Epithelial-Mesenchymal Transition, human (Scheel, 2011)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
YY1
|
ENSG00000100811.6 | YY1 |
|
YY2
|
ENSG00000230797.2 | YY2 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| YY2 | hg19_v2_chrX_+_21874105_21874105 | 0.38 | 3.5e-01 | Click! |
| YY1 | hg19_v2_chr14_+_100705322_100705360 | 0.10 | 8.1e-01 | Click! |
| Promoter | Score | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr12_-_91539918 | 2.66 |
ENST00000548218.1 |
DCN |
decorin |
| chr12_+_56075330 | 1.77 |
ENST00000394252.3 |
METTL7B |
methyltransferase like 7B |
| chr2_-_190044480 | 1.56 |
ENST00000374866.3 |
COL5A2 |
collagen, type V, alpha 2 |
| chr5_+_71403061 | 1.50 |
ENST00000512974.1 ENST00000296755.7 |
MAP1B |
microtubule-associated protein 1B |
| chr3_-_197676740 | 1.37 |
ENST00000452735.1 ENST00000453254.1 ENST00000455191.1 |
IQCG |
IQ motif containing G |
| chr14_-_30396802 | 1.29 |
ENST00000415220.2 |
PRKD1 |
protein kinase D1 |
| chr5_-_41510656 | 1.27 |
ENST00000377801.3 |
PLCXD3 |
phosphatidylinositol-specific phospholipase C, X domain containing 3 |
| chr5_-_41510725 | 1.23 |
ENST00000328457.3 |
PLCXD3 |
phosphatidylinositol-specific phospholipase C, X domain containing 3 |
| chr12_-_91546926 | 1.20 |
ENST00000550758.1 |
DCN |
decorin |
| chr15_+_33022885 | 1.18 |
ENST00000322805.4 |
GREM1 |
gremlin 1, DAN family BMP antagonist |
| chr1_-_85870177 | 1.10 |
ENST00000542148.1 |
DDAH1 |
dimethylarginine dimethylaminohydrolase 1 |
| chr5_-_139943830 | 1.10 |
ENST00000412920.3 ENST00000511201.2 ENST00000356738.2 ENST00000354402.5 ENST00000358580.5 ENST00000508496.2 |
APBB3 |
amyloid beta (A4) precursor protein-binding, family B, member 3 |
| chr5_-_139944196 | 1.05 |
ENST00000357560.4 |
APBB3 |
amyloid beta (A4) precursor protein-binding, family B, member 3 |
| chr8_-_120685608 | 0.96 |
ENST00000427067.2 |
ENPP2 |
ectonucleotide pyrophosphatase/phosphodiesterase 2 |
| chr1_+_114522049 | 0.92 |
ENST00000369551.1 ENST00000320334.4 |
OLFML3 |
olfactomedin-like 3 |
| chr14_-_30396948 | 0.89 |
ENST00000331968.5 |
PRKD1 |
protein kinase D1 |
| chr19_-_50316489 | 0.89 |
ENST00000533418.1 |
FUZ |
fuzzy planar cell polarity protein |
| chr16_+_30662050 | 0.88 |
ENST00000568754.1 |
PRR14 |
proline rich 14 |
| chrX_+_57618269 | 0.86 |
ENST00000374888.1 |
ZXDB |
zinc finger, X-linked, duplicated B |
| chr19_-_50316517 | 0.86 |
ENST00000313777.4 ENST00000445575.2 |
FUZ |
fuzzy planar cell polarity protein |
| chr2_-_127864839 | 0.85 |
ENST00000409400.1 ENST00000357970.3 ENST00000393040.3 ENST00000348750.4 ENST00000259238.4 ENST00000346226.3 ENST00000393041.3 ENST00000351659.3 ENST00000352848.3 ENST00000316724.5 |
BIN1 |
bridging integrator 1 |
| chr5_+_119799927 | 0.82 |
ENST00000407149.2 ENST00000379551.2 |
PRR16 |
proline rich 16 |
| chr14_-_53417732 | 0.79 |
ENST00000399304.3 ENST00000395631.2 ENST00000341590.3 ENST00000343279.4 |
FERMT2 |
fermitin family member 2 |
| chr3_-_48700310 | 0.77 |
ENST00000164024.4 ENST00000544264.1 |
CELSR3 |
cadherin, EGF LAG seven-pass G-type receptor 3 |
| chr19_+_507299 | 0.77 |
ENST00000359315.5 |
TPGS1 |
tubulin polyglutamylase complex subunit 1 |
| chr14_-_53331239 | 0.73 |
ENST00000553663.1 |
FERMT2 |
fermitin family member 2 |
| chr2_+_33172012 | 0.72 |
ENST00000404816.2 |
LTBP1 |
latent transforming growth factor beta binding protein 1 |
| chrX_+_16964985 | 0.71 |
ENST00000303843.7 |
REPS2 |
RALBP1 associated Eps domain containing 2 |
| chr19_+_17326191 | 0.70 |
ENST00000595101.1 ENST00000596136.1 ENST00000379776.4 |
USE1 |
unconventional SNARE in the ER 1 homolog (S. cerevisiae) |
| chr2_+_33172221 | 0.70 |
ENST00000354476.3 |
LTBP1 |
latent transforming growth factor beta binding protein 1 |
| chr19_-_50316423 | 0.69 |
ENST00000528094.1 ENST00000526575.1 |
FUZ |
fuzzy planar cell polarity protein |
| chr16_+_30662360 | 0.69 |
ENST00000542965.2 |
PRR14 |
proline rich 14 |
| chr11_+_77532155 | 0.69 |
ENST00000532481.1 ENST00000526415.1 ENST00000393427.2 ENST00000527134.1 ENST00000304716.8 |
AAMDC |
adipogenesis associated, Mth938 domain containing |
| chr19_+_17326141 | 0.67 |
ENST00000445667.2 ENST00000263897.5 |
USE1 |
unconventional SNARE in the ER 1 homolog (S. cerevisiae) |
| chr17_+_38599693 | 0.66 |
ENST00000542955.1 ENST00000269593.4 |
IGFBP4 |
insulin-like growth factor binding protein 4 |
| chr11_+_77532233 | 0.66 |
ENST00000525409.1 |
AAMDC |
adipogenesis associated, Mth938 domain containing |
| chr19_-_39322299 | 0.65 |
ENST00000601094.1 ENST00000595567.1 ENST00000602115.1 ENST00000601778.1 ENST00000597205.1 ENST00000595470.1 |
ECH1 |
enoyl CoA hydratase 1, peroxisomal |
| chr11_-_74109422 | 0.65 |
ENST00000298198.4 |
PGM2L1 |
phosphoglucomutase 2-like 1 |
| chr16_-_67260691 | 0.65 |
ENST00000447579.1 ENST00000393992.1 ENST00000424285.1 |
LRRC29 |
leucine rich repeat containing 29 |
| chr11_+_47270475 | 0.64 |
ENST00000481889.2 ENST00000436778.1 ENST00000531660.1 ENST00000407404.1 |
NR1H3 |
nuclear receptor subfamily 1, group H, member 3 |
| chr9_-_20622478 | 0.64 |
ENST00000355930.6 ENST00000380338.4 |
MLLT3 |
myeloid/lymphoid or mixed-lineage leukemia (trithorax homolog, Drosophila); translocated to, 3 |
| chr17_+_44668035 | 0.63 |
ENST00000398238.4 ENST00000225282.8 |
NSF |
N-ethylmaleimide-sensitive factor |
| chr15_+_63340553 | 0.62 |
ENST00000334895.5 |
TPM1 |
tropomyosin 1 (alpha) |
| chr11_+_47270436 | 0.62 |
ENST00000395397.3 ENST00000405576.1 |
NR1H3 |
nuclear receptor subfamily 1, group H, member 3 |
| chr1_+_244998602 | 0.61 |
ENST00000411948.2 |
COX20 |
COX20 cytochrome C oxidase assembly factor |
| chr20_-_34042558 | 0.61 |
ENST00000374372.1 |
GDF5 |
growth differentiation factor 5 |
| chr1_+_164528866 | 0.61 |
ENST00000420696.2 |
PBX1 |
pre-B-cell leukemia homeobox 1 |
| chr2_-_175870085 | 0.60 |
ENST00000409156.3 |
CHN1 |
chimerin 1 |
| chr11_+_67250490 | 0.60 |
ENST00000528641.2 ENST00000279146.3 |
AIP |
aryl hydrocarbon receptor interacting protein |
| chr6_-_74363803 | 0.60 |
ENST00000355773.5 |
SLC17A5 |
solute carrier family 17 (acidic sugar transporter), member 5 |
| chr10_-_79397316 | 0.60 |
ENST00000372421.5 ENST00000457953.1 |
KCNMA1 |
potassium large conductance calcium-activated channel, subfamily M, alpha member 1 |
| chr5_-_124080203 | 0.60 |
ENST00000504926.1 |
ZNF608 |
zinc finger protein 608 |
| chr2_-_175869936 | 0.58 |
ENST00000409900.3 |
CHN1 |
chimerin 1 |
| chr3_-_197686847 | 0.58 |
ENST00000265239.6 |
IQCG |
IQ motif containing G |
| chr22_-_36902522 | 0.58 |
ENST00000397223.4 |
FOXRED2 |
FAD-dependent oxidoreductase domain containing 2 |
| chr8_-_11058847 | 0.58 |
ENST00000297303.4 ENST00000416569.2 |
XKR6 |
XK, Kell blood group complex subunit-related family, member 6 |
| chr20_+_10415931 | 0.58 |
ENST00000334534.5 |
SLX4IP |
SLX4 interacting protein |
| chr1_-_161102367 | 0.58 |
ENST00000464113.1 |
DEDD |
death effector domain containing |
| chr12_+_94071341 | 0.57 |
ENST00000542893.2 |
CRADD |
CASP2 and RIPK1 domain containing adaptor with death domain |
| chr19_+_17326521 | 0.57 |
ENST00000593597.1 |
USE1 |
unconventional SNARE in the ER 1 homolog (S. cerevisiae) |
| chr10_-_79397391 | 0.57 |
ENST00000286628.8 ENST00000406533.3 ENST00000354353.5 ENST00000404857.1 |
KCNMA1 |
potassium large conductance calcium-activated channel, subfamily M, alpha member 1 |
| chr16_+_30662184 | 0.56 |
ENST00000300835.4 |
PRR14 |
proline rich 14 |
| chrX_-_57937067 | 0.56 |
ENST00000358697.4 |
ZXDA |
zinc finger, X-linked, duplicated A |
| chr10_+_104614008 | 0.55 |
ENST00000369883.3 |
C10orf32 |
chromosome 10 open reading frame 32 |
| chr10_-_81205373 | 0.55 |
ENST00000372336.3 |
ZCCHC24 |
zinc finger, CCHC domain containing 24 |
| chr13_-_33859819 | 0.55 |
ENST00000336934.5 |
STARD13 |
StAR-related lipid transfer (START) domain containing 13 |
| chr12_-_2113583 | 0.55 |
ENST00000397173.4 ENST00000280665.6 |
DCP1B |
decapping mRNA 1B |
| chr15_+_63340775 | 0.55 |
ENST00000559281.1 ENST00000317516.7 |
TPM1 |
tropomyosin 1 (alpha) |
| chr7_+_139026057 | 0.54 |
ENST00000541515.3 |
LUC7L2 |
LUC7-like 2 (S. cerevisiae) |
| chr12_+_94071129 | 0.54 |
ENST00000552983.1 ENST00000332896.3 ENST00000552033.1 ENST00000548483.1 |
CRADD |
CASP2 and RIPK1 domain containing adaptor with death domain |
| chr21_-_45079341 | 0.54 |
ENST00000443485.1 ENST00000291560.2 |
HSF2BP |
heat shock transcription factor 2 binding protein |
| chr16_-_30006922 | 0.53 |
ENST00000564026.1 |
HIRIP3 |
HIRA interacting protein 3 |
| chr9_-_35689900 | 0.53 |
ENST00000378300.5 ENST00000329305.2 ENST00000360958.2 |
TPM2 |
tropomyosin 2 (beta) |
| chr10_-_70092671 | 0.53 |
ENST00000358769.2 ENST00000432941.1 ENST00000495025.2 |
PBLD |
phenazine biosynthesis-like protein domain containing |
| chr1_+_245133278 | 0.53 |
ENST00000366522.2 |
EFCAB2 |
EF-hand calcium binding domain 2 |
| chr10_-_79397479 | 0.53 |
ENST00000404771.3 |
KCNMA1 |
potassium large conductance calcium-activated channel, subfamily M, alpha member 1 |
| chr12_+_56862301 | 0.52 |
ENST00000338146.5 |
SPRYD4 |
SPRY domain containing 4 |
| chr14_-_74551172 | 0.52 |
ENST00000553458.1 |
ALDH6A1 |
aldehyde dehydrogenase 6 family, member A1 |
| chr9_-_123342415 | 0.51 |
ENST00000349780.4 ENST00000360190.4 ENST00000360822.3 ENST00000359309.3 |
CDK5RAP2 |
CDK5 regulatory subunit associated protein 2 |
| chr5_-_95158644 | 0.51 |
ENST00000237858.6 |
GLRX |
glutaredoxin (thioltransferase) |
| chr1_+_156756667 | 0.51 |
ENST00000526188.1 ENST00000454659.1 |
PRCC |
papillary renal cell carcinoma (translocation-associated) |
| chr5_+_173315283 | 0.51 |
ENST00000265085.5 |
CPEB4 |
cytoplasmic polyadenylation element binding protein 4 |
| chr10_+_104613980 | 0.50 |
ENST00000339834.5 |
C10orf32 |
chromosome 10 open reading frame 32 |
| chr2_+_120770581 | 0.50 |
ENST00000263713.5 |
EPB41L5 |
erythrocyte membrane protein band 4.1 like 5 |
| chr17_-_43045439 | 0.50 |
ENST00000253407.3 |
C1QL1 |
complement component 1, q subcomponent-like 1 |
| chr4_+_77870960 | 0.50 |
ENST00000505788.1 ENST00000510515.1 ENST00000504637.1 |
SEPT11 |
septin 11 |
| chr5_-_95158375 | 0.50 |
ENST00000512469.2 ENST00000379979.4 ENST00000505427.1 ENST00000508780.1 |
GLRX |
glutaredoxin (thioltransferase) |
| chr11_+_45907177 | 0.49 |
ENST00000241014.2 |
MAPK8IP1 |
mitogen-activated protein kinase 8 interacting protein 1 |
| chr3_-_149688896 | 0.49 |
ENST00000239940.7 |
PFN2 |
profilin 2 |
| chr5_-_172756506 | 0.49 |
ENST00000265087.4 |
STC2 |
stanniocalcin 2 |
| chr15_+_63340858 | 0.49 |
ENST00000560615.1 |
TPM1 |
tropomyosin 1 (alpha) |
| chr15_+_89010923 | 0.48 |
ENST00000353598.6 |
MRPS11 |
mitochondrial ribosomal protein S11 |
| chrX_+_85403487 | 0.48 |
ENST00000373125.4 |
DACH2 |
dachshund homolog 2 (Drosophila) |
| chr12_-_56101647 | 0.48 |
ENST00000347027.6 ENST00000257879.6 ENST00000257880.7 ENST00000394230.2 ENST00000394229.2 |
ITGA7 |
integrin, alpha 7 |
| chr17_+_66509019 | 0.48 |
ENST00000585981.1 ENST00000589480.1 ENST00000585815.1 |
PRKAR1A |
protein kinase, cAMP-dependent, regulatory, type I, alpha |
| chr7_+_139025875 | 0.48 |
ENST00000297534.6 |
C7orf55 |
chromosome 7 open reading frame 55 |
| chr5_+_139944024 | 0.48 |
ENST00000323146.3 |
SLC35A4 |
solute carrier family 35, member A4 |
| chr19_+_14551066 | 0.47 |
ENST00000342216.4 |
PKN1 |
protein kinase N1 |
| chr20_+_44563267 | 0.47 |
ENST00000372409.3 |
PCIF1 |
PDX1 C-terminal inhibiting factor 1 |
| chr8_-_108510224 | 0.47 |
ENST00000517746.1 ENST00000297450.3 |
ANGPT1 |
angiopoietin 1 |
| chr3_-_149688502 | 0.47 |
ENST00000481767.1 ENST00000475518.1 |
PFN2 |
profilin 2 |
| chr5_-_14871866 | 0.47 |
ENST00000284268.6 |
ANKH |
ANKH inorganic pyrophosphate transport regulator |
| chr6_+_144904334 | 0.45 |
ENST00000367526.4 |
UTRN |
utrophin |
| chr9_+_104161123 | 0.45 |
ENST00000374861.3 ENST00000339664.2 ENST00000259395.4 |
ZNF189 |
zinc finger protein 189 |
| chr10_-_70092635 | 0.45 |
ENST00000309049.4 |
PBLD |
phenazine biosynthesis-like protein domain containing |
| chr1_-_150849174 | 0.45 |
ENST00000515192.1 |
ARNT |
aryl hydrocarbon receptor nuclear translocator |
| chr1_-_150849208 | 0.45 |
ENST00000358595.5 |
ARNT |
aryl hydrocarbon receptor nuclear translocator |
| chr19_+_18043810 | 0.45 |
ENST00000445755.2 |
CCDC124 |
coiled-coil domain containing 124 |
| chr3_-_49314640 | 0.45 |
ENST00000436325.1 |
C3orf62 |
chromosome 3 open reading frame 62 |
| chr17_-_58603568 | 0.44 |
ENST00000083182.3 |
APPBP2 |
amyloid beta precursor protein (cytoplasmic tail) binding protein 2 |
| chr15_+_63340734 | 0.44 |
ENST00000560959.1 |
TPM1 |
tropomyosin 1 (alpha) |
| chr2_+_210517895 | 0.44 |
ENST00000447185.1 |
MAP2 |
microtubule-associated protein 2 |
| chr12_+_32260085 | 0.44 |
ENST00000548411.1 ENST00000281474.5 ENST00000551086.1 |
BICD1 |
bicaudal D homolog 1 (Drosophila) |
| chr1_+_162467595 | 0.43 |
ENST00000538489.1 ENST00000489294.1 |
UHMK1 |
U2AF homology motif (UHM) kinase 1 |
| chr11_+_6411670 | 0.43 |
ENST00000530395.1 ENST00000527275.1 |
SMPD1 |
sphingomyelin phosphodiesterase 1, acid lysosomal |
| chr16_-_18801643 | 0.43 |
ENST00000322989.4 ENST00000563390.1 |
RPS15A |
ribosomal protein S15a |
| chr7_+_138916231 | 0.43 |
ENST00000473989.3 ENST00000288561.8 |
UBN2 |
ubinuclein 2 |
| chr1_+_164529004 | 0.42 |
ENST00000559240.1 ENST00000367897.1 ENST00000540236.1 ENST00000401534.1 |
PBX1 |
pre-B-cell leukemia homeobox 1 |
| chr10_-_79397202 | 0.42 |
ENST00000372437.1 ENST00000372408.2 ENST00000372403.4 |
KCNMA1 |
potassium large conductance calcium-activated channel, subfamily M, alpha member 1 |
| chr2_+_210444142 | 0.42 |
ENST00000360351.4 ENST00000361559.4 |
MAP2 |
microtubule-associated protein 2 |
| chr7_+_104654623 | 0.42 |
ENST00000311117.3 ENST00000334877.4 ENST00000257745.4 ENST00000334914.7 ENST00000478990.1 ENST00000495267.1 ENST00000476671.1 |
KMT2E |
lysine (K)-specific methyltransferase 2E |
| chr4_+_77870856 | 0.42 |
ENST00000264893.6 ENST00000502584.1 ENST00000510641.1 |
SEPT11 |
septin 11 |
| chr1_-_150849047 | 0.42 |
ENST00000354396.2 ENST00000505755.1 |
ARNT |
aryl hydrocarbon receptor nuclear translocator |
| chrX_+_119005399 | 0.42 |
ENST00000371437.4 |
NDUFA1 |
NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 1, 7.5kDa |
| chr3_-_48754599 | 0.42 |
ENST00000413654.1 ENST00000454335.1 ENST00000440424.1 ENST00000449610.1 ENST00000443964.1 ENST00000417896.1 ENST00000413298.1 ENST00000449563.1 ENST00000443853.1 ENST00000437427.1 ENST00000446860.1 ENST00000412850.1 ENST00000424035.1 ENST00000340879.4 ENST00000431721.2 ENST00000434860.1 ENST00000328631.5 ENST00000432678.2 |
IP6K2 |
inositol hexakisphosphate kinase 2 |
| chr1_-_222885770 | 0.42 |
ENST00000355727.2 ENST00000340020.6 |
AIDA |
axin interactor, dorsalization associated |
| chr1_+_153631130 | 0.42 |
ENST00000368685.5 |
SNAPIN |
SNAP-associated protein |
| chr20_+_46130671 | 0.42 |
ENST00000371998.3 ENST00000371997.3 |
NCOA3 |
nuclear receptor coactivator 3 |
| chr17_+_47075023 | 0.42 |
ENST00000431824.2 |
IGF2BP1 |
insulin-like growth factor 2 mRNA binding protein 1 |
| chr15_-_75198954 | 0.41 |
ENST00000565772.1 |
FAM219B |
family with sequence similarity 219, member B |
| chr19_+_49458107 | 0.41 |
ENST00000539787.1 ENST00000345358.7 ENST00000391871.3 ENST00000415969.2 ENST00000354470.3 ENST00000506183.1 ENST00000293288.8 |
BAX |
BCL2-associated X protein |
| chr5_-_140027357 | 0.40 |
ENST00000252102.4 |
NDUFA2 |
NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 2, 8kDa |
| chr11_-_82782861 | 0.40 |
ENST00000524635.1 ENST00000526205.1 ENST00000527633.1 ENST00000533486.1 ENST00000533276.2 |
RAB30 |
RAB30, member RAS oncogene family |
| chr5_-_139930713 | 0.40 |
ENST00000602657.1 |
SRA1 |
steroid receptor RNA activator 1 |
| chr13_-_114898016 | 0.40 |
ENST00000542651.1 ENST00000334062.7 |
RASA3 |
RAS p21 protein activator 3 |
| chr17_-_8066250 | 0.40 |
ENST00000488857.1 ENST00000481878.1 ENST00000316509.6 ENST00000498285.1 |
VAMP2 RP11-599B13.6 |
vesicle-associated membrane protein 2 (synaptobrevin 2) Uncharacterized protein |
| chr4_+_52917451 | 0.40 |
ENST00000295213.4 ENST00000419395.2 |
SPATA18 |
spermatogenesis associated 18 |
| chr17_+_47074758 | 0.40 |
ENST00000290341.3 |
IGF2BP1 |
insulin-like growth factor 2 mRNA binding protein 1 |
| chr15_-_57025759 | 0.40 |
ENST00000267807.7 |
ZNF280D |
zinc finger protein 280D |
| chr20_+_56884752 | 0.40 |
ENST00000244040.3 |
RAB22A |
RAB22A, member RAS oncogene family |
| chr1_+_11866207 | 0.40 |
ENST00000312413.6 ENST00000346436.6 |
CLCN6 |
chloride channel, voltage-sensitive 6 |
| chr9_+_135037334 | 0.39 |
ENST00000393229.3 ENST00000360670.3 ENST00000393228.4 ENST00000372179.3 |
NTNG2 |
netrin G2 |
| chrX_-_77395186 | 0.39 |
ENST00000341864.5 |
TAF9B |
TAF9B RNA polymerase II, TATA box binding protein (TBP)-associated factor, 31kDa |
| chr7_-_72971934 | 0.39 |
ENST00000411832.1 |
BCL7B |
B-cell CLL/lymphoma 7B |
| chr4_+_76439665 | 0.39 |
ENST00000508105.1 ENST00000311638.3 ENST00000380837.3 ENST00000507556.1 ENST00000504190.1 ENST00000507885.1 ENST00000502620.1 ENST00000514480.1 |
THAP6 |
THAP domain containing 6 |
| chr17_-_33448468 | 0.39 |
ENST00000591723.1 ENST00000593039.1 ENST00000587405.1 |
RAD51L3-RFFL RAD51D |
Uncharacterized protein RAD51 paralog D |
| chr11_+_101785727 | 0.39 |
ENST00000263468.8 |
KIAA1377 |
KIAA1377 |
| chr11_+_6411636 | 0.39 |
ENST00000299397.3 ENST00000356761.2 ENST00000342245.4 |
SMPD1 |
sphingomyelin phosphodiesterase 1, acid lysosomal |
| chr19_-_59010565 | 0.39 |
ENST00000594786.1 |
SLC27A5 |
solute carrier family 27 (fatty acid transporter), member 5 |
| chr13_-_33780133 | 0.38 |
ENST00000399365.3 |
STARD13 |
StAR-related lipid transfer (START) domain containing 13 |
| chr9_-_115819039 | 0.38 |
ENST00000555206.1 |
ZFP37 |
ZFP37 zinc finger protein |
| chr9_-_115818951 | 0.38 |
ENST00000553380.1 ENST00000374227.3 |
ZFP37 |
ZFP37 zinc finger protein |
| chr7_-_72972319 | 0.38 |
ENST00000223368.2 |
BCL7B |
B-cell CLL/lymphoma 7B |
| chr17_-_33288467 | 0.38 |
ENST00000436961.3 |
CCT6B |
chaperonin containing TCP1, subunit 6B (zeta 2) |
| chr5_-_140027175 | 0.38 |
ENST00000512088.1 |
NDUFA2 |
NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 2, 8kDa |
| chr19_-_51869592 | 0.38 |
ENST00000596253.1 ENST00000309244.4 |
ETFB |
electron-transfer-flavoprotein, beta polypeptide |
| chr3_-_129325660 | 0.37 |
ENST00000324093.4 ENST00000393239.1 |
PLXND1 |
plexin D1 |
| chr14_-_74551096 | 0.37 |
ENST00000350259.4 |
ALDH6A1 |
aldehyde dehydrogenase 6 family, member A1 |
| chr3_-_12705600 | 0.37 |
ENST00000542177.1 ENST00000442415.2 ENST00000251849.4 |
RAF1 |
v-raf-1 murine leukemia viral oncogene homolog 1 |
| chr1_-_24151903 | 0.37 |
ENST00000436439.2 ENST00000374490.3 |
HMGCL |
3-hydroxymethyl-3-methylglutaryl-CoA lyase |
| chr6_-_34360413 | 0.37 |
ENST00000607016.1 |
NUDT3 |
nudix (nucleoside diphosphate linked moiety X)-type motif 3 |
| chr3_-_149688655 | 0.37 |
ENST00000461930.1 ENST00000423691.2 ENST00000490975.1 ENST00000461868.1 ENST00000452853.2 |
PFN2 |
profilin 2 |
| chr11_-_34937858 | 0.37 |
ENST00000278359.5 |
APIP |
APAF1 interacting protein |
| chr6_-_153452356 | 0.37 |
ENST00000206262.1 |
RGS17 |
regulator of G-protein signaling 17 |
| chr5_-_178054014 | 0.37 |
ENST00000520957.1 |
CLK4 |
CDC-like kinase 4 |
| chr19_+_55897699 | 0.37 |
ENST00000558131.1 ENST00000558752.1 ENST00000458349.2 |
RPL28 |
ribosomal protein L28 |
| chr3_-_114343768 | 0.37 |
ENST00000393785.2 |
ZBTB20 |
zinc finger and BTB domain containing 20 |
| chr9_-_89562104 | 0.37 |
ENST00000298743.7 |
GAS1 |
growth arrest-specific 1 |
| chr1_-_24151892 | 0.36 |
ENST00000235958.4 |
HMGCL |
3-hydroxymethyl-3-methylglutaryl-CoA lyase |
| chr17_-_33288522 | 0.36 |
ENST00000314144.5 |
CCT6B |
chaperonin containing TCP1, subunit 6B (zeta 2) |
| chr16_-_67969888 | 0.36 |
ENST00000574576.2 |
PSMB10 |
proteasome (prosome, macropain) subunit, beta type, 10 |
| chr4_+_109541772 | 0.36 |
ENST00000506397.1 ENST00000394668.2 |
RPL34 |
ribosomal protein L34 |
| chr21_-_39288743 | 0.36 |
ENST00000609713.1 |
KCNJ6 |
potassium inwardly-rectifying channel, subfamily J, member 6 |
| chr2_-_175712270 | 0.36 |
ENST00000295497.7 ENST00000444394.1 |
CHN1 |
chimerin 1 |
| chr14_-_50999190 | 0.36 |
ENST00000557390.1 |
MAP4K5 |
mitogen-activated protein kinase kinase kinase kinase 5 |
| chr1_+_145507587 | 0.36 |
ENST00000330165.8 ENST00000369307.3 |
RBM8A |
RNA binding motif protein 8A |
| chr2_+_128175997 | 0.36 |
ENST00000234071.3 ENST00000429925.1 ENST00000442644.1 ENST00000453608.2 |
PROC |
protein C (inactivator of coagulation factors Va and VIIIa) |
| chr17_+_2207238 | 0.36 |
ENST00000575840.1 ENST00000576620.1 ENST00000576848.1 ENST00000574987.1 |
SRR |
serine racemase |
| chr17_+_80332153 | 0.36 |
ENST00000313135.2 |
UTS2R |
urotensin 2 receptor |
| chr2_-_219433014 | 0.35 |
ENST00000418019.1 ENST00000454775.1 ENST00000338465.5 ENST00000415516.1 ENST00000258399.3 |
USP37 |
ubiquitin specific peptidase 37 |
| chr3_+_38537960 | 0.35 |
ENST00000453767.1 |
EXOG |
endo/exonuclease (5'-3'), endonuclease G-like |
| chr6_+_72596604 | 0.35 |
ENST00000348717.5 ENST00000517960.1 ENST00000518273.1 ENST00000522291.1 ENST00000521978.1 ENST00000520567.1 ENST00000264839.7 |
RIMS1 |
regulating synaptic membrane exocytosis 1 |
| chr1_+_43232913 | 0.35 |
ENST00000372525.5 ENST00000536543.1 |
C1orf50 |
chromosome 1 open reading frame 50 |
| chr20_-_30310336 | 0.35 |
ENST00000434194.1 ENST00000376062.2 |
BCL2L1 |
BCL2-like 1 |
| chr20_-_45985414 | 0.35 |
ENST00000461685.1 ENST00000372023.3 ENST00000540497.1 ENST00000435836.1 ENST00000471951.2 ENST00000352431.2 ENST00000396281.4 ENST00000355972.4 ENST00000360911.3 |
ZMYND8 |
zinc finger, MYND-type containing 8 |
| chr4_+_109541740 | 0.35 |
ENST00000394665.1 |
RPL34 |
ribosomal protein L34 |
| chr20_+_46130619 | 0.35 |
ENST00000372004.3 |
NCOA3 |
nuclear receptor coactivator 3 |
| chr2_+_48667983 | 0.34 |
ENST00000449090.2 |
PPP1R21 |
protein phosphatase 1, regulatory subunit 21 |
| chr6_-_85474219 | 0.34 |
ENST00000369663.5 |
TBX18 |
T-box 18 |
| chr14_-_92588013 | 0.34 |
ENST00000553514.1 ENST00000605997.1 |
NDUFB1 |
NADH dehydrogenase (ubiquinone) 1 beta subcomplex, 1, 7kDa |
| chr20_-_45985464 | 0.34 |
ENST00000458360.2 ENST00000262975.4 |
ZMYND8 |
zinc finger, MYND-type containing 8 |
| chr2_+_68872954 | 0.34 |
ENST00000394342.2 |
PROKR1 |
prokineticin receptor 1 |
| chrX_+_135579238 | 0.34 |
ENST00000535601.1 ENST00000448450.1 ENST00000425695.1 |
HTATSF1 |
HIV-1 Tat specific factor 1 |
| chr6_+_108882069 | 0.34 |
ENST00000406360.1 |
FOXO3 |
forkhead box O3 |
| chr20_-_45985172 | 0.34 |
ENST00000536340.1 |
ZMYND8 |
zinc finger, MYND-type containing 8 |
| chrX_+_102840408 | 0.34 |
ENST00000468024.1 ENST00000472484.1 ENST00000415568.2 ENST00000490644.1 ENST00000459722.1 ENST00000472745.1 ENST00000494801.1 ENST00000434216.2 ENST00000425011.1 |
TCEAL4 |
transcription elongation factor A (SII)-like 4 |
| chr2_-_175462934 | 0.34 |
ENST00000392546.2 ENST00000436221.1 |
WIPF1 |
WAS/WASL interacting protein family, member 1 |
| chr2_+_204192942 | 0.34 |
ENST00000295851.5 ENST00000261017.5 |
ABI2 |
abl-interactor 2 |
| chr3_-_67705006 | 0.33 |
ENST00000492795.1 ENST00000493112.1 ENST00000307227.5 |
SUCLG2 |
succinate-CoA ligase, GDP-forming, beta subunit |
| chr1_+_244998918 | 0.33 |
ENST00000366528.3 |
COX20 |
COX20 cytochrome C oxidase assembly factor |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 2.4 | GO:2000314 | regulation of neural crest formation(GO:0090299) negative regulation of neural crest formation(GO:0090301) negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
| 0.5 | 1.6 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.4 | 1.3 | GO:0090341 | negative regulation of secretion of lysosomal enzymes(GO:0090341) |
| 0.4 | 1.2 | GO:1900158 | negative regulation of osteoclast proliferation(GO:0090291) negative regulation of bone mineralization involved in bone maturation(GO:1900158) |
| 0.4 | 3.0 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
| 0.3 | 2.2 | GO:0089700 | protein kinase D signaling(GO:0089700) |
| 0.3 | 0.9 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.3 | 2.8 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
| 0.3 | 0.8 | GO:1902824 | positive regulation of late endosome to lysosome transport(GO:1902824) |
| 0.3 | 3.9 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
| 0.2 | 1.0 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.2 | 0.9 | GO:0006208 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
| 0.2 | 0.6 | GO:0035494 | SNARE complex disassembly(GO:0035494) |
| 0.2 | 0.6 | GO:0001544 | initiation of primordial ovarian follicle growth(GO:0001544) |
| 0.2 | 2.1 | GO:0034465 | response to carbon monoxide(GO:0034465) |
| 0.2 | 1.0 | GO:1903758 | regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903756) negative regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903758) |
| 0.2 | 0.5 | GO:0030505 | inorganic diphosphate transport(GO:0030505) |
| 0.2 | 0.9 | GO:0097498 | endothelial tube lumen extension(GO:0097498) |
| 0.2 | 0.8 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
| 0.1 | 0.6 | GO:0061743 | motor learning(GO:0061743) |
| 0.1 | 0.4 | GO:0006427 | histidyl-tRNA aminoacylation(GO:0006427) |
| 0.1 | 1.4 | GO:0035583 | sequestering of TGFbeta in extracellular matrix(GO:0035583) |
| 0.1 | 0.4 | GO:0002904 | B cell negative selection(GO:0002352) positive regulation of B cell apoptotic process(GO:0002904) post-embryonic camera-type eye morphogenesis(GO:0048597) apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
| 0.1 | 0.1 | GO:0046543 | development of secondary sexual characteristics(GO:0045136) development of secondary female sexual characteristics(GO:0046543) |
| 0.1 | 0.5 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
| 0.1 | 0.4 | GO:1904530 | negative regulation of actin filament binding(GO:1904530) negative regulation of actin binding(GO:1904617) |
| 0.1 | 0.4 | GO:0009996 | negative regulation of cell fate specification(GO:0009996) negative regulation of gastrulation(GO:2000542) |
| 0.1 | 0.4 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
| 0.1 | 1.4 | GO:0046886 | positive regulation of hormone biosynthetic process(GO:0046886) |
| 0.1 | 0.4 | GO:0044537 | regulation of circulating fibrinogen levels(GO:0044537) |
| 0.1 | 0.4 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
| 0.1 | 0.1 | GO:0070585 | protein localization to mitochondrion(GO:0070585) |
| 0.1 | 0.8 | GO:0023021 | termination of signal transduction(GO:0023021) |
| 0.1 | 0.3 | GO:1900276 | regulation of proteinase activated receptor activity(GO:1900276) negative regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900737) |
| 0.1 | 0.3 | GO:0060823 | canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060823) |
| 0.1 | 0.8 | GO:0035624 | receptor transactivation(GO:0035624) |
| 0.1 | 0.3 | GO:1902309 | regulation of heart rate by hormone(GO:0003064) negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.1 | 0.3 | GO:0036058 | filtration diaphragm assembly(GO:0036058) slit diaphragm assembly(GO:0036060) |
| 0.1 | 0.4 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
| 0.1 | 0.5 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
| 0.1 | 0.3 | GO:0071418 | cellular response to amine stimulus(GO:0071418) |
| 0.1 | 0.6 | GO:0051344 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
| 0.1 | 0.9 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.1 | 0.9 | GO:0006552 | leucine catabolic process(GO:0006552) |
| 0.1 | 1.2 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.1 | 0.2 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.1 | 0.3 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
| 0.1 | 0.4 | GO:0005986 | sucrose biosynthetic process(GO:0005986) |
| 0.1 | 0.2 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.1 | 0.7 | GO:0097577 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.1 | 0.3 | GO:0051685 | maintenance of ER location(GO:0051685) |
| 0.1 | 0.6 | GO:0043932 | ossification involved in bone remodeling(GO:0043932) |
| 0.1 | 1.5 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
| 0.1 | 0.1 | GO:0016340 | calcium-dependent cell-matrix adhesion(GO:0016340) |
| 0.1 | 0.9 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.1 | 0.4 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.1 | 0.7 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
| 0.1 | 1.5 | GO:0061162 | establishment of monopolar cell polarity(GO:0061162) establishment or maintenance of monopolar cell polarity(GO:0061339) |
| 0.1 | 0.1 | GO:0048239 | negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
| 0.1 | 0.2 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) Golgi to plasma membrane CFTR protein transport(GO:0043000) |
| 0.1 | 0.5 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
| 0.1 | 0.2 | GO:0018008 | N-terminal peptidyl-glycine N-myristoylation(GO:0018008) |
| 0.1 | 0.3 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.1 | 0.2 | GO:1904170 | NAD transport(GO:0043132) regulation of bleb assembly(GO:1904170) positive regulation of bleb assembly(GO:1904172) |
| 0.1 | 0.3 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
| 0.1 | 0.7 | GO:0031087 | deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.1 | 0.1 | GO:0097325 | melanocyte proliferation(GO:0097325) |
| 0.1 | 0.3 | GO:1901662 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.1 | 0.3 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.1 | 0.1 | GO:0051771 | negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
| 0.1 | 0.1 | GO:0031990 | mRNA export from nucleus in response to heat stress(GO:0031990) |
| 0.1 | 0.2 | GO:0036371 | protein localization to T-tubule(GO:0036371) |
| 0.1 | 0.4 | GO:0034551 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.1 | 0.5 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.1 | 0.4 | GO:1901906 | diadenosine polyphosphate catabolic process(GO:0015961) diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
| 0.1 | 0.2 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
| 0.1 | 0.2 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.1 | 1.0 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
| 0.1 | 0.4 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.1 | 0.8 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
| 0.1 | 0.6 | GO:0070269 | pyroptosis(GO:0070269) |
| 0.1 | 0.2 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.1 | 0.2 | GO:0061358 | negative regulation of Wnt protein secretion(GO:0061358) |
| 0.1 | 0.4 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.1 | 0.4 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.1 | 1.1 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
| 0.1 | 0.7 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 0.1 | 0.6 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.1 | 1.8 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.1 | 0.5 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
| 0.1 | 1.2 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
| 0.1 | 0.3 | GO:1902748 | positive regulation of lens fiber cell differentiation(GO:1902748) |
| 0.1 | 0.2 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.1 | 1.2 | GO:0097034 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.1 | 0.5 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 0.1 | 3.9 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.1 | 0.2 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.1 | 0.3 | GO:0021564 | vagus nerve development(GO:0021564) |
| 0.1 | 0.2 | GO:0010165 | response to X-ray(GO:0010165) |
| 0.1 | 0.2 | GO:1902951 | negative regulation of dendritic spine maintenance(GO:1902951) |
| 0.1 | 0.4 | GO:1903593 | regulation of histamine secretion by mast cell(GO:1903593) |
| 0.1 | 0.2 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
| 0.1 | 0.2 | GO:0042427 | serotonin biosynthetic process(GO:0042427) |
| 0.0 | 0.3 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
| 0.0 | 0.1 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
| 0.0 | 0.8 | GO:0045793 | positive regulation of cell size(GO:0045793) |
| 0.0 | 0.1 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 0.0 | 1.4 | GO:0033622 | integrin activation(GO:0033622) |
| 0.0 | 0.2 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.0 | 0.1 | GO:0009447 | putrescine catabolic process(GO:0009447) |
| 0.0 | 0.2 | GO:0044240 | multicellular organism lipid catabolic process(GO:0044240) |
| 0.0 | 0.5 | GO:0045046 | protein import into peroxisome membrane(GO:0045046) |
| 0.0 | 0.5 | GO:0014877 | response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 0.0 | 0.2 | GO:1902255 | positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
| 0.0 | 0.4 | GO:0070885 | negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
| 0.0 | 1.4 | GO:0008045 | motor neuron axon guidance(GO:0008045) |
| 0.0 | 0.2 | GO:0006119 | oxidative phosphorylation(GO:0006119) |
| 0.0 | 0.5 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.0 | 0.4 | GO:1904781 | positive regulation of protein localization to centrosome(GO:1904781) |
| 0.0 | 0.4 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.0 | 0.0 | GO:1903935 | response to sodium arsenite(GO:1903935) cellular response to sodium arsenite(GO:1903936) |
| 0.0 | 0.4 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
| 0.0 | 0.1 | GO:0052330 | induction of programmed cell death(GO:0012502) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) |
| 0.0 | 0.3 | GO:0006311 | meiotic gene conversion(GO:0006311) |
| 0.0 | 0.7 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.0 | 0.6 | GO:0014041 | regulation of neuron maturation(GO:0014041) |
| 0.0 | 0.5 | GO:0007093 | mitotic cell cycle checkpoint(GO:0007093) |
| 0.0 | 1.5 | GO:0010971 | positive regulation of G2/M transition of mitotic cell cycle(GO:0010971) |
| 0.0 | 0.5 | GO:0071550 | death-inducing signaling complex assembly(GO:0071550) |
| 0.0 | 0.4 | GO:0010994 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
| 0.0 | 0.2 | GO:0008078 | mesoderm migration involved in gastrulation(GO:0007509) mesodermal cell migration(GO:0008078) |
| 0.0 | 0.4 | GO:0034382 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 0.0 | 0.7 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
| 0.0 | 0.2 | GO:0006540 | glutamate decarboxylation to succinate(GO:0006540) |
| 0.0 | 0.2 | GO:0009236 | cobalamin biosynthetic process(GO:0009236) |
| 0.0 | 0.2 | GO:0043461 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 0.0 | 0.6 | GO:0019388 | galactose catabolic process(GO:0019388) |
| 0.0 | 0.1 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
| 0.0 | 0.1 | GO:0043449 | olfactory learning(GO:0008355) cellular alkene metabolic process(GO:0043449) |
| 0.0 | 0.8 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.0 | 0.7 | GO:0007021 | tubulin complex assembly(GO:0007021) |
| 0.0 | 0.4 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
| 0.0 | 0.1 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.0 | 0.5 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
| 0.0 | 0.8 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
| 0.0 | 0.3 | GO:0043161 | proteasome-mediated ubiquitin-dependent protein catabolic process(GO:0043161) |
| 0.0 | 0.3 | GO:0006105 | succinate metabolic process(GO:0006105) |
| 0.0 | 0.1 | GO:1904253 | positive regulation of bile acid biosynthetic process(GO:0070859) positive regulation of bile acid metabolic process(GO:1904253) |
| 0.0 | 0.2 | GO:0099590 | neurotransmitter receptor internalization(GO:0099590) |
| 0.0 | 0.3 | GO:0044211 | CTP salvage(GO:0044211) |
| 0.0 | 0.2 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.0 | 0.1 | GO:0006850 | mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
| 0.0 | 0.1 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
| 0.0 | 0.1 | GO:0003162 | atrioventricular node development(GO:0003162) |
| 0.0 | 0.1 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.0 | 0.2 | GO:0046504 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) ether biosynthetic process(GO:1901503) |
| 0.0 | 0.2 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
| 0.0 | 0.5 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.0 | 0.1 | GO:0033385 | geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
| 0.0 | 0.2 | GO:0021521 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 0.0 | 0.6 | GO:0030043 | actin filament fragmentation(GO:0030043) |
| 0.0 | 0.3 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.0 | 0.2 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.0 | 0.3 | GO:0033500 | carbohydrate homeostasis(GO:0033500) glucose homeostasis(GO:0042593) |
| 0.0 | 0.4 | GO:1902659 | regulation of glucose mediated signaling pathway(GO:1902659) |
| 0.0 | 0.1 | GO:0044376 | RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
| 0.0 | 0.1 | GO:0046909 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.0 | 0.6 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) modulation of inhibitory postsynaptic potential(GO:0098828) |
| 0.0 | 0.1 | GO:0018312 | peptidyl-serine ADP-ribosylation(GO:0018312) |
| 0.0 | 0.1 | GO:0048241 | epinephrine transport(GO:0048241) |
| 0.0 | 0.4 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.0 | 0.1 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
| 0.0 | 0.1 | GO:0002762 | negative regulation of myeloid leukocyte differentiation(GO:0002762) negative regulation of osteoclast differentiation(GO:0045671) |
| 0.0 | 0.2 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
| 0.0 | 0.5 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 | 0.3 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.0 | 0.3 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
| 0.0 | 0.2 | GO:0010265 | SCF complex assembly(GO:0010265) |
| 0.0 | 0.0 | GO:2000177 | regulation of neural precursor cell proliferation(GO:2000177) |
| 0.0 | 0.2 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.0 | 0.2 | GO:0060296 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
| 0.0 | 0.2 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.0 | 0.1 | GO:0016240 | autophagosome docking(GO:0016240) |
| 0.0 | 0.5 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
| 0.0 | 0.2 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.0 | 0.1 | GO:0035927 | RNA import into mitochondrion(GO:0035927) rRNA import into mitochondrion(GO:0035928) |
| 0.0 | 0.0 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
| 0.0 | 0.1 | GO:0007062 | sister chromatid cohesion(GO:0007062) |
| 0.0 | 0.2 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.0 | 0.5 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
| 0.0 | 0.1 | GO:0015670 | carbon dioxide transport(GO:0015670) |
| 0.0 | 0.1 | GO:0080154 | regulation of fertilization(GO:0080154) activation of meiosis(GO:0090427) |
| 0.0 | 1.1 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.0 | 0.7 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.0 | 0.1 | GO:0001832 | blastocyst growth(GO:0001832) |
| 0.0 | 0.5 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.0 | 0.1 | GO:1900039 | positive regulation of cellular response to hypoxia(GO:1900039) |
| 0.0 | 0.1 | GO:0061419 | positive regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061419) |
| 0.0 | 0.1 | GO:0006338 | chromatin remodeling(GO:0006338) |
| 0.0 | 0.1 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
| 0.0 | 1.0 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
| 0.0 | 0.2 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.0 | 0.1 | GO:0038030 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.0 | 0.2 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.0 | 0.2 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
| 0.0 | 0.1 | GO:1902954 | regulation of early endosome to recycling endosome transport(GO:1902954) |
| 0.0 | 0.0 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
| 0.0 | 0.2 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
| 0.0 | 0.5 | GO:0006978 | DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) |
| 0.0 | 0.3 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
| 0.0 | 0.1 | GO:0006447 | regulation of translational initiation by iron(GO:0006447) |
| 0.0 | 0.4 | GO:0032508 | DNA duplex unwinding(GO:0032508) |
| 0.0 | 0.1 | GO:0070370 | heat acclimation(GO:0010286) cellular heat acclimation(GO:0070370) |
| 0.0 | 0.2 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.0 | 0.1 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
| 0.0 | 0.0 | GO:0033138 | positive regulation of peptidyl-serine phosphorylation(GO:0033138) |
| 0.0 | 0.0 | GO:0046668 | regulation of retinal cell programmed cell death(GO:0046668) |
| 0.0 | 0.1 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 0.0 | 0.2 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
| 0.0 | 0.1 | GO:0046203 | spermidine catabolic process(GO:0046203) |
| 0.0 | 0.8 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
| 0.0 | 0.4 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.0 | 0.3 | GO:0018342 | protein prenylation(GO:0018342) prenylation(GO:0097354) |
| 0.0 | 0.2 | GO:0035799 | ureter maturation(GO:0035799) |
| 0.0 | 0.1 | GO:0048496 | desmosome assembly(GO:0002159) adherens junction maintenance(GO:0034334) maintenance of organ identity(GO:0048496) |
| 0.0 | 0.1 | GO:0048168 | regulation of neuronal synaptic plasticity(GO:0048168) |
| 0.0 | 0.2 | GO:0070862 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.0 | 0.6 | GO:2000300 | regulation of synaptic vesicle exocytosis(GO:2000300) |
| 0.0 | 0.2 | GO:0032418 | lysosome localization(GO:0032418) |
| 0.0 | 0.1 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.0 | 0.1 | GO:0045963 | cellular response to phosphate starvation(GO:0016036) positive regulation of sulfur amino acid metabolic process(GO:0031337) negative regulation of catecholamine metabolic process(GO:0045914) negative regulation of dopamine metabolic process(GO:0045963) positive regulation of homocysteine metabolic process(GO:0050668) |
| 0.0 | 0.1 | GO:2000397 | regulation of ubiquitin-dependent endocytosis(GO:2000395) positive regulation of ubiquitin-dependent endocytosis(GO:2000397) |
| 0.0 | 0.1 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.0 | 0.3 | GO:0050932 | regulation of pigment cell differentiation(GO:0050932) |
| 0.0 | 0.1 | GO:0006679 | glucosylceramide biosynthetic process(GO:0006679) |
| 0.0 | 0.2 | GO:0086024 | adrenergic receptor signaling pathway involved in positive regulation of heart rate(GO:0086024) |
| 0.0 | 0.2 | GO:1990564 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.0 | 0.3 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.0 | 0.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.0 | 0.6 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.0 | 0.3 | GO:0023019 | signal transduction involved in regulation of gene expression(GO:0023019) |
| 0.0 | 0.1 | GO:0016476 | regulation of embryonic cell shape(GO:0016476) |
| 0.0 | 2.8 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.0 | 0.1 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.0 | 0.1 | GO:1901798 | positive regulation of signal transduction by p53 class mediator(GO:1901798) |
| 0.0 | 0.1 | GO:0038193 | thromboxane A2 signaling pathway(GO:0038193) |
| 0.0 | 0.1 | GO:0035303 | regulation of dephosphorylation(GO:0035303) |
| 0.0 | 0.1 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.0 | 0.1 | GO:0035281 | pre-miRNA export from nucleus(GO:0035281) |
| 0.0 | 0.3 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.0 | 0.0 | GO:0051029 | rRNA transport(GO:0051029) |
| 0.0 | 0.4 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.0 | 0.4 | GO:0032012 | regulation of ARF protein signal transduction(GO:0032012) |
| 0.0 | 0.0 | GO:0090149 | mitochondrial membrane fission(GO:0090149) |
| 0.0 | 0.1 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.0 | 0.1 | GO:0070221 | sulfide oxidation(GO:0019418) sulfide oxidation, using sulfide:quinone oxidoreductase(GO:0070221) |
| 0.0 | 0.0 | GO:0060017 | parathyroid gland development(GO:0060017) |
| 0.0 | 0.2 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.0 | 0.1 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.0 | 0.1 | GO:0015811 | L-cystine transport(GO:0015811) |
| 0.0 | 0.0 | GO:0010621 | negative regulation of transcription by transcription factor localization(GO:0010621) |
| 0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.1 | GO:0097369 | sodium ion import(GO:0097369) |
| 0.0 | 0.1 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.0 | 0.3 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.0 | 0.2 | GO:1902037 | negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
| 0.0 | 0.1 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.0 | 0.1 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
| 0.0 | 0.1 | GO:0034770 | histone H4-K20 methylation(GO:0034770) |
| 0.0 | 0.2 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
| 0.0 | 0.1 | GO:0036089 | cleavage furrow formation(GO:0036089) |
| 0.0 | 0.8 | GO:0045599 | negative regulation of fat cell differentiation(GO:0045599) |
| 0.0 | 0.1 | GO:1904885 | beta-catenin destruction complex assembly(GO:1904885) |
| 0.0 | 0.1 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
| 0.0 | 0.2 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
| 0.0 | 0.1 | GO:0035900 | response to isolation stress(GO:0035900) |
| 0.0 | 0.2 | GO:0051256 | mitotic spindle midzone assembly(GO:0051256) |
| 0.0 | 0.2 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
| 0.0 | 0.0 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
| 0.0 | 0.6 | GO:0097178 | ruffle assembly(GO:0097178) |
| 0.0 | 0.1 | GO:0016260 | selenocysteine biosynthetic process(GO:0016260) |
| 0.0 | 0.1 | GO:0035105 | sterol regulatory element binding protein import into nucleus(GO:0035105) |
| 0.0 | 0.1 | GO:0000960 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.0 | 0.2 | GO:0034063 | stress granule assembly(GO:0034063) |
| 0.0 | 0.1 | GO:1902525 | regulation of protein monoubiquitination(GO:1902525) |
| 0.0 | 0.1 | GO:0042418 | epinephrine metabolic process(GO:0042414) epinephrine biosynthetic process(GO:0042418) |
| 0.0 | 0.1 | GO:0090402 | oncogene-induced cell senescence(GO:0090402) |
| 0.0 | 0.2 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.0 | 0.3 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.0 | 0.1 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
| 0.0 | 0.4 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.0 | 0.1 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.0 | 0.1 | GO:0036414 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
| 0.0 | 0.0 | GO:0052422 | modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.0 | 0.2 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
| 0.0 | 0.3 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
| 0.0 | 0.3 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.0 | 1.1 | GO:0045600 | positive regulation of fat cell differentiation(GO:0045600) |
| 0.0 | 0.3 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.0 | 0.1 | GO:0051594 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
| 0.0 | 0.2 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 0.0 | 1.6 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
| 0.0 | 0.4 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.0 | 0.1 | GO:0090063 | positive regulation of microtubule nucleation(GO:0090063) |
| 0.0 | 0.2 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
| 0.0 | 0.1 | GO:0072513 | semicircular canal morphogenesis(GO:0048752) semicircular canal development(GO:0060872) positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.0 | 0.1 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
| 0.0 | 1.2 | GO:0033275 | muscle filament sliding(GO:0030049) actin-myosin filament sliding(GO:0033275) |
| 0.0 | 0.1 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
| 0.0 | 0.1 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.0 | 0.4 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.0 | 0.3 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.0 | 0.0 | GO:0032472 | Golgi calcium ion transport(GO:0032472) |
| 0.0 | 0.1 | GO:0039692 | single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) |
| 0.0 | 0.1 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.0 | 0.1 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
| 0.0 | 0.1 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.0 | 0.0 | GO:0006669 | sphinganine-1-phosphate biosynthetic process(GO:0006669) |
| 0.0 | 0.1 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
| 0.0 | 0.1 | GO:0003025 | regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
| 0.0 | 0.2 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
| 0.0 | 0.1 | GO:0097010 | eukaryotic translation initiation factor 4F complex assembly(GO:0097010) |
| 0.0 | 0.3 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 | 0.2 | GO:0006782 | protoporphyrinogen IX biosynthetic process(GO:0006782) |
| 0.0 | 0.2 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
| 0.0 | 0.0 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.0 | 0.2 | GO:0018214 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.0 | 0.5 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
| 0.0 | 0.1 | GO:0045089 | positive regulation of innate immune response(GO:0045089) |
| 0.0 | 0.2 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
| 0.0 | 0.4 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
| 0.0 | 1.4 | GO:0008625 | extrinsic apoptotic signaling pathway via death domain receptors(GO:0008625) |
| 0.0 | 0.1 | GO:0006206 | pyrimidine nucleobase metabolic process(GO:0006206) |
| 0.0 | 0.1 | GO:0010666 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.0 | 0.3 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.0 | 0.1 | GO:0043486 | histone exchange(GO:0043486) |
| 0.0 | 0.1 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.0 | 0.3 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
| 0.0 | 0.1 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.0 | 0.9 | GO:0008542 | visual learning(GO:0008542) |
| 0.0 | 0.4 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.0 | 0.1 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.0 | 0.0 | GO:0031929 | TOR signaling(GO:0031929) regulation of TOR signaling(GO:0032006) |
| 0.0 | 0.2 | GO:0006662 | glycerol ether metabolic process(GO:0006662) |
| 0.0 | 0.4 | GO:0035924 | cellular response to vascular endothelial growth factor stimulus(GO:0035924) |
| 0.0 | 0.1 | GO:0043323 | regulation of natural killer cell degranulation(GO:0043321) positive regulation of natural killer cell degranulation(GO:0043323) |
| 0.0 | 0.1 | GO:0006094 | gluconeogenesis(GO:0006094) |
| 0.0 | 0.2 | GO:0006554 | lysine catabolic process(GO:0006554) |
| 0.0 | 0.2 | GO:0042753 | positive regulation of circadian rhythm(GO:0042753) |
| 0.0 | 0.1 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.0 | 0.2 | GO:0032802 | low-density lipoprotein particle receptor catabolic process(GO:0032802) |
| 0.0 | 0.1 | GO:0034201 | response to oleic acid(GO:0034201) |
| 0.0 | 0.2 | GO:1901620 | regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901620) |
| 0.0 | 0.0 | GO:0019249 | lactate biosynthetic process(GO:0019249) |
| 0.0 | 0.1 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 0.0 | 0.0 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.0 | 0.1 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.0 | 0.4 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
| 0.0 | 0.2 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.0 | 0.0 | GO:0009396 | folic acid-containing compound biosynthetic process(GO:0009396) |
| 0.0 | 0.3 | GO:0006221 | pyrimidine nucleotide biosynthetic process(GO:0006221) |
| 0.0 | 0.1 | GO:0007519 | skeletal muscle tissue development(GO:0007519) |
| 0.0 | 0.8 | GO:0006635 | fatty acid beta-oxidation(GO:0006635) |
| 0.0 | 0.4 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.0 | 0.1 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
| 0.0 | 0.1 | GO:0048839 | inner ear development(GO:0048839) |
| 0.0 | 0.1 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 0.0 | 0.2 | GO:1901748 | leukotriene D4 metabolic process(GO:1901748) leukotriene D4 biosynthetic process(GO:1901750) |
| 0.0 | 0.1 | GO:0048070 | regulation of developmental pigmentation(GO:0048070) |
| 0.0 | 0.1 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.0 | 0.0 | GO:1901526 | positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
| 0.0 | 0.1 | GO:0042048 | olfactory behavior(GO:0042048) |
| 0.0 | 0.0 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
| 0.0 | 0.2 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
| 0.0 | 0.1 | GO:0008343 | adult feeding behavior(GO:0008343) |
| 0.0 | 0.0 | GO:0061570 | dADP phosphorylation(GO:0006174) dGDP phosphorylation(GO:0006186) AMP phosphorylation(GO:0006756) CDP phosphorylation(GO:0061508) dAMP phosphorylation(GO:0061565) CMP phosphorylation(GO:0061566) dCMP phosphorylation(GO:0061567) GDP phosphorylation(GO:0061568) UDP phosphorylation(GO:0061569) dCDP phosphorylation(GO:0061570) TDP phosphorylation(GO:0061571) |
| 0.0 | 0.6 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 | 0.2 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.0 | 0.1 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.0 | 0.1 | GO:0036498 | IRE1-mediated unfolded protein response(GO:0036498) |
| 0.0 | 0.3 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.0 | 0.2 | GO:0048747 | muscle fiber development(GO:0048747) |
| 0.0 | 0.0 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) regulation of centromere complex assembly(GO:0090230) |
| 0.0 | 0.1 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.0 | 0.0 | GO:0061056 | sclerotome development(GO:0061056) |
| 0.0 | 0.0 | GO:0035965 | cardiolipin acyl-chain remodeling(GO:0035965) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 1.6 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.3 | 1.9 | GO:0002177 | manchette(GO:0002177) |
| 0.3 | 3.9 | GO:0005589 | collagen type VI trimer(GO:0005589) collagen beaded filament(GO:0098647) |
| 0.2 | 0.9 | GO:0097442 | CA3 pyramidal cell dendrite(GO:0097442) |
| 0.2 | 3.9 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 0.2 | 0.7 | GO:0070288 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
| 0.2 | 1.3 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 0.1 | 0.6 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
| 0.1 | 0.5 | GO:0044301 | climbing fiber(GO:0044301) |
| 0.1 | 0.5 | GO:0031213 | RSF complex(GO:0031213) |
| 0.1 | 0.3 | GO:0072517 | viral factory(GO:0039713) cytoplasmic viral factory(GO:0039714) host cell viral assembly compartment(GO:0072517) |
| 0.1 | 0.3 | GO:0043224 | nuclear SCF ubiquitin ligase complex(GO:0043224) |
| 0.1 | 0.4 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.1 | 0.7 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.1 | 0.4 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.1 | 0.3 | GO:0097196 | Shu complex(GO:0097196) |
| 0.1 | 0.1 | GO:0031372 | UBC13-MMS2 complex(GO:0031372) |
| 0.1 | 1.4 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
| 0.1 | 0.3 | GO:0032044 | DSIF complex(GO:0032044) |
| 0.1 | 0.9 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.1 | 0.7 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.1 | 0.1 | GO:0005953 | CAAX-protein geranylgeranyltransferase complex(GO:0005953) |
| 0.1 | 1.0 | GO:0019774 | proteasome core complex, beta-subunit complex(GO:0019774) |
| 0.1 | 0.9 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.1 | 0.3 | GO:0000333 | telomerase catalytic core complex(GO:0000333) |
| 0.1 | 0.5 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.1 | 0.4 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.1 | 0.2 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.1 | 0.8 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.1 | 0.3 | GO:0035370 | UBC13-UEV1A complex(GO:0035370) |
| 0.1 | 0.5 | GO:0005638 | lamin filament(GO:0005638) |
| 0.1 | 1.4 | GO:0043205 | microfibril(GO:0001527) fibril(GO:0043205) |
| 0.1 | 0.3 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.1 | 0.7 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.1 | 0.4 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.1 | 2.3 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.0 | 3.6 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.0 | 0.2 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.0 | 0.8 | GO:0097227 | sperm annulus(GO:0097227) |
| 0.0 | 0.4 | GO:0030905 | retromer, tubulation complex(GO:0030905) |
| 0.0 | 0.1 | GO:0071203 | WASH complex(GO:0071203) |
| 0.0 | 0.4 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.0 | 1.0 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.0 | 0.3 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.0 | 0.1 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.0 | 0.2 | GO:0045160 | myosin I complex(GO:0045160) |
| 0.0 | 0.4 | GO:0034464 | BBSome(GO:0034464) |
| 0.0 | 0.4 | GO:0051286 | cell tip(GO:0051286) |
| 0.0 | 0.5 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.0 | 0.4 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
| 0.0 | 0.2 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.0 | 0.0 | GO:0042721 | mitochondrial inner membrane protein insertion complex(GO:0042721) |
| 0.0 | 0.2 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
| 0.0 | 0.1 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
| 0.0 | 0.2 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.0 | 0.3 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.0 | 0.5 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.0 | 0.1 | GO:0045281 | mitochondrial respiratory chain complex II, succinate dehydrogenase complex (ubiquinone)(GO:0005749) succinate dehydrogenase complex (ubiquinone)(GO:0045257) respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) fumarate reductase complex(GO:0045283) |
| 0.0 | 0.9 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.0 | 0.6 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.0 | 0.4 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.0 | 1.5 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.0 | 0.2 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.0 | 0.4 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.0 | 0.4 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.0 | 0.8 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.0 | 0.2 | GO:0001740 | Barr body(GO:0001740) |
| 0.0 | 0.5 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.0 | 0.2 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.0 | 1.1 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.0 | 0.7 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 0.2 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.0 | 0.7 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.0 | 0.1 | GO:0001741 | XY body(GO:0001741) |
| 0.0 | 0.2 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.0 | 0.1 | GO:0032302 | MutSbeta complex(GO:0032302) |
| 0.0 | 0.4 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
| 0.0 | 0.5 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.0 | 0.4 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.0 | 0.6 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.0 | 1.8 | GO:0043198 | dendritic shaft(GO:0043198) |
| 0.0 | 0.4 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.0 | 0.6 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.0 | 0.4 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.0 | 0.1 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.0 | 0.1 | GO:0030678 | mitochondrial ribonuclease P complex(GO:0030678) |
| 0.0 | 0.2 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.0 | 0.3 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.0 | 0.4 | GO:0097346 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) INO80-type complex(GO:0097346) |
| 0.0 | 0.5 | GO:0036020 | endolysosome membrane(GO:0036020) |
| 0.0 | 0.1 | GO:0089701 | U2AF(GO:0089701) |
| 0.0 | 0.3 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.0 | 0.2 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) |
| 0.0 | 0.1 | GO:0031905 | early endosome lumen(GO:0031905) |
| 0.0 | 0.1 | GO:0042565 | RNA nuclear export complex(GO:0042565) |
| 0.0 | 0.2 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.0 | 0.2 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.0 | 0.2 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.0 | 0.2 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.0 | 0.2 | GO:0098559 | cytoplasmic side of early endosome membrane(GO:0098559) |
| 0.0 | 0.1 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.0 | 2.3 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.0 | 0.1 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.0 | 0.3 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.0 | 0.1 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.0 | 0.2 | GO:0060091 | kinocilium(GO:0060091) |
| 0.0 | 0.2 | GO:0016342 | catenin complex(GO:0016342) |
| 0.0 | 0.2 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.0 | 0.1 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.0 | 0.8 | GO:0000786 | nucleosome(GO:0000786) |
| 0.0 | 0.1 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.0 | 0.1 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.0 | 1.1 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.0 | 0.1 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.0 | 2.0 | GO:0005901 | caveola(GO:0005901) |
| 0.0 | 0.1 | GO:0005854 | nascent polypeptide-associated complex(GO:0005854) |
| 0.0 | 0.2 | GO:0033010 | paranodal junction(GO:0033010) |
| 0.0 | 3.3 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
| 0.0 | 0.1 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.0 | 1.9 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
| 0.0 | 0.0 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.0 | 0.2 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.0 | 0.2 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.0 | 0.0 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.0 | 0.0 | GO:0070939 | Dsl1p complex(GO:0070939) |
| 0.0 | 0.4 | GO:1902562 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
| 0.0 | 0.5 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.0 | 0.1 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.0 | 0.8 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 0.1 | GO:1903440 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
| 0.0 | 2.7 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
| 0.0 | 0.1 | GO:1905202 | 3-methylcrotonyl-CoA carboxylase complex, mitochondrial(GO:0002169) methylcrotonoyl-CoA carboxylase complex(GO:1905202) |
| 0.0 | 0.0 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
| 0.0 | 0.1 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.0 | 0.1 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
| 0.0 | 0.0 | GO:0020003 | symbiont-containing vacuole(GO:0020003) symbiont-containing vacuole membrane(GO:0020005) |
| 0.0 | 0.1 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.0 | 0.1 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.0 | 0.4 | GO:0005685 | U1 snRNP(GO:0005685) |
| 0.0 | 0.1 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 0.1 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.0 | 0.1 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
| 0.0 | 0.0 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.0 | 0.1 | GO:0097179 | protease inhibitor complex(GO:0097179) |
| 0.0 | 0.1 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.0 | 0.0 | GO:0005873 | plus-end kinesin complex(GO:0005873) |
| 0.0 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.0 | 0.2 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.0 | 1.0 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.0 | 0.2 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 0.3 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
| 0.0 | 0.5 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.0 | 0.0 | GO:0000780 | condensed nuclear chromosome, centromeric region(GO:0000780) |
| 0.0 | 0.2 | GO:0030897 | HOPS complex(GO:0030897) |
| 0.0 | 0.1 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.0 | 0.2 | GO:0030478 | actin cap(GO:0030478) |
| 0.0 | 0.4 | GO:0043596 | nuclear replication fork(GO:0043596) |
| 0.0 | 0.6 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.0 | 0.1 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.0 | 0.1 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.0 | 0.0 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.0 | 0.3 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) |
| 0.0 | 0.3 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.0 | 0.0 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
| 0.0 | 0.8 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.0 | 0.4 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.0 | 0.5 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.0 | 1.2 | GO:0042641 | actomyosin(GO:0042641) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 1.3 | GO:0004874 | aryl hydrocarbon receptor activity(GO:0004874) |
| 0.3 | 1.4 | GO:0050436 | microfibril binding(GO:0050436) |
| 0.3 | 2.1 | GO:0060072 | large conductance calcium-activated potassium channel activity(GO:0060072) |
| 0.3 | 1.3 | GO:0032810 | sterol response element binding(GO:0032810) |
| 0.2 | 1.0 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
| 0.2 | 0.7 | GO:0003863 | alpha-ketoacid dehydrogenase activity(GO:0003826) 3-methyl-2-oxobutanoate dehydrogenase (2-methylpropanoyl-transferring) activity(GO:0003863) |
| 0.2 | 1.1 | GO:0016403 | dimethylargininase activity(GO:0016403) |
| 0.1 | 0.7 | GO:0004419 | hydroxymethylglutaryl-CoA lyase activity(GO:0004419) |
| 0.1 | 0.4 | GO:0004821 | histidine-tRNA ligase activity(GO:0004821) |
| 0.1 | 0.6 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.1 | 0.1 | GO:1904047 | S-adenosyl-L-methionine binding(GO:1904047) |
| 0.1 | 0.4 | GO:0036361 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
| 0.1 | 0.5 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
| 0.1 | 0.4 | GO:0004157 | dihydropyrimidinase activity(GO:0004157) |
| 0.1 | 2.2 | GO:0070513 | death domain binding(GO:0070513) |
| 0.1 | 1.2 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.1 | 0.3 | GO:0031531 | thyrotropin-releasing hormone receptor binding(GO:0031531) |
| 0.1 | 0.3 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.1 | 0.4 | GO:0052836 | inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
| 0.1 | 0.3 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
| 0.1 | 0.3 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.1 | 0.8 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
| 0.1 | 0.4 | GO:0042132 | fructose 1,6-bisphosphate 1-phosphatase activity(GO:0042132) |
| 0.1 | 0.3 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.1 | 0.6 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.1 | 0.4 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
| 0.1 | 0.7 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.1 | 0.6 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.1 | 0.5 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.1 | 1.0 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.1 | 0.2 | GO:0004379 | glycylpeptide N-tetradecanoyltransferase activity(GO:0004379) myristoyltransferase activity(GO:0019107) |
| 0.1 | 0.3 | GO:0008410 | CoA-transferase activity(GO:0008410) |
| 0.1 | 0.5 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.1 | 1.4 | GO:0005402 | sugar:proton symporter activity(GO:0005351) cation:sugar symporter activity(GO:0005402) |
| 0.1 | 0.6 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.1 | 0.4 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.1 | 0.8 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.1 | 0.5 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.1 | 0.1 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.1 | 0.3 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
| 0.1 | 0.2 | GO:0052810 | 1-phosphatidylinositol-5-kinase activity(GO:0052810) |
| 0.1 | 0.2 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.1 | 0.2 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.1 | 0.8 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.1 | 0.3 | GO:0016900 | oxidoreductase activity, acting on the CH-OH group of donors, disulfide as acceptor(GO:0016900) vitamin-K-epoxide reductase (warfarin-sensitive) activity(GO:0047057) |
| 0.1 | 0.4 | GO:0052844 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) inositol diphosphate tetrakisphosphate diphosphatase activity(GO:0052840) inositol bisdiphosphate tetrakisphosphate diphosphatase activity(GO:0052841) inositol diphosphate pentakisphosphate diphosphatase activity(GO:0052842) inositol-1-diphosphate-2,3,4,5,6-pentakisphosphate diphosphatase activity(GO:0052843) inositol-3-diphosphate-1,2,4,5,6-pentakisphosphate diphosphatase activity(GO:0052844) inositol-5-diphosphate-1,2,3,4,6-pentakisphosphate diphosphatase activity(GO:0052845) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 1-diphosphatase activity(GO:0052846) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052847) inositol-3,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052848) |
| 0.1 | 0.4 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.1 | 0.7 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.1 | 0.2 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.1 | 0.6 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.1 | 3.6 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.1 | 0.9 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.1 | 0.2 | GO:0008798 | beta-aspartyl-peptidase activity(GO:0008798) |
| 0.1 | 0.3 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.1 | 0.2 | GO:0038047 | beta-endorphin receptor activity(GO:0004979) morphine receptor activity(GO:0038047) |
| 0.1 | 0.3 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.1 | 1.4 | GO:0004697 | protein kinase C activity(GO:0004697) |
| 0.1 | 0.2 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.1 | 0.3 | GO:0003998 | acylphosphatase activity(GO:0003998) |
| 0.1 | 0.2 | GO:0004853 | uroporphyrinogen decarboxylase activity(GO:0004853) |
| 0.1 | 0.2 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
| 0.0 | 1.3 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
| 0.0 | 0.5 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.0 | 0.2 | GO:0061733 | histone acetyltransferase activity(GO:0004402) peptide N-acetyltransferase activity(GO:0034212) peptide-lysine-N-acetyltransferase activity(GO:0061733) |
| 0.0 | 0.4 | GO:0036122 | BMP binding(GO:0036122) |
| 0.0 | 0.3 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.8 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.0 | 0.3 | GO:1904929 | coreceptor activity involved in Wnt signaling pathway, planar cell polarity pathway(GO:1904929) |
| 0.0 | 0.8 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.0 | 0.1 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) |
| 0.0 | 0.0 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.0 | 0.1 | GO:0050211 | procollagen galactosyltransferase activity(GO:0050211) |
| 0.0 | 0.2 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.0 | 0.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.0 | 0.1 | GO:0034038 | deoxyhypusine synthase activity(GO:0034038) |
| 0.0 | 0.4 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.0 | 0.2 | GO:0030305 | heparanase activity(GO:0030305) |
| 0.0 | 0.2 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.0 | 0.4 | GO:0015266 | protein channel activity(GO:0015266) |
| 0.0 | 0.3 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.0 | 0.1 | GO:0042799 | histone methyltransferase activity (H4-K20 specific)(GO:0042799) |
| 0.0 | 1.2 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.0 | 0.5 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.0 | 0.1 | GO:0030626 | U12 snRNA binding(GO:0030626) |
| 0.0 | 0.3 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.0 | 1.0 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.0 | 0.1 | GO:0009041 | uridylate kinase activity(GO:0009041) |
| 0.0 | 0.1 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.0 | 0.4 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.0 | 0.3 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.0 | 0.2 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.0 | 0.2 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
| 0.0 | 3.4 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.0 | 0.1 | GO:0032038 | myosin II heavy chain binding(GO:0032038) |
| 0.0 | 0.2 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.0 | 2.7 | GO:0050840 | extracellular matrix binding(GO:0050840) |
| 0.0 | 0.4 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.0 | 0.2 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 0.0 | 1.1 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.0 | 0.3 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.0 | 0.1 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.0 | 0.2 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
| 0.0 | 0.1 | GO:1901375 | acetylcholine transmembrane transporter activity(GO:0005277) secondary active organic cation transmembrane transporter activity(GO:0008513) acetate ester transmembrane transporter activity(GO:1901375) |
| 0.0 | 0.7 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.0 | 0.8 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
| 0.0 | 1.0 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.0 | 0.2 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
| 0.0 | 0.1 | GO:0060422 | peptidyl-dipeptidase inhibitor activity(GO:0060422) |
| 0.0 | 0.4 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
| 0.0 | 1.3 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.0 | 0.4 | GO:0016004 | phospholipase activator activity(GO:0016004) |
| 0.0 | 0.2 | GO:0042610 | CD8 receptor binding(GO:0042610) |
| 0.0 | 0.2 | GO:0004331 | 6-phosphofructo-2-kinase activity(GO:0003873) fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.0 | 0.1 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.0 | 1.6 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
| 0.0 | 0.1 | GO:0015616 | DNA translocase activity(GO:0015616) |
| 0.0 | 0.2 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 0.0 | 0.1 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.0 | 0.5 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.0 | 0.1 | GO:0016402 | pristanoyl-CoA oxidase activity(GO:0016402) |
| 0.0 | 0.3 | GO:0009374 | biotin binding(GO:0009374) |
| 0.0 | 0.1 | GO:0032181 | heteroduplex DNA loop binding(GO:0000404) double-strand/single-strand DNA junction binding(GO:0000406) dinucleotide repeat insertion binding(GO:0032181) |
| 0.0 | 0.5 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.0 | 0.6 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.0 | 0.2 | GO:0008318 | protein prenyltransferase activity(GO:0008318) |
| 0.0 | 0.1 | GO:0035651 | AP-1 adaptor complex binding(GO:0035650) AP-3 adaptor complex binding(GO:0035651) |
| 0.0 | 0.3 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
| 0.0 | 0.7 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
| 0.0 | 0.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.0 | 0.2 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.0 | 0.1 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
| 0.0 | 0.2 | GO:0030911 | TPR domain binding(GO:0030911) |
| 0.0 | 0.1 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
| 0.0 | 0.4 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.0 | 0.3 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
| 0.0 | 0.2 | GO:0005113 | patched binding(GO:0005113) |
| 0.0 | 0.5 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.0 | 0.3 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.0 | 0.2 | GO:0034485 | phosphatidylinositol-3,4,5-trisphosphate 5-phosphatase activity(GO:0034485) |
| 0.0 | 0.2 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
| 0.0 | 0.4 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.0 | 0.1 | GO:0097158 | pre-mRNA intronic pyrimidine-rich binding(GO:0097158) |
| 0.0 | 0.2 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.0 | 0.1 | GO:0003727 | single-stranded RNA binding(GO:0003727) |
| 0.0 | 0.1 | GO:0004337 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
| 0.0 | 0.2 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
| 0.0 | 0.1 | GO:0043813 | phosphatidylinositol-3,5-bisphosphate 5-phosphatase activity(GO:0043813) |
| 0.0 | 0.6 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.0 | 0.2 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.0 | 2.1 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
| 0.0 | 0.1 | GO:0004960 | thromboxane receptor activity(GO:0004960) thromboxane A2 receptor activity(GO:0004961) |
| 0.0 | 0.4 | GO:0005522 | profilin binding(GO:0005522) |
| 0.0 | 0.2 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.0 | 0.1 | GO:0090631 | pre-miRNA transporter activity(GO:0090631) |
| 0.0 | 0.3 | GO:0019826 | oxygen sensor activity(GO:0019826) |
| 0.0 | 0.9 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
| 0.0 | 1.0 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.0 | 0.2 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
| 0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.0 | 0.6 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.0 | 0.1 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
| 0.0 | 0.3 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
| 0.0 | 0.2 | GO:0003696 | satellite DNA binding(GO:0003696) |
| 0.0 | 0.1 | GO:0016728 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.0 | 0.3 | GO:0001104 | RNA polymerase II transcription cofactor activity(GO:0001104) |
| 0.0 | 0.1 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
| 0.0 | 2.1 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.0 | 0.1 | GO:0047522 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
| 0.0 | 0.5 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.0 | 0.1 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 0.0 | 1.0 | GO:0050699 | WW domain binding(GO:0050699) |
| 0.0 | 0.2 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
| 0.0 | 0.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.0 | 0.2 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.0 | 0.4 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.0 | 0.2 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
| 0.0 | 0.1 | GO:0045518 | interleukin-22 receptor binding(GO:0045518) |
| 0.0 | 0.2 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
| 0.0 | 0.2 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.0 | 0.3 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
| 0.0 | 0.1 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.0 | 0.1 | GO:0016781 | selenide, water dikinase activity(GO:0004756) phosphotransferase activity, paired acceptors(GO:0016781) |
| 0.0 | 0.1 | GO:0004603 | phenylethanolamine N-methyltransferase activity(GO:0004603) |
| 0.0 | 0.1 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.0 | 0.1 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.0 | 0.1 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.0 | 2.2 | GO:0008081 | phosphoric diester hydrolase activity(GO:0008081) |
| 0.0 | 0.5 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
| 0.0 | 0.3 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.0 | 0.5 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.0 | 0.1 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.0 | 1.2 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.0 | 0.1 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
| 0.0 | 0.1 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 0.0 | 0.1 | GO:0097643 | amylin receptor activity(GO:0097643) |
| 0.0 | 0.1 | GO:0099529 | neurotransmitter receptor activity involved in regulation of postsynaptic membrane potential(GO:0099529) transmitter-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1904315) |
| 0.0 | 0.1 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.0 | 0.1 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.0 | 0.1 | GO:1990948 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.0 | 0.1 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.0 | 0.0 | GO:0061752 | telomeric repeat-containing RNA binding(GO:0061752) |
| 0.0 | 0.1 | GO:0019215 | intermediate filament binding(GO:0019215) |
| 0.0 | 0.1 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.0 | 0.7 | GO:0001221 | transcription cofactor binding(GO:0001221) |
| 0.0 | 0.0 | GO:0035379 | carbon dioxide transmembrane transporter activity(GO:0035379) |
| 0.0 | 0.6 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.0 | 0.0 | GO:0003955 | NAD(P)H dehydrogenase (quinone) activity(GO:0003955) 3-oxoacyl-[acyl-carrier-protein] reductase (NADH) activity(GO:0047025) |
| 0.0 | 0.1 | GO:0003678 | DNA helicase activity(GO:0003678) |
| 0.0 | 0.3 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.0 | 0.1 | GO:0099580 | ion antiporter activity involved in regulation of postsynaptic membrane potential(GO:0099580) |
| 0.0 | 0.2 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.0 | 0.1 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 0.0 | 3.1 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.2 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
| 0.0 | 0.3 | GO:0015278 | calcium-release channel activity(GO:0015278) ligand-gated calcium channel activity(GO:0099604) |
| 0.0 | 0.1 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.0 | 0.1 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
| 0.0 | 0.1 | GO:0015184 | L-cystine transmembrane transporter activity(GO:0015184) |
| 0.0 | 0.5 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.0 | 0.1 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.0 | 0.5 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.3 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
| 0.0 | 0.2 | GO:0019789 | SUMO transferase activity(GO:0019789) |
| 0.0 | 0.3 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.0 | 0.1 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
| 0.0 | 0.2 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.0 | 0.2 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.0 | 0.7 | GO:0016836 | hydro-lyase activity(GO:0016836) |
| 0.0 | 0.1 | GO:0044736 | acid-sensing ion channel activity(GO:0044736) |
| 0.0 | 0.4 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.0 | 0.2 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.0 | 0.2 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
| 0.0 | 0.3 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
| 0.0 | 0.2 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.0 | 0.0 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
| 0.0 | 0.2 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
| 0.0 | 0.4 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.0 | 0.3 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.0 | 0.3 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
| 0.0 | 0.7 | GO:0004407 | histone deacetylase activity(GO:0004407) |
| 0.0 | 0.0 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.0 | 0.1 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.0 | 0.0 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.0 | 0.1 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
| 0.0 | 0.3 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 0.0 | 0.3 | GO:0030371 | translation repressor activity(GO:0030371) |
| 0.0 | 0.1 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
| 0.0 | 0.3 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.0 | 0.2 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.0 | 0.1 | GO:0070064 | proline-rich region binding(GO:0070064) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 1.2 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.1 | 3.5 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.1 | 2.6 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.0 | 1.1 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 3.7 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
| 0.0 | 2.6 | ST GA13 PATHWAY | G alpha 13 Pathway |
| 0.0 | 0.4 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 2.8 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
| 0.0 | 1.4 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.0 | 0.3 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.0 | 0.6 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.0 | 0.2 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.0 | 1.6 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.0 | 0.7 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.0 | 1.5 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 0.3 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.0 | 0.5 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.0 | 0.1 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.0 | 0.9 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.0 | 0.6 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.0 | 0.9 | PID MYC PATHWAY | C-MYC pathway |
| 0.0 | 0.0 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.0 | 0.5 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 0.4 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.0 | 1.4 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
| 0.0 | 0.9 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.0 | 0.4 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.0 | 0.2 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.0 | 0.8 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 0.2 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.0 | 0.3 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.0 | 1.4 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.0 | 0.4 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.0 | 0.9 | PID BMP PATHWAY | BMP receptor signaling |
| 0.0 | 0.2 | ST ADRENERGIC | Adrenergic Pathway |
| 0.0 | 0.4 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.0 | 0.2 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.0 | 1.2 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.0 | 0.7 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 3.9 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
| 0.1 | 2.2 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.1 | 1.6 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.1 | 4.3 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.1 | 0.7 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.1 | 1.8 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.1 | 1.0 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.1 | 4.7 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.0 | 0.4 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.0 | 0.7 | REACTOME RAF MAP KINASE CASCADE | Genes involved in RAF/MAP kinase cascade |
| 0.0 | 1.4 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.0 | 2.1 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
| 0.0 | 0.1 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
| 0.0 | 0.5 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 0.0 | 1.3 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.0 | 1.4 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 0.4 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.0 | 0.6 | REACTOME CELL DEATH SIGNALLING VIA NRAGE NRIF AND NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
| 0.0 | 0.6 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 0.2 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.0 | 0.9 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.0 | 0.7 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.0 | 1.1 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 0.1 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
| 0.0 | 0.4 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.0 | 1.7 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 0.6 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.0 | 0.4 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
| 0.0 | 1.3 | REACTOME SPHINGOLIPID METABOLISM | Genes involved in Sphingolipid metabolism |
| 0.0 | 3.8 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.0 | 0.5 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.0 | 0.7 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
| 0.0 | 1.1 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.0 | 0.3 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.0 | 0.7 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.0 | 0.2 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.0 | 0.4 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.0 | 0.5 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.0 | 0.4 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.0 | 0.3 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.0 | 1.2 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
| 0.0 | 0.8 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.0 | 0.5 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.0 | 0.2 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.0 | 1.3 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 0.1 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.0 | 0.8 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.0 | 0.2 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
| 0.0 | 0.5 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
| 0.0 | 2.9 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.0 | 0.6 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.0 | 0.1 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
| 0.0 | 0.1 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.0 | 0.6 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.0 | 0.3 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.0 | 0.7 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.0 | 0.3 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.0 | 0.2 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
| 0.0 | 0.3 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
| 0.0 | 0.1 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.0 | 0.1 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
| 0.0 | 0.6 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.0 | 0.2 | REACTOME OPSINS | Genes involved in Opsins |
| 0.0 | 0.1 | REACTOME HOST INTERACTIONS OF HIV FACTORS | Genes involved in Host Interactions of HIV factors |
| 0.0 | 0.1 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.0 | 0.2 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.0 | 0.3 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.0 | 0.1 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |