| 0.1 | 0.4 | GO:0008670 | 2,4-dienoyl-CoA reductase (NADPH) activity(GO:0008670) |
| 0.1 | 0.3 | GO:0004525 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
| 0.1 | 1.2 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.1 | 0.3 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.1 | 0.8 | GO:0071936 | coreceptor activity involved in Wnt signaling pathway(GO:0071936) |
| 0.1 | 0.6 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.1 | 1.5 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.1 | 0.3 | GO:0015131 | thiosulfate transmembrane transporter activity(GO:0015117) oxaloacetate transmembrane transporter activity(GO:0015131) |
| 0.1 | 0.5 | GO:0004748 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.1 | 0.5 | GO:0042806 | fucose binding(GO:0042806) |
| 0.1 | 0.4 | GO:0047820 | D-glutamate cyclase activity(GO:0047820) |
| 0.1 | 0.2 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.1 | 1.2 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.1 | 0.3 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
| 0.1 | 0.9 | GO:0055104 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.1 | 1.1 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.1 | 0.8 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
| 0.1 | 0.3 | GO:0004020 | adenylylsulfate kinase activity(GO:0004020) sulfate adenylyltransferase activity(GO:0004779) sulfate adenylyltransferase (ATP) activity(GO:0004781) |
| 0.1 | 2.1 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
| 0.1 | 0.6 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.1 | 0.5 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.1 | 0.1 | GO:0005048 | signal sequence binding(GO:0005048) ER retention sequence binding(GO:0046923) |
| 0.1 | 0.8 | GO:0048039 | ubiquinone binding(GO:0048039) |
| 0.1 | 1.7 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.1 | 0.8 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
| 0.1 | 0.3 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
| 0.1 | 0.1 | GO:0070546 | L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.1 | 0.3 | GO:0004057 | arginyltransferase activity(GO:0004057) |
| 0.1 | 0.6 | GO:0005372 | water transmembrane transporter activity(GO:0005372) water channel activity(GO:0015250) |
| 0.1 | 1.2 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
| 0.1 | 0.2 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.1 | 0.2 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
| 0.1 | 0.2 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.1 | 0.2 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.1 | 6.5 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.1 | 0.3 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.1 | 0.2 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
| 0.1 | 0.2 | GO:0033858 | N-acetylgalactosamine kinase activity(GO:0033858) |
| 0.1 | 0.2 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.1 | 0.3 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 0.1 | 0.6 | GO:0034603 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.1 | 0.2 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.1 | 0.5 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.1 | 0.5 | GO:0004471 | malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
| 0.1 | 0.3 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.1 | 0.2 | GO:0005136 | interleukin-4 receptor binding(GO:0005136) |
| 0.1 | 0.2 | GO:0030366 | molybdopterin synthase activity(GO:0030366) |
| 0.1 | 5.8 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
| 0.1 | 0.4 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
| 0.1 | 0.2 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
| 0.1 | 2.2 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.1 | 0.2 | GO:0004470 | malic enzyme activity(GO:0004470) |
| 0.1 | 0.5 | GO:0035800 | deubiquitinase activator activity(GO:0035800) |
| 0.1 | 2.0 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.1 | 0.4 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.1 | 2.1 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.1 | 0.2 | GO:0033754 | indoleamine 2,3-dioxygenase activity(GO:0033754) |
| 0.1 | 0.3 | GO:0004660 | protein farnesyltransferase activity(GO:0004660) |
| 0.1 | 0.2 | GO:0004756 | selenide, water dikinase activity(GO:0004756) phosphotransferase activity, paired acceptors(GO:0016781) |
| 0.1 | 0.1 | GO:0008169 | C-methyltransferase activity(GO:0008169) |
| 0.1 | 0.5 | GO:0035473 | lipase binding(GO:0035473) |
| 0.1 | 0.3 | GO:0015234 | thiamine transmembrane transporter activity(GO:0015234) |
| 0.1 | 0.2 | GO:0015265 | urea channel activity(GO:0015265) |
| 0.1 | 0.1 | GO:0015501 | glutamate:sodium symporter activity(GO:0015501) |
| 0.1 | 0.5 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.1 | 0.5 | GO:0099604 | calcium-release channel activity(GO:0015278) ligand-gated calcium channel activity(GO:0099604) |
| 0.1 | 0.8 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.1 | 1.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.1 | 1.3 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.1 | 0.2 | GO:0015235 | cobalamin transporter activity(GO:0015235) |
| 0.1 | 0.3 | GO:0004666 | prostaglandin-endoperoxide synthase activity(GO:0004666) |
| 0.1 | 0.1 | GO:0052901 | polyamine oxidase activity(GO:0046592) spermine:oxygen oxidoreductase (spermidine-forming) activity(GO:0052901) |
| 0.1 | 0.7 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.1 | 0.2 | GO:0030626 | U12 snRNA binding(GO:0030626) |
| 0.1 | 0.3 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.1 | 0.4 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
| 0.1 | 0.3 | GO:0098531 | RNA polymerase II transcription factor activity, ligand-activated sequence-specific DNA binding(GO:0004879) transcription factor activity, direct ligand regulated sequence-specific DNA binding(GO:0098531) |
| 0.1 | 0.5 | GO:0030267 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.1 | 0.1 | GO:0008665 | 2'-phosphotransferase activity(GO:0008665) |
| 0.1 | 0.3 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.1 | 0.1 | GO:0043559 | insulin binding(GO:0043559) |
| 0.1 | 1.2 | GO:0044213 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) intronic transcription regulatory region DNA binding(GO:0044213) |
| 0.1 | 2.5 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.1 | 0.2 | GO:0047783 | steroid 11-beta-monooxygenase activity(GO:0004507) corticosterone 18-monooxygenase activity(GO:0047783) |
| 0.1 | 0.1 | GO:1901677 | organophosphate ester transmembrane transporter activity(GO:0015605) phosphate transmembrane transporter activity(GO:1901677) |
| 0.1 | 0.2 | GO:0090541 | MIT domain binding(GO:0090541) |
| 0.1 | 0.2 | GO:0052642 | lysophosphatidic acid phosphatase activity(GO:0052642) |
| 0.1 | 0.4 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.1 | 0.1 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
| 0.1 | 0.2 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
| 0.1 | 1.0 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.1 | 0.3 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.1 | 1.0 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.1 | 0.2 | GO:0097617 | annealing activity(GO:0097617) |
| 0.1 | 0.4 | GO:0070404 | NADH binding(GO:0070404) |
| 0.1 | 0.8 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.1 | 0.3 | GO:0050509 | N-acetylglucosaminyl-proteoglycan 4-beta-glucuronosyltransferase activity(GO:0050509) |
| 0.1 | 0.4 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
| 0.1 | 0.4 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
| 0.1 | 1.1 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.1 | 0.4 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 0.1 | 0.7 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.1 | 0.1 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
| 0.1 | 0.9 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
| 0.1 | 0.2 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.1 | 0.1 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.1 | 0.9 | GO:0001087 | transcription factor activity, sequence-specific DNA binding, RNA polymerase recruiting(GO:0001011) transcription factor activity, TFIIB-class binding(GO:0001087) |
| 0.1 | 1.6 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.1 | 0.5 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.1 | 0.3 | GO:0001512 | dihydronicotinamide riboside quinone reductase activity(GO:0001512) melatonin binding(GO:1904408) |
| 0.1 | 0.3 | GO:0030151 | molybdenum ion binding(GO:0030151) |
| 0.1 | 0.4 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.1 | 0.1 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.1 | 0.2 | GO:0008478 | pyridoxal kinase activity(GO:0008478) lithium ion binding(GO:0031403) |
| 0.1 | 0.2 | GO:0004382 | guanosine-diphosphatase activity(GO:0004382) |
| 0.1 | 0.2 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.1 | 0.5 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.1 | 1.5 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.1 | 0.5 | GO:0009008 | DNA-methyltransferase activity(GO:0009008) |
| 0.1 | 0.3 | GO:0047708 | biotinidase activity(GO:0047708) |
| 0.1 | 0.4 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.1 | 0.3 | GO:0015199 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.1 | 0.3 | GO:0005046 | KDEL sequence binding(GO:0005046) |
| 0.1 | 0.1 | GO:0000403 | Y-form DNA binding(GO:0000403) |
| 0.1 | 0.4 | GO:0031705 | bombesin receptor binding(GO:0031705) |
| 0.1 | 4.0 | GO:0042805 | actinin binding(GO:0042805) |
| 0.1 | 0.7 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.1 | 0.1 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
| 0.1 | 0.7 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.1 | 0.6 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.1 | 2.1 | GO:0019894 | kinesin binding(GO:0019894) |
| 0.1 | 0.2 | GO:0008430 | selenium binding(GO:0008430) |
| 0.1 | 0.2 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
| 0.1 | 0.2 | GO:0004766 | spermidine synthase activity(GO:0004766) |
| 0.1 | 0.2 | GO:0008808 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) CDP-diacylglycerol-phosphatidylglycerol phosphatidyltransferase activity(GO:0043337) |
| 0.1 | 0.1 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
| 0.1 | 0.8 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.1 | 0.1 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
| 0.1 | 0.4 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.1 | 0.2 | GO:0016603 | glutaminyl-peptide cyclotransferase activity(GO:0016603) |
| 0.1 | 0.1 | GO:0008296 | 3'-5'-exodeoxyribonuclease activity(GO:0008296) |
| 0.1 | 2.0 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.1 | 0.2 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
| 0.1 | 1.1 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
| 0.1 | 0.1 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
| 0.1 | 0.4 | GO:0004372 | glycine hydroxymethyltransferase activity(GO:0004372) threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.1 | 0.2 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
| 0.1 | 0.4 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
| 0.1 | 0.4 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
| 0.1 | 0.2 | GO:0015207 | ATP:ADP antiporter activity(GO:0005471) adenine transmembrane transporter activity(GO:0015207) |
| 0.1 | 0.1 | GO:0052812 | phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) |
| 0.1 | 0.3 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.1 | 1.5 | GO:0070034 | telomerase RNA binding(GO:0070034) |
| 0.1 | 0.9 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.1 | 0.4 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.1 | 1.1 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.1 | 0.5 | GO:0019863 | IgE binding(GO:0019863) |
| 0.1 | 0.3 | GO:0015254 | glycerol channel activity(GO:0015254) |
| 0.1 | 0.7 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.1 | 7.3 | GO:0043130 | ubiquitin binding(GO:0043130) |
| 0.1 | 0.2 | GO:0071885 | N-terminal protein N-methyltransferase activity(GO:0071885) |
| 0.1 | 0.6 | GO:0008175 | tRNA methyltransferase activity(GO:0008175) |
| 0.1 | 0.2 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
| 0.1 | 1.2 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.1 | 0.1 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.1 | 0.2 | GO:0016748 | succinyltransferase activity(GO:0016748) |
| 0.1 | 0.4 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.1 | 0.2 | GO:0086077 | gap junction channel activity involved in AV node cell-bundle of His cell electrical coupling(GO:0086077) |
| 0.1 | 0.2 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.1 | 0.3 | GO:0038051 | glucocorticoid receptor activity(GO:0004883) glucocorticoid-activated RNA polymerase II transcription factor binding transcription factor activity(GO:0038051) |
| 0.1 | 0.1 | GO:0070717 | poly-purine tract binding(GO:0070717) |
| 0.1 | 0.2 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.1 | 0.5 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.1 | 0.9 | GO:0031491 | nucleosome binding(GO:0031491) |
| 0.1 | 0.5 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.1 | 0.2 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.1 | 0.6 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
| 0.1 | 0.2 | GO:0003989 | acetyl-CoA carboxylase activity(GO:0003989) |
| 0.1 | 0.6 | GO:0070888 | E-box binding(GO:0070888) |
| 0.1 | 0.2 | GO:0000829 | inositol-1,3,4,5,6-pentakisphosphate kinase activity(GO:0000827) inositol hexakisphosphate kinase activity(GO:0000828) inositol heptakisphosphate kinase activity(GO:0000829) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.1 | 2.6 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.1 | 0.5 | GO:0071253 | connexin binding(GO:0071253) |
| 0.1 | 0.3 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
| 0.1 | 0.1 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
| 0.1 | 1.0 | GO:0030331 | estrogen receptor binding(GO:0030331) |
| 0.1 | 0.4 | GO:0016416 | O-palmitoyltransferase activity(GO:0016416) |
| 0.1 | 0.6 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
| 0.1 | 0.2 | GO:0008281 | sulfonylurea receptor activity(GO:0008281) |
| 0.1 | 0.5 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.1 | 2.3 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
| 0.1 | 0.5 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.1 | 1.3 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.1 | 0.2 | GO:0004730 | pseudouridylate synthase activity(GO:0004730) |
| 0.1 | 0.2 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
| 0.1 | 0.1 | GO:0004167 | dopachrome isomerase activity(GO:0004167) |
| 0.1 | 0.4 | GO:0015166 | polyol transmembrane transporter activity(GO:0015166) |
| 0.1 | 0.1 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.1 | 0.2 | GO:0016652 | NAD(P)+ transhydrogenase activity(GO:0008746) oxidoreductase activity, acting on NAD(P)H, NAD(P) as acceptor(GO:0016652) |
| 0.1 | 0.4 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
| 0.1 | 1.8 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.1 | 0.2 | GO:0000035 | acyl binding(GO:0000035) |
| 0.1 | 0.1 | GO:0003993 | acid phosphatase activity(GO:0003993) |
| 0.1 | 0.3 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
| 0.1 | 0.3 | GO:0047685 | amine sulfotransferase activity(GO:0047685) |
| 0.1 | 0.2 | GO:0004560 | alpha-L-fucosidase activity(GO:0004560) fucosidase activity(GO:0015928) |
| 0.1 | 0.2 | GO:0035034 | histone acetyltransferase regulator activity(GO:0035034) |
| 0.1 | 0.2 | GO:0004914 | interleukin-5 receptor activity(GO:0004914) |
| 0.1 | 0.1 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
| 0.1 | 0.1 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 0.1 | 0.2 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
| 0.1 | 0.2 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.0 | 0.3 | GO:0030228 | low-density lipoprotein receptor activity(GO:0005041) lipoprotein particle receptor activity(GO:0030228) |
| 0.0 | 1.2 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.0 | 0.2 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
| 0.0 | 0.2 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.0 | 0.1 | GO:0016639 | oxidoreductase activity, acting on the CH-NH2 group of donors, NAD or NADP as acceptor(GO:0016639) |
| 0.0 | 0.4 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.0 | 0.2 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
| 0.0 | 0.2 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.0 | 0.3 | GO:0031013 | troponin I binding(GO:0031013) |
| 0.0 | 0.1 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
| 0.0 | 0.8 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.0 | 1.1 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
| 0.0 | 0.1 | GO:0008457 | beta-galactosyl-N-acetylglucosaminylgalactosylglucosyl-ceramide beta-1,3-acetylglucosaminyltransferase activity(GO:0008457) lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase activity(GO:0047256) |
| 0.0 | 0.7 | GO:0033549 | MAP kinase phosphatase activity(GO:0033549) |
| 0.0 | 1.0 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.0 | 0.3 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.0 | 0.3 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.0 | 0.6 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
| 0.0 | 2.1 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
| 0.0 | 0.0 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
| 0.0 | 0.4 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.0 | 0.1 | GO:0033695 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
| 0.0 | 0.0 | GO:0043492 | ATPase activity, coupled to movement of substances(GO:0043492) |
| 0.0 | 0.3 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.0 | 0.4 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.0 | 2.9 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
| 0.0 | 0.1 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.0 | 0.2 | GO:0004337 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
| 0.0 | 1.3 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.0 | 0.2 | GO:0008410 | CoA-transferase activity(GO:0008410) |
| 0.0 | 0.1 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.0 | 0.0 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.0 | 0.4 | GO:0043225 | anion transmembrane-transporting ATPase activity(GO:0043225) |
| 0.0 | 0.1 | GO:0004853 | uroporphyrinogen decarboxylase activity(GO:0004853) |
| 0.0 | 0.1 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.0 | 0.3 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.0 | 2.1 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.0 | 1.6 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
| 0.0 | 0.1 | GO:0004878 | complement component C5a receptor activity(GO:0004878) |
| 0.0 | 0.3 | GO:0015307 | drug:proton antiporter activity(GO:0015307) |
| 0.0 | 0.2 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.0 | 0.6 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.0 | 1.1 | GO:0004532 | exoribonuclease activity(GO:0004532) |
| 0.0 | 0.2 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.0 | 0.5 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.0 | 1.4 | GO:0097472 | cyclin-dependent protein kinase activity(GO:0097472) |
| 0.0 | 0.3 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.0 | 0.1 | GO:0001181 | transcription factor activity, core RNA polymerase I binding(GO:0001181) |
| 0.0 | 0.0 | GO:0080122 | coenzyme A transmembrane transporter activity(GO:0015228) adenosine 3',5'-bisphosphate transmembrane transporter activity(GO:0071077) AMP transmembrane transporter activity(GO:0080122) |
| 0.0 | 0.3 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.0 | 0.1 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.0 | 8.5 | GO:0042393 | histone binding(GO:0042393) |
| 0.0 | 0.2 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.0 | 0.7 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.0 | 0.3 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.0 | 0.1 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.0 | 0.1 | GO:0030247 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.0 | 0.2 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.0 | 0.2 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.0 | 0.0 | GO:0005119 | smoothened binding(GO:0005119) |
| 0.0 | 0.1 | GO:0016810 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds(GO:0016810) |
| 0.0 | 0.2 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.0 | 0.5 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.0 | 0.8 | GO:0033613 | activating transcription factor binding(GO:0033613) |
| 0.0 | 0.3 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
| 0.0 | 0.1 | GO:0048256 | flap endonuclease activity(GO:0048256) |
| 0.0 | 0.8 | GO:0008252 | nucleotidase activity(GO:0008252) |
| 0.0 | 0.4 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.0 | 0.2 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.0 | 1.9 | GO:0050681 | androgen receptor binding(GO:0050681) |
| 0.0 | 0.3 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.0 | 0.2 | GO:0042132 | fructose 1,6-bisphosphate 1-phosphatase activity(GO:0042132) |
| 0.0 | 0.0 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.0 | 0.5 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.2 | GO:1901612 | phosphatidylglycerol binding(GO:1901611) cardiolipin binding(GO:1901612) |
| 0.0 | 0.1 | GO:0015218 | pyrimidine nucleotide transmembrane transporter activity(GO:0015218) |
| 0.0 | 1.1 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 0.0 | 0.7 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.0 | 0.3 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
| 0.0 | 2.1 | GO:0051082 | unfolded protein binding(GO:0051082) |
| 0.0 | 0.2 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
| 0.0 | 1.4 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.0 | 0.0 | GO:0022848 | acetylcholine-gated cation channel activity(GO:0022848) |
| 0.0 | 0.1 | GO:0019534 | toxin transporter activity(GO:0019534) |
| 0.0 | 0.3 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.0 | 0.1 | GO:0005174 | CD40 receptor binding(GO:0005174) |
| 0.0 | 0.3 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.0 | 1.0 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.0 | 0.2 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.0 | 0.5 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.0 | 0.1 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
| 0.0 | 0.1 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| 0.0 | 0.4 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.0 | 0.0 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.0 | 0.1 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.0 | 0.7 | GO:0070412 | R-SMAD binding(GO:0070412) |
| 0.0 | 0.1 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.0 | 0.5 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.0 | 0.2 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
| 0.0 | 0.0 | GO:0046030 | inositol bisphosphate phosphatase activity(GO:0016312) inositol trisphosphate phosphatase activity(GO:0046030) |
| 0.0 | 0.2 | GO:0043532 | angiostatin binding(GO:0043532) |
| 0.0 | 0.3 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.0 | 0.0 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.0 | 0.6 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
| 0.0 | 0.1 | GO:0047006 | 17-alpha,20-alpha-dihydroxypregn-4-en-3-one dehydrogenase activity(GO:0047006) |
| 0.0 | 0.1 | GO:0033981 | D-dopachrome decarboxylase activity(GO:0033981) |
| 0.0 | 1.0 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.0 | 0.6 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.0 | 0.1 | GO:0030348 | syntaxin-3 binding(GO:0030348) |
| 0.0 | 0.1 | GO:0004996 | thyroid-stimulating hormone receptor activity(GO:0004996) |
| 0.0 | 0.0 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
| 0.0 | 0.1 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.0 | 0.5 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
| 0.0 | 0.3 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
| 0.0 | 0.2 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 0.0 | 0.1 | GO:0051538 | 3 iron, 4 sulfur cluster binding(GO:0051538) |
| 0.0 | 0.2 | GO:0016934 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
| 0.0 | 0.1 | GO:0070984 | SET domain binding(GO:0070984) |
| 0.0 | 0.2 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
| 0.0 | 0.2 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.0 | 0.1 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.0 | 0.1 | GO:0046556 | alpha-L-arabinofuranosidase activity(GO:0046556) |
| 0.0 | 0.2 | GO:0051287 | NAD binding(GO:0051287) |
| 0.0 | 0.2 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.0 | 0.0 | GO:0052811 | 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) |
| 0.0 | 1.1 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.0 | 0.2 | GO:0016428 | tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
| 0.0 | 1.2 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.0 | 0.2 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.0 | 0.5 | GO:0004896 | cytokine receptor activity(GO:0004896) |
| 0.0 | 0.1 | GO:0046906 | tetrapyrrole binding(GO:0046906) |
| 0.0 | 0.7 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.0 | 0.1 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
| 0.0 | 0.1 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.0 | 0.7 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.0 | 0.2 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.0 | 0.1 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
| 0.0 | 0.2 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.0 | 0.4 | GO:0003924 | GTPase activity(GO:0003924) |
| 0.0 | 0.6 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.0 | 0.1 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
| 0.0 | 0.7 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.0 | 0.1 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
| 0.0 | 1.3 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.3 | GO:0019789 | SUMO transferase activity(GO:0019789) |
| 0.0 | 0.3 | GO:0008081 | phosphoric diester hydrolase activity(GO:0008081) |
| 0.0 | 0.1 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
| 0.0 | 0.2 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.0 | 0.0 | GO:0001855 | complement component C4b binding(GO:0001855) |
| 0.0 | 0.6 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
| 0.0 | 0.1 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
| 0.0 | 0.2 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.0 | 0.1 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
| 0.0 | 0.2 | GO:0015184 | L-cystine transmembrane transporter activity(GO:0015184) |
| 0.0 | 0.1 | GO:0050253 | retinyl-palmitate esterase activity(GO:0050253) |
| 0.0 | 0.0 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.0 | 2.2 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.0 | 0.4 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.0 | 0.1 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
| 0.0 | 0.1 | GO:0016453 | C-acetyltransferase activity(GO:0016453) |
| 0.0 | 0.3 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.0 | 0.2 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
| 0.0 | 0.7 | GO:0042605 | peptide antigen binding(GO:0042605) |
| 0.0 | 0.1 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.0 | 0.3 | GO:0001223 | transcription coactivator binding(GO:0001223) |
| 0.0 | 0.5 | GO:0001221 | transcription cofactor binding(GO:0001221) |
| 0.0 | 0.2 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.0 | 0.1 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.0 | 0.1 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.0 | 0.1 | GO:0004597 | peptide-aspartate beta-dioxygenase activity(GO:0004597) |
| 0.0 | 0.1 | GO:0032451 | demethylase activity(GO:0032451) |
| 0.0 | 1.5 | GO:0043621 | protein self-association(GO:0043621) |
| 0.0 | 0.5 | GO:0035004 | phosphatidylinositol 3-kinase activity(GO:0035004) |
| 0.0 | 0.1 | GO:0004132 | dCMP deaminase activity(GO:0004132) |
| 0.0 | 1.1 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.0 | 0.0 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
| 0.0 | 0.2 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.0 | 1.3 | GO:0050699 | WW domain binding(GO:0050699) |
| 0.0 | 0.0 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.0 | 0.1 | GO:0003960 | NADPH:quinone reductase activity(GO:0003960) |
| 0.0 | 0.2 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
| 0.0 | 0.1 | GO:0030371 | translation repressor activity(GO:0030371) |
| 0.0 | 0.4 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.0 | 0.2 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.0 | 1.1 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.0 | 0.2 | GO:0016972 | thiol oxidase activity(GO:0016972) |
| 0.0 | 0.3 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.0 | 0.1 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
| 0.0 | 0.1 | GO:0022842 | leak channel activity(GO:0022840) narrow pore channel activity(GO:0022842) |
| 0.0 | 0.2 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
| 0.0 | 0.1 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.0 | 0.1 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.0 | 0.1 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
| 0.0 | 0.7 | GO:0019198 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
| 0.0 | 0.1 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.0 | 0.4 | GO:0097110 | scaffold protein binding(GO:0097110) |
| 0.0 | 0.1 | GO:0022897 | peptide:proton symporter activity(GO:0015333) proton-dependent peptide secondary active transmembrane transporter activity(GO:0022897) |
| 0.0 | 2.1 | GO:0008565 | protein transporter activity(GO:0008565) |
| 0.0 | 0.5 | GO:0008143 | poly(A) binding(GO:0008143) |
| 0.0 | 0.0 | GO:0001083 | transcription factor activity, RNA polymerase II basal transcription factor binding(GO:0001083) |
| 0.0 | 0.1 | GO:0080019 | fatty-acyl-CoA reductase (alcohol-forming) activity(GO:0080019) |
| 0.0 | 0.3 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.0 | 0.1 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.0 | 0.1 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.0 | 0.0 | GO:0043734 | DNA demethylase activity(GO:0035514) DNA-N1-methyladenine dioxygenase activity(GO:0043734) |
| 0.0 | 1.1 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 0.0 | 0.2 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.0 | 0.0 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.0 | 0.1 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
| 0.0 | 0.1 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.0 | 0.1 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.0 | 0.6 | GO:0070001 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
| 0.0 | 0.1 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
| 0.0 | 0.3 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 0.0 | 0.2 | GO:0034062 | DNA-directed RNA polymerase activity(GO:0003899) RNA polymerase activity(GO:0034062) |
| 0.0 | 0.2 | GO:0047894 | flavonol 3-sulfotransferase activity(GO:0047894) |
| 0.0 | 0.4 | GO:0008391 | arachidonic acid monooxygenase activity(GO:0008391) arachidonic acid epoxygenase activity(GO:0008392) |
| 0.0 | 0.0 | GO:0005171 | hepatocyte growth factor receptor binding(GO:0005171) |
| 0.0 | 0.1 | GO:0022850 | serotonin-gated cation channel activity(GO:0022850) |
| 0.0 | 0.4 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
| 0.0 | 0.8 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.0 | 1.4 | GO:0051087 | chaperone binding(GO:0051087) |
| 0.0 | 0.1 | GO:0070320 | inward rectifier potassium channel inhibitor activity(GO:0070320) |
| 0.0 | 10.3 | GO:0004842 | ubiquitin-protein transferase activity(GO:0004842) |
| 0.0 | 0.1 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
| 0.0 | 0.0 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.0 | 0.3 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.0 | 0.1 | GO:0070990 | snRNP binding(GO:0070990) |
| 0.0 | 0.1 | GO:0047275 | glucosaminylgalactosylglucosylceramide beta-galactosyltransferase activity(GO:0047275) |
| 0.0 | 0.1 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.0 | 0.1 | GO:0005534 | galactose binding(GO:0005534) |
| 0.0 | 0.0 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 0.0 | 0.0 | GO:0008047 | enzyme activator activity(GO:0008047) |
| 0.0 | 0.0 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.0 | 0.1 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
| 0.0 | 0.3 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.0 | 0.5 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
| 0.0 | 0.1 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
| 0.0 | 0.1 | GO:0050544 | arachidonic acid binding(GO:0050544) |
| 0.0 | 0.1 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
| 0.0 | 0.3 | GO:0016776 | phosphotransferase activity, phosphate group as acceptor(GO:0016776) |
| 0.0 | 0.1 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.0 | 0.2 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
| 0.0 | 0.1 | GO:0001972 | retinoic acid binding(GO:0001972) |
| 0.0 | 0.1 | GO:0102008 | cytosolic dipeptidase activity(GO:0102008) |
| 0.0 | 0.9 | GO:0032813 | tumor necrosis factor receptor superfamily binding(GO:0032813) |
| 0.0 | 0.7 | GO:0045309 | protein phosphorylated amino acid binding(GO:0045309) |
| 0.0 | 0.1 | GO:0050254 | rhodopsin kinase activity(GO:0050254) |
| 0.0 | 0.0 | GO:0008426 | protein kinase C inhibitor activity(GO:0008426) |
| 0.0 | 0.4 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
| 0.0 | 0.1 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
| 0.0 | 0.1 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
| 0.0 | 0.0 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
| 0.0 | 0.2 | GO:0016818 | hydrolase activity, acting on acid anhydrides, in phosphorus-containing anhydrides(GO:0016818) |
| 0.0 | 0.3 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.0 | 0.1 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.0 | 0.0 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.0 | 0.1 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.0 | 0.1 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.0 | 0.0 | GO:0044549 | GTP cyclohydrolase binding(GO:0044549) |
| 0.0 | 0.1 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
| 0.0 | 0.0 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
| 0.0 | 0.1 | GO:0004906 | interferon-gamma receptor activity(GO:0004906) |
| 0.0 | 0.0 | GO:0016211 | glutamate-ammonia ligase activity(GO:0004356) ammonia ligase activity(GO:0016211) acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.0 | 0.1 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.0 | 0.1 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.0 | 0.1 | GO:0004945 | angiotensin receptor activity(GO:0001595) angiotensin type II receptor activity(GO:0004945) |
| 0.0 | 0.1 | GO:0031432 | titin binding(GO:0031432) |
| 0.0 | 0.1 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
| 0.0 | 0.0 | GO:0004579 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 0.1 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 0.0 | 0.3 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
| 0.0 | 0.0 | GO:0035326 | enhancer binding(GO:0035326) |
| 0.0 | 0.1 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.0 | 0.1 | GO:0015288 | porin activity(GO:0015288) |
| 0.0 | 0.1 | GO:0019787 | ubiquitin-like protein transferase activity(GO:0019787) |
| 0.0 | 0.1 | GO:0017159 | pantetheine hydrolase activity(GO:0017159) |
| 0.0 | 0.1 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.0 | 0.1 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
| 0.0 | 0.1 | GO:0030345 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
| 0.0 | 0.1 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.0 | 1.0 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
| 0.0 | 0.3 | GO:0033038 | bitter taste receptor activity(GO:0033038) |
| 0.0 | 0.2 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.0 | 0.0 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
| 0.0 | 0.1 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.0 | 0.1 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.0 | 0.0 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
| 0.0 | 0.0 | GO:0005165 | neurotrophin receptor binding(GO:0005165) |
| 0.0 | 0.0 | GO:0004492 | methylmalonyl-CoA decarboxylase activity(GO:0004492) |
| 0.0 | 0.1 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.0 | 0.1 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
| 0.0 | 0.1 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.0 | 0.1 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.0 | 0.0 | GO:0008312 | 7S RNA binding(GO:0008312) |
| 0.0 | 0.0 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.0 | 0.0 | GO:0035276 | ethanol binding(GO:0035276) |
| 0.0 | 0.1 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
| 0.0 | 0.0 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 0.0 | 0.3 | GO:0043531 | ADP binding(GO:0043531) |
| 0.0 | 0.0 | GO:0050429 | calcium-dependent phospholipase C activity(GO:0050429) |
| 0.0 | 0.3 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.0 | 0.1 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.0 | 0.1 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.0 | 0.0 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
| 0.0 | 0.0 | GO:0008374 | O-acyltransferase activity(GO:0008374) |
| 0.0 | 0.1 | GO:0001076 | transcription factor activity, RNA polymerase II transcription factor binding(GO:0001076) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 0.4 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
| 0.2 | 15.3 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.2 | 1.6 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.2 | 0.3 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.2 | 0.9 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.2 | 6.9 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.1 | 0.4 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.1 | 8.2 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.1 | 1.8 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.1 | 0.6 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.1 | 6.6 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.1 | 6.1 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.1 | 0.6 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.1 | 6.4 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.1 | 3.7 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.1 | 7.9 | PID E2F PATHWAY | E2F transcription factor network |
| 0.1 | 2.7 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.1 | 3.4 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
| 0.1 | 2.5 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.1 | 0.6 | PID EPO PATHWAY | EPO signaling pathway |
| 0.1 | 1.3 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.1 | 2.5 | PID ATR PATHWAY | ATR signaling pathway |
| 0.1 | 1.4 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.1 | 0.8 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.1 | 0.4 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.1 | 1.3 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.1 | 1.8 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.1 | 0.3 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.1 | 1.2 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.1 | 4.0 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.1 | 2.0 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.1 | 0.9 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.1 | 0.4 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.1 | 0.2 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.1 | 0.5 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.1 | 1.1 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.1 | 5.0 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.1 | 1.4 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.1 | 2.8 | PID MYC PATHWAY | C-MYC pathway |
| 0.1 | 3.6 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.1 | 0.2 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.1 | 0.9 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.1 | 2.6 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.1 | 5.3 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.1 | 0.1 | PID S1P S1P2 PATHWAY | S1P2 pathway |
| 0.1 | 0.1 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.1 | 0.5 | PID IGF1 PATHWAY | IGF1 pathway |
| 0.0 | 3.3 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.0 | 2.8 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 1.2 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 0.7 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.0 | 0.3 | PID SHP2 PATHWAY | SHP2 signaling |
| 0.0 | 1.6 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 0.3 | PID ENDOTHELIN PATHWAY | Endothelins |
| 0.0 | 0.6 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.0 | 1.2 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
| 0.0 | 0.1 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.0 | 1.5 | PID AP1 PATHWAY | AP-1 transcription factor network |
| 0.0 | 1.8 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.0 | 0.9 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.0 | 0.1 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.0 | 0.1 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.0 | 0.3 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.0 | 1.3 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 0.4 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
| 0.0 | 0.1 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
| 0.0 | 1.1 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.0 | 1.4 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
| 0.0 | 1.3 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| 0.0 | 0.9 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.0 | 0.7 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.0 | 1.3 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.0 | 0.4 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.0 | 0.8 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.0 | 0.1 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.0 | 1.4 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.0 | 0.8 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.0 | 3.1 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
| 0.0 | 0.8 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.0 | 1.6 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 0.0 | 0.5 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.0 | 0.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.0 | 0.6 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.0 | 0.3 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 1.1 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
| 0.0 | 0.6 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.0 | 0.2 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.0 | 0.4 | PID P73PATHWAY | p73 transcription factor network |
| 0.0 | 0.1 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.0 | 0.0 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.0 | 0.6 | PID BMP PATHWAY | BMP receptor signaling |
| 0.0 | 0.0 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.0 | 3.6 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.0 | 0.2 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.0 | 0.0 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
| 0.0 | 0.9 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
| 0.0 | 0.9 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.0 | 0.4 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.0 | 0.4 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
| 0.0 | 0.1 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.0 | 0.1 | PID IL3 PATHWAY | IL3-mediated signaling events |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 0.5 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.4 | 1.3 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
| 0.3 | 1.3 | REACTOME DNA STRAND ELONGATION | Genes involved in DNA strand elongation |
| 0.3 | 9.4 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.3 | 1.6 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
| 0.3 | 6.9 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 0.3 | 9.6 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.2 | 4.6 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.2 | 4.7 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
| 0.2 | 5.2 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.2 | 6.6 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.2 | 3.9 | REACTOME GLOBAL GENOMIC NER GG NER | Genes involved in Global Genomic NER (GG-NER) |
| 0.1 | 2.7 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
| 0.1 | 4.4 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.1 | 4.8 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.1 | 0.4 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.1 | 2.4 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.1 | 0.3 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.1 | 2.5 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.1 | 2.0 | REACTOME ACTIVATION OF ATR IN RESPONSE TO REPLICATION STRESS | Genes involved in Activation of ATR in response to replication stress |
| 0.1 | 3.5 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.1 | 14.8 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.1 | 2.9 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.1 | 3.9 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 0.1 | 3.7 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.1 | 1.4 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.1 | 3.5 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.1 | 2.9 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.1 | 0.1 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
| 0.1 | 0.8 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.1 | 3.6 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.1 | 2.3 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.1 | 1.0 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.1 | 0.6 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.1 | 1.8 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.1 | 0.6 | REACTOME AQUAPORIN MEDIATED TRANSPORT | Genes involved in Aquaporin-mediated transport |
| 0.1 | 1.1 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.1 | 2.4 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.1 | 1.3 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.1 | 0.7 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
| 0.1 | 1.0 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
| 0.1 | 2.7 | REACTOME NUCLEAR EVENTS KINASE AND TRANSCRIPTION FACTOR ACTIVATION | Genes involved in Nuclear Events (kinase and transcription factor activation) |
| 0.1 | 1.0 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 0.1 | 7.1 | REACTOME SCFSKP2 MEDIATED DEGRADATION OF P27 P21 | Genes involved in SCF(Skp2)-mediated degradation of p27/p21 |
| 0.1 | 2.1 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.1 | 2.5 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.1 | 1.7 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
| 0.1 | 0.4 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.1 | 3.4 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.1 | 1.6 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.1 | 2.4 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
| 0.1 | 0.6 | REACTOME OPIOID SIGNALLING | Genes involved in Opioid Signalling |
| 0.1 | 3.6 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.1 | 0.8 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.1 | 0.7 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.1 | 0.6 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
| 0.1 | 2.1 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.1 | 2.3 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.1 | 1.4 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.1 | 1.3 | REACTOME SIGNALING BY NOTCH4 | Genes involved in Signaling by NOTCH4 |
| 0.1 | 1.9 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
| 0.1 | 1.9 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.1 | 1.9 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
| 0.1 | 1.3 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.1 | 0.5 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.1 | 1.2 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.1 | 0.6 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
| 0.1 | 1.6 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.1 | 1.9 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
| 0.1 | 1.0 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.1 | 0.8 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.1 | 1.6 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.1 | 3.9 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.1 | 1.0 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.1 | 0.8 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.1 | 2.6 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.1 | 1.5 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.1 | 0.7 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.1 | 0.9 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.1 | 1.0 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
| 0.1 | 1.0 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.1 | 2.2 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.1 | 4.5 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 0.1 | 2.4 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.1 | 0.7 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
| 0.1 | 2.7 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
| 0.1 | 0.3 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.1 | 0.8 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
| 0.0 | 1.2 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.0 | 1.0 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
| 0.0 | 0.2 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.0 | 0.1 | REACTOME G1 S TRANSITION | Genes involved in G1/S Transition |
| 0.0 | 0.2 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
| 0.0 | 0.3 | REACTOME INFLUENZA LIFE CYCLE | Genes involved in Influenza Life Cycle |
| 0.0 | 0.5 | REACTOME RECRUITMENT OF MITOTIC CENTROSOME PROTEINS AND COMPLEXES | Genes involved in Recruitment of mitotic centrosome proteins and complexes |
| 0.0 | 0.3 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.0 | 0.3 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.0 | 1.4 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
| 0.0 | 0.8 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.0 | 1.6 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.0 | 0.5 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
| 0.0 | 3.0 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.0 | 2.1 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.0 | 0.5 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.0 | 1.1 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.0 | 0.5 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
| 0.0 | 1.4 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.0 | 1.8 | REACTOME RNA POL III TRANSCRIPTION | Genes involved in RNA Polymerase III Transcription |
| 0.0 | 1.3 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 2.1 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.0 | 1.2 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.0 | 0.7 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.0 | 1.1 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
| 0.0 | 0.2 | REACTOME ADP SIGNALLING THROUGH P2RY12 | Genes involved in ADP signalling through P2Y purinoceptor 12 |
| 0.0 | 0.5 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.0 | 0.7 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.0 | 0.3 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.0 | 0.3 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.0 | 0.4 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.0 | 0.8 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.0 | 0.7 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.0 | 0.3 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.0 | 0.7 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.0 | 0.5 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.0 | 0.2 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.0 | 0.4 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.0 | 0.6 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 0.0 | 0.4 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.0 | 3.0 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.0 | 0.7 | REACTOME RNA POL I RNA POL III AND MITOCHONDRIAL TRANSCRIPTION | Genes involved in RNA Polymerase I, RNA Polymerase III, and Mitochondrial Transcription |
| 0.0 | 0.0 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.0 | 0.7 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.0 | 0.4 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.0 | 1.2 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.0 | 0.2 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
| 0.0 | 1.1 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.0 | 3.6 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
| 0.0 | 0.5 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.0 | 0.9 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 0.0 | 0.1 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
| 0.0 | 0.7 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.0 | 4.2 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.0 | 1.1 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.0 | 0.5 | REACTOME TRNA AMINOACYLATION | Genes involved in tRNA Aminoacylation |
| 0.0 | 0.4 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
| 0.0 | 0.6 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.0 | 0.7 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.0 | 0.6 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.0 | 0.4 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.0 | 0.1 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.0 | 0.8 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.0 | 0.2 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.0 | 0.1 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
| 0.0 | 1.0 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.0 | 0.2 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
| 0.0 | 0.6 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.0 | 0.5 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.0 | 0.1 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.0 | 0.1 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
| 0.0 | 0.2 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.0 | 0.1 | REACTOME TAK1 ACTIVATES NFKB BY PHOSPHORYLATION AND ACTIVATION OF IKKS COMPLEX | Genes involved in TAK1 activates NFkB by phosphorylation and activation of IKKs complex |
| 0.0 | 1.1 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 0.1 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.0 | 0.2 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.0 | 0.2 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.0 | 0.1 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |