ENCODE cell lines, expression (Ernst 2011)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
FOXM1
|
ENSG00000111206.8 | FOXM1 |
|
TBL1XR1
|
ENSG00000177565.11 | TBL1XR1 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| TBL1XR1 | hg19_v2_chr3_-_176914238_176914277 | 0.30 | 2.5e-01 | Click! |
| FOXM1 | hg19_v2_chr12_-_2986107_2986258 | -0.10 | 7.1e-01 | Click! |
| Promoter | Score | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr11_-_104972158 | 3.49 |
ENST00000598974.1 ENST00000593315.1 ENST00000594519.1 ENST00000415981.2 ENST00000525374.1 ENST00000375707.1 |
CASP1 CARD16 CARD17 |
caspase 1, apoptosis-related cysteine peptidase caspase recruitment domain family, member 16 caspase recruitment domain family, member 17 |
| chr22_+_23241661 | 2.50 |
ENST00000390322.2 |
IGLJ2 |
immunoglobulin lambda joining 2 |
| chr11_+_5710919 | 2.19 |
ENST00000379965.3 ENST00000425490.1 |
TRIM22 |
tripartite motif containing 22 |
| chr1_+_160709055 | 2.16 |
ENST00000368043.3 ENST00000368042.3 ENST00000458602.2 ENST00000458104.2 |
SLAMF7 |
SLAM family member 7 |
| chr1_-_169680745 | 2.13 |
ENST00000236147.4 |
SELL |
selectin L |
| chr11_-_104905840 | 2.07 |
ENST00000526568.1 ENST00000393136.4 ENST00000531166.1 ENST00000534497.1 ENST00000527979.1 ENST00000446369.1 ENST00000353247.5 ENST00000528974.1 ENST00000533400.1 ENST00000525825.1 ENST00000436863.3 |
CASP1 |
caspase 1, apoptosis-related cysteine peptidase |
| chr11_-_58343319 | 2.05 |
ENST00000395074.2 |
LPXN |
leupaxin |
| chr7_+_73623717 | 2.03 |
ENST00000344995.5 ENST00000460943.1 |
LAT2 |
linker for activation of T cells family, member 2 |
| chrX_-_70329118 | 1.99 |
ENST00000374188.3 |
IL2RG |
interleukin 2 receptor, gamma |
| chr1_-_25291475 | 1.91 |
ENST00000338888.3 ENST00000399916.1 |
RUNX3 |
runt-related transcription factor 3 |
| chr13_-_46756351 | 1.90 |
ENST00000323076.2 |
LCP1 |
lymphocyte cytosolic protein 1 (L-plastin) |
| chr12_-_91574142 | 1.86 |
ENST00000547937.1 |
DCN |
decorin |
| chr6_+_32605195 | 1.83 |
ENST00000374949.2 |
HLA-DQA1 |
major histocompatibility complex, class II, DQ alpha 1 |
| chr3_-_127455200 | 1.83 |
ENST00000398101.3 |
MGLL |
monoglyceride lipase |
| chr22_+_23247030 | 1.81 |
ENST00000390324.2 |
IGLJ3 |
immunoglobulin lambda joining 3 |
| chr22_+_23264766 | 1.77 |
ENST00000390331.2 |
IGLC7 |
immunoglobulin lambda constant 7 |
| chr6_+_6588902 | 1.72 |
ENST00000230568.4 |
LY86 |
lymphocyte antigen 86 |
| chr19_-_7766991 | 1.69 |
ENST00000597921.1 ENST00000346664.5 |
FCER2 |
Fc fragment of IgE, low affinity II, receptor for (CD23) |
| chr2_+_127413677 | 1.66 |
ENST00000356887.7 |
GYPC |
glycophorin C (Gerbich blood group) |
| chr6_+_33048222 | 1.66 |
ENST00000428835.1 |
HLA-DPB1 |
major histocompatibility complex, class II, DP beta 1 |
| chr17_+_67498538 | 1.58 |
ENST00000589647.1 |
MAP2K6 |
mitogen-activated protein kinase kinase 6 |
| chr18_+_61554932 | 1.55 |
ENST00000299502.4 ENST00000457692.1 ENST00000413956.1 |
SERPINB2 |
serpin peptidase inhibitor, clade B (ovalbumin), member 2 |
| chr3_-_107777208 | 1.54 |
ENST00000398258.3 |
CD47 |
CD47 molecule |
| chr6_+_29691056 | 1.52 |
ENST00000414333.1 ENST00000334668.4 ENST00000259951.7 |
HLA-F |
major histocompatibility complex, class I, F |
| chr17_-_38721711 | 1.50 |
ENST00000578085.1 ENST00000246657.2 |
CCR7 |
chemokine (C-C motif) receptor 7 |
| chr19_-_7764281 | 1.49 |
ENST00000360067.4 |
FCER2 |
Fc fragment of IgE, low affinity II, receptor for (CD23) |
| chr6_+_32605134 | 1.48 |
ENST00000343139.5 ENST00000395363.1 ENST00000496318.1 |
HLA-DQA1 |
major histocompatibility complex, class II, DQ alpha 1 |
| chr6_+_33043703 | 1.47 |
ENST00000418931.2 ENST00000535465.1 |
HLA-DPB1 |
major histocompatibility complex, class II, DP beta 1 |
| chr4_-_40517984 | 1.45 |
ENST00000381795.6 |
RBM47 |
RNA binding motif protein 47 |
| chr2_+_102608306 | 1.45 |
ENST00000332549.3 |
IL1R2 |
interleukin 1 receptor, type II |
| chr1_+_79086088 | 1.45 |
ENST00000370751.5 ENST00000342282.3 |
IFI44L |
interferon-induced protein 44-like |
| chr2_-_158345462 | 1.43 |
ENST00000439355.1 ENST00000540637.1 |
CYTIP |
cytohesin 1 interacting protein |
| chr14_+_75988851 | 1.39 |
ENST00000555504.1 |
BATF |
basic leucine zipper transcription factor, ATF-like |
| chr5_+_118690466 | 1.38 |
ENST00000503646.1 |
TNFAIP8 |
tumor necrosis factor, alpha-induced protein 8 |
| chr19_+_42381173 | 1.36 |
ENST00000221972.3 |
CD79A |
CD79a molecule, immunoglobulin-associated alpha |
| chr6_-_32784687 | 1.33 |
ENST00000447394.1 ENST00000438763.2 |
HLA-DOB |
major histocompatibility complex, class II, DO beta |
| chr2_-_158300556 | 1.33 |
ENST00000264192.3 |
CYTIP |
cytohesin 1 interacting protein |
| chr6_+_32709119 | 1.33 |
ENST00000374940.3 |
HLA-DQA2 |
major histocompatibility complex, class II, DQ alpha 2 |
| chr16_+_30483962 | 1.32 |
ENST00000356798.6 |
ITGAL |
integrin, alpha L (antigen CD11A (p180), lymphocyte function-associated antigen 1; alpha polypeptide) |
| chr19_+_49838653 | 1.30 |
ENST00000598095.1 ENST00000426897.2 ENST00000323906.4 ENST00000535669.2 ENST00000597602.1 ENST00000595660.1 |
CD37 |
CD37 molecule |
| chr15_-_80263506 | 1.30 |
ENST00000335661.6 |
BCL2A1 |
BCL2-related protein A1 |
| chr14_-_106692191 | 1.30 |
ENST00000390607.2 |
IGHV3-21 |
immunoglobulin heavy variable 3-21 |
| chr6_-_32920794 | 1.29 |
ENST00000395305.3 ENST00000395303.3 ENST00000374843.4 ENST00000429234.1 |
HLA-DMA XXbac-BPG181M17.5 |
major histocompatibility complex, class II, DM alpha Uncharacterized protein |
| chr21_-_43816052 | 1.28 |
ENST00000398405.1 |
TMPRSS3 |
transmembrane protease, serine 3 |
| chr8_-_41166953 | 1.27 |
ENST00000220772.3 |
SFRP1 |
secreted frizzled-related protein 1 |
| chr4_-_71532339 | 1.27 |
ENST00000254801.4 |
IGJ |
immunoglobulin J polypeptide, linker protein for immunoglobulin alpha and mu polypeptides |
| chr19_+_42381337 | 1.26 |
ENST00000597454.1 ENST00000444740.2 |
CD79A |
CD79a molecule, immunoglobulin-associated alpha |
| chr2_-_231090344 | 1.24 |
ENST00000540870.1 ENST00000416610.1 |
SP110 |
SP110 nuclear body protein |
| chr22_+_23237555 | 1.22 |
ENST00000390321.2 |
IGLC1 |
immunoglobulin lambda constant 1 (Mcg marker) |
| chr1_+_160709029 | 1.22 |
ENST00000444090.2 ENST00000441662.2 |
SLAMF7 |
SLAM family member 7 |
| chrX_-_70331298 | 1.21 |
ENST00000456850.2 ENST00000473378.1 ENST00000487883.1 ENST00000374202.2 |
IL2RG |
interleukin 2 receptor, gamma |
| chr7_+_73624327 | 1.20 |
ENST00000361082.3 ENST00000275635.7 ENST00000470709.1 |
LAT2 |
linker for activation of T cells family, member 2 |
| chr16_+_32077386 | 1.19 |
ENST00000354689.6 |
IGHV3OR16-9 |
immunoglobulin heavy variable 3/OR16-9 (non-functional) |
| chr1_+_158815588 | 1.19 |
ENST00000438394.1 |
MNDA |
myeloid cell nuclear differentiation antigen |
| chr6_+_31540056 | 1.17 |
ENST00000418386.2 |
LTA |
lymphotoxin alpha |
| chr17_-_29641084 | 1.16 |
ENST00000544462.1 |
EVI2B |
ecotropic viral integration site 2B |
| chr17_-_34524157 | 1.15 |
ENST00000378354.4 ENST00000394484.1 |
CCL3L3 |
chemokine (C-C motif) ligand 3-like 3 |
| chr1_+_158969752 | 1.15 |
ENST00000566111.1 |
IFI16 |
interferon, gamma-inducible protein 16 |
| chr3_+_113251143 | 1.15 |
ENST00000264852.4 ENST00000393830.3 |
SIDT1 |
SID1 transmembrane family, member 1 |
| chr19_-_43709703 | 1.14 |
ENST00000599391.1 ENST00000244295.9 |
PSG4 |
pregnancy specific beta-1-glycoprotein 4 |
| chr6_+_13272904 | 1.12 |
ENST00000379335.3 ENST00000379329.1 |
PHACTR1 |
phosphatase and actin regulator 1 |
| chr14_-_106518922 | 1.09 |
ENST00000390598.2 |
IGHV3-7 |
immunoglobulin heavy variable 3-7 |
| chr17_-_29648761 | 1.08 |
ENST00000247270.3 ENST00000462804.2 |
EVI2A |
ecotropic viral integration site 2A |
| chr9_-_123676827 | 1.08 |
ENST00000546084.1 |
TRAF1 |
TNF receptor-associated factor 1 |
| chr1_-_159046617 | 1.07 |
ENST00000368130.4 |
AIM2 |
absent in melanoma 2 |
| chr2_+_127413704 | 1.06 |
ENST00000409836.3 |
GYPC |
glycophorin C (Gerbich blood group) |
| chrX_-_114253536 | 1.06 |
ENST00000371936.1 |
IL13RA2 |
interleukin 13 receptor, alpha 2 |
| chr4_+_40198527 | 1.05 |
ENST00000381799.5 |
RHOH |
ras homolog family member H |
| chr13_+_31309645 | 1.05 |
ENST00000380490.3 |
ALOX5AP |
arachidonate 5-lipoxygenase-activating protein |
| chr5_+_118691706 | 1.05 |
ENST00000415806.2 |
TNFAIP8 |
tumor necrosis factor, alpha-induced protein 8 |
| chr2_+_231090433 | 1.04 |
ENST00000486687.2 ENST00000350136.5 ENST00000392045.3 ENST00000417495.3 ENST00000343805.6 ENST00000420434.3 |
SP140 |
SP140 nuclear body protein |
| chr14_+_21249200 | 1.04 |
ENST00000304677.2 |
RNASE6 |
ribonuclease, RNase A family, k6 |
| chr22_-_42336209 | 1.03 |
ENST00000472374.2 |
CENPM |
centromere protein M |
| chr10_+_91152303 | 1.03 |
ENST00000371804.3 |
IFIT1 |
interferon-induced protein with tetratricopeptide repeats 1 |
| chr11_-_57335750 | 1.03 |
ENST00000340573.4 |
UBE2L6 |
ubiquitin-conjugating enzyme E2L 6 |
| chr13_-_47012325 | 1.03 |
ENST00000409879.2 |
KIAA0226L |
KIAA0226-like |
| chr11_+_35198243 | 1.02 |
ENST00000528455.1 |
CD44 |
CD44 molecule (Indian blood group) |
| chr12_-_91572278 | 1.02 |
ENST00000425043.1 ENST00000420120.2 ENST00000441303.2 ENST00000456569.2 |
DCN |
decorin |
| chr11_+_35201826 | 1.02 |
ENST00000531873.1 |
CD44 |
CD44 molecule (Indian blood group) |
| chr14_-_106471723 | 1.00 |
ENST00000390595.2 |
IGHV1-3 |
immunoglobulin heavy variable 1-3 |
| chr12_-_91573132 | 1.00 |
ENST00000550563.1 ENST00000546370.1 |
DCN |
decorin |
| chr2_+_127413481 | 0.98 |
ENST00000259254.4 |
GYPC |
glycophorin C (Gerbich blood group) |
| chr3_-_158390282 | 0.98 |
ENST00000264265.3 |
LXN |
latexin |
| chr22_+_23243156 | 0.97 |
ENST00000390323.2 |
IGLC2 |
immunoglobulin lambda constant 2 (Kern-Oz- marker) |
| chr12_+_25205568 | 0.97 |
ENST00000548766.1 ENST00000556887.1 |
LRMP |
lymphoid-restricted membrane protein |
| chr22_+_23040274 | 0.97 |
ENST00000390306.2 |
IGLV2-23 |
immunoglobulin lambda variable 2-23 |
| chrX_-_73072534 | 0.96 |
ENST00000429829.1 |
XIST |
X inactive specific transcript (non-protein coding) |
| chr3_+_98250743 | 0.94 |
ENST00000284311.3 |
GPR15 |
G protein-coupled receptor 15 |
| chr3_-_124839648 | 0.94 |
ENST00000430155.2 |
SLC12A8 |
solute carrier family 12, member 8 |
| chr14_-_106539557 | 0.94 |
ENST00000390599.2 |
IGHV1-8 |
immunoglobulin heavy variable 1-8 |
| chr1_+_192544857 | 0.94 |
ENST00000367459.3 ENST00000469578.2 |
RGS1 |
regulator of G-protein signaling 1 |
| chr17_-_34417479 | 0.93 |
ENST00000225245.5 |
CCL3 |
chemokine (C-C motif) ligand 3 |
| chr17_-_29641104 | 0.93 |
ENST00000577894.1 ENST00000330927.4 |
EVI2B |
ecotropic viral integration site 2B |
| chr1_+_198608146 | 0.92 |
ENST00000367376.2 ENST00000352140.3 ENST00000594404.1 ENST00000598951.1 ENST00000530727.1 ENST00000442510.2 ENST00000367367.4 ENST00000348564.6 ENST00000367364.1 ENST00000413409.2 |
PTPRC |
protein tyrosine phosphatase, receptor type, C |
| chr6_+_32821924 | 0.92 |
ENST00000374859.2 ENST00000453265.2 |
PSMB9 |
proteasome (prosome, macropain) subunit, beta type, 9 |
| chr6_+_31583761 | 0.92 |
ENST00000376049.4 |
AIF1 |
allograft inflammatory factor 1 |
| chr6_-_33048483 | 0.91 |
ENST00000419277.1 |
HLA-DPA1 |
major histocompatibility complex, class II, DP alpha 1 |
| chr15_-_22448819 | 0.91 |
ENST00000604066.1 |
IGHV1OR15-1 |
immunoglobulin heavy variable 1/OR15-1 (non-functional) |
| chr14_-_106926724 | 0.91 |
ENST00000434710.1 |
IGHV3-43 |
immunoglobulin heavy variable 3-43 |
| chr12_+_75874580 | 0.91 |
ENST00000456650.3 |
GLIPR1 |
GLI pathogenesis-related 1 |
| chr1_-_160681593 | 0.90 |
ENST00000368045.3 ENST00000368046.3 |
CD48 |
CD48 molecule |
| chr2_+_152214098 | 0.90 |
ENST00000243347.3 |
TNFAIP6 |
tumor necrosis factor, alpha-induced protein 6 |
| chr3_-_197300194 | 0.90 |
ENST00000358186.2 ENST00000431056.1 |
BDH1 |
3-hydroxybutyrate dehydrogenase, type 1 |
| chr14_-_106963409 | 0.89 |
ENST00000390621.2 |
IGHV1-45 |
immunoglobulin heavy variable 1-45 |
| chr17_+_65373531 | 0.89 |
ENST00000580974.1 |
PITPNC1 |
phosphatidylinositol transfer protein, cytoplasmic 1 |
| chr12_-_91576429 | 0.89 |
ENST00000552145.1 ENST00000546745.1 |
DCN |
decorin |
| chr1_+_158985457 | 0.89 |
ENST00000567661.1 ENST00000474473.1 |
IFI16 |
interferon, gamma-inducible protein 16 |
| chr4_+_47487285 | 0.88 |
ENST00000273859.3 ENST00000504445.1 |
ATP10D |
ATPase, class V, type 10D |
| chr11_+_35160709 | 0.88 |
ENST00000415148.2 ENST00000433354.2 ENST00000449691.2 ENST00000437706.2 ENST00000360158.4 ENST00000428726.2 ENST00000526669.2 ENST00000433892.2 ENST00000278386.6 ENST00000434472.2 ENST00000352818.4 ENST00000442151.2 |
CD44 |
CD44 molecule (Indian blood group) |
| chr12_+_6554021 | 0.88 |
ENST00000266557.3 |
CD27 |
CD27 molecule |
| chr10_-_121296045 | 0.87 |
ENST00000392865.1 |
RGS10 |
regulator of G-protein signaling 10 |
| chrX_-_114252193 | 0.87 |
ENST00000243213.1 |
IL13RA2 |
interleukin 13 receptor, alpha 2 |
| chr8_-_120605194 | 0.87 |
ENST00000522167.1 |
ENPP2 |
ectonucleotide pyrophosphatase/phosphodiesterase 2 |
| chr16_+_28943260 | 0.87 |
ENST00000538922.1 ENST00000324662.3 ENST00000567541.1 |
CD19 |
CD19 molecule |
| chr2_+_68592305 | 0.86 |
ENST00000234313.7 |
PLEK |
pleckstrin |
| chr16_-_84651647 | 0.85 |
ENST00000564057.1 |
COTL1 |
coactosin-like 1 (Dictyostelium) |
| chr9_-_117853297 | 0.85 |
ENST00000542877.1 ENST00000537320.1 ENST00000341037.4 |
TNC |
tenascin C |
| chr12_+_4385230 | 0.85 |
ENST00000536537.1 |
CCND2 |
cyclin D2 |
| chr8_+_54793425 | 0.85 |
ENST00000522225.1 |
RGS20 |
regulator of G-protein signaling 20 |
| chr6_-_32812420 | 0.85 |
ENST00000374881.2 |
PSMB8 |
proteasome (prosome, macropain) subunit, beta type, 8 |
| chr1_-_9129735 | 0.84 |
ENST00000377424.4 |
SLC2A5 |
solute carrier family 2 (facilitated glucose/fructose transporter), member 5 |
| chr14_-_106733624 | 0.84 |
ENST00000390610.2 |
IGHV1-24 |
immunoglobulin heavy variable 1-24 |
| chr2_-_191878162 | 0.84 |
ENST00000540176.1 |
STAT1 |
signal transducer and activator of transcription 1, 91kDa |
| chr6_-_32498046 | 0.84 |
ENST00000374975.3 |
HLA-DRB5 |
major histocompatibility complex, class II, DR beta 5 |
| chr1_-_207095324 | 0.83 |
ENST00000530505.1 ENST00000367091.3 ENST00000442471.2 |
FAIM3 |
Fas apoptotic inhibitory molecule 3 |
| chr21_+_27011584 | 0.83 |
ENST00000400532.1 ENST00000480456.1 ENST00000312957.5 |
JAM2 |
junctional adhesion molecule 2 |
| chr2_+_33661382 | 0.83 |
ENST00000402538.3 |
RASGRP3 |
RAS guanyl releasing protein 3 (calcium and DAG-regulated) |
| chr12_+_113354341 | 0.82 |
ENST00000553152.1 |
OAS1 |
2'-5'-oligoadenylate synthetase 1, 40/46kDa |
| chr1_+_79115503 | 0.81 |
ENST00000370747.4 ENST00000438486.1 ENST00000545124.1 |
IFI44 |
interferon-induced protein 44 |
| chr11_+_58912240 | 0.81 |
ENST00000527629.1 ENST00000361723.3 ENST00000531408.1 |
FAM111A |
family with sequence similarity 111, member A |
| chr12_-_91573249 | 0.81 |
ENST00000550099.1 ENST00000546391.1 ENST00000551354.1 |
DCN |
decorin |
| chr12_-_91576561 | 0.80 |
ENST00000547568.2 ENST00000552962.1 |
DCN |
decorin |
| chr1_+_158801095 | 0.80 |
ENST00000368141.4 |
MNDA |
myeloid cell nuclear differentiation antigen |
| chr12_+_113344582 | 0.80 |
ENST00000202917.5 ENST00000445409.2 ENST00000452357.2 |
OAS1 |
2'-5'-oligoadenylate synthetase 1, 40/46kDa |
| chr13_-_99959641 | 0.80 |
ENST00000376414.4 |
GPR183 |
G protein-coupled receptor 183 |
| chr11_-_58345569 | 0.80 |
ENST00000528954.1 ENST00000528489.1 |
LPXN |
leupaxin |
| chr6_+_32812568 | 0.80 |
ENST00000414474.1 |
PSMB9 |
proteasome (prosome, macropain) subunit, beta type, 9 |
| chr17_+_72462766 | 0.80 |
ENST00000392625.3 ENST00000361933.3 ENST00000310828.5 |
CD300A |
CD300a molecule |
| chr6_+_106959718 | 0.79 |
ENST00000369066.3 |
AIM1 |
absent in melanoma 1 |
| chr2_-_191885686 | 0.79 |
ENST00000432058.1 |
STAT1 |
signal transducer and activator of transcription 1, 91kDa |
| chr1_+_209929377 | 0.79 |
ENST00000400959.3 ENST00000367025.3 |
TRAF3IP3 |
TRAF3 interacting protein 3 |
| chr6_-_32636145 | 0.79 |
ENST00000399084.1 |
HLA-DQB1 |
major histocompatibility complex, class II, DQ beta 1 |
| chr14_-_106573756 | 0.79 |
ENST00000390601.2 |
IGHV3-11 |
immunoglobulin heavy variable 3-11 (gene/pseudogene) |
| chr3_-_189840223 | 0.79 |
ENST00000427335.2 |
LEPREL1 |
leprecan-like 1 |
| chr14_-_106322288 | 0.79 |
ENST00000390559.2 |
IGHM |
immunoglobulin heavy constant mu |
| chr1_+_181003067 | 0.79 |
ENST00000434571.2 ENST00000367579.3 ENST00000282990.6 ENST00000367580.5 |
MR1 |
major histocompatibility complex, class I-related |
| chr22_+_23077065 | 0.78 |
ENST00000390310.2 |
IGLV2-18 |
immunoglobulin lambda variable 2-18 |
| chr8_+_54793454 | 0.77 |
ENST00000276500.4 |
RGS20 |
regulator of G-protein signaling 20 |
| chr11_+_102188272 | 0.77 |
ENST00000532808.1 |
BIRC3 |
baculoviral IAP repeat containing 3 |
| chr10_-_101690650 | 0.77 |
ENST00000543621.1 |
DNMBP |
dynamin binding protein |
| chr4_-_84035868 | 0.76 |
ENST00000426923.2 ENST00000509973.1 |
PLAC8 |
placenta-specific 8 |
| chr1_+_171060018 | 0.76 |
ENST00000367755.4 ENST00000392085.2 ENST00000542847.1 ENST00000538429.1 ENST00000479749.1 |
FMO3 |
flavin containing monooxygenase 3 |
| chr11_+_5646213 | 0.76 |
ENST00000429814.2 |
TRIM34 |
tripartite motif containing 34 |
| chr13_-_38172863 | 0.75 |
ENST00000541481.1 ENST00000379743.4 ENST00000379742.4 ENST00000379749.4 ENST00000541179.1 ENST00000379747.4 |
POSTN |
periostin, osteoblast specific factor |
| chr10_-_98031265 | 0.75 |
ENST00000224337.5 ENST00000371176.2 |
BLNK |
B-cell linker |
| chr1_-_9129631 | 0.75 |
ENST00000377414.3 |
SLC2A5 |
solute carrier family 2 (facilitated glucose/fructose transporter), member 5 |
| chr12_-_91546926 | 0.75 |
ENST00000550758.1 |
DCN |
decorin |
| chr12_+_113344755 | 0.75 |
ENST00000550883.1 |
OAS1 |
2'-5'-oligoadenylate synthetase 1, 40/46kDa |
| chr19_+_35820064 | 0.74 |
ENST00000341773.6 ENST00000600131.1 ENST00000270311.6 ENST00000595780.1 ENST00000597916.1 ENST00000593867.1 ENST00000600424.1 ENST00000599811.1 ENST00000536635.2 ENST00000085219.5 ENST00000544992.2 ENST00000419549.2 |
CD22 |
CD22 molecule |
| chr8_-_95274536 | 0.74 |
ENST00000297596.2 ENST00000396194.2 |
GEM |
GTP binding protein overexpressed in skeletal muscle |
| chr17_+_34639793 | 0.74 |
ENST00000394465.2 ENST00000394463.2 ENST00000378342.4 |
CCL4L2 |
chemokine (C-C motif) ligand 4-like 2 |
| chr8_+_28196157 | 0.74 |
ENST00000522209.1 |
PNOC |
prepronociceptin |
| chr14_-_106994333 | 0.74 |
ENST00000390624.2 |
IGHV3-48 |
immunoglobulin heavy variable 3-48 |
| chr19_+_6531010 | 0.73 |
ENST00000245817.3 |
TNFSF9 |
tumor necrosis factor (ligand) superfamily, member 9 |
| chr12_-_102872317 | 0.73 |
ENST00000424202.2 |
IGF1 |
insulin-like growth factor 1 (somatomedin C) |
| chr1_+_156124162 | 0.73 |
ENST00000368282.1 |
SEMA4A |
sema domain, immunoglobulin domain (Ig), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 4A |
| chr19_+_18284477 | 0.73 |
ENST00000407280.3 |
IFI30 |
interferon, gamma-inducible protein 30 |
| chr17_-_34625719 | 0.73 |
ENST00000422211.2 ENST00000542124.1 |
CCL3L1 |
chemokine (C-C motif) ligand 3-like 1 |
| chr11_+_121461097 | 0.72 |
ENST00000527934.1 |
SORL1 |
sortilin-related receptor, L(DLR class) A repeats containing |
| chr17_-_66951474 | 0.72 |
ENST00000269080.2 |
ABCA8 |
ATP-binding cassette, sub-family A (ABC1), member 8 |
| chr21_-_43816152 | 0.72 |
ENST00000433957.2 ENST00000398397.3 |
TMPRSS3 |
transmembrane protease, serine 3 |
| chr12_-_53601000 | 0.71 |
ENST00000338737.4 ENST00000549086.2 |
ITGB7 |
integrin, beta 7 |
| chr9_+_2157655 | 0.71 |
ENST00000452193.1 |
SMARCA2 |
SWI/SNF related, matrix associated, actin dependent regulator of chromatin, subfamily a, member 2 |
| chr4_+_55095264 | 0.71 |
ENST00000257290.5 |
PDGFRA |
platelet-derived growth factor receptor, alpha polypeptide |
| chr12_-_91539918 | 0.71 |
ENST00000548218.1 |
DCN |
decorin |
| chr19_-_43383789 | 0.71 |
ENST00000595356.1 |
PSG1 |
pregnancy specific beta-1-glycoprotein 1 |
| chr7_+_116660246 | 0.71 |
ENST00000434836.1 ENST00000393443.1 ENST00000465133.1 ENST00000477742.1 ENST00000393447.4 ENST00000393444.3 |
ST7 |
suppression of tumorigenicity 7 |
| chr11_-_87908600 | 0.71 |
ENST00000531138.1 ENST00000526372.1 ENST00000243662.6 |
RAB38 |
RAB38, member RAS oncogene family |
| chr21_+_42792442 | 0.71 |
ENST00000398600.2 |
MX1 |
myxovirus (influenza virus) resistance 1, interferon-inducible protein p78 (mouse) |
| chr17_+_34431212 | 0.71 |
ENST00000394495.1 |
CCL4 |
chemokine (C-C motif) ligand 4 |
| chr11_+_63304273 | 0.70 |
ENST00000439013.2 ENST00000255688.3 |
RARRES3 |
retinoic acid receptor responder (tazarotene induced) 3 |
| chr6_+_32811885 | 0.70 |
ENST00000458296.1 ENST00000413039.1 ENST00000429600.1 ENST00000412095.1 ENST00000415067.1 ENST00000395330.1 |
TAPSAR1 PSMB9 |
TAP1 and PSMB8 antisense RNA 1 proteasome (prosome, macropain) subunit, beta type, 9 |
| chr11_+_102188224 | 0.70 |
ENST00000263464.3 |
BIRC3 |
baculoviral IAP repeat containing 3 |
| chr6_+_31543334 | 0.69 |
ENST00000449264.2 |
TNF |
tumor necrosis factor |
| chr10_-_98031310 | 0.69 |
ENST00000427367.2 ENST00000413476.2 |
BLNK |
B-cell linker |
| chr11_-_104817919 | 0.69 |
ENST00000533252.1 |
CASP4 |
caspase 4, apoptosis-related cysteine peptidase |
| chr13_-_46716969 | 0.68 |
ENST00000435666.2 |
LCP1 |
lymphocyte cytosolic protein 1 (L-plastin) |
| chr2_+_102972363 | 0.68 |
ENST00000409599.1 |
IL18R1 |
interleukin 18 receptor 1 |
| chr2_-_60780702 | 0.68 |
ENST00000359629.5 |
BCL11A |
B-cell CLL/lymphoma 11A (zinc finger protein) |
| chr12_-_719573 | 0.68 |
ENST00000397265.3 |
NINJ2 |
ninjurin 2 |
| chr1_+_158975744 | 0.68 |
ENST00000426592.2 |
IFI16 |
interferon, gamma-inducible protein 16 |
| chr17_+_34640031 | 0.68 |
ENST00000339270.6 ENST00000482104.1 |
CCL4L2 |
chemokine (C-C motif) ligand 4-like 2 |
| chr12_-_772901 | 0.68 |
ENST00000305108.4 |
NINJ2 |
ninjurin 2 |
| chr17_+_72462525 | 0.68 |
ENST00000360141.3 |
CD300A |
CD300a molecule |
| chr3_-_182880541 | 0.67 |
ENST00000470251.1 ENST00000265598.3 |
LAMP3 |
lysosomal-associated membrane protein 3 |
| chr12_+_25205446 | 0.66 |
ENST00000557489.1 ENST00000354454.3 ENST00000536173.1 |
LRMP |
lymphoid-restricted membrane protein |
| chr7_-_137028534 | 0.66 |
ENST00000348225.2 |
PTN |
pleiotrophin |
| chr11_-_57335280 | 0.66 |
ENST00000287156.4 |
UBE2L6 |
ubiquitin-conjugating enzyme E2L 6 |
| chr6_-_32557610 | 0.65 |
ENST00000360004.5 |
HLA-DRB1 |
major histocompatibility complex, class II, DR beta 1 |
| chr7_-_144435985 | 0.65 |
ENST00000549981.1 |
TPK1 |
thiamin pyrophosphokinase 1 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.4 | 5.5 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
| 1.0 | 4.9 | GO:0002925 | positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 0.8 | 9.0 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
| 0.7 | 5.2 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.6 | 0.6 | GO:1903973 | negative regulation of macrophage colony-stimulating factor signaling pathway(GO:1902227) negative regulation of response to macrophage colony-stimulating factor(GO:1903970) negative regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903973) |
| 0.6 | 1.7 | GO:0072709 | cellular response to sorbitol(GO:0072709) |
| 0.6 | 2.2 | GO:2000520 | regulation of immunological synapse formation(GO:2000520) |
| 0.5 | 4.4 | GO:1900625 | regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
| 0.5 | 2.6 | GO:0002399 | MHC class II protein complex assembly(GO:0002399) |
| 0.5 | 1.5 | GO:0002581 | negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) |
| 0.5 | 1.9 | GO:0003366 | cell-matrix adhesion involved in ameboidal cell migration(GO:0003366) |
| 0.5 | 1.9 | GO:0050705 | regulation of interleukin-1 alpha secretion(GO:0050705) |
| 0.5 | 1.9 | GO:0072183 | negative regulation by virus of viral protein levels in host cell(GO:0046725) negative regulation of nephron tubule epithelial cell differentiation(GO:0072183) negative regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072308) negative regulation of epithelial cell differentiation involved in kidney development(GO:2000697) |
| 0.5 | 3.2 | GO:0038110 | interleukin-2-mediated signaling pathway(GO:0038110) |
| 0.5 | 1.4 | GO:2000173 | negative regulation of dendrite extension(GO:1903860) regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.4 | 0.4 | GO:0034340 | response to type I interferon(GO:0034340) |
| 0.4 | 1.3 | GO:1902771 | regulation of choline O-acetyltransferase activity(GO:1902769) positive regulation of choline O-acetyltransferase activity(GO:1902771) negative regulation of tau-protein kinase activity(GO:1902948) positive regulation of early endosome to recycling endosome transport(GO:1902955) negative regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902960) negative regulation of neurofibrillary tangle assembly(GO:1902997) negative regulation of aspartic-type peptidase activity(GO:1905246) |
| 0.4 | 0.4 | GO:2001190 | positive regulation of T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:2001190) |
| 0.4 | 2.0 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) regulation of trophectodermal cell proliferation(GO:1904073) positive regulation of trophectodermal cell proliferation(GO:1904075) |
| 0.4 | 1.1 | GO:1904395 | retinal rod cell differentiation(GO:0060221) positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
| 0.4 | 2.3 | GO:0043305 | negative regulation of mast cell degranulation(GO:0043305) |
| 0.4 | 3.7 | GO:0002480 | antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
| 0.4 | 1.5 | GO:0071461 | cellular response to redox state(GO:0071461) |
| 0.4 | 2.5 | GO:1990539 | fructose transport(GO:0015755) fructose import(GO:0032445) carbohydrate import into cell(GO:0097319) carbohydrate import across plasma membrane(GO:0098704) fructose import across plasma membrane(GO:1990539) |
| 0.4 | 1.1 | GO:0051097 | negative regulation of helicase activity(GO:0051097) |
| 0.4 | 2.8 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.3 | 2.4 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.3 | 2.8 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
| 0.3 | 1.0 | GO:1990523 | bone regeneration(GO:1990523) |
| 0.3 | 0.3 | GO:0051255 | spindle midzone assembly(GO:0051255) |
| 0.3 | 1.6 | GO:0003402 | planar cell polarity pathway involved in axis elongation(GO:0003402) |
| 0.3 | 2.2 | GO:2000124 | regulation of endocannabinoid signaling pathway(GO:2000124) |
| 0.3 | 0.9 | GO:0093001 | glycolysis from storage polysaccharide through glucose-1-phosphate(GO:0093001) |
| 0.3 | 0.9 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
| 0.3 | 1.5 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.3 | 0.6 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.3 | 0.9 | GO:0072275 | metanephric glomerulus morphogenesis(GO:0072275) metanephric glomerulus vasculature morphogenesis(GO:0072276) metanephric glomerular capillary formation(GO:0072277) |
| 0.3 | 0.8 | GO:0046586 | regulation of calcium-dependent cell-cell adhesion(GO:0046586) |
| 0.3 | 1.1 | GO:0002906 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 0.3 | 0.6 | GO:0035408 | histone H3-T6 phosphorylation(GO:0035408) |
| 0.3 | 0.6 | GO:0002027 | regulation of heart rate(GO:0002027) |
| 0.3 | 2.5 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.3 | 0.8 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) detection of triacyl bacterial lipopeptide(GO:0042495) detection of bacterial lipopeptide(GO:0070340) |
| 0.3 | 0.5 | GO:0002605 | negative regulation of dendritic cell antigen processing and presentation(GO:0002605) |
| 0.3 | 0.8 | GO:0060369 | positive regulation of Fc receptor mediated stimulatory signaling pathway(GO:0060369) |
| 0.3 | 30.7 | GO:0050853 | B cell receptor signaling pathway(GO:0050853) |
| 0.3 | 1.0 | GO:0033625 | positive regulation of integrin activation(GO:0033625) |
| 0.2 | 1.2 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.2 | 0.7 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.2 | 1.5 | GO:1903435 | positive regulation of constitutive secretory pathway(GO:1903435) |
| 0.2 | 0.5 | GO:0006550 | isoleucine catabolic process(GO:0006550) |
| 0.2 | 1.2 | GO:0014900 | muscle hyperplasia(GO:0014900) |
| 0.2 | 0.9 | GO:0042357 | thiamine diphosphate metabolic process(GO:0042357) |
| 0.2 | 0.7 | GO:0034124 | regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034124) |
| 0.2 | 0.2 | GO:1903778 | protein localization to vacuolar membrane(GO:1903778) |
| 0.2 | 1.1 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.2 | 0.8 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.2 | 0.6 | GO:0090291 | negative regulation of osteoclast proliferation(GO:0090291) |
| 0.2 | 1.0 | GO:0070269 | pyroptosis(GO:0070269) |
| 0.2 | 0.8 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.2 | 0.2 | GO:0001782 | B cell homeostasis(GO:0001782) |
| 0.2 | 0.2 | GO:0045636 | regulation of melanocyte differentiation(GO:0045634) positive regulation of melanocyte differentiation(GO:0045636) regulation of pigment cell differentiation(GO:0050932) positive regulation of pigment cell differentiation(GO:0050942) positive regulation of neuroepithelial cell differentiation(GO:1902913) |
| 0.2 | 2.2 | GO:0006032 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.2 | 0.2 | GO:0035376 | sterol import(GO:0035376) cholesterol import(GO:0070508) |
| 0.2 | 0.4 | GO:0043132 | NAD transport(GO:0043132) |
| 0.2 | 0.8 | GO:1902044 | regulation of Fas signaling pathway(GO:1902044) |
| 0.2 | 0.2 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
| 0.2 | 0.7 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.2 | 0.2 | GO:1903487 | regulation of lactation(GO:1903487) |
| 0.2 | 0.2 | GO:0009118 | regulation of nucleoside metabolic process(GO:0009118) regulation of ATP metabolic process(GO:1903578) |
| 0.2 | 1.5 | GO:0006216 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
| 0.2 | 0.5 | GO:1904204 | regulation of skeletal muscle hypertrophy(GO:1904204) |
| 0.2 | 0.4 | GO:0070383 | DNA cytosine deamination(GO:0070383) |
| 0.2 | 0.7 | GO:0035627 | ceramide transport(GO:0035627) |
| 0.2 | 1.2 | GO:2000111 | positive regulation of macrophage apoptotic process(GO:2000111) |
| 0.2 | 1.2 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
| 0.2 | 1.2 | GO:0097577 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.2 | 0.5 | GO:0036150 | phosphatidylserine acyl-chain remodeling(GO:0036150) |
| 0.2 | 0.3 | GO:0032641 | lymphotoxin A production(GO:0032641) lymphotoxin A biosynthetic process(GO:0042109) |
| 0.2 | 1.5 | GO:0033227 | dsRNA transport(GO:0033227) |
| 0.2 | 1.0 | GO:2000334 | blood microparticle formation(GO:0072564) regulation of blood microparticle formation(GO:2000332) positive regulation of blood microparticle formation(GO:2000334) |
| 0.2 | 19.0 | GO:0060333 | interferon-gamma-mediated signaling pathway(GO:0060333) |
| 0.2 | 0.5 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) |
| 0.2 | 1.2 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
| 0.2 | 0.5 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
| 0.2 | 0.7 | GO:0045423 | regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045423) positive regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045425) |
| 0.2 | 3.3 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
| 0.2 | 1.0 | GO:0019418 | sulfide oxidation(GO:0019418) sulfide oxidation, using sulfide:quinone oxidoreductase(GO:0070221) |
| 0.2 | 1.5 | GO:2001300 | lipoxin metabolic process(GO:2001300) |
| 0.2 | 0.2 | GO:0042986 | positive regulation of amyloid precursor protein biosynthetic process(GO:0042986) |
| 0.2 | 0.8 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.2 | 0.2 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
| 0.2 | 0.3 | GO:0048880 | sensory system development(GO:0048880) |
| 0.2 | 0.3 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
| 0.2 | 0.5 | GO:1990922 | regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 0.2 | 0.6 | GO:2000620 | positive regulation of histone H4-K16 acetylation(GO:2000620) |
| 0.2 | 1.2 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
| 0.1 | 0.1 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
| 0.1 | 0.4 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.1 | 0.7 | GO:0033078 | extrathymic T cell differentiation(GO:0033078) |
| 0.1 | 0.4 | GO:0014016 | neuroblast differentiation(GO:0014016) |
| 0.1 | 0.4 | GO:0090149 | synaptic vesicle recycling via endosome(GO:0036466) mitochondrial membrane fission(GO:0090149) |
| 0.1 | 0.4 | GO:0033364 | mast cell secretory granule organization(GO:0033364) |
| 0.1 | 1.1 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.1 | 0.3 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.1 | 0.4 | GO:0044210 | 'de novo' CTP biosynthetic process(GO:0044210) |
| 0.1 | 0.5 | GO:0046967 | cytosol to ER transport(GO:0046967) |
| 0.1 | 0.8 | GO:0061737 | leukotriene signaling pathway(GO:0061737) |
| 0.1 | 0.4 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.1 | 1.3 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
| 0.1 | 0.5 | GO:0042483 | negative regulation of odontogenesis(GO:0042483) |
| 0.1 | 0.4 | GO:0002580 | regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002580) regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002586) |
| 0.1 | 0.1 | GO:0046579 | positive regulation of Ras protein signal transduction(GO:0046579) |
| 0.1 | 0.5 | GO:0036228 | protein targeting to nuclear inner membrane(GO:0036228) |
| 0.1 | 2.2 | GO:0072540 | T-helper 17 cell lineage commitment(GO:0072540) |
| 0.1 | 0.6 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
| 0.1 | 0.5 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.1 | 0.5 | GO:0030242 | pexophagy(GO:0030242) |
| 0.1 | 0.1 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
| 0.1 | 1.0 | GO:1901475 | pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
| 0.1 | 0.4 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
| 0.1 | 0.4 | GO:0050902 | leukocyte adhesive activation(GO:0050902) |
| 0.1 | 0.5 | GO:0006780 | uroporphyrinogen III biosynthetic process(GO:0006780) uroporphyrinogen III metabolic process(GO:0046502) |
| 0.1 | 0.4 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
| 0.1 | 0.4 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.1 | 0.4 | GO:0038098 | sequestering of BMP from receptor via BMP binding(GO:0038098) |
| 0.1 | 0.2 | GO:0045994 | positive regulation of translational initiation by iron(GO:0045994) |
| 0.1 | 0.4 | GO:0018262 | isopeptide cross-linking via N6-(L-isoglutamyl)-L-lysine(GO:0018153) isopeptide cross-linking(GO:0018262) |
| 0.1 | 0.5 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
| 0.1 | 0.2 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.1 | 0.6 | GO:1904845 | response to L-glutamine(GO:1904844) cellular response to L-glutamine(GO:1904845) |
| 0.1 | 0.3 | GO:0046061 | dATP catabolic process(GO:0046061) |
| 0.1 | 0.1 | GO:0100009 | regulation of fever generation by regulation of prostaglandin secretion(GO:0071810) positive regulation of fever generation by positive regulation of prostaglandin secretion(GO:0071812) positive regulation of ERK1 and ERK2 cascade via TNFSF11-mediated signaling(GO:0071848) regulation of fever generation by prostaglandin secretion(GO:0100009) |
| 0.1 | 0.2 | GO:1903413 | cellular response to bile acid(GO:1903413) |
| 0.1 | 1.0 | GO:0003373 | dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
| 0.1 | 0.6 | GO:0061767 | negative regulation of lung blood pressure(GO:0061767) |
| 0.1 | 0.1 | GO:0009441 | glycolate metabolic process(GO:0009441) |
| 0.1 | 0.3 | GO:1904868 | telomerase catalytic core complex assembly(GO:1904868) regulation of telomerase catalytic core complex assembly(GO:1904882) positive regulation of telomerase catalytic core complex assembly(GO:1904884) |
| 0.1 | 0.1 | GO:0006517 | protein deglycosylation(GO:0006517) |
| 0.1 | 0.4 | GO:0043128 | regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043126) positive regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043128) |
| 0.1 | 4.9 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
| 0.1 | 0.1 | GO:0032425 | regulation of mismatch repair(GO:0032423) positive regulation of mismatch repair(GO:0032425) |
| 0.1 | 1.9 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
| 0.1 | 0.3 | GO:0071789 | spindle pole body duplication(GO:0030474) spindle pole body organization(GO:0051300) spindle pole body localization(GO:0070631) establishment of spindle pole body localization(GO:0070632) spindle pole body localization to nuclear envelope(GO:0071789) establishment of spindle pole body localization to nuclear envelope(GO:0071790) |
| 0.1 | 0.3 | GO:0008355 | olfactory learning(GO:0008355) |
| 0.1 | 0.4 | GO:1904566 | response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 0.1 | 0.1 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
| 0.1 | 0.1 | GO:0035990 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
| 0.1 | 0.3 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
| 0.1 | 0.2 | GO:0061394 | regulation of transcription from RNA polymerase II promoter in response to arsenic-containing substance(GO:0061394) |
| 0.1 | 0.2 | GO:0009608 | response to symbiont(GO:0009608) response to symbiotic bacterium(GO:0009609) |
| 0.1 | 0.1 | GO:0021761 | limbic system development(GO:0021761) hippocampus development(GO:0021766) |
| 0.1 | 0.7 | GO:0042415 | norepinephrine metabolic process(GO:0042415) |
| 0.1 | 0.1 | GO:0044266 | angiotensin catabolic process in blood(GO:0002005) multicellular organismal protein catabolic process(GO:0044254) protein digestion(GO:0044256) multicellular organismal macromolecule catabolic process(GO:0044266) multicellular organismal protein metabolic process(GO:0044268) |
| 0.1 | 0.6 | GO:1990822 | basic amino acid transmembrane transport(GO:1990822) |
| 0.1 | 0.3 | GO:0043006 | activation of phospholipase A2 activity by calcium-mediated signaling(GO:0043006) |
| 0.1 | 0.1 | GO:0072520 | seminiferous tubule development(GO:0072520) |
| 0.1 | 0.4 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.1 | 0.9 | GO:0006552 | leucine catabolic process(GO:0006552) |
| 0.1 | 0.3 | GO:0090070 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.1 | 0.7 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
| 0.1 | 0.2 | GO:0002224 | toll-like receptor signaling pathway(GO:0002224) |
| 0.1 | 0.5 | GO:0044351 | macropinocytosis(GO:0044351) |
| 0.1 | 0.2 | GO:0002774 | Fc receptor mediated inhibitory signaling pathway(GO:0002774) |
| 0.1 | 0.3 | GO:0031064 | negative regulation of histone deacetylation(GO:0031064) |
| 0.1 | 0.4 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
| 0.1 | 0.5 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.1 | 0.5 | GO:0070091 | glucagon secretion(GO:0070091) |
| 0.1 | 0.3 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.1 | 0.1 | GO:0051715 | cytolysis in other organism(GO:0051715) |
| 0.1 | 0.2 | GO:0002727 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
| 0.1 | 0.4 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
| 0.1 | 0.1 | GO:0071353 | response to interleukin-4(GO:0070670) cellular response to interleukin-4(GO:0071353) |
| 0.1 | 0.4 | GO:0046836 | glycolipid transport(GO:0046836) |
| 0.1 | 0.4 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
| 0.1 | 0.4 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
| 0.1 | 0.5 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
| 0.1 | 0.1 | GO:0002884 | negative regulation of hypersensitivity(GO:0002884) |
| 0.1 | 0.5 | GO:0032468 | Golgi calcium ion homeostasis(GO:0032468) |
| 0.1 | 1.8 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.1 | 0.1 | GO:2000670 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) positive regulation of dendritic cell apoptotic process(GO:2000670) |
| 0.1 | 0.7 | GO:0010818 | T cell chemotaxis(GO:0010818) |
| 0.1 | 0.8 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.1 | 0.1 | GO:0044265 | cellular macromolecule catabolic process(GO:0044265) |
| 0.1 | 0.8 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
| 0.1 | 0.1 | GO:0050850 | positive regulation of calcium-mediated signaling(GO:0050850) |
| 0.1 | 0.2 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
| 0.1 | 0.3 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
| 0.1 | 0.2 | GO:0014052 | regulation of gamma-aminobutyric acid secretion(GO:0014052) |
| 0.1 | 0.3 | GO:0046813 | receptor-mediated virion attachment to host cell(GO:0046813) |
| 0.1 | 0.3 | GO:0050869 | negative regulation of B cell activation(GO:0050869) |
| 0.1 | 0.2 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.1 | 0.2 | GO:0035723 | interleukin-15-mediated signaling pathway(GO:0035723) cellular response to interleukin-15(GO:0071350) |
| 0.1 | 0.3 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.1 | 0.3 | GO:0007499 | ectoderm and mesoderm interaction(GO:0007499) |
| 0.1 | 0.2 | GO:0045345 | positive regulation of MHC class I biosynthetic process(GO:0045345) |
| 0.1 | 0.3 | GO:0046452 | dihydrofolate metabolic process(GO:0046452) |
| 0.1 | 0.4 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.1 | 0.2 | GO:1902966 | regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 0.1 | 0.9 | GO:0045176 | apical protein localization(GO:0045176) |
| 0.1 | 0.6 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 0.1 | 0.1 | GO:0015883 | FAD transport(GO:0015883) FAD transmembrane transport(GO:0035350) |
| 0.1 | 0.9 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.1 | 1.4 | GO:1990001 | inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.1 | 0.4 | GO:0072143 | mesangial cell development(GO:0072143) glomerular mesangial cell development(GO:0072144) |
| 0.1 | 0.1 | GO:2000705 | dense core granule biogenesis(GO:0061110) regulation of dense core granule biogenesis(GO:2000705) |
| 0.1 | 0.4 | GO:2000638 | regulation of SREBP signaling pathway(GO:2000638) negative regulation of SREBP signaling pathway(GO:2000639) |
| 0.1 | 0.3 | GO:0061092 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.1 | 0.5 | GO:0001661 | conditioned taste aversion(GO:0001661) |
| 0.1 | 0.3 | GO:0060455 | negative regulation of gastric acid secretion(GO:0060455) |
| 0.1 | 0.2 | GO:0060167 | regulation of adenosine receptor signaling pathway(GO:0060167) |
| 0.1 | 0.3 | GO:1902037 | negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
| 0.1 | 0.3 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
| 0.1 | 0.5 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.1 | 0.2 | GO:0060441 | epithelial tube branching involved in lung morphogenesis(GO:0060441) |
| 0.1 | 0.4 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
| 0.1 | 0.1 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.1 | 0.6 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
| 0.1 | 0.4 | GO:0010767 | regulation of transcription from RNA polymerase II promoter in response to UV-induced DNA damage(GO:0010767) |
| 0.1 | 0.8 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
| 0.1 | 0.1 | GO:0023016 | signal transduction by trans-phosphorylation(GO:0023016) |
| 0.1 | 0.4 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.1 | 0.3 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.1 | 0.1 | GO:1903378 | positive regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903378) |
| 0.1 | 0.2 | GO:0019242 | methylglyoxal biosynthetic process(GO:0019242) |
| 0.1 | 0.4 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
| 0.1 | 0.2 | GO:1900224 | positive regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900224) |
| 0.1 | 0.1 | GO:0072019 | proximal convoluted tubule development(GO:0072019) metanephric proximal convoluted tubule development(GO:0072229) |
| 0.1 | 0.1 | GO:0032679 | TRAIL production(GO:0032639) regulation of TRAIL production(GO:0032679) positive regulation of TRAIL production(GO:0032759) |
| 0.1 | 0.1 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
| 0.1 | 0.1 | GO:1905064 | negative regulation of vascular smooth muscle cell differentiation(GO:1905064) |
| 0.1 | 0.8 | GO:0048535 | lymph node development(GO:0048535) |
| 0.1 | 0.1 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
| 0.1 | 0.7 | GO:0010592 | positive regulation of lamellipodium assembly(GO:0010592) |
| 0.1 | 0.1 | GO:0034250 | positive regulation of cellular amide metabolic process(GO:0034250) |
| 0.1 | 0.3 | GO:0099590 | neurotransmitter receptor internalization(GO:0099590) |
| 0.1 | 0.4 | GO:0060842 | arterial endothelial cell differentiation(GO:0060842) |
| 0.1 | 0.1 | GO:0051461 | positive regulation of corticotropin secretion(GO:0051461) |
| 0.1 | 0.5 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.1 | 0.2 | GO:0048254 | snoRNA localization(GO:0048254) |
| 0.1 | 0.1 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.1 | 0.1 | GO:0021986 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.1 | 0.2 | GO:2000395 | ubiquitin-dependent endocytosis(GO:0070086) regulation of ubiquitin-dependent endocytosis(GO:2000395) positive regulation of ubiquitin-dependent endocytosis(GO:2000397) |
| 0.1 | 0.1 | GO:0007057 | spindle assembly involved in female meiosis I(GO:0007057) |
| 0.1 | 0.2 | GO:0051311 | meiotic metaphase I plate congression(GO:0043060) meiotic spindle midzone assembly(GO:0051257) meiotic metaphase plate congression(GO:0051311) |
| 0.1 | 1.4 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
| 0.1 | 0.3 | GO:0048749 | compound eye development(GO:0048749) |
| 0.1 | 10.5 | GO:0002433 | immune response-regulating cell surface receptor signaling pathway involved in phagocytosis(GO:0002433) Fc-gamma receptor signaling pathway involved in phagocytosis(GO:0038096) |
| 0.1 | 0.5 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.1 | 0.9 | GO:1990845 | adaptive thermogenesis(GO:1990845) |
| 0.1 | 0.5 | GO:0032790 | ribosome disassembly(GO:0032790) |
| 0.1 | 0.5 | GO:0035655 | interleukin-18-mediated signaling pathway(GO:0035655) cellular response to interleukin-18(GO:0071351) |
| 0.1 | 0.2 | GO:0032966 | negative regulation of collagen biosynthetic process(GO:0032966) |
| 0.1 | 0.5 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.1 | 0.1 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
| 0.1 | 0.2 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.1 | 0.3 | GO:0071477 | hypotonic salinity response(GO:0042539) cellular hypotonic salinity response(GO:0071477) |
| 0.1 | 2.5 | GO:0033198 | response to ATP(GO:0033198) |
| 0.1 | 0.2 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.1 | 0.2 | GO:1904924 | negative regulation of mitophagy in response to mitochondrial depolarization(GO:1904924) |
| 0.1 | 1.4 | GO:0008053 | mitochondrial fusion(GO:0008053) |
| 0.1 | 0.3 | GO:0042908 | xenobiotic transport(GO:0042908) |
| 0.1 | 0.2 | GO:0060693 | regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
| 0.1 | 0.1 | GO:0044415 | evasion or tolerance of host defenses by virus(GO:0019049) avoidance of host defenses(GO:0044413) evasion or tolerance of host defenses(GO:0044415) avoidance of defenses of other organism involved in symbiotic interaction(GO:0051832) evasion or tolerance of defenses of other organism involved in symbiotic interaction(GO:0051834) |
| 0.1 | 0.4 | GO:0032411 | positive regulation of transporter activity(GO:0032411) |
| 0.1 | 0.6 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
| 0.1 | 0.2 | GO:1903625 | negative regulation of DNA catabolic process(GO:1903625) |
| 0.1 | 0.2 | GO:0090362 | positive regulation of platelet-derived growth factor production(GO:0090362) |
| 0.1 | 0.1 | GO:1901341 | activation of store-operated calcium channel activity(GO:0032237) regulation of store-operated calcium channel activity(GO:1901339) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.1 | 0.2 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 | 0.2 | GO:0006272 | leading strand elongation(GO:0006272) |
| 0.1 | 0.1 | GO:2000170 | positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
| 0.1 | 0.1 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
| 0.1 | 0.2 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
| 0.1 | 0.1 | GO:0014834 | skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
| 0.1 | 0.1 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
| 0.1 | 0.4 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.1 | 0.2 | GO:0016334 | morphogenesis of follicular epithelium(GO:0016333) establishment or maintenance of polarity of follicular epithelium(GO:0016334) establishment of planar polarity of follicular epithelium(GO:0042247) |
| 0.1 | 0.1 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.1 | 0.2 | GO:0038178 | complement component C5a signaling pathway(GO:0038178) |
| 0.1 | 0.2 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
| 0.1 | 0.6 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.1 | 0.3 | GO:0099518 | vesicle cytoskeletal trafficking(GO:0099518) |
| 0.1 | 0.2 | GO:0033590 | response to cobalamin(GO:0033590) |
| 0.1 | 0.2 | GO:0070638 | nicotinamide riboside catabolic process(GO:0006738) nicotinamide riboside metabolic process(GO:0046495) pyridine nucleoside metabolic process(GO:0070637) pyridine nucleoside catabolic process(GO:0070638) pyridine-containing compound catabolic process(GO:0072526) |
| 0.1 | 0.2 | GO:0035425 | autocrine signaling(GO:0035425) |
| 0.1 | 0.7 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.1 | 0.2 | GO:0036336 | dendritic cell migration(GO:0036336) |
| 0.1 | 0.1 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
| 0.1 | 1.2 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
| 0.1 | 0.4 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
| 0.1 | 0.8 | GO:1902745 | positive regulation of lamellipodium organization(GO:1902745) |
| 0.1 | 0.1 | GO:0007021 | tubulin complex assembly(GO:0007021) |
| 0.1 | 1.0 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
| 0.1 | 0.8 | GO:0022401 | desensitization of G-protein coupled receptor protein signaling pathway(GO:0002029) negative adaptation of signaling pathway(GO:0022401) |
| 0.1 | 0.1 | GO:0006145 | purine nucleobase catabolic process(GO:0006145) |
| 0.1 | 0.4 | GO:1990592 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.1 | 0.5 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 0.1 | 0.8 | GO:0060397 | JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
| 0.1 | 0.2 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.1 | 0.3 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
| 0.1 | 1.3 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
| 0.1 | 0.2 | GO:0010836 | negative regulation of protein ADP-ribosylation(GO:0010836) |
| 0.1 | 0.6 | GO:0015939 | pantothenate metabolic process(GO:0015939) |
| 0.1 | 0.1 | GO:0051792 | medium-chain fatty acid biosynthetic process(GO:0051792) |
| 0.1 | 0.4 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.1 | 0.6 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.1 | 0.3 | GO:0035624 | receptor transactivation(GO:0035624) |
| 0.1 | 0.1 | GO:0045080 | positive regulation of chemokine biosynthetic process(GO:0045080) |
| 0.1 | 0.1 | GO:2001236 | regulation of extrinsic apoptotic signaling pathway(GO:2001236) |
| 0.1 | 0.3 | GO:0051708 | intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 0.1 | 0.3 | GO:0019255 | glucose 1-phosphate metabolic process(GO:0019255) |
| 0.1 | 0.1 | GO:0045006 | DNA deamination(GO:0045006) |
| 0.1 | 0.4 | GO:0010529 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.1 | 0.2 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) positive regulation of natural killer cell degranulation(GO:0043323) |
| 0.1 | 0.4 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.1 | 0.1 | GO:0030431 | sleep(GO:0030431) |
| 0.1 | 0.2 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.1 | 0.6 | GO:0001913 | T cell mediated cytotoxicity(GO:0001913) |
| 0.1 | 0.1 | GO:2000664 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
| 0.1 | 0.3 | GO:0046676 | negative regulation of insulin secretion(GO:0046676) |
| 0.1 | 0.1 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.1 | 0.1 | GO:0046320 | regulation of fatty acid oxidation(GO:0046320) |
| 0.1 | 0.3 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
| 0.1 | 0.2 | GO:0000912 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 0.1 | 0.2 | GO:0009106 | lipoate metabolic process(GO:0009106) |
| 0.1 | 0.1 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
| 0.1 | 0.1 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
| 0.1 | 0.1 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) |
| 0.1 | 0.4 | GO:0002523 | leukocyte migration involved in inflammatory response(GO:0002523) |
| 0.1 | 2.4 | GO:0042267 | natural killer cell mediated cytotoxicity(GO:0042267) |
| 0.1 | 0.1 | GO:1900112 | regulation of histone H3-K9 trimethylation(GO:1900112) |
| 0.1 | 0.3 | GO:0098501 | polynucleotide dephosphorylation(GO:0098501) |
| 0.1 | 0.1 | GO:0009125 | nucleoside monophosphate catabolic process(GO:0009125) |
| 0.1 | 1.1 | GO:0035025 | positive regulation of Rho protein signal transduction(GO:0035025) |
| 0.1 | 0.2 | GO:0001189 | RNA polymerase I transcriptional preinitiation complex assembly(GO:0001188) RNA polymerase I transcriptional preinitiation complex assembly at the promoter for the nuclear large rRNA transcript(GO:0001189) |
| 0.1 | 0.4 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
| 0.1 | 1.1 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
| 0.1 | 0.6 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.1 | 0.6 | GO:0045794 | negative regulation of cell volume(GO:0045794) |
| 0.1 | 0.2 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
| 0.1 | 0.1 | GO:0043932 | ossification involved in bone remodeling(GO:0043932) |
| 0.1 | 0.3 | GO:0071918 | urea transmembrane transport(GO:0071918) |
| 0.1 | 0.3 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
| 0.1 | 0.2 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.1 | 0.9 | GO:0050961 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
| 0.1 | 0.1 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
| 0.1 | 0.1 | GO:0045824 | negative regulation of innate immune response(GO:0045824) |
| 0.1 | 0.1 | GO:0018894 | dibenzo-p-dioxin metabolic process(GO:0018894) |
| 0.1 | 0.2 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
| 0.1 | 0.2 | GO:1904044 | response to aldosterone(GO:1904044) |
| 0.0 | 0.4 | GO:0045779 | negative regulation of bone resorption(GO:0045779) |
| 0.0 | 0.3 | GO:0016559 | peroxisome fission(GO:0016559) |
| 0.0 | 0.3 | GO:0046782 | regulation of viral transcription(GO:0046782) |
| 0.0 | 0.3 | GO:0045007 | depurination(GO:0045007) |
| 0.0 | 0.1 | GO:0048627 | myoblast development(GO:0048627) |
| 0.0 | 0.3 | GO:0060134 | prepulse inhibition(GO:0060134) |
| 0.0 | 0.2 | GO:0050433 | regulation of catecholamine secretion(GO:0050433) |
| 0.0 | 0.2 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.0 | 0.0 | GO:0007159 | leukocyte cell-cell adhesion(GO:0007159) |
| 0.0 | 1.5 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.0 | 0.1 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
| 0.0 | 0.5 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.0 | 0.3 | GO:0002360 | T cell lineage commitment(GO:0002360) |
| 0.0 | 0.1 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
| 0.0 | 0.3 | GO:0046940 | nucleoside monophosphate phosphorylation(GO:0046940) |
| 0.0 | 0.0 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.0 | 0.3 | GO:0045842 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
| 0.0 | 0.4 | GO:1902412 | regulation of mitotic cytokinesis(GO:1902412) |
| 0.0 | 0.2 | GO:0018352 | protein-pyridoxal-5-phosphate linkage(GO:0018352) |
| 0.0 | 0.1 | GO:0046601 | positive regulation of centriole replication(GO:0046601) |
| 0.0 | 0.1 | GO:1900369 | regulation of RNA interference(GO:1900368) negative regulation of RNA interference(GO:1900369) |
| 0.0 | 0.5 | GO:0014809 | regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014809) |
| 0.0 | 0.8 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.0 | 0.1 | GO:0007418 | ventral midline development(GO:0007418) smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) |
| 0.0 | 0.7 | GO:0090168 | Golgi reassembly(GO:0090168) |
| 0.0 | 1.1 | GO:0045730 | respiratory burst(GO:0045730) |
| 0.0 | 0.1 | GO:0035284 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| 0.0 | 0.1 | GO:0071301 | transcription factor catabolic process(GO:0036369) cellular response to vitamin B1(GO:0071301) response to formaldehyde(GO:1904404) |
| 0.0 | 0.1 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
| 0.0 | 0.4 | GO:0097341 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) |
| 0.0 | 0.1 | GO:0005989 | lactose metabolic process(GO:0005988) lactose biosynthetic process(GO:0005989) |
| 0.0 | 0.1 | GO:0036058 | filtration diaphragm assembly(GO:0036058) slit diaphragm assembly(GO:0036060) negative regulation of retinal ganglion cell axon guidance(GO:0090260) |
| 0.0 | 0.1 | GO:0038060 | nitric oxide-cGMP-mediated signaling pathway(GO:0038060) |
| 0.0 | 0.1 | GO:0036269 | swimming behavior(GO:0036269) |
| 0.0 | 0.7 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
| 0.0 | 0.1 | GO:0061056 | sclerotome development(GO:0061056) |
| 0.0 | 0.1 | GO:0046081 | dUTP metabolic process(GO:0046080) dUTP catabolic process(GO:0046081) |
| 0.0 | 0.2 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
| 0.0 | 0.1 | GO:0070640 | calcitriol biosynthetic process from calciol(GO:0036378) vitamin D3 metabolic process(GO:0070640) |
| 0.0 | 0.0 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
| 0.0 | 0.1 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.0 | 0.4 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.0 | 0.1 | GO:1901656 | glycoside transport(GO:1901656) |
| 0.0 | 1.2 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
| 0.0 | 0.2 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
| 0.0 | 0.2 | GO:2000617 | positive regulation of histone H3-K9 acetylation(GO:2000617) |
| 0.0 | 0.4 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
| 0.0 | 0.2 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.0 | 0.4 | GO:0043247 | protection from non-homologous end joining at telomere(GO:0031848) telomere maintenance in response to DNA damage(GO:0043247) |
| 0.0 | 0.1 | GO:0030073 | insulin secretion(GO:0030073) |
| 0.0 | 0.2 | GO:0035865 | cellular response to potassium ion(GO:0035865) |
| 0.0 | 0.2 | GO:2001076 | regulation of metanephric ureteric bud development(GO:2001074) positive regulation of metanephric ureteric bud development(GO:2001076) |
| 0.0 | 0.3 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) |
| 0.0 | 0.1 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.0 | 0.0 | GO:0034163 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) |
| 0.0 | 0.2 | GO:0048165 | ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.0 | 0.2 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.0 | 0.3 | GO:0006600 | creatine metabolic process(GO:0006600) |
| 0.0 | 0.0 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
| 0.0 | 0.1 | GO:0036148 | phosphatidylglycerol acyl-chain remodeling(GO:0036148) |
| 0.0 | 0.2 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.0 | 0.2 | GO:0015811 | L-cystine transport(GO:0015811) |
| 0.0 | 0.7 | GO:0007160 | cell-matrix adhesion(GO:0007160) |
| 0.0 | 0.2 | GO:0055064 | chloride ion homeostasis(GO:0055064) |
| 0.0 | 0.1 | GO:0002507 | tolerance induction(GO:0002507) |
| 0.0 | 0.0 | GO:0090069 | regulation of ribosome biogenesis(GO:0090069) |
| 0.0 | 0.1 | GO:0036015 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
| 0.0 | 0.4 | GO:0010623 | programmed cell death involved in cell development(GO:0010623) |
| 0.0 | 0.2 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
| 0.0 | 0.2 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.0 | 0.2 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.0 | 1.4 | GO:0007094 | mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
| 0.0 | 0.1 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.0 | 0.3 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
| 0.0 | 0.0 | GO:0015919 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
| 0.0 | 0.0 | GO:0061030 | epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
| 0.0 | 0.1 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
| 0.0 | 0.1 | GO:1903410 | lysine import(GO:0034226) L-lysine import(GO:0061461) L-lysine import into cell(GO:1903410) |
| 0.0 | 0.2 | GO:0035493 | SNARE complex assembly(GO:0035493) |
| 0.0 | 0.1 | GO:0009304 | tRNA transcription(GO:0009304) 5S class rRNA transcription from RNA polymerase III type 1 promoter(GO:0042791) tRNA transcription from RNA polymerase III promoter(GO:0042797) |
| 0.0 | 0.2 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
| 0.0 | 0.2 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.0 | 0.5 | GO:0044818 | mitotic G2 DNA damage checkpoint(GO:0007095) mitotic G2/M transition checkpoint(GO:0044818) |
| 0.0 | 0.1 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
| 0.0 | 0.1 | GO:0097325 | melanocyte proliferation(GO:0097325) |
| 0.0 | 0.2 | GO:0071651 | positive regulation of chemokine (C-C motif) ligand 5 production(GO:0071651) |
| 0.0 | 0.1 | GO:1900127 | positive regulation of hyaluronan biosynthetic process(GO:1900127) |
| 0.0 | 1.4 | GO:0050832 | defense response to fungus(GO:0050832) |
| 0.0 | 0.3 | GO:0010968 | regulation of microtubule nucleation(GO:0010968) |
| 0.0 | 0.2 | GO:1904764 | negative regulation of fibril organization(GO:1902904) chaperone-mediated autophagy translocation complex disassembly(GO:1904764) |
| 0.0 | 0.0 | GO:0033861 | negative regulation of NAD(P)H oxidase activity(GO:0033861) |
| 0.0 | 0.0 | GO:1900039 | positive regulation of cellular response to hypoxia(GO:1900039) |
| 0.0 | 0.3 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.0 | 0.2 | GO:0044381 | glucose import in response to insulin stimulus(GO:0044381) |
| 0.0 | 0.4 | GO:0060737 | prostate epithelial cord elongation(GO:0060523) prostate gland morphogenetic growth(GO:0060737) |
| 0.0 | 0.3 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
| 0.0 | 0.3 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
| 0.0 | 0.3 | GO:0030157 | pancreatic juice secretion(GO:0030157) |
| 0.0 | 0.2 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.0 | 0.2 | GO:0039530 | MDA-5 signaling pathway(GO:0039530) |
| 0.0 | 0.1 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
| 0.0 | 0.2 | GO:0031022 | nuclear migration along microfilament(GO:0031022) |
| 0.0 | 0.1 | GO:0031622 | positive regulation of fever generation(GO:0031622) trans-synaptic signalling, modulating synaptic transmission(GO:0099550) trans-synaptic signaling by lipid, modulating synaptic transmission(GO:0099552) trans-synaptic signaling by endocannabinoid, modulating synaptic transmission(GO:0099553) |
| 0.0 | 0.2 | GO:0030812 | negative regulation of nucleotide catabolic process(GO:0030812) |
| 0.0 | 0.1 | GO:0060467 | negative regulation of fertilization(GO:0060467) |
| 0.0 | 0.3 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
| 0.0 | 0.2 | GO:1902093 | positive regulation of sperm motility(GO:1902093) |
| 0.0 | 0.2 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
| 0.0 | 0.3 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.0 | 0.2 | GO:1903039 | positive regulation of leukocyte cell-cell adhesion(GO:1903039) |
| 0.0 | 0.2 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
| 0.0 | 0.2 | GO:0072643 | interferon-gamma secretion(GO:0072643) |
| 0.0 | 0.2 | GO:0006051 | mannosamine metabolic process(GO:0006050) N-acetylmannosamine metabolic process(GO:0006051) |
| 0.0 | 0.1 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.0 | 0.1 | GO:0032508 | DNA duplex unwinding(GO:0032508) |
| 0.0 | 0.2 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
| 0.0 | 0.2 | GO:0044245 | polysaccharide digestion(GO:0044245) |
| 0.0 | 0.2 | GO:0006127 | glycerophosphate shuttle(GO:0006127) |
| 0.0 | 1.7 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
| 0.0 | 1.0 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
| 0.0 | 0.5 | GO:0045577 | regulation of B cell differentiation(GO:0045577) |
| 0.0 | 0.1 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.0 | 0.1 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) |
| 0.0 | 0.0 | GO:0060982 | coronary artery morphogenesis(GO:0060982) |
| 0.0 | 0.1 | GO:0060920 | cardiac pacemaker cell differentiation(GO:0060920) cardiac pacemaker cell development(GO:0060926) |
| 0.0 | 0.8 | GO:2000144 | positive regulation of DNA-templated transcription, initiation(GO:2000144) |
| 0.0 | 0.1 | GO:0036071 | N-glycan fucosylation(GO:0036071) |
| 0.0 | 0.2 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
| 0.0 | 0.2 | GO:0090646 | mitochondrial tRNA processing(GO:0090646) |
| 0.0 | 0.1 | GO:0019086 | late viral transcription(GO:0019086) |
| 0.0 | 0.7 | GO:0006744 | ubiquinone metabolic process(GO:0006743) ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.0 | 0.1 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
| 0.0 | 0.1 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
| 0.0 | 0.0 | GO:0006533 | aspartate catabolic process(GO:0006533) |
| 0.0 | 0.1 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
| 0.0 | 0.1 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
| 0.0 | 0.1 | GO:0060017 | parathyroid gland development(GO:0060017) |
| 0.0 | 0.3 | GO:0070307 | lens fiber cell development(GO:0070307) |
| 0.0 | 0.0 | GO:0070911 | global genome nucleotide-excision repair(GO:0070911) |
| 0.0 | 0.1 | GO:0032099 | negative regulation of response to food(GO:0032096) negative regulation of appetite(GO:0032099) |
| 0.0 | 0.2 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
| 0.0 | 0.5 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
| 0.0 | 0.3 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.0 | 0.1 | GO:0090301 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of neural crest formation(GO:0090299) negative regulation of neural crest formation(GO:0090301) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
| 0.0 | 0.1 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.0 | 0.1 | GO:0046833 | positive regulation of nucleobase-containing compound transport(GO:0032241) positive regulation of RNA export from nucleus(GO:0046833) |
| 0.0 | 0.2 | GO:0006477 | protein sulfation(GO:0006477) |
| 0.0 | 0.5 | GO:0044030 | regulation of DNA methylation(GO:0044030) |
| 0.0 | 0.1 | GO:0090656 | t-circle formation(GO:0090656) |
| 0.0 | 0.1 | GO:0035754 | B cell chemotaxis(GO:0035754) |
| 0.0 | 0.1 | GO:1990022 | RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
| 0.0 | 0.2 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.0 | 0.0 | GO:0043954 | cellular component maintenance(GO:0043954) |
| 0.0 | 0.1 | GO:0051944 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.0 | 0.1 | GO:0033522 | histone H2A ubiquitination(GO:0033522) |
| 0.0 | 0.9 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.0 | 0.3 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
| 0.0 | 0.3 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
| 0.0 | 0.2 | GO:0060536 | cartilage morphogenesis(GO:0060536) |
| 0.0 | 0.1 | GO:0048539 | bone marrow development(GO:0048539) |
| 0.0 | 0.1 | GO:0043666 | regulation of phosphoprotein phosphatase activity(GO:0043666) |
| 0.0 | 0.1 | GO:0031342 | negative regulation of cell killing(GO:0031342) |
| 0.0 | 0.2 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) |
| 0.0 | 0.0 | GO:0060993 | kidney morphogenesis(GO:0060993) |
| 0.0 | 0.0 | GO:0090487 | toxin catabolic process(GO:0009407) secondary metabolite catabolic process(GO:0090487) |
| 0.0 | 0.1 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
| 0.0 | 0.2 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.0 | 0.2 | GO:0031069 | hair follicle morphogenesis(GO:0031069) |
| 0.0 | 0.4 | GO:0035455 | response to interferon-alpha(GO:0035455) |
| 0.0 | 0.1 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.0 | 0.2 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.0 | 0.0 | GO:0071877 | regulation of adrenergic receptor signaling pathway(GO:0071877) |
| 0.0 | 0.1 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.0 | 0.1 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
| 0.0 | 0.1 | GO:0009048 | dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.0 | 0.1 | GO:0038043 | interleukin-5-mediated signaling pathway(GO:0038043) |
| 0.0 | 0.2 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.0 | 0.2 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.0 | 0.1 | GO:0072131 | kidney mesenchyme morphogenesis(GO:0072131) metanephric mesenchyme morphogenesis(GO:0072133) |
| 0.0 | 0.1 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 0.0 | 0.1 | GO:2000484 | positive regulation of interleukin-8 secretion(GO:2000484) |
| 0.0 | 0.2 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) double-strand break repair via single-strand annealing(GO:0045002) |
| 0.0 | 0.1 | GO:0070444 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.0 | 0.1 | GO:0044771 | meiotic cell cycle phase transition(GO:0044771) regulation of meiotic cell cycle phase transition(GO:1901993) negative regulation of meiotic cell cycle phase transition(GO:1901994) |
| 0.0 | 0.1 | GO:0042297 | vocal learning(GO:0042297) imitative learning(GO:0098596) learned vocalization behavior or vocal learning(GO:0098598) |
| 0.0 | 0.0 | GO:0002865 | negative regulation of acute inflammatory response to antigenic stimulus(GO:0002865) |
| 0.0 | 0.1 | GO:0071105 | response to interleukin-11(GO:0071105) |
| 0.0 | 0.5 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
| 0.0 | 0.2 | GO:1901526 | positive regulation of macromitophagy(GO:1901526) regulation of mitophagy in response to mitochondrial depolarization(GO:1904923) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
| 0.0 | 0.2 | GO:0070842 | aggresome assembly(GO:0070842) |
| 0.0 | 0.3 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
| 0.0 | 0.0 | GO:0071306 | cellular response to vitamin E(GO:0071306) |
| 0.0 | 3.2 | GO:0051436 | negative regulation of ubiquitin-protein ligase activity involved in mitotic cell cycle(GO:0051436) regulation of ubiquitin-protein ligase activity involved in mitotic cell cycle(GO:0051439) |
| 0.0 | 0.0 | GO:0006542 | glutamine biosynthetic process(GO:0006542) |
| 0.0 | 0.1 | GO:0007567 | parturition(GO:0007567) |
| 0.0 | 0.1 | GO:0002276 | basophil activation involved in immune response(GO:0002276) |
| 0.0 | 0.1 | GO:0006669 | sphinganine-1-phosphate biosynthetic process(GO:0006669) |
| 0.0 | 0.1 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 0.0 | 0.1 | GO:0021510 | spinal cord development(GO:0021510) |
| 0.0 | 0.1 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.0 | 0.0 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
| 0.0 | 0.2 | GO:0016078 | tRNA catabolic process(GO:0016078) |
| 0.0 | 0.0 | GO:0043931 | ossification involved in bone maturation(GO:0043931) bone maturation(GO:0070977) |
| 0.0 | 0.1 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
| 0.0 | 1.0 | GO:0006099 | tricarboxylic acid cycle(GO:0006099) |
| 0.0 | 0.0 | GO:0033206 | meiotic cytokinesis(GO:0033206) |
| 0.0 | 0.1 | GO:2000722 | nuclear fragmentation involved in apoptotic nuclear change(GO:0030264) mineralocorticoid receptor signaling pathway(GO:0031959) regulation of cardiac vascular smooth muscle cell differentiation(GO:2000722) positive regulation of cardiac vascular smooth muscle cell differentiation(GO:2000724) |
| 0.0 | 0.1 | GO:2001160 | regulation of histone H3-K79 methylation(GO:2001160) positive regulation of histone H3-K79 methylation(GO:2001162) |
| 0.0 | 0.1 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 0.0 | 0.1 | GO:0019417 | sulfur oxidation(GO:0019417) |
| 0.0 | 0.1 | GO:0060901 | regulation of monophenol monooxygenase activity(GO:0032771) positive regulation of monophenol monooxygenase activity(GO:0032773) negative regulation of catagen(GO:0051796) regulation of hair cycle by canonical Wnt signaling pathway(GO:0060901) positive regulation of melanosome transport(GO:1902910) |
| 0.0 | 0.2 | GO:0000012 | single strand break repair(GO:0000012) |
| 0.0 | 0.1 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
| 0.0 | 1.3 | GO:0034260 | negative regulation of GTPase activity(GO:0034260) |
| 0.0 | 0.1 | GO:0015732 | prostaglandin transport(GO:0015732) |
| 0.0 | 0.1 | GO:0031179 | peptide amidation(GO:0001519) protein amidation(GO:0018032) peptide modification(GO:0031179) |
| 0.0 | 0.0 | GO:0016068 | regulation of type I hypersensitivity(GO:0001810) type I hypersensitivity(GO:0016068) |
| 0.0 | 0.2 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.0 | 0.0 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
| 0.0 | 0.1 | GO:2001023 | regulation of response to drug(GO:2001023) |
| 0.0 | 0.1 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
| 0.0 | 0.2 | GO:0099563 | modification of synaptic structure(GO:0099563) |
| 0.0 | 0.2 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.0 | 0.1 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.0 | 0.2 | GO:0015886 | heme transport(GO:0015886) |
| 0.0 | 0.1 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.0 | 0.1 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
| 0.0 | 0.1 | GO:0008204 | ergosterol biosynthetic process(GO:0006696) ergosterol metabolic process(GO:0008204) |
| 0.0 | 0.1 | GO:0051342 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
| 0.0 | 0.0 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
| 0.0 | 0.1 | GO:0071033 | nuclear mRNA surveillance of spliceosomal pre-mRNA splicing(GO:0071030) nuclear retention of pre-mRNA at the site of transcription(GO:0071033) nuclear retention of unspliced pre-mRNA at the site of transcription(GO:0071048) |
| 0.0 | 0.1 | GO:0048104 | establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 0.0 | 0.1 | GO:0016198 | axon choice point recognition(GO:0016198) |
| 0.0 | 0.1 | GO:1902527 | positive regulation of protein monoubiquitination(GO:1902527) |
| 0.0 | 0.1 | GO:0034121 | regulation of toll-like receptor signaling pathway(GO:0034121) |
| 0.0 | 0.2 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
| 0.0 | 0.1 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
| 0.0 | 0.1 | GO:0006012 | galactose metabolic process(GO:0006012) |
| 0.0 | 0.1 | GO:0006835 | dicarboxylic acid transport(GO:0006835) |
| 0.0 | 0.1 | GO:0010225 | response to UV-C(GO:0010225) |
| 0.0 | 0.0 | GO:0071043 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
| 0.0 | 0.1 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.0 | 0.1 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.0 | 0.0 | GO:1905073 | occluding junction disassembly(GO:1905071) regulation of occluding junction disassembly(GO:1905073) positive regulation of occluding junction disassembly(GO:1905075) |
| 0.0 | 0.2 | GO:0050858 | negative regulation of antigen receptor-mediated signaling pathway(GO:0050858) |
| 0.0 | 0.1 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
| 0.0 | 0.5 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
| 0.0 | 0.3 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
| 0.0 | 0.1 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 0.0 | 0.1 | GO:0050848 | regulation of calcium-mediated signaling(GO:0050848) |
| 0.0 | 0.1 | GO:0009756 | carbohydrate mediated signaling(GO:0009756) |
| 0.0 | 0.1 | GO:0032847 | regulation of cellular pH reduction(GO:0032847) |
| 0.0 | 0.1 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) negative regulation of actin nucleation(GO:0051126) |
| 0.0 | 0.1 | GO:0015747 | urate transport(GO:0015747) |
| 0.0 | 0.1 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
| 0.0 | 0.1 | GO:0042492 | gamma-delta T cell differentiation(GO:0042492) |
| 0.0 | 0.1 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
| 0.0 | 0.2 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
| 0.0 | 0.4 | GO:0034453 | microtubule anchoring(GO:0034453) |
| 0.0 | 0.2 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.0 | 0.1 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 | 0.0 | GO:0045076 | regulation of interleukin-2 biosynthetic process(GO:0045076) |
| 0.0 | 0.1 | GO:0048703 | embryonic viscerocranium morphogenesis(GO:0048703) |
| 0.0 | 0.1 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.0 | 0.2 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
| 0.0 | 0.7 | GO:0006298 | mismatch repair(GO:0006298) |
| 0.0 | 0.4 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
| 0.0 | 0.1 | GO:0086018 | SA node cell action potential(GO:0086015) SA node cell to atrial cardiac muscle cell signalling(GO:0086018) |
| 0.0 | 0.3 | GO:0071481 | cellular response to X-ray(GO:0071481) |
| 0.0 | 0.1 | GO:0021764 | amygdala development(GO:0021764) |
| 0.0 | 0.1 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.0 | 0.1 | GO:0061739 | protein lipidation involved in autophagosome assembly(GO:0061739) |
| 0.0 | 0.0 | GO:0051083 | 'de novo' cotranslational protein folding(GO:0051083) |
| 0.0 | 0.1 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.0 | 0.2 | GO:0090481 | pyrimidine nucleotide-sugar transmembrane transport(GO:0090481) |
| 0.0 | 0.1 | GO:0032782 | bile acid secretion(GO:0032782) |
| 0.0 | 0.1 | GO:0051121 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.0 | 0.1 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
| 0.0 | 0.8 | GO:0071526 | semaphorin-plexin signaling pathway(GO:0071526) |
| 0.0 | 0.1 | GO:0006404 | RNA import into nucleus(GO:0006404) |
| 0.0 | 0.2 | GO:0006264 | mitochondrial DNA replication(GO:0006264) |
| 0.0 | 0.2 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) depyrimidination(GO:0045008) |
| 0.0 | 0.4 | GO:0043486 | histone exchange(GO:0043486) |
| 0.0 | 0.2 | GO:0008105 | asymmetric protein localization(GO:0008105) |
| 0.0 | 0.2 | GO:0046618 | drug export(GO:0046618) |
| 0.0 | 0.0 | GO:0006978 | DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) DNA damage response, signal transduction resulting in transcription(GO:0042772) |
| 0.0 | 0.1 | GO:0046066 | dGDP metabolic process(GO:0046066) |
| 0.0 | 0.1 | GO:0016476 | regulation of embryonic cell shape(GO:0016476) |
| 0.0 | 0.1 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
| 0.0 | 0.4 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.0 | 0.1 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.0 | 0.1 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
| 0.0 | 0.0 | GO:0071910 | determination of liver left/right asymmetry(GO:0071910) |
| 0.0 | 0.1 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
| 0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.0 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
| 0.0 | 0.3 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
| 0.0 | 0.1 | GO:0036111 | very long-chain fatty-acyl-CoA metabolic process(GO:0036111) |
| 0.0 | 0.0 | GO:0021648 | vestibulocochlear nerve morphogenesis(GO:0021648) |
| 0.0 | 0.1 | GO:0046113 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) nucleobase catabolic process(GO:0046113) |
| 0.0 | 0.1 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.0 | 0.2 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.0 | 0.0 | GO:1900239 | phenotypic switching(GO:0036166) regulation of phenotypic switching(GO:1900239) |
| 0.0 | 0.1 | GO:0009988 | cell-cell recognition(GO:0009988) |
| 0.0 | 0.0 | GO:0060938 | cardiac fibroblast cell differentiation(GO:0060935) cardiac fibroblast cell development(GO:0060936) epicardium-derived cardiac fibroblast cell differentiation(GO:0060938) epicardium-derived cardiac fibroblast cell development(GO:0060939) |
| 0.0 | 0.0 | GO:1904996 | positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 0.0 | 0.9 | GO:0031295 | T cell costimulation(GO:0031295) |
| 0.0 | 0.1 | GO:0030916 | otic vesicle formation(GO:0030916) |
| 0.0 | 0.1 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.0 | 0.0 | GO:0052251 | induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) |
| 0.0 | 0.1 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.0 | 0.1 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.0 | 0.3 | GO:0006089 | lactate metabolic process(GO:0006089) |
| 0.0 | 0.2 | GO:0018065 | protein-cofactor linkage(GO:0018065) |
| 0.0 | 0.1 | GO:0014029 | neural crest formation(GO:0014029) |
| 0.0 | 0.1 | GO:0014062 | regulation of serotonin secretion(GO:0014062) |
| 0.0 | 0.1 | GO:0042226 | interleukin-6 biosynthetic process(GO:0042226) |
| 0.0 | 0.2 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.0 | 0.1 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.0 | 0.0 | GO:0097052 | L-kynurenine metabolic process(GO:0097052) |
| 0.0 | 0.6 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.0 | 0.0 | GO:0048867 | stem cell fate determination(GO:0048867) |
| 0.0 | 0.0 | GO:0002644 | negative regulation of tolerance induction(GO:0002644) |
| 0.0 | 1.0 | GO:0008542 | visual learning(GO:0008542) |
| 0.0 | 0.1 | GO:2000679 | positive regulation of transcription regulatory region DNA binding(GO:2000679) |
| 0.0 | 0.0 | GO:0060018 | astrocyte fate commitment(GO:0060018) |
| 0.0 | 0.0 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.0 | 0.1 | GO:0043105 | regulation of GTP cyclohydrolase I activity(GO:0043095) negative regulation of GTP cyclohydrolase I activity(GO:0043105) |
| 0.0 | 0.1 | GO:0035377 | transepithelial water transport(GO:0035377) positive regulation of cyclic nucleotide-gated ion channel activity(GO:1902161) |
| 0.0 | 0.1 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.0 | 0.1 | GO:0035690 | cellular response to drug(GO:0035690) |
| 0.0 | 0.2 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.0 | 0.1 | GO:0048298 | positive regulation of isotype switching to IgA isotypes(GO:0048298) |
| 0.0 | 0.2 | GO:0010759 | positive regulation of macrophage chemotaxis(GO:0010759) |
| 0.0 | 0.3 | GO:0035456 | response to interferon-beta(GO:0035456) |
| 0.0 | 0.3 | GO:0032945 | negative regulation of mononuclear cell proliferation(GO:0032945) negative regulation of lymphocyte proliferation(GO:0050672) |
| 0.0 | 0.2 | GO:0048538 | thymus development(GO:0048538) |
| 0.0 | 0.1 | GO:0015853 | adenine transport(GO:0015853) |
| 0.0 | 0.1 | GO:0046642 | negative regulation of alpha-beta T cell proliferation(GO:0046642) |
| 0.0 | 0.3 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
| 0.0 | 0.1 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.0 | 0.0 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
| 0.0 | 0.0 | GO:1900060 | negative regulation of sphingolipid biosynthetic process(GO:0090155) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.0 | 0.2 | GO:0071476 | cellular hypotonic response(GO:0071476) |
| 0.0 | 0.0 | GO:0009176 | pyrimidine deoxyribonucleoside monophosphate metabolic process(GO:0009176) |
| 0.0 | 0.2 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
| 0.0 | 0.0 | GO:0002541 | activation of plasma proteins involved in acute inflammatory response(GO:0002541) |
| 0.0 | 0.3 | GO:0019388 | galactose catabolic process(GO:0019388) |
| 0.0 | 0.0 | GO:0071542 | dopaminergic neuron differentiation(GO:0071542) |
| 0.0 | 0.3 | GO:0034656 | nucleobase-containing small molecule catabolic process(GO:0034656) |
| 0.0 | 0.1 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.0 | 0.1 | GO:0035898 | parathyroid hormone secretion(GO:0035898) post-embryonic body morphogenesis(GO:0040032) regulation of parathyroid hormone secretion(GO:2000828) |
| 0.0 | 0.3 | GO:0006657 | CDP-choline pathway(GO:0006657) |
| 0.0 | 0.1 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.0 | 0.1 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.0 | 0.0 | GO:2000434 | regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
| 0.0 | 0.1 | GO:0032928 | regulation of superoxide anion generation(GO:0032928) positive regulation of superoxide anion generation(GO:0032930) |
| 0.0 | 0.4 | GO:0000291 | nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
| 0.0 | 1.5 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
| 0.0 | 0.1 | GO:0007113 | endomitotic cell cycle(GO:0007113) |
| 0.0 | 0.5 | GO:0002260 | lymphocyte homeostasis(GO:0002260) |
| 0.0 | 0.0 | GO:0018283 | metal incorporation into metallo-sulfur cluster(GO:0018282) iron incorporation into metallo-sulfur cluster(GO:0018283) |
| 0.0 | 0.0 | GO:0006090 | pyruvate metabolic process(GO:0006090) |
| 0.0 | 0.0 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
| 0.0 | 0.3 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
| 0.0 | 0.1 | GO:0071800 | podosome assembly(GO:0071800) |
| 0.0 | 0.0 | GO:0050432 | catecholamine secretion(GO:0050432) |
| 0.0 | 0.0 | GO:0045744 | negative regulation of G-protein coupled receptor protein signaling pathway(GO:0045744) |
| 0.0 | 0.1 | GO:0019064 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
| 0.0 | 0.2 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.0 | 0.1 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.0 | 0.5 | GO:2001259 | positive regulation of cation channel activity(GO:2001259) |
| 0.0 | 0.2 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
| 0.0 | 0.2 | GO:1902166 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
| 0.0 | 0.1 | GO:2000825 | positive regulation of androgen receptor activity(GO:2000825) |
| 0.0 | 0.1 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
| 0.0 | 0.1 | GO:1904721 | regulation of mRNA cleavage(GO:0031437) negative regulation of mRNA cleavage(GO:0031438) negative regulation of immunoglobulin secretion(GO:0051025) regulation of endoribonuclease activity(GO:0060699) negative regulation of ribonuclease activity(GO:0060701) negative regulation of endoribonuclease activity(GO:0060702) regulation of mRNA endonucleolytic cleavage involved in unfolded protein response(GO:1904720) negative regulation of mRNA endonucleolytic cleavage involved in unfolded protein response(GO:1904721) |
| 0.0 | 0.1 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
| 0.0 | 0.1 | GO:0046469 | platelet activating factor metabolic process(GO:0046469) |
| 0.0 | 0.0 | GO:0007292 | female gamete generation(GO:0007292) |
| 0.0 | 0.1 | GO:0030210 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.0 | 0.0 | GO:0043696 | dedifferentiation(GO:0043696) cell dedifferentiation(GO:0043697) |
| 0.0 | 0.4 | GO:0030728 | ovulation(GO:0030728) |
| 0.0 | 0.3 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
| 0.0 | 0.1 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
| 0.0 | 0.0 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
| 0.0 | 0.1 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
| 0.0 | 0.3 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
| 0.0 | 1.7 | GO:0007286 | spermatid development(GO:0007286) |
| 0.0 | 0.1 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.0 | 0.1 | GO:0017062 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.0 | 0.1 | GO:0001971 | negative regulation of activation of membrane attack complex(GO:0001971) |
| 0.0 | 0.3 | GO:0060117 | auditory receptor cell development(GO:0060117) |
| 0.0 | 0.1 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.0 | 0.2 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
| 0.0 | 0.1 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
| 0.0 | 0.7 | GO:0060113 | inner ear receptor cell differentiation(GO:0060113) |
| 0.0 | 0.0 | GO:0002101 | tRNA wobble cytosine modification(GO:0002101) |
| 0.0 | 0.1 | GO:0048664 | neuron fate determination(GO:0048664) |
| 0.0 | 0.0 | GO:0003241 | growth involved in heart morphogenesis(GO:0003241) |
| 0.0 | 0.3 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.0 | 0.1 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.0 | 0.0 | GO:1904637 | response to ionomycin(GO:1904636) cellular response to ionomycin(GO:1904637) |
| 0.0 | 0.1 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
| 0.0 | 0.1 | GO:1904415 | regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
| 0.0 | 0.2 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
| 0.0 | 0.3 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
| 0.0 | 0.3 | GO:2000772 | regulation of cellular senescence(GO:2000772) |
| 0.0 | 0.1 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.0 | 0.0 | GO:0072112 | renal filtration cell differentiation(GO:0061318) glomerular visceral epithelial cell differentiation(GO:0072112) |
| 0.0 | 0.0 | GO:0010826 | negative regulation of centrosome duplication(GO:0010826) |
| 0.0 | 1.6 | GO:0002377 | immunoglobulin production(GO:0002377) |
| 0.0 | 0.0 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
| 0.0 | 0.0 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
| 0.0 | 0.2 | GO:0006188 | IMP biosynthetic process(GO:0006188) |
| 0.0 | 0.1 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
| 0.0 | 0.0 | GO:0006688 | glycosphingolipid biosynthetic process(GO:0006688) |
| 0.0 | 0.1 | GO:0048733 | sebaceous gland development(GO:0048733) |
| 0.0 | 0.4 | GO:0006301 | postreplication repair(GO:0006301) |
| 0.0 | 0.1 | GO:0060527 | prostate glandular acinus morphogenesis(GO:0060526) prostate epithelial cord arborization involved in prostate glandular acinus morphogenesis(GO:0060527) |
| 0.0 | 0.1 | GO:0034184 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.0 | 0.0 | GO:0044208 | 'de novo' AMP biosynthetic process(GO:0044208) |
| 0.0 | 0.2 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.0 | 0.1 | GO:0035307 | positive regulation of dephosphorylation(GO:0035306) positive regulation of protein dephosphorylation(GO:0035307) |
| 0.0 | 0.1 | GO:0032053 | ciliary basal body organization(GO:0032053) |
| 0.0 | 0.0 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
| 0.0 | 0.0 | GO:0060180 | negative regulation of female receptivity(GO:0007621) female courtship behavior(GO:0008050) regulation of female receptivity(GO:0045924) female mating behavior(GO:0060180) |
| 0.0 | 0.1 | GO:0002803 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antimicrobial humoral response(GO:0002760) positive regulation of antibacterial peptide production(GO:0002803) |
| 0.0 | 0.1 | GO:1904528 | regulation of microtubule plus-end binding(GO:1903031) positive regulation of microtubule plus-end binding(GO:1903033) positive regulation of microtubule binding(GO:1904528) |
| 0.0 | 0.1 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
| 0.0 | 0.2 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
| 0.0 | 0.2 | GO:0042454 | ribonucleoside catabolic process(GO:0042454) |
| 0.0 | 0.3 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.0 | 0.0 | GO:0042374 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.0 | 0.5 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.0 | 0.1 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.0 | 0.0 | GO:0046449 | creatinine metabolic process(GO:0046449) |
| 0.0 | 0.1 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
| 0.0 | 0.0 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
| 0.0 | 0.0 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.0 | 0.0 | GO:1990668 | vesicle fusion with endoplasmic reticulum-Golgi intermediate compartment (ERGIC) membrane(GO:1990668) |
| 0.0 | 0.1 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.0 | 0.1 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) regulation of neuromuscular junction development(GO:1904396) |
| 0.0 | 0.0 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.0 | 0.1 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
| 0.0 | 0.5 | GO:0045071 | negative regulation of viral genome replication(GO:0045071) |
| 0.0 | 0.1 | GO:0042407 | cristae formation(GO:0042407) |
| 0.0 | 0.1 | GO:0048263 | determination of dorsal identity(GO:0048263) |
| 0.0 | 0.0 | GO:0043589 | skin morphogenesis(GO:0043589) |
| 0.0 | 0.1 | GO:0010155 | regulation of proton transport(GO:0010155) |
| 0.0 | 0.1 | GO:0050908 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.0 | 0.1 | GO:0007352 | zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.0 | 0.3 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
| 0.0 | 0.0 | GO:0045815 | positive regulation of gene expression, epigenetic(GO:0045815) |
| 0.0 | 0.0 | GO:0050982 | detection of mechanical stimulus(GO:0050982) |
| 0.0 | 0.0 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.0 | 0.0 | GO:0016048 | detection of temperature stimulus(GO:0016048) |
| 0.0 | 0.1 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.0 | 0.1 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.0 | 0.2 | GO:0006228 | UTP biosynthetic process(GO:0006228) UTP metabolic process(GO:0046051) |
| 0.0 | 0.0 | GO:0014912 | negative regulation of smooth muscle cell migration(GO:0014912) |
| 0.0 | 0.1 | GO:0072017 | distal tubule development(GO:0072017) |
| 0.0 | 0.3 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.0 | 0.0 | GO:0043144 | snoRNA processing(GO:0043144) |
| 0.0 | 0.0 | GO:0031427 | response to methotrexate(GO:0031427) |
| 0.0 | 0.0 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) peptidyl-arginine omega-N-methylation(GO:0035247) |
| 0.0 | 0.2 | GO:0033081 | regulation of T cell differentiation in thymus(GO:0033081) regulation of thymocyte aggregation(GO:2000398) |
| 0.0 | 0.0 | GO:0002118 | aggressive behavior(GO:0002118) |
| 0.0 | 0.1 | GO:0051571 | positive regulation of histone H3-K4 methylation(GO:0051571) |
| 0.0 | 0.2 | GO:0002220 | innate immune response activating cell surface receptor signaling pathway(GO:0002220) |
| 0.0 | 0.0 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.0 | 0.1 | GO:0009250 | glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
| 0.0 | 0.0 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.0 | 0.0 | GO:0006015 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.0 | 0.1 | GO:0036010 | protein localization to endosome(GO:0036010) |
| 0.0 | 0.0 | GO:0089700 | protein kinase D signaling(GO:0089700) |
| 0.0 | 0.1 | GO:0044144 | modulation of growth of symbiont involved in interaction with host(GO:0044144) |
| 0.0 | 0.0 | GO:0035087 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.0 | 0.0 | GO:0021680 | cerebellar Purkinje cell layer development(GO:0021680) |
| 0.0 | 0.0 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
| 0.0 | 0.1 | GO:0071539 | protein localization to centrosome(GO:0071539) |
| 0.0 | 0.1 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.0 | 0.1 | GO:1902570 | protein localization to nucleolus(GO:1902570) |
| 0.0 | 0.1 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.0 | 0.0 | GO:0043461 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 0.0 | 0.1 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
| 0.0 | 0.0 | GO:0034505 | tooth mineralization(GO:0034505) |
| 0.0 | 0.0 | GO:0044705 | mating behavior(GO:0007617) multi-organism reproductive behavior(GO:0044705) |
| 0.0 | 0.1 | GO:0017085 | response to insecticide(GO:0017085) |
| 0.0 | 0.2 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.0 | 0.6 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.0 | 0.2 | GO:0021692 | cerebellar Purkinje cell layer morphogenesis(GO:0021692) |
| 0.0 | 0.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.0 | 0.1 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
| 0.0 | 0.3 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.0 | 0.0 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.0 | 0.0 | GO:0046203 | spermidine catabolic process(GO:0046203) |
| 0.0 | 0.1 | GO:0090154 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.0 | 0.0 | GO:0033145 | positive regulation of intracellular steroid hormone receptor signaling pathway(GO:0033145) |
| 0.0 | 0.1 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.0 | 0.0 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
| 0.0 | 0.0 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.0 | 0.0 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.0 | 0.2 | GO:0032088 | negative regulation of NF-kappaB transcription factor activity(GO:0032088) |
| 0.0 | 0.3 | GO:0051560 | mitochondrial calcium ion homeostasis(GO:0051560) |
| 0.0 | 0.2 | GO:0009083 | branched-chain amino acid metabolic process(GO:0009081) branched-chain amino acid catabolic process(GO:0009083) |
| 0.0 | 0.0 | GO:0033341 | regulation of collagen binding(GO:0033341) |
| 0.0 | 0.1 | GO:0070193 | synaptonemal complex organization(GO:0070193) |
| 0.0 | 0.3 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
| 0.0 | 0.2 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
| 0.0 | 0.0 | GO:0006422 | aspartyl-tRNA aminoacylation(GO:0006422) |
| 0.0 | 0.1 | GO:0060644 | mammary gland epithelial cell differentiation(GO:0060644) |
| 0.0 | 0.0 | GO:1900449 | regulation of glutamate receptor signaling pathway(GO:1900449) |
| 0.0 | 0.1 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.0 | 1.2 | GO:0090630 | activation of GTPase activity(GO:0090630) |
| 0.0 | 0.0 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.0 | 0.4 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 0.0 | 0.0 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
| 0.0 | 0.0 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.0 | 0.1 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.0 | 0.0 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
| 0.0 | 0.1 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.0 | 0.0 | GO:0031642 | negative regulation of myelination(GO:0031642) |
| 0.0 | 0.0 | GO:0015846 | polyamine transport(GO:0015846) |
| 0.0 | 0.0 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.0 | 0.0 | GO:0060979 | vasculogenesis involved in coronary vascular morphogenesis(GO:0060979) |
| 0.0 | 0.0 | GO:0033591 | response to L-ascorbic acid(GO:0033591) |
| 0.0 | 0.1 | GO:0034587 | piRNA metabolic process(GO:0034587) |
| 0.0 | 0.0 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
| 0.0 | 0.2 | GO:0009615 | response to virus(GO:0009615) |
| 0.0 | 0.0 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.0 | 0.0 | GO:0007272 | ensheathment of neurons(GO:0007272) axon ensheathment(GO:0008366) |
| 0.0 | 0.0 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
| 0.0 | 0.0 | GO:0003018 | vascular process in circulatory system(GO:0003018) |
| 0.0 | 0.1 | GO:0009396 | folic acid-containing compound biosynthetic process(GO:0009396) |
| 0.0 | 0.0 | GO:0031268 | pseudopodium organization(GO:0031268) |
| 0.0 | 0.0 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.0 | 0.0 | GO:0015800 | acidic amino acid transport(GO:0015800) |
| 0.0 | 0.0 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
| 0.0 | 0.0 | GO:0090183 | regulation of kidney development(GO:0090183) |
| 0.0 | 0.0 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.0 | 0.1 | GO:0051290 | protein heterotetramerization(GO:0051290) |
| 0.0 | 0.0 | GO:0045763 | negative regulation of cellular amino acid metabolic process(GO:0045763) |
| 0.0 | 0.0 | GO:0097010 | eukaryotic translation initiation factor 4F complex assembly(GO:0097010) |
| 0.0 | 0.1 | GO:0000732 | strand displacement(GO:0000732) |
| 0.0 | 0.0 | GO:0046010 | positive regulation of circadian sleep/wake cycle, non-REM sleep(GO:0046010) |
| 0.0 | 0.1 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.0 | 0.0 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
| 0.0 | 0.0 | GO:1903748 | negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
| 0.0 | 0.0 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
| 0.0 | 0.0 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
| 0.0 | 0.0 | GO:0009566 | fertilization(GO:0009566) |
| 0.0 | 0.0 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
| 0.0 | 0.1 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
| 0.0 | 0.2 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
| 0.0 | 0.0 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.0 | 0.1 | GO:0006004 | fucose metabolic process(GO:0006004) |
| 0.0 | 0.1 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.0 | 0.1 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.0 | 0.0 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.0 | 0.0 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.0 | 0.1 | GO:1902775 | mitochondrial ribosome assembly(GO:0061668) mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.0 | 0.0 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
| 0.0 | 0.1 | GO:0070255 | regulation of mucus secretion(GO:0070255) positive regulation of mucus secretion(GO:0070257) |
| 0.0 | 0.1 | GO:0008340 | determination of adult lifespan(GO:0008340) |
| 0.0 | 0.0 | GO:0000729 | DNA double-strand break processing(GO:0000729) |
| 0.0 | 0.2 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
| 0.0 | 0.0 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 0.0 | 0.0 | GO:0045880 | positive regulation of smoothened signaling pathway(GO:0045880) |
| 0.0 | 0.0 | GO:0009224 | CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) CMP metabolic process(GO:0046035) |
| 0.0 | 0.2 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.0 | 0.0 | GO:0051754 | meiotic sister chromatid cohesion(GO:0051177) meiotic sister chromatid cohesion, centromeric(GO:0051754) |
| 0.0 | 0.1 | GO:0046069 | cGMP catabolic process(GO:0046069) |
| 0.0 | 0.0 | GO:0090322 | regulation of superoxide metabolic process(GO:0090322) |
| 0.0 | 0.0 | GO:0033138 | positive regulation of peptidyl-serine phosphorylation(GO:0033138) |
| 0.0 | 0.1 | GO:0010608 | posttranscriptional regulation of gene expression(GO:0010608) |
| 0.0 | 0.0 | GO:0048515 | spermatid differentiation(GO:0048515) |
| 0.0 | 0.5 | GO:0050911 | detection of chemical stimulus involved in sensory perception of smell(GO:0050911) |
| 0.0 | 0.2 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
| 0.0 | 0.1 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
| 0.0 | 0.1 | GO:0030168 | platelet activation(GO:0030168) |
| 0.0 | 0.1 | GO:0043435 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.0 | 0.1 | GO:0006284 | base-excision repair(GO:0006284) |
| 0.0 | 0.4 | GO:0070671 | response to interleukin-12(GO:0070671) |
| 0.0 | 0.0 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
| 0.0 | 0.1 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
| 0.0 | 0.3 | GO:0072676 | lymphocyte migration(GO:0072676) |
| 0.0 | 0.1 | GO:0038061 | NIK/NF-kappaB signaling(GO:0038061) |
| 0.0 | 0.0 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.0 | 0.0 | GO:0097156 | fasciculation of motor neuron axon(GO:0097156) |
| 0.0 | 0.1 | GO:0045005 | DNA-dependent DNA replication maintenance of fidelity(GO:0045005) |
| 0.0 | 0.0 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
| 0.0 | 0.1 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
| 0.0 | 0.0 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
| 0.0 | 0.0 | GO:0034113 | heterotypic cell-cell adhesion(GO:0034113) |
| 0.0 | 0.1 | GO:1903830 | magnesium ion transmembrane transport(GO:1903830) |
| 0.0 | 0.1 | GO:0030091 | protein repair(GO:0030091) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 7.5 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.3 | 1.6 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.2 | 2.0 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
| 0.2 | 5.7 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.2 | 4.6 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.2 | 0.2 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.2 | 9.2 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.2 | 1.8 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.1 | 2.2 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.1 | 5.3 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.1 | 11.9 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.1 | 4.3 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
| 0.1 | 0.2 | PID EPO PATHWAY | EPO signaling pathway |
| 0.1 | 2.7 | PID IGF1 PATHWAY | IGF1 pathway |
| 0.1 | 0.3 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.1 | 2.6 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
| 0.1 | 4.1 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.1 | 2.9 | PID RAS PATHWAY | Regulation of Ras family activation |
| 0.1 | 0.1 | ST STAT3 PATHWAY | STAT3 Pathway |
| 0.1 | 3.0 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.1 | 0.4 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.1 | 2.1 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.1 | 1.1 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.1 | 2.6 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.1 | 0.2 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.1 | 0.7 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
| 0.1 | 0.6 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
| 0.1 | 0.6 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.1 | 0.1 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.1 | 2.8 | PID ATR PATHWAY | ATR signaling pathway |
| 0.1 | 0.2 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.1 | 0.3 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.1 | 1.6 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.1 | 3.1 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| 0.0 | 0.9 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.0 | 0.3 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.0 | 1.6 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.0 | 1.3 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 0.0 | 1.0 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.0 | 1.3 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.0 | 1.6 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.0 | 0.4 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.0 | 0.7 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 1.1 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.0 | 1.0 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
| 0.0 | 1.7 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.0 | 0.1 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.0 | 2.1 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.0 | 0.3 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.0 | 1.0 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 0.4 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.0 | 0.1 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.0 | 2.2 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.0 | 1.6 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.0 | 0.1 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.0 | 0.0 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
| 0.0 | 0.6 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 0.8 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 0.6 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.0 | 3.0 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 0.4 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.0 | 0.2 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.0 | 1.1 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.0 | 0.3 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.0 | 0.1 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.0 | 0.5 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
| 0.0 | 0.3 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 0.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.0 | 0.6 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.0 | 0.4 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.0 | 0.5 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
| 0.0 | 0.3 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.0 | 0.2 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.0 | 0.3 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.0 | 0.0 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
| 0.0 | 0.0 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.0 | 1.2 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.0 | 0.1 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.0 | 0.3 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.0 | 0.2 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.0 | 0.1 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.0 | 0.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.1 | 5.6 | GO:0097179 | protease inhibitor complex(GO:0097179) |
| 0.8 | 16.6 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.7 | 10.0 | GO:0098647 | collagen type VI trimer(GO:0005589) collagen beaded filament(GO:0098647) |
| 0.7 | 4.2 | GO:0035692 | macrophage migration inhibitory factor receptor complex(GO:0035692) |
| 0.5 | 4.1 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.5 | 1.9 | GO:0034669 | integrin alpha4-beta7 complex(GO:0034669) |
| 0.5 | 3.2 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.4 | 1.2 | GO:0071751 | IgA immunoglobulin complex(GO:0071745) IgA immunoglobulin complex, circulating(GO:0071746) monomeric IgA immunoglobulin complex(GO:0071748) polymeric IgA immunoglobulin complex(GO:0071749) secretory IgA immunoglobulin complex(GO:0071751) |
| 0.4 | 2.4 | GO:0034687 | integrin alphaL-beta2 complex(GO:0034687) |
| 0.4 | 2.3 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
| 0.4 | 4.1 | GO:0042611 | MHC protein complex(GO:0042611) |
| 0.4 | 16.9 | GO:0042571 | immunoglobulin complex(GO:0019814) immunoglobulin complex, circulating(GO:0042571) |
| 0.3 | 0.3 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.3 | 2.8 | GO:0016942 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) |
| 0.3 | 0.8 | GO:0035354 | Toll-like receptor 1-Toll-like receptor 2 protein complex(GO:0035354) |
| 0.2 | 0.2 | GO:0034688 | integrin alphaM-beta2 complex(GO:0034688) |
| 0.2 | 2.3 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.2 | 1.0 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.2 | 1.2 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.2 | 1.2 | GO:0044326 | dendritic spine neck(GO:0044326) |
| 0.2 | 3.3 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.2 | 1.1 | GO:0036021 | endolysosome lumen(GO:0036021) |
| 0.2 | 0.5 | GO:0034271 | phosphatidylinositol 3-kinase complex, class III, type I(GO:0034271) phosphatidylinositol 3-kinase complex, class III, type II(GO:0034272) |
| 0.2 | 1.2 | GO:0032010 | phagolysosome(GO:0032010) |
| 0.1 | 0.6 | GO:0000811 | GINS complex(GO:0000811) |
| 0.1 | 0.9 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.1 | 0.7 | GO:0036398 | TCR signalosome(GO:0036398) |
| 0.1 | 0.1 | GO:0030315 | T-tubule(GO:0030315) |
| 0.1 | 0.6 | GO:0005923 | bicellular tight junction(GO:0005923) |
| 0.1 | 0.1 | GO:0071437 | invadopodium(GO:0071437) |
| 0.1 | 0.8 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.1 | 0.1 | GO:0071065 | alpha9-beta1 integrin-vascular cell adhesion molecule-1 complex(GO:0071065) |
| 0.1 | 0.5 | GO:0031905 | early endosome lumen(GO:0031905) |
| 0.1 | 1.9 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.1 | 0.8 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.1 | 0.4 | GO:0048269 | methionine adenosyltransferase complex(GO:0048269) |
| 0.1 | 0.4 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
| 0.1 | 0.6 | GO:0002169 | 3-methylcrotonyl-CoA carboxylase complex, mitochondrial(GO:0002169) methylcrotonoyl-CoA carboxylase complex(GO:1905202) |
| 0.1 | 0.5 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.1 | 0.4 | GO:0005712 | chiasma(GO:0005712) |
| 0.1 | 3.9 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.1 | 0.5 | GO:0001652 | granular component(GO:0001652) |
| 0.1 | 0.8 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.1 | 0.3 | GO:0070762 | nuclear pore transmembrane ring(GO:0070762) |
| 0.1 | 0.1 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.1 | 0.3 | GO:1990298 | mitotic checkpoint complex(GO:0033597) bub1-bub3 complex(GO:1990298) |
| 0.1 | 0.4 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.1 | 0.1 | GO:0000805 | X chromosome(GO:0000805) |
| 0.1 | 2.3 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.1 | 0.4 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
| 0.1 | 0.8 | GO:0071144 | SMAD2-SMAD3 protein complex(GO:0071144) |
| 0.1 | 0.3 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.1 | 0.3 | GO:0097489 | multivesicular body, internal vesicle lumen(GO:0097489) |
| 0.1 | 0.6 | GO:0042825 | TAP complex(GO:0042825) |
| 0.1 | 0.4 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.1 | 0.4 | GO:1990578 | perinuclear endoplasmic reticulum membrane(GO:1990578) |
| 0.1 | 0.3 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.1 | 1.3 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.1 | 0.1 | GO:0034678 | integrin alpha8-beta1 complex(GO:0034678) |
| 0.1 | 0.4 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.1 | 0.3 | GO:0036502 | Derlin-1-VIMP complex(GO:0036502) |
| 0.1 | 0.2 | GO:0043159 | acrosomal matrix(GO:0043159) |
| 0.1 | 0.5 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.1 | 0.4 | GO:0000235 | astral microtubule(GO:0000235) aster(GO:0005818) |
| 0.1 | 0.7 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.1 | 0.3 | GO:0070382 | exocytic vesicle(GO:0070382) |
| 0.1 | 0.2 | GO:0005960 | glycine cleavage complex(GO:0005960) |
| 0.1 | 0.7 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) |
| 0.1 | 0.2 | GO:1990622 | CHOP-ATF3 complex(GO:1990622) |
| 0.1 | 0.3 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.1 | 0.5 | GO:0097209 | epidermal lamellar body(GO:0097209) |
| 0.1 | 3.4 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.1 | 0.6 | GO:0000796 | condensin complex(GO:0000796) |
| 0.1 | 0.5 | GO:0097486 | multivesicular body lumen(GO:0097486) |
| 0.1 | 0.4 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.1 | 0.2 | GO:0060187 | cell pole(GO:0060187) |
| 0.1 | 0.2 | GO:1990462 | omegasome(GO:1990462) |
| 0.1 | 0.4 | GO:0035976 | AP1 complex(GO:0035976) |
| 0.1 | 0.5 | GO:0016012 | sarcoglycan complex(GO:0016012) |
| 0.1 | 0.4 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
| 0.1 | 0.2 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
| 0.1 | 0.3 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
| 0.1 | 0.2 | GO:0034455 | t-UTP complex(GO:0034455) |
| 0.1 | 0.1 | GO:0002945 | cyclin K-CDK13 complex(GO:0002945) |
| 0.1 | 0.1 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.1 | 0.4 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
| 0.1 | 0.2 | GO:0045257 | mitochondrial respiratory chain complex II, succinate dehydrogenase complex (ubiquinone)(GO:0005749) succinate dehydrogenase complex (ubiquinone)(GO:0045257) respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) fumarate reductase complex(GO:0045283) |
| 0.1 | 0.6 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.1 | 0.1 | GO:0032009 | early phagosome(GO:0032009) |
| 0.1 | 0.3 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.1 | 0.8 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
| 0.1 | 0.2 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.1 | 0.1 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
| 0.1 | 0.2 | GO:0070081 | clathrin-sculpted monoamine transport vesicle(GO:0070081) clathrin-sculpted monoamine transport vesicle membrane(GO:0070083) |
| 0.1 | 0.3 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.1 | 0.1 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.1 | 0.2 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.1 | 0.2 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.1 | 0.1 | GO:0030427 | site of polarized growth(GO:0030427) |
| 0.1 | 0.1 | GO:0016528 | sarcoplasm(GO:0016528) |
| 0.1 | 0.1 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.1 | 0.6 | GO:0097433 | dense body(GO:0097433) |
| 0.1 | 0.3 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.1 | 0.9 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.1 | 0.1 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 0.0 | 0.2 | GO:0032389 | MutLalpha complex(GO:0032389) |
| 0.0 | 0.2 | GO:0010370 | perinucleolar chromocenter(GO:0010370) |
| 0.0 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.0 | 0.2 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.0 | 0.9 | GO:0098576 | lumenal side of membrane(GO:0098576) |
| 0.0 | 0.3 | GO:0051286 | cell tip(GO:0051286) |
| 0.0 | 0.7 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.0 | 12.8 | GO:0009897 | external side of plasma membrane(GO:0009897) |
| 0.0 | 0.3 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.0 | 0.1 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
| 0.0 | 0.2 | GO:0055087 | Ski complex(GO:0055087) |
| 0.0 | 0.5 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.0 | 0.8 | GO:0045277 | respiratory chain complex IV(GO:0045277) |
| 0.0 | 0.5 | GO:0042555 | MCM complex(GO:0042555) |
| 0.0 | 1.0 | GO:0005884 | actin filament(GO:0005884) |
| 0.0 | 0.2 | GO:0030666 | endocytic vesicle membrane(GO:0030666) |
| 0.0 | 0.0 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.0 | 2.8 | GO:0015030 | Cajal body(GO:0015030) |
| 0.0 | 0.2 | GO:0030678 | mitochondrial ribonuclease P complex(GO:0030678) |
| 0.0 | 0.2 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.0 | 0.3 | GO:0030893 | meiotic cohesin complex(GO:0030893) |
| 0.0 | 0.2 | GO:0032449 | CBM complex(GO:0032449) |
| 0.0 | 0.2 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.0 | 0.3 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.0 | 0.6 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.0 | 0.7 | GO:0032154 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
| 0.0 | 0.3 | GO:0098559 | cytoplasmic side of early endosome membrane(GO:0098559) |
| 0.0 | 0.1 | GO:0000818 | nuclear MIS12/MIND complex(GO:0000818) |
| 0.0 | 0.4 | GO:0043198 | dendritic shaft(GO:0043198) |
| 0.0 | 0.1 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.0 | 0.1 | GO:0044308 | axonal spine(GO:0044308) |
| 0.0 | 0.2 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.0 | 1.1 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.0 | 0.0 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
| 0.0 | 0.3 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 0.3 | GO:0000782 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
| 0.0 | 1.2 | GO:0070821 | tertiary granule membrane(GO:0070821) |
| 0.0 | 0.5 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.0 | 0.3 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.0 | 0.4 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.0 | 0.1 | GO:0000438 | core TFIIH complex portion of holo TFIIH complex(GO:0000438) |
| 0.0 | 0.6 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.0 | 0.2 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.0 | 1.4 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.0 | 0.1 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.0 | 0.2 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.0 | 0.5 | GO:0036020 | endolysosome membrane(GO:0036020) |
| 0.0 | 0.7 | GO:0051233 | spindle midzone(GO:0051233) |
| 0.0 | 0.2 | GO:0009368 | endopeptidase Clp complex(GO:0009368) |
| 0.0 | 0.3 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.0 | 0.2 | GO:0071438 | invadopodium membrane(GO:0071438) |
| 0.0 | 0.2 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.0 | 0.2 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.0 | 0.3 | GO:0045261 | proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 0.0 | 0.1 | GO:0098592 | cytoplasmic side of apical plasma membrane(GO:0098592) |
| 0.0 | 2.4 | GO:0035577 | azurophil granule membrane(GO:0035577) |
| 0.0 | 0.1 | GO:1990031 | pinceau fiber(GO:1990031) |
| 0.0 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.0 | 0.3 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
| 0.0 | 0.3 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.0 | 0.1 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
| 0.0 | 0.2 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 0.1 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.0 | 0.4 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
| 0.0 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.0 | 0.1 | GO:0098536 | deuterosome(GO:0098536) |
| 0.0 | 0.4 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.0 | 0.2 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.0 | 0.1 | GO:0005771 | multivesicular body(GO:0005771) |
| 0.0 | 0.4 | GO:0044447 | axoneme part(GO:0044447) |
| 0.0 | 0.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.0 | 0.3 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.0 | 0.2 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
| 0.0 | 0.7 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
| 0.0 | 2.6 | GO:0035579 | specific granule membrane(GO:0035579) |
| 0.0 | 1.3 | GO:0002102 | podosome(GO:0002102) |
| 0.0 | 0.1 | GO:0005873 | plus-end kinesin complex(GO:0005873) |
| 0.0 | 0.1 | GO:0031436 | BRCA1-BARD1 complex(GO:0031436) |
| 0.0 | 0.2 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.0 | 0.2 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.0 | 0.1 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.0 | 0.1 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
| 0.0 | 0.1 | GO:0000780 | condensed nuclear chromosome, centromeric region(GO:0000780) |
| 0.0 | 0.5 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 0.2 | GO:0030175 | filopodium(GO:0030175) |
| 0.0 | 0.2 | GO:0005688 | U6 snRNP(GO:0005688) |
| 0.0 | 0.2 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.0 | 0.1 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.0 | 0.2 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.0 | 0.1 | GO:0031213 | RSF complex(GO:0031213) |
| 0.0 | 0.3 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
| 0.0 | 0.4 | GO:0097227 | sperm annulus(GO:0097227) |
| 0.0 | 0.5 | GO:0000795 | synaptonemal complex(GO:0000795) |
| 0.0 | 0.2 | GO:0031105 | septin complex(GO:0031105) |
| 0.0 | 0.2 | GO:0044279 | other organism cell membrane(GO:0044218) other organism membrane(GO:0044279) |
| 0.0 | 0.1 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.0 | 0.1 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.0 | 0.2 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.0 | 0.1 | GO:0038038 | G-protein coupled receptor homodimeric complex(GO:0038038) |
| 0.0 | 0.1 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.0 | 0.2 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.0 | 0.5 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
| 0.0 | 0.1 | GO:0005889 | hydrogen:potassium-exchanging ATPase complex(GO:0005889) |
| 0.0 | 0.3 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.0 | 0.4 | GO:0000145 | exocyst(GO:0000145) |
| 0.0 | 3.5 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.0 | 0.8 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 0.1 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.0 | 0.0 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.0 | 0.2 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.0 | 0.3 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
| 0.0 | 0.2 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.0 | 0.0 | GO:0008091 | spectrin(GO:0008091) |
| 0.0 | 0.0 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
| 0.0 | 0.1 | GO:0033503 | HULC complex(GO:0033503) |
| 0.0 | 0.2 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.0 | 0.3 | GO:0032420 | stereocilium(GO:0032420) |
| 0.0 | 0.4 | GO:0097228 | sperm principal piece(GO:0097228) |
| 0.0 | 0.5 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.0 | 0.5 | GO:0031904 | endosome lumen(GO:0031904) |
| 0.0 | 0.0 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
| 0.0 | 0.1 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.0 | 0.0 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.0 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.0 | 0.1 | GO:0030891 | VCB complex(GO:0030891) |
| 0.0 | 0.1 | GO:0031417 | NatC complex(GO:0031417) |
| 0.0 | 0.2 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.0 | 0.5 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.0 | 3.9 | GO:1904813 | ficolin-1-rich granule(GO:0101002) ficolin-1-rich granule lumen(GO:1904813) |
| 0.0 | 0.2 | GO:0032039 | integrator complex(GO:0032039) |
| 0.0 | 0.1 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.0 | 0.1 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.0 | 0.2 | GO:0042575 | DNA polymerase complex(GO:0042575) |
| 0.0 | 0.1 | GO:1990769 | proximal neuron projection(GO:1990769) |
| 0.0 | 0.7 | GO:1902711 | GABA-A receptor complex(GO:1902711) |
| 0.0 | 0.1 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.0 | 0.1 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.0 | 1.6 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
| 0.0 | 0.6 | GO:0009898 | cytoplasmic side of plasma membrane(GO:0009898) |
| 0.0 | 0.2 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.0 | 0.1 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
| 0.0 | 0.2 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.0 | 0.4 | GO:0044295 | axonal growth cone(GO:0044295) |
| 0.0 | 0.0 | GO:0031372 | UBC13-MMS2 complex(GO:0031372) |
| 0.0 | 0.7 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.0 | 0.1 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.0 | 0.1 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.0 | 0.1 | GO:0032302 | MutSbeta complex(GO:0032302) |
| 0.0 | 0.4 | GO:0030120 | vesicle coat(GO:0030120) |
| 0.0 | 0.1 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.0 | 0.1 | GO:0031251 | PAN complex(GO:0031251) |
| 0.0 | 0.1 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.0 | 0.1 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.0 | 0.1 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.0 | 0.0 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
| 0.0 | 0.5 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.0 | 0.2 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.0 | 0.7 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
| 0.0 | 0.1 | GO:0002177 | manchette(GO:0002177) |
| 0.0 | 0.0 | GO:0071546 | pi-body(GO:0071546) |
| 0.0 | 0.3 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.0 | 0.3 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) nuclear membrane part(GO:0044453) |
| 0.0 | 0.1 | GO:0043073 | germ cell nucleus(GO:0043073) |
| 0.0 | 0.1 | GO:0030897 | HOPS complex(GO:0030897) |
| 0.0 | 0.0 | GO:0097059 | CNTFR-CLCF1 complex(GO:0097059) |
| 0.0 | 0.1 | GO:0042721 | mitochondrial inner membrane protein insertion complex(GO:0042721) |
| 0.0 | 0.4 | GO:0032982 | myosin filament(GO:0032982) |
| 0.0 | 1.5 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) potassium channel complex(GO:0034705) |
| 0.0 | 0.1 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.0 | 0.7 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.0 | 0.0 | GO:0031225 | anchored component of membrane(GO:0031225) |
| 0.0 | 0.0 | GO:0070939 | Dsl1p complex(GO:0070939) |
| 0.0 | 0.4 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.0 | 1.8 | GO:0055037 | recycling endosome(GO:0055037) |
| 0.0 | 0.0 | GO:0033647 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
| 0.0 | 0.1 | GO:0034448 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.0 | 0.1 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.0 | 0.1 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.0 | 0.0 | GO:0097441 | basilar dendrite(GO:0097441) |
| 0.0 | 0.2 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
| 0.0 | 0.1 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.0 | 0.1 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
| 0.0 | 0.1 | GO:0097413 | Lewy body(GO:0097413) |
| 0.0 | 0.1 | GO:0042589 | zymogen granule membrane(GO:0042589) |
| 0.0 | 0.0 | GO:0033150 | perinuclear theca(GO:0033011) cytoskeletal calyx(GO:0033150) |
| 0.0 | 0.2 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.0 | 0.3 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
| 0.0 | 0.1 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.0 | 0.2 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.0 | 0.4 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.0 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.0 | 0.3 | GO:1990391 | DNA repair complex(GO:1990391) |
| 0.0 | 0.1 | GO:0032021 | NELF complex(GO:0032021) |
| 0.0 | 5.1 | GO:0016607 | nuclear speck(GO:0016607) |
| 0.0 | 0.2 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 0.2 | GO:0005657 | replication fork(GO:0005657) |
| 0.0 | 0.2 | GO:0005871 | kinesin complex(GO:0005871) |
| 0.0 | 0.5 | GO:0005775 | vacuolar lumen(GO:0005775) |
| 0.0 | 0.1 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.0 | 3.3 | GO:0000790 | nuclear chromatin(GO:0000790) |
| 0.0 | 0.2 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.0 | 0.1 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.0 | 0.0 | GO:0005846 | nuclear cap binding complex(GO:0005846) |
| 0.0 | 0.1 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.0 | 0.9 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.0 | 0.1 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 0.1 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 0.0 | 0.0 | GO:0097447 | dendritic tree(GO:0097447) |
| 0.0 | 0.2 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.0 | 0.0 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| 0.0 | 0.0 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.0 | 0.6 | GO:0043657 | host(GO:0018995) host cell(GO:0043657) |
| 0.0 | 0.9 | GO:0044306 | neuron projection terminus(GO:0044306) |
| 0.0 | 0.1 | GO:0005869 | dynactin complex(GO:0005869) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.2 | 3.5 | GO:0004917 | interleukin-7 receptor activity(GO:0004917) |
| 0.7 | 9.9 | GO:0032395 | MHC class II receptor activity(GO:0032395) |
| 0.5 | 6.6 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.5 | 3.7 | GO:0019863 | IgE binding(GO:0019863) |
| 0.4 | 2.6 | GO:0046979 | TAP2 binding(GO:0046979) |
| 0.4 | 2.5 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.4 | 1.9 | GO:0004910 | interleukin-1, Type II, blocking receptor activity(GO:0004910) |
| 0.4 | 2.7 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 0.4 | 2.5 | GO:0005353 | fructose transmembrane transporter activity(GO:0005353) |
| 0.3 | 2.4 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
| 0.3 | 0.3 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
| 0.3 | 2.3 | GO:0030369 | ICAM-3 receptor activity(GO:0030369) |
| 0.3 | 18.0 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.3 | 0.9 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.3 | 2.9 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.3 | 1.1 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.3 | 0.5 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 0.3 | 2.6 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.2 | 0.5 | GO:0071949 | FAD binding(GO:0071949) |
| 0.2 | 0.7 | GO:0017130 | poly(C) RNA binding(GO:0017130) |
| 0.2 | 0.7 | GO:0005017 | platelet-derived growth factor-activated receptor activity(GO:0005017) |
| 0.2 | 5.3 | GO:0042605 | peptide antigen binding(GO:0042605) |
| 0.2 | 0.7 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
| 0.2 | 1.4 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.2 | 0.9 | GO:0005477 | pyruvate secondary active transmembrane transporter activity(GO:0005477) |
| 0.2 | 0.2 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.2 | 0.9 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.2 | 0.7 | GO:0005148 | prolactin receptor binding(GO:0005148) |
| 0.2 | 0.9 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
| 0.2 | 0.2 | GO:0001851 | complement component C3b binding(GO:0001851) |
| 0.2 | 2.2 | GO:0004568 | chitinase activity(GO:0004568) chitin binding(GO:0008061) |
| 0.2 | 0.6 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
| 0.2 | 1.3 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.2 | 0.6 | GO:0035403 | histone kinase activity (H3-T6 specific)(GO:0035403) |
| 0.2 | 0.7 | GO:0030107 | HLA-A specific inhibitory MHC class I receptor activity(GO:0030107) |
| 0.2 | 5.2 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.2 | 0.3 | GO:0072510 | ferric iron transmembrane transporter activity(GO:0015091) trivalent inorganic cation transmembrane transporter activity(GO:0072510) |
| 0.2 | 2.2 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.2 | 0.5 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
| 0.2 | 1.0 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
| 0.2 | 1.4 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.2 | 2.5 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.2 | 1.1 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.2 | 0.5 | GO:0004139 | deoxyribose-phosphate aldolase activity(GO:0004139) |
| 0.2 | 0.5 | GO:0015230 | FAD transmembrane transporter activity(GO:0015230) |
| 0.2 | 0.6 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.2 | 1.5 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.1 | 0.4 | GO:0004464 | leukotriene-C4 synthase activity(GO:0004464) |
| 0.1 | 0.6 | GO:0016639 | oxidoreductase activity, acting on the CH-NH2 group of donors, NAD or NADP as acceptor(GO:0016639) |
| 0.1 | 0.6 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
| 0.1 | 0.4 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.1 | 0.6 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
| 0.1 | 0.6 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.1 | 0.6 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.1 | 1.3 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.1 | 0.7 | GO:0017159 | pantetheine hydrolase activity(GO:0017159) |
| 0.1 | 0.3 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
| 0.1 | 0.4 | GO:0003883 | CTP synthase activity(GO:0003883) |
| 0.1 | 0.4 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
| 0.1 | 0.4 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.1 | 0.4 | GO:0004947 | bradykinin receptor activity(GO:0004947) |
| 0.1 | 0.9 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 0.1 | 0.1 | GO:0003990 | acetylcholinesterase activity(GO:0003990) |
| 0.1 | 2.0 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.1 | 0.6 | GO:0004485 | methylcrotonoyl-CoA carboxylase activity(GO:0004485) |
| 0.1 | 0.3 | GO:0032090 | Pyrin domain binding(GO:0032090) |
| 0.1 | 3.5 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.1 | 0.9 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
| 0.1 | 1.0 | GO:0032393 | MHC class I receptor activity(GO:0032393) |
| 0.1 | 0.4 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
| 0.1 | 0.7 | GO:0043532 | angiostatin binding(GO:0043532) |
| 0.1 | 1.8 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.1 | 0.6 | GO:0031962 | mineralocorticoid receptor binding(GO:0031962) |
| 0.1 | 0.3 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.1 | 1.2 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.1 | 0.1 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
| 0.1 | 1.6 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.1 | 0.3 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
| 0.1 | 0.3 | GO:0071566 | UFM1 activating enzyme activity(GO:0071566) |
| 0.1 | 0.7 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.1 | 2.0 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.1 | 0.5 | GO:0047820 | D-glutamate cyclase activity(GO:0047820) |
| 0.1 | 0.7 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.1 | 0.8 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.1 | 14.8 | GO:0003823 | antigen binding(GO:0003823) |
| 0.1 | 0.3 | GO:0022897 | peptide:proton symporter activity(GO:0015333) proton-dependent peptide secondary active transmembrane transporter activity(GO:0022897) |
| 0.1 | 8.5 | GO:0005518 | collagen binding(GO:0005518) |
| 0.1 | 0.5 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.1 | 0.3 | GO:0008859 | exoribonuclease II activity(GO:0008859) |
| 0.1 | 0.5 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.1 | 0.6 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 0.1 | 1.2 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.1 | 0.3 | GO:0051748 | UTP:glucose-1-phosphate uridylyltransferase activity(GO:0003983) UTP-monosaccharide-1-phosphate uridylyltransferase activity(GO:0051748) |
| 0.1 | 4.1 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.1 | 0.7 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
| 0.1 | 1.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.1 | 4.1 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.1 | 0.1 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
| 0.1 | 0.5 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
| 0.1 | 0.3 | GO:0003863 | alpha-ketoacid dehydrogenase activity(GO:0003826) 3-methyl-2-oxobutanoate dehydrogenase (2-methylpropanoyl-transferring) activity(GO:0003863) |
| 0.1 | 0.5 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.1 | 1.4 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
| 0.1 | 2.8 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
| 0.1 | 1.8 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.1 | 0.5 | GO:0036122 | BMP binding(GO:0036122) |
| 0.1 | 0.4 | GO:0004906 | interferon-gamma receptor activity(GO:0004906) |
| 0.1 | 0.3 | GO:0030337 | DNA polymerase processivity factor activity(GO:0030337) |
| 0.1 | 0.3 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.1 | 0.4 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
| 0.1 | 0.7 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.1 | 0.3 | GO:0004666 | prostaglandin-endoperoxide synthase activity(GO:0004666) |
| 0.1 | 1.9 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.1 | 0.3 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
| 0.1 | 0.3 | GO:0033981 | D-dopachrome decarboxylase activity(GO:0033981) |
| 0.1 | 0.2 | GO:0016623 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, oxygen as acceptor(GO:0016623) |
| 0.1 | 0.6 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.1 | 0.2 | GO:0005497 | androgen binding(GO:0005497) |
| 0.1 | 0.5 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 0.1 | 0.4 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
| 0.1 | 1.5 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.1 | 0.4 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.1 | 0.2 | GO:0047757 | chondroitin-glucuronate 5-epimerase activity(GO:0047757) |
| 0.1 | 0.7 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
| 0.1 | 0.2 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.1 | 0.3 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
| 0.1 | 0.3 | GO:0032408 | MutLbeta complex binding(GO:0032406) MutSbeta complex binding(GO:0032408) |
| 0.1 | 1.4 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.1 | 0.2 | GO:0017129 | triglyceride binding(GO:0017129) |
| 0.1 | 0.3 | GO:0043398 | HLH domain binding(GO:0043398) |
| 0.1 | 0.2 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.1 | 0.2 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.1 | 0.3 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
| 0.1 | 0.2 | GO:0097677 | STAT family protein binding(GO:0097677) |
| 0.1 | 0.2 | GO:0102008 | cytosolic dipeptidase activity(GO:0102008) |
| 0.1 | 0.2 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) NAD(P)+ nucleosidase activity(GO:0050135) |
| 0.1 | 0.2 | GO:0004347 | glucose-6-phosphate isomerase activity(GO:0004347) |
| 0.1 | 0.3 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
| 0.1 | 0.1 | GO:0004461 | lactose synthase activity(GO:0004461) |
| 0.1 | 0.1 | GO:0002134 | pyrimidine nucleoside binding(GO:0001884) UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
| 0.1 | 0.2 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
| 0.1 | 1.1 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.1 | 0.4 | GO:0004883 | glucocorticoid receptor activity(GO:0004883) glucocorticoid-activated RNA polymerase II transcription factor binding transcription factor activity(GO:0038051) |
| 0.1 | 0.9 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.1 | 2.9 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 0.1 | 0.1 | GO:0055104 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.1 | 0.4 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
| 0.1 | 1.5 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.1 | 0.2 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.1 | 0.3 | GO:0016728 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.1 | 0.3 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
| 0.1 | 0.8 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.1 | 0.2 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.1 | 1.5 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.1 | 0.4 | GO:0032407 | MutSalpha complex binding(GO:0032407) |
| 0.1 | 0.4 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.1 | 0.7 | GO:0003696 | satellite DNA binding(GO:0003696) |
| 0.1 | 0.2 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.1 | 0.7 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.1 | 0.4 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
| 0.1 | 0.3 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.1 | 0.2 | GO:0033878 | hormone-sensitive lipase activity(GO:0033878) |
| 0.1 | 0.6 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.1 | 0.2 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.1 | 0.3 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.1 | 1.8 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.1 | 0.1 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.1 | 0.5 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.1 | 0.4 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) L-lactate dehydrogenase activity(GO:0004459) |
| 0.1 | 0.2 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.1 | 0.2 | GO:0004878 | complement component C5a receptor activity(GO:0004878) |
| 0.1 | 0.3 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.1 | 0.6 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.1 | 0.3 | GO:0015184 | L-cystine transmembrane transporter activity(GO:0015184) |
| 0.1 | 0.4 | GO:0016769 | transferase activity, transferring nitrogenous groups(GO:0016769) |
| 0.1 | 0.6 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
| 0.1 | 0.2 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.1 | 0.5 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
| 0.1 | 0.2 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.1 | 0.2 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.1 | 0.6 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.1 | 0.4 | GO:0052654 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
| 0.1 | 0.4 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.1 | 1.0 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.1 | 0.4 | GO:0060072 | large conductance calcium-activated potassium channel activity(GO:0060072) |
| 0.1 | 0.3 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.1 | 0.1 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.1 | 0.2 | GO:0015265 | urea channel activity(GO:0015265) |
| 0.1 | 0.2 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.1 | 0.1 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
| 0.1 | 0.1 | GO:0019966 | interleukin-1 binding(GO:0019966) |
| 0.1 | 0.5 | GO:0005534 | galactose binding(GO:0005534) |
| 0.1 | 1.1 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.1 | 0.3 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.1 | 0.2 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.1 | 0.3 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
| 0.1 | 0.7 | GO:0043047 | single-stranded telomeric DNA binding(GO:0043047) |
| 0.1 | 0.3 | GO:0031432 | titin binding(GO:0031432) |
| 0.1 | 0.3 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.1 | 0.2 | GO:0004618 | phosphoglycerate kinase activity(GO:0004618) |
| 0.1 | 0.3 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
| 0.1 | 0.2 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.1 | 0.2 | GO:0043812 | phosphatidylinositol-4-phosphate phosphatase activity(GO:0043812) |
| 0.1 | 0.1 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.1 | 0.3 | GO:0010859 | calcium-dependent cysteine-type endopeptidase inhibitor activity(GO:0010859) |
| 0.1 | 0.2 | GO:0070735 | protein-glycine ligase activity(GO:0070735) |
| 0.1 | 1.3 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.1 | 0.3 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
| 0.1 | 0.2 | GO:0061513 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.1 | 1.2 | GO:0016814 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amidines(GO:0016814) |
| 0.1 | 0.1 | GO:0016725 | oxidoreductase activity, acting on CH or CH2 groups(GO:0016725) |
| 0.0 | 0.1 | GO:0042610 | CD8 receptor binding(GO:0042610) |
| 0.0 | 0.8 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.0 | 0.1 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
| 0.0 | 0.5 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.0 | 0.0 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
| 0.0 | 0.6 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.0 | 0.1 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
| 0.0 | 0.2 | GO:0052590 | sn-glycerol-3-phosphate:ubiquinone oxidoreductase activity(GO:0052590) sn-glycerol-3-phosphate:ubiquinone-8 oxidoreductase activity(GO:0052591) |
| 0.0 | 0.4 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
| 0.0 | 0.1 | GO:0015361 | low-affinity sodium:dicarboxylate symporter activity(GO:0015361) |
| 0.0 | 0.1 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) |
| 0.0 | 0.1 | GO:0061663 | NEDD8 ligase activity(GO:0061663) |
| 0.0 | 0.3 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.0 | 0.1 | GO:0004170 | dUTP diphosphatase activity(GO:0004170) |
| 0.0 | 0.2 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
| 0.0 | 0.1 | GO:0030343 | vitamin D3 25-hydroxylase activity(GO:0030343) vitamin D 25-hydroxylase activity(GO:0070643) |
| 0.0 | 1.5 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.0 | 0.5 | GO:0050664 | oxidoreductase activity, acting on NAD(P)H, oxygen as acceptor(GO:0050664) |
| 0.0 | 0.1 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.0 | 0.2 | GO:0008410 | CoA-transferase activity(GO:0008410) |
| 0.0 | 0.1 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 0.0 | 0.3 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.0 | 0.8 | GO:0045028 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
| 0.0 | 0.5 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.0 | 0.8 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
| 0.0 | 0.1 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.0 | 0.2 | GO:0015307 | drug:proton antiporter activity(GO:0015307) |
| 0.0 | 0.3 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
| 0.0 | 0.1 | GO:0033188 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
| 0.0 | 0.2 | GO:0052834 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.0 | 0.2 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.0 | 0.1 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.0 | 0.2 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.0 | 1.9 | GO:0003678 | DNA helicase activity(GO:0003678) |
| 0.0 | 0.3 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.0 | 0.2 | GO:0008241 | peptidyl-dipeptidase activity(GO:0008241) |
| 0.0 | 0.0 | GO:0035326 | enhancer binding(GO:0035326) |
| 0.0 | 0.4 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
| 0.0 | 0.1 | GO:1901476 | carbohydrate transmembrane transporter activity(GO:0015144) carbohydrate transporter activity(GO:1901476) |
| 0.0 | 0.1 | GO:0008386 | cholesterol monooxygenase (side-chain-cleaving) activity(GO:0008386) |
| 0.0 | 1.5 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.4 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.0 | 0.2 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.0 | 0.1 | GO:0008094 | DNA-dependent ATPase activity(GO:0008094) |
| 0.0 | 0.2 | GO:0008466 | glycogenin glucosyltransferase activity(GO:0008466) |
| 0.0 | 0.1 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
| 0.0 | 0.1 | GO:0043813 | phosphatidylinositol-3,5-bisphosphate 5-phosphatase activity(GO:0043813) |
| 0.0 | 0.6 | GO:0019841 | retinol binding(GO:0019841) |
| 0.0 | 0.2 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
| 0.0 | 0.1 | GO:0008424 | glycoprotein 6-alpha-L-fucosyltransferase activity(GO:0008424) alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
| 0.0 | 0.3 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
| 0.0 | 0.1 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
| 0.0 | 0.1 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
| 0.0 | 0.3 | GO:0038052 | RNA polymerase II transcription factor activity, estrogen-activated sequence-specific DNA binding(GO:0038052) |
| 0.0 | 0.1 | GO:0016748 | succinyltransferase activity(GO:0016748) |
| 0.0 | 0.1 | GO:0035673 | oligopeptide transporter activity(GO:0015198) oligopeptide transmembrane transporter activity(GO:0035673) |
| 0.0 | 0.2 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.0 | 0.1 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.0 | 0.1 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 0.0 | 0.5 | GO:0043855 | intracellular cyclic nucleotide activated cation channel activity(GO:0005221) cyclic nucleotide-gated ion channel activity(GO:0043855) |
| 0.0 | 0.1 | GO:0016160 | amylase activity(GO:0016160) |
| 0.0 | 0.1 | GO:0004157 | dihydropyrimidinase activity(GO:0004157) |
| 0.0 | 0.4 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.0 | 0.4 | GO:0005112 | Notch binding(GO:0005112) |
| 0.0 | 0.1 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
| 0.0 | 0.5 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.0 | 0.2 | GO:0032296 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
| 0.0 | 0.1 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.0 | 0.1 | GO:0004914 | interleukin-5 receptor activity(GO:0004914) |
| 0.0 | 0.1 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.0 | 0.0 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.0 | 0.1 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
| 0.0 | 0.3 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.0 | 2.9 | GO:0035004 | phosphatidylinositol 3-kinase activity(GO:0035004) |
| 0.0 | 0.4 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.0 | 0.1 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.0 | 0.1 | GO:0004775 | succinate-CoA ligase (ADP-forming) activity(GO:0004775) |
| 0.0 | 0.1 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
| 0.0 | 0.1 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
| 0.0 | 0.0 | GO:0016880 | glutamate-ammonia ligase activity(GO:0004356) ammonia ligase activity(GO:0016211) acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.0 | 0.5 | GO:0043295 | glutathione binding(GO:0043295) |
| 0.0 | 0.3 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.0 | 0.4 | GO:0001087 | transcription factor activity, sequence-specific DNA binding, RNA polymerase recruiting(GO:0001011) transcription factor activity, TFIIB-class binding(GO:0001087) |
| 0.0 | 0.2 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
| 0.0 | 0.1 | GO:1903136 | cuprous ion binding(GO:1903136) |
| 0.0 | 0.2 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
| 0.0 | 0.2 | GO:0005119 | smoothened binding(GO:0005119) |
| 0.0 | 0.4 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
| 0.0 | 0.2 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
| 0.0 | 0.1 | GO:0050473 | arachidonate 15-lipoxygenase activity(GO:0050473) |
| 0.0 | 0.4 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.0 | 0.3 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
| 0.0 | 0.4 | GO:0043548 | phosphatidylinositol 3-kinase binding(GO:0043548) |
| 0.0 | 0.9 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.0 | 0.3 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.0 | 0.1 | GO:0017082 | mineralocorticoid receptor activity(GO:0017082) |
| 0.0 | 0.1 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
| 0.0 | 0.2 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.0 | 0.6 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.0 | 0.3 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.0 | 0.1 | GO:0008431 | vitamin E binding(GO:0008431) |
| 0.0 | 0.1 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) procollagen-proline dioxygenase activity(GO:0019798) |
| 0.0 | 1.1 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.0 | 0.1 | GO:0048039 | ubiquinone binding(GO:0048039) |
| 0.0 | 0.1 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
| 0.0 | 0.2 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.0 | 0.3 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.0 | 0.5 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.2 | GO:0052739 | phosphatidylserine 1-acylhydrolase activity(GO:0052739) |
| 0.0 | 0.6 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.0 | 0.1 | GO:0031208 | POZ domain binding(GO:0031208) |
| 0.0 | 0.0 | GO:0019003 | GDP binding(GO:0019003) |
| 0.0 | 0.1 | GO:0030272 | 5-formyltetrahydrofolate cyclo-ligase activity(GO:0030272) |
| 0.0 | 0.3 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.0 | 0.5 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
| 0.0 | 0.1 | GO:0099529 | neurotransmitter receptor activity involved in regulation of postsynaptic membrane potential(GO:0099529) transmitter-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1904315) |
| 0.0 | 0.1 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.0 | 0.1 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
| 0.0 | 0.2 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 0.0 | 0.3 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.0 | 0.1 | GO:0016314 | phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase activity(GO:0016314) phosphatidylinositol trisphosphate phosphatase activity(GO:0034594) |
| 0.0 | 0.1 | GO:0016404 | 15-hydroxyprostaglandin dehydrogenase (NAD+) activity(GO:0016404) |
| 0.0 | 0.1 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.0 | 0.2 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
| 0.0 | 0.1 | GO:0008670 | 2,4-dienoyl-CoA reductase (NADPH) activity(GO:0008670) |
| 0.0 | 0.1 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.0 | 0.2 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.0 | 0.2 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.0 | 0.1 | GO:0051733 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.0 | 0.1 | GO:0000339 | RNA cap binding(GO:0000339) |
| 0.0 | 0.1 | GO:0099583 | postsynaptic neurotransmitter receptor activity(GO:0098960) neurotransmitter receptor activity involved in regulation of postsynaptic cytosolic calcium ion concentration(GO:0099583) |
| 0.0 | 0.4 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.0 | 0.1 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
| 0.0 | 0.2 | GO:0008865 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.0 | 0.0 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
| 0.0 | 0.3 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.0 | 0.3 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
| 0.0 | 1.0 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.0 | 0.7 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.0 | 0.1 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.0 | 0.5 | GO:0030276 | clathrin binding(GO:0030276) |
| 0.0 | 0.2 | GO:0042978 | ornithine decarboxylase activator activity(GO:0042978) |
| 0.0 | 0.0 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.0 | 0.2 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.0 | 0.1 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 0.0 | 0.1 | GO:0004692 | cGMP-dependent protein kinase activity(GO:0004692) |
| 0.0 | 0.3 | GO:0016594 | glycine binding(GO:0016594) |
| 0.0 | 0.1 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
| 0.0 | 0.2 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
| 0.0 | 0.1 | GO:0004882 | androgen receptor activity(GO:0004882) |
| 0.0 | 0.1 | GO:0044549 | GTP cyclohydrolase binding(GO:0044549) |
| 0.0 | 0.1 | GO:0005260 | channel-conductance-controlling ATPase activity(GO:0005260) |
| 0.0 | 0.1 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.0 | 0.2 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.0 | 0.1 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
| 0.0 | 0.0 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.0 | 0.0 | GO:0071723 | lipopeptide binding(GO:0071723) |
| 0.0 | 0.1 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.0 | 0.1 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
| 0.0 | 0.3 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
| 0.0 | 0.1 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.0 | 0.3 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
| 0.0 | 1.0 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.0 | 0.0 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
| 0.0 | 0.2 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.0 | 0.2 | GO:0030618 | transforming growth factor beta receptor, pathway-specific cytoplasmic mediator activity(GO:0030618) |
| 0.0 | 0.3 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
| 0.0 | 0.1 | GO:0016295 | oleoyl-[acyl-carrier-protein] hydrolase activity(GO:0004320) myristoyl-[acyl-carrier-protein] hydrolase activity(GO:0016295) palmitoyl-[acyl-carrier-protein] hydrolase activity(GO:0016296) acyl-[acyl-carrier-protein] hydrolase activity(GO:0016297) |
| 0.0 | 0.1 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 0.0 | 10.3 | GO:0000978 | RNA polymerase II core promoter proximal region sequence-specific DNA binding(GO:0000978) |
| 0.0 | 0.1 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.0 | 0.1 | GO:0004727 | prenylated protein tyrosine phosphatase activity(GO:0004727) |
| 0.0 | 0.1 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.0 | 0.1 | GO:0019826 | oxygen sensor activity(GO:0019826) |
| 0.0 | 0.1 | GO:0033265 | choline binding(GO:0033265) |
| 0.0 | 0.0 | GO:0008200 | ion channel inhibitor activity(GO:0008200) |
| 0.0 | 0.1 | GO:0019843 | rRNA binding(GO:0019843) |
| 0.0 | 0.3 | GO:0034483 | heparan sulfate sulfotransferase activity(GO:0034483) |
| 0.0 | 0.1 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.0 | 0.1 | GO:0042608 | T cell receptor binding(GO:0042608) |
| 0.0 | 0.4 | GO:0015923 | mannosidase activity(GO:0015923) |
| 0.0 | 0.2 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
| 0.0 | 1.0 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 0.0 | 0.3 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.0 | 0.1 | GO:0004815 | aspartate-tRNA ligase activity(GO:0004815) |
| 0.0 | 0.1 | GO:0060698 | endoribonuclease inhibitor activity(GO:0060698) |
| 0.0 | 0.5 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.0 | 0.2 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.0 | 0.3 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.0 | 0.0 | GO:0016618 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.0 | 0.0 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
| 0.0 | 0.4 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.0 | 0.2 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.0 | 0.0 | GO:0046625 | sphingolipid binding(GO:0046625) |
| 0.0 | 0.1 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.1 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.0 | 0.3 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.0 | 0.1 | GO:0030020 | extracellular matrix structural constituent conferring tensile strength(GO:0030020) |
| 0.0 | 0.1 | GO:0005471 | ATP:ADP antiporter activity(GO:0005471) adenine transmembrane transporter activity(GO:0015207) |
| 0.0 | 0.4 | GO:0070001 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
| 0.0 | 0.3 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.0 | 0.1 | GO:0004874 | aryl hydrocarbon receptor activity(GO:0004874) |
| 0.0 | 0.4 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.0 | 0.1 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
| 0.0 | 0.1 | GO:0000404 | heteroduplex DNA loop binding(GO:0000404) double-strand/single-strand DNA junction binding(GO:0000406) dinucleotide repeat insertion binding(GO:0032181) |
| 0.0 | 0.3 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
| 0.0 | 0.1 | GO:0004781 | adenylylsulfate kinase activity(GO:0004020) sulfate adenylyltransferase activity(GO:0004779) sulfate adenylyltransferase (ATP) activity(GO:0004781) |
| 0.0 | 0.1 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.0 | 0.1 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.0 | 2.0 | GO:0017124 | SH3 domain binding(GO:0017124) |
| 0.0 | 0.1 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.0 | 0.1 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.0 | 0.1 | GO:0036134 | thromboxane-A synthase activity(GO:0004796) 12-hydroxyheptadecatrienoic acid synthase activity(GO:0036134) |
| 0.0 | 0.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.0 | 0.3 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
| 0.0 | 0.1 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
| 0.0 | 0.1 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
| 0.0 | 0.6 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.0 | 0.1 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.0 | 0.1 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.0 | 0.2 | GO:0004875 | complement receptor activity(GO:0004875) |
| 0.0 | 0.1 | GO:0016979 | lipoate-protein ligase activity(GO:0016979) |
| 0.0 | 0.1 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.0 | 0.4 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.0 | 0.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.0 | 0.2 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.0 | 0.3 | GO:0004520 | endodeoxyribonuclease activity(GO:0004520) |
| 0.0 | 0.1 | GO:0019956 | chemokine binding(GO:0019956) |
| 0.0 | 0.1 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.0 | 0.5 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.0 | 0.1 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.0 | 0.4 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
| 0.0 | 0.1 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.0 | 0.0 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
| 0.0 | 0.1 | GO:0004102 | choline O-acetyltransferase activity(GO:0004102) |
| 0.0 | 0.0 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.0 | 0.0 | GO:0016730 | ferredoxin-NADP+ reductase activity(GO:0004324) NADPH-adrenodoxin reductase activity(GO:0015039) oxidoreductase activity, acting on iron-sulfur proteins as donors(GO:0016730) oxidoreductase activity, acting on iron-sulfur proteins as donors, NAD or NADP as acceptor(GO:0016731) |
| 0.0 | 0.2 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
| 0.0 | 0.0 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.0 | 0.1 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.0 | 0.1 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.0 | 0.1 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.0 | 0.0 | GO:0034038 | deoxyhypusine synthase activity(GO:0034038) |
| 0.0 | 0.1 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.0 | 5.8 | GO:0005525 | GTP binding(GO:0005525) |
| 0.0 | 0.0 | GO:0051538 | 3 iron, 4 sulfur cluster binding(GO:0051538) |
| 0.0 | 0.9 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
| 0.0 | 0.3 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.0 | 0.0 | GO:0004766 | spermidine synthase activity(GO:0004766) |
| 0.0 | 0.6 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.0 | 0.0 | GO:0008296 | 3'-5'-exodeoxyribonuclease activity(GO:0008296) |
| 0.0 | 0.1 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.0 | 0.2 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.0 | 0.1 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) |
| 0.0 | 0.1 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.0 | 0.0 | GO:0008271 | secondary active sulfate transmembrane transporter activity(GO:0008271) |
| 0.0 | 0.1 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.0 | 0.1 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
| 0.0 | 0.0 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.0 | 0.0 | GO:0008079 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
| 0.0 | 0.0 | GO:0004137 | deoxycytidine kinase activity(GO:0004137) |
| 0.0 | 0.2 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.0 | 0.0 | GO:0043021 | ribonucleoprotein complex binding(GO:0043021) |
| 0.0 | 0.1 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.0 | 0.3 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.0 | 0.6 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.0 | 0.1 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.0 | 0.2 | GO:0004659 | prenyltransferase activity(GO:0004659) |
| 0.0 | 0.0 | GO:0016781 | selenide, water dikinase activity(GO:0004756) phosphotransferase activity, paired acceptors(GO:0016781) |
| 0.0 | 0.1 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 0.0 | 0.1 | GO:0042301 | phosphate ion binding(GO:0042301) |
| 0.0 | 0.1 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.0 | 0.1 | GO:0016530 | metallochaperone activity(GO:0016530) copper chaperone activity(GO:0016531) |
| 0.0 | 0.1 | GO:0030983 | mismatched DNA binding(GO:0030983) |
| 0.0 | 0.1 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.0 | 0.0 | GO:0098811 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
| 0.0 | 0.0 | GO:0031402 | sodium ion binding(GO:0031402) |
| 0.0 | 0.0 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
| 0.0 | 0.1 | GO:0070259 | tyrosyl-DNA phosphodiesterase activity(GO:0070259) |
| 0.0 | 0.0 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.0 | 0.0 | GO:0047322 | [hydroxymethylglutaryl-CoA reductase (NADPH)] kinase activity(GO:0047322) [acetyl-CoA carboxylase] kinase activity(GO:0050405) |
| 0.0 | 0.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.0 | 0.2 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
| 0.0 | 0.0 | GO:1901567 | icosanoid binding(GO:0050542) arachidonic acid binding(GO:0050544) fatty acid derivative binding(GO:1901567) |
| 0.0 | 0.1 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.0 | 0.3 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.1 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.0 | 0.1 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.0 | 0.2 | GO:0008392 | arachidonic acid monooxygenase activity(GO:0008391) arachidonic acid epoxygenase activity(GO:0008392) |
| 0.0 | 0.0 | GO:0034057 | RNA strand-exchange activity(GO:0034057) |
| 0.0 | 0.0 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.0 | 0.1 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.0 | 0.0 | GO:0051996 | farnesyl-diphosphate farnesyltransferase activity(GO:0004310) squalene synthase activity(GO:0051996) |
| 0.0 | 0.0 | GO:0003960 | NADPH:quinone reductase activity(GO:0003960) |
| 0.0 | 0.1 | GO:0034061 | DNA polymerase activity(GO:0034061) |
| 0.0 | 0.1 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.0 | 0.0 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.0 | 0.2 | GO:0033613 | activating transcription factor binding(GO:0033613) |
| 0.0 | 0.0 | GO:0042834 | peptidoglycan binding(GO:0042834) |
| 0.0 | 0.3 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.0 | 0.0 | GO:0035254 | glutamate receptor binding(GO:0035254) |
| 0.0 | 0.0 | GO:0009975 | cyclase activity(GO:0009975) |
| 0.0 | 0.1 | GO:0015248 | sterol transporter activity(GO:0015248) |
| 0.0 | 0.1 | GO:0043426 | MRF binding(GO:0043426) |
| 0.0 | 0.5 | GO:0004984 | olfactory receptor activity(GO:0004984) |
| 0.0 | 0.1 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.0 | 0.1 | GO:0015056 | corticotrophin-releasing factor receptor activity(GO:0015056) |
| 0.0 | 0.1 | GO:0005044 | scavenger receptor activity(GO:0005044) |
| 0.0 | 0.0 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.0 | 0.2 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.0 | 0.5 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.0 | 0.0 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.0 | 0.1 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.0 | 0.0 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 0.0 | 0.0 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
| 0.0 | 0.7 | GO:0000149 | SNARE binding(GO:0000149) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 10.2 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 0.4 | 4.1 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.3 | 9.0 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
| 0.3 | 4.3 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 0.3 | 5.6 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.3 | 5.5 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.2 | 1.2 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.2 | 7.9 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.2 | 1.5 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.2 | 3.5 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.1 | 0.6 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 0.1 | 2.1 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.1 | 1.5 | REACTOME POL SWITCHING | Genes involved in Polymerase switching |
| 0.1 | 1.5 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.1 | 1.2 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.1 | 1.2 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
| 0.1 | 2.9 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| 0.1 | 0.2 | REACTOME TCR SIGNALING | Genes involved in TCR signaling |
| 0.1 | 1.0 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
| 0.1 | 3.2 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
| 0.1 | 3.1 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.1 | 1.2 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.1 | 1.6 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.1 | 4.5 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.1 | 5.8 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.1 | 1.1 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.1 | 3.2 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
| 0.1 | 2.0 | REACTOME ACTIVATION OF ATR IN RESPONSE TO REPLICATION STRESS | Genes involved in Activation of ATR in response to replication stress |
| 0.1 | 1.6 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
| 0.1 | 0.1 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
| 0.1 | 0.6 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.1 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.1 | 0.6 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.1 | 0.1 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
| 0.1 | 1.7 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.1 | 2.7 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 0.1 | 0.7 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
| 0.1 | 1.5 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.1 | 5.8 | REACTOME ANTIGEN PROCESSING CROSS PRESENTATION | Genes involved in Antigen processing-Cross presentation |
| 0.1 | 0.8 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.1 | 1.1 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
| 0.1 | 0.1 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
| 0.1 | 5.8 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
| 0.1 | 0.8 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.1 | 1.2 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.0 | 0.9 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.0 | 1.0 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.0 | 0.0 | REACTOME AUTODEGRADATION OF THE E3 UBIQUITIN LIGASE COP1 | Genes involved in Autodegradation of the E3 ubiquitin ligase COP1 |
| 0.0 | 0.5 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.0 | 0.5 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
| 0.0 | 0.5 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.0 | 0.3 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.0 | 0.6 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.0 | 1.4 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.0 | 2.1 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.0 | 0.6 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.0 | 1.9 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
| 0.0 | 1.5 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.0 | 1.9 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.6 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.0 | 1.0 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
| 0.0 | 0.6 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.0 | 0.5 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.0 | 0.2 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.0 | 0.2 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.0 | 1.3 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 0.1 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.0 | 0.6 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.0 | 0.2 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
| 0.0 | 0.1 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 0.0 | 0.9 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.0 | 0.2 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.0 | 0.2 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.0 | 0.6 | REACTOME ACTIVATED POINT MUTANTS OF FGFR2 | Genes involved in Activated point mutants of FGFR2 |
| 0.0 | 0.3 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.0 | 0.3 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.0 | 2.3 | REACTOME TOLL RECEPTOR CASCADES | Genes involved in Toll Receptor Cascades |
| 0.0 | 0.5 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.0 | 0.3 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
| 0.0 | 2.3 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.0 | 0.6 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.0 | 0.6 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.0 | 0.7 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.0 | 1.0 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
| 0.0 | 1.3 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 0.4 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.0 | 0.5 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.0 | 0.7 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
| 0.0 | 0.3 | REACTOME REVERSIBLE HYDRATION OF CARBON DIOXIDE | Genes involved in Reversible Hydration of Carbon Dioxide |
| 0.0 | 0.4 | REACTOME GLUCAGON TYPE LIGAND RECEPTORS | Genes involved in Glucagon-type ligand receptors |
| 0.0 | 0.4 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
| 0.0 | 0.1 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
| 0.0 | 0.4 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.0 | 1.8 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.0 | 0.6 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 0.0 | 0.2 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.0 | 0.1 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.0 | 0.4 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
| 0.0 | 0.2 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
| 0.0 | 0.4 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.0 | 0.4 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
| 0.0 | 1.0 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.0 | 0.4 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.0 | 0.1 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.0 | 0.4 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.0 | 0.5 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.0 | 0.2 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 0.0 | 1.1 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.0 | 0.2 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.0 | 0.2 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.0 | 0.0 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
| 0.0 | 0.1 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.0 | 0.3 | REACTOME POST NMDA RECEPTOR ACTIVATION EVENTS | Genes involved in Post NMDA receptor activation events |
| 0.0 | 0.0 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.0 | 0.1 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.0 | 0.2 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.0 | 0.2 | REACTOME CHROMOSOME MAINTENANCE | Genes involved in Chromosome Maintenance |
| 0.0 | 0.6 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
| 0.0 | 0.0 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 0.0 | 0.2 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
| 0.0 | 0.4 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
| 0.0 | 0.2 | REACTOME DOWNSTREAM SIGNAL TRANSDUCTION | Genes involved in Downstream signal transduction |
| 0.0 | 0.1 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.0 | 0.1 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.0 | 0.6 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.0 | 0.3 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
| 0.0 | 0.3 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.0 | 0.2 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.0 | 0.1 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.0 | 0.1 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
| 0.0 | 0.2 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 0.4 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
| 0.0 | 0.1 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.0 | 0.0 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
| 0.0 | 1.1 | REACTOME MEIOSIS | Genes involved in Meiosis |
| 0.0 | 0.5 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
| 0.0 | 0.1 | REACTOME REGULATION OF APOPTOSIS | Genes involved in Regulation of Apoptosis |
| 0.0 | 0.2 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |