ENCODE cell lines, expression (Ernst 2011)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
EBF1
|
ENSG00000164330.12 | EBF1 |
| Promoter | Score | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr22_+_23229960 | 6.91 |
ENST00000526893.1 ENST00000532223.2 ENST00000531372.1 |
IGLL5 |
immunoglobulin lambda-like polypeptide 5 |
| chr22_+_23101182 | 4.52 |
ENST00000390312.2 |
IGLV2-14 |
immunoglobulin lambda variable 2-14 |
| chr5_-_149792295 | 4.31 |
ENST00000518797.1 ENST00000524315.1 ENST00000009530.7 ENST00000377795.3 |
CD74 |
CD74 molecule, major histocompatibility complex, class II invariant chain |
| chr22_+_23134974 | 3.99 |
ENST00000390314.2 |
IGLV2-11 |
immunoglobulin lambda variable 2-11 |
| chr6_-_167369612 | 3.84 |
ENST00000507747.1 |
RP11-514O12.4 |
RP11-514O12.4 |
| chr22_+_23165153 | 3.68 |
ENST00000390317.2 |
IGLV2-8 |
immunoglobulin lambda variable 2-8 |
| chr14_+_105953204 | 3.64 |
ENST00000409393.2 |
CRIP1 |
cysteine-rich protein 1 (intestinal) |
| chr14_+_105953246 | 3.48 |
ENST00000392531.3 |
CRIP1 |
cysteine-rich protein 1 (intestinal) |
| chr22_+_23241661 | 3.46 |
ENST00000390322.2 |
IGLJ2 |
immunoglobulin lambda joining 2 |
| chr11_+_121447469 | 3.45 |
ENST00000532694.1 ENST00000534286.1 |
SORL1 |
sortilin-related receptor, L(DLR class) A repeats containing |
| chr22_+_23077065 | 3.37 |
ENST00000390310.2 |
IGLV2-18 |
immunoglobulin lambda variable 2-18 |
| chr12_+_7055631 | 2.93 |
ENST00000543115.1 ENST00000399448.1 |
PTPN6 |
protein tyrosine phosphatase, non-receptor type 6 |
| chr19_-_39108568 | 2.92 |
ENST00000586296.1 |
MAP4K1 |
mitogen-activated protein kinase kinase kinase kinase 1 |
| chr11_+_116700614 | 2.90 |
ENST00000375345.1 |
APOC3 |
apolipoprotein C-III |
| chr2_-_158300556 | 2.83 |
ENST00000264192.3 |
CYTIP |
cytohesin 1 interacting protein |
| chr19_+_4229495 | 2.82 |
ENST00000221847.5 |
EBI3 |
Epstein-Barr virus induced 3 |
| chr22_-_23922410 | 2.70 |
ENST00000249053.3 |
IGLL1 |
immunoglobulin lambda-like polypeptide 1 |
| chr6_-_31550192 | 2.70 |
ENST00000429299.2 ENST00000446745.2 |
LTB |
lymphotoxin beta (TNF superfamily, member 3) |
| chr12_+_7055767 | 2.68 |
ENST00000447931.2 |
PTPN6 |
protein tyrosine phosphatase, non-receptor type 6 |
| chr11_+_22689648 | 2.66 |
ENST00000278187.3 |
GAS2 |
growth arrest-specific 2 |
| chr11_+_60223225 | 2.65 |
ENST00000524807.1 ENST00000345732.4 |
MS4A1 |
membrane-spanning 4-domains, subfamily A, member 1 |
| chr11_+_60223312 | 2.65 |
ENST00000532491.1 ENST00000532073.1 ENST00000534668.1 ENST00000528313.1 ENST00000533306.1 |
MS4A1 |
membrane-spanning 4-domains, subfamily A, member 1 |
| chr14_-_106174960 | 2.64 |
ENST00000390547.2 |
IGHA1 |
immunoglobulin heavy constant alpha 1 |
| chr22_+_22930626 | 2.58 |
ENST00000390302.2 |
IGLV2-33 |
immunoglobulin lambda variable 2-33 (non-functional) |
| chr17_-_46507567 | 2.58 |
ENST00000584924.1 |
SKAP1 |
src kinase associated phosphoprotein 1 |
| chr19_-_7766991 | 2.56 |
ENST00000597921.1 ENST00000346664.5 |
FCER2 |
Fc fragment of IgE, low affinity II, receptor for (CD23) |
| chr14_+_105952648 | 2.54 |
ENST00000330233.7 |
CRIP1 |
cysteine-rich protein 1 (intestinal) |
| chr5_-_138725594 | 2.50 |
ENST00000302125.8 |
MZB1 |
marginal zone B and B1 cell-specific protein |
| chr5_-_138725560 | 2.50 |
ENST00000412103.2 ENST00000457570.2 |
MZB1 |
marginal zone B and B1 cell-specific protein |
| chr11_+_116700600 | 2.48 |
ENST00000227667.3 |
APOC3 |
apolipoprotein C-III |
| chr22_+_23040274 | 2.47 |
ENST00000390306.2 |
IGLV2-23 |
immunoglobulin lambda variable 2-23 |
| chr17_+_47448102 | 2.45 |
ENST00000576461.1 |
RP11-81K2.1 |
Uncharacterized protein |
| chr11_-_116708302 | 2.43 |
ENST00000375320.1 ENST00000359492.2 ENST00000375329.2 ENST00000375323.1 |
APOA1 |
apolipoprotein A-I |
| chr17_-_7082668 | 2.34 |
ENST00000573083.1 ENST00000574388.1 |
ASGR1 |
asialoglycoprotein receptor 1 |
| chr6_+_33043703 | 2.34 |
ENST00000418931.2 ENST00000535465.1 |
HLA-DPB1 |
major histocompatibility complex, class II, DP beta 1 |
| chr14_-_106406090 | 2.34 |
ENST00000390593.2 |
IGHV6-1 |
immunoglobulin heavy variable 6-1 |
| chr13_-_99959641 | 2.34 |
ENST00000376414.4 |
GPR183 |
G protein-coupled receptor 183 |
| chr19_-_39108552 | 2.28 |
ENST00000591517.1 |
MAP4K1 |
mitogen-activated protein kinase kinase kinase kinase 1 |
| chr14_-_106054659 | 2.26 |
ENST00000390539.2 |
IGHA2 |
immunoglobulin heavy constant alpha 2 (A2m marker) |
| chr14_+_95078714 | 2.16 |
ENST00000393078.3 ENST00000393080.4 ENST00000467132.1 |
SERPINA3 |
serpin peptidase inhibitor, clade A (alpha-1 antiproteinase, antitrypsin), member 3 |
| chr21_-_46330545 | 2.09 |
ENST00000320216.6 ENST00000397852.1 |
ITGB2 |
integrin, beta 2 (complement component 3 receptor 3 and 4 subunit) |
| chr20_+_56136136 | 2.06 |
ENST00000319441.4 ENST00000543666.1 |
PCK1 |
phosphoenolpyruvate carboxykinase 1 (soluble) |
| chr1_+_213123976 | 2.04 |
ENST00000366965.2 ENST00000366967.2 |
VASH2 |
vasohibin 2 |
| chr8_-_80680078 | 2.04 |
ENST00000337919.5 ENST00000354724.3 |
HEY1 |
hes-related family bHLH transcription factor with YRPW motif 1 |
| chr7_+_26331541 | 2.00 |
ENST00000416246.1 ENST00000338523.4 ENST00000412416.1 |
SNX10 |
sorting nexin 10 |
| chr4_+_128554081 | 1.99 |
ENST00000335251.6 ENST00000296461.5 |
INTU |
inturned planar cell polarity protein |
| chr3_+_16926441 | 1.99 |
ENST00000418129.2 ENST00000396755.2 |
PLCL2 |
phospholipase C-like 2 |
| chr1_+_213123915 | 1.97 |
ENST00000366968.4 ENST00000490792.1 |
VASH2 |
vasohibin 2 |
| chr19_+_42381337 | 1.97 |
ENST00000597454.1 ENST00000444740.2 |
CD79A |
CD79a molecule, immunoglobulin-associated alpha |
| chr17_-_64225508 | 1.94 |
ENST00000205948.6 |
APOH |
apolipoprotein H (beta-2-glycoprotein I) |
| chr21_-_46340884 | 1.91 |
ENST00000302347.5 ENST00000517819.1 |
ITGB2 |
integrin, beta 2 (complement component 3 receptor 3 and 4 subunit) |
| chr7_-_100881109 | 1.90 |
ENST00000308344.5 |
CLDN15 |
claudin 15 |
| chr16_-_29910853 | 1.88 |
ENST00000308713.5 |
SEZ6L2 |
seizure related 6 homolog (mouse)-like 2 |
| chr10_+_114133773 | 1.84 |
ENST00000354655.4 |
ACSL5 |
acyl-CoA synthetase long-chain family member 5 |
| chr1_-_151431647 | 1.82 |
ENST00000368863.2 ENST00000409503.1 ENST00000491586.1 ENST00000533351.1 ENST00000540984.1 |
POGZ |
pogo transposable element with ZNF domain |
| chr22_+_22550113 | 1.79 |
ENST00000390285.3 |
IGLV6-57 |
immunoglobulin lambda variable 6-57 |
| chr6_+_31895467 | 1.77 |
ENST00000556679.1 ENST00000456570.1 |
CFB CFB |
complement factor B Complement factor B; Uncharacterized protein; cDNA FLJ55673, highly similar to Complement factor B |
| chr5_+_75699040 | 1.75 |
ENST00000274364.6 |
IQGAP2 |
IQ motif containing GTPase activating protein 2 |
| chr19_-_39108643 | 1.74 |
ENST00000396857.2 |
MAP4K1 |
mitogen-activated protein kinase kinase kinase kinase 1 |
| chr12_-_26986076 | 1.73 |
ENST00000381340.3 |
ITPR2 |
inositol 1,4,5-trisphosphate receptor, type 2 |
| chr6_+_31895480 | 1.73 |
ENST00000418949.2 ENST00000383177.3 ENST00000477310.1 |
C2 CFB |
complement component 2 Complement factor B; Uncharacterized protein; cDNA FLJ55673, highly similar to Complement factor B |
| chr1_-_169555779 | 1.71 |
ENST00000367797.3 ENST00000367796.3 |
F5 |
coagulation factor V (proaccelerin, labile factor) |
| chr7_+_101928380 | 1.68 |
ENST00000536178.1 |
SH2B2 |
SH2B adaptor protein 2 |
| chr12_-_772901 | 1.67 |
ENST00000305108.4 |
NINJ2 |
ninjurin 2 |
| chr9_-_130742792 | 1.67 |
ENST00000373095.1 |
FAM102A |
family with sequence similarity 102, member A |
| chr7_+_75609672 | 1.67 |
ENST00000545601.1 ENST00000450476.1 |
POR |
P450 (cytochrome) oxidoreductase |
| chr16_-_21289627 | 1.64 |
ENST00000396023.2 ENST00000415987.2 |
CRYM |
crystallin, mu |
| chr1_-_161193349 | 1.64 |
ENST00000469730.2 ENST00000463273.1 ENST00000464492.1 ENST00000367990.3 ENST00000470459.2 ENST00000468465.1 ENST00000463812.1 |
APOA2 |
apolipoprotein A-II |
| chr1_-_32801825 | 1.64 |
ENST00000329421.7 |
MARCKSL1 |
MARCKS-like 1 |
| chr10_+_114135952 | 1.64 |
ENST00000356116.1 ENST00000433418.1 ENST00000354273.4 |
ACSL5 |
acyl-CoA synthetase long-chain family member 5 |
| chr3_-_8686479 | 1.63 |
ENST00000544814.1 ENST00000427408.1 |
SSUH2 |
ssu-2 homolog (C. elegans) |
| chr17_-_7082861 | 1.63 |
ENST00000269299.3 |
ASGR1 |
asialoglycoprotein receptor 1 |
| chr14_+_24630465 | 1.62 |
ENST00000557894.1 ENST00000559284.1 ENST00000560275.1 |
IRF9 |
interferon regulatory factor 9 |
| chrX_+_129305623 | 1.61 |
ENST00000257017.4 |
RAB33A |
RAB33A, member RAS oncogene family |
| chr1_-_173886491 | 1.60 |
ENST00000367698.3 |
SERPINC1 |
serpin peptidase inhibitor, clade C (antithrombin), member 1 |
| chr6_-_24877490 | 1.58 |
ENST00000540914.1 ENST00000378023.4 |
FAM65B |
family with sequence similarity 65, member B |
| chr17_+_65374075 | 1.54 |
ENST00000581322.1 |
PITPNC1 |
phosphatidylinositol transfer protein, cytoplasmic 1 |
| chr15_+_81475047 | 1.51 |
ENST00000559388.1 |
IL16 |
interleukin 16 |
| chr2_-_44065946 | 1.51 |
ENST00000260645.1 |
ABCG5 |
ATP-binding cassette, sub-family G (WHITE), member 5 |
| chr5_+_156712372 | 1.49 |
ENST00000541131.1 |
CYFIP2 |
cytoplasmic FMR1 interacting protein 2 |
| chr19_+_42381173 | 1.49 |
ENST00000221972.3 |
CD79A |
CD79a molecule, immunoglobulin-associated alpha |
| chr22_-_37545972 | 1.49 |
ENST00000216223.5 |
IL2RB |
interleukin 2 receptor, beta |
| chr6_-_32731299 | 1.49 |
ENST00000435145.2 ENST00000437316.2 |
HLA-DQB2 |
major histocompatibility complex, class II, DQ beta 2 |
| chr22_-_23922448 | 1.48 |
ENST00000438703.1 ENST00000330377.2 |
IGLL1 |
immunoglobulin lambda-like polypeptide 1 |
| chr17_-_46507537 | 1.46 |
ENST00000336915.6 |
SKAP1 |
src kinase associated phosphoprotein 1 |
| chr22_+_23264766 | 1.46 |
ENST00000390331.2 |
IGLC7 |
immunoglobulin lambda constant 7 |
| chr6_-_32634425 | 1.46 |
ENST00000399082.3 ENST00000399079.3 ENST00000374943.4 ENST00000434651.2 |
HLA-DQB1 |
major histocompatibility complex, class II, DQ beta 1 |
| chr2_+_219283815 | 1.43 |
ENST00000248444.5 ENST00000454069.1 ENST00000392114.2 |
VIL1 |
villin 1 |
| chr2_-_44065889 | 1.43 |
ENST00000543989.1 ENST00000405322.1 |
ABCG5 |
ATP-binding cassette, sub-family G (WHITE), member 5 |
| chr15_-_74495188 | 1.43 |
ENST00000563965.1 ENST00000395105.4 |
STRA6 |
stimulated by retinoic acid 6 |
| chr6_+_106959718 | 1.42 |
ENST00000369066.3 |
AIM1 |
absent in melanoma 1 |
| chr1_+_26644441 | 1.42 |
ENST00000374213.2 |
CD52 |
CD52 molecule |
| chr8_-_30585217 | 1.41 |
ENST00000520888.1 ENST00000414019.1 |
GSR |
glutathione reductase |
| chr16_+_69599899 | 1.41 |
ENST00000567239.1 |
NFAT5 |
nuclear factor of activated T-cells 5, tonicity-responsive |
| chr4_-_155533787 | 1.40 |
ENST00000407946.1 ENST00000405164.1 ENST00000336098.3 ENST00000393846.2 ENST00000404648.3 ENST00000443553.1 |
FGG |
fibrinogen gamma chain |
| chr8_-_101321584 | 1.39 |
ENST00000523167.1 |
RNF19A |
ring finger protein 19A, RBR E3 ubiquitin protein ligase |
| chrX_+_128913906 | 1.39 |
ENST00000356892.3 |
SASH3 |
SAM and SH3 domain containing 3 |
| chr17_-_7080227 | 1.38 |
ENST00000574330.1 |
ASGR1 |
asialoglycoprotein receptor 1 |
| chr6_+_6588316 | 1.38 |
ENST00000379953.2 |
LY86 |
lymphocyte antigen 86 |
| chr1_-_92351769 | 1.38 |
ENST00000212355.4 |
TGFBR3 |
transforming growth factor, beta receptor III |
| chr16_+_69599861 | 1.37 |
ENST00000354436.2 |
NFAT5 |
nuclear factor of activated T-cells 5, tonicity-responsive |
| chr13_-_46961580 | 1.37 |
ENST00000378787.3 ENST00000378797.2 ENST00000429979.1 ENST00000378781.3 |
KIAA0226L |
KIAA0226-like |
| chr16_+_30194916 | 1.35 |
ENST00000570045.1 ENST00000565497.1 ENST00000570244.1 |
CORO1A |
coronin, actin binding protein, 1A |
| chr17_+_16318909 | 1.33 |
ENST00000577397.1 |
TRPV2 |
transient receptor potential cation channel, subfamily V, member 2 |
| chr19_+_35630628 | 1.32 |
ENST00000588715.1 ENST00000588607.1 |
FXYD1 |
FXYD domain containing ion transport regulator 1 |
| chr17_-_34417479 | 1.30 |
ENST00000225245.5 |
CCL3 |
chemokine (C-C motif) ligand 3 |
| chr4_-_40517984 | 1.30 |
ENST00000381795.6 |
RBM47 |
RNA binding motif protein 47 |
| chr1_-_27961720 | 1.30 |
ENST00000545953.1 ENST00000374005.3 |
FGR |
feline Gardner-Rasheed sarcoma viral oncogene homolog |
| chr19_+_50922187 | 1.30 |
ENST00000595883.1 ENST00000597855.1 ENST00000596074.1 ENST00000439922.2 ENST00000594685.1 ENST00000270632.7 |
SPIB |
Spi-B transcription factor (Spi-1/PU.1 related) |
| chr20_+_34203794 | 1.29 |
ENST00000374273.3 |
SPAG4 |
sperm associated antigen 4 |
| chr17_-_62009621 | 1.27 |
ENST00000349817.2 ENST00000392795.3 |
CD79B |
CD79b molecule, immunoglobulin-associated beta |
| chr1_-_9129735 | 1.26 |
ENST00000377424.4 |
SLC2A5 |
solute carrier family 2 (facilitated glucose/fructose transporter), member 5 |
| chr17_+_4675175 | 1.26 |
ENST00000270560.3 |
TM4SF5 |
transmembrane 4 L six family member 5 |
| chr14_-_106573756 | 1.25 |
ENST00000390601.2 |
IGHV3-11 |
immunoglobulin heavy variable 3-11 (gene/pseudogene) |
| chr9_+_139921916 | 1.24 |
ENST00000314330.2 |
C9orf139 |
chromosome 9 open reading frame 139 |
| chr1_+_6105974 | 1.24 |
ENST00000378083.3 |
KCNAB2 |
potassium voltage-gated channel, shaker-related subfamily, beta member 2 |
| chr7_+_150065879 | 1.24 |
ENST00000397281.2 ENST00000444957.1 ENST00000466559.1 ENST00000489432.2 ENST00000475514.1 ENST00000482680.1 ENST00000488943.1 ENST00000518514.1 ENST00000478789.1 |
REPIN1 ZNF775 |
replication initiator 1 zinc finger protein 775 |
| chr17_-_56595196 | 1.23 |
ENST00000579921.1 ENST00000579925.1 ENST00000323456.5 |
MTMR4 |
myotubularin related protein 4 |
| chr13_+_113777105 | 1.23 |
ENST00000409306.1 ENST00000375551.3 ENST00000375559.3 |
F10 |
coagulation factor X |
| chr2_+_11696464 | 1.23 |
ENST00000234142.5 |
GREB1 |
growth regulation by estrogen in breast cancer 1 |
| chr1_-_110306562 | 1.23 |
ENST00000369805.3 |
EPS8L3 |
EPS8-like 3 |
| chr3_-_58196688 | 1.23 |
ENST00000486455.1 |
DNASE1L3 |
deoxyribonuclease I-like 3 |
| chr17_+_66511540 | 1.22 |
ENST00000588188.2 |
PRKAR1A |
protein kinase, cAMP-dependent, regulatory, type I, alpha |
| chr1_-_27952741 | 1.22 |
ENST00000399173.1 |
FGR |
feline Gardner-Rasheed sarcoma viral oncogene homolog |
| chr10_-_98031310 | 1.20 |
ENST00000427367.2 ENST00000413476.2 |
BLNK |
B-cell linker |
| chr19_-_6591113 | 1.19 |
ENST00000423145.3 ENST00000245903.3 |
CD70 |
CD70 molecule |
| chr19_-_6720686 | 1.19 |
ENST00000245907.6 |
C3 |
complement component 3 |
| chr14_+_106384295 | 1.19 |
ENST00000449410.1 ENST00000429431.1 |
KIAA0125 |
KIAA0125 |
| chr12_-_51717875 | 1.19 |
ENST00000604560.1 |
BIN2 |
bridging integrator 2 |
| chr14_-_23285011 | 1.19 |
ENST00000397532.3 |
SLC7A7 |
solute carrier family 7 (amino acid transporter light chain, y+L system), member 7 |
| chr15_+_81591757 | 1.18 |
ENST00000558332.1 |
IL16 |
interleukin 16 |
| chr1_-_9129598 | 1.17 |
ENST00000535586.1 |
SLC2A5 |
solute carrier family 2 (facilitated glucose/fructose transporter), member 5 |
| chr19_+_49838653 | 1.17 |
ENST00000598095.1 ENST00000426897.2 ENST00000323906.4 ENST00000535669.2 ENST00000597602.1 ENST00000595660.1 |
CD37 |
CD37 molecule |
| chr6_-_32820529 | 1.17 |
ENST00000425148.2 |
TAP1 |
transporter 1, ATP-binding cassette, sub-family B (MDR/TAP) |
| chr17_-_42200996 | 1.16 |
ENST00000587135.1 ENST00000225983.6 ENST00000393622.2 ENST00000588703.1 |
HDAC5 |
histone deacetylase 5 |
| chr14_-_106963409 | 1.15 |
ENST00000390621.2 |
IGHV1-45 |
immunoglobulin heavy variable 1-45 |
| chr17_-_7018128 | 1.14 |
ENST00000380952.2 ENST00000254850.7 |
ASGR2 |
asialoglycoprotein receptor 2 |
| chr17_-_7017968 | 1.14 |
ENST00000355035.5 |
ASGR2 |
asialoglycoprotein receptor 2 |
| chr11_+_61520075 | 1.14 |
ENST00000278836.5 |
MYRF |
myelin regulatory factor |
| chr3_+_52828805 | 1.14 |
ENST00000416872.2 ENST00000449956.2 |
ITIH3 |
inter-alpha-trypsin inhibitor heavy chain 3 |
| chr17_-_34308524 | 1.14 |
ENST00000293275.3 |
CCL16 |
chemokine (C-C motif) ligand 16 |
| chr5_-_95158375 | 1.13 |
ENST00000512469.2 ENST00000379979.4 ENST00000505427.1 ENST00000508780.1 |
GLRX |
glutaredoxin (thioltransferase) |
| chr17_+_72427477 | 1.13 |
ENST00000342648.5 ENST00000481232.1 |
GPRC5C |
G protein-coupled receptor, family C, group 5, member C |
| chr4_-_186877502 | 1.12 |
ENST00000431902.1 ENST00000284776.7 ENST00000415274.1 |
SORBS2 |
sorbin and SH3 domain containing 2 |
| chr1_+_13742808 | 1.11 |
ENST00000602960.1 |
PRAMEF20 |
PRAME family member 20 |
| chr17_-_62009702 | 1.11 |
ENST00000006750.3 |
CD79B |
CD79b molecule, immunoglobulin-associated beta |
| chr9_+_35673853 | 1.11 |
ENST00000378357.4 |
CA9 |
carbonic anhydrase IX |
| chrX_+_192989 | 1.11 |
ENST00000399012.1 ENST00000430923.2 |
PLCXD1 |
phosphatidylinositol-specific phospholipase C, X domain containing 1 |
| chr11_-_46142948 | 1.11 |
ENST00000257821.4 |
PHF21A |
PHD finger protein 21A |
| chr6_-_32811771 | 1.11 |
ENST00000395339.3 ENST00000374882.3 |
PSMB8 |
proteasome (prosome, macropain) subunit, beta type, 8 |
| chr19_-_11688447 | 1.10 |
ENST00000590420.1 |
ACP5 |
acid phosphatase 5, tartrate resistant |
| chr14_+_95047744 | 1.10 |
ENST00000553511.1 ENST00000554633.1 ENST00000555681.1 ENST00000554276.1 |
SERPINA5 |
serpin peptidase inhibitor, clade A (alpha-1 antiproteinase, antitrypsin), member 5 |
| chr2_+_223289208 | 1.09 |
ENST00000321276.7 |
SGPP2 |
sphingosine-1-phosphate phosphatase 2 |
| chr7_-_100823496 | 1.09 |
ENST00000455377.1 ENST00000443096.1 ENST00000300303.2 |
NAT16 |
N-acetyltransferase 16 (GCN5-related, putative) |
| chr19_-_10450287 | 1.09 |
ENST00000589261.1 ENST00000590569.1 ENST00000589580.1 ENST00000589249.1 |
ICAM3 |
intercellular adhesion molecule 3 |
| chr16_-_70472946 | 1.09 |
ENST00000342907.2 |
ST3GAL2 |
ST3 beta-galactoside alpha-2,3-sialyltransferase 2 |
| chr1_-_21995794 | 1.09 |
ENST00000542643.2 ENST00000374765.4 ENST00000317967.7 |
RAP1GAP |
RAP1 GTPase activating protein |
| chr12_-_51717948 | 1.09 |
ENST00000267012.4 |
BIN2 |
bridging integrator 2 |
| chr1_+_207262540 | 1.09 |
ENST00000452902.2 |
C4BPB |
complement component 4 binding protein, beta |
| chr17_+_76165213 | 1.08 |
ENST00000590201.1 |
SYNGR2 |
synaptogyrin 2 |
| chr3_-_79816965 | 1.08 |
ENST00000464233.1 |
ROBO1 |
roundabout, axon guidance receptor, homolog 1 (Drosophila) |
| chr19_-_11688500 | 1.08 |
ENST00000433365.2 |
ACP5 |
acid phosphatase 5, tartrate resistant |
| chr5_+_130599735 | 1.07 |
ENST00000503291.1 ENST00000360515.3 ENST00000505065.1 |
CDC42SE2 |
CDC42 small effector 2 |
| chr3_-_124839648 | 1.07 |
ENST00000430155.2 |
SLC12A8 |
solute carrier family 12, member 8 |
| chr6_-_32908792 | 1.07 |
ENST00000418107.2 |
HLA-DMB |
major histocompatibility complex, class II, DM beta |
| chr3_+_133118839 | 1.07 |
ENST00000302334.2 |
BFSP2 |
beaded filament structural protein 2, phakinin |
| chr2_-_239197201 | 1.06 |
ENST00000254658.3 |
PER2 |
period circadian clock 2 |
| chr6_+_32811885 | 1.06 |
ENST00000458296.1 ENST00000413039.1 ENST00000429600.1 ENST00000412095.1 ENST00000415067.1 ENST00000395330.1 |
TAPSAR1 PSMB9 |
TAP1 and PSMB8 antisense RNA 1 proteasome (prosome, macropain) subunit, beta type, 9 |
| chr11_+_117049445 | 1.05 |
ENST00000324225.4 ENST00000532960.1 |
SIDT2 |
SID1 transmembrane family, member 2 |
| chr19_-_2041159 | 1.05 |
ENST00000589441.1 |
MKNK2 |
MAP kinase interacting serine/threonine kinase 2 |
| chr12_-_51717922 | 1.05 |
ENST00000452142.2 |
BIN2 |
bridging integrator 2 |
| chr19_-_10445399 | 1.04 |
ENST00000592945.1 |
ICAM3 |
intercellular adhesion molecule 3 |
| chr20_-_33999766 | 1.04 |
ENST00000349714.5 ENST00000438533.1 ENST00000359226.2 ENST00000374384.2 ENST00000374377.5 ENST00000407996.2 ENST00000424405.1 ENST00000542501.1 ENST00000397554.1 ENST00000540457.1 ENST00000374380.2 ENST00000374385.5 |
UQCC1 |
ubiquinol-cytochrome c reductase complex assembly factor 1 |
| chr2_-_239197238 | 1.03 |
ENST00000254657.3 |
PER2 |
period circadian clock 2 |
| chr20_-_4804244 | 1.03 |
ENST00000379400.3 |
RASSF2 |
Ras association (RalGDS/AF-6) domain family member 2 |
| chr7_-_150329421 | 1.02 |
ENST00000493969.1 ENST00000328902.5 |
GIMAP6 |
GTPase, IMAP family member 6 |
| chr7_+_102715315 | 1.01 |
ENST00000428183.2 ENST00000323716.3 ENST00000441711.2 ENST00000454559.1 ENST00000425331.1 ENST00000541300.1 |
ARMC10 |
armadillo repeat containing 10 |
| chr5_-_42825983 | 1.01 |
ENST00000506577.1 |
SEPP1 |
selenoprotein P, plasma, 1 |
| chr19_+_35630926 | 1.00 |
ENST00000588081.1 ENST00000589121.1 |
FXYD1 |
FXYD domain containing ion transport regulator 1 |
| chr10_+_45869652 | 1.00 |
ENST00000542434.1 ENST00000374391.2 |
ALOX5 |
arachidonate 5-lipoxygenase |
| chrX_-_1571810 | 0.99 |
ENST00000381333.4 |
ASMTL |
acetylserotonin O-methyltransferase-like |
| chr19_-_10450328 | 0.99 |
ENST00000160262.5 |
ICAM3 |
intercellular adhesion molecule 3 |
| chr20_+_34204939 | 0.99 |
ENST00000454819.1 |
SPAG4 |
sperm associated antigen 4 |
| chr14_+_22984601 | 0.99 |
ENST00000390509.1 |
TRAJ28 |
T cell receptor alpha joining 28 |
| chr8_-_103136481 | 0.99 |
ENST00000524209.1 ENST00000517822.1 ENST00000523923.1 ENST00000521599.1 ENST00000521964.1 ENST00000311028.3 ENST00000518166.1 |
NCALD |
neurocalcin delta |
| chr7_-_137686791 | 0.98 |
ENST00000452463.1 ENST00000330387.6 ENST00000456390.1 |
CREB3L2 |
cAMP responsive element binding protein 3-like 2 |
| chr18_-_67624160 | 0.98 |
ENST00000581982.1 ENST00000280200.4 |
CD226 |
CD226 molecule |
| chr1_-_110306526 | 0.98 |
ENST00000361965.4 ENST00000361852.4 |
EPS8L3 |
EPS8-like 3 |
| chr5_+_133450365 | 0.98 |
ENST00000342854.5 ENST00000321603.6 ENST00000321584.4 ENST00000378564.1 ENST00000395029.1 |
TCF7 |
transcription factor 7 (T-cell specific, HMG-box) |
| chr14_-_106725723 | 0.98 |
ENST00000390609.2 |
IGHV3-23 |
immunoglobulin heavy variable 3-23 |
| chr7_+_75544466 | 0.98 |
ENST00000421059.1 ENST00000394893.1 ENST00000412521.1 ENST00000414186.1 |
POR |
P450 (cytochrome) oxidoreductase |
| chr11_+_68080077 | 0.98 |
ENST00000294304.7 |
LRP5 |
low density lipoprotein receptor-related protein 5 |
| chr2_+_42396472 | 0.96 |
ENST00000318522.5 ENST00000402711.2 |
EML4 |
echinoderm microtubule associated protein like 4 |
| chr3_-_49726486 | 0.96 |
ENST00000449682.2 |
MST1 |
macrophage stimulating 1 (hepatocyte growth factor-like) |
| chr1_-_9129631 | 0.96 |
ENST00000377414.3 |
SLC2A5 |
solute carrier family 2 (facilitated glucose/fructose transporter), member 5 |
| chr7_-_99573640 | 0.96 |
ENST00000411734.1 |
AZGP1 |
alpha-2-glycoprotein 1, zinc-binding |
| chr1_-_9129895 | 0.96 |
ENST00000473209.1 |
SLC2A5 |
solute carrier family 2 (facilitated glucose/fructose transporter), member 5 |
| chr14_-_106733624 | 0.95 |
ENST00000390610.2 |
IGHV1-24 |
immunoglobulin heavy variable 1-24 |
| chr6_+_31895254 | 0.95 |
ENST00000299367.5 ENST00000442278.2 |
C2 |
complement component 2 |
| chr6_+_292051 | 0.95 |
ENST00000344450.5 |
DUSP22 |
dual specificity phosphatase 22 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.2 | 9.6 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
| 1.8 | 14.3 | GO:0016997 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) |
| 0.9 | 2.7 | GO:0035501 | MH1 domain binding(GO:0035501) |
| 0.7 | 2.1 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
| 0.6 | 13.6 | GO:0015929 | hexosaminidase activity(GO:0015929) |
| 0.6 | 2.6 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.6 | 2.6 | GO:0015180 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
| 0.5 | 1.6 | GO:0015439 | heme-transporting ATPase activity(GO:0015439) |
| 0.5 | 8.4 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.5 | 4.5 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.5 | 2.8 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.5 | 1.4 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.5 | 1.4 | GO:0005137 | interleukin-5 receptor binding(GO:0005137) |
| 0.4 | 4.4 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.4 | 1.8 | GO:0032145 | 4-aminobutyrate transaminase activity(GO:0003867) succinate-semialdehyde dehydrogenase binding(GO:0032145) (S)-3-amino-2-methylpropionate transaminase activity(GO:0047298) |
| 0.4 | 4.8 | GO:0051434 | BH3 domain binding(GO:0051434) |
| 0.4 | 1.7 | GO:0015184 | L-cystine transmembrane transporter activity(GO:0015184) |
| 0.4 | 1.6 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.4 | 1.6 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.4 | 1.1 | GO:0035500 | MH2 domain binding(GO:0035500) |
| 0.4 | 1.5 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 0.4 | 0.4 | GO:0001099 | basal transcription machinery binding(GO:0001098) basal RNA polymerase II transcription machinery binding(GO:0001099) |
| 0.4 | 1.5 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.3 | 1.0 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.3 | 1.3 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.3 | 7.1 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
| 0.3 | 1.6 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
| 0.3 | 1.3 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.3 | 0.9 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.3 | 0.9 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.3 | 1.5 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.3 | 4.9 | GO:0008484 | sulfuric ester hydrolase activity(GO:0008484) |
| 0.3 | 1.1 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
| 0.3 | 0.8 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.3 | 3.8 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.2 | 2.7 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.2 | 4.4 | GO:0048185 | activin binding(GO:0048185) |
| 0.2 | 0.7 | GO:0003980 | UDP-glucose:glycoprotein glucosyltransferase activity(GO:0003980) |
| 0.2 | 1.0 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.2 | 1.9 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.2 | 0.9 | GO:0008336 | gamma-butyrobetaine dioxygenase activity(GO:0008336) |
| 0.2 | 1.1 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.2 | 3.6 | GO:0016641 | oxidoreductase activity, acting on the CH-NH2 group of donors, oxygen as acceptor(GO:0016641) |
| 0.2 | 1.5 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
| 0.2 | 1.4 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
| 0.2 | 0.8 | GO:0019828 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) aspartic-type endopeptidase inhibitor activity(GO:0019828) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.2 | 0.6 | GO:0052810 | 1-phosphatidylinositol-5-kinase activity(GO:0052810) |
| 0.2 | 0.5 | GO:0061752 | telomeric repeat-containing RNA binding(GO:0061752) |
| 0.2 | 0.7 | GO:0008466 | glycogenin glucosyltransferase activity(GO:0008466) |
| 0.2 | 0.7 | GO:0061628 | H3K27me3 modified histone binding(GO:0061628) |
| 0.2 | 5.2 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.2 | 1.9 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.2 | 2.0 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.2 | 1.3 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.2 | 1.4 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
| 0.2 | 0.5 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
| 0.2 | 0.9 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
| 0.1 | 1.6 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.1 | 0.4 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.1 | 3.4 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.1 | 0.8 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
| 0.1 | 1.1 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.1 | 1.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.1 | 0.8 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
| 0.1 | 0.5 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
| 0.1 | 0.9 | GO:0030267 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.1 | 0.5 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 0.1 | 0.8 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
| 0.1 | 4.6 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.1 | 0.6 | GO:0047237 | glucuronylgalactosylproteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047237) |
| 0.1 | 0.7 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.1 | 1.6 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
| 0.1 | 1.3 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.1 | 2.5 | GO:0070001 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
| 0.1 | 2.6 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 0.1 | 0.3 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
| 0.1 | 2.3 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 0.1 | 0.7 | GO:0102337 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.1 | 1.1 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.1 | 1.8 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
| 0.1 | 0.3 | GO:0004103 | choline kinase activity(GO:0004103) |
| 0.1 | 0.3 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.1 | 5.0 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.1 | 0.3 | GO:0033867 | Fas-activated serine/threonine kinase activity(GO:0033867) |
| 0.1 | 0.5 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
| 0.1 | 1.1 | GO:0043225 | anion transmembrane-transporting ATPase activity(GO:0043225) |
| 0.1 | 1.3 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 0.1 | 9.6 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.1 | 0.4 | GO:0034057 | RNA strand-exchange activity(GO:0034057) |
| 0.1 | 0.5 | GO:0052740 | 1-acyl-2-lysophosphatidylserine acylhydrolase activity(GO:0052740) |
| 0.1 | 1.3 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.1 | 0.3 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
| 0.1 | 0.5 | GO:0030548 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
| 0.1 | 0.9 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.1 | 0.7 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.1 | 1.3 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.1 | 1.1 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.1 | 0.2 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.1 | 0.9 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.1 | 0.2 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) |
| 0.1 | 0.9 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
| 0.1 | 0.2 | GO:0034038 | deoxyhypusine synthase activity(GO:0034038) |
| 0.1 | 0.3 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
| 0.1 | 1.2 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.1 | 1.5 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
| 0.1 | 2.9 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.1 | 4.0 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.1 | 0.4 | GO:0017060 | 3-galactosyl-N-acetylglucosaminide 4-alpha-L-fucosyltransferase activity(GO:0017060) |
| 0.1 | 0.2 | GO:0043398 | HLH domain binding(GO:0043398) |
| 0.1 | 2.0 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.1 | 1.2 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.1 | 0.3 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.1 | 0.5 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.1 | 1.9 | GO:0001848 | complement binding(GO:0001848) |
| 0.1 | 1.6 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.1 | 0.3 | GO:0004461 | lactose synthase activity(GO:0004461) |
| 0.1 | 0.2 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.1 | 0.4 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.1 | 0.2 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.1 | 1.7 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.1 | 0.6 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.1 | 1.9 | GO:0015248 | sterol transporter activity(GO:0015248) |
| 0.1 | 0.6 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
| 0.1 | 0.7 | GO:0030247 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.1 | 0.2 | GO:0047708 | biotinidase activity(GO:0047708) |
| 0.1 | 4.0 | GO:0048365 | Rac GTPase binding(GO:0048365) |
| 0.1 | 4.0 | GO:0005507 | copper ion binding(GO:0005507) |
| 0.1 | 0.8 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.1 | 0.2 | GO:0070026 | cystathionine beta-synthase activity(GO:0004122) oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) nitrite reductase (NO-forming) activity(GO:0050421) carbon monoxide binding(GO:0070025) nitric oxide binding(GO:0070026) nitrite reductase activity(GO:0098809) |
| 0.1 | 0.6 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.1 | 0.9 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.1 | 3.0 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 0.1 | 5.2 | GO:0008013 | beta-catenin binding(GO:0008013) |
| 0.1 | 0.3 | GO:0015307 | drug:proton antiporter activity(GO:0015307) |
| 0.1 | 0.9 | GO:0031005 | filamin binding(GO:0031005) |
| 0.1 | 3.7 | GO:0004004 | ATP-dependent RNA helicase activity(GO:0004004) |
| 0.1 | 0.5 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
| 0.1 | 0.3 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.0 | 0.4 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 0.0 | 0.8 | GO:0034185 | apolipoprotein binding(GO:0034185) |
| 0.0 | 0.2 | GO:0004982 | N-formyl peptide receptor activity(GO:0004982) |
| 0.0 | 0.9 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.0 | 0.6 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 0.0 | 4.2 | GO:0001618 | virus receptor activity(GO:0001618) |
| 0.0 | 0.2 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
| 0.0 | 0.9 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.0 | 1.4 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
| 0.0 | 1.5 | GO:0005044 | scavenger receptor activity(GO:0005044) |
| 0.0 | 0.6 | GO:0005537 | mannose binding(GO:0005537) |
| 0.0 | 0.1 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.0 | 3.5 | GO:0051219 | phosphoprotein binding(GO:0051219) |
| 0.0 | 0.5 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.0 | 1.2 | GO:0016790 | thiolester hydrolase activity(GO:0016790) |
| 0.0 | 0.2 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.0 | 2.7 | GO:0016879 | ligase activity, forming carbon-nitrogen bonds(GO:0016879) |
| 0.0 | 0.9 | GO:0030276 | clathrin binding(GO:0030276) |
| 0.0 | 1.3 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
| 0.0 | 0.2 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.0 | 0.5 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.0 | 0.3 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.0 | 0.8 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.0 | 0.5 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
| 0.0 | 1.0 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.0 | 1.9 | GO:0098811 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
| 0.0 | 0.1 | GO:0019981 | interleukin-6 receptor activity(GO:0004915) interleukin-6 binding(GO:0019981) |
| 0.0 | 2.5 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.0 | 1.0 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.0 | 0.1 | GO:0004666 | prostaglandin-endoperoxide synthase activity(GO:0004666) |
| 0.0 | 0.6 | GO:0003924 | GTPase activity(GO:0003924) |
| 0.0 | 0.4 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.0 | 0.2 | GO:0000990 | transcription factor activity, core RNA polymerase binding(GO:0000990) |
| 0.0 | 0.5 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
| 0.0 | 0.1 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
| 0.0 | 2.0 | GO:0019843 | rRNA binding(GO:0019843) |
| 0.0 | 0.1 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
| 0.0 | 0.1 | GO:0052851 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
| 0.0 | 0.1 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
| 0.0 | 0.2 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.0 | 2.5 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
| 0.0 | 0.2 | GO:0004396 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.0 | 0.3 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.0 | 2.0 | GO:0030165 | PDZ domain binding(GO:0030165) |
| 0.0 | 0.1 | GO:0034584 | piRNA binding(GO:0034584) |
| 0.0 | 0.2 | GO:0003998 | acylphosphatase activity(GO:0003998) |
| 0.0 | 1.6 | GO:0050840 | extracellular matrix binding(GO:0050840) |
| 0.0 | 0.1 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
| 0.0 | 1.4 | GO:0070063 | RNA polymerase binding(GO:0070063) |
| 0.0 | 0.4 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.0 | 0.1 | GO:0070362 | mitochondrial light strand promoter anti-sense binding(GO:0070361) mitochondrial heavy strand promoter anti-sense binding(GO:0070362) mitochondrial heavy strand promoter sense binding(GO:0070364) |
| 0.0 | 0.1 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.0 | 0.5 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.0 | 0.2 | GO:0030020 | extracellular matrix structural constituent conferring tensile strength(GO:0030020) |
| 0.0 | 0.6 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.0 | 0.3 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.0 | 0.2 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.0 | 0.1 | GO:0051120 | hepoxilin A3 synthase activity(GO:0051120) |
| 0.0 | 0.9 | GO:0030507 | spectrin binding(GO:0030507) |
| 0.0 | 0.1 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.0 | 0.2 | GO:0035240 | dopamine binding(GO:0035240) |
| 0.0 | 0.4 | GO:0015485 | cholesterol binding(GO:0015485) |
| 0.0 | 2.6 | GO:0051082 | unfolded protein binding(GO:0051082) |
| 0.0 | 1.6 | GO:0046332 | SMAD binding(GO:0046332) |
| 0.0 | 0.1 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.0 | 0.1 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.0 | 0.1 | GO:0016160 | amylase activity(GO:0016160) |
| 0.0 | 0.4 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
| 0.0 | 0.3 | GO:0030331 | estrogen receptor binding(GO:0030331) |
| 0.0 | 0.2 | GO:0050780 | dopamine receptor binding(GO:0050780) |
| 0.0 | 0.0 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.0 | 0.2 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.0 | 0.1 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.0 | 0.2 | GO:0043548 | phosphatidylinositol 3-kinase binding(GO:0043548) |
| 0.0 | 0.6 | GO:0005158 | insulin receptor binding(GO:0005158) |
| 0.0 | 0.1 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
| 0.0 | 0.4 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.0 | 0.0 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.0 | 2.4 | GO:0001047 | core promoter binding(GO:0001047) |
| 0.0 | 0.1 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
| 0.0 | 0.0 | GO:0016781 | selenide, water dikinase activity(GO:0004756) phosphotransferase activity, paired acceptors(GO:0016781) |
| 0.0 | 0.1 | GO:0048018 | receptor agonist activity(GO:0048018) |
| 0.0 | 0.4 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.0 | 0.3 | GO:0046875 | ephrin receptor binding(GO:0046875) |
| 0.0 | 0.1 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
| 0.0 | 1.0 | GO:0003725 | double-stranded RNA binding(GO:0003725) |
| 0.0 | 0.4 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.0 | 0.9 | GO:0019003 | GDP binding(GO:0019003) |
| 0.0 | 0.1 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.1 | GO:0015171 | amino acid transmembrane transporter activity(GO:0015171) |
| 0.0 | 2.2 | GO:0005125 | cytokine activity(GO:0005125) |
| 0.0 | 0.1 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
| 0.0 | 0.3 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
| 0.0 | 0.1 | GO:0019215 | intermediate filament binding(GO:0019215) phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.0 | 0.2 | GO:0070402 | NADPH binding(GO:0070402) |
| 0.0 | 0.3 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.4 | 9.6 | GO:0002086 | maltose metabolic process(GO:0000023) diaphragm contraction(GO:0002086) |
| 1.9 | 5.6 | GO:2000393 | negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 1.6 | 4.9 | GO:0014022 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 1.6 | 4.8 | GO:1902445 | B cell negative selection(GO:0002352) post-embryonic camera-type eye morphogenesis(GO:0048597) apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) apoptotic process involved in embryonic digit morphogenesis(GO:1902263) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) positive regulation of apoptotic DNA fragmentation(GO:1902512) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
| 1.5 | 6.0 | GO:0043323 | regulation of natural killer cell degranulation(GO:0043321) positive regulation of natural killer cell degranulation(GO:0043323) |
| 1.4 | 12.9 | GO:1904715 | negative regulation of chaperone-mediated autophagy(GO:1904715) |
| 1.2 | 5.8 | GO:0002415 | immunoglobulin transcytosis in epithelial cells mediated by polymeric immunoglobulin receptor(GO:0002415) |
| 1.1 | 1.1 | GO:0050787 | detoxification of mercury ion(GO:0050787) |
| 1.1 | 7.7 | GO:0018158 | protein oxidation(GO:0018158) |
| 1.0 | 6.1 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
| 0.9 | 9.0 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.9 | 2.7 | GO:0035978 | mesodermal-endodermal cell signaling(GO:0003131) programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) histone H2A-S139 phosphorylation(GO:0035978) positive regulation of cellular response to X-ray(GO:2000685) |
| 0.7 | 2.1 | GO:0006788 | heme oxidation(GO:0006788) smooth muscle hyperplasia(GO:0014806) |
| 0.6 | 2.6 | GO:0015808 | L-alanine transport(GO:0015808) |
| 0.6 | 1.7 | GO:0061394 | regulation of transcription from RNA polymerase II promoter in response to arsenic-containing substance(GO:0061394) |
| 0.6 | 2.3 | GO:0035752 | lysosomal lumen pH elevation(GO:0035752) |
| 0.6 | 8.4 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
| 0.5 | 4.4 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.5 | 4.2 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 0.5 | 1.5 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.5 | 1.5 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
| 0.5 | 1.4 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
| 0.4 | 1.8 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
| 0.4 | 4.4 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.4 | 1.8 | GO:0061528 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) aspartate secretion(GO:0061528) regulation of aspartate secretion(GO:1904448) positive regulation of aspartate secretion(GO:1904450) |
| 0.4 | 2.6 | GO:0071873 | response to norepinephrine(GO:0071873) |
| 0.4 | 1.3 | GO:0061357 | positive regulation of Wnt protein secretion(GO:0061357) |
| 0.4 | 1.3 | GO:0061227 | apoptotic process involved in endocardial cushion morphogenesis(GO:0003277) intermediate mesoderm development(GO:0048389) intermediate mesoderm morphogenesis(GO:0048390) intermediate mesoderm formation(GO:0048391) intermediate mesodermal cell differentiation(GO:0048392) regulation of cardiac muscle fiber development(GO:0055018) positive regulation of cardiac muscle fiber development(GO:0055020) bud dilation involved in lung branching(GO:0060503) regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) BMP signaling pathway involved in ureter morphogenesis(GO:0061149) renal system segmentation(GO:0061150) BMP signaling pathway involved in renal system segmentation(GO:0061151) pulmonary artery endothelial tube morphogenesis(GO:0061155) regulation of transcription from RNA polymerase II promoter involved in mesonephros development(GO:0061216) pattern specification involved in mesonephros development(GO:0061227) BMP signaling pathway involved in nephric duct formation(GO:0071893) negative regulation of branch elongation involved in ureteric bud branching(GO:0072096) negative regulation of branch elongation involved in ureteric bud branching by BMP signaling pathway(GO:0072097) anterior/posterior pattern specification involved in kidney development(GO:0072098) anterior/posterior pattern specification involved in ureteric bud development(GO:0072099) specification of ureteric bud anterior/posterior symmetry(GO:0072100) specification of ureteric bud anterior/posterior symmetry by BMP signaling pathway(GO:0072101) ureter epithelial cell differentiation(GO:0072192) negative regulation of mesenchymal cell proliferation involved in ureter development(GO:0072200) positive regulation of cell proliferation involved in outflow tract morphogenesis(GO:1901964) cardiac jelly development(GO:1905072) regulation of metanephric S-shaped body morphogenesis(GO:2000004) negative regulation of metanephric S-shaped body morphogenesis(GO:2000005) regulation of metanephric comma-shaped body morphogenesis(GO:2000006) negative regulation of metanephric comma-shaped body morphogenesis(GO:2000007) |
| 0.4 | 1.7 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
| 0.4 | 2.1 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
| 0.4 | 1.7 | GO:0015811 | L-cystine transport(GO:0015811) |
| 0.4 | 2.0 | GO:1900063 | regulation of peroxisome organization(GO:1900063) |
| 0.4 | 7.3 | GO:0042340 | keratan sulfate catabolic process(GO:0042340) |
| 0.4 | 2.3 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.4 | 1.5 | GO:0006208 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
| 0.4 | 1.1 | GO:0060535 | trachea cartilage morphogenesis(GO:0060535) |
| 0.4 | 2.2 | GO:1902998 | macrophage proliferation(GO:0061517) microglial cell proliferation(GO:0061518) regulation of neuronal signal transduction(GO:1902847) positive regulation of neurofibrillary tangle assembly(GO:1902998) |
| 0.3 | 1.0 | GO:0061055 | myotome development(GO:0061055) |
| 0.3 | 1.4 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
| 0.3 | 1.6 | GO:0033274 | response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.3 | 3.1 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
| 0.3 | 0.9 | GO:1903542 | negative regulation of exosomal secretion(GO:1903542) |
| 0.3 | 1.2 | GO:1905123 | regulation of endosome organization(GO:1904978) regulation of glucosylceramidase activity(GO:1905123) |
| 0.3 | 1.2 | GO:1903224 | regulation of endodermal cell differentiation(GO:1903224) |
| 0.3 | 0.9 | GO:0003285 | septum secundum development(GO:0003285) |
| 0.3 | 3.5 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.3 | 8.4 | GO:0006884 | cell volume homeostasis(GO:0006884) |
| 0.3 | 0.9 | GO:0006258 | UDP-glucose catabolic process(GO:0006258) galactose catabolic process via UDP-galactose(GO:0033499) |
| 0.3 | 1.7 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.3 | 2.0 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
| 0.3 | 1.1 | GO:1901804 | glucosylceramide catabolic process(GO:0006680) termination of signal transduction(GO:0023021) beta-glucoside metabolic process(GO:1901804) beta-glucoside catabolic process(GO:1901805) positive regulation of neuronal action potential(GO:1904457) |
| 0.3 | 0.8 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 0.3 | 0.8 | GO:0043317 | regulation of cytotoxic T cell degranulation(GO:0043317) negative regulation of cytotoxic T cell degranulation(GO:0043318) insulin catabolic process(GO:1901143) |
| 0.3 | 3.3 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.3 | 0.5 | GO:1903936 | response to sodium arsenite(GO:1903935) cellular response to sodium arsenite(GO:1903936) |
| 0.3 | 0.8 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
| 0.3 | 0.5 | GO:1902568 | positive regulation of eosinophil degranulation(GO:0043311) positive regulation of eosinophil activation(GO:1902568) |
| 0.3 | 0.8 | GO:0035606 | induction of programmed cell death(GO:0012502) peptidyl-cysteine S-trans-nitrosylation(GO:0035606) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) |
| 0.3 | 3.3 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.3 | 2.0 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
| 0.2 | 0.7 | GO:0048203 | vesicle targeting, trans-Golgi to endosome(GO:0048203) |
| 0.2 | 0.7 | GO:0097359 | UDP-glucosylation(GO:0097359) |
| 0.2 | 1.2 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) |
| 0.2 | 0.9 | GO:0006893 | Golgi to plasma membrane transport(GO:0006893) |
| 0.2 | 2.4 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
| 0.2 | 1.5 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.2 | 0.2 | GO:0040019 | positive regulation of embryonic development(GO:0040019) |
| 0.2 | 1.0 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
| 0.2 | 1.2 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
| 0.2 | 1.9 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.2 | 1.3 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) |
| 0.2 | 0.6 | GO:0060086 | circadian temperature homeostasis(GO:0060086) |
| 0.2 | 1.5 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
| 0.2 | 1.1 | GO:0002501 | peptide antigen assembly with MHC protein complex(GO:0002501) |
| 0.2 | 0.2 | GO:1903056 | regulation of melanosome organization(GO:1903056) |
| 0.2 | 1.8 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.2 | 0.7 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.2 | 1.4 | GO:1903874 | ferrous iron transport(GO:0015684) ferrous iron transmembrane transport(GO:1903874) |
| 0.2 | 1.6 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
| 0.2 | 1.2 | GO:0006489 | dolichyl diphosphate biosynthetic process(GO:0006489) dolichyl diphosphate metabolic process(GO:0046465) |
| 0.2 | 1.2 | GO:0090204 | protein localization to nuclear pore(GO:0090204) |
| 0.2 | 1.7 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.2 | 0.9 | GO:1903564 | regulation of protein localization to cilium(GO:1903564) |
| 0.2 | 0.5 | GO:1904247 | positive regulation of polynucleotide adenylyltransferase activity(GO:1904247) |
| 0.2 | 0.5 | GO:0061624 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) |
| 0.2 | 2.6 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
| 0.2 | 0.5 | GO:0060592 | mammary gland formation(GO:0060592) |
| 0.2 | 0.5 | GO:1903697 | negative regulation of microvillus assembly(GO:1903697) |
| 0.2 | 0.8 | GO:0050428 | purine ribonucleoside bisphosphate biosynthetic process(GO:0034036) 3'-phosphoadenosine 5'-phosphosulfate biosynthetic process(GO:0050428) |
| 0.2 | 0.5 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.2 | 2.8 | GO:0050812 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) regulation of acyl-CoA biosynthetic process(GO:0050812) |
| 0.2 | 0.6 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.2 | 0.8 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.2 | 0.8 | GO:0090650 | rRNA transport(GO:0051029) response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
| 0.2 | 2.4 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
| 0.1 | 0.3 | GO:0051031 | tRNA export from nucleus(GO:0006409) tRNA transport(GO:0051031) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.1 | 0.9 | GO:0070560 | protein secretion by platelet(GO:0070560) |
| 0.1 | 0.4 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 | 1.3 | GO:0009414 | response to water deprivation(GO:0009414) |
| 0.1 | 1.0 | GO:0042415 | norepinephrine metabolic process(GO:0042415) surfactant homeostasis(GO:0043129) |
| 0.1 | 1.0 | GO:1990253 | cellular response to leucine starvation(GO:1990253) |
| 0.1 | 0.6 | GO:1902954 | regulation of early endosome to recycling endosome transport(GO:1902954) |
| 0.1 | 1.6 | GO:0015886 | heme transport(GO:0015886) |
| 0.1 | 0.1 | GO:0002188 | translation reinitiation(GO:0002188) |
| 0.1 | 1.1 | GO:0060449 | bud elongation involved in lung branching(GO:0060449) |
| 0.1 | 0.7 | GO:0036369 | transcription factor catabolic process(GO:0036369) |
| 0.1 | 0.4 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.1 | 0.8 | GO:0034372 | very-low-density lipoprotein particle remodeling(GO:0034372) |
| 0.1 | 1.1 | GO:0035986 | senescence-associated heterochromatin focus assembly(GO:0035986) |
| 0.1 | 0.3 | GO:2000854 | positive regulation of corticosterone secretion(GO:2000854) |
| 0.1 | 0.9 | GO:0046549 | retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
| 0.1 | 0.3 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.1 | 3.4 | GO:0006491 | N-glycan processing(GO:0006491) |
| 0.1 | 0.6 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
| 0.1 | 0.1 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.1 | 0.5 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
| 0.1 | 0.6 | GO:1990034 | calcium ion export from cell(GO:1990034) |
| 0.1 | 3.1 | GO:0030220 | platelet formation(GO:0030220) |
| 0.1 | 0.5 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.1 | 0.3 | GO:0006286 | base-excision repair, base-free sugar-phosphate removal(GO:0006286) |
| 0.1 | 0.6 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
| 0.1 | 0.5 | GO:0043335 | protein unfolding(GO:0043335) |
| 0.1 | 2.8 | GO:0007567 | parturition(GO:0007567) |
| 0.1 | 0.4 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
| 0.1 | 0.7 | GO:0034625 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.1 | 2.5 | GO:0003334 | keratinocyte development(GO:0003334) |
| 0.1 | 1.6 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.1 | 1.2 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
| 0.1 | 0.3 | GO:0001207 | histone displacement(GO:0001207) regulation of transcription involved in meiotic cell cycle(GO:0051037) positive regulation of transcription involved in meiotic cell cycle(GO:0051039) |
| 0.1 | 1.8 | GO:0043485 | endosome to melanosome transport(GO:0035646) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
| 0.1 | 0.8 | GO:0030043 | actin filament fragmentation(GO:0030043) |
| 0.1 | 1.6 | GO:0016042 | lipid catabolic process(GO:0016042) |
| 0.1 | 0.3 | GO:1900075 | regulation of neuromuscular synaptic transmission(GO:1900073) positive regulation of neuromuscular synaptic transmission(GO:1900075) |
| 0.1 | 1.2 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
| 0.1 | 0.3 | GO:0002752 | leukocyte chemotaxis involved in inflammatory response(GO:0002232) cell surface pattern recognition receptor signaling pathway(GO:0002752) |
| 0.1 | 2.6 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
| 0.1 | 0.6 | GO:0006824 | cobalt ion transport(GO:0006824) |
| 0.1 | 0.9 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.1 | 1.5 | GO:0006558 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
| 0.1 | 0.3 | GO:0042727 | flavin-containing compound biosynthetic process(GO:0042727) |
| 0.1 | 0.7 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
| 0.1 | 1.0 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.1 | 0.6 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
| 0.1 | 0.3 | GO:0034201 | response to oleic acid(GO:0034201) |
| 0.1 | 0.3 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
| 0.1 | 0.5 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
| 0.1 | 0.8 | GO:0006069 | ethanol oxidation(GO:0006069) |
| 0.1 | 0.4 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
| 0.1 | 0.9 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.1 | 0.4 | GO:1905244 | regulation of modification of synaptic structure(GO:1905244) |
| 0.1 | 2.4 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
| 0.1 | 0.8 | GO:0045617 | negative regulation of keratinocyte differentiation(GO:0045617) |
| 0.1 | 0.5 | GO:0010641 | positive regulation of platelet-derived growth factor receptor signaling pathway(GO:0010641) |
| 0.1 | 2.1 | GO:0051447 | negative regulation of meiotic cell cycle(GO:0051447) |
| 0.1 | 0.9 | GO:0040034 | regulation of development, heterochronic(GO:0040034) regulation of timing of cell differentiation(GO:0048505) |
| 0.1 | 4.8 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
| 0.1 | 4.4 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.1 | 3.4 | GO:0006699 | bile acid biosynthetic process(GO:0006699) |
| 0.1 | 0.7 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
| 0.1 | 1.6 | GO:0042921 | glucocorticoid receptor signaling pathway(GO:0042921) |
| 0.1 | 1.3 | GO:0000338 | protein deneddylation(GO:0000338) |
| 0.1 | 0.6 | GO:0000724 | double-strand break repair via homologous recombination(GO:0000724) recombinational repair(GO:0000725) |
| 0.1 | 1.6 | GO:0032012 | regulation of ARF protein signal transduction(GO:0032012) |
| 0.1 | 0.6 | GO:0090063 | positive regulation of microtubule nucleation(GO:0090063) |
| 0.1 | 0.5 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) |
| 0.1 | 0.2 | GO:1901526 | positive regulation of macromitophagy(GO:1901526) regulation of mitophagy in response to mitochondrial depolarization(GO:1904923) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
| 0.1 | 0.6 | GO:0002759 | regulation of antimicrobial humoral response(GO:0002759) |
| 0.1 | 0.5 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.1 | 1.4 | GO:0050775 | positive regulation of dendrite morphogenesis(GO:0050775) |
| 0.1 | 1.6 | GO:1900363 | regulation of mRNA polyadenylation(GO:1900363) |
| 0.1 | 2.5 | GO:0048286 | lung alveolus development(GO:0048286) |
| 0.1 | 0.7 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.1 | 0.1 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
| 0.1 | 5.9 | GO:0046324 | regulation of glucose import(GO:0046324) |
| 0.1 | 0.8 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 0.1 | 0.5 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
| 0.1 | 0.2 | GO:0048200 | COPI-coated vesicle budding(GO:0035964) Golgi transport vesicle coating(GO:0048200) COPI coating of Golgi vesicle(GO:0048205) |
| 0.1 | 0.5 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
| 0.1 | 2.1 | GO:0007040 | lysosome organization(GO:0007040) lytic vacuole organization(GO:0080171) |
| 0.1 | 0.6 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.1 | 3.9 | GO:0006953 | acute-phase response(GO:0006953) |
| 0.1 | 0.3 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
| 0.1 | 1.3 | GO:0045672 | positive regulation of osteoclast differentiation(GO:0045672) |
| 0.1 | 0.3 | GO:2000254 | regulation of male germ cell proliferation(GO:2000254) negative regulation of male germ cell proliferation(GO:2000255) |
| 0.1 | 0.3 | GO:1904977 | lymphatic endothelial cell migration(GO:1904977) |
| 0.1 | 0.5 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
| 0.1 | 1.2 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
| 0.1 | 0.2 | GO:0001973 | adenosine receptor signaling pathway(GO:0001973) G-protein coupled purinergic receptor signaling pathway(GO:0035588) |
| 0.1 | 0.2 | GO:0006535 | cysteine biosynthetic process from serine(GO:0006535) |
| 0.1 | 0.3 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
| 0.1 | 0.3 | GO:0046618 | drug export(GO:0046618) |
| 0.1 | 0.3 | GO:0043550 | regulation of lipid kinase activity(GO:0043550) |
| 0.1 | 0.9 | GO:0061049 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.1 | 1.1 | GO:0060441 | epithelial tube branching involved in lung morphogenesis(GO:0060441) |
| 0.1 | 1.2 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.1 | 0.3 | GO:0016240 | autophagosome docking(GO:0016240) |
| 0.1 | 0.8 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
| 0.1 | 0.3 | GO:0021546 | rhombomere development(GO:0021546) |
| 0.1 | 0.2 | GO:0050760 | negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
| 0.0 | 0.1 | GO:0060265 | positive regulation of respiratory burst involved in inflammatory response(GO:0060265) |
| 0.0 | 1.1 | GO:0010669 | epithelial structure maintenance(GO:0010669) |
| 0.0 | 0.2 | GO:0010793 | regulation of mRNA export from nucleus(GO:0010793) |
| 0.0 | 0.2 | GO:1902430 | negative regulation of beta-amyloid formation(GO:1902430) |
| 0.0 | 0.2 | GO:1904327 | protein localization to cytosolic proteasome complex(GO:1904327) protein localization to cytosolic proteasome complex involved in ERAD pathway(GO:1904379) |
| 0.0 | 0.2 | GO:0032898 | nerve growth factor processing(GO:0032455) neurotrophin production(GO:0032898) |
| 0.0 | 0.3 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
| 0.0 | 0.2 | GO:0046203 | spermidine catabolic process(GO:0046203) |
| 0.0 | 0.4 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
| 0.0 | 0.6 | GO:0071285 | cellular response to lithium ion(GO:0071285) |
| 0.0 | 0.4 | GO:0042693 | muscle cell fate commitment(GO:0042693) |
| 0.0 | 0.5 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
| 0.0 | 0.5 | GO:0031953 | negative regulation of protein autophosphorylation(GO:0031953) |
| 0.0 | 0.3 | GO:0042908 | xenobiotic transport(GO:0042908) |
| 0.0 | 0.4 | GO:2000781 | positive regulation of double-strand break repair(GO:2000781) |
| 0.0 | 0.6 | GO:0043586 | tongue development(GO:0043586) |
| 0.0 | 1.4 | GO:0008045 | motor neuron axon guidance(GO:0008045) |
| 0.0 | 0.2 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.0 | 0.4 | GO:0019317 | fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
| 0.0 | 0.2 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.0 | 0.1 | GO:1904578 | response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) response to hypobaric hypoxia(GO:1990910) |
| 0.0 | 0.5 | GO:0051085 | chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.0 | 0.2 | GO:0035879 | plasma membrane lactate transport(GO:0035879) |
| 0.0 | 0.2 | GO:0060539 | diaphragm development(GO:0060539) |
| 0.0 | 0.5 | GO:1901748 | leukotriene D4 metabolic process(GO:1901748) leukotriene D4 biosynthetic process(GO:1901750) |
| 0.0 | 2.5 | GO:0045071 | negative regulation of viral genome replication(GO:0045071) |
| 0.0 | 0.3 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
| 0.0 | 0.1 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.0 | 0.1 | GO:0070459 | prolactin secretion(GO:0070459) |
| 0.0 | 0.6 | GO:0016264 | gap junction assembly(GO:0016264) |
| 0.0 | 2.9 | GO:0042795 | snRNA transcription(GO:0009301) snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.0 | 0.1 | GO:0042539 | hypotonic salinity response(GO:0042539) cellular hypotonic salinity response(GO:0071477) |
| 0.0 | 1.6 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
| 0.0 | 1.1 | GO:1903393 | positive regulation of focal adhesion assembly(GO:0051894) positive regulation of adherens junction organization(GO:1903393) |
| 0.0 | 0.1 | GO:0060279 | regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
| 0.0 | 1.2 | GO:0097178 | ruffle assembly(GO:0097178) |
| 0.0 | 1.1 | GO:0048009 | insulin-like growth factor receptor signaling pathway(GO:0048009) |
| 0.0 | 0.3 | GO:0019695 | choline metabolic process(GO:0019695) |
| 0.0 | 0.3 | GO:0043401 | steroid hormone mediated signaling pathway(GO:0043401) |
| 0.0 | 0.5 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.0 | 0.5 | GO:0043982 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
| 0.0 | 0.2 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.0 | 0.1 | GO:0015677 | copper ion import(GO:0015677) |
| 0.0 | 0.2 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.0 | 0.1 | GO:0048698 | negative regulation of collateral sprouting in absence of injury(GO:0048698) |
| 0.0 | 0.4 | GO:0006939 | smooth muscle contraction(GO:0006939) |
| 0.0 | 0.4 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.0 | 0.1 | GO:0007270 | neuron-neuron synaptic transmission(GO:0007270) |
| 0.0 | 0.1 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
| 0.0 | 0.1 | GO:0051611 | negative regulation of neurotransmitter uptake(GO:0051581) serotonin uptake(GO:0051610) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.0 | 0.1 | GO:0021903 | rostrocaudal neural tube patterning(GO:0021903) |
| 0.0 | 0.3 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
| 0.0 | 0.1 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
| 0.0 | 0.3 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
| 0.0 | 0.0 | GO:0035376 | sterol import(GO:0035376) cholesterol import(GO:0070508) |
| 0.0 | 0.3 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
| 0.0 | 0.4 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.0 | 0.5 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.0 | 0.2 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
| 0.0 | 2.1 | GO:0030574 | collagen catabolic process(GO:0030574) |
| 0.0 | 0.8 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.0 | 0.2 | GO:0031647 | regulation of protein stability(GO:0031647) |
| 0.0 | 0.1 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
| 0.0 | 0.6 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.0 | 1.1 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
| 0.0 | 0.1 | GO:0070407 | oxidation-dependent protein catabolic process(GO:0070407) |
| 0.0 | 0.1 | GO:1904616 | regulation of actin filament binding(GO:1904529) negative regulation of actin filament binding(GO:1904530) regulation of actin binding(GO:1904616) negative regulation of actin binding(GO:1904617) |
| 0.0 | 0.7 | GO:0071625 | vocalization behavior(GO:0071625) |
| 0.0 | 1.4 | GO:0005978 | glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
| 0.0 | 0.1 | GO:0030222 | eosinophil differentiation(GO:0030222) |
| 0.0 | 0.2 | GO:0021603 | cranial nerve formation(GO:0021603) |
| 0.0 | 1.3 | GO:0019915 | lipid storage(GO:0019915) |
| 0.0 | 0.3 | GO:0090190 | positive regulation of mesonephros development(GO:0061213) positive regulation of branching involved in ureteric bud morphogenesis(GO:0090190) |
| 0.0 | 0.6 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 | 0.1 | GO:0006050 | mannosamine metabolic process(GO:0006050) N-acetylmannosamine metabolic process(GO:0006051) |
| 0.0 | 0.1 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
| 0.0 | 0.3 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.0 | 0.7 | GO:0097421 | liver regeneration(GO:0097421) |
| 0.0 | 0.3 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
| 0.0 | 0.2 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
| 0.0 | 0.4 | GO:0060999 | positive regulation of dendritic spine development(GO:0060999) |
| 0.0 | 0.4 | GO:0090023 | positive regulation of neutrophil chemotaxis(GO:0090023) |
| 0.0 | 0.9 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
| 0.0 | 0.1 | GO:0044861 | protein transport into plasma membrane raft(GO:0044861) |
| 0.0 | 0.3 | GO:0019372 | lipoxygenase pathway(GO:0019372) |
| 0.0 | 0.1 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.0 | 0.1 | GO:0032679 | antigen processing and presentation of peptide antigen via MHC class Ib(GO:0002428) antigen processing and presentation of endogenous peptide antigen via MHC class Ib(GO:0002476) TRAIL production(GO:0032639) regulation of TRAIL production(GO:0032679) positive regulation of TRAIL production(GO:0032759) protection from natural killer cell mediated cytotoxicity(GO:0042270) positive regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000566) |
| 0.0 | 0.1 | GO:0007538 | primary sex determination(GO:0007538) |
| 0.0 | 0.5 | GO:1904376 | negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
| 0.0 | 0.1 | GO:0007198 | adenylate cyclase-inhibiting serotonin receptor signaling pathway(GO:0007198) |
| 0.0 | 0.1 | GO:0046689 | response to mercury ion(GO:0046689) |
| 0.0 | 2.2 | GO:0007224 | smoothened signaling pathway(GO:0007224) |
| 0.0 | 0.1 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
| 0.0 | 0.4 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.0 | 0.2 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.0 | 0.1 | GO:0021514 | ventral spinal cord interneuron differentiation(GO:0021514) |
| 0.0 | 0.2 | GO:0033344 | cholesterol efflux(GO:0033344) |
| 0.0 | 0.1 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.0 | 0.6 | GO:0006921 | cellular component disassembly involved in execution phase of apoptosis(GO:0006921) apoptotic nuclear changes(GO:0030262) |
| 0.0 | 0.1 | GO:0032007 | negative regulation of TOR signaling(GO:0032007) |
| 0.0 | 0.2 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 0.0 | 0.1 | GO:0009386 | translational attenuation(GO:0009386) |
| 0.0 | 0.2 | GO:0060009 | Sertoli cell development(GO:0060009) |
| 0.0 | 0.1 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.0 | 0.3 | GO:1901798 | positive regulation of signal transduction by p53 class mediator(GO:1901798) |
| 0.0 | 0.1 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.0 | 0.3 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.0 | 0.1 | GO:0035965 | cardiolipin acyl-chain remodeling(GO:0035965) |
| 0.0 | 0.2 | GO:0048706 | embryonic skeletal system development(GO:0048706) |
| 0.0 | 0.8 | GO:0051865 | protein autoubiquitination(GO:0051865) |
| 0.0 | 0.2 | GO:0006768 | biotin metabolic process(GO:0006768) |
| 0.0 | 0.6 | GO:0018279 | protein N-linked glycosylation via asparagine(GO:0018279) |
| 0.0 | 0.4 | GO:0042339 | keratan sulfate metabolic process(GO:0042339) |
| 0.0 | 0.1 | GO:0036414 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
| 0.0 | 0.0 | GO:0044791 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
| 0.0 | 0.1 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.0 | 0.0 | GO:0035509 | negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.0 | 0.1 | GO:0060742 | epithelial cell differentiation involved in prostate gland development(GO:0060742) |
| 0.0 | 0.2 | GO:0001696 | gastric acid secretion(GO:0001696) |
| 0.0 | 0.6 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
| 0.0 | 0.2 | GO:0010762 | regulation of fibroblast migration(GO:0010762) |
| 0.0 | 0.1 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) |
| 0.0 | 0.3 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
| 0.0 | 0.0 | GO:0010626 | regulation of Schwann cell proliferation(GO:0010624) negative regulation of Schwann cell proliferation(GO:0010626) spongiotrophoblast differentiation(GO:0060708) |
| 0.0 | 0.4 | GO:0009268 | response to pH(GO:0009268) |
| 0.0 | 0.1 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.0 | 0.7 | GO:0048477 | oogenesis(GO:0048477) |
| 0.0 | 0.6 | GO:0031102 | neuron projection regeneration(GO:0031102) |
| 0.0 | 0.3 | GO:0035025 | positive regulation of Rho protein signal transduction(GO:0035025) |
| 0.0 | 0.6 | GO:0030818 | negative regulation of cAMP biosynthetic process(GO:0030818) |
| 0.0 | 0.1 | GO:0007000 | nucleolus organization(GO:0007000) |
| 0.0 | 0.1 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.0 | 0.3 | GO:0042573 | retinoic acid metabolic process(GO:0042573) |
| 0.0 | 0.1 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
| 0.0 | 0.3 | GO:0006636 | unsaturated fatty acid biosynthetic process(GO:0006636) |
| 0.0 | 0.1 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
| 0.0 | 0.3 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
| 0.0 | 0.1 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.0 | 2.6 | GO:0006457 | protein folding(GO:0006457) |
| 0.0 | 0.0 | GO:0019605 | benzoate metabolic process(GO:0018874) butyrate metabolic process(GO:0019605) |
| 0.0 | 0.7 | GO:0048024 | regulation of mRNA splicing, via spliceosome(GO:0048024) |
| 0.0 | 0.4 | GO:0050909 | sensory perception of taste(GO:0050909) |
| 0.0 | 0.6 | GO:0030032 | lamellipodium assembly(GO:0030032) |
| 0.0 | 0.1 | GO:0045329 | amino-acid betaine biosynthetic process(GO:0006578) carnitine biosynthetic process(GO:0045329) |
| 0.0 | 0.1 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.0 | 0.3 | GO:0015804 | neutral amino acid transport(GO:0015804) |
| 0.0 | 0.1 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.0 | 0.2 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.6 | 4.9 | GO:0071745 | IgA immunoglobulin complex(GO:0071745) IgA immunoglobulin complex, circulating(GO:0071746) monomeric IgA immunoglobulin complex(GO:0071748) polymeric IgA immunoglobulin complex(GO:0071749) secretory IgA immunoglobulin complex(GO:0071751) |
| 1.0 | 7.8 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 0.9 | 6.3 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.8 | 4.0 | GO:0034688 | integrin alphaM-beta2 complex(GO:0034688) |
| 0.6 | 4.8 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.6 | 1.7 | GO:0097180 | protein C inhibitor-TMPRSS7 complex(GO:0036024) protein C inhibitor-TMPRSS11E complex(GO:0036025) protein C inhibitor-PLAT complex(GO:0036026) protein C inhibitor-PLAU complex(GO:0036027) protein C inhibitor-thrombin complex(GO:0036028) protein C inhibitor-KLK3 complex(GO:0036029) protein C inhibitor-plasma kallikrein complex(GO:0036030) serine protease inhibitor complex(GO:0097180) protein C inhibitor-coagulation factor V complex(GO:0097181) protein C inhibitor-coagulation factor Xa complex(GO:0097182) protein C inhibitor-coagulation factor XI complex(GO:0097183) |
| 0.5 | 11.4 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.5 | 5.6 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.4 | 1.7 | GO:1990031 | pinceau fiber(GO:1990031) |
| 0.4 | 6.7 | GO:0042627 | chylomicron(GO:0042627) |
| 0.4 | 17.4 | GO:0042571 | immunoglobulin complex(GO:0019814) immunoglobulin complex, circulating(GO:0042571) |
| 0.3 | 1.4 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.3 | 2.0 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.3 | 6.0 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.3 | 2.3 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.3 | 2.9 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
| 0.3 | 0.9 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.3 | 3.9 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.3 | 4.6 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.3 | 0.8 | GO:0031251 | PAN complex(GO:0031251) |
| 0.2 | 1.4 | GO:0030893 | meiotic cohesin complex(GO:0030893) |
| 0.2 | 1.7 | GO:0043196 | varicosity(GO:0043196) |
| 0.2 | 0.7 | GO:0060187 | cell pole(GO:0060187) |
| 0.2 | 1.8 | GO:0045179 | apical cortex(GO:0045179) |
| 0.2 | 0.9 | GO:0034669 | integrin alpha4-beta7 complex(GO:0034669) |
| 0.2 | 0.6 | GO:0030689 | Noc complex(GO:0030689) |
| 0.2 | 1.2 | GO:0042825 | TAP complex(GO:0042825) |
| 0.2 | 0.5 | GO:0010370 | perinucleolar chromocenter(GO:0010370) |
| 0.2 | 3.4 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.2 | 2.8 | GO:0031095 | platelet dense tubular network membrane(GO:0031095) |
| 0.2 | 3.0 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.2 | 2.2 | GO:0060293 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
| 0.2 | 1.1 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.1 | 1.0 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.1 | 0.6 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.1 | 0.6 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 0.1 | 2.9 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.1 | 0.6 | GO:0000799 | nuclear condensin complex(GO:0000799) |
| 0.1 | 0.7 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.1 | 3.0 | GO:0031105 | septin complex(GO:0031105) |
| 0.1 | 1.0 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.1 | 1.1 | GO:0016013 | syntrophin complex(GO:0016013) |
| 0.1 | 0.6 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
| 0.1 | 1.6 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.1 | 1.5 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.1 | 0.9 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.1 | 0.4 | GO:0000811 | GINS complex(GO:0000811) |
| 0.1 | 0.3 | GO:0045293 | MIS complex(GO:0036396) mRNA editing complex(GO:0045293) |
| 0.1 | 0.4 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.1 | 0.4 | GO:0070369 | beta-catenin-TCF7L2 complex(GO:0070369) |
| 0.1 | 0.8 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.1 | 1.8 | GO:0097342 | ripoptosome(GO:0097342) |
| 0.1 | 1.2 | GO:0044447 | axoneme part(GO:0044447) |
| 0.1 | 1.2 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.1 | 2.6 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.1 | 1.2 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.1 | 0.7 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.1 | 3.6 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.1 | 0.3 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.1 | 5.1 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.1 | 0.3 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| 0.1 | 0.4 | GO:0032009 | early phagosome(GO:0032009) |
| 0.1 | 0.4 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.1 | 0.4 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.1 | 0.2 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.1 | 0.2 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.1 | 2.0 | GO:0030673 | axolemma(GO:0030673) |
| 0.1 | 0.3 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.1 | 0.5 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.1 | 0.4 | GO:0005771 | multivesicular body(GO:0005771) |
| 0.1 | 0.6 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.1 | 0.2 | GO:0070195 | growth hormone receptor complex(GO:0070195) |
| 0.1 | 1.4 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.1 | 0.9 | GO:0000145 | exocyst(GO:0000145) |
| 0.1 | 0.3 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.1 | 1.0 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
| 0.1 | 0.4 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.1 | 0.3 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.1 | 3.0 | GO:0016235 | aggresome(GO:0016235) |
| 0.1 | 1.4 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.1 | 0.6 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.1 | 0.3 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.1 | 0.4 | GO:0035976 | AP1 complex(GO:0035976) |
| 0.1 | 0.2 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.1 | 0.2 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.1 | 0.4 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.1 | 0.4 | GO:0032010 | phagolysosome(GO:0032010) |
| 0.1 | 0.8 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.1 | 2.2 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.0 | 0.4 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.0 | 0.4 | GO:0032039 | integrator complex(GO:0032039) |
| 0.0 | 0.2 | GO:0017102 | methionyl glutamyl tRNA synthetase complex(GO:0017102) |
| 0.0 | 0.2 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.0 | 0.2 | GO:0032280 | symmetric synapse(GO:0032280) |
| 0.0 | 0.2 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.0 | 0.7 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.0 | 4.6 | GO:0031093 | platelet alpha granule lumen(GO:0031093) |
| 0.0 | 0.6 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.0 | 0.2 | GO:0032021 | NELF complex(GO:0032021) |
| 0.0 | 0.2 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.0 | 0.2 | GO:0089701 | U2AF(GO:0089701) |
| 0.0 | 0.7 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.0 | 0.2 | GO:1990393 | 3M complex(GO:1990393) |
| 0.0 | 0.1 | GO:0031417 | NatC complex(GO:0031417) |
| 0.0 | 2.2 | GO:0005902 | microvillus(GO:0005902) |
| 0.0 | 0.2 | GO:0009368 | endopeptidase Clp complex(GO:0009368) |
| 0.0 | 0.2 | GO:0070821 | tertiary granule membrane(GO:0070821) |
| 0.0 | 0.4 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.0 | 3.3 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.0 | 1.7 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
| 0.0 | 9.2 | GO:0009897 | external side of plasma membrane(GO:0009897) |
| 0.0 | 0.1 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
| 0.0 | 0.1 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.0 | 0.2 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
| 0.0 | 0.4 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.0 | 0.2 | GO:1990769 | proximal neuron projection(GO:1990769) |
| 0.0 | 2.0 | GO:0016324 | apical plasma membrane(GO:0016324) |
| 0.0 | 0.3 | GO:0010369 | chromocenter(GO:0010369) |
| 0.0 | 0.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.0 | 0.1 | GO:1990357 | terminal web(GO:1990357) |
| 0.0 | 2.5 | GO:0035579 | specific granule membrane(GO:0035579) |
| 0.0 | 1.5 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.0 | 0.3 | GO:0033018 | sarcoplasmic reticulum lumen(GO:0033018) |
| 0.0 | 0.5 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
| 0.0 | 0.2 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.0 | 0.2 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.0 | 0.3 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.0 | 3.7 | GO:0072562 | blood microparticle(GO:0072562) |
| 0.0 | 0.4 | GO:0001741 | XY body(GO:0001741) |
| 0.0 | 0.5 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 3.5 | GO:0031225 | anchored component of membrane(GO:0031225) |
| 0.0 | 2.0 | GO:0101003 | ficolin-1-rich granule membrane(GO:0101003) |
| 0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.0 | 0.9 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.0 | 0.2 | GO:0070938 | contractile ring(GO:0070938) |
| 0.0 | 0.4 | GO:0005922 | connexon complex(GO:0005922) |
| 0.0 | 0.0 | GO:0000939 | condensed chromosome inner kinetochore(GO:0000939) |
| 0.0 | 2.1 | GO:0000779 | condensed chromosome, centromeric region(GO:0000779) |
| 0.0 | 4.7 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
| 0.0 | 0.2 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.0 | 0.3 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 0.2 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.0 | 0.5 | GO:0051233 | spindle midzone(GO:0051233) |
| 0.0 | 0.1 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.0 | 0.1 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.0 | 0.1 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.0 | 0.2 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.0 | 0.7 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
| 0.0 | 1.1 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.0 | 0.2 | GO:0097486 | multivesicular body lumen(GO:0097486) |
| 0.0 | 0.2 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.0 | 0.2 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.0 | 0.1 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.0 | 0.1 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.0 | 0.1 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.0 | 0.6 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.0 | 0.4 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.0 | 1.2 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 0.1 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.0 | 0.2 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.0 | 0.3 | GO:0072686 | mitotic spindle(GO:0072686) |
| 0.0 | 0.4 | GO:0071565 | nBAF complex(GO:0071565) |
| 0.0 | 0.4 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
| 0.0 | 0.1 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 0.2 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 1.1 | GO:0005769 | early endosome(GO:0005769) |
| 0.0 | 0.2 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.0 | 0.4 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.1 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
| 0.0 | 1.6 | GO:0055037 | recycling endosome(GO:0055037) |
| 0.0 | 0.6 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 0.2 | GO:0032994 | protein-lipid complex(GO:0032994) |
| 0.0 | 0.1 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.0 | 0.0 | GO:0090568 | nuclear transcriptional repressor complex(GO:0090568) |
| 0.0 | 0.0 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
| 0.0 | 0.1 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.0 | 0.2 | GO:0071437 | invadopodium(GO:0071437) |
| 0.0 | 0.9 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) organelle envelope lumen(GO:0031970) |
| 0.0 | 0.7 | GO:0070160 | occluding junction(GO:0070160) |
| 0.0 | 0.4 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.0 | 0.3 | GO:0045095 | keratin filament(GO:0045095) |
| 0.0 | 1.2 | GO:0000922 | spindle pole(GO:0000922) |
| 0.0 | 0.1 | GO:0031904 | endosome lumen(GO:0031904) |
| 0.0 | 0.1 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.0 | 0.4 | GO:0043204 | perikaryon(GO:0043204) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 6.8 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.3 | 9.5 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.2 | 10.5 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.1 | 1.8 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.1 | 5.5 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.1 | 12.9 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.1 | 1.6 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.1 | 1.0 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.1 | 0.6 | ST STAT3 PATHWAY | STAT3 Pathway |
| 0.1 | 2.3 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.1 | 0.3 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.1 | 4.4 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.1 | 6.0 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.1 | 1.8 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.1 | 0.9 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
| 0.1 | 0.5 | PID FOXO PATHWAY | FoxO family signaling |
| 0.1 | 2.0 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.1 | 1.3 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.1 | 1.8 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.1 | 0.4 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.1 | 2.1 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.1 | 0.6 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
| 0.1 | 2.0 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.0 | 0.3 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.0 | 2.3 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 0.0 | 2.0 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.0 | 2.3 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 0.8 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.0 | 2.5 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.0 | 0.6 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.0 | 1.8 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.0 | 0.5 | PID EPO PATHWAY | EPO signaling pathway |
| 0.0 | 2.1 | PID FGF PATHWAY | FGF signaling pathway |
| 0.0 | 0.7 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.0 | 1.0 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.0 | 1.0 | ST ADRENERGIC | Adrenergic Pathway |
| 0.0 | 0.2 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.0 | 2.0 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.0 | 0.2 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.0 | 0.5 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 0.3 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 1.9 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
| 0.0 | 1.4 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.0 | 0.3 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.0 | 0.2 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.0 | 1.3 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.0 | 0.1 | PID S1P S1P2 PATHWAY | S1P2 pathway |
| 0.0 | 0.2 | PID ENDOTHELIN PATHWAY | Endothelins |
| 0.0 | 0.5 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.0 | 0.6 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.0 | 0.1 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.0 | 0.3 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
| 0.0 | 0.8 | PID ATM PATHWAY | ATM pathway |
| 0.0 | 0.4 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.0 | 1.1 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
| 0.0 | 0.2 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.0 | 0.6 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.0 | 0.2 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.0 | 0.2 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.0 | 0.2 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.0 | 0.5 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| 0.0 | 0.2 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.0 | 0.0 | PID IL23 PATHWAY | IL23-mediated signaling events |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.4 | 9.5 | GO:0010903 | negative regulation of very-low-density lipoprotein particle remodeling(GO:0010903) |
| 2.0 | 9.8 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 1.4 | 5.6 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
| 1.1 | 3.4 | GO:0046210 | nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) |
| 1.1 | 3.4 | GO:1902997 | regulation of choline O-acetyltransferase activity(GO:1902769) positive regulation of choline O-acetyltransferase activity(GO:1902771) negative regulation of tau-protein kinase activity(GO:1902948) positive regulation of early endosome to recycling endosome transport(GO:1902955) negative regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902960) negative regulation of neurofibrillary tangle assembly(GO:1902997) negative regulation of aspartic-type peptidase activity(GO:1905246) |
| 1.0 | 5.0 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 1.0 | 2.9 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
| 0.9 | 4.3 | GO:0002905 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 0.8 | 2.3 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
| 0.7 | 2.0 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
| 0.6 | 4.4 | GO:0015755 | fructose transport(GO:0015755) fructose import(GO:0032445) carbohydrate import into cell(GO:0097319) carbohydrate import across plasma membrane(GO:0098704) fructose import across plasma membrane(GO:1990539) |
| 0.6 | 1.7 | GO:1901253 | negative regulation of intracellular transport of viral material(GO:1901253) |
| 0.5 | 3.2 | GO:0010732 | protein glutathionylation(GO:0010731) regulation of protein glutathionylation(GO:0010732) negative regulation of protein glutathionylation(GO:0010734) |
| 0.5 | 2.6 | GO:0071332 | cellular response to fructose stimulus(GO:0071332) |
| 0.5 | 0.5 | GO:0021535 | cell migration in hindbrain(GO:0021535) |
| 0.5 | 2.6 | GO:0002925 | positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 0.5 | 2.0 | GO:2000820 | negative regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000820) |
| 0.5 | 1.5 | GO:0090294 | nitrogen catabolite regulation of transcription from RNA polymerase II promoter(GO:0001079) nitrogen catabolite activation of transcription from RNA polymerase II promoter(GO:0001080) regulation of urea metabolic process(GO:0034255) intracellular bile acid receptor signaling pathway(GO:0038185) interleukin-17 secretion(GO:0072615) nitrogen catabolite regulation of transcription(GO:0090293) nitrogen catabolite activation of transcription(GO:0090294) regulation of nitrogen cycle metabolic process(GO:1903314) positive regulation of glutamate metabolic process(GO:2000213) regulation of ammonia assimilation cycle(GO:2001248) positive regulation of ammonia assimilation cycle(GO:2001250) |
| 0.5 | 2.3 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
| 0.5 | 4.7 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 0.4 | 1.3 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
| 0.4 | 2.2 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.4 | 2.2 | GO:0061143 | alveolar primary septum development(GO:0061143) |
| 0.4 | 2.2 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
| 0.4 | 1.3 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.4 | 1.7 | GO:0061107 | seminal vesicle development(GO:0061107) |
| 0.4 | 1.6 | GO:1903412 | response to bile acid(GO:1903412) |
| 0.4 | 1.6 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) |
| 0.4 | 1.2 | GO:0001798 | positive regulation of type IIa hypersensitivity(GO:0001798) positive regulation of type II hypersensitivity(GO:0002894) |
| 0.4 | 1.9 | GO:0051941 | regulation of amino acid uptake involved in synaptic transmission(GO:0051941) regulation of glutamate uptake involved in transmission of nerve impulse(GO:0051946) regulation of L-glutamate import(GO:1900920) |
| 0.4 | 1.5 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.4 | 1.1 | GO:0009447 | putrescine catabolic process(GO:0009447) |
| 0.4 | 0.8 | GO:0043385 | mycotoxin metabolic process(GO:0043385) aflatoxin metabolic process(GO:0046222) organic heteropentacyclic compound metabolic process(GO:1901376) |
| 0.4 | 1.5 | GO:0072197 | ureter urothelium development(GO:0072190) ureter morphogenesis(GO:0072197) |
| 0.4 | 1.8 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
| 0.4 | 1.1 | GO:1903697 | negative regulation of microvillus assembly(GO:1903697) |
| 0.4 | 1.1 | GO:2001190 | positive regulation of T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:2001190) |
| 0.4 | 1.8 | GO:0033590 | response to cobalamin(GO:0033590) |
| 0.3 | 2.1 | GO:1990822 | basic amino acid transmembrane transport(GO:1990822) |
| 0.3 | 2.4 | GO:0045007 | depurination(GO:0045007) |
| 0.3 | 1.7 | GO:0032571 | response to vitamin K(GO:0032571) |
| 0.3 | 2.7 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.3 | 1.0 | GO:0002370 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) positive regulation of Fc receptor mediated stimulatory signaling pathway(GO:0060369) |
| 0.3 | 1.0 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.3 | 2.8 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.3 | 0.9 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
| 0.3 | 6.9 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.3 | 0.9 | GO:0002522 | leukocyte migration involved in immune response(GO:0002522) |
| 0.3 | 43.6 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
| 0.3 | 0.9 | GO:1905154 | negative regulation of eosinophil activation(GO:1902567) negative regulation of membrane invagination(GO:1905154) |
| 0.3 | 0.9 | GO:0045014 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 0.3 | 2.6 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.3 | 1.2 | GO:0046967 | cytosol to ER transport(GO:0046967) |
| 0.3 | 0.3 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.3 | 2.3 | GO:0070779 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
| 0.3 | 0.8 | GO:0046440 | L-lysine catabolic process to acetyl-CoA(GO:0019474) L-lysine catabolic process(GO:0019477) L-lysine metabolic process(GO:0046440) |
| 0.3 | 0.3 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
| 0.3 | 1.3 | GO:1902896 | terminal web assembly(GO:1902896) |
| 0.3 | 2.9 | GO:0033227 | dsRNA transport(GO:0033227) |
| 0.3 | 1.0 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
| 0.3 | 0.3 | GO:0045588 | positive regulation of gamma-delta T cell differentiation(GO:0045588) |
| 0.3 | 0.8 | GO:0072428 | signal transduction involved in intra-S DNA damage checkpoint(GO:0072428) response to bisphenol A(GO:1903925) cellular response to bisphenol A(GO:1903926) |
| 0.3 | 3.8 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.2 | 1.0 | GO:0061312 | BMP signaling pathway involved in heart development(GO:0061312) |
| 0.2 | 4.8 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
| 0.2 | 0.7 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
| 0.2 | 0.4 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.2 | 0.9 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
| 0.2 | 0.7 | GO:0016095 | polyprenol catabolic process(GO:0016095) |
| 0.2 | 1.3 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.2 | 0.9 | GO:0003366 | cell-matrix adhesion involved in ameboidal cell migration(GO:0003366) |
| 0.2 | 0.6 | GO:0043318 | regulation of cytotoxic T cell degranulation(GO:0043317) negative regulation of cytotoxic T cell degranulation(GO:0043318) insulin catabolic process(GO:1901143) |
| 0.2 | 0.6 | GO:0070171 | negative regulation of tooth mineralization(GO:0070171) |
| 0.2 | 1.5 | GO:0038110 | interleukin-2-mediated signaling pathway(GO:0038110) |
| 0.2 | 1.7 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.2 | 1.6 | GO:0006554 | lysine catabolic process(GO:0006554) |
| 0.2 | 0.2 | GO:1904379 | protein localization to cytosolic proteasome complex(GO:1904327) protein localization to cytosolic proteasome complex involved in ERAD pathway(GO:1904379) |
| 0.2 | 0.2 | GO:1901837 | negative regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901837) |
| 0.2 | 0.6 | GO:1902988 | neurofibrillary tangle assembly(GO:1902988) |
| 0.2 | 0.6 | GO:0000967 | endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
| 0.2 | 2.1 | GO:0034372 | very-low-density lipoprotein particle remodeling(GO:0034372) |
| 0.2 | 0.6 | GO:0070105 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) positive regulation of interleukin-6-mediated signaling pathway(GO:0070105) |
| 0.2 | 0.6 | GO:2000296 | negative regulation of hydrogen peroxide catabolic process(GO:2000296) |
| 0.2 | 0.6 | GO:1904247 | positive regulation of polynucleotide adenylyltransferase activity(GO:1904247) |
| 0.2 | 0.6 | GO:0050902 | leukocyte adhesive activation(GO:0050902) |
| 0.2 | 0.9 | GO:1902724 | positive regulation of skeletal muscle satellite cell proliferation(GO:1902724) positive regulation of growth factor dependent skeletal muscle satellite cell proliferation(GO:1902728) |
| 0.2 | 1.5 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.2 | 1.3 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.2 | 0.6 | GO:0044805 | late nucleophagy(GO:0044805) |
| 0.2 | 0.5 | GO:0014057 | positive regulation of acetylcholine secretion, neurotransmission(GO:0014057) |
| 0.2 | 3.8 | GO:0097242 | beta-amyloid clearance(GO:0097242) |
| 0.2 | 0.5 | GO:0045659 | regulation of neutrophil differentiation(GO:0045658) negative regulation of neutrophil differentiation(GO:0045659) |
| 0.2 | 2.2 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.2 | 0.5 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) negative regulation of DNA catabolic process(GO:1903625) regulation of aminoacyl-tRNA ligase activity(GO:1903630) |
| 0.2 | 0.7 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.2 | 0.7 | GO:0009386 | translational attenuation(GO:0009386) |
| 0.2 | 1.8 | GO:0002726 | positive regulation of T cell cytokine production(GO:0002726) |
| 0.2 | 0.5 | GO:1990502 | dense core granule maturation(GO:1990502) |
| 0.2 | 1.8 | GO:1903944 | regulation of hepatocyte apoptotic process(GO:1903943) negative regulation of hepatocyte apoptotic process(GO:1903944) |
| 0.2 | 1.1 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.2 | 0.5 | GO:1901895 | negative regulation of calcium-transporting ATPase activity(GO:1901895) |
| 0.2 | 0.7 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
| 0.2 | 1.4 | GO:0002455 | humoral immune response mediated by circulating immunoglobulin(GO:0002455) |
| 0.2 | 0.7 | GO:2001295 | malonyl-CoA biosynthetic process(GO:2001295) |
| 0.2 | 1.2 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.2 | 0.5 | GO:0036071 | N-glycan fucosylation(GO:0036071) |
| 0.2 | 2.2 | GO:0051382 | kinetochore assembly(GO:0051382) |
| 0.2 | 0.7 | GO:0010915 | regulation of very-low-density lipoprotein particle clearance(GO:0010915) negative regulation of very-low-density lipoprotein particle clearance(GO:0010916) |
| 0.2 | 0.5 | GO:0043105 | regulation of GTP cyclohydrolase I activity(GO:0043095) negative regulation of GTP cyclohydrolase I activity(GO:0043105) |
| 0.2 | 0.5 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.2 | 0.5 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.2 | 0.7 | GO:0036343 | psychomotor behavior(GO:0036343) |
| 0.2 | 0.2 | GO:0060283 | negative regulation of oocyte development(GO:0060283) negative regulation of oocyte maturation(GO:1900194) |
| 0.2 | 3.4 | GO:0060716 | labyrinthine layer blood vessel development(GO:0060716) |
| 0.2 | 0.9 | GO:0055129 | proline biosynthetic process(GO:0006561) L-proline biosynthetic process(GO:0055129) |
| 0.2 | 0.3 | GO:0001909 | leukocyte mediated cytotoxicity(GO:0001909) |
| 0.2 | 1.1 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
| 0.2 | 8.6 | GO:0018279 | protein N-linked glycosylation via asparagine(GO:0018279) |
| 0.2 | 0.6 | GO:0006210 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
| 0.2 | 0.6 | GO:0060054 | positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
| 0.2 | 0.5 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
| 0.2 | 0.3 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
| 0.2 | 0.5 | GO:0042822 | pyridoxal phosphate metabolic process(GO:0042822) pyridoxal phosphate biosynthetic process(GO:0042823) |
| 0.2 | 0.5 | GO:0038178 | complement component C5a signaling pathway(GO:0038178) |
| 0.2 | 0.8 | GO:0010985 | negative regulation of lipoprotein particle clearance(GO:0010985) |
| 0.2 | 0.3 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) |
| 0.2 | 0.6 | GO:1903273 | regulation of sodium ion export(GO:1903273) positive regulation of sodium ion export(GO:1903275) regulation of sodium ion export from cell(GO:1903276) positive regulation of sodium ion export from cell(GO:1903278) |
| 0.2 | 1.1 | GO:1901315 | negative regulation of histone ubiquitination(GO:0033183) negative regulation of protein K63-linked ubiquitination(GO:1900045) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.1 | 2.7 | GO:0043306 | positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
| 0.1 | 1.0 | GO:0019264 | glycine biosynthetic process from serine(GO:0019264) |
| 0.1 | 0.9 | GO:0070458 | cellular detoxification of nitrogen compound(GO:0070458) |
| 0.1 | 0.9 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.1 | 1.4 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
| 0.1 | 1.0 | GO:0043401 | steroid hormone mediated signaling pathway(GO:0043401) |
| 0.1 | 0.7 | GO:0048489 | synaptic vesicle transport(GO:0048489) synaptic vesicle localization(GO:0097479) establishment of synaptic vesicle localization(GO:0097480) |
| 0.1 | 0.1 | GO:0099565 | chemical synaptic transmission, postsynaptic(GO:0099565) |
| 0.1 | 1.4 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.1 | 1.0 | GO:0002710 | negative regulation of T cell mediated immunity(GO:0002710) |
| 0.1 | 3.3 | GO:0035338 | long-chain fatty-acyl-CoA biosynthetic process(GO:0035338) |
| 0.1 | 0.9 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.1 | 0.3 | GO:0008053 | mitochondrial fusion(GO:0008053) positive regulation of mitochondrial fission(GO:0090141) |
| 0.1 | 2.1 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.1 | 8.4 | GO:0050853 | B cell receptor signaling pathway(GO:0050853) |
| 0.1 | 2.8 | GO:0097320 | membrane tubulation(GO:0097320) |
| 0.1 | 0.3 | GO:1902081 | regulation of calcium ion import into sarcoplasmic reticulum(GO:1902080) negative regulation of calcium ion import into sarcoplasmic reticulum(GO:1902081) |
| 0.1 | 0.5 | GO:0090237 | regulation of arachidonic acid secretion(GO:0090237) |
| 0.1 | 2.9 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.1 | 0.4 | GO:1903348 | positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.1 | 0.6 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.1 | 0.6 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.1 | 0.4 | GO:0035621 | ER to Golgi ceramide transport(GO:0035621) |
| 0.1 | 0.4 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
| 0.1 | 0.9 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.1 | 0.2 | GO:0060842 | arterial endothelial cell differentiation(GO:0060842) |
| 0.1 | 0.4 | GO:2000661 | positive regulation of interleukin-1-mediated signaling pathway(GO:2000661) |
| 0.1 | 0.5 | GO:0003335 | corneocyte development(GO:0003335) |
| 0.1 | 0.2 | GO:0042770 | signal transduction in response to DNA damage(GO:0042770) |
| 0.1 | 0.5 | GO:0002086 | diaphragm contraction(GO:0002086) |
| 0.1 | 1.4 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 0.1 | 0.6 | GO:0090625 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing by siRNA(GO:0090625) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.1 | 0.6 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) |
| 0.1 | 0.6 | GO:0098707 | ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
| 0.1 | 0.5 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) chondroitin sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0050653) |
| 0.1 | 1.6 | GO:1901750 | leukotriene D4 metabolic process(GO:1901748) leukotriene D4 biosynthetic process(GO:1901750) |
| 0.1 | 2.1 | GO:0021513 | spinal cord dorsal/ventral patterning(GO:0021513) |
| 0.1 | 0.8 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.1 | 0.7 | GO:0035754 | B cell chemotaxis(GO:0035754) |
| 0.1 | 1.0 | GO:0002480 | antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
| 0.1 | 1.1 | GO:0014809 | regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014809) |
| 0.1 | 0.5 | GO:0036229 | glutamine secretion(GO:0010585) L-glutamine import(GO:0036229) L-glutamine import into cell(GO:1903803) |
| 0.1 | 0.9 | GO:0021978 | telencephalon regionalization(GO:0021978) |
| 0.1 | 0.4 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
| 0.1 | 0.6 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) sphingolipid mediated signaling pathway(GO:0090520) |
| 0.1 | 1.0 | GO:2001300 | lipoxin metabolic process(GO:2001300) |
| 0.1 | 0.7 | GO:0090116 | C-5 methylation of cytosine(GO:0090116) |
| 0.1 | 0.3 | GO:0006422 | aspartyl-tRNA aminoacylation(GO:0006422) |
| 0.1 | 0.4 | GO:0071393 | cellular response to progesterone stimulus(GO:0071393) |
| 0.1 | 0.8 | GO:0014894 | response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 0.1 | 0.6 | GO:1904352 | positive regulation of protein catabolic process in the vacuole(GO:1904352) |
| 0.1 | 2.0 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
| 0.1 | 0.2 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
| 0.1 | 1.0 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.1 | 0.3 | GO:0044332 | Wnt signaling pathway involved in dorsal/ventral axis specification(GO:0044332) |
| 0.1 | 0.8 | GO:0051899 | membrane depolarization(GO:0051899) |
| 0.1 | 0.6 | GO:0051549 | positive regulation of keratinocyte migration(GO:0051549) |
| 0.1 | 0.2 | GO:0034971 | histone H3-R17 methylation(GO:0034971) |
| 0.1 | 0.3 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
| 0.1 | 1.5 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.1 | 2.0 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
| 0.1 | 1.6 | GO:0006670 | sphingosine metabolic process(GO:0006670) diol metabolic process(GO:0034311) |
| 0.1 | 0.6 | GO:0090131 | renal interstitial fibroblast development(GO:0072141) mesangial cell development(GO:0072143) glomerular mesangial cell development(GO:0072144) mesenchyme migration(GO:0090131) |
| 0.1 | 0.2 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
| 0.1 | 1.4 | GO:0036109 | alpha-linolenic acid metabolic process(GO:0036109) |
| 0.1 | 0.7 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.1 | 0.8 | GO:0006477 | protein sulfation(GO:0006477) |
| 0.1 | 1.3 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.1 | 0.6 | GO:0070560 | protein secretion by platelet(GO:0070560) |
| 0.1 | 0.4 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
| 0.1 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.6 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) |
| 0.1 | 0.3 | GO:0072093 | ureteric bud invasion(GO:0072092) metanephric renal vesicle formation(GO:0072093) |
| 0.1 | 0.5 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
| 0.1 | 0.6 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.1 | 1.0 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
| 0.1 | 1.4 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
| 0.1 | 0.4 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
| 0.1 | 0.7 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.1 | 0.6 | GO:0032202 | telomere assembly(GO:0032202) |
| 0.1 | 0.8 | GO:2000479 | regulation of cAMP-dependent protein kinase activity(GO:2000479) |
| 0.1 | 0.3 | GO:1903691 | positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
| 0.1 | 0.2 | GO:0032881 | regulation of polysaccharide metabolic process(GO:0032881) regulation of glycogen metabolic process(GO:0070873) |
| 0.1 | 0.2 | GO:0043449 | cellular alkene metabolic process(GO:0043449) |
| 0.1 | 0.2 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.1 | 0.2 | GO:0043315 | positive regulation of neutrophil degranulation(GO:0043315) cellular response to gravity(GO:0071258) positive regulation of neutrophil activation(GO:1902565) regulation of transcytosis(GO:1904298) positive regulation of transcytosis(GO:1904300) regulation of maternal process involved in parturition(GO:1904301) positive regulation of maternal process involved in parturition(GO:1904303) regulation of gastro-intestinal system smooth muscle contraction(GO:1904304) positive regulation of gastro-intestinal system smooth muscle contraction(GO:1904306) response to 2-O-acetyl-1-O-hexadecyl-sn-glycero-3-phosphocholine(GO:1904316) cellular response to 2-O-acetyl-1-O-hexadecyl-sn-glycero-3-phosphocholine(GO:1904317) |
| 0.1 | 0.1 | GO:0010644 | cell communication by electrical coupling(GO:0010644) |
| 0.1 | 0.2 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
| 0.1 | 0.2 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 | 0.3 | GO:1903593 | regulation of histamine secretion by mast cell(GO:1903593) |
| 0.1 | 1.7 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
| 0.1 | 0.9 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.1 | 0.9 | GO:0015868 | purine nucleotide transport(GO:0015865) purine ribonucleotide transport(GO:0015868) |
| 0.1 | 0.7 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.1 | 2.0 | GO:0071539 | protein localization to centrosome(GO:0071539) |
| 0.1 | 0.4 | GO:0009439 | cyanate metabolic process(GO:0009439) cyanate catabolic process(GO:0009440) |
| 0.1 | 0.1 | GO:0002434 | immune complex clearance(GO:0002434) immune complex clearance by monocytes and macrophages(GO:0002436) regulation of immune complex clearance by monocytes and macrophages(GO:0090264) |
| 0.1 | 0.2 | GO:1904529 | regulation of actin filament binding(GO:1904529) negative regulation of actin filament binding(GO:1904530) regulation of actin binding(GO:1904616) negative regulation of actin binding(GO:1904617) |
| 0.1 | 1.1 | GO:0070307 | lens fiber cell development(GO:0070307) |
| 0.1 | 0.4 | GO:0003069 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 0.1 | 0.3 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.1 | 0.2 | GO:0061187 | regulation of chromatin silencing at rDNA(GO:0061187) negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 0.1 | 0.4 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.1 | 0.2 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.1 | 2.0 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
| 0.1 | 0.3 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.1 | 0.4 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.1 | 1.4 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
| 0.1 | 0.3 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
| 0.1 | 0.4 | GO:0061088 | regulation of sequestering of zinc ion(GO:0061088) |
| 0.1 | 0.4 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.1 | 0.2 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
| 0.1 | 1.3 | GO:0051923 | sulfation(GO:0051923) |
| 0.1 | 0.2 | GO:0061056 | sclerotome development(GO:0061056) |
| 0.1 | 0.7 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.1 | 0.2 | GO:0016999 | antibiotic metabolic process(GO:0016999) cellular amide catabolic process(GO:0043605) |
| 0.1 | 0.3 | GO:0030853 | negative regulation of granulocyte differentiation(GO:0030853) |
| 0.1 | 0.3 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.1 | 0.1 | GO:0070093 | negative regulation of glucagon secretion(GO:0070093) |
| 0.1 | 0.1 | GO:1902075 | cellular response to salt(GO:1902075) |
| 0.1 | 0.5 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.1 | 0.3 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.1 | 0.3 | GO:0072553 | terminal button organization(GO:0072553) |
| 0.1 | 0.3 | GO:0080009 | mRNA methylation(GO:0080009) |
| 0.1 | 0.7 | GO:0015886 | heme transport(GO:0015886) |
| 0.1 | 0.6 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.1 | 1.9 | GO:0006309 | apoptotic DNA fragmentation(GO:0006309) |
| 0.1 | 0.3 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
| 0.1 | 0.1 | GO:0000189 | MAPK import into nucleus(GO:0000189) |
| 0.1 | 0.2 | GO:0071409 | cellular response to cycloheximide(GO:0071409) |
| 0.1 | 0.3 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.1 | 0.2 | GO:1903976 | negative regulation of glial cell migration(GO:1903976) |
| 0.1 | 1.6 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.1 | 0.3 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
| 0.1 | 0.7 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
| 0.1 | 0.4 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.1 | 0.1 | GO:1904798 | positive regulation of core promoter binding(GO:1904798) |
| 0.1 | 3.6 | GO:0071357 | type I interferon signaling pathway(GO:0060337) cellular response to type I interferon(GO:0071357) |
| 0.1 | 0.3 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.1 | 0.2 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.1 | 0.4 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.1 | 0.5 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
| 0.1 | 0.2 | GO:0038043 | interleukin-5-mediated signaling pathway(GO:0038043) |
| 0.1 | 0.3 | GO:0097194 | execution phase of apoptosis(GO:0097194) |
| 0.1 | 0.5 | GO:0019375 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.1 | 0.2 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
| 0.1 | 0.3 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.1 | 2.6 | GO:0043486 | histone exchange(GO:0043486) |
| 0.1 | 0.2 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
| 0.1 | 1.3 | GO:0003301 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.1 | 1.3 | GO:0035455 | response to interferon-alpha(GO:0035455) |
| 0.1 | 0.3 | GO:2001020 | regulation of response to DNA damage stimulus(GO:2001020) |
| 0.1 | 0.4 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
| 0.1 | 0.4 | GO:0060872 | semicircular canal morphogenesis(GO:0048752) semicircular canal development(GO:0060872) |
| 0.1 | 0.3 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
| 0.1 | 0.2 | GO:0015942 | folic acid-containing compound catabolic process(GO:0009397) formate metabolic process(GO:0015942) pteridine-containing compound catabolic process(GO:0042560) |
| 0.1 | 3.5 | GO:0050852 | T cell receptor signaling pathway(GO:0050852) |
| 0.1 | 3.2 | GO:0006749 | glutathione metabolic process(GO:0006749) |
| 0.1 | 0.4 | GO:2000491 | hepatic stellate cell activation(GO:0035733) regulation of hepatic stellate cell activation(GO:2000489) positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.1 | 0.4 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.1 | 0.3 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.1 | 0.5 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
| 0.1 | 0.3 | GO:0006857 | oligopeptide transport(GO:0006857) |
| 0.1 | 0.2 | GO:0002644 | negative regulation of tolerance induction(GO:0002644) |
| 0.1 | 0.4 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.1 | 0.3 | GO:1901090 | regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
| 0.0 | 0.1 | GO:1901503 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) ether biosynthetic process(GO:1901503) |
| 0.0 | 4.8 | GO:0031295 | T cell costimulation(GO:0031295) |
| 0.0 | 0.0 | GO:0018196 | peptidyl-asparagine modification(GO:0018196) |
| 0.0 | 3.4 | GO:0006501 | C-terminal protein lipidation(GO:0006501) |
| 0.0 | 0.4 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
| 0.0 | 0.2 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
| 0.0 | 0.5 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.0 | 0.3 | GO:0030210 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.0 | 0.5 | GO:0032264 | IMP salvage(GO:0032264) |
| 0.0 | 0.2 | GO:0033274 | response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.0 | 0.8 | GO:0071625 | vocalization behavior(GO:0071625) |
| 0.0 | 0.2 | GO:0060482 | lobar bronchus epithelium development(GO:0060481) lobar bronchus development(GO:0060482) |
| 0.0 | 0.3 | GO:0051198 | negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
| 0.0 | 0.2 | GO:1990167 | protein K27-linked deubiquitination(GO:1990167) |
| 0.0 | 0.5 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.0 | 0.4 | GO:0043570 | maintenance of DNA repeat elements(GO:0043570) |
| 0.0 | 0.1 | GO:0032223 | negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 0.0 | 0.4 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.0 | 0.1 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.0 | 0.5 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.0 | 0.5 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
| 0.0 | 1.3 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.0 | 1.0 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
| 0.0 | 0.4 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.0 | 0.1 | GO:1902490 | regulation of sperm capacitation(GO:1902490) |
| 0.0 | 0.4 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.0 | 0.1 | GO:1905224 | clathrin-coated pit assembly(GO:1905224) |
| 0.0 | 0.3 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.0 | 0.2 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
| 0.0 | 2.4 | GO:0042100 | B cell proliferation(GO:0042100) |
| 0.0 | 0.2 | GO:0007198 | adenylate cyclase-inhibiting serotonin receptor signaling pathway(GO:0007198) |
| 0.0 | 0.5 | GO:1903003 | positive regulation of protein deubiquitination(GO:1903003) |
| 0.0 | 0.6 | GO:0060395 | SMAD protein signal transduction(GO:0060395) |
| 0.0 | 1.1 | GO:0098743 | cell aggregation(GO:0098743) |
| 0.0 | 0.6 | GO:0006473 | protein acetylation(GO:0006473) |
| 0.0 | 0.2 | GO:2000394 | positive regulation of lamellipodium morphogenesis(GO:2000394) |
| 0.0 | 0.3 | GO:0098914 | membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
| 0.0 | 0.1 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
| 0.0 | 0.3 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.0 | 0.3 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.0 | 0.8 | GO:0016254 | preassembly of GPI anchor in ER membrane(GO:0016254) |
| 0.0 | 0.3 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.0 | 0.1 | GO:0048852 | hypophysis morphogenesis(GO:0048850) diencephalon morphogenesis(GO:0048852) |
| 0.0 | 1.1 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
| 0.0 | 0.4 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.0 | 0.1 | GO:0097477 | spinal cord motor neuron migration(GO:0097476) lateral motor column neuron migration(GO:0097477) |
| 0.0 | 1.0 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 | 0.3 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.0 | 0.5 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.0 | 0.2 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
| 0.0 | 0.6 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
| 0.0 | 0.9 | GO:0008211 | glucocorticoid metabolic process(GO:0008211) |
| 0.0 | 0.6 | GO:0099514 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
| 0.0 | 0.1 | GO:0060539 | diaphragm development(GO:0060539) |
| 0.0 | 0.2 | GO:1901739 | regulation of myoblast fusion(GO:1901739) |
| 0.0 | 0.2 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 | 0.5 | GO:0006152 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
| 0.0 | 0.4 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.0 | 0.3 | GO:0070235 | regulation of activation-induced cell death of T cells(GO:0070235) negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.0 | 0.7 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
| 0.0 | 0.2 | GO:0010536 | positive regulation of activation of Janus kinase activity(GO:0010536) |
| 0.0 | 0.1 | GO:0061762 | CAMKK-AMPK signaling cascade(GO:0061762) |
| 0.0 | 0.5 | GO:0021924 | cell proliferation in external granule layer(GO:0021924) cerebellar granule cell precursor proliferation(GO:0021930) |
| 0.0 | 0.1 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.0 | 0.6 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.0 | 0.1 | GO:0061743 | motor learning(GO:0061743) |
| 0.0 | 0.1 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
| 0.0 | 0.4 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
| 0.0 | 0.3 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
| 0.0 | 0.2 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.0 | 0.1 | GO:0070460 | thyroid-stimulating hormone secretion(GO:0070460) regulation of thyroid-stimulating hormone secretion(GO:2000612) |
| 0.0 | 0.0 | GO:0019418 | sulfide oxidation(GO:0019418) sulfide oxidation, using sulfide:quinone oxidoreductase(GO:0070221) |
| 0.0 | 0.2 | GO:0060215 | primitive hemopoiesis(GO:0060215) regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.0 | 1.0 | GO:0046513 | ceramide biosynthetic process(GO:0046513) |
| 0.0 | 0.1 | GO:0061537 | glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.0 | 0.1 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
| 0.0 | 0.1 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.0 | 0.1 | GO:0032776 | DNA methylation on cytosine(GO:0032776) |
| 0.0 | 0.3 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.0 | 0.4 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
| 0.0 | 1.4 | GO:0015914 | phospholipid transport(GO:0015914) |
| 0.0 | 0.2 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
| 0.0 | 0.3 | GO:0010968 | regulation of microtubule nucleation(GO:0010968) |
| 0.0 | 0.3 | GO:0032695 | negative regulation of interleukin-12 production(GO:0032695) |
| 0.0 | 0.3 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 0.0 | 0.5 | GO:0006700 | C21-steroid hormone biosynthetic process(GO:0006700) |
| 0.0 | 0.2 | GO:0010842 | retina layer formation(GO:0010842) |
| 0.0 | 3.0 | GO:0002377 | immunoglobulin production(GO:0002377) |
| 0.0 | 1.7 | GO:0048016 | inositol phosphate-mediated signaling(GO:0048016) |
| 0.0 | 0.1 | GO:2000354 | response to prolactin(GO:1990637) regulation of ovarian follicle development(GO:2000354) |
| 0.0 | 0.2 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
| 0.0 | 0.5 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
| 0.0 | 0.4 | GO:0050919 | negative chemotaxis(GO:0050919) |
| 0.0 | 0.2 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.0 | 0.1 | GO:0060796 | regulation of transcription involved in primary germ layer cell fate commitment(GO:0060796) |
| 0.0 | 0.4 | GO:0050427 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 0.0 | 0.1 | GO:1900736 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) |
| 0.0 | 0.1 | GO:0051497 | negative regulation of stress fiber assembly(GO:0051497) |
| 0.0 | 0.3 | GO:0030050 | vesicle transport along actin filament(GO:0030050) actin filament-based transport(GO:0099515) |
| 0.0 | 0.0 | GO:0018894 | dibenzo-p-dioxin metabolic process(GO:0018894) |
| 0.0 | 0.4 | GO:0042772 | DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) DNA damage response, signal transduction resulting in transcription(GO:0042772) |
| 0.0 | 0.1 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.0 | 0.9 | GO:0015804 | neutral amino acid transport(GO:0015804) |
| 0.0 | 0.3 | GO:0019722 | calcium-mediated signaling(GO:0019722) |
| 0.0 | 0.2 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.0 | 0.3 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.0 | 0.3 | GO:0002115 | store-operated calcium entry(GO:0002115) |
| 0.0 | 0.4 | GO:0009165 | nucleotide biosynthetic process(GO:0009165) |
| 0.0 | 0.8 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
| 0.0 | 0.4 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
| 0.0 | 0.2 | GO:1903147 | negative regulation of macromitophagy(GO:1901525) negative regulation of mitophagy(GO:1903147) |
| 0.0 | 0.1 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
| 0.0 | 0.2 | GO:0048845 | venous blood vessel morphogenesis(GO:0048845) fibroblast growth factor production(GO:0090269) regulation of fibroblast growth factor production(GO:0090270) |
| 0.0 | 0.4 | GO:0044782 | cilium organization(GO:0044782) |
| 0.0 | 0.2 | GO:0032097 | positive regulation of response to food(GO:0032097) positive regulation of appetite(GO:0032100) |
| 0.0 | 0.4 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.0 | 0.1 | GO:2001168 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.0 | 0.2 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.0 | 0.1 | GO:0001712 | ectoderm formation(GO:0001705) ectodermal cell fate commitment(GO:0001712) |
| 0.0 | 0.8 | GO:0032212 | positive regulation of telomere maintenance via telomerase(GO:0032212) |
| 0.0 | 0.1 | GO:0040034 | regulation of development, heterochronic(GO:0040034) regulation of timing of cell differentiation(GO:0048505) |
| 0.0 | 0.2 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
| 0.0 | 0.1 | GO:0038170 | somatostatin receptor signaling pathway(GO:0038169) somatostatin signaling pathway(GO:0038170) |
| 0.0 | 0.6 | GO:0009648 | photoperiodism(GO:0009648) |
| 0.0 | 1.2 | GO:0045010 | actin nucleation(GO:0045010) |
| 0.0 | 0.2 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
| 0.0 | 0.4 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
| 0.0 | 0.7 | GO:0090004 | positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
| 0.0 | 0.1 | GO:0036102 | leukotriene catabolic process(GO:0036100) leukotriene B4 catabolic process(GO:0036101) leukotriene B4 metabolic process(GO:0036102) icosanoid catabolic process(GO:1901523) fatty acid derivative catabolic process(GO:1901569) |
| 0.0 | 0.4 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
| 0.0 | 0.1 | GO:0040031 | snRNA modification(GO:0040031) |
| 0.0 | 0.2 | GO:0090042 | tubulin deacetylation(GO:0090042) regulation of tubulin deacetylation(GO:0090043) |
| 0.0 | 0.1 | GO:0009880 | embryonic pattern specification(GO:0009880) |
| 0.0 | 0.1 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.0 | 0.1 | GO:0010765 | positive regulation of sodium ion transport(GO:0010765) |
| 0.0 | 0.1 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
| 0.0 | 0.2 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.0 | 0.2 | GO:0035933 | glucocorticoid secretion(GO:0035933) corticosterone secretion(GO:0035934) regulation of glucocorticoid secretion(GO:2000849) regulation of corticosterone secretion(GO:2000852) |
| 0.0 | 0.2 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.0 | 0.2 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
| 0.0 | 0.2 | GO:0043950 | positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.0 | 0.0 | GO:2000824 | negative regulation of androgen receptor activity(GO:2000824) |
| 0.0 | 0.4 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.0 | 0.0 | GO:0032632 | interleukin-3 production(GO:0032632) cadmium ion homeostasis(GO:0055073) |
| 0.0 | 0.1 | GO:0033033 | negative regulation of myeloid cell apoptotic process(GO:0033033) |
| 0.0 | 0.2 | GO:0071499 | cellular response to laminar fluid shear stress(GO:0071499) |
| 0.0 | 0.7 | GO:0008206 | bile acid metabolic process(GO:0008206) |
| 0.0 | 0.2 | GO:0021988 | olfactory bulb development(GO:0021772) olfactory lobe development(GO:0021988) |
| 0.0 | 0.2 | GO:0033540 | fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
| 0.0 | 0.2 | GO:0048745 | smooth muscle tissue development(GO:0048745) |
| 0.0 | 0.5 | GO:0015893 | drug transport(GO:0015893) |
| 0.0 | 0.2 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
| 0.0 | 0.3 | GO:0035825 | reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
| 0.0 | 0.2 | GO:0045023 | G0 to G1 transition(GO:0045023) |
| 0.0 | 0.1 | GO:0097012 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
| 0.0 | 0.1 | GO:0048665 | neuron fate specification(GO:0048665) |
| 0.0 | 0.2 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
| 0.0 | 0.1 | GO:0000412 | histone peptidyl-prolyl isomerization(GO:0000412) |
| 0.0 | 0.1 | GO:0036228 | protein targeting to nuclear inner membrane(GO:0036228) |
| 0.0 | 0.6 | GO:0048247 | lymphocyte chemotaxis(GO:0048247) |
| 0.0 | 0.2 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
| 0.0 | 0.1 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
| 0.0 | 0.5 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
| 0.0 | 0.4 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
| 0.0 | 0.2 | GO:1901018 | positive regulation of potassium ion transmembrane transporter activity(GO:1901018) |
| 0.0 | 0.1 | GO:0019074 | viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
| 0.0 | 0.3 | GO:0034453 | microtubule anchoring(GO:0034453) |
| 0.0 | 0.5 | GO:0006198 | cAMP catabolic process(GO:0006198) |
| 0.0 | 0.1 | GO:0042670 | retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
| 0.0 | 0.1 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.0 | 0.1 | GO:0022900 | electron transport chain(GO:0022900) |
| 0.0 | 0.1 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
| 0.0 | 0.5 | GO:0001580 | detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
| 0.0 | 0.7 | GO:1903146 | regulation of mitophagy(GO:1903146) |
| 0.0 | 0.1 | GO:0008228 | opsonization(GO:0008228) |
| 0.0 | 0.1 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.0 | 0.2 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.0 | 0.5 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
| 0.0 | 0.5 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
| 0.0 | 0.2 | GO:0065005 | protein-lipid complex assembly(GO:0065005) |
| 0.0 | 0.3 | GO:1990001 | inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.0 | 0.0 | GO:0002864 | regulation of acute inflammatory response to antigenic stimulus(GO:0002864) |
| 0.0 | 1.3 | GO:0016073 | snRNA metabolic process(GO:0016073) |
| 0.0 | 0.1 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.0 | 0.5 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.0 | 0.1 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.0 | 0.3 | GO:0006706 | steroid catabolic process(GO:0006706) |
| 0.0 | 0.2 | GO:0007088 | regulation of mitotic nuclear division(GO:0007088) |
| 0.0 | 0.2 | GO:2000171 | negative regulation of dendrite development(GO:2000171) |
| 0.0 | 0.0 | GO:1901052 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
| 0.0 | 0.1 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.0 | 0.1 | GO:1902961 | positive regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902961) positive regulation of aspartic-type peptidase activity(GO:1905247) |
| 0.0 | 0.1 | GO:0016322 | neuron remodeling(GO:0016322) |
| 0.0 | 0.6 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
| 0.0 | 0.1 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.0 | 0.0 | GO:2000078 | columnar/cuboidal epithelial cell maturation(GO:0002069) glandular epithelial cell maturation(GO:0002071) type B pancreatic cell maturation(GO:0072560) positive regulation of type B pancreatic cell development(GO:2000078) |
| 0.0 | 0.5 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
| 0.0 | 0.1 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
| 0.0 | 0.7 | GO:0006487 | protein N-linked glycosylation(GO:0006487) |
| 0.0 | 0.2 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.0 | 0.2 | GO:0006986 | response to unfolded protein(GO:0006986) |
| 0.0 | 0.1 | GO:0021702 | cerebellar Purkinje cell layer formation(GO:0021694) cerebellar Purkinje cell differentiation(GO:0021702) |
| 0.0 | 0.1 | GO:1900077 | negative regulation of insulin receptor signaling pathway(GO:0046627) negative regulation of cellular response to insulin stimulus(GO:1900077) |
| 0.0 | 0.2 | GO:0009086 | methionine biosynthetic process(GO:0009086) |
| 0.0 | 0.1 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.0 | 0.2 | GO:0051865 | protein autoubiquitination(GO:0051865) |
| 0.0 | 0.0 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.0 | 0.2 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.0 | 0.4 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
| 0.0 | 1.8 | GO:0002223 | stimulatory C-type lectin receptor signaling pathway(GO:0002223) |
| 0.0 | 0.1 | GO:0045872 | positive regulation of rhodopsin gene expression(GO:0045872) |
| 0.0 | 0.1 | GO:1903826 | arginine transmembrane transport(GO:1903826) |
| 0.0 | 0.2 | GO:0043101 | purine-containing compound salvage(GO:0043101) |
| 0.0 | 0.1 | GO:0031087 | deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.0 | 0.0 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.0 | 0.1 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.0 | 0.2 | GO:0090026 | positive regulation of monocyte chemotaxis(GO:0090026) |
| 0.0 | 0.1 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.0 | 0.3 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.0 | 0.1 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
| 0.0 | 0.0 | GO:2000617 | positive regulation of histone H3-K9 acetylation(GO:2000617) |
| 0.0 | 0.4 | GO:1904837 | beta-catenin-TCF complex assembly(GO:1904837) |
| 0.0 | 0.7 | GO:0051438 | regulation of ubiquitin-protein transferase activity(GO:0051438) |
| 0.0 | 0.1 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.0 | 0.1 | GO:0007351 | tripartite regional subdivision(GO:0007351) anterior/posterior axis specification, embryo(GO:0008595) |
| 0.0 | 0.2 | GO:0035428 | hexose transmembrane transport(GO:0035428) glucose transmembrane transport(GO:1904659) |
| 0.0 | 0.1 | GO:0033344 | cholesterol efflux(GO:0033344) |
| 0.0 | 0.1 | GO:0002024 | diet induced thermogenesis(GO:0002024) |
| 0.0 | 0.2 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
| 0.0 | 0.0 | GO:0050912 | detection of chemical stimulus involved in sensory perception of taste(GO:0050912) |
| 0.0 | 0.2 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
| 0.0 | 0.3 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
| 0.0 | 0.1 | GO:2001225 | regulation of chloride transport(GO:2001225) |
| 0.0 | 0.1 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
| 0.0 | 0.1 | GO:0031497 | chromatin assembly(GO:0031497) |
| 0.0 | 0.0 | GO:0034447 | very-low-density lipoprotein particle clearance(GO:0034447) |
| 0.0 | 0.2 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
| 0.0 | 0.5 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
| 0.0 | 0.0 | GO:1990523 | bone regeneration(GO:1990523) |
| 0.0 | 0.1 | GO:0070942 | neutrophil mediated cytotoxicity(GO:0070942) neutrophil mediated killing of symbiont cell(GO:0070943) neutrophil mediated killing of bacterium(GO:0070944) |
| 0.0 | 0.1 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 | 0.0 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.0 | 0.0 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
| 0.0 | 0.1 | GO:0060397 | JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 4.8 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.4 | 18.8 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
| 0.3 | 5.3 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
| 0.2 | 5.9 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.2 | 4.3 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.2 | 4.1 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.2 | 3.5 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.2 | 2.8 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.2 | 4.4 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.2 | 3.4 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.2 | 1.5 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.1 | 1.7 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 0.1 | 2.0 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.1 | 0.5 | REACTOME SIGNALING BY NOTCH4 | Genes involved in Signaling by NOTCH4 |
| 0.1 | 5.2 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.1 | 1.2 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.1 | 0.8 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.1 | 7.9 | REACTOME CELL DEATH SIGNALLING VIA NRAGE NRIF AND NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
| 0.1 | 1.8 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.1 | 1.4 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 0.1 | 3.1 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
| 0.1 | 1.6 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.1 | 0.8 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.1 | 2.4 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.1 | 1.2 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
| 0.1 | 1.5 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.1 | 0.7 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
| 0.1 | 8.1 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
| 0.1 | 2.5 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
| 0.1 | 1.5 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.1 | 1.8 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.0 | 0.9 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.0 | 3.8 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
| 0.0 | 0.8 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.0 | 5.6 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
| 0.0 | 1.5 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.0 | 2.9 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 0.0 | 0.5 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.0 | 2.0 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.0 | 0.5 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.0 | 1.0 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.0 | 0.3 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.0 | 0.5 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.0 | 0.9 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.0 | 0.7 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.0 | 0.3 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
| 0.0 | 0.7 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
| 0.0 | 0.8 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 2.6 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.0 | 0.6 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
| 0.0 | 0.6 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.0 | 1.1 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.0 | 0.5 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.0 | 0.9 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
| 0.0 | 0.4 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.0 | 0.3 | REACTOME FORMATION OF RNA POL II ELONGATION COMPLEX | Genes involved in Formation of RNA Pol II elongation complex |
| 0.0 | 1.0 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.0 | 0.6 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.0 | 3.6 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.0 | 3.2 | REACTOME G ALPHA I SIGNALLING EVENTS | Genes involved in G alpha (i) signalling events |
| 0.0 | 0.4 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
| 0.0 | 0.4 | REACTOME CELL CELL JUNCTION ORGANIZATION | Genes involved in Cell-cell junction organization |
| 0.0 | 1.0 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
| 0.0 | 0.2 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.0 | 0.2 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.0 | 0.1 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.0 | 0.8 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.0 | 0.4 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
| 0.0 | 0.2 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.0 | 0.0 | REACTOME ACTIVATION OF THE MRNA UPON BINDING OF THE CAP BINDING COMPLEX AND EIFS AND SUBSEQUENT BINDING TO 43S | Genes involved in Activation of the mRNA upon binding of the cap-binding complex and eIFs, and subsequent binding to 43S |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 4.8 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.2 | 11.0 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.2 | 4.5 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.1 | 15.6 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
| 0.1 | 29.7 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.1 | 6.4 | PID BMP PATHWAY | BMP receptor signaling |
| 0.1 | 4.9 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| 0.1 | 2.3 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.1 | 3.7 | ST GAQ PATHWAY | G alpha q Pathway |
| 0.1 | 4.8 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.1 | 4.2 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.1 | 3.9 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
| 0.0 | 0.6 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.0 | 1.0 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.0 | 0.7 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.0 | 3.1 | PID MTOR 4PATHWAY | mTOR signaling pathway |
| 0.0 | 2.8 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.0 | 1.7 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 0.5 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 0.6 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.0 | 0.4 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.0 | 0.2 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 0.3 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.0 | 1.3 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
| 0.0 | 1.4 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 1.1 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.0 | 1.1 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.0 | 1.0 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 0.5 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 1.6 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 0.0 | 3.5 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
| 0.0 | 0.5 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.0 | 1.0 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.0 | 0.4 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.0 | 0.1 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.0 | 1.8 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.0 | 0.6 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.0 | 1.1 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
| 0.0 | 0.1 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.0 | 1.0 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.0 | 0.5 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.0 | 1.5 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 0.0 | 0.1 | ST STAT3 PATHWAY | STAT3 Pathway |
| 0.0 | 0.1 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.0 | 0.9 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
| 0.0 | 0.2 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 0.3 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.0 | 0.2 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.0 | 2.2 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 9.7 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.4 | 5.9 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.3 | 6.4 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
| 0.3 | 8.9 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
| 0.2 | 1.7 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.2 | 4.4 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.2 | 3.5 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.2 | 8.3 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.1 | 3.0 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
| 0.1 | 1.8 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.1 | 0.4 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
| 0.1 | 2.4 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.1 | 3.3 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
| 0.1 | 10.1 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.1 | 1.6 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 0.1 | 2.6 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.1 | 0.4 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.1 | 1.5 | REACTOME REVERSIBLE HYDRATION OF CARBON DIOXIDE | Genes involved in Reversible Hydration of Carbon Dioxide |
| 0.1 | 1.5 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.1 | 6.1 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
| 0.1 | 0.3 | REACTOME IL 2 SIGNALING | Genes involved in Interleukin-2 signaling |
| 0.1 | 1.2 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.1 | 0.8 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.1 | 2.0 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.1 | 4.1 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.1 | 2.5 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.1 | 2.0 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.1 | 0.9 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
| 0.1 | 4.1 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.1 | 1.3 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.1 | 0.9 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.1 | 1.7 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
| 0.1 | 4.3 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.1 | 1.8 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.1 | 0.8 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
| 0.1 | 1.2 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.1 | 0.4 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.1 | 0.9 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS | Genes involved in Synthesis of bile acids and bile salts |
| 0.1 | 1.7 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.1 | 0.6 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.1 | 0.7 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.1 | 1.2 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.1 | 0.9 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.0 | 0.8 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.0 | 3.7 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.0 | 0.8 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.0 | 1.5 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.0 | 0.7 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.0 | 0.4 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.0 | 1.0 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 1.1 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.0 | 0.4 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.0 | 0.4 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.0 | 2.2 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
| 0.0 | 3.5 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
| 0.0 | 1.1 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.0 | 0.3 | REACTOME DEFENSINS | Genes involved in Defensins |
| 0.0 | 0.8 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.0 | 0.5 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.0 | 1.6 | REACTOME DAG AND IP3 SIGNALING | Genes involved in DAG and IP3 signaling |
| 0.0 | 0.4 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 0.0 | 0.7 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.0 | 0.9 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
| 0.0 | 0.1 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.0 | 0.8 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.0 | 0.3 | REACTOME BILE ACID AND BILE SALT METABOLISM | Genes involved in Bile acid and bile salt metabolism |
| 0.0 | 0.3 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.0 | 0.3 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.0 | 0.6 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.0 | 1.2 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.0 | 0.3 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.0 | 0.4 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.0 | 0.6 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
| 0.0 | 0.4 | REACTOME NUCLEAR EVENTS KINASE AND TRANSCRIPTION FACTOR ACTIVATION | Genes involved in Nuclear Events (kinase and transcription factor activation) |
| 0.0 | 0.4 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.0 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.0 | 0.3 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.0 | 2.5 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
| 0.0 | 1.1 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
| 0.0 | 0.4 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.0 | 0.3 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.0 | 0.3 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.0 | 0.3 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.0 | 0.4 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.0 | 0.5 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
| 0.0 | 0.3 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
| 0.0 | 0.6 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.3 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
| 0.0 | 0.2 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.0 | 0.3 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 0.2 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.0 | 0.4 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
| 0.0 | 0.3 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.0 | 0.2 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.0 | 0.2 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 0.3 | REACTOME TRNA AMINOACYLATION | Genes involved in tRNA Aminoacylation |
| 0.0 | 0.3 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
| 0.0 | 0.1 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.9 | 13.1 | GO:0098575 | lumenal side of lysosomal membrane(GO:0098575) |
| 0.8 | 6.7 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.7 | 2.8 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.7 | 6.9 | GO:0097413 | Lewy body(GO:0097413) |
| 0.5 | 1.5 | GO:0019034 | viral replication complex(GO:0019034) |
| 0.4 | 1.8 | GO:0032144 | 4-aminobutyrate transaminase complex(GO:0032144) |
| 0.4 | 1.7 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.4 | 1.2 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.4 | 3.1 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.4 | 4.8 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.3 | 3.8 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.3 | 1.7 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.3 | 0.9 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 0.3 | 2.0 | GO:1990812 | growth cone filopodium(GO:1990812) |
| 0.3 | 4.8 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
| 0.3 | 1.6 | GO:0098560 | cytoplasmic side of late endosome membrane(GO:0098560) |
| 0.2 | 1.1 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.2 | 1.1 | GO:0071148 | TEAD-1-YAP complex(GO:0071148) |
| 0.2 | 3.3 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.2 | 0.6 | GO:1903349 | omegasome membrane(GO:1903349) |
| 0.2 | 3.0 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
| 0.2 | 25.9 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.2 | 0.9 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.2 | 2.4 | GO:0097227 | sperm annulus(GO:0097227) |
| 0.2 | 1.0 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.2 | 1.1 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.1 | 1.1 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
| 0.1 | 11.8 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.1 | 1.9 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.1 | 0.8 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.1 | 3.6 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.1 | 1.6 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
| 0.1 | 1.2 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.1 | 0.5 | GO:0070985 | TFIIK complex(GO:0070985) |
| 0.1 | 0.8 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.1 | 0.5 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.1 | 6.2 | GO:0016235 | aggresome(GO:0016235) |
| 0.1 | 1.3 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.1 | 9.4 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.1 | 0.6 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.1 | 0.5 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.1 | 1.5 | GO:0031089 | platelet dense granule lumen(GO:0031089) |
| 0.1 | 0.7 | GO:0097165 | nuclear stress granule(GO:0097165) |
| 0.1 | 2.2 | GO:0002102 | podosome(GO:0002102) |
| 0.1 | 0.7 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.1 | 4.5 | GO:0005844 | polysome(GO:0005844) |
| 0.1 | 0.8 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.1 | 5.4 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.1 | 0.9 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.1 | 0.4 | GO:0098837 | postsynaptic recycling endosome(GO:0098837) |
| 0.1 | 7.7 | GO:0005901 | caveola(GO:0005901) |
| 0.1 | 0.6 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
| 0.1 | 0.5 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
| 0.1 | 1.0 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.1 | 0.5 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.1 | 0.4 | GO:0071203 | WASH complex(GO:0071203) |
| 0.1 | 4.7 | GO:0035578 | azurophil granule lumen(GO:0035578) |
| 0.1 | 3.1 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.1 | 0.3 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.1 | 0.3 | GO:0000801 | central element(GO:0000801) |
| 0.1 | 1.6 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.1 | 1.0 | GO:0000782 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
| 0.1 | 0.2 | GO:0002177 | manchette(GO:0002177) |
| 0.1 | 0.3 | GO:0099634 | postsynaptic specialization membrane(GO:0099634) |
| 0.0 | 1.3 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 0.0 | 1.0 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.0 | 1.5 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.0 | 0.6 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.0 | 0.5 | GO:0030897 | HOPS complex(GO:0030897) |
| 0.0 | 0.6 | GO:0005883 | neurofilament(GO:0005883) |
| 0.0 | 0.2 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.0 | 0.7 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.0 | 3.5 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.0 | 0.1 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.0 | 0.9 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.0 | 0.4 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.0 | 1.3 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.0 | 0.6 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.0 | 0.6 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.0 | 12.7 | GO:0005938 | cell cortex(GO:0005938) |
| 0.0 | 1.0 | GO:0009925 | basal plasma membrane(GO:0009925) |
| 0.0 | 1.2 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.0 | 0.3 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.0 | 0.1 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.0 | 0.1 | GO:0000333 | telomerase catalytic core complex(GO:0000333) |
| 0.0 | 2.9 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.0 | 1.8 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.0 | 0.7 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.0 | 0.9 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
| 0.0 | 0.5 | GO:0005922 | connexon complex(GO:0005922) |
| 0.0 | 0.5 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.0 | 0.5 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.0 | 8.5 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
| 0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.0 | 0.8 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.0 | 1.4 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
| 0.0 | 0.6 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.0 | 0.2 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.0 | 0.1 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.0 | 2.8 | GO:0032587 | ruffle membrane(GO:0032587) |
| 0.0 | 2.6 | GO:0005814 | centriole(GO:0005814) |
| 0.0 | 1.5 | GO:0005604 | basement membrane(GO:0005604) |
| 0.0 | 0.6 | GO:0034706 | sodium channel complex(GO:0034706) |
| 0.0 | 0.4 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.0 | 0.2 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.0 | 0.1 | GO:0031085 | BLOC-3 complex(GO:0031085) |
| 0.0 | 1.3 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 1.2 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
| 0.0 | 2.8 | GO:0030496 | midbody(GO:0030496) |
| 0.0 | 0.9 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 0.4 | GO:0005685 | U1 snRNP(GO:0005685) |
| 0.0 | 0.2 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.0 | 0.1 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.0 | 0.9 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
| 0.0 | 0.3 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.0 | 5.5 | GO:0005765 | lysosomal membrane(GO:0005765) lytic vacuole membrane(GO:0098852) |
| 0.0 | 0.2 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.0 | 0.3 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.0 | 0.1 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 0.1 | GO:0045272 | plasma membrane respiratory chain complex I(GO:0045272) |
| 0.0 | 0.4 | GO:0030057 | desmosome(GO:0030057) |
| 0.0 | 0.4 | GO:0005764 | lytic vacuole(GO:0000323) lysosome(GO:0005764) |
| 0.0 | 1.7 | GO:0005770 | late endosome(GO:0005770) |
| 0.0 | 0.8 | GO:0097517 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
| 0.0 | 0.4 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.0 | 1.4 | GO:0031514 | motile cilium(GO:0031514) |
| 0.0 | 0.0 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
| 0.0 | 0.1 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.0 | 0.3 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 0.2 | GO:0097014 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.4 | 9.5 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 1.1 | 3.4 | GO:0016708 | nitric oxide dioxygenase activity(GO:0008941) oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of two atoms of oxygen into one donor(GO:0016708) iron-cytochrome-c reductase activity(GO:0047726) |
| 1.0 | 2.9 | GO:0004362 | glutathione-disulfide reductase activity(GO:0004362) |
| 1.0 | 7.6 | GO:0004873 | asialoglycoprotein receptor activity(GO:0004873) |
| 0.7 | 2.1 | GO:0004613 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 0.6 | 4.4 | GO:0005353 | fructose transmembrane transporter activity(GO:0005353) |
| 0.6 | 2.4 | GO:0032408 | MutLbeta complex binding(GO:0032406) MutSbeta complex binding(GO:0032408) |
| 0.6 | 2.4 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.6 | 2.4 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.6 | 4.0 | GO:0030369 | ICAM-3 receptor activity(GO:0030369) |
| 0.5 | 9.1 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.5 | 2.1 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.5 | 2.4 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.5 | 2.9 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.5 | 1.9 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.5 | 1.5 | GO:1902122 | chenodeoxycholic acid binding(GO:1902122) |
| 0.4 | 22.3 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.4 | 1.6 | GO:0016639 | oxidoreductase activity, acting on the CH-NH2 group of donors, NAD or NADP as acceptor(GO:0016639) |
| 0.4 | 1.2 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
| 0.4 | 1.9 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.4 | 6.9 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.4 | 1.5 | GO:0019976 | interleukin-2 receptor activity(GO:0004911) interleukin-2 binding(GO:0019976) |
| 0.4 | 2.1 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.3 | 2.3 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.3 | 2.6 | GO:0019863 | IgE binding(GO:0019863) |
| 0.3 | 2.0 | GO:0015501 | glutamate:sodium symporter activity(GO:0015501) |
| 0.3 | 0.9 | GO:0036134 | thromboxane-A synthase activity(GO:0004796) 12-hydroxyheptadecatrienoic acid synthase activity(GO:0036134) |
| 0.3 | 3.7 | GO:0032395 | MHC class II receptor activity(GO:0032395) |
| 0.3 | 1.3 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
| 0.3 | 1.5 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.3 | 1.0 | GO:0033981 | D-dopachrome decarboxylase activity(GO:0033981) |
| 0.2 | 6.5 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
| 0.2 | 0.9 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.2 | 3.7 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.2 | 4.0 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.2 | 1.9 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.2 | 5.6 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
| 0.2 | 0.8 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
| 0.2 | 2.0 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.2 | 0.8 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.2 | 1.4 | GO:0043548 | phosphatidylinositol 3-kinase binding(GO:0043548) |
| 0.2 | 28.7 | GO:0003823 | antigen binding(GO:0003823) |
| 0.2 | 2.6 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.2 | 0.6 | GO:0017129 | triglyceride binding(GO:0017129) |
| 0.2 | 2.1 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
| 0.2 | 0.8 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.2 | 1.3 | GO:0047894 | flavonol 3-sulfotransferase activity(GO:0047894) steroid sulfotransferase activity(GO:0050294) |
| 0.2 | 1.7 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.2 | 0.5 | GO:0016314 | phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase activity(GO:0016314) |
| 0.2 | 1.1 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.2 | 0.7 | GO:0003989 | acetyl-CoA carboxylase activity(GO:0003989) |
| 0.2 | 0.5 | GO:0046921 | glycoprotein 6-alpha-L-fucosyltransferase activity(GO:0008424) alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
| 0.2 | 0.7 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
| 0.2 | 0.5 | GO:0044549 | GTP cyclohydrolase binding(GO:0044549) |
| 0.2 | 2.9 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
| 0.2 | 0.7 | GO:0008940 | nitrate reductase activity(GO:0008940) |
| 0.2 | 1.3 | GO:0009008 | DNA-methyltransferase activity(GO:0009008) |
| 0.2 | 0.5 | GO:0004324 | ferredoxin-NADP+ reductase activity(GO:0004324) NADPH-adrenodoxin reductase activity(GO:0015039) oxidoreductase activity, acting on iron-sulfur proteins as donors(GO:0016730) oxidoreductase activity, acting on iron-sulfur proteins as donors, NAD or NADP as acceptor(GO:0016731) |
| 0.2 | 0.7 | GO:0047718 | indanol dehydrogenase activity(GO:0047718) |
| 0.2 | 2.3 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
| 0.2 | 1.1 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.2 | 0.5 | GO:0030226 | apolipoprotein receptor activity(GO:0030226) |
| 0.2 | 1.3 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.2 | 0.5 | GO:0008955 | peptidoglycan glycosyltransferase activity(GO:0008955) |
| 0.2 | 0.3 | GO:0030348 | syntaxin-3 binding(GO:0030348) |
| 0.2 | 0.5 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
| 0.2 | 1.5 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
| 0.2 | 0.5 | GO:0004878 | complement component C5a receptor activity(GO:0004878) |
| 0.1 | 0.6 | GO:0099609 | microtubule lateral binding(GO:0099609) |
| 0.1 | 1.0 | GO:0004372 | glycine hydroxymethyltransferase activity(GO:0004372) threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.1 | 0.6 | GO:0004998 | transferrin receptor activity(GO:0004998) |
| 0.1 | 0.6 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
| 0.1 | 3.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.1 | 0.6 | GO:0005124 | scavenger receptor binding(GO:0005124) |
| 0.1 | 1.0 | GO:0019534 | toxin transporter activity(GO:0019534) |
| 0.1 | 0.7 | GO:0004905 | type I interferon receptor activity(GO:0004905) |
| 0.1 | 0.6 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
| 0.1 | 0.5 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 0.1 | 3.2 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
| 0.1 | 0.4 | GO:0017130 | poly(C) RNA binding(GO:0017130) |
| 0.1 | 0.8 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.1 | 1.2 | GO:0003964 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
| 0.1 | 3.7 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.1 | 0.5 | GO:0047057 | oxidoreductase activity, acting on the CH-OH group of donors, disulfide as acceptor(GO:0016900) vitamin-K-epoxide reductase (warfarin-sensitive) activity(GO:0047057) |
| 0.1 | 0.9 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
| 0.1 | 0.6 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.1 | 0.9 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.1 | 1.6 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
| 0.1 | 0.5 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.1 | 2.4 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
| 0.1 | 3.4 | GO:0001848 | complement binding(GO:0001848) |
| 0.1 | 0.6 | GO:0003713 | transcription coactivator activity(GO:0003713) |
| 0.1 | 2.3 | GO:0043495 | protein anchor(GO:0043495) |
| 0.1 | 5.4 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.1 | 0.3 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) NAD(P)+ nucleosidase activity(GO:0050135) |
| 0.1 | 0.9 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.1 | 0.2 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
| 0.1 | 1.5 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.1 | 0.5 | GO:0052833 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.1 | 0.3 | GO:0016422 | mRNA (2'-O-methyladenosine-N6-)-methyltransferase activity(GO:0016422) |
| 0.1 | 0.6 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.1 | 1.2 | GO:0005436 | sodium:phosphate symporter activity(GO:0005436) |
| 0.1 | 0.7 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 0.1 | 2.0 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.1 | 0.3 | GO:0022897 | peptide:proton symporter activity(GO:0015333) proton-dependent peptide secondary active transmembrane transporter activity(GO:0022897) |
| 0.1 | 1.0 | GO:0034185 | apolipoprotein binding(GO:0034185) |
| 0.1 | 0.6 | GO:0033218 | amide binding(GO:0033218) |
| 0.1 | 0.3 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
| 0.1 | 1.1 | GO:0003996 | acyl-CoA ligase activity(GO:0003996) |
| 0.1 | 0.4 | GO:0016784 | 3-mercaptopyruvate sulfurtransferase activity(GO:0016784) |
| 0.1 | 0.4 | GO:0005497 | androgen binding(GO:0005497) |
| 0.1 | 0.4 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.1 | 0.6 | GO:0030492 | hemoglobin binding(GO:0030492) |
| 0.1 | 1.0 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.1 | 0.6 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.1 | 0.3 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.1 | 1.5 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.1 | 2.3 | GO:0016701 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen(GO:0016701) oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
| 0.1 | 1.5 | GO:0043295 | glutathione binding(GO:0043295) |
| 0.1 | 0.3 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.1 | 0.3 | GO:0004119 | cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) |
| 0.1 | 0.6 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.1 | 1.4 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.1 | 0.7 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
| 0.1 | 0.6 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.1 | 0.3 | GO:0004909 | interleukin-1, Type I, activating receptor activity(GO:0004909) |
| 0.1 | 0.2 | GO:0004137 | deoxycytidine kinase activity(GO:0004137) |
| 0.1 | 0.3 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
| 0.1 | 0.2 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.1 | 0.4 | GO:0001641 | group II metabotropic glutamate receptor activity(GO:0001641) |
| 0.1 | 1.0 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.1 | 1.2 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.1 | 2.2 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
| 0.1 | 3.6 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.1 | 0.2 | GO:0019798 | procollagen-proline 4-dioxygenase activity(GO:0004656) procollagen-proline dioxygenase activity(GO:0019798) |
| 0.1 | 0.5 | GO:0015186 | L-glutamine transmembrane transporter activity(GO:0015186) |
| 0.1 | 2.5 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.1 | 1.3 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.1 | 0.3 | GO:0004102 | choline O-acetyltransferase activity(GO:0004102) |
| 0.1 | 0.4 | GO:0039552 | RIG-I binding(GO:0039552) |
| 0.1 | 0.4 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 0.1 | 0.5 | GO:0001733 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.1 | 2.8 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
| 0.1 | 0.2 | GO:0032093 | SAM domain binding(GO:0032093) |
| 0.1 | 0.2 | GO:0030272 | 5-formyltetrahydrofolate cyclo-ligase activity(GO:0030272) |
| 0.1 | 0.4 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.1 | 0.2 | GO:0070576 | vitamin D 24-hydroxylase activity(GO:0070576) |
| 0.1 | 0.3 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.1 | 0.3 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
| 0.1 | 0.2 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.1 | 0.3 | GO:0051916 | granulocyte colony-stimulating factor binding(GO:0051916) |
| 0.1 | 0.3 | GO:0004815 | aspartate-tRNA ligase activity(GO:0004815) |
| 0.1 | 0.9 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.1 | 0.6 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.1 | 1.4 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.1 | 0.1 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.1 | 0.2 | GO:1904599 | advanced glycation end-product binding(GO:1904599) |
| 0.1 | 1.8 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.1 | 0.2 | GO:0004488 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
| 0.1 | 0.3 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.1 | 0.4 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.1 | 0.4 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.1 | 0.2 | GO:0005148 | prolactin receptor binding(GO:0005148) |
| 0.1 | 0.5 | GO:0043426 | MRF binding(GO:0043426) |
| 0.1 | 0.6 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
| 0.1 | 0.2 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.1 | 0.3 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.1 | 0.1 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.1 | 0.5 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.1 | 0.2 | GO:0004914 | interleukin-5 receptor activity(GO:0004914) |
| 0.1 | 0.3 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
| 0.1 | 1.0 | GO:0022884 | macromolecule transmembrane transporter activity(GO:0022884) |
| 0.1 | 0.3 | GO:0044390 | ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
| 0.1 | 0.2 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.1 | 1.0 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.1 | 0.5 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.1 | 0.5 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.1 | 0.3 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.1 | 0.2 | GO:0030197 | extracellular matrix constituent, lubricant activity(GO:0030197) |
| 0.1 | 0.3 | GO:0060698 | endoribonuclease inhibitor activity(GO:0060698) |
| 0.1 | 0.4 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.1 | 0.6 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.0 | 1.6 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
| 0.0 | 0.2 | GO:0031701 | angiotensin receptor binding(GO:0031701) |
| 0.0 | 0.5 | GO:0052689 | carboxylic ester hydrolase activity(GO:0052689) |
| 0.0 | 0.2 | GO:0004992 | platelet activating factor receptor activity(GO:0004992) |
| 0.0 | 0.2 | GO:0004874 | aryl hydrocarbon receptor activity(GO:0004874) |
| 0.0 | 1.1 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 0.0 | 0.3 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.0 | 0.1 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.0 | 1.1 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.0 | 0.2 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
| 0.0 | 0.9 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.0 | 0.7 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.0 | 0.2 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.0 | 0.4 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.0 | 0.6 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.0 | 0.2 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
| 0.0 | 0.2 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.0 | 0.2 | GO:0032558 | adenyl deoxyribonucleotide binding(GO:0032558) dATP binding(GO:0032564) |
| 0.0 | 0.2 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.0 | 0.2 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.0 | 0.3 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.0 | 0.2 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.0 | 0.6 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.0 | 0.2 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.0 | 0.2 | GO:0050436 | microfibril binding(GO:0050436) |
| 0.0 | 0.9 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.0 | 0.9 | GO:0015175 | neutral amino acid transmembrane transporter activity(GO:0015175) |
| 0.0 | 0.9 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.0 | 0.4 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.0 | 0.2 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
| 0.0 | 0.2 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.0 | 0.3 | GO:0032052 | bile acid binding(GO:0032052) |
| 0.0 | 0.2 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
| 0.0 | 0.7 | GO:0005537 | mannose binding(GO:0005537) |
| 0.0 | 0.2 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.0 | 0.1 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) |
| 0.0 | 3.9 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.0 | 0.4 | GO:0031005 | filamin binding(GO:0031005) |
| 0.0 | 0.1 | GO:0097258 | tocopherol omega-hydroxylase activity(GO:0052870) alpha-tocopherol omega-hydroxylase activity(GO:0052871) 20-hydroxy-leukotriene B4 omega oxidase activity(GO:0097258) 20-aldehyde-leukotriene B4 20-monooxygenase activity(GO:0097259) |
| 0.0 | 1.0 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
| 0.0 | 0.2 | GO:0002046 | opsin binding(GO:0002046) |
| 0.0 | 0.2 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.0 | 0.8 | GO:0005158 | insulin receptor binding(GO:0005158) |
| 0.0 | 0.7 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.0 | 0.3 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.0 | 0.7 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.0 | 0.5 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
| 0.0 | 0.4 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.0 | 0.4 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 0.0 | 0.3 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.0 | 0.5 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.0 | 0.6 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.0 | 0.2 | GO:0044594 | 3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-enoyl-CoA hydratase activity(GO:0033989) 17-beta-hydroxysteroid dehydrogenase (NAD+) activity(GO:0044594) |
| 0.0 | 0.2 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.0 | 0.9 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.0 | 0.3 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.0 | 0.3 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.0 | 0.0 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.0 | 0.5 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.0 | 0.6 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.0 | 0.9 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.0 | 0.1 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
| 0.0 | 0.4 | GO:0016462 | pyrophosphatase activity(GO:0016462) |
| 0.0 | 0.7 | GO:0030515 | snoRNA binding(GO:0030515) |
| 0.0 | 0.1 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.0 | 0.3 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.0 | 0.1 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.0 | 1.1 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.0 | 0.6 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
| 0.0 | 0.1 | GO:0004461 | lactose synthase activity(GO:0004461) |
| 0.0 | 0.1 | GO:0047066 | phospholipid-hydroperoxide glutathione peroxidase activity(GO:0047066) |
| 0.0 | 0.5 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.0 | 0.6 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.0 | 0.5 | GO:0005522 | profilin binding(GO:0005522) |
| 0.0 | 0.1 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.0 | 0.6 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.0 | 0.3 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
| 0.0 | 0.1 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
| 0.0 | 0.3 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.0 | 0.0 | GO:0033695 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
| 0.0 | 0.9 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.0 | 0.1 | GO:0098640 | integrin binding involved in cell-matrix adhesion(GO:0098640) |
| 0.0 | 0.5 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.3 | GO:0019237 | centromeric DNA binding(GO:0019237) |
| 0.0 | 0.2 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.0 | 1.5 | GO:0004866 | endopeptidase inhibitor activity(GO:0004866) |
| 0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.2 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.0 | 0.1 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
| 0.0 | 0.6 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
| 0.0 | 0.2 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.0 | 0.2 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.0 | 0.1 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.0 | 0.8 | GO:0051183 | vitamin transporter activity(GO:0051183) |
| 0.0 | 0.1 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) RNA polymerase II transcription coactivator binding(GO:0001225) |
| 0.0 | 0.2 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.0 | 0.5 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.0 | 0.0 | GO:0001034 | RNA polymerase III transcription factor activity, sequence-specific DNA binding(GO:0001034) |
| 0.0 | 0.1 | GO:1904493 | Ac-Asp-Glu binding(GO:1904492) tetrahydrofolyl-poly(glutamate) polymer binding(GO:1904493) |
| 0.0 | 0.2 | GO:0018024 | histone-lysine N-methyltransferase activity(GO:0018024) |
| 0.0 | 0.1 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
| 0.0 | 0.3 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
| 0.0 | 1.2 | GO:0070063 | RNA polymerase binding(GO:0070063) |
| 0.0 | 0.7 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
| 0.0 | 0.1 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.0 | 0.2 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
| 0.0 | 0.1 | GO:0008391 | arachidonic acid monooxygenase activity(GO:0008391) arachidonic acid epoxygenase activity(GO:0008392) |
| 0.0 | 0.1 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.0 | 0.1 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
| 0.0 | 0.4 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.0 | 0.6 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.0 | 0.2 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
| 0.0 | 0.0 | GO:0099529 | neurotransmitter receptor activity involved in regulation of postsynaptic membrane potential(GO:0099529) transmitter-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1904315) |
| 0.0 | 0.1 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.0 | 0.5 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.0 | 0.1 | GO:0035800 | deubiquitinase activator activity(GO:0035800) |
| 0.0 | 2.3 | GO:0001047 | core promoter binding(GO:0001047) |
| 0.0 | 0.1 | GO:0044736 | acid-sensing ion channel activity(GO:0044736) |
| 0.0 | 0.5 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
| 0.0 | 0.1 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.0 | 0.1 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.0 | 1.6 | GO:0005179 | hormone activity(GO:0005179) |
| 0.0 | 0.1 | GO:0004618 | phosphoglycerate kinase activity(GO:0004618) |
| 0.0 | 1.0 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
| 0.0 | 0.1 | GO:0004530 | deoxyribonuclease I activity(GO:0004530) |
| 0.0 | 0.2 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
| 0.0 | 0.1 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
| 0.0 | 0.2 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.2 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 0.5 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.0 | 0.0 | GO:0030151 | molybdenum ion binding(GO:0030151) |
| 0.0 | 0.0 | GO:0034353 | RNA pyrophosphohydrolase activity(GO:0034353) |
| 0.0 | 0.0 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.0 | 0.0 | GO:0046997 | sarcosine dehydrogenase activity(GO:0008480) oxidoreductase activity, acting on the CH-NH group of donors, flavin as acceptor(GO:0046997) |
| 0.0 | 0.5 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
| 0.0 | 0.1 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
| 0.0 | 0.3 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
| 0.0 | 0.3 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.0 | 0.1 | GO:0015288 | porin activity(GO:0015288) |
| 0.0 | 0.1 | GO:0016748 | succinyltransferase activity(GO:0016748) |
| 0.0 | 0.1 | GO:0003998 | acylphosphatase activity(GO:0003998) |
| 0.0 | 0.8 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.0 | 0.0 | GO:0051139 | metal ion:proton antiporter activity(GO:0051139) |
| 0.0 | 0.1 | GO:0004697 | protein kinase C activity(GO:0004697) |
| 0.0 | 0.3 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.0 | 0.2 | GO:0043176 | amine binding(GO:0043176) serotonin binding(GO:0051378) |
| 0.0 | 0.1 | GO:0004996 | thyroid-stimulating hormone receptor activity(GO:0004996) |
| 0.0 | 0.3 | GO:0008484 | sulfuric ester hydrolase activity(GO:0008484) |
| 0.0 | 0.4 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
| 0.0 | 0.7 | GO:0019213 | deacetylase activity(GO:0019213) |
| 0.0 | 0.8 | GO:0030971 | receptor tyrosine kinase binding(GO:0030971) |
| 0.0 | 0.2 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 0.0 | 0.4 | GO:0042393 | histone binding(GO:0042393) |
| 0.0 | 0.9 | GO:0042826 | histone deacetylase binding(GO:0042826) |
| 0.0 | 1.0 | GO:0101005 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
| 0.0 | 0.1 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.0 | 0.0 | GO:0070697 | activin receptor binding(GO:0070697) |
| 0.0 | 0.1 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.0 | 0.6 | GO:0035064 | methylated histone binding(GO:0035064) |
| 0.0 | 0.0 | GO:0043812 | phosphatidylinositol-4-phosphate phosphatase activity(GO:0043812) |
| 0.0 | 0.2 | GO:0004622 | lysophospholipase activity(GO:0004622) |
| 0.0 | 0.0 | GO:0052835 | inositol tetrakisphosphate 1-kinase activity(GO:0047325) inositol tetrakisphosphate kinase activity(GO:0051765) inositol-1,3,4-trisphosphate 6-kinase activity(GO:0052725) inositol-1,3,4-trisphosphate 5-kinase activity(GO:0052726) inositol-1,3,4,5,6-pentakisphosphate 1-phosphatase activity(GO:0052825) inositol-1,3,4,6-tetrakisphosphate 6-phosphatase activity(GO:0052830) inositol-1,3,4,6-tetrakisphosphate 1-phosphatase activity(GO:0052831) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) |
| 0.0 | 0.1 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
| 0.0 | 0.4 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.0 | 0.1 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
| 0.0 | 0.0 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
| 0.0 | 0.0 | GO:0050262 | ribosylnicotinamide kinase activity(GO:0050262) ribosylnicotinate kinase activity(GO:0061769) |
| 0.0 | 0.3 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.0 | 0.5 | GO:0030170 | pyridoxal phosphate binding(GO:0030170) |
| 0.0 | 0.1 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.0 | 0.0 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
| 0.0 | 0.1 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
| 0.0 | 0.2 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.0 | 0.2 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.0 | 0.5 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
| 0.0 | 3.4 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
| 0.0 | 0.2 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.0 | 0.4 | GO:0043621 | protein self-association(GO:0043621) |