Mucociliary differentiation, bronchial epithelial cells, human (Ross 2007)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
SIN3A
|
ENSG00000169375.11 | SIN3 transcription regulator family member A |
|
CHD1
|
ENSG00000153922.6 | chromodomain helicase DNA binding protein 1 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| SIN3A | hg19_v2_chr15_-_75743915_75743933, hg19_v2_chr15_-_75748115_75748126 | 0.55 | 1.8e-03 | Click! |
| CHD1 | hg19_v2_chr5_-_98262240_98262240 | -0.01 | 9.7e-01 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr3_-_19988462 | 24.70 |
ENST00000344838.4
|
EFHB
|
EF-hand domain family, member B |
| chr4_-_7044657 | 14.65 |
ENST00000310085.4
|
CCDC96
|
coiled-coil domain containing 96 |
| chr16_-_66959429 | 14.39 |
ENST00000420652.1
ENST00000299759.6 |
RRAD
|
Ras-related associated with diabetes |
| chr13_+_35516390 | 14.11 |
ENST00000540320.1
ENST00000400445.3 ENST00000310336.4 |
NBEA
|
neurobeachin |
| chr19_-_7990991 | 13.90 |
ENST00000318978.4
|
CTXN1
|
cortexin 1 |
| chr16_-_52580920 | 11.56 |
ENST00000219746.9
|
TOX3
|
TOX high mobility group box family member 3 |
| chr17_+_55333876 | 11.14 |
ENST00000284073.2
|
MSI2
|
musashi RNA-binding protein 2 |
| chr4_+_72052964 | 10.01 |
ENST00000264485.5
ENST00000425175.1 |
SLC4A4
|
solute carrier family 4 (sodium bicarbonate cotransporter), member 4 |
| chr11_-_75379612 | 8.62 |
ENST00000526740.1
|
MAP6
|
microtubule-associated protein 6 |
| chrX_+_16964794 | 8.46 |
ENST00000357277.3
|
REPS2
|
RALBP1 associated Eps domain containing 2 |
| chrX_+_16964985 | 8.39 |
ENST00000303843.7
|
REPS2
|
RALBP1 associated Eps domain containing 2 |
| chr16_+_67465016 | 7.36 |
ENST00000326152.5
|
HSD11B2
|
hydroxysteroid (11-beta) dehydrogenase 2 |
| chr11_+_61276214 | 7.17 |
ENST00000378075.2
|
LRRC10B
|
leucine rich repeat containing 10B |
| chr13_-_37494365 | 7.13 |
ENST00000350148.5
|
SMAD9
|
SMAD family member 9 |
| chr5_-_180018540 | 6.94 |
ENST00000292641.3
|
SCGB3A1
|
secretoglobin, family 3A, member 1 |
| chr11_-_75380165 | 6.90 |
ENST00000304771.3
|
MAP6
|
microtubule-associated protein 6 |
| chr14_-_65438865 | 6.83 |
ENST00000267512.5
|
RAB15
|
RAB15, member RAS oncogene family |
| chr22_-_31741757 | 6.81 |
ENST00000215919.3
|
PATZ1
|
POZ (BTB) and AT hook containing zinc finger 1 |
| chr1_-_67390474 | 6.70 |
ENST00000371023.3
ENST00000371022.3 ENST00000371026.3 ENST00000431318.1 |
WDR78
|
WD repeat domain 78 |
| chr1_+_41827594 | 6.66 |
ENST00000372591.1
|
FOXO6
|
forkhead box O6 |
| chr7_-_131241361 | 6.59 |
ENST00000378555.3
ENST00000322985.9 ENST00000541194.1 ENST00000537928.1 |
PODXL
|
podocalyxin-like |
| chr6_+_107811162 | 6.36 |
ENST00000317357.5
|
SOBP
|
sine oculis binding protein homolog (Drosophila) |
| chr2_+_73612858 | 5.95 |
ENST00000409009.1
ENST00000264448.6 ENST00000377715.1 |
ALMS1
|
Alstrom syndrome 1 |
| chr5_+_42423872 | 5.93 |
ENST00000230882.4
ENST00000357703.3 |
GHR
|
growth hormone receptor |
| chr13_-_37494391 | 5.84 |
ENST00000379826.4
|
SMAD9
|
SMAD family member 9 |
| chrX_-_44202857 | 5.77 |
ENST00000420999.1
|
EFHC2
|
EF-hand domain (C-terminal) containing 2 |
| chr1_-_223537475 | 5.74 |
ENST00000344029.6
ENST00000494793.2 ENST00000366878.4 ENST00000366877.3 |
SUSD4
|
sushi domain containing 4 |
| chr6_-_111804393 | 5.72 |
ENST00000368802.3
ENST00000368805.1 |
REV3L
|
REV3-like, polymerase (DNA directed), zeta, catalytic subunit |
| chr13_-_36705425 | 5.46 |
ENST00000255448.4
ENST00000360631.3 ENST00000379892.4 |
DCLK1
|
doublecortin-like kinase 1 |
| chr2_-_174828892 | 5.42 |
ENST00000418194.2
|
SP3
|
Sp3 transcription factor |
| chr9_-_124991124 | 5.39 |
ENST00000394319.4
ENST00000340587.3 |
LHX6
|
LIM homeobox 6 |
| chr3_-_18466787 | 5.26 |
ENST00000338745.6
ENST00000450898.1 |
SATB1
|
SATB homeobox 1 |
| chr10_+_12391685 | 5.09 |
ENST00000378845.1
|
CAMK1D
|
calcium/calmodulin-dependent protein kinase ID |
| chr4_-_16228083 | 5.03 |
ENST00000399920.3
|
TAPT1
|
transmembrane anterior posterior transformation 1 |
| chr6_-_29595779 | 5.02 |
ENST00000355973.3
ENST00000377012.4 |
GABBR1
|
gamma-aminobutyric acid (GABA) B receptor, 1 |
| chr2_+_121103706 | 4.96 |
ENST00000295228.3
|
INHBB
|
inhibin, beta B |
| chr4_+_72053017 | 4.93 |
ENST00000351898.6
|
SLC4A4
|
solute carrier family 4 (sodium bicarbonate cotransporter), member 4 |
| chr10_-_28287968 | 4.85 |
ENST00000305242.5
|
ARMC4
|
armadillo repeat containing 4 |
| chr17_+_7788104 | 4.79 |
ENST00000380358.4
|
CHD3
|
chromodomain helicase DNA binding protein 3 |
| chr11_-_33891362 | 4.79 |
ENST00000395833.3
|
LMO2
|
LIM domain only 2 (rhombotin-like 1) |
| chr11_+_45907177 | 4.75 |
ENST00000241014.2
|
MAPK8IP1
|
mitogen-activated protein kinase 8 interacting protein 1 |
| chr20_+_51588873 | 4.72 |
ENST00000371497.5
|
TSHZ2
|
teashirt zinc finger homeobox 2 |
| chr20_+_56725952 | 4.61 |
ENST00000371168.3
|
C20orf85
|
chromosome 20 open reading frame 85 |
| chr5_+_139027877 | 4.56 |
ENST00000302517.3
|
CXXC5
|
CXXC finger protein 5 |
| chr18_-_24765248 | 4.55 |
ENST00000580774.1
ENST00000284224.8 |
CHST9
|
carbohydrate (N-acetylgalactosamine 4-0) sulfotransferase 9 |
| chr7_-_158380371 | 4.52 |
ENST00000389418.4
ENST00000389416.4 |
PTPRN2
|
protein tyrosine phosphatase, receptor type, N polypeptide 2 |
| chr2_+_8822113 | 4.52 |
ENST00000396290.1
ENST00000331129.3 |
ID2
|
inhibitor of DNA binding 2, dominant negative helix-loop-helix protein |
| chr10_+_12391481 | 4.48 |
ENST00000378847.3
|
CAMK1D
|
calcium/calmodulin-dependent protein kinase ID |
| chr19_+_708910 | 4.41 |
ENST00000264560.7
|
PALM
|
paralemmin |
| chr19_+_709101 | 4.39 |
ENST00000338448.5
|
PALM
|
paralemmin |
| chr17_-_74137374 | 4.37 |
ENST00000322957.6
|
FOXJ1
|
forkhead box J1 |
| chr1_-_223537401 | 4.28 |
ENST00000343846.3
ENST00000454695.2 ENST00000484758.2 |
SUSD4
|
sushi domain containing 4 |
| chr9_+_34458771 | 4.28 |
ENST00000437363.1
ENST00000242317.4 |
DNAI1
|
dynein, axonemal, intermediate chain 1 |
| chr6_-_43478239 | 4.27 |
ENST00000372441.1
|
LRRC73
|
leucine rich repeat containing 73 |
| chr6_+_19837592 | 4.24 |
ENST00000378700.3
|
ID4
|
inhibitor of DNA binding 4, dominant negative helix-loop-helix protein |
| chr5_+_32174483 | 4.19 |
ENST00000606994.1
|
CTD-2186M15.3
|
CTD-2186M15.3 |
| chr14_-_61190754 | 4.18 |
ENST00000216513.4
|
SIX4
|
SIX homeobox 4 |
| chr1_+_118148556 | 4.17 |
ENST00000369448.3
|
FAM46C
|
family with sequence similarity 46, member C |
| chr4_+_95679072 | 4.16 |
ENST00000515059.1
|
BMPR1B
|
bone morphogenetic protein receptor, type IB |
| chr9_-_120177216 | 4.15 |
ENST00000373996.3
ENST00000313400.4 ENST00000361477.3 |
ASTN2
|
astrotactin 2 |
| chr10_+_115803650 | 4.12 |
ENST00000369295.2
|
ADRB1
|
adrenoceptor beta 1 |
| chr10_-_13570533 | 4.11 |
ENST00000396900.2
ENST00000396898.2 |
BEND7
|
BEN domain containing 7 |
| chr2_-_230579185 | 4.08 |
ENST00000341772.4
|
DNER
|
delta/notch-like EGF repeat containing |
| chr9_-_120177342 | 4.05 |
ENST00000361209.2
|
ASTN2
|
astrotactin 2 |
| chr19_-_6110474 | 3.91 |
ENST00000587181.1
ENST00000587321.1 ENST00000586806.1 ENST00000589742.1 ENST00000592546.1 ENST00000303657.5 |
RFX2
|
regulatory factor X, 2 (influences HLA class II expression) |
| chr9_+_72435709 | 3.90 |
ENST00000377197.3
ENST00000527647.1 |
C9orf135
|
chromosome 9 open reading frame 135 |
| chr1_-_22469459 | 3.88 |
ENST00000290167.6
|
WNT4
|
wingless-type MMTV integration site family, member 4 |
| chr14_+_56585048 | 3.87 |
ENST00000267460.4
|
PELI2
|
pellino E3 ubiquitin protein ligase family member 2 |
| chr7_+_3340989 | 3.87 |
ENST00000404826.2
ENST00000389531.3 |
SDK1
|
sidekick cell adhesion molecule 1 |
| chr16_-_54320675 | 3.83 |
ENST00000329734.3
|
IRX3
|
iroquois homeobox 3 |
| chr11_+_94245617 | 3.78 |
ENST00000542198.1
|
RP11-867G2.2
|
long intergenic non-protein coding RNA 1171 |
| chr17_-_56065484 | 3.77 |
ENST00000581208.1
|
VEZF1
|
vascular endothelial zinc finger 1 |
| chr6_-_79787902 | 3.77 |
ENST00000275034.4
|
PHIP
|
pleckstrin homology domain interacting protein |
| chr19_+_41620335 | 3.76 |
ENST00000331105.2
|
CYP2F1
|
cytochrome P450, family 2, subfamily F, polypeptide 1 |
| chr19_+_13106383 | 3.73 |
ENST00000397661.2
|
NFIX
|
nuclear factor I/X (CCAAT-binding transcription factor) |
| chr15_+_76352178 | 3.72 |
ENST00000388942.3
|
C15orf27
|
chromosome 15 open reading frame 27 |
| chr1_+_33722080 | 3.72 |
ENST00000483388.1
ENST00000539719.1 |
ZNF362
|
zinc finger protein 362 |
| chr19_+_4343524 | 3.70 |
ENST00000262966.8
ENST00000359935.4 ENST00000599840.1 |
MPND
|
MPN domain containing |
| chr9_+_140135665 | 3.69 |
ENST00000340384.4
|
TUBB4B
|
tubulin, beta 4B class IVb |
| chr14_+_67999999 | 3.69 |
ENST00000329153.5
|
PLEKHH1
|
pleckstrin homology domain containing, family H (with MyTH4 domain) member 1 |
| chr17_+_55334364 | 3.69 |
ENST00000322684.3
ENST00000579590.1 |
MSI2
|
musashi RNA-binding protein 2 |
| chr7_-_73184588 | 3.67 |
ENST00000395145.2
|
CLDN3
|
claudin 3 |
| chr1_+_210406121 | 3.63 |
ENST00000367012.3
|
SERTAD4
|
SERTA domain containing 4 |
| chr14_-_65439132 | 3.63 |
ENST00000533601.2
|
RAB15
|
RAB15, member RAS oncogene family |
| chr19_+_4343691 | 3.60 |
ENST00000597036.1
|
MPND
|
MPN domain containing |
| chr9_+_96338647 | 3.59 |
ENST00000359246.4
|
PHF2
|
PHD finger protein 2 |
| chr22_-_37172111 | 3.57 |
ENST00000417951.2
ENST00000430701.1 ENST00000433985.2 |
IFT27
|
intraflagellar transport 27 homolog (Chlamydomonas) |
| chr6_+_157099036 | 3.54 |
ENST00000350026.5
ENST00000346085.5 ENST00000367148.1 ENST00000275248.4 |
ARID1B
|
AT rich interactive domain 1B (SWI1-like) |
| chr12_-_63328817 | 3.52 |
ENST00000228705.6
|
PPM1H
|
protein phosphatase, Mg2+/Mn2+ dependent, 1H |
| chr7_-_139876812 | 3.51 |
ENST00000397560.2
|
JHDM1D
|
lysine (K)-specific demethylase 7A |
| chr1_-_48937838 | 3.49 |
ENST00000371847.3
|
SPATA6
|
spermatogenesis associated 6 |
| chr17_+_14204389 | 3.47 |
ENST00000360954.2
|
HS3ST3B1
|
heparan sulfate (glucosamine) 3-O-sulfotransferase 3B1 |
| chr22_-_31503490 | 3.47 |
ENST00000400299.2
|
SELM
|
Selenoprotein M |
| chr16_-_66730583 | 3.46 |
ENST00000330687.4
ENST00000394106.2 ENST00000563952.1 |
CMTM4
|
CKLF-like MARVEL transmembrane domain containing 4 |
| chr11_-_93276582 | 3.46 |
ENST00000298966.2
|
SMCO4
|
single-pass membrane protein with coiled-coil domains 4 |
| chr9_-_86432547 | 3.46 |
ENST00000376365.3
ENST00000376371.2 |
GKAP1
|
G kinase anchoring protein 1 |
| chr22_+_39853258 | 3.46 |
ENST00000341184.6
|
MGAT3
|
mannosyl (beta-1,4-)-glycoprotein beta-1,4-N-acetylglucosaminyltransferase |
| chr6_-_109762344 | 3.45 |
ENST00000521072.2
ENST00000424445.2 ENST00000440797.2 |
PPIL6
|
peptidylprolyl isomerase (cyclophilin)-like 6 |
| chr18_-_30050395 | 3.41 |
ENST00000269209.6
ENST00000399218.4 |
GAREM
|
GRB2 associated, regulator of MAPK1 |
| chr22_-_37172191 | 3.41 |
ENST00000340630.5
|
IFT27
|
intraflagellar transport 27 homolog (Chlamydomonas) |
| chr1_+_205538105 | 3.38 |
ENST00000367147.4
ENST00000539267.1 |
MFSD4
|
major facilitator superfamily domain containing 4 |
| chr3_-_15901278 | 3.37 |
ENST00000399451.2
|
ANKRD28
|
ankyrin repeat domain 28 |
| chr6_+_36164487 | 3.36 |
ENST00000357641.6
|
BRPF3
|
bromodomain and PHD finger containing, 3 |
| chr15_-_45480153 | 3.33 |
ENST00000560471.1
ENST00000560540.1 |
SHF
|
Src homology 2 domain containing F |
| chr3_+_23986748 | 3.32 |
ENST00000312521.4
|
NR1D2
|
nuclear receptor subfamily 1, group D, member 2 |
| chr2_+_10183651 | 3.32 |
ENST00000305883.1
|
KLF11
|
Kruppel-like factor 11 |
| chr11_-_106889157 | 3.31 |
ENST00000282249.2
|
GUCY1A2
|
guanylate cyclase 1, soluble, alpha 2 |
| chr10_+_120789223 | 3.29 |
ENST00000425699.1
|
NANOS1
|
nanos homolog 1 (Drosophila) |
| chr1_+_211433275 | 3.29 |
ENST00000367005.4
|
RCOR3
|
REST corepressor 3 |
| chr19_+_4343584 | 3.29 |
ENST00000596722.1
|
MPND
|
MPN domain containing |
| chr1_+_245133656 | 3.27 |
ENST00000366521.3
|
EFCAB2
|
EF-hand calcium binding domain 2 |
| chr22_+_29279552 | 3.25 |
ENST00000544604.2
|
ZNRF3
|
zinc and ring finger 3 |
| chr6_-_111804905 | 3.21 |
ENST00000358835.3
ENST00000435970.1 |
REV3L
|
REV3-like, polymerase (DNA directed), zeta, catalytic subunit |
| chr17_+_8924837 | 3.14 |
ENST00000173229.2
|
NTN1
|
netrin 1 |
| chr19_+_1285890 | 3.14 |
ENST00000344663.3
|
MUM1
|
melanoma associated antigen (mutated) 1 |
| chr17_+_36861735 | 3.12 |
ENST00000378137.5
ENST00000325718.7 |
MLLT6
|
myeloid/lymphoid or mixed-lineage leukemia (trithorax homolog, Drosophila); translocated to, 6 |
| chr10_+_72164135 | 3.09 |
ENST00000373218.4
|
EIF4EBP2
|
eukaryotic translation initiation factor 4E binding protein 2 |
| chr18_-_45935663 | 3.09 |
ENST00000589194.1
ENST00000591279.1 ENST00000590855.1 ENST00000587107.1 ENST00000588970.1 ENST00000586525.1 ENST00000592387.1 ENST00000590800.1 |
ZBTB7C
|
zinc finger and BTB domain containing 7C |
| chr10_-_61513146 | 3.08 |
ENST00000430431.1
|
LINC00948
|
long intergenic non-protein coding RNA 948 |
| chr2_-_158732340 | 3.05 |
ENST00000539637.1
ENST00000413751.1 ENST00000434821.1 ENST00000424669.1 |
ACVR1
|
activin A receptor, type I |
| chr1_+_211432593 | 3.04 |
ENST00000367006.4
|
RCOR3
|
REST corepressor 3 |
| chr1_+_87794150 | 3.04 |
ENST00000370544.5
|
LMO4
|
LIM domain only 4 |
| chr7_-_99869799 | 3.01 |
ENST00000436886.2
|
GATS
|
GATS, stromal antigen 3 opposite strand |
| chr22_-_31742218 | 3.00 |
ENST00000266269.5
ENST00000405309.3 ENST00000351933.4 |
PATZ1
|
POZ (BTB) and AT hook containing zinc finger 1 |
| chr2_-_99757977 | 2.99 |
ENST00000355053.4
|
TSGA10
|
testis specific, 10 |
| chr5_+_127419449 | 2.97 |
ENST00000262461.2
ENST00000343225.4 |
SLC12A2
|
solute carrier family 12 (sodium/potassium/chloride transporter), member 2 |
| chr10_+_70587279 | 2.97 |
ENST00000298596.6
ENST00000399169.4 ENST00000399165.4 ENST00000399162.2 |
STOX1
|
storkhead box 1 |
| chr9_-_126030817 | 2.96 |
ENST00000348403.5
ENST00000447404.2 ENST00000360998.3 |
STRBP
|
spermatid perinuclear RNA binding protein |
| chr1_+_114472222 | 2.94 |
ENST00000369558.1
ENST00000369561.4 |
HIPK1
|
homeodomain interacting protein kinase 1 |
| chr9_+_96338860 | 2.93 |
ENST00000375376.4
|
PHF2
|
PHD finger protein 2 |
| chr10_-_123357910 | 2.92 |
ENST00000336553.6
ENST00000457416.2 ENST00000360144.3 ENST00000369059.1 ENST00000356226.4 ENST00000351936.6 |
FGFR2
|
fibroblast growth factor receptor 2 |
| chr20_+_19193269 | 2.90 |
ENST00000328041.6
|
SLC24A3
|
solute carrier family 24 (sodium/potassium/calcium exchanger), member 3 |
| chr2_+_176994408 | 2.89 |
ENST00000429017.1
ENST00000313173.4 ENST00000544999.1 |
HOXD8
|
homeobox D8 |
| chr19_-_821931 | 2.88 |
ENST00000359894.2
ENST00000520876.3 ENST00000519502.1 |
LPPR3
|
hsa-mir-3187 |
| chr9_+_129089088 | 2.88 |
ENST00000361171.3
ENST00000545391.1 |
MVB12B
|
multivesicular body subunit 12B |
| chr1_+_100818156 | 2.85 |
ENST00000336454.3
|
CDC14A
|
cell division cycle 14A |
| chr4_-_125633876 | 2.85 |
ENST00000504087.1
ENST00000515641.1 |
ANKRD50
|
ankyrin repeat domain 50 |
| chr6_-_90121938 | 2.84 |
ENST00000369415.4
|
RRAGD
|
Ras-related GTP binding D |
| chr3_-_9994021 | 2.84 |
ENST00000411976.2
ENST00000412055.1 |
PRRT3
|
proline-rich transmembrane protein 3 |
| chr17_+_68165657 | 2.83 |
ENST00000243457.3
|
KCNJ2
|
potassium inwardly-rectifying channel, subfamily J, member 2 |
| chr15_+_73344791 | 2.82 |
ENST00000261908.6
|
NEO1
|
neogenin 1 |
| chr1_-_223536679 | 2.81 |
ENST00000608996.1
|
SUSD4
|
sushi domain containing 4 |
| chr19_+_14544099 | 2.81 |
ENST00000242783.6
ENST00000586557.1 ENST00000590097.1 |
PKN1
|
protein kinase N1 |
| chr4_-_170192185 | 2.81 |
ENST00000284637.9
|
SH3RF1
|
SH3 domain containing ring finger 1 |
| chr10_+_69644404 | 2.79 |
ENST00000212015.6
|
SIRT1
|
sirtuin 1 |
| chr17_+_7155343 | 2.78 |
ENST00000573513.1
ENST00000354429.2 ENST00000574255.1 ENST00000396627.2 ENST00000356683.2 |
ELP5
|
elongator acetyltransferase complex subunit 5 |
| chr10_-_123357598 | 2.78 |
ENST00000358487.5
ENST00000369058.3 ENST00000369060.4 ENST00000359354.2 |
FGFR2
|
fibroblast growth factor receptor 2 |
| chr5_+_139028510 | 2.76 |
ENST00000502336.1
ENST00000520967.1 ENST00000511048.1 |
CXXC5
|
CXXC finger protein 5 |
| chr2_+_132286754 | 2.69 |
ENST00000434330.1
|
CCDC74A
|
coiled-coil domain containing 74A |
| chr4_-_25864581 | 2.69 |
ENST00000399878.3
|
SEL1L3
|
sel-1 suppressor of lin-12-like 3 (C. elegans) |
| chr1_+_114472481 | 2.68 |
ENST00000369555.2
|
HIPK1
|
homeodomain interacting protein kinase 1 |
| chr11_-_2292182 | 2.67 |
ENST00000331289.4
|
ASCL2
|
achaete-scute family bHLH transcription factor 2 |
| chr2_-_99757876 | 2.64 |
ENST00000539964.1
ENST00000393482.3 |
TSGA10
|
testis specific, 10 |
| chr19_-_49149553 | 2.64 |
ENST00000084798.4
|
CA11
|
carbonic anhydrase XI |
| chr18_-_53255766 | 2.63 |
ENST00000566286.1
ENST00000564999.1 ENST00000566279.1 ENST00000354452.3 ENST00000356073.4 |
TCF4
|
transcription factor 4 |
| chr4_+_30721968 | 2.62 |
ENST00000361762.2
|
PCDH7
|
protocadherin 7 |
| chr2_-_148778323 | 2.62 |
ENST00000440042.1
ENST00000535373.1 ENST00000540442.1 ENST00000536575.1 |
ORC4
|
origin recognition complex, subunit 4 |
| chr5_-_137368708 | 2.61 |
ENST00000033079.3
|
FAM13B
|
family with sequence similarity 13, member B |
| chr14_+_45431379 | 2.57 |
ENST00000361577.3
ENST00000361462.2 ENST00000382233.2 |
FAM179B
|
family with sequence similarity 179, member B |
| chr5_+_76506706 | 2.54 |
ENST00000340978.3
ENST00000346042.3 ENST00000264917.5 ENST00000342343.4 ENST00000333194.4 |
PDE8B
|
phosphodiesterase 8B |
| chr1_-_114301960 | 2.54 |
ENST00000369598.1
ENST00000369600.1 |
PHTF1
|
putative homeodomain transcription factor 1 |
| chr4_-_149365827 | 2.54 |
ENST00000344721.4
|
NR3C2
|
nuclear receptor subfamily 3, group C, member 2 |
| chr14_+_96949319 | 2.53 |
ENST00000554706.1
|
AK7
|
adenylate kinase 7 |
| chr1_-_173991434 | 2.52 |
ENST00000367696.2
|
RC3H1
|
ring finger and CCCH-type domains 1 |
| chr14_-_93673353 | 2.51 |
ENST00000556566.1
ENST00000306954.4 |
C14orf142
|
chromosome 14 open reading frame 142 |
| chr8_-_140715294 | 2.51 |
ENST00000303015.1
ENST00000520439.1 |
KCNK9
|
potassium channel, subfamily K, member 9 |
| chr10_+_76585303 | 2.49 |
ENST00000372725.1
|
KAT6B
|
K(lysine) acetyltransferase 6B |
| chr6_+_17281573 | 2.49 |
ENST00000379052.5
|
RBM24
|
RNA binding motif protein 24 |
| chr20_+_36531499 | 2.49 |
ENST00000373458.3
ENST00000373461.4 ENST00000373459.4 |
VSTM2L
|
V-set and transmembrane domain containing 2 like |
| chr4_-_105416039 | 2.49 |
ENST00000394767.2
|
CXXC4
|
CXXC finger protein 4 |
| chr10_+_22610124 | 2.48 |
ENST00000376663.3
|
BMI1
|
BMI1 polycomb ring finger oncogene |
| chr4_-_147867025 | 2.47 |
ENST00000502319.1
ENST00000325106.4 ENST00000504425.1 |
TTC29
|
tetratricopeptide repeat domain 29 |
| chr8_-_80680078 | 2.47 |
ENST00000337919.5
ENST00000354724.3 |
HEY1
|
hes-related family bHLH transcription factor with YRPW motif 1 |
| chr1_+_217804661 | 2.45 |
ENST00000366933.4
|
SPATA17
|
spermatogenesis associated 17 |
| chr10_-_61513201 | 2.45 |
ENST00000414264.1
ENST00000594536.1 |
LINC00948
|
long intergenic non-protein coding RNA 948 |
| chr3_+_160473996 | 2.45 |
ENST00000498165.1
|
PPM1L
|
protein phosphatase, Mg2+/Mn2+ dependent, 1L |
| chr14_-_95786200 | 2.45 |
ENST00000298912.4
|
CLMN
|
calmin (calponin-like, transmembrane) |
| chr7_-_5821225 | 2.44 |
ENST00000416985.1
|
RNF216
|
ring finger protein 216 |
| chr14_-_67982146 | 2.44 |
ENST00000557779.1
ENST00000557006.1 |
TMEM229B
|
transmembrane protein 229B |
| chr20_+_2673383 | 2.44 |
ENST00000380648.4
ENST00000342725.5 |
EBF4
|
early B-cell factor 4 |
| chr2_+_97481974 | 2.44 |
ENST00000377060.3
ENST00000305510.3 |
CNNM3
|
cyclin M3 |
| chr10_-_105992059 | 2.43 |
ENST00000369720.1
ENST00000369719.1 ENST00000357060.3 ENST00000428666.1 ENST00000278064.2 |
WDR96
|
WD repeat domain 96 |
| chr4_-_147866960 | 2.43 |
ENST00000513335.1
|
TTC29
|
tetratricopeptide repeat domain 29 |
| chr10_+_35415851 | 2.42 |
ENST00000374726.3
|
CREM
|
cAMP responsive element modulator |
| chr17_+_62075703 | 2.42 |
ENST00000577953.1
ENST00000582540.1 ENST00000579184.1 ENST00000425164.3 ENST00000412177.1 ENST00000539996.1 ENST00000583891.1 ENST00000580752.1 |
C17orf72
|
chromosome 17 open reading frame 72 |
| chr2_-_48132814 | 2.41 |
ENST00000316377.4
ENST00000378314.3 |
FBXO11
|
F-box protein 11 |
| chr3_-_183979251 | 2.41 |
ENST00000296238.3
|
CAMK2N2
|
calcium/calmodulin-dependent protein kinase II inhibitor 2 |
| chr3_-_113415441 | 2.41 |
ENST00000491165.1
ENST00000316407.4 |
KIAA2018
|
KIAA2018 |
| chr1_-_114301755 | 2.39 |
ENST00000393357.2
ENST00000369596.2 ENST00000446739.1 |
PHTF1
|
putative homeodomain transcription factor 1 |
| chr1_-_109656439 | 2.38 |
ENST00000369949.4
|
C1orf194
|
chromosome 1 open reading frame 194 |
| chr3_+_58223228 | 2.36 |
ENST00000478253.1
ENST00000295962.4 |
ABHD6
|
abhydrolase domain containing 6 |
| chr1_-_114301503 | 2.36 |
ENST00000447664.2
|
PHTF1
|
putative homeodomain transcription factor 1 |
| chr11_-_118023490 | 2.35 |
ENST00000324727.4
|
SCN4B
|
sodium channel, voltage-gated, type IV, beta subunit |
| chr22_+_39745930 | 2.34 |
ENST00000318801.4
ENST00000216155.7 ENST00000406293.3 ENST00000328933.5 |
SYNGR1
|
synaptogyrin 1 |
| chr9_-_92112953 | 2.32 |
ENST00000339861.4
ENST00000422704.2 ENST00000455551.2 |
SEMA4D
|
sema domain, immunoglobulin domain (Ig), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 4D |
| chr11_-_46142615 | 2.31 |
ENST00000529734.1
ENST00000323180.6 |
PHF21A
|
PHD finger protein 21A |
| chr20_+_9049682 | 2.30 |
ENST00000334005.3
ENST00000378473.3 |
PLCB4
|
phospholipase C, beta 4 |
| chr5_+_56111361 | 2.30 |
ENST00000399503.3
|
MAP3K1
|
mitogen-activated protein kinase kinase kinase 1, E3 ubiquitin protein ligase |
| chr8_+_37553261 | 2.29 |
ENST00000331569.4
|
ZNF703
|
zinc finger protein 703 |
| chr1_+_61547894 | 2.29 |
ENST00000403491.3
|
NFIA
|
nuclear factor I/A |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.6 | 14.4 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 2.2 | 6.5 | GO:0061188 | negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 2.0 | 8.0 | GO:0000255 | allantoin metabolic process(GO:0000255) |
| 1.9 | 5.7 | GO:0035603 | fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) |
| 1.8 | 8.9 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 1.7 | 5.0 | GO:0061183 | dermatome development(GO:0061054) regulation of dermatome development(GO:0061183) |
| 1.6 | 6.5 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 1.6 | 4.7 | GO:0021919 | BMP signaling pathway involved in spinal cord dorsal/ventral patterning(GO:0021919) |
| 1.5 | 3.1 | GO:0003274 | endocardial cushion fusion(GO:0003274) |
| 1.5 | 4.4 | GO:0002514 | B cell tolerance induction(GO:0002514) regulation of B cell tolerance induction(GO:0002661) positive regulation of B cell tolerance induction(GO:0002663) |
| 1.4 | 4.2 | GO:1902725 | negative regulation of satellite cell differentiation(GO:1902725) |
| 1.4 | 4.1 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
| 1.3 | 3.8 | GO:0060279 | regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
| 1.2 | 9.8 | GO:0048105 | establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 1.2 | 3.6 | GO:1904899 | regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 1.2 | 2.3 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 1.1 | 11.2 | GO:0021853 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 1.0 | 4.1 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 1.0 | 8.1 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 1.0 | 2.0 | GO:0051549 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
| 1.0 | 1.0 | GO:0061227 | intermediate mesoderm development(GO:0048389) pattern specification involved in mesonephros development(GO:0061227) anterior/posterior pattern specification involved in kidney development(GO:0072098) |
| 1.0 | 3.0 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 1.0 | 1.0 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
| 1.0 | 2.9 | GO:0016260 | selenocysteine biosynthetic process(GO:0016260) |
| 1.0 | 9.7 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 1.0 | 7.8 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 1.0 | 5.8 | GO:0003149 | membranous septum morphogenesis(GO:0003149) |
| 0.9 | 2.8 | GO:0090076 | relaxation of skeletal muscle(GO:0090076) |
| 0.9 | 2.8 | GO:0016256 | N-glycan processing to lysosome(GO:0016256) |
| 0.9 | 2.8 | GO:0051097 | negative regulation of helicase activity(GO:0051097) |
| 0.9 | 3.6 | GO:0097026 | dendritic cell dendrite assembly(GO:0097026) |
| 0.9 | 2.7 | GO:0002032 | desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
| 0.9 | 3.6 | GO:0061030 | epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
| 0.9 | 3.6 | GO:0072134 | nephrogenic mesenchyme morphogenesis(GO:0072134) |
| 0.9 | 3.5 | GO:0072047 | proximal/distal pattern formation involved in nephron development(GO:0072047) specification of nephron tubule identity(GO:0072081) |
| 0.9 | 2.6 | GO:1904048 | regulation of spontaneous neurotransmitter secretion(GO:1904048) |
| 0.8 | 5.1 | GO:0060235 | lens induction in camera-type eye(GO:0060235) |
| 0.8 | 4.2 | GO:0001550 | ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.8 | 0.8 | GO:0048371 | lateral mesodermal cell differentiation(GO:0048371) |
| 0.8 | 2.4 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.8 | 5.6 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.8 | 0.8 | GO:0021529 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 0.8 | 3.1 | GO:1902361 | mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
| 0.8 | 3.8 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
| 0.8 | 3.8 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.8 | 0.8 | GO:0060412 | ventricular septum morphogenesis(GO:0060412) |
| 0.7 | 2.2 | GO:0035284 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| 0.7 | 2.9 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.7 | 5.0 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.7 | 3.6 | GO:1901090 | regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
| 0.7 | 2.1 | GO:0032240 | negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.7 | 2.1 | GO:0070904 | L-ascorbic acid transport(GO:0015882) molecular hydrogen transport(GO:0015993) transepithelial L-ascorbic acid transport(GO:0070904) |
| 0.7 | 2.8 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
| 0.7 | 2.1 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
| 0.7 | 0.7 | GO:0010452 | histone H3-K36 methylation(GO:0010452) |
| 0.7 | 2.7 | GO:0097676 | histone H3-K36 dimethylation(GO:0097676) |
| 0.7 | 1.3 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.7 | 2.0 | GO:1904504 | regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
| 0.6 | 3.9 | GO:1901674 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
| 0.6 | 0.6 | GO:0010830 | regulation of myotube differentiation(GO:0010830) |
| 0.6 | 1.9 | GO:0098582 | innate vocalization behavior(GO:0098582) |
| 0.6 | 1.9 | GO:2000173 | negative regulation of dendrite extension(GO:1903860) regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.6 | 1.8 | GO:0045212 | negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 0.6 | 4.8 | GO:0071233 | cellular response to leucine(GO:0071233) |
| 0.6 | 2.4 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
| 0.6 | 1.2 | GO:0072095 | regulation of branch elongation involved in ureteric bud branching(GO:0072095) |
| 0.6 | 3.0 | GO:0019075 | virus maturation(GO:0019075) |
| 0.6 | 0.6 | GO:0090343 | positive regulation of cell aging(GO:0090343) positive regulation of cellular senescence(GO:2000774) |
| 0.6 | 1.8 | GO:0060139 | positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation of apoptotic process by virus(GO:0060139) |
| 0.6 | 5.3 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.6 | 2.9 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
| 0.6 | 2.3 | GO:2000820 | negative regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000820) |
| 0.6 | 8.0 | GO:0051256 | mitotic spindle midzone assembly(GO:0051256) |
| 0.6 | 1.1 | GO:0061289 | cell-cell signaling involved in kidney development(GO:0060995) Wnt signaling pathway involved in kidney development(GO:0061289) canonical Wnt signaling pathway involved in metanephric kidney development(GO:0061290) cell-cell signaling involved in metanephros development(GO:0072204) |
| 0.6 | 3.4 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
| 0.6 | 0.6 | GO:1902003 | beta-amyloid formation(GO:0034205) regulation of beta-amyloid formation(GO:1902003) positive regulation of beta-amyloid formation(GO:1902004) |
| 0.5 | 1.6 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 0.5 | 0.5 | GO:0090272 | negative regulation of fibroblast growth factor production(GO:0090272) |
| 0.5 | 3.2 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.5 | 2.1 | GO:0009447 | putrescine catabolic process(GO:0009447) |
| 0.5 | 1.6 | GO:0061394 | regulation of transcription from RNA polymerase II promoter in response to arsenic-containing substance(GO:0061394) |
| 0.5 | 11.1 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 0.5 | 1.6 | GO:0050760 | negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
| 0.5 | 3.6 | GO:2000795 | negative regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000795) |
| 0.5 | 3.1 | GO:0007352 | zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.5 | 1.5 | GO:0045925 | positive regulation of female receptivity(GO:0045925) |
| 0.5 | 3.0 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.5 | 1.5 | GO:2000078 | glandular epithelial cell maturation(GO:0002071) type B pancreatic cell maturation(GO:0072560) positive regulation of type B pancreatic cell development(GO:2000078) |
| 0.5 | 0.5 | GO:0002519 | natural killer cell tolerance induction(GO:0002519) |
| 0.5 | 1.5 | GO:0010845 | positive regulation of reciprocal meiotic recombination(GO:0010845) |
| 0.5 | 2.0 | GO:0070602 | regulation of centromeric sister chromatid cohesion(GO:0070602) |
| 0.5 | 8.4 | GO:0003084 | positive regulation of systemic arterial blood pressure(GO:0003084) |
| 0.5 | 1.5 | GO:0033386 | geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
| 0.5 | 2.0 | GO:0010842 | retina layer formation(GO:0010842) |
| 0.5 | 1.0 | GO:0060809 | mesodermal to mesenchymal transition involved in gastrulation(GO:0060809) |
| 0.5 | 1.4 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.5 | 1.9 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.5 | 5.7 | GO:0006657 | CDP-choline pathway(GO:0006657) |
| 0.5 | 0.9 | GO:0034453 | microtubule anchoring(GO:0034453) |
| 0.5 | 1.4 | GO:1990108 | protein linear deubiquitination(GO:1990108) |
| 0.5 | 0.5 | GO:0009411 | response to UV(GO:0009411) |
| 0.5 | 0.9 | GO:0051604 | protein maturation(GO:0051604) |
| 0.5 | 2.3 | GO:2001168 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.5 | 1.4 | GO:0050902 | leukocyte adhesive activation(GO:0050902) |
| 0.5 | 0.9 | GO:0009648 | photoperiodism(GO:0009648) entrainment of circadian clock by photoperiod(GO:0043153) |
| 0.4 | 3.6 | GO:1901858 | regulation of mitochondrial DNA metabolic process(GO:1901858) |
| 0.4 | 1.8 | GO:0003402 | planar cell polarity pathway involved in axis elongation(GO:0003402) |
| 0.4 | 0.4 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
| 0.4 | 0.4 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.4 | 0.4 | GO:0001502 | cartilage condensation(GO:0001502) |
| 0.4 | 2.2 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.4 | 1.8 | GO:0006542 | glutamine biosynthetic process(GO:0006542) |
| 0.4 | 2.2 | GO:0015670 | carbon dioxide transport(GO:0015670) |
| 0.4 | 2.2 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
| 0.4 | 1.7 | GO:0097089 | methyl-branched fatty acid metabolic process(GO:0097089) |
| 0.4 | 0.9 | GO:0060166 | olfactory pit development(GO:0060166) |
| 0.4 | 0.4 | GO:0010730 | negative regulation of hydrogen peroxide biosynthetic process(GO:0010730) |
| 0.4 | 2.1 | GO:0006203 | dGTP catabolic process(GO:0006203) |
| 0.4 | 2.5 | GO:0015798 | myo-inositol transport(GO:0015798) |
| 0.4 | 2.5 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
| 0.4 | 0.8 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.4 | 0.8 | GO:0003408 | optic cup formation involved in camera-type eye development(GO:0003408) |
| 0.4 | 0.4 | GO:0070914 | UV-damage excision repair(GO:0070914) |
| 0.4 | 2.4 | GO:1904381 | Golgi apparatus mannose trimming(GO:1904381) |
| 0.4 | 6.6 | GO:1903012 | positive regulation of bone development(GO:1903012) |
| 0.4 | 2.7 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
| 0.4 | 1.2 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.4 | 2.7 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
| 0.4 | 2.3 | GO:0006014 | D-ribose metabolic process(GO:0006014) |
| 0.4 | 0.8 | GO:0009060 | aerobic respiration(GO:0009060) |
| 0.4 | 0.4 | GO:0021984 | adenohypophysis development(GO:0021984) |
| 0.4 | 5.6 | GO:0021514 | ventral spinal cord interneuron differentiation(GO:0021514) |
| 0.4 | 1.5 | GO:2000314 | regulation of neural crest formation(GO:0090299) negative regulation of neural crest formation(GO:0090301) negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
| 0.4 | 1.8 | GO:0044861 | protein transport into plasma membrane raft(GO:0044861) |
| 0.4 | 1.8 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) |
| 0.4 | 2.5 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.4 | 1.1 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
| 0.4 | 1.1 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.4 | 0.4 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
| 0.4 | 0.4 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
| 0.4 | 1.1 | GO:1903348 | positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.4 | 1.1 | GO:0021966 | corticospinal neuron axon guidance(GO:0021966) |
| 0.3 | 0.3 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
| 0.3 | 2.4 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.3 | 2.4 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.3 | 2.4 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.3 | 1.7 | GO:2001076 | regulation of metanephric ureteric bud development(GO:2001074) positive regulation of metanephric ureteric bud development(GO:2001076) |
| 0.3 | 1.0 | GO:0035668 | TRAM-dependent toll-like receptor signaling pathway(GO:0035668) TRAM-dependent toll-like receptor 4 signaling pathway(GO:0035669) |
| 0.3 | 8.8 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
| 0.3 | 2.0 | GO:0072674 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.3 | 1.3 | GO:1990736 | positive regulation of regulation of vascular smooth muscle cell membrane depolarization(GO:1904199) regulation of vascular smooth muscle cell membrane depolarization(GO:1990736) |
| 0.3 | 1.3 | GO:0032898 | neurotrophin production(GO:0032898) |
| 0.3 | 3.0 | GO:0043634 | polyadenylation-dependent ncRNA catabolic process(GO:0043634) |
| 0.3 | 1.6 | GO:0000973 | posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
| 0.3 | 3.9 | GO:0007379 | segment specification(GO:0007379) |
| 0.3 | 1.0 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 0.3 | 0.3 | GO:1904252 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.3 | 2.6 | GO:0071386 | cellular response to corticosterone stimulus(GO:0071386) |
| 0.3 | 4.1 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.3 | 1.3 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
| 0.3 | 0.9 | GO:0001798 | positive regulation of type IIa hypersensitivity(GO:0001798) positive regulation of type II hypersensitivity(GO:0002894) |
| 0.3 | 0.9 | GO:0061300 | cerebellum vasculature development(GO:0061300) |
| 0.3 | 1.3 | GO:0010157 | response to chlorate(GO:0010157) |
| 0.3 | 2.5 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.3 | 2.5 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 0.3 | 1.2 | GO:0015910 | peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.3 | 1.2 | GO:1902730 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) canonical Wnt signaling pathway involved in positive regulation of epithelial to mesenchymal transition(GO:0044334) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.3 | 0.9 | GO:0006679 | glucosylceramide biosynthetic process(GO:0006679) |
| 0.3 | 1.5 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
| 0.3 | 0.9 | GO:0061508 | dADP phosphorylation(GO:0006174) dGDP phosphorylation(GO:0006186) AMP phosphorylation(GO:0006756) CDP phosphorylation(GO:0061508) dAMP phosphorylation(GO:0061565) CMP phosphorylation(GO:0061566) dCMP phosphorylation(GO:0061567) GDP phosphorylation(GO:0061568) UDP phosphorylation(GO:0061569) dCDP phosphorylation(GO:0061570) TDP phosphorylation(GO:0061571) |
| 0.3 | 2.5 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.3 | 1.2 | GO:0009386 | translational attenuation(GO:0009386) |
| 0.3 | 3.4 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
| 0.3 | 1.8 | GO:2000272 | negative regulation of receptor activity(GO:2000272) |
| 0.3 | 0.6 | GO:0042982 | amyloid precursor protein metabolic process(GO:0042982) |
| 0.3 | 7.5 | GO:0044458 | motile cilium assembly(GO:0044458) |
| 0.3 | 0.9 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
| 0.3 | 0.9 | GO:0070105 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) positive regulation of interleukin-6-mediated signaling pathway(GO:0070105) |
| 0.3 | 0.9 | GO:2000661 | positive regulation of interleukin-1-mediated signaling pathway(GO:2000661) |
| 0.3 | 3.2 | GO:0002634 | regulation of germinal center formation(GO:0002634) |
| 0.3 | 1.4 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
| 0.3 | 1.7 | GO:0034163 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) |
| 0.3 | 0.8 | GO:0021538 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.3 | 0.6 | GO:1901074 | regulation of engulfment of apoptotic cell(GO:1901074) |
| 0.3 | 1.7 | GO:1901300 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) |
| 0.3 | 2.2 | GO:0030917 | midbrain-hindbrain boundary development(GO:0030917) |
| 0.3 | 2.2 | GO:0018211 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.3 | 0.8 | GO:0034553 | respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 0.3 | 1.6 | GO:0071630 | nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
| 0.3 | 0.8 | GO:0060734 | regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:0060734) |
| 0.3 | 1.3 | GO:0043570 | maintenance of DNA repeat elements(GO:0043570) |
| 0.3 | 2.9 | GO:0007351 | tripartite regional subdivision(GO:0007351) anterior/posterior axis specification, embryo(GO:0008595) |
| 0.3 | 0.5 | GO:0035408 | histone H3-T6 phosphorylation(GO:0035408) |
| 0.3 | 1.3 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.3 | 0.3 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
| 0.3 | 1.9 | GO:0040038 | polar body extrusion after meiotic divisions(GO:0040038) formin-nucleated actin cable assembly(GO:0070649) |
| 0.3 | 0.8 | GO:0070839 | divalent metal ion export(GO:0070839) |
| 0.3 | 4.2 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.3 | 0.5 | GO:1902732 | positive regulation of chondrocyte proliferation(GO:1902732) |
| 0.3 | 3.4 | GO:0021694 | cerebellar Purkinje cell layer formation(GO:0021694) cerebellar Purkinje cell differentiation(GO:0021702) |
| 0.3 | 1.0 | GO:0006740 | NADPH regeneration(GO:0006740) |
| 0.3 | 2.3 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) |
| 0.3 | 2.3 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.3 | 3.4 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.3 | 1.0 | GO:0040019 | positive regulation of embryonic development(GO:0040019) |
| 0.3 | 0.3 | GO:0072054 | renal inner medulla development(GO:0072053) renal outer medulla development(GO:0072054) |
| 0.3 | 0.5 | GO:0060314 | regulation of ryanodine-sensitive calcium-release channel activity(GO:0060314) |
| 0.3 | 3.1 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.3 | 2.5 | GO:0098700 | neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.3 | 3.0 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
| 0.3 | 0.8 | GO:0002296 | T-helper 1 cell lineage commitment(GO:0002296) |
| 0.2 | 1.7 | GO:1901315 | negative regulation of histone ubiquitination(GO:0033183) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) |
| 0.2 | 5.7 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
| 0.2 | 0.2 | GO:0036035 | osteoclast development(GO:0036035) |
| 0.2 | 3.9 | GO:0051382 | kinetochore assembly(GO:0051382) |
| 0.2 | 1.2 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.2 | 0.7 | GO:0035377 | transepithelial water transport(GO:0035377) positive regulation of cyclic nucleotide-gated ion channel activity(GO:1902161) |
| 0.2 | 0.5 | GO:0050975 | sensory perception of touch(GO:0050975) |
| 0.2 | 1.0 | GO:0030242 | pexophagy(GO:0030242) |
| 0.2 | 2.2 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
| 0.2 | 1.4 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 0.2 | 0.2 | GO:0022038 | corpus callosum development(GO:0022038) |
| 0.2 | 1.2 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.2 | 1.7 | GO:2000828 | post-embryonic body morphogenesis(GO:0040032) regulation of parathyroid hormone secretion(GO:2000828) |
| 0.2 | 0.7 | GO:0035521 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
| 0.2 | 0.2 | GO:0009405 | pathogenesis(GO:0009405) |
| 0.2 | 0.7 | GO:1900060 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.2 | 0.9 | GO:0072660 | maintenance of protein location in membrane(GO:0072658) maintenance of protein location in plasma membrane(GO:0072660) positive regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900827) |
| 0.2 | 2.8 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.2 | 3.7 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.2 | 0.5 | GO:0010956 | negative regulation of calcidiol 1-monooxygenase activity(GO:0010956) |
| 0.2 | 0.7 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.2 | 0.7 | GO:0071418 | cellular response to amine stimulus(GO:0071418) |
| 0.2 | 0.5 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
| 0.2 | 0.2 | GO:0032025 | response to cobalt ion(GO:0032025) |
| 0.2 | 0.9 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.2 | 0.7 | GO:0006669 | sphinganine-1-phosphate biosynthetic process(GO:0006669) |
| 0.2 | 3.3 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
| 0.2 | 0.7 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
| 0.2 | 6.4 | GO:0060122 | inner ear receptor stereocilium organization(GO:0060122) |
| 0.2 | 1.1 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
| 0.2 | 5.3 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.2 | 0.4 | GO:0090325 | regulation of locomotion involved in locomotory behavior(GO:0090325) |
| 0.2 | 5.2 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.2 | 4.3 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.2 | 1.9 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
| 0.2 | 1.3 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
| 0.2 | 3.6 | GO:0070314 | G1 to G0 transition(GO:0070314) |
| 0.2 | 1.9 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.2 | 0.2 | GO:1902915 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.2 | 0.6 | GO:1904245 | regulation of polynucleotide adenylyltransferase activity(GO:1904245) positive regulation of polynucleotide adenylyltransferase activity(GO:1904247) |
| 0.2 | 0.6 | GO:0031548 | regulation of brain-derived neurotrophic factor receptor signaling pathway(GO:0031548) |
| 0.2 | 1.7 | GO:0072592 | oxygen metabolic process(GO:0072592) |
| 0.2 | 1.0 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
| 0.2 | 1.5 | GO:0042254 | ribosome biogenesis(GO:0042254) |
| 0.2 | 2.1 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.2 | 0.2 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.2 | 1.6 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
| 0.2 | 0.2 | GO:0071284 | cellular response to lead ion(GO:0071284) |
| 0.2 | 0.2 | GO:1904933 | regulation of cell proliferation in midbrain(GO:1904933) |
| 0.2 | 1.2 | GO:0032377 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.2 | 0.6 | GO:0061055 | myotome development(GO:0061055) |
| 0.2 | 0.6 | GO:0010226 | response to lithium ion(GO:0010226) |
| 0.2 | 1.8 | GO:0046831 | regulation of RNA export from nucleus(GO:0046831) |
| 0.2 | 0.8 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
| 0.2 | 0.6 | GO:0038178 | complement component C5a signaling pathway(GO:0038178) |
| 0.2 | 0.6 | GO:1904020 | regulation of G-protein coupled receptor internalization(GO:1904020) |
| 0.2 | 1.0 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.2 | 1.4 | GO:0018146 | keratan sulfate biosynthetic process(GO:0018146) |
| 0.2 | 0.4 | GO:1900365 | positive regulation of mRNA polyadenylation(GO:1900365) |
| 0.2 | 2.4 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.2 | 1.8 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
| 0.2 | 1.4 | GO:2000124 | regulation of endocannabinoid signaling pathway(GO:2000124) |
| 0.2 | 1.2 | GO:0061458 | reproductive system development(GO:0061458) |
| 0.2 | 7.0 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.2 | 2.3 | GO:0035269 | protein mannosylation(GO:0035268) protein O-linked mannosylation(GO:0035269) |
| 0.2 | 0.4 | GO:1900920 | regulation of amino acid uptake involved in synaptic transmission(GO:0051941) regulation of glutamate uptake involved in transmission of nerve impulse(GO:0051946) regulation of L-glutamate import(GO:1900920) |
| 0.2 | 6.2 | GO:0003341 | cilium movement(GO:0003341) |
| 0.2 | 0.2 | GO:0003220 | left ventricular cardiac muscle tissue morphogenesis(GO:0003220) |
| 0.2 | 1.5 | GO:0097577 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.2 | 1.9 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.2 | 0.2 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
| 0.2 | 0.2 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.2 | 0.6 | GO:1990926 | short-term synaptic potentiation(GO:1990926) |
| 0.2 | 1.3 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
| 0.2 | 0.6 | GO:0060179 | male mating behavior(GO:0060179) |
| 0.2 | 0.8 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.2 | 6.2 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.2 | 0.6 | GO:0006864 | pyrimidine nucleotide transport(GO:0006864) mitochondrial pyrimidine nucleotide import(GO:1990519) |
| 0.2 | 0.6 | GO:0070902 | mitochondrial tRNA pseudouridine synthesis(GO:0070902) |
| 0.2 | 4.9 | GO:0035082 | axoneme assembly(GO:0035082) |
| 0.2 | 0.6 | GO:1903750 | regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
| 0.2 | 0.9 | GO:2001293 | malonyl-CoA metabolic process(GO:2001293) |
| 0.2 | 0.7 | GO:0045475 | locomotor rhythm(GO:0045475) |
| 0.2 | 1.1 | GO:0071105 | response to interleukin-11(GO:0071105) |
| 0.2 | 1.3 | GO:0034086 | maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
| 0.2 | 0.5 | GO:0007595 | lactation(GO:0007595) |
| 0.2 | 0.7 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
| 0.2 | 0.7 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.2 | 0.5 | GO:0019520 | aldonic acid metabolic process(GO:0019520) D-gluconate metabolic process(GO:0019521) |
| 0.2 | 0.5 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
| 0.2 | 0.9 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
| 0.2 | 1.3 | GO:1902267 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
| 0.2 | 2.5 | GO:0045989 | positive regulation of striated muscle contraction(GO:0045989) |
| 0.2 | 0.4 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
| 0.2 | 1.4 | GO:1990416 | cellular response to brain-derived neurotrophic factor stimulus(GO:1990416) |
| 0.2 | 0.7 | GO:0097009 | energy homeostasis(GO:0097009) |
| 0.2 | 0.9 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) |
| 0.2 | 3.7 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.2 | 0.7 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) |
| 0.2 | 1.4 | GO:0070444 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.2 | 1.1 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.2 | 2.5 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.2 | 1.4 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.2 | 0.9 | GO:1902904 | negative regulation of fibril organization(GO:1902904) chaperone-mediated autophagy translocation complex disassembly(GO:1904764) |
| 0.2 | 0.7 | GO:1903677 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.2 | 1.4 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
| 0.2 | 1.6 | GO:0071798 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
| 0.2 | 3.5 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.2 | 2.3 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.2 | 0.7 | GO:0044782 | cilium organization(GO:0044782) |
| 0.2 | 4.5 | GO:0048864 | stem cell development(GO:0048864) |
| 0.2 | 0.3 | GO:0021827 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) chemorepulsion involved in postnatal olfactory bulb interneuron migration(GO:0021836) |
| 0.2 | 0.7 | GO:0035553 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.2 | 0.5 | GO:0043552 | positive regulation of phosphatidylinositol 3-kinase activity(GO:0043552) positive regulation of lipid kinase activity(GO:0090218) |
| 0.2 | 0.9 | GO:2001106 | regulation of Rho guanyl-nucleotide exchange factor activity(GO:2001106) |
| 0.2 | 2.4 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.2 | 1.5 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.2 | 2.5 | GO:1900038 | negative regulation of cellular response to hypoxia(GO:1900038) |
| 0.2 | 0.7 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.2 | 1.8 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
| 0.2 | 1.0 | GO:1990441 | negative regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990441) |
| 0.2 | 0.5 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.2 | 1.0 | GO:0006983 | ER overload response(GO:0006983) |
| 0.2 | 0.3 | GO:0003186 | tricuspid valve morphogenesis(GO:0003186) |
| 0.2 | 1.2 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.2 | 6.8 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.2 | 1.5 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.2 | 2.1 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.2 | 0.6 | GO:0051892 | negative regulation of cardioblast differentiation(GO:0051892) regulation of cardiac muscle cell myoblast differentiation(GO:2000690) negative regulation of cardiac muscle cell myoblast differentiation(GO:2000691) |
| 0.2 | 1.0 | GO:0051531 | NFAT protein import into nucleus(GO:0051531) |
| 0.2 | 0.6 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
| 0.2 | 0.3 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
| 0.2 | 0.8 | GO:0070560 | protein secretion by platelet(GO:0070560) |
| 0.2 | 0.8 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
| 0.2 | 0.2 | GO:0071873 | response to norepinephrine(GO:0071873) cellular response to norepinephrine stimulus(GO:0071874) |
| 0.2 | 0.3 | GO:0060120 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
| 0.2 | 1.1 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
| 0.2 | 0.6 | GO:0071934 | thiamine transmembrane transport(GO:0071934) |
| 0.2 | 0.3 | GO:0006541 | glutamine metabolic process(GO:0006541) |
| 0.2 | 0.3 | GO:0043615 | astrocyte cell migration(GO:0043615) |
| 0.2 | 0.6 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.2 | 0.9 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.2 | 1.4 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
| 0.2 | 0.9 | GO:1990822 | basic amino acid transmembrane transport(GO:1990822) |
| 0.2 | 0.5 | GO:0070781 | response to biotin(GO:0070781) |
| 0.2 | 1.1 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
| 0.2 | 0.5 | GO:0035621 | ER to Golgi ceramide transport(GO:0035621) |
| 0.2 | 1.1 | GO:0010960 | magnesium ion homeostasis(GO:0010960) |
| 0.2 | 0.5 | GO:0089709 | acyl carnitine transport(GO:0006844) histidine transport(GO:0015817) L-histidine transmembrane transport(GO:0089709) L-histidine transport(GO:1902024) acyl carnitine transmembrane transport(GO:1902616) |
| 0.2 | 0.6 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.2 | 1.2 | GO:1904177 | regulation of adipose tissue development(GO:1904177) |
| 0.2 | 2.0 | GO:0070070 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.2 | 0.3 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
| 0.2 | 0.3 | GO:0003064 | regulation of heart rate by hormone(GO:0003064) |
| 0.1 | 0.6 | GO:0072156 | distal tubule morphogenesis(GO:0072156) |
| 0.1 | 1.2 | GO:0008343 | adult feeding behavior(GO:0008343) |
| 0.1 | 0.3 | GO:1900248 | cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
| 0.1 | 1.0 | GO:0006527 | arginine catabolic process(GO:0006527) |
| 0.1 | 1.0 | GO:0023021 | termination of signal transduction(GO:0023021) |
| 0.1 | 0.6 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.1 | 2.6 | GO:0046069 | cGMP catabolic process(GO:0046069) |
| 0.1 | 0.1 | GO:0003192 | mitral valve formation(GO:0003192) cell migration involved in endocardial cushion formation(GO:0003273) |
| 0.1 | 0.4 | GO:2000366 | regulation of STAT protein import into nucleus(GO:2000364) positive regulation of STAT protein import into nucleus(GO:2000366) |
| 0.1 | 0.4 | GO:0043602 | nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) |
| 0.1 | 0.1 | GO:0048807 | female genitalia morphogenesis(GO:0048807) |
| 0.1 | 0.6 | GO:1903644 | regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.1 | 3.6 | GO:0021952 | central nervous system projection neuron axonogenesis(GO:0021952) |
| 0.1 | 1.7 | GO:0060766 | negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.1 | 0.7 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.1 | 0.4 | GO:0020027 | hemoglobin metabolic process(GO:0020027) |
| 0.1 | 0.1 | GO:0060038 | cardiac muscle cell proliferation(GO:0060038) |
| 0.1 | 0.9 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.1 | 0.8 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.1 | 0.6 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.1 | 1.3 | GO:0086024 | adrenergic receptor signaling pathway involved in positive regulation of heart rate(GO:0086024) |
| 0.1 | 8.7 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
| 0.1 | 0.3 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 1.2 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.1 | 0.4 | GO:0003190 | atrioventricular valve formation(GO:0003190) |
| 0.1 | 1.2 | GO:2000505 | regulation of energy homeostasis(GO:2000505) |
| 0.1 | 0.8 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 | 2.0 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
| 0.1 | 0.4 | GO:0071529 | cementum mineralization(GO:0071529) |
| 0.1 | 0.4 | GO:0044691 | tooth eruption(GO:0044691) |
| 0.1 | 0.4 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.1 | 1.1 | GO:0070862 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.1 | 0.3 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.1 | 0.5 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.1 | 0.8 | GO:0002467 | germinal center formation(GO:0002467) |
| 0.1 | 0.8 | GO:0090005 | negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
| 0.1 | 2.2 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
| 0.1 | 0.4 | GO:0002093 | auditory receptor cell morphogenesis(GO:0002093) |
| 0.1 | 0.4 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
| 0.1 | 1.0 | GO:2000580 | positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
| 0.1 | 0.5 | GO:0001714 | endodermal cell fate specification(GO:0001714) |
| 0.1 | 2.4 | GO:0042789 | mRNA transcription from RNA polymerase II promoter(GO:0042789) |
| 0.1 | 10.5 | GO:0032418 | lysosome localization(GO:0032418) |
| 0.1 | 0.3 | GO:0048664 | neuron fate determination(GO:0048664) |
| 0.1 | 0.5 | GO:0072364 | regulation of cellular ketone metabolic process by regulation of transcription from RNA polymerase II promoter(GO:0072364) |
| 0.1 | 1.0 | GO:0030473 | nucleokinesis involved in cell motility in cerebral cortex radial glia guided migration(GO:0021817) nuclear migration along microtubule(GO:0030473) |
| 0.1 | 0.1 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.1 | 1.0 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.1 | 0.4 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.1 | 2.7 | GO:1900151 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.1 | 1.0 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
| 0.1 | 0.2 | GO:0000294 | nuclear-transcribed mRNA catabolic process, endonucleolytic cleavage-dependent decay(GO:0000294) |
| 0.1 | 0.5 | GO:0080009 | mRNA methylation(GO:0080009) |
| 0.1 | 0.7 | GO:0042733 | embryonic digit morphogenesis(GO:0042733) |
| 0.1 | 0.1 | GO:0070076 | histone lysine demethylation(GO:0070076) |
| 0.1 | 0.6 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.1 | 0.4 | GO:0097327 | response to antineoplastic agent(GO:0097327) |
| 0.1 | 0.5 | GO:0071638 | negative regulation of monocyte chemotactic protein-1 production(GO:0071638) |
| 0.1 | 0.7 | GO:0019732 | antifungal humoral response(GO:0019732) |
| 0.1 | 2.4 | GO:0046676 | negative regulation of insulin secretion(GO:0046676) |
| 0.1 | 0.4 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
| 0.1 | 0.2 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
| 0.1 | 1.0 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
| 0.1 | 0.2 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
| 0.1 | 1.9 | GO:0034243 | regulation of transcription elongation from RNA polymerase II promoter(GO:0034243) |
| 0.1 | 0.2 | GO:0044253 | positive regulation of collagen metabolic process(GO:0010714) positive regulation of collagen biosynthetic process(GO:0032967) positive regulation of multicellular organismal metabolic process(GO:0044253) |
| 0.1 | 10.8 | GO:0030901 | midbrain development(GO:0030901) |
| 0.1 | 0.4 | GO:0052026 | modulation by virus of host transcription(GO:0019056) positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) modulation by symbiont of host transcription(GO:0052026) |
| 0.1 | 0.2 | GO:0080154 | regulation of fertilization(GO:0080154) |
| 0.1 | 0.4 | GO:0032099 | negative regulation of response to food(GO:0032096) negative regulation of appetite(GO:0032099) |
| 0.1 | 0.2 | GO:1904760 | myofibroblast differentiation(GO:0036446) regulation of myofibroblast differentiation(GO:1904760) |
| 0.1 | 0.8 | GO:0006477 | protein sulfation(GO:0006477) |
| 0.1 | 0.1 | GO:0044598 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.1 | 1.3 | GO:0038203 | TORC2 signaling(GO:0038203) |
| 0.1 | 1.9 | GO:0015866 | ADP transport(GO:0015866) |
| 0.1 | 0.6 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.1 | 3.9 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.1 | 0.9 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
| 0.1 | 2.1 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
| 0.1 | 0.6 | GO:2001288 | positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.1 | 0.8 | GO:1990403 | embryonic brain development(GO:1990403) |
| 0.1 | 0.7 | GO:0090625 | mRNA cleavage involved in gene silencing by siRNA(GO:0090625) |
| 0.1 | 0.3 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
| 0.1 | 1.6 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
| 0.1 | 0.1 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
| 0.1 | 0.7 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.1 | 0.3 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
| 0.1 | 0.3 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.1 | 0.1 | GO:1902669 | positive regulation of axon guidance(GO:1902669) |
| 0.1 | 1.7 | GO:1904886 | beta-catenin destruction complex disassembly(GO:1904886) |
| 0.1 | 0.7 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
| 0.1 | 1.4 | GO:1990118 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.1 | 0.2 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.1 | 0.8 | GO:0051386 | regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
| 0.1 | 0.3 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
| 0.1 | 0.3 | GO:0019348 | dolichol metabolic process(GO:0019348) |
| 0.1 | 0.4 | GO:0030856 | regulation of epithelial cell differentiation(GO:0030856) |
| 0.1 | 0.4 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
| 0.1 | 0.8 | GO:0006885 | regulation of pH(GO:0006885) |
| 0.1 | 0.6 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.1 | 0.2 | GO:0072709 | cellular response to sorbitol(GO:0072709) |
| 0.1 | 0.2 | GO:1903233 | positive regulation of endoplasmic reticulum calcium ion concentration(GO:0032470) regulation of calcium ion-dependent exocytosis of neurotransmitter(GO:1903233) |
| 0.1 | 0.3 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.1 | 0.6 | GO:0044331 | cell-cell adhesion mediated by cadherin(GO:0044331) |
| 0.1 | 1.1 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.1 | 0.3 | GO:0071880 | adenylate cyclase-activating adrenergic receptor signaling pathway(GO:0071880) |
| 0.1 | 0.2 | GO:0042984 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.1 | 0.4 | GO:0002833 | positive regulation of response to biotic stimulus(GO:0002833) |
| 0.1 | 0.9 | GO:0009048 | dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.1 | 0.3 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.1 | 0.3 | GO:0002232 | leukocyte chemotaxis involved in inflammatory response(GO:0002232) cell surface pattern recognition receptor signaling pathway(GO:0002752) |
| 0.1 | 0.7 | GO:0097338 | response to clozapine(GO:0097338) |
| 0.1 | 0.3 | GO:0061762 | CAMKK-AMPK signaling cascade(GO:0061762) |
| 0.1 | 0.8 | GO:1990573 | potassium ion import across plasma membrane(GO:1990573) |
| 0.1 | 0.9 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
| 0.1 | 0.1 | GO:0034162 | toll-like receptor 9 signaling pathway(GO:0034162) |
| 0.1 | 1.8 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
| 0.1 | 1.0 | GO:0045663 | positive regulation of myoblast differentiation(GO:0045663) |
| 0.1 | 0.6 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
| 0.1 | 3.1 | GO:0032480 | negative regulation of type I interferon production(GO:0032480) |
| 0.1 | 1.1 | GO:0045329 | carnitine biosynthetic process(GO:0045329) |
| 0.1 | 1.1 | GO:0060736 | prostate gland growth(GO:0060736) |
| 0.1 | 0.3 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.1 | 1.2 | GO:0045671 | negative regulation of osteoclast differentiation(GO:0045671) |
| 0.1 | 0.2 | GO:2000561 | CD4-positive, alpha-beta T cell proliferation(GO:0035739) regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.1 | 0.1 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.1 | 0.3 | GO:0042832 | defense response to protozoan(GO:0042832) |
| 0.1 | 0.5 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.1 | 0.6 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
| 0.1 | 1.1 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
| 0.1 | 2.0 | GO:0060644 | mammary gland epithelial cell differentiation(GO:0060644) |
| 0.1 | 0.5 | GO:1900107 | regulation of nodal signaling pathway(GO:1900107) |
| 0.1 | 0.2 | GO:0032687 | negative regulation of interferon-alpha production(GO:0032687) |
| 0.1 | 0.6 | GO:0009756 | carbohydrate mediated signaling(GO:0009756) |
| 0.1 | 0.9 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
| 0.1 | 0.3 | GO:0002143 | tRNA wobble position uridine thiolation(GO:0002143) |
| 0.1 | 0.9 | GO:1900364 | negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.1 | 1.0 | GO:0031440 | regulation of mRNA 3'-end processing(GO:0031440) |
| 0.1 | 0.7 | GO:0043550 | regulation of lipid kinase activity(GO:0043550) |
| 0.1 | 2.3 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.1 | 0.3 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 0.1 | 0.4 | GO:0038092 | nodal signaling pathway(GO:0038092) |
| 0.1 | 0.1 | GO:0031016 | pancreas development(GO:0031016) |
| 0.1 | 0.6 | GO:0014005 | microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.1 | 0.7 | GO:0045007 | depurination(GO:0045007) |
| 0.1 | 0.6 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
| 0.1 | 0.7 | GO:0002371 | dendritic cell cytokine production(GO:0002371) |
| 0.1 | 1.8 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.1 | 0.3 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
| 0.1 | 2.1 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.1 | 2.0 | GO:0032012 | regulation of ARF protein signal transduction(GO:0032012) |
| 0.1 | 0.5 | GO:0090669 | telomerase RNA stabilization(GO:0090669) |
| 0.1 | 0.3 | GO:0002184 | cytoplasmic translational termination(GO:0002184) |
| 0.1 | 12.4 | GO:0030449 | regulation of complement activation(GO:0030449) |
| 0.1 | 0.2 | GO:0006540 | glutamate decarboxylation to succinate(GO:0006540) |
| 0.1 | 0.1 | GO:1904321 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.1 | 0.5 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) |
| 0.1 | 1.6 | GO:0072189 | ureter development(GO:0072189) |
| 0.1 | 0.4 | GO:0072367 | regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) |
| 0.1 | 0.6 | GO:0070265 | necrotic cell death(GO:0070265) |
| 0.1 | 0.4 | GO:0042693 | muscle cell fate commitment(GO:0042693) |
| 0.1 | 2.2 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.1 | 0.7 | GO:0043555 | regulation of translation in response to stress(GO:0043555) |
| 0.1 | 0.4 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
| 0.1 | 0.2 | GO:0006409 | tRNA export from nucleus(GO:0006409) tRNA transport(GO:0051031) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.1 | 0.3 | GO:0006711 | estrogen catabolic process(GO:0006711) |
| 0.1 | 0.3 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.1 | 1.5 | GO:0051450 | myoblast proliferation(GO:0051450) |
| 0.1 | 0.5 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
| 0.1 | 0.2 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
| 0.1 | 0.3 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
| 0.1 | 0.9 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.1 | 0.6 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
| 0.1 | 2.2 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
| 0.1 | 0.3 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.1 | 0.2 | GO:2000276 | negative regulation of oxidative phosphorylation uncoupler activity(GO:2000276) |
| 0.1 | 0.5 | GO:0018022 | peptidyl-lysine methylation(GO:0018022) |
| 0.1 | 1.3 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
| 0.1 | 0.1 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
| 0.1 | 0.4 | GO:2000381 | negative regulation of mesoderm development(GO:2000381) |
| 0.1 | 1.1 | GO:0031643 | positive regulation of myelination(GO:0031643) |
| 0.1 | 0.3 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.1 | 0.3 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
| 0.1 | 0.3 | GO:0051102 | DNA ligation involved in DNA recombination(GO:0051102) |
| 0.1 | 0.8 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.1 | 1.3 | GO:0086016 | AV node cell action potential(GO:0086016) AV node cell to bundle of His cell signaling(GO:0086027) |
| 0.1 | 0.5 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
| 0.1 | 0.2 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.1 | 2.1 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
| 0.1 | 1.2 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.1 | 0.2 | GO:0030505 | inorganic diphosphate transport(GO:0030505) |
| 0.1 | 0.8 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.1 | 0.5 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.1 | 0.2 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.1 | 1.6 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.1 | 1.0 | GO:0051298 | centrosome duplication(GO:0051298) |
| 0.1 | 0.5 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
| 0.1 | 0.3 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.1 | 1.4 | GO:0070986 | left/right axis specification(GO:0070986) |
| 0.1 | 0.2 | GO:0071812 | circadian temperature homeostasis(GO:0060086) regulation of fever generation by regulation of prostaglandin secretion(GO:0071810) positive regulation of fever generation by positive regulation of prostaglandin secretion(GO:0071812) positive regulation of ERK1 and ERK2 cascade via TNFSF11-mediated signaling(GO:0071848) regulation of fever generation by prostaglandin secretion(GO:0100009) |
| 0.1 | 0.7 | GO:0048286 | lung alveolus development(GO:0048286) |
| 0.1 | 1.9 | GO:0016254 | preassembly of GPI anchor in ER membrane(GO:0016254) |
| 0.1 | 0.6 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.1 | 0.5 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.1 | 0.3 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.1 | 0.6 | GO:0071277 | cellular response to calcium ion(GO:0071277) |
| 0.1 | 0.2 | GO:0010803 | regulation of tumor necrosis factor-mediated signaling pathway(GO:0010803) |
| 0.1 | 0.2 | GO:1902525 | regulation of protein monoubiquitination(GO:1902525) |
| 0.1 | 0.1 | GO:0021553 | olfactory nerve development(GO:0021553) |
| 0.1 | 0.5 | GO:0051085 | chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.1 | 0.2 | GO:0014859 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.1 | 0.2 | GO:0060033 | anatomical structure regression(GO:0060033) |
| 0.1 | 0.2 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
| 0.1 | 0.2 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) |
| 0.1 | 0.4 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.1 | 0.4 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.1 | 0.8 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.1 | 0.3 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.1 | 0.3 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 0.1 | 0.4 | GO:0045204 | MAPK export from nucleus(GO:0045204) |
| 0.1 | 0.4 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.1 | 0.4 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
| 0.1 | 0.2 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.1 | 1.2 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
| 0.1 | 0.6 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
| 0.1 | 0.7 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
| 0.1 | 4.7 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.1 | 4.1 | GO:0007368 | determination of left/right symmetry(GO:0007368) |
| 0.1 | 0.2 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
| 0.1 | 0.1 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
| 0.1 | 0.2 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 0.1 | 1.1 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.1 | 0.4 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
| 0.1 | 2.5 | GO:0032878 | regulation of establishment or maintenance of cell polarity(GO:0032878) |
| 0.1 | 0.3 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.1 | 1.2 | GO:0032703 | negative regulation of interleukin-2 production(GO:0032703) |
| 0.1 | 0.1 | GO:0015853 | adenine transport(GO:0015853) |
| 0.1 | 0.1 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.1 | 0.1 | GO:0034587 | piRNA metabolic process(GO:0034587) |
| 0.1 | 0.6 | GO:0071569 | protein ufmylation(GO:0071569) |
| 0.1 | 0.7 | GO:0015886 | heme transport(GO:0015886) |
| 0.1 | 0.6 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.1 | 3.7 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.1 | 0.5 | GO:0008090 | retrograde axonal transport(GO:0008090) |
| 0.1 | 0.6 | GO:0070269 | pyroptosis(GO:0070269) |
| 0.1 | 0.6 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) |
| 0.1 | 0.4 | GO:0032782 | bile acid secretion(GO:0032782) |
| 0.1 | 0.6 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
| 0.1 | 1.4 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.1 | 0.4 | GO:0045716 | positive regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045716) |
| 0.1 | 0.3 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.1 | 0.4 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.1 | 0.1 | GO:0060633 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) |
| 0.1 | 1.2 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.1 | 0.2 | GO:0036302 | atrioventricular canal development(GO:0036302) |
| 0.1 | 0.3 | GO:0098814 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
| 0.1 | 0.3 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.1 | 0.1 | GO:0032849 | positive regulation of cellular pH reduction(GO:0032849) |
| 0.1 | 0.1 | GO:2000566 | CD8-positive, alpha-beta T cell proliferation(GO:0035740) regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000564) positive regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000566) |
| 0.1 | 0.3 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
| 0.1 | 0.5 | GO:1902101 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
| 0.1 | 0.3 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.1 | 0.6 | GO:0002115 | store-operated calcium entry(GO:0002115) |
| 0.1 | 4.2 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
| 0.1 | 0.4 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.1 | 0.2 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.1 | 1.0 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.1 | 0.6 | GO:0097646 | calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
| 0.1 | 0.6 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
| 0.1 | 0.7 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.1 | 0.3 | GO:0052651 | monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.1 | 0.3 | GO:0032100 | adenylate cyclase-inhibiting opioid receptor signaling pathway(GO:0031635) positive regulation of response to food(GO:0032097) positive regulation of appetite(GO:0032100) negative regulation of Wnt protein secretion(GO:0061358) |
| 0.1 | 0.3 | GO:0046116 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.1 | 0.5 | GO:2000278 | regulation of DNA biosynthetic process(GO:2000278) |
| 0.1 | 0.4 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.1 | 0.6 | GO:0032264 | IMP salvage(GO:0032264) |
| 0.1 | 0.6 | GO:0031498 | chromatin disassembly(GO:0031498) |
| 0.1 | 4.3 | GO:0035773 | insulin secretion involved in cellular response to glucose stimulus(GO:0035773) |
| 0.1 | 0.3 | GO:0030916 | otic vesicle formation(GO:0030916) |
| 0.1 | 0.5 | GO:0048050 | post-embryonic eye morphogenesis(GO:0048050) post-embryonic organ morphogenesis(GO:0048563) |
| 0.1 | 0.3 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.1 | 0.6 | GO:1902856 | negative regulation of nonmotile primary cilium assembly(GO:1902856) |
| 0.1 | 3.4 | GO:0043966 | histone H3 acetylation(GO:0043966) |
| 0.1 | 0.3 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
| 0.1 | 0.2 | GO:0046825 | regulation of protein export from nucleus(GO:0046825) |
| 0.1 | 0.2 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.1 | 0.1 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
| 0.1 | 0.7 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.1 | 0.2 | GO:0035411 | catenin import into nucleus(GO:0035411) |
| 0.1 | 0.6 | GO:0042996 | regulation of Golgi to plasma membrane protein transport(GO:0042996) |
| 0.1 | 0.1 | GO:0006404 | RNA import into nucleus(GO:0006404) |
| 0.1 | 0.3 | GO:0042993 | positive regulation of transcription factor import into nucleus(GO:0042993) |
| 0.1 | 0.3 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
| 0.1 | 0.2 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.1 | 0.4 | GO:0097056 | selenocysteinyl-tRNA(Sec) biosynthetic process(GO:0097056) |
| 0.1 | 0.1 | GO:0070673 | response to interleukin-18(GO:0070673) |
| 0.1 | 0.2 | GO:0018032 | protein amidation(GO:0018032) |
| 0.1 | 0.5 | GO:0008228 | opsonization(GO:0008228) |
| 0.1 | 0.3 | GO:0044208 | 'de novo' AMP biosynthetic process(GO:0044208) |
| 0.1 | 1.1 | GO:0035246 | peptidyl-arginine N-methylation(GO:0035246) |
| 0.1 | 0.9 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
| 0.1 | 0.4 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.1 | 0.4 | GO:0048630 | skeletal muscle tissue growth(GO:0048630) |
| 0.1 | 0.2 | GO:0031572 | G2 DNA damage checkpoint(GO:0031572) |
| 0.1 | 0.3 | GO:0052405 | negative regulation by host of symbiont molecular function(GO:0052405) |
| 0.1 | 1.1 | GO:0042135 | neurotransmitter catabolic process(GO:0042135) |
| 0.1 | 0.8 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 0.1 | 0.1 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
| 0.1 | 1.7 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.1 | 0.3 | GO:0042822 | pyridoxal phosphate metabolic process(GO:0042822) |
| 0.1 | 0.2 | GO:0038193 | thromboxane A2 signaling pathway(GO:0038193) |
| 0.1 | 0.2 | GO:0007113 | endomitotic cell cycle(GO:0007113) |
| 0.1 | 2.0 | GO:1900739 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 0.1 | 0.3 | GO:0097178 | ruffle assembly(GO:0097178) |
| 0.1 | 2.8 | GO:0051453 | regulation of intracellular pH(GO:0051453) |
| 0.1 | 0.2 | GO:1990034 | calcium ion export from cell(GO:1990034) |
| 0.1 | 0.1 | GO:0044854 | plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) caveola assembly(GO:0070836) |
| 0.1 | 0.8 | GO:0031069 | hair follicle morphogenesis(GO:0031069) |
| 0.1 | 0.1 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
| 0.1 | 0.6 | GO:0072332 | intrinsic apoptotic signaling pathway by p53 class mediator(GO:0072332) |
| 0.1 | 0.3 | GO:0034982 | mitochondrial protein processing(GO:0034982) |
| 0.1 | 0.2 | GO:0060313 | negative regulation of blood vessel remodeling(GO:0060313) |
| 0.1 | 0.2 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
| 0.1 | 4.0 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.1 | 0.2 | GO:0070459 | prolactin secretion(GO:0070459) |
| 0.1 | 0.4 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
| 0.1 | 0.2 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
| 0.1 | 0.3 | GO:0015793 | glycerol transport(GO:0015793) |
| 0.1 | 0.1 | GO:0003350 | pulmonary myocardium development(GO:0003350) |
| 0.1 | 0.2 | GO:0048203 | vesicle targeting, trans-Golgi to endosome(GO:0048203) |
| 0.1 | 0.1 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 0.1 | 1.5 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
| 0.1 | 0.2 | GO:1905097 | regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
| 0.1 | 0.9 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
| 0.1 | 0.3 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
| 0.1 | 0.8 | GO:0006677 | glycosylceramide metabolic process(GO:0006677) |
| 0.1 | 0.2 | GO:1902528 | regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 0.1 | 0.2 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.1 | 0.3 | GO:0048296 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) positive regulation of isotype switching to IgA isotypes(GO:0048298) |
| 0.1 | 1.0 | GO:0036148 | phosphatidylglycerol acyl-chain remodeling(GO:0036148) |
| 0.1 | 0.2 | GO:1902416 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
| 0.1 | 0.3 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
| 0.1 | 0.1 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.1 | 0.1 | GO:0002154 | thyroid hormone mediated signaling pathway(GO:0002154) |
| 0.1 | 0.5 | GO:0035067 | negative regulation of histone acetylation(GO:0035067) |
| 0.1 | 0.3 | GO:0071028 | nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
| 0.1 | 0.3 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.1 | 0.3 | GO:0075713 | establishment of integrated proviral latency(GO:0075713) |
| 0.1 | 0.4 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
| 0.1 | 0.1 | GO:0015917 | aminophospholipid transport(GO:0015917) |
| 0.0 | 0.0 | GO:0061312 | BMP signaling pathway involved in heart development(GO:0061312) |
| 0.0 | 0.2 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.0 | 0.1 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.0 | 4.9 | GO:0031338 | regulation of vesicle fusion(GO:0031338) |
| 0.0 | 0.3 | GO:0060155 | platelet dense granule organization(GO:0060155) |
| 0.0 | 0.2 | GO:1904978 | regulation of endosome organization(GO:1904978) |
| 0.0 | 0.1 | GO:0021988 | olfactory bulb development(GO:0021772) olfactory lobe development(GO:0021988) |
| 0.0 | 0.3 | GO:0006591 | ornithine metabolic process(GO:0006591) |
| 0.0 | 0.2 | GO:0002084 | protein depalmitoylation(GO:0002084) |
| 0.0 | 0.2 | GO:0045880 | positive regulation of smoothened signaling pathway(GO:0045880) |
| 0.0 | 0.2 | GO:0019605 | butyrate metabolic process(GO:0019605) |
| 0.0 | 0.5 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
| 0.0 | 0.1 | GO:1904397 | negative regulation of neuromuscular junction development(GO:1904397) |
| 0.0 | 0.2 | GO:0032881 | regulation of polysaccharide metabolic process(GO:0032881) |
| 0.0 | 0.3 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
| 0.0 | 2.0 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 0.0 | 0.3 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
| 0.0 | 0.3 | GO:0090267 | positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 0.0 | 2.3 | GO:0006363 | transcription elongation from RNA polymerase I promoter(GO:0006362) termination of RNA polymerase I transcription(GO:0006363) |
| 0.0 | 0.8 | GO:2001046 | positive regulation of integrin-mediated signaling pathway(GO:2001046) |
| 0.0 | 0.2 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.0 | 0.1 | GO:0048711 | positive regulation of astrocyte differentiation(GO:0048711) |
| 0.0 | 0.7 | GO:0061512 | protein localization to cilium(GO:0061512) |
| 0.0 | 0.2 | GO:0032484 | Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
| 0.0 | 0.1 | GO:0043589 | skin morphogenesis(GO:0043589) |
| 0.0 | 0.2 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.0 | 1.8 | GO:0006699 | bile acid biosynthetic process(GO:0006699) |
| 0.0 | 0.5 | GO:0030210 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.0 | 0.3 | GO:0051968 | positive regulation of synaptic transmission, glutamatergic(GO:0051968) |
| 0.0 | 0.6 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
| 0.0 | 0.2 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.0 | 0.1 | GO:0019085 | early viral transcription(GO:0019085) |
| 0.0 | 0.2 | GO:0015870 | acetylcholine transport(GO:0015870) |
| 0.0 | 1.5 | GO:0033173 | calcineurin-NFAT signaling cascade(GO:0033173) |
| 0.0 | 0.8 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.0 | 0.1 | GO:0046640 | regulation of alpha-beta T cell proliferation(GO:0046640) positive regulation of alpha-beta T cell proliferation(GO:0046641) |
| 0.0 | 0.1 | GO:0003032 | detection of oxygen(GO:0003032) |
| 0.0 | 1.1 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
| 0.0 | 0.2 | GO:1904970 | brush border assembly(GO:1904970) |
| 0.0 | 0.1 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
| 0.0 | 0.1 | GO:0032007 | negative regulation of TOR signaling(GO:0032007) |
| 0.0 | 0.2 | GO:0035865 | cellular response to potassium ion(GO:0035865) |
| 0.0 | 0.3 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.0 | 1.3 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 | 0.2 | GO:0002933 | lipid hydroxylation(GO:0002933) |
| 0.0 | 0.4 | GO:0009414 | response to water deprivation(GO:0009414) |
| 0.0 | 0.3 | GO:0072600 | establishment of protein localization to Golgi(GO:0072600) |
| 0.0 | 0.3 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.0 | 0.1 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.0 | 0.7 | GO:0033137 | negative regulation of peptidyl-serine phosphorylation(GO:0033137) |
| 0.0 | 0.1 | GO:0046056 | dADP metabolic process(GO:0046056) |
| 0.0 | 0.4 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.0 | 0.4 | GO:0019317 | fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
| 0.0 | 0.2 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
| 0.0 | 0.0 | GO:0009155 | purine deoxyribonucleotide catabolic process(GO:0009155) purine deoxyribonucleoside triphosphate catabolic process(GO:0009217) |
| 0.0 | 0.1 | GO:0051138 | positive regulation of NK T cell differentiation(GO:0051138) |
| 0.0 | 0.3 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
| 0.0 | 3.0 | GO:0006687 | glycosphingolipid metabolic process(GO:0006687) |
| 0.0 | 0.6 | GO:0045954 | positive regulation of natural killer cell mediated cytotoxicity(GO:0045954) |
| 0.0 | 0.6 | GO:0006911 | phagocytosis, engulfment(GO:0006911) |
| 0.0 | 1.1 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
| 0.0 | 0.2 | GO:0045023 | G0 to G1 transition(GO:0045023) |
| 0.0 | 0.1 | GO:0042727 | flavin-containing compound biosynthetic process(GO:0042727) |
| 0.0 | 0.2 | GO:0031122 | cytoplasmic microtubule organization(GO:0031122) |
| 0.0 | 0.6 | GO:0002523 | leukocyte migration involved in inflammatory response(GO:0002523) |
| 0.0 | 0.5 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
| 0.0 | 0.1 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
| 0.0 | 0.2 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.0 | 0.3 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
| 0.0 | 0.2 | GO:0015871 | choline transport(GO:0015871) |
| 0.0 | 0.2 | GO:1903385 | regulation of homophilic cell adhesion(GO:1903385) |
| 0.0 | 0.2 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.0 | 0.1 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.0 | 0.1 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.0 | 0.7 | GO:0045332 | phospholipid translocation(GO:0045332) |
| 0.0 | 0.1 | GO:0050435 | beta-amyloid metabolic process(GO:0050435) |
| 0.0 | 0.3 | GO:0015732 | prostaglandin transport(GO:0015732) |
| 0.0 | 0.1 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.0 | 0.8 | GO:0050908 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.0 | 1.4 | GO:0006336 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
| 0.0 | 1.2 | GO:0005980 | glycogen catabolic process(GO:0005980) |
| 0.0 | 0.5 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
| 0.0 | 0.9 | GO:0019731 | antibacterial humoral response(GO:0019731) |
| 0.0 | 0.2 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
| 0.0 | 0.6 | GO:0016024 | CDP-diacylglycerol biosynthetic process(GO:0016024) |
| 0.0 | 0.3 | GO:0060080 | inhibitory postsynaptic potential(GO:0060080) |
| 0.0 | 0.2 | GO:0031629 | synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
| 0.0 | 1.1 | GO:0046677 | response to antibiotic(GO:0046677) |
| 0.0 | 0.5 | GO:0051205 | protein insertion into membrane(GO:0051205) |
| 0.0 | 0.1 | GO:0042351 | 'de novo' GDP-L-fucose biosynthetic process(GO:0042351) |
| 0.0 | 0.2 | GO:0060765 | regulation of androgen receptor signaling pathway(GO:0060765) |
| 0.0 | 0.3 | GO:0016075 | rRNA catabolic process(GO:0016075) |
| 0.0 | 0.1 | GO:1904849 | positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
| 0.0 | 0.3 | GO:0010265 | SCF complex assembly(GO:0010265) |
| 0.0 | 0.1 | GO:0010763 | positive regulation of fibroblast migration(GO:0010763) |
| 0.0 | 0.2 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
| 0.0 | 0.0 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) negative regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901837) |
| 0.0 | 0.2 | GO:0009650 | UV protection(GO:0009650) |
| 0.0 | 0.0 | GO:0071231 | cellular response to folic acid(GO:0071231) |
| 0.0 | 0.2 | GO:0070197 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.0 | 0.8 | GO:0043631 | RNA polyadenylation(GO:0043631) |
| 0.0 | 0.4 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
| 0.0 | 0.3 | GO:0042953 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.0 | 0.2 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
| 0.0 | 0.1 | GO:0034124 | regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034124) negative regulation of macrophage apoptotic process(GO:2000110) |
| 0.0 | 0.5 | GO:0006505 | GPI anchor metabolic process(GO:0006505) GPI anchor biosynthetic process(GO:0006506) |
| 0.0 | 0.1 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.0 | 0.1 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.0 | 0.4 | GO:0043247 | protection from non-homologous end joining at telomere(GO:0031848) telomere maintenance in response to DNA damage(GO:0043247) |
| 0.0 | 0.7 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.0 | 0.4 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.0 | 0.1 | GO:0002644 | negative regulation of tolerance induction(GO:0002644) |
| 0.0 | 0.6 | GO:0006119 | oxidative phosphorylation(GO:0006119) |
| 0.0 | 0.1 | GO:0072334 | UDP-galactose transport(GO:0015785) UDP-galactose transmembrane transport(GO:0072334) |
| 0.0 | 0.1 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.0 | 0.0 | GO:0045919 | positive regulation of cytolysis(GO:0045919) |
| 0.0 | 0.1 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.0 | 0.2 | GO:0009162 | deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
| 0.0 | 0.7 | GO:0006783 | heme biosynthetic process(GO:0006783) |
| 0.0 | 0.1 | GO:0030187 | melatonin metabolic process(GO:0030186) melatonin biosynthetic process(GO:0030187) |
| 0.0 | 0.4 | GO:0008213 | protein methylation(GO:0006479) protein alkylation(GO:0008213) |
| 0.0 | 0.1 | GO:0006424 | glutamyl-tRNA aminoacylation(GO:0006424) |
| 0.0 | 0.1 | GO:0006848 | pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
| 0.0 | 0.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.0 | 0.1 | GO:0050982 | detection of mechanical stimulus(GO:0050982) |
| 0.0 | 0.0 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.0 | 0.1 | GO:0099624 | atrial cardiac muscle cell membrane repolarization(GO:0099624) |
| 0.0 | 0.1 | GO:0000423 | macromitophagy(GO:0000423) |
| 0.0 | 0.1 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.0 | 0.1 | GO:0035494 | SNARE complex disassembly(GO:0035494) |
| 0.0 | 0.4 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.0 | 1.3 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 | 0.1 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
| 0.0 | 0.1 | GO:0033364 | mast cell secretory granule organization(GO:0033364) |
| 0.0 | 0.7 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.0 | 0.1 | GO:0030581 | intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 0.0 | 0.1 | GO:0060823 | canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060823) |
| 0.0 | 0.1 | GO:0031058 | positive regulation of histone modification(GO:0031058) |
| 0.0 | 0.0 | GO:1901253 | negative regulation of intracellular transport of viral material(GO:1901253) |
| 0.0 | 0.3 | GO:0001937 | negative regulation of endothelial cell proliferation(GO:0001937) |
| 0.0 | 0.4 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
| 0.0 | 0.0 | GO:1903936 | response to sodium arsenite(GO:1903935) cellular response to sodium arsenite(GO:1903936) |
| 0.0 | 0.0 | GO:0031268 | pseudopodium organization(GO:0031268) |
| 0.0 | 0.2 | GO:1900015 | regulation of cytokine production involved in inflammatory response(GO:1900015) positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.0 | 0.5 | GO:1990090 | cellular response to nerve growth factor stimulus(GO:1990090) |
| 0.0 | 0.3 | GO:0090148 | membrane fission(GO:0090148) |
| 0.0 | 0.1 | GO:0048485 | sympathetic nervous system development(GO:0048485) |
| 0.0 | 0.1 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.0 | 0.1 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
| 0.0 | 0.1 | GO:2000825 | positive regulation of androgen receptor activity(GO:2000825) |
| 0.0 | 0.1 | GO:0040009 | regulation of growth rate(GO:0040009) G-quadruplex DNA unwinding(GO:0044806) |
| 0.0 | 0.6 | GO:0051491 | positive regulation of filopodium assembly(GO:0051491) |
| 0.0 | 0.1 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
| 0.0 | 0.0 | GO:1902229 | regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902229) |
| 0.0 | 0.1 | GO:0016322 | neuron remodeling(GO:0016322) |
| 0.0 | 0.1 | GO:0010816 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.0 | 0.3 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.0 | 0.2 | GO:0001553 | luteinization(GO:0001553) |
| 0.0 | 0.1 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.0 | 1.1 | GO:0032479 | regulation of type I interferon production(GO:0032479) |
| 0.0 | 0.1 | GO:0009137 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
| 0.0 | 0.1 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
| 0.0 | 0.2 | GO:0043583 | ear development(GO:0043583) |
| 0.0 | 0.3 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
| 0.0 | 0.2 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
| 0.0 | 0.2 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
| 0.0 | 0.1 | GO:0046452 | dihydrofolate metabolic process(GO:0046452) |
| 0.0 | 0.1 | GO:0035815 | positive regulation of renal sodium excretion(GO:0035815) |
| 0.0 | 0.3 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
| 0.0 | 0.0 | GO:2000172 | regulation of branching morphogenesis of a nerve(GO:2000172) |
| 0.0 | 0.4 | GO:0006073 | glycogen metabolic process(GO:0005977) cellular glucan metabolic process(GO:0006073) glucan metabolic process(GO:0044042) |
| 0.0 | 0.1 | GO:0051451 | myoblast migration(GO:0051451) |
| 0.0 | 0.3 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.0 | 0.1 | GO:0036149 | phosphatidylinositol acyl-chain remodeling(GO:0036149) |
| 0.0 | 0.2 | GO:0010818 | T cell chemotaxis(GO:0010818) |
| 0.0 | 0.2 | GO:0042340 | keratan sulfate catabolic process(GO:0042340) |
| 0.0 | 0.2 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.0 | 0.1 | GO:0007191 | adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
| 0.0 | 0.3 | GO:0051290 | protein heterotetramerization(GO:0051290) |
| 0.0 | 0.1 | GO:2000170 | negative regulation of gap junction assembly(GO:1903597) positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
| 0.0 | 0.1 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.0 | 0.2 | GO:0006491 | N-glycan processing(GO:0006491) |
| 0.0 | 0.1 | GO:0034116 | positive regulation of heterotypic cell-cell adhesion(GO:0034116) |
| 0.0 | 0.0 | GO:0061101 | neuroendocrine cell differentiation(GO:0061101) |
| 0.0 | 1.6 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.0 | 0.0 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.0 | 0.0 | GO:0000019 | regulation of mitotic recombination(GO:0000019) |
| 0.0 | 0.3 | GO:0048745 | smooth muscle tissue development(GO:0048745) |
| 0.0 | 0.0 | GO:0021590 | cerebellum maturation(GO:0021590) cerebellar Purkinje cell layer maturation(GO:0021691) cerebellar cortex maturation(GO:0021699) |
| 0.0 | 0.2 | GO:0038145 | response to macrophage colony-stimulating factor(GO:0036005) cellular response to macrophage colony-stimulating factor stimulus(GO:0036006) macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.0 | 0.2 | GO:0045176 | apical protein localization(GO:0045176) |
| 0.0 | 0.2 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 0.0 | 0.3 | GO:0045599 | negative regulation of fat cell differentiation(GO:0045599) |
| 0.0 | 0.1 | GO:0046040 | IMP metabolic process(GO:0046040) |
| 0.0 | 0.1 | GO:1901678 | iron coordination entity transport(GO:1901678) |
| 0.0 | 0.1 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.0 | 0.2 | GO:0007019 | microtubule depolymerization(GO:0007019) |
| 0.0 | 0.1 | GO:0090220 | chromosome localization to nuclear envelope involved in homologous chromosome segregation(GO:0090220) |
| 0.0 | 0.1 | GO:0051182 | coenzyme transport(GO:0051182) |
| 0.0 | 0.2 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
| 0.0 | 0.1 | GO:0007625 | grooming behavior(GO:0007625) |
| 0.0 | 0.1 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
| 0.0 | 0.3 | GO:0035338 | long-chain fatty-acyl-CoA biosynthetic process(GO:0035338) |
| 0.0 | 0.1 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
| 0.0 | 0.1 | GO:0061727 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.0 | 0.1 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.0 | 0.1 | GO:0050774 | negative regulation of dendrite morphogenesis(GO:0050774) |
| 0.0 | 0.0 | GO:0044537 | regulation of circulating fibrinogen levels(GO:0044537) |
| 0.0 | 0.0 | GO:0033182 | regulation of histone ubiquitination(GO:0033182) |
| 0.0 | 0.4 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.0 | 0.2 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.0 | 0.0 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.0 | 0.9 | GO:0048208 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
| 0.0 | 0.1 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.0 | 0.0 | GO:0002865 | negative regulation of acute inflammatory response to antigenic stimulus(GO:0002865) |
| 0.0 | 0.2 | GO:0048255 | mRNA stabilization(GO:0048255) |
| 0.0 | 0.2 | GO:0019720 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.0 | 1.5 | GO:0007286 | spermatid development(GO:0007286) |
| 0.0 | 0.1 | GO:0052805 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
| 0.0 | 0.1 | GO:0051101 | regulation of DNA binding(GO:0051101) |
| 0.0 | 0.1 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 0.0 | 0.1 | GO:0019627 | urea cycle(GO:0000050) urea metabolic process(GO:0019627) |
| 0.0 | 0.1 | GO:0006032 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.0 | 0.1 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 0.0 | 0.2 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.0 | 0.1 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
| 0.0 | 0.2 | GO:0046473 | phosphatidic acid metabolic process(GO:0046473) |
| 0.0 | 0.0 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.0 | 0.0 | GO:0002675 | positive regulation of acute inflammatory response(GO:0002675) |
| 0.0 | 0.2 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
| 0.0 | 0.1 | GO:0042026 | protein refolding(GO:0042026) |
| 0.0 | 0.0 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
| 0.0 | 0.1 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
| 0.0 | 0.3 | GO:0055078 | sodium ion homeostasis(GO:0055078) |
| 0.0 | 0.0 | GO:1990481 | mRNA pseudouridine synthesis(GO:1990481) |
| 0.0 | 0.6 | GO:0015949 | nucleobase-containing small molecule interconversion(GO:0015949) |
| 0.0 | 0.2 | GO:0014889 | muscle atrophy(GO:0014889) |
| 0.0 | 0.1 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
| 0.0 | 0.1 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.0 | 0.2 | GO:0042475 | odontogenesis of dentin-containing tooth(GO:0042475) |
| 0.0 | 0.0 | GO:0046838 | phosphorylated carbohydrate dephosphorylation(GO:0046838) inositol phosphate dephosphorylation(GO:0046855) |
| 0.0 | 0.0 | GO:0090235 | regulation of metaphase plate congression(GO:0090235) |
| 0.0 | 0.1 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
| 0.0 | 0.4 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.0 | 0.0 | GO:0007520 | myoblast fusion(GO:0007520) |
| 0.0 | 0.7 | GO:0030593 | neutrophil chemotaxis(GO:0030593) |
| 0.0 | 0.1 | GO:0050713 | negative regulation of interleukin-1 beta secretion(GO:0050713) |
| 0.0 | 0.0 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
| 0.0 | 0.2 | GO:0006903 | vesicle targeting(GO:0006903) |
| 0.0 | 0.1 | GO:0042940 | D-amino acid transport(GO:0042940) |
| 0.0 | 0.1 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 0.0 | 0.1 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.0 | 0.4 | GO:1902475 | L-alpha-amino acid transmembrane transport(GO:1902475) |
| 0.0 | 0.2 | GO:0033617 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.0 | 0.0 | GO:0008628 | hormone-mediated apoptotic signaling pathway(GO:0008628) |
| 0.0 | 0.1 | GO:0008340 | determination of adult lifespan(GO:0008340) |
| 0.0 | 0.0 | GO:0072138 | mesenchymal cell proliferation involved in ureteric bud development(GO:0072138) |
| 0.0 | 0.5 | GO:0044364 | killing of cells of other organism(GO:0031640) disruption of cells of other organism(GO:0044364) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.4 | 9.7 | GO:0060187 | cell pole(GO:0060187) |
| 2.0 | 5.9 | GO:0070195 | growth hormone receptor complex(GO:0070195) |
| 1.8 | 7.1 | GO:0097224 | sperm connecting piece(GO:0097224) |
| 1.5 | 4.6 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
| 1.4 | 4.3 | GO:0048179 | activin receptor complex(GO:0048179) |
| 1.4 | 8.3 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 1.0 | 4.1 | GO:0005667 | transcription factor complex(GO:0005667) |
| 1.0 | 7.9 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.9 | 8.2 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.8 | 9.3 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.6 | 8.8 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.6 | 4.3 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.6 | 3.4 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.6 | 2.2 | GO:0044292 | dendrite terminus(GO:0044292) |
| 0.6 | 1.7 | GO:0005873 | plus-end kinesin complex(GO:0005873) |
| 0.5 | 10.4 | GO:0005858 | axonemal dynein complex(GO:0005858) |
| 0.5 | 2.6 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.5 | 2.4 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.5 | 2.4 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.5 | 1.4 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.5 | 10.6 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.4 | 2.2 | GO:0098536 | deuterosome(GO:0098536) |
| 0.4 | 4.9 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.4 | 4.0 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 0.4 | 5.2 | GO:0060091 | kinocilium(GO:0060091) |
| 0.4 | 2.1 | GO:0070695 | FHF complex(GO:0070695) |
| 0.4 | 5.8 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.4 | 1.6 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.4 | 9.6 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
| 0.4 | 8.7 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.4 | 0.4 | GO:0044753 | amphisome(GO:0044753) |
| 0.4 | 1.4 | GO:0070288 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
| 0.3 | 1.0 | GO:1990622 | CHOP-ATF3 complex(GO:1990622) |
| 0.3 | 1.7 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.3 | 2.1 | GO:0070369 | beta-catenin-TCF7L2 complex(GO:0070369) |
| 0.3 | 4.8 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.3 | 2.9 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.3 | 1.3 | GO:0097196 | Shu complex(GO:0097196) |
| 0.3 | 2.2 | GO:0070554 | synaptobrevin 2-SNAP-25-syntaxin-3-complexin complex(GO:0070554) |
| 0.3 | 0.9 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.3 | 1.5 | GO:0001740 | Barr body(GO:0001740) |
| 0.3 | 0.9 | GO:0019034 | viral replication complex(GO:0019034) |
| 0.3 | 0.9 | GO:0043291 | RAVE complex(GO:0043291) |
| 0.3 | 1.5 | GO:0000308 | cytoplasmic cyclin-dependent protein kinase holoenzyme complex(GO:0000308) |
| 0.3 | 2.0 | GO:1990393 | 3M complex(GO:1990393) |
| 0.3 | 1.7 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.3 | 1.1 | GO:0032301 | MutSalpha complex(GO:0032301) |
| 0.3 | 0.8 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
| 0.3 | 1.6 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.3 | 2.6 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.3 | 2.6 | GO:0016589 | NURF complex(GO:0016589) |
| 0.3 | 2.1 | GO:0017059 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
| 0.3 | 1.3 | GO:1990769 | proximal neuron projection(GO:1990769) |
| 0.3 | 4.1 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.3 | 4.1 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.2 | 2.0 | GO:0072487 | MSL complex(GO:0072487) |
| 0.2 | 0.7 | GO:0048269 | methionine adenosyltransferase complex(GO:0048269) |
| 0.2 | 0.7 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.2 | 3.0 | GO:0097433 | dense body(GO:0097433) |
| 0.2 | 4.2 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.2 | 6.3 | GO:0034706 | sodium channel complex(GO:0034706) |
| 0.2 | 1.6 | GO:0033503 | HULC complex(GO:0033503) |
| 0.2 | 0.9 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.2 | 0.2 | GO:0032302 | MutSbeta complex(GO:0032302) |
| 0.2 | 8.7 | GO:0090544 | BAF-type complex(GO:0090544) |
| 0.2 | 0.7 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
| 0.2 | 1.5 | GO:0002177 | manchette(GO:0002177) |
| 0.2 | 0.8 | GO:1990578 | perinuclear endoplasmic reticulum membrane(GO:1990578) |
| 0.2 | 2.3 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.2 | 2.5 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.2 | 0.8 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.2 | 2.0 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.2 | 0.7 | GO:0031673 | H zone(GO:0031673) |
| 0.2 | 0.9 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.2 | 0.5 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.2 | 2.0 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.2 | 2.7 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.2 | 1.4 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.2 | 0.7 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.2 | 1.8 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.2 | 25.9 | GO:0016605 | PML body(GO:0016605) |
| 0.2 | 0.5 | GO:0034657 | GID complex(GO:0034657) |
| 0.2 | 0.3 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.2 | 1.5 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.2 | 1.7 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.2 | 2.0 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.2 | 0.6 | GO:0045293 | MIS complex(GO:0036396) mRNA editing complex(GO:0045293) |
| 0.2 | 1.4 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.2 | 1.4 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.2 | 4.6 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.2 | 0.6 | GO:0001652 | granular component(GO:0001652) |
| 0.2 | 1.5 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.2 | 2.4 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.1 | 0.7 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.1 | 4.7 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.1 | 1.4 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.1 | 15.0 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.1 | 0.6 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.1 | 0.4 | GO:0020003 | symbiont-containing vacuole(GO:0020003) symbiont-containing vacuole membrane(GO:0020005) |
| 0.1 | 1.8 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.1 | 1.9 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.1 | 1.9 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.1 | 0.7 | GO:0060201 | clathrin-sculpted acetylcholine transport vesicle(GO:0060200) clathrin-sculpted acetylcholine transport vesicle membrane(GO:0060201) |
| 0.1 | 0.1 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 0.1 | 0.7 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.1 | 2.6 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.1 | 0.8 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.1 | 0.1 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.1 | 1.2 | GO:0034464 | BBSome(GO:0034464) |
| 0.1 | 6.7 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.1 | 1.5 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.1 | 0.3 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
| 0.1 | 0.4 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.1 | 2.8 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.1 | 0.9 | GO:0098575 | lumenal side of lysosomal membrane(GO:0098575) |
| 0.1 | 0.5 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.1 | 2.8 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.1 | 0.6 | GO:0000938 | GARP complex(GO:0000938) |
| 0.1 | 0.7 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 0.1 | 1.2 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.1 | 0.6 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.1 | 0.4 | GO:0034271 | phosphatidylinositol 3-kinase complex, class III, type I(GO:0034271) phosphatidylinositol 3-kinase complex, class III, type II(GO:0034272) |
| 0.1 | 3.4 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
| 0.1 | 1.5 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.1 | 0.5 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.1 | 0.9 | GO:0000235 | astral microtubule(GO:0000235) aster(GO:0005818) |
| 0.1 | 11.1 | GO:0005930 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
| 0.1 | 0.1 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.1 | 0.3 | GO:0036398 | TCR signalosome(GO:0036398) |
| 0.1 | 1.5 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.1 | 2.3 | GO:0030057 | desmosome(GO:0030057) |
| 0.1 | 1.9 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
| 0.1 | 12.2 | GO:0042175 | nuclear outer membrane-endoplasmic reticulum membrane network(GO:0042175) |
| 0.1 | 0.8 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.1 | 1.4 | GO:0032039 | integrator complex(GO:0032039) |
| 0.1 | 0.7 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.1 | 0.6 | GO:0043198 | dendritic shaft(GO:0043198) |
| 0.1 | 1.8 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 0.1 | 0.5 | GO:0030891 | VCB complex(GO:0030891) |
| 0.1 | 1.5 | GO:0097386 | glial cell projection(GO:0097386) |
| 0.1 | 1.3 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.1 | 6.6 | GO:0005844 | polysome(GO:0005844) |
| 0.1 | 1.7 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.1 | 0.8 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.1 | 0.7 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.1 | 0.3 | GO:0070083 | clathrin-sculpted monoamine transport vesicle(GO:0070081) clathrin-sculpted monoamine transport vesicle membrane(GO:0070083) |
| 0.1 | 5.6 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.1 | 9.9 | GO:0030672 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
| 0.1 | 0.3 | GO:0018444 | translation release factor complex(GO:0018444) |
| 0.1 | 1.5 | GO:0044295 | axonal growth cone(GO:0044295) |
| 0.1 | 0.7 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.1 | 4.3 | GO:0000123 | histone acetyltransferase complex(GO:0000123) |
| 0.1 | 2.7 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.1 | 1.0 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
| 0.1 | 8.1 | GO:0036064 | ciliary basal body(GO:0036064) |
| 0.1 | 0.4 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.1 | 0.8 | GO:0034687 | integrin alphaL-beta2 complex(GO:0034687) |
| 0.1 | 6.1 | GO:0015030 | Cajal body(GO:0015030) |
| 0.1 | 0.6 | GO:1903439 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
| 0.1 | 1.5 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.1 | 0.9 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.1 | 1.1 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
| 0.1 | 0.3 | GO:0030905 | retromer, tubulation complex(GO:0030905) |
| 0.1 | 0.1 | GO:0009330 | DNA topoisomerase complex (ATP-hydrolyzing)(GO:0009330) |
| 0.1 | 1.9 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.1 | 0.4 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.1 | 0.2 | GO:0071458 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) |
| 0.1 | 0.4 | GO:0045272 | plasma membrane respiratory chain complex I(GO:0045272) |
| 0.1 | 0.6 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.1 | 1.5 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.1 | 0.7 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.1 | 4.9 | GO:0005747 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.1 | 0.1 | GO:1990923 | PET complex(GO:1990923) |
| 0.1 | 0.4 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
| 0.1 | 0.6 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.1 | 4.2 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.1 | 9.8 | GO:0005923 | bicellular tight junction(GO:0005923) |
| 0.1 | 0.2 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
| 0.1 | 0.9 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.1 | 0.3 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.1 | 0.3 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.1 | 2.2 | GO:0031305 | intrinsic component of mitochondrial inner membrane(GO:0031304) integral component of mitochondrial inner membrane(GO:0031305) |
| 0.1 | 0.6 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
| 0.1 | 0.3 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.1 | 0.6 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
| 0.1 | 0.4 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.1 | 0.9 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.1 | 0.2 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.1 | 0.3 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.1 | 0.9 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 0.1 | 0.7 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.1 | 0.1 | GO:0034680 | integrin alpha10-beta1 complex(GO:0034680) |
| 0.1 | 1.1 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.1 | 0.2 | GO:0043218 | compact myelin(GO:0043218) |
| 0.1 | 0.7 | GO:0030286 | dynein complex(GO:0030286) |
| 0.1 | 0.5 | GO:0016012 | sarcoglycan complex(GO:0016012) |
| 0.1 | 0.2 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.1 | 0.3 | GO:0031515 | tRNA (m1A) methyltransferase complex(GO:0031515) |
| 0.1 | 0.4 | GO:0033165 | interphotoreceptor matrix(GO:0033165) |
| 0.1 | 0.2 | GO:0098855 | HCN channel complex(GO:0098855) |
| 0.1 | 0.9 | GO:0031089 | platelet dense granule lumen(GO:0031089) |
| 0.1 | 0.2 | GO:0030897 | HOPS complex(GO:0030897) |
| 0.1 | 0.6 | GO:0033270 | paranode region of axon(GO:0033270) |
| 0.1 | 0.1 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
| 0.1 | 0.4 | GO:0032009 | early phagosome(GO:0032009) |
| 0.1 | 0.4 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.1 | 0.3 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.1 | 0.2 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.1 | 0.5 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.1 | 1.6 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.0 | 0.0 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.0 | 0.2 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.0 | 1.3 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
| 0.0 | 0.2 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.0 | 0.1 | GO:0005953 | CAAX-protein geranylgeranyltransferase complex(GO:0005953) |
| 0.0 | 0.4 | GO:0014802 | terminal cisterna(GO:0014802) |
| 0.0 | 0.7 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.0 | 0.2 | GO:0005921 | gap junction(GO:0005921) |
| 0.0 | 1.4 | GO:1902711 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
| 0.0 | 0.2 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
| 0.0 | 6.5 | GO:0044438 | microbody part(GO:0044438) peroxisomal part(GO:0044439) |
| 0.0 | 0.1 | GO:0019008 | molybdopterin synthase complex(GO:0019008) |
| 0.0 | 0.9 | GO:0071437 | invadopodium(GO:0071437) |
| 0.0 | 2.6 | GO:0000786 | nucleosome(GO:0000786) |
| 0.0 | 0.3 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.0 | 1.5 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.0 | 1.9 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.0 | 0.6 | GO:0010369 | chromocenter(GO:0010369) |
| 0.0 | 0.7 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.0 | 0.3 | GO:0031010 | ISWI-type complex(GO:0031010) |
| 0.0 | 0.3 | GO:0032807 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) DNA ligase IV complex(GO:0032807) |
| 0.0 | 0.5 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.0 | 0.6 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.0 | 0.3 | GO:0034709 | methylosome(GO:0034709) |
| 0.0 | 1.8 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.0 | 0.8 | GO:0042599 | lamellar body(GO:0042599) |
| 0.0 | 0.6 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.0 | 0.2 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.0 | 0.1 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
| 0.0 | 1.3 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
| 0.0 | 0.4 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 0.0 | 0.3 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
| 0.0 | 2.9 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
| 0.0 | 0.2 | GO:0032156 | septin cytoskeleton(GO:0032156) |
| 0.0 | 0.2 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.0 | 3.0 | GO:0005814 | centriole(GO:0005814) |
| 0.0 | 0.0 | GO:0044094 | host cell nucleus(GO:0042025) host cell nuclear part(GO:0044094) |
| 0.0 | 1.0 | GO:0005685 | U1 snRNP(GO:0005685) |
| 0.0 | 4.3 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
| 0.0 | 0.1 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
| 0.0 | 0.3 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
| 0.0 | 0.3 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.0 | 2.2 | GO:0032154 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
| 0.0 | 2.9 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.0 | 0.8 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.0 | 0.5 | GO:0031095 | platelet dense tubular network membrane(GO:0031095) |
| 0.0 | 0.1 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.0 | 6.9 | GO:0005802 | trans-Golgi network(GO:0005802) |
| 0.0 | 0.3 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.0 | 0.2 | GO:0005798 | Golgi-associated vesicle(GO:0005798) |
| 0.0 | 0.4 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.0 | 0.2 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
| 0.0 | 0.2 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
| 0.0 | 0.3 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.0 | 0.2 | GO:0070938 | contractile ring(GO:0070938) |
| 0.0 | 0.2 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
| 0.0 | 0.1 | GO:0090543 | Flemming body(GO:0090543) |
| 0.0 | 0.7 | GO:0030117 | membrane coat(GO:0030117) coated membrane(GO:0048475) |
| 0.0 | 0.5 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.0 | 0.9 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.0 | 0.6 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.0 | 0.1 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.0 | 0.2 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 1.0 | GO:0016592 | mediator complex(GO:0016592) |
| 0.0 | 0.1 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
| 0.0 | 0.3 | GO:0032590 | dendrite membrane(GO:0032590) |
| 0.0 | 0.3 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.0 | 0.0 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.0 | 0.1 | GO:1990589 | ATF4-CREB1 transcription factor complex(GO:1990589) |
| 0.0 | 0.5 | GO:0016324 | apical plasma membrane(GO:0016324) |
| 0.0 | 0.1 | GO:0031302 | intrinsic component of endosome membrane(GO:0031302) |
| 0.0 | 0.2 | GO:0071203 | WASH complex(GO:0071203) |
| 0.0 | 0.1 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.0 | 1.1 | GO:0035578 | azurophil granule lumen(GO:0035578) |
| 0.0 | 0.2 | GO:0043203 | axon hillock(GO:0043203) |
| 0.0 | 1.3 | GO:0001669 | acrosomal vesicle(GO:0001669) |
| 0.0 | 0.2 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.0 | 0.6 | GO:0044298 | neuronal cell body membrane(GO:0032809) cell body membrane(GO:0044298) |
| 0.0 | 0.5 | GO:0098576 | lumenal side of membrane(GO:0098576) |
| 0.0 | 0.2 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.0 | 5.7 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
| 0.0 | 0.3 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.0 | 0.6 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 0.2 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 0.0 | 0.0 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
| 0.0 | 0.2 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
| 0.0 | 0.1 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) |
| 0.0 | 0.1 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.0 | 1.8 | GO:0000779 | condensed chromosome, centromeric region(GO:0000779) |
| 0.0 | 0.1 | GO:0034686 | integrin alphav-beta8 complex(GO:0034686) |
| 0.0 | 2.6 | GO:0005815 | microtubule organizing center(GO:0005815) |
| 0.0 | 0.3 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.0 | 0.6 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.0 | 0.7 | GO:0005746 | mitochondrial respiratory chain(GO:0005746) |
| 0.0 | 0.2 | GO:0030669 | clathrin-coated endocytic vesicle membrane(GO:0030669) |
| 0.0 | 0.4 | GO:0071682 | endocytic vesicle lumen(GO:0071682) |
| 0.0 | 0.4 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.0 | 0.1 | GO:0032389 | MutLalpha complex(GO:0032389) |
| 0.0 | 0.0 | GO:0016342 | catenin complex(GO:0016342) |
| 0.0 | 0.0 | GO:0005960 | glycine cleavage complex(GO:0005960) |
| 0.0 | 0.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.0 | 0.3 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.0 | 0.3 | GO:1904724 | tertiary granule lumen(GO:1904724) |
| 0.0 | 0.0 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.0 | 0.0 | GO:0032798 | Swi5-Sfr1 complex(GO:0032798) |
| 0.0 | 0.1 | GO:0042589 | zymogen granule membrane(GO:0042589) |
| 0.0 | 0.0 | GO:0031372 | UBC13-MMS2 complex(GO:0031372) |
| 0.0 | 0.0 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.0 | 0.0 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
| 0.0 | 0.1 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.0 | 0.1 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.5 | 7.4 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
| 1.8 | 8.8 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 1.7 | 6.6 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 1.4 | 4.1 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
| 1.3 | 13.8 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 1.2 | 4.6 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 1.1 | 6.9 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 1.0 | 2.9 | GO:0016781 | selenide, water dikinase activity(GO:0004756) phosphotransferase activity, paired acceptors(GO:0016781) |
| 1.0 | 13.5 | GO:0030618 | transforming growth factor beta receptor, pathway-specific cytoplasmic mediator activity(GO:0030618) |
| 0.9 | 8.4 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.9 | 2.8 | GO:0052810 | 1-phosphatidylinositol-5-kinase activity(GO:0052810) |
| 0.9 | 5.5 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.9 | 2.7 | GO:0031859 | platelet activating factor receptor binding(GO:0031859) |
| 0.9 | 2.7 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.9 | 3.5 | GO:0043398 | HLH domain binding(GO:0043398) |
| 0.9 | 3.5 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 0.9 | 4.3 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
| 0.8 | 2.5 | GO:0004103 | choline kinase activity(GO:0004103) |
| 0.8 | 2.5 | GO:0047322 | [hydroxymethylglutaryl-CoA reductase (NADPH)] kinase activity(GO:0047322) [acetyl-CoA carboxylase] kinase activity(GO:0050405) |
| 0.8 | 5.7 | GO:0004522 | ribonuclease A activity(GO:0004522) |
| 0.8 | 3.2 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
| 0.8 | 1.6 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.8 | 3.2 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
| 0.8 | 2.4 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
| 0.8 | 3.1 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.8 | 2.3 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
| 0.7 | 2.2 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
| 0.7 | 2.2 | GO:0031896 | V2 vasopressin receptor binding(GO:0031896) |
| 0.7 | 7.1 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.7 | 3.5 | GO:0004306 | ethanolamine-phosphate cytidylyltransferase activity(GO:0004306) |
| 0.7 | 2.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.7 | 2.0 | GO:0015361 | low-affinity sodium:dicarboxylate symporter activity(GO:0015361) |
| 0.7 | 2.6 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
| 0.7 | 3.9 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.6 | 1.3 | GO:0004620 | phospholipase activity(GO:0004620) |
| 0.6 | 0.6 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
| 0.6 | 1.9 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.6 | 2.4 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.6 | 2.9 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
| 0.6 | 6.8 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.6 | 3.4 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.6 | 2.2 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
| 0.6 | 1.7 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.5 | 2.7 | GO:0052740 | 1-acyl-2-lysophosphatidylserine acylhydrolase activity(GO:0052740) |
| 0.5 | 3.2 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.5 | 11.7 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.5 | 1.6 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
| 0.5 | 0.5 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.5 | 3.6 | GO:0016403 | dimethylargininase activity(GO:0016403) |
| 0.5 | 3.6 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.5 | 1.5 | GO:0008798 | beta-aspartyl-peptidase activity(GO:0008798) |
| 0.5 | 6.6 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.5 | 3.0 | GO:0044736 | acid-sensing ion channel activity(GO:0044736) |
| 0.5 | 1.5 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
| 0.5 | 4.2 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.5 | 3.3 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.5 | 1.4 | GO:0031780 | corticotropin hormone receptor binding(GO:0031780) type 5 melanocortin receptor binding(GO:0031783) |
| 0.5 | 1.8 | GO:0004104 | acetylcholinesterase activity(GO:0003990) cholinesterase activity(GO:0004104) |
| 0.4 | 1.8 | GO:0016211 | glutamate-ammonia ligase activity(GO:0004356) ammonia ligase activity(GO:0016211) acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.4 | 14.0 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.4 | 0.4 | GO:0004935 | adrenergic receptor activity(GO:0004935) |
| 0.4 | 2.1 | GO:0046592 | polyamine oxidase activity(GO:0046592) spermine:oxygen oxidoreductase (spermidine-forming) activity(GO:0052901) |
| 0.4 | 4.7 | GO:0016274 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
| 0.4 | 1.2 | GO:0004958 | prostaglandin F receptor activity(GO:0004958) |
| 0.4 | 2.0 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
| 0.4 | 3.2 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.4 | 7.7 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.4 | 2.8 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.4 | 10.0 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.4 | 4.7 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.4 | 2.3 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
| 0.4 | 2.3 | GO:0004118 | cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) |
| 0.4 | 2.2 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.4 | 2.5 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
| 0.4 | 12.9 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.4 | 2.1 | GO:0045118 | azole transporter activity(GO:0045118) |
| 0.4 | 1.4 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 0.3 | 4.5 | GO:0001011 | transcription factor activity, sequence-specific DNA binding, RNA polymerase recruiting(GO:0001011) transcription factor activity, TFIIB-class binding(GO:0001087) |
| 0.3 | 1.0 | GO:0008746 | NAD(P)+ transhydrogenase activity(GO:0008746) oxidoreductase activity, acting on NAD(P)H, NAD(P) as acceptor(GO:0016652) |
| 0.3 | 1.0 | GO:0033867 | Fas-activated serine/threonine kinase activity(GO:0033867) |
| 0.3 | 1.0 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
| 0.3 | 1.0 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
| 0.3 | 2.0 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.3 | 2.9 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.3 | 2.4 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
| 0.3 | 2.1 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.3 | 3.3 | GO:0015166 | polyol transmembrane transporter activity(GO:0015166) |
| 0.3 | 1.2 | GO:0008336 | gamma-butyrobetaine dioxygenase activity(GO:0008336) |
| 0.3 | 2.7 | GO:0001225 | RNA polymerase II transcription coactivator binding(GO:0001225) |
| 0.3 | 3.6 | GO:0019826 | oxygen sensor activity(GO:0019826) |
| 0.3 | 1.2 | GO:0004803 | transposase activity(GO:0004803) |
| 0.3 | 1.5 | GO:0004161 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
| 0.3 | 2.3 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.3 | 4.0 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.3 | 2.0 | GO:0050682 | AF-2 domain binding(GO:0050682) |
| 0.3 | 0.6 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.3 | 0.6 | GO:0047389 | glycerophosphocholine phosphodiesterase activity(GO:0047389) |
| 0.3 | 1.1 | GO:0032143 | single thymine insertion binding(GO:0032143) |
| 0.3 | 1.4 | GO:0016454 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
| 0.3 | 5.7 | GO:0008391 | arachidonic acid monooxygenase activity(GO:0008391) arachidonic acid epoxygenase activity(GO:0008392) |
| 0.3 | 1.0 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.3 | 2.1 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.3 | 0.8 | GO:0032427 | GBD domain binding(GO:0032427) |
| 0.3 | 0.8 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.3 | 1.5 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
| 0.2 | 1.5 | GO:0004471 | malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
| 0.2 | 1.5 | GO:0005119 | smoothened binding(GO:0005119) |
| 0.2 | 2.0 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.2 | 1.0 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.2 | 1.0 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.2 | 0.7 | GO:0005260 | channel-conductance-controlling ATPase activity(GO:0005260) |
| 0.2 | 0.7 | GO:0030375 | thyroid hormone receptor activator activity(GO:0010861) thyroid hormone receptor coactivator activity(GO:0030375) |
| 0.2 | 4.9 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
| 0.2 | 0.7 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
| 0.2 | 0.2 | GO:0000406 | heteroduplex DNA loop binding(GO:0000404) double-strand/single-strand DNA junction binding(GO:0000406) dinucleotide repeat insertion binding(GO:0032181) |
| 0.2 | 0.9 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
| 0.2 | 0.7 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
| 0.2 | 2.8 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.2 | 0.4 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.2 | 1.1 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.2 | 0.9 | GO:0004909 | interleukin-1, Type I, activating receptor activity(GO:0004909) |
| 0.2 | 0.9 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
| 0.2 | 2.5 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.2 | 1.5 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.2 | 0.8 | GO:0042903 | tubulin deacetylase activity(GO:0042903) |
| 0.2 | 4.3 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.2 | 3.5 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.2 | 1.2 | GO:0043532 | angiostatin binding(GO:0043532) |
| 0.2 | 1.4 | GO:0016618 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.2 | 0.6 | GO:0004878 | complement component C5a receptor activity(GO:0004878) |
| 0.2 | 0.6 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.2 | 1.0 | GO:0004905 | type I interferon receptor activity(GO:0004905) |
| 0.2 | 1.4 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.2 | 1.0 | GO:0042954 | lipoprotein transporter activity(GO:0042954) |
| 0.2 | 1.0 | GO:0071253 | connexin binding(GO:0071253) |
| 0.2 | 3.6 | GO:0031402 | sodium ion binding(GO:0031402) |
| 0.2 | 1.2 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.2 | 3.2 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
| 0.2 | 0.7 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.2 | 0.6 | GO:0015218 | pyrimidine nucleotide transmembrane transporter activity(GO:0015218) |
| 0.2 | 5.2 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
| 0.2 | 0.6 | GO:0004730 | pseudouridylate synthase activity(GO:0004730) |
| 0.2 | 4.3 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
| 0.2 | 0.6 | GO:0047977 | hepoxilin-epoxide hydrolase activity(GO:0047977) |
| 0.2 | 2.2 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.2 | 0.6 | GO:0001147 | transcription termination site sequence-specific DNA binding(GO:0001147) transcription termination site DNA binding(GO:0001160) |
| 0.2 | 1.6 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.2 | 14.2 | GO:0061733 | peptide-lysine-N-acetyltransferase activity(GO:0061733) |
| 0.2 | 3.2 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.2 | 5.9 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.2 | 0.5 | GO:0005169 | neurotrophin TRKB receptor binding(GO:0005169) |
| 0.2 | 1.7 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 0.2 | 0.5 | GO:0070260 | tyrosyl-RNA phosphodiesterase activity(GO:0036317) 5'-tyrosyl-DNA phosphodiesterase activity(GO:0070260) |
| 0.2 | 0.7 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.2 | 2.7 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.2 | 1.5 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.2 | 0.5 | GO:0016422 | mRNA (2'-O-methyladenosine-N6-)-methyltransferase activity(GO:0016422) |
| 0.2 | 1.0 | GO:0035276 | ethanol binding(GO:0035276) |
| 0.2 | 0.3 | GO:0001026 | TFIIIB-type transcription factor activity(GO:0001026) |
| 0.2 | 2.3 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 0.2 | 1.8 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.2 | 0.7 | GO:0004727 | prenylated protein tyrosine phosphatase activity(GO:0004727) |
| 0.2 | 0.7 | GO:0032406 | MutLbeta complex binding(GO:0032406) MutSbeta complex binding(GO:0032408) |
| 0.2 | 0.7 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
| 0.2 | 0.8 | GO:0032296 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
| 0.2 | 3.2 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.2 | 0.8 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.2 | 0.5 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.2 | 1.4 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.2 | 1.6 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.2 | 5.3 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.2 | 0.8 | GO:1904929 | coreceptor activity involved in Wnt signaling pathway, planar cell polarity pathway(GO:1904929) |
| 0.2 | 1.1 | GO:0047894 | flavonol 3-sulfotransferase activity(GO:0047894) steroid sulfotransferase activity(GO:0050294) |
| 0.2 | 0.5 | GO:0015227 | acyl carnitine transmembrane transporter activity(GO:0015227) |
| 0.2 | 1.4 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 0.2 | 1.5 | GO:0015250 | water channel activity(GO:0015250) |
| 0.2 | 2.1 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
| 0.2 | 1.1 | GO:0047522 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
| 0.1 | 0.6 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.1 | 1.3 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.1 | 1.8 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.1 | 0.9 | GO:0005534 | galactose binding(GO:0005534) |
| 0.1 | 1.3 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.1 | 0.6 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
| 0.1 | 1.9 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.1 | 0.6 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.1 | 1.4 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.1 | 0.4 | GO:0047726 | iron-cytochrome-c reductase activity(GO:0047726) |
| 0.1 | 7.1 | GO:0051393 | alpha-actinin binding(GO:0051393) |
| 0.1 | 0.6 | GO:0038187 | signaling pattern recognition receptor activity(GO:0008329) pattern recognition receptor activity(GO:0038187) |
| 0.1 | 1.6 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.1 | 0.7 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.1 | 6.8 | GO:0030371 | translation repressor activity(GO:0030371) |
| 0.1 | 2.7 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.1 | 1.7 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.1 | 0.7 | GO:0031208 | POZ domain binding(GO:0031208) |
| 0.1 | 0.6 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
| 0.1 | 1.8 | GO:0042826 | histone deacetylase binding(GO:0042826) |
| 0.1 | 1.6 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) potassium ion antiporter activity(GO:0022821) |
| 0.1 | 0.4 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.1 | 8.0 | GO:0031491 | nucleosome binding(GO:0031491) |
| 0.1 | 0.4 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.1 | 2.6 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.1 | 1.3 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.1 | 0.1 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.1 | 0.4 | GO:0047661 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
| 0.1 | 0.9 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
| 0.1 | 0.4 | GO:0004019 | adenylosuccinate synthase activity(GO:0004019) |
| 0.1 | 2.3 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.1 | 0.8 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.1 | 0.1 | GO:0050659 | N-acetylgalactosamine 4-sulfate 6-O-sulfotransferase activity(GO:0050659) |
| 0.1 | 0.4 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.1 | 0.7 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.1 | 1.2 | GO:0034485 | phosphatidylinositol-3,4,5-trisphosphate 5-phosphatase activity(GO:0034485) |
| 0.1 | 0.1 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
| 0.1 | 1.0 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
| 0.1 | 0.8 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.1 | 0.8 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
| 0.1 | 1.0 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.1 | 1.1 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
| 0.1 | 1.0 | GO:0043559 | insulin binding(GO:0043559) |
| 0.1 | 0.6 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.1 | 0.8 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.1 | 1.9 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) ADP transmembrane transporter activity(GO:0015217) |
| 0.1 | 10.1 | GO:0033613 | activating transcription factor binding(GO:0033613) |
| 0.1 | 3.0 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
| 0.1 | 2.1 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.1 | 3.2 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.1 | 0.8 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.1 | 0.4 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.1 | 0.3 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.1 | 4.3 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.1 | 0.4 | GO:0046404 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.1 | 0.7 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.1 | 3.3 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.1 | 0.7 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.1 | 1.5 | GO:0043175 | RNA polymerase core enzyme binding(GO:0043175) |
| 0.1 | 0.6 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.1 | 0.4 | GO:0043812 | phosphatidylinositol-4-phosphate phosphatase activity(GO:0043812) |
| 0.1 | 0.4 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
| 0.1 | 3.0 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.1 | 1.4 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.1 | 0.7 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.1 | 0.6 | GO:0070735 | protein-glycine ligase activity(GO:0070735) |
| 0.1 | 0.7 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.1 | 3.3 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.1 | 0.3 | GO:1904455 | ubiquitin-specific protease activity involved in negative regulation of ERAD pathway(GO:1904455) |
| 0.1 | 3.6 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.1 | 0.3 | GO:0004779 | adenylylsulfate kinase activity(GO:0004020) sulfate adenylyltransferase activity(GO:0004779) sulfate adenylyltransferase (ATP) activity(GO:0004781) |
| 0.1 | 0.4 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.1 | 0.7 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.1 | 4.9 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.1 | 1.3 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.1 | 0.5 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.1 | 0.5 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
| 0.1 | 0.5 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.1 | 1.0 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.1 | 0.3 | GO:0019959 | interleukin-8 binding(GO:0019959) |
| 0.1 | 0.3 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
| 0.1 | 0.9 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.1 | 0.9 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.1 | 0.5 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
| 0.1 | 0.9 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.1 | 0.5 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.1 | 2.7 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.1 | 2.6 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.1 | 1.5 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.1 | 1.6 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.1 | 0.4 | GO:0016426 | tRNA (adenine) methyltransferase activity(GO:0016426) tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
| 0.1 | 0.6 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.1 | 1.6 | GO:0001223 | transcription coactivator binding(GO:0001223) |
| 0.1 | 5.5 | GO:0004407 | histone deacetylase activity(GO:0004407) |
| 0.1 | 28.7 | GO:0000978 | RNA polymerase II core promoter proximal region sequence-specific DNA binding(GO:0000978) |
| 0.1 | 1.1 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
| 0.1 | 1.0 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
| 0.1 | 0.9 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.1 | 2.5 | GO:0000030 | mannosyltransferase activity(GO:0000030) |
| 0.1 | 0.8 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
| 0.1 | 1.3 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.1 | 2.5 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.1 | 1.0 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
| 0.1 | 2.9 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.1 | 0.3 | GO:0055102 | phospholipase inhibitor activity(GO:0004859) lipase inhibitor activity(GO:0055102) |
| 0.1 | 1.2 | GO:0099602 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
| 0.1 | 0.3 | GO:0071566 | UFM1 activating enzyme activity(GO:0071566) |
| 0.1 | 0.7 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
| 0.1 | 0.3 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.1 | 0.3 | GO:0034353 | RNA pyrophosphohydrolase activity(GO:0034353) |
| 0.1 | 3.1 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.1 | 1.0 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
| 0.1 | 0.5 | GO:0047685 | amine sulfotransferase activity(GO:0047685) |
| 0.1 | 0.7 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.1 | 0.6 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.1 | 0.6 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 0.1 | 0.7 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
| 0.1 | 0.2 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) |
| 0.1 | 1.1 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.1 | 0.6 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.1 | 0.5 | GO:0042978 | ornithine decarboxylase activator activity(GO:0042978) |
| 0.1 | 0.8 | GO:0030369 | ICAM-3 receptor activity(GO:0030369) |
| 0.1 | 23.3 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
| 0.1 | 0.3 | GO:0015616 | DNA translocase activity(GO:0015616) |
| 0.1 | 0.4 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
| 0.1 | 0.4 | GO:1902444 | riboflavin binding(GO:1902444) |
| 0.1 | 5.2 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.1 | 4.7 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.1 | 0.8 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
| 0.1 | 0.4 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
| 0.1 | 0.8 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.1 | 0.1 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.1 | 1.9 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
| 0.1 | 0.1 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
| 0.1 | 0.6 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.1 | 0.4 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.1 | 0.9 | GO:1990459 | transferrin receptor binding(GO:1990459) |
| 0.1 | 0.7 | GO:0003910 | DNA ligase (ATP) activity(GO:0003910) |
| 0.1 | 0.8 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
| 0.1 | 1.4 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
| 0.1 | 3.2 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.1 | 0.6 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.1 | 1.2 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.1 | 0.8 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.1 | 1.6 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.1 | 1.0 | GO:0033691 | sialic acid binding(GO:0033691) |
| 0.1 | 0.2 | GO:0001228 | transcriptional activator activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001228) |
| 0.1 | 0.3 | GO:0004979 | beta-endorphin receptor activity(GO:0004979) morphine receptor activity(GO:0038047) |
| 0.1 | 0.4 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.1 | 0.5 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.1 | 0.7 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.1 | 0.2 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
| 0.1 | 0.3 | GO:0001855 | complement component C4b binding(GO:0001855) |
| 0.1 | 1.1 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.1 | 0.5 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.1 | 0.5 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
| 0.1 | 0.3 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.1 | 0.3 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.1 | 0.3 | GO:0044388 | small protein activating enzyme binding(GO:0044388) |
| 0.1 | 0.4 | GO:0003998 | acylphosphatase activity(GO:0003998) |
| 0.1 | 1.4 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
| 0.1 | 2.6 | GO:0016278 | lysine N-methyltransferase activity(GO:0016278) |
| 0.1 | 0.4 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
| 0.1 | 0.1 | GO:0004470 | malic enzyme activity(GO:0004470) |
| 0.1 | 0.3 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 0.1 | 0.1 | GO:0098639 | protein binding involved in cell-matrix adhesion(GO:0098634) collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.1 | 0.4 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.1 | 1.4 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.1 | 0.6 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.1 | 0.2 | GO:0004598 | peptidylglycine monooxygenase activity(GO:0004504) peptidylamidoglycolate lyase activity(GO:0004598) |
| 0.1 | 0.4 | GO:0043121 | neurotrophin binding(GO:0043121) |
| 0.1 | 0.6 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.1 | 0.3 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
| 0.1 | 0.3 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
| 0.1 | 0.2 | GO:0004960 | thromboxane receptor activity(GO:0004960) thromboxane A2 receptor activity(GO:0004961) |
| 0.1 | 0.6 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.1 | 0.2 | GO:0030226 | apolipoprotein receptor activity(GO:0030226) |
| 0.1 | 0.2 | GO:0047708 | biotinidase activity(GO:0047708) |
| 0.1 | 0.2 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.1 | 0.3 | GO:0052723 | inositol-1,3,4,5,6-pentakisphosphate kinase activity(GO:0000827) inositol hexakisphosphate kinase activity(GO:0000828) inositol heptakisphosphate kinase activity(GO:0000829) inositol hexakisphosphate 5-kinase activity(GO:0000832) diphosphoinositol-pentakisphosphate kinase activity(GO:0033857) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.1 | 0.2 | GO:0035034 | histone acetyltransferase regulator activity(GO:0035034) |
| 0.1 | 0.5 | GO:0070324 | thyroid hormone binding(GO:0070324) |
| 0.1 | 0.2 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.1 | 0.1 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
| 0.1 | 0.6 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
| 0.1 | 1.8 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.1 | 0.3 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.1 | 1.1 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.1 | 1.2 | GO:0036442 | hydrogen-exporting ATPase activity(GO:0036442) proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.1 | 1.3 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.1 | 0.3 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.1 | 0.4 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.1 | 0.6 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
| 0.1 | 0.5 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.1 | 0.1 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.1 | 0.6 | GO:0031386 | protein tag(GO:0031386) |
| 0.1 | 0.4 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.0 | 1.9 | GO:0015248 | sterol transporter activity(GO:0015248) |
| 0.0 | 0.8 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
| 0.0 | 0.4 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 0.0 | 1.0 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
| 0.0 | 0.1 | GO:0070404 | NADH binding(GO:0070404) |
| 0.0 | 0.8 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.0 | 0.2 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.0 | 0.1 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 0.0 | 0.2 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.0 | 1.8 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
| 0.0 | 0.6 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.2 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.0 | 0.1 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.0 | 0.1 | GO:0030366 | molybdopterin synthase activity(GO:0030366) |
| 0.0 | 0.2 | GO:0030151 | molybdenum ion binding(GO:0030151) |
| 0.0 | 0.2 | GO:0005277 | acetylcholine transmembrane transporter activity(GO:0005277) acetate ester transmembrane transporter activity(GO:1901375) |
| 0.0 | 0.1 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.0 | 0.1 | GO:0008267 | poly-glutamine tract binding(GO:0008267) |
| 0.0 | 0.3 | GO:0031420 | alkali metal ion binding(GO:0031420) |
| 0.0 | 0.3 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
| 0.0 | 1.1 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.0 | 0.3 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
| 0.0 | 0.3 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) |
| 0.0 | 0.2 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.0 | 0.2 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.0 | 0.4 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.0 | 0.2 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
| 0.0 | 0.4 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.0 | 0.3 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.0 | 0.3 | GO:0016301 | kinase activity(GO:0016301) |
| 0.0 | 0.1 | GO:0019211 | phosphatase activator activity(GO:0019211) |
| 0.0 | 0.5 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
| 0.0 | 1.8 | GO:0008375 | acetylglucosaminyltransferase activity(GO:0008375) |
| 0.0 | 0.2 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
| 0.0 | 0.4 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
| 0.0 | 1.2 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.0 | 0.3 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
| 0.0 | 0.1 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.0 | 0.6 | GO:0030275 | LRR domain binding(GO:0030275) |
| 0.0 | 0.1 | GO:0015928 | alpha-L-fucosidase activity(GO:0004560) fucosidase activity(GO:0015928) |
| 0.0 | 1.3 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.0 | 0.5 | GO:0016004 | phospholipase activator activity(GO:0016004) |
| 0.0 | 1.0 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.1 | GO:0008969 | phosphohistidine phosphatase activity(GO:0008969) |
| 0.0 | 3.2 | GO:0015078 | hydrogen ion transmembrane transporter activity(GO:0015078) |
| 0.0 | 0.1 | GO:0030627 | pre-mRNA 5'-splice site binding(GO:0030627) |
| 0.0 | 0.2 | GO:0004910 | interleukin-1, Type II, blocking receptor activity(GO:0004910) |
| 0.0 | 0.1 | GO:0004844 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
| 0.0 | 0.3 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.0 | 0.3 | GO:0008079 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
| 0.0 | 0.4 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.0 | 0.3 | GO:0042301 | phosphate ion binding(GO:0042301) |
| 0.0 | 0.8 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.0 | 0.3 | GO:0008430 | selenium binding(GO:0008430) |
| 0.0 | 0.4 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.0 | 0.2 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.0 | 0.2 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.0 | 0.1 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
| 0.0 | 0.3 | GO:0001042 | RNA polymerase I core binding(GO:0001042) |
| 0.0 | 0.5 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.0 | 2.2 | GO:0008186 | RNA helicase activity(GO:0003724) ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
| 0.0 | 0.8 | GO:0005272 | sodium channel activity(GO:0005272) |
| 0.0 | 0.7 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
| 0.0 | 0.1 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.0 | 0.2 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.0 | 0.1 | GO:0005459 | UDP-galactose transmembrane transporter activity(GO:0005459) |
| 0.0 | 0.1 | GO:0098640 | integrin binding involved in cell-matrix adhesion(GO:0098640) |
| 0.0 | 0.4 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
| 0.0 | 0.4 | GO:0004568 | chitinase activity(GO:0004568) |
| 0.0 | 0.1 | GO:0004818 | glutamate-tRNA ligase activity(GO:0004818) |
| 0.0 | 0.3 | GO:0003996 | acyl-CoA ligase activity(GO:0003996) |
| 0.0 | 1.3 | GO:0008009 | chemokine activity(GO:0008009) |
| 0.0 | 0.5 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.0 | 4.4 | GO:0017137 | Rab GTPase binding(GO:0017137) |
| 0.0 | 0.1 | GO:0008281 | sulfonylurea receptor activity(GO:0008281) |
| 0.0 | 1.1 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.0 | 0.2 | GO:0048039 | ubiquinone binding(GO:0048039) |
| 0.0 | 0.0 | GO:0038064 | collagen receptor activity(GO:0038064) |
| 0.0 | 0.5 | GO:0005112 | Notch binding(GO:0005112) |
| 0.0 | 0.3 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.0 | 0.3 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.0 | 0.2 | GO:0010181 | FMN binding(GO:0010181) |
| 0.0 | 6.4 | GO:0005516 | calmodulin binding(GO:0005516) |
| 0.0 | 0.3 | GO:0008028 | monocarboxylic acid transmembrane transporter activity(GO:0008028) |
| 0.0 | 0.1 | GO:0044213 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) intronic transcription regulatory region DNA binding(GO:0044213) |
| 0.0 | 0.1 | GO:0032089 | NACHT domain binding(GO:0032089) |
| 0.0 | 0.1 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
| 0.0 | 0.3 | GO:0046875 | ephrin receptor binding(GO:0046875) |
| 0.0 | 0.1 | GO:0019237 | centromeric DNA binding(GO:0019237) |
| 0.0 | 0.6 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.0 | 1.0 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
| 0.0 | 1.1 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
| 0.0 | 0.1 | GO:0052794 | exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
| 0.0 | 1.2 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.0 | 0.5 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.0 | 1.6 | GO:0003727 | single-stranded RNA binding(GO:0003727) |
| 0.0 | 0.2 | GO:0005003 | ephrin receptor activity(GO:0005003) |
| 0.0 | 0.2 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.0 | 0.3 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
| 0.0 | 0.8 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
| 0.0 | 0.2 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.0 | 0.1 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.0 | 0.3 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
| 0.0 | 0.1 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
| 0.0 | 1.6 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
| 0.0 | 0.1 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) oxidoreductase activity, acting on NAD(P)H, oxygen as acceptor(GO:0050664) |
| 0.0 | 1.0 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) RNA polymerase activity(GO:0034062) |
| 0.0 | 0.2 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
| 0.0 | 0.8 | GO:0002039 | p53 binding(GO:0002039) |
| 0.0 | 0.0 | GO:0004660 | protein farnesyltransferase activity(GO:0004660) |
| 0.0 | 0.2 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 0.0 | 0.1 | GO:0005151 | interleukin-1, Type II receptor binding(GO:0005151) |
| 0.0 | 0.4 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 0.0 | 34.2 | GO:0003677 | DNA binding(GO:0003677) |
| 0.0 | 1.3 | GO:0016798 | hydrolase activity, acting on glycosyl bonds(GO:0016798) |
| 0.0 | 0.1 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.0 | 0.1 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.0 | 0.1 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.0 | 0.2 | GO:0070330 | aromatase activity(GO:0070330) |
| 0.0 | 0.1 | GO:0001104 | RNA polymerase II transcription cofactor activity(GO:0001104) |
| 0.0 | 0.0 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.0 | 1.0 | GO:0016820 | hydrolase activity, acting on acid anhydrides, catalyzing transmembrane movement of substances(GO:0016820) |
| 0.0 | 0.2 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.0 | 0.1 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.0 | 0.0 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
| 0.0 | 0.1 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
| 0.0 | 0.1 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.0 | 0.0 | GO:0003720 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
| 0.0 | 0.1 | GO:0050661 | NADP binding(GO:0050661) |
| 0.0 | 0.1 | GO:0051916 | granulocyte colony-stimulating factor binding(GO:0051916) |
| 0.0 | 0.1 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
| 0.0 | 0.2 | GO:0004114 | 3',5'-cyclic-nucleotide phosphodiesterase activity(GO:0004114) |
| 0.0 | 0.0 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.0 | 0.4 | GO:0030515 | snoRNA binding(GO:0030515) |
| 0.0 | 0.1 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.0 | 0.0 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.0 | 0.1 | GO:0019789 | SUMO transferase activity(GO:0019789) |
| 0.0 | 0.1 | GO:0047144 | 2-acylglycerol-3-phosphate O-acyltransferase activity(GO:0047144) |
| 0.0 | 0.0 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
| 0.0 | 0.0 | GO:0097643 | calcitonin family receptor activity(GO:0097642) amylin receptor activity(GO:0097643) |
| 0.0 | 0.0 | GO:0016530 | metallochaperone activity(GO:0016530) copper chaperone activity(GO:0016531) |
| 0.0 | 0.0 | GO:0060422 | peptidyl-dipeptidase inhibitor activity(GO:0060422) |
| 0.0 | 0.1 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.1 | 20.1 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.4 | 0.8 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.3 | 3.4 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
| 0.2 | 0.9 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.2 | 4.0 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.2 | 9.7 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.2 | 3.4 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.2 | 0.7 | PID S1P S1P3 PATHWAY | S1P3 pathway |
| 0.2 | 2.4 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.2 | 15.4 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.1 | 16.9 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 0.1 | 1.4 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.1 | 4.1 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.1 | 5.8 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.1 | 9.3 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.1 | 5.8 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.1 | 1.7 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.1 | 7.6 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.1 | 6.8 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.1 | 3.3 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.1 | 0.1 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.1 | 0.6 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.1 | 7.7 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.1 | 1.7 | PID EPO PATHWAY | EPO signaling pathway |
| 0.1 | 2.7 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.1 | 2.3 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.1 | 2.1 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.1 | 0.2 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.1 | 3.3 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.1 | 0.2 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.1 | 1.3 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.1 | 8.2 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
| 0.1 | 0.7 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.1 | 0.6 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.1 | 0.8 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.1 | 0.3 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.1 | 3.2 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.1 | 0.3 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.1 | 3.6 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.0 | 0.5 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.0 | 3.4 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.0 | 0.3 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
| 0.0 | 2.3 | PID BMP PATHWAY | BMP receptor signaling |
| 0.0 | 0.7 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.0 | 1.2 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.0 | 2.5 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.0 | 0.3 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.0 | 2.6 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 4.3 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.0 | 0.3 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.0 | 0.6 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.0 | 2.7 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
| 0.0 | 0.8 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.0 | 0.1 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.0 | 1.6 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 0.2 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.0 | 0.5 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
| 0.0 | 0.5 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 0.2 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
| 0.0 | 1.2 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.0 | 0.5 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.0 | 0.3 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.0 | 0.3 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.0 | 1.0 | REACTOME DAG AND IP3 SIGNALING | Genes involved in DAG and IP3 signaling |
| 0.4 | 0.8 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
| 0.4 | 5.1 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.3 | 9.3 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.3 | 5.4 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
| 0.3 | 5.7 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
| 0.3 | 7.9 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.3 | 3.9 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.3 | 3.8 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
| 0.3 | 4.2 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.2 | 8.1 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.2 | 5.6 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.2 | 8.9 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.2 | 0.2 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
| 0.2 | 1.7 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
| 0.2 | 6.5 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
| 0.2 | 2.9 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 0.2 | 4.6 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.2 | 4.5 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.2 | 8.2 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.2 | 1.4 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.2 | 9.4 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.2 | 2.5 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.2 | 0.5 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 0.2 | 1.3 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.2 | 0.6 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.1 | 1.0 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
| 0.1 | 3.3 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.1 | 1.8 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.1 | 3.9 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
| 0.1 | 2.2 | REACTOME FORMATION OF RNA POL II ELONGATION COMPLEX | Genes involved in Formation of RNA Pol II elongation complex |
| 0.1 | 1.4 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.1 | 5.1 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
| 0.1 | 1.9 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
| 0.1 | 0.7 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.1 | 4.7 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.1 | 0.4 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.1 | 2.3 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
| 0.1 | 0.8 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
| 0.1 | 2.6 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
| 0.1 | 3.1 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
| 0.1 | 0.9 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.1 | 3.7 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
| 0.1 | 2.4 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.1 | 1.4 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.1 | 2.8 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.1 | 2.7 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.1 | 1.7 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
| 0.1 | 4.8 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.1 | 12.3 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 0.1 | 3.4 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.1 | 1.7 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.1 | 2.3 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.1 | 7.2 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 0.1 | 0.8 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |
| 0.1 | 1.7 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.1 | 0.9 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.1 | 2.6 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.1 | 2.6 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
| 0.1 | 1.9 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.1 | 2.2 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.1 | 1.6 | REACTOME CHONDROITIN SULFATE DERMATAN SULFATE METABOLISM | Genes involved in Chondroitin sulfate/dermatan sulfate metabolism |
| 0.1 | 0.1 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.1 | 1.2 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.1 | 1.1 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
| 0.1 | 0.5 | REACTOME KERATAN SULFATE KERATIN METABOLISM | Genes involved in Keratan sulfate/keratin metabolism |
| 0.1 | 1.9 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
| 0.1 | 0.7 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.1 | 6.7 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
| 0.1 | 3.3 | REACTOME SIGNALING BY NOTCH1 | Genes involved in Signaling by NOTCH1 |
| 0.1 | 5.3 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.1 | 3.2 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
| 0.1 | 0.4 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.0 | 1.0 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.0 | 0.8 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.0 | 0.6 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.0 | 1.4 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.0 | 0.7 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.0 | 0.7 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.0 | 0.1 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
| 0.0 | 0.6 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.0 | 0.3 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.0 | 0.1 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 0.0 | 0.9 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.0 | 1.1 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.0 | 0.4 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.0 | 2.6 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.0 | 0.9 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
| 0.0 | 0.3 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.0 | 1.7 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
| 0.0 | 0.6 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.0 | 1.6 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.0 | 0.8 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.0 | 0.2 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 0.0 | 0.6 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.0 | 0.2 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
| 0.0 | 0.1 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.0 | 0.5 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.0 | 0.6 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.0 | 1.4 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.0 | 1.7 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 0.6 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.0 | 0.2 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.0 | 0.2 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.0 | 0.5 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.0 | 0.5 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.0 | 1.0 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
| 0.0 | 2.0 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.0 | 1.2 | REACTOME G ALPHA S SIGNALLING EVENTS | Genes involved in G alpha (s) signalling events |
| 0.0 | 0.2 | REACTOME RNA POL I RNA POL III AND MITOCHONDRIAL TRANSCRIPTION | Genes involved in RNA Polymerase I, RNA Polymerase III, and Mitochondrial Transcription |
| 0.0 | 0.3 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
| 0.0 | 1.1 | REACTOME HEPARAN SULFATE HEPARIN HS GAG METABOLISM | Genes involved in Heparan sulfate/heparin (HS-GAG) metabolism |
| 0.0 | 0.3 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 0.3 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.0 | 0.1 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.0 | 0.4 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |