Epithelial-Mesenchymal Transition, human (Scheel, 2011): : averaged replicates
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
HIC1
|
ENSG00000177374.8 | HIC1 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| HIC1 | hg19_v2_chr17_+_1959369_1959604, hg19_v2_chr17_+_1958388_1958404 | 0.39 | 3.4e-01 | Click! |
| Promoter | Score | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr5_+_176237478 | 1.32 |
ENST00000329542.4 |
UNC5A |
unc-5 homolog A (C. elegans) |
| chr2_+_7057523 | 1.29 |
ENST00000320892.6 |
RNF144A |
ring finger protein 144A |
| chr6_+_56819773 | 0.88 |
ENST00000370750.2 |
BEND6 |
BEN domain containing 6 |
| chr11_-_2160611 | 0.84 |
ENST00000416167.2 |
IGF2 |
insulin-like growth factor 2 (somatomedin A) |
| chr2_+_241938255 | 0.81 |
ENST00000401884.1 ENST00000405547.3 ENST00000310397.8 ENST00000342631.6 |
SNED1 |
sushi, nidogen and EGF-like domains 1 |
| chr11_+_65779283 | 0.72 |
ENST00000312134.2 |
CST6 |
cystatin E/M |
| chr6_-_46459099 | 0.71 |
ENST00000371374.1 |
RCAN2 |
regulator of calcineurin 2 |
| chr1_-_184006611 | 0.70 |
ENST00000546159.1 |
COLGALT2 |
collagen beta(1-O)galactosyltransferase 2 |
| chr20_-_62462566 | 0.67 |
ENST00000245663.4 ENST00000302995.2 |
ZBTB46 |
zinc finger and BTB domain containing 46 |
| chrX_-_142722897 | 0.67 |
ENST00000338017.4 |
SLITRK4 |
SLIT and NTRK-like family, member 4 |
| chr6_+_56820018 | 0.67 |
ENST00000370746.3 |
BEND6 |
BEN domain containing 6 |
| chr21_+_27011899 | 0.62 |
ENST00000425221.2 |
JAM2 |
junctional adhesion molecule 2 |
| chr12_+_26274917 | 0.60 |
ENST00000538142.1 |
SSPN |
sarcospan |
| chr6_+_124125286 | 0.59 |
ENST00000368416.1 ENST00000368417.1 ENST00000546092.1 |
NKAIN2 |
Na+/K+ transporting ATPase interacting 2 |
| chr10_+_111985713 | 0.53 |
ENST00000239007.7 |
MXI1 |
MAX interactor 1, dimerization protein |
| chr7_-_122526799 | 0.53 |
ENST00000334010.7 ENST00000313070.7 |
CADPS2 |
Ca++-dependent secretion activator 2 |
| chr18_-_500692 | 0.52 |
ENST00000400256.3 |
COLEC12 |
collectin sub-family member 12 |
| chr3_+_52280173 | 0.51 |
ENST00000296487.4 |
PPM1M |
protein phosphatase, Mg2+/Mn2+ dependent, 1M |
| chr16_-_65155833 | 0.51 |
ENST00000566827.1 ENST00000394156.3 ENST00000562998.1 |
CDH11 |
cadherin 11, type 2, OB-cadherin (osteoblast) |
| chr3_+_53528659 | 0.50 |
ENST00000350061.5 |
CACNA1D |
calcium channel, voltage-dependent, L type, alpha 1D subunit |
| chr3_+_52280220 | 0.50 |
ENST00000409502.3 ENST00000323588.4 |
PPM1M |
protein phosphatase, Mg2+/Mn2+ dependent, 1M |
| chr4_-_175443943 | 0.49 |
ENST00000296522.6 |
HPGD |
hydroxyprostaglandin dehydrogenase 15-(NAD) |
| chr6_+_72596604 | 0.48 |
ENST00000348717.5 ENST00000517960.1 ENST00000518273.1 ENST00000522291.1 ENST00000521978.1 ENST00000520567.1 ENST00000264839.7 |
RIMS1 |
regulating synaptic membrane exocytosis 1 |
| chr2_-_10220538 | 0.48 |
ENST00000381813.4 |
CYS1 |
cystin 1 |
| chr19_+_35521572 | 0.48 |
ENST00000262631.5 |
SCN1B |
sodium channel, voltage-gated, type I, beta subunit |
| chr3_-_186080012 | 0.48 |
ENST00000544847.1 ENST00000265022.3 |
DGKG |
diacylglycerol kinase, gamma 90kDa |
| chr7_-_150946015 | 0.47 |
ENST00000262188.8 |
SMARCD3 |
SWI/SNF related, matrix associated, actin dependent regulator of chromatin, subfamily d, member 3 |
| chr7_-_150864635 | 0.47 |
ENST00000297537.4 |
GBX1 |
gastrulation brain homeobox 1 |
| chr19_+_46367518 | 0.46 |
ENST00000302177.2 |
FOXA3 |
forkhead box A3 |
| chr10_+_111767720 | 0.46 |
ENST00000356080.4 ENST00000277900.8 |
ADD3 |
adducin 3 (gamma) |
| chr14_+_59104741 | 0.44 |
ENST00000395153.3 ENST00000335867.4 |
DACT1 |
dishevelled-binding antagonist of beta-catenin 1 |
| chr12_-_124457371 | 0.43 |
ENST00000238156.3 ENST00000545037.1 |
CCDC92 |
coiled-coil domain containing 92 |
| chr21_-_44495919 | 0.43 |
ENST00000398158.1 |
CBS |
cystathionine-beta-synthase |
| chr2_+_30370382 | 0.42 |
ENST00000402708.1 |
YPEL5 |
yippee-like 5 (Drosophila) |
| chr6_+_72596406 | 0.42 |
ENST00000491071.2 |
RIMS1 |
regulating synaptic membrane exocytosis 1 |
| chr11_+_64059464 | 0.42 |
ENST00000394525.2 |
KCNK4 |
potassium channel, subfamily K, member 4 |
| chr1_-_62785054 | 0.42 |
ENST00000371153.4 |
KANK4 |
KN motif and ankyrin repeat domains 4 |
| chr1_+_215256467 | 0.41 |
ENST00000391894.2 ENST00000444842.2 |
KCNK2 |
potassium channel, subfamily K, member 2 |
| chr2_+_96012397 | 0.41 |
ENST00000468529.1 |
KCNIP3 |
Kv channel interacting protein 3, calsenilin |
| chr6_-_109330702 | 0.40 |
ENST00000356644.7 |
SESN1 |
sestrin 1 |
| chr7_+_130131907 | 0.40 |
ENST00000223215.4 ENST00000437945.1 |
MEST |
mesoderm specific transcript |
| chr21_+_46825032 | 0.39 |
ENST00000400337.2 |
COL18A1 |
collagen, type XVIII, alpha 1 |
| chr4_+_3768075 | 0.39 |
ENST00000509482.1 ENST00000330055.5 |
ADRA2C |
adrenoceptor alpha 2C |
| chr16_+_67313412 | 0.39 |
ENST00000379344.3 ENST00000568621.1 ENST00000450733.1 ENST00000567938.1 |
PLEKHG4 |
pleckstrin homology domain containing, family G (with RhoGef domain) member 4 |
| chr8_-_120685608 | 0.38 |
ENST00000427067.2 |
ENPP2 |
ectonucleotide pyrophosphatase/phosphodiesterase 2 |
| chr8_+_97506033 | 0.38 |
ENST00000518385.1 |
SDC2 |
syndecan 2 |
| chr12_+_94542459 | 0.38 |
ENST00000258526.4 |
PLXNC1 |
plexin C1 |
| chr7_+_70597109 | 0.38 |
ENST00000333538.5 |
WBSCR17 |
Williams-Beuren syndrome chromosome region 17 |
| chr21_-_28338732 | 0.38 |
ENST00000284987.5 |
ADAMTS5 |
ADAM metallopeptidase with thrombospondin type 1 motif, 5 |
| chr16_+_85646763 | 0.37 |
ENST00000411612.1 ENST00000253458.7 |
GSE1 |
Gse1 coiled-coil protein |
| chr5_-_168727786 | 0.37 |
ENST00000332966.8 |
SLIT3 |
slit homolog 3 (Drosophila) |
| chr10_+_95753714 | 0.36 |
ENST00000260766.3 |
PLCE1 |
phospholipase C, epsilon 1 |
| chr2_+_128175997 | 0.35 |
ENST00000234071.3 ENST00000429925.1 ENST00000442644.1 ENST00000453608.2 |
PROC |
protein C (inactivator of coagulation factors Va and VIIIa) |
| chr19_-_3029011 | 0.35 |
ENST00000590536.1 ENST00000587137.1 ENST00000455444.2 ENST00000262953.6 |
TLE2 |
transducin-like enhancer of split 2 (E(sp1) homolog, Drosophila) |
| chr16_+_85646891 | 0.35 |
ENST00000393243.1 |
GSE1 |
Gse1 coiled-coil protein |
| chrX_-_100914781 | 0.35 |
ENST00000431597.1 ENST00000458024.1 ENST00000413506.1 ENST00000440675.1 ENST00000328766.5 ENST00000356824.4 |
ARMCX2 |
armadillo repeat containing, X-linked 2 |
| chr5_-_168727713 | 0.35 |
ENST00000404867.3 |
SLIT3 |
slit homolog 3 (Drosophila) |
| chr13_+_42031679 | 0.35 |
ENST00000379359.3 |
RGCC |
regulator of cell cycle |
| chr19_+_17392672 | 0.34 |
ENST00000594072.1 ENST00000598347.1 |
ANKLE1 |
ankyrin repeat and LEM domain containing 1 |
| chr10_+_42970962 | 0.34 |
ENST00000429940.2 |
LINC00839 |
long intergenic non-protein coding RNA 839 |
| chr10_+_42971050 | 0.34 |
ENST00000424751.2 |
LINC00839 |
long intergenic non-protein coding RNA 839 |
| chr4_-_175443788 | 0.34 |
ENST00000541923.1 |
HPGD |
hydroxyprostaglandin dehydrogenase 15-(NAD) |
| chr19_+_33685490 | 0.33 |
ENST00000253193.7 |
LRP3 |
low density lipoprotein receptor-related protein 3 |
| chr4_-_175443484 | 0.33 |
ENST00000514584.1 ENST00000542498.1 ENST00000296521.7 ENST00000422112.2 ENST00000504433.1 |
HPGD |
hydroxyprostaglandin dehydrogenase 15-(NAD) |
| chr1_-_62784935 | 0.33 |
ENST00000354381.3 |
KANK4 |
KN motif and ankyrin repeat domains 4 |
| chrX_+_153686614 | 0.32 |
ENST00000369682.3 |
PLXNA3 |
plexin A3 |
| chr4_-_57522470 | 0.32 |
ENST00000503639.3 |
HOPX |
HOP homeobox |
| chr3_+_12329358 | 0.32 |
ENST00000309576.6 |
PPARG |
peroxisome proliferator-activated receptor gamma |
| chr4_-_57522598 | 0.32 |
ENST00000553379.2 |
HOPX |
HOP homeobox |
| chr16_-_4987065 | 0.32 |
ENST00000590782.2 ENST00000345988.2 |
PPL |
periplakin |
| chr7_+_2559399 | 0.32 |
ENST00000222725.5 ENST00000359574.3 |
LFNG |
LFNG O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase |
| chr4_-_57522673 | 0.32 |
ENST00000381255.3 ENST00000317745.7 ENST00000555760.2 ENST00000556614.2 |
HOPX |
HOP homeobox |
| chr5_+_15500280 | 0.32 |
ENST00000504595.1 |
FBXL7 |
F-box and leucine-rich repeat protein 7 |
| chr10_+_120789223 | 0.31 |
ENST00000425699.1 |
NANOS1 |
nanos homolog 1 (Drosophila) |
| chr17_-_78009647 | 0.31 |
ENST00000310924.2 |
TBC1D16 |
TBC1 domain family, member 16 |
| chr1_+_6845497 | 0.31 |
ENST00000473578.1 ENST00000557126.1 |
CAMTA1 |
calmodulin binding transcription activator 1 |
| chr18_-_56940611 | 0.31 |
ENST00000256852.7 ENST00000334889.3 |
RAX |
retina and anterior neural fold homeobox |
| chr4_-_17783135 | 0.30 |
ENST00000265018.3 |
FAM184B |
family with sequence similarity 184, member B |
| chr7_+_73082152 | 0.30 |
ENST00000324941.4 ENST00000451519.1 |
VPS37D |
vacuolar protein sorting 37 homolog D (S. cerevisiae) |
| chr10_+_31608054 | 0.29 |
ENST00000320985.10 ENST00000361642.5 ENST00000560721.2 ENST00000558440.1 ENST00000424869.1 ENST00000542815.3 |
ZEB1 |
zinc finger E-box binding homeobox 1 |
| chr2_+_217498105 | 0.29 |
ENST00000233809.4 |
IGFBP2 |
insulin-like growth factor binding protein 2, 36kDa |
| chr11_+_1891380 | 0.29 |
ENST00000429923.1 ENST00000418975.1 ENST00000406638.2 |
LSP1 |
lymphocyte-specific protein 1 |
| chr16_-_79634595 | 0.29 |
ENST00000326043.4 ENST00000393350.1 |
MAF |
v-maf avian musculoaponeurotic fibrosarcoma oncogene homolog |
| chr1_-_236228403 | 0.29 |
ENST00000366595.3 |
NID1 |
nidogen 1 |
| chr1_-_236228417 | 0.29 |
ENST00000264187.6 |
NID1 |
nidogen 1 |
| chr5_-_168728103 | 0.28 |
ENST00000519560.1 |
SLIT3 |
slit homolog 3 (Drosophila) |
| chr7_+_1609694 | 0.28 |
ENST00000437621.2 ENST00000457484.2 |
PSMG3-AS1 |
PSMG3 antisense RNA 1 (head to head) |
| chr16_-_79633799 | 0.28 |
ENST00000569649.1 |
MAF |
v-maf avian musculoaponeurotic fibrosarcoma oncogene homolog |
| chr9_-_131534188 | 0.28 |
ENST00000414921.1 |
ZER1 |
zyg-11 related, cell cycle regulator |
| chr12_+_53440753 | 0.28 |
ENST00000379902.3 |
TENC1 |
tensin like C1 domain containing phosphatase (tensin 2) |
| chr16_+_226658 | 0.28 |
ENST00000320868.5 ENST00000397797.1 |
HBA1 |
hemoglobin, alpha 1 |
| chr4_-_185747188 | 0.28 |
ENST00000507295.1 ENST00000504900.1 ENST00000281455.2 ENST00000454703.2 |
ACSL1 |
acyl-CoA synthetase long-chain family member 1 |
| chr1_+_6845384 | 0.28 |
ENST00000303635.7 |
CAMTA1 |
calmodulin binding transcription activator 1 |
| chr3_+_12329397 | 0.28 |
ENST00000397015.2 |
PPARG |
peroxisome proliferator-activated receptor gamma |
| chr19_-_47922750 | 0.27 |
ENST00000331559.5 |
MEIS3 |
Meis homeobox 3 |
| chr8_+_104152922 | 0.27 |
ENST00000309982.5 ENST00000438105.2 ENST00000297574.6 |
BAALC |
brain and acute leukemia, cytoplasmic |
| chr9_+_17579084 | 0.26 |
ENST00000380607.4 |
SH3GL2 |
SH3-domain GRB2-like 2 |
| chr8_+_136469684 | 0.26 |
ENST00000355849.5 |
KHDRBS3 |
KH domain containing, RNA binding, signal transduction associated 3 |
| chr9_-_140353748 | 0.26 |
ENST00000371472.2 ENST00000371475.3 ENST00000265663.7 ENST00000437259.1 ENST00000392812.4 ENST00000371474.3 ENST00000371473.3 |
NSMF |
NMDA receptor synaptonuclear signaling and neuronal migration factor |
| chr14_+_96505659 | 0.26 |
ENST00000555004.1 |
C14orf132 |
chromosome 14 open reading frame 132 |
| chr3_-_18466026 | 0.26 |
ENST00000417717.2 |
SATB1 |
SATB homeobox 1 |
| chr11_+_94822968 | 0.26 |
ENST00000278505.4 |
ENDOD1 |
endonuclease domain containing 1 |
| chr11_-_17035943 | 0.26 |
ENST00000355661.3 ENST00000532079.1 ENST00000448080.2 ENST00000531066.1 |
PLEKHA7 |
pleckstrin homology domain containing, family A member 7 |
| chr8_+_1922024 | 0.26 |
ENST00000320248.3 |
KBTBD11 |
kelch repeat and BTB (POZ) domain containing 11 |
| chr8_-_101571933 | 0.26 |
ENST00000520311.1 |
ANKRD46 |
ankyrin repeat domain 46 |
| chr1_-_32801825 | 0.26 |
ENST00000329421.7 |
MARCKSL1 |
MARCKS-like 1 |
| chr22_-_45559540 | 0.25 |
ENST00000432502.1 |
CTA-217C2.1 |
CTA-217C2.1 |
| chr8_+_97657449 | 0.25 |
ENST00000220763.5 |
CPQ |
carboxypeptidase Q |
| chr13_-_49107303 | 0.25 |
ENST00000344532.3 |
RCBTB2 |
regulator of chromosome condensation (RCC1) and BTB (POZ) domain containing protein 2 |
| chr11_-_67980744 | 0.25 |
ENST00000401547.2 ENST00000453170.1 ENST00000304363.4 |
SUV420H1 |
suppressor of variegation 4-20 homolog 1 (Drosophila) |
| chr9_+_135037334 | 0.25 |
ENST00000393229.3 ENST00000360670.3 ENST00000393228.4 ENST00000372179.3 |
NTNG2 |
netrin G2 |
| chr6_+_139456226 | 0.25 |
ENST00000367658.2 |
HECA |
headcase homolog (Drosophila) |
| chr17_-_6459768 | 0.25 |
ENST00000421306.3 |
PITPNM3 |
PITPNM family member 3 |
| chr2_-_175870085 | 0.25 |
ENST00000409156.3 |
CHN1 |
chimerin 1 |
| chr6_+_107811162 | 0.25 |
ENST00000317357.5 |
SOBP |
sine oculis binding protein homolog (Drosophila) |
| chr8_-_101571964 | 0.25 |
ENST00000520552.1 ENST00000521345.1 ENST00000523000.1 ENST00000335659.3 ENST00000358990.3 ENST00000519597.1 |
ANKRD46 |
ankyrin repeat domain 46 |
| chr21_+_44073860 | 0.24 |
ENST00000335512.4 ENST00000539837.1 ENST00000291539.6 ENST00000380328.2 ENST00000398232.3 ENST00000398234.3 ENST00000398236.3 ENST00000328862.6 ENST00000335440.6 ENST00000398225.3 ENST00000398229.3 ENST00000398227.3 |
PDE9A |
phosphodiesterase 9A |
| chr17_-_6459802 | 0.24 |
ENST00000262483.8 |
PITPNM3 |
PITPNM family member 3 |
| chr6_+_168841817 | 0.24 |
ENST00000356284.2 ENST00000354536.5 |
SMOC2 |
SPARC related modular calcium binding 2 |
| chr12_+_108523133 | 0.24 |
ENST00000547525.1 |
WSCD2 |
WSC domain containing 2 |
| chr16_-_1661988 | 0.24 |
ENST00000426508.2 |
IFT140 |
intraflagellar transport 140 homolog (Chlamydomonas) |
| chr10_-_81205373 | 0.24 |
ENST00000372336.3 |
ZCCHC24 |
zinc finger, CCHC domain containing 24 |
| chr22_-_39239987 | 0.24 |
ENST00000333039.2 |
NPTXR |
neuronal pentraxin receptor |
| chr18_-_21242774 | 0.24 |
ENST00000322980.9 |
ANKRD29 |
ankyrin repeat domain 29 |
| chr16_+_67700673 | 0.24 |
ENST00000403458.4 ENST00000602365.1 |
C16orf86 |
chromosome 16 open reading frame 86 |
| chr2_+_65283529 | 0.24 |
ENST00000546106.1 ENST00000537589.1 ENST00000260569.4 |
CEP68 |
centrosomal protein 68kDa |
| chr20_+_33146510 | 0.24 |
ENST00000397709.1 |
MAP1LC3A |
microtubule-associated protein 1 light chain 3 alpha |
| chr2_+_65283506 | 0.24 |
ENST00000377990.2 |
CEP68 |
centrosomal protein 68kDa |
| chr3_+_72937182 | 0.24 |
ENST00000389617.4 |
GXYLT2 |
glucoside xylosyltransferase 2 |
| chr19_-_47922373 | 0.23 |
ENST00000559524.1 ENST00000557833.1 ENST00000558555.1 ENST00000561293.1 ENST00000441740.2 |
MEIS3 |
Meis homeobox 3 |
| chr8_+_37654693 | 0.23 |
ENST00000412232.2 |
GPR124 |
G protein-coupled receptor 124 |
| chr8_+_38831683 | 0.23 |
ENST00000302495.4 |
HTRA4 |
HtrA serine peptidase 4 |
| chr2_+_204193129 | 0.23 |
ENST00000417864.1 |
ABI2 |
abl-interactor 2 |
| chr16_+_67282853 | 0.23 |
ENST00000299798.11 |
SLC9A5 |
solute carrier family 9, subfamily A (NHE5, cation proton antiporter 5), member 5 |
| chr6_+_56819895 | 0.23 |
ENST00000370748.3 |
BEND6 |
BEN domain containing 6 |
| chr8_+_22022800 | 0.23 |
ENST00000397814.3 |
BMP1 |
bone morphogenetic protein 1 |
| chr20_+_62887081 | 0.23 |
ENST00000369758.4 ENST00000299468.7 ENST00000609372.1 ENST00000610196.1 ENST00000308824.6 |
PCMTD2 |
protein-L-isoaspartate (D-aspartate) O-methyltransferase domain containing 2 |
| chr9_-_16870704 | 0.22 |
ENST00000380672.4 ENST00000380667.2 ENST00000380666.2 ENST00000486514.1 |
BNC2 |
basonuclin 2 |
| chr2_+_23608064 | 0.22 |
ENST00000486442.1 |
KLHL29 |
kelch-like family member 29 |
| chr1_+_6845578 | 0.22 |
ENST00000467404.2 ENST00000439411.2 |
CAMTA1 |
calmodulin binding transcription activator 1 |
| chr14_-_101034407 | 0.22 |
ENST00000443071.2 ENST00000557378.1 |
BEGAIN |
brain-enriched guanylate kinase-associated |
| chrX_-_107018969 | 0.22 |
ENST00000372383.4 |
TSC22D3 |
TSC22 domain family, member 3 |
| chr17_-_74236382 | 0.22 |
ENST00000592271.1 ENST00000319945.6 ENST00000269391.6 |
RNF157 |
ring finger protein 157 |
| chr10_-_89623194 | 0.22 |
ENST00000445946.3 |
KLLN |
killin, p53-regulated DNA replication inhibitor |
| chr19_-_18653781 | 0.22 |
ENST00000596558.2 ENST00000453489.2 |
FKBP8 |
FK506 binding protein 8, 38kDa |
| chr1_-_8086343 | 0.22 |
ENST00000474874.1 ENST00000469499.1 ENST00000377482.5 |
ERRFI1 |
ERBB receptor feedback inhibitor 1 |
| chr10_+_75670862 | 0.22 |
ENST00000446342.1 ENST00000372764.3 ENST00000372762.4 |
PLAU |
plasminogen activator, urokinase |
| chrX_-_107019181 | 0.22 |
ENST00000315660.4 ENST00000372384.2 ENST00000502650.1 ENST00000506724.1 |
TSC22D3 |
TSC22 domain family, member 3 |
| chr17_+_73083816 | 0.21 |
ENST00000580123.1 ENST00000578847.1 |
SLC16A5 |
solute carrier family 16 (monocarboxylate transporter), member 5 |
| chr4_+_2965307 | 0.21 |
ENST00000398051.4 ENST00000503518.2 ENST00000398052.4 ENST00000345167.6 ENST00000504933.1 ENST00000442472.2 |
GRK4 |
G protein-coupled receptor kinase 4 |
| chr20_+_44034804 | 0.21 |
ENST00000357275.2 ENST00000372720.3 |
DBNDD2 |
dysbindin (dystrobrevin binding protein 1) domain containing 2 |
| chr1_+_8378140 | 0.21 |
ENST00000377479.2 |
SLC45A1 |
solute carrier family 45, member 1 |
| chr4_+_4388245 | 0.21 |
ENST00000433139.2 |
NSG1 |
Homo sapiens neuron specific gene family member 1 (NSG1), transcript variant 3, mRNA. |
| chr4_+_86396321 | 0.21 |
ENST00000503995.1 |
ARHGAP24 |
Rho GTPase activating protein 24 |
| chr1_-_1535455 | 0.21 |
ENST00000422725.1 |
C1orf233 |
chromosome 1 open reading frame 233 |
| chr17_-_30185946 | 0.21 |
ENST00000579741.1 |
COPRS |
coordinator of PRMT5, differentiation stimulator |
| chr14_-_74960030 | 0.21 |
ENST00000553490.1 ENST00000557510.1 |
NPC2 |
Niemann-Pick disease, type C2 |
| chr2_+_39893043 | 0.20 |
ENST00000281961.2 |
TMEM178A |
transmembrane protein 178A |
| chr22_-_37505449 | 0.20 |
ENST00000406725.1 |
TMPRSS6 |
transmembrane protease, serine 6 |
| chr14_+_73704201 | 0.20 |
ENST00000340738.5 ENST00000427855.1 ENST00000381166.3 |
PAPLN |
papilin, proteoglycan-like sulfated glycoprotein |
| chr19_-_5567842 | 0.20 |
ENST00000587632.1 |
TINCR |
tissue differentiation-inducing non-protein coding RNA |
| chr2_+_204193149 | 0.20 |
ENST00000422511.2 |
ABI2 |
abl-interactor 2 |
| chr20_-_50385138 | 0.20 |
ENST00000338821.5 |
ATP9A |
ATPase, class II, type 9A |
| chr19_-_18717627 | 0.20 |
ENST00000392386.3 |
CRLF1 |
cytokine receptor-like factor 1 |
| chr8_+_141521386 | 0.20 |
ENST00000220913.5 ENST00000519533.1 |
CHRAC1 |
chromatin accessibility complex 1 |
| chr20_-_50384864 | 0.20 |
ENST00000311637.5 ENST00000402822.1 |
ATP9A |
ATPase, class II, type 9A |
| chr22_-_37505588 | 0.20 |
ENST00000406856.1 |
TMPRSS6 |
transmembrane protease, serine 6 |
| chr2_-_175869936 | 0.20 |
ENST00000409900.3 |
CHN1 |
chimerin 1 |
| chr2_+_30369859 | 0.20 |
ENST00000402003.3 |
YPEL5 |
yippee-like 5 (Drosophila) |
| chr16_+_85645007 | 0.19 |
ENST00000405402.2 |
GSE1 |
Gse1 coiled-coil protein |
| chr1_-_33815486 | 0.19 |
ENST00000373418.3 |
PHC2 |
polyhomeotic homolog 2 (Drosophila) |
| chr11_-_66336060 | 0.19 |
ENST00000310325.5 |
CTSF |
cathepsin F |
| chr2_+_24346324 | 0.19 |
ENST00000407625.1 ENST00000420135.2 |
FAM228B |
family with sequence similarity 228, member B |
| chr11_+_113930291 | 0.19 |
ENST00000335953.4 |
ZBTB16 |
zinc finger and BTB domain containing 16 |
| chr9_+_91606355 | 0.19 |
ENST00000358157.2 |
S1PR3 |
sphingosine-1-phosphate receptor 3 |
| chr14_+_33408449 | 0.19 |
ENST00000346562.2 ENST00000341321.4 ENST00000548645.1 ENST00000356141.4 ENST00000357798.5 |
NPAS3 |
neuronal PAS domain protein 3 |
| chr22_-_45559642 | 0.19 |
ENST00000426282.2 |
CTA-217C2.1 |
CTA-217C2.1 |
| chr9_-_130742792 | 0.19 |
ENST00000373095.1 |
FAM102A |
family with sequence similarity 102, member A |
| chr4_+_4387983 | 0.19 |
ENST00000397958.1 |
NSG1 |
Homo sapiens neuron specific gene family member 1 (NSG1), transcript variant 3, mRNA. |
| chr4_-_2264015 | 0.19 |
ENST00000337190.2 |
MXD4 |
MAX dimerization protein 4 |
| chr11_+_126225789 | 0.19 |
ENST00000530591.1 ENST00000534083.1 |
ST3GAL4 |
ST3 beta-galactoside alpha-2,3-sialyltransferase 4 |
| chr11_+_66045634 | 0.19 |
ENST00000528852.1 ENST00000311445.6 |
CNIH2 |
cornichon family AMPA receptor auxiliary protein 2 |
| chr14_-_89883412 | 0.18 |
ENST00000557258.1 |
FOXN3 |
forkhead box N3 |
| chr5_+_6633534 | 0.18 |
ENST00000537411.1 ENST00000538824.1 |
SRD5A1 |
steroid-5-alpha-reductase, alpha polypeptide 1 (3-oxo-5 alpha-steroid delta 4-dehydrogenase alpha 1) |
| chr12_+_108523489 | 0.18 |
ENST00000261400.3 |
WSCD2 |
WSC domain containing 2 |
| chr11_+_13299186 | 0.18 |
ENST00000527998.1 ENST00000396441.3 ENST00000533520.1 ENST00000529825.1 ENST00000389707.4 ENST00000401424.1 ENST00000529388.1 ENST00000530357.1 ENST00000403290.1 ENST00000361003.4 ENST00000389708.3 ENST00000403510.3 ENST00000482049.1 |
ARNTL |
aryl hydrocarbon receptor nuclear translocator-like |
| chr8_-_110703819 | 0.18 |
ENST00000532779.1 ENST00000534578.1 |
SYBU |
syntabulin (syntaxin-interacting) |
| chr13_-_44361025 | 0.18 |
ENST00000261488.6 |
ENOX1 |
ecto-NOX disulfide-thiol exchanger 1 |
| chr17_+_7255208 | 0.18 |
ENST00000333751.3 |
KCTD11 |
potassium channel tetramerization domain containing 11 |
| chr12_+_9067327 | 0.18 |
ENST00000433083.2 ENST00000544916.1 ENST00000544539.1 ENST00000539063.1 |
PHC1 |
polyhomeotic homolog 1 (Drosophila) |
| chr9_+_130922537 | 0.18 |
ENST00000372994.1 |
C9orf16 |
chromosome 9 open reading frame 16 |
| chr11_+_57365150 | 0.18 |
ENST00000457869.1 ENST00000340687.6 ENST00000378323.4 ENST00000378324.2 ENST00000403558.1 |
SERPING1 |
serpin peptidase inhibitor, clade G (C1 inhibitor), member 1 |
| chr19_-_3025614 | 0.18 |
ENST00000447365.2 |
TLE2 |
transducin-like enhancer of split 2 (E(sp1) homolog, Drosophila) |
| chr8_-_145688231 | 0.18 |
ENST00000530374.1 |
CYHR1 |
cysteine/histidine-rich 1 |
| chr15_-_55700457 | 0.18 |
ENST00000442196.3 ENST00000563171.1 ENST00000425574.3 |
CCPG1 |
cell cycle progression 1 |
| chr1_+_236305826 | 0.18 |
ENST00000366592.3 ENST00000366591.4 |
GPR137B |
G protein-coupled receptor 137B |
| chr6_-_105627735 | 0.18 |
ENST00000254765.3 |
POPDC3 |
popeye domain containing 3 |
| chr19_+_35521616 | 0.17 |
ENST00000595652.1 |
SCN1B |
sodium channel, voltage-gated, type I, beta subunit |
| chr3_+_39851094 | 0.17 |
ENST00000302541.6 |
MYRIP |
myosin VIIA and Rab interacting protein |
| chr2_-_128145498 | 0.17 |
ENST00000409179.2 |
MAP3K2 |
mitogen-activated protein kinase kinase kinase 2 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.7 | GO:0021966 | corticospinal neuron axon guidance(GO:0021966) |
| 0.2 | 1.0 | GO:0021834 | chemorepulsion involved in embryonic olfactory bulb interneuron precursor migration(GO:0021834) |
| 0.2 | 1.3 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.2 | 0.7 | GO:2000230 | negative regulation of pancreatic stellate cell proliferation(GO:2000230) |
| 0.2 | 0.7 | GO:0071469 | detection of mechanical stimulus involved in sensory perception of touch(GO:0050976) cellular response to alkaline pH(GO:0071469) |
| 0.1 | 0.4 | GO:0006535 | cysteine biosynthetic process from serine(GO:0006535) |
| 0.1 | 0.4 | GO:1900039 | positive regulation of cellular response to hypoxia(GO:1900039) |
| 0.1 | 0.4 | GO:0044691 | tooth eruption(GO:0044691) |
| 0.1 | 1.1 | GO:2001300 | lipoxin metabolic process(GO:2001300) |
| 0.1 | 0.4 | GO:0044537 | regulation of circulating fibrinogen levels(GO:0044537) |
| 0.1 | 0.6 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 1.0 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.1 | 0.4 | GO:0032811 | negative regulation of epinephrine secretion(GO:0032811) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
| 0.1 | 0.4 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
| 0.1 | 0.3 | GO:1904617 | negative regulation of actin filament binding(GO:1904530) negative regulation of actin binding(GO:1904617) |
| 0.1 | 0.3 | GO:0045062 | extrathymic T cell selection(GO:0045062) |
| 0.1 | 0.1 | GO:0035357 | peroxisome proliferator activated receptor signaling pathway(GO:0035357) |
| 0.1 | 0.5 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
| 0.1 | 0.1 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.1 | 0.4 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
| 0.1 | 0.3 | GO:0003330 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
| 0.1 | 0.6 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
| 0.1 | 0.2 | GO:0003162 | atrioventricular node development(GO:0003162) |
| 0.1 | 0.2 | GO:1902490 | regulation of sperm capacitation(GO:1902490) |
| 0.1 | 0.5 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
| 0.1 | 0.5 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.1 | 0.3 | GO:0002086 | diaphragm contraction(GO:0002086) |
| 0.1 | 0.1 | GO:0003192 | mitral valve formation(GO:0003192) |
| 0.1 | 0.2 | GO:0001544 | initiation of primordial ovarian follicle growth(GO:0001544) |
| 0.1 | 0.5 | GO:1990504 | dense core granule exocytosis(GO:1990504) |
| 0.1 | 0.2 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 0.1 | 0.5 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
| 0.1 | 0.4 | GO:0008218 | bioluminescence(GO:0008218) |
| 0.1 | 0.8 | GO:0030853 | negative regulation of granulocyte differentiation(GO:0030853) |
| 0.1 | 0.2 | GO:0042351 | 'de novo' GDP-L-fucose biosynthetic process(GO:0042351) |
| 0.1 | 0.3 | GO:2001106 | regulation of Rho guanyl-nucleotide exchange factor activity(GO:2001106) |
| 0.1 | 0.2 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
| 0.1 | 1.1 | GO:0098828 | positive regulation of inhibitory postsynaptic potential(GO:0097151) modulation of inhibitory postsynaptic potential(GO:0098828) |
| 0.1 | 0.2 | GO:0019322 | pentose biosynthetic process(GO:0019322) |
| 0.1 | 0.5 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
| 0.1 | 0.6 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.1 | 0.5 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
| 0.1 | 0.2 | GO:0045226 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
| 0.1 | 0.5 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.1 | 0.2 | GO:0060926 | cardiac pacemaker cell development(GO:0060926) |
| 0.1 | 0.3 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.0 | 0.4 | GO:0007498 | mesoderm development(GO:0007498) |
| 0.0 | 0.1 | GO:0021569 | rhombomere 3 development(GO:0021569) central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| 0.0 | 0.1 | GO:0021823 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) chemorepulsion involved in postnatal olfactory bulb interneuron migration(GO:0021836) |
| 0.0 | 0.4 | GO:0070197 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.0 | 0.1 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.0 | 0.4 | GO:0018317 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.0 | 0.4 | GO:0016191 | synaptic vesicle uncoating(GO:0016191) |
| 0.0 | 0.2 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.0 | 0.1 | GO:1902303 | regulation of heart rate by hormone(GO:0003064) negative regulation of potassium ion export(GO:1902303) |
| 0.0 | 0.2 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.0 | 0.3 | GO:0060992 | response to fungicide(GO:0060992) |
| 0.0 | 0.2 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
| 0.0 | 0.4 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.0 | 0.5 | GO:0098887 | neurotransmitter receptor transport, endosome to postsynaptic membrane(GO:0098887) |
| 0.0 | 0.1 | GO:0006816 | calcium ion transport(GO:0006816) |
| 0.0 | 0.2 | GO:1900247 | cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
| 0.0 | 0.2 | GO:0002572 | pro-T cell differentiation(GO:0002572) negative regulation of DNA demethylation(GO:1901536) |
| 0.0 | 0.3 | GO:0032383 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.0 | 0.4 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
| 0.0 | 0.2 | GO:2000691 | negative regulation of cardioblast differentiation(GO:0051892) regulation of cardiac muscle cell myoblast differentiation(GO:2000690) negative regulation of cardiac muscle cell myoblast differentiation(GO:2000691) |
| 0.0 | 0.2 | GO:0010157 | response to chlorate(GO:0010157) |
| 0.0 | 1.8 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
| 0.0 | 0.2 | GO:2001153 | regulation of renal water transport(GO:2001151) positive regulation of renal water transport(GO:2001153) |
| 0.0 | 0.1 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.0 | 0.1 | GO:0006478 | peptidyl-tyrosine sulfation(GO:0006478) |
| 0.0 | 0.2 | GO:0098728 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.0 | 0.2 | GO:0001315 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 0.0 | 0.0 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
| 0.0 | 0.1 | GO:1900034 | regulation of cellular response to heat(GO:1900034) |
| 0.0 | 0.2 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.0 | 0.2 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
| 0.0 | 0.1 | GO:1904020 | regulation of G-protein coupled receptor internalization(GO:1904020) |
| 0.0 | 0.4 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 0.0 | 0.1 | GO:1905244 | regulation of modification of synaptic structure(GO:1905244) |
| 0.0 | 0.2 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.0 | 0.9 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
| 0.0 | 0.0 | GO:0035621 | ER to Golgi ceramide transport(GO:0035621) |
| 0.0 | 0.1 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.0 | 0.6 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
| 0.0 | 0.4 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.0 | 0.4 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.0 | 0.1 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.0 | 0.1 | GO:1900224 | positive regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900224) |
| 0.0 | 0.1 | GO:1904106 | protein localization to microvillus(GO:1904106) |
| 0.0 | 0.2 | GO:0061314 | Notch signaling involved in heart development(GO:0061314) |
| 0.0 | 0.1 | GO:1902161 | positive regulation of cyclic nucleotide-gated ion channel activity(GO:1902161) |
| 0.0 | 0.1 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.0 | 0.5 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.0 | 0.1 | GO:0090156 | cellular sphingolipid homeostasis(GO:0090156) |
| 0.0 | 0.2 | GO:0038007 | netrin-activated signaling pathway(GO:0038007) |
| 0.0 | 0.1 | GO:0003160 | endocardium morphogenesis(GO:0003160) endocardium formation(GO:0060214) |
| 0.0 | 0.1 | GO:1902460 | regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.0 | 0.2 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.0 | 0.1 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
| 0.0 | 0.1 | GO:0048936 | visceral motor neuron differentiation(GO:0021524) peripheral nervous system neuron axonogenesis(GO:0048936) cardiac cell fate determination(GO:0060913) |
| 0.0 | 0.2 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
| 0.0 | 0.1 | GO:0070563 | negative regulation of vitamin D receptor signaling pathway(GO:0070563) |
| 0.0 | 0.1 | GO:1903697 | negative regulation of microvillus assembly(GO:1903697) |
| 0.0 | 0.2 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.0 | 0.0 | GO:0001954 | positive regulation of cell-matrix adhesion(GO:0001954) |
| 0.0 | 0.2 | GO:0002934 | desmosome organization(GO:0002934) |
| 0.0 | 0.1 | GO:1903971 | mammary gland fat development(GO:0060611) positive regulation of macrophage colony-stimulating factor signaling pathway(GO:1902228) positive regulation of response to macrophage colony-stimulating factor(GO:1903971) positive regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903974) positive regulation of microglial cell migration(GO:1904141) |
| 0.0 | 0.1 | GO:0046836 | glycolipid transport(GO:0046836) |
| 0.0 | 0.1 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
| 0.0 | 0.1 | GO:0006059 | hexitol metabolic process(GO:0006059) inner medullary collecting duct development(GO:0072061) |
| 0.0 | 0.3 | GO:2000111 | positive regulation of macrophage apoptotic process(GO:2000111) |
| 0.0 | 0.1 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.0 | 0.2 | GO:1903243 | negative regulation of cardiac muscle adaptation(GO:0010616) negative regulation of cardiac muscle hypertrophy in response to stress(GO:1903243) |
| 0.0 | 0.2 | GO:0014062 | regulation of serotonin secretion(GO:0014062) negative regulation of serotonin secretion(GO:0014063) |
| 0.0 | 0.1 | GO:1901162 | primary amino compound biosynthetic process(GO:1901162) |
| 0.0 | 0.1 | GO:1904425 | negative regulation of GTP binding(GO:1904425) |
| 0.0 | 0.1 | GO:0035494 | SNARE complex disassembly(GO:0035494) |
| 0.0 | 0.1 | GO:0038170 | somatostatin receptor signaling pathway(GO:0038169) somatostatin signaling pathway(GO:0038170) |
| 0.0 | 0.4 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
| 0.0 | 0.1 | GO:0051685 | maintenance of ER location(GO:0051685) |
| 0.0 | 0.4 | GO:2000394 | positive regulation of lamellipodium morphogenesis(GO:2000394) |
| 0.0 | 0.1 | GO:0098814 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
| 0.0 | 0.3 | GO:0021859 | pyramidal neuron differentiation(GO:0021859) pyramidal neuron development(GO:0021860) |
| 0.0 | 0.0 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.0 | 0.1 | GO:0002528 | regulation of vascular permeability involved in acute inflammatory response(GO:0002528) |
| 0.0 | 0.4 | GO:0046069 | cGMP catabolic process(GO:0046069) |
| 0.0 | 0.1 | GO:1904204 | regulation of skeletal muscle hypertrophy(GO:1904204) |
| 0.0 | 0.4 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
| 0.0 | 0.1 | GO:0019859 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) beta-alanine metabolic process(GO:0019482) thymine metabolic process(GO:0019859) uracil metabolic process(GO:0019860) |
| 0.0 | 0.1 | GO:0097089 | methyl-branched fatty acid metabolic process(GO:0097089) |
| 0.0 | 0.1 | GO:0060139 | positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation of apoptotic process by virus(GO:0060139) apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
| 0.0 | 0.2 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.0 | 0.3 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.0 | 0.4 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.0 | 0.1 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) |
| 0.0 | 0.1 | GO:0038162 | erythropoietin-mediated signaling pathway(GO:0038162) |
| 0.0 | 0.2 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
| 0.0 | 0.1 | GO:0016240 | autophagosome docking(GO:0016240) |
| 0.0 | 0.1 | GO:0048203 | vesicle targeting, trans-Golgi to endosome(GO:0048203) |
| 0.0 | 0.1 | GO:0035720 | intraciliary anterograde transport(GO:0035720) |
| 0.0 | 0.1 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
| 0.0 | 0.1 | GO:1904381 | Golgi apparatus mannose trimming(GO:1904381) |
| 0.0 | 0.1 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
| 0.0 | 0.1 | GO:0044858 | plasma membrane raft distribution(GO:0044855) plasma membrane raft localization(GO:0044856) plasma membrane raft polarization(GO:0044858) regulation of plasma membrane raft polarization(GO:1903906) |
| 0.0 | 0.1 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.0 | 0.2 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
| 0.0 | 0.1 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.0 | 0.0 | GO:0022604 | regulation of cell morphogenesis(GO:0022604) |
| 0.0 | 0.2 | GO:0010265 | SCF complex assembly(GO:0010265) |
| 0.0 | 0.1 | GO:1904933 | regulation of cell proliferation in midbrain(GO:1904933) |
| 0.0 | 0.1 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
| 0.0 | 0.0 | GO:0051931 | regulation of sensory perception of pain(GO:0051930) regulation of sensory perception(GO:0051931) |
| 0.0 | 0.4 | GO:0071318 | cellular response to ATP(GO:0071318) |
| 0.0 | 0.1 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.0 | 0.1 | GO:0003350 | pulmonary myocardium development(GO:0003350) |
| 0.0 | 0.1 | GO:0002384 | hepatic immune response(GO:0002384) |
| 0.0 | 0.1 | GO:0043449 | olfactory learning(GO:0008355) cellular alkene metabolic process(GO:0043449) |
| 0.0 | 0.6 | GO:0070306 | lens fiber cell differentiation(GO:0070306) |
| 0.0 | 0.4 | GO:1900153 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.0 | 0.1 | GO:0001928 | regulation of exocyst assembly(GO:0001928) regulation of exocyst localization(GO:0060178) |
| 0.0 | 0.0 | GO:0061300 | cerebellum vasculature development(GO:0061300) |
| 0.0 | 0.1 | GO:1990927 | short-term synaptic potentiation(GO:1990926) calcium ion regulated lysosome exocytosis(GO:1990927) |
| 0.0 | 0.3 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.0 | 0.1 | GO:0034059 | response to anoxia(GO:0034059) |
| 0.0 | 0.1 | GO:0030098 | lymphocyte differentiation(GO:0030098) |
| 0.0 | 0.1 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.0 | 0.1 | GO:0016036 | cellular response to phosphate starvation(GO:0016036) positive regulation of sulfur amino acid metabolic process(GO:0031337) negative regulation of catecholamine metabolic process(GO:0045914) negative regulation of dopamine metabolic process(GO:0045963) positive regulation of homocysteine metabolic process(GO:0050668) |
| 0.0 | 0.1 | GO:0000432 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) positive regulation of transcription by glucose(GO:0046016) |
| 0.0 | 0.1 | GO:1902960 | regulation of choline O-acetyltransferase activity(GO:1902769) positive regulation of choline O-acetyltransferase activity(GO:1902771) negative regulation of tau-protein kinase activity(GO:1902948) positive regulation of early endosome to recycling endosome transport(GO:1902955) negative regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902960) negative regulation of neurofibrillary tangle assembly(GO:1902997) negative regulation of aspartic-type peptidase activity(GO:1905246) |
| 0.0 | 0.1 | GO:0030514 | negative regulation of BMP signaling pathway(GO:0030514) |
| 0.0 | 0.1 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.0 | 0.1 | GO:0002024 | diet induced thermogenesis(GO:0002024) |
| 0.0 | 0.1 | GO:0043323 | regulation of natural killer cell degranulation(GO:0043321) positive regulation of natural killer cell degranulation(GO:0043323) |
| 0.0 | 0.1 | GO:0015808 | L-alanine transport(GO:0015808) |
| 0.0 | 0.1 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.0 | 0.1 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.0 | 0.1 | GO:0072364 | regulation of cellular ketone metabolic process by regulation of transcription from RNA polymerase II promoter(GO:0072364) |
| 0.0 | 0.0 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) negative regulation of double-strand break repair via nonhomologous end joining(GO:2001033) |
| 0.0 | 0.1 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.0 | 0.0 | GO:1900449 | regulation of glutamate receptor signaling pathway(GO:1900449) |
| 0.0 | 0.2 | GO:0030091 | protein repair(GO:0030091) |
| 0.0 | 0.0 | GO:0014054 | positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
| 0.0 | 0.1 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) |
| 0.0 | 0.5 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
| 0.0 | 0.1 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.0 | 0.1 | GO:0033274 | response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.0 | 0.1 | GO:0003190 | atrioventricular valve formation(GO:0003190) |
| 0.0 | 0.0 | GO:0097187 | dentinogenesis(GO:0097187) |
| 0.0 | 0.0 | GO:0015817 | acyl carnitine transport(GO:0006844) histidine transport(GO:0015817) L-histidine transmembrane transport(GO:0089709) L-histidine transport(GO:1902024) acyl carnitine transmembrane transport(GO:1902616) |
| 0.0 | 0.4 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.0 | 0.0 | GO:0061054 | dermatome development(GO:0061054) regulation of dermatome development(GO:0061183) renal vesicle induction(GO:0072034) |
| 0.0 | 0.0 | GO:0007113 | endomitotic cell cycle(GO:0007113) |
| 0.0 | 0.0 | GO:0032803 | regulation of low-density lipoprotein particle receptor catabolic process(GO:0032803) |
| 0.0 | 0.1 | GO:0072108 | positive regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0072108) |
| 0.0 | 0.2 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.0 | 0.0 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.0 | 0.1 | GO:0032962 | positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
| 0.0 | 0.3 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
| 0.0 | 0.1 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
| 0.0 | 0.1 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.0 | 0.0 | GO:0002265 | astrocyte activation involved in immune response(GO:0002265) |
| 0.0 | 0.4 | GO:0042994 | cytoplasmic sequestering of transcription factor(GO:0042994) |
| 0.0 | 0.1 | GO:0035176 | social behavior(GO:0035176) intraspecies interaction between organisms(GO:0051703) |
| 0.0 | 0.1 | GO:0075044 | autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
| 0.0 | 0.1 | GO:0035583 | sequestering of TGFbeta in extracellular matrix(GO:0035583) |
| 0.0 | 0.1 | GO:2000170 | positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
| 0.0 | 0.0 | GO:0030047 | actin modification(GO:0030047) |
| 0.0 | 0.4 | GO:0010226 | response to lithium ion(GO:0010226) |
| 0.0 | 0.4 | GO:0045332 | lipid translocation(GO:0034204) phospholipid translocation(GO:0045332) |
| 0.0 | 0.3 | GO:0071526 | semaphorin-plexin signaling pathway(GO:0071526) |
| 0.0 | 0.2 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.0 | 0.0 | GO:0015880 | coenzyme A transport(GO:0015880) coenzyme A transmembrane transport(GO:0035349) adenosine 3',5'-bisphosphate transmembrane transport(GO:0071106) AMP transport(GO:0080121) |
| 0.0 | 0.1 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.0 | 0.0 | GO:0071344 | diphosphate metabolic process(GO:0071344) |
| 0.0 | 0.0 | GO:1900075 | regulation of neuromuscular synaptic transmission(GO:1900073) positive regulation of neuromuscular synaptic transmission(GO:1900075) |
| 0.0 | 0.1 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 0.0 | 0.0 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.0 | 0.1 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 0.0 | 0.3 | GO:0008045 | motor neuron axon guidance(GO:0008045) |
| 0.0 | 0.1 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) |
| 0.0 | 0.1 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.0 | 0.2 | GO:0006590 | thyroid hormone generation(GO:0006590) |
| 0.0 | 0.1 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.0 | 0.0 | GO:1901985 | positive regulation of histone acetylation(GO:0035066) positive regulation of protein acetylation(GO:1901985) positive regulation of peptidyl-lysine acetylation(GO:2000758) |
| 0.0 | 0.1 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.0 | 0.1 | GO:0016198 | axon choice point recognition(GO:0016198) |
| 0.0 | 0.0 | GO:0090031 | positive regulation of steroid hormone biosynthetic process(GO:0090031) |
| 0.0 | 0.2 | GO:0001502 | cartilage condensation(GO:0001502) |
| 0.0 | 0.0 | GO:0046984 | regulation of hemoglobin biosynthetic process(GO:0046984) |
| 0.0 | 0.1 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
| 0.0 | 0.4 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.0 | 0.1 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.0 | 0.1 | GO:0086024 | adrenergic receptor signaling pathway involved in positive regulation of heart rate(GO:0086024) |
| 0.0 | 0.1 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.0 | 0.2 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
| 0.0 | 0.1 | GO:0071277 | cellular response to calcium ion(GO:0071277) |
| 0.0 | 0.2 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.0 | 0.0 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
| 0.0 | 0.0 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.0 | 0.3 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
| 0.0 | 0.0 | GO:0032484 | Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.4 | GO:0044305 | calyx of Held(GO:0044305) |
| 0.1 | 0.3 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 0.1 | 0.2 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.1 | 0.5 | GO:0098845 | postsynaptic endosome(GO:0098845) |
| 0.0 | 0.3 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.0 | 0.5 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
| 0.0 | 0.7 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.0 | 0.1 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.0 | 0.6 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.0 | 0.1 | GO:0060187 | cell pole(GO:0060187) |
| 0.0 | 0.3 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.0 | 0.5 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.0 | 0.2 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.0 | 0.4 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.0 | 0.3 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.0 | 0.5 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.0 | 0.1 | GO:0019034 | viral replication complex(GO:0019034) |
| 0.0 | 0.5 | GO:0032059 | muscle thin filament tropomyosin(GO:0005862) bleb(GO:0032059) |
| 0.0 | 0.5 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.0 | 0.1 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
| 0.0 | 0.3 | GO:0016589 | NURF complex(GO:0016589) |
| 0.0 | 0.1 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.0 | 0.2 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.0 | 0.2 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.0 | 0.1 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.0 | 0.2 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.0 | 0.4 | GO:0044754 | autolysosome(GO:0044754) |
| 0.0 | 1.1 | GO:0032809 | neuronal cell body membrane(GO:0032809) cell body membrane(GO:0044298) |
| 0.0 | 0.2 | GO:0035976 | AP1 complex(GO:0035976) |
| 0.0 | 0.1 | GO:1990769 | proximal neuron projection(GO:1990769) |
| 0.0 | 0.0 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.0 | 0.1 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
| 0.0 | 0.3 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 0.1 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.0 | 0.1 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 0.0 | 0.1 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.0 | 0.1 | GO:0097196 | Shu complex(GO:0097196) |
| 0.0 | 0.1 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 0.0 | 1.0 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.0 | 0.1 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.0 | 0.1 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.0 | 0.7 | GO:0005605 | basal lamina(GO:0005605) |
| 0.0 | 0.4 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.0 | 0.2 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.0 | 0.2 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.0 | 0.1 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.0 | 0.1 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
| 0.0 | 0.1 | GO:0044292 | dendrite terminus(GO:0044292) |
| 0.0 | 1.0 | GO:0001533 | cornified envelope(GO:0001533) |
| 0.0 | 0.1 | GO:0031673 | H zone(GO:0031673) |
| 0.0 | 0.5 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.0 | 0.1 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.0 | 0.3 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.0 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.0 | 0.1 | GO:0001740 | Barr body(GO:0001740) |
| 0.0 | 0.3 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.0 | 0.1 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.0 | 0.1 | GO:0044326 | dendritic spine neck(GO:0044326) |
| 0.0 | 0.1 | GO:1990578 | perinuclear endoplasmic reticulum membrane(GO:1990578) |
| 0.0 | 0.2 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.0 | 0.2 | GO:0031045 | dense core granule(GO:0031045) |
| 0.0 | 0.1 | GO:0098642 | network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) |
| 0.0 | 0.3 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.0 | 0.1 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.0 | 0.1 | GO:1990584 | cardiac Troponin complex(GO:1990584) |
| 0.0 | 0.2 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.0 | 0.0 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
| 0.0 | 0.0 | GO:0045160 | myosin I complex(GO:0045160) |
| 0.0 | 0.1 | GO:0071144 | SMAD2-SMAD3 protein complex(GO:0071144) |
| 0.0 | 0.2 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.0 | 1.4 | GO:0031093 | platelet alpha granule lumen(GO:0031093) |
| 0.0 | 0.1 | GO:0033268 | node of Ranvier(GO:0033268) |
| 0.0 | 0.8 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.0 | 0.1 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.0 | 0.3 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.0 | 1.5 | GO:0043679 | axon terminus(GO:0043679) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 1.2 | GO:0016404 | 15-hydroxyprostaglandin dehydrogenase (NAD+) activity(GO:0016404) |
| 0.2 | 0.7 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
| 0.2 | 0.7 | GO:0098782 | mechanically-gated potassium channel activity(GO:0098782) |
| 0.2 | 0.8 | GO:0050211 | procollagen galactosyltransferase activity(GO:0050211) |
| 0.1 | 0.4 | GO:0098809 | cystathionine beta-synthase activity(GO:0004122) oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) nitrite reductase (NO-forming) activity(GO:0050421) carbon monoxide binding(GO:0070025) nitrite reductase activity(GO:0098809) |
| 0.1 | 0.4 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
| 0.1 | 0.7 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.1 | 1.0 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.1 | 0.9 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.1 | 0.9 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.1 | 0.4 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
| 0.1 | 0.3 | GO:0047751 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) steroid dehydrogenase activity, acting on the CH-CH group of donors(GO:0033765) cholestenone 5-alpha-reductase activity(GO:0047751) |
| 0.1 | 0.3 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.1 | 0.2 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
| 0.1 | 0.7 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.1 | 0.3 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
| 0.1 | 0.5 | GO:0070728 | leucine binding(GO:0070728) |
| 0.1 | 0.2 | GO:0050254 | rhodopsin kinase activity(GO:0050254) |
| 0.1 | 0.3 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
| 0.1 | 0.5 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.1 | 0.5 | GO:0005534 | galactose binding(GO:0005534) |
| 0.1 | 0.6 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.1 | 0.2 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.1 | 0.1 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.1 | 0.5 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.1 | 0.2 | GO:0015439 | heme-transporting ATPase activity(GO:0015439) |
| 0.1 | 0.2 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
| 0.1 | 0.2 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.1 | 0.2 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.1 | 0.2 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.0 | 0.0 | GO:0032427 | GBD domain binding(GO:0032427) |
| 0.0 | 0.2 | GO:0050262 | ribosylnicotinamide kinase activity(GO:0050262) ribosylnicotinate kinase activity(GO:0061769) |
| 0.0 | 0.4 | GO:0043426 | MRF binding(GO:0043426) |
| 0.0 | 0.3 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
| 0.0 | 0.3 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 0.0 | 0.2 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.0 | 0.1 | GO:0008969 | phosphohistidine phosphatase activity(GO:0008969) |
| 0.0 | 0.1 | GO:0099580 | ion antiporter activity involved in regulation of postsynaptic membrane potential(GO:0099580) |
| 0.0 | 0.2 | GO:0043812 | phosphatidylinositol-4-phosphate phosphatase activity(GO:0043812) |
| 0.0 | 0.1 | GO:0008476 | protein-tyrosine sulfotransferase activity(GO:0008476) |
| 0.0 | 0.3 | GO:0004522 | ribonuclease A activity(GO:0004522) |
| 0.0 | 0.2 | GO:0003774 | motor activity(GO:0003774) |
| 0.0 | 0.2 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.0 | 0.1 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
| 0.0 | 0.2 | GO:0003998 | acylphosphatase activity(GO:0003998) |
| 0.0 | 0.2 | GO:0005152 | interleukin-1 receptor antagonist activity(GO:0005152) |
| 0.0 | 0.2 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.0 | 0.2 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
| 0.0 | 0.1 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
| 0.0 | 0.3 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.0 | 0.1 | GO:0004157 | dihydropyrimidinase activity(GO:0004157) |
| 0.0 | 0.2 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 0.0 | 1.4 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.0 | 0.1 | GO:0050698 | proteoglycan sulfotransferase activity(GO:0050698) |
| 0.0 | 1.6 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.0 | 0.1 | GO:0005260 | channel-conductance-controlling ATPase activity(GO:0005260) |
| 0.0 | 0.2 | GO:0005119 | smoothened binding(GO:0005119) |
| 0.0 | 0.6 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.0 | 0.1 | GO:0019981 | interleukin-6 receptor activity(GO:0004915) interleukin-6 binding(GO:0019981) |
| 0.0 | 0.3 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.0 | 0.2 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.0 | 0.2 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.0 | 0.5 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
| 0.0 | 0.3 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.0 | 0.1 | GO:0050436 | microfibril binding(GO:0050436) |
| 0.0 | 0.3 | GO:0031386 | protein tag(GO:0031386) |
| 0.0 | 0.1 | GO:0008410 | CoA-transferase activity(GO:0008410) |
| 0.0 | 0.1 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.0 | 0.1 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.0 | 0.2 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.0 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.0 | 0.0 | GO:0015227 | acyl carnitine transmembrane transporter activity(GO:0015227) |
| 0.0 | 0.5 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.0 | 0.6 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.0 | 0.2 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.0 | 0.1 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.0 | 0.1 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.0 | 0.2 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.0 | 0.1 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 0.0 | 0.3 | GO:0008061 | chitin binding(GO:0008061) |
| 0.0 | 0.1 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 0.0 | 0.7 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.0 | 0.2 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.0 | 0.1 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.0 | 0.3 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.0 | 0.5 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.0 | 0.1 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.0 | 0.1 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
| 0.0 | 0.1 | GO:0016402 | pristanoyl-CoA oxidase activity(GO:0016402) |
| 0.0 | 0.0 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.0 | 0.1 | GO:0010465 | nerve growth factor receptor activity(GO:0010465) |
| 0.0 | 0.1 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
| 0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.0 | 0.2 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.0 | 0.1 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.0 | 0.4 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.0 | 0.1 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
| 0.0 | 0.2 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.0 | 0.3 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.0 | 0.1 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.0 | 0.1 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.0 | 0.2 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.0 | 0.1 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.0 | 0.4 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.0 | 0.1 | GO:0022858 | L-alanine transmembrane transporter activity(GO:0015180) L-cystine transmembrane transporter activity(GO:0015184) alanine transmembrane transporter activity(GO:0022858) |
| 0.0 | 0.0 | GO:0030226 | apolipoprotein receptor activity(GO:0030226) |
| 0.0 | 0.1 | GO:0004692 | cGMP-dependent protein kinase activity(GO:0004692) |
| 0.0 | 0.1 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
| 0.0 | 0.3 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.0 | 0.1 | GO:0003996 | acyl-CoA ligase activity(GO:0003996) |
| 0.0 | 0.3 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.0 | 0.0 | GO:0080122 | coenzyme A transmembrane transporter activity(GO:0015228) adenosine 3',5'-bisphosphate transmembrane transporter activity(GO:0071077) AMP transmembrane transporter activity(GO:0080122) |
| 0.0 | 0.0 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.0 | 0.1 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.0 | 0.1 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
| 0.0 | 0.1 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.0 | 0.1 | GO:0008048 | calcium sensitive guanylate cyclase activator activity(GO:0008048) |
| 0.0 | 0.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.0 | 0.7 | GO:0070888 | E-box binding(GO:0070888) |
| 0.0 | 0.1 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.0 | 0.1 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
| 0.0 | 0.1 | GO:0045159 | myosin II binding(GO:0045159) |
| 0.0 | 0.0 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.0 | 0.1 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.0 | 1.8 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.0 | 1.5 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.0 | 1.0 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.0 | 0.0 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.0 | 0.2 | PID FOXO PATHWAY | FoxO family signaling |
| 0.0 | 0.7 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.0 | 1.1 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.0 | 0.8 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.0 | 0.5 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
| 0.0 | 0.2 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.0 | 0.1 | PID EPHB FWD PATHWAY | EPHB forward signaling |
| 0.0 | 0.1 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
| 0.0 | 0.4 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 1.3 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.1 | 1.1 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.1 | 1.3 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.1 | 0.9 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
| 0.0 | 0.4 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 0.0 | 0.3 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.0 | 0.3 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.0 | 0.1 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
| 0.0 | 0.5 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.0 | 0.6 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.0 | 0.6 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.0 | 0.3 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.0 | 0.7 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
| 0.0 | 0.5 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.0 | 0.9 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
| 0.0 | 0.3 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.0 | 0.3 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.0 | 0.2 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.0 | 1.0 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.0 | 0.5 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 0.0 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
| 0.0 | 0.1 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |