Project
Mucociliary differentiation, bronchial epithelial cells, human (Ross 2007)
Navigation
Downloads
Results for ZNF711_TFAP2A_TFAP2D
Z-value: 1.85
Motif logo
Transcription factors associated with ZNF711_TFAP2A_TFAP2D
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
ZNF711
|
ENSG00000147180.12 | zinc finger protein 711 |
|
TFAP2A
|
ENSG00000137203.6 | transcription factor AP-2 alpha |
|
TFAP2D
|
ENSG00000008197.4 | transcription factor AP-2 delta |
Activity-expression correlation:
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| ZNF711 | hg19_v2_chrX_+_84498989_84499003, hg19_v2_chrX_+_84499038_84499078 | -0.50 | 4.5e-03 | Click! |
| TFAP2A | hg19_v2_chr6_-_10415470_10415508 | -0.48 | 7.2e-03 | Click! |
| TFAP2D | hg19_v2_chr6_+_50681541_50681541 | -0.48 | 7.7e-03 | Click! |
Activity profile of ZNF711_TFAP2A_TFAP2D motif
Sorted Z-values of ZNF711_TFAP2A_TFAP2D motif
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr5_-_180018540 | 11.89 |
ENST00000292641.3
|
SCGB3A1
|
secretoglobin, family 3A, member 1 |
| chr4_-_7044657 | 11.24 |
ENST00000310085.4
|
CCDC96
|
coiled-coil domain containing 96 |
| chr12_+_50355647 | 11.02 |
ENST00000293599.6
|
AQP5
|
aquaporin 5 |
| chr21_-_43916433 | 7.96 |
ENST00000291536.3
|
RSPH1
|
radial spoke head 1 homolog (Chlamydomonas) |
| chr22_-_50970506 | 7.71 |
ENST00000428989.2
ENST00000403326.1 |
ODF3B
|
outer dense fiber of sperm tails 3B |
| chr14_+_105953204 | 7.40 |
ENST00000409393.2
|
CRIP1
|
cysteine-rich protein 1 (intestinal) |
| chr2_-_130902567 | 7.08 |
ENST00000457413.1
ENST00000392984.3 ENST00000409128.1 ENST00000441670.1 ENST00000409943.3 ENST00000409234.3 ENST00000310463.6 |
CCDC74B
|
coiled-coil domain containing 74B |
| chr21_+_36041688 | 6.98 |
ENST00000360731.3
ENST00000349499.2 |
CLIC6
|
chloride intracellular channel 6 |
| chr4_-_16085340 | 6.82 |
ENST00000508167.1
|
PROM1
|
prominin 1 |
| chr5_+_10441970 | 6.81 |
ENST00000274134.4
|
ROPN1L
|
rhophilin associated tail protein 1-like |
| chr11_+_94245617 | 6.56 |
ENST00000542198.1
|
RP11-867G2.2
|
long intergenic non-protein coding RNA 1171 |
| chr14_+_105953246 | 6.07 |
ENST00000392531.3
|
CRIP1
|
cysteine-rich protein 1 (intestinal) |
| chr10_+_22634384 | 5.87 |
ENST00000376624.3
ENST00000376603.2 ENST00000376601.1 ENST00000538630.1 ENST00000456231.2 ENST00000313311.6 ENST00000435326.1 |
SPAG6
|
sperm associated antigen 6 |
| chr2_+_132285406 | 5.83 |
ENST00000295171.6
ENST00000409856.3 |
CCDC74A
|
coiled-coil domain containing 74A |
| chr2_-_239148599 | 5.76 |
ENST00000409182.1
ENST00000409002.3 ENST00000450098.1 ENST00000409356.1 ENST00000409160.3 ENST00000409574.1 ENST00000272937.5 |
HES6
|
hes family bHLH transcription factor 6 |
| chr7_-_131241361 | 5.68 |
ENST00000378555.3
ENST00000322985.9 ENST00000541194.1 ENST00000537928.1 |
PODXL
|
podocalyxin-like |
| chr6_-_33048483 | 5.66 |
ENST00000419277.1
|
HLA-DPA1
|
major histocompatibility complex, class II, DP alpha 1 |
| chr3_-_169530452 | 5.66 |
ENST00000446859.1
|
LRRC34
|
leucine rich repeat containing 34 |
| chr14_+_105952648 | 5.63 |
ENST00000330233.7
|
CRIP1
|
cysteine-rich protein 1 (intestinal) |
| chr3_-_197686847 | 5.57 |
ENST00000265239.6
|
IQCG
|
IQ motif containing G |
| chr20_+_56725952 | 5.52 |
ENST00000371168.3
|
C20orf85
|
chromosome 20 open reading frame 85 |
| chr21_-_43916296 | 5.50 |
ENST00000398352.3
|
RSPH1
|
radial spoke head 1 homolog (Chlamydomonas) |
| chr3_-_169530574 | 5.48 |
ENST00000316515.7
ENST00000522830.1 ENST00000522526.2 |
LRRC34
|
leucine rich repeat containing 34 |
| chr19_-_55677920 | 5.42 |
ENST00000524407.2
ENST00000526003.1 ENST00000534170.1 |
DNAAF3
|
dynein, axonemal, assembly factor 3 |
| chr6_-_132272504 | 5.31 |
ENST00000367976.3
|
CTGF
|
connective tissue growth factor |
| chr9_+_71320557 | 5.25 |
ENST00000541509.1
|
PIP5K1B
|
phosphatidylinositol-4-phosphate 5-kinase, type I, beta |
| chr19_+_5914213 | 5.24 |
ENST00000222125.5
ENST00000452990.2 ENST00000588865.1 |
CAPS
|
calcyphosine |
| chr5_+_76506706 | 5.21 |
ENST00000340978.3
ENST00000346042.3 ENST00000264917.5 ENST00000342343.4 ENST00000333194.4 |
PDE8B
|
phosphodiesterase 8B |
| chr9_+_127615733 | 5.17 |
ENST00000373574.1
|
WDR38
|
WD repeat domain 38 |
| chr7_+_48075108 | 5.14 |
ENST00000420324.1
ENST00000435376.1 ENST00000430738.1 ENST00000348904.3 ENST00000539619.1 |
C7orf57
|
chromosome 7 open reading frame 57 |
| chr7_+_106685079 | 5.12 |
ENST00000265717.4
|
PRKAR2B
|
protein kinase, cAMP-dependent, regulatory, type II, beta |
| chr7_+_102105370 | 5.11 |
ENST00000292616.5
|
LRWD1
|
leucine-rich repeats and WD repeat domain containing 1 |
| chr16_+_699319 | 4.92 |
ENST00000549091.1
ENST00000293879.4 |
WDR90
|
WD repeat domain 90 |
| chr16_+_67465016 | 4.86 |
ENST00000326152.5
|
HSD11B2
|
hydroxysteroid (11-beta) dehydrogenase 2 |
| chr11_+_61276214 | 4.85 |
ENST00000378075.2
|
LRRC10B
|
leucine rich repeat containing 10B |
| chr15_+_71145578 | 4.85 |
ENST00000544974.2
ENST00000558546.1 |
LRRC49
|
leucine rich repeat containing 49 |
| chrY_+_2803322 | 4.78 |
ENST00000383052.1
ENST00000155093.3 ENST00000449237.1 ENST00000443793.1 |
ZFY
|
zinc finger protein, Y-linked |
| chr3_-_158450475 | 4.76 |
ENST00000237696.5
|
RARRES1
|
retinoic acid receptor responder (tazarotene induced) 1 |
| chr9_-_99381660 | 4.76 |
ENST00000375240.3
ENST00000463569.1 |
CDC14B
|
cell division cycle 14B |
| chr11_+_1244288 | 4.69 |
ENST00000529681.1
ENST00000447027.1 |
MUC5B
|
mucin 5B, oligomeric mucus/gel-forming |
| chr20_-_39317868 | 4.65 |
ENST00000373313.2
|
MAFB
|
v-maf avian musculoaponeurotic fibrosarcoma oncogene homolog B |
| chr19_-_7990991 | 4.62 |
ENST00000318978.4
|
CTXN1
|
cortexin 1 |
| chr20_-_35580104 | 4.60 |
ENST00000373694.5
|
SAMHD1
|
SAM domain and HD domain 1 |
| chr13_+_37005967 | 4.57 |
ENST00000440264.1
ENST00000449823.1 |
CCNA1
|
cyclin A1 |
| chr9_-_34381536 | 4.56 |
ENST00000379126.3
ENST00000379127.1 ENST00000379133.3 |
C9orf24
|
chromosome 9 open reading frame 24 |
| chr9_-_138391692 | 4.51 |
ENST00000429260.2
|
C9orf116
|
chromosome 9 open reading frame 116 |
| chr16_+_58283814 | 4.49 |
ENST00000443128.2
ENST00000219299.4 |
CCDC113
|
coiled-coil domain containing 113 |
| chr9_+_71320596 | 4.46 |
ENST00000265382.3
|
PIP5K1B
|
phosphatidylinositol-4-phosphate 5-kinase, type I, beta |
| chr16_+_810728 | 4.45 |
ENST00000563941.1
ENST00000545450.2 ENST00000566549.1 |
MSLN
|
mesothelin |
| chr5_-_54529415 | 4.45 |
ENST00000282572.4
|
CCNO
|
cyclin O |
| chr16_-_28621353 | 4.44 |
ENST00000567512.1
|
SULT1A1
|
sulfotransferase family, cytosolic, 1A, phenol-preferring, member 1 |
| chr17_-_30185946 | 4.31 |
ENST00000579741.1
|
COPRS
|
coordinator of PRMT5, differentiation stimulator |
| chr4_+_3465027 | 4.29 |
ENST00000389653.2
ENST00000507039.1 ENST00000340083.5 |
DOK7
|
docking protein 7 |
| chr3_+_42947600 | 4.28 |
ENST00000328199.6
ENST00000541208.1 |
ZNF662
|
zinc finger protein 662 |
| chr17_+_1633755 | 4.28 |
ENST00000545662.1
|
WDR81
|
WD repeat domain 81 |
| chr14_+_67999999 | 4.27 |
ENST00000329153.5
|
PLEKHH1
|
pleckstrin homology domain containing, family H (with MyTH4 domain) member 1 |
| chr2_+_132287237 | 4.26 |
ENST00000467992.2
|
CCDC74A
|
coiled-coil domain containing 74A |
| chr16_+_811073 | 4.25 |
ENST00000382862.3
ENST00000563651.1 |
MSLN
|
mesothelin |
| chr19_-_55677999 | 4.24 |
ENST00000532817.1
ENST00000527223.2 ENST00000391720.4 |
DNAAF3
|
dynein, axonemal, assembly factor 3 |
| chrX_-_99665262 | 4.24 |
ENST00000373034.4
ENST00000255531.7 |
PCDH19
|
protocadherin 19 |
| chr15_-_68497657 | 4.24 |
ENST00000448060.2
ENST00000467889.1 |
CALML4
|
calmodulin-like 4 |
| chr7_-_5821225 | 4.19 |
ENST00000416985.1
|
RNF216
|
ring finger protein 216 |
| chr22_+_29279552 | 4.19 |
ENST00000544604.2
|
ZNRF3
|
zinc and ring finger 3 |
| chr16_+_80574854 | 4.17 |
ENST00000305904.6
ENST00000568035.1 |
DYNLRB2
|
dynein, light chain, roadblock-type 2 |
| chr4_+_187065978 | 4.17 |
ENST00000227065.4
ENST00000502970.1 ENST00000514153.1 |
FAM149A
|
family with sequence similarity 149, member A |
| chr7_-_102715263 | 4.15 |
ENST00000379305.3
|
FBXL13
|
F-box and leucine-rich repeat protein 13 |
| chr4_-_16085314 | 4.12 |
ENST00000510224.1
|
PROM1
|
prominin 1 |
| chr2_+_170335924 | 4.12 |
ENST00000554017.1
ENST00000392663.2 ENST00000513963.1 |
BBS5
RP11-724O16.1
|
Bardet-Biedl syndrome 5 Bardet-Biedl syndrome 5 protein; Uncharacterized protein |
| chr1_+_78956651 | 4.07 |
ENST00000370757.3
ENST00000370756.3 |
PTGFR
|
prostaglandin F receptor (FP) |
| chr19_-_3029011 | 4.04 |
ENST00000590536.1
ENST00000587137.1 ENST00000455444.2 ENST00000262953.6 |
TLE2
|
transducin-like enhancer of split 2 (E(sp1) homolog, Drosophila) |
| chr2_-_241500447 | 4.01 |
ENST00000536462.1
ENST00000405002.1 ENST00000441168.1 ENST00000403283.1 |
ANKMY1
|
ankyrin repeat and MYND domain containing 1 |
| chr17_-_42276574 | 3.98 |
ENST00000589805.1
|
ATXN7L3
|
ataxin 7-like 3 |
| chr12_-_104531785 | 3.98 |
ENST00000551727.1
|
NFYB
|
nuclear transcription factor Y, beta |
| chr6_+_163148973 | 3.93 |
ENST00000366888.2
|
PACRG
|
PARK2 co-regulated |
| chr10_-_28287968 | 3.93 |
ENST00000305242.5
|
ARMC4
|
armadillo repeat containing 4 |
| chr5_+_131630117 | 3.93 |
ENST00000200652.3
|
SLC22A4
|
solute carrier family 22 (organic cation/zwitterion transporter), member 4 |
| chr10_+_70587279 | 3.90 |
ENST00000298596.6
ENST00000399169.4 ENST00000399165.4 ENST00000399162.2 |
STOX1
|
storkhead box 1 |
| chr9_-_80263220 | 3.89 |
ENST00000341700.6
|
GNA14
|
guanine nucleotide binding protein (G protein), alpha 14 |
| chr16_-_776431 | 3.88 |
ENST00000293889.6
|
CCDC78
|
coiled-coil domain containing 78 |
| chr22_-_50765489 | 3.88 |
ENST00000413817.3
|
DENND6B
|
DENN/MADD domain containing 6B |
| chr3_-_158450231 | 3.87 |
ENST00000479756.1
|
RARRES1
|
retinoic acid receptor responder (tazarotene induced) 1 |
| chr8_-_110703819 | 3.87 |
ENST00000532779.1
ENST00000534578.1 |
SYBU
|
syntabulin (syntaxin-interacting) |
| chr9_-_34381511 | 3.86 |
ENST00000379124.1
|
C9orf24
|
chromosome 9 open reading frame 24 |
| chr20_+_55205825 | 3.83 |
ENST00000544508.1
|
TFAP2C
|
transcription factor AP-2 gamma (activating enhancer binding protein 2 gamma) |
| chr9_-_124991124 | 3.82 |
ENST00000394319.4
ENST00000340587.3 |
LHX6
|
LIM homeobox 6 |
| chr8_-_49647791 | 3.81 |
ENST00000262103.3
ENST00000523092.1 ENST00000433756.1 |
EFCAB1
|
EF-hand calcium binding domain 1 |
| chr13_-_26625169 | 3.81 |
ENST00000319420.3
|
SHISA2
|
shisa family member 2 |
| chr17_-_6735012 | 3.79 |
ENST00000535086.1
|
TEKT1
|
tektin 1 |
| chr17_-_6735035 | 3.79 |
ENST00000338694.2
|
TEKT1
|
tektin 1 |
| chr12_+_111051832 | 3.78 |
ENST00000550703.2
ENST00000551590.1 |
TCTN1
|
tectonic family member 1 |
| chr19_+_4639514 | 3.77 |
ENST00000327473.4
|
TNFAIP8L1
|
tumor necrosis factor, alpha-induced protein 8-like 1 |
| chr1_+_25944341 | 3.76 |
ENST00000263979.3
|
MAN1C1
|
mannosidase, alpha, class 1C, member 1 |
| chr1_+_38022513 | 3.74 |
ENST00000296218.7
|
DNALI1
|
dynein, axonemal, light intermediate chain 1 |
| chr3_-_19988462 | 3.73 |
ENST00000344838.4
|
EFHB
|
EF-hand domain family, member B |
| chr16_+_84178874 | 3.71 |
ENST00000378553.5
|
DNAAF1
|
dynein, axonemal, assembly factor 1 |
| chr12_+_111051902 | 3.70 |
ENST00000397655.3
ENST00000471804.2 ENST00000377654.3 ENST00000397659.4 |
TCTN1
|
tectonic family member 1 |
| chr11_-_108369101 | 3.69 |
ENST00000323468.5
|
KDELC2
|
KDEL (Lys-Asp-Glu-Leu) containing 2 |
| chr16_+_4784273 | 3.68 |
ENST00000299320.5
ENST00000586724.1 |
C16orf71
|
chromosome 16 open reading frame 71 |
| chr16_+_2880157 | 3.63 |
ENST00000382280.3
|
ZG16B
|
zymogen granule protein 16B |
| chr4_-_149365827 | 3.61 |
ENST00000344721.4
|
NR3C2
|
nuclear receptor subfamily 3, group C, member 2 |
| chr11_+_111385497 | 3.61 |
ENST00000375618.4
ENST00000529167.1 ENST00000332814.6 |
C11orf88
|
chromosome 11 open reading frame 88 |
| chr10_+_23217006 | 3.60 |
ENST00000376528.4
ENST00000447081.1 |
ARMC3
|
armadillo repeat containing 3 |
| chr20_-_55841398 | 3.60 |
ENST00000395864.3
|
BMP7
|
bone morphogenetic protein 7 |
| chr1_+_205538105 | 3.59 |
ENST00000367147.4
ENST00000539267.1 |
MFSD4
|
major facilitator superfamily domain containing 4 |
| chr17_-_30185971 | 3.58 |
ENST00000378634.2
|
COPRS
|
coordinator of PRMT5, differentiation stimulator |
| chr1_+_245133656 | 3.55 |
ENST00000366521.3
|
EFCAB2
|
EF-hand calcium binding domain 2 |
| chr2_+_26624775 | 3.55 |
ENST00000288710.2
|
DRC1
|
dynein regulatory complex subunit 1 homolog (Chlamydomonas) |
| chr3_-_50383096 | 3.54 |
ENST00000442887.1
ENST00000360165.3 |
ZMYND10
|
zinc finger, MYND-type containing 10 |
| chr5_-_149792295 | 3.53 |
ENST00000518797.1
ENST00000524315.1 ENST00000009530.7 ENST00000377795.3 |
CD74
|
CD74 molecule, major histocompatibility complex, class II invariant chain |
| chr4_-_141348789 | 3.53 |
ENST00000414773.1
|
CLGN
|
calmegin |
| chr3_-_66551397 | 3.52 |
ENST00000383703.3
|
LRIG1
|
leucine-rich repeats and immunoglobulin-like domains 1 |
| chr14_+_75536335 | 3.52 |
ENST00000554763.1
ENST00000439583.2 ENST00000526130.1 ENST00000525046.1 |
ZC2HC1C
|
zinc finger, C2HC-type containing 1C |
| chr1_-_32801825 | 3.50 |
ENST00000329421.7
|
MARCKSL1
|
MARCKS-like 1 |
| chr10_+_23216944 | 3.50 |
ENST00000298032.5
ENST00000409983.3 ENST00000409049.3 |
ARMC3
|
armadillo repeat containing 3 |
| chr11_+_124543694 | 3.49 |
ENST00000227135.2
ENST00000532692.1 |
SPA17
|
sperm autoantigenic protein 17 |
| chr16_-_75590114 | 3.49 |
ENST00000568377.1
ENST00000565067.1 ENST00000258173.6 |
TMEM231
|
transmembrane protein 231 |
| chr11_-_47736896 | 3.48 |
ENST00000525123.1
ENST00000528244.1 ENST00000532595.1 ENST00000529154.1 ENST00000530969.1 |
AGBL2
|
ATP/GTP binding protein-like 2 |
| chr8_-_145115584 | 3.48 |
ENST00000426825.1
|
OPLAH
|
5-oxoprolinase (ATP-hydrolysing) |
| chr7_-_123174610 | 3.45 |
ENST00000324698.6
ENST00000434450.1 |
IQUB
|
IQ motif and ubiquitin domain containing |
| chr14_+_74486043 | 3.39 |
ENST00000464394.1
ENST00000394009.3 |
CCDC176
|
coiled-coil domain containing 176 |
| chr4_-_16077741 | 3.39 |
ENST00000447510.2
ENST00000540805.1 ENST00000539194.1 |
PROM1
|
prominin 1 |
| chr17_+_260097 | 3.39 |
ENST00000360127.6
ENST00000571106.1 ENST00000491373.1 |
C17orf97
|
chromosome 17 open reading frame 97 |
| chr14_+_75536280 | 3.39 |
ENST00000238686.8
|
ZC2HC1C
|
zinc finger, C2HC-type containing 1C |
| chr19_+_17581253 | 3.35 |
ENST00000252595.7
ENST00000598424.1 |
SLC27A1
|
solute carrier family 27 (fatty acid transporter), member 1 |
| chr22_-_47134077 | 3.31 |
ENST00000541677.1
ENST00000216264.8 |
CERK
|
ceramide kinase |
| chr17_-_30186328 | 3.29 |
ENST00000302362.6
|
COPRS
|
coordinator of PRMT5, differentiation stimulator |
| chr1_+_38022572 | 3.28 |
ENST00000541606.1
|
DNALI1
|
dynein, axonemal, light intermediate chain 1 |
| chr3_+_42544084 | 3.28 |
ENST00000543411.1
ENST00000438259.2 ENST00000439731.1 ENST00000325123.4 |
VIPR1
|
vasoactive intestinal peptide receptor 1 |
| chr17_-_74137374 | 3.26 |
ENST00000322957.6
|
FOXJ1
|
forkhead box J1 |
| chr19_+_17337406 | 3.25 |
ENST00000597836.1
|
OCEL1
|
occludin/ELL domain containing 1 |
| chr18_-_71815051 | 3.25 |
ENST00000582526.1
ENST00000419743.2 |
FBXO15
|
F-box protein 15 |
| chr2_-_230579185 | 3.23 |
ENST00000341772.4
|
DNER
|
delta/notch-like EGF repeat containing |
| chr18_-_71814999 | 3.21 |
ENST00000269500.5
|
FBXO15
|
F-box protein 15 |
| chr20_+_9049682 | 3.21 |
ENST00000334005.3
ENST00000378473.3 |
PLCB4
|
phospholipase C, beta 4 |
| chr6_+_32821924 | 3.20 |
ENST00000374859.2
ENST00000453265.2 |
PSMB9
|
proteasome (prosome, macropain) subunit, beta type, 9 |
| chr16_-_1020849 | 3.20 |
ENST00000568897.1
|
LMF1
|
lipase maturation factor 1 |
| chr6_-_24911195 | 3.20 |
ENST00000259698.4
|
FAM65B
|
family with sequence similarity 65, member B |
| chr2_-_220110187 | 3.20 |
ENST00000295759.7
ENST00000392089.2 |
GLB1L
|
galactosidase, beta 1-like |
| chr1_+_3569129 | 3.19 |
ENST00000354437.4
ENST00000357733.3 ENST00000346387.4 |
TP73
|
tumor protein p73 |
| chr8_+_17354587 | 3.19 |
ENST00000494857.1
ENST00000522656.1 |
SLC7A2
|
solute carrier family 7 (cationic amino acid transporter, y+ system), member 2 |
| chr8_+_17354617 | 3.18 |
ENST00000470360.1
|
SLC7A2
|
solute carrier family 7 (cationic amino acid transporter, y+ system), member 2 |
| chr11_-_111944895 | 3.17 |
ENST00000431456.1
ENST00000280350.4 ENST00000530641.1 |
PIH1D2
|
PIH1 domain containing 2 |
| chr9_-_124976154 | 3.17 |
ENST00000482062.1
|
LHX6
|
LIM homeobox 6 |
| chr21_-_46330545 | 3.17 |
ENST00000320216.6
ENST00000397852.1 |
ITGB2
|
integrin, beta 2 (complement component 3 receptor 3 and 4 subunit) |
| chr16_-_66959429 | 3.16 |
ENST00000420652.1
ENST00000299759.6 |
RRAD
|
Ras-related associated with diabetes |
| chr10_-_98480243 | 3.16 |
ENST00000339364.5
|
PIK3AP1
|
phosphoinositide-3-kinase adaptor protein 1 |
| chr12_-_42877726 | 3.14 |
ENST00000548696.1
|
PRICKLE1
|
prickle homolog 1 (Drosophila) |
| chr5_+_176237478 | 3.12 |
ENST00000329542.4
|
UNC5A
|
unc-5 homolog A (C. elegans) |
| chr1_+_3569072 | 3.12 |
ENST00000378295.4
ENST00000604074.1 |
TP73
|
tumor protein p73 |
| chr16_+_777118 | 3.11 |
ENST00000562141.1
|
HAGHL
|
hydroxyacylglutathione hydrolase-like |
| chr8_-_110704014 | 3.10 |
ENST00000529190.1
ENST00000422135.1 ENST00000419099.1 |
SYBU
|
syntabulin (syntaxin-interacting) |
| chr14_+_100259666 | 3.10 |
ENST00000262233.6
ENST00000334192.4 |
EML1
|
echinoderm microtubule associated protein like 1 |
| chr14_+_96858433 | 3.10 |
ENST00000267584.4
|
AK7
|
adenylate kinase 7 |
| chr13_+_37006398 | 3.10 |
ENST00000418263.1
|
CCNA1
|
cyclin A1 |
| chr9_+_96338860 | 3.09 |
ENST00000375376.4
|
PHF2
|
PHD finger protein 2 |
| chr11_-_34937858 | 3.08 |
ENST00000278359.5
|
APIP
|
APAF1 interacting protein |
| chr3_+_97483572 | 3.07 |
ENST00000335979.2
ENST00000394206.1 |
ARL6
|
ADP-ribosylation factor-like 6 |
| chr14_-_65438865 | 3.07 |
ENST00000267512.5
|
RAB15
|
RAB15, member RAS oncogene family |
| chr6_-_43478239 | 3.06 |
ENST00000372441.1
|
LRRC73
|
leucine rich repeat containing 73 |
| chr5_+_156693159 | 3.02 |
ENST00000347377.6
|
CYFIP2
|
cytoplasmic FMR1 interacting protein 2 |
| chr20_-_3154162 | 2.99 |
ENST00000360342.3
|
LZTS3
|
Homo sapiens leucine zipper, putative tumor suppressor family member 3 (LZTS3), mRNA. |
| chr9_+_96338647 | 2.97 |
ENST00000359246.4
|
PHF2
|
PHD finger protein 2 |
| chr17_-_56065484 | 2.96 |
ENST00000581208.1
|
VEZF1
|
vascular endothelial zinc finger 1 |
| chr20_+_31870927 | 2.96 |
ENST00000253354.1
|
BPIFB1
|
BPI fold containing family B, member 1 |
| chr3_+_108308513 | 2.96 |
ENST00000361582.3
|
DZIP3
|
DAZ interacting zinc finger protein 3 |
| chr22_-_50970919 | 2.93 |
ENST00000329363.4
ENST00000437588.1 |
ODF3B
|
outer dense fiber of sperm tails 3B |
| chr11_+_101918153 | 2.93 |
ENST00000434758.2
ENST00000526781.1 ENST00000534360.1 |
C11orf70
|
chromosome 11 open reading frame 70 |
| chr2_+_8822113 | 2.93 |
ENST00000396290.1
ENST00000331129.3 |
ID2
|
inhibitor of DNA binding 2, dominant negative helix-loop-helix protein |
| chr13_+_37006421 | 2.92 |
ENST00000255465.4
|
CCNA1
|
cyclin A1 |
| chr16_+_84209539 | 2.92 |
ENST00000569735.1
|
DNAAF1
|
dynein, axonemal, assembly factor 1 |
| chr1_+_118148556 | 2.91 |
ENST00000369448.3
|
FAM46C
|
family with sequence similarity 46, member C |
| chr2_+_120189422 | 2.91 |
ENST00000306406.4
|
TMEM37
|
transmembrane protein 37 |
| chr17_-_4689649 | 2.91 |
ENST00000441199.2
ENST00000416307.2 |
VMO1
|
vitelline membrane outer layer 1 homolog (chicken) |
| chr17_-_19281203 | 2.91 |
ENST00000487415.2
|
B9D1
|
B9 protein domain 1 |
| chr11_+_86511549 | 2.90 |
ENST00000533902.2
|
PRSS23
|
protease, serine, 23 |
| chr2_+_106682103 | 2.89 |
ENST00000238044.3
|
C2orf40
|
chromosome 2 open reading frame 40 |
| chr9_-_117150243 | 2.88 |
ENST00000374088.3
|
AKNA
|
AT-hook transcription factor |
| chr10_-_123357598 | 2.88 |
ENST00000358487.5
ENST00000369058.3 ENST00000369060.4 ENST00000359354.2 |
FGFR2
|
fibroblast growth factor receptor 2 |
| chr9_+_34458771 | 2.88 |
ENST00000437363.1
ENST00000242317.4 |
DNAI1
|
dynein, axonemal, intermediate chain 1 |
| chrX_-_8700171 | 2.88 |
ENST00000262648.3
|
KAL1
|
Kallmann syndrome 1 sequence |
| chr12_+_56661033 | 2.87 |
ENST00000433805.2
|
COQ10A
|
coenzyme Q10 homolog A (S. cerevisiae) |
| chr7_-_102715172 | 2.86 |
ENST00000456695.1
ENST00000455112.2 ENST00000440067.1 |
FBXL13
|
F-box and leucine-rich repeat protein 13 |
| chr2_+_102759199 | 2.85 |
ENST00000409288.1
ENST00000410023.1 |
IL1R1
|
interleukin 1 receptor, type I |
| chr3_+_113666748 | 2.85 |
ENST00000330212.3
ENST00000498275.1 |
ZDHHC23
|
zinc finger, DHHC-type containing 23 |
| chr5_+_35617940 | 2.82 |
ENST00000282469.6
ENST00000509059.1 ENST00000356031.3 ENST00000510777.1 |
SPEF2
|
sperm flagellar 2 |
| chr11_+_66045634 | 2.82 |
ENST00000528852.1
ENST00000311445.6 |
CNIH2
|
cornichon family AMPA receptor auxiliary protein 2 |
| chr16_-_52580920 | 2.82 |
ENST00000219746.9
|
TOX3
|
TOX high mobility group box family member 3 |
| chr1_+_3598871 | 2.81 |
ENST00000603362.1
ENST00000604479.1 |
TP73
|
tumor protein p73 |
| chr3_+_138327542 | 2.79 |
ENST00000360570.3
ENST00000393035.2 |
FAIM
|
Fas apoptotic inhibitory molecule |
| chr11_+_125757556 | 2.78 |
ENST00000526028.1
|
HYLS1
|
hydrolethalus syndrome 1 |
| chr10_+_120789223 | 2.78 |
ENST00000425699.1
|
NANOS1
|
nanos homolog 1 (Drosophila) |
| chr19_-_55672037 | 2.78 |
ENST00000588076.1
|
DNAAF3
|
dynein, axonemal, assembly factor 3 |
| chr1_-_173991434 | 2.78 |
ENST00000367696.2
|
RC3H1
|
ring finger and CCCH-type domains 1 |
| chr13_+_24153488 | 2.77 |
ENST00000382258.4
ENST00000382263.3 |
TNFRSF19
|
tumor necrosis factor receptor superfamily, member 19 |
| chr8_+_144099914 | 2.77 |
ENST00000521699.1
ENST00000520531.1 ENST00000520466.1 ENST00000521003.1 ENST00000522528.1 ENST00000522971.1 ENST00000519611.1 ENST00000521182.1 ENST00000519546.1 ENST00000523847.1 ENST00000522024.1 |
LY6E
|
lymphocyte antigen 6 complex, locus E |
| chr5_+_156693091 | 2.77 |
ENST00000318218.6
ENST00000442283.2 ENST00000522463.1 ENST00000521420.1 |
CYFIP2
|
cytoplasmic FMR1 interacting protein 2 |
| chr12_+_122356488 | 2.76 |
ENST00000397454.2
|
WDR66
|
WD repeat domain 66 |
| chr22_-_51222070 | 2.76 |
ENST00000395593.3
ENST00000395598.3 ENST00000435118.1 ENST00000395591.1 ENST00000395595.3 |
RABL2B
|
RAB, member of RAS oncogene family-like 2B |
| chr1_+_36549676 | 2.74 |
ENST00000207457.3
|
TEKT2
|
tektin 2 (testicular) |
| chr19_+_17337473 | 2.74 |
ENST00000598068.1
|
OCEL1
|
occludin/ELL domain containing 1 |
Network of associatons between targets according to the STRING database.
First level regulatory network of ZNF711_TFAP2A_TFAP2D
Gene Ontology Analysis
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 4.5 | 22.4 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 4.4 | 17.6 | GO:0072139 | glomerular parietal epithelial cell differentiation(GO:0072139) |
| 2.1 | 6.2 | GO:1904897 | regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 2.0 | 6.1 | GO:0061188 | negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 2.0 | 6.1 | GO:1903410 | lysine import(GO:0034226) L-lysine import(GO:0061461) L-lysine import into cell(GO:1903410) |
| 1.9 | 5.8 | GO:0034059 | response to anoxia(GO:0034059) |
| 1.9 | 7.6 | GO:0070662 | mast cell proliferation(GO:0070662) |
| 1.9 | 5.7 | GO:1903568 | negative regulation of protein localization to cilium(GO:1903565) regulation of protein localization to ciliary membrane(GO:1903567) negative regulation of protein localization to ciliary membrane(GO:1903568) |
| 1.9 | 7.5 | GO:0072134 | nephrogenic mesenchyme morphogenesis(GO:0072134) |
| 1.9 | 7.4 | GO:0051892 | negative regulation of cardioblast differentiation(GO:0051892) regulation of cardiac muscle cell myoblast differentiation(GO:2000690) negative regulation of cardiac muscle cell myoblast differentiation(GO:2000691) |
| 1.9 | 1.9 | GO:0051255 | spindle midzone assembly(GO:0051255) |
| 1.8 | 8.8 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 1.7 | 5.2 | GO:0035604 | fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) |
| 1.6 | 1.6 | GO:0060411 | cardiac septum morphogenesis(GO:0060411) |
| 1.5 | 4.6 | GO:2000661 | positive regulation of interleukin-1-mediated signaling pathway(GO:2000661) |
| 1.5 | 7.6 | GO:0015670 | carbon dioxide transport(GO:0015670) |
| 1.5 | 4.5 | GO:0035283 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| 1.4 | 1.4 | GO:0010634 | positive regulation of epithelial cell migration(GO:0010634) |
| 1.4 | 47.4 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
| 1.3 | 5.3 | GO:0035720 | intraciliary anterograde transport(GO:0035720) |
| 1.3 | 14.3 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 1.3 | 3.8 | GO:0045976 | negative regulation of mitotic cell cycle, embryonic(GO:0045976) |
| 1.3 | 3.8 | GO:0050760 | negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
| 1.3 | 5.0 | GO:0097089 | methyl-branched fatty acid metabolic process(GO:0097089) |
| 1.3 | 3.8 | GO:0016260 | selenocysteine biosynthetic process(GO:0016260) |
| 1.2 | 8.7 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
| 1.2 | 6.2 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 1.2 | 3.7 | GO:0061181 | regulation of chondrocyte development(GO:0061181) |
| 1.2 | 2.3 | GO:0098935 | dendritic transport(GO:0098935) anterograde dendritic transport(GO:0098937) |
| 1.2 | 3.5 | GO:2000276 | negative regulation of oxidative phosphorylation uncoupler activity(GO:2000276) |
| 1.1 | 3.4 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 1.1 | 6.8 | GO:1904381 | Golgi apparatus mannose trimming(GO:1904381) |
| 1.1 | 2.2 | GO:0061183 | dermatome development(GO:0061054) regulation of dermatome development(GO:0061183) |
| 1.1 | 3.4 | GO:0071893 | apoptotic process involved in endocardial cushion morphogenesis(GO:0003277) intermediate mesoderm morphogenesis(GO:0048390) intermediate mesoderm formation(GO:0048391) intermediate mesodermal cell differentiation(GO:0048392) regulation of cardiac muscle fiber development(GO:0055018) positive regulation of cardiac muscle fiber development(GO:0055020) bud dilation involved in lung branching(GO:0060503) BMP signaling pathway involved in ureter morphogenesis(GO:0061149) renal system segmentation(GO:0061150) BMP signaling pathway involved in renal system segmentation(GO:0061151) pulmonary artery endothelial tube morphogenesis(GO:0061155) regulation of transcription from RNA polymerase II promoter involved in mesonephros development(GO:0061216) BMP signaling pathway involved in nephric duct formation(GO:0071893) negative regulation of branch elongation involved in ureteric bud branching(GO:0072096) negative regulation of branch elongation involved in ureteric bud branching by BMP signaling pathway(GO:0072097) anterior/posterior pattern specification involved in ureteric bud development(GO:0072099) specification of ureteric bud anterior/posterior symmetry(GO:0072100) specification of ureteric bud anterior/posterior symmetry by BMP signaling pathway(GO:0072101) ureter epithelial cell differentiation(GO:0072192) negative regulation of mesenchymal cell proliferation involved in ureter development(GO:0072200) regulation of cell proliferation involved in outflow tract morphogenesis(GO:1901963) positive regulation of cell proliferation involved in outflow tract morphogenesis(GO:1901964) cardiac jelly development(GO:1905072) regulation of metanephric S-shaped body morphogenesis(GO:2000004) negative regulation of metanephric S-shaped body morphogenesis(GO:2000005) regulation of metanephric comma-shaped body morphogenesis(GO:2000006) negative regulation of metanephric comma-shaped body morphogenesis(GO:2000007) |
| 1.1 | 4.5 | GO:1903445 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 1.1 | 1.1 | GO:0098751 | bone cell development(GO:0098751) |
| 1.1 | 3.3 | GO:0042351 | 'de novo' GDP-L-fucose biosynthetic process(GO:0042351) |
| 1.1 | 2.2 | GO:1904760 | myofibroblast differentiation(GO:0036446) regulation of myofibroblast differentiation(GO:1904760) |
| 1.1 | 3.3 | GO:0003147 | neural crest cell migration involved in heart formation(GO:0003147) anterior neural tube closure(GO:0061713) |
| 1.0 | 3.1 | GO:2001303 | lipoxin biosynthetic process(GO:2001301) lipoxin A4 metabolic process(GO:2001302) lipoxin A4 biosynthetic process(GO:2001303) |
| 1.0 | 23.7 | GO:0035082 | axoneme assembly(GO:0035082) |
| 1.0 | 3.1 | GO:1903348 | positive regulation of bicellular tight junction assembly(GO:1903348) |
| 1.0 | 5.1 | GO:0006203 | dGTP catabolic process(GO:0006203) |
| 1.0 | 3.0 | GO:0032203 | telomere formation via telomerase(GO:0032203) |
| 1.0 | 13.0 | GO:0021853 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 1.0 | 3.0 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
| 1.0 | 2.9 | GO:0006864 | pyrimidine nucleotide transport(GO:0006864) mitochondrial pyrimidine nucleotide import(GO:1990519) |
| 1.0 | 16.5 | GO:0003351 | epithelial cilium movement(GO:0003351) |
| 1.0 | 3.9 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.9 | 3.8 | GO:0097195 | pilomotor reflex(GO:0097195) |
| 0.9 | 0.9 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
| 0.9 | 3.6 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.9 | 0.9 | GO:0031990 | mRNA export from nucleus in response to heat stress(GO:0031990) |
| 0.9 | 1.7 | GO:0003099 | positive regulation of the force of heart contraction by chemical signal(GO:0003099) |
| 0.8 | 4.2 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) |
| 0.8 | 17.5 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
| 0.8 | 2.5 | GO:0060279 | regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
| 0.8 | 4.1 | GO:0002415 | immunoglobulin transcytosis in epithelial cells mediated by polymeric immunoglobulin receptor(GO:0002415) |
| 0.8 | 4.1 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.8 | 8.3 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
| 0.8 | 15.2 | GO:0003341 | cilium movement(GO:0003341) |
| 0.8 | 3.9 | GO:1901093 | regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
| 0.8 | 2.3 | GO:1904868 | telomerase catalytic core complex assembly(GO:1904868) regulation of telomerase catalytic core complex assembly(GO:1904882) positive regulation of telomerase catalytic core complex assembly(GO:1904884) |
| 0.7 | 3.0 | GO:0006850 | mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
| 0.7 | 3.7 | GO:0071500 | cellular response to nitrosative stress(GO:0071500) |
| 0.7 | 2.9 | GO:0061030 | epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
| 0.7 | 7.2 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.7 | 2.9 | GO:0000255 | allantoin metabolic process(GO:0000255) |
| 0.7 | 5.0 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.7 | 2.9 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.7 | 2.1 | GO:0032053 | ciliary basal body organization(GO:0032053) |
| 0.7 | 8.5 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
| 0.7 | 2.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.7 | 2.8 | GO:0043335 | protein unfolding(GO:0043335) |
| 0.7 | 5.6 | GO:0018317 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.7 | 0.7 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.7 | 1.4 | GO:2000563 | positive regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000563) |
| 0.7 | 0.7 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
| 0.7 | 2.1 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.7 | 2.1 | GO:0019243 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.7 | 4.8 | GO:0097338 | response to clozapine(GO:0097338) |
| 0.7 | 2.0 | GO:0021919 | BMP signaling pathway involved in spinal cord dorsal/ventral patterning(GO:0021919) |
| 0.7 | 8.8 | GO:0044458 | motile cilium assembly(GO:0044458) |
| 0.7 | 1.3 | GO:0038202 | TORC1 signaling(GO:0038202) |
| 0.7 | 6.0 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
| 0.7 | 7.3 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
| 0.7 | 0.7 | GO:1990441 | negative regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990441) |
| 0.7 | 3.3 | GO:0000973 | posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
| 0.6 | 2.6 | GO:0046452 | dihydrofolate metabolic process(GO:0046452) |
| 0.6 | 1.9 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
| 0.6 | 3.9 | GO:0010731 | protein glutathionylation(GO:0010731) regulation of protein glutathionylation(GO:0010732) negative regulation of protein glutathionylation(GO:0010734) |
| 0.6 | 1.9 | GO:1904048 | regulation of spontaneous neurotransmitter secretion(GO:1904048) |
| 0.6 | 1.3 | GO:1903400 | L-arginine transmembrane transport(GO:1903400) |
| 0.6 | 3.8 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.6 | 31.8 | GO:0042073 | intraciliary transport(GO:0042073) |
| 0.6 | 2.5 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
| 0.6 | 0.6 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
| 0.6 | 0.6 | GO:0042137 | sequestering of neurotransmitter(GO:0042137) |
| 0.6 | 1.9 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.6 | 1.9 | GO:0032223 | negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 0.6 | 1.9 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.6 | 3.1 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
| 0.6 | 1.9 | GO:1902356 | thiosulfate transport(GO:0015709) oxaloacetate transport(GO:0015729) malate transport(GO:0015743) malate transmembrane transport(GO:0071423) oxaloacetate(2-) transmembrane transport(GO:1902356) |
| 0.6 | 1.9 | GO:1900159 | iron assimilation(GO:0033212) iron assimilation by chelation and transport(GO:0033214) positive regulation of bone mineralization involved in bone maturation(GO:1900159) negative regulation of tumor necrosis factor (ligand) superfamily member 11 production(GO:2000308) |
| 0.6 | 0.6 | GO:0002519 | natural killer cell tolerance induction(GO:0002519) |
| 0.6 | 1.8 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
| 0.6 | 4.3 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.6 | 1.8 | GO:2000298 | regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
| 0.6 | 3.0 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.6 | 3.6 | GO:0045819 | positive regulation of glycogen catabolic process(GO:0045819) |
| 0.6 | 1.8 | GO:0003186 | tricuspid valve morphogenesis(GO:0003186) |
| 0.6 | 6.0 | GO:0002480 | antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
| 0.6 | 5.4 | GO:1990253 | cellular response to leucine starvation(GO:1990253) |
| 0.6 | 1.8 | GO:1902595 | regulation of DNA replication origin binding(GO:1902595) |
| 0.6 | 0.6 | GO:0021903 | rostrocaudal neural tube patterning(GO:0021903) |
| 0.6 | 0.6 | GO:0070602 | regulation of centromeric sister chromatid cohesion(GO:0070602) |
| 0.6 | 0.6 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.6 | 0.6 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.6 | 2.4 | GO:0097676 | histone H3-K36 dimethylation(GO:0097676) |
| 0.6 | 1.2 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.6 | 0.6 | GO:0035668 | TRAM-dependent toll-like receptor signaling pathway(GO:0035668) TRAM-dependent toll-like receptor 4 signaling pathway(GO:0035669) |
| 0.6 | 1.7 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.6 | 2.3 | GO:0072086 | specification of loop of Henle identity(GO:0072086) |
| 0.6 | 2.9 | GO:0019075 | virus maturation(GO:0019075) |
| 0.6 | 1.7 | GO:0097032 | respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 0.6 | 2.3 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.6 | 1.7 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.6 | 2.8 | GO:0072312 | metanephric glomerular epithelium development(GO:0072244) metanephric glomerular visceral epithelial cell differentiation(GO:0072248) metanephric glomerular visceral epithelial cell development(GO:0072249) metanephric glomerular epithelial cell differentiation(GO:0072312) metanephric glomerular epithelial cell development(GO:0072313) |
| 0.6 | 1.1 | GO:0071655 | granulocyte colony-stimulating factor production(GO:0071611) regulation of granulocyte colony-stimulating factor production(GO:0071655) |
| 0.6 | 3.9 | GO:0000710 | meiotic mismatch repair(GO:0000710) |
| 0.6 | 0.6 | GO:0030200 | proteoglycan catabolic process(GO:0030167) heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.6 | 1.7 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.5 | 1.6 | GO:0021986 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.5 | 2.7 | GO:0060633 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) |
| 0.5 | 2.2 | GO:0002086 | diaphragm contraction(GO:0002086) |
| 0.5 | 1.6 | GO:0043105 | regulation of GTP cyclohydrolase I activity(GO:0043095) negative regulation of GTP cyclohydrolase I activity(GO:0043105) |
| 0.5 | 1.6 | GO:0045897 | positive regulation of transcription during mitosis(GO:0045897) |
| 0.5 | 3.2 | GO:0014038 | regulation of Schwann cell differentiation(GO:0014038) |
| 0.5 | 3.2 | GO:0061518 | macrophage proliferation(GO:0061517) microglial cell proliferation(GO:0061518) regulation of neuronal signal transduction(GO:1902847) positive regulation of neurofibrillary tangle assembly(GO:1902998) |
| 0.5 | 2.7 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.5 | 2.2 | GO:0035521 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
| 0.5 | 0.5 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
| 0.5 | 2.1 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.5 | 2.7 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.5 | 1.6 | GO:0009446 | putrescine biosynthetic process(GO:0009446) |
| 0.5 | 3.7 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.5 | 3.2 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.5 | 1.6 | GO:0035470 | positive regulation of vascular wound healing(GO:0035470) |
| 0.5 | 2.1 | GO:0006542 | glutamine biosynthetic process(GO:0006542) |
| 0.5 | 0.5 | GO:0046642 | negative regulation of alpha-beta T cell proliferation(GO:0046642) |
| 0.5 | 1.6 | GO:1905007 | positive regulation of epithelial to mesenchymal transition involved in endocardial cushion formation(GO:1905007) |
| 0.5 | 1.6 | GO:0006679 | glucosylceramide biosynthetic process(GO:0006679) |
| 0.5 | 4.7 | GO:0071798 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
| 0.5 | 6.3 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.5 | 1.5 | GO:0070904 | L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
| 0.5 | 4.1 | GO:1990416 | cellular response to brain-derived neurotrophic factor stimulus(GO:1990416) |
| 0.5 | 2.1 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.5 | 4.6 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.5 | 8.6 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
| 0.5 | 3.5 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
| 0.5 | 1.5 | GO:0035935 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
| 0.5 | 1.5 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) fasciculation of motor neuron axon(GO:0097156) |
| 0.5 | 3.5 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.5 | 3.0 | GO:0006083 | acetate metabolic process(GO:0006083) |
| 0.5 | 2.5 | GO:0046223 | mycotoxin catabolic process(GO:0043387) aflatoxin catabolic process(GO:0046223) organic heteropentacyclic compound catabolic process(GO:1901377) regulation of glutathione biosynthetic process(GO:1903786) positive regulation of glutathione biosynthetic process(GO:1903788) |
| 0.5 | 3.5 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
| 0.5 | 1.0 | GO:0043634 | polyadenylation-dependent RNA catabolic process(GO:0043633) polyadenylation-dependent ncRNA catabolic process(GO:0043634) |
| 0.5 | 1.5 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.5 | 1.9 | GO:0042986 | positive regulation of amyloid precursor protein biosynthetic process(GO:0042986) |
| 0.5 | 1.0 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.5 | 0.5 | GO:0072019 | proximal convoluted tubule development(GO:0072019) metanephric proximal convoluted tubule development(GO:0072229) |
| 0.5 | 1.0 | GO:0033591 | response to L-ascorbic acid(GO:0033591) |
| 0.5 | 1.4 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.5 | 1.4 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 0.5 | 4.8 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.5 | 3.3 | GO:0023021 | termination of signal transduction(GO:0023021) |
| 0.5 | 2.4 | GO:0061055 | myotome development(GO:0061055) |
| 0.5 | 0.5 | GO:0006925 | inflammatory cell apoptotic process(GO:0006925) |
| 0.5 | 2.3 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
| 0.5 | 2.3 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
| 0.5 | 0.5 | GO:0060061 | Spemann organizer formation(GO:0060061) |
| 0.5 | 2.8 | GO:0032380 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.5 | 1.4 | GO:0090076 | relaxation of skeletal muscle(GO:0090076) |
| 0.5 | 2.8 | GO:0006014 | D-ribose metabolic process(GO:0006014) |
| 0.5 | 3.7 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) |
| 0.5 | 1.4 | GO:0006669 | sphinganine-1-phosphate biosynthetic process(GO:0006669) |
| 0.5 | 2.8 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.5 | 3.2 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.5 | 0.5 | GO:1902037 | negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
| 0.5 | 3.2 | GO:0048104 | establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 0.5 | 1.4 | GO:0048203 | vesicle targeting, trans-Golgi to endosome(GO:0048203) |
| 0.5 | 0.9 | GO:0045925 | positive regulation of female receptivity(GO:0045925) |
| 0.5 | 1.8 | GO:0060434 | bronchus morphogenesis(GO:0060434) |
| 0.5 | 2.7 | GO:0003190 | atrioventricular valve formation(GO:0003190) |
| 0.5 | 2.3 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
| 0.5 | 2.7 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 0.5 | 2.3 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.4 | 1.8 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
| 0.4 | 1.3 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
| 0.4 | 2.2 | GO:0034144 | negative regulation of toll-like receptor 4 signaling pathway(GO:0034144) |
| 0.4 | 10.7 | GO:1901663 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.4 | 2.7 | GO:1904031 | positive regulation of cyclin-dependent protein kinase activity(GO:1904031) |
| 0.4 | 1.3 | GO:0046075 | dTTP metabolic process(GO:0046075) |
| 0.4 | 1.3 | GO:0033504 | floor plate development(GO:0033504) |
| 0.4 | 2.2 | GO:1901159 | glucuronate catabolic process(GO:0006064) glucuronate catabolic process to xylulose 5-phosphate(GO:0019640) xylulose 5-phosphate metabolic process(GO:0051167) xylulose 5-phosphate biosynthetic process(GO:1901159) |
| 0.4 | 3.5 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.4 | 1.3 | GO:0032240 | negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.4 | 1.7 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) |
| 0.4 | 0.9 | GO:0060994 | regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 0.4 | 2.6 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
| 0.4 | 0.4 | GO:0072098 | intermediate mesoderm development(GO:0048389) pattern specification involved in mesonephros development(GO:0061227) anterior/posterior pattern specification involved in kidney development(GO:0072098) |
| 0.4 | 1.3 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
| 0.4 | 0.4 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
| 0.4 | 4.3 | GO:0015677 | copper ion import(GO:0015677) |
| 0.4 | 6.0 | GO:0006108 | malate metabolic process(GO:0006108) |
| 0.4 | 0.4 | GO:0015883 | FAD transport(GO:0015883) FAD transmembrane transport(GO:0035350) |
| 0.4 | 1.3 | GO:1900039 | positive regulation of cellular response to hypoxia(GO:1900039) |
| 0.4 | 0.4 | GO:0048254 | snoRNA localization(GO:0048254) |
| 0.4 | 7.0 | GO:0071850 | mitotic cell cycle arrest(GO:0071850) |
| 0.4 | 10.8 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
| 0.4 | 3.3 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.4 | 2.1 | GO:0022029 | telencephalon cell migration(GO:0022029) |
| 0.4 | 0.4 | GO:0060734 | regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:0060734) |
| 0.4 | 2.1 | GO:0048165 | ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.4 | 3.3 | GO:1990504 | dense core granule exocytosis(GO:1990504) |
| 0.4 | 1.2 | GO:1901253 | negative regulation of intracellular transport of viral material(GO:1901253) |
| 0.4 | 6.1 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.4 | 1.2 | GO:0043602 | nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) |
| 0.4 | 2.9 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.4 | 1.2 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.4 | 1.2 | GO:0045362 | regulation of interleukin-1 biosynthetic process(GO:0045360) positive regulation of interleukin-1 biosynthetic process(GO:0045362) |
| 0.4 | 2.4 | GO:0071105 | response to interleukin-11(GO:0071105) |
| 0.4 | 0.8 | GO:0072204 | cell-cell signaling involved in kidney development(GO:0060995) Wnt signaling pathway involved in kidney development(GO:0061289) canonical Wnt signaling pathway involved in metanephric kidney development(GO:0061290) cell-cell signaling involved in metanephros development(GO:0072204) |
| 0.4 | 2.0 | GO:0019255 | glucose 1-phosphate metabolic process(GO:0019255) |
| 0.4 | 2.0 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.4 | 1.2 | GO:0071371 | cellular response to gonadotropin stimulus(GO:0071371) |
| 0.4 | 1.6 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.4 | 0.8 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.4 | 1.2 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) |
| 0.4 | 10.2 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.4 | 0.4 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.4 | 0.8 | GO:0034184 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.4 | 10.1 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.4 | 9.3 | GO:0016254 | preassembly of GPI anchor in ER membrane(GO:0016254) |
| 0.4 | 1.5 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
| 0.4 | 1.2 | GO:0052151 | positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation of apoptotic process by virus(GO:0060139) |
| 0.4 | 1.2 | GO:0090156 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.4 | 1.2 | GO:0002894 | positive regulation of type IIa hypersensitivity(GO:0001798) positive regulation of type II hypersensitivity(GO:0002894) |
| 0.4 | 9.2 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.4 | 0.4 | GO:0042994 | cytoplasmic sequestering of transcription factor(GO:0042994) |
| 0.4 | 0.4 | GO:0034140 | negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) |
| 0.4 | 4.9 | GO:0006273 | lagging strand elongation(GO:0006273) |
| 0.4 | 0.4 | GO:2000584 | regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000583) negative regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000584) |
| 0.4 | 0.8 | GO:0002528 | regulation of vascular permeability involved in acute inflammatory response(GO:0002528) |
| 0.4 | 1.1 | GO:0042727 | flavin-containing compound biosynthetic process(GO:0042727) |
| 0.4 | 0.8 | GO:0036102 | leukotriene catabolic process(GO:0036100) leukotriene B4 catabolic process(GO:0036101) leukotriene B4 metabolic process(GO:0036102) icosanoid catabolic process(GO:1901523) fatty acid derivative catabolic process(GO:1901569) |
| 0.4 | 0.4 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
| 0.4 | 1.5 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
| 0.4 | 1.9 | GO:2000980 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.4 | 0.7 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.4 | 0.4 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
| 0.4 | 1.1 | GO:0019521 | aldonic acid metabolic process(GO:0019520) D-gluconate metabolic process(GO:0019521) |
| 0.4 | 1.5 | GO:0097045 | phosphatidylserine exposure on blood platelet(GO:0097045) |
| 0.4 | 1.8 | GO:1900920 | regulation of amino acid uptake involved in synaptic transmission(GO:0051941) regulation of glutamate uptake involved in transmission of nerve impulse(GO:0051946) regulation of L-glutamate import(GO:1900920) |
| 0.4 | 1.8 | GO:1903976 | negative regulation of glial cell migration(GO:1903976) |
| 0.4 | 0.4 | GO:0048302 | isotype switching to IgG isotypes(GO:0048291) regulation of isotype switching to IgG isotypes(GO:0048302) |
| 0.4 | 1.8 | GO:0061760 | antifungal innate immune response(GO:0061760) |
| 0.4 | 1.1 | GO:1902303 | negative regulation of potassium ion export(GO:1902303) |
| 0.4 | 1.1 | GO:0002184 | cytoplasmic translational termination(GO:0002184) |
| 0.4 | 1.1 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.4 | 0.4 | GO:0072237 | metanephric proximal tubule development(GO:0072237) |
| 0.4 | 1.8 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.4 | 0.4 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.4 | 1.4 | GO:0045872 | positive regulation of rhodopsin gene expression(GO:0045872) |
| 0.4 | 0.4 | GO:2000366 | regulation of STAT protein import into nucleus(GO:2000364) positive regulation of STAT protein import into nucleus(GO:2000366) |
| 0.4 | 0.7 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
| 0.4 | 2.8 | GO:0060180 | female mating behavior(GO:0060180) |
| 0.4 | 2.8 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.4 | 2.8 | GO:0072733 | response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
| 0.4 | 0.4 | GO:0097201 | negative regulation of transcription from RNA polymerase II promoter in response to stress(GO:0097201) |
| 0.4 | 1.1 | GO:1902824 | positive regulation of late endosome to lysosome transport(GO:1902824) |
| 0.3 | 0.3 | GO:0071469 | cellular response to alkaline pH(GO:0071469) |
| 0.3 | 1.7 | GO:1900133 | regulation of renin secretion into blood stream(GO:1900133) |
| 0.3 | 1.4 | GO:0006740 | NADPH regeneration(GO:0006740) |
| 0.3 | 1.0 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.3 | 0.7 | GO:0000491 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) |
| 0.3 | 0.3 | GO:0097485 | neuron projection guidance(GO:0097485) |
| 0.3 | 1.4 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
| 0.3 | 0.3 | GO:0072053 | renal inner medulla development(GO:0072053) renal outer medulla development(GO:0072054) |
| 0.3 | 5.5 | GO:0003084 | positive regulation of systemic arterial blood pressure(GO:0003084) |
| 0.3 | 1.0 | GO:0021836 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) chemorepulsion involved in postnatal olfactory bulb interneuron migration(GO:0021836) |
| 0.3 | 2.1 | GO:1901300 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) |
| 0.3 | 0.3 | GO:0071284 | cellular response to lead ion(GO:0071284) |
| 0.3 | 3.1 | GO:0045023 | G0 to G1 transition(GO:0045023) |
| 0.3 | 0.7 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
| 0.3 | 3.1 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
| 0.3 | 0.3 | GO:0021897 | forebrain astrocyte differentiation(GO:0021896) forebrain astrocyte development(GO:0021897) |
| 0.3 | 1.7 | GO:0043328 | protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.3 | 1.4 | GO:0016598 | protein arginylation(GO:0016598) |
| 0.3 | 1.7 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.3 | 0.7 | GO:0035739 | CD4-positive, alpha-beta T cell proliferation(GO:0035739) regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.3 | 2.7 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.3 | 0.7 | GO:0036215 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
| 0.3 | 0.7 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.3 | 0.7 | GO:1904204 | regulation of skeletal muscle hypertrophy(GO:1904204) |
| 0.3 | 1.7 | GO:0061741 | vacuolar transmembrane transport(GO:0034486) chaperone-mediated protein transport involved in chaperone-mediated autophagy(GO:0061741) negative regulation of fibril organization(GO:1902904) chaperone-mediated autophagy translocation complex disassembly(GO:1904764) |
| 0.3 | 0.7 | GO:0006780 | uroporphyrinogen III biosynthetic process(GO:0006780) uroporphyrinogen III metabolic process(GO:0046502) |
| 0.3 | 1.0 | GO:1990108 | protein linear deubiquitination(GO:1990108) |
| 0.3 | 0.3 | GO:0030575 | nuclear body organization(GO:0030575) |
| 0.3 | 2.0 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
| 0.3 | 0.7 | GO:0006338 | chromatin remodeling(GO:0006338) |
| 0.3 | 4.2 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.3 | 0.6 | GO:1901620 | regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901620) |
| 0.3 | 5.1 | GO:1902260 | negative regulation of delayed rectifier potassium channel activity(GO:1902260) |
| 0.3 | 1.3 | GO:1900224 | positive regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900224) |
| 0.3 | 1.3 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.3 | 1.6 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
| 0.3 | 1.0 | GO:1902528 | regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 0.3 | 0.3 | GO:0051450 | myoblast proliferation(GO:0051450) |
| 0.3 | 1.3 | GO:0002503 | peptide antigen assembly with MHC class II protein complex(GO:0002503) |
| 0.3 | 0.9 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
| 0.3 | 0.9 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.3 | 0.3 | GO:0061010 | gall bladder development(GO:0061010) |
| 0.3 | 2.8 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
| 0.3 | 1.3 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
| 0.3 | 0.3 | GO:0046619 | optic placode formation involved in camera-type eye formation(GO:0046619) |
| 0.3 | 1.2 | GO:0042126 | nitrate metabolic process(GO:0042126) |
| 0.3 | 1.9 | GO:0061083 | regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) |
| 0.3 | 1.6 | GO:0014004 | microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.3 | 4.7 | GO:0070314 | G1 to G0 transition(GO:0070314) |
| 0.3 | 1.2 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
| 0.3 | 2.8 | GO:1902412 | regulation of mitotic cytokinesis(GO:1902412) |
| 0.3 | 0.9 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.3 | 4.0 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.3 | 5.8 | GO:0009437 | carnitine metabolic process(GO:0009437) |
| 0.3 | 4.3 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
| 0.3 | 0.9 | GO:0001781 | neutrophil apoptotic process(GO:0001781) regulation of neutrophil apoptotic process(GO:0033029) |
| 0.3 | 0.3 | GO:0015917 | aminophospholipid transport(GO:0015917) |
| 0.3 | 0.3 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.3 | 1.5 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
| 0.3 | 2.4 | GO:0070091 | glucagon secretion(GO:0070091) regulation of glucagon secretion(GO:0070092) |
| 0.3 | 0.9 | GO:1904247 | positive regulation of polynucleotide adenylyltransferase activity(GO:1904247) |
| 0.3 | 2.4 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.3 | 1.2 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) |
| 0.3 | 0.3 | GO:0002589 | regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) negative regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002590) |
| 0.3 | 1.2 | GO:0034224 | cellular response to zinc ion starvation(GO:0034224) |
| 0.3 | 0.6 | GO:0006404 | RNA import into nucleus(GO:0006404) |
| 0.3 | 5.7 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.3 | 1.8 | GO:0015853 | adenine transport(GO:0015853) |
| 0.3 | 0.9 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.3 | 1.2 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
| 0.3 | 0.3 | GO:0016048 | detection of temperature stimulus(GO:0016048) sensory perception of temperature stimulus(GO:0050951) |
| 0.3 | 1.5 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
| 0.3 | 0.9 | GO:0097327 | response to antineoplastic agent(GO:0097327) |
| 0.3 | 0.3 | GO:0060742 | epithelial cell differentiation involved in prostate gland development(GO:0060742) |
| 0.3 | 0.6 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.3 | 0.3 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
| 0.3 | 0.3 | GO:0031064 | negative regulation of histone deacetylation(GO:0031064) |
| 0.3 | 0.3 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
| 0.3 | 1.1 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
| 0.3 | 1.1 | GO:0006379 | mRNA cleavage(GO:0006379) |
| 0.3 | 0.8 | GO:0031548 | regulation of brain-derived neurotrophic factor receptor signaling pathway(GO:0031548) |
| 0.3 | 0.8 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
| 0.3 | 0.6 | GO:0008045 | motor neuron axon guidance(GO:0008045) |
| 0.3 | 0.3 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.3 | 0.8 | GO:0070781 | response to biotin(GO:0070781) |
| 0.3 | 1.1 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.3 | 1.7 | GO:0015798 | myo-inositol transport(GO:0015798) |
| 0.3 | 1.7 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.3 | 1.4 | GO:0035608 | protein deglutamylation(GO:0035608) |
| 0.3 | 2.8 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.3 | 0.8 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
| 0.3 | 1.1 | GO:1904199 | positive regulation of regulation of vascular smooth muscle cell membrane depolarization(GO:1904199) regulation of vascular smooth muscle cell membrane depolarization(GO:1990736) |
| 0.3 | 0.8 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 0.3 | 1.6 | GO:0070560 | protein secretion by platelet(GO:0070560) |
| 0.3 | 0.3 | GO:0009405 | pathogenesis(GO:0009405) |
| 0.3 | 0.8 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
| 0.3 | 0.8 | GO:0050822 | peptide stabilization(GO:0050822) peptide antigen stabilization(GO:0050823) |
| 0.3 | 3.3 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
| 0.3 | 2.2 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.3 | 3.3 | GO:0002115 | store-operated calcium entry(GO:0002115) |
| 0.3 | 1.6 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
| 0.3 | 1.4 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
| 0.3 | 1.1 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.3 | 0.3 | GO:1902074 | response to salt(GO:1902074) |
| 0.3 | 1.1 | GO:0009912 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
| 0.3 | 0.3 | GO:1900110 | negative regulation of histone H3-K9 dimethylation(GO:1900110) |
| 0.3 | 0.8 | GO:0060406 | positive regulation of penile erection(GO:0060406) |
| 0.3 | 0.3 | GO:0046368 | GDP-L-fucose metabolic process(GO:0046368) |
| 0.3 | 0.5 | GO:0032849 | positive regulation of cellular pH reduction(GO:0032849) |
| 0.3 | 0.8 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.3 | 0.8 | GO:0071106 | coenzyme A transport(GO:0015880) coenzyme A transmembrane transport(GO:0035349) adenosine 3',5'-bisphosphate transmembrane transport(GO:0071106) AMP transport(GO:0080121) |
| 0.3 | 0.8 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) positive regulation of calcium:sodium antiporter activity(GO:1903281) |
| 0.3 | 0.8 | GO:1901202 | negative regulation of extracellular matrix assembly(GO:1901202) |
| 0.3 | 0.8 | GO:2000521 | negative regulation of immunological synapse formation(GO:2000521) |
| 0.3 | 0.8 | GO:0014056 | acetylcholine secretion, neurotransmission(GO:0014055) regulation of acetylcholine secretion, neurotransmission(GO:0014056) acetylcholine secretion(GO:0061526) |
| 0.3 | 0.8 | GO:0032764 | negative regulation of mast cell cytokine production(GO:0032764) |
| 0.3 | 9.6 | GO:0015682 | ferric iron transport(GO:0015682) trivalent inorganic cation transport(GO:0072512) |
| 0.3 | 0.8 | GO:0061394 | regulation of transcription from RNA polymerase II promoter in response to arsenic-containing substance(GO:0061394) |
| 0.3 | 2.6 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
| 0.3 | 1.0 | GO:0035904 | aorta development(GO:0035904) |
| 0.3 | 9.5 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.3 | 5.4 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.3 | 2.8 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
| 0.3 | 4.6 | GO:0031441 | negative regulation of mRNA 3'-end processing(GO:0031441) |
| 0.3 | 5.1 | GO:0072189 | ureter development(GO:0072189) |
| 0.3 | 0.8 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.3 | 0.8 | GO:0060151 | peroxisome localization(GO:0060151) microtubule-based peroxisome localization(GO:0060152) |
| 0.3 | 0.8 | GO:0002143 | tRNA wobble position uridine thiolation(GO:0002143) |
| 0.3 | 0.5 | GO:0030185 | nitric oxide transport(GO:0030185) |
| 0.3 | 1.5 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.3 | 3.5 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.3 | 0.8 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) |
| 0.2 | 0.2 | GO:0034127 | regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034127) negative regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034128) |
| 0.2 | 1.2 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.2 | 3.2 | GO:0070072 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.2 | 2.7 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.2 | 1.5 | GO:0090267 | positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 0.2 | 1.7 | GO:0043570 | maintenance of DNA repeat elements(GO:0043570) |
| 0.2 | 0.5 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.2 | 1.5 | GO:0048298 | positive regulation of isotype switching to IgA isotypes(GO:0048298) |
| 0.2 | 1.5 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
| 0.2 | 0.7 | GO:0000821 | regulation of arginine metabolic process(GO:0000821) |
| 0.2 | 2.2 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.2 | 1.0 | GO:1990418 | response to insulin-like growth factor stimulus(GO:1990418) |
| 0.2 | 0.5 | GO:0010956 | negative regulation of calcidiol 1-monooxygenase activity(GO:0010956) |
| 0.2 | 0.7 | GO:0050902 | leukocyte adhesive activation(GO:0050902) |
| 0.2 | 0.2 | GO:1901374 | acetate ester transport(GO:1901374) |
| 0.2 | 2.4 | GO:0070862 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.2 | 0.5 | GO:0039019 | pronephric nephron development(GO:0039019) |
| 0.2 | 1.2 | GO:1900153 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.2 | 1.4 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
| 0.2 | 0.7 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.2 | 0.7 | GO:0043012 | regulation of fusion of sperm to egg plasma membrane(GO:0043012) |
| 0.2 | 3.5 | GO:0019336 | phenol-containing compound catabolic process(GO:0019336) |
| 0.2 | 0.7 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
| 0.2 | 0.9 | GO:0030242 | pexophagy(GO:0030242) |
| 0.2 | 0.2 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
| 0.2 | 0.5 | GO:0090148 | membrane fission(GO:0090148) |
| 0.2 | 0.5 | GO:1902732 | positive regulation of chondrocyte proliferation(GO:1902732) |
| 0.2 | 51.9 | GO:0060271 | cilium morphogenesis(GO:0060271) |
| 0.2 | 0.9 | GO:0010730 | negative regulation of hydrogen peroxide biosynthetic process(GO:0010730) |
| 0.2 | 0.7 | GO:0035404 | histone-serine phosphorylation(GO:0035404) |
| 0.2 | 1.1 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
| 0.2 | 0.7 | GO:0002296 | T-helper 1 cell lineage commitment(GO:0002296) |
| 0.2 | 2.3 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.2 | 0.9 | GO:0051083 | 'de novo' cotranslational protein folding(GO:0051083) |
| 0.2 | 1.4 | GO:0072600 | establishment of protein localization to Golgi(GO:0072600) |
| 0.2 | 1.8 | GO:0001302 | replicative cell aging(GO:0001302) |
| 0.2 | 3.6 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.2 | 0.4 | GO:0006409 | tRNA export from nucleus(GO:0006409) tRNA transport(GO:0051031) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.2 | 0.4 | GO:0071360 | cellular response to exogenous dsRNA(GO:0071360) |
| 0.2 | 6.0 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.2 | 0.4 | GO:1904938 | dopaminergic neuron axon guidance(GO:0036514) planar cell polarity pathway involved in axon guidance(GO:1904938) |
| 0.2 | 1.1 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
| 0.2 | 0.4 | GO:0044804 | nucleophagy(GO:0044804) |
| 0.2 | 2.0 | GO:0042984 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.2 | 0.2 | GO:0035878 | nail development(GO:0035878) |
| 0.2 | 0.7 | GO:0015783 | GDP-fucose transport(GO:0015783) purine nucleotide-sugar transport(GO:0036079) |
| 0.2 | 1.1 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
| 0.2 | 0.7 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.2 | 0.9 | GO:0070445 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.2 | 1.5 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
| 0.2 | 3.9 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.2 | 0.7 | GO:0038178 | complement component C5a signaling pathway(GO:0038178) |
| 0.2 | 3.7 | GO:0045008 | depyrimidination(GO:0045008) |
| 0.2 | 0.9 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.2 | 1.9 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.2 | 2.6 | GO:0038092 | nodal signaling pathway(GO:0038092) |
| 0.2 | 1.5 | GO:0035898 | parathyroid hormone secretion(GO:0035898) post-embryonic body morphogenesis(GO:0040032) regulation of parathyroid hormone secretion(GO:2000828) |
| 0.2 | 1.1 | GO:0071386 | cellular response to corticosterone stimulus(GO:0071386) |
| 0.2 | 0.6 | GO:0035494 | SNARE complex disassembly(GO:0035494) |
| 0.2 | 1.5 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.2 | 2.1 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.2 | 0.6 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.2 | 5.7 | GO:0032007 | negative regulation of TOR signaling(GO:0032007) |
| 0.2 | 1.1 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
| 0.2 | 2.5 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.2 | 1.7 | GO:0006880 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.2 | 4.6 | GO:0033617 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.2 | 0.4 | GO:0036228 | protein targeting to nuclear inner membrane(GO:0036228) |
| 0.2 | 0.6 | GO:0033386 | geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
| 0.2 | 0.6 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.2 | 0.6 | GO:0090343 | positive regulation of cell aging(GO:0090343) positive regulation of cellular senescence(GO:2000774) |
| 0.2 | 0.2 | GO:1901624 | negative regulation of lymphocyte chemotaxis(GO:1901624) |
| 0.2 | 2.7 | GO:0006086 | acetyl-CoA biosynthetic process from pyruvate(GO:0006086) regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.2 | 0.4 | GO:1900369 | negative regulation of RNA interference(GO:1900369) |
| 0.2 | 0.4 | GO:2000564 | CD8-positive, alpha-beta T cell proliferation(GO:0035740) regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000564) |
| 0.2 | 1.6 | GO:2000121 | regulation of removal of superoxide radicals(GO:2000121) |
| 0.2 | 0.4 | GO:0044340 | canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
| 0.2 | 0.4 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.2 | 0.4 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.2 | 0.6 | GO:0038193 | thromboxane A2 signaling pathway(GO:0038193) |
| 0.2 | 0.6 | GO:0007185 | transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
| 0.2 | 0.2 | GO:0034088 | maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
| 0.2 | 1.0 | GO:2001293 | malonyl-CoA metabolic process(GO:2001293) |
| 0.2 | 0.4 | GO:1903949 | positive regulation of atrial cardiac muscle cell action potential(GO:1903949) |
| 0.2 | 0.2 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
| 0.2 | 3.4 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
| 0.2 | 1.2 | GO:0071543 | diadenosine polyphosphate catabolic process(GO:0015961) diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
| 0.2 | 1.6 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
| 0.2 | 0.2 | GO:2000397 | regulation of ubiquitin-dependent endocytosis(GO:2000395) positive regulation of ubiquitin-dependent endocytosis(GO:2000397) |
| 0.2 | 1.0 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
| 0.2 | 1.0 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.2 | 0.8 | GO:0048669 | collateral sprouting in absence of injury(GO:0048669) regulation of collateral sprouting in absence of injury(GO:0048696) negative regulation of collateral sprouting in absence of injury(GO:0048698) |
| 0.2 | 0.8 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
| 0.2 | 1.9 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
| 0.2 | 0.4 | GO:0007231 | osmosensory signaling pathway(GO:0007231) |
| 0.2 | 2.5 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.2 | 0.8 | GO:0098886 | modification of dendritic spine(GO:0098886) |
| 0.2 | 0.4 | GO:0017004 | cytochrome complex assembly(GO:0017004) |
| 0.2 | 0.8 | GO:1905229 | cellular response to glycoprotein(GO:1904588) cellular response to thyrotropin-releasing hormone(GO:1905229) |
| 0.2 | 0.9 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.2 | 0.6 | GO:0043686 | co-translational protein modification(GO:0043686) |
| 0.2 | 2.6 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.2 | 0.8 | GO:0032898 | neurotrophin production(GO:0032898) |
| 0.2 | 1.5 | GO:1902741 | interferon-alpha secretion(GO:0072642) regulation of interferon-alpha secretion(GO:1902739) positive regulation of interferon-alpha secretion(GO:1902741) |
| 0.2 | 1.7 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.2 | 0.8 | GO:0039516 | modulation by virus of host molecular function(GO:0039506) suppression by virus of host molecular function(GO:0039507) suppression by virus of host catalytic activity(GO:0039513) modulation by virus of host catalytic activity(GO:0039516) suppression by virus of host cysteine-type endopeptidase activity involved in apoptotic process(GO:0039650) negative regulation by symbiont of host catalytic activity(GO:0052053) negative regulation by symbiont of host molecular function(GO:0052056) modulation by symbiont of host catalytic activity(GO:0052148) |
| 0.2 | 0.4 | GO:0032687 | negative regulation of interferon-alpha production(GO:0032687) |
| 0.2 | 2.1 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.2 | 0.6 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.2 | 0.9 | GO:0002032 | desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
| 0.2 | 0.7 | GO:0015910 | peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.2 | 1.7 | GO:0032264 | IMP salvage(GO:0032264) |
| 0.2 | 0.2 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
| 0.2 | 0.6 | GO:0061565 | dADP phosphorylation(GO:0006174) dGDP phosphorylation(GO:0006186) AMP phosphorylation(GO:0006756) CDP phosphorylation(GO:0061508) dAMP phosphorylation(GO:0061565) CMP phosphorylation(GO:0061566) dCMP phosphorylation(GO:0061567) GDP phosphorylation(GO:0061568) UDP phosphorylation(GO:0061569) dCDP phosphorylation(GO:0061570) TDP phosphorylation(GO:0061571) |
| 0.2 | 0.6 | GO:0002925 | positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 0.2 | 0.4 | GO:0090669 | telomerase RNA stabilization(GO:0090669) |
| 0.2 | 1.1 | GO:2000234 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.2 | 0.4 | GO:0036124 | histone H3-K9 trimethylation(GO:0036124) |
| 0.2 | 0.2 | GO:0032506 | cytokinetic process(GO:0032506) |
| 0.2 | 0.4 | GO:0009651 | response to salt stress(GO:0009651) |
| 0.2 | 0.9 | GO:1904977 | lymphatic endothelial cell migration(GO:1904977) |
| 0.2 | 0.5 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) |
| 0.2 | 1.3 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.2 | 0.9 | GO:1903385 | regulation of homophilic cell adhesion(GO:1903385) |
| 0.2 | 1.3 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.2 | 0.5 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.2 | 0.5 | GO:0070839 | divalent metal ion export(GO:0070839) |
| 0.2 | 1.1 | GO:0098881 | exocytic insertion of neurotransmitter receptor to plasma membrane(GO:0098881) exocytic insertion of neurotransmitter receptor to postsynaptic membrane(GO:0098967) |
| 0.2 | 1.1 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
| 0.2 | 1.1 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.2 | 0.5 | GO:0002181 | cytoplasmic translation(GO:0002181) |
| 0.2 | 0.5 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
| 0.2 | 0.9 | GO:0006011 | UDP-glucose metabolic process(GO:0006011) |
| 0.2 | 0.9 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
| 0.2 | 0.2 | GO:2001279 | regulation of prostaglandin biosynthetic process(GO:0031392) regulation of unsaturated fatty acid biosynthetic process(GO:2001279) |
| 0.2 | 1.6 | GO:0006552 | leucine catabolic process(GO:0006552) |
| 0.2 | 2.1 | GO:0015886 | heme transport(GO:0015886) |
| 0.2 | 0.7 | GO:0033685 | negative regulation of luteinizing hormone secretion(GO:0033685) |
| 0.2 | 0.5 | GO:0070914 | UV-damage excision repair(GO:0070914) |
| 0.2 | 1.2 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
| 0.2 | 2.1 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.2 | 0.7 | GO:0044331 | cell-cell adhesion mediated by cadherin(GO:0044331) |
| 0.2 | 0.5 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.2 | 1.7 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
| 0.2 | 0.9 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.2 | 2.1 | GO:0021694 | cerebellar Purkinje cell layer formation(GO:0021694) cerebellar Purkinje cell differentiation(GO:0021702) |
| 0.2 | 0.5 | GO:0045829 | negative regulation of isotype switching(GO:0045829) |
| 0.2 | 0.7 | GO:0042357 | thiamine diphosphate metabolic process(GO:0042357) |
| 0.2 | 1.4 | GO:0044782 | cilium organization(GO:0044782) |
| 0.2 | 0.7 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
| 0.2 | 0.5 | GO:0009258 | 10-formyltetrahydrofolate catabolic process(GO:0009258) |
| 0.2 | 0.3 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.2 | 0.5 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.2 | 0.2 | GO:2001022 | positive regulation of response to DNA damage stimulus(GO:2001022) |
| 0.2 | 0.7 | GO:0043366 | beta selection(GO:0043366) |
| 0.2 | 0.5 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
| 0.2 | 0.2 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.2 | 0.8 | GO:0071025 | RNA surveillance(GO:0071025) |
| 0.2 | 0.3 | GO:2001162 | regulation of histone H3-K79 methylation(GO:2001160) positive regulation of histone H3-K79 methylation(GO:2001162) |
| 0.2 | 0.7 | GO:0072396 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) |
| 0.2 | 0.3 | GO:1904415 | regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
| 0.2 | 2.7 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.2 | 1.7 | GO:0010265 | SCF complex assembly(GO:0010265) |
| 0.2 | 2.2 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.2 | 0.3 | GO:0070434 | positive regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070426) positive regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070434) |
| 0.2 | 0.2 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
| 0.2 | 0.5 | GO:1903677 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.2 | 3.1 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.2 | 0.5 | GO:0035915 | pore formation in membrane of other organism(GO:0035915) |
| 0.2 | 0.2 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.2 | 0.8 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
| 0.2 | 1.0 | GO:0071499 | cellular response to laminar fluid shear stress(GO:0071499) |
| 0.2 | 0.6 | GO:0071934 | thiamine transmembrane transport(GO:0071934) |
| 0.2 | 1.6 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.2 | 0.2 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
| 0.2 | 0.2 | GO:2000727 | positive regulation of cardiac muscle cell differentiation(GO:2000727) |
| 0.2 | 0.5 | GO:0021650 | vestibulocochlear nerve formation(GO:0021650) |
| 0.2 | 0.5 | GO:1990569 | UDP-N-acetylglucosamine transport(GO:0015788) UDP-N-acetylglucosamine transmembrane transport(GO:1990569) |
| 0.2 | 1.6 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
| 0.2 | 1.6 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.2 | 0.6 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.2 | 0.2 | GO:0002644 | negative regulation of tolerance induction(GO:0002644) |
| 0.2 | 0.2 | GO:1904294 | positive regulation of ERAD pathway(GO:1904294) |
| 0.2 | 0.2 | GO:0016078 | tRNA catabolic process(GO:0016078) |
| 0.2 | 1.9 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) |
| 0.2 | 1.9 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.2 | 0.8 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.2 | 0.8 | GO:1902659 | regulation of glucose mediated signaling pathway(GO:1902659) |
| 0.2 | 0.2 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
| 0.2 | 0.2 | GO:0060353 | cell adhesion molecule production(GO:0060352) regulation of cell adhesion molecule production(GO:0060353) |
| 0.2 | 0.3 | GO:2000035 | regulation of stem cell division(GO:2000035) |
| 0.2 | 0.8 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.2 | 0.2 | GO:0003162 | atrioventricular node development(GO:0003162) |
| 0.2 | 3.3 | GO:0016075 | rRNA catabolic process(GO:0016075) |
| 0.2 | 1.6 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.2 | 0.3 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.2 | 2.5 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
| 0.2 | 0.6 | GO:2001288 | positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.2 | 2.4 | GO:0017121 | phospholipid scrambling(GO:0017121) |
| 0.2 | 0.6 | GO:0090234 | regulation of kinetochore assembly(GO:0090234) |
| 0.2 | 1.4 | GO:0097647 | calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
| 0.2 | 0.3 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.2 | 0.6 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.2 | 0.8 | GO:0044240 | multicellular organism lipid catabolic process(GO:0044240) |
| 0.2 | 2.3 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.2 | 0.6 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
| 0.2 | 3.5 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
| 0.2 | 0.5 | GO:0032618 | interleukin-15 production(GO:0032618) |
| 0.2 | 1.5 | GO:0043631 | RNA polyadenylation(GO:0043631) |
| 0.1 | 1.8 | GO:0045663 | positive regulation of myoblast differentiation(GO:0045663) |
| 0.1 | 0.7 | GO:0010960 | magnesium ion homeostasis(GO:0010960) |
| 0.1 | 0.1 | GO:0050787 | detoxification of mercury ion(GO:0050787) |
| 0.1 | 0.3 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
| 0.1 | 2.7 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
| 0.1 | 1.3 | GO:0038203 | TORC2 signaling(GO:0038203) |
| 0.1 | 0.4 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
| 0.1 | 0.6 | GO:1901985 | positive regulation of protein acetylation(GO:1901985) |
| 0.1 | 0.4 | GO:0043314 | negative regulation of neutrophil degranulation(GO:0043314) |
| 0.1 | 1.3 | GO:0060452 | positive regulation of cardiac muscle contraction(GO:0060452) |
| 0.1 | 0.7 | GO:0046627 | negative regulation of insulin receptor signaling pathway(GO:0046627) |
| 0.1 | 2.6 | GO:1903206 | negative regulation of hydrogen peroxide-induced cell death(GO:1903206) |
| 0.1 | 2.9 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.1 | 6.1 | GO:0070911 | global genome nucleotide-excision repair(GO:0070911) |
| 0.1 | 1.3 | GO:0003096 | renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
| 0.1 | 0.3 | GO:2000374 | regulation of oxygen metabolic process(GO:2000374) |
| 0.1 | 0.1 | GO:0014034 | neural crest cell fate commitment(GO:0014034) |
| 0.1 | 0.7 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.1 | 3.7 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.1 | 0.7 | GO:0015793 | glycerol transport(GO:0015793) |
| 0.1 | 2.1 | GO:0006458 | 'de novo' protein folding(GO:0006458) |
| 0.1 | 2.6 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 0.1 | 0.1 | GO:0032242 | regulation of nucleoside transport(GO:0032242) |
| 0.1 | 2.8 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
| 0.1 | 0.1 | GO:0018894 | dibenzo-p-dioxin metabolic process(GO:0018894) |
| 0.1 | 0.4 | GO:2000269 | regulation of fibroblast apoptotic process(GO:2000269) |
| 0.1 | 0.1 | GO:0006266 | DNA ligation(GO:0006266) |
| 0.1 | 1.0 | GO:0032472 | Golgi calcium ion transport(GO:0032472) |
| 0.1 | 0.3 | GO:2000569 | T-helper 2 cell activation(GO:0035712) regulation of T-helper 2 cell activation(GO:2000569) positive regulation of T-helper 2 cell activation(GO:2000570) |
| 0.1 | 0.7 | GO:0034982 | mitochondrial protein processing(GO:0034982) |
| 0.1 | 1.1 | GO:0033014 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
| 0.1 | 1.1 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
| 0.1 | 0.1 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) |
| 0.1 | 2.1 | GO:2000651 | positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
| 0.1 | 0.1 | GO:1903721 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.1 | 1.1 | GO:0006983 | ER overload response(GO:0006983) |
| 0.1 | 1.0 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.1 | 1.5 | GO:0006824 | cobalt ion transport(GO:0006824) |
| 0.1 | 2.1 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.1 | 1.0 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
| 0.1 | 0.3 | GO:0045003 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.1 | 0.1 | GO:0045056 | transcytosis(GO:0045056) |
| 0.1 | 0.5 | GO:0007549 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.1 | 0.5 | GO:0009386 | translational attenuation(GO:0009386) |
| 0.1 | 1.1 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
| 0.1 | 1.1 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.1 | 0.5 | GO:0009227 | UDP-N-acetylglucosamine catabolic process(GO:0006049) nucleotide-sugar catabolic process(GO:0009227) |
| 0.1 | 1.2 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.1 | 0.5 | GO:0042441 | eye pigment biosynthetic process(GO:0006726) eye pigment metabolic process(GO:0042441) pigment metabolic process involved in developmental pigmentation(GO:0043324) pigment metabolic process involved in pigmentation(GO:0043474) |
| 0.1 | 1.3 | GO:0031087 | deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.1 | 0.5 | GO:1901674 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 0.1 | 0.1 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.1 | 0.7 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
| 0.1 | 0.1 | GO:0043144 | snoRNA processing(GO:0043144) |
| 0.1 | 0.8 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
| 0.1 | 0.5 | GO:0045579 | positive regulation of B cell differentiation(GO:0045579) |
| 0.1 | 0.9 | GO:0051531 | NFAT protein import into nucleus(GO:0051531) |
| 0.1 | 7.0 | GO:0033173 | calcineurin-NFAT signaling cascade(GO:0033173) |
| 0.1 | 0.7 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.1 | 0.3 | GO:0003350 | pulmonary myocardium development(GO:0003350) |
| 0.1 | 0.4 | GO:0000354 | cis assembly of pre-catalytic spliceosome(GO:0000354) |
| 0.1 | 0.5 | GO:0097026 | dendritic cell dendrite assembly(GO:0097026) |
| 0.1 | 0.4 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.1 | 1.7 | GO:1901522 | positive regulation of transcription from RNA polymerase II promoter involved in cellular response to chemical stimulus(GO:1901522) |
| 0.1 | 0.8 | GO:0071630 | nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
| 0.1 | 0.4 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.1 | 0.5 | GO:0044872 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.1 | 5.1 | GO:0001580 | detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
| 0.1 | 1.4 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
| 0.1 | 0.8 | GO:0072675 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.1 | 0.3 | GO:0007320 | insemination(GO:0007320) |
| 0.1 | 0.6 | GO:0045204 | MAPK export from nucleus(GO:0045204) |
| 0.1 | 0.3 | GO:2001176 | mediator complex assembly(GO:0036034) regulation of mediator complex assembly(GO:2001176) positive regulation of mediator complex assembly(GO:2001178) |
| 0.1 | 0.5 | GO:1902570 | protein localization to nucleolus(GO:1902570) |
| 0.1 | 0.3 | GO:0052472 | modulation by host of viral transcription(GO:0043921) negative regulation by host of viral transcription(GO:0043922) modulation by host of symbiont transcription(GO:0052472) |
| 0.1 | 0.9 | GO:0032439 | endosome localization(GO:0032439) |
| 0.1 | 12.1 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.1 | 0.5 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.1 | 1.9 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
| 0.1 | 0.3 | GO:0021592 | fourth ventricle development(GO:0021592) |
| 0.1 | 3.0 | GO:0097242 | beta-amyloid clearance(GO:0097242) |
| 0.1 | 0.4 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) |
| 0.1 | 0.6 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.1 | 0.4 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.1 | 0.4 | GO:0071421 | manganese ion transmembrane transport(GO:0071421) |
| 0.1 | 0.1 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) |
| 0.1 | 0.4 | GO:0060449 | bud elongation involved in lung branching(GO:0060449) |
| 0.1 | 0.6 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
| 0.1 | 0.9 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.1 | 2.2 | GO:0000729 | DNA double-strand break processing(GO:0000729) |
| 0.1 | 0.4 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
| 0.1 | 0.4 | GO:0072334 | UDP-galactose transport(GO:0015785) UDP-galactose transmembrane transport(GO:0072334) |
| 0.1 | 3.2 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.1 | 0.9 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.1 | 0.7 | GO:0097033 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.1 | 10.4 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.1 | 0.4 | GO:1903826 | arginine transmembrane transport(GO:1903826) |
| 0.1 | 2.8 | GO:0090022 | regulation of neutrophil chemotaxis(GO:0090022) |
| 0.1 | 0.9 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
| 0.1 | 0.4 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
| 0.1 | 0.2 | GO:0070417 | cellular response to cold(GO:0070417) |
| 0.1 | 0.4 | GO:0042418 | epinephrine metabolic process(GO:0042414) epinephrine biosynthetic process(GO:0042418) |
| 0.1 | 0.4 | GO:2001045 | negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 0.1 | 0.6 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.1 | 0.1 | GO:2000381 | negative regulation of mesoderm development(GO:2000381) |
| 0.1 | 0.6 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
| 0.1 | 0.4 | GO:0000478 | endonucleolytic cleavage involved in rRNA processing(GO:0000478) |
| 0.1 | 0.6 | GO:0042738 | exogenous drug catabolic process(GO:0042738) |
| 0.1 | 2.0 | GO:0022900 | electron transport chain(GO:0022900) |
| 0.1 | 0.6 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.1 | 0.4 | GO:0051571 | positive regulation of histone H3-K4 methylation(GO:0051571) |
| 0.1 | 0.2 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
| 0.1 | 0.4 | GO:0044205 | 'de novo' UMP biosynthetic process(GO:0044205) |
| 0.1 | 0.8 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
| 0.1 | 0.2 | GO:0032470 | positive regulation of endoplasmic reticulum calcium ion concentration(GO:0032470) regulation of calcium ion-dependent exocytosis of neurotransmitter(GO:1903233) |
| 0.1 | 0.2 | GO:0030969 | mRNA splicing via endonucleolytic cleavage and ligation involved in unfolded protein response(GO:0030969) mRNA splicing, via endonucleolytic cleavage and ligation(GO:0070054) mRNA endonucleolytic cleavage involved in unfolded protein response(GO:0070055) |
| 0.1 | 0.2 | GO:1904383 | response to sodium phosphate(GO:1904383) |
| 0.1 | 0.4 | GO:0035621 | ER to Golgi ceramide transport(GO:0035621) |
| 0.1 | 0.3 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
| 0.1 | 1.7 | GO:0031935 | regulation of chromatin silencing(GO:0031935) |
| 0.1 | 0.3 | GO:0021678 | third ventricle development(GO:0021678) |
| 0.1 | 2.0 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.1 | 0.6 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.1 | 1.7 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.1 | 0.6 | GO:1902267 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.1 | 1.0 | GO:0006368 | transcription elongation from RNA polymerase II promoter(GO:0006368) |
| 0.1 | 0.7 | GO:0035709 | memory T cell activation(GO:0035709) regulation of memory T cell activation(GO:2000567) positive regulation of memory T cell activation(GO:2000568) |
| 0.1 | 0.2 | GO:0009068 | aspartate family amino acid catabolic process(GO:0009068) |
| 0.1 | 0.7 | GO:0042733 | embryonic digit morphogenesis(GO:0042733) |
| 0.1 | 0.7 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.1 | 0.7 | GO:0043435 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.1 | 0.3 | GO:0070902 | mitochondrial tRNA pseudouridine synthesis(GO:0070902) |
| 0.1 | 1.0 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.1 | 0.5 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
| 0.1 | 0.2 | GO:0030860 | regulation of polarized epithelial cell differentiation(GO:0030860) |
| 0.1 | 0.8 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
| 0.1 | 0.2 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
| 0.1 | 0.3 | GO:0052203 | modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.1 | 1.2 | GO:0048011 | neurotrophin TRK receptor signaling pathway(GO:0048011) |
| 0.1 | 0.6 | GO:1901318 | negative regulation of sperm motility(GO:1901318) |
| 0.1 | 0.3 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
| 0.1 | 1.0 | GO:0042355 | fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
| 0.1 | 0.1 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.1 | 0.3 | GO:0036309 | protein localization to M-band(GO:0036309) |
| 0.1 | 0.3 | GO:0090611 | ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
| 0.1 | 0.8 | GO:0002084 | protein depalmitoylation(GO:0002084) |
| 0.1 | 0.5 | GO:0036493 | positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
| 0.1 | 0.2 | GO:1903038 | negative regulation of leukocyte cell-cell adhesion(GO:1903038) |
| 0.1 | 0.7 | GO:0003157 | endocardium development(GO:0003157) |
| 0.1 | 0.4 | GO:1901475 | pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
| 0.1 | 1.0 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.1 | 4.4 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.1 | 0.5 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
| 0.1 | 0.6 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
| 0.1 | 0.3 | GO:0090398 | cellular senescence(GO:0090398) |
| 0.1 | 0.1 | GO:0032455 | nerve growth factor processing(GO:0032455) |
| 0.1 | 1.0 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.1 | 0.3 | GO:0035377 | transepithelial water transport(GO:0035377) |
| 0.1 | 0.6 | GO:0010761 | fibroblast migration(GO:0010761) |
| 0.1 | 5.4 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
| 0.1 | 0.4 | GO:0009644 | response to high light intensity(GO:0009644) |
| 0.1 | 1.1 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.1 | 1.3 | GO:0071379 | cellular response to prostaglandin stimulus(GO:0071379) |
| 0.1 | 0.5 | GO:0098727 | maintenance of cell number(GO:0098727) |
| 0.1 | 0.6 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
| 0.1 | 0.5 | GO:1903588 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.1 | 1.4 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.1 | 0.6 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.1 | 0.6 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.1 | 0.2 | GO:0021819 | layer formation in cerebral cortex(GO:0021819) |
| 0.1 | 0.3 | GO:0021997 | neural plate axis specification(GO:0021997) |
| 0.1 | 0.1 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 0.1 | 0.3 | GO:0060736 | prostate gland growth(GO:0060736) |
| 0.1 | 3.3 | GO:1904837 | beta-catenin-TCF complex assembly(GO:1904837) |
| 0.1 | 0.7 | GO:0070649 | meiotic cytokinesis(GO:0033206) polar body extrusion after meiotic divisions(GO:0040038) formin-nucleated actin cable assembly(GO:0070649) |
| 0.1 | 0.1 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
| 0.1 | 0.1 | GO:0060038 | cardiac muscle cell proliferation(GO:0060038) |
| 0.1 | 0.1 | GO:0061218 | negative regulation of mesonephros development(GO:0061218) |
| 0.1 | 0.3 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.1 | 0.2 | GO:0070424 | regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) |
| 0.1 | 0.3 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
| 0.1 | 0.3 | GO:0006574 | valine catabolic process(GO:0006574) |
| 0.1 | 0.7 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
| 0.1 | 0.3 | GO:0036500 | ATF6-mediated unfolded protein response(GO:0036500) |
| 0.1 | 0.5 | GO:0060612 | adipose tissue development(GO:0060612) |
| 0.1 | 0.4 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.1 | 0.1 | GO:1902956 | regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902956) |
| 0.1 | 1.0 | GO:1900044 | regulation of protein K63-linked ubiquitination(GO:1900044) |
| 0.1 | 0.8 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.1 | 0.1 | GO:0070673 | response to interleukin-18(GO:0070673) |
| 0.1 | 3.3 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.1 | 0.1 | GO:0015870 | acetylcholine transport(GO:0015870) |
| 0.1 | 3.0 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.1 | 0.9 | GO:0046929 | negative regulation of neurotransmitter secretion(GO:0046929) |
| 0.1 | 0.1 | GO:2000425 | regulation of apoptotic cell clearance(GO:2000425) |
| 0.1 | 3.1 | GO:0006198 | cAMP catabolic process(GO:0006198) |
| 0.1 | 0.2 | GO:0033341 | regulation of collagen binding(GO:0033341) |
| 0.1 | 4.7 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
| 0.1 | 0.5 | GO:0043967 | histone H4 acetylation(GO:0043967) |
| 0.1 | 1.9 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
| 0.1 | 0.2 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
| 0.1 | 1.2 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 0.1 | 0.6 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.1 | 0.9 | GO:2000781 | positive regulation of double-strand break repair(GO:2000781) |
| 0.1 | 0.3 | GO:0042489 | negative regulation of odontogenesis of dentin-containing tooth(GO:0042489) |
| 0.1 | 0.7 | GO:0035865 | cellular response to potassium ion(GO:0035865) |
| 0.1 | 0.6 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
| 0.1 | 0.3 | GO:0002752 | cell surface pattern recognition receptor signaling pathway(GO:0002752) |
| 0.1 | 0.4 | GO:1905064 | negative regulation of vascular smooth muscle cell differentiation(GO:1905064) |
| 0.1 | 0.2 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
| 0.1 | 0.6 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.1 | 0.3 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
| 0.1 | 0.3 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.1 | 0.6 | GO:0036111 | very long-chain fatty-acyl-CoA metabolic process(GO:0036111) |
| 0.1 | 1.5 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.1 | 0.4 | GO:0048239 | negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
| 0.1 | 0.3 | GO:0003032 | detection of oxygen(GO:0003032) |
| 0.1 | 5.5 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.1 | 0.2 | GO:0072364 | regulation of cellular ketone metabolic process by regulation of transcription from RNA polymerase II promoter(GO:0072364) |
| 0.1 | 0.1 | GO:0071675 | mononuclear cell migration(GO:0071674) regulation of mononuclear cell migration(GO:0071675) |
| 0.1 | 0.2 | GO:0003011 | involuntary skeletal muscle contraction(GO:0003011) |
| 0.1 | 2.0 | GO:0032012 | regulation of ARF protein signal transduction(GO:0032012) |
| 0.1 | 0.2 | GO:0009240 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate metabolic process(GO:0046490) |
| 0.1 | 0.3 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.1 | 0.5 | GO:0072367 | regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) |
| 0.1 | 0.7 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
| 0.1 | 0.6 | GO:0009157 | deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) |
| 0.1 | 0.3 | GO:1900025 | negative regulation of substrate adhesion-dependent cell spreading(GO:1900025) |
| 0.1 | 3.2 | GO:0051973 | positive regulation of telomerase activity(GO:0051973) |
| 0.1 | 1.7 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.1 | 0.2 | GO:0009191 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) ribonucleoside diphosphate catabolic process(GO:0009191) |
| 0.1 | 0.7 | GO:2000860 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.1 | 0.6 | GO:0046856 | phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.1 | 1.6 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
| 0.1 | 0.3 | GO:0071529 | cementum mineralization(GO:0071529) |
| 0.1 | 1.4 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
| 0.1 | 1.1 | GO:0030889 | negative regulation of B cell proliferation(GO:0030889) |
| 0.1 | 0.3 | GO:0035815 | positive regulation of renal sodium excretion(GO:0035815) |
| 0.1 | 0.3 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) |
| 0.1 | 0.5 | GO:1901419 | regulation of response to alcohol(GO:1901419) |
| 0.1 | 0.4 | GO:0046519 | sphingoid metabolic process(GO:0046519) |
| 0.1 | 0.2 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) |
| 0.1 | 0.9 | GO:0021759 | globus pallidus development(GO:0021759) |
| 0.1 | 0.4 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.1 | 0.4 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.1 | 0.1 | GO:0009954 | proximal/distal pattern formation(GO:0009954) |
| 0.1 | 0.4 | GO:0042487 | regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
| 0.1 | 0.6 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.1 | 3.9 | GO:0015949 | nucleobase-containing small molecule interconversion(GO:0015949) |
| 0.1 | 1.1 | GO:0016574 | histone ubiquitination(GO:0016574) |
| 0.1 | 0.3 | GO:0051386 | regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
| 0.1 | 0.3 | GO:0033483 | gas homeostasis(GO:0033483) |
| 0.1 | 0.2 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
| 0.1 | 0.6 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.1 | 0.1 | GO:0050684 | regulation of mRNA processing(GO:0050684) |
| 0.1 | 2.8 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
| 0.1 | 0.6 | GO:0043987 | histone H3-S10 phosphorylation(GO:0043987) |
| 0.1 | 0.3 | GO:0050712 | negative regulation of interleukin-1 alpha production(GO:0032690) negative regulation of interleukin-1 alpha secretion(GO:0050712) |
| 0.1 | 0.2 | GO:0019430 | removal of superoxide radicals(GO:0019430) |
| 0.1 | 0.2 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.1 | 0.3 | GO:0016188 | synaptic vesicle maturation(GO:0016188) |
| 0.1 | 0.7 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.1 | 0.6 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.1 | 0.5 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.1 | 4.4 | GO:0007368 | determination of left/right symmetry(GO:0007368) |
| 0.1 | 0.3 | GO:0060767 | epithelial cell proliferation involved in prostate gland development(GO:0060767) regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) |
| 0.1 | 0.5 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.1 | 0.3 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.1 | 0.4 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.1 | 0.7 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
| 0.1 | 0.3 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
| 0.1 | 0.2 | GO:1903332 | regulation of protein folding(GO:1903332) regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.1 | 1.1 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
| 0.1 | 5.5 | GO:1903955 | positive regulation of protein targeting to mitochondrion(GO:1903955) |
| 0.1 | 0.4 | GO:0044130 | negative regulation of growth of symbiont in host(GO:0044130) |
| 0.1 | 3.2 | GO:0034260 | negative regulation of GTPase activity(GO:0034260) |
| 0.1 | 0.2 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
| 0.1 | 1.8 | GO:0001510 | RNA methylation(GO:0001510) |
| 0.1 | 0.5 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
| 0.1 | 0.3 | GO:0045917 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.1 | 0.2 | GO:0009236 | cobalamin biosynthetic process(GO:0009236) |
| 0.1 | 0.5 | GO:0021522 | spinal cord motor neuron differentiation(GO:0021522) |
| 0.1 | 0.2 | GO:1901052 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
| 0.1 | 0.5 | GO:0006105 | succinate metabolic process(GO:0006105) |
| 0.1 | 0.6 | GO:0044211 | CTP salvage(GO:0044211) |
| 0.1 | 0.3 | GO:0055014 | atrial cardiac muscle cell differentiation(GO:0055011) atrial cardiac muscle cell development(GO:0055014) |
| 0.1 | 2.0 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
| 0.1 | 0.4 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
| 0.1 | 0.3 | GO:0043949 | regulation of cAMP-mediated signaling(GO:0043949) |
| 0.1 | 1.7 | GO:0035456 | response to interferon-beta(GO:0035456) |
| 0.1 | 0.2 | GO:0070295 | renal water absorption(GO:0070295) |
| 0.1 | 0.1 | GO:1902299 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 0.1 | 0.3 | GO:0045599 | negative regulation of fat cell differentiation(GO:0045599) |
| 0.1 | 1.4 | GO:0034453 | microtubule anchoring(GO:0034453) |
| 0.1 | 0.2 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.1 | 0.5 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.1 | 1.0 | GO:1900038 | negative regulation of cellular response to hypoxia(GO:1900038) |
| 0.1 | 0.2 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.1 | 0.1 | GO:0060313 | negative regulation of blood vessel remodeling(GO:0060313) |
| 0.1 | 1.7 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
| 0.1 | 2.6 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.1 | 2.4 | GO:0032784 | regulation of DNA-templated transcription, elongation(GO:0032784) |
| 0.1 | 2.0 | GO:0014904 | myotube cell development(GO:0014904) |
| 0.1 | 0.4 | GO:0042822 | pyridoxal phosphate metabolic process(GO:0042822) |
| 0.1 | 0.2 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.1 | 0.4 | GO:0036336 | dendritic cell migration(GO:0036336) |
| 0.1 | 0.5 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
| 0.1 | 0.1 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
| 0.1 | 0.9 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
| 0.1 | 0.2 | GO:1900073 | regulation of neuromuscular synaptic transmission(GO:1900073) positive regulation of neuromuscular synaptic transmission(GO:1900075) |
| 0.1 | 0.2 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
| 0.1 | 0.4 | GO:0043619 | regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
| 0.1 | 0.1 | GO:0010803 | regulation of tumor necrosis factor-mediated signaling pathway(GO:0010803) |
| 0.1 | 0.2 | GO:0048075 | positive regulation of eye pigmentation(GO:0048075) |
| 0.1 | 0.1 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
| 0.1 | 0.2 | GO:0007000 | nucleolus organization(GO:0007000) |
| 0.1 | 0.2 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.1 | 0.4 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.1 | 0.1 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.1 | 0.5 | GO:0033683 | nucleotide-excision repair, DNA incision(GO:0033683) |
| 0.1 | 0.7 | GO:0051612 | negative regulation of neurotransmitter uptake(GO:0051581) serotonin uptake(GO:0051610) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.1 | 0.1 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.1 | 0.6 | GO:0009304 | tRNA transcription(GO:0009304) |
| 0.1 | 1.9 | GO:0031498 | chromatin disassembly(GO:0031498) |
| 0.1 | 0.1 | GO:0002302 | CD8-positive, alpha-beta T cell differentiation involved in immune response(GO:0002302) |
| 0.1 | 0.2 | GO:0010452 | regulation of histone H3-K36 methylation(GO:0000414) histone H3-K36 methylation(GO:0010452) specification of axis polarity(GO:0065001) |
| 0.1 | 0.6 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
| 0.1 | 0.1 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.1 | 1.0 | GO:0016024 | CDP-diacylglycerol biosynthetic process(GO:0016024) |
| 0.1 | 0.1 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
| 0.1 | 0.7 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
| 0.1 | 1.3 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
| 0.1 | 6.9 | GO:0035308 | negative regulation of protein dephosphorylation(GO:0035308) |
| 0.1 | 0.2 | GO:0060168 | positive regulation of adenosine receptor signaling pathway(GO:0060168) |
| 0.1 | 0.6 | GO:0051547 | regulation of keratinocyte migration(GO:0051547) |
| 0.1 | 0.1 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.1 | 0.1 | GO:1904994 | regulation of leukocyte adhesion to vascular endothelial cell(GO:1904994) |
| 0.1 | 0.3 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 | 0.2 | GO:0045076 | interleukin-2 biosynthetic process(GO:0042094) regulation of interleukin-2 biosynthetic process(GO:0045076) |
| 0.1 | 0.8 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
| 0.1 | 0.8 | GO:0031643 | positive regulation of myelination(GO:0031643) |
| 0.1 | 0.1 | GO:1900114 | positive regulation of histone H3-K9 trimethylation(GO:1900114) |
| 0.1 | 0.3 | GO:0052651 | monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.1 | 0.1 | GO:0021691 | cerebellar Purkinje cell layer maturation(GO:0021691) |
| 0.1 | 0.2 | GO:0006286 | base-excision repair, base-free sugar-phosphate removal(GO:0006286) |
| 0.1 | 0.3 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.1 | 0.8 | GO:0031054 | pre-miRNA processing(GO:0031054) |
| 0.1 | 1.1 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
| 0.1 | 0.1 | GO:0051136 | regulation of NK T cell differentiation(GO:0051136) |
| 0.1 | 0.3 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.1 | 0.3 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
| 0.1 | 1.7 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
| 0.1 | 19.6 | GO:0000209 | protein polyubiquitination(GO:0000209) |
| 0.1 | 0.5 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.1 | 1.1 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.1 | 1.1 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
| 0.1 | 0.3 | GO:0000186 | activation of MAPKK activity(GO:0000186) |
| 0.1 | 0.9 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.1 | 0.1 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.1 | 0.1 | GO:0010269 | response to selenium ion(GO:0010269) |
| 0.1 | 1.0 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
| 0.1 | 0.5 | GO:0050428 | purine ribonucleoside bisphosphate biosynthetic process(GO:0034036) 3'-phosphoadenosine 5'-phosphosulfate biosynthetic process(GO:0050428) |
| 0.1 | 0.4 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
| 0.1 | 0.1 | GO:0046707 | IDP metabolic process(GO:0046707) IDP catabolic process(GO:0046709) |
| 0.1 | 0.1 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.1 | 0.8 | GO:0019043 | establishment of viral latency(GO:0019043) |
| 0.1 | 0.8 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
| 0.1 | 0.1 | GO:1904796 | regulation of core promoter binding(GO:1904796) |
| 0.1 | 0.2 | GO:0035408 | histone H3-T6 phosphorylation(GO:0035408) |
| 0.1 | 0.2 | GO:0044691 | tooth eruption(GO:0044691) |
| 0.1 | 0.2 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.1 | 0.1 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
| 0.1 | 0.7 | GO:0006942 | regulation of striated muscle contraction(GO:0006942) |
| 0.1 | 0.2 | GO:0051569 | regulation of histone H3-K4 methylation(GO:0051569) |
| 0.1 | 0.2 | GO:0000967 | endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
| 0.1 | 5.1 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.1 | 0.9 | GO:0006119 | oxidative phosphorylation(GO:0006119) |
| 0.1 | 4.2 | GO:0008033 | tRNA processing(GO:0008033) |
| 0.1 | 0.4 | GO:0090154 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.1 | 0.1 | GO:0050869 | negative regulation of B cell activation(GO:0050869) |
| 0.1 | 0.6 | GO:0008340 | determination of adult lifespan(GO:0008340) |
| 0.1 | 0.4 | GO:0046329 | negative regulation of JNK cascade(GO:0046329) |
| 0.1 | 0.3 | GO:0002320 | lymphoid progenitor cell differentiation(GO:0002320) |
| 0.1 | 0.2 | GO:0043392 | negative regulation of DNA binding(GO:0043392) |
| 0.1 | 0.7 | GO:2000680 | rubidium ion transport(GO:0035826) regulation of rubidium ion transport(GO:2000680) |
| 0.1 | 0.3 | GO:0016246 | RNA interference(GO:0016246) |
| 0.1 | 0.3 | GO:0010902 | positive regulation of very-low-density lipoprotein particle remodeling(GO:0010902) |
| 0.1 | 0.3 | GO:0060481 | lobar bronchus epithelium development(GO:0060481) |
| 0.1 | 0.6 | GO:0045646 | regulation of erythrocyte differentiation(GO:0045646) |
| 0.1 | 0.3 | GO:1904851 | positive regulation of establishment of protein localization to telomere(GO:1904851) |
| 0.1 | 0.6 | GO:0022404 | molting cycle process(GO:0022404) hair cycle process(GO:0022405) |
| 0.1 | 6.8 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.1 | 0.2 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
| 0.1 | 0.1 | GO:0002371 | dendritic cell cytokine production(GO:0002371) |
| 0.1 | 1.4 | GO:0010830 | regulation of myotube differentiation(GO:0010830) |
| 0.1 | 0.2 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.1 | 0.1 | GO:0032571 | response to vitamin K(GO:0032571) |
| 0.1 | 0.3 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.1 | 2.0 | GO:0006699 | bile acid biosynthetic process(GO:0006699) |
| 0.1 | 0.1 | GO:0038162 | erythropoietin-mediated signaling pathway(GO:0038162) |
| 0.1 | 0.5 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 0.1 | 0.1 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.1 | 0.7 | GO:0019985 | translesion synthesis(GO:0019985) |
| 0.1 | 0.1 | GO:0002200 | somatic diversification of immune receptors(GO:0002200) |
| 0.1 | 0.1 | GO:0046514 | ceramide catabolic process(GO:0046514) |
| 0.1 | 0.1 | GO:0050886 | regulation of angiotensin levels in blood(GO:0002002) regulation of systemic arterial blood pressure by renin-angiotensin(GO:0003081) endocrine process(GO:0050886) regulation of angiotensin metabolic process(GO:0060177) |
| 0.1 | 0.3 | GO:0090102 | cochlea development(GO:0090102) |
| 0.1 | 1.1 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.1 | 0.2 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.1 | 0.1 | GO:0008542 | visual learning(GO:0008542) |
| 0.1 | 0.2 | GO:1904046 | negative regulation of vascular endothelial growth factor production(GO:1904046) |
| 0.1 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.1 | GO:0050655 | dermatan sulfate proteoglycan metabolic process(GO:0050655) |
| 0.1 | 0.1 | GO:0071211 | protein targeting to vacuole involved in autophagy(GO:0071211) |
| 0.1 | 0.4 | GO:0071569 | protein ufmylation(GO:0071569) |
| 0.1 | 0.3 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 0.1 | 0.3 | GO:0021781 | glial cell fate commitment(GO:0021781) |
| 0.1 | 0.4 | GO:2001028 | positive regulation of endothelial cell chemotaxis(GO:2001028) |
| 0.1 | 0.6 | GO:0048003 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
| 0.1 | 0.4 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
| 0.1 | 0.4 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
| 0.1 | 0.1 | GO:0072708 | response to sorbitol(GO:0072708) |
| 0.1 | 0.3 | GO:0032204 | regulation of telomere maintenance(GO:0032204) |
| 0.1 | 0.2 | GO:2000825 | positive regulation of androgen receptor activity(GO:2000825) |
| 0.1 | 0.1 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
| 0.1 | 6.7 | GO:0006661 | phosphatidylinositol biosynthetic process(GO:0006661) |
| 0.1 | 0.2 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
| 0.1 | 0.1 | GO:0099563 | modification of synaptic structure(GO:0099563) |
| 0.1 | 0.3 | GO:1904352 | positive regulation of protein catabolic process in the vacuole(GO:1904352) |
| 0.1 | 0.1 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
| 0.1 | 0.3 | GO:0097052 | L-kynurenine metabolic process(GO:0097052) |
| 0.1 | 0.1 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
| 0.1 | 0.3 | GO:0048147 | negative regulation of fibroblast proliferation(GO:0048147) |
| 0.1 | 0.2 | GO:0060662 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
| 0.1 | 0.1 | GO:0033484 | nitric oxide homeostasis(GO:0033484) |
| 0.1 | 0.7 | GO:0007094 | mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
| 0.1 | 0.5 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.1 | 0.8 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.1 | 0.2 | GO:0051182 | coenzyme transport(GO:0051182) |
| 0.1 | 0.3 | GO:0045046 | protein import into peroxisome membrane(GO:0045046) |
| 0.1 | 0.4 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.1 | 0.1 | GO:1902525 | regulation of protein monoubiquitination(GO:1902525) |
| 0.1 | 0.1 | GO:2000417 | negative regulation of eosinophil migration(GO:2000417) |
| 0.1 | 0.3 | GO:0040036 | regulation of fibroblast growth factor receptor signaling pathway(GO:0040036) |
| 0.1 | 2.3 | GO:0043966 | histone H3 acetylation(GO:0043966) |
| 0.1 | 0.2 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.1 | 0.1 | GO:0033007 | negative regulation of mast cell activation involved in immune response(GO:0033007) |
| 0.1 | 1.0 | GO:0034389 | lipid particle organization(GO:0034389) |
| 0.1 | 0.1 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
| 0.1 | 0.6 | GO:0042921 | glucocorticoid receptor signaling pathway(GO:0042921) |
| 0.1 | 0.4 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
| 0.1 | 0.3 | GO:0060056 | mammary gland involution(GO:0060056) |
| 0.1 | 0.5 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.0 | 0.2 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.0 | 0.0 | GO:0051792 | medium-chain fatty acid biosynthetic process(GO:0051792) |
| 0.0 | 0.1 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
| 0.0 | 0.2 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.0 | 0.1 | GO:0018023 | peptidyl-lysine trimethylation(GO:0018023) |
| 0.0 | 0.2 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
| 0.0 | 0.2 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.0 | 0.1 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.0 | 0.2 | GO:0006517 | protein deglycosylation(GO:0006517) |
| 0.0 | 0.3 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
| 0.0 | 0.4 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.0 | 0.1 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
| 0.0 | 0.9 | GO:0042026 | protein refolding(GO:0042026) |
| 0.0 | 0.3 | GO:0034138 | toll-like receptor 3 signaling pathway(GO:0034138) |
| 0.0 | 0.0 | GO:0033625 | positive regulation of integrin activation(GO:0033625) |
| 0.0 | 1.1 | GO:0051491 | positive regulation of filopodium assembly(GO:0051491) |
| 0.0 | 0.4 | GO:0086024 | adrenergic receptor signaling pathway involved in positive regulation of heart rate(GO:0086024) |
| 0.0 | 0.1 | GO:0038066 | p38MAPK cascade(GO:0038066) |
| 0.0 | 0.1 | GO:0042045 | epithelial fluid transport(GO:0042045) |
| 0.0 | 0.0 | GO:0051972 | regulation of telomerase activity(GO:0051972) |
| 0.0 | 2.2 | GO:0032729 | positive regulation of interferon-gamma production(GO:0032729) |
| 0.0 | 0.1 | GO:0090650 | response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
| 0.0 | 0.1 | GO:0030520 | intracellular estrogen receptor signaling pathway(GO:0030520) |
| 0.0 | 0.1 | GO:0010935 | regulation of macrophage cytokine production(GO:0010935) negative regulation of macrophage cytokine production(GO:0010936) |
| 0.0 | 0.3 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
| 0.0 | 0.3 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.0 | 0.2 | GO:0046500 | S-adenosylmethionine metabolic process(GO:0046500) |
| 0.0 | 0.0 | GO:0051771 | negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
| 0.0 | 0.0 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.0 | 0.2 | GO:2000484 | positive regulation of interleukin-8 secretion(GO:2000484) |
| 0.0 | 0.2 | GO:0020027 | hemoglobin metabolic process(GO:0020027) |
| 0.0 | 0.7 | GO:1904886 | beta-catenin destruction complex disassembly(GO:1904886) |
| 0.0 | 0.0 | GO:0018410 | C-terminal protein amino acid modification(GO:0018410) |
| 0.0 | 3.0 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.0 | 0.3 | GO:2000152 | regulation of ubiquitin-specific protease activity(GO:2000152) positive regulation of ubiquitin-specific protease activity(GO:2000158) |
| 0.0 | 0.1 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.0 | 0.0 | GO:0035455 | response to interferon-alpha(GO:0035455) |
| 0.0 | 0.0 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
| 0.0 | 0.5 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
| 0.0 | 0.2 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.0 | 0.1 | GO:0032185 | septin cytoskeleton organization(GO:0032185) |
| 0.0 | 0.1 | GO:0006711 | estrogen catabolic process(GO:0006711) |
| 0.0 | 0.2 | GO:0010166 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.0 | 2.5 | GO:0006672 | ceramide metabolic process(GO:0006672) |
| 0.0 | 0.1 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.0 | 0.0 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.0 | 0.1 | GO:0021697 | cerebellar cortex formation(GO:0021697) |
| 0.0 | 0.0 | GO:1903903 | regulation of establishment of T cell polarity(GO:1903903) |
| 0.0 | 0.2 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.0 | 0.2 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.0 | 0.1 | GO:0071449 | cellular response to lipid hydroperoxide(GO:0071449) |
| 0.0 | 0.4 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
| 0.0 | 0.3 | GO:0031629 | synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
| 0.0 | 0.9 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.0 | 0.2 | GO:0009404 | toxin metabolic process(GO:0009404) |
| 0.0 | 0.1 | GO:0032200 | telomere organization(GO:0032200) |
| 0.0 | 0.0 | GO:0097695 | establishment of RNA localization to telomere(GO:0097694) establishment of macromolecular complex localization to telomere(GO:0097695) |
| 0.0 | 3.6 | GO:0006501 | C-terminal protein lipidation(GO:0006501) |
| 0.0 | 0.2 | GO:0001893 | maternal placenta development(GO:0001893) |
| 0.0 | 0.2 | GO:0001937 | negative regulation of endothelial cell proliferation(GO:0001937) |
| 0.0 | 0.0 | GO:0045622 | alpha-beta T cell activation involved in immune response(GO:0002287) alpha-beta T cell differentiation involved in immune response(GO:0002293) regulation of T-helper cell differentiation(GO:0045622) |
| 0.0 | 0.4 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.0 | 0.1 | GO:0098501 | polynucleotide dephosphorylation(GO:0098501) |
| 0.0 | 0.3 | GO:0051290 | protein heterotetramerization(GO:0051290) |
| 0.0 | 0.5 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.0 | 0.0 | GO:0033079 | immature T cell proliferation(GO:0033079) regulation of immature T cell proliferation(GO:0033083) |
| 0.0 | 0.0 | GO:0015993 | molecular hydrogen transport(GO:0015993) |
| 0.0 | 0.1 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.0 | 0.1 | GO:1902896 | terminal web assembly(GO:1902896) |
| 0.0 | 0.2 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
| 0.0 | 0.3 | GO:1904424 | regulation of GTP binding(GO:1904424) |
| 0.0 | 0.3 | GO:2000124 | regulation of endocannabinoid signaling pathway(GO:2000124) |
| 0.0 | 0.1 | GO:0046900 | tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.0 | 0.1 | GO:0043666 | regulation of phosphoprotein phosphatase activity(GO:0043666) |
| 0.0 | 0.1 | GO:0072205 | metanephric collecting duct development(GO:0072205) |
| 0.0 | 0.4 | GO:0031442 | positive regulation of mRNA 3'-end processing(GO:0031442) |
| 0.0 | 0.2 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.0 | 2.2 | GO:0045454 | cell redox homeostasis(GO:0045454) |
| 0.0 | 0.1 | GO:0048875 | chemical homeostasis within a tissue(GO:0048875) |
| 0.0 | 0.7 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.0 | 0.5 | GO:0045332 | phospholipid translocation(GO:0045332) |
| 0.0 | 0.1 | GO:0001507 | acetylcholine catabolic process in synaptic cleft(GO:0001507) acetylcholine catabolic process(GO:0006581) |
| 0.0 | 0.1 | GO:0031112 | positive regulation of microtubule polymerization or depolymerization(GO:0031112) positive regulation of microtubule polymerization(GO:0031116) |
| 0.0 | 0.1 | GO:0060297 | regulation of sarcomere organization(GO:0060297) |
| 0.0 | 0.0 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
| 0.0 | 0.5 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
| 0.0 | 0.0 | GO:0034204 | lipid translocation(GO:0034204) |
| 0.0 | 1.0 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 0.0 | 0.7 | GO:0043620 | regulation of DNA-templated transcription in response to stress(GO:0043620) |
| 0.0 | 0.2 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.0 | 0.1 | GO:0035067 | negative regulation of histone acetylation(GO:0035067) |
| 0.0 | 0.1 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.0 | 0.1 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.0 | 0.3 | GO:0051057 | positive regulation of small GTPase mediated signal transduction(GO:0051057) |
| 0.0 | 0.0 | GO:0036089 | cleavage furrow formation(GO:0036089) |
| 0.0 | 0.1 | GO:0019566 | arabinose metabolic process(GO:0019566) L-arabinose metabolic process(GO:0046373) |
| 0.0 | 0.3 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
| 0.0 | 0.0 | GO:0000454 | snoRNA guided rRNA pseudouridine synthesis(GO:0000454) |
| 0.0 | 0.1 | GO:0006210 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
| 0.0 | 0.0 | GO:0071542 | dopaminergic neuron differentiation(GO:0071542) |
| 0.0 | 0.3 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
| 0.0 | 0.1 | GO:0002522 | leukocyte migration involved in immune response(GO:0002522) |
| 0.0 | 0.2 | GO:1904872 | regulation of telomerase RNA localization to Cajal body(GO:1904872) |
| 0.0 | 0.1 | GO:0003374 | dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
| 0.0 | 0.1 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.0 | 0.2 | GO:0097324 | melanocyte migration(GO:0097324) regulation of melanosome organization(GO:1903056) |
| 0.0 | 0.1 | GO:0060969 | negative regulation of gene silencing by miRNA(GO:0060965) negative regulation of gene silencing(GO:0060969) |
| 0.0 | 0.4 | GO:0042340 | keratan sulfate catabolic process(GO:0042340) |
| 0.0 | 0.2 | GO:0015867 | ATP transport(GO:0015867) |
| 0.0 | 0.3 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.0 | 0.1 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
| 0.0 | 0.4 | GO:0010529 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.0 | 0.1 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
| 0.0 | 0.1 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.0 | 0.0 | GO:0002437 | inflammatory response to antigenic stimulus(GO:0002437) |
| 0.0 | 0.1 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.0 | 0.1 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.0 | 0.7 | GO:0043123 | positive regulation of I-kappaB kinase/NF-kappaB signaling(GO:0043123) |
| 0.0 | 1.1 | GO:0098760 | interleukin-7-mediated signaling pathway(GO:0038111) response to interleukin-7(GO:0098760) cellular response to interleukin-7(GO:0098761) |
| 0.0 | 0.1 | GO:0044857 | plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) caveola assembly(GO:0070836) |
| 0.0 | 0.1 | GO:0034356 | NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
| 0.0 | 0.8 | GO:0009409 | response to cold(GO:0009409) |
| 0.0 | 0.2 | GO:0007099 | centriole replication(GO:0007099) |
| 0.0 | 0.2 | GO:0009642 | response to light intensity(GO:0009642) |
| 0.0 | 0.1 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.0 | 8.2 | GO:0000375 | RNA splicing, via transesterification reactions(GO:0000375) |
| 0.0 | 2.6 | GO:0048515 | spermatid differentiation(GO:0048515) |
| 0.0 | 0.1 | GO:0021966 | corticospinal neuron axon guidance(GO:0021966) |
| 0.0 | 0.1 | GO:0002428 | antigen processing and presentation of peptide antigen via MHC class Ib(GO:0002428) antigen processing and presentation of endogenous peptide antigen via MHC class Ib(GO:0002476) |
| 0.0 | 0.1 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
| 0.0 | 0.1 | GO:0032096 | negative regulation of response to food(GO:0032096) negative regulation of appetite(GO:0032099) |
| 0.0 | 0.0 | GO:1904429 | regulation of t-circle formation(GO:1904429) |
| 0.0 | 0.1 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
| 0.0 | 0.1 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
| 0.0 | 0.2 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
| 0.0 | 0.1 | GO:0034334 | adherens junction maintenance(GO:0034334) |
| 0.0 | 0.1 | GO:0009756 | carbohydrate mediated signaling(GO:0009756) |
| 0.0 | 0.4 | GO:0050908 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.0 | 0.3 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.0 | 0.2 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
| 0.0 | 0.0 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.0 | 0.2 | GO:0006188 | IMP biosynthetic process(GO:0006188) |
| 0.0 | 0.0 | GO:1901532 | regulation of hematopoietic progenitor cell differentiation(GO:1901532) |
| 0.0 | 0.1 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
| 0.0 | 0.1 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
| 0.0 | 0.0 | GO:1902563 | regulation of neutrophil degranulation(GO:0043313) regulation of neutrophil activation(GO:1902563) |
| 0.0 | 0.1 | GO:0051568 | histone H3-K4 methylation(GO:0051568) |
| 0.0 | 0.0 | GO:0061762 | CAMKK-AMPK signaling cascade(GO:0061762) |
| 0.0 | 0.1 | GO:0032801 | receptor catabolic process(GO:0032801) |
| 0.0 | 0.1 | GO:0060005 | vestibular reflex(GO:0060005) |
| 0.0 | 0.0 | GO:0090298 | regulation of mitochondrial DNA replication(GO:0090296) negative regulation of mitochondrial DNA replication(GO:0090298) negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
| 0.0 | 0.0 | GO:0002154 | thyroid hormone mediated signaling pathway(GO:0002154) regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
| 0.0 | 0.3 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
| 0.0 | 0.1 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.0 | 0.0 | GO:0015988 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) |
| 0.0 | 0.2 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.0 | 0.1 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
| 0.0 | 0.2 | GO:0006853 | carnitine shuttle(GO:0006853) |
| 0.0 | 0.1 | GO:1901162 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
| 0.0 | 0.1 | GO:0015891 | iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
| 0.0 | 0.1 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.0 | 0.0 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
| 0.0 | 0.1 | GO:0007379 | segment specification(GO:0007379) |
| 0.0 | 0.0 | GO:0015813 | L-glutamate transport(GO:0015813) |
| 0.0 | 0.1 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.0 | 1.0 | GO:0006968 | cellular defense response(GO:0006968) |
| 0.0 | 0.0 | GO:0051254 | positive regulation of RNA metabolic process(GO:0051254) |
| 0.0 | 0.5 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 | 0.1 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
| 0.0 | 0.0 | GO:0007352 | zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.0 | 0.0 | GO:0098792 | xenophagy(GO:0098792) |
| 0.0 | 0.1 | GO:0007131 | reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
| 0.0 | 0.1 | GO:0018032 | protein amidation(GO:0018032) |
| 0.0 | 0.2 | GO:2000142 | regulation of DNA-templated transcription, initiation(GO:2000142) |
| 0.0 | 0.0 | GO:0060763 | mammary duct terminal end bud growth(GO:0060763) |
| 0.0 | 0.0 | GO:0098758 | response to interleukin-8(GO:0098758) cellular response to interleukin-8(GO:0098759) |
| 0.0 | 0.0 | GO:0034285 | response to sucrose(GO:0009744) response to disaccharide(GO:0034285) |
| 0.0 | 0.1 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.0 | 0.1 | GO:0042908 | xenobiotic transport(GO:0042908) |
| 0.0 | 0.1 | GO:0099515 | actin filament-based transport(GO:0099515) |
| 0.0 | 0.3 | GO:0050909 | sensory perception of taste(GO:0050909) |
| 0.0 | 0.1 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) positive regulation of neuron projection regeneration(GO:0070572) |
| 0.0 | 0.0 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
| 0.0 | 0.2 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.0 | 0.1 | GO:0040014 | regulation of multicellular organism growth(GO:0040014) |
| 0.0 | 0.0 | GO:0008595 | tripartite regional subdivision(GO:0007351) anterior/posterior axis specification, embryo(GO:0008595) |
| 0.0 | 0.0 | GO:0030916 | otic vesicle formation(GO:0030916) |
| 0.0 | 0.4 | GO:0000266 | mitochondrial fission(GO:0000266) |
| 0.0 | 0.0 | GO:0097267 | omega-hydroxylase P450 pathway(GO:0097267) |
| 0.0 | 0.2 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
| 0.0 | 0.1 | GO:0032411 | positive regulation of transporter activity(GO:0032411) |
| 0.0 | 0.0 | GO:1903412 | response to bile acid(GO:1903412) cellular response to bile acid(GO:1903413) |
| 0.0 | 0.2 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.0 | 0.0 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
| 0.0 | 0.0 | GO:0093001 | glycolysis from storage polysaccharide through glucose-1-phosphate(GO:0093001) |
| 0.0 | 0.0 | GO:0009624 | response to nematode(GO:0009624) |
| 0.0 | 0.0 | GO:0046825 | regulation of protein export from nucleus(GO:0046825) |
| 0.0 | 0.0 | GO:0090045 | positive regulation of deacetylase activity(GO:0090045) positive regulation of histone deacetylase activity(GO:1901727) |
| 0.0 | 0.0 | GO:0044827 | modulation by host of viral genome replication(GO:0044827) |
| 0.0 | 0.0 | GO:0060715 | syncytiotrophoblast cell differentiation involved in labyrinthine layer development(GO:0060715) |
| 0.0 | 0.1 | GO:1901018 | positive regulation of potassium ion transmembrane transporter activity(GO:1901018) |
| 0.0 | 0.0 | GO:0003214 | cardiac left ventricle morphogenesis(GO:0003214) |
| 0.0 | 0.0 | GO:1903595 | positive regulation of histamine secretion by mast cell(GO:1903595) |
| 0.0 | 0.1 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.0 | 0.1 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
| 0.0 | 0.0 | GO:0002385 | mucosal immune response(GO:0002385) |
| 0.0 | 0.0 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 0.0 | 0.2 | GO:0042254 | ribosome biogenesis(GO:0042254) |
| 0.0 | 0.1 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.0 | 0.0 | GO:0015705 | iodide transport(GO:0015705) |
| 0.0 | 0.0 | GO:0035065 | regulation of histone acetylation(GO:0035065) |
| 0.0 | 0.1 | GO:1904970 | brush border assembly(GO:1904970) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.1 | 10.4 | GO:0097123 | cyclin A1-CDK2 complex(GO:0097123) |
| 2.0 | 6.0 | GO:0001534 | radial spoke(GO:0001534) |
| 1.7 | 5.0 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 1.6 | 8.2 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 1.5 | 20.3 | GO:0001520 | outer dense fiber(GO:0001520) |
| 1.4 | 26.1 | GO:0036038 | MKS complex(GO:0036038) |
| 1.4 | 9.6 | GO:0002177 | manchette(GO:0002177) |
| 1.3 | 3.8 | GO:0034678 | integrin alpha8-beta1 complex(GO:0034678) |
| 1.2 | 5.0 | GO:0097224 | sperm connecting piece(GO:0097224) |
| 1.2 | 12.2 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 1.2 | 6.0 | GO:0098536 | deuterosome(GO:0098536) |
| 1.1 | 1.1 | GO:0097598 | sperm cytoplasmic droplet(GO:0097598) |
| 1.0 | 4.0 | GO:0016939 | kinesin II complex(GO:0016939) |
| 1.0 | 2.9 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
| 0.9 | 9.9 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.9 | 7.8 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.8 | 2.5 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.8 | 3.4 | GO:0097196 | Shu complex(GO:0097196) |
| 0.8 | 3.3 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.8 | 2.4 | GO:0020003 | symbiont-containing vacuole(GO:0020003) symbiont-containing vacuole membrane(GO:0020005) |
| 0.8 | 0.8 | GO:0032302 | MutSbeta complex(GO:0032302) |
| 0.8 | 3.9 | GO:1990769 | proximal neuron projection(GO:1990769) |
| 0.8 | 2.3 | GO:0005608 | laminin-3 complex(GO:0005608) |
| 0.7 | 0.7 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 0.7 | 4.3 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.7 | 3.6 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.7 | 7.8 | GO:0034464 | BBSome(GO:0034464) |
| 0.7 | 7.1 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.7 | 2.8 | GO:0060187 | cell pole(GO:0060187) |
| 0.7 | 14.6 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.7 | 10.7 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.7 | 5.3 | GO:0034688 | integrin alphaM-beta2 complex(GO:0034688) |
| 0.7 | 5.9 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 0.7 | 3.3 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.7 | 4.6 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.6 | 2.5 | GO:0032301 | MutSalpha complex(GO:0032301) |
| 0.6 | 1.9 | GO:0044295 | axonal growth cone(GO:0044295) |
| 0.6 | 13.8 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
| 0.6 | 8.1 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.6 | 6.8 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.6 | 2.5 | GO:0005889 | hydrogen:potassium-exchanging ATPase complex(GO:0005889) |
| 0.6 | 1.2 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.6 | 4.9 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.6 | 10.5 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.6 | 4.0 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.6 | 1.7 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.6 | 3.3 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.5 | 4.4 | GO:0000923 | equatorial microtubule organizing center(GO:0000923) |
| 0.5 | 5.4 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.5 | 4.8 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.5 | 0.5 | GO:0044292 | dendrite terminus(GO:0044292) |
| 0.5 | 18.0 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
| 0.5 | 12.0 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.5 | 1.6 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.5 | 5.7 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.5 | 1.0 | GO:0035976 | AP1 complex(GO:0035976) |
| 0.5 | 3.0 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.5 | 1.5 | GO:0030689 | Noc complex(GO:0030689) |
| 0.5 | 2.0 | GO:0031673 | H zone(GO:0031673) |
| 0.5 | 2.9 | GO:0070369 | beta-catenin-TCF7L2 complex(GO:0070369) |
| 0.5 | 1.9 | GO:0000235 | astral microtubule(GO:0000235) aster(GO:0005818) |
| 0.5 | 1.4 | GO:0044753 | amphisome(GO:0044753) |
| 0.5 | 1.4 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.5 | 40.1 | GO:0097014 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
| 0.4 | 2.2 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.4 | 1.3 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
| 0.4 | 5.7 | GO:0097433 | dense body(GO:0097433) |
| 0.4 | 3.0 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.4 | 3.4 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) |
| 0.4 | 1.3 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.4 | 0.8 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.4 | 2.0 | GO:0097125 | cyclin B1-CDK1 complex(GO:0097125) |
| 0.4 | 4.3 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.4 | 1.2 | GO:0019034 | viral replication complex(GO:0019034) |
| 0.4 | 1.9 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.4 | 1.1 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.4 | 4.4 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.4 | 1.1 | GO:0018444 | translation release factor complex(GO:0018444) |
| 0.4 | 5.4 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.4 | 0.7 | GO:0030849 | autosome(GO:0030849) |
| 0.3 | 1.7 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
| 0.3 | 0.3 | GO:0005839 | proteasome core complex(GO:0005839) |
| 0.3 | 6.1 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.3 | 4.4 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.3 | 15.7 | GO:0009925 | basal plasma membrane(GO:0009925) |
| 0.3 | 1.7 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.3 | 1.9 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.3 | 4.2 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.3 | 3.5 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.3 | 1.9 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
| 0.3 | 1.6 | GO:0045272 | plasma membrane respiratory chain complex I(GO:0045272) |
| 0.3 | 3.1 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.3 | 2.2 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
| 0.3 | 0.9 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.3 | 0.3 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.3 | 21.0 | GO:0036064 | ciliary basal body(GO:0036064) |
| 0.3 | 0.3 | GO:0032156 | septin cytoskeleton(GO:0032156) |
| 0.3 | 1.2 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.3 | 1.5 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
| 0.3 | 1.2 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.3 | 0.9 | GO:0043291 | RAVE complex(GO:0043291) |
| 0.3 | 0.6 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.3 | 0.6 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 0.3 | 1.2 | GO:1990578 | perinuclear endoplasmic reticulum membrane(GO:1990578) |
| 0.3 | 7.2 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.3 | 1.1 | GO:0019867 | outer membrane(GO:0019867) |
| 0.3 | 0.3 | GO:0044453 | nuclear membrane part(GO:0044453) |
| 0.3 | 2.3 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.3 | 4.8 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.3 | 3.4 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.3 | 6.3 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.3 | 1.9 | GO:0001740 | Barr body(GO:0001740) |
| 0.3 | 1.1 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.3 | 2.2 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.3 | 1.6 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.3 | 4.1 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.3 | 1.1 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 0.3 | 2.1 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.3 | 1.0 | GO:1990796 | photoreceptor cell terminal bouton(GO:1990796) |
| 0.3 | 1.5 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.2 | 13.2 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.2 | 0.7 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.2 | 7.4 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.2 | 1.2 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.2 | 2.4 | GO:0005844 | polysome(GO:0005844) |
| 0.2 | 0.7 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.2 | 1.4 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.2 | 0.5 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
| 0.2 | 0.7 | GO:0016935 | glycine-gated chloride channel complex(GO:0016935) |
| 0.2 | 0.7 | GO:1990037 | Lewy body core(GO:1990037) |
| 0.2 | 1.9 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.2 | 1.4 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
| 0.2 | 4.4 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.2 | 4.6 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.2 | 1.1 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) |
| 0.2 | 5.0 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.2 | 1.3 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.2 | 1.6 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
| 0.2 | 1.8 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.2 | 0.9 | GO:0031211 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
| 0.2 | 6.4 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.2 | 3.5 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.2 | 1.5 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.2 | 1.1 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.2 | 1.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.2 | 0.6 | GO:0070195 | growth hormone receptor complex(GO:0070195) |
| 0.2 | 4.3 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.2 | 2.1 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.2 | 3.4 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.2 | 3.0 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.2 | 3.0 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.2 | 0.6 | GO:0048269 | methionine adenosyltransferase complex(GO:0048269) |
| 0.2 | 0.6 | GO:0070081 | clathrin-sculpted monoamine transport vesicle(GO:0070081) clathrin-sculpted monoamine transport vesicle membrane(GO:0070083) |
| 0.2 | 0.2 | GO:0042025 | host cell nucleus(GO:0042025) host cell nuclear part(GO:0044094) |
| 0.2 | 8.8 | GO:0016592 | mediator complex(GO:0016592) |
| 0.2 | 6.5 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
| 0.2 | 2.9 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.2 | 0.6 | GO:1990622 | CHOP-ATF3 complex(GO:1990622) |
| 0.2 | 1.5 | GO:1990589 | ATF4-CREB1 transcription factor complex(GO:1990589) |
| 0.2 | 3.3 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.2 | 2.7 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.2 | 2.0 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.2 | 1.4 | GO:1903439 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
| 0.2 | 1.0 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.2 | 1.8 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.2 | 1.0 | GO:0070695 | FHF complex(GO:0070695) |
| 0.2 | 1.0 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.2 | 7.7 | GO:0090544 | BAF-type complex(GO:0090544) |
| 0.2 | 0.6 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
| 0.2 | 1.3 | GO:0098575 | lumenal side of lysosomal membrane(GO:0098575) |
| 0.2 | 1.1 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.2 | 0.2 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.2 | 0.9 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.2 | 0.4 | GO:0070938 | contractile ring(GO:0070938) |
| 0.2 | 0.2 | GO:0034272 | phosphatidylinositol 3-kinase complex, class III, type I(GO:0034271) phosphatidylinositol 3-kinase complex, class III, type II(GO:0034272) |
| 0.2 | 0.5 | GO:0044609 | DBIRD complex(GO:0044609) |
| 0.2 | 0.5 | GO:0031372 | UBC13-MMS2 complex(GO:0031372) |
| 0.2 | 0.5 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.2 | 1.6 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.2 | 18.3 | GO:0031514 | motile cilium(GO:0031514) |
| 0.2 | 1.1 | GO:1990584 | cardiac Troponin complex(GO:1990584) |
| 0.2 | 0.7 | GO:0036396 | MIS complex(GO:0036396) mRNA editing complex(GO:0045293) |
| 0.2 | 0.2 | GO:0005901 | caveola(GO:0005901) |
| 0.2 | 0.5 | GO:0016342 | catenin complex(GO:0016342) |
| 0.2 | 2.6 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.2 | 0.7 | GO:0070288 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
| 0.2 | 0.5 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.2 | 1.8 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.2 | 1.6 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.2 | 1.9 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
| 0.2 | 0.5 | GO:0036398 | TCR signalosome(GO:0036398) |
| 0.2 | 1.3 | GO:0072487 | MSL complex(GO:0072487) |
| 0.2 | 0.3 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.2 | 10.6 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
| 0.2 | 0.6 | GO:0030891 | VCB complex(GO:0030891) |
| 0.2 | 0.8 | GO:1905202 | 3-methylcrotonyl-CoA carboxylase complex, mitochondrial(GO:0002169) methylcrotonoyl-CoA carboxylase complex(GO:1905202) |
| 0.2 | 5.6 | GO:0045259 | proton-transporting ATP synthase complex(GO:0045259) |
| 0.2 | 1.5 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.2 | 0.8 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.2 | 0.6 | GO:0031213 | RSF complex(GO:0031213) |
| 0.2 | 10.6 | GO:0005778 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.1 | 3.9 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.1 | 0.4 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
| 0.1 | 1.2 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 0.1 | 0.3 | GO:0060200 | clathrin-sculpted acetylcholine transport vesicle(GO:0060200) clathrin-sculpted acetylcholine transport vesicle membrane(GO:0060201) |
| 0.1 | 0.9 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.1 | 2.0 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.1 | 0.4 | GO:0005715 | late recombination nodule(GO:0005715) |
| 0.1 | 0.3 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
| 0.1 | 1.4 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
| 0.1 | 0.1 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.1 | 0.4 | GO:0033565 | ESCRT-0 complex(GO:0033565) |
| 0.1 | 2.0 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.1 | 1.1 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.1 | 1.0 | GO:0044754 | autolysosome(GO:0044754) |
| 0.1 | 5.4 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
| 0.1 | 0.5 | GO:1990393 | 3M complex(GO:1990393) |
| 0.1 | 5.2 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.1 | 0.5 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
| 0.1 | 0.4 | GO:0016938 | kinesin I complex(GO:0016938) |
| 0.1 | 0.5 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
| 0.1 | 0.3 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
| 0.1 | 0.1 | GO:0005684 | U2-type spliceosomal complex(GO:0005684) |
| 0.1 | 0.8 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
| 0.1 | 0.8 | GO:0001652 | granular component(GO:0001652) |
| 0.1 | 0.9 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.1 | 2.2 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.1 | 2.3 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
| 0.1 | 7.7 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.1 | 9.7 | GO:0035577 | azurophil granule membrane(GO:0035577) |
| 0.1 | 1.0 | GO:0060091 | kinocilium(GO:0060091) |
| 0.1 | 0.9 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.1 | 0.7 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.1 | 1.1 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
| 0.1 | 0.4 | GO:0034455 | t-UTP complex(GO:0034455) |
| 0.1 | 0.6 | GO:0000308 | cytoplasmic cyclin-dependent protein kinase holoenzyme complex(GO:0000308) |
| 0.1 | 0.2 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
| 0.1 | 1.1 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.1 | 0.5 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.1 | 1.5 | GO:0032039 | integrator complex(GO:0032039) |
| 0.1 | 2.3 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.1 | 1.0 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.1 | 0.5 | GO:0031085 | BLOC-3 complex(GO:0031085) |
| 0.1 | 3.4 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.1 | 0.7 | GO:0031010 | ISWI-type complex(GO:0031010) |
| 0.1 | 0.3 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
| 0.1 | 1.8 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.1 | 1.2 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.1 | 1.2 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.1 | 1.6 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.1 | 3.8 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.1 | 0.3 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.1 | 2.6 | GO:0071010 | prespliceosome(GO:0071010) |
| 0.1 | 0.8 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.1 | 0.8 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.1 | 0.5 | GO:0043235 | receptor complex(GO:0043235) |
| 0.1 | 0.5 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.1 | 1.5 | GO:0034709 | methylosome(GO:0034709) |
| 0.1 | 0.5 | GO:0032389 | MutLalpha complex(GO:0032389) |
| 0.1 | 0.9 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.1 | 0.2 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
| 0.1 | 2.7 | GO:0097546 | ciliary base(GO:0097546) |
| 0.1 | 0.3 | GO:0032040 | small-subunit processome(GO:0032040) |
| 0.1 | 0.7 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.1 | 0.5 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.1 | 0.4 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.1 | 2.4 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.1 | 3.3 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.1 | 0.2 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.1 | 0.5 | GO:0070826 | paraferritin complex(GO:0070826) |
| 0.1 | 0.5 | GO:0031515 | tRNA (m1A) methyltransferase complex(GO:0031515) |
| 0.1 | 0.3 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
| 0.1 | 0.3 | GO:0000229 | cytoplasmic chromosome(GO:0000229) |
| 0.1 | 1.1 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.1 | 5.1 | GO:0015030 | Cajal body(GO:0015030) |
| 0.1 | 3.3 | GO:0030286 | dynein complex(GO:0030286) |
| 0.1 | 3.9 | GO:0044298 | neuronal cell body membrane(GO:0032809) cell body membrane(GO:0044298) |
| 0.1 | 0.2 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.1 | 12.1 | GO:0016605 | PML body(GO:0016605) |
| 0.1 | 1.9 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.1 | 0.6 | GO:0070554 | synaptobrevin 2-SNAP-25-syntaxin-3-complexin complex(GO:0070554) |
| 0.1 | 1.0 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.1 | 0.8 | GO:0044218 | other organism cell membrane(GO:0044218) other organism membrane(GO:0044279) |
| 0.1 | 0.9 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 0.1 | 0.6 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.1 | 0.9 | GO:0097386 | glial cell projection(GO:0097386) |
| 0.1 | 0.2 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
| 0.1 | 0.9 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
| 0.1 | 1.7 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.1 | 0.4 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.1 | 0.3 | GO:0032044 | DSIF complex(GO:0032044) |
| 0.1 | 6.7 | GO:0070469 | respiratory chain(GO:0070469) |
| 0.1 | 0.2 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.1 | 0.5 | GO:0071437 | invadopodium(GO:0071437) |
| 0.1 | 0.2 | GO:0071821 | FANCM-MHF complex(GO:0071821) |
| 0.1 | 1.9 | GO:0032993 | protein-DNA complex(GO:0032993) |
| 0.1 | 4.5 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.1 | 1.0 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) |
| 0.1 | 0.4 | GO:0000938 | GARP complex(GO:0000938) |
| 0.1 | 0.9 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.1 | 0.6 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.1 | 0.4 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.1 | 0.7 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.1 | 0.3 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.1 | 0.3 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.1 | 3.7 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.1 | 3.2 | GO:0000123 | histone acetyltransferase complex(GO:0000123) |
| 0.1 | 1.6 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.1 | 0.3 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
| 0.1 | 2.2 | GO:0005802 | trans-Golgi network(GO:0005802) |
| 0.1 | 0.3 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.1 | 0.5 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.1 | 0.3 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.1 | 29.6 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
| 0.1 | 2.4 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.1 | 0.3 | GO:0032021 | NELF complex(GO:0032021) |
| 0.1 | 1.5 | GO:0034706 | sodium channel complex(GO:0034706) |
| 0.1 | 0.9 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.1 | 0.2 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
| 0.1 | 0.3 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.1 | 4.3 | GO:0005929 | cilium(GO:0005929) |
| 0.1 | 0.2 | GO:0043596 | nuclear replication fork(GO:0043596) |
| 0.1 | 0.4 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.1 | 0.2 | GO:1990357 | terminal web(GO:1990357) |
| 0.1 | 0.1 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.1 | 4.8 | GO:0099501 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
| 0.1 | 0.2 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.1 | 0.1 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.1 | 2.8 | GO:0000786 | nucleosome(GO:0000786) |
| 0.1 | 0.2 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.1 | 1.4 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.1 | 0.4 | GO:0036021 | endolysosome lumen(GO:0036021) |
| 0.1 | 3.4 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.1 | 0.5 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.1 | 0.3 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.1 | 0.2 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.0 | 1.1 | GO:0031094 | platelet dense tubular network(GO:0031094) |
| 0.0 | 0.1 | GO:0009330 | DNA topoisomerase complex (ATP-hydrolyzing)(GO:0009330) |
| 0.0 | 0.6 | GO:0043186 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
| 0.0 | 1.5 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.0 | 0.4 | GO:0031201 | SNARE complex(GO:0031201) |
| 0.0 | 0.2 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.0 | 0.1 | GO:0098855 | HCN channel complex(GO:0098855) |
| 0.0 | 0.1 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.0 | 6.5 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.0 | 0.8 | GO:0036452 | ESCRT complex(GO:0036452) |
| 0.0 | 0.7 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.0 | 0.3 | GO:0033503 | HULC complex(GO:0033503) |
| 0.0 | 0.0 | GO:0005953 | CAAX-protein geranylgeranyltransferase complex(GO:0005953) |
| 0.0 | 0.2 | GO:0097362 | MCM8-MCM9 complex(GO:0097362) |
| 0.0 | 0.2 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 1.2 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.0 | 0.5 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.0 | 0.1 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
| 0.0 | 0.2 | GO:0070985 | TFIIK complex(GO:0070985) |
| 0.0 | 0.3 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
| 0.0 | 0.3 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.0 | 0.2 | GO:0005846 | nuclear cap binding complex(GO:0005846) |
| 0.0 | 0.3 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.0 | 0.2 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.0 | 0.2 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.0 | 3.1 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.0 | 0.1 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
| 0.0 | 5.5 | GO:0005815 | microtubule organizing center(GO:0005815) |
| 0.0 | 0.5 | GO:0033202 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 0.0 | 0.2 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.0 | 0.1 | GO:0090543 | Flemming body(GO:0090543) |
| 0.0 | 0.9 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
| 0.0 | 0.1 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
| 0.0 | 0.3 | GO:0000793 | condensed chromosome(GO:0000793) |
| 0.0 | 4.7 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
| 0.0 | 1.1 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.0 | 7.4 | GO:0000151 | ubiquitin ligase complex(GO:0000151) |
| 0.0 | 0.1 | GO:0089701 | U2AF(GO:0089701) |
| 0.0 | 0.2 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.0 | 2.3 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.0 | 4.8 | GO:0055037 | recycling endosome(GO:0055037) |
| 0.0 | 0.1 | GO:0044455 | mitochondrial membrane part(GO:0044455) |
| 0.0 | 0.3 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.0 | 0.9 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.0 | 0.2 | GO:0005694 | chromosome(GO:0005694) |
| 0.0 | 1.2 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.0 | 0.2 | GO:0031300 | intrinsic component of organelle membrane(GO:0031300) |
| 0.0 | 0.1 | GO:0097165 | nuclear stress granule(GO:0097165) |
| 0.0 | 1.9 | GO:0005814 | centriole(GO:0005814) |
| 0.0 | 0.4 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.0 | 0.1 | GO:0071148 | TEAD-1-YAP complex(GO:0071148) |
| 0.0 | 0.4 | GO:0032590 | dendrite membrane(GO:0032590) |
| 0.0 | 0.3 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
| 0.0 | 0.1 | GO:0035354 | Toll-like receptor 1-Toll-like receptor 2 protein complex(GO:0035354) |
| 0.0 | 1.7 | GO:0031901 | early endosome membrane(GO:0031901) |
| 0.0 | 0.1 | GO:0043293 | apoptosome(GO:0043293) |
| 0.0 | 0.2 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.0 | 0.1 | GO:0071203 | WASH complex(GO:0071203) |
| 0.0 | 0.2 | GO:0010369 | chromocenter(GO:0010369) |
| 0.0 | 0.2 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.0 | 0.4 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.0 | 0.0 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.0 | 0.1 | GO:0031302 | intrinsic component of endosome membrane(GO:0031302) |
| 0.0 | 0.1 | GO:0005687 | U4 snRNP(GO:0005687) |
| 0.0 | 0.0 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.0 | 0.1 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.0 | 1.3 | GO:0016459 | myosin complex(GO:0016459) |
| 0.0 | 0.4 | GO:0051233 | spindle midzone(GO:0051233) |
| 0.0 | 0.5 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.0 | 0.1 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.0 | 0.5 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
| 0.0 | 0.0 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.0 | 0.0 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.0 | 0.2 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.0 | 0.3 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.0 | 0.2 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
| 0.0 | 0.0 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.0 | 0.5 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 0.2 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.0 | 0.1 | GO:0017102 | methionyl glutamyl tRNA synthetase complex(GO:0017102) |
| 0.0 | 0.1 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.0 | 34.6 | GO:0005654 | nucleoplasm(GO:0005654) |
| 0.0 | 0.0 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.2 | 9.6 | GO:0052810 | 1-phosphatidylinositol-5-kinase activity(GO:0052810) |
| 1.9 | 7.6 | GO:0005292 | high-affinity basic amino acid transmembrane transporter activity(GO:0005287) high-affinity arginine transmembrane transporter activity(GO:0005289) high-affinity lysine transmembrane transporter activity(GO:0005292) |
| 1.6 | 3.1 | GO:0030371 | translation repressor activity(GO:0030371) |
| 1.5 | 4.4 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
| 1.4 | 1.4 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
| 1.3 | 4.0 | GO:0004958 | prostaglandin F receptor activity(GO:0004958) |
| 1.3 | 3.8 | GO:0016781 | selenide, water dikinase activity(GO:0004756) phosphotransferase activity, paired acceptors(GO:0016781) |
| 1.2 | 8.7 | GO:0047894 | flavonol 3-sulfotransferase activity(GO:0047894) |
| 1.2 | 1.2 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 1.2 | 4.8 | GO:0004909 | interleukin-1, Type I, activating receptor activity(GO:0004909) |
| 1.2 | 4.7 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 1.2 | 9.3 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
| 1.1 | 5.6 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 1.1 | 3.2 | GO:0008808 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) CDP-diacylglycerol-phosphatidylglycerol phosphatidyltransferase activity(GO:0043337) |
| 1.1 | 6.3 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
| 1.0 | 3.1 | GO:0047977 | hepoxilin-epoxide hydrolase activity(GO:0047977) |
| 1.0 | 6.9 | GO:0050682 | AF-2 domain binding(GO:0050682) |
| 1.0 | 2.9 | GO:0015218 | pyrimidine nucleotide transmembrane transporter activity(GO:0015218) |
| 1.0 | 12.5 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 1.0 | 6.7 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
| 0.9 | 0.9 | GO:0044378 | non-sequence-specific DNA binding, bending(GO:0044378) |
| 0.9 | 2.7 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
| 0.9 | 3.6 | GO:0008513 | secondary active organic cation transmembrane transporter activity(GO:0008513) |
| 0.9 | 16.0 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.9 | 5.2 | GO:0051870 | methotrexate binding(GO:0051870) |
| 0.8 | 18.2 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.8 | 2.5 | GO:0050135 | NAD(P)+ nucleosidase activity(GO:0050135) |
| 0.8 | 2.5 | GO:0035379 | carbon dioxide transmembrane transporter activity(GO:0035379) |
| 0.8 | 2.4 | GO:0008124 | 4-alpha-hydroxytetrahydrobiopterin dehydratase activity(GO:0008124) |
| 0.8 | 2.4 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.8 | 3.1 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.8 | 3.9 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.8 | 6.9 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
| 0.8 | 2.3 | GO:0031862 | prostanoid receptor binding(GO:0031862) |
| 0.7 | 3.0 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 0.7 | 3.0 | GO:0008336 | gamma-butyrobetaine dioxygenase activity(GO:0008336) |
| 0.7 | 7.2 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.7 | 2.8 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.7 | 2.8 | GO:0004803 | transposase activity(GO:0004803) |
| 0.7 | 2.1 | GO:0098625 | methylselenol reductase activity(GO:0098625) methylseleninic acid reductase activity(GO:0098626) |
| 0.7 | 2.1 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.7 | 6.8 | GO:0003910 | DNA ligase (ATP) activity(GO:0003910) |
| 0.7 | 1.3 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
| 0.7 | 3.3 | GO:0032142 | single guanine insertion binding(GO:0032142) |
| 0.7 | 2.6 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
| 0.7 | 4.6 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.7 | 4.6 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 0.7 | 2.0 | GO:0001160 | transcription termination site sequence-specific DNA binding(GO:0001147) transcription termination site DNA binding(GO:0001160) |
| 0.6 | 7.8 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.6 | 2.5 | GO:0016504 | peptidase activator activity(GO:0016504) |
| 0.6 | 1.9 | GO:0015131 | thiosulfate transmembrane transporter activity(GO:0015117) oxaloacetate transmembrane transporter activity(GO:0015131) |
| 0.6 | 1.2 | GO:0015925 | galactosidase activity(GO:0015925) |
| 0.6 | 1.9 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.6 | 1.9 | GO:0047273 | galactosylgalactosylglucosylceramide beta-D-acetylgalactosaminyltransferase activity(GO:0047273) |
| 0.6 | 0.6 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.6 | 4.9 | GO:0004844 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
| 0.6 | 7.3 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.6 | 5.4 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
| 0.6 | 1.2 | GO:0030337 | DNA polymerase processivity factor activity(GO:0030337) |
| 0.6 | 4.1 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
| 0.6 | 1.8 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
| 0.6 | 3.0 | GO:0047820 | D-glutamate cyclase activity(GO:0047820) |
| 0.6 | 9.1 | GO:0015250 | water channel activity(GO:0015250) |
| 0.6 | 7.3 | GO:0032395 | MHC class II receptor activity(GO:0032395) |
| 0.6 | 2.3 | GO:0043398 | HLH domain binding(GO:0043398) |
| 0.6 | 2.8 | GO:0052740 | 1-acyl-2-lysophosphatidylserine acylhydrolase activity(GO:0052740) |
| 0.6 | 1.7 | GO:0047322 | [hydroxymethylglutaryl-CoA reductase (NADPH)] kinase activity(GO:0047322) [acetyl-CoA carboxylase] kinase activity(GO:0050405) |
| 0.6 | 1.7 | GO:0008746 | NAD(P)+ transhydrogenase activity(GO:0008746) oxidoreductase activity, acting on NAD(P)H, NAD(P) as acceptor(GO:0016652) |
| 0.5 | 1.6 | GO:0033867 | Fas-activated serine/threonine kinase activity(GO:0033867) |
| 0.5 | 1.6 | GO:0008798 | beta-aspartyl-peptidase activity(GO:0008798) |
| 0.5 | 1.6 | GO:0044549 | GTP cyclohydrolase binding(GO:0044549) |
| 0.5 | 1.6 | GO:0004103 | choline kinase activity(GO:0004103) |
| 0.5 | 2.1 | GO:0016880 | glutamate-ammonia ligase activity(GO:0004356) ammonia ligase activity(GO:0016211) acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.5 | 4.2 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
| 0.5 | 5.3 | GO:0030369 | ICAM-3 receptor activity(GO:0030369) |
| 0.5 | 3.2 | GO:0004471 | malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
| 0.5 | 2.1 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 0.5 | 2.1 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.5 | 1.5 | GO:0015229 | L-ascorbate:sodium symporter activity(GO:0008520) L-ascorbic acid transporter activity(GO:0015229) sodium-dependent L-ascorbate transmembrane transporter activity(GO:0070890) |
| 0.5 | 5.7 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.5 | 4.6 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.5 | 0.5 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
| 0.5 | 2.5 | GO:0004306 | ethanolamine-phosphate cytidylyltransferase activity(GO:0004306) |
| 0.5 | 1.0 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
| 0.5 | 1.5 | GO:0051500 | D-aminoacyl-tRNA deacylase activity(GO:0051499) D-tyrosyl-tRNA(Tyr) deacylase activity(GO:0051500) |
| 0.5 | 0.5 | GO:0001884 | pyrimidine nucleoside binding(GO:0001884) UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
| 0.5 | 4.4 | GO:0001225 | RNA polymerase II transcription coactivator binding(GO:0001225) |
| 0.5 | 3.9 | GO:0016803 | ether hydrolase activity(GO:0016803) |
| 0.5 | 7.9 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.5 | 0.5 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
| 0.5 | 2.8 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
| 0.5 | 0.5 | GO:0050659 | N-acetylgalactosamine 4-sulfate 6-O-sulfotransferase activity(GO:0050659) |
| 0.5 | 3.3 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.5 | 1.9 | GO:0004104 | acetylcholinesterase activity(GO:0003990) cholinesterase activity(GO:0004104) |
| 0.5 | 3.8 | GO:0050693 | LBD domain binding(GO:0050693) |
| 0.5 | 4.2 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.5 | 1.4 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.5 | 4.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.5 | 6.0 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.5 | 3.7 | GO:0015923 | mannosidase activity(GO:0015923) |
| 0.5 | 4.1 | GO:0048039 | ubiquinone binding(GO:0048039) |
| 0.5 | 5.9 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.5 | 2.7 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
| 0.5 | 5.4 | GO:0019826 | oxygen sensor activity(GO:0019826) |
| 0.5 | 2.7 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.4 | 1.3 | GO:0010309 | acireductone dioxygenase [iron(II)-requiring] activity(GO:0010309) |
| 0.4 | 0.4 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
| 0.4 | 0.4 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.4 | 1.3 | GO:0004137 | deoxycytidine kinase activity(GO:0004137) |
| 0.4 | 7.0 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.4 | 1.3 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.4 | 3.5 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 0.4 | 3.0 | GO:0046979 | TAP2 binding(GO:0046979) |
| 0.4 | 1.7 | GO:0001512 | dihydronicotinamide riboside quinone reductase activity(GO:0001512) melatonin binding(GO:1904408) |
| 0.4 | 3.4 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.4 | 3.8 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
| 0.4 | 3.0 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.4 | 2.1 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.4 | 0.4 | GO:0015230 | FAD transmembrane transporter activity(GO:0015230) |
| 0.4 | 5.4 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.4 | 1.7 | GO:0042806 | fucose binding(GO:0042806) |
| 0.4 | 0.4 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
| 0.4 | 5.8 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
| 0.4 | 0.8 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
| 0.4 | 2.1 | GO:0032296 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
| 0.4 | 2.5 | GO:0003998 | acylphosphatase activity(GO:0003998) |
| 0.4 | 1.6 | GO:0097363 | protein O-GlcNAc transferase activity(GO:0097363) |
| 0.4 | 1.6 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.4 | 1.2 | GO:0047726 | iron-cytochrome-c reductase activity(GO:0047726) |
| 0.4 | 5.9 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.4 | 2.3 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.4 | 0.4 | GO:0009041 | uridylate kinase activity(GO:0009041) |
| 0.4 | 2.7 | GO:0004522 | ribonuclease A activity(GO:0004522) |
| 0.4 | 3.8 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.4 | 1.1 | GO:0090541 | MIT domain binding(GO:0090541) |
| 0.4 | 3.8 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.4 | 0.4 | GO:0005119 | smoothened binding(GO:0005119) |
| 0.4 | 2.3 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.4 | 10.5 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.4 | 0.7 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
| 0.4 | 1.5 | GO:0043812 | phosphatidylinositol-4-phosphate phosphatase activity(GO:0043812) |
| 0.4 | 1.5 | GO:0047066 | phospholipid-hydroperoxide glutathione peroxidase activity(GO:0047066) |
| 0.4 | 1.8 | GO:0015166 | polyol transmembrane transporter activity(GO:0015166) |
| 0.4 | 2.9 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.4 | 2.5 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
| 0.4 | 1.1 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.4 | 2.2 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.4 | 1.8 | GO:0030151 | molybdenum ion binding(GO:0030151) |
| 0.4 | 2.2 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.4 | 1.4 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
| 0.4 | 1.1 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.4 | 0.4 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.4 | 0.4 | GO:0042132 | fructose 1,6-bisphosphate 1-phosphatase activity(GO:0042132) |
| 0.4 | 1.1 | GO:0004040 | amidase activity(GO:0004040) |
| 0.3 | 1.0 | GO:0008969 | phosphohistidine phosphatase activity(GO:0008969) |
| 0.3 | 1.4 | GO:0050309 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.3 | 2.4 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
| 0.3 | 1.0 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
| 0.3 | 1.4 | GO:0015207 | ATP:ADP antiporter activity(GO:0005471) adenine transmembrane transporter activity(GO:0015207) |
| 0.3 | 4.1 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.3 | 1.4 | GO:0004057 | arginyltransferase activity(GO:0004057) |
| 0.3 | 1.4 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.3 | 2.7 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
| 0.3 | 1.0 | GO:0045155 | electron transporter, transferring electrons from CoQH2-cytochrome c reductase complex and cytochrome c oxidase complex activity(GO:0045155) |
| 0.3 | 1.3 | GO:0008670 | 2,4-dienoyl-CoA reductase (NADPH) activity(GO:0008670) |
| 0.3 | 1.7 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 0.3 | 1.6 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.3 | 2.3 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.3 | 0.3 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
| 0.3 | 1.6 | GO:0051731 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) |
| 0.3 | 1.0 | GO:0016435 | rRNA (guanine) methyltransferase activity(GO:0016435) |
| 0.3 | 6.0 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.3 | 1.6 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 0.3 | 0.9 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.3 | 12.2 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.3 | 1.6 | GO:0004905 | type I interferon receptor activity(GO:0004905) |
| 0.3 | 0.3 | GO:0019211 | phosphatase activator activity(GO:0019211) |
| 0.3 | 1.2 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.3 | 0.9 | GO:0033858 | N-acetylgalactosamine kinase activity(GO:0033858) |
| 0.3 | 7.3 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.3 | 1.8 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.3 | 1.2 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.3 | 0.9 | GO:0102007 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 0.3 | 0.9 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.3 | 4.1 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.3 | 1.8 | GO:0047685 | amine sulfotransferase activity(GO:0047685) |
| 0.3 | 2.1 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.3 | 7.3 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
| 0.3 | 1.2 | GO:0003896 | DNA primase activity(GO:0003896) |
| 0.3 | 1.7 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.3 | 0.9 | GO:0070336 | flap-structured DNA binding(GO:0070336) |
| 0.3 | 0.9 | GO:0032440 | 2-alkenal reductase [NAD(P)] activity(GO:0032440) |
| 0.3 | 0.3 | GO:0004019 | adenylosuccinate synthase activity(GO:0004019) |
| 0.3 | 0.3 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.3 | 1.4 | GO:0052901 | polyamine oxidase activity(GO:0046592) spermine:oxygen oxidoreductase (spermidine-forming) activity(GO:0052901) |
| 0.3 | 0.9 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.3 | 0.6 | GO:0001228 | transcriptional activator activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001228) |
| 0.3 | 2.8 | GO:0047144 | 2-acylglycerol-3-phosphate O-acyltransferase activity(GO:0047144) |
| 0.3 | 0.8 | GO:0016855 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
| 0.3 | 1.1 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.3 | 0.6 | GO:0004660 | protein farnesyltransferase activity(GO:0004660) |
| 0.3 | 0.8 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.3 | 2.5 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.3 | 0.8 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.3 | 1.7 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 0.3 | 2.5 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.3 | 0.6 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
| 0.3 | 0.8 | GO:0035034 | histone acetyltransferase regulator activity(GO:0035034) |
| 0.3 | 1.4 | GO:0033857 | diphosphoinositol-pentakisphosphate kinase activity(GO:0033857) |
| 0.3 | 1.4 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) cardiolipin binding(GO:1901612) |
| 0.3 | 0.8 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
| 0.3 | 2.2 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.3 | 0.8 | GO:0097158 | pre-mRNA intronic pyrimidine-rich binding(GO:0097158) |
| 0.3 | 2.2 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
| 0.3 | 0.8 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
| 0.3 | 1.1 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
| 0.3 | 0.3 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.3 | 0.8 | GO:0031692 | alpha-1A adrenergic receptor binding(GO:0031691) alpha-1B adrenergic receptor binding(GO:0031692) follicle-stimulating hormone receptor binding(GO:0031762) V2 vasopressin receptor binding(GO:0031896) |
| 0.3 | 2.9 | GO:1990459 | transferrin receptor binding(GO:1990459) |
| 0.3 | 1.1 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.3 | 1.3 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
| 0.3 | 5.6 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.3 | 7.5 | GO:0019198 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
| 0.3 | 0.3 | GO:0019787 | ubiquitin-like protein transferase activity(GO:0019787) |
| 0.3 | 2.4 | GO:0016723 | oxidoreductase activity, oxidizing metal ions, NAD or NADP as acceptor(GO:0016723) |
| 0.3 | 3.4 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 0.3 | 0.8 | GO:0015228 | coenzyme A transmembrane transporter activity(GO:0015228) adenosine 3',5'-bisphosphate transmembrane transporter activity(GO:0071077) AMP transmembrane transporter activity(GO:0080122) |
| 0.3 | 7.3 | GO:0000030 | mannosyltransferase activity(GO:0000030) |
| 0.3 | 0.5 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
| 0.3 | 1.0 | GO:1904492 | Ac-Asp-Glu binding(GO:1904492) tetrahydrofolyl-poly(glutamate) polymer binding(GO:1904493) |
| 0.3 | 2.5 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.3 | 0.8 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.2 | 5.7 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
| 0.2 | 6.2 | GO:0031005 | filamin binding(GO:0031005) |
| 0.2 | 1.2 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.2 | 1.0 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.2 | 1.5 | GO:0019863 | IgE binding(GO:0019863) |
| 0.2 | 1.2 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 0.2 | 0.5 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
| 0.2 | 0.7 | GO:0035500 | MH2 domain binding(GO:0035500) |
| 0.2 | 0.7 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
| 0.2 | 7.6 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.2 | 2.2 | GO:0071936 | coreceptor activity involved in Wnt signaling pathway(GO:0071936) |
| 0.2 | 0.7 | GO:0016453 | C-acetyltransferase activity(GO:0016453) |
| 0.2 | 1.4 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
| 0.2 | 0.7 | GO:0050429 | calcium-dependent phospholipase C activity(GO:0050429) |
| 0.2 | 0.7 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
| 0.2 | 0.7 | GO:0032427 | GBD domain binding(GO:0032427) |
| 0.2 | 1.9 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.2 | 1.0 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.2 | 1.4 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.2 | 6.8 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.2 | 9.6 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.2 | 17.8 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
| 0.2 | 3.7 | GO:0046527 | glucosyltransferase activity(GO:0046527) |
| 0.2 | 10.2 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
| 0.2 | 2.5 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.2 | 0.5 | GO:0000035 | acyl binding(GO:0000035) |
| 0.2 | 1.6 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
| 0.2 | 4.1 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.2 | 1.6 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 0.2 | 0.5 | GO:0032052 | bile acid binding(GO:0032052) |
| 0.2 | 0.9 | GO:0036132 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
| 0.2 | 5.2 | GO:0070330 | aromatase activity(GO:0070330) |
| 0.2 | 0.7 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.2 | 0.4 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
| 0.2 | 0.2 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.2 | 0.7 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.2 | 1.1 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
| 0.2 | 0.2 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.2 | 0.7 | GO:0036080 | GDP-fucose transmembrane transporter activity(GO:0005457) purine nucleotide-sugar transmembrane transporter activity(GO:0036080) |
| 0.2 | 0.4 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.2 | 0.7 | GO:0097259 | tocopherol omega-hydroxylase activity(GO:0052870) alpha-tocopherol omega-hydroxylase activity(GO:0052871) 20-hydroxy-leukotriene B4 omega oxidase activity(GO:0097258) 20-aldehyde-leukotriene B4 20-monooxygenase activity(GO:0097259) |
| 0.2 | 1.5 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.2 | 0.7 | GO:0004878 | complement component C5a receptor activity(GO:0004878) |
| 0.2 | 0.6 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.2 | 0.6 | GO:0015403 | thiamine uptake transmembrane transporter activity(GO:0015403) |
| 0.2 | 10.3 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.2 | 3.9 | GO:0042605 | peptide antigen binding(GO:0042605) |
| 0.2 | 9.9 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.2 | 1.5 | GO:0043559 | insulin binding(GO:0043559) |
| 0.2 | 2.8 | GO:0019104 | DNA N-glycosylase activity(GO:0019104) |
| 0.2 | 4.0 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.2 | 0.6 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
| 0.2 | 6.0 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.2 | 3.8 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.2 | 0.6 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
| 0.2 | 0.6 | GO:0045118 | azole transporter activity(GO:0045118) |
| 0.2 | 13.9 | GO:0042805 | actinin binding(GO:0042805) |
| 0.2 | 0.6 | GO:0031531 | thyrotropin-releasing hormone receptor binding(GO:0031531) |
| 0.2 | 3.3 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.2 | 0.4 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
| 0.2 | 3.9 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.2 | 0.6 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.2 | 0.4 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
| 0.2 | 0.4 | GO:0016796 | exonuclease activity, active with either ribo- or deoxyribonucleic acids and producing 5'-phosphomonoesters(GO:0016796) |
| 0.2 | 0.8 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
| 0.2 | 0.4 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.2 | 0.8 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.2 | 0.6 | GO:0004960 | thromboxane receptor activity(GO:0004960) thromboxane A2 receptor activity(GO:0004961) |
| 0.2 | 0.2 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
| 0.2 | 0.6 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.2 | 1.0 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 0.2 | 2.0 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.2 | 1.2 | GO:0052846 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) inositol diphosphate tetrakisphosphate diphosphatase activity(GO:0052840) inositol bisdiphosphate tetrakisphosphate diphosphatase activity(GO:0052841) inositol diphosphate pentakisphosphate diphosphatase activity(GO:0052842) inositol-1-diphosphate-2,3,4,5,6-pentakisphosphate diphosphatase activity(GO:0052843) inositol-3-diphosphate-1,2,4,5,6-pentakisphosphate diphosphatase activity(GO:0052844) inositol-5-diphosphate-1,2,3,4,6-pentakisphosphate diphosphatase activity(GO:0052845) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 1-diphosphatase activity(GO:0052846) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052847) inositol-3,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052848) |
| 0.2 | 1.6 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.2 | 0.8 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
| 0.2 | 1.8 | GO:0030618 | transforming growth factor beta receptor, pathway-specific cytoplasmic mediator activity(GO:0030618) |
| 0.2 | 1.8 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.2 | 1.4 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
| 0.2 | 0.6 | GO:0031783 | corticotropin hormone receptor binding(GO:0031780) type 5 melanocortin receptor binding(GO:0031783) |
| 0.2 | 2.3 | GO:0015248 | sterol transporter activity(GO:0015248) |
| 0.2 | 1.0 | GO:0016208 | AMP binding(GO:0016208) |
| 0.2 | 1.0 | GO:0047237 | glucuronylgalactosylproteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047237) |
| 0.2 | 2.9 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 0.2 | 0.6 | GO:0004560 | alpha-L-fucosidase activity(GO:0004560) fucosidase activity(GO:0015928) |
| 0.2 | 1.4 | GO:0030267 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.2 | 2.7 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.2 | 5.4 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.2 | 1.9 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.2 | 1.9 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.2 | 1.3 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.2 | 1.7 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.2 | 0.6 | GO:0016426 | tRNA (adenine) methyltransferase activity(GO:0016426) tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
| 0.2 | 0.8 | GO:0004996 | thyroid-stimulating hormone receptor activity(GO:0004996) |
| 0.2 | 1.7 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.2 | 4.7 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.2 | 2.1 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.2 | 2.3 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.2 | 0.6 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.2 | 2.4 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
| 0.2 | 0.5 | GO:0005169 | neurotrophin TRKB receptor binding(GO:0005169) |
| 0.2 | 2.5 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.2 | 0.2 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.2 | 0.4 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.2 | 2.3 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.2 | 1.4 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.2 | 2.8 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
| 0.2 | 0.7 | GO:0016411 | acylglycerol O-acyltransferase activity(GO:0016411) |
| 0.2 | 0.9 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.2 | 0.3 | GO:0016160 | amylase activity(GO:0016160) |
| 0.2 | 1.0 | GO:0008430 | selenium binding(GO:0008430) |
| 0.2 | 0.3 | GO:0051538 | 3 iron, 4 sulfur cluster binding(GO:0051538) |
| 0.2 | 0.5 | GO:0016155 | formyltetrahydrofolate dehydrogenase activity(GO:0016155) |
| 0.2 | 0.5 | GO:0034353 | RNA pyrophosphohydrolase activity(GO:0034353) |
| 0.2 | 1.7 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
| 0.2 | 7.8 | GO:0016409 | palmitoyltransferase activity(GO:0016409) |
| 0.2 | 0.3 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.2 | 0.8 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.2 | 5.7 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.2 | 0.7 | GO:0052723 | inositol-1,3,4,5,6-pentakisphosphate kinase activity(GO:0000827) inositol hexakisphosphate kinase activity(GO:0000828) inositol heptakisphosphate kinase activity(GO:0000829) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.2 | 0.3 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.2 | 0.2 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
| 0.2 | 1.8 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.2 | 0.3 | GO:0016417 | S-acyltransferase activity(GO:0016417) |
| 0.2 | 0.5 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
| 0.2 | 3.5 | GO:0008320 | protein transmembrane transporter activity(GO:0008320) |
| 0.2 | 0.3 | GO:0001034 | RNA polymerase III transcription factor activity, sequence-specific DNA binding(GO:0001034) |
| 0.2 | 0.8 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
| 0.2 | 1.5 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.2 | 2.3 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.2 | 0.3 | GO:1990763 | arrestin family protein binding(GO:1990763) |
| 0.2 | 3.3 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.2 | 0.5 | GO:0005462 | UDP-N-acetylglucosamine transmembrane transporter activity(GO:0005462) |
| 0.2 | 0.6 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
| 0.2 | 0.8 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.2 | 0.2 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
| 0.2 | 2.0 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 0.2 | 0.6 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
| 0.2 | 2.2 | GO:0099602 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
| 0.2 | 0.8 | GO:0004485 | methylcrotonoyl-CoA carboxylase activity(GO:0004485) |
| 0.2 | 6.3 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.2 | 1.2 | GO:0004197 | cysteine-type endopeptidase activity(GO:0004197) |
| 0.2 | 0.6 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.2 | 1.2 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.2 | 1.4 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.2 | 4.1 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
| 0.2 | 5.7 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
| 0.2 | 0.5 | GO:0016891 | endoribonuclease activity, producing 5'-phosphomonoesters(GO:0016891) |
| 0.2 | 0.5 | GO:0015361 | low-affinity sodium:dicarboxylate symporter activity(GO:0015361) |
| 0.1 | 0.9 | GO:0019789 | SUMO transferase activity(GO:0019789) |
| 0.1 | 2.4 | GO:0016004 | phospholipase activator activity(GO:0016004) |
| 0.1 | 1.8 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.1 | 1.0 | GO:0042978 | ornithine decarboxylase activator activity(GO:0042978) |
| 0.1 | 0.4 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
| 0.1 | 1.0 | GO:0031013 | troponin I binding(GO:0031013) |
| 0.1 | 1.6 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.1 | 0.1 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 0.1 | 0.6 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.1 | 0.4 | GO:0070699 | type II activin receptor binding(GO:0070699) |
| 0.1 | 1.0 | GO:0016403 | dimethylargininase activity(GO:0016403) |
| 0.1 | 0.4 | GO:0031432 | titin binding(GO:0031432) |
| 0.1 | 1.9 | GO:0001011 | transcription factor activity, sequence-specific DNA binding, RNA polymerase recruiting(GO:0001011) transcription factor activity, TFIIB-class binding(GO:0001087) |
| 0.1 | 0.4 | GO:0008940 | nitrate reductase activity(GO:0008940) |
| 0.1 | 0.7 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.1 | 1.0 | GO:0031402 | sodium ion binding(GO:0031402) |
| 0.1 | 0.4 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
| 0.1 | 0.7 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.1 | 12.7 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
| 0.1 | 0.4 | GO:1904455 | ubiquitin-specific protease activity involved in negative regulation of ERAD pathway(GO:1904455) |
| 0.1 | 1.1 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.1 | 0.4 | GO:0016422 | mRNA (2'-O-methyladenosine-N6-)-methyltransferase activity(GO:0016422) |
| 0.1 | 0.4 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.1 | 0.4 | GO:0003826 | alpha-ketoacid dehydrogenase activity(GO:0003826) 3-methyl-2-oxobutanoate dehydrogenase (2-methylpropanoyl-transferring) activity(GO:0003863) |
| 0.1 | 3.3 | GO:0036442 | hydrogen-exporting ATPase activity(GO:0036442) proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.1 | 0.7 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
| 0.1 | 1.2 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
| 0.1 | 1.4 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.1 | 0.4 | GO:0030366 | molybdopterin synthase activity(GO:0030366) |
| 0.1 | 0.5 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.1 | 0.4 | GO:0070404 | NADH binding(GO:0070404) |
| 0.1 | 3.1 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 0.1 | 0.4 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.1 | 0.5 | GO:0031078 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
| 0.1 | 0.3 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.1 | 1.9 | GO:0008171 | O-methyltransferase activity(GO:0008171) |
| 0.1 | 0.5 | GO:0003989 | acetyl-CoA carboxylase activity(GO:0003989) |
| 0.1 | 0.7 | GO:0016900 | oxidoreductase activity, acting on the CH-OH group of donors, disulfide as acceptor(GO:0016900) vitamin-K-epoxide reductase (warfarin-sensitive) activity(GO:0047057) |
| 0.1 | 0.4 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.1 | 2.5 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.1 | 1.4 | GO:0033558 | protein deacetylase activity(GO:0033558) |
| 0.1 | 0.5 | GO:0044390 | ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
| 0.1 | 1.0 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) |
| 0.1 | 1.7 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.1 | 0.3 | GO:0043139 | 5'-3' DNA helicase activity(GO:0043139) |
| 0.1 | 2.5 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.1 | 1.4 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.1 | 0.3 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.1 | 2.4 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
| 0.1 | 2.6 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.1 | 0.3 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.1 | 1.8 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
| 0.1 | 0.8 | GO:0035276 | ethanol binding(GO:0035276) |
| 0.1 | 0.3 | GO:0032138 | single base insertion or deletion binding(GO:0032138) |
| 0.1 | 0.8 | GO:0097199 | cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097199) |
| 0.1 | 0.1 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
| 0.1 | 0.4 | GO:0102008 | cytosolic dipeptidase activity(GO:0102008) |
| 0.1 | 1.7 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.1 | 4.2 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.1 | 0.9 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.1 | 1.6 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.1 | 1.1 | GO:0004518 | nuclease activity(GO:0004518) |
| 0.1 | 0.4 | GO:0005459 | UDP-galactose transmembrane transporter activity(GO:0005459) |
| 0.1 | 0.9 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.1 | 5.0 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.1 | 0.5 | GO:0047708 | biotinidase activity(GO:0047708) |
| 0.1 | 1.0 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.1 | 0.9 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.1 | 6.2 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.1 | 2.3 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
| 0.1 | 3.3 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.1 | 0.2 | GO:0061733 | peptide-lysine-N-acetyltransferase activity(GO:0061733) |
| 0.1 | 0.1 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 0.1 | 0.6 | GO:0070363 | mitochondrial light strand promoter sense binding(GO:0070363) |
| 0.1 | 0.4 | GO:0004603 | phenylethanolamine N-methyltransferase activity(GO:0004603) |
| 0.1 | 0.2 | GO:0016229 | steroid dehydrogenase activity(GO:0016229) |
| 0.1 | 0.7 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.1 | 0.6 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.1 | 1.7 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
| 0.1 | 0.7 | GO:0090599 | alpha-glucosidase activity(GO:0090599) |
| 0.1 | 1.5 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
| 0.1 | 2.8 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
| 0.1 | 0.1 | GO:0052812 | phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) |
| 0.1 | 0.4 | GO:0043532 | angiostatin binding(GO:0043532) |
| 0.1 | 0.4 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 0.1 | 1.3 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.1 | 0.7 | GO:0023025 | MHC class Ib protein complex binding(GO:0023025) MHC class Ib protein binding, via antigen binding groove(GO:0023030) |
| 0.1 | 1.0 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.1 | 1.0 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.1 | 0.6 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) ornithine decarboxylase regulator activity(GO:0042979) |
| 0.1 | 2.1 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
| 0.1 | 0.3 | GO:0004730 | pseudouridylate synthase activity(GO:0004730) |
| 0.1 | 0.7 | GO:0022850 | serotonin-gated cation channel activity(GO:0022850) |
| 0.1 | 0.9 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.1 | 0.6 | GO:0016934 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
| 0.1 | 0.5 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.1 | 0.3 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.1 | 2.0 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.1 | 0.3 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
| 0.1 | 2.1 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.1 | 0.3 | GO:0030627 | pre-mRNA 5'-splice site binding(GO:0030627) |
| 0.1 | 0.5 | GO:0005534 | galactose binding(GO:0005534) |
| 0.1 | 2.9 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.1 | 0.2 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.1 | 0.6 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
| 0.1 | 0.4 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.1 | 0.3 | GO:0052642 | lysophosphatidic acid phosphatase activity(GO:0052642) |
| 0.1 | 2.0 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 0.1 | 2.4 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.1 | 0.3 | GO:0005260 | channel-conductance-controlling ATPase activity(GO:0005260) |
| 0.1 | 0.5 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.1 | 1.0 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.1 | 1.7 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.1 | 2.1 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.1 | 0.4 | GO:0047006 | 17-alpha,20-alpha-dihydroxypregn-4-en-3-one dehydrogenase activity(GO:0047006) |
| 0.1 | 7.1 | GO:0033613 | activating transcription factor binding(GO:0033613) |
| 0.1 | 0.7 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.1 | 10.5 | GO:0051082 | unfolded protein binding(GO:0051082) |
| 0.1 | 0.3 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.1 | 0.4 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
| 0.1 | 0.7 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.1 | 0.6 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
| 0.1 | 0.4 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
| 0.1 | 0.2 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
| 0.1 | 0.3 | GO:0008424 | glycoprotein 6-alpha-L-fucosyltransferase activity(GO:0008424) alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
| 0.1 | 0.5 | GO:0004910 | interleukin-1, Type II, blocking receptor activity(GO:0004910) |
| 0.1 | 1.3 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.1 | 3.2 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.1 | 0.7 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.1 | 0.1 | GO:1901375 | acetylcholine transmembrane transporter activity(GO:0005277) acetate ester transmembrane transporter activity(GO:1901375) |
| 0.1 | 2.1 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
| 0.1 | 0.3 | GO:0004324 | ferredoxin-NADP+ reductase activity(GO:0004324) NADPH-adrenodoxin reductase activity(GO:0015039) oxidoreductase activity, acting on iron-sulfur proteins as donors(GO:0016730) oxidoreductase activity, acting on iron-sulfur proteins as donors, NAD or NADP as acceptor(GO:0016731) |
| 0.1 | 0.1 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.1 | 0.3 | GO:0047223 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase activity(GO:0047223) |
| 0.1 | 0.8 | GO:0043175 | RNA polymerase core enzyme binding(GO:0043175) |
| 0.1 | 0.3 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
| 0.1 | 0.2 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.1 | 0.6 | GO:0044594 | 3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-enoyl-CoA hydratase activity(GO:0033989) 17-beta-hydroxysteroid dehydrogenase (NAD+) activity(GO:0044594) |
| 0.1 | 1.5 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.1 | 0.2 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
| 0.1 | 0.3 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.1 | 0.6 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
| 0.1 | 0.7 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.1 | 0.4 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.1 | 0.2 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.1 | 0.4 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.1 | 1.1 | GO:0043225 | anion transmembrane-transporting ATPase activity(GO:0043225) |
| 0.1 | 0.3 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.1 | 0.3 | GO:0050613 | delta14-sterol reductase activity(GO:0050613) |
| 0.1 | 0.5 | GO:0004515 | nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.1 | 0.3 | GO:0036137 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
| 0.1 | 0.3 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.1 | 0.1 | GO:0000982 | transcription factor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0000982) |
| 0.1 | 0.4 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.1 | 0.4 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.1 | 0.6 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) intronic transcription regulatory region DNA binding(GO:0044213) |
| 0.1 | 1.2 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.1 | 2.0 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.1 | 0.1 | GO:0051184 | cofactor transporter activity(GO:0051184) |
| 0.1 | 0.9 | GO:0030882 | lipid antigen binding(GO:0030882) endogenous lipid antigen binding(GO:0030883) exogenous lipid antigen binding(GO:0030884) |
| 0.1 | 1.4 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.1 | 2.1 | GO:0030275 | LRR domain binding(GO:0030275) |
| 0.1 | 0.6 | GO:0008375 | acetylglucosaminyltransferase activity(GO:0008375) |
| 0.1 | 2.4 | GO:0070034 | telomerase RNA binding(GO:0070034) |
| 0.1 | 4.7 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.1 | 0.3 | GO:0031812 | G-protein coupled nucleotide receptor binding(GO:0031811) P2Y1 nucleotide receptor binding(GO:0031812) |
| 0.1 | 0.4 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
| 0.1 | 2.4 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.1 | 0.1 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.1 | 0.2 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) rRNA (adenine) methyltransferase activity(GO:0016433) |
| 0.1 | 1.5 | GO:0031491 | nucleosome binding(GO:0031491) |
| 0.1 | 0.2 | GO:0008480 | sarcosine dehydrogenase activity(GO:0008480) |
| 0.1 | 0.2 | GO:0004492 | methylmalonyl-CoA decarboxylase activity(GO:0004492) |
| 0.1 | 0.4 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.1 | 0.4 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.1 | 0.4 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
| 0.1 | 0.2 | GO:0050571 | 1,5-anhydro-D-fructose reductase activity(GO:0050571) |
| 0.1 | 0.2 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
| 0.1 | 0.6 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.1 | 0.6 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
| 0.1 | 0.5 | GO:0008048 | calcium sensitive guanylate cyclase activator activity(GO:0008048) |
| 0.1 | 1.3 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.1 | 3.7 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.1 | 2.0 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.1 | 0.3 | GO:0004532 | exoribonuclease activity(GO:0004532) |
| 0.1 | 0.2 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.1 | 5.5 | GO:0016820 | hydrolase activity, acting on acid anhydrides, catalyzing transmembrane movement of substances(GO:0016820) |
| 0.1 | 0.2 | GO:0061663 | NEDD8 ligase activity(GO:0061663) |
| 0.1 | 0.4 | GO:0002046 | opsin binding(GO:0002046) |
| 0.1 | 0.4 | GO:0071253 | connexin binding(GO:0071253) |
| 0.1 | 0.8 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.1 | 1.0 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.1 | 0.1 | GO:0098770 | FBXO family protein binding(GO:0098770) |
| 0.1 | 0.4 | GO:0050543 | icosatetraenoic acid binding(GO:0050543) |
| 0.1 | 1.3 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.1 | 0.9 | GO:0005044 | scavenger receptor activity(GO:0005044) |
| 0.1 | 1.5 | GO:0000175 | 3'-5'-exoribonuclease activity(GO:0000175) exoribonuclease activity, producing 5'-phosphomonoesters(GO:0016896) |
| 0.1 | 0.1 | GO:0038064 | collagen receptor activity(GO:0038064) |
| 0.1 | 0.1 | GO:0009055 | electron carrier activity(GO:0009055) |
| 0.1 | 4.8 | GO:0008013 | beta-catenin binding(GO:0008013) |
| 0.1 | 0.4 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
| 0.1 | 0.3 | GO:0016712 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen(GO:0016712) |
| 0.1 | 0.6 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.1 | 0.4 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.1 | 0.2 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
| 0.1 | 9.6 | GO:0042393 | histone binding(GO:0042393) |
| 0.1 | 0.8 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
| 0.1 | 0.1 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.1 | 0.4 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.1 | 0.3 | GO:0009383 | C-methyltransferase activity(GO:0008169) rRNA (cytosine-C5-)-methyltransferase activity(GO:0009383) |
| 0.1 | 0.6 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.1 | 0.3 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.1 | 0.7 | GO:0005346 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
| 0.1 | 0.6 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.1 | 0.3 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.1 | 0.1 | GO:0005136 | interleukin-4 receptor binding(GO:0005136) |
| 0.1 | 0.5 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.1 | 0.4 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.1 | 0.5 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.1 | 0.2 | GO:0004531 | deoxyribonuclease II activity(GO:0004531) |
| 0.1 | 0.3 | GO:0015926 | glucosidase activity(GO:0015926) |
| 0.1 | 0.3 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
| 0.1 | 0.4 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.1 | 0.2 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.1 | 36.2 | GO:0004842 | ubiquitin-protein transferase activity(GO:0004842) |
| 0.1 | 0.6 | GO:0008175 | tRNA methyltransferase activity(GO:0008175) |
| 0.1 | 1.6 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.1 | 0.2 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.1 | 0.1 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
| 0.1 | 1.0 | GO:0001221 | transcription cofactor binding(GO:0001221) |
| 0.1 | 4.3 | GO:0043130 | ubiquitin binding(GO:0043130) |
| 0.1 | 0.1 | GO:0019200 | carbohydrate kinase activity(GO:0019200) |
| 0.1 | 0.1 | GO:0047389 | glycerophosphocholine phosphodiesterase activity(GO:0047389) |
| 0.1 | 0.6 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
| 0.1 | 4.3 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
| 0.1 | 0.5 | GO:0005521 | lamin binding(GO:0005521) |
| 0.1 | 0.3 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.1 | 1.9 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.1 | 1.7 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.1 | 0.6 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
| 0.1 | 0.7 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
| 0.1 | 0.1 | GO:0003993 | acid phosphatase activity(GO:0003993) |
| 0.1 | 0.1 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
| 0.1 | 0.1 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.1 | 0.1 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.1 | 0.3 | GO:0009008 | DNA-methyltransferase activity(GO:0009008) |
| 0.1 | 0.3 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.1 | 0.1 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
| 0.1 | 0.5 | GO:0055104 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.1 | 0.1 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
| 0.1 | 0.1 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.1 | 0.6 | GO:0050681 | androgen receptor binding(GO:0050681) |
| 0.1 | 0.2 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.1 | 0.1 | GO:0032090 | Pyrin domain binding(GO:0032090) |
| 0.1 | 0.3 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
| 0.1 | 0.6 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.1 | 0.2 | GO:0004507 | steroid 11-beta-monooxygenase activity(GO:0004507) corticosterone 18-monooxygenase activity(GO:0047783) |
| 0.1 | 0.1 | GO:0033691 | sialic acid binding(GO:0033691) |
| 0.0 | 0.1 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
| 0.0 | 0.1 | GO:0019825 | oxygen binding(GO:0019825) |
| 0.0 | 0.6 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.0 | 0.3 | GO:0003720 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
| 0.0 | 0.2 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 0.0 | 1.6 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.0 | 0.1 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
| 0.0 | 0.1 | GO:0070546 | L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.0 | 0.4 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
| 0.0 | 0.1 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
| 0.0 | 0.3 | GO:0045159 | myosin II binding(GO:0045159) |
| 0.0 | 1.6 | GO:0016279 | protein-lysine N-methyltransferase activity(GO:0016279) |
| 0.0 | 0.0 | GO:0004662 | CAAX-protein geranylgeranyltransferase activity(GO:0004662) |
| 0.0 | 0.2 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
| 0.0 | 0.5 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.0 | 0.0 | GO:0015036 | disulfide oxidoreductase activity(GO:0015036) |
| 0.0 | 0.3 | GO:0035800 | deubiquitinase activator activity(GO:0035800) |
| 0.0 | 0.4 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.0 | 0.6 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
| 0.0 | 0.3 | GO:0004721 | phosphoprotein phosphatase activity(GO:0004721) |
| 0.0 | 0.2 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.0 | 0.7 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.0 | 0.2 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.0 | 0.2 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.0 | 0.4 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
| 0.0 | 13.2 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
| 0.0 | 0.2 | GO:0034979 | NAD-dependent protein deacetylase activity(GO:0034979) |
| 0.0 | 0.4 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.0 | 0.1 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) inositol trisphosphate kinase activity(GO:0051766) |
| 0.0 | 0.0 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.0 | 0.2 | GO:0008665 | 2'-phosphotransferase activity(GO:0008665) |
| 0.0 | 0.5 | GO:0008028 | monocarboxylic acid transmembrane transporter activity(GO:0008028) |
| 0.0 | 0.2 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.0 | 2.0 | GO:0008235 | metalloexopeptidase activity(GO:0008235) |
| 0.0 | 0.5 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.0 | 0.2 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.0 | 0.5 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.0 | 0.5 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
| 0.0 | 1.0 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.0 | 0.3 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.0 | 0.1 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.0 | 0.2 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.0 | 0.1 | GO:0046556 | alpha-L-arabinofuranosidase activity(GO:0046556) |
| 0.0 | 0.5 | GO:0070513 | death domain binding(GO:0070513) |
| 0.0 | 0.5 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
| 0.0 | 1.3 | GO:0051087 | chaperone binding(GO:0051087) |
| 0.0 | 0.0 | GO:0008374 | O-acyltransferase activity(GO:0008374) |
| 0.0 | 2.3 | GO:0101005 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
| 0.0 | 0.1 | GO:0032038 | myosin II heavy chain binding(GO:0032038) |
| 0.0 | 0.4 | GO:0045502 | dynein binding(GO:0045502) |
| 0.0 | 0.1 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
| 0.0 | 0.3 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.0 | 0.1 | GO:0016901 | glycerol-3-phosphate dehydrogenase activity(GO:0004368) oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
| 0.0 | 0.2 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
| 0.0 | 0.2 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 0.0 | 0.1 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.0 | 0.1 | GO:0016979 | lipoate-protein ligase activity(GO:0016979) |
| 0.0 | 0.1 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.0 | 0.1 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
| 0.0 | 0.2 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.0 | 0.1 | GO:0016830 | carbon-carbon lyase activity(GO:0016830) |
| 0.0 | 0.1 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
| 0.0 | 57.0 | GO:0003677 | DNA binding(GO:0003677) |
| 0.0 | 0.2 | GO:0030020 | extracellular matrix structural constituent conferring tensile strength(GO:0030020) |
| 0.0 | 0.2 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
| 0.0 | 0.8 | GO:0008009 | chemokine activity(GO:0008009) |
| 0.0 | 0.2 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.0 | 0.6 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.0 | 0.0 | GO:1990782 | protein tyrosine kinase binding(GO:1990782) |
| 0.0 | 0.0 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.0 | 0.0 | GO:0016879 | ligase activity, forming carbon-nitrogen bonds(GO:0016879) |
| 0.0 | 0.1 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.0 | 1.2 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
| 0.0 | 0.1 | GO:0004161 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
| 0.0 | 0.4 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.0 | 1.3 | GO:0003714 | transcription corepressor activity(GO:0003714) |
| 0.0 | 0.0 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 0.0 | 0.1 | GO:0043295 | glutathione binding(GO:0043295) |
| 0.0 | 0.0 | GO:0031386 | protein tag(GO:0031386) |
| 0.0 | 0.0 | GO:0017171 | serine hydrolase activity(GO:0017171) |
| 0.0 | 0.3 | GO:0003951 | NAD+ kinase activity(GO:0003951) |
| 0.0 | 0.0 | GO:0070984 | SET domain binding(GO:0070984) |
| 0.0 | 0.0 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.0 | 0.0 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
| 0.0 | 0.3 | GO:0004540 | ribonuclease activity(GO:0004540) |
| 0.0 | 0.1 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
| 0.0 | 0.4 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.0 | 0.2 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 8.7 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.4 | 0.4 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.3 | 10.8 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.3 | 1.9 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.3 | 12.6 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.3 | 9.5 | PID MYC PATHWAY | C-MYC pathway |
| 0.3 | 0.5 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.3 | 11.3 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.2 | 3.8 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.2 | 5.5 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.2 | 14.3 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.2 | 1.5 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.2 | 0.8 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.2 | 17.0 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.2 | 5.9 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.2 | 0.7 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.2 | 0.7 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.2 | 8.2 | PID BMP PATHWAY | BMP receptor signaling |
| 0.2 | 8.0 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.1 | 1.0 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.1 | 5.8 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.1 | 9.6 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.1 | 1.3 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.1 | 13.7 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
| 0.1 | 3.6 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.1 | 1.4 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.1 | 3.6 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.1 | 3.1 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.1 | 4.7 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.1 | 6.4 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.1 | 5.2 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.1 | 7.8 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.1 | 6.4 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
| 0.1 | 1.2 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.1 | 5.6 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
| 0.1 | 7.4 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 0.1 | 4.7 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.1 | 0.3 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.1 | 1.3 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.1 | 1.2 | PID S1P S1P2 PATHWAY | S1P2 pathway |
| 0.1 | 4.4 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.1 | 1.6 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.1 | 5.0 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.1 | 6.2 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.1 | 1.8 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.1 | 2.6 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.1 | 0.2 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.1 | 0.4 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
| 0.1 | 2.5 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.1 | 0.3 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.1 | 3.1 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.1 | 0.8 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.1 | 0.4 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.1 | 1.9 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.1 | 4.0 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.1 | 2.1 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.1 | 2.1 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.1 | 9.5 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
| 0.1 | 0.7 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.1 | 3.7 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.1 | 0.1 | PID S1P S1P1 PATHWAY | S1P1 pathway |
| 0.1 | 2.8 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.1 | 2.5 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.1 | 0.3 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.1 | 0.4 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.1 | 0.2 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.1 | 0.8 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.1 | 0.8 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.0 | 0.4 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.0 | 1.2 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.0 | 2.5 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.0 | 0.8 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 1.0 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.0 | 0.5 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.0 | 0.3 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.0 | 1.2 | PID ATM PATHWAY | ATM pathway |
| 0.0 | 0.9 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.0 | 0.9 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
| 0.0 | 0.6 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 0.2 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.0 | 0.3 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.0 | 2.3 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
| 0.0 | 1.5 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.0 | 0.4 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.0 | 0.8 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.0 | 0.7 | PID MTOR 4PATHWAY | mTOR signaling pathway |
| 0.0 | 0.6 | PID P73PATHWAY | p73 transcription factor network |
| 0.0 | 0.5 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.9 | 13.7 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.8 | 0.8 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
| 0.7 | 3.6 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
| 0.6 | 6.0 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.6 | 6.2 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
| 0.5 | 1.0 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
| 0.5 | 7.2 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 0.4 | 10.1 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 0.4 | 5.2 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.4 | 4.4 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.4 | 10.5 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.4 | 0.7 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
| 0.4 | 10.8 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.4 | 11.6 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.4 | 9.6 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.3 | 8.7 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.3 | 6.0 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
| 0.3 | 15.6 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
| 0.3 | 4.2 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.3 | 7.1 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.3 | 4.7 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.3 | 1.9 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.3 | 4.4 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.3 | 6.0 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.3 | 6.0 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.3 | 11.1 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.3 | 9.8 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.2 | 1.2 | REACTOME PLC BETA MEDIATED EVENTS | Genes involved in PLC beta mediated events |
| 0.2 | 7.1 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.2 | 12.8 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.2 | 1.5 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
| 0.2 | 4.3 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.2 | 4.4 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.2 | 1.8 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
| 0.2 | 4.7 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.2 | 5.6 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
| 0.2 | 1.9 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
| 0.2 | 4.7 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.2 | 5.8 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.2 | 0.5 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.2 | 3.1 | REACTOME SIGNALING BY NOTCH4 | Genes involved in Signaling by NOTCH4 |
| 0.2 | 2.3 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
| 0.2 | 2.2 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.2 | 1.0 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
| 0.2 | 5.2 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.2 | 12.7 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.2 | 0.8 | REACTOME DAG AND IP3 SIGNALING | Genes involved in DAG and IP3 signaling |
| 0.2 | 2.3 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.2 | 0.6 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
| 0.2 | 3.1 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.2 | 1.3 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
| 0.2 | 6.7 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.2 | 0.5 | REACTOME P75NTR SIGNALS VIA NFKB | Genes involved in p75NTR signals via NF-kB |
| 0.2 | 6.0 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.2 | 2.2 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.2 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
| 0.2 | 9.8 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.1 | 7.9 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.1 | 3.2 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
| 0.1 | 2.7 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.1 | 5.7 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.1 | 13.5 | REACTOME RECRUITMENT OF MITOTIC CENTROSOME PROTEINS AND COMPLEXES | Genes involved in Recruitment of mitotic centrosome proteins and complexes |
| 0.1 | 4.1 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.1 | 4.3 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.1 | 1.1 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.1 | 3.2 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.1 | 1.4 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 0.1 | 4.1 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.1 | 0.4 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
| 0.1 | 9.7 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.1 | 0.7 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.1 | 3.6 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
| 0.1 | 1.3 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
| 0.1 | 2.0 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.1 | 40.6 | REACTOME GENERIC TRANSCRIPTION PATHWAY | Genes involved in Generic Transcription Pathway |
| 0.1 | 0.6 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
| 0.1 | 0.9 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
| 0.1 | 6.0 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
| 0.1 | 1.7 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
| 0.1 | 0.1 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
| 0.1 | 1.2 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
| 0.1 | 0.5 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
| 0.1 | 1.7 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.1 | 0.4 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
| 0.1 | 1.2 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.1 | 5.3 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
| 0.1 | 4.1 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
| 0.1 | 1.9 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
| 0.1 | 3.1 | REACTOME NUCLEAR EVENTS KINASE AND TRANSCRIPTION FACTOR ACTIVATION | Genes involved in Nuclear Events (kinase and transcription factor activation) |
| 0.1 | 0.2 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 0.1 | 3.8 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.1 | 2.2 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.1 | 1.0 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.1 | 1.4 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.1 | 2.8 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.1 | 1.6 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.1 | 0.8 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.1 | 0.2 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.1 | 2.0 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.1 | 1.7 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.1 | 1.9 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.1 | 1.2 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
| 0.1 | 0.5 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.1 | 1.5 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
| 0.1 | 1.2 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.1 | 1.7 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
| 0.1 | 4.9 | REACTOME RNA POL I RNA POL III AND MITOCHONDRIAL TRANSCRIPTION | Genes involved in RNA Polymerase I, RNA Polymerase III, and Mitochondrial Transcription |
| 0.1 | 1.3 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
| 0.1 | 1.8 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.1 | 0.5 | REACTOME MAPK TARGETS NUCLEAR EVENTS MEDIATED BY MAP KINASES | Genes involved in MAPK targets/ Nuclear events mediated by MAP kinases |
| 0.1 | 1.1 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
| 0.0 | 2.0 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.0 | 2.6 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
| 0.0 | 0.1 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS | Genes involved in Synthesis of bile acids and bile salts |
| 0.0 | 0.5 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.0 | 0.2 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 0.0 | 0.4 | REACTOME BILE ACID AND BILE SALT METABOLISM | Genes involved in Bile acid and bile salt metabolism |
| 0.0 | 0.4 | REACTOME ION CHANNEL TRANSPORT | Genes involved in Ion channel transport |
| 0.0 | 0.6 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.0 | 0.1 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.0 | 1.2 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.0 | 0.3 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.0 | 0.3 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
| 0.0 | 0.5 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.0 | 0.1 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
| 0.0 | 0.2 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
| 0.0 | 0.2 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.0 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
| 0.0 | 0.6 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.0 | 0.2 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
| 0.0 | 0.1 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
| 0.0 | 0.3 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
| 0.0 | 0.5 | REACTOME MYD88 MAL CASCADE INITIATED ON PLASMA MEMBRANE | Genes involved in MyD88:Mal cascade initiated on plasma membrane |
| 0.0 | 0.2 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.0 | 0.7 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
| 0.0 | 0.9 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.0 | 0.2 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |