Mucociliary differentiation, bronchial epithelial cells, human (Ross 2007)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
YY1
|
ENSG00000100811.6 | YY1 transcription factor |
|
YY2
|
ENSG00000230797.2 | YY2 transcription factor |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| YY1 | hg19_v2_chr14_+_100705322_100705360 | 0.30 | 1.1e-01 | Click! |
| YY2 | hg19_v2_chrX_+_21874105_21874105 | -0.07 | 7.1e-01 | Click! |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.0 | 3.0 | GO:0070632 | spindle pole body duplication(GO:0030474) spindle pole body organization(GO:0051300) spindle pole body localization(GO:0070631) establishment of spindle pole body localization(GO:0070632) spindle pole body localization to nuclear envelope(GO:0071789) establishment of spindle pole body localization to nuclear envelope(GO:0071790) |
| 0.7 | 5.5 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
| 0.7 | 2.0 | GO:0090341 | negative regulation of secretion of lysosomal enzymes(GO:0090341) |
| 0.6 | 1.9 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.6 | 0.6 | GO:0090149 | mitochondrial membrane fission(GO:0090149) |
| 0.5 | 1.5 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.5 | 1.4 | GO:0052047 | interaction with other organism via secreted substance involved in symbiotic interaction(GO:0052047) |
| 0.5 | 1.4 | GO:0044209 | AMP salvage(GO:0044209) |
| 0.4 | 1.2 | GO:0036466 | synaptic vesicle recycling via endosome(GO:0036466) |
| 0.3 | 0.7 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.3 | 3.1 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
| 0.3 | 1.0 | GO:0006427 | histidyl-tRNA aminoacylation(GO:0006427) |
| 0.3 | 1.9 | GO:0019418 | sulfide oxidation(GO:0019418) sulfide oxidation, using sulfide:quinone oxidoreductase(GO:0070221) |
| 0.3 | 0.9 | GO:1900195 | positive regulation of oocyte maturation(GO:1900195) |
| 0.3 | 0.9 | GO:1902512 | positive regulation of apoptotic DNA fragmentation(GO:1902512) |
| 0.3 | 2.4 | GO:0001661 | conditioned taste aversion(GO:0001661) |
| 0.3 | 1.2 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
| 0.3 | 1.1 | GO:0035625 | negative regulation of epinephrine secretion(GO:0032811) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
| 0.3 | 2.3 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 0.3 | 1.4 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
| 0.3 | 0.8 | GO:2000681 | negative regulation of rubidium ion transport(GO:2000681) negative regulation of rubidium ion transmembrane transporter activity(GO:2000687) |
| 0.3 | 1.3 | GO:2001168 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.3 | 0.3 | GO:0007263 | nitric oxide mediated signal transduction(GO:0007263) |
| 0.3 | 0.8 | GO:2000646 | regulation of phospholipid efflux(GO:1902994) positive regulation of phospholipid efflux(GO:1902995) positive regulation of receptor catabolic process(GO:2000646) |
| 0.3 | 2.0 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.3 | 0.5 | GO:0006733 | oxidoreduction coenzyme metabolic process(GO:0006733) |
| 0.2 | 1.5 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.2 | 1.5 | GO:0002225 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antimicrobial humoral response(GO:0002760) positive regulation of antibacterial peptide production(GO:0002803) |
| 0.2 | 1.2 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 0.2 | 0.7 | GO:0006425 | glutaminyl-tRNA aminoacylation(GO:0006425) |
| 0.2 | 0.7 | GO:1990022 | RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
| 0.2 | 0.7 | GO:0035624 | receptor transactivation(GO:0035624) |
| 0.2 | 2.4 | GO:0060753 | regulation of mast cell chemotaxis(GO:0060753) |
| 0.2 | 0.7 | GO:0070859 | positive regulation of bile acid biosynthetic process(GO:0070859) positive regulation of bile acid metabolic process(GO:1904253) |
| 0.2 | 2.8 | GO:0031580 | membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
| 0.2 | 0.9 | GO:0035616 | histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.2 | 1.3 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
| 0.2 | 1.0 | GO:0043129 | surfactant homeostasis(GO:0043129) |
| 0.2 | 0.4 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.2 | 0.6 | GO:1900244 | positive regulation of synaptic vesicle endocytosis(GO:1900244) positive regulation of synaptic vesicle recycling(GO:1903423) |
| 0.2 | 1.9 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.2 | 0.2 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.2 | 0.4 | GO:0010841 | positive regulation of circadian sleep/wake cycle, wakefulness(GO:0010841) |
| 0.2 | 0.9 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.2 | 1.1 | GO:0042335 | cuticle development(GO:0042335) |
| 0.2 | 1.1 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.2 | 1.1 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.2 | 0.7 | GO:0033091 | positive regulation of immature T cell proliferation(GO:0033091) |
| 0.2 | 1.3 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
| 0.2 | 1.1 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.2 | 0.5 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 0.2 | 0.5 | GO:0046947 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.2 | 2.2 | GO:0070072 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.2 | 0.5 | GO:0051086 | chaperone mediated protein folding independent of cofactor(GO:0051086) |
| 0.2 | 0.8 | GO:0070829 | response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.2 | 0.8 | GO:0018101 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
| 0.2 | 4.7 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.2 | 0.2 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
| 0.2 | 0.5 | GO:0036060 | filtration diaphragm assembly(GO:0036058) slit diaphragm assembly(GO:0036060) |
| 0.2 | 1.9 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.2 | 0.8 | GO:0099590 | neurotransmitter receptor internalization(GO:0099590) |
| 0.2 | 0.9 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.2 | 0.5 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.2 | 0.2 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
| 0.1 | 0.3 | GO:0046626 | regulation of insulin receptor signaling pathway(GO:0046626) |
| 0.1 | 0.4 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.1 | 1.5 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
| 0.1 | 0.4 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.1 | 2.2 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
| 0.1 | 0.6 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.1 | 1.0 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 | 0.1 | GO:1903094 | regulation of protein K48-linked deubiquitination(GO:1903093) negative regulation of protein K48-linked deubiquitination(GO:1903094) negative regulation of ubiquitin-specific protease activity(GO:2000157) |
| 0.1 | 0.6 | GO:0051754 | meiotic sister chromatid cohesion, centromeric(GO:0051754) |
| 0.1 | 0.4 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
| 0.1 | 0.1 | GO:1902954 | regulation of early endosome to recycling endosome transport(GO:1902954) |
| 0.1 | 0.4 | GO:0097254 | renal tubular secretion(GO:0097254) |
| 0.1 | 0.7 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
| 0.1 | 0.7 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.1 | 0.1 | GO:0031958 | corticosteroid receptor signaling pathway(GO:0031958) glucocorticoid receptor signaling pathway(GO:0042921) |
| 0.1 | 0.7 | GO:1902951 | negative regulation of dendritic spine maintenance(GO:1902951) |
| 0.1 | 0.7 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.1 | 0.6 | GO:0017185 | peptidyl-lysine hydroxylation(GO:0017185) |
| 0.1 | 0.3 | GO:0051665 | membrane raft localization(GO:0051665) |
| 0.1 | 3.9 | GO:0006491 | N-glycan processing(GO:0006491) |
| 0.1 | 0.4 | GO:1904617 | regulation of actin filament binding(GO:1904529) negative regulation of actin filament binding(GO:1904530) regulation of actin binding(GO:1904616) negative regulation of actin binding(GO:1904617) |
| 0.1 | 0.8 | GO:0000432 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
| 0.1 | 1.4 | GO:1902600 | hydrogen ion transmembrane transport(GO:1902600) |
| 0.1 | 0.4 | GO:0043686 | co-translational protein modification(GO:0043686) |
| 0.1 | 0.5 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.1 | 1.0 | GO:0044821 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.1 | 0.5 | GO:0007509 | mesoderm migration involved in gastrulation(GO:0007509) |
| 0.1 | 0.6 | GO:0016036 | cellular response to phosphate starvation(GO:0016036) positive regulation of sulfur amino acid metabolic process(GO:0031337) positive regulation of homocysteine metabolic process(GO:0050668) |
| 0.1 | 1.2 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.1 | 1.2 | GO:0035583 | sequestering of TGFbeta in extracellular matrix(GO:0035583) |
| 0.1 | 0.7 | GO:0007079 | mitotic chromosome movement towards spindle pole(GO:0007079) |
| 0.1 | 0.4 | GO:0048213 | Golgi vesicle prefusion complex stabilization(GO:0048213) |
| 0.1 | 0.6 | GO:0003322 | pancreatic A cell development(GO:0003322) |
| 0.1 | 1.4 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.1 | 0.3 | GO:0048241 | epinephrine transport(GO:0048241) |
| 0.1 | 0.3 | GO:0010652 | regulation of cell communication by chemical coupling(GO:0010645) positive regulation of cell communication by chemical coupling(GO:0010652) |
| 0.1 | 0.3 | GO:0090156 | cellular sphingolipid homeostasis(GO:0090156) |
| 0.1 | 0.6 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.1 | 0.8 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 0.1 | 0.9 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
| 0.1 | 0.6 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
| 0.1 | 0.4 | GO:0070901 | mitochondrial tRNA methylation(GO:0070901) |
| 0.1 | 0.6 | GO:0042471 | ear morphogenesis(GO:0042471) inner ear morphogenesis(GO:0042472) |
| 0.1 | 0.5 | GO:0060356 | leucine import(GO:0060356) |
| 0.1 | 0.3 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
| 0.1 | 0.3 | GO:0070898 | RNA polymerase III transcriptional preinitiation complex assembly(GO:0070898) |
| 0.1 | 0.5 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.1 | 1.2 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.1 | 0.4 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.1 | 1.5 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.1 | 0.5 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.1 | 0.3 | GO:0018008 | N-terminal peptidyl-glycine N-myristoylation(GO:0018008) |
| 0.1 | 0.5 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.1 | 0.6 | GO:1902952 | positive regulation of dendritic spine maintenance(GO:1902952) |
| 0.1 | 2.2 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.1 | 0.4 | GO:1903436 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 0.1 | 0.7 | GO:0018022 | peptidyl-lysine methylation(GO:0018022) |
| 0.1 | 0.8 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.1 | 0.5 | GO:0071035 | nuclear ncRNA surveillance(GO:0071029) nuclear polyadenylation-dependent rRNA catabolic process(GO:0071035) nuclear polyadenylation-dependent ncRNA catabolic process(GO:0071046) |
| 0.1 | 0.9 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
| 0.1 | 0.5 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.1 | 0.5 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.1 | 1.1 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
| 0.1 | 0.9 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
| 0.1 | 0.4 | GO:0048205 | COPI-coated vesicle budding(GO:0035964) Golgi transport vesicle coating(GO:0048200) COPI coating of Golgi vesicle(GO:0048205) |
| 0.1 | 0.3 | GO:0036309 | protein localization to M-band(GO:0036309) regulation of SA node cell action potential(GO:0098907) |
| 0.1 | 0.6 | GO:0072180 | mesonephric duct morphogenesis(GO:0072180) |
| 0.1 | 0.8 | GO:0034625 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.1 | 1.1 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.1 | 0.5 | GO:0046504 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) ether biosynthetic process(GO:1901503) |
| 0.1 | 0.3 | GO:0048250 | mitochondrial iron ion transport(GO:0048250) |
| 0.1 | 0.3 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
| 0.1 | 1.6 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
| 0.1 | 0.4 | GO:1904896 | ESCRT complex disassembly(GO:1904896) ESCRT III complex disassembly(GO:1904903) |
| 0.1 | 0.2 | GO:0010621 | negative regulation of transcription by transcription factor localization(GO:0010621) |
| 0.1 | 0.4 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.1 | 0.3 | GO:0046707 | IDP metabolic process(GO:0046707) IDP catabolic process(GO:0046709) |
| 0.1 | 0.6 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.1 | 0.3 | GO:1904604 | regulation of connective tissue replacement involved in inflammatory response wound healing(GO:1904596) negative regulation of connective tissue replacement involved in inflammatory response wound healing(GO:1904597) regulation of advanced glycation end-product receptor activity(GO:1904603) negative regulation of advanced glycation end-product receptor activity(GO:1904604) negative regulation of connective tissue replacement(GO:1905204) |
| 0.1 | 1.2 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.1 | 4.0 | GO:1902475 | L-alpha-amino acid transmembrane transport(GO:1902475) |
| 0.1 | 0.7 | GO:1903764 | regulation of potassium ion export across plasma membrane(GO:1903764) |
| 0.1 | 0.3 | GO:0046203 | spermidine catabolic process(GO:0046203) |
| 0.1 | 0.3 | GO:1903348 | cellular response to lead ion(GO:0071284) positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.1 | 0.2 | GO:1902965 | regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 0.1 | 0.6 | GO:0070900 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
| 0.1 | 1.5 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
| 0.1 | 0.4 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.1 | 0.2 | GO:0006617 | SRP-dependent cotranslational protein targeting to membrane, signal sequence recognition(GO:0006617) |
| 0.1 | 0.2 | GO:0035065 | regulation of histone acetylation(GO:0035065) |
| 0.1 | 0.5 | GO:0097498 | endothelial tube lumen extension(GO:0097498) |
| 0.1 | 0.4 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
| 0.1 | 0.3 | GO:1904046 | negative regulation of vascular endothelial growth factor production(GO:1904046) |
| 0.1 | 1.3 | GO:0030043 | actin filament fragmentation(GO:0030043) |
| 0.1 | 0.9 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
| 0.1 | 0.7 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.1 | 0.3 | GO:0003409 | optic cup structural organization(GO:0003409) |
| 0.1 | 0.2 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.1 | 0.4 | GO:0042376 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.1 | 1.3 | GO:0010663 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.1 | 0.4 | GO:0051298 | centrosome duplication(GO:0051298) |
| 0.1 | 0.5 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.1 | 0.3 | GO:1903644 | regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.1 | 0.4 | GO:0007000 | nucleolus organization(GO:0007000) |
| 0.1 | 0.4 | GO:0006065 | UDP-glucuronate biosynthetic process(GO:0006065) |
| 0.1 | 0.6 | GO:1901098 | positive regulation of autophagosome maturation(GO:1901098) |
| 0.1 | 0.1 | GO:0061010 | cardiac cell fate determination(GO:0060913) gall bladder development(GO:0061010) |
| 0.1 | 0.4 | GO:0070885 | negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
| 0.1 | 0.4 | GO:0070071 | proton-transporting two-sector ATPase complex assembly(GO:0070071) |
| 0.1 | 0.2 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
| 0.1 | 0.1 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.1 | 0.4 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
| 0.1 | 0.9 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.1 | 0.2 | GO:1903542 | negative regulation of exosomal secretion(GO:1903542) |
| 0.1 | 7.1 | GO:0050911 | detection of chemical stimulus involved in sensory perception of smell(GO:0050911) |
| 0.1 | 0.1 | GO:1990481 | mRNA pseudouridine synthesis(GO:1990481) |
| 0.1 | 0.9 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
| 0.1 | 0.3 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
| 0.1 | 0.5 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.1 | 0.3 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.1 | 0.3 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.1 | 0.2 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
| 0.1 | 0.3 | GO:0042539 | hypotonic salinity response(GO:0042539) cellular hypotonic salinity response(GO:0071477) |
| 0.1 | 1.1 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.1 | 0.5 | GO:1902962 | regulation of metalloendopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902962) negative regulation of metalloendopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902963) |
| 0.1 | 0.4 | GO:0019348 | dolichol metabolic process(GO:0019348) |
| 0.1 | 0.4 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.1 | 1.8 | GO:0033622 | integrin activation(GO:0033622) |
| 0.1 | 0.7 | GO:0070561 | vitamin D receptor signaling pathway(GO:0070561) |
| 0.1 | 0.2 | GO:0044179 | hemolysis by symbiont of host erythrocytes(GO:0019836) hemolysis in other organism(GO:0044179) hemolysis in other organism involved in symbiotic interaction(GO:0052331) |
| 0.1 | 0.5 | GO:0010968 | regulation of microtubule nucleation(GO:0010968) |
| 0.1 | 0.2 | GO:0035281 | pre-miRNA export from nucleus(GO:0035281) |
| 0.1 | 0.2 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
| 0.1 | 0.2 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.1 | 0.3 | GO:0042418 | epinephrine metabolic process(GO:0042414) epinephrine biosynthetic process(GO:0042418) |
| 0.1 | 0.3 | GO:0007056 | spindle assembly involved in female meiosis(GO:0007056) |
| 0.1 | 0.5 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 | 0.3 | GO:0019918 | peptidyl-arginine methylation, to symmetrical-dimethyl arginine(GO:0019918) |
| 0.1 | 0.6 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
| 0.1 | 0.3 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
| 0.1 | 0.2 | GO:1902075 | cellular response to salt(GO:1902075) response to sodium arsenite(GO:1903935) cellular response to sodium arsenite(GO:1903936) |
| 0.1 | 0.1 | GO:0046512 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
| 0.1 | 0.1 | GO:1904815 | negative regulation of protein localization to chromosome, telomeric region(GO:1904815) |
| 0.1 | 0.3 | GO:0090324 | negative regulation of oxidative phosphorylation(GO:0090324) |
| 0.1 | 0.5 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.1 | 0.2 | GO:0046967 | cytosol to ER transport(GO:0046967) |
| 0.1 | 0.6 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
| 0.1 | 0.1 | GO:1904000 | positive regulation of eating behavior(GO:1904000) regulation of small intestine smooth muscle contraction(GO:1904347) positive regulation of small intestine smooth muscle contraction(GO:1904349) small intestine smooth muscle contraction(GO:1990770) |
| 0.1 | 0.3 | GO:2000273 | positive regulation of receptor activity(GO:2000273) |
| 0.1 | 2.2 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.1 | 0.2 | GO:0003164 | His-Purkinje system development(GO:0003164) |
| 0.1 | 0.2 | GO:0000960 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.1 | 6.8 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.1 | 0.8 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.1 | 0.3 | GO:0051594 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
| 0.1 | 0.5 | GO:0060017 | parathyroid gland development(GO:0060017) |
| 0.1 | 0.3 | GO:0007525 | somatic muscle development(GO:0007525) |
| 0.1 | 0.1 | GO:0034971 | histone H3-R17 methylation(GO:0034971) |
| 0.1 | 0.1 | GO:0015965 | diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
| 0.1 | 0.3 | GO:0090646 | mitochondrial tRNA processing(GO:0090646) |
| 0.1 | 0.3 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.1 | 0.3 | GO:0097384 | cellular lipid biosynthetic process(GO:0097384) |
| 0.1 | 0.1 | GO:0003162 | atrioventricular node development(GO:0003162) |
| 0.1 | 1.1 | GO:0016024 | CDP-diacylglycerol biosynthetic process(GO:0016024) |
| 0.1 | 0.3 | GO:0036506 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.1 | 0.8 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
| 0.1 | 0.5 | GO:0046604 | positive regulation of mitotic centrosome separation(GO:0046604) |
| 0.1 | 0.1 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
| 0.1 | 0.3 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
| 0.1 | 0.3 | GO:0051461 | positive regulation of corticotropin secretion(GO:0051461) |
| 0.1 | 0.3 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.1 | 0.3 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.1 | 0.1 | GO:0042369 | vitamin D catabolic process(GO:0042369) |
| 0.1 | 0.2 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.1 | 8.8 | GO:0045047 | protein targeting to ER(GO:0045047) establishment of protein localization to endoplasmic reticulum(GO:0072599) |
| 0.1 | 0.2 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.1 | 0.2 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
| 0.1 | 1.0 | GO:0090520 | sphingosine-1-phosphate signaling pathway(GO:0003376) sphingolipid mediated signaling pathway(GO:0090520) |
| 0.1 | 0.5 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.1 | 0.7 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.1 | 0.2 | GO:1902499 | positive regulation of protein autoubiquitination(GO:1902499) |
| 0.1 | 0.7 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.1 | 0.2 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
| 0.1 | 0.6 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.1 | 1.1 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.1 | 0.2 | GO:1900110 | negative regulation of histone H3-K9 dimethylation(GO:1900110) |
| 0.1 | 0.1 | GO:0061386 | closure of optic fissure(GO:0061386) |
| 0.1 | 0.6 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.1 | 0.8 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.1 | 0.3 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
| 0.1 | 0.3 | GO:0009635 | response to herbicide(GO:0009635) |
| 0.1 | 0.1 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.0 | 1.1 | GO:1901798 | positive regulation of signal transduction by p53 class mediator(GO:1901798) |
| 0.0 | 0.7 | GO:1902548 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) negative regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902548) |
| 0.0 | 0.9 | GO:0071481 | cellular response to X-ray(GO:0071481) |
| 0.0 | 0.6 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
| 0.0 | 0.0 | GO:0007096 | regulation of exit from mitosis(GO:0007096) exit from mitosis(GO:0010458) |
| 0.0 | 0.2 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.0 | 0.7 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.0 | 0.0 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
| 0.0 | 0.2 | GO:0065002 | intracellular protein transmembrane transport(GO:0065002) protein transmembrane transport(GO:0071806) |
| 0.0 | 0.0 | GO:1901091 | regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
| 0.0 | 0.1 | GO:0061537 | glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.0 | 0.4 | GO:0006857 | oligopeptide transport(GO:0006857) |
| 0.0 | 0.2 | GO:0035105 | sterol regulatory element binding protein import into nucleus(GO:0035105) |
| 0.0 | 0.3 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
| 0.0 | 0.4 | GO:0097116 | gephyrin clustering involved in postsynaptic density assembly(GO:0097116) |
| 0.0 | 0.4 | GO:0036089 | cleavage furrow formation(GO:0036089) |
| 0.0 | 0.0 | GO:0043622 | cortical microtubule organization(GO:0043622) |
| 0.0 | 0.1 | GO:0051029 | rRNA transport(GO:0051029) |
| 0.0 | 3.7 | GO:0006521 | regulation of cellular amino acid metabolic process(GO:0006521) |
| 0.0 | 0.4 | GO:0030091 | protein repair(GO:0030091) |
| 0.0 | 0.4 | GO:0009396 | folic acid-containing compound biosynthetic process(GO:0009396) |
| 0.0 | 0.3 | GO:0090070 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.0 | 0.8 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.0 | 0.7 | GO:0014041 | regulation of neuron maturation(GO:0014041) |
| 0.0 | 0.3 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.0 | 0.1 | GO:1905224 | clathrin-coated pit assembly(GO:1905224) |
| 0.0 | 0.2 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
| 0.0 | 0.1 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.0 | 0.3 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
| 0.0 | 0.4 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.0 | 0.2 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
| 0.0 | 0.1 | GO:0021986 | proprioception(GO:0019230) epithalamus development(GO:0021538) habenula development(GO:0021986) sensory system development(GO:0048880) |
| 0.0 | 0.8 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
| 0.0 | 0.1 | GO:0030505 | inorganic diphosphate transport(GO:0030505) |
| 0.0 | 0.3 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
| 0.0 | 0.0 | GO:0036342 | post-anal tail morphogenesis(GO:0036342) |
| 0.0 | 0.2 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.0 | 0.8 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
| 0.0 | 0.9 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.0 | 0.8 | GO:0043619 | regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
| 0.0 | 0.2 | GO:1903378 | positive regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903378) |
| 0.0 | 0.1 | GO:0009996 | negative regulation of cell fate specification(GO:0009996) |
| 0.0 | 0.1 | GO:0061743 | motor learning(GO:0061743) |
| 0.0 | 0.4 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
| 0.0 | 0.1 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 0.0 | 0.3 | GO:1905049 | negative regulation of metallopeptidase activity(GO:1905049) |
| 0.0 | 0.5 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
| 0.0 | 0.6 | GO:0048703 | embryonic viscerocranium morphogenesis(GO:0048703) |
| 0.0 | 0.1 | GO:0071422 | succinate transport(GO:0015744) succinate transmembrane transport(GO:0071422) |
| 0.0 | 0.4 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.0 | 0.8 | GO:0009650 | UV protection(GO:0009650) |
| 0.0 | 0.8 | GO:0051290 | protein heterotetramerization(GO:0051290) |
| 0.0 | 0.3 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
| 0.0 | 0.2 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.0 | 0.3 | GO:0032933 | SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
| 0.0 | 0.4 | GO:0046549 | retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
| 0.0 | 0.1 | GO:0061724 | lipophagy(GO:0061724) |
| 0.0 | 0.4 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
| 0.0 | 0.4 | GO:1904715 | negative regulation of chaperone-mediated autophagy(GO:1904715) |
| 0.0 | 1.0 | GO:0007141 | male meiosis I(GO:0007141) |
| 0.0 | 0.1 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
| 0.0 | 0.3 | GO:0051182 | coenzyme transport(GO:0051182) |
| 0.0 | 0.2 | GO:1905040 | vestibulocochlear nerve structural organization(GO:0021649) cerebral cortex tangential migration using cell-axon interactions(GO:0021824) gonadotrophin-releasing hormone neuronal migration to the hypothalamus(GO:0021828) hypothalamic tangential migration using cell-axon interactions(GO:0021856) hypothalamus gonadotrophin-releasing hormone neuron differentiation(GO:0021886) hypothalamus gonadotrophin-releasing hormone neuron development(GO:0021888) neuropilin signaling pathway(GO:0038189) VEGF-activated neuropilin signaling pathway(GO:0038190) positive regulation of cytokine activity(GO:0060301) ganglion morphogenesis(GO:0061552) endothelial tip cell fate specification(GO:0097102) sensory neuron axon guidance(GO:0097374) positive regulation of retinal ganglion cell axon guidance(GO:1902336) VEGF-activated neuropilin signaling pathway involved in axon guidance(GO:1902378) facioacoustic ganglion development(GO:1903375) dorsal root ganglion morphogenesis(GO:1904835) otic placode development(GO:1905040) |
| 0.0 | 0.1 | GO:0090291 | negative regulation of osteoclast proliferation(GO:0090291) |
| 0.0 | 0.3 | GO:0070914 | UV-damage excision repair(GO:0070914) |
| 0.0 | 1.6 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
| 0.0 | 0.1 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.0 | 0.4 | GO:0030210 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.0 | 0.2 | GO:0071651 | positive regulation of chemokine (C-C motif) ligand 5 production(GO:0071651) |
| 0.0 | 0.6 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
| 0.0 | 0.1 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.0 | 0.2 | GO:0001776 | leukocyte homeostasis(GO:0001776) lymphocyte homeostasis(GO:0002260) |
| 0.0 | 0.4 | GO:0048845 | venous blood vessel morphogenesis(GO:0048845) |
| 0.0 | 0.5 | GO:0099638 | endosome to plasma membrane protein transport(GO:0099638) |
| 0.0 | 0.1 | GO:0009235 | cobalamin metabolic process(GO:0009235) tetrapyrrole metabolic process(GO:0033013) |
| 0.0 | 0.1 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) Golgi to plasma membrane CFTR protein transport(GO:0043000) |
| 0.0 | 0.1 | GO:1902396 | protein localization to bicellular tight junction(GO:1902396) |
| 0.0 | 0.1 | GO:0006423 | cysteinyl-tRNA aminoacylation(GO:0006423) |
| 0.0 | 0.3 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
| 0.0 | 0.1 | GO:1903691 | positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
| 0.0 | 0.2 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.0 | 0.3 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.0 | 0.1 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
| 0.0 | 0.3 | GO:0045599 | negative regulation of fat cell differentiation(GO:0045599) |
| 0.0 | 1.3 | GO:0005980 | glycogen catabolic process(GO:0005980) |
| 0.0 | 0.2 | GO:0071526 | semaphorin-plexin signaling pathway(GO:0071526) |
| 0.0 | 0.2 | GO:0061737 | leukotriene signaling pathway(GO:0061737) |
| 0.0 | 0.7 | GO:0006907 | pinocytosis(GO:0006907) |
| 0.0 | 0.2 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.0 | 0.1 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
| 0.0 | 0.2 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
| 0.0 | 0.0 | GO:0046668 | regulation of retinal cell programmed cell death(GO:0046668) |
| 0.0 | 0.2 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
| 0.0 | 0.2 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 | 0.2 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.0 | 0.2 | GO:0033686 | oocyte growth(GO:0001555) extraocular skeletal muscle development(GO:0002074) positive regulation of luteinizing hormone secretion(GO:0033686) |
| 0.0 | 0.0 | GO:0048147 | negative regulation of fibroblast proliferation(GO:0048147) |
| 0.0 | 0.0 | GO:0031990 | mRNA export from nucleus in response to heat stress(GO:0031990) |
| 0.0 | 0.2 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
| 0.0 | 0.5 | GO:0034162 | toll-like receptor 9 signaling pathway(GO:0034162) |
| 0.0 | 0.5 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.0 | 0.1 | GO:0048867 | ganglion mother cell fate determination(GO:0007402) stem cell fate determination(GO:0048867) |
| 0.0 | 0.2 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.0 | 0.2 | GO:0060770 | regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.0 | 0.3 | GO:0042904 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.0 | 0.1 | GO:0006694 | steroid biosynthetic process(GO:0006694) |
| 0.0 | 0.9 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.0 | 0.0 | GO:1904562 | phosphatidylinositol 5-phosphate metabolic process(GO:1904562) |
| 0.0 | 0.1 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.0 | 0.1 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
| 0.0 | 1.3 | GO:0045841 | negative regulation of mitotic metaphase/anaphase transition(GO:0045841) |
| 0.0 | 0.1 | GO:0007343 | egg activation(GO:0007343) |
| 0.0 | 0.3 | GO:0007088 | regulation of mitotic nuclear division(GO:0007088) |
| 0.0 | 2.1 | GO:0030049 | muscle filament sliding(GO:0030049) actin-myosin filament sliding(GO:0033275) |
| 0.0 | 0.1 | GO:0021586 | pons maturation(GO:0021586) superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
| 0.0 | 0.7 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.0 | 0.8 | GO:0071542 | dopaminergic neuron differentiation(GO:0071542) |
| 0.0 | 0.1 | GO:0009236 | cobalamin biosynthetic process(GO:0009236) |
| 0.0 | 0.5 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
| 0.0 | 0.1 | GO:0019249 | lactate biosynthetic process(GO:0019249) |
| 0.0 | 0.1 | GO:0007538 | primary sex determination(GO:0007538) |
| 0.0 | 0.1 | GO:1900112 | regulation of histone H3-K9 trimethylation(GO:1900112) |
| 0.0 | 0.4 | GO:0048243 | norepinephrine secretion(GO:0048243) |
| 0.0 | 0.2 | GO:0036343 | psychomotor behavior(GO:0036343) |
| 0.0 | 0.1 | GO:0046166 | glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 0.0 | 0.2 | GO:0071105 | response to interleukin-11(GO:0071105) |
| 0.0 | 0.4 | GO:0043320 | natural killer cell degranulation(GO:0043320) |
| 0.0 | 0.7 | GO:1990001 | inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.0 | 0.1 | GO:0010716 | negative regulation of extracellular matrix disassembly(GO:0010716) melanocyte proliferation(GO:0097325) |
| 0.0 | 0.2 | GO:2000535 | regulation of entry of bacterium into host cell(GO:2000535) |
| 0.0 | 0.3 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.0 | 0.3 | GO:0048663 | neuron fate commitment(GO:0048663) |
| 0.0 | 0.2 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
| 0.0 | 0.4 | GO:0098703 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
| 0.0 | 0.0 | GO:0046016 | positive regulation of transcription by glucose(GO:0046016) |
| 0.0 | 0.4 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.0 | 0.6 | GO:0006704 | glucocorticoid biosynthetic process(GO:0006704) |
| 0.0 | 0.1 | GO:1901978 | positive regulation of cell cycle checkpoint(GO:1901978) |
| 0.0 | 0.2 | GO:2000418 | regulation of eosinophil migration(GO:2000416) positive regulation of eosinophil migration(GO:2000418) |
| 0.0 | 0.2 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
| 0.0 | 0.1 | GO:0006433 | prolyl-tRNA aminoacylation(GO:0006433) |
| 0.0 | 0.2 | GO:0048262 | determination of dorsal/ventral asymmetry(GO:0048262) |
| 0.0 | 0.3 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
| 0.0 | 0.1 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.0 | 0.1 | GO:1900737 | negative regulation of phospholipase C activity(GO:1900275) regulation of proteinase activated receptor activity(GO:1900276) negative regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900737) |
| 0.0 | 0.5 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
| 0.0 | 0.1 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.0 | 0.3 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
| 0.0 | 0.4 | GO:0042330 | chemotaxis(GO:0006935) taxis(GO:0042330) |
| 0.0 | 0.3 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.0 | 0.1 | GO:2000662 | interleukin-5 secretion(GO:0072603) regulation of interleukin-5 secretion(GO:2000662) |
| 0.0 | 0.6 | GO:0044030 | regulation of DNA methylation(GO:0044030) |
| 0.0 | 0.1 | GO:0035897 | proteolysis in other organism(GO:0035897) |
| 0.0 | 0.9 | GO:1903861 | regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
| 0.0 | 0.2 | GO:0001878 | response to yeast(GO:0001878) |
| 0.0 | 0.5 | GO:0038202 | TORC1 signaling(GO:0038202) |
| 0.0 | 0.3 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.0 | 0.3 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
| 0.0 | 0.2 | GO:0002230 | positive regulation of defense response to virus by host(GO:0002230) |
| 0.0 | 0.6 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
| 0.0 | 0.4 | GO:0032463 | negative regulation of protein homooligomerization(GO:0032463) |
| 0.0 | 0.4 | GO:0018214 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.0 | 1.0 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.0 | 0.2 | GO:0030521 | androgen receptor signaling pathway(GO:0030521) |
| 0.0 | 0.3 | GO:0003215 | cardiac right ventricle morphogenesis(GO:0003215) |
| 0.0 | 0.3 | GO:0055092 | cholesterol homeostasis(GO:0042632) sterol homeostasis(GO:0055092) |
| 0.0 | 0.5 | GO:0002717 | positive regulation of natural killer cell mediated immunity(GO:0002717) |
| 0.0 | 0.2 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.0 | 0.1 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
| 0.0 | 0.4 | GO:0034656 | nucleobase-containing small molecule catabolic process(GO:0034656) |
| 0.0 | 0.1 | GO:0032661 | regulation of interleukin-18 production(GO:0032661) |
| 0.0 | 0.1 | GO:0060022 | hard palate development(GO:0060022) |
| 0.0 | 0.3 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.0 | 0.3 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 0.0 | 0.1 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.0 | 0.2 | GO:0003025 | regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
| 0.0 | 0.3 | GO:0000338 | protein deneddylation(GO:0000338) |
| 0.0 | 0.1 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 0.0 | 0.3 | GO:0006782 | protoporphyrinogen IX biosynthetic process(GO:0006782) |
| 0.0 | 2.1 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
| 0.0 | 0.2 | GO:0002052 | positive regulation of neuroblast proliferation(GO:0002052) |
| 0.0 | 0.3 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.0 | 0.7 | GO:0001755 | neural crest cell migration(GO:0001755) |
| 0.0 | 0.6 | GO:0045737 | positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
| 0.0 | 0.3 | GO:0030220 | platelet formation(GO:0030220) |
| 0.0 | 0.4 | GO:1900363 | regulation of mRNA polyadenylation(GO:1900363) |
| 0.0 | 0.1 | GO:0038042 | dimeric G-protein coupled receptor signaling pathway(GO:0038042) |
| 0.0 | 0.3 | GO:0020027 | hemoglobin metabolic process(GO:0020027) |
| 0.0 | 0.3 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.0 | 1.0 | GO:0006363 | transcription initiation from RNA polymerase I promoter(GO:0006361) transcription elongation from RNA polymerase I promoter(GO:0006362) termination of RNA polymerase I transcription(GO:0006363) |
| 0.0 | 0.2 | GO:0031061 | negative regulation of histone methylation(GO:0031061) |
| 0.0 | 0.1 | GO:1901162 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
| 0.0 | 2.9 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
| 0.0 | 0.3 | GO:0032495 | response to muramyl dipeptide(GO:0032495) |
| 0.0 | 1.2 | GO:0010507 | negative regulation of autophagy(GO:0010507) |
| 0.0 | 0.2 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
| 0.0 | 0.3 | GO:0036109 | alpha-linolenic acid metabolic process(GO:0036109) |
| 0.0 | 0.2 | GO:0010259 | multicellular organism aging(GO:0010259) |
| 0.0 | 0.3 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.0 | 0.1 | GO:0006919 | activation of cysteine-type endopeptidase activity involved in apoptotic process(GO:0006919) |
| 0.0 | 0.3 | GO:0006970 | response to osmotic stress(GO:0006970) |
| 0.0 | 0.2 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.0 | 0.7 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
| 0.0 | 1.1 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 | 0.5 | GO:0007520 | myoblast fusion(GO:0007520) |
| 0.0 | 0.1 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.0 | 0.1 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
| 0.0 | 0.0 | GO:0036023 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
| 0.0 | 0.1 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.0 | 0.2 | GO:1904869 | regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) |
| 0.0 | 0.2 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.0 | 0.4 | GO:0045332 | phospholipid translocation(GO:0045332) |
| 0.0 | 0.1 | GO:0050703 | interleukin-1 alpha secretion(GO:0050703) |
| 0.0 | 0.5 | GO:0006337 | nucleosome disassembly(GO:0006337) |
| 0.0 | 0.1 | GO:0038110 | interleukin-2-mediated signaling pathway(GO:0038110) |
| 0.0 | 0.1 | GO:0019477 | L-lysine catabolic process to acetyl-CoA(GO:0019474) L-lysine catabolic process(GO:0019477) L-lysine metabolic process(GO:0046440) |
| 0.0 | 0.2 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.0 | 0.6 | GO:0032094 | response to food(GO:0032094) |
| 0.0 | 0.8 | GO:1903959 | regulation of anion transmembrane transport(GO:1903959) |
| 0.0 | 0.2 | GO:1905146 | lysosomal protein catabolic process(GO:1905146) |
| 0.0 | 0.2 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.0 | 0.5 | GO:0050435 | beta-amyloid metabolic process(GO:0050435) |
| 0.0 | 0.2 | GO:0015889 | cobalamin transport(GO:0015889) |
| 0.0 | 0.1 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
| 0.0 | 0.2 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 0.0 | 0.4 | GO:0070423 | nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) |
| 0.0 | 0.5 | GO:0022400 | regulation of rhodopsin mediated signaling pathway(GO:0022400) |
| 0.0 | 0.5 | GO:0000281 | mitotic cytokinesis(GO:0000281) |
| 0.0 | 0.0 | GO:0008216 | spermidine metabolic process(GO:0008216) |
| 0.0 | 0.3 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
| 0.0 | 0.9 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.0 | 0.4 | GO:0050908 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.0 | 0.1 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
| 0.0 | 0.1 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.0 | 0.1 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.0 | 0.1 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.0 | 0.4 | GO:0010880 | regulation of release of sequestered calcium ion into cytosol by sarcoplasmic reticulum(GO:0010880) |
| 0.0 | 0.1 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.0 | 0.0 | GO:0032627 | interleukin-23 production(GO:0032627) regulation of interleukin-23 production(GO:0032667) |
| 0.0 | 0.6 | GO:0010863 | positive regulation of phospholipase C activity(GO:0010863) regulation of phospholipase C activity(GO:1900274) |
| 0.0 | 0.5 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
| 0.0 | 0.3 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.0 | 0.1 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.0 | 0.2 | GO:0043587 | tongue morphogenesis(GO:0043587) |
| 0.0 | 0.2 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.0 | 1.9 | GO:0006939 | smooth muscle contraction(GO:0006939) |
| 0.0 | 0.1 | GO:0061734 | parkin-mediated mitophagy in response to mitochondrial depolarization(GO:0061734) |
| 0.0 | 0.3 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.0 | 0.2 | GO:0030575 | nuclear body organization(GO:0030575) |
| 0.0 | 0.6 | GO:0032570 | response to progesterone(GO:0032570) |
| 0.0 | 0.3 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.0 | 0.6 | GO:0032456 | endocytic recycling(GO:0032456) |
| 0.0 | 1.2 | GO:0046847 | filopodium assembly(GO:0046847) |
| 0.0 | 0.3 | GO:0071800 | podosome assembly(GO:0071800) |
| 0.0 | 0.1 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.0 | 0.1 | GO:0022038 | corpus callosum development(GO:0022038) |
| 0.0 | 0.3 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.0 | 1.0 | GO:0006027 | glycosaminoglycan catabolic process(GO:0006027) |
| 0.0 | 0.0 | GO:0000294 | nuclear-transcribed mRNA catabolic process, endonucleolytic cleavage-dependent decay(GO:0000294) |
| 0.0 | 0.1 | GO:0006449 | regulation of translational termination(GO:0006449) |
| 0.0 | 0.7 | GO:0007032 | endosome organization(GO:0007032) |
| 0.0 | 0.0 | GO:1990822 | basic amino acid transmembrane transport(GO:1990822) |
| 0.0 | 0.2 | GO:2000637 | positive regulation of posttranscriptional gene silencing(GO:0060148) positive regulation of gene silencing by miRNA(GO:2000637) |
| 0.0 | 0.1 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.0 | 0.2 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) acetylcholine receptor signaling pathway(GO:0095500) postsynaptic signal transduction(GO:0098926) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
| 0.0 | 0.1 | GO:0060008 | Sertoli cell differentiation(GO:0060008) |
| 0.0 | 0.2 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
| 0.0 | 0.1 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.0 | 0.2 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.0 | 0.1 | GO:1900084 | regulation of peptidyl-tyrosine autophosphorylation(GO:1900084) positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
| 0.0 | 0.3 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
| 0.0 | 0.2 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.0 | 0.2 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.0 | 0.1 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.0 | 0.2 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
| 0.0 | 0.2 | GO:0002323 | natural killer cell activation involved in immune response(GO:0002323) |
| 0.0 | 0.2 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.0 | 0.2 | GO:0051798 | positive regulation of hair follicle development(GO:0051798) |
| 0.0 | 0.1 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
| 0.0 | 0.1 | GO:0042177 | negative regulation of protein catabolic process(GO:0042177) |
| 0.0 | 0.1 | GO:0006789 | bilirubin conjugation(GO:0006789) |
| 0.0 | 1.1 | GO:0045071 | negative regulation of viral genome replication(GO:0045071) |
| 0.0 | 0.8 | GO:0070671 | response to interleukin-12(GO:0070671) |
| 0.0 | 0.3 | GO:0030299 | intestinal cholesterol absorption(GO:0030299) intestinal lipid absorption(GO:0098856) |
| 0.0 | 0.1 | GO:0043171 | peptide catabolic process(GO:0043171) |
| 0.0 | 0.1 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.0 | 0.0 | GO:0045897 | positive regulation of transcription during mitosis(GO:0045897) |
| 0.0 | 0.2 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.0 | 0.1 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
| 0.0 | 0.1 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
| 0.0 | 0.1 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
| 0.0 | 0.1 | GO:0015732 | prostaglandin transport(GO:0015732) |
| 0.0 | 0.3 | GO:0019228 | neuronal action potential(GO:0019228) |
| 0.0 | 1.1 | GO:0006901 | vesicle coating(GO:0006901) vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
| 0.0 | 0.1 | GO:0016074 | snoRNA metabolic process(GO:0016074) snoRNA processing(GO:0043144) |
| 0.0 | 0.4 | GO:0036065 | fucosylation(GO:0036065) |
| 0.0 | 0.3 | GO:0055072 | iron ion homeostasis(GO:0055072) |
| 0.0 | 0.1 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
| 0.0 | 0.2 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
| 0.0 | 0.2 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.0 | 3.4 | GO:0000209 | protein polyubiquitination(GO:0000209) |
| 0.0 | 0.8 | GO:0036498 | IRE1-mediated unfolded protein response(GO:0036498) |
| 0.0 | 0.0 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
| 0.0 | 0.1 | GO:0009583 | detection of light stimulus(GO:0009583) |
| 0.0 | 0.1 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
| 0.0 | 0.2 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.0 | 0.1 | GO:0021987 | cerebral cortex development(GO:0021987) |
| 0.0 | 0.1 | GO:0045793 | positive regulation of cell size(GO:0045793) |
| 0.0 | 0.0 | GO:0089700 | protein kinase D signaling(GO:0089700) |
| 0.0 | 0.2 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.0 | 0.1 | GO:0007008 | outer mitochondrial membrane organization(GO:0007008) protein import into mitochondrial outer membrane(GO:0045040) |
| 0.0 | 0.1 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
| 0.0 | 0.3 | GO:0046627 | negative regulation of insulin receptor signaling pathway(GO:0046627) |
| 0.0 | 0.2 | GO:0070193 | synaptonemal complex assembly(GO:0007130) synaptonemal complex organization(GO:0070193) |
| 0.0 | 0.1 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
| 0.0 | 0.4 | GO:2000177 | regulation of neural precursor cell proliferation(GO:2000177) |
| 0.0 | 0.0 | GO:0016556 | mRNA modification(GO:0016556) mRNA methylation(GO:0080009) |
| 0.0 | 0.2 | GO:0042255 | ribosome assembly(GO:0042255) |
| 0.0 | 0.1 | GO:0051354 | negative regulation of oxidoreductase activity(GO:0051354) |
| 0.0 | 0.2 | GO:0014047 | glutamate secretion(GO:0014047) |
| 0.0 | 0.4 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
| 0.0 | 0.4 | GO:0035418 | protein localization to synapse(GO:0035418) |
| 0.0 | 0.1 | GO:0045732 | positive regulation of protein catabolic process(GO:0045732) |
| 0.0 | 0.2 | GO:0042462 | eye photoreceptor cell development(GO:0042462) |
| 0.0 | 0.2 | GO:0071450 | cellular response to oxygen radical(GO:0071450) cellular response to superoxide(GO:0071451) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.0 | 3.0 | GO:0070762 | nuclear pore transmembrane ring(GO:0070762) |
| 0.6 | 1.9 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.5 | 4.2 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.4 | 1.7 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.4 | 7.7 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 0.4 | 1.2 | GO:0043512 | inhibin complex(GO:0043511) inhibin A complex(GO:0043512) |
| 0.4 | 2.5 | GO:0097209 | epidermal lamellar body(GO:0097209) |
| 0.3 | 1.4 | GO:0097442 | CA3 pyramidal cell dendrite(GO:0097442) |
| 0.3 | 2.5 | GO:0035976 | AP1 complex(GO:0035976) |
| 0.3 | 2.7 | GO:0005638 | lamin filament(GO:0005638) |
| 0.3 | 1.7 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.3 | 0.8 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
| 0.3 | 2.0 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.3 | 1.3 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.3 | 1.0 | GO:0005694 | chromosome(GO:0005694) |
| 0.3 | 1.3 | GO:0071458 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) |
| 0.2 | 0.7 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.2 | 0.7 | GO:0034676 | integrin alpha6-beta4 complex(GO:0034676) |
| 0.2 | 2.3 | GO:0000796 | condensin complex(GO:0000796) |
| 0.2 | 0.7 | GO:0005873 | plus-end kinesin complex(GO:0005873) |
| 0.2 | 1.8 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.2 | 1.1 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.2 | 3.1 | GO:0019774 | proteasome core complex, beta-subunit complex(GO:0019774) |
| 0.2 | 0.2 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.2 | 1.3 | GO:0033503 | HULC complex(GO:0033503) |
| 0.2 | 1.4 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.2 | 0.7 | GO:1990423 | RZZ complex(GO:1990423) |
| 0.2 | 0.4 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.2 | 2.6 | GO:0042555 | MCM complex(GO:0042555) |
| 0.2 | 0.5 | GO:0000806 | Y chromosome(GO:0000806) |
| 0.2 | 0.9 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.1 | 0.9 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 0.1 | 1.3 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 0.1 | 0.4 | GO:0016938 | kinesin I complex(GO:0016938) |
| 0.1 | 1.4 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.1 | 0.7 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.1 | 0.8 | GO:0030678 | mitochondrial ribonuclease P complex(GO:0030678) |
| 0.1 | 1.0 | GO:0097165 | nuclear stress granule(GO:0097165) |
| 0.1 | 0.8 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.1 | 1.8 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.1 | 1.3 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.1 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.1 | 0.4 | GO:1903349 | omegasome membrane(GO:1903349) |
| 0.1 | 1.4 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.1 | 0.3 | GO:0000126 | transcription factor TFIIIB complex(GO:0000126) |
| 0.1 | 0.2 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.1 | 1.4 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.1 | 1.0 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.1 | 1.5 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.1 | 0.7 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.1 | 0.7 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.1 | 3.1 | GO:0033202 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 0.1 | 1.2 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.1 | 0.7 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.1 | 0.7 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.1 | 0.3 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.1 | 0.4 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.1 | 1.4 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.1 | 0.2 | GO:0070939 | Dsl1p complex(GO:0070939) |
| 0.1 | 0.3 | GO:0031417 | NatC complex(GO:0031417) |
| 0.1 | 0.8 | GO:0016012 | sarcoglycan complex(GO:0016012) |
| 0.1 | 0.3 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.1 | 0.3 | GO:0000839 | Hrd1p ubiquitin ligase ERAD-L complex(GO:0000839) |
| 0.1 | 1.1 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
| 0.1 | 0.3 | GO:0045160 | myosin I complex(GO:0045160) |
| 0.1 | 3.1 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.1 | 0.4 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.1 | 0.4 | GO:0035370 | UBC13-UEV1A complex(GO:0035370) |
| 0.1 | 0.3 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.1 | 0.5 | GO:0070381 | endosome to plasma membrane transport vesicle(GO:0070381) |
| 0.1 | 5.5 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.1 | 1.7 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.1 | 0.5 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
| 0.1 | 0.7 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
| 0.1 | 0.6 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.1 | 0.3 | GO:0070985 | TFIIK complex(GO:0070985) |
| 0.1 | 0.3 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
| 0.1 | 0.6 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.1 | 1.5 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.1 | 0.5 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.1 | 0.4 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.1 | 0.2 | GO:0002945 | cyclin K-CDK13 complex(GO:0002945) |
| 0.1 | 1.8 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.1 | 0.8 | GO:0043219 | lateral loop(GO:0043219) |
| 0.1 | 0.1 | GO:0071004 | commitment complex(GO:0000243) U2-type prespliceosome(GO:0071004) |
| 0.1 | 0.3 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
| 0.1 | 1.3 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
| 0.1 | 1.2 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
| 0.1 | 0.3 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.1 | 0.6 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.1 | 0.3 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
| 0.1 | 0.5 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.1 | 0.4 | GO:0005854 | nascent polypeptide-associated complex(GO:0005854) |
| 0.1 | 1.1 | GO:0034709 | methylosome(GO:0034709) |
| 0.1 | 0.1 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
| 0.1 | 0.6 | GO:0030478 | actin cap(GO:0030478) |
| 0.1 | 0.3 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.1 | 2.6 | GO:0031941 | filamentous actin(GO:0031941) |
| 0.1 | 0.6 | GO:0032059 | bleb(GO:0032059) |
| 0.1 | 0.4 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.1 | 0.7 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.1 | 5.0 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
| 0.1 | 0.3 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
| 0.1 | 0.7 | GO:0005589 | collagen type VI trimer(GO:0005589) collagen beaded filament(GO:0098647) |
| 0.1 | 0.7 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.1 | 0.1 | GO:0044301 | climbing fiber(GO:0044301) |
| 0.0 | 2.1 | GO:0015629 | actin cytoskeleton(GO:0015629) |
| 0.0 | 2.0 | GO:0005761 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
| 0.0 | 0.5 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.0 | 1.2 | GO:0043205 | microfibril(GO:0001527) fibril(GO:0043205) |
| 0.0 | 0.1 | GO:0071159 | NF-kappaB complex(GO:0071159) |
| 0.0 | 0.7 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.0 | 0.1 | GO:0072589 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) box H/ACA scaRNP complex(GO:0072589) box H/ACA telomerase RNP complex(GO:0090661) |
| 0.0 | 0.3 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
| 0.0 | 0.8 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.0 | 0.2 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
| 0.0 | 0.4 | GO:0098845 | postsynaptic endosome(GO:0098845) |
| 0.0 | 0.8 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.0 | 0.4 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.0 | 4.9 | GO:0015934 | large ribosomal subunit(GO:0015934) |
| 0.0 | 0.6 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.0 | 1.0 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.0 | 0.4 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
| 0.0 | 0.8 | GO:0030424 | axon(GO:0030424) |
| 0.0 | 0.6 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.0 | 0.2 | GO:0089701 | U2AF(GO:0089701) |
| 0.0 | 0.4 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
| 0.0 | 0.4 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.0 | 3.0 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.0 | 2.5 | GO:0002102 | podosome(GO:0002102) |
| 0.0 | 0.2 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.0 | 0.5 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.0 | 0.3 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.0 | 0.3 | GO:0031415 | NatA complex(GO:0031415) |
| 0.0 | 0.4 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.0 | 0.4 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.0 | 0.1 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.0 | 0.2 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.0 | 0.4 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) |
| 0.0 | 2.3 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.0 | 0.4 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.0 | 0.5 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.0 | 0.3 | GO:0005911 | cell-cell junction(GO:0005911) |
| 0.0 | 0.1 | GO:0038038 | G-protein coupled receptor homodimeric complex(GO:0038038) |
| 0.0 | 0.6 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.0 | 0.3 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.0 | 0.5 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.0 | 0.3 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.0 | 0.3 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.0 | 3.0 | GO:0043195 | terminal bouton(GO:0043195) |
| 0.0 | 0.1 | GO:0032044 | DSIF complex(GO:0032044) |
| 0.0 | 0.2 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.0 | 0.1 | GO:0071203 | WASH complex(GO:0071203) |
| 0.0 | 0.1 | GO:0042721 | mitochondrial inner membrane protein insertion complex(GO:0042721) |
| 0.0 | 0.1 | GO:0036398 | TCR signalosome(GO:0036398) |
| 0.0 | 0.3 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.0 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
| 0.0 | 0.5 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.0 | 0.1 | GO:0098536 | deuterosome(GO:0098536) |
| 0.0 | 0.3 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.0 | 0.1 | GO:0072517 | viral factory(GO:0039713) cytoplasmic viral factory(GO:0039714) host cell viral assembly compartment(GO:0072517) |
| 0.0 | 0.7 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.0 | 0.3 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.0 | 0.2 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.0 | 0.5 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 1.2 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.0 | 0.6 | GO:0031105 | septin complex(GO:0031105) |
| 0.0 | 0.3 | GO:0005883 | neurofilament(GO:0005883) |
| 0.0 | 0.2 | GO:0051286 | cell tip(GO:0051286) |
| 0.0 | 0.1 | GO:0030663 | COPI-coated vesicle membrane(GO:0030663) |
| 0.0 | 0.2 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.0 | 0.2 | GO:0014802 | terminal cisterna(GO:0014802) |
| 0.0 | 1.8 | GO:0001725 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
| 0.0 | 0.0 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.0 | 0.1 | GO:0033011 | perinuclear theca(GO:0033011) |
| 0.0 | 0.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.0 | 0.1 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.0 | 0.2 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.0 | 0.3 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 0.0 | 0.1 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
| 0.0 | 0.2 | GO:0042589 | zymogen granule membrane(GO:0042589) |
| 0.0 | 0.0 | GO:0045272 | plasma membrane respiratory chain complex I(GO:0045272) |
| 0.0 | 0.4 | GO:0005840 | ribosome(GO:0005840) |
| 0.0 | 0.6 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.0 | 0.2 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.0 | 0.1 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.0 | 2.8 | GO:0030666 | endocytic vesicle membrane(GO:0030666) |
| 0.0 | 0.3 | GO:0097346 | INO80-type complex(GO:0097346) |
| 0.0 | 0.2 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.0 | 0.2 | GO:0030897 | HOPS complex(GO:0030897) |
| 0.0 | 0.2 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.0 | 0.4 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 0.3 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.0 | 0.2 | GO:0072686 | mitotic spindle(GO:0072686) |
| 0.0 | 1.2 | GO:0001533 | cornified envelope(GO:0001533) |
| 0.0 | 0.4 | GO:0046930 | pore complex(GO:0046930) |
| 0.0 | 1.0 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
| 0.0 | 1.3 | GO:0005884 | actin filament(GO:0005884) |
| 0.0 | 0.2 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.0 | 0.1 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.0 | 0.4 | GO:0010369 | chromocenter(GO:0010369) |
| 0.0 | 0.1 | GO:0034685 | integrin alphav-beta6 complex(GO:0034685) integrin alphav-beta8 complex(GO:0034686) |
| 0.0 | 0.2 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.0 | 0.2 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.0 | 0.4 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
| 0.0 | 0.3 | GO:0030686 | 90S preribosome(GO:0030686) |
| 0.0 | 0.3 | GO:0090545 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.0 | 0.1 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.0 | 0.3 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.0 | 0.1 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.0 | 0.2 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.0 | 0.0 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
| 0.0 | 2.4 | GO:0044798 | nuclear transcription factor complex(GO:0044798) |
| 0.0 | 0.2 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 0.3 | GO:0098827 | endoplasmic reticulum tubular network(GO:0071782) endoplasmic reticulum subcompartment(GO:0098827) |
| 0.0 | 0.2 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.0 | 0.1 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 0.1 | GO:0071438 | invadopodium membrane(GO:0071438) |
| 0.0 | 0.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.0 | 2.0 | GO:0005882 | intermediate filament(GO:0005882) |
| 0.0 | 0.3 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.0 | 0.1 | GO:0032806 | carboxy-terminal domain protein kinase complex(GO:0032806) |
| 0.0 | 0.1 | GO:1903440 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
| 0.0 | 0.2 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.0 | 0.5 | GO:0000922 | spindle pole(GO:0000922) |
| 0.0 | 0.8 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.0 | 0.9 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.0 | 4.6 | GO:0045121 | membrane raft(GO:0045121) membrane microdomain(GO:0098857) |
| 0.0 | 0.1 | GO:0030057 | desmosome(GO:0030057) |
| 0.0 | 2.2 | GO:0043197 | dendritic spine(GO:0043197) |
| 0.0 | 0.4 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.0 | 0.1 | GO:0032021 | NELF complex(GO:0032021) |
| 0.0 | 0.6 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.0 | 0.3 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.0 | 0.4 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.0 | 0.1 | GO:0097433 | dense body(GO:0097433) |
| 0.0 | 0.3 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.0 | 0.1 | GO:0043005 | neuron projection(GO:0043005) |
| 0.0 | 0.1 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.0 | 0.0 | GO:0005684 | U2-type spliceosomal complex(GO:0005684) |
| 0.0 | 0.0 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.0 | 0.7 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.0 | 0.0 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.0 | 0.1 | GO:0005602 | complement component C1 complex(GO:0005602) |
| 0.0 | 0.4 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 0.1 | GO:0016589 | NURF complex(GO:0016589) |
| 0.0 | 0.7 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
| 0.0 | 2.5 | GO:0005938 | cell cortex(GO:0005938) |
| 0.0 | 0.2 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 2.0 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
| 0.4 | 2.0 | GO:0032810 | sterol response element binding(GO:0032810) |
| 0.4 | 1.1 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
| 0.3 | 1.0 | GO:0004821 | histidine-tRNA ligase activity(GO:0004821) |
| 0.3 | 0.9 | GO:0070699 | type II activin receptor binding(GO:0070699) |
| 0.3 | 0.9 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.3 | 1.0 | GO:0050211 | procollagen galactosyltransferase activity(GO:0050211) |
| 0.2 | 0.7 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| 0.2 | 1.0 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
| 0.2 | 1.2 | GO:0050436 | microfibril binding(GO:0050436) |
| 0.2 | 1.2 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.2 | 0.7 | GO:0036134 | thromboxane-A synthase activity(GO:0004796) 12-hydroxyheptadecatrienoic acid synthase activity(GO:0036134) |
| 0.2 | 0.7 | GO:0004819 | glutamine-tRNA ligase activity(GO:0004819) |
| 0.2 | 0.9 | GO:0030305 | heparanase activity(GO:0030305) |
| 0.2 | 0.6 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
| 0.2 | 0.8 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.2 | 0.6 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
| 0.2 | 0.6 | GO:0050659 | N-acetylgalactosamine 4-sulfate 6-O-sulfotransferase activity(GO:0050659) |
| 0.2 | 0.5 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.2 | 0.5 | GO:0004853 | uroporphyrinogen decarboxylase activity(GO:0004853) |
| 0.2 | 0.7 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
| 0.2 | 0.5 | GO:0004766 | spermidine synthase activity(GO:0004766) |
| 0.2 | 0.5 | GO:0070984 | SET domain binding(GO:0070984) |
| 0.2 | 0.8 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
| 0.2 | 2.7 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.2 | 0.8 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.2 | 0.6 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
| 0.2 | 4.8 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.2 | 0.8 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.2 | 0.6 | GO:0004874 | aryl hydrocarbon receptor activity(GO:0004874) |
| 0.1 | 1.2 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
| 0.1 | 0.4 | GO:0000026 | alpha-1,2-mannosyltransferase activity(GO:0000026) |
| 0.1 | 1.0 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.1 | 0.4 | GO:0008798 | beta-aspartyl-peptidase activity(GO:0008798) |
| 0.1 | 1.0 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.1 | 0.6 | GO:0060422 | peptidyl-dipeptidase inhibitor activity(GO:0060422) |
| 0.1 | 2.4 | GO:0005549 | odorant binding(GO:0005549) |
| 0.1 | 2.4 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.1 | 0.5 | GO:0052839 | inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
| 0.1 | 0.7 | GO:0004748 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.1 | 0.4 | GO:0004157 | dihydropyrimidinase activity(GO:0004157) |
| 0.1 | 0.5 | GO:0009041 | uridylate kinase activity(GO:0009041) |
| 0.1 | 0.4 | GO:0005171 | hepatocyte growth factor receptor binding(GO:0005171) |
| 0.1 | 1.7 | GO:0042608 | T cell receptor binding(GO:0042608) |
| 0.1 | 1.7 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
| 0.1 | 0.4 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.1 | 2.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.1 | 3.8 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.1 | 0.5 | GO:0097677 | STAT family protein binding(GO:0097677) |
| 0.1 | 0.8 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
| 0.1 | 0.4 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.1 | 0.3 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
| 0.1 | 0.3 | GO:0030272 | 5-formyltetrahydrofolate cyclo-ligase activity(GO:0030272) |
| 0.1 | 0.3 | GO:0052596 | tryptamine:oxygen oxidoreductase (deaminating) activity(GO:0052593) aminoacetone:oxygen oxidoreductase(deaminating) activity(GO:0052594) aliphatic-amine oxidase activity(GO:0052595) phenethylamine:oxygen oxidoreductase (deaminating) activity(GO:0052596) |
| 0.1 | 0.7 | GO:0042835 | BRE binding(GO:0042835) |
| 0.1 | 0.3 | GO:0001026 | TFIIIB-type transcription factor activity(GO:0001026) |
| 0.1 | 0.6 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.1 | 0.5 | GO:0047057 | oxidoreductase activity, acting on the CH-OH group of donors, disulfide as acceptor(GO:0016900) vitamin-K-epoxide reductase (warfarin-sensitive) activity(GO:0047057) |
| 0.1 | 0.3 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.1 | 0.5 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
| 0.1 | 0.5 | GO:0005294 | neutral L-amino acid secondary active transmembrane transporter activity(GO:0005294) |
| 0.1 | 0.3 | GO:0004379 | glycylpeptide N-tetradecanoyltransferase activity(GO:0004379) myristoyltransferase activity(GO:0019107) |
| 0.1 | 4.0 | GO:0042605 | peptide antigen binding(GO:0042605) |
| 0.1 | 1.1 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.1 | 0.3 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
| 0.1 | 0.6 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.1 | 0.5 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.1 | 10.4 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.1 | 0.8 | GO:0102336 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.1 | 0.3 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.1 | 0.4 | GO:0022897 | peptide:proton symporter activity(GO:0015333) proton-dependent peptide secondary active transmembrane transporter activity(GO:0022897) |
| 0.1 | 0.3 | GO:0032093 | SAM domain binding(GO:0032093) |
| 0.1 | 1.1 | GO:0015266 | protein channel activity(GO:0015266) |
| 0.1 | 1.0 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.1 | 1.6 | GO:0033549 | MAP kinase phosphatase activity(GO:0033549) |
| 0.1 | 0.8 | GO:0060002 | plus-end directed microfilament motor activity(GO:0060002) |
| 0.1 | 0.3 | GO:1904599 | advanced glycation end-product binding(GO:1904599) |
| 0.1 | 0.5 | GO:0030492 | hemoglobin binding(GO:0030492) |
| 0.1 | 0.2 | GO:0047661 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
| 0.1 | 0.3 | GO:0034038 | deoxyhypusine synthase activity(GO:0034038) |
| 0.1 | 0.3 | GO:1901375 | acetylcholine transmembrane transporter activity(GO:0005277) secondary active organic cation transmembrane transporter activity(GO:0008513) acetate ester transmembrane transporter activity(GO:1901375) |
| 0.1 | 0.3 | GO:0004603 | phenylethanolamine N-methyltransferase activity(GO:0004603) |
| 0.1 | 0.9 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
| 0.1 | 0.4 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.1 | 1.4 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.1 | 0.3 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.1 | 0.3 | GO:0061628 | H3K27me3 modified histone binding(GO:0061628) |
| 0.1 | 0.2 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.1 | 0.2 | GO:0015275 | stretch-activated, cation-selective, calcium channel activity(GO:0015275) |
| 0.1 | 0.2 | GO:0003826 | alpha-ketoacid dehydrogenase activity(GO:0003826) 3-methyl-2-oxobutanoate dehydrogenase (2-methylpropanoyl-transferring) activity(GO:0003863) |
| 0.1 | 0.2 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
| 0.1 | 0.1 | GO:0052742 | phosphatidylinositol kinase activity(GO:0052742) |
| 0.1 | 4.0 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.1 | 0.5 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
| 0.1 | 1.8 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.1 | 1.8 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.1 | 0.3 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.1 | 3.5 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.1 | 0.7 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.1 | 1.5 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.1 | 0.4 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.1 | 0.4 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
| 0.1 | 0.7 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.1 | 0.4 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.1 | 0.2 | GO:0004119 | cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) |
| 0.1 | 0.3 | GO:0051996 | farnesyl-diphosphate farnesyltransferase activity(GO:0004310) squalene synthase activity(GO:0051996) |
| 0.1 | 0.2 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.1 | 0.3 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
| 0.1 | 0.2 | GO:0055077 | gap junction hemi-channel activity(GO:0055077) |
| 0.1 | 0.3 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.1 | 0.3 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.1 | 0.2 | GO:0052810 | 1-phosphatidylinositol-5-kinase activity(GO:0052810) |
| 0.1 | 0.4 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.1 | 0.6 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
| 0.1 | 0.5 | GO:0005497 | androgen binding(GO:0005497) |
| 0.1 | 0.4 | GO:0004331 | 6-phosphofructo-2-kinase activity(GO:0003873) fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.1 | 1.2 | GO:0016273 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
| 0.1 | 0.1 | GO:0051998 | carboxyl-O-methyltransferase activity(GO:0010340) protein carboxyl O-methyltransferase activity(GO:0051998) |
| 0.1 | 0.5 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
| 0.1 | 0.2 | GO:0090631 | pre-miRNA transporter activity(GO:0090631) |
| 0.1 | 0.1 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.1 | 0.3 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 0.1 | 0.4 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.1 | 0.3 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
| 0.1 | 1.0 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.1 | 0.4 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.1 | 0.2 | GO:0001632 | leukotriene B4 receptor activity(GO:0001632) |
| 0.1 | 0.8 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.1 | 1.2 | GO:0005351 | sugar:proton symporter activity(GO:0005351) cation:sugar symporter activity(GO:0005402) |
| 0.1 | 1.3 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.1 | 0.2 | GO:0035651 | AP-1 adaptor complex binding(GO:0035650) AP-3 adaptor complex binding(GO:0035651) |
| 0.1 | 1.8 | GO:0019200 | carbohydrate kinase activity(GO:0019200) |
| 0.1 | 0.2 | GO:0015235 | cobalamin transporter activity(GO:0015235) |
| 0.1 | 0.6 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.1 | 0.5 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.1 | 1.9 | GO:0016702 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
| 0.1 | 1.1 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.1 | 2.9 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.1 | 0.4 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.1 | 1.4 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.1 | 0.9 | GO:0001671 | ATPase activator activity(GO:0001671) |
| 0.1 | 4.7 | GO:0004984 | olfactory receptor activity(GO:0004984) |
| 0.1 | 0.8 | GO:0003993 | acid phosphatase activity(GO:0003993) |
| 0.1 | 0.3 | GO:0019144 | ADP-sugar diphosphatase activity(GO:0019144) adenosine-diphosphatase activity(GO:0043262) |
| 0.1 | 0.6 | GO:0051434 | BH3 domain binding(GO:0051434) |
| 0.1 | 0.3 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
| 0.1 | 0.9 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.1 | 0.1 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.1 | 0.4 | GO:0031432 | titin binding(GO:0031432) |
| 0.1 | 3.0 | GO:0005080 | protein kinase C binding(GO:0005080) |
| 0.1 | 1.3 | GO:0070001 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
| 0.0 | 0.3 | GO:0071253 | connexin binding(GO:0071253) gap junction channel activity involved in cardiac conduction electrical coupling(GO:0086075) |
| 0.0 | 0.5 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.0 | 0.1 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.0 | 12.8 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.2 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
| 0.0 | 0.9 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.0 | 0.1 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
| 0.0 | 0.2 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) |
| 0.0 | 1.5 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
| 0.0 | 1.1 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
| 0.0 | 0.3 | GO:0048038 | quinone binding(GO:0048038) |
| 0.0 | 0.3 | GO:0004527 | exonuclease activity(GO:0004527) |
| 0.0 | 0.3 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.0 | 0.4 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.0 | 0.3 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.0 | 0.2 | GO:0004102 | choline O-acetyltransferase activity(GO:0004102) |
| 0.0 | 0.5 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.0 | 2.2 | GO:0070412 | R-SMAD binding(GO:0070412) |
| 0.0 | 1.5 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
| 0.0 | 0.1 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.0 | 0.1 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.0 | 0.5 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
| 0.0 | 0.2 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.0 | 0.3 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.0 | 0.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.0 | 0.2 | GO:0086083 | cell adhesive protein binding involved in bundle of His cell-Purkinje myocyte communication(GO:0086083) |
| 0.0 | 0.2 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.0 | 0.2 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.0 | 0.4 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.0 | 0.2 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.0 | 0.6 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.0 | 0.2 | GO:0005046 | KDEL sequence binding(GO:0005046) |
| 0.0 | 0.4 | GO:0016997 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) |
| 0.0 | 0.5 | GO:0008312 | 7S RNA binding(GO:0008312) |
| 0.0 | 0.1 | GO:1990948 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.0 | 0.2 | GO:0016608 | growth hormone-releasing hormone activity(GO:0016608) |
| 0.0 | 0.6 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.0 | 1.2 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.0 | 0.5 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.0 | 0.3 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.0 | 0.7 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
| 0.0 | 0.1 | GO:0061752 | telomeric repeat-containing RNA binding(GO:0061752) |
| 0.0 | 0.1 | GO:0004817 | cysteine-tRNA ligase activity(GO:0004817) |
| 0.0 | 0.2 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
| 0.0 | 0.4 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
| 0.0 | 0.5 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.0 | 0.4 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.0 | 2.7 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.0 | 0.4 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.0 | 0.7 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
| 0.0 | 0.4 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.0 | 0.3 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.0 | 0.1 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.0 | 1.9 | GO:0016504 | peptidase activator activity(GO:0016504) |
| 0.0 | 0.3 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.0 | 0.4 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.0 | 1.1 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.0 | 0.2 | GO:0031728 | CCR3 chemokine receptor binding(GO:0031728) |
| 0.0 | 1.7 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.0 | 0.5 | GO:0019894 | kinesin binding(GO:0019894) |
| 0.0 | 0.7 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.0 | 0.4 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.0 | 0.1 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.0 | 0.2 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.0 | 0.3 | GO:0070324 | thyroid hormone binding(GO:0070324) |
| 0.0 | 0.2 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
| 0.0 | 0.1 | GO:0016534 | cyclin-dependent protein kinase 5 activator activity(GO:0016534) |
| 0.0 | 0.2 | GO:0015556 | C4-dicarboxylate transmembrane transporter activity(GO:0015556) |
| 0.0 | 0.1 | GO:0003943 | N-acetylgalactosamine-4-sulfatase activity(GO:0003943) |
| 0.0 | 0.2 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.0 | 0.2 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.0 | 0.4 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.0 | 0.3 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
| 0.0 | 0.3 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.0 | 1.0 | GO:0016676 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.0 | 0.5 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.0 | 0.5 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
| 0.0 | 0.3 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) protein histidine kinase activity(GO:0004673) |
| 0.0 | 1.3 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.0 | 0.1 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.0 | 0.1 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
| 0.0 | 1.5 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 0.0 | 0.1 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
| 0.0 | 1.1 | GO:0000175 | 3'-5'-exoribonuclease activity(GO:0000175) |
| 0.0 | 0.2 | GO:0010859 | calcium-dependent cysteine-type endopeptidase inhibitor activity(GO:0010859) |
| 0.0 | 0.1 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
| 0.0 | 0.2 | GO:0030620 | U2 snRNA binding(GO:0030620) histone pre-mRNA DCP binding(GO:0071208) |
| 0.0 | 0.4 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 0.2 | GO:0015288 | porin activity(GO:0015288) |
| 0.0 | 0.3 | GO:0005248 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
| 0.0 | 0.4 | GO:0003924 | GTPase activity(GO:0003924) |
| 0.0 | 0.4 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.0 | 0.1 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
| 0.0 | 0.4 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.0 | 0.6 | GO:0015929 | hexosaminidase activity(GO:0015929) |
| 0.0 | 0.6 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
| 0.0 | 0.1 | GO:0009383 | rRNA (cytosine-C5-)-methyltransferase activity(GO:0009383) |
| 0.0 | 0.2 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.0 | 0.1 | GO:0019976 | interleukin-2 receptor activity(GO:0004911) interleukin-2 binding(GO:0019976) |
| 0.0 | 0.3 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
| 0.0 | 0.1 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 0.0 | 0.1 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
| 0.0 | 3.3 | GO:0047485 | protein N-terminus binding(GO:0047485) |
| 0.0 | 0.0 | GO:0004660 | protein farnesyltransferase activity(GO:0004660) |
| 0.0 | 0.3 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.0 | 0.1 | GO:0001181 | transcription factor activity, core RNA polymerase I binding(GO:0001181) |
| 0.0 | 0.4 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.0 | 0.1 | GO:0004180 | carboxypeptidase activity(GO:0004180) |
| 0.0 | 1.3 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
| 0.0 | 0.6 | GO:0031490 | chromatin DNA binding(GO:0031490) |
| 0.0 | 0.3 | GO:0098960 | postsynaptic neurotransmitter receptor activity(GO:0098960) |
| 0.0 | 0.3 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.0 | 0.3 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.0 | 0.3 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.0 | 0.3 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.0 | 0.7 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.0 | 0.0 | GO:0098847 | sequence-specific single stranded DNA binding(GO:0098847) |
| 0.0 | 1.1 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
| 0.0 | 0.2 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.0 | 0.6 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.0 | 0.3 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.1 | GO:0044736 | acid-sensing ion channel activity(GO:0044736) |
| 0.0 | 0.1 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.0 | 0.1 | GO:0080019 | fatty-acyl-CoA reductase (alcohol-forming) activity(GO:0080019) |
| 0.0 | 1.5 | GO:0046332 | SMAD binding(GO:0046332) |
| 0.0 | 0.3 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.0 | 0.7 | GO:0016303 | 1-phosphatidylinositol-3-kinase activity(GO:0016303) |
| 0.0 | 0.2 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 0.0 | 0.5 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
| 0.0 | 0.3 | GO:0005537 | mannose binding(GO:0005537) |
| 0.0 | 2.7 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.0 | 0.0 | GO:0008410 | CoA-transferase activity(GO:0008410) |
| 0.0 | 0.2 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 0.0 | 0.2 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
| 0.0 | 0.4 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.0 | 0.1 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.0 | 0.3 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.0 | 0.2 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.0 | 0.2 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.0 | 0.1 | GO:0047522 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
| 0.0 | 0.2 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.0 | 0.2 | GO:0015924 | mannosyl-oligosaccharide mannosidase activity(GO:0015924) |
| 0.0 | 0.1 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.0 | 0.3 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.0 | 0.5 | GO:0036002 | pre-mRNA binding(GO:0036002) |
| 0.0 | 1.2 | GO:0030145 | manganese ion binding(GO:0030145) |
| 0.0 | 0.3 | GO:0051536 | iron-sulfur cluster binding(GO:0051536) 4 iron, 4 sulfur cluster binding(GO:0051539) metal cluster binding(GO:0051540) |
| 0.0 | 0.1 | GO:0016435 | rRNA (guanine) methyltransferase activity(GO:0016435) |
| 0.0 | 0.1 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.0 | 0.1 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.0 | 0.1 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 0.0 | 0.1 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.0 | 0.4 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.0 | 0.4 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
| 0.0 | 0.2 | GO:0016853 | isomerase activity(GO:0016853) |
| 0.0 | 0.3 | GO:0043021 | ribonucleoprotein complex binding(GO:0043021) |
| 0.0 | 0.3 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
| 0.0 | 0.4 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
| 0.0 | 1.1 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
| 0.0 | 0.3 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 0.0 | 0.1 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.0 | 0.2 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
| 0.0 | 0.1 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.0 | 0.3 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.0 | 0.5 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.0 | 0.4 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.0 | 0.1 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.0 | 1.5 | GO:0051087 | chaperone binding(GO:0051087) |
| 0.0 | 0.2 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.0 | 0.4 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 0.0 | 0.5 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.0 | 0.0 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
| 0.0 | 0.4 | GO:0043548 | phosphatidylinositol 3-kinase binding(GO:0043548) |
| 0.0 | 0.0 | GO:0035473 | lipase binding(GO:0035473) |
| 0.0 | 0.1 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.0 | 0.1 | GO:0019534 | toxin transporter activity(GO:0019534) |
| 0.0 | 0.3 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.0 | 3.0 | GO:0051015 | actin filament binding(GO:0051015) |
| 0.0 | 0.1 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.0 | 0.2 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.0 | 0.5 | GO:0005123 | death receptor binding(GO:0005123) |
| 0.0 | 0.1 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.0 | 0.4 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.0 | 0.5 | GO:0004702 | receptor signaling protein serine/threonine kinase activity(GO:0004702) |
| 0.0 | 0.2 | GO:0044213 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) intronic transcription regulatory region DNA binding(GO:0044213) |
| 0.0 | 1.0 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
| 0.0 | 0.5 | GO:0017022 | myosin binding(GO:0017022) |
| 0.0 | 0.4 | GO:0019956 | chemokine binding(GO:0019956) |
| 0.0 | 0.0 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.0 | 0.4 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.0 | 0.0 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
| 0.0 | 0.1 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.0 | 0.0 | GO:0047150 | betaine-homocysteine S-methyltransferase activity(GO:0047150) |
| 0.0 | 0.1 | GO:0097643 | amylin receptor activity(GO:0097643) |
| 0.0 | 2.1 | GO:0005178 | integrin binding(GO:0005178) |
| 0.0 | 0.9 | GO:0003725 | double-stranded RNA binding(GO:0003725) |
| 0.0 | 0.5 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.0 | 0.3 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.0 | 0.1 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.0 | 0.1 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.0 | 0.1 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
| 0.0 | 0.0 | GO:0045518 | interleukin-22 receptor binding(GO:0045518) |
| 0.0 | 0.4 | GO:0004622 | lysophospholipase activity(GO:0004622) |
| 0.0 | 0.3 | GO:0030515 | snoRNA binding(GO:0030515) |
| 0.0 | 0.4 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
| 0.0 | 0.1 | GO:0089720 | caspase binding(GO:0089720) |
| 0.0 | 0.1 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.0 | 0.2 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.0 | 0.1 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.0 | 0.4 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.0 | 0.1 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
| 0.0 | 0.1 | GO:0004815 | aspartate-tRNA ligase activity(GO:0004815) |
| 0.0 | 0.1 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.0 | 0.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.0 | 0.2 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.0 | 0.1 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.0 | 0.1 | GO:0015232 | heme transporter activity(GO:0015232) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 4.9 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.1 | 2.6 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.1 | 6.8 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.1 | 0.4 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.1 | 3.3 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.1 | 1.8 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.1 | 3.4 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
| 0.1 | 0.8 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.1 | 1.5 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.0 | 2.4 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.0 | 0.8 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.0 | 1.0 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 2.2 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.0 | 1.9 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.0 | 0.6 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.0 | 0.6 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.0 | 1.3 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.0 | 2.1 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.0 | 2.2 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.0 | 0.9 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.0 | 0.3 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.0 | 0.6 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.0 | 0.2 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.0 | 1.4 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.0 | 1.0 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.0 | 0.4 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.0 | 0.8 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.0 | 1.1 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
| 0.0 | 0.6 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.0 | 1.2 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.0 | 0.6 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.0 | 0.7 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.0 | 0.8 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.0 | 1.3 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.0 | 0.3 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 0.1 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.0 | 0.5 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.0 | 0.5 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.0 | 0.6 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.0 | 1.1 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.0 | 0.3 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.0 | 1.4 | PID CDC42 PATHWAY | CDC42 signaling events |
| 0.0 | 0.8 | PID ATR PATHWAY | ATR signaling pathway |
| 0.0 | 1.7 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 0.6 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.0 | 0.8 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.0 | 0.7 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.0 | 0.2 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.0 | 4.3 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.0 | 0.6 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| 0.0 | 0.6 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.0 | 0.1 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.0 | 0.9 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.0 | 0.3 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.0 | 0.5 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.0 | 0.6 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.0 | 0.5 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.0 | 0.3 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.0 | 0.0 | PID MYC PATHWAY | C-MYC pathway |
| 0.0 | 0.2 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
| 0.0 | 1.1 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.0 | 0.7 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
| 0.0 | 0.6 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.0 | 0.7 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.0 | 0.4 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
| 0.0 | 0.5 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
| 0.0 | 0.3 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.0 | 1.1 | PID E2F PATHWAY | E2F transcription factor network |
| 0.0 | 0.4 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.0 | 0.4 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.0 | 0.0 | PID IGF1 PATHWAY | IGF1 pathway |
| 0.0 | 0.6 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 0.4 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 0.3 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 0.3 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.0 | 3.1 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 3.7 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
| 0.2 | 0.2 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.1 | 2.6 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.1 | 8.8 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.1 | 2.7 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.1 | 2.6 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.1 | 1.3 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 0.1 | 4.4 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
| 0.1 | 3.6 | REACTOME INHIBITION OF THE PROTEOLYTIC ACTIVITY OF APC C REQUIRED FOR THE ONSET OF ANAPHASE BY MITOTIC SPINDLE CHECKPOINT COMPONENTS | Genes involved in Inhibition of the proteolytic activity of APC/C required for the onset of anaphase by mitotic spindle checkpoint components |
| 0.1 | 2.1 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.1 | 0.8 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
| 0.1 | 0.2 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
| 0.1 | 1.5 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
| 0.1 | 6.4 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.1 | 5.0 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
| 0.1 | 3.0 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 0.1 | 2.3 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.1 | 7.2 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
| 0.1 | 1.8 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
| 0.1 | 0.8 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.1 | 1.5 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.1 | 0.8 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.1 | 6.7 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.1 | 1.7 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.1 | 0.1 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
| 0.1 | 0.5 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.1 | 0.9 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.1 | 1.8 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.1 | 0.7 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 0.1 | 1.4 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.1 | 1.3 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 0.1 | 1.7 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
| 0.1 | 3.7 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.1 | 0.1 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
| 0.1 | 1.5 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.1 | 0.7 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.1 | 3.7 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.0 | 0.3 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
| 0.0 | 2.3 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.0 | 0.5 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.0 | 1.9 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.0 | 1.9 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.0 | 1.7 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.0 | 0.3 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 0.0 | 1.6 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
| 0.0 | 1.6 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.0 | 4.6 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.0 | 1.7 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.0 | 0.7 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
| 0.0 | 0.8 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.0 | 1.4 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.0 | 0.4 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.0 | 1.1 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.0 | 0.3 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
| 0.0 | 1.3 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.0 | 0.9 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.0 | 0.5 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
| 0.0 | 3.3 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
| 0.0 | 1.1 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.0 | 0.9 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.0 | 0.3 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.0 | 2.5 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.0 | 0.6 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 0.0 | 0.1 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.0 | 1.0 | REACTOME MITOTIC M M G1 PHASES | Genes involved in Mitotic M-M/G1 phases |
| 0.0 | 0.8 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
| 0.0 | 1.1 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
| 0.0 | 0.5 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.0 | 0.9 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
| 0.0 | 1.2 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
| 0.0 | 0.1 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
| 0.0 | 2.3 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.0 | 0.3 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
| 0.0 | 1.5 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.0 | 0.9 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 1.4 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.0 | 0.3 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.0 | 1.7 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
| 0.0 | 0.4 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.0 | 1.1 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
| 0.0 | 1.3 | REACTOME LATE PHASE OF HIV LIFE CYCLE | Genes involved in Late Phase of HIV Life Cycle |
| 0.0 | 0.1 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
| 0.0 | 0.4 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.0 | 0.8 | REACTOME GAB1 SIGNALOSOME | Genes involved in GAB1 signalosome |
| 0.0 | 0.8 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
| 0.0 | 0.1 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
| 0.0 | 0.3 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.0 | 0.6 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.0 | 0.9 | REACTOME APOPTOTIC CLEAVAGE OF CELLULAR PROTEINS | Genes involved in Apoptotic cleavage of cellular proteins |
| 0.0 | 0.3 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
| 0.0 | 0.3 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.0 | 3.8 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.0 | 0.3 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
| 0.0 | 0.7 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
| 0.0 | 0.5 | REACTOME TRNA AMINOACYLATION | Genes involved in tRNA Aminoacylation |
| 0.0 | 1.1 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
| 0.0 | 0.4 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.0 | 0.5 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.0 | 0.4 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.0 | 0.7 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.0 | 0.8 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.9 | REACTOME TRANSLATION | Genes involved in Translation |
| 0.0 | 0.3 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.0 | 0.5 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.0 | 0.5 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
| 0.0 | 0.3 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.0 | 0.4 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
| 0.0 | 0.3 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.0 | 0.4 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
| 0.0 | 0.5 | REACTOME TAK1 ACTIVATES NFKB BY PHOSPHORYLATION AND ACTIVATION OF IKKS COMPLEX | Genes involved in TAK1 activates NFkB by phosphorylation and activation of IKKs complex |
| 0.0 | 0.2 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.0 | 0.3 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.0 | 0.2 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
| 0.0 | 1.2 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 0.0 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 0.0 | 0.3 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.0 | 0.2 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.0 | 0.4 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |
| 0.0 | 0.2 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.0 | 0.5 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
| 0.0 | 0.3 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.0 | 0.2 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.0 | 0.4 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
| 0.0 | 0.2 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.0 | 0.2 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.0 | 0.9 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 0.2 | REACTOME GLUCAGON TYPE LIGAND RECEPTORS | Genes involved in Glucagon-type ligand receptors |