ENCODE cell lines, expression (Ernst 2011)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
ID4
|
ENSG00000172201.6 | ID4 |
|
TCF4
|
ENSG00000196628.9 | TCF4 |
|
SNAI2
|
ENSG00000019549.4 | SNAI2 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| TCF4 | hg19_v2_chr18_-_53068911_53068935 | -0.55 | 2.6e-02 | Click! |
| SNAI2 | hg19_v2_chr8_-_49833978_49833996, hg19_v2_chr8_-_49834299_49834446 | -0.49 | 5.5e-02 | Click! |
| ID4 | hg19_v2_chr6_+_19837592_19837621 | 0.06 | 8.3e-01 | Click! |
| Promoter | Score | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr18_+_29077990 | 10.23 |
ENST00000261590.8 |
DSG2 |
desmoglein 2 |
| chr14_+_31343951 | 7.01 |
ENST00000556908.1 ENST00000555881.1 ENST00000460581.2 |
COCH |
cochlin |
| chr14_+_31343747 | 6.92 |
ENST00000216361.4 ENST00000396618.3 ENST00000475087.1 |
COCH |
cochlin |
| chr14_-_55369525 | 6.10 |
ENST00000543643.2 ENST00000536224.2 ENST00000395514.1 ENST00000491895.2 |
GCH1 |
GTP cyclohydrolase 1 |
| chr1_+_60280458 | 5.56 |
ENST00000455990.1 ENST00000371208.3 |
HOOK1 |
hook microtubule-tethering protein 1 |
| chr2_+_47596287 | 5.33 |
ENST00000263735.4 |
EPCAM |
epithelial cell adhesion molecule |
| chr12_+_56473628 | 4.70 |
ENST00000549282.1 ENST00000549061.1 ENST00000267101.3 |
ERBB3 |
v-erb-b2 avian erythroblastic leukemia viral oncogene homolog 3 |
| chr17_+_73521763 | 4.55 |
ENST00000167462.5 ENST00000375227.4 ENST00000392550.3 ENST00000578363.1 ENST00000579392.1 |
LLGL2 |
lethal giant larvae homolog 2 (Drosophila) |
| chr4_-_40631859 | 4.53 |
ENST00000295971.7 ENST00000319592.4 |
RBM47 |
RNA binding motif protein 47 |
| chrX_+_115567767 | 4.19 |
ENST00000371900.4 |
SLC6A14 |
solute carrier family 6 (amino acid transporter), member 14 |
| chr8_-_81083890 | 3.98 |
ENST00000518937.1 |
TPD52 |
tumor protein D52 |
| chr3_+_167453493 | 3.90 |
ENST00000295777.5 ENST00000472747.2 |
SERPINI1 |
serpin peptidase inhibitor, clade I (neuroserpin), member 1 |
| chr19_+_35739280 | 3.86 |
ENST00000602122.1 |
LSR |
lipolysis stimulated lipoprotein receptor |
| chr16_+_32077386 | 3.75 |
ENST00000354689.6 |
IGHV3OR16-9 |
immunoglobulin heavy variable 3/OR16-9 (non-functional) |
| chr11_+_68080077 | 3.67 |
ENST00000294304.7 |
LRP5 |
low density lipoprotein receptor-related protein 5 |
| chr1_+_1981890 | 3.62 |
ENST00000378567.3 ENST00000468310.1 |
PRKCZ |
protein kinase C, zeta |
| chr5_+_156693091 | 3.60 |
ENST00000318218.6 ENST00000442283.2 ENST00000522463.1 ENST00000521420.1 |
CYFIP2 |
cytoplasmic FMR1 interacting protein 2 |
| chr11_+_60223225 | 3.51 |
ENST00000524807.1 ENST00000345732.4 |
MS4A1 |
membrane-spanning 4-domains, subfamily A, member 1 |
| chr11_+_60223312 | 3.49 |
ENST00000532491.1 ENST00000532073.1 ENST00000534668.1 ENST00000528313.1 ENST00000533306.1 |
MS4A1 |
membrane-spanning 4-domains, subfamily A, member 1 |
| chr19_+_35739597 | 3.46 |
ENST00000361790.3 |
LSR |
lipolysis stimulated lipoprotein receptor |
| chr1_-_160990886 | 3.42 |
ENST00000537746.1 |
F11R |
F11 receptor |
| chr19_+_35739631 | 3.39 |
ENST00000602003.1 ENST00000360798.3 ENST00000354900.3 |
LSR |
lipolysis stimulated lipoprotein receptor |
| chr2_+_170590321 | 3.32 |
ENST00000392647.2 |
KLHL23 |
kelch-like family member 23 |
| chr2_+_219283815 | 3.27 |
ENST00000248444.5 ENST00000454069.1 ENST00000392114.2 |
VIL1 |
villin 1 |
| chr4_+_40198527 | 3.20 |
ENST00000381799.5 |
RHOH |
ras homolog family member H |
| chr14_-_106322288 | 3.20 |
ENST00000390559.2 |
IGHM |
immunoglobulin heavy constant mu |
| chr8_-_144952631 | 3.14 |
ENST00000525985.1 |
EPPK1 |
epiplakin 1 |
| chr2_-_89157161 | 3.12 |
ENST00000390237.2 |
IGKC |
immunoglobulin kappa constant |
| chr19_+_35739782 | 3.05 |
ENST00000347609.4 |
LSR |
lipolysis stimulated lipoprotein receptor |
| chr15_+_50474385 | 3.05 |
ENST00000267842.5 |
SLC27A2 |
solute carrier family 27 (fatty acid transporter), member 2 |
| chr17_+_76164639 | 3.04 |
ENST00000225777.3 ENST00000585591.1 ENST00000589711.1 ENST00000588282.1 ENST00000589168.1 |
SYNGR2 |
synaptogyrin 2 |
| chr14_+_95078714 | 3.03 |
ENST00000393078.3 ENST00000393080.4 ENST00000467132.1 |
SERPINA3 |
serpin peptidase inhibitor, clade A (alpha-1 antiproteinase, antitrypsin), member 3 |
| chr7_-_150675372 | 3.01 |
ENST00000262186.5 |
KCNH2 |
potassium voltage-gated channel, subfamily H (eag-related), member 2 |
| chr8_-_80993010 | 2.98 |
ENST00000537855.1 ENST00000520527.1 ENST00000517427.1 ENST00000448733.2 ENST00000379097.3 |
TPD52 |
tumor protein D52 |
| chr1_+_2005425 | 2.88 |
ENST00000461106.2 |
PRKCZ |
protein kinase C, zeta |
| chr5_+_156693159 | 2.87 |
ENST00000347377.6 |
CYFIP2 |
cytoplasmic FMR1 interacting protein 2 |
| chr1_-_111746966 | 2.85 |
ENST00000369752.5 |
DENND2D |
DENN/MADD domain containing 2D |
| chr17_+_76165213 | 2.76 |
ENST00000590201.1 |
SYNGR2 |
synaptogyrin 2 |
| chr15_+_74833518 | 2.75 |
ENST00000346246.5 |
ARID3B |
AT rich interactive domain 3B (BRIGHT-like) |
| chr15_+_50474412 | 2.75 |
ENST00000380902.4 |
SLC27A2 |
solute carrier family 27 (fatty acid transporter), member 2 |
| chr22_+_21133469 | 2.73 |
ENST00000406799.1 |
SERPIND1 |
serpin peptidase inhibitor, clade D (heparin cofactor), member 1 |
| chr8_-_81083731 | 2.72 |
ENST00000379096.5 |
TPD52 |
tumor protein D52 |
| chr10_-_82049424 | 2.71 |
ENST00000372213.3 |
MAT1A |
methionine adenosyltransferase I, alpha |
| chr6_+_7541845 | 2.68 |
ENST00000418664.2 |
DSP |
desmoplakin |
| chr1_-_27240455 | 2.60 |
ENST00000254227.3 |
NR0B2 |
nuclear receptor subfamily 0, group B, member 2 |
| chrX_+_70443050 | 2.58 |
ENST00000361726.6 |
GJB1 |
gap junction protein, beta 1, 32kDa |
| chr12_-_63328817 | 2.57 |
ENST00000228705.6 |
PPM1H |
protein phosphatase, Mg2+/Mn2+ dependent, 1H |
| chr7_-_22396533 | 2.55 |
ENST00000344041.6 |
RAPGEF5 |
Rap guanine nucleotide exchange factor (GEF) 5 |
| chr6_+_7541808 | 2.55 |
ENST00000379802.3 |
DSP |
desmoplakin |
| chr4_+_128703295 | 2.54 |
ENST00000296464.4 ENST00000508549.1 |
HSPA4L |
heat shock 70kDa protein 4-like |
| chr4_-_16085314 | 2.50 |
ENST00000510224.1 |
PROM1 |
prominin 1 |
| chr7_+_26331541 | 2.49 |
ENST00000416246.1 ENST00000338523.4 ENST00000412416.1 |
SNX10 |
sorting nexin 10 |
| chr12_-_117537240 | 2.45 |
ENST00000392545.4 ENST00000541210.1 ENST00000335209.7 |
TESC |
tescalcin |
| chr5_-_150603679 | 2.45 |
ENST00000355417.2 |
CCDC69 |
coiled-coil domain containing 69 |
| chr4_-_16085340 | 2.40 |
ENST00000508167.1 |
PROM1 |
prominin 1 |
| chr19_+_42381337 | 2.39 |
ENST00000597454.1 ENST00000444740.2 |
CD79A |
CD79a molecule, immunoglobulin-associated alpha |
| chr21_-_43816052 | 2.32 |
ENST00000398405.1 |
TMPRSS3 |
transmembrane protease, serine 3 |
| chr21_-_46330545 | 2.31 |
ENST00000320216.6 ENST00000397852.1 |
ITGB2 |
integrin, beta 2 (complement component 3 receptor 3 and 4 subunit) |
| chr18_-_74844713 | 2.29 |
ENST00000397860.3 |
MBP |
myelin basic protein |
| chr2_-_208634287 | 2.24 |
ENST00000295417.3 |
FZD5 |
frizzled family receptor 5 |
| chr8_-_81083341 | 2.21 |
ENST00000519303.2 |
TPD52 |
tumor protein D52 |
| chr4_-_155533787 | 2.19 |
ENST00000407946.1 ENST00000405164.1 ENST00000336098.3 ENST00000393846.2 ENST00000404648.3 ENST00000443553.1 |
FGG |
fibrinogen gamma chain |
| chr14_-_91884150 | 2.18 |
ENST00000553403.1 |
CCDC88C |
coiled-coil domain containing 88C |
| chr16_+_58059470 | 2.17 |
ENST00000219271.3 |
MMP15 |
matrix metallopeptidase 15 (membrane-inserted) |
| chr20_-_22565101 | 2.16 |
ENST00000419308.2 |
FOXA2 |
forkhead box A2 |
| chr7_-_994302 | 2.16 |
ENST00000265846.5 |
ADAP1 |
ArfGAP with dual PH domains 1 |
| chr13_+_50202435 | 2.14 |
ENST00000282026.1 |
ARL11 |
ADP-ribosylation factor-like 11 |
| chr2_+_65216462 | 2.12 |
ENST00000234256.3 |
SLC1A4 |
solute carrier family 1 (glutamate/neutral amino acid transporter), member 4 |
| chr1_+_39456895 | 2.12 |
ENST00000432648.3 ENST00000446189.2 ENST00000372984.4 |
AKIRIN1 |
akirin 1 |
| chr22_+_23412479 | 2.11 |
ENST00000248996.4 |
GNAZ |
guanine nucleotide binding protein (G protein), alpha z polypeptide |
| chr2_-_238499303 | 2.09 |
ENST00000409576.1 |
RAB17 |
RAB17, member RAS oncogene family |
| chr3_+_142315225 | 2.06 |
ENST00000457734.2 ENST00000483373.1 ENST00000475296.1 ENST00000495744.1 ENST00000476044.1 ENST00000461644.1 |
PLS1 |
plastin 1 |
| chr11_-_2170786 | 2.04 |
ENST00000300632.5 |
IGF2 |
insulin-like growth factor 2 (somatomedin A) |
| chr7_-_156803329 | 2.01 |
ENST00000252971.6 |
MNX1 |
motor neuron and pancreas homeobox 1 |
| chr1_-_24126023 | 1.98 |
ENST00000429356.1 |
GALE |
UDP-galactose-4-epimerase |
| chr19_+_42381173 | 1.98 |
ENST00000221972.3 |
CD79A |
CD79a molecule, immunoglobulin-associated alpha |
| chr20_-_45981138 | 1.95 |
ENST00000446994.2 |
ZMYND8 |
zinc finger, MYND-type containing 8 |
| chr9_-_35650900 | 1.94 |
ENST00000259608.3 |
SIT1 |
signaling threshold regulating transmembrane adaptor 1 |
| chr16_+_85645007 | 1.94 |
ENST00000405402.2 |
GSE1 |
Gse1 coiled-coil protein |
| chr11_+_102188224 | 1.94 |
ENST00000263464.3 |
BIRC3 |
baculoviral IAP repeat containing 3 |
| chr14_-_38064198 | 1.93 |
ENST00000250448.2 |
FOXA1 |
forkhead box A1 |
| chr11_+_7618413 | 1.91 |
ENST00000528883.1 |
PPFIBP2 |
PTPRF interacting protein, binding protein 2 (liprin beta 2) |
| chr17_+_37894179 | 1.89 |
ENST00000577695.1 ENST00000309156.4 ENST00000309185.3 |
GRB7 |
growth factor receptor-bound protein 7 |
| chrX_-_130423386 | 1.88 |
ENST00000370903.3 |
IGSF1 |
immunoglobulin superfamily, member 1 |
| chr3_-_49459878 | 1.87 |
ENST00000546031.1 ENST00000458307.2 ENST00000430521.1 |
AMT |
aminomethyltransferase |
| chr17_-_46507567 | 1.87 |
ENST00000584924.1 |
SKAP1 |
src kinase associated phosphoprotein 1 |
| chr2_+_64681103 | 1.87 |
ENST00000464281.1 |
LGALSL |
lectin, galactoside-binding-like |
| chr1_-_169680745 | 1.85 |
ENST00000236147.4 |
SELL |
selectin L |
| chr17_-_7017559 | 1.85 |
ENST00000446679.2 |
ASGR2 |
asialoglycoprotein receptor 2 |
| chr12_-_48398104 | 1.83 |
ENST00000337299.6 ENST00000380518.3 |
COL2A1 |
collagen, type II, alpha 1 |
| chr19_-_18717627 | 1.79 |
ENST00000392386.3 |
CRLF1 |
cytokine receptor-like factor 1 |
| chr9_+_71320596 | 1.78 |
ENST00000265382.3 |
PIP5K1B |
phosphatidylinositol-4-phosphate 5-kinase, type I, beta |
| chr20_+_61273797 | 1.77 |
ENST00000217159.1 |
SLCO4A1 |
solute carrier organic anion transporter family, member 4A1 |
| chr3_-_13461807 | 1.75 |
ENST00000254508.5 |
NUP210 |
nucleoporin 210kDa |
| chr18_+_55816546 | 1.74 |
ENST00000435432.2 ENST00000357895.5 ENST00000586263.1 |
NEDD4L |
neural precursor cell expressed, developmentally down-regulated 4-like, E3 ubiquitin protein ligase |
| chr19_+_18284477 | 1.74 |
ENST00000407280.3 |
IFI30 |
interferon, gamma-inducible protein 30 |
| chr2_+_64681219 | 1.74 |
ENST00000238875.5 |
LGALSL |
lectin, galactoside-binding-like |
| chr13_-_46756351 | 1.73 |
ENST00000323076.2 |
LCP1 |
lymphocyte cytosolic protein 1 (L-plastin) |
| chr12_-_6484715 | 1.73 |
ENST00000228916.2 |
SCNN1A |
sodium channel, non-voltage-gated 1 alpha subunit |
| chr17_-_38721711 | 1.72 |
ENST00000578085.1 ENST00000246657.2 |
CCR7 |
chemokine (C-C motif) receptor 7 |
| chr3_-_49459865 | 1.72 |
ENST00000427987.1 |
AMT |
aminomethyltransferase |
| chrX_-_130423240 | 1.71 |
ENST00000370910.1 ENST00000370901.4 |
IGSF1 |
immunoglobulin superfamily, member 1 |
| chr1_-_169455169 | 1.71 |
ENST00000367804.4 ENST00000236137.5 |
SLC19A2 |
solute carrier family 19 (thiamine transporter), member 2 |
| chrX_-_130423200 | 1.69 |
ENST00000361420.3 |
IGSF1 |
immunoglobulin superfamily, member 1 |
| chr10_+_7745232 | 1.69 |
ENST00000358415.4 |
ITIH2 |
inter-alpha-trypsin inhibitor heavy chain 2 |
| chr16_-_103572 | 1.68 |
ENST00000293860.5 |
POLR3K |
polymerase (RNA) III (DNA directed) polypeptide K, 12.3 kDa |
| chr21_-_46340770 | 1.68 |
ENST00000397854.3 |
ITGB2 |
integrin, beta 2 (complement component 3 receptor 3 and 4 subunit) |
| chr1_-_27961720 | 1.68 |
ENST00000545953.1 ENST00000374005.3 |
FGR |
feline Gardner-Rasheed sarcoma viral oncogene homolog |
| chr5_-_149792295 | 1.68 |
ENST00000518797.1 ENST00000524315.1 ENST00000009530.7 ENST00000377795.3 |
CD74 |
CD74 molecule, major histocompatibility complex, class II invariant chain |
| chr10_+_7745303 | 1.68 |
ENST00000429820.1 ENST00000379587.4 |
ITIH2 |
inter-alpha-trypsin inhibitor heavy chain 2 |
| chr9_+_114287433 | 1.68 |
ENST00000358151.4 ENST00000355824.3 ENST00000374374.3 ENST00000309235.5 |
ZNF483 |
zinc finger protein 483 |
| chr9_+_103790991 | 1.65 |
ENST00000374874.3 |
LPPR1 |
Lipid phosphate phosphatase-related protein type 1 |
| chr22_+_23237555 | 1.64 |
ENST00000390321.2 |
IGLC1 |
immunoglobulin lambda constant 1 (Mcg marker) |
| chr7_+_150065278 | 1.63 |
ENST00000519397.1 ENST00000479668.1 ENST00000540729.1 |
REPIN1 |
replication initiator 1 |
| chr7_-_148580563 | 1.61 |
ENST00000476773.1 |
EZH2 |
enhancer of zeste homolog 2 (Drosophila) |
| chr15_-_52587945 | 1.60 |
ENST00000443683.2 ENST00000558479.1 ENST00000261839.7 |
MYO5C |
myosin VC |
| chr6_-_3227877 | 1.60 |
ENST00000259818.7 |
TUBB2B |
tubulin, beta 2B class IIb |
| chr7_+_50344289 | 1.60 |
ENST00000413698.1 ENST00000359197.5 ENST00000331340.3 ENST00000357364.4 ENST00000343574.5 ENST00000349824.4 ENST00000346667.4 ENST00000440768.2 |
IKZF1 |
IKAROS family zinc finger 1 (Ikaros) |
| chr8_-_127570603 | 1.58 |
ENST00000304916.3 |
FAM84B |
family with sequence similarity 84, member B |
| chr2_-_163175133 | 1.58 |
ENST00000421365.2 ENST00000263642.2 |
IFIH1 |
interferon induced with helicase C domain 1 |
| chr4_-_151936416 | 1.56 |
ENST00000510413.1 ENST00000507224.1 |
LRBA |
LPS-responsive vesicle trafficking, beach and anchor containing |
| chr14_-_36278412 | 1.55 |
ENST00000389698.3 ENST00000258840.6 |
RALGAPA1 |
Ral GTPase activating protein, alpha subunit 1 (catalytic) |
| chr6_-_155635583 | 1.55 |
ENST00000367166.4 |
TFB1M |
transcription factor B1, mitochondrial |
| chr19_+_1071203 | 1.54 |
ENST00000543365.1 |
HMHA1 |
histocompatibility (minor) HA-1 |
| chr20_-_32891151 | 1.54 |
ENST00000217426.2 |
AHCY |
adenosylhomocysteinase |
| chr2_-_216946500 | 1.54 |
ENST00000265322.7 |
PECR |
peroxisomal trans-2-enoyl-CoA reductase |
| chr4_+_6202448 | 1.53 |
ENST00000508601.1 |
RP11-586D19.1 |
RP11-586D19.1 |
| chr18_-_6414884 | 1.53 |
ENST00000317931.7 ENST00000284898.6 ENST00000400104.3 |
L3MBTL4 |
l(3)mbt-like 4 (Drosophila) |
| chr3_+_113251143 | 1.52 |
ENST00000264852.4 ENST00000393830.3 |
SIDT1 |
SID1 transmembrane family, member 1 |
| chr17_-_7017968 | 1.52 |
ENST00000355035.5 |
ASGR2 |
asialoglycoprotein receptor 2 |
| chrX_+_105969893 | 1.52 |
ENST00000255499.2 |
RNF128 |
ring finger protein 128, E3 ubiquitin protein ligase |
| chr6_-_41715128 | 1.52 |
ENST00000356667.4 ENST00000373025.3 ENST00000425343.2 |
PGC |
progastricsin (pepsinogen C) |
| chrX_-_48776292 | 1.50 |
ENST00000376509.4 |
PIM2 |
pim-2 oncogene |
| chr2_+_163200598 | 1.49 |
ENST00000437150.2 ENST00000453113.2 |
GCA |
grancalcin, EF-hand calcium binding protein |
| chr6_-_31550192 | 1.48 |
ENST00000429299.2 ENST00000446745.2 |
LTB |
lymphotoxin beta (TNF superfamily, member 3) |
| chr6_+_31982539 | 1.47 |
ENST00000435363.2 ENST00000425700.2 |
C4B |
complement component 4B (Chido blood group) |
| chr2_+_163200848 | 1.47 |
ENST00000233612.4 |
GCA |
grancalcin, EF-hand calcium binding protein |
| chr20_-_22566089 | 1.47 |
ENST00000377115.4 |
FOXA2 |
forkhead box A2 |
| chr19_+_45418067 | 1.46 |
ENST00000589078.1 ENST00000586638.1 |
APOC1 |
apolipoprotein C-I |
| chr9_-_116840728 | 1.46 |
ENST00000265132.3 |
AMBP |
alpha-1-microglobulin/bikunin precursor |
| chr14_-_71107921 | 1.45 |
ENST00000553982.1 ENST00000500016.1 |
CTD-2540L5.5 CTD-2540L5.6 |
CTD-2540L5.5 CTD-2540L5.6 |
| chr4_-_41884620 | 1.44 |
ENST00000504870.1 |
LINC00682 |
long intergenic non-protein coding RNA 682 |
| chr22_+_22550113 | 1.44 |
ENST00000390285.3 |
IGLV6-57 |
immunoglobulin lambda variable 6-57 |
| chr17_-_39942940 | 1.44 |
ENST00000310706.5 ENST00000393931.3 ENST00000424457.1 ENST00000591690.1 |
JUP |
junction plakoglobin |
| chr12_+_53497263 | 1.43 |
ENST00000551896.1 ENST00000301466.3 |
SOAT2 |
sterol O-acyltransferase 2 |
| chr14_-_106406090 | 1.43 |
ENST00000390593.2 |
IGHV6-1 |
immunoglobulin heavy variable 6-1 |
| chrX_-_133119476 | 1.43 |
ENST00000543339.1 |
GPC3 |
glypican 3 |
| chr16_+_85687999 | 1.42 |
ENST00000412692.1 |
GSE1 |
Gse1 coiled-coil protein |
| chr3_-_138553594 | 1.42 |
ENST00000477593.1 ENST00000483968.1 |
PIK3CB |
phosphatidylinositol-4,5-bisphosphate 3-kinase, catalytic subunit beta |
| chr12_-_102874102 | 1.42 |
ENST00000392905.2 |
IGF1 |
insulin-like growth factor 1 (somatomedin C) |
| chr3_-_8693755 | 1.41 |
ENST00000341795.3 |
SSUH2 |
ssu-2 homolog (C. elegans) |
| chr7_+_73624327 | 1.40 |
ENST00000361082.3 ENST00000275635.7 ENST00000470709.1 |
LAT2 |
linker for activation of T cells family, member 2 |
| chr17_-_46507537 | 1.40 |
ENST00000336915.6 |
SKAP1 |
src kinase associated phosphoprotein 1 |
| chr11_+_102188272 | 1.39 |
ENST00000532808.1 |
BIRC3 |
baculoviral IAP repeat containing 3 |
| chr13_+_113760098 | 1.38 |
ENST00000346342.3 ENST00000541084.1 ENST00000375581.3 |
F7 |
coagulation factor VII (serum prothrombin conversion accelerator) |
| chr14_+_72052983 | 1.37 |
ENST00000358550.2 |
SIPA1L1 |
signal-induced proliferation-associated 1 like 1 |
| chr3_+_52828805 | 1.36 |
ENST00000416872.2 ENST00000449956.2 |
ITIH3 |
inter-alpha-trypsin inhibitor heavy chain 3 |
| chr8_-_79717750 | 1.36 |
ENST00000263851.4 ENST00000379113.2 |
IL7 |
interleukin 7 |
| chr3_-_57199397 | 1.36 |
ENST00000296318.7 |
IL17RD |
interleukin 17 receptor D |
| chr22_-_21581926 | 1.35 |
ENST00000401924.1 |
GGT2 |
gamma-glutamyltransferase 2 |
| chr6_+_106534192 | 1.35 |
ENST00000369091.2 ENST00000369096.4 |
PRDM1 |
PR domain containing 1, with ZNF domain |
| chr12_-_46662772 | 1.35 |
ENST00000549049.1 ENST00000439706.1 ENST00000398637.5 |
SLC38A1 |
solute carrier family 38, member 1 |
| chr8_-_103136481 | 1.34 |
ENST00000524209.1 ENST00000517822.1 ENST00000523923.1 ENST00000521599.1 ENST00000521964.1 ENST00000311028.3 ENST00000518166.1 |
NCALD |
neurocalcin delta |
| chr17_+_55163075 | 1.34 |
ENST00000571629.1 ENST00000570423.1 ENST00000575186.1 ENST00000573085.1 ENST00000572814.1 |
AKAP1 |
A kinase (PRKA) anchor protein 1 |
| chr16_+_30205754 | 1.34 |
ENST00000354723.6 ENST00000355544.5 |
SULT1A3 |
sulfotransferase family, cytosolic, 1A, phenol-preferring, member 3 |
| chr3_+_53880588 | 1.34 |
ENST00000288167.3 ENST00000494338.1 |
IL17RB |
interleukin 17 receptor B |
| chr13_+_33590553 | 1.33 |
ENST00000380099.3 |
KL |
klotho |
| chr3_-_197282821 | 1.33 |
ENST00000445160.2 ENST00000446746.1 ENST00000432819.1 ENST00000392379.1 ENST00000441275.1 ENST00000392378.2 |
BDH1 |
3-hydroxybutyrate dehydrogenase, type 1 |
| chr3_+_5020801 | 1.33 |
ENST00000256495.3 |
BHLHE40 |
basic helix-loop-helix family, member e40 |
| chr16_+_71660079 | 1.32 |
ENST00000565261.1 ENST00000268485.3 ENST00000299952.4 |
MARVELD3 |
MARVEL domain containing 3 |
| chr11_+_116700600 | 1.32 |
ENST00000227667.3 |
APOC3 |
apolipoprotein C-III |
| chr19_-_41903161 | 1.32 |
ENST00000602129.1 ENST00000593771.1 ENST00000596905.1 ENST00000221233.4 |
EXOSC5 |
exosome component 5 |
| chr10_+_12391481 | 1.31 |
ENST00000378847.3 |
CAMK1D |
calcium/calmodulin-dependent protein kinase ID |
| chr17_+_53342311 | 1.31 |
ENST00000226067.5 |
HLF |
hepatic leukemia factor |
| chr12_+_7282795 | 1.30 |
ENST00000266546.6 |
CLSTN3 |
calsyntenin 3 |
| chr16_+_68771128 | 1.30 |
ENST00000261769.5 ENST00000422392.2 |
CDH1 |
cadherin 1, type 1, E-cadherin (epithelial) |
| chr19_-_7764281 | 1.29 |
ENST00000360067.4 |
FCER2 |
Fc fragment of IgE, low affinity II, receptor for (CD23) |
| chr13_+_28194873 | 1.29 |
ENST00000302979.3 |
POLR1D |
polymerase (RNA) I polypeptide D, 16kDa |
| chr4_-_36246060 | 1.29 |
ENST00000303965.4 |
ARAP2 |
ArfGAP with RhoGAP domain, ankyrin repeat and PH domain 2 |
| chr2_+_228678550 | 1.28 |
ENST00000409189.3 ENST00000358813.4 |
CCL20 |
chemokine (C-C motif) ligand 20 |
| chr19_+_45409011 | 1.28 |
ENST00000252486.4 ENST00000446996.1 ENST00000434152.1 |
APOE |
apolipoprotein E |
| chr22_+_23229960 | 1.27 |
ENST00000526893.1 ENST00000532223.2 ENST00000531372.1 |
IGLL5 |
immunoglobulin lambda-like polypeptide 5 |
| chr1_+_27189631 | 1.27 |
ENST00000339276.4 |
SFN |
stratifin |
| chr2_+_120517174 | 1.26 |
ENST00000263708.2 |
PTPN4 |
protein tyrosine phosphatase, non-receptor type 4 (megakaryocyte) |
| chr19_+_7701985 | 1.26 |
ENST00000595950.1 ENST00000441779.2 ENST00000221283.5 ENST00000414284.2 |
STXBP2 |
syntaxin binding protein 2 |
| chr20_-_30795511 | 1.26 |
ENST00000246229.4 |
PLAGL2 |
pleiomorphic adenoma gene-like 2 |
| chr19_+_19779619 | 1.26 |
ENST00000444249.2 ENST00000592502.1 |
ZNF101 |
zinc finger protein 101 |
| chr6_+_36097992 | 1.26 |
ENST00000211287.4 |
MAPK13 |
mitogen-activated protein kinase 13 |
| chr17_+_55162453 | 1.26 |
ENST00000575322.1 ENST00000337714.3 ENST00000314126.3 |
AKAP1 |
A kinase (PRKA) anchor protein 1 |
| chr12_-_53320245 | 1.26 |
ENST00000552150.1 |
KRT8 |
keratin 8 |
| chr6_+_36098262 | 1.26 |
ENST00000373761.6 ENST00000373766.5 |
MAPK13 |
mitogen-activated protein kinase 13 |
| chr12_-_103310987 | 1.25 |
ENST00000307000.2 |
PAH |
phenylalanine hydroxylase |
| chr14_-_65346555 | 1.25 |
ENST00000542895.1 ENST00000556626.1 |
SPTB |
spectrin, beta, erythrocytic |
| chr5_+_65018017 | 1.25 |
ENST00000380985.5 ENST00000502464.1 |
NLN |
neurolysin (metallopeptidase M3 family) |
| chr3_-_182833863 | 1.24 |
ENST00000492597.1 |
MCCC1 |
methylcrotonoyl-CoA carboxylase 1 (alpha) |
| chr2_-_220118631 | 1.24 |
ENST00000248437.4 |
TUBA4A |
tubulin, alpha 4a |
| chr2_+_11674213 | 1.24 |
ENST00000381486.2 |
GREB1 |
growth regulation by estrogen in breast cancer 1 |
| chr8_+_22224811 | 1.24 |
ENST00000381237.1 |
SLC39A14 |
solute carrier family 39 (zinc transporter), member 14 |
| chr9_-_127905736 | 1.23 |
ENST00000336505.6 ENST00000373549.4 |
SCAI |
suppressor of cancer cell invasion |
| chr11_+_64879317 | 1.23 |
ENST00000526809.1 ENST00000279263.7 ENST00000524986.1 ENST00000534371.1 ENST00000540748.1 ENST00000525385.1 ENST00000345348.5 ENST00000531321.1 ENST00000529414.1 ENST00000526085.1 ENST00000530750.1 |
TM7SF2 |
transmembrane 7 superfamily member 2 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.4 | 14.6 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 1.2 | 3.7 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 1.0 | 8.0 | GO:0045179 | apical cortex(GO:0045179) |
| 1.0 | 4.9 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.9 | 4.7 | GO:0034688 | integrin alphaM-beta2 complex(GO:0034688) |
| 0.9 | 6.2 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.8 | 3.1 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.8 | 3.1 | GO:0070695 | FHF complex(GO:0070695) |
| 0.8 | 6.0 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 0.6 | 20.2 | GO:0030057 | desmosome(GO:0030057) |
| 0.6 | 3.0 | GO:1905202 | 3-methylcrotonyl-CoA carboxylase complex, mitochondrial(GO:0002169) methylcrotonoyl-CoA carboxylase complex(GO:1905202) |
| 0.6 | 1.8 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.6 | 29.4 | GO:0042571 | immunoglobulin complex(GO:0019814) immunoglobulin complex, circulating(GO:0042571) |
| 0.5 | 1.5 | GO:0005960 | glycine cleavage complex(GO:0005960) |
| 0.5 | 2.0 | GO:0034669 | integrin alpha4-beta7 complex(GO:0034669) |
| 0.5 | 1.8 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 0.4 | 1.3 | GO:0042584 | chromaffin granule membrane(GO:0042584) |
| 0.4 | 4.4 | GO:0042627 | chylomicron(GO:0042627) |
| 0.4 | 1.9 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.4 | 2.3 | GO:1990357 | terminal web(GO:1990357) |
| 0.4 | 1.1 | GO:0035354 | Toll-like receptor 1-Toll-like receptor 2 protein complex(GO:0035354) |
| 0.3 | 2.4 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.3 | 0.3 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
| 0.3 | 4.1 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.3 | 1.9 | GO:0098560 | cytoplasmic side of late endosome membrane(GO:0098560) |
| 0.3 | 0.6 | GO:0036387 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
| 0.3 | 4.6 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.3 | 0.6 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.3 | 1.6 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.3 | 1.9 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
| 0.3 | 0.8 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.3 | 0.8 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
| 0.3 | 5.3 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.3 | 0.5 | GO:0034686 | integrin alphav-beta8 complex(GO:0034686) |
| 0.3 | 1.3 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
| 0.2 | 1.7 | GO:0097209 | epidermal lamellar body(GO:0097209) |
| 0.2 | 2.1 | GO:0016013 | syntrophin complex(GO:0016013) |
| 0.2 | 0.9 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.2 | 2.5 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.2 | 0.9 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.2 | 0.9 | GO:0000811 | GINS complex(GO:0000811) |
| 0.2 | 9.9 | GO:0045095 | keratin filament(GO:0045095) |
| 0.2 | 2.0 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.2 | 0.6 | GO:0070762 | nuclear pore transmembrane ring(GO:0070762) |
| 0.2 | 0.6 | GO:0031417 | NatC complex(GO:0031417) |
| 0.2 | 0.2 | GO:0031436 | BRCA1-BARD1 complex(GO:0031436) |
| 0.2 | 15.6 | GO:0016328 | lateral plasma membrane(GO:0016328) |
| 0.2 | 0.8 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
| 0.2 | 2.6 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.2 | 1.6 | GO:0005587 | collagen type IV trimer(GO:0005587) |
| 0.2 | 5.0 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
| 0.2 | 1.0 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.2 | 3.3 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.2 | 3.3 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.2 | 0.8 | GO:1990578 | perinuclear endoplasmic reticulum membrane(GO:1990578) |
| 0.2 | 0.2 | GO:0033503 | HULC complex(GO:0033503) |
| 0.2 | 4.5 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.2 | 2.9 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.2 | 1.0 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.2 | 2.5 | GO:0045120 | pronucleus(GO:0045120) |
| 0.2 | 1.3 | GO:0051233 | spindle midzone(GO:0051233) |
| 0.2 | 1.4 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.2 | 2.7 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.2 | 1.1 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.2 | 1.9 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.2 | 0.9 | GO:0042825 | TAP complex(GO:0042825) |
| 0.2 | 0.8 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.2 | 0.8 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.2 | 1.7 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.2 | 0.9 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.2 | 0.6 | GO:0032420 | stereocilium(GO:0032420) |
| 0.2 | 1.7 | GO:0042555 | MCM complex(GO:0042555) |
| 0.1 | 0.6 | GO:1990031 | pinceau fiber(GO:1990031) |
| 0.1 | 0.1 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.1 | 0.4 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.1 | 2.8 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.1 | 3.4 | GO:0034706 | sodium channel complex(GO:0034706) |
| 0.1 | 0.4 | GO:0036398 | TCR signalosome(GO:0036398) |
| 0.1 | 1.5 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.1 | 0.3 | GO:0005638 | lamin filament(GO:0005638) |
| 0.1 | 1.4 | GO:0070187 | telosome(GO:0070187) |
| 0.1 | 0.3 | GO:0032585 | multivesicular body membrane(GO:0032585) |
| 0.1 | 0.4 | GO:0030689 | Noc complex(GO:0030689) |
| 0.1 | 2.4 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.1 | 0.8 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.1 | 0.3 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
| 0.1 | 1.2 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.1 | 1.9 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
| 0.1 | 0.6 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.1 | 0.5 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 0.1 | 0.5 | GO:0031166 | integral component of vacuolar membrane(GO:0031166) |
| 0.1 | 0.4 | GO:0033150 | perinuclear theca(GO:0033011) cytoskeletal calyx(GO:0033150) |
| 0.1 | 0.1 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.1 | 0.4 | GO:0071065 | alpha9-beta1 integrin-vascular cell adhesion molecule-1 complex(GO:0071065) |
| 0.1 | 0.1 | GO:0097228 | sperm principal piece(GO:0097228) |
| 0.1 | 0.7 | GO:0030673 | axolemma(GO:0030673) |
| 0.1 | 0.5 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.1 | 0.5 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
| 0.1 | 0.5 | GO:0032144 | 4-aminobutyrate transaminase complex(GO:0032144) |
| 0.1 | 0.6 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.1 | 0.1 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.1 | 1.2 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.1 | 1.4 | GO:0000800 | lateral element(GO:0000800) |
| 0.1 | 1.6 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.1 | 0.3 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
| 0.1 | 0.3 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.1 | 0.2 | GO:0035976 | AP1 complex(GO:0035976) |
| 0.1 | 0.3 | GO:0002139 | stereocilia coupling link(GO:0002139) |
| 0.1 | 0.5 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.1 | 2.1 | GO:0044295 | axonal growth cone(GO:0044295) |
| 0.1 | 0.8 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.1 | 0.4 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.1 | 0.5 | GO:0031970 | organelle envelope lumen(GO:0031970) |
| 0.1 | 0.9 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.1 | 1.3 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.1 | 0.5 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.1 | 0.6 | GO:0070470 | plasma membrane respiratory chain(GO:0070470) |
| 0.1 | 1.0 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.1 | 0.8 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.1 | 1.5 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.1 | 5.9 | GO:0015030 | Cajal body(GO:0015030) |
| 0.1 | 5.3 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.1 | 0.5 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.1 | 0.4 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.1 | 1.7 | GO:0032156 | septin cytoskeleton(GO:0032156) |
| 0.1 | 1.4 | GO:0001741 | XY body(GO:0001741) |
| 0.1 | 2.5 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.1 | 2.1 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 0.1 | 4.5 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.1 | 0.5 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.1 | 1.5 | GO:0045277 | respiratory chain complex IV(GO:0045277) |
| 0.1 | 5.7 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.1 | 0.3 | GO:0098559 | cytoplasmic side of endosome membrane(GO:0010009) cytoplasmic side of early endosome membrane(GO:0098559) |
| 0.1 | 2.4 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.1 | 0.1 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.1 | 1.5 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.1 | 1.1 | GO:0097433 | dense body(GO:0097433) |
| 0.1 | 0.5 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.1 | 11.4 | GO:0048471 | perinuclear region of cytoplasm(GO:0048471) |
| 0.1 | 0.3 | GO:0034455 | t-UTP complex(GO:0034455) |
| 0.1 | 1.5 | GO:0044309 | dendritic spine(GO:0043197) neuron spine(GO:0044309) |
| 0.1 | 0.2 | GO:0044423 | virion(GO:0019012) virion part(GO:0044423) |
| 0.1 | 0.7 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.1 | 0.2 | GO:0034685 | integrin alphav-beta6 complex(GO:0034685) |
| 0.1 | 0.5 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.1 | 0.1 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 0.1 | 0.6 | GO:0000782 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
| 0.1 | 1.6 | GO:0044447 | axoneme part(GO:0044447) |
| 0.1 | 0.4 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.1 | 4.6 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.1 | 1.2 | GO:0030686 | 90S preribosome(GO:0030686) |
| 0.1 | 0.4 | GO:0030905 | retromer, tubulation complex(GO:0030905) |
| 0.1 | 0.5 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.1 | 0.1 | GO:1990769 | proximal neuron projection(GO:1990769) |
| 0.1 | 0.3 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.1 | 0.2 | GO:0031523 | Myb complex(GO:0031523) |
| 0.1 | 0.2 | GO:0009330 | DNA topoisomerase complex (ATP-hydrolyzing)(GO:0009330) |
| 0.1 | 0.8 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.1 | 1.6 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.1 | 0.4 | GO:0032021 | NELF complex(GO:0032021) |
| 0.1 | 0.4 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.1 | 0.6 | GO:0034361 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
| 0.1 | 1.0 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.1 | 0.5 | GO:0070554 | synaptobrevin 2-SNAP-25-syntaxin-3-complexin complex(GO:0070554) |
| 0.1 | 2.1 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.1 | 0.2 | GO:0001652 | granular component(GO:0001652) |
| 0.1 | 0.4 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
| 0.1 | 0.7 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.1 | 0.2 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.1 | 0.3 | GO:0072536 | interleukin-23 receptor complex(GO:0072536) |
| 0.1 | 0.2 | GO:0030895 | apolipoprotein B mRNA editing enzyme complex(GO:0030895) |
| 0.1 | 0.4 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.1 | 0.1 | GO:0031967 | organelle envelope(GO:0031967) envelope(GO:0031975) |
| 0.1 | 0.3 | GO:0043293 | apoptosome(GO:0043293) |
| 0.1 | 0.3 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.1 | 2.2 | GO:1902710 | GABA receptor complex(GO:1902710) |
| 0.1 | 0.3 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.1 | 0.2 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
| 0.1 | 0.3 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.1 | 0.2 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.1 | 0.7 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.1 | 2.4 | GO:0005902 | microvillus(GO:0005902) |
| 0.1 | 0.3 | GO:0032280 | symmetric synapse(GO:0032280) |
| 0.1 | 0.2 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.1 | 0.6 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
| 0.1 | 1.0 | GO:0033202 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 0.1 | 19.4 | GO:0031965 | nuclear membrane(GO:0031965) |
| 0.1 | 2.8 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.1 | 0.4 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.1 | 0.8 | GO:0031089 | platelet dense granule lumen(GO:0031089) |
| 0.1 | 0.2 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.1 | 5.6 | GO:0035578 | azurophil granule lumen(GO:0035578) |
| 0.1 | 0.3 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
| 0.1 | 0.4 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.1 | 0.3 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.1 | 0.2 | GO:0005873 | plus-end kinesin complex(GO:0005873) |
| 0.1 | 0.6 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.1 | 0.1 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.1 | 0.2 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.1 | 0.2 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.1 | 0.1 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.1 | 0.5 | GO:0000796 | condensin complex(GO:0000796) |
| 0.1 | 1.3 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.0 | 2.3 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.0 | 1.0 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.3 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.0 | 0.5 | GO:0042589 | zymogen granule membrane(GO:0042589) |
| 0.0 | 1.2 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.0 | 0.2 | GO:0032449 | CBM complex(GO:0032449) |
| 0.0 | 0.8 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.0 | 0.1 | GO:0031201 | SNARE complex(GO:0031201) |
| 0.0 | 0.4 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.0 | 0.2 | GO:0044326 | dendritic spine neck(GO:0044326) |
| 0.0 | 0.1 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.0 | 1.7 | GO:0005762 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.0 | 0.2 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.0 | 0.4 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.0 | 0.2 | GO:1990393 | 3M complex(GO:1990393) |
| 0.0 | 1.6 | GO:0031672 | A band(GO:0031672) |
| 0.0 | 0.3 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 3.1 | GO:0030672 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
| 0.0 | 0.0 | GO:1903349 | omegasome membrane(GO:1903349) |
| 0.0 | 0.1 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.0 | 6.4 | GO:0000922 | spindle pole(GO:0000922) |
| 0.0 | 7.6 | GO:0031968 | organelle outer membrane(GO:0031968) |
| 0.0 | 2.2 | GO:0005871 | kinesin complex(GO:0005871) |
| 0.0 | 2.7 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.0 | 0.1 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.0 | 0.3 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.0 | 0.2 | GO:0005657 | replication fork(GO:0005657) |
| 0.0 | 0.7 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 0.3 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.0 | 0.4 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.0 | 1.0 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.0 | 0.7 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.0 | 0.6 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.0 | 1.9 | GO:0045335 | phagocytic vesicle(GO:0045335) |
| 0.0 | 1.4 | GO:0090544 | BAF-type complex(GO:0090544) |
| 0.0 | 0.3 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.0 | 0.4 | GO:0097486 | multivesicular body lumen(GO:0097486) |
| 0.0 | 0.8 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.0 | 1.8 | GO:0016235 | aggresome(GO:0016235) |
| 0.0 | 0.2 | GO:0043203 | axon hillock(GO:0043203) |
| 0.0 | 0.1 | GO:0000818 | nuclear MIS12/MIND complex(GO:0000818) |
| 0.0 | 0.2 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.0 | 0.2 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
| 0.0 | 0.1 | GO:0098536 | deuterosome(GO:0098536) |
| 0.0 | 0.1 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
| 0.0 | 1.3 | GO:0034707 | chloride channel complex(GO:0034707) |
| 0.0 | 0.3 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 0.1 | GO:0044305 | calyx of Held(GO:0044305) |
| 0.0 | 0.3 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.0 | 3.5 | GO:0016605 | PML body(GO:0016605) |
| 0.0 | 1.7 | GO:0044815 | nucleosome(GO:0000786) DNA packaging complex(GO:0044815) |
| 0.0 | 0.0 | GO:0060201 | clathrin-sculpted glutamate transport vesicle(GO:0060199) clathrin-sculpted acetylcholine transport vesicle(GO:0060200) clathrin-sculpted acetylcholine transport vesicle membrane(GO:0060201) clathrin-sculpted glutamate transport vesicle membrane(GO:0060203) |
| 0.0 | 0.1 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.0 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.0 | 0.4 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.0 | 0.1 | GO:1990622 | CHOP-ATF3 complex(GO:1990622) |
| 0.0 | 0.2 | GO:0097361 | CIA complex(GO:0097361) |
| 0.0 | 0.8 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.0 | 0.2 | GO:0000784 | nuclear chromosome, telomeric region(GO:0000784) |
| 0.0 | 0.2 | GO:0044279 | other organism cell membrane(GO:0044218) other organism membrane(GO:0044279) |
| 0.0 | 0.2 | GO:1904115 | cell projection cytoplasm(GO:0032838) axon cytoplasm(GO:1904115) |
| 0.0 | 0.4 | GO:0070069 | cytochrome complex(GO:0070069) |
| 0.0 | 0.2 | GO:0017102 | methionyl glutamyl tRNA synthetase complex(GO:0017102) |
| 0.0 | 0.7 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.5 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.0 | 0.1 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.0 | 0.3 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.0 | 0.8 | GO:0044454 | nuclear chromosome part(GO:0044454) |
| 0.0 | 0.1 | GO:0019867 | outer membrane(GO:0019867) |
| 0.0 | 0.2 | GO:0031045 | dense core granule(GO:0031045) |
| 0.0 | 0.1 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 0.0 | 0.4 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.0 | 2.2 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.0 | 0.1 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
| 0.0 | 0.1 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
| 0.0 | 0.6 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
| 0.0 | 0.2 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.0 | 0.6 | GO:0031901 | early endosome membrane(GO:0031901) |
| 0.0 | 0.5 | GO:0000795 | synaptonemal complex(GO:0000795) |
| 0.0 | 0.1 | GO:0032302 | MutSbeta complex(GO:0032302) |
| 0.0 | 0.5 | GO:0009897 | external side of plasma membrane(GO:0009897) |
| 0.0 | 1.1 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
| 0.0 | 2.0 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.0 | 0.1 | GO:0097513 | myosin II filament(GO:0097513) |
| 0.0 | 3.5 | GO:0072562 | blood microparticle(GO:0072562) |
| 0.0 | 0.5 | GO:0098576 | lumenal side of membrane(GO:0098576) |
| 0.0 | 0.2 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
| 0.0 | 0.5 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.0 | 0.5 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
| 0.0 | 0.1 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.0 | 1.8 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
| 0.0 | 2.7 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
| 0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.0 | 0.1 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.0 | 0.1 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.0 | 0.2 | GO:0098839 | postsynaptic density membrane(GO:0098839) |
| 0.0 | 0.1 | GO:0060198 | clathrin-sculpted vesicle(GO:0060198) |
| 0.0 | 0.3 | GO:0032040 | small-subunit processome(GO:0032040) |
| 0.0 | 0.1 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
| 0.0 | 0.0 | GO:0033565 | ESCRT-0 complex(GO:0033565) |
| 0.0 | 0.1 | GO:1990745 | EARP complex(GO:1990745) |
| 0.0 | 0.1 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.0 | 0.4 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.0 | 0.2 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) |
| 0.0 | 0.1 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.0 | 0.1 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.0 | 0.0 | GO:0035838 | growing cell tip(GO:0035838) cell tip(GO:0051286) |
| 0.0 | 1.4 | GO:0043204 | perikaryon(GO:0043204) |
| 0.0 | 0.2 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.0 | 7.1 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.0 | 0.0 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.0 | 0.2 | GO:0071682 | endocytic vesicle lumen(GO:0071682) |
| 0.0 | 0.2 | GO:0044754 | autolysosome(GO:0044754) |
| 0.0 | 1.5 | GO:0015934 | large ribosomal subunit(GO:0015934) |
| 0.0 | 0.1 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.0 | 0.1 | GO:0035370 | UBC13-UEV1A complex(GO:0035370) |
| 0.0 | 0.1 | GO:0034657 | GID complex(GO:0034657) |
| 0.0 | 14.0 | GO:0005730 | nucleolus(GO:0005730) |
| 0.0 | 0.3 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 1.0 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.0 | 0.6 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.0 | 0.3 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.0 | 0.1 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 0.0 | 1.6 | GO:0048770 | melanosome(GO:0042470) pigment granule(GO:0048770) |
| 0.0 | 0.1 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
| 0.0 | 0.3 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
| 0.0 | 0.4 | GO:0001533 | cornified envelope(GO:0001533) |
| 0.0 | 0.0 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.0 | 0.2 | GO:0005922 | connexon complex(GO:0005922) |
| 0.0 | 0.4 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.0 | 0.1 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.0 | 0.0 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.0 | 0.3 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.0 | 0.1 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.0 | 0.1 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.0 | 0.1 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.0 | 0.7 | GO:0005814 | centriole(GO:0005814) |
| 0.0 | 0.0 | GO:0038038 | G-protein coupled receptor homodimeric complex(GO:0038038) |
| 0.0 | 0.1 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.0 | 0.1 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.0 | 0.0 | GO:0031461 | cullin-RING ubiquitin ligase complex(GO:0031461) |
| 0.0 | 0.1 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.0 | 0.0 | GO:0008287 | protein serine/threonine phosphatase complex(GO:0008287) phosphatase complex(GO:1903293) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.8 | 15.6 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.7 | 7.3 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.5 | 10.9 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.4 | 1.2 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.4 | 7.9 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.3 | 7.8 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.3 | 5.4 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.3 | 4.3 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.3 | 4.1 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.2 | 5.1 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.2 | 5.1 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.2 | 5.1 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 0.2 | 9.8 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.2 | 4.4 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.2 | 4.5 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
| 0.2 | 5.4 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.2 | 3.9 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.2 | 4.1 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.2 | 3.1 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.2 | 3.0 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.2 | 1.6 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 0.2 | 1.2 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.2 | 1.5 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.2 | 4.4 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.2 | 0.3 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
| 0.2 | 1.6 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
| 0.2 | 0.5 | REACTOME LAGGING STRAND SYNTHESIS | Genes involved in Lagging Strand Synthesis |
| 0.1 | 2.1 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.1 | 1.4 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.1 | 3.3 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.1 | 2.0 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
| 0.1 | 0.8 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
| 0.1 | 0.2 | REACTOME GLUCAGON SIGNALING IN METABOLIC REGULATION | Genes involved in Glucagon signaling in metabolic regulation |
| 0.1 | 1.3 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.1 | 2.1 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.1 | 4.3 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.1 | 5.2 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 0.1 | 1.6 | REACTOME REVERSIBLE HYDRATION OF CARBON DIOXIDE | Genes involved in Reversible Hydration of Carbon Dioxide |
| 0.1 | 2.0 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.1 | 5.1 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.1 | 0.3 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |
| 0.1 | 1.8 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.1 | 3.2 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.1 | 1.6 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.1 | 1.8 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.1 | 5.8 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.1 | 1.2 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.1 | 1.4 | REACTOME POL SWITCHING | Genes involved in Polymerase switching |
| 0.1 | 1.9 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.1 | 1.9 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.1 | 2.2 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.1 | 1.7 | REACTOME PEPTIDE HORMONE BIOSYNTHESIS | Genes involved in Peptide hormone biosynthesis |
| 0.1 | 2.6 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.1 | 0.8 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.1 | 0.7 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
| 0.1 | 2.3 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
| 0.1 | 7.5 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.1 | 0.6 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.1 | 0.5 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.1 | 1.8 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.1 | 3.3 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.1 | 1.3 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.1 | 4.0 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.1 | 1.2 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.1 | 1.8 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
| 0.1 | 5.3 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.1 | 1.7 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
| 0.1 | 1.7 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.1 | 1.5 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.1 | 2.1 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.1 | 2.4 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.1 | 0.8 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.1 | 0.7 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
| 0.1 | 1.6 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.1 | 0.1 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
| 0.1 | 2.4 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.1 | 1.0 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.1 | 2.5 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.1 | 2.9 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.1 | 3.7 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.1 | 2.1 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 0.1 | 1.4 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.1 | 2.3 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.1 | 0.6 | REACTOME ACTIVATION OF ATR IN RESPONSE TO REPLICATION STRESS | Genes involved in Activation of ATR in response to replication stress |
| 0.1 | 1.3 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| 0.1 | 2.9 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.1 | 0.9 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.1 | 0.6 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.1 | 0.3 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.1 | 0.8 | REACTOME TELOMERE MAINTENANCE | Genes involved in Telomere Maintenance |
| 0.1 | 0.2 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.1 | 0.3 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.1 | 1.6 | REACTOME SHC MEDIATED CASCADE | Genes involved in SHC-mediated cascade |
| 0.1 | 1.2 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.1 | 1.0 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.1 | 1.7 | REACTOME SIGNALING BY ILS | Genes involved in Signaling by Interleukins |
| 0.1 | 0.9 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.1 | 1.1 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
| 0.1 | 4.2 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
| 0.1 | 1.7 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
| 0.1 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.0 | 0.9 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.0 | 1.5 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.0 | 0.5 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
| 0.0 | 0.9 | REACTOME DAG AND IP3 SIGNALING | Genes involved in DAG and IP3 signaling |
| 0.0 | 0.3 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.0 | 1.0 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
| 0.0 | 0.4 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.0 | 0.7 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
| 0.0 | 0.6 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.0 | 1.5 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
| 0.0 | 0.4 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
| 0.0 | 1.4 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.0 | 0.3 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.0 | 0.2 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.0 | 0.3 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
| 0.0 | 1.2 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.0 | 0.9 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.0 | 1.5 | REACTOME SIGNALING BY FGFR | Genes involved in Signaling by FGFR |
| 0.0 | 0.9 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.0 | 0.1 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.0 | 3.3 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.0 | 0.8 | REACTOME SIGNALING BY FGFR1 MUTANTS | Genes involved in Signaling by FGFR1 mutants |
| 0.0 | 3.0 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 0.0 | 0.6 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.0 | 1.1 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.0 | 0.8 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
| 0.0 | 0.5 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.0 | 1.1 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
| 0.0 | 0.5 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
| 0.0 | 4.3 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.0 | 0.7 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
| 0.0 | 0.4 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.0 | 0.3 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 0.0 | 0.3 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.0 | 0.3 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
| 0.0 | 1.0 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 0.0 | 0.7 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.0 | 0.5 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.0 | 0.8 | REACTOME NGF SIGNALLING VIA TRKA FROM THE PLASMA MEMBRANE | Genes involved in NGF signalling via TRKA from the plasma membrane |
| 0.0 | 0.6 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
| 0.0 | 0.3 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.0 | 0.3 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.0 | 0.6 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.0 | 0.4 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
| 0.0 | 0.7 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.0 | 0.2 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
| 0.0 | 0.3 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 2.1 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
| 0.0 | 0.4 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.0 | 0.3 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
| 0.0 | 0.9 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.0 | 0.0 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
| 0.0 | 0.3 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
| 0.0 | 0.8 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.0 | 3.5 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.0 | 0.2 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.0 | 6.5 | REACTOME GENERIC TRANSCRIPTION PATHWAY | Genes involved in Generic Transcription Pathway |
| 0.0 | 0.9 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
| 0.0 | 0.1 | REACTOME PROCESSING OF CAPPED INTRONLESS PRE MRNA | Genes involved in Processing of Capped Intronless Pre-mRNA |
| 0.0 | 1.7 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.0 | 1.8 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.0 | 0.2 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.0 | 0.5 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
| 0.0 | 0.1 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
| 0.0 | 0.1 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.0 | 0.1 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
| 0.0 | 0.2 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.0 | 0.1 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
| 0.0 | 0.0 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.9 | 14.6 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
| 2.2 | 6.6 | GO:0051066 | dihydrobiopterin metabolic process(GO:0051066) |
| 2.2 | 19.5 | GO:0086042 | cardiac muscle cell-cardiac muscle cell adhesion(GO:0086042) bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
| 1.8 | 5.3 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 1.4 | 5.8 | GO:0097089 | methyl-branched fatty acid metabolic process(GO:0097089) |
| 1.2 | 3.7 | GO:0045014 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 1.2 | 6.2 | GO:0042100 | B cell proliferation(GO:0042100) |
| 1.2 | 7.4 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
| 1.2 | 4.9 | GO:2000768 | glomerular parietal epithelial cell differentiation(GO:0072139) positive regulation of nephron tubule epithelial cell differentiation(GO:2000768) |
| 1.2 | 3.5 | GO:2000909 | regulation of cholesterol import(GO:0060620) negative regulation of cholesterol import(GO:0060621) regulation of sterol import(GO:2000909) negative regulation of sterol import(GO:2000910) |
| 1.1 | 3.4 | GO:1902303 | regulation of heart rate by hormone(GO:0003064) negative regulation of potassium ion export(GO:1902303) |
| 1.1 | 3.2 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
| 1.0 | 5.2 | GO:1902896 | terminal web assembly(GO:1902896) |
| 1.0 | 5.1 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 1.0 | 5.9 | GO:0044332 | Wnt signaling pathway involved in dorsal/ventral axis specification(GO:0044332) |
| 0.9 | 4.3 | GO:0002415 | immunoglobulin transcytosis in epithelial cells mediated by polymeric immunoglobulin receptor(GO:0002415) |
| 0.9 | 5.1 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.8 | 2.5 | GO:0030264 | nuclear fragmentation involved in apoptotic nuclear change(GO:0030264) positive regulation of cardiac vascular smooth muscle cell differentiation(GO:2000724) |
| 0.8 | 3.3 | GO:0010900 | negative regulation of phosphatidylcholine catabolic process(GO:0010900) |
| 0.8 | 3.3 | GO:0072180 | mesonephric duct morphogenesis(GO:0072180) |
| 0.8 | 2.4 | GO:0010902 | positive regulation of very-low-density lipoprotein particle remodeling(GO:0010902) |
| 0.8 | 6.2 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.8 | 2.3 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.7 | 3.7 | GO:0009440 | cyanate metabolic process(GO:0009439) cyanate catabolic process(GO:0009440) |
| 0.7 | 1.4 | GO:0060751 | epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) branch elongation involved in mammary gland duct branching(GO:0060751) |
| 0.7 | 1.3 | GO:0021521 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 0.6 | 2.5 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.6 | 1.9 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
| 0.6 | 3.0 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.6 | 1.8 | GO:0071934 | thiamine transport(GO:0015888) thiamine transmembrane transport(GO:0071934) |
| 0.6 | 1.7 | GO:0097026 | dendritic cell dendrite assembly(GO:0097026) regulation of dendritic cell dendrite assembly(GO:2000547) |
| 0.6 | 2.3 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
| 0.5 | 1.6 | GO:1904897 | regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 0.5 | 4.3 | GO:2000343 | positive regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000343) |
| 0.5 | 0.5 | GO:0001766 | membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
| 0.5 | 1.6 | GO:0009107 | lipoate biosynthetic process(GO:0009107) |
| 0.5 | 1.6 | GO:2000296 | negative regulation of hydrogen peroxide catabolic process(GO:2000296) |
| 0.5 | 1.6 | GO:1904772 | hepatocyte homeostasis(GO:0036333) response to tetrachloromethane(GO:1904772) |
| 0.5 | 1.0 | GO:0051973 | positive regulation of telomerase activity(GO:0051973) |
| 0.5 | 2.6 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) positive regulation of interleukin-12 secretion(GO:2001184) |
| 0.5 | 1.5 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) negative regulation of neutrophil differentiation(GO:0045659) |
| 0.5 | 1.5 | GO:0060381 | regulation of single-stranded telomeric DNA binding(GO:0060380) positive regulation of single-stranded telomeric DNA binding(GO:0060381) positive regulation of telomeric DNA binding(GO:1904744) |
| 0.5 | 3.5 | GO:0008218 | bioluminescence(GO:0008218) |
| 0.5 | 1.5 | GO:0043105 | regulation of GTP cyclohydrolase I activity(GO:0043095) negative regulation of GTP cyclohydrolase I activity(GO:0043105) |
| 0.5 | 0.5 | GO:0002159 | desmosome assembly(GO:0002159) |
| 0.5 | 2.5 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.5 | 2.0 | GO:0003366 | cell-matrix adhesion involved in ameboidal cell migration(GO:0003366) |
| 0.5 | 2.4 | GO:2001288 | positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.5 | 1.5 | GO:0046210 | nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) |
| 0.5 | 1.9 | GO:1903660 | negative regulation of complement-dependent cytotoxicity(GO:1903660) |
| 0.5 | 1.9 | GO:0002026 | regulation of the force of heart contraction(GO:0002026) |
| 0.5 | 1.9 | GO:0015808 | L-alanine transport(GO:0015808) |
| 0.5 | 0.5 | GO:1903846 | positive regulation of transforming growth factor beta receptor signaling pathway(GO:0030511) positive regulation of cellular response to transforming growth factor beta stimulus(GO:1903846) |
| 0.5 | 1.4 | GO:1902994 | regulation of phospholipid efflux(GO:1902994) positive regulation of phospholipid efflux(GO:1902995) |
| 0.5 | 2.8 | GO:0002225 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antimicrobial humoral response(GO:0002760) positive regulation of antibacterial peptide production(GO:0002803) |
| 0.5 | 0.5 | GO:0034250 | positive regulation of cellular amide metabolic process(GO:0034250) |
| 0.5 | 2.7 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
| 0.5 | 1.8 | GO:0045399 | response to molecule of fungal origin(GO:0002238) regulation of interleukin-3 production(GO:0032672) positive regulation of interleukin-3 production(GO:0032752) interleukin-3 biosynthetic process(GO:0042223) regulation of interleukin-3 biosynthetic process(GO:0045399) positive regulation of interleukin-3 biosynthetic process(GO:0045401) cellular response to molecule of fungal origin(GO:0071226) |
| 0.4 | 1.8 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.4 | 1.3 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
| 0.4 | 0.4 | GO:0036115 | fatty-acyl-CoA catabolic process(GO:0036115) |
| 0.4 | 1.3 | GO:0002925 | positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 0.4 | 1.3 | GO:0045360 | regulation of interleukin-1 biosynthetic process(GO:0045360) positive regulation of interleukin-1 biosynthetic process(GO:0045362) |
| 0.4 | 0.4 | GO:0001302 | replicative cell aging(GO:0001302) |
| 0.4 | 1.3 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.4 | 1.7 | GO:0050712 | negative regulation of interleukin-1 alpha production(GO:0032690) negative regulation of interleukin-1 alpha secretion(GO:0050712) |
| 0.4 | 1.3 | GO:0035408 | histone H3-T6 phosphorylation(GO:0035408) |
| 0.4 | 2.9 | GO:0098989 | NMDA selective glutamate receptor signaling pathway(GO:0098989) |
| 0.4 | 3.8 | GO:0051547 | regulation of keratinocyte migration(GO:0051547) |
| 0.4 | 1.3 | GO:1903697 | negative regulation of microvillus assembly(GO:1903697) |
| 0.4 | 2.1 | GO:0003069 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 0.4 | 3.7 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.4 | 2.1 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.4 | 2.0 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.4 | 1.2 | GO:1902809 | skeletal muscle fiber differentiation(GO:0098528) regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.4 | 28.5 | GO:0006910 | phagocytosis, recognition(GO:0006910) |
| 0.4 | 0.8 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
| 0.4 | 1.1 | GO:1901253 | negative regulation of intracellular transport of viral material(GO:1901253) |
| 0.4 | 1.9 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.4 | 5.3 | GO:1901748 | leukotriene D4 metabolic process(GO:1901748) leukotriene D4 biosynthetic process(GO:1901750) |
| 0.4 | 1.5 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.4 | 1.1 | GO:0070340 | detection of bacterial lipoprotein(GO:0042494) detection of triacyl bacterial lipopeptide(GO:0042495) detection of bacterial lipopeptide(GO:0070340) |
| 0.4 | 1.9 | GO:1904073 | trophectodermal cell proliferation(GO:0001834) regulation of trophectodermal cell proliferation(GO:1904073) positive regulation of trophectodermal cell proliferation(GO:1904075) |
| 0.4 | 0.4 | GO:0060697 | positive regulation of phospholipid catabolic process(GO:0060697) |
| 0.4 | 2.2 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.4 | 3.3 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.4 | 1.1 | GO:0021650 | vestibulocochlear nerve formation(GO:0021650) |
| 0.4 | 1.1 | GO:1903413 | cellular response to bile acid(GO:1903413) |
| 0.4 | 3.6 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
| 0.4 | 1.1 | GO:0044179 | hemolysis by symbiont of host erythrocytes(GO:0019836) hemolysis in other organism(GO:0044179) hemolysis in other organism involved in symbiotic interaction(GO:0052331) |
| 0.3 | 2.4 | GO:1904044 | response to aldosterone(GO:1904044) |
| 0.3 | 2.1 | GO:0006540 | glutamate decarboxylation to succinate(GO:0006540) |
| 0.3 | 3.1 | GO:0006552 | leucine catabolic process(GO:0006552) |
| 0.3 | 0.7 | GO:1902001 | carnitine shuttle(GO:0006853) fatty acid transmembrane transport(GO:1902001) carnitine transmembrane transport(GO:1902603) |
| 0.3 | 3.0 | GO:0036376 | sodium ion export from cell(GO:0036376) sodium ion export(GO:0071436) |
| 0.3 | 1.7 | GO:0042816 | vitamin B6 metabolic process(GO:0042816) |
| 0.3 | 1.3 | GO:0034344 | type III interferon production(GO:0034343) regulation of type III interferon production(GO:0034344) |
| 0.3 | 1.0 | GO:1904386 | response to thyroxine(GO:0097068) response to L-phenylalanine derivative(GO:1904386) |
| 0.3 | 3.3 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
| 0.3 | 2.0 | GO:1903756 | regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903756) negative regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903758) |
| 0.3 | 1.6 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.3 | 1.6 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.3 | 1.3 | GO:0045917 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.3 | 2.5 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 0.3 | 1.9 | GO:0046940 | nucleoside monophosphate phosphorylation(GO:0046940) |
| 0.3 | 0.3 | GO:1904591 | positive regulation of protein import into nucleus(GO:0042307) positive regulation of protein import(GO:1904591) |
| 0.3 | 4.0 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.3 | 1.2 | GO:0071393 | cellular response to progesterone stimulus(GO:0071393) |
| 0.3 | 1.2 | GO:0003335 | corneocyte development(GO:0003335) |
| 0.3 | 1.2 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) |
| 0.3 | 0.9 | GO:0044537 | regulation of circulating fibrinogen levels(GO:0044537) |
| 0.3 | 0.9 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.3 | 3.2 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
| 0.3 | 1.2 | GO:0010730 | negative regulation of hydrogen peroxide biosynthetic process(GO:0010730) |
| 0.3 | 3.2 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.3 | 1.2 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) positive regulation of thyroid hormone generation(GO:2000611) |
| 0.3 | 1.2 | GO:0015942 | formate metabolic process(GO:0015942) |
| 0.3 | 1.1 | GO:0051754 | meiotic sister chromatid cohesion, centromeric(GO:0051754) |
| 0.3 | 3.2 | GO:0035747 | natural killer cell chemotaxis(GO:0035747) |
| 0.3 | 5.7 | GO:0002523 | leukocyte migration involved in inflammatory response(GO:0002523) |
| 0.3 | 0.9 | GO:2000861 | estrogen secretion(GO:0035937) estradiol secretion(GO:0035938) regulation of estrogen secretion(GO:2000861) regulation of estradiol secretion(GO:2000864) |
| 0.3 | 2.0 | GO:1903764 | regulation of potassium ion export(GO:1902302) regulation of potassium ion export across plasma membrane(GO:1903764) |
| 0.3 | 0.8 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) |
| 0.3 | 0.8 | GO:2000173 | negative regulation of dendrite extension(GO:1903860) regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.3 | 1.1 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.3 | 1.6 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.3 | 3.5 | GO:0019388 | galactose catabolic process(GO:0019388) |
| 0.3 | 1.9 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 0.3 | 0.8 | GO:1904351 | negative regulation of protein catabolic process in the vacuole(GO:1904351) negative regulation of lysosomal protein catabolic process(GO:1905166) |
| 0.3 | 0.8 | GO:0048627 | myoblast development(GO:0048627) |
| 0.3 | 1.1 | GO:0006670 | sphingosine metabolic process(GO:0006670) diol metabolic process(GO:0034311) |
| 0.3 | 0.3 | GO:0032423 | regulation of mismatch repair(GO:0032423) positive regulation of mismatch repair(GO:0032425) |
| 0.3 | 1.1 | GO:0032415 | regulation of sodium:proton antiporter activity(GO:0032415) negative regulation of sodium:proton antiporter activity(GO:0032416) |
| 0.3 | 0.5 | GO:0072709 | cellular response to sorbitol(GO:0072709) |
| 0.3 | 0.8 | GO:0007260 | tyrosine phosphorylation of STAT protein(GO:0007260) regulation of tyrosine phosphorylation of STAT protein(GO:0042509) |
| 0.3 | 1.0 | GO:1903719 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.3 | 1.3 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.3 | 1.8 | GO:0032445 | fructose transport(GO:0015755) fructose import(GO:0032445) carbohydrate import into cell(GO:0097319) carbohydrate import across plasma membrane(GO:0098704) fructose import across plasma membrane(GO:1990539) |
| 0.3 | 0.5 | GO:0043615 | astrocyte cell migration(GO:0043615) |
| 0.3 | 0.8 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.3 | 0.8 | GO:0090070 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.3 | 1.3 | GO:0061143 | alveolar primary septum development(GO:0061143) |
| 0.3 | 1.0 | GO:0014028 | notochord formation(GO:0014028) |
| 0.3 | 1.0 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
| 0.3 | 0.8 | GO:1903625 | negative regulation of DNA catabolic process(GO:1903625) |
| 0.3 | 1.0 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
| 0.3 | 0.5 | GO:0098727 | stem cell population maintenance(GO:0019827) maintenance of cell number(GO:0098727) |
| 0.2 | 0.2 | GO:0046730 | induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) |
| 0.2 | 0.5 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
| 0.2 | 1.0 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.2 | 0.7 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.2 | 0.2 | GO:0044240 | multicellular organism lipid catabolic process(GO:0044240) |
| 0.2 | 0.2 | GO:0051177 | meiotic sister chromatid cohesion(GO:0051177) |
| 0.2 | 2.6 | GO:0070424 | regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) |
| 0.2 | 0.2 | GO:0009404 | toxin metabolic process(GO:0009404) |
| 0.2 | 1.0 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
| 0.2 | 0.7 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
| 0.2 | 1.9 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.2 | 1.2 | GO:0033490 | cholesterol biosynthetic process via desmosterol(GO:0033489) cholesterol biosynthetic process via lathosterol(GO:0033490) |
| 0.2 | 2.3 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.2 | 0.9 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.2 | 0.5 | GO:0002266 | follicular dendritic cell activation(GO:0002266) follicular dendritic cell differentiation(GO:0002268) |
| 0.2 | 0.7 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.2 | 0.9 | GO:2000664 | positive regulation of interleukin-5 secretion(GO:2000664) |
| 0.2 | 0.5 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
| 0.2 | 1.4 | GO:0090116 | C-5 methylation of cytosine(GO:0090116) |
| 0.2 | 0.5 | GO:2000417 | negative regulation of eosinophil migration(GO:2000417) |
| 0.2 | 2.1 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.2 | 0.7 | GO:1903348 | positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.2 | 0.7 | GO:2000538 | regulation of B cell chemotaxis(GO:2000537) positive regulation of B cell chemotaxis(GO:2000538) |
| 0.2 | 0.9 | GO:1901162 | primary amino compound biosynthetic process(GO:1901162) |
| 0.2 | 0.9 | GO:1903436 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 0.2 | 2.2 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.2 | 0.7 | GO:0031133 | regulation of axon diameter(GO:0031133) |
| 0.2 | 1.3 | GO:0010133 | proline catabolic process to glutamate(GO:0010133) |
| 0.2 | 0.2 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.2 | 4.6 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.2 | 0.2 | GO:0045763 | negative regulation of cellular amino acid metabolic process(GO:0045763) |
| 0.2 | 2.4 | GO:0000050 | urea cycle(GO:0000050) |
| 0.2 | 0.7 | GO:0019242 | methylglyoxal biosynthetic process(GO:0019242) |
| 0.2 | 0.6 | GO:0071789 | spindle pole body duplication(GO:0030474) spindle pole body organization(GO:0051300) spindle pole body localization(GO:0070631) establishment of spindle pole body localization(GO:0070632) spindle pole body localization to nuclear envelope(GO:0071789) establishment of spindle pole body localization to nuclear envelope(GO:0071790) |
| 0.2 | 0.9 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
| 0.2 | 1.1 | GO:0042539 | hypotonic salinity response(GO:0042539) cellular hypotonic salinity response(GO:0071477) |
| 0.2 | 0.8 | GO:0042126 | nitrate metabolic process(GO:0042126) |
| 0.2 | 0.4 | GO:0071812 | regulation of fever generation by regulation of prostaglandin secretion(GO:0071810) positive regulation of fever generation by positive regulation of prostaglandin secretion(GO:0071812) positive regulation of ERK1 and ERK2 cascade via TNFSF11-mediated signaling(GO:0071848) regulation of fever generation by prostaglandin secretion(GO:0100009) |
| 0.2 | 0.6 | GO:1904482 | response to tetrahydrofolate(GO:1904481) cellular response to tetrahydrofolate(GO:1904482) |
| 0.2 | 0.4 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.2 | 0.2 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) |
| 0.2 | 0.2 | GO:0010725 | regulation of primitive erythrocyte differentiation(GO:0010725) eosinophil fate commitment(GO:0035854) |
| 0.2 | 0.6 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.2 | 0.6 | GO:0032119 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
| 0.2 | 1.0 | GO:0002399 | MHC class II protein complex assembly(GO:0002399) |
| 0.2 | 1.2 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.2 | 0.8 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.2 | 1.4 | GO:0044130 | negative regulation of growth of symbiont in host(GO:0044130) |
| 0.2 | 1.4 | GO:1900045 | negative regulation of histone ubiquitination(GO:0033183) negative regulation of protein K63-linked ubiquitination(GO:1900045) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.2 | 0.4 | GO:0002884 | negative regulation of hypersensitivity(GO:0002884) |
| 0.2 | 1.2 | GO:0070560 | protein secretion by platelet(GO:0070560) |
| 0.2 | 1.2 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.2 | 1.0 | GO:0048733 | sebaceous gland development(GO:0048733) |
| 0.2 | 0.6 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
| 0.2 | 1.4 | GO:0034378 | chylomicron assembly(GO:0034378) |
| 0.2 | 0.6 | GO:0070105 | positive regulation of interleukin-6-mediated signaling pathway(GO:0070105) |
| 0.2 | 0.6 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.2 | 1.6 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.2 | 0.8 | GO:0097021 | lymphocyte migration into lymphoid organs(GO:0097021) |
| 0.2 | 1.8 | GO:0010623 | programmed cell death involved in cell development(GO:0010623) |
| 0.2 | 0.4 | GO:0002371 | dendritic cell cytokine production(GO:0002371) |
| 0.2 | 3.2 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.2 | 0.4 | GO:0016999 | antibiotic metabolic process(GO:0016999) |
| 0.2 | 0.2 | GO:0061032 | visceral serous pericardium development(GO:0061032) |
| 0.2 | 0.6 | GO:0044501 | modulation of signal transduction in other organism(GO:0044501) modulation by symbiont of host signal transduction pathway(GO:0052027) modulation of signal transduction in other organism involved in symbiotic interaction(GO:0052250) modulation by symbiont of host I-kappaB kinase/NF-kappaB cascade(GO:0085032) |
| 0.2 | 1.4 | GO:0060481 | lobar bronchus epithelium development(GO:0060481) |
| 0.2 | 1.4 | GO:0051136 | regulation of NK T cell differentiation(GO:0051136) |
| 0.2 | 1.0 | GO:0030070 | insulin processing(GO:0030070) |
| 0.2 | 0.2 | GO:0046882 | negative regulation of follicle-stimulating hormone secretion(GO:0046882) regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
| 0.2 | 1.0 | GO:0044351 | macropinocytosis(GO:0044351) |
| 0.2 | 1.0 | GO:1990834 | response to odorant(GO:1990834) |
| 0.2 | 1.2 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.2 | 1.1 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.2 | 1.1 | GO:1902414 | protein localization to cell junction(GO:1902414) |
| 0.2 | 0.4 | GO:0010897 | negative regulation of triglyceride catabolic process(GO:0010897) |
| 0.2 | 1.1 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.2 | 0.7 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.2 | 2.0 | GO:0003374 | dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
| 0.2 | 1.3 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) |
| 0.2 | 0.6 | GO:1902499 | positive regulation of protein autoubiquitination(GO:1902499) |
| 0.2 | 0.7 | GO:0044571 | [2Fe-2S] cluster assembly(GO:0044571) |
| 0.2 | 0.4 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
| 0.2 | 1.5 | GO:0034379 | very-low-density lipoprotein particle assembly(GO:0034379) |
| 0.2 | 0.2 | GO:0035821 | modification of morphology or physiology of other organism(GO:0035821) |
| 0.2 | 0.5 | GO:0046680 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031660) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031662) response to DDT(GO:0046680) histone H3-S10 phosphorylation involved in chromosome condensation(GO:2000775) |
| 0.2 | 1.1 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
| 0.2 | 1.8 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
| 0.2 | 0.7 | GO:0003011 | diaphragm contraction(GO:0002086) involuntary skeletal muscle contraction(GO:0003011) |
| 0.2 | 0.2 | GO:0060482 | lobar bronchus development(GO:0060482) |
| 0.2 | 0.7 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
| 0.2 | 0.2 | GO:0035963 | cellular response to interleukin-13(GO:0035963) |
| 0.2 | 0.2 | GO:0046533 | negative regulation of photoreceptor cell differentiation(GO:0046533) |
| 0.2 | 0.9 | GO:0070092 | regulation of glucagon secretion(GO:0070092) |
| 0.2 | 1.4 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
| 0.2 | 0.3 | GO:0014040 | positive regulation of Schwann cell differentiation(GO:0014040) |
| 0.2 | 1.4 | GO:1900004 | negative regulation of serine-type endopeptidase activity(GO:1900004) negative regulation of serine-type peptidase activity(GO:1902572) |
| 0.2 | 1.9 | GO:0014809 | regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014809) |
| 0.2 | 0.7 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.2 | 0.5 | GO:0009750 | response to fructose(GO:0009750) |
| 0.2 | 6.6 | GO:0031122 | cytoplasmic microtubule organization(GO:0031122) |
| 0.2 | 0.5 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.2 | 0.9 | GO:0008211 | glucocorticoid metabolic process(GO:0008211) |
| 0.2 | 0.7 | GO:0006408 | snRNA export from nucleus(GO:0006408) |
| 0.2 | 0.3 | GO:1903896 | positive regulation of IRE1-mediated unfolded protein response(GO:1903896) |
| 0.2 | 1.5 | GO:0019375 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.2 | 0.5 | GO:1904404 | cellular response to vitamin B1(GO:0071301) response to formaldehyde(GO:1904404) |
| 0.2 | 0.3 | GO:0014805 | smooth muscle adaptation(GO:0014805) |
| 0.2 | 2.2 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.2 | 2.8 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
| 0.2 | 1.0 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
| 0.2 | 4.0 | GO:0072539 | T-helper 17 cell differentiation(GO:0072539) |
| 0.2 | 1.3 | GO:0055069 | cellular zinc ion homeostasis(GO:0006882) zinc ion homeostasis(GO:0055069) |
| 0.2 | 0.7 | GO:1904048 | regulation of spontaneous neurotransmitter secretion(GO:1904048) |
| 0.2 | 4.0 | GO:0006337 | nucleosome disassembly(GO:0006337) |
| 0.2 | 0.5 | GO:0043103 | hypoxanthine salvage(GO:0043103) |
| 0.2 | 1.8 | GO:0033623 | regulation of integrin activation(GO:0033623) |
| 0.2 | 2.9 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.2 | 0.2 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
| 0.2 | 0.3 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
| 0.2 | 0.5 | GO:0090341 | negative regulation of secretion of lysosomal enzymes(GO:0090341) |
| 0.2 | 0.5 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.2 | 0.3 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
| 0.2 | 0.6 | GO:0002034 | regulation of blood vessel size by renin-angiotensin(GO:0002034) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) |
| 0.2 | 2.1 | GO:0046852 | positive regulation of bone resorption(GO:0045780) positive regulation of bone remodeling(GO:0046852) |
| 0.2 | 0.2 | GO:0044146 | negative regulation of growth of symbiont involved in interaction with host(GO:0044146) |
| 0.2 | 0.8 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
| 0.2 | 0.6 | GO:0097010 | eukaryotic translation initiation factor 4F complex assembly(GO:0097010) |
| 0.2 | 2.4 | GO:0061436 | establishment of skin barrier(GO:0061436) |
| 0.2 | 2.4 | GO:0016024 | CDP-diacylglycerol biosynthetic process(GO:0016024) |
| 0.2 | 0.5 | GO:0045976 | negative regulation of mitotic cell cycle, embryonic(GO:0045976) |
| 0.2 | 0.5 | GO:2000660 | negative regulation of interleukin-1-mediated signaling pathway(GO:2000660) |
| 0.2 | 0.5 | GO:0007057 | spindle assembly involved in female meiosis I(GO:0007057) |
| 0.2 | 1.2 | GO:0007140 | male meiosis(GO:0007140) |
| 0.2 | 0.8 | GO:0016998 | cell wall macromolecule catabolic process(GO:0016998) |
| 0.2 | 0.3 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
| 0.2 | 0.9 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.2 | 0.6 | GO:0016240 | autophagosome docking(GO:0016240) |
| 0.2 | 2.1 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 0.2 | 3.0 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
| 0.2 | 0.3 | GO:0045994 | positive regulation of translational initiation by iron(GO:0045994) |
| 0.2 | 0.2 | GO:0034201 | response to oleic acid(GO:0034201) |
| 0.2 | 0.5 | GO:2000489 | regulation of hepatic stellate cell activation(GO:2000489) positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.2 | 0.9 | GO:0048298 | positive regulation of isotype switching to IgA isotypes(GO:0048298) |
| 0.2 | 1.1 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.2 | 0.3 | GO:0033683 | nucleotide-excision repair, DNA incision(GO:0033683) |
| 0.2 | 0.3 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.1 | 0.7 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.1 | 1.6 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.1 | 2.1 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
| 0.1 | 0.7 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.1 | 0.1 | GO:0006165 | nucleoside diphosphate phosphorylation(GO:0006165) |
| 0.1 | 1.6 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
| 0.1 | 0.9 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 0.1 | 0.3 | GO:0038163 | thrombopoietin-mediated signaling pathway(GO:0038163) |
| 0.1 | 0.9 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.1 | 0.3 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.1 | 0.6 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
| 0.1 | 1.2 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.1 | 0.4 | GO:0071422 | thiosulfate transport(GO:0015709) oxaloacetate transport(GO:0015729) malate transport(GO:0015743) succinate transport(GO:0015744) succinate transmembrane transport(GO:0071422) malate transmembrane transport(GO:0071423) oxaloacetate(2-) transmembrane transport(GO:1902356) |
| 0.1 | 0.4 | GO:0006422 | aspartyl-tRNA aminoacylation(GO:0006422) |
| 0.1 | 1.4 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.1 | 1.6 | GO:1902222 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
| 0.1 | 0.6 | GO:0009386 | translational attenuation(GO:0009386) |
| 0.1 | 1.3 | GO:0002360 | T cell lineage commitment(GO:0002360) |
| 0.1 | 0.9 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
| 0.1 | 0.4 | GO:0031126 | snoRNA 3'-end processing(GO:0031126) |
| 0.1 | 0.1 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
| 0.1 | 0.9 | GO:0035795 | negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 0.1 | 0.3 | GO:0060017 | parathyroid gland development(GO:0060017) |
| 0.1 | 0.4 | GO:1901503 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) ether biosynthetic process(GO:1901503) |
| 0.1 | 0.4 | GO:0000973 | posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
| 0.1 | 0.1 | GO:0018393 | internal peptidyl-lysine acetylation(GO:0018393) peptidyl-lysine acetylation(GO:0018394) |
| 0.1 | 0.7 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.1 | 0.4 | GO:0002316 | follicular B cell differentiation(GO:0002316) |
| 0.1 | 0.4 | GO:0044208 | 'de novo' AMP biosynthetic process(GO:0044208) |
| 0.1 | 0.4 | GO:2000824 | negative regulation of androgen receptor activity(GO:2000824) |
| 0.1 | 0.4 | GO:0070171 | negative regulation of tooth mineralization(GO:0070171) |
| 0.1 | 0.8 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
| 0.1 | 1.4 | GO:0070673 | response to interleukin-18(GO:0070673) |
| 0.1 | 0.1 | GO:0060632 | regulation of microtubule-based movement(GO:0060632) |
| 0.1 | 2.1 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
| 0.1 | 0.8 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.1 | 1.5 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.1 | 0.1 | GO:0048296 | regulation of isotype switching to IgA isotypes(GO:0048296) |
| 0.1 | 0.5 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
| 0.1 | 0.3 | GO:0044036 | cell wall macromolecule metabolic process(GO:0044036) cell wall organization or biogenesis(GO:0071554) |
| 0.1 | 0.1 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) modulation of inhibitory postsynaptic potential(GO:0098828) |
| 0.1 | 0.4 | GO:0032223 | negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 0.1 | 0.1 | GO:1904798 | regulation of core promoter binding(GO:1904796) positive regulation of core promoter binding(GO:1904798) |
| 0.1 | 0.5 | GO:0008277 | regulation of G-protein coupled receptor protein signaling pathway(GO:0008277) |
| 0.1 | 0.9 | GO:0070269 | pyroptosis(GO:0070269) |
| 0.1 | 0.5 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.1 | 0.7 | GO:0032494 | response to peptidoglycan(GO:0032494) |
| 0.1 | 0.5 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.1 | 0.4 | GO:0045423 | regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045423) positive regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045425) |
| 0.1 | 1.2 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 0.1 | 0.1 | GO:0051231 | mitotic spindle elongation(GO:0000022) spindle elongation(GO:0051231) |
| 0.1 | 0.3 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
| 0.1 | 0.1 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
| 0.1 | 0.5 | GO:0001757 | somite specification(GO:0001757) |
| 0.1 | 0.3 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.1 | 1.0 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
| 0.1 | 1.7 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 0.1 | 0.4 | GO:1901998 | toxin transport(GO:1901998) |
| 0.1 | 0.1 | GO:0010644 | cell communication by electrical coupling(GO:0010644) |
| 0.1 | 2.0 | GO:0034063 | stress granule assembly(GO:0034063) |
| 0.1 | 2.0 | GO:0030889 | negative regulation of B cell proliferation(GO:0030889) |
| 0.1 | 0.4 | GO:0009212 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) |
| 0.1 | 1.1 | GO:0015868 | purine nucleotide transport(GO:0015865) purine ribonucleotide transport(GO:0015868) |
| 0.1 | 1.5 | GO:0033008 | positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
| 0.1 | 0.3 | GO:0061156 | pulmonary artery morphogenesis(GO:0061156) |
| 0.1 | 0.1 | GO:0072366 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) |
| 0.1 | 0.5 | GO:0032411 | positive regulation of transporter activity(GO:0032411) |
| 0.1 | 0.9 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.1 | 0.6 | GO:0071233 | cellular response to leucine(GO:0071233) |
| 0.1 | 0.5 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.1 | 0.2 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.1 | 0.2 | GO:0050902 | leukocyte adhesive activation(GO:0050902) |
| 0.1 | 0.4 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.1 | 0.4 | GO:0006591 | ornithine metabolic process(GO:0006591) |
| 0.1 | 4.8 | GO:0002260 | lymphocyte homeostasis(GO:0002260) |
| 0.1 | 0.5 | GO:0060088 | auditory receptor cell stereocilium organization(GO:0060088) |
| 0.1 | 0.5 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.1 | 0.4 | GO:0032203 | telomere formation via telomerase(GO:0032203) |
| 0.1 | 2.0 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
| 0.1 | 0.8 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.1 | 14.0 | GO:0030183 | B cell differentiation(GO:0030183) |
| 0.1 | 0.4 | GO:1902943 | positive regulation of cyclic nucleotide-gated ion channel activity(GO:1902161) regulation of voltage-gated chloride channel activity(GO:1902941) positive regulation of voltage-gated chloride channel activity(GO:1902943) |
| 0.1 | 0.2 | GO:1990418 | response to insulin-like growth factor stimulus(GO:1990418) |
| 0.1 | 2.2 | GO:0071539 | protein localization to centrosome(GO:0071539) |
| 0.1 | 0.9 | GO:1990668 | vesicle fusion with endoplasmic reticulum-Golgi intermediate compartment (ERGIC) membrane(GO:1990668) |
| 0.1 | 0.6 | GO:0006216 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
| 0.1 | 0.8 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
| 0.1 | 0.1 | GO:0009217 | purine deoxyribonucleotide catabolic process(GO:0009155) purine deoxyribonucleoside triphosphate catabolic process(GO:0009217) dATP catabolic process(GO:0046061) |
| 0.1 | 1.5 | GO:0045008 | depyrimidination(GO:0045008) |
| 0.1 | 2.5 | GO:0071354 | cellular response to interleukin-6(GO:0071354) |
| 0.1 | 6.7 | GO:0045576 | mast cell activation(GO:0045576) |
| 0.1 | 0.3 | GO:0043154 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic process(GO:0043154) |
| 0.1 | 0.3 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
| 0.1 | 0.2 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
| 0.1 | 0.2 | GO:0060268 | negative regulation of respiratory burst(GO:0060268) |
| 0.1 | 0.5 | GO:1904448 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) aspartate secretion(GO:0061528) positive regulation of prolactin secretion(GO:1902722) regulation of aspartate secretion(GO:1904448) positive regulation of aspartate secretion(GO:1904450) |
| 0.1 | 0.9 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.1 | 0.4 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.1 | 0.4 | GO:2000980 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.1 | 2.1 | GO:0051255 | spindle midzone assembly(GO:0051255) |
| 0.1 | 0.9 | GO:0042908 | xenobiotic transport(GO:0042908) |
| 0.1 | 0.7 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.1 | 0.2 | GO:0090170 | regulation of Golgi inheritance(GO:0090170) |
| 0.1 | 0.9 | GO:0015886 | heme transport(GO:0015886) |
| 0.1 | 0.2 | GO:0048319 | axial mesoderm morphogenesis(GO:0048319) |
| 0.1 | 1.0 | GO:0010663 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.1 | 1.0 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
| 0.1 | 0.6 | GO:0046642 | negative regulation of alpha-beta T cell proliferation(GO:0046642) |
| 0.1 | 0.3 | GO:0007518 | myoblast fate determination(GO:0007518) |
| 0.1 | 1.0 | GO:0031935 | regulation of chromatin silencing(GO:0031935) |
| 0.1 | 0.2 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.1 | 0.6 | GO:0097460 | ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
| 0.1 | 1.5 | GO:1904816 | positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
| 0.1 | 1.2 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) sphingolipid mediated signaling pathway(GO:0090520) |
| 0.1 | 0.4 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.1 | 1.0 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.1 | 0.5 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.1 | 0.7 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.1 | 0.9 | GO:0015939 | pantothenate metabolic process(GO:0015939) |
| 0.1 | 0.3 | GO:1901994 | meiotic cell cycle phase transition(GO:0044771) regulation of meiotic cell cycle phase transition(GO:1901993) negative regulation of meiotic cell cycle phase transition(GO:1901994) |
| 0.1 | 0.7 | GO:0042426 | choline catabolic process(GO:0042426) |
| 0.1 | 0.4 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 0.1 | 0.6 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.1 | 0.6 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.1 | 0.8 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
| 0.1 | 0.2 | GO:0046627 | negative regulation of insulin receptor signaling pathway(GO:0046627) negative regulation of cellular response to insulin stimulus(GO:1900077) |
| 0.1 | 0.3 | GO:0060368 | regulation of Fc receptor mediated stimulatory signaling pathway(GO:0060368) |
| 0.1 | 0.5 | GO:0035799 | ureter maturation(GO:0035799) |
| 0.1 | 0.7 | GO:0015840 | urea transport(GO:0015840) |
| 0.1 | 1.0 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.1 | 0.7 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) regulation of parathyroid hormone secretion(GO:2000828) |
| 0.1 | 1.0 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.1 | 0.3 | GO:0048539 | bone marrow development(GO:0048539) |
| 0.1 | 0.4 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.1 | 0.8 | GO:0006449 | regulation of translational termination(GO:0006449) |
| 0.1 | 0.4 | GO:0046452 | dihydrofolate metabolic process(GO:0046452) |
| 0.1 | 0.8 | GO:0045745 | positive regulation of G-protein coupled receptor protein signaling pathway(GO:0045745) |
| 0.1 | 0.1 | GO:0051085 | 'de novo' posttranslational protein folding(GO:0051084) chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.1 | 1.5 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
| 0.1 | 0.5 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing by siRNA(GO:0090625) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.1 | 0.4 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
| 0.1 | 0.3 | GO:0044806 | G-quadruplex DNA unwinding(GO:0044806) |
| 0.1 | 1.0 | GO:0048007 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
| 0.1 | 0.7 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.1 | 0.6 | GO:0044211 | CTP salvage(GO:0044211) |
| 0.1 | 0.4 | GO:0048817 | negative regulation of hair follicle maturation(GO:0048817) |
| 0.1 | 0.3 | GO:0061534 | gamma-aminobutyric acid secretion, neurotransmission(GO:0061534) |
| 0.1 | 2.3 | GO:0046337 | phosphatidylethanolamine metabolic process(GO:0046337) |
| 0.1 | 2.0 | GO:0035338 | long-chain fatty-acyl-CoA biosynthetic process(GO:0035338) |
| 0.1 | 0.3 | GO:0042256 | mature ribosome assembly(GO:0042256) |
| 0.1 | 1.2 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.1 | 0.2 | GO:0006425 | glutaminyl-tRNA aminoacylation(GO:0006425) |
| 0.1 | 0.4 | GO:0019086 | late viral transcription(GO:0019086) |
| 0.1 | 0.3 | GO:0030101 | natural killer cell activation(GO:0030101) |
| 0.1 | 0.2 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
| 0.1 | 0.3 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.1 | 0.8 | GO:1903003 | positive regulation of protein deubiquitination(GO:1903003) |
| 0.1 | 0.1 | GO:0009448 | gamma-aminobutyric acid metabolic process(GO:0009448) |
| 0.1 | 0.2 | GO:1903412 | response to bile acid(GO:1903412) |
| 0.1 | 0.8 | GO:0015705 | iodide transport(GO:0015705) |
| 0.1 | 0.3 | GO:0035616 | histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.1 | 0.7 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
| 0.1 | 0.3 | GO:0072535 | tumor necrosis factor (ligand) superfamily member 11 production(GO:0072535) regulation of tumor necrosis factor (ligand) superfamily member 11 production(GO:2000307) |
| 0.1 | 0.3 | GO:2001166 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.1 | 0.5 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
| 0.1 | 0.1 | GO:0072174 | metanephric tubule formation(GO:0072174) |
| 0.1 | 0.4 | GO:0090164 | asymmetric Golgi ribbon formation(GO:0090164) |
| 0.1 | 0.5 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
| 0.1 | 0.4 | GO:0019346 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
| 0.1 | 0.9 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.1 | 0.5 | GO:0019640 | glucuronate catabolic process(GO:0006064) glucuronate catabolic process to xylulose 5-phosphate(GO:0019640) xylulose 5-phosphate metabolic process(GO:0051167) xylulose 5-phosphate biosynthetic process(GO:1901159) |
| 0.1 | 1.7 | GO:0006743 | ubiquinone metabolic process(GO:0006743) ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.1 | 0.3 | GO:0034115 | negative regulation of heterotypic cell-cell adhesion(GO:0034115) regulation of cell-cell adhesion involved in gastrulation(GO:0070587) |
| 0.1 | 0.3 | GO:2000822 | regulation of fear response(GO:1903365) positive regulation of fear response(GO:1903367) regulation of behavioral fear response(GO:2000822) positive regulation of behavioral fear response(GO:2000987) |
| 0.1 | 0.2 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
| 0.1 | 0.2 | GO:1904526 | regulation of microtubule binding(GO:1904526) |
| 0.1 | 5.9 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
| 0.1 | 1.7 | GO:0006379 | mRNA cleavage(GO:0006379) |
| 0.1 | 0.5 | GO:0070829 | response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.1 | 0.6 | GO:0002710 | negative regulation of T cell mediated immunity(GO:0002710) |
| 0.1 | 0.2 | GO:0035983 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
| 0.1 | 0.2 | GO:1901859 | base-excision repair, DNA ligation(GO:0006288) negative regulation of mitochondrial DNA replication(GO:0090298) negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
| 0.1 | 0.2 | GO:0032782 | bile acid secretion(GO:0032782) |
| 0.1 | 1.8 | GO:0032878 | regulation of establishment or maintenance of cell polarity(GO:0032878) |
| 0.1 | 0.2 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
| 0.1 | 0.3 | GO:0038188 | cholecystokinin signaling pathway(GO:0038188) |
| 0.1 | 0.4 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.1 | 0.3 | GO:1990502 | dense core granule maturation(GO:1990502) |
| 0.1 | 1.1 | GO:0000478 | endonucleolytic cleavage involved in rRNA processing(GO:0000478) |
| 0.1 | 0.3 | GO:0009258 | 10-formyltetrahydrofolate catabolic process(GO:0009258) |
| 0.1 | 0.4 | GO:0019348 | dolichol metabolic process(GO:0019348) |
| 0.1 | 1.1 | GO:0042354 | fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
| 0.1 | 0.1 | GO:0006498 | N-terminal protein lipidation(GO:0006498) |
| 0.1 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.4 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.1 | 0.5 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.1 | 0.1 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
| 0.1 | 3.2 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.1 | 0.3 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.1 | 1.9 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.1 | 0.1 | GO:0000019 | regulation of mitotic recombination(GO:0000019) |
| 0.1 | 0.9 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
| 0.1 | 1.3 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.1 | 0.1 | GO:1905232 | cellular response to L-glutamate(GO:1905232) |
| 0.1 | 0.7 | GO:0006600 | creatine metabolic process(GO:0006600) |
| 0.1 | 0.3 | GO:0043335 | protein unfolding(GO:0043335) |
| 0.1 | 0.3 | GO:1904338 | regulation of dopaminergic neuron differentiation(GO:1904338) |
| 0.1 | 4.1 | GO:0018279 | protein N-linked glycosylation via asparagine(GO:0018279) |
| 0.1 | 1.2 | GO:1903830 | magnesium ion transmembrane transport(GO:1903830) |
| 0.1 | 0.2 | GO:0045006 | DNA deamination(GO:0045006) DNA cytosine deamination(GO:0070383) |
| 0.1 | 0.3 | GO:0035752 | lysosomal lumen pH elevation(GO:0035752) |
| 0.1 | 0.7 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.1 | 0.1 | GO:0048147 | negative regulation of fibroblast proliferation(GO:0048147) |
| 0.1 | 0.1 | GO:0043570 | maintenance of DNA repeat elements(GO:0043570) |
| 0.1 | 1.6 | GO:0006968 | cellular defense response(GO:0006968) |
| 0.1 | 0.8 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.1 | 0.3 | GO:0021514 | ventral spinal cord interneuron differentiation(GO:0021514) |
| 0.1 | 0.1 | GO:1902159 | regulation of cyclic nucleotide-gated ion channel activity(GO:1902159) |
| 0.1 | 0.7 | GO:0048853 | forebrain morphogenesis(GO:0048853) |
| 0.1 | 0.2 | GO:0000038 | very long-chain fatty acid metabolic process(GO:0000038) |
| 0.1 | 0.2 | GO:0035521 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
| 0.1 | 0.2 | GO:1903031 | regulation of microtubule plus-end binding(GO:1903031) positive regulation of microtubule plus-end binding(GO:1903033) |
| 0.1 | 1.3 | GO:0031167 | rRNA methylation(GO:0031167) |
| 0.1 | 0.2 | GO:0006086 | acetyl-CoA biosynthetic process(GO:0006085) acetyl-CoA biosynthetic process from pyruvate(GO:0006086) regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.1 | 1.4 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.1 | 0.3 | GO:1903236 | regulation of leukocyte tethering or rolling(GO:1903236) negative regulation of leukocyte tethering or rolling(GO:1903237) |
| 0.1 | 0.2 | GO:0036016 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
| 0.1 | 3.1 | GO:0071431 | tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.1 | 0.2 | GO:1901490 | regulation of lymphangiogenesis(GO:1901490) |
| 0.1 | 0.6 | GO:2001225 | regulation of chloride transport(GO:2001225) |
| 0.1 | 0.6 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
| 0.1 | 0.3 | GO:0060126 | somatotropin secreting cell differentiation(GO:0060126) |
| 0.1 | 0.5 | GO:0043316 | cytotoxic T cell degranulation(GO:0043316) positive regulation of constitutive secretory pathway(GO:1903435) |
| 0.1 | 0.2 | GO:0031548 | regulation of brain-derived neurotrophic factor receptor signaling pathway(GO:0031548) |
| 0.1 | 0.2 | GO:0036493 | positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
| 0.1 | 0.1 | GO:0003220 | left ventricular cardiac muscle tissue morphogenesis(GO:0003220) |
| 0.1 | 0.6 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.1 | 1.7 | GO:0061178 | regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061178) |
| 0.1 | 2.6 | GO:0005980 | glycogen catabolic process(GO:0005980) |
| 0.1 | 1.1 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
| 0.1 | 1.3 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.1 | 1.1 | GO:0045730 | respiratory burst(GO:0045730) |
| 0.1 | 1.0 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.1 | 0.5 | GO:0009409 | response to cold(GO:0009409) |
| 0.1 | 0.9 | GO:0042994 | cytoplasmic sequestering of transcription factor(GO:0042994) |
| 0.1 | 2.5 | GO:0051932 | synaptic transmission, GABAergic(GO:0051932) |
| 0.1 | 2.6 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.1 | 0.5 | GO:0032695 | negative regulation of interleukin-12 production(GO:0032695) |
| 0.1 | 0.2 | GO:0072092 | ureteric bud invasion(GO:0072092) |
| 0.1 | 0.3 | GO:0098838 | methotrexate transport(GO:0051958) reduced folate transmembrane transport(GO:0098838) |
| 0.1 | 0.2 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) |
| 0.1 | 0.2 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
| 0.1 | 1.1 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.1 | 0.3 | GO:0060633 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) |
| 0.1 | 0.2 | GO:0003016 | respiratory system process(GO:0003016) |
| 0.1 | 0.1 | GO:0002674 | negative regulation of acute inflammatory response(GO:0002674) |
| 0.1 | 0.3 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.1 | 0.4 | GO:0021759 | globus pallidus development(GO:0021759) |
| 0.1 | 0.4 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.1 | 0.8 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
| 0.1 | 0.4 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.1 | 0.1 | GO:0042137 | sequestering of neurotransmitter(GO:0042137) |
| 0.1 | 0.1 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
| 0.1 | 0.4 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.1 | 0.2 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.1 | 0.3 | GO:0018377 | protein myristoylation(GO:0018377) |
| 0.1 | 0.7 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.1 | 0.1 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
| 0.1 | 0.1 | GO:0060525 | prostate glandular acinus development(GO:0060525) |
| 0.1 | 0.2 | GO:0097056 | seryl-tRNA aminoacylation(GO:0006434) selenocysteinyl-tRNA(Sec) biosynthetic process(GO:0097056) |
| 0.1 | 0.1 | GO:0006711 | estrogen catabolic process(GO:0006711) |
| 0.1 | 0.4 | GO:0055129 | proline biosynthetic process(GO:0006561) L-proline biosynthetic process(GO:0055129) |
| 0.1 | 0.7 | GO:1900864 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
| 0.1 | 0.4 | GO:0072643 | interferon-gamma secretion(GO:0072643) |
| 0.1 | 1.2 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
| 0.1 | 0.6 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 | 0.8 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
| 0.1 | 0.4 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
| 0.1 | 1.2 | GO:0035428 | hexose transmembrane transport(GO:0035428) glucose transmembrane transport(GO:1904659) |
| 0.1 | 0.4 | GO:0042026 | protein refolding(GO:0042026) |
| 0.1 | 0.5 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
| 0.1 | 0.3 | GO:0007212 | dopamine receptor signaling pathway(GO:0007212) |
| 0.1 | 0.3 | GO:1904378 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.1 | 0.6 | GO:0045741 | positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
| 0.1 | 0.8 | GO:0033227 | dsRNA transport(GO:0033227) |
| 0.1 | 0.1 | GO:1902714 | negative regulation of interferon-gamma secretion(GO:1902714) |
| 0.1 | 0.7 | GO:0016075 | rRNA catabolic process(GO:0016075) |
| 0.1 | 1.0 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
| 0.1 | 0.4 | GO:1903027 | regulation of opsonization(GO:1903027) |
| 0.1 | 0.1 | GO:0002467 | germinal center formation(GO:0002467) |
| 0.1 | 0.3 | GO:0010818 | T cell chemotaxis(GO:0010818) |
| 0.1 | 0.2 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.1 | 1.3 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.1 | 0.4 | GO:0030032 | lamellipodium assembly(GO:0030032) |
| 0.1 | 0.7 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.1 | 0.3 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.1 | 0.7 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.1 | 0.1 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.1 | 0.4 | GO:0018065 | protein-cofactor linkage(GO:0018065) |
| 0.1 | 0.4 | GO:0060148 | positive regulation of posttranscriptional gene silencing(GO:0060148) positive regulation of gene silencing by miRNA(GO:2000637) |
| 0.1 | 0.5 | GO:0070375 | ERK5 cascade(GO:0070375) |
| 0.1 | 1.9 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 0.1 | 0.2 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
| 0.1 | 0.2 | GO:0030242 | pexophagy(GO:0030242) |
| 0.1 | 0.3 | GO:1900736 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.1 | 0.1 | GO:0035864 | response to potassium ion(GO:0035864) |
| 0.1 | 0.3 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.1 | 0.4 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
| 0.1 | 0.1 | GO:0042536 | negative regulation of tumor necrosis factor biosynthetic process(GO:0042536) regulation of locomotion involved in locomotory behavior(GO:0090325) |
| 0.1 | 1.0 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.1 | 0.6 | GO:1904872 | regulation of telomerase RNA localization to Cajal body(GO:1904872) |
| 0.1 | 0.2 | GO:0038043 | interleukin-5-mediated signaling pathway(GO:0038043) |
| 0.1 | 4.6 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
| 0.1 | 0.2 | GO:0021577 | hindbrain structural organization(GO:0021577) cerebellum structural organization(GO:0021589) spinal cord motor neuron migration(GO:0097476) lateral motor column neuron migration(GO:0097477) |
| 0.1 | 9.0 | GO:0002431 | Fc receptor mediated stimulatory signaling pathway(GO:0002431) |
| 0.1 | 0.6 | GO:0035082 | axoneme assembly(GO:0035082) |
| 0.1 | 0.2 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.1 | 0.3 | GO:1900246 | positive regulation of RIG-I signaling pathway(GO:1900246) |
| 0.1 | 0.4 | GO:0003301 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.1 | 0.6 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
| 0.1 | 0.1 | GO:0060019 | radial glial cell differentiation(GO:0060019) |
| 0.1 | 0.5 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
| 0.1 | 0.1 | GO:0035935 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
| 0.1 | 0.8 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.1 | 0.7 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.1 | 1.9 | GO:0050830 | defense response to Gram-positive bacterium(GO:0050830) |
| 0.1 | 0.1 | GO:1901656 | glycoside transport(GO:1901656) |
| 0.1 | 0.6 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.1 | 0.2 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
| 0.1 | 0.2 | GO:0042789 | mRNA transcription(GO:0009299) mRNA transcription from RNA polymerase II promoter(GO:0042789) |
| 0.1 | 0.4 | GO:0051026 | chiasma assembly(GO:0051026) |
| 0.1 | 0.2 | GO:0071372 | cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
| 0.1 | 0.2 | GO:0010908 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) canonical Wnt signaling pathway involved in positive regulation of epithelial to mesenchymal transition(GO:0044334) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.1 | 0.2 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.1 | 0.2 | GO:0048241 | epinephrine transport(GO:0048241) |
| 0.1 | 0.6 | GO:0008340 | determination of adult lifespan(GO:0008340) |
| 0.1 | 0.8 | GO:0050855 | regulation of B cell receptor signaling pathway(GO:0050855) |
| 0.1 | 0.1 | GO:0042369 | vitamin D catabolic process(GO:0042369) |
| 0.1 | 0.1 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
| 0.1 | 0.1 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.1 | 0.2 | GO:1902723 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.1 | 0.2 | GO:0000154 | rRNA modification(GO:0000154) |
| 0.1 | 0.1 | GO:0034163 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
| 0.1 | 0.1 | GO:0090009 | primitive streak formation(GO:0090009) |
| 0.1 | 0.2 | GO:0035865 | cellular response to potassium ion(GO:0035865) |
| 0.1 | 1.5 | GO:0031055 | chromatin remodeling at centromere(GO:0031055) CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.1 | 4.8 | GO:0042742 | defense response to bacterium(GO:0042742) |
| 0.1 | 0.2 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.1 | 0.2 | GO:0045229 | cell envelope organization(GO:0043163) external encapsulating structure organization(GO:0045229) |
| 0.1 | 0.1 | GO:1901317 | regulation of sperm motility(GO:1901317) |
| 0.1 | 0.2 | GO:0060541 | respiratory system development(GO:0060541) |
| 0.1 | 0.8 | GO:0046324 | regulation of glucose import(GO:0046324) |
| 0.1 | 0.5 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
| 0.1 | 2.4 | GO:0045815 | positive regulation of gene expression, epigenetic(GO:0045815) |
| 0.1 | 0.3 | GO:0000079 | regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0000079) |
| 0.1 | 0.1 | GO:0034502 | protein localization to chromosome(GO:0034502) |
| 0.1 | 0.2 | GO:0034447 | very-low-density lipoprotein particle clearance(GO:0034447) |
| 0.1 | 0.2 | GO:0031349 | positive regulation of defense response(GO:0031349) |
| 0.1 | 0.7 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.1 | 1.0 | GO:0055078 | sodium ion homeostasis(GO:0055078) |
| 0.1 | 0.4 | GO:0007029 | endoplasmic reticulum organization(GO:0007029) |
| 0.1 | 0.5 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 0.1 | 0.2 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 0.1 | 0.1 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
| 0.1 | 0.1 | GO:0042636 | negative regulation of hair cycle(GO:0042636) |
| 0.1 | 1.0 | GO:0097186 | amelogenesis(GO:0097186) |
| 0.1 | 0.4 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
| 0.1 | 0.3 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
| 0.1 | 0.3 | GO:0010866 | regulation of triglyceride biosynthetic process(GO:0010866) |
| 0.1 | 0.1 | GO:0099525 | presynaptic dense core granule exocytosis(GO:0099525) |
| 0.1 | 0.3 | GO:0042904 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.1 | 0.1 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
| 0.1 | 0.9 | GO:0034656 | nucleobase-containing small molecule catabolic process(GO:0034656) |
| 0.1 | 0.2 | GO:0045897 | positive regulation of transcription during mitosis(GO:0045897) |
| 0.1 | 0.4 | GO:0031643 | positive regulation of myelination(GO:0031643) |
| 0.1 | 0.2 | GO:0046629 | gamma-delta T cell differentiation(GO:0042492) gamma-delta T cell activation(GO:0046629) |
| 0.1 | 1.2 | GO:0009648 | photoperiodism(GO:0009648) |
| 0.1 | 0.3 | GO:0016128 | phytosteroid metabolic process(GO:0016128) phytosteroid biosynthetic process(GO:0016129) |
| 0.1 | 0.5 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.1 | 0.1 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
| 0.1 | 0.1 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.1 | 0.3 | GO:1990035 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
| 0.1 | 0.2 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.1 | 0.4 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
| 0.1 | 0.2 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
| 0.1 | 0.7 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.1 | 0.2 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.1 | 0.2 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.1 | 0.6 | GO:0042738 | exogenous drug catabolic process(GO:0042738) |
| 0.1 | 0.2 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.1 | 0.1 | GO:1903818 | positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.1 | 0.1 | GO:0006581 | acetylcholine catabolic process in synaptic cleft(GO:0001507) acetylcholine catabolic process(GO:0006581) |
| 0.1 | 4.8 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
| 0.1 | 1.6 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
| 0.1 | 0.1 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
| 0.1 | 2.1 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
| 0.1 | 0.2 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.1 | 0.6 | GO:0003084 | positive regulation of systemic arterial blood pressure(GO:0003084) |
| 0.1 | 0.1 | GO:0035413 | positive regulation of catenin import into nucleus(GO:0035413) |
| 0.1 | 0.2 | GO:0010533 | regulation of activation of Janus kinase activity(GO:0010533) |
| 0.1 | 0.2 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 | 0.6 | GO:0070072 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.1 | 0.3 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
| 0.1 | 0.2 | GO:0035278 | miRNA mediated inhibition of translation(GO:0035278) negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
| 0.1 | 1.0 | GO:0046676 | negative regulation of insulin secretion(GO:0046676) |
| 0.1 | 0.7 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
| 0.1 | 0.1 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
| 0.1 | 0.5 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
| 0.1 | 0.4 | GO:0045002 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) double-strand break repair via single-strand annealing(GO:0045002) |
| 0.1 | 0.2 | GO:0098935 | dendritic transport(GO:0098935) anterograde dendritic transport(GO:0098937) |
| 0.1 | 0.3 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
| 0.1 | 0.4 | GO:0007631 | feeding behavior(GO:0007631) |
| 0.1 | 0.8 | GO:0071800 | podosome assembly(GO:0071800) |
| 0.1 | 0.3 | GO:1901523 | leukotriene catabolic process(GO:0036100) leukotriene B4 catabolic process(GO:0036101) leukotriene B4 metabolic process(GO:0036102) icosanoid catabolic process(GO:1901523) fatty acid derivative catabolic process(GO:1901569) |
| 0.1 | 0.7 | GO:1903955 | positive regulation of protein targeting to mitochondrion(GO:1903955) |
| 0.1 | 0.2 | GO:1903298 | regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
| 0.0 | 0.1 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 | 0.1 | GO:0002933 | lipid hydroxylation(GO:0002933) |
| 0.0 | 0.1 | GO:0002755 | MyD88-dependent toll-like receptor signaling pathway(GO:0002755) |
| 0.0 | 0.2 | GO:0018206 | peptidyl-methionine modification(GO:0018206) N-terminal protein amino acid modification(GO:0031365) |
| 0.0 | 0.2 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.0 | 3.7 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
| 0.0 | 0.1 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
| 0.0 | 0.1 | GO:0051693 | actin filament capping(GO:0051693) |
| 0.0 | 0.1 | GO:0009595 | detection of biotic stimulus(GO:0009595) |
| 0.0 | 0.2 | GO:1903644 | regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.0 | 0.1 | GO:1990089 | response to nerve growth factor(GO:1990089) cellular response to nerve growth factor stimulus(GO:1990090) |
| 0.0 | 1.1 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
| 0.0 | 0.6 | GO:0033875 | nucleoside bisphosphate metabolic process(GO:0033865) ribonucleoside bisphosphate metabolic process(GO:0033875) purine nucleoside bisphosphate metabolic process(GO:0034032) |
| 0.0 | 0.1 | GO:0010960 | magnesium ion homeostasis(GO:0010960) |
| 0.0 | 0.1 | GO:0003430 | growth plate cartilage chondrocyte growth(GO:0003430) growth plate cartilage chondrocyte development(GO:0003431) |
| 0.0 | 0.7 | GO:1990118 | sodium ion import(GO:0097369) sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.0 | 0.2 | GO:1904977 | lymphatic endothelial cell migration(GO:1904977) |
| 0.0 | 0.1 | GO:0021937 | cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
| 0.0 | 0.3 | GO:0060539 | diaphragm development(GO:0060539) |
| 0.0 | 0.4 | GO:0020027 | hemoglobin metabolic process(GO:0020027) |
| 0.0 | 0.4 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.0 | 0.1 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.0 | 0.2 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
| 0.0 | 0.2 | GO:0042159 | lipoprotein catabolic process(GO:0042159) |
| 0.0 | 0.2 | GO:0034142 | toll-like receptor 4 signaling pathway(GO:0034142) |
| 0.0 | 0.9 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
| 0.0 | 0.3 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.0 | 0.3 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.0 | 0.1 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.0 | 0.1 | GO:0060463 | lung lobe development(GO:0060462) lung lobe morphogenesis(GO:0060463) |
| 0.0 | 1.9 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.0 | 1.2 | GO:0032024 | positive regulation of insulin secretion(GO:0032024) |
| 0.0 | 0.1 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
| 0.0 | 0.3 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.0 | 0.1 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
| 0.0 | 0.0 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.0 | 0.1 | GO:1901355 | response to rapamycin(GO:1901355) |
| 0.0 | 0.1 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
| 0.0 | 0.2 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
| 0.0 | 0.0 | GO:0010266 | response to vitamin B1(GO:0010266) |
| 0.0 | 0.4 | GO:0071285 | cellular response to lithium ion(GO:0071285) |
| 0.0 | 0.1 | GO:0010763 | positive regulation of fibroblast migration(GO:0010763) |
| 0.0 | 0.5 | GO:0038092 | nodal signaling pathway(GO:0038092) |
| 0.0 | 0.4 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.0 | 0.3 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
| 0.0 | 0.8 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
| 0.0 | 0.1 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.0 | 4.1 | GO:0070268 | cornification(GO:0070268) |
| 0.0 | 0.7 | GO:0014046 | dopamine secretion(GO:0014046) regulation of dopamine secretion(GO:0014059) |
| 0.0 | 0.0 | GO:0010579 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
| 0.0 | 0.1 | GO:0043552 | positive regulation of phosphatidylinositol 3-kinase activity(GO:0043552) |
| 0.0 | 0.4 | GO:0032264 | IMP salvage(GO:0032264) |
| 0.0 | 0.3 | GO:0060430 | lung saccule development(GO:0060430) |
| 0.0 | 1.1 | GO:0033198 | response to ATP(GO:0033198) |
| 0.0 | 0.1 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
| 0.0 | 0.2 | GO:0015961 | diadenosine polyphosphate catabolic process(GO:0015961) diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
| 0.0 | 0.4 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.0 | 0.9 | GO:0048873 | homeostasis of number of cells within a tissue(GO:0048873) |
| 0.0 | 0.3 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.0 | 0.0 | GO:0031268 | pseudopodium organization(GO:0031268) |
| 0.0 | 0.2 | GO:2000567 | memory T cell activation(GO:0035709) regulation of memory T cell activation(GO:2000567) positive regulation of memory T cell activation(GO:2000568) |
| 0.0 | 1.6 | GO:0006400 | tRNA modification(GO:0006400) |
| 0.0 | 0.1 | GO:0071105 | response to interleukin-11(GO:0071105) |
| 0.0 | 0.7 | GO:0036499 | PERK-mediated unfolded protein response(GO:0036499) |
| 0.0 | 1.1 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
| 0.0 | 0.2 | GO:0044380 | protein localization to cytoskeleton(GO:0044380) |
| 0.0 | 0.2 | GO:0030220 | platelet formation(GO:0030220) |
| 0.0 | 0.2 | GO:0009125 | nucleoside monophosphate catabolic process(GO:0009125) |
| 0.0 | 0.3 | GO:0001502 | cartilage condensation(GO:0001502) |
| 0.0 | 1.5 | GO:0030219 | megakaryocyte differentiation(GO:0030219) |
| 0.0 | 1.2 | GO:0071346 | cellular response to interferon-gamma(GO:0071346) |
| 0.0 | 0.6 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.0 | 0.0 | GO:1902866 | regulation of neural retina development(GO:0061074) regulation of retina development in camera-type eye(GO:1902866) |
| 0.0 | 0.3 | GO:0006111 | regulation of gluconeogenesis(GO:0006111) |
| 0.0 | 0.1 | GO:0006428 | isoleucyl-tRNA aminoacylation(GO:0006428) |
| 0.0 | 0.3 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
| 0.0 | 1.1 | GO:0032481 | positive regulation of type I interferon production(GO:0032481) |
| 0.0 | 0.1 | GO:0006015 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.0 | 0.2 | GO:0072502 | cellular phosphate ion homeostasis(GO:0030643) cellular divalent inorganic anion homeostasis(GO:0072501) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.0 | 0.6 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.0 | 0.1 | GO:0019056 | modulation by virus of host transcription(GO:0019056) positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) modulation by symbiont of host transcription(GO:0052026) |
| 0.0 | 0.7 | GO:0008053 | mitochondrial fusion(GO:0008053) |
| 0.0 | 0.0 | GO:1901836 | regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901836) |
| 0.0 | 1.0 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
| 0.0 | 3.3 | GO:0090630 | activation of GTPase activity(GO:0090630) |
| 0.0 | 0.3 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.0 | 0.3 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.0 | 0.3 | GO:0035608 | protein deglutamylation(GO:0035608) |
| 0.0 | 0.6 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.0 | 0.1 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
| 0.0 | 0.3 | GO:0034383 | low-density lipoprotein particle clearance(GO:0034383) |
| 0.0 | 0.3 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.0 | 0.3 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 0.0 | 0.3 | GO:0090005 | negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
| 0.0 | 0.9 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
| 0.0 | 0.1 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
| 0.0 | 0.1 | GO:0050894 | determination of affect(GO:0050894) |
| 0.0 | 0.1 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) regulation of G0 to G1 transition(GO:0070316) |
| 0.0 | 0.8 | GO:0050715 | positive regulation of cytokine secretion(GO:0050715) |
| 0.0 | 0.6 | GO:0042255 | ribosome assembly(GO:0042255) |
| 0.0 | 0.3 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.0 | 0.1 | GO:0045872 | positive regulation of rhodopsin gene expression(GO:0045872) |
| 0.0 | 0.0 | GO:0006562 | proline catabolic process(GO:0006562) |
| 0.0 | 0.1 | GO:0030299 | intestinal cholesterol absorption(GO:0030299) intestinal lipid absorption(GO:0098856) |
| 0.0 | 0.1 | GO:0015917 | aminophospholipid transport(GO:0015917) |
| 0.0 | 0.1 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 0.0 | 0.2 | GO:0021892 | cerebral cortex GABAergic interneuron differentiation(GO:0021892) cerebral cortex GABAergic interneuron development(GO:0021894) GABAergic neuron differentiation(GO:0097154) |
| 0.0 | 0.2 | GO:0015874 | norepinephrine transport(GO:0015874) |
| 0.0 | 0.1 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.0 | 0.2 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.0 | 0.1 | GO:0034505 | tooth mineralization(GO:0034505) |
| 0.0 | 0.1 | GO:0098501 | polynucleotide dephosphorylation(GO:0098501) |
| 0.0 | 0.3 | GO:0060338 | regulation of type I interferon-mediated signaling pathway(GO:0060338) |
| 0.0 | 0.3 | GO:1900151 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.0 | 0.9 | GO:0007019 | microtubule depolymerization(GO:0007019) |
| 0.0 | 0.3 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.0 | 0.2 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.0 | 0.2 | GO:0019896 | axonal transport of mitochondrion(GO:0019896) |
| 0.0 | 0.9 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.0 | 0.9 | GO:1903859 | regulation of dendrite extension(GO:1903859) |
| 0.0 | 1.3 | GO:0035722 | interleukin-12-mediated signaling pathway(GO:0035722) response to interleukin-12(GO:0070671) cellular response to interleukin-12(GO:0071349) |
| 0.0 | 2.1 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.0 | 0.3 | GO:0010498 | proteasomal protein catabolic process(GO:0010498) |
| 0.0 | 0.1 | GO:0072017 | distal tubule development(GO:0072017) |
| 0.0 | 0.3 | GO:0070831 | basement membrane assembly(GO:0070831) |
| 0.0 | 0.2 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.0 | 0.4 | GO:0072673 | lamellipodium morphogenesis(GO:0072673) |
| 0.0 | 0.3 | GO:0018214 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.0 | 0.6 | GO:0006333 | chromatin assembly or disassembly(GO:0006333) |
| 0.0 | 1.1 | GO:0006198 | cAMP catabolic process(GO:0006198) |
| 0.0 | 0.2 | GO:0038044 | transforming growth factor-beta secretion(GO:0038044) |
| 0.0 | 0.5 | GO:0070262 | peptidyl-serine dephosphorylation(GO:0070262) |
| 0.0 | 0.6 | GO:0002076 | osteoblast development(GO:0002076) |
| 0.0 | 0.4 | GO:0051438 | regulation of ubiquitin-protein transferase activity(GO:0051438) |
| 0.0 | 0.1 | GO:0046968 | peptide antigen transport(GO:0046968) |
| 0.0 | 0.2 | GO:0060235 | lens induction in camera-type eye(GO:0060235) |
| 0.0 | 0.6 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.0 | 0.1 | GO:0016259 | selenocysteine metabolic process(GO:0016259) selenocysteine biosynthetic process(GO:0016260) |
| 0.0 | 0.2 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
| 0.0 | 0.1 | GO:0006004 | fucose metabolic process(GO:0006004) |
| 0.0 | 0.3 | GO:0044784 | metaphase/anaphase transition of mitotic cell cycle(GO:0007091) metaphase/anaphase transition of cell cycle(GO:0044784) |
| 0.0 | 0.0 | GO:0042222 | interleukin-1 biosynthetic process(GO:0042222) |
| 0.0 | 0.2 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
| 0.0 | 0.3 | GO:0048266 | behavioral response to pain(GO:0048266) |
| 0.0 | 0.1 | GO:0071548 | response to dexamethasone(GO:0071548) |
| 0.0 | 0.2 | GO:0021895 | cerebral cortex neuron differentiation(GO:0021895) |
| 0.0 | 0.2 | GO:0060260 | regulation of transcription initiation from RNA polymerase II promoter(GO:0060260) |
| 0.0 | 0.2 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
| 0.0 | 0.4 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
| 0.0 | 0.2 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
| 0.0 | 0.1 | GO:0060179 | male mating behavior(GO:0060179) |
| 0.0 | 0.4 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.0 | 0.6 | GO:0016254 | preassembly of GPI anchor in ER membrane(GO:0016254) |
| 0.0 | 0.2 | GO:0048484 | enteric nervous system development(GO:0048484) |
| 0.0 | 0.1 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.0 | 0.4 | GO:0051775 | response to redox state(GO:0051775) |
| 0.0 | 0.1 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) |
| 0.0 | 0.3 | GO:0010833 | telomere maintenance via telomere lengthening(GO:0010833) |
| 0.0 | 0.6 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
| 0.0 | 0.1 | GO:1903691 | positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
| 0.0 | 0.0 | GO:0014041 | regulation of neuron maturation(GO:0014041) negative regulation of neuron maturation(GO:0014043) |
| 0.0 | 0.1 | GO:0042262 | DNA protection(GO:0042262) |
| 0.0 | 0.2 | GO:1901796 | regulation of signal transduction by p53 class mediator(GO:1901796) |
| 0.0 | 0.5 | GO:0014047 | glutamate secretion(GO:0014047) |
| 0.0 | 0.1 | GO:0010529 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.0 | 0.1 | GO:0014904 | myotube cell development(GO:0014904) |
| 0.0 | 0.6 | GO:0035456 | response to interferon-beta(GO:0035456) |
| 0.0 | 0.7 | GO:0002220 | innate immune response activating cell surface receptor signaling pathway(GO:0002220) |
| 0.0 | 2.2 | GO:0060333 | interferon-gamma-mediated signaling pathway(GO:0060333) |
| 0.0 | 0.6 | GO:0042438 | melanin biosynthetic process(GO:0042438) |
| 0.0 | 0.5 | GO:0040001 | establishment of mitotic spindle localization(GO:0040001) |
| 0.0 | 0.6 | GO:0032755 | positive regulation of interleukin-6 production(GO:0032755) |
| 0.0 | 0.2 | GO:0051962 | positive regulation of nervous system development(GO:0051962) |
| 0.0 | 0.2 | GO:0060397 | JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
| 0.0 | 1.1 | GO:0061245 | establishment or maintenance of apical/basal cell polarity(GO:0035088) establishment or maintenance of epithelial cell apical/basal polarity(GO:0045197) establishment or maintenance of bipolar cell polarity(GO:0061245) |
| 0.0 | 0.1 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
| 0.0 | 0.4 | GO:0098760 | interleukin-7-mediated signaling pathway(GO:0038111) response to interleukin-7(GO:0098760) cellular response to interleukin-7(GO:0098761) |
| 0.0 | 0.9 | GO:0050852 | T cell receptor signaling pathway(GO:0050852) |
| 0.0 | 0.3 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
| 0.0 | 0.0 | GO:0010840 | regulation of circadian sleep/wake cycle, wakefulness(GO:0010840) circadian sleep/wake cycle, wakefulness(GO:0042746) |
| 0.0 | 0.4 | GO:0046686 | response to cadmium ion(GO:0046686) |
| 0.0 | 0.2 | GO:1900078 | positive regulation of cellular response to insulin stimulus(GO:1900078) |
| 0.0 | 0.1 | GO:0046689 | response to mercury ion(GO:0046689) |
| 0.0 | 0.1 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.0 | 0.3 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
| 0.0 | 0.1 | GO:0002115 | store-operated calcium entry(GO:0002115) |
| 0.0 | 1.1 | GO:1901799 | negative regulation of proteasomal protein catabolic process(GO:1901799) |
| 0.0 | 0.0 | GO:0071542 | dopaminergic neuron differentiation(GO:0071542) |
| 0.0 | 0.1 | GO:0018022 | peptidyl-lysine methylation(GO:0018022) |
| 0.0 | 0.2 | GO:0001573 | ganglioside metabolic process(GO:0001573) |
| 0.0 | 0.1 | GO:0046368 | GDP-L-fucose biosynthetic process(GO:0042350) 'de novo' GDP-L-fucose biosynthetic process(GO:0042351) GDP-L-fucose metabolic process(GO:0046368) |
| 0.0 | 0.1 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
| 0.0 | 0.0 | GO:0051024 | positive regulation of immunoglobulin secretion(GO:0051024) |
| 0.0 | 0.1 | GO:0045023 | G0 to G1 transition(GO:0045023) |
| 0.0 | 0.1 | GO:1902570 | protein localization to nucleolus(GO:1902570) |
| 0.0 | 0.1 | GO:0071315 | cellular response to morphine(GO:0071315) cellular response to isoquinoline alkaloid(GO:0071317) |
| 0.0 | 0.1 | GO:0032292 | myelination in peripheral nervous system(GO:0022011) peripheral nervous system axon ensheathment(GO:0032292) |
| 0.0 | 0.3 | GO:0043486 | histone exchange(GO:0043486) |
| 0.0 | 0.1 | GO:0017062 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.0 | 0.4 | GO:0060292 | long term synaptic depression(GO:0060292) |
| 0.0 | 2.3 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
| 0.0 | 0.1 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
| 0.0 | 0.2 | GO:0031116 | positive regulation of microtubule polymerization(GO:0031116) |
| 0.0 | 0.0 | GO:0071971 | extracellular exosome assembly(GO:0071971) regulation of extracellular exosome assembly(GO:1903551) |
| 0.0 | 0.2 | GO:0070193 | synaptonemal complex assembly(GO:0007130) synaptonemal complex organization(GO:0070193) |
| 0.0 | 0.1 | GO:0070071 | proton-transporting two-sector ATPase complex assembly(GO:0070071) |
| 0.0 | 0.3 | GO:1903363 | negative regulation of cellular protein catabolic process(GO:1903363) |
| 0.0 | 0.1 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.0 | 0.6 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
| 0.0 | 0.2 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
| 0.0 | 0.1 | GO:0007080 | mitotic metaphase plate congression(GO:0007080) |
| 0.0 | 0.3 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.0 | 0.1 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.0 | 0.0 | GO:0051181 | cofactor transport(GO:0051181) |
| 0.0 | 0.0 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) 7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
| 0.0 | 0.1 | GO:0060285 | cilium-dependent cell motility(GO:0060285) |
| 0.0 | 0.1 | GO:1904355 | positive regulation of telomere capping(GO:1904355) |
| 0.0 | 0.1 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.0 | 0.2 | GO:0051569 | regulation of histone H3-K4 methylation(GO:0051569) |
| 0.0 | 0.1 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
| 0.0 | 0.0 | GO:0016322 | neuron remodeling(GO:0016322) |
| 0.0 | 0.2 | GO:0032608 | interferon-beta production(GO:0032608) regulation of interferon-beta production(GO:0032648) |
| 0.0 | 0.8 | GO:0007050 | cell cycle arrest(GO:0007050) |
| 0.0 | 0.1 | GO:0006570 | tyrosine metabolic process(GO:0006570) |
| 0.0 | 0.1 | GO:0050853 | B cell receptor signaling pathway(GO:0050853) |
| 0.0 | 0.4 | GO:0006094 | gluconeogenesis(GO:0006094) |
| 0.0 | 0.2 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
| 0.0 | 0.1 | GO:0060644 | mammary gland epithelial cell differentiation(GO:0060644) |
| 0.0 | 0.1 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
| 0.0 | 0.1 | GO:1904589 | regulation of protein import(GO:1904589) |
| 0.0 | 0.0 | GO:0050847 | progesterone receptor signaling pathway(GO:0050847) |
| 0.0 | 0.3 | GO:0008356 | asymmetric cell division(GO:0008356) |
| 0.0 | 0.1 | GO:0034219 | carbohydrate transmembrane transport(GO:0034219) |
| 0.0 | 0.1 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.0 | 0.0 | GO:0001906 | cell killing(GO:0001906) |
| 0.0 | 0.4 | GO:0051703 | social behavior(GO:0035176) intraspecies interaction between organisms(GO:0051703) |
| 0.0 | 0.3 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.0 | 0.1 | GO:0071625 | vocalization behavior(GO:0071625) |
| 0.0 | 0.7 | GO:0007602 | phototransduction(GO:0007602) |
| 0.0 | 0.0 | GO:0010998 | regulation of translational initiation by eIF2 alpha phosphorylation(GO:0010998) evasion or tolerance of host defenses by virus(GO:0019049) avoidance of host defenses(GO:0044413) evasion or tolerance of host defenses(GO:0044415) avoidance of defenses of other organism involved in symbiotic interaction(GO:0051832) evasion or tolerance of defenses of other organism involved in symbiotic interaction(GO:0051834) |
| 0.0 | 0.1 | GO:0051028 | mRNA transport(GO:0051028) |
| 0.0 | 0.1 | GO:0060746 | maternal behavior(GO:0042711) parental behavior(GO:0060746) |
| 0.0 | 0.3 | GO:0016575 | histone deacetylation(GO:0016575) |
| 0.0 | 0.6 | GO:0046847 | filopodium assembly(GO:0046847) |
| 0.0 | 0.3 | GO:0031424 | keratinization(GO:0031424) |
| 0.0 | 0.1 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
| 0.0 | 0.1 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
| 0.0 | 0.1 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.0 | 0.1 | GO:0010771 | negative regulation of cell morphogenesis involved in differentiation(GO:0010771) |
| 0.0 | 0.1 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
| 0.0 | 0.3 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
| 0.0 | 0.1 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
| 0.0 | 0.1 | GO:0002088 | lens development in camera-type eye(GO:0002088) |
| 0.0 | 0.1 | GO:0006477 | protein sulfation(GO:0006477) |
| 0.0 | 0.1 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.0 | 0.0 | GO:2000687 | negative regulation of rubidium ion transport(GO:2000681) negative regulation of rubidium ion transmembrane transporter activity(GO:2000687) |
| 0.0 | 0.1 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.0 | 0.2 | GO:0060314 | regulation of ryanodine-sensitive calcium-release channel activity(GO:0060314) |
| 0.0 | 0.0 | GO:0043313 | regulation of neutrophil degranulation(GO:0043313) |
| 0.0 | 0.2 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.0 | 0.0 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.0 | 0.0 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
| 0.0 | 0.0 | GO:1901739 | regulation of myoblast fusion(GO:1901739) |
| 0.0 | 0.1 | GO:0070875 | positive regulation of glycogen biosynthetic process(GO:0045725) positive regulation of glycogen metabolic process(GO:0070875) |
| 0.0 | 0.1 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.0 | 0.0 | GO:0006423 | cysteinyl-tRNA aminoacylation(GO:0006423) |
| 0.0 | 0.4 | GO:0046677 | response to antibiotic(GO:0046677) |
| 0.0 | 0.1 | GO:0014072 | response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
| 0.0 | 0.0 | GO:0070781 | response to biotin(GO:0070781) |
| 0.0 | 0.3 | GO:0051782 | negative regulation of cell division(GO:0051782) |
| 0.0 | 0.1 | GO:0044364 | killing of cells of other organism(GO:0031640) disruption of cells of other organism(GO:0044364) |
| 0.0 | 0.0 | GO:1901522 | positive regulation of transcription from RNA polymerase II promoter involved in cellular response to chemical stimulus(GO:1901522) |
| 0.0 | 0.1 | GO:0006228 | UTP biosynthetic process(GO:0006228) UTP metabolic process(GO:0046051) |
| 0.0 | 0.0 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.0 | 0.1 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.0 | 0.1 | GO:0032479 | regulation of type I interferon production(GO:0032479) |
| 0.0 | 0.1 | GO:0051806 | entry into host cell(GO:0030260) entry into host(GO:0044409) entry into cell of other organism involved in symbiotic interaction(GO:0051806) entry into other organism involved in symbiotic interaction(GO:0051828) |
| 0.0 | 0.0 | GO:0002903 | negative regulation of B cell apoptotic process(GO:0002903) |
| 0.0 | 0.1 | GO:0032218 | riboflavin transport(GO:0032218) |
| 0.0 | 0.1 | GO:0060071 | Wnt signaling pathway, planar cell polarity pathway(GO:0060071) regulation of establishment of planar polarity(GO:0090175) |
| 0.0 | 0.1 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
| 0.0 | 0.1 | GO:0014898 | muscle hypertrophy in response to stress(GO:0003299) cardiac muscle adaptation(GO:0014887) cardiac muscle hypertrophy in response to stress(GO:0014898) |
| 0.0 | 0.1 | GO:0002429 | immune response-activating cell surface receptor signaling pathway(GO:0002429) |
| 0.0 | 0.0 | GO:1902075 | cellular response to salt(GO:1902075) |
| 0.0 | 0.0 | GO:2000463 | positive regulation of excitatory postsynaptic potential(GO:2000463) |
| 0.0 | 0.0 | GO:0002024 | diet induced thermogenesis(GO:0002024) |
| 0.0 | 0.3 | GO:0050919 | negative chemotaxis(GO:0050919) |
| 0.0 | 0.1 | GO:1901679 | nucleotide transmembrane transport(GO:1901679) |
| 0.0 | 0.1 | GO:0045669 | positive regulation of osteoblast differentiation(GO:0045669) |
| 0.0 | 0.0 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.0 | 0.0 | GO:0002724 | regulation of T cell cytokine production(GO:0002724) |
| 0.0 | 0.0 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
| 0.0 | 0.2 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
| 0.0 | 0.1 | GO:0060033 | anatomical structure regression(GO:0060033) |
| 0.0 | 0.1 | GO:0006777 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.0 | 0.2 | GO:0000338 | protein deneddylation(GO:0000338) |
| 0.0 | 0.0 | GO:0099566 | regulation of postsynaptic cytosolic calcium ion concentration(GO:0099566) |
| 0.0 | 0.1 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
| 0.0 | 0.0 | GO:0046541 | carbon dioxide transport(GO:0015670) saliva secretion(GO:0046541) |
| 0.0 | 0.0 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
| 0.0 | 0.1 | GO:0051769 | nitric-oxide synthase biosynthetic process(GO:0051767) regulation of nitric-oxide synthase biosynthetic process(GO:0051769) positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
| 0.0 | 0.2 | GO:0050913 | sensory perception of bitter taste(GO:0050913) |
| 0.0 | 0.0 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
| 0.0 | 0.0 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
| 0.0 | 0.0 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
| 0.0 | 0.0 | GO:0046463 | triglyceride biosynthetic process(GO:0019432) neutral lipid biosynthetic process(GO:0046460) acylglycerol biosynthetic process(GO:0046463) |
| 0.0 | 0.1 | GO:0006368 | transcription elongation from RNA polymerase II promoter(GO:0006368) |
| 0.0 | 0.0 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.0 | 0.1 | GO:0048305 | immunoglobulin secretion(GO:0048305) |
| 0.0 | 0.1 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
| 0.0 | 0.1 | GO:0007020 | microtubule nucleation(GO:0007020) |
| 0.0 | 0.0 | GO:0051552 | flavone metabolic process(GO:0051552) |
| 0.0 | 0.1 | GO:0032098 | regulation of appetite(GO:0032098) |
| 0.0 | 0.0 | GO:0006183 | GTP biosynthetic process(GO:0006183) |
| 0.0 | 1.9 | GO:0042254 | ribosome biogenesis(GO:0042254) |
| 0.0 | 0.0 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.0 | 0.1 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.0 | 0.0 | GO:0035315 | hair cell differentiation(GO:0035315) |
| 0.0 | 0.1 | GO:0010606 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.2 | 19.5 | GO:0086083 | cell adhesive protein binding involved in bundle of His cell-Purkinje myocyte communication(GO:0086083) |
| 1.1 | 3.3 | GO:0003974 | UDP-N-acetylglucosamine 4-epimerase activity(GO:0003974) UDP-glucose 4-epimerase activity(GO:0003978) |
| 1.1 | 3.2 | GO:0008859 | exoribonuclease II activity(GO:0008859) |
| 1.0 | 6.3 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
| 1.0 | 3.9 | GO:0004047 | aminomethyltransferase activity(GO:0004047) |
| 1.0 | 2.9 | GO:0052810 | 1-phosphatidylinositol-5-kinase activity(GO:0052810) |
| 0.9 | 3.8 | GO:0016784 | 3-mercaptopyruvate sulfurtransferase activity(GO:0016784) |
| 0.9 | 3.5 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.8 | 2.5 | GO:0017082 | mineralocorticoid receptor activity(GO:0017082) |
| 0.8 | 3.3 | GO:0060422 | peptidyl-dipeptidase inhibitor activity(GO:0060422) |
| 0.8 | 0.8 | GO:0045118 | azole transporter activity(GO:0045118) |
| 0.8 | 4.6 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
| 0.7 | 5.3 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.7 | 5.3 | GO:0004873 | asialoglycoprotein receptor activity(GO:0004873) |
| 0.6 | 4.5 | GO:0030369 | ICAM-3 receptor activity(GO:0030369) |
| 0.6 | 3.0 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.6 | 3.0 | GO:0004485 | methylcrotonoyl-CoA carboxylase activity(GO:0004485) |
| 0.6 | 2.4 | GO:0004998 | transferrin receptor activity(GO:0004998) |
| 0.6 | 1.8 | GO:0015234 | thiamine transmembrane transporter activity(GO:0015234) thiamine uptake transmembrane transporter activity(GO:0015403) |
| 0.6 | 3.5 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.6 | 12.0 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
| 0.6 | 30.6 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.5 | 1.6 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.5 | 1.6 | GO:0070283 | lipoate synthase activity(GO:0016992) radical SAM enzyme activity(GO:0070283) |
| 0.5 | 1.6 | GO:0016314 | phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase activity(GO:0016314) |
| 0.5 | 7.0 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.5 | 1.6 | GO:0004613 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 0.5 | 1.5 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.5 | 7.0 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.5 | 1.5 | GO:0044549 | GTP cyclohydrolase binding(GO:0044549) |
| 0.5 | 2.9 | GO:0047685 | amine sulfotransferase activity(GO:0047685) |
| 0.5 | 1.5 | GO:0047726 | nitric oxide dioxygenase activity(GO:0008941) oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of two atoms of oxygen into one donor(GO:0016708) iron-cytochrome-c reductase activity(GO:0047726) |
| 0.5 | 3.4 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.5 | 1.9 | GO:0032038 | myosin II heavy chain binding(GO:0032038) |
| 0.5 | 1.9 | GO:0015180 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
| 0.5 | 1.9 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
| 0.5 | 2.4 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.5 | 3.7 | GO:0071936 | coreceptor activity involved in Wnt signaling pathway(GO:0071936) |
| 0.5 | 1.4 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
| 0.4 | 1.3 | GO:0032551 | pyrimidine nucleoside binding(GO:0001884) UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
| 0.4 | 1.3 | GO:0031731 | CCR6 chemokine receptor binding(GO:0031731) |
| 0.4 | 2.1 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
| 0.4 | 1.3 | GO:0008426 | protein kinase C inhibitor activity(GO:0008426) |
| 0.4 | 1.3 | GO:0035403 | histone kinase activity (H3-T6 specific)(GO:0035403) |
| 0.4 | 1.2 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
| 0.4 | 3.3 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.4 | 1.2 | GO:0050613 | delta14-sterol reductase activity(GO:0050613) |
| 0.4 | 1.9 | GO:0004306 | ethanolamine-phosphate cytidylyltransferase activity(GO:0004306) |
| 0.4 | 5.3 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
| 0.4 | 1.9 | GO:0004910 | interleukin-1, Type II, blocking receptor activity(GO:0004910) |
| 0.4 | 2.2 | GO:0030492 | hemoglobin binding(GO:0030492) |
| 0.4 | 1.5 | GO:0019862 | IgA binding(GO:0019862) |
| 0.4 | 1.8 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.4 | 0.7 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
| 0.3 | 2.4 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
| 0.3 | 2.4 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
| 0.3 | 1.7 | GO:0070404 | NADH binding(GO:0070404) |
| 0.3 | 3.4 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
| 0.3 | 0.7 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
| 0.3 | 4.3 | GO:0015926 | glucosidase activity(GO:0015926) |
| 0.3 | 1.3 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.3 | 1.0 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
| 0.3 | 4.5 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.3 | 1.6 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.3 | 1.3 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.3 | 2.2 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.3 | 1.3 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 0.3 | 1.2 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
| 0.3 | 1.6 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
| 0.3 | 3.7 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.3 | 1.8 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.3 | 2.4 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.3 | 2.1 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 0.3 | 1.8 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.3 | 0.9 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.3 | 0.9 | GO:0015119 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.3 | 0.9 | GO:0051538 | 3 iron, 4 sulfur cluster binding(GO:0051538) |
| 0.3 | 0.9 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
| 0.3 | 1.1 | GO:0033981 | D-dopachrome decarboxylase activity(GO:0033981) |
| 0.3 | 2.0 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.3 | 2.8 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.3 | 1.1 | GO:0071253 | connexin binding(GO:0071253) |
| 0.3 | 3.6 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.3 | 1.1 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.3 | 1.8 | GO:0005353 | fructose transmembrane transporter activity(GO:0005353) |
| 0.3 | 1.6 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
| 0.3 | 1.3 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 0.3 | 2.8 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.2 | 0.7 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 0.2 | 2.4 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.2 | 1.4 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
| 0.2 | 1.2 | GO:0030151 | molybdenum ion binding(GO:0030151) |
| 0.2 | 0.2 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) |
| 0.2 | 4.9 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.2 | 0.9 | GO:0004657 | proline dehydrogenase activity(GO:0004657) |
| 0.2 | 1.4 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.2 | 0.7 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.2 | 0.7 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.2 | 1.4 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.2 | 3.1 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.2 | 1.6 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 0.2 | 0.7 | GO:0052593 | tryptamine:oxygen oxidoreductase (deaminating) activity(GO:0052593) aminoacetone:oxygen oxidoreductase(deaminating) activity(GO:0052594) aliphatic-amine oxidase activity(GO:0052595) phenethylamine:oxygen oxidoreductase (deaminating) activity(GO:0052596) |
| 0.2 | 1.5 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.2 | 0.7 | GO:0004347 | glucose-6-phosphate isomerase activity(GO:0004347) |
| 0.2 | 4.6 | GO:0005328 | neurotransmitter:sodium symporter activity(GO:0005328) |
| 0.2 | 3.6 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.2 | 2.4 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.2 | 1.7 | GO:0005283 | sodium:amino acid symporter activity(GO:0005283) |
| 0.2 | 0.6 | GO:0015235 | cobalamin transporter activity(GO:0015235) |
| 0.2 | 0.8 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.2 | 0.6 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
| 0.2 | 0.6 | GO:0004362 | glutathione-disulfide reductase activity(GO:0004362) |
| 0.2 | 0.6 | GO:0008534 | oxidized purine nucleobase lesion DNA N-glycosylase activity(GO:0008534) |
| 0.2 | 1.0 | GO:0052834 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.2 | 1.6 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.2 | 0.8 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
| 0.2 | 2.2 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.2 | 0.6 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.2 | 0.8 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
| 0.2 | 1.8 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.2 | 0.6 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.2 | 0.8 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
| 0.2 | 1.4 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.2 | 4.5 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.2 | 1.4 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.2 | 3.1 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.2 | 0.6 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.2 | 0.8 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.2 | 1.1 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
| 0.2 | 0.6 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.2 | 1.1 | GO:0030020 | extracellular matrix structural constituent conferring tensile strength(GO:0030020) |
| 0.2 | 1.1 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.2 | 1.1 | GO:0046979 | TAP2 binding(GO:0046979) |
| 0.2 | 0.4 | GO:0004906 | interferon-gamma receptor activity(GO:0004906) |
| 0.2 | 4.7 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.2 | 1.1 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.2 | 9.2 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.2 | 0.7 | GO:0032564 | adenyl deoxyribonucleotide binding(GO:0032558) dATP binding(GO:0032564) |
| 0.2 | 0.5 | GO:0000026 | alpha-1,2-mannosyltransferase activity(GO:0000026) |
| 0.2 | 1.6 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.2 | 0.9 | GO:0004905 | type I interferon receptor activity(GO:0004905) |
| 0.2 | 0.9 | GO:0017159 | pantetheine hydrolase activity(GO:0017159) |
| 0.2 | 1.0 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.2 | 0.7 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.2 | 1.4 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.2 | 6.8 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
| 0.2 | 2.9 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.2 | 0.8 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
| 0.2 | 0.2 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
| 0.2 | 1.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.2 | 0.8 | GO:0032395 | MHC class II receptor activity(GO:0032395) |
| 0.2 | 0.5 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.2 | 0.5 | GO:0070728 | leucine binding(GO:0070728) |
| 0.2 | 0.6 | GO:0034057 | RNA strand-exchange activity(GO:0034057) |
| 0.2 | 1.8 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.2 | 0.6 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.2 | 0.5 | GO:0034191 | apolipoprotein receptor binding(GO:0034190) apolipoprotein A-I receptor binding(GO:0034191) |
| 0.2 | 3.8 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.2 | 2.2 | GO:0003993 | acid phosphatase activity(GO:0003993) |
| 0.2 | 1.7 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.2 | 3.0 | GO:0045028 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
| 0.2 | 0.6 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
| 0.1 | 0.7 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.1 | 1.5 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.1 | 0.1 | GO:0050405 | [hydroxymethylglutaryl-CoA reductase (NADPH)] kinase activity(GO:0047322) [acetyl-CoA carboxylase] kinase activity(GO:0050405) |
| 0.1 | 0.7 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
| 0.1 | 0.9 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.1 | 3.1 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.1 | 0.9 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.1 | 0.4 | GO:0015141 | thiosulfate transmembrane transporter activity(GO:0015117) oxaloacetate transmembrane transporter activity(GO:0015131) succinate transmembrane transporter activity(GO:0015141) |
| 0.1 | 0.3 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
| 0.1 | 6.5 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
| 0.1 | 1.0 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.1 | 0.7 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.1 | 0.6 | GO:0016639 | oxidoreductase activity, acting on the CH-NH2 group of donors, NAD or NADP as acceptor(GO:0016639) |
| 0.1 | 0.4 | GO:0047150 | betaine-homocysteine S-methyltransferase activity(GO:0047150) |
| 0.1 | 1.0 | GO:0042978 | ornithine decarboxylase activator activity(GO:0042978) |
| 0.1 | 0.4 | GO:0097259 | tocopherol omega-hydroxylase activity(GO:0052870) alpha-tocopherol omega-hydroxylase activity(GO:0052871) 20-hydroxy-leukotriene B4 omega oxidase activity(GO:0097258) 20-aldehyde-leukotriene B4 20-monooxygenase activity(GO:0097259) |
| 0.1 | 0.3 | GO:0001129 | RNA polymerase II transcription factor activity, TBP-class protein binding, involved in preinitiation complex assembly(GO:0001129) RNA polymerase II transcription factor activity, TBP-class protein binding(GO:0001132) |
| 0.1 | 5.4 | GO:0050699 | WW domain binding(GO:0050699) |
| 0.1 | 0.8 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.1 | 0.6 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) |
| 0.1 | 0.4 | GO:1990404 | protein ADP-ribosylase activity(GO:1990404) |
| 0.1 | 0.5 | GO:0005471 | ATP:ADP antiporter activity(GO:0005471) adenine transmembrane transporter activity(GO:0015207) |
| 0.1 | 1.4 | GO:0010181 | FMN binding(GO:0010181) |
| 0.1 | 0.6 | GO:0070905 | serine binding(GO:0070905) |
| 0.1 | 0.8 | GO:0036310 | annealing helicase activity(GO:0036310) |
| 0.1 | 0.5 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
| 0.1 | 1.5 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 0.1 | 5.0 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
| 0.1 | 0.4 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.1 | 0.4 | GO:0030272 | 5-formyltetrahydrofolate cyclo-ligase activity(GO:0030272) |
| 0.1 | 0.5 | GO:0032810 | sterol response element binding(GO:0032810) |
| 0.1 | 0.5 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.1 | 0.6 | GO:0005152 | interleukin-1 receptor antagonist activity(GO:0005152) |
| 0.1 | 2.2 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.1 | 0.2 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
| 0.1 | 0.9 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.1 | 0.2 | GO:0015275 | stretch-activated, cation-selective, calcium channel activity(GO:0015275) |
| 0.1 | 0.4 | GO:0005260 | channel-conductance-controlling ATPase activity(GO:0005260) |
| 0.1 | 0.7 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.1 | 0.9 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
| 0.1 | 9.6 | GO:0030165 | PDZ domain binding(GO:0030165) |
| 0.1 | 0.1 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
| 0.1 | 1.3 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.1 | 0.3 | GO:0004119 | cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) |
| 0.1 | 1.8 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.1 | 0.9 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.1 | 0.8 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.1 | 0.8 | GO:0050694 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.1 | 0.5 | GO:0047298 | 4-aminobutyrate transaminase activity(GO:0003867) succinate-semialdehyde dehydrogenase binding(GO:0032145) (S)-3-amino-2-methylpropionate transaminase activity(GO:0047298) |
| 0.1 | 5.2 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.1 | 3.3 | GO:0001848 | complement binding(GO:0001848) |
| 0.1 | 0.2 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.1 | 0.6 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.1 | 0.7 | GO:0023030 | MHC class Ib protein complex binding(GO:0023025) MHC class Ib protein binding, via antigen binding groove(GO:0023030) |
| 0.1 | 1.2 | GO:0035004 | phosphatidylinositol 3-kinase activity(GO:0035004) |
| 0.1 | 0.6 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.1 | 0.3 | GO:0004819 | glutamine-tRNA ligase activity(GO:0004819) |
| 0.1 | 1.5 | GO:0016594 | glycine binding(GO:0016594) |
| 0.1 | 1.7 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.1 | 1.2 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.1 | 0.4 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
| 0.1 | 1.2 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.1 | 1.7 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.1 | 0.3 | GO:0004775 | succinate-CoA ligase (ADP-forming) activity(GO:0004775) |
| 0.1 | 1.8 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.1 | 0.4 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.1 | 0.3 | GO:0016454 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
| 0.1 | 0.4 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.1 | 0.6 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.1 | 0.6 | GO:0004331 | 6-phosphofructo-2-kinase activity(GO:0003873) fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.1 | 0.5 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
| 0.1 | 0.3 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.1 | 3.9 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.1 | 0.5 | GO:0010465 | nerve growth factor receptor activity(GO:0010465) |
| 0.1 | 1.2 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.1 | 0.5 | GO:0004815 | aspartate-tRNA ligase activity(GO:0004815) |
| 0.1 | 1.2 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.1 | 0.3 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
| 0.1 | 0.5 | GO:0004368 | glycerol-3-phosphate dehydrogenase activity(GO:0004368) oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
| 0.1 | 0.3 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
| 0.1 | 0.4 | GO:0003990 | acetylcholinesterase activity(GO:0003990) |
| 0.1 | 0.4 | GO:0051996 | farnesyl-diphosphate farnesyltransferase activity(GO:0004310) squalene synthase activity(GO:0051996) |
| 0.1 | 0.7 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.1 | 1.0 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.1 | 1.2 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
| 0.1 | 1.9 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
| 0.1 | 1.0 | GO:0030883 | lipid antigen binding(GO:0030882) endogenous lipid antigen binding(GO:0030883) exogenous lipid antigen binding(GO:0030884) |
| 0.1 | 1.1 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.1 | 3.0 | GO:0042605 | peptide antigen binding(GO:0042605) |
| 0.1 | 0.5 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.1 | 0.2 | GO:0070546 | L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.1 | 1.6 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.1 | 0.5 | GO:0070008 | serine-type carboxypeptidase activity(GO:0004185) serine-type exopeptidase activity(GO:0070008) |
| 0.1 | 0.6 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.1 | 0.3 | GO:0004951 | cholecystokinin receptor activity(GO:0004951) |
| 0.1 | 0.3 | GO:0003863 | alpha-ketoacid dehydrogenase activity(GO:0003826) 3-methyl-2-oxobutanoate dehydrogenase (2-methylpropanoyl-transferring) activity(GO:0003863) |
| 0.1 | 0.3 | GO:0030627 | pre-mRNA 5'-splice site binding(GO:0030627) |
| 0.1 | 1.9 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.1 | 1.1 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.1 | 1.9 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.1 | 0.3 | GO:0045155 | electron transporter, transferring electrons from CoQH2-cytochrome c reductase complex and cytochrome c oxidase complex activity(GO:0045155) |
| 0.1 | 0.3 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.1 | 0.3 | GO:0005333 | norepinephrine transmembrane transporter activity(GO:0005333) |
| 0.1 | 0.4 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 0.1 | 1.2 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.1 | 0.3 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 0.1 | 1.8 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.1 | 0.6 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.1 | 0.5 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
| 0.1 | 0.7 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.1 | 0.3 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.1 | 0.2 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.1 | 0.4 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.1 | 0.2 | GO:0032090 | Pyrin domain binding(GO:0032090) |
| 0.1 | 2.1 | GO:0050664 | oxidoreductase activity, acting on NAD(P)H, oxygen as acceptor(GO:0050664) |
| 0.1 | 0.2 | GO:0031177 | phosphopantetheine binding(GO:0031177) |
| 0.1 | 1.9 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.1 | 0.4 | GO:0055104 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.1 | 2.0 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.1 | 1.4 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.1 | 0.5 | GO:1903135 | cupric ion binding(GO:1903135) |
| 0.1 | 0.2 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.1 | 0.7 | GO:0031628 | opioid receptor binding(GO:0031628) |
| 0.1 | 0.2 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.1 | 0.3 | GO:0015350 | reduced folate carrier activity(GO:0008518) methotrexate transporter activity(GO:0015350) |
| 0.1 | 0.5 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.1 | 1.0 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
| 0.1 | 0.5 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.1 | 1.6 | GO:0015278 | calcium-release channel activity(GO:0015278) ligand-gated calcium channel activity(GO:0099604) |
| 0.1 | 3.3 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.1 | 0.8 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.1 | 0.2 | GO:0030984 | kininogen binding(GO:0030984) |
| 0.1 | 1.6 | GO:0031005 | filamin binding(GO:0031005) |
| 0.1 | 0.1 | GO:0005174 | CD40 receptor binding(GO:0005174) |
| 0.1 | 0.9 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.1 | 0.4 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.1 | 0.6 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.1 | 0.2 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
| 0.1 | 1.0 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
| 0.1 | 0.4 | GO:0004525 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
| 0.1 | 1.1 | GO:0044213 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) intronic transcription regulatory region DNA binding(GO:0044213) |
| 0.1 | 0.8 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.1 | 1.6 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.1 | 5.8 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
| 0.1 | 0.4 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.1 | 0.1 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.1 | 1.0 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
| 0.1 | 0.3 | GO:0035473 | lipase binding(GO:0035473) |
| 0.1 | 0.1 | GO:0042903 | tubulin deacetylase activity(GO:0042903) |
| 0.1 | 0.6 | GO:0015385 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
| 0.1 | 0.7 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.1 | 1.0 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.1 | 1.2 | GO:0005355 | glucose transmembrane transporter activity(GO:0005355) |
| 0.1 | 0.3 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 0.1 | 0.6 | GO:0042608 | T cell receptor binding(GO:0042608) |
| 0.1 | 2.6 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.1 | 1.0 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.1 | 0.1 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
| 0.1 | 0.1 | GO:0030371 | translation repressor activity(GO:0030371) |
| 0.1 | 0.5 | GO:0019158 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.1 | 0.7 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.1 | 0.2 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.1 | 0.3 | GO:0042019 | interleukin-23 binding(GO:0042019) interleukin-23 receptor activity(GO:0042020) |
| 0.1 | 0.5 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.1 | 1.5 | GO:0070403 | NAD+ binding(GO:0070403) |
| 0.1 | 0.8 | GO:0030247 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.1 | 0.3 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.1 | 1.1 | GO:0008320 | protein transmembrane transporter activity(GO:0008320) |
| 0.1 | 0.5 | GO:0043426 | MRF binding(GO:0043426) |
| 0.1 | 0.3 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.1 | 1.7 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.1 | 2.1 | GO:0005158 | insulin receptor binding(GO:0005158) |
| 0.1 | 0.2 | GO:0004914 | interleukin-5 receptor activity(GO:0004914) |
| 0.1 | 0.3 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
| 0.1 | 0.5 | GO:0019863 | IgE binding(GO:0019863) |
| 0.1 | 1.1 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
| 0.1 | 0.4 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.1 | 1.2 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.1 | 0.3 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.1 | 0.3 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) |
| 0.1 | 0.2 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.1 | 0.6 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
| 0.1 | 0.4 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.1 | 1.0 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.1 | 2.4 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.1 | 1.5 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.1 | 0.6 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.1 | 1.1 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
| 0.1 | 0.3 | GO:0019798 | procollagen-proline 4-dioxygenase activity(GO:0004656) procollagen-proline dioxygenase activity(GO:0019798) |
| 0.1 | 0.2 | GO:0016434 | rRNA (cytosine) methyltransferase activity(GO:0016434) |
| 0.1 | 0.9 | GO:0019843 | rRNA binding(GO:0019843) |
| 0.1 | 0.2 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.1 | 0.4 | GO:0008649 | rRNA methyltransferase activity(GO:0008649) |
| 0.1 | 0.1 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.1 | 0.7 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
| 0.1 | 0.6 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
| 0.1 | 0.5 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.1 | 0.2 | GO:0004963 | follicle-stimulating hormone receptor activity(GO:0004963) |
| 0.1 | 0.2 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.1 | 0.7 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.1 | 1.5 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.1 | 0.2 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.1 | 1.0 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.1 | 1.8 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.1 | 0.2 | GO:0098809 | cystathionine beta-synthase activity(GO:0004122) oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) nitrite reductase (NO-forming) activity(GO:0050421) carbon monoxide binding(GO:0070025) nitrite reductase activity(GO:0098809) |
| 0.1 | 0.1 | GO:0005326 | neurotransmitter transporter activity(GO:0005326) |
| 0.1 | 0.4 | GO:0016416 | O-palmitoyltransferase activity(GO:0016416) |
| 0.1 | 0.9 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.1 | 0.3 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.1 | 0.2 | GO:0038025 | reelin receptor activity(GO:0038025) |
| 0.1 | 0.4 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
| 0.1 | 1.1 | GO:0051183 | vitamin transporter activity(GO:0051183) |
| 0.1 | 0.2 | GO:0004040 | amidase activity(GO:0004040) |
| 0.1 | 0.1 | GO:0005026 | transforming growth factor beta receptor activity, type II(GO:0005026) |
| 0.1 | 0.5 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.1 | 0.2 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.1 | 0.2 | GO:0032093 | SAM domain binding(GO:0032093) |
| 0.1 | 0.4 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.1 | 0.7 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.1 | 2.8 | GO:0005518 | collagen binding(GO:0005518) |
| 0.1 | 1.0 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.1 | 0.2 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.1 | 5.0 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.1 | 2.3 | GO:0008374 | O-acyltransferase activity(GO:0008374) |
| 0.1 | 0.2 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.1 | 0.1 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.1 | 0.7 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.1 | 0.2 | GO:0003968 | RNA-directed RNA polymerase activity(GO:0003968) |
| 0.1 | 0.3 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.1 | 0.2 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.1 | 0.3 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.1 | 1.2 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.1 | 1.5 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
| 0.1 | 0.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.1 | 0.1 | GO:0019981 | interleukin-6 receptor activity(GO:0004915) interleukin-6 binding(GO:0019981) |
| 0.1 | 0.1 | GO:0034618 | arginine binding(GO:0034618) |
| 0.1 | 0.5 | GO:0034483 | heparan sulfate sulfotransferase activity(GO:0034483) |
| 0.1 | 0.2 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.1 | 0.2 | GO:0046404 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.1 | 5.0 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.1 | 0.5 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.1 | 0.5 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.1 | 0.8 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.0 | 0.2 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.0 | 0.2 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
| 0.0 | 0.2 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.0 | 0.0 | GO:0005310 | dicarboxylic acid transmembrane transporter activity(GO:0005310) |
| 0.0 | 0.4 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.0 | 3.5 | GO:0019003 | GDP binding(GO:0019003) |
| 0.0 | 1.3 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
| 0.0 | 1.0 | GO:0042166 | acetylcholine binding(GO:0042166) |
| 0.0 | 0.2 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
| 0.0 | 0.2 | GO:0098960 | postsynaptic neurotransmitter receptor activity(GO:0098960) neurotransmitter receptor activity involved in regulation of postsynaptic cytosolic calcium ion concentration(GO:0099583) |
| 0.0 | 1.0 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
| 0.0 | 0.4 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.0 | 2.4 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.0 | 0.2 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 0.0 | 0.3 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
| 0.0 | 1.8 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.0 | 0.1 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
| 0.0 | 0.3 | GO:0004844 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
| 0.0 | 0.5 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.0 | 0.3 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
| 0.0 | 0.1 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
| 0.0 | 0.2 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.0 | 0.1 | GO:0046573 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 0.0 | 0.2 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 0.0 | 0.2 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.0 | 1.1 | GO:0031420 | alkali metal ion binding(GO:0031420) |
| 0.0 | 4.0 | GO:0003727 | single-stranded RNA binding(GO:0003727) |
| 0.0 | 0.1 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
| 0.0 | 0.1 | GO:0052895 | norspermine:oxygen oxidoreductase activity(GO:0052894) N1-acetylspermine:oxygen oxidoreductase (N1-acetylspermidine-forming) activity(GO:0052895) |
| 0.0 | 0.2 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
| 0.0 | 0.0 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.0 | 0.3 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
| 0.0 | 0.1 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.0 | 0.1 | GO:0034584 | piRNA binding(GO:0034584) |
| 0.0 | 3.1 | GO:0001071 | nucleic acid binding transcription factor activity(GO:0001071) transcription factor activity, sequence-specific DNA binding(GO:0003700) |
| 0.0 | 0.3 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
| 0.0 | 0.2 | GO:0016402 | pristanoyl-CoA oxidase activity(GO:0016402) |
| 0.0 | 0.3 | GO:0050682 | AF-2 domain binding(GO:0050682) |
| 0.0 | 0.6 | GO:0016878 | acid-thiol ligase activity(GO:0016878) |
| 0.0 | 3.3 | GO:0008026 | ATP-dependent helicase activity(GO:0008026) purine NTP-dependent helicase activity(GO:0070035) |
| 0.0 | 0.7 | GO:0016769 | transferase activity, transferring nitrogenous groups(GO:0016769) |
| 0.0 | 0.1 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.0 | 0.4 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.0 | 0.3 | GO:0001225 | RNA polymerase II transcription coactivator binding(GO:0001225) |
| 0.0 | 0.2 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.0 | 0.8 | GO:0070034 | telomerase RNA binding(GO:0070034) |
| 0.0 | 0.2 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.0 | 0.2 | GO:0052844 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) inositol diphosphate tetrakisphosphate diphosphatase activity(GO:0052840) inositol bisdiphosphate tetrakisphosphate diphosphatase activity(GO:0052841) inositol diphosphate pentakisphosphate diphosphatase activity(GO:0052842) inositol-1-diphosphate-2,3,4,5,6-pentakisphosphate diphosphatase activity(GO:0052843) inositol-3-diphosphate-1,2,4,5,6-pentakisphosphate diphosphatase activity(GO:0052844) inositol-5-diphosphate-1,2,3,4,6-pentakisphosphate diphosphatase activity(GO:0052845) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 1-diphosphatase activity(GO:0052846) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052847) inositol-3,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052848) |
| 0.0 | 0.2 | GO:0015056 | corticotrophin-releasing factor receptor activity(GO:0015056) |
| 0.0 | 0.3 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.0 | 0.1 | GO:0001098 | basal transcription machinery binding(GO:0001098) basal RNA polymerase II transcription machinery binding(GO:0001099) |
| 0.0 | 0.2 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.0 | 0.1 | GO:0004822 | isoleucine-tRNA ligase activity(GO:0004822) |
| 0.0 | 0.5 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.0 | 0.3 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.0 | 0.7 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.0 | 0.2 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 0.0 | 0.3 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
| 0.0 | 0.1 | GO:0043121 | neurotrophin binding(GO:0043121) |
| 0.0 | 0.2 | GO:0033613 | activating transcription factor binding(GO:0033613) |
| 0.0 | 0.8 | GO:0005123 | death receptor binding(GO:0005123) |
| 0.0 | 0.9 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) |
| 0.0 | 0.7 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.0 | 0.2 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.0 | 0.3 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
| 0.0 | 0.4 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.0 | 0.8 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.0 | 0.1 | GO:0047493 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
| 0.0 | 0.2 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 0.0 | 0.1 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) |
| 0.0 | 0.5 | GO:0036459 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
| 0.0 | 0.6 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.0 | 0.1 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.0 | 2.2 | GO:0000980 | RNA polymerase II distal enhancer sequence-specific DNA binding(GO:0000980) |
| 0.0 | 0.2 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
| 0.0 | 0.2 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.0 | 0.1 | GO:0051916 | granulocyte colony-stimulating factor binding(GO:0051916) |
| 0.0 | 0.1 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.0 | 0.8 | GO:0030170 | pyridoxal phosphate binding(GO:0030170) |
| 0.0 | 0.8 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
| 0.0 | 0.3 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.0 | 0.3 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.0 | 0.9 | GO:0008080 | N-acetyltransferase activity(GO:0008080) |
| 0.0 | 0.2 | GO:0043225 | anion transmembrane-transporting ATPase activity(GO:0043225) |
| 0.0 | 0.1 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
| 0.0 | 0.2 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.0 | 0.2 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
| 0.0 | 0.5 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
| 0.0 | 0.9 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
| 0.0 | 0.2 | GO:0000403 | Y-form DNA binding(GO:0000403) |
| 0.0 | 0.6 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.0 | 0.3 | GO:0015464 | acetylcholine receptor activity(GO:0015464) |
| 0.0 | 0.3 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
| 0.0 | 0.3 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.0 | 0.1 | GO:0016781 | selenide, water dikinase activity(GO:0004756) phosphotransferase activity, paired acceptors(GO:0016781) |
| 0.0 | 0.7 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.0 | 0.9 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.0 | 0.4 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.0 | 0.3 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.0 | 0.1 | GO:0032052 | bile acid binding(GO:0032052) |
| 0.0 | 0.3 | GO:1905030 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
| 0.0 | 0.1 | GO:0047374 | methylumbelliferyl-acetate deacetylase activity(GO:0047374) |
| 0.0 | 0.1 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.0 | 0.9 | GO:0031491 | nucleosome binding(GO:0031491) |
| 0.0 | 0.1 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.0 | 1.0 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.2 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
| 0.0 | 0.4 | GO:0004659 | prenyltransferase activity(GO:0004659) |
| 0.0 | 0.1 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.0 | 0.4 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.0 | 0.1 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 0.0 | 1.2 | GO:0019213 | deacetylase activity(GO:0019213) |
| 0.0 | 0.2 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.0 | 0.1 | GO:0016635 | succinate dehydrogenase (ubiquinone) activity(GO:0008177) oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
| 0.0 | 0.2 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.0 | 0.1 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
| 0.0 | 0.2 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.0 | 0.1 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
| 0.0 | 0.4 | GO:0016814 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amidines(GO:0016814) |
| 0.0 | 1.6 | GO:0015108 | chloride transmembrane transporter activity(GO:0015108) |
| 0.0 | 0.9 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.0 | 0.1 | GO:0070576 | vitamin D 24-hydroxylase activity(GO:0070576) |
| 0.0 | 0.1 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.0 | 0.1 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.0 | 0.1 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.0 | 0.1 | GO:0090556 | apolipoprotein A-I receptor activity(GO:0034188) phosphatidylserine-translocating ATPase activity(GO:0090556) |
| 0.0 | 0.2 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.0 | 0.1 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) |
| 0.0 | 0.1 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
| 0.0 | 0.1 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.0 | 5.0 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.2 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.0 | 0.1 | GO:0050693 | LBD domain binding(GO:0050693) |
| 0.0 | 0.1 | GO:0099609 | microtubule lateral binding(GO:0099609) |
| 0.0 | 0.4 | GO:0005537 | mannose binding(GO:0005537) |
| 0.0 | 1.1 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
| 0.0 | 0.1 | GO:0098988 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) G-protein coupled glutamate receptor activity(GO:0098988) |
| 0.0 | 0.2 | GO:0005057 | receptor signaling protein activity(GO:0005057) |
| 0.0 | 0.2 | GO:0097110 | scaffold protein binding(GO:0097110) |
| 0.0 | 0.3 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.0 | 0.3 | GO:0019864 | IgG binding(GO:0019864) |
| 0.0 | 0.4 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
| 0.0 | 0.1 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 0.0 | 0.1 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
| 0.0 | 3.4 | GO:0004721 | phosphoprotein phosphatase activity(GO:0004721) |
| 0.0 | 0.2 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.0 | 0.1 | GO:0003916 | DNA topoisomerase activity(GO:0003916) DNA topoisomerase type I activity(GO:0003917) |
| 0.0 | 1.4 | GO:0042826 | histone deacetylase binding(GO:0042826) |
| 0.0 | 0.1 | GO:0004883 | glucocorticoid receptor activity(GO:0004883) glucocorticoid-activated RNA polymerase II transcription factor binding transcription factor activity(GO:0038051) |
| 0.0 | 0.3 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.0 | 0.1 | GO:0016775 | creatine kinase activity(GO:0004111) phosphotransferase activity, nitrogenous group as acceptor(GO:0016775) |
| 0.0 | 0.1 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
| 0.0 | 0.2 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
| 0.0 | 0.5 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
| 0.0 | 0.1 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
| 0.0 | 0.1 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
| 0.0 | 0.2 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.0 | 0.1 | GO:0023024 | MHC class I protein complex binding(GO:0023024) |
| 0.0 | 0.1 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
| 0.0 | 0.2 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.0 | 0.1 | GO:0051184 | cofactor transporter activity(GO:0051184) |
| 0.0 | 1.9 | GO:0017124 | SH3 domain binding(GO:0017124) |
| 0.0 | 0.4 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
| 0.0 | 0.1 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.0 | 0.3 | GO:0008392 | arachidonic acid monooxygenase activity(GO:0008391) arachidonic acid epoxygenase activity(GO:0008392) |
| 0.0 | 0.1 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
| 0.0 | 0.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.0 | 0.2 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.0 | 0.4 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.0 | 0.2 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
| 0.0 | 0.0 | GO:0071949 | FAD binding(GO:0071949) |
| 0.0 | 0.1 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
| 0.0 | 0.4 | GO:0003951 | NAD+ kinase activity(GO:0003951) |
| 0.0 | 0.7 | GO:0042805 | actinin binding(GO:0042805) |
| 0.0 | 0.3 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) DNA polymerase activity(GO:0034061) |
| 0.0 | 0.2 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 0.0 | 0.1 | GO:0016004 | phospholipase activator activity(GO:0016004) lipase activator activity(GO:0060229) |
| 0.0 | 0.1 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.0 | 0.0 | GO:0001596 | angiotensin type I receptor activity(GO:0001596) |
| 0.0 | 0.3 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.0 | 0.1 | GO:0042834 | peptidoglycan binding(GO:0042834) |
| 0.0 | 0.1 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
| 0.0 | 0.0 | GO:0003881 | CDP-diacylglycerol-inositol 3-phosphatidyltransferase activity(GO:0003881) |
| 0.0 | 0.1 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.0 | 0.2 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
| 0.0 | 0.0 | GO:0004817 | cysteine-tRNA ligase activity(GO:0004817) |
| 0.0 | 0.0 | GO:0008061 | chitinase activity(GO:0004568) chitin binding(GO:0008061) |
| 0.0 | 0.1 | GO:0045569 | TRAIL binding(GO:0045569) |
| 0.0 | 0.1 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
| 0.0 | 0.0 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.0 | 0.0 | GO:0005124 | scavenger receptor binding(GO:0005124) |
| 0.0 | 0.1 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) 3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-enoyl-CoA hydratase activity(GO:0033989) 17-beta-hydroxysteroid dehydrogenase (NAD+) activity(GO:0044594) |
| 0.0 | 0.1 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
| 0.0 | 0.0 | GO:0015144 | carbohydrate transmembrane transporter activity(GO:0015144) carbohydrate transporter activity(GO:1901476) |
| 0.0 | 0.1 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 0.2 | GO:0004065 | arylsulfatase activity(GO:0004065) |
| 0.0 | 0.0 | GO:0047275 | glucosaminylgalactosylglucosylceramide beta-galactosyltransferase activity(GO:0047275) |
| 0.0 | 0.4 | GO:0043621 | protein self-association(GO:0043621) |
| 0.0 | 0.0 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.1 | GO:0089720 | caspase binding(GO:0089720) |
| 0.0 | 0.1 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.0 | 0.1 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.0 | 0.5 | GO:0042393 | histone binding(GO:0042393) |
| 0.0 | 0.1 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.0 | 0.1 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.0 | 0.1 | GO:0032393 | MHC class I receptor activity(GO:0032393) |
| 0.0 | 0.5 | GO:0004519 | endonuclease activity(GO:0004519) |
| 0.0 | 0.2 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
| 0.0 | 0.0 | GO:0004958 | prostaglandin F receptor activity(GO:0004958) |
| 0.0 | 0.0 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
| 0.0 | 0.1 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.0 | 0.0 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.0 | 0.2 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.0 | 0.4 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.0 | 0.0 | GO:0047066 | phospholipid-hydroperoxide glutathione peroxidase activity(GO:0047066) |
| 0.0 | 0.2 | GO:0016303 | 1-phosphatidylinositol-3-kinase activity(GO:0016303) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.1 | 2.1 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.3 | 0.5 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.2 | 2.7 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
| 0.2 | 7.3 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.2 | 8.0 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.2 | 15.8 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.2 | 14.9 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.2 | 0.8 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.2 | 3.7 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.2 | 2.5 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.2 | 0.7 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
| 0.2 | 1.0 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.2 | 5.1 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.2 | 9.1 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.2 | 1.6 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.2 | 12.2 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| 0.1 | 2.9 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.1 | 0.6 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.1 | 2.7 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.1 | 0.7 | PID EPO PATHWAY | EPO signaling pathway |
| 0.1 | 2.2 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.1 | 4.0 | PID IGF1 PATHWAY | IGF1 pathway |
| 0.1 | 0.8 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
| 0.1 | 2.8 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.1 | 2.4 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.1 | 0.8 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.1 | 4.2 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.1 | 2.5 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.1 | 2.5 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.1 | 6.3 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.1 | 1.8 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.1 | 1.1 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
| 0.1 | 2.7 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.1 | 0.5 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.1 | 3.4 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.1 | 2.4 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.1 | 3.7 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.1 | 4.6 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.1 | 2.2 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.1 | 4.2 | PID ATR PATHWAY | ATR signaling pathway |
| 0.1 | 3.9 | PID FOXO PATHWAY | FoxO family signaling |
| 0.1 | 1.4 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.1 | 1.5 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.1 | 2.9 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.1 | 0.6 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.1 | 2.2 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.1 | 3.7 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.1 | 6.1 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.1 | 1.9 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.1 | 2.0 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
| 0.1 | 3.4 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.1 | 0.3 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.1 | 0.1 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.1 | 1.7 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.1 | 0.7 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.1 | 2.1 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.1 | 0.2 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.1 | 0.8 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
| 0.1 | 0.9 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
| 0.1 | 1.3 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.1 | 0.2 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.1 | 0.1 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
| 0.1 | 0.7 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.1 | 1.2 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
| 0.1 | 0.2 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.1 | 0.8 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.1 | 1.7 | PID FGF PATHWAY | FGF signaling pathway |
| 0.1 | 0.6 | PID RAS PATHWAY | Regulation of Ras family activation |
| 0.0 | 1.1 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.0 | 1.9 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.0 | 0.6 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
| 0.0 | 0.9 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 0.0 | 3.6 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.0 | 2.7 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.0 | 2.2 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
| 0.0 | 0.4 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.0 | 0.4 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.0 | 0.3 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.0 | 0.5 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.0 | 1.6 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.0 | 0.2 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.0 | 0.2 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.0 | 0.8 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.0 | 0.5 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.0 | 0.5 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
| 0.0 | 0.2 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.0 | 0.6 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 0.6 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.0 | 0.1 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.0 | 0.1 | ST STAT3 PATHWAY | STAT3 Pathway |
| 0.0 | 0.4 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.0 | 0.6 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
| 0.0 | 1.0 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.0 | 0.1 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.0 | 0.3 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 0.8 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.0 | 0.5 | PID ATM PATHWAY | ATM pathway |
| 0.0 | 0.1 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.0 | 1.5 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 0.2 | PID NOTCH PATHWAY | Notch signaling pathway |
| 0.0 | 0.1 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.0 | 0.9 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.0 | 0.4 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.0 | 0.8 | PID E2F PATHWAY | E2F transcription factor network |
| 0.0 | 0.5 | PID P73PATHWAY | p73 transcription factor network |
| 0.0 | 0.1 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.0 | 0.0 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.0 | 0.3 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.0 | 0.3 | PID AP1 PATHWAY | AP-1 transcription factor network |