ENCODE cell lines, expression (Ernst 2011)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
MAZ
|
ENSG00000103495.9 | MAZ |
|
ZNF281
|
ENSG00000162702.7 | ZNF281 |
|
GTF2F1
|
ENSG00000125651.9 | GTF2F1 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| ZNF281 | hg19_v2_chr1_-_200379129_200379174, hg19_v2_chr1_-_200379180_200379191, hg19_v2_chr1_-_200379104_200379128 | 0.51 | 4.3e-02 | Click! |
| MAZ | hg19_v2_chr16_+_29818857_29819023 | 0.42 | 1.0e-01 | Click! |
| GTF2F1 | hg19_v2_chr19_-_6393465_6393479 | 0.38 | 1.5e-01 | Click! |
| Promoter | Score | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr7_+_94023873 | 6.38 |
ENST00000297268.6 |
COL1A2 |
collagen, type I, alpha 2 |
| chr21_-_28338732 | 4.17 |
ENST00000284987.5 |
ADAMTS5 |
ADAM metallopeptidase with thrombospondin type 1 motif, 5 |
| chr1_-_103574024 | 3.49 |
ENST00000512756.1 ENST00000370096.3 ENST00000358392.2 ENST00000353414.4 |
COL11A1 |
collagen, type XI, alpha 1 |
| chr10_+_31608054 | 3.40 |
ENST00000320985.10 ENST00000361642.5 ENST00000560721.2 ENST00000558440.1 ENST00000424869.1 ENST00000542815.3 |
ZEB1 |
zinc finger E-box binding homeobox 1 |
| chr2_+_5832799 | 3.29 |
ENST00000322002.3 |
SOX11 |
SRY (sex determining region Y)-box 11 |
| chr1_-_32801825 | 3.29 |
ENST00000329421.7 |
MARCKSL1 |
MARCKS-like 1 |
| chr2_-_200322723 | 3.21 |
ENST00000417098.1 |
SATB2 |
SATB homeobox 2 |
| chr11_-_111783595 | 3.16 |
ENST00000528628.1 |
CRYAB |
crystallin, alpha B |
| chr3_+_154797428 | 3.14 |
ENST00000460393.1 |
MME |
membrane metallo-endopeptidase |
| chr5_-_88179302 | 3.14 |
ENST00000504921.2 |
MEF2C |
myocyte enhancer factor 2C |
| chr2_-_145275228 | 2.96 |
ENST00000427902.1 ENST00000409487.3 ENST00000470879.1 ENST00000435831.1 |
ZEB2 |
zinc finger E-box binding homeobox 2 |
| chr7_-_150675372 | 2.94 |
ENST00000262186.5 |
KCNH2 |
potassium voltage-gated channel, subfamily H (eag-related), member 2 |
| chr5_-_81046841 | 2.87 |
ENST00000509013.2 ENST00000505980.1 ENST00000509053.1 |
SSBP2 |
single-stranded DNA binding protein 2 |
| chr5_-_81046922 | 2.86 |
ENST00000514493.1 ENST00000320672.4 |
SSBP2 |
single-stranded DNA binding protein 2 |
| chr12_-_56101647 | 2.83 |
ENST00000347027.6 ENST00000257879.6 ENST00000257880.7 ENST00000394230.2 ENST00000394229.2 |
ITGA7 |
integrin, alpha 7 |
| chr5_-_81046904 | 2.78 |
ENST00000515395.1 |
SSBP2 |
single-stranded DNA binding protein 2 |
| chr5_-_88178964 | 2.77 |
ENST00000513252.1 ENST00000508569.1 ENST00000510942.1 ENST00000506554.1 |
MEF2C |
myocyte enhancer factor 2C |
| chr16_+_85645007 | 2.74 |
ENST00000405402.2 |
GSE1 |
Gse1 coiled-coil protein |
| chr12_+_93965609 | 2.70 |
ENST00000549887.1 ENST00000551556.1 |
SOCS2 |
suppressor of cytokine signaling 2 |
| chrX_-_137793826 | 2.68 |
ENST00000315930.6 |
FGF13 |
fibroblast growth factor 13 |
| chr2_-_145277569 | 2.61 |
ENST00000303660.4 |
ZEB2 |
zinc finger E-box binding homeobox 2 |
| chr11_+_46403303 | 2.60 |
ENST00000407067.1 ENST00000395565.1 |
MDK |
midkine (neurite growth-promoting factor 2) |
| chr21_+_47518011 | 2.57 |
ENST00000300527.4 ENST00000357838.4 ENST00000310645.5 |
COL6A2 |
collagen, type VI, alpha 2 |
| chr12_+_93965451 | 2.52 |
ENST00000548537.1 |
SOCS2 |
suppressor of cytokine signaling 2 |
| chr5_-_111092930 | 2.50 |
ENST00000257435.7 |
NREP |
neuronal regeneration related protein |
| chr2_-_200323414 | 2.45 |
ENST00000443023.1 |
SATB2 |
SATB homeobox 2 |
| chr6_+_1389989 | 2.45 |
ENST00000259806.1 |
FOXF2 |
forkhead box F2 |
| chr5_-_88179017 | 2.43 |
ENST00000514028.1 ENST00000514015.1 ENST00000503075.1 ENST00000437473.2 |
MEF2C |
myocyte enhancer factor 2C |
| chr19_-_55658650 | 2.37 |
ENST00000589226.1 |
TNNT1 |
troponin T type 1 (skeletal, slow) |
| chr11_+_111782934 | 2.33 |
ENST00000304298.3 |
HSPB2 |
Homo sapiens heat shock 27kDa protein 2 (HSPB2), mRNA. |
| chr2_-_145278475 | 2.32 |
ENST00000558170.2 |
ZEB2 |
zinc finger E-box binding homeobox 2 |
| chr2_-_145277640 | 2.30 |
ENST00000539609.3 |
ZEB2 |
zinc finger E-box binding homeobox 2 |
| chr5_-_111093167 | 2.30 |
ENST00000446294.2 ENST00000419114.2 |
NREP |
neuronal regeneration related protein |
| chr1_-_1293904 | 2.28 |
ENST00000309212.6 ENST00000342753.4 ENST00000445648.2 |
MXRA8 |
matrix-remodelling associated 8 |
| chr19_-_55658281 | 2.27 |
ENST00000585321.2 ENST00000587465.2 |
TNNT1 |
troponin T type 1 (skeletal, slow) |
| chr19_-_55660561 | 2.27 |
ENST00000587758.1 ENST00000356783.5 ENST00000291901.8 ENST00000588426.1 ENST00000588147.1 ENST00000536926.1 ENST00000588981.1 |
TNNT1 |
troponin T type 1 (skeletal, slow) |
| chr3_+_157154578 | 2.26 |
ENST00000295927.3 |
PTX3 |
pentraxin 3, long |
| chr10_+_11207438 | 2.19 |
ENST00000609692.1 ENST00000354897.3 |
CELF2 |
CUGBP, Elav-like family member 2 |
| chr5_-_111092873 | 2.15 |
ENST00000509025.1 ENST00000515855.1 |
NREP |
neuronal regeneration related protein |
| chr5_-_111093406 | 2.14 |
ENST00000379671.3 |
NREP |
neuronal regeneration related protein |
| chr5_-_172756506 | 2.14 |
ENST00000265087.4 |
STC2 |
stanniocalcin 2 |
| chr11_+_111783450 | 2.13 |
ENST00000537382.1 |
HSPB2 |
Homo sapiens heat shock 27kDa protein 2 (HSPB2), mRNA. |
| chr11_-_111784005 | 2.11 |
ENST00000527899.1 |
CRYAB |
crystallin, alpha B |
| chrX_-_151903101 | 2.11 |
ENST00000393900.3 |
MAGEA12 |
melanoma antigen family A, 12 |
| chr11_+_114128522 | 2.07 |
ENST00000535401.1 |
NNMT |
nicotinamide N-methyltransferase |
| chr6_-_125623046 | 2.07 |
ENST00000608295.1 ENST00000398153.2 ENST00000608284.1 ENST00000368377.4 |
HDDC2 |
HD domain containing 2 |
| chr11_+_46403194 | 2.06 |
ENST00000395569.4 ENST00000395566.4 |
MDK |
midkine (neurite growth-promoting factor 2) |
| chr2_+_8822113 | 2.05 |
ENST00000396290.1 ENST00000331129.3 |
ID2 |
inhibitor of DNA binding 2, dominant negative helix-loop-helix protein |
| chr11_-_111782696 | 2.02 |
ENST00000227251.3 ENST00000526180.1 |
CRYAB |
crystallin, alpha B |
| chr5_-_111093081 | 2.01 |
ENST00000453526.2 ENST00000509427.1 |
NREP |
neuronal regeneration related protein |
| chrX_-_151938171 | 2.01 |
ENST00000393902.3 ENST00000417212.1 ENST00000370278.3 |
MAGEA3 |
melanoma antigen family A, 3 |
| chr5_-_111093340 | 2.00 |
ENST00000508870.1 |
NREP |
neuronal regeneration related protein |
| chr20_+_31350184 | 1.99 |
ENST00000328111.2 ENST00000353855.2 ENST00000348286.2 |
DNMT3B |
DNA (cytosine-5-)-methyltransferase 3 beta |
| chr2_-_238322770 | 1.98 |
ENST00000472056.1 |
COL6A3 |
collagen, type VI, alpha 3 |
| chrX_-_151903184 | 1.98 |
ENST00000357916.4 ENST00000393869.3 |
MAGEA12 |
melanoma antigen family A, 12 |
| chr14_-_21994525 | 1.98 |
ENST00000538754.1 |
SALL2 |
spalt-like transcription factor 2 |
| chr2_-_238322800 | 1.97 |
ENST00000392004.3 ENST00000433762.1 ENST00000347401.3 ENST00000353578.4 ENST00000346358.4 ENST00000392003.2 |
COL6A3 |
collagen, type VI, alpha 3 |
| chr3_+_154797877 | 1.95 |
ENST00000462745.1 ENST00000493237.1 |
MME |
membrane metallo-endopeptidase |
| chr11_-_2906979 | 1.94 |
ENST00000380725.1 ENST00000313407.6 ENST00000430149.2 ENST00000440480.2 ENST00000414822.3 |
CDKN1C |
cyclin-dependent kinase inhibitor 1C (p57, Kip2) |
| chr19_-_11308190 | 1.89 |
ENST00000586659.1 ENST00000592903.1 ENST00000589359.1 ENST00000588724.1 ENST00000432929.2 |
KANK2 |
KN motif and ankyrin repeat domains 2 |
| chr9_-_16870704 | 1.88 |
ENST00000380672.4 ENST00000380667.2 ENST00000380666.2 ENST00000486514.1 |
BNC2 |
basonuclin 2 |
| chr3_+_54156570 | 1.87 |
ENST00000415676.2 |
CACNA2D3 |
calcium channel, voltage-dependent, alpha 2/delta subunit 3 |
| chr3_+_54156664 | 1.86 |
ENST00000474759.1 ENST00000288197.5 |
CACNA2D3 |
calcium channel, voltage-dependent, alpha 2/delta subunit 3 |
| chr11_-_111782484 | 1.86 |
ENST00000533971.1 |
CRYAB |
crystallin, alpha B |
| chr10_-_75410771 | 1.84 |
ENST00000372873.4 |
SYNPO2L |
synaptopodin 2-like |
| chr2_-_238323007 | 1.82 |
ENST00000295550.4 |
COL6A3 |
collagen, type VI, alpha 3 |
| chr1_+_211433275 | 1.80 |
ENST00000367005.4 |
RCOR3 |
REST corepressor 3 |
| chrX_-_135849484 | 1.79 |
ENST00000370620.1 ENST00000535227.1 |
ARHGEF6 |
Rac/Cdc42 guanine nucleotide exchange factor (GEF) 6 |
| chr1_-_203155868 | 1.79 |
ENST00000255409.3 |
CHI3L1 |
chitinase 3-like 1 (cartilage glycoprotein-39) |
| chr11_-_111783919 | 1.79 |
ENST00000531198.1 ENST00000533879.1 |
CRYAB |
crystallin, alpha B |
| chr2_+_30454390 | 1.78 |
ENST00000395323.3 ENST00000406087.1 ENST00000404397.1 |
LBH |
limb bud and heart development |
| chr11_-_64512469 | 1.77 |
ENST00000377485.1 |
RASGRP2 |
RAS guanyl releasing protein 2 (calcium and DAG-regulated) |
| chr12_+_93964158 | 1.77 |
ENST00000549206.1 |
SOCS2 |
suppressor of cytokine signaling 2 |
| chrX_+_151883090 | 1.76 |
ENST00000370293.2 ENST00000423993.1 ENST00000447530.1 ENST00000458057.1 ENST00000331220.2 ENST00000422085.1 ENST00000453150.1 ENST00000409560.1 |
MAGEA2B |
melanoma antigen family A, 2B |
| chr8_+_106330920 | 1.72 |
ENST00000407775.2 |
ZFPM2 |
zinc finger protein, FOG family member 2 |
| chr7_-_100239132 | 1.69 |
ENST00000223051.3 ENST00000431692.1 |
TFR2 |
transferrin receptor 2 |
| chr20_+_35169885 | 1.68 |
ENST00000279022.2 ENST00000346786.2 |
MYL9 |
myosin, light chain 9, regulatory |
| chrX_+_151867214 | 1.66 |
ENST00000329342.5 ENST00000412733.1 ENST00000457643.1 |
MAGEA6 |
melanoma antigen family A, 6 |
| chr6_-_31697563 | 1.65 |
ENST00000375789.2 ENST00000416410.1 |
DDAH2 |
dimethylarginine dimethylaminohydrolase 2 |
| chr12_+_93963590 | 1.64 |
ENST00000340600.2 |
SOCS2 |
suppressor of cytokine signaling 2 |
| chr11_+_125034586 | 1.64 |
ENST00000298282.9 |
PKNOX2 |
PBX/knotted 1 homeobox 2 |
| chr4_-_73434498 | 1.63 |
ENST00000286657.4 |
ADAMTS3 |
ADAM metallopeptidase with thrombospondin type 1 motif, 3 |
| chr4_-_1166954 | 1.62 |
ENST00000514490.1 ENST00000431380.1 ENST00000503765.1 |
SPON2 |
spondin 2, extracellular matrix protein |
| chr15_-_35088340 | 1.59 |
ENST00000290378.4 |
ACTC1 |
actin, alpha, cardiac muscle 1 |
| chrX_+_48644962 | 1.58 |
ENST00000376670.3 ENST00000376665.3 |
GATA1 |
GATA binding protein 1 (globin transcription factor 1) |
| chr15_+_43809797 | 1.58 |
ENST00000399453.1 ENST00000300231.5 |
MAP1A |
microtubule-associated protein 1A |
| chr17_+_16318909 | 1.57 |
ENST00000577397.1 |
TRPV2 |
transient receptor potential cation channel, subfamily V, member 2 |
| chrX_-_152486108 | 1.57 |
ENST00000356661.5 |
MAGEA1 |
melanoma antigen family A, 1 (directs expression of antigen MZ2-E) |
| chr5_+_82767583 | 1.55 |
ENST00000512590.2 ENST00000513960.1 ENST00000513984.1 ENST00000502527.2 |
VCAN |
versican |
| chrX_-_11445856 | 1.55 |
ENST00000380736.1 |
ARHGAP6 |
Rho GTPase activating protein 6 |
| chr4_+_4861385 | 1.54 |
ENST00000382723.4 |
MSX1 |
msh homeobox 1 |
| chr4_+_174089904 | 1.54 |
ENST00000265000.4 |
GALNT7 |
UDP-N-acetyl-alpha-D-galactosamine:polypeptide N-acetylgalactosaminyltransferase 7 (GalNAc-T7) |
| chr1_+_211432593 | 1.53 |
ENST00000367006.4 |
RCOR3 |
REST corepressor 3 |
| chr15_-_37392703 | 1.53 |
ENST00000382766.2 ENST00000444725.1 |
MEIS2 |
Meis homeobox 2 |
| chr4_-_109090106 | 1.53 |
ENST00000379951.2 |
LEF1 |
lymphoid enhancer-binding factor 1 |
| chr7_-_19157248 | 1.52 |
ENST00000242261.5 |
TWIST1 |
twist family bHLH transcription factor 1 |
| chr17_+_16318850 | 1.51 |
ENST00000338560.7 |
TRPV2 |
transient receptor potential cation channel, subfamily V, member 2 |
| chr10_+_21823079 | 1.50 |
ENST00000377100.3 ENST00000377072.3 ENST00000446906.2 |
MLLT10 |
myeloid/lymphoid or mixed-lineage leukemia (trithorax homolog, Drosophila); translocated to, 10 |
| chr16_+_23847339 | 1.50 |
ENST00000303531.7 |
PRKCB |
protein kinase C, beta |
| chrX_+_49235708 | 1.48 |
ENST00000381725.1 |
GAGE2B |
G antigen 2B |
| chr16_+_2039946 | 1.46 |
ENST00000248121.2 ENST00000568896.1 |
SYNGR3 |
synaptogyrin 3 |
| chr11_-_85779971 | 1.45 |
ENST00000393346.3 |
PICALM |
phosphatidylinositol binding clathrin assembly protein |
| chr11_-_85779786 | 1.44 |
ENST00000356360.5 |
PICALM |
phosphatidylinositol binding clathrin assembly protein |
| chr12_+_119616447 | 1.43 |
ENST00000281938.2 |
HSPB8 |
heat shock 22kDa protein 8 |
| chr11_+_34073872 | 1.43 |
ENST00000530820.1 |
CAPRIN1 |
cell cycle associated protein 1 |
| chrX_+_49197607 | 1.42 |
ENST00000402590.3 |
GAGE2E |
G antigen 2E |
| chr9_+_137533615 | 1.42 |
ENST00000371817.3 |
COL5A1 |
collagen, type V, alpha 1 |
| chr1_+_211432775 | 1.41 |
ENST00000419091.2 |
RCOR3 |
REST corepressor 3 |
| chr11_+_46402583 | 1.41 |
ENST00000359803.3 |
MDK |
midkine (neurite growth-promoting factor 2) |
| chrX_+_151903253 | 1.40 |
ENST00000452779.2 ENST00000370291.2 |
CSAG1 |
chondrosarcoma associated gene 1 |
| chr8_-_105601134 | 1.40 |
ENST00000276654.5 ENST00000424843.2 |
LRP12 |
low density lipoprotein receptor-related protein 12 |
| chr1_-_53018654 | 1.40 |
ENST00000257177.4 ENST00000355809.4 ENST00000528642.1 ENST00000470626.1 ENST00000371544.3 |
ZCCHC11 |
zinc finger, CCHC domain containing 11 |
| chr6_+_17393888 | 1.39 |
ENST00000493172.1 ENST00000465994.1 |
CAP2 |
CAP, adenylate cyclase-associated protein, 2 (yeast) |
| chr5_-_176923846 | 1.37 |
ENST00000506537.1 |
PDLIM7 |
PDZ and LIM domain 7 (enigma) |
| chr3_+_12838161 | 1.36 |
ENST00000456430.2 |
CAND2 |
cullin-associated and neddylation-dissociated 2 (putative) |
| chr4_-_1166623 | 1.36 |
ENST00000290902.5 |
SPON2 |
spondin 2, extracellular matrix protein |
| chr21_+_47401650 | 1.36 |
ENST00000361866.3 |
COL6A1 |
collagen, type VI, alpha 1 |
| chrX_+_49296814 | 1.36 |
ENST00000420398.2 |
GAGE12C |
G antigen 12C |
| chr12_+_7023735 | 1.35 |
ENST00000538763.1 ENST00000544774.1 ENST00000545045.2 |
ENO2 |
enolase 2 (gamma, neuronal) |
| chrX_+_151903207 | 1.34 |
ENST00000370287.3 |
CSAG1 |
chondrosarcoma associated gene 1 |
| chrX_+_102469997 | 1.33 |
ENST00000372695.5 ENST00000372691.3 |
BEX4 |
brain expressed, X-linked 4 |
| chr5_-_176923803 | 1.33 |
ENST00000506161.1 |
PDLIM7 |
PDZ and LIM domain 7 (enigma) |
| chr1_-_167906020 | 1.32 |
ENST00000458574.1 |
MPC2 |
mitochondrial pyruvate carrier 2 |
| chr3_-_8811288 | 1.32 |
ENST00000316793.3 ENST00000431493.1 |
OXTR |
oxytocin receptor |
| chr16_+_30386098 | 1.32 |
ENST00000322861.7 |
MYLPF |
myosin light chain, phosphorylatable, fast skeletal muscle |
| chrX_-_151922340 | 1.30 |
ENST00000370284.1 ENST00000543232.1 ENST00000393876.1 ENST00000393872.3 |
MAGEA2 |
melanoma antigen family A, 2 |
| chr18_-_53255766 | 1.29 |
ENST00000566286.1 ENST00000564999.1 ENST00000566279.1 ENST00000354452.3 ENST00000356073.4 |
TCF4 |
transcription factor 4 |
| chr16_+_85646763 | 1.28 |
ENST00000411612.1 ENST00000253458.7 |
GSE1 |
Gse1 coiled-coil protein |
| chr11_-_2158507 | 1.27 |
ENST00000381392.1 ENST00000381395.1 ENST00000418738.2 |
IGF2 |
insulin-like growth factor 2 (somatomedin A) |
| chr17_-_42276574 | 1.26 |
ENST00000589805.1 |
ATXN7L3 |
ataxin 7-like 3 |
| chr6_-_30709980 | 1.25 |
ENST00000416018.1 ENST00000445853.1 ENST00000413165.1 ENST00000418160.1 |
FLOT1 |
flotillin 1 |
| chr5_-_137674000 | 1.25 |
ENST00000510119.1 ENST00000513970.1 |
CDC25C |
cell division cycle 25C |
| chr19_+_3366547 | 1.24 |
ENST00000341919.3 ENST00000590282.1 ENST00000443272.2 |
NFIC |
nuclear factor I/C (CCAAT-binding transcription factor) |
| chr19_-_49149553 | 1.23 |
ENST00000084798.4 |
CA11 |
carbonic anhydrase XI |
| chrX_+_49363665 | 1.23 |
ENST00000381700.6 |
GAGE1 |
G antigen 1 |
| chr7_-_149470297 | 1.23 |
ENST00000484747.1 |
ZNF467 |
zinc finger protein 467 |
| chr6_-_32157947 | 1.23 |
ENST00000375050.4 |
PBX2 |
pre-B-cell leukemia homeobox 2 |
| chr4_-_186456766 | 1.22 |
ENST00000284771.6 |
PDLIM3 |
PDZ and LIM domain 3 |
| chr10_+_11047259 | 1.22 |
ENST00000379261.4 ENST00000416382.2 |
CELF2 |
CUGBP, Elav-like family member 2 |
| chr8_-_41754231 | 1.21 |
ENST00000265709.8 |
ANK1 |
ankyrin 1, erythrocytic |
| chr19_-_55658687 | 1.21 |
ENST00000593046.1 |
TNNT1 |
troponin T type 1 (skeletal, slow) |
| chr10_+_17270214 | 1.20 |
ENST00000544301.1 |
VIM |
vimentin |
| chr2_+_48757278 | 1.19 |
ENST00000404752.1 ENST00000406226.1 |
STON1 |
stonin 1 |
| chr3_+_23986748 | 1.19 |
ENST00000312521.4 |
NR1D2 |
nuclear receptor subfamily 1, group D, member 2 |
| chr4_-_186456652 | 1.19 |
ENST00000284767.5 ENST00000284770.5 |
PDLIM3 |
PDZ and LIM domain 3 |
| chr2_+_46926048 | 1.19 |
ENST00000306503.5 |
SOCS5 |
suppressor of cytokine signaling 5 |
| chr16_+_29817841 | 1.18 |
ENST00000322945.6 ENST00000562337.1 ENST00000566906.2 ENST00000563402.1 ENST00000219782.6 |
MAZ |
MYC-associated zinc finger protein (purine-binding transcription factor) |
| chr22_-_22901477 | 1.18 |
ENST00000420709.1 ENST00000398741.1 ENST00000405655.3 |
PRAME |
preferentially expressed antigen in melanoma |
| chr2_-_230135937 | 1.18 |
ENST00000392054.3 ENST00000409462.1 ENST00000392055.3 |
PID1 |
phosphotyrosine interaction domain containing 1 |
| chr11_-_60719213 | 1.17 |
ENST00000227880.3 |
SLC15A3 |
solute carrier family 15 (oligopeptide transporter), member 3 |
| chr16_-_65155833 | 1.17 |
ENST00000566827.1 ENST00000394156.3 ENST00000562998.1 |
CDH11 |
cadherin 11, type 2, OB-cadherin (osteoblast) |
| chr2_-_127864577 | 1.16 |
ENST00000376113.2 |
BIN1 |
bridging integrator 1 |
| chr13_-_67804445 | 1.15 |
ENST00000456367.1 ENST00000377861.3 ENST00000544246.1 |
PCDH9 |
protocadherin 9 |
| chr16_+_85646891 | 1.15 |
ENST00000393243.1 |
GSE1 |
Gse1 coiled-coil protein |
| chrX_-_148669116 | 1.15 |
ENST00000243314.5 |
MAGEA9B |
melanoma antigen family A, 9B |
| chr19_-_45996465 | 1.14 |
ENST00000430715.2 |
RTN2 |
reticulon 2 |
| chr5_+_82767284 | 1.14 |
ENST00000265077.3 |
VCAN |
versican |
| chr17_+_7788104 | 1.14 |
ENST00000380358.4 |
CHD3 |
chromodomain helicase DNA binding protein 3 |
| chr4_+_123747834 | 1.13 |
ENST00000264498.3 |
FGF2 |
fibroblast growth factor 2 (basic) |
| chr10_+_35416223 | 1.13 |
ENST00000489321.1 ENST00000427847.2 ENST00000345491.3 ENST00000395895.2 ENST00000374728.3 ENST00000487132.1 |
CREM |
cAMP responsive element modulator |
| chr2_-_217560248 | 1.12 |
ENST00000233813.4 |
IGFBP5 |
insulin-like growth factor binding protein 5 |
| chr2_+_58655461 | 1.12 |
ENST00000429095.1 ENST00000429664.1 ENST00000452840.1 |
AC007092.1 |
long intergenic non-protein coding RNA 1122 |
| chr8_+_70378852 | 1.12 |
ENST00000525061.1 ENST00000458141.2 ENST00000260128.4 |
SULF1 |
sulfatase 1 |
| chr3_-_114866084 | 1.10 |
ENST00000357258.3 |
ZBTB20 |
zinc finger and BTB domain containing 20 |
| chr10_+_21823243 | 1.10 |
ENST00000307729.7 ENST00000377091.2 |
MLLT10 |
myeloid/lymphoid or mixed-lineage leukemia (trithorax homolog, Drosophila); translocated to, 10 |
| chr12_-_54694807 | 1.09 |
ENST00000435572.2 |
NFE2 |
nuclear factor, erythroid 2 |
| chr1_-_155948318 | 1.09 |
ENST00000361247.4 |
ARHGEF2 |
Rho/Rac guanine nucleotide exchange factor (GEF) 2 |
| chr11_-_64510409 | 1.09 |
ENST00000394429.1 ENST00000394428.1 |
RASGRP2 |
RAS guanyl releasing protein 2 (calcium and DAG-regulated) |
| chr8_-_119964434 | 1.09 |
ENST00000297350.4 |
TNFRSF11B |
tumor necrosis factor receptor superfamily, member 11b |
| chr11_+_46402297 | 1.09 |
ENST00000405308.2 |
MDK |
midkine (neurite growth-promoting factor 2) |
| chr1_-_145039835 | 1.08 |
ENST00000533259.1 |
PDE4DIP |
phosphodiesterase 4D interacting protein |
| chr8_+_38758737 | 1.07 |
ENST00000521746.1 ENST00000420274.1 |
PLEKHA2 |
pleckstrin homology domain containing, family A (phosphoinositide binding specific) member 2 |
| chr5_-_121413974 | 1.07 |
ENST00000231004.4 |
LOX |
lysyl oxidase |
| chr1_+_235491714 | 1.06 |
ENST00000471812.1 ENST00000358966.2 ENST00000282841.5 ENST00000391855.2 |
GGPS1 |
geranylgeranyl diphosphate synthase 1 |
| chr1_-_155162658 | 1.06 |
ENST00000368389.2 ENST00000368396.4 ENST00000343256.5 ENST00000342482.4 ENST00000368398.3 ENST00000368390.3 ENST00000337604.5 ENST00000368392.3 ENST00000438413.1 ENST00000368393.3 ENST00000457295.2 ENST00000338684.5 ENST00000368395.1 |
MUC1 |
mucin 1, cell surface associated |
| chr10_+_11206925 | 1.06 |
ENST00000354440.2 ENST00000315874.4 ENST00000427450.1 |
CELF2 |
CUGBP, Elav-like family member 2 |
| chr7_-_149470540 | 1.06 |
ENST00000302017.3 |
ZNF467 |
zinc finger protein 467 |
| chr8_+_21777159 | 1.05 |
ENST00000434536.1 ENST00000252512.9 |
XPO7 |
exportin 7 |
| chr1_-_145039949 | 1.05 |
ENST00000313382.9 |
PDE4DIP |
phosphodiesterase 4D interacting protein |
| chr11_-_64512273 | 1.05 |
ENST00000377497.3 ENST00000377487.1 ENST00000430645.1 |
RASGRP2 |
RAS guanyl releasing protein 2 (calcium and DAG-regulated) |
| chr7_+_128470431 | 1.03 |
ENST00000325888.8 ENST00000346177.6 |
FLNC |
filamin C, gamma |
| chr14_-_30396948 | 1.03 |
ENST00000331968.5 |
PRKD1 |
protein kinase D1 |
| chr3_-_88108212 | 1.02 |
ENST00000482016.1 |
CGGBP1 |
CGG triplet repeat binding protein 1 |
| chr6_-_31697255 | 1.02 |
ENST00000436437.1 |
DDAH2 |
dimethylarginine dimethylaminohydrolase 2 |
| chr1_-_38471156 | 1.02 |
ENST00000373016.3 |
FHL3 |
four and a half LIM domains 3 |
| chr17_-_46682321 | 1.02 |
ENST00000225648.3 ENST00000484302.2 |
HOXB6 |
homeobox B6 |
| chr16_+_23847267 | 1.02 |
ENST00000321728.7 |
PRKCB |
protein kinase C, beta |
| chr15_+_79165372 | 1.01 |
ENST00000558502.1 |
MORF4L1 |
mortality factor 4 like 1 |
| chr15_-_37390482 | 1.01 |
ENST00000559085.1 ENST00000397624.3 |
MEIS2 |
Meis homeobox 2 |
| chr7_+_150065879 | 1.01 |
ENST00000397281.2 ENST00000444957.1 ENST00000466559.1 ENST00000489432.2 ENST00000475514.1 ENST00000482680.1 ENST00000488943.1 ENST00000518514.1 ENST00000478789.1 |
REPIN1 ZNF775 |
replication initiator 1 zinc finger protein 775 |
| chr15_+_79165222 | 1.01 |
ENST00000559930.1 |
MORF4L1 |
mortality factor 4 like 1 |
| chr1_-_167906277 | 1.01 |
ENST00000271373.4 |
MPC2 |
mitochondrial pyruvate carrier 2 |
| chrX_+_52235228 | 1.00 |
ENST00000518075.1 |
XAGE1B |
X antigen family, member 1B |
| chr10_-_23003460 | 0.99 |
ENST00000376573.4 |
PIP4K2A |
phosphatidylinositol-5-phosphate 4-kinase, type II, alpha |
| chr17_+_42634844 | 0.99 |
ENST00000315323.3 |
FZD2 |
frizzled family receptor 2 |
| chr15_+_68871569 | 0.99 |
ENST00000566799.1 |
CORO2B |
coronin, actin binding protein, 2B |
| chr9_-_35691017 | 0.99 |
ENST00000378292.3 |
TPM2 |
tropomyosin 2 (beta) |
| chr3_-_138665969 | 0.99 |
ENST00000330315.3 |
FOXL2 |
forkhead box L2 |
| chr5_-_176900610 | 0.98 |
ENST00000477391.2 ENST00000393565.1 ENST00000309007.5 |
DBN1 |
drebrin 1 |
| chr17_-_19290483 | 0.98 |
ENST00000395592.2 ENST00000299610.4 |
MFAP4 |
microfibrillar-associated protein 4 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 6.3 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.3 | 0.3 | REACTOME PLC BETA MEDIATED EVENTS | Genes involved in PLC beta mediated events |
| 0.3 | 11.5 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.3 | 6.9 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
| 0.3 | 1.0 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 0.2 | 16.5 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.2 | 12.5 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.2 | 2.3 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.2 | 2.5 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 0.2 | 4.4 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.2 | 10.2 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.2 | 3.1 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.1 | 0.3 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.1 | 1.2 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.1 | 1.9 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.1 | 5.9 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.1 | 3.2 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
| 0.1 | 1.5 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
| 0.1 | 1.2 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.1 | 2.4 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.1 | 0.1 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
| 0.1 | 4.8 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.1 | 0.7 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.1 | 2.6 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.1 | 2.5 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.1 | 2.4 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.1 | 2.7 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
| 0.1 | 0.9 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.1 | 4.1 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.1 | 1.1 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.1 | 0.2 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
| 0.1 | 0.8 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
| 0.1 | 2.0 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.1 | 0.7 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.1 | 2.4 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.1 | 0.3 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.1 | 0.8 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.1 | 0.8 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.1 | 2.0 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.1 | 4.0 | REACTOME PI METABOLISM | Genes involved in PI Metabolism |
| 0.1 | 0.2 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 0.1 | 0.4 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
| 0.1 | 1.4 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.1 | 1.5 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.1 | 0.6 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
| 0.1 | 0.1 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.1 | 1.5 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.1 | 0.4 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.1 | 0.4 | REACTOME NGF SIGNALLING VIA TRKA FROM THE PLASMA MEMBRANE | Genes involved in NGF signalling via TRKA from the plasma membrane |
| 0.1 | 0.5 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.1 | 0.2 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.1 | 2.3 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.1 | 2.2 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.1 | 1.2 | REACTOME PI3K AKT ACTIVATION | Genes involved in PI3K/AKT activation |
| 0.1 | 0.5 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.1 | 1.8 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.1 | 0.2 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
| 0.1 | 0.5 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.1 | 0.6 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 0.1 | 0.1 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
| 0.1 | 0.9 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.0 | 1.6 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
| 0.0 | 0.9 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.0 | 0.1 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.0 | 0.5 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
| 0.0 | 3.8 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 1.4 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
| 0.0 | 6.0 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.0 | 1.1 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
| 0.0 | 1.8 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
| 0.0 | 0.7 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.0 | 0.3 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.0 | 0.2 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
| 0.0 | 1.0 | REACTOME PHOSPHORYLATION OF THE APC C | Genes involved in Phosphorylation of the APC/C |
| 0.0 | 1.4 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.0 | 0.7 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.0 | 0.6 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.0 | 0.5 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.0 | 2.7 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.0 | 0.1 | REACTOME TAK1 ACTIVATES NFKB BY PHOSPHORYLATION AND ACTIVATION OF IKKS COMPLEX | Genes involved in TAK1 activates NFkB by phosphorylation and activation of IKKs complex |
| 0.0 | 1.8 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
| 0.0 | 0.9 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
| 0.0 | 0.9 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.0 | 0.1 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
| 0.0 | 1.4 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.0 | 0.8 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.0 | 2.8 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.0 | 0.8 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.0 | 0.2 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.0 | 0.5 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.0 | 0.2 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
| 0.0 | 0.2 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
| 0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.0 | 1.1 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
| 0.0 | 0.9 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
| 0.0 | 0.1 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.0 | 0.1 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
| 0.0 | 1.2 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 2.9 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
| 0.0 | 0.1 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
| 0.0 | 0.4 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 0.0 | 0.5 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.0 | 0.4 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
| 0.0 | 3.9 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.0 | 0.8 | REACTOME ACTIVATION OF NMDA RECEPTOR UPON GLUTAMATE BINDING AND POSTSYNAPTIC EVENTS | Genes involved in Activation of NMDA receptor upon glutamate binding and postsynaptic events |
| 0.0 | 0.1 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.0 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.0 | 0.6 | REACTOME SIGNALING BY FGFR1 MUTANTS | Genes involved in Signaling by FGFR1 mutants |
| 0.0 | 0.2 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.0 | 0.1 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.0 | 0.4 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
| 0.0 | 0.3 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
| 0.0 | 0.1 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
| 0.0 | 0.3 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.0 | 0.2 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.0 | 0.1 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.0 | 0.3 | REACTOME REGULATION OF APOPTOSIS | Genes involved in Regulation of Apoptosis |
| 0.0 | 0.5 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.0 | 0.3 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.0 | 0.1 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
| 0.0 | 0.3 | REACTOME NCAM SIGNALING FOR NEURITE OUT GROWTH | Genes involved in NCAM signaling for neurite out-growth |
| 0.0 | 0.1 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
| 0.0 | 0.4 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.0 | 0.8 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
| 0.0 | 0.7 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.0 | 0.2 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 0.2 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.0 | 0.8 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.0 | 0.2 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.0 | 0.2 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.0 | 1.5 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.0 | 0.2 | REACTOME FORMATION OF RNA POL II ELONGATION COMPLEX | Genes involved in Formation of RNA Pol II elongation complex |
| 0.0 | 0.2 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.0 | 0.1 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
| 0.0 | 0.4 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 0.4 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.0 | 0.5 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
| 0.0 | 0.2 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
| 0.0 | 0.1 | REACTOME SIGNALING BY ERBB4 | Genes involved in Signaling by ERBB4 |
| 0.0 | 0.1 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.0 | 0.1 | REACTOME DNA STRAND ELONGATION | Genes involved in DNA strand elongation |
| 0.0 | 0.1 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
| 0.0 | 0.1 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.0 | 0.2 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.0 | 0.2 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.0 | 0.4 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
| 0.0 | 0.1 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.0 | 0.1 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 0.0 | 0.0 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.0 | 0.2 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.0 | 0.0 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.0 | 0.2 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.0 | 0.1 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.5 | 10.2 | GO:1902748 | positive regulation of lens fiber cell differentiation(GO:1902748) |
| 2.1 | 8.3 | GO:0003172 | primary heart field specification(GO:0003138) sinoatrial valve development(GO:0003172) sinoatrial valve morphogenesis(GO:0003185) |
| 1.5 | 8.8 | GO:0030421 | defecation(GO:0030421) |
| 1.3 | 5.2 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 1.2 | 3.7 | GO:1902303 | negative regulation of potassium ion export(GO:1902303) |
| 1.1 | 3.3 | GO:0061386 | closure of optic fissure(GO:0061386) |
| 1.0 | 8.6 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 0.8 | 2.5 | GO:0035408 | histone H3-T6 phosphorylation(GO:0035408) |
| 0.7 | 2.1 | GO:1902746 | regulation of lens fiber cell differentiation(GO:1902746) |
| 0.7 | 2.0 | GO:0006535 | cysteine biosynthetic process from serine(GO:0006535) |
| 0.6 | 2.6 | GO:0061030 | epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
| 0.6 | 1.9 | GO:1901202 | negative regulation of extracellular matrix assembly(GO:1901202) |
| 0.6 | 11.4 | GO:0007021 | tubulin complex assembly(GO:0007021) |
| 0.6 | 1.9 | GO:0070563 | negative regulation of vitamin D receptor signaling pathway(GO:0070563) |
| 0.6 | 11.3 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
| 0.6 | 3.7 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
| 0.6 | 1.8 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 0.6 | 2.3 | GO:1902361 | mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
| 0.6 | 4.0 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
| 0.6 | 2.8 | GO:0090131 | mesenchyme migration(GO:0090131) |
| 0.6 | 10.6 | GO:0070208 | protein heterotrimerization(GO:0070208) |
| 0.5 | 1.6 | GO:0010725 | regulation of primitive erythrocyte differentiation(GO:0010725) eosinophil fate commitment(GO:0035854) |
| 0.5 | 2.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.5 | 2.1 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
| 0.5 | 1.5 | GO:2000276 | negative regulation of oxidative phosphorylation uncoupler activity(GO:2000276) |
| 0.5 | 1.5 | GO:0090427 | activation of meiosis(GO:0090427) |
| 0.5 | 1.4 | GO:0033385 | geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
| 0.5 | 1.4 | GO:0021919 | BMP signaling pathway involved in spinal cord dorsal/ventral patterning(GO:0021919) |
| 0.5 | 1.4 | GO:0060599 | lateral sprouting involved in mammary gland duct morphogenesis(GO:0060599) |
| 0.5 | 5.1 | GO:0033227 | dsRNA transport(GO:0033227) |
| 0.5 | 2.3 | GO:0052199 | negative regulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052199) |
| 0.4 | 1.8 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.4 | 0.9 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
| 0.4 | 0.9 | GO:0060374 | mast cell differentiation(GO:0060374) |
| 0.4 | 1.3 | GO:0061760 | antifungal innate immune response(GO:0061760) |
| 0.4 | 1.6 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
| 0.4 | 1.2 | GO:0006679 | glucosylceramide biosynthetic process(GO:0006679) |
| 0.4 | 4.0 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
| 0.4 | 1.2 | GO:0090298 | negative regulation of mitochondrial DNA replication(GO:0090298) negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
| 0.4 | 1.2 | GO:0031548 | regulation of brain-derived neurotrophic factor receptor signaling pathway(GO:0031548) |
| 0.4 | 3.2 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
| 0.4 | 1.2 | GO:1901899 | positive regulation of relaxation of cardiac muscle(GO:1901899) regulation of calcium ion import into sarcoplasmic reticulum(GO:1902080) negative regulation of calcium ion import into sarcoplasmic reticulum(GO:1902081) |
| 0.4 | 1.2 | GO:0060844 | arterial endothelial cell fate commitment(GO:0060844) blood vessel lumenization(GO:0072554) positive regulation of ephrin receptor signaling pathway(GO:1901189) positive regulation of canonical Wnt signaling pathway involved in cardiac muscle cell fate commitment(GO:1901297) positive regulation of canonical Wnt signaling pathway involved in heart development(GO:1905068) |
| 0.4 | 1.5 | GO:0072299 | posterior mesonephric tubule development(GO:0072166) negative regulation of metanephric glomerulus development(GO:0072299) negative regulation of metanephric glomerular mesangial cell proliferation(GO:0072302) |
| 0.4 | 1.1 | GO:2000523 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.4 | 0.8 | GO:0036228 | protein targeting to nuclear inner membrane(GO:0036228) |
| 0.4 | 5.7 | GO:0098711 | iron ion import into cell(GO:0097459) iron ion import across plasma membrane(GO:0098711) |
| 0.4 | 1.5 | GO:1903224 | regulation of endodermal cell differentiation(GO:1903224) |
| 0.4 | 1.9 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.4 | 1.1 | GO:1904204 | regulation of skeletal muscle hypertrophy(GO:1904204) |
| 0.4 | 4.4 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.4 | 1.1 | GO:1904772 | hepatocyte homeostasis(GO:0036333) response to tetrachloromethane(GO:1904772) |
| 0.4 | 1.5 | GO:0032972 | regulation of muscle filament sliding speed(GO:0032972) |
| 0.4 | 2.9 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.4 | 1.1 | GO:0093001 | glycolysis from storage polysaccharide through glucose-1-phosphate(GO:0093001) |
| 0.4 | 2.8 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.3 | 2.1 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
| 0.3 | 1.0 | GO:2000729 | positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
| 0.3 | 1.4 | GO:0042483 | negative regulation of odontogenesis(GO:0042483) |
| 0.3 | 1.4 | GO:0048371 | lateral mesoderm morphogenesis(GO:0048369) lateral mesoderm formation(GO:0048370) lateral mesodermal cell differentiation(GO:0048371) |
| 0.3 | 1.4 | GO:2000546 | positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
| 0.3 | 1.0 | GO:0072276 | metanephric glomerulus morphogenesis(GO:0072275) metanephric glomerulus vasculature morphogenesis(GO:0072276) metanephric glomerular capillary formation(GO:0072277) |
| 0.3 | 2.0 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
| 0.3 | 0.7 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
| 0.3 | 1.0 | GO:0071529 | cementum mineralization(GO:0071529) |
| 0.3 | 0.7 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.3 | 1.0 | GO:0009447 | putrescine catabolic process(GO:0009447) |
| 0.3 | 0.7 | GO:0003402 | planar cell polarity pathway involved in axis elongation(GO:0003402) |
| 0.3 | 1.0 | GO:0060578 | subthalamic nucleus development(GO:0021763) prolactin secreting cell differentiation(GO:0060127) left lung morphogenesis(GO:0060460) pulmonary vein morphogenesis(GO:0060577) superior vena cava morphogenesis(GO:0060578) |
| 0.3 | 1.0 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
| 0.3 | 1.9 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
| 0.3 | 1.9 | GO:0090116 | C-5 methylation of cytosine(GO:0090116) |
| 0.3 | 0.9 | GO:0001544 | initiation of primordial ovarian follicle growth(GO:0001544) |
| 0.3 | 0.9 | GO:1904617 | negative regulation of actin filament binding(GO:1904530) negative regulation of actin binding(GO:1904617) |
| 0.3 | 1.8 | GO:0009082 | branched-chain amino acid biosynthetic process(GO:0009082) leucine biosynthetic process(GO:0009098) valine biosynthetic process(GO:0009099) |
| 0.3 | 0.9 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.3 | 0.9 | GO:0032900 | negative regulation of neurotrophin production(GO:0032900) |
| 0.3 | 1.4 | GO:2000035 | regulation of stem cell division(GO:2000035) |
| 0.3 | 0.3 | GO:2000586 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) |
| 0.3 | 0.9 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
| 0.3 | 1.7 | GO:0034670 | chemotaxis to arachidonic acid(GO:0034670) response to arachidonic acid(GO:1904550) |
| 0.3 | 2.8 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 0.3 | 0.8 | GO:0061713 | neural crest cell migration involved in heart formation(GO:0003147) cell migration involved in heart formation(GO:0060974) anterior neural tube closure(GO:0061713) |
| 0.3 | 3.1 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.3 | 0.8 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.3 | 1.4 | GO:0035377 | transepithelial water transport(GO:0035377) |
| 0.3 | 3.1 | GO:0034356 | NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
| 0.3 | 1.1 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.3 | 1.4 | GO:1904844 | response to L-glutamine(GO:1904844) cellular response to L-glutamine(GO:1904845) |
| 0.3 | 2.4 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
| 0.3 | 1.3 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.3 | 2.9 | GO:0034465 | response to carbon monoxide(GO:0034465) |
| 0.3 | 0.8 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
| 0.3 | 0.8 | GO:0000821 | regulation of arginine metabolic process(GO:0000821) |
| 0.3 | 0.3 | GO:0055096 | lipoprotein particle mediated signaling(GO:0055095) low-density lipoprotein particle mediated signaling(GO:0055096) |
| 0.3 | 4.2 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.2 | 0.7 | GO:0003408 | optic cup formation involved in camera-type eye development(GO:0003408) |
| 0.2 | 1.0 | GO:0019086 | late viral transcription(GO:0019086) |
| 0.2 | 1.2 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
| 0.2 | 1.0 | GO:0051458 | corticotropin secretion(GO:0051458) |
| 0.2 | 1.4 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.2 | 1.0 | GO:1903566 | positive regulation of protein localization to cilium(GO:1903566) |
| 0.2 | 0.7 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.2 | 0.5 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.2 | 1.2 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.2 | 1.6 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.2 | 0.7 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.2 | 1.1 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
| 0.2 | 0.7 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
| 0.2 | 5.6 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
| 0.2 | 2.5 | GO:0006032 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.2 | 0.9 | GO:0010730 | negative regulation of hydrogen peroxide biosynthetic process(GO:0010730) |
| 0.2 | 0.7 | GO:0090341 | negative regulation of secretion of lysosomal enzymes(GO:0090341) |
| 0.2 | 2.2 | GO:0032264 | IMP salvage(GO:0032264) |
| 0.2 | 0.7 | GO:0036388 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 0.2 | 1.1 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
| 0.2 | 0.9 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.2 | 0.7 | GO:1904395 | positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) negative regulation of neuromuscular junction development(GO:1904397) |
| 0.2 | 0.9 | GO:0090076 | relaxation of skeletal muscle(GO:0090076) |
| 0.2 | 2.2 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
| 0.2 | 2.2 | GO:0010265 | SCF complex assembly(GO:0010265) |
| 0.2 | 0.6 | GO:2000298 | regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
| 0.2 | 1.3 | GO:0071317 | cellular response to morphine(GO:0071315) cellular response to isoquinoline alkaloid(GO:0071317) |
| 0.2 | 3.4 | GO:0006527 | arginine catabolic process(GO:0006527) |
| 0.2 | 5.0 | GO:0006337 | nucleosome disassembly(GO:0006337) |
| 0.2 | 1.5 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.2 | 0.6 | GO:0000412 | histone peptidyl-prolyl isomerization(GO:0000412) |
| 0.2 | 0.6 | GO:1903697 | negative regulation of microvillus assembly(GO:1903697) |
| 0.2 | 0.8 | GO:2000820 | negative regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000820) |
| 0.2 | 0.8 | GO:0070982 | L-asparagine biosynthetic process(GO:0070981) L-asparagine metabolic process(GO:0070982) |
| 0.2 | 0.8 | GO:0071279 | cellular response to cobalt ion(GO:0071279) |
| 0.2 | 1.6 | GO:1905007 | positive regulation of epithelial to mesenchymal transition involved in endocardial cushion formation(GO:1905007) |
| 0.2 | 1.2 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.2 | 3.0 | GO:0042249 | establishment of planar polarity of embryonic epithelium(GO:0042249) |
| 0.2 | 0.4 | GO:0070093 | negative regulation of glucagon secretion(GO:0070093) |
| 0.2 | 0.4 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.2 | 1.4 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.2 | 1.8 | GO:0045988 | negative regulation of striated muscle contraction(GO:0045988) |
| 0.2 | 1.0 | GO:1902751 | positive regulation of cell cycle G2/M phase transition(GO:1902751) |
| 0.2 | 0.8 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.2 | 1.0 | GO:0071460 | cellular response to cell-matrix adhesion(GO:0071460) |
| 0.2 | 0.8 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
| 0.2 | 1.0 | GO:1903974 | positive regulation of odontogenesis of dentin-containing tooth(GO:0042488) mammary gland fat development(GO:0060611) positive regulation of macrophage colony-stimulating factor signaling pathway(GO:1902228) positive regulation of response to macrophage colony-stimulating factor(GO:1903971) positive regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903974) positive regulation of microglial cell migration(GO:1904141) |
| 0.2 | 1.4 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.2 | 0.6 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.2 | 1.9 | GO:0046325 | negative regulation of glucose import(GO:0046325) |
| 0.2 | 0.8 | GO:0010900 | negative regulation of phosphatidylcholine catabolic process(GO:0010900) |
| 0.2 | 0.8 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.2 | 1.1 | GO:1903385 | regulation of homophilic cell adhesion(GO:1903385) |
| 0.2 | 0.6 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
| 0.2 | 0.6 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.2 | 1.1 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
| 0.2 | 0.9 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.2 | 1.5 | GO:0070236 | regulation of activation-induced cell death of T cells(GO:0070235) negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.2 | 0.4 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.2 | 0.9 | GO:1903412 | response to bile acid(GO:1903412) |
| 0.2 | 0.2 | GO:0002625 | regulation of T cell antigen processing and presentation(GO:0002625) |
| 0.2 | 0.7 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 0.2 | 0.9 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
| 0.2 | 1.3 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
| 0.2 | 0.7 | GO:0048749 | compound eye development(GO:0048749) |
| 0.2 | 0.5 | GO:2000563 | positive regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000563) |
| 0.2 | 0.9 | GO:0043696 | dedifferentiation(GO:0043696) cell dedifferentiation(GO:0043697) |
| 0.2 | 0.5 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
| 0.2 | 0.2 | GO:0090270 | fibroblast growth factor production(GO:0090269) regulation of fibroblast growth factor production(GO:0090270) |
| 0.2 | 2.7 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
| 0.2 | 0.2 | GO:0006110 | regulation of glycolytic process(GO:0006110) |
| 0.2 | 6.5 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 0.2 | 1.2 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.2 | 0.7 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
| 0.2 | 4.9 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.2 | 0.8 | GO:0086047 | membrane depolarization during Purkinje myocyte cell action potential(GO:0086047) |
| 0.2 | 0.8 | GO:1903588 | negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.2 | 0.7 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.2 | 1.3 | GO:0098734 | macromolecule depalmitoylation(GO:0098734) |
| 0.2 | 0.5 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.2 | 0.7 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.2 | 0.5 | GO:1904899 | regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 0.2 | 0.7 | GO:0060613 | fat pad development(GO:0060613) |
| 0.2 | 0.5 | GO:0016185 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
| 0.2 | 0.7 | GO:2000672 | regulation of motor neuron apoptotic process(GO:2000671) negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.2 | 0.5 | GO:0038193 | thromboxane A2 signaling pathway(GO:0038193) |
| 0.2 | 0.2 | GO:0045351 | interferon-alpha biosynthetic process(GO:0045349) interferon-beta biosynthetic process(GO:0045350) type I interferon biosynthetic process(GO:0045351) regulation of interferon-alpha biosynthetic process(GO:0045354) regulation of interferon-beta biosynthetic process(GO:0045357) |
| 0.2 | 1.8 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.2 | 0.8 | GO:0000973 | posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
| 0.2 | 2.1 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
| 0.2 | 0.3 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
| 0.2 | 1.0 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.2 | 0.6 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
| 0.2 | 0.2 | GO:2000381 | negative regulation of mesoderm development(GO:2000381) |
| 0.2 | 0.6 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) |
| 0.2 | 0.2 | GO:2001028 | positive regulation of endothelial cell chemotaxis(GO:2001028) |
| 0.2 | 1.4 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
| 0.2 | 0.5 | GO:0007206 | phospholipase C-activating G-protein coupled glutamate receptor signaling pathway(GO:0007206) |
| 0.2 | 0.8 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.2 | 0.5 | GO:0050760 | negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
| 0.2 | 0.6 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.2 | 0.3 | GO:0045925 | positive regulation of female receptivity(GO:0045925) |
| 0.2 | 0.5 | GO:2000587 | negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.1 | 0.6 | GO:0021897 | forebrain astrocyte differentiation(GO:0021896) forebrain astrocyte development(GO:0021897) |
| 0.1 | 0.3 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.1 | 1.8 | GO:0035020 | regulation of Rac protein signal transduction(GO:0035020) |
| 0.1 | 0.4 | GO:1904637 | response to ionomycin(GO:1904636) cellular response to ionomycin(GO:1904637) |
| 0.1 | 0.3 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
| 0.1 | 0.9 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.1 | 0.4 | GO:0046100 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
| 0.1 | 1.9 | GO:0035826 | rubidium ion transport(GO:0035826) regulation of rubidium ion transport(GO:2000680) |
| 0.1 | 0.9 | GO:0008090 | retrograde axonal transport(GO:0008090) |
| 0.1 | 1.1 | GO:0021853 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 0.1 | 0.9 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.1 | 0.7 | GO:0032487 | regulation of Rap protein signal transduction(GO:0032487) |
| 0.1 | 0.3 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
| 0.1 | 0.1 | GO:0021529 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.1 | 1.0 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
| 0.1 | 1.2 | GO:0016191 | synaptic vesicle uncoating(GO:0016191) |
| 0.1 | 1.4 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 0.1 | 0.8 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
| 0.1 | 1.0 | GO:0099566 | regulation of postsynaptic cytosolic calcium ion concentration(GO:0099566) |
| 0.1 | 0.7 | GO:1901906 | diadenosine polyphosphate catabolic process(GO:0015961) diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
| 0.1 | 0.3 | GO:0044320 | cellular response to leptin stimulus(GO:0044320) |
| 0.1 | 0.1 | GO:0007296 | cytoplasm organization(GO:0007028) vitellogenesis(GO:0007296) |
| 0.1 | 0.4 | GO:0002265 | astrocyte activation involved in immune response(GO:0002265) |
| 0.1 | 1.0 | GO:0006226 | dUMP biosynthetic process(GO:0006226) |
| 0.1 | 0.1 | GO:0061032 | visceral serous pericardium development(GO:0061032) |
| 0.1 | 0.7 | GO:0015862 | uridine transport(GO:0015862) |
| 0.1 | 0.7 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.1 | 0.4 | GO:1902528 | regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 0.1 | 1.5 | GO:0045793 | positive regulation of cell size(GO:0045793) |
| 0.1 | 0.1 | GO:0012502 | induction of programmed cell death(GO:0012502) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) |
| 0.1 | 0.3 | GO:0021569 | rhombomere 3 development(GO:0021569) |
| 0.1 | 0.4 | GO:0060734 | regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:0060734) positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.1 | 1.1 | GO:0070344 | fat cell proliferation(GO:0070341) regulation of fat cell proliferation(GO:0070344) negative regulation of fat cell proliferation(GO:0070345) |
| 0.1 | 0.4 | GO:0031587 | detection of endogenous stimulus(GO:0009726) positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.1 | 0.1 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.1 | 0.4 | GO:0044210 | 'de novo' CTP biosynthetic process(GO:0044210) |
| 0.1 | 0.4 | GO:0046449 | creatinine metabolic process(GO:0046449) |
| 0.1 | 0.3 | GO:0050913 | sensory perception of bitter taste(GO:0050913) |
| 0.1 | 0.4 | GO:0007518 | myoblast fate determination(GO:0007518) |
| 0.1 | 0.5 | GO:0009224 | CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) CMP metabolic process(GO:0046035) |
| 0.1 | 0.9 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.1 | 0.3 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
| 0.1 | 0.9 | GO:1902659 | regulation of glucose mediated signaling pathway(GO:1902659) |
| 0.1 | 0.5 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.1 | 0.3 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
| 0.1 | 0.4 | GO:0042137 | sequestering of neurotransmitter(GO:0042137) |
| 0.1 | 0.8 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.1 | 0.4 | GO:1990502 | dense core granule maturation(GO:1990502) |
| 0.1 | 0.4 | GO:1990168 | protein K33-linked deubiquitination(GO:1990168) |
| 0.1 | 0.1 | GO:0051885 | positive regulation of anagen(GO:0051885) |
| 0.1 | 1.0 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
| 0.1 | 0.2 | GO:0070296 | sarcoplasmic reticulum calcium ion transport(GO:0070296) |
| 0.1 | 0.7 | GO:0055129 | proline biosynthetic process(GO:0006561) L-proline biosynthetic process(GO:0055129) |
| 0.1 | 1.5 | GO:0060087 | relaxation of vascular smooth muscle(GO:0060087) |
| 0.1 | 0.2 | GO:0036166 | phenotypic switching(GO:0036166) regulation of phenotypic switching(GO:1900239) |
| 0.1 | 0.9 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
| 0.1 | 0.4 | GO:0006404 | RNA import into nucleus(GO:0006404) |
| 0.1 | 0.1 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.1 | 0.6 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing by siRNA(GO:0090625) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.1 | 0.4 | GO:0061743 | motor learning(GO:0061743) |
| 0.1 | 0.5 | GO:0006235 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) |
| 0.1 | 1.5 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.1 | 1.4 | GO:0070070 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.1 | 0.6 | GO:1902904 | clathrin coat disassembly(GO:0072318) negative regulation of fibril organization(GO:1902904) chaperone-mediated autophagy translocation complex disassembly(GO:1904764) |
| 0.1 | 0.4 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
| 0.1 | 0.5 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
| 0.1 | 0.5 | GO:1904565 | response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 0.1 | 0.2 | GO:1904502 | regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
| 0.1 | 0.1 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
| 0.1 | 1.6 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
| 0.1 | 0.7 | GO:0032825 | positive regulation of natural killer cell differentiation(GO:0032825) |
| 0.1 | 0.8 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 | 1.6 | GO:1904776 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
| 0.1 | 0.1 | GO:0021877 | forebrain neuron fate commitment(GO:0021877) |
| 0.1 | 0.5 | GO:0003366 | cell-matrix adhesion involved in ameboidal cell migration(GO:0003366) |
| 0.1 | 0.5 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
| 0.1 | 0.2 | GO:0014004 | microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.1 | 0.9 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.1 | 0.4 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
| 0.1 | 0.2 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 0.1 | 0.3 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.1 | 1.2 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.1 | 1.2 | GO:0006089 | lactate metabolic process(GO:0006089) |
| 0.1 | 0.1 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.1 | 0.2 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
| 0.1 | 0.6 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.1 | 0.5 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
| 0.1 | 1.3 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
| 0.1 | 1.0 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
| 0.1 | 0.1 | GO:0061074 | regulation of neural retina development(GO:0061074) regulation of retina development in camera-type eye(GO:1902866) |
| 0.1 | 0.6 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) |
| 0.1 | 0.3 | GO:0097477 | spinal cord motor neuron migration(GO:0097476) lateral motor column neuron migration(GO:0097477) |
| 0.1 | 0.4 | GO:0072526 | pyridine-containing compound catabolic process(GO:0072526) |
| 0.1 | 0.9 | GO:0030091 | protein repair(GO:0030091) |
| 0.1 | 0.5 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
| 0.1 | 0.3 | GO:0002884 | negative regulation of hypersensitivity(GO:0002884) |
| 0.1 | 0.1 | GO:0051582 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.1 | 0.2 | GO:0032803 | regulation of low-density lipoprotein particle receptor catabolic process(GO:0032803) |
| 0.1 | 0.2 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
| 0.1 | 2.6 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.1 | 0.1 | GO:0002874 | regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) |
| 0.1 | 0.1 | GO:2000542 | negative regulation of cell fate specification(GO:0009996) negative regulation of gastrulation(GO:2000542) |
| 0.1 | 1.0 | GO:0001866 | NK T cell proliferation(GO:0001866) |
| 0.1 | 0.1 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
| 0.1 | 1.2 | GO:0046051 | UTP biosynthetic process(GO:0006228) UTP metabolic process(GO:0046051) |
| 0.1 | 0.8 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.1 | 0.4 | GO:2001171 | positive regulation of ATP biosynthetic process(GO:2001171) |
| 0.1 | 1.8 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.1 | 0.3 | GO:0002925 | positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 0.1 | 0.7 | GO:1902047 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
| 0.1 | 0.8 | GO:0002326 | B cell lineage commitment(GO:0002326) |
| 0.1 | 0.7 | GO:0002371 | dendritic cell cytokine production(GO:0002371) |
| 0.1 | 6.6 | GO:0030049 | muscle filament sliding(GO:0030049) actin-myosin filament sliding(GO:0033275) |
| 0.1 | 0.4 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
| 0.1 | 0.6 | GO:0045819 | positive regulation of glycogen catabolic process(GO:0045819) |
| 0.1 | 0.5 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
| 0.1 | 0.1 | GO:0040031 | snRNA modification(GO:0040031) |
| 0.1 | 0.1 | GO:0060029 | convergent extension involved in organogenesis(GO:0060029) |
| 0.1 | 0.3 | GO:0031116 | positive regulation of microtubule polymerization(GO:0031116) |
| 0.1 | 0.3 | GO:0003190 | atrioventricular valve formation(GO:0003190) |
| 0.1 | 0.8 | GO:0001955 | blood vessel maturation(GO:0001955) |
| 0.1 | 0.1 | GO:1905005 | regulation of epithelial to mesenchymal transition involved in endocardial cushion formation(GO:1905005) |
| 0.1 | 0.2 | GO:0038162 | erythropoietin-mediated signaling pathway(GO:0038162) |
| 0.1 | 0.6 | GO:1990253 | cellular response to leucine starvation(GO:1990253) |
| 0.1 | 0.1 | GO:2000078 | glandular epithelial cell maturation(GO:0002071) type B pancreatic cell maturation(GO:0072560) positive regulation of type B pancreatic cell development(GO:2000078) |
| 0.1 | 0.5 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.1 | 0.4 | GO:0043128 | regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043126) positive regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043128) |
| 0.1 | 1.4 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.1 | 0.4 | GO:0003357 | noradrenergic neuron differentiation(GO:0003357) |
| 0.1 | 0.3 | GO:0002092 | positive regulation of receptor internalization(GO:0002092) |
| 0.1 | 0.3 | GO:0008628 | hormone-mediated apoptotic signaling pathway(GO:0008628) |
| 0.1 | 0.4 | GO:0036302 | atrioventricular canal development(GO:0036302) |
| 0.1 | 0.2 | GO:0061762 | CAMKK-AMPK signaling cascade(GO:0061762) |
| 0.1 | 0.7 | GO:0032790 | ribosome disassembly(GO:0032790) |
| 0.1 | 0.1 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.1 | 0.1 | GO:0061101 | neuroendocrine cell differentiation(GO:0061101) |
| 0.1 | 0.9 | GO:0042535 | positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
| 0.1 | 0.2 | GO:0072131 | kidney mesenchyme morphogenesis(GO:0072131) metanephric mesenchyme morphogenesis(GO:0072133) nephrogenic mesenchyme morphogenesis(GO:0072134) |
| 0.1 | 0.7 | GO:0045059 | positive thymic T cell selection(GO:0045059) |
| 0.1 | 0.5 | GO:0043316 | cytotoxic T cell degranulation(GO:0043316) |
| 0.1 | 0.4 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
| 0.1 | 0.3 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
| 0.1 | 0.4 | GO:0045955 | negative regulation of calcium ion-dependent exocytosis(GO:0045955) |
| 0.1 | 0.6 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
| 0.1 | 0.3 | GO:0006172 | ADP biosynthetic process(GO:0006172) purine deoxyribonucleoside diphosphate biosynthetic process(GO:0009183) deoxyribonucleoside diphosphate biosynthetic process(GO:0009189) |
| 0.1 | 0.2 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) positive regulation of natural killer cell degranulation(GO:0043323) |
| 0.1 | 0.1 | GO:2001045 | negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 0.1 | 0.6 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
| 0.1 | 0.3 | GO:0006880 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.1 | 0.7 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.1 | 1.1 | GO:0051382 | kinetochore assembly(GO:0051382) |
| 0.1 | 0.2 | GO:0015886 | heme transport(GO:0015886) |
| 0.1 | 0.3 | GO:0031291 | Ran protein signal transduction(GO:0031291) |
| 0.1 | 1.1 | GO:0006782 | protoporphyrinogen IX biosynthetic process(GO:0006782) |
| 0.1 | 0.3 | GO:1904528 | regulation of microtubule plus-end binding(GO:1903031) positive regulation of microtubule plus-end binding(GO:1903033) positive regulation of microtubule binding(GO:1904528) |
| 0.1 | 0.9 | GO:0030157 | pancreatic juice secretion(GO:0030157) |
| 0.1 | 0.6 | GO:0008218 | bioluminescence(GO:0008218) |
| 0.1 | 1.8 | GO:0006825 | copper ion transport(GO:0006825) |
| 0.1 | 0.3 | GO:0052553 | induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) |
| 0.1 | 0.3 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
| 0.1 | 0.1 | GO:0021769 | orbitofrontal cortex development(GO:0021769) |
| 0.1 | 1.2 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.1 | 0.2 | GO:0035822 | gene conversion(GO:0035822) |
| 0.1 | 1.2 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.1 | 0.3 | GO:0060010 | Sertoli cell fate commitment(GO:0060010) |
| 0.1 | 0.4 | GO:0001880 | Mullerian duct regression(GO:0001880) |
| 0.1 | 0.6 | GO:0021936 | regulation of cerebellar granule cell precursor proliferation(GO:0021936) |
| 0.1 | 0.6 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.1 | 0.4 | GO:0021759 | globus pallidus development(GO:0021759) |
| 0.1 | 0.3 | GO:0098703 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
| 0.1 | 0.2 | GO:2001160 | regulation of histone H3-K79 methylation(GO:2001160) positive regulation of histone H3-K79 methylation(GO:2001162) |
| 0.1 | 0.2 | GO:0048664 | neuron fate determination(GO:0048664) |
| 0.1 | 0.4 | GO:1901660 | calcium ion export(GO:1901660) |
| 0.1 | 0.3 | GO:0036343 | psychomotor behavior(GO:0036343) |
| 0.1 | 0.2 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.1 | 0.4 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.1 | 0.3 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.1 | 0.2 | GO:0035739 | CD4-positive, alpha-beta T cell proliferation(GO:0035739) regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) |
| 0.1 | 0.2 | GO:0001978 | regulation of systemic arterial blood pressure by carotid sinus baroreceptor feedback(GO:0001978) baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
| 0.1 | 0.8 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.1 | 0.1 | GO:1903116 | positive regulation of actin filament-based movement(GO:1903116) |
| 0.1 | 0.1 | GO:0034091 | regulation of maintenance of sister chromatid cohesion(GO:0034091) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) |
| 0.1 | 0.3 | GO:0044111 | development involved in symbiotic interaction(GO:0044111) |
| 0.1 | 0.2 | GO:1903206 | negative regulation of hydrogen peroxide-induced cell death(GO:1903206) |
| 0.1 | 0.3 | GO:0071373 | cellular response to luteinizing hormone stimulus(GO:0071373) |
| 0.1 | 0.1 | GO:0032455 | nerve growth factor processing(GO:0032455) |
| 0.1 | 0.3 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
| 0.1 | 0.2 | GO:1900039 | positive regulation of cellular response to hypoxia(GO:1900039) |
| 0.1 | 0.2 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
| 0.1 | 0.6 | GO:0007379 | segment specification(GO:0007379) |
| 0.1 | 0.2 | GO:0090235 | regulation of metaphase plate congression(GO:0090235) |
| 0.1 | 0.4 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.1 | 0.5 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
| 0.1 | 0.2 | GO:0044806 | G-quadruplex DNA unwinding(GO:0044806) |
| 0.1 | 0.4 | GO:0060536 | cartilage morphogenesis(GO:0060536) |
| 0.1 | 0.3 | GO:0001188 | RNA polymerase I transcriptional preinitiation complex assembly(GO:0001188) RNA polymerase I transcriptional preinitiation complex assembly at the promoter for the nuclear large rRNA transcript(GO:0001189) |
| 0.1 | 3.6 | GO:0008542 | visual learning(GO:0008542) |
| 0.1 | 0.1 | GO:0030823 | regulation of cGMP metabolic process(GO:0030823) |
| 0.1 | 0.2 | GO:1990108 | protein linear deubiquitination(GO:1990108) |
| 0.1 | 0.1 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
| 0.1 | 0.4 | GO:0038110 | interleukin-2-mediated signaling pathway(GO:0038110) |
| 0.1 | 0.2 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
| 0.1 | 0.9 | GO:0070734 | histone H3-K27 methylation(GO:0070734) |
| 0.1 | 0.5 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.1 | 1.3 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.1 | 0.5 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 0.1 | 0.8 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.1 | 0.7 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.1 | 0.4 | GO:0097498 | endothelial tube lumen extension(GO:0097498) |
| 0.1 | 0.3 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
| 0.1 | 0.2 | GO:0070781 | response to biotin(GO:0070781) |
| 0.1 | 0.5 | GO:0015911 | plasma membrane long-chain fatty acid transport(GO:0015911) |
| 0.1 | 0.2 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.1 | 0.3 | GO:0046452 | dihydrofolate metabolic process(GO:0046452) |
| 0.1 | 1.8 | GO:0043949 | regulation of cAMP-mediated signaling(GO:0043949) |
| 0.1 | 0.1 | GO:0032241 | positive regulation of nucleobase-containing compound transport(GO:0032241) |
| 0.1 | 1.0 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
| 0.1 | 0.4 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.1 | 1.2 | GO:0042340 | keratan sulfate catabolic process(GO:0042340) |
| 0.1 | 0.3 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
| 0.1 | 0.1 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.1 | 0.2 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
| 0.1 | 1.0 | GO:0016024 | CDP-diacylglycerol biosynthetic process(GO:0016024) |
| 0.1 | 1.4 | GO:0003416 | endochondral bone growth(GO:0003416) |
| 0.1 | 0.4 | GO:0070827 | chromatin maintenance(GO:0070827) |
| 0.1 | 1.4 | GO:1902236 | negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
| 0.1 | 0.1 | GO:0032898 | neurotrophin production(GO:0032898) |
| 0.1 | 0.2 | GO:0010390 | histone monoubiquitination(GO:0010390) |
| 0.1 | 0.2 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.1 | 1.0 | GO:2001044 | regulation of integrin-mediated signaling pathway(GO:2001044) |
| 0.1 | 0.5 | GO:0060897 | neural plate regionalization(GO:0060897) |
| 0.1 | 0.1 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.1 | 0.2 | GO:0006524 | alanine metabolic process(GO:0006522) alanine catabolic process(GO:0006524) pyruvate family amino acid metabolic process(GO:0009078) pyruvate family amino acid catabolic process(GO:0009080) |
| 0.1 | 3.0 | GO:0061718 | NADH regeneration(GO:0006735) canonical glycolysis(GO:0061621) glucose catabolic process to pyruvate(GO:0061718) |
| 0.1 | 0.7 | GO:0048711 | positive regulation of astrocyte differentiation(GO:0048711) |
| 0.1 | 0.1 | GO:0002644 | negative regulation of tolerance induction(GO:0002644) |
| 0.1 | 0.1 | GO:0046504 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) ether biosynthetic process(GO:1901503) |
| 0.1 | 0.6 | GO:0006552 | leucine catabolic process(GO:0006552) |
| 0.1 | 0.2 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.1 | 0.7 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.1 | 0.2 | GO:0032506 | cytokinetic process(GO:0032506) |
| 0.1 | 0.3 | GO:0035865 | cellular response to potassium ion(GO:0035865) |
| 0.1 | 0.3 | GO:0070375 | ERK5 cascade(GO:0070375) |
| 0.1 | 0.2 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.1 | 0.1 | GO:1904996 | positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 0.1 | 0.1 | GO:0050720 | interleukin-1 beta biosynthetic process(GO:0050720) |
| 0.1 | 0.2 | GO:2000980 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.1 | 0.4 | GO:0046185 | aldehyde catabolic process(GO:0046185) |
| 0.1 | 0.3 | GO:0048630 | skeletal muscle tissue growth(GO:0048630) |
| 0.1 | 2.5 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
| 0.1 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 1.0 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.1 | 0.3 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.1 | 0.3 | GO:0007571 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 0.1 | 0.1 | GO:0014858 | positive regulation of skeletal muscle cell proliferation(GO:0014858) positive regulation of skeletal muscle satellite cell proliferation(GO:1902724) positive regulation of growth factor dependent skeletal muscle satellite cell proliferation(GO:1902728) |
| 0.1 | 0.1 | GO:2000825 | positive regulation of androgen receptor activity(GO:2000825) |
| 0.1 | 0.6 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.1 | 0.1 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.1 | 0.3 | GO:0046125 | thymidine metabolic process(GO:0046104) pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.1 | 0.3 | GO:1990785 | response to water-immersion restraint stress(GO:1990785) |
| 0.1 | 0.4 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.1 | 0.3 | GO:1901419 | regulation of response to alcohol(GO:1901419) |
| 0.1 | 0.6 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
| 0.1 | 0.8 | GO:0033160 | positive regulation of protein import into nucleus, translocation(GO:0033160) |
| 0.1 | 0.7 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
| 0.1 | 0.9 | GO:0075713 | establishment of viral latency(GO:0019043) establishment of integrated proviral latency(GO:0075713) |
| 0.1 | 0.3 | GO:0014050 | negative regulation of glutamate secretion(GO:0014050) |
| 0.1 | 0.5 | GO:0051001 | negative regulation of nitric-oxide synthase activity(GO:0051001) |
| 0.1 | 0.5 | GO:0051451 | myoblast migration(GO:0051451) |
| 0.1 | 0.6 | GO:1901642 | nucleoside transmembrane transport(GO:1901642) |
| 0.1 | 0.2 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 0.1 | 0.2 | GO:0070901 | mitochondrial tRNA methylation(GO:0070901) |
| 0.1 | 1.0 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.1 | 0.2 | GO:0010759 | positive regulation of macrophage chemotaxis(GO:0010759) |
| 0.1 | 0.7 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.1 | 2.1 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
| 0.1 | 0.2 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.1 | 0.4 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.1 | 0.2 | GO:2000197 | regulation of ribonucleoprotein complex localization(GO:2000197) |
| 0.1 | 0.7 | GO:0042789 | mRNA transcription from RNA polymerase II promoter(GO:0042789) |
| 0.1 | 0.1 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.1 | 0.1 | GO:0035509 | negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.1 | 0.7 | GO:0090128 | regulation of synapse maturation(GO:0090128) |
| 0.1 | 0.2 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.1 | 0.1 | GO:1901228 | positive regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003257) positive regulation of transcription from RNA polymerase II promoter involved in heart development(GO:1901228) |
| 0.1 | 0.2 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
| 0.1 | 0.1 | GO:0050902 | leukocyte adhesive activation(GO:0050902) |
| 0.1 | 0.2 | GO:0038188 | cholecystokinin signaling pathway(GO:0038188) |
| 0.1 | 0.8 | GO:0061162 | establishment of monopolar cell polarity(GO:0061162) establishment or maintenance of monopolar cell polarity(GO:0061339) |
| 0.1 | 0.9 | GO:0008340 | determination of adult lifespan(GO:0008340) |
| 0.1 | 0.3 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
| 0.1 | 0.1 | GO:0015965 | diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
| 0.1 | 0.3 | GO:1903976 | negative regulation of glial cell migration(GO:1903976) |
| 0.1 | 0.2 | GO:0007440 | foregut morphogenesis(GO:0007440) |
| 0.1 | 0.3 | GO:0051901 | positive regulation of mitochondrial depolarization(GO:0051901) |
| 0.1 | 0.2 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
| 0.1 | 0.6 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
| 0.1 | 0.3 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.1 | 0.8 | GO:0034063 | stress granule assembly(GO:0034063) |
| 0.1 | 0.3 | GO:0070307 | lens fiber cell development(GO:0070307) |
| 0.1 | 0.2 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
| 0.1 | 0.3 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
| 0.1 | 1.3 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
| 0.1 | 0.2 | GO:0098937 | dendritic transport(GO:0098935) anterograde dendritic transport(GO:0098937) |
| 0.1 | 0.2 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.1 | 0.2 | GO:0086097 | phospholipase C-activating angiotensin-activated signaling pathway(GO:0086097) |
| 0.1 | 0.3 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.1 | 0.4 | GO:0016556 | mRNA modification(GO:0016556) |
| 0.1 | 1.0 | GO:0072539 | T-helper 17 cell differentiation(GO:0072539) |
| 0.1 | 0.5 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
| 0.1 | 0.1 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.1 | 0.1 | GO:1904338 | regulation of dopaminergic neuron differentiation(GO:1904338) |
| 0.1 | 0.2 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
| 0.1 | 0.5 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
| 0.1 | 0.2 | GO:0060019 | radial glial cell differentiation(GO:0060019) |
| 0.1 | 0.1 | GO:0051414 | response to cortisol(GO:0051414) |
| 0.1 | 0.3 | GO:1904879 | positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.1 | 0.4 | GO:0051569 | regulation of histone H3-K4 methylation(GO:0051569) |
| 0.1 | 0.4 | GO:0014854 | response to inactivity(GO:0014854) |
| 0.1 | 0.4 | GO:0097398 | response to interleukin-17(GO:0097396) cellular response to interleukin-17(GO:0097398) |
| 0.1 | 0.4 | GO:0010533 | regulation of activation of Janus kinase activity(GO:0010533) |
| 0.1 | 3.5 | GO:0071277 | cellular response to calcium ion(GO:0071277) |
| 0.1 | 0.2 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
| 0.1 | 0.4 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.1 | 1.1 | GO:0000717 | nucleotide-excision repair, DNA duplex unwinding(GO:0000717) |
| 0.1 | 0.3 | GO:1901093 | regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
| 0.1 | 4.0 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.1 | 0.3 | GO:0001554 | luteolysis(GO:0001554) |
| 0.1 | 0.8 | GO:0048266 | behavioral response to pain(GO:0048266) |
| 0.1 | 3.8 | GO:0006968 | cellular defense response(GO:0006968) |
| 0.1 | 0.5 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.1 | 0.2 | GO:0000967 | endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
| 0.1 | 0.4 | GO:0046476 | glycosylceramide biosynthetic process(GO:0046476) |
| 0.1 | 0.3 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.1 | 0.3 | GO:0009247 | glycolipid biosynthetic process(GO:0009247) |
| 0.1 | 0.1 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
| 0.1 | 0.4 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.1 | 1.0 | GO:0006625 | protein targeting to peroxisome(GO:0006625) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
| 0.1 | 0.2 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.0 | 2.3 | GO:0071349 | interleukin-12-mediated signaling pathway(GO:0035722) cellular response to interleukin-12(GO:0071349) |
| 0.0 | 0.4 | GO:0097106 | postsynaptic density organization(GO:0097106) postsynaptic density assembly(GO:0097107) |
| 0.0 | 0.9 | GO:0098915 | membrane repolarization during ventricular cardiac muscle cell action potential(GO:0098915) |
| 0.0 | 1.7 | GO:0032508 | DNA duplex unwinding(GO:0032508) |
| 0.0 | 0.4 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
| 0.0 | 0.5 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.0 | 0.4 | GO:0060526 | prostate glandular acinus morphogenesis(GO:0060526) prostate epithelial cord arborization involved in prostate glandular acinus morphogenesis(GO:0060527) |
| 0.0 | 0.2 | GO:0070669 | response to interleukin-2(GO:0070669) |
| 0.0 | 0.1 | GO:0015785 | UDP-galactose transport(GO:0015785) UDP-galactose transmembrane transport(GO:0072334) |
| 0.0 | 0.6 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.0 | 0.1 | GO:1902951 | negative regulation of dendritic spine maintenance(GO:1902951) |
| 0.0 | 0.1 | GO:0016260 | selenocysteine biosynthetic process(GO:0016260) |
| 0.0 | 0.1 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
| 0.0 | 0.1 | GO:1901299 | negative regulation of hydrogen peroxide-mediated programmed cell death(GO:1901299) regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
| 0.0 | 0.3 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
| 0.0 | 0.4 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.0 | 0.1 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
| 0.0 | 0.1 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.0 | 0.0 | GO:0038001 | paracrine signaling(GO:0038001) |
| 0.0 | 1.2 | GO:2000114 | regulation of establishment of cell polarity(GO:2000114) |
| 0.0 | 0.1 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.0 | 0.1 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) |
| 0.0 | 0.1 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
| 0.0 | 0.1 | GO:0061010 | gall bladder development(GO:0061010) |
| 0.0 | 0.3 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.0 | 0.0 | GO:1903797 | positive regulation of inorganic anion transmembrane transport(GO:1903797) |
| 0.0 | 0.5 | GO:1990845 | adaptive thermogenesis(GO:1990845) |
| 0.0 | 0.8 | GO:1903392 | negative regulation of adherens junction organization(GO:1903392) |
| 0.0 | 0.1 | GO:0051685 | maintenance of ER location(GO:0051685) |
| 0.0 | 0.1 | GO:1904044 | response to aldosterone(GO:1904044) |
| 0.0 | 0.3 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
| 0.0 | 0.3 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.0 | 0.2 | GO:0048669 | collateral sprouting in absence of injury(GO:0048669) regulation of collateral sprouting in absence of injury(GO:0048696) negative regulation of collateral sprouting in absence of injury(GO:0048698) |
| 0.0 | 0.3 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.0 | 0.8 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
| 0.0 | 0.2 | GO:0006668 | sphinganine-1-phosphate metabolic process(GO:0006668) |
| 0.0 | 2.1 | GO:0065002 | intracellular protein transmembrane transport(GO:0065002) |
| 0.0 | 0.0 | GO:0006999 | nuclear pore organization(GO:0006999) nuclear pore complex assembly(GO:0051292) |
| 0.0 | 0.0 | GO:0060126 | somatotropin secreting cell differentiation(GO:0060126) |
| 0.0 | 0.0 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
| 0.0 | 0.0 | GO:0072661 | protein targeting to plasma membrane(GO:0072661) |
| 0.0 | 0.7 | GO:0050775 | positive regulation of dendrite morphogenesis(GO:0050775) |
| 0.0 | 3.0 | GO:0006687 | glycosphingolipid metabolic process(GO:0006687) |
| 0.0 | 0.1 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
| 0.0 | 0.6 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
| 0.0 | 0.1 | GO:0035621 | ER to Golgi ceramide transport(GO:0035621) |
| 0.0 | 0.1 | GO:0034127 | regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034127) negative regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034128) |
| 0.0 | 0.1 | GO:0034398 | telomere tethering at nuclear periphery(GO:0034398) |
| 0.0 | 1.3 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.0 | 0.2 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
| 0.0 | 0.2 | GO:0032228 | regulation of synaptic transmission, GABAergic(GO:0032228) |
| 0.0 | 0.3 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.0 | 0.2 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
| 0.0 | 0.2 | GO:0048104 | establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 0.0 | 0.5 | GO:0030210 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.0 | 1.0 | GO:0007131 | reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
| 0.0 | 0.3 | GO:0034214 | protein hexamerization(GO:0034214) |
| 0.0 | 0.9 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.0 | 0.0 | GO:0046831 | regulation of RNA export from nucleus(GO:0046831) |
| 0.0 | 1.0 | GO:0050779 | RNA destabilization(GO:0050779) |
| 0.0 | 1.0 | GO:0009954 | proximal/distal pattern formation(GO:0009954) |
| 0.0 | 0.3 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.0 | 0.2 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.0 | 0.5 | GO:0042023 | regulation of DNA endoreduplication(GO:0032875) DNA endoreduplication(GO:0042023) |
| 0.0 | 0.2 | GO:0035617 | stress granule disassembly(GO:0035617) |
| 0.0 | 0.5 | GO:0035493 | SNARE complex assembly(GO:0035493) |
| 0.0 | 0.1 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
| 0.0 | 0.2 | GO:0048255 | mRNA stabilization(GO:0048255) |
| 0.0 | 0.1 | GO:0032776 | DNA methylation on cytosine(GO:0032776) |
| 0.0 | 0.2 | GO:0042631 | cellular response to water deprivation(GO:0042631) |
| 0.0 | 1.3 | GO:0043486 | histone exchange(GO:0043486) |
| 0.0 | 0.2 | GO:1902525 | regulation of protein monoubiquitination(GO:1902525) |
| 0.0 | 0.6 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.0 | 0.0 | GO:0042090 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
| 0.0 | 0.2 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.0 | 0.1 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.0 | 0.2 | GO:0016601 | Rac protein signal transduction(GO:0016601) |
| 0.0 | 0.3 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
| 0.0 | 1.0 | GO:0046856 | phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.0 | 0.4 | GO:0098719 | sodium ion import(GO:0097369) sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.0 | 1.0 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.0 | 0.1 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.0 | 0.4 | GO:0021511 | spinal cord patterning(GO:0021511) |
| 0.0 | 0.2 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.0 | 0.6 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
| 0.0 | 0.8 | GO:0032411 | positive regulation of transporter activity(GO:0032411) |
| 0.0 | 0.3 | GO:0051383 | kinetochore organization(GO:0051383) |
| 0.0 | 0.2 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.0 | 0.5 | GO:0071514 | genetic imprinting(GO:0071514) |
| 0.0 | 0.1 | GO:1900125 | regulation of hyaluronan biosynthetic process(GO:1900125) |
| 0.0 | 0.3 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
| 0.0 | 0.9 | GO:0051602 | response to electrical stimulus(GO:0051602) |
| 0.0 | 1.3 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
| 0.0 | 0.1 | GO:1900154 | regulation of bone trabecula formation(GO:1900154) negative regulation of bone trabecula formation(GO:1900155) |
| 0.0 | 0.1 | GO:0021538 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.0 | 0.4 | GO:1903504 | regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
| 0.0 | 0.0 | GO:0045910 | negative regulation of DNA recombination(GO:0045910) |
| 0.0 | 0.7 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
| 0.0 | 1.0 | GO:0015695 | organic cation transport(GO:0015695) |
| 0.0 | 0.2 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.0 | 0.1 | GO:0007079 | mitotic chromosome movement towards spindle pole(GO:0007079) |
| 0.0 | 0.1 | GO:0006422 | aspartyl-tRNA aminoacylation(GO:0006422) |
| 0.0 | 1.4 | GO:0045652 | regulation of megakaryocyte differentiation(GO:0045652) |
| 0.0 | 0.1 | GO:0070407 | oxidation-dependent protein catabolic process(GO:0070407) |
| 0.0 | 0.4 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.0 | 0.2 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.0 | 0.2 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
| 0.0 | 0.1 | GO:0071360 | cellular response to exogenous dsRNA(GO:0071360) |
| 0.0 | 0.1 | GO:0042074 | cell migration involved in gastrulation(GO:0042074) |
| 0.0 | 0.2 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.0 | 0.1 | GO:1901877 | regulation of calcium ion binding(GO:1901876) negative regulation of calcium ion binding(GO:1901877) |
| 0.0 | 0.0 | GO:0014009 | glial cell proliferation(GO:0014009) |
| 0.0 | 0.2 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.0 | 0.4 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.0 | 0.0 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.0 | 0.3 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.0 | 0.2 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
| 0.0 | 0.1 | GO:0019532 | oxalate transport(GO:0019532) |
| 0.0 | 0.0 | GO:0070666 | regulation of mast cell proliferation(GO:0070666) positive regulation of mast cell proliferation(GO:0070668) |
| 0.0 | 0.1 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.0 | 0.1 | GO:0042538 | hyperosmotic salinity response(GO:0042538) |
| 0.0 | 0.6 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.0 | 0.4 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
| 0.0 | 0.3 | GO:0006069 | ethanol oxidation(GO:0006069) |
| 0.0 | 0.1 | GO:1900138 | negative regulation of phospholipase A2 activity(GO:1900138) |
| 0.0 | 0.0 | GO:2001027 | negative regulation of endothelial cell chemotaxis(GO:2001027) |
| 0.0 | 0.1 | GO:0009956 | radial pattern formation(GO:0009956) |
| 0.0 | 0.6 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
| 0.0 | 0.2 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.0 | 0.1 | GO:0042533 | tumor necrosis factor biosynthetic process(GO:0042533) regulation of tumor necrosis factor biosynthetic process(GO:0042534) |
| 0.0 | 0.1 | GO:1904779 | regulation of protein localization to centrosome(GO:1904779) |
| 0.0 | 0.0 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 0.0 | 0.2 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.0 | 0.2 | GO:0042045 | epithelial fluid transport(GO:0042045) |
| 0.0 | 0.3 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
| 0.0 | 0.0 | GO:0051935 | amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
| 0.0 | 0.2 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
| 0.0 | 0.4 | GO:0000022 | mitotic spindle elongation(GO:0000022) |
| 0.0 | 0.1 | GO:0071313 | cellular response to caffeine(GO:0071313) |
| 0.0 | 0.1 | GO:0072107 | ureteric bud formation(GO:0060676) regulation of ureteric bud formation(GO:0072106) positive regulation of ureteric bud formation(GO:0072107) mesonephric tubule formation(GO:0072172) |
| 0.0 | 0.1 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.0 | 0.0 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
| 0.0 | 0.1 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
| 0.0 | 0.7 | GO:0048240 | sperm capacitation(GO:0048240) |
| 0.0 | 0.1 | GO:0035815 | positive regulation of renal sodium excretion(GO:0035815) |
| 0.0 | 0.3 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.0 | 0.3 | GO:0030815 | negative regulation of cAMP metabolic process(GO:0030815) |
| 0.0 | 0.0 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
| 0.0 | 0.3 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
| 0.0 | 0.1 | GO:0045542 | positive regulation of cholesterol biosynthetic process(GO:0045542) |
| 0.0 | 0.6 | GO:0002755 | MyD88-dependent toll-like receptor signaling pathway(GO:0002755) |
| 0.0 | 0.3 | GO:0070986 | left/right axis specification(GO:0070986) |
| 0.0 | 0.1 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
| 0.0 | 0.1 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.0 | 0.6 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
| 0.0 | 0.4 | GO:1990001 | inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.0 | 0.6 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
| 0.0 | 0.2 | GO:0038092 | nodal signaling pathway(GO:0038092) |
| 0.0 | 0.4 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
| 0.0 | 0.1 | GO:0060424 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) primary lung bud formation(GO:0060431) lung induction(GO:0060492) |
| 0.0 | 0.1 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
| 0.0 | 0.1 | GO:0001826 | inner cell mass cell differentiation(GO:0001826) |
| 0.0 | 0.0 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
| 0.0 | 0.5 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.0 | 0.1 | GO:0021592 | fourth ventricle development(GO:0021592) third ventricle development(GO:0021678) |
| 0.0 | 0.0 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.0 | 0.1 | GO:0006014 | D-ribose metabolic process(GO:0006014) |
| 0.0 | 3.7 | GO:0009408 | response to heat(GO:0009408) |
| 0.0 | 0.8 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.0 | 0.1 | GO:0043666 | regulation of phosphoprotein phosphatase activity(GO:0043666) |
| 0.0 | 0.2 | GO:0090307 | mitotic spindle assembly(GO:0090307) |
| 0.0 | 0.2 | GO:0007352 | zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.0 | 0.1 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
| 0.0 | 0.1 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.0 | 0.1 | GO:1903527 | positive regulation of membrane tubulation(GO:1903527) |
| 0.0 | 0.1 | GO:1902949 | positive regulation of tau-protein kinase activity(GO:1902949) |
| 0.0 | 0.1 | GO:0002522 | leukocyte migration involved in immune response(GO:0002522) |
| 0.0 | 0.1 | GO:0030070 | insulin processing(GO:0030070) |
| 0.0 | 0.0 | GO:0038195 | urokinase plasminogen activator signaling pathway(GO:0038195) |
| 0.0 | 0.3 | GO:0006108 | malate metabolic process(GO:0006108) |
| 0.0 | 0.2 | GO:0014029 | neural crest formation(GO:0014029) |
| 0.0 | 0.7 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
| 0.0 | 0.2 | GO:0097319 | fructose transport(GO:0015755) fructose import(GO:0032445) carbohydrate import into cell(GO:0097319) carbohydrate import across plasma membrane(GO:0098704) fructose import across plasma membrane(GO:1990539) |
| 0.0 | 0.2 | GO:0071173 | mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
| 0.0 | 0.1 | GO:0044130 | negative regulation of growth of symbiont in host(GO:0044130) |
| 0.0 | 3.0 | GO:0015992 | proton transport(GO:0015992) |
| 0.0 | 0.2 | GO:1903003 | positive regulation of protein deubiquitination(GO:1903003) |
| 0.0 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.0 | 0.1 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.0 | 0.5 | GO:0032784 | regulation of DNA-templated transcription, elongation(GO:0032784) |
| 0.0 | 0.0 | GO:0010621 | negative regulation of transcription by transcription factor localization(GO:0010621) |
| 0.0 | 0.2 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.0 | 0.1 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) proteasome regulatory particle assembly(GO:0070682) |
| 0.0 | 0.5 | GO:2000144 | positive regulation of DNA-templated transcription, initiation(GO:2000144) |
| 0.0 | 0.4 | GO:0030252 | growth hormone secretion(GO:0030252) |
| 0.0 | 0.2 | GO:0071709 | membrane assembly(GO:0071709) |
| 0.0 | 0.2 | GO:0060612 | adipose tissue development(GO:0060612) |
| 0.0 | 0.1 | GO:0051446 | positive regulation of meiotic cell cycle(GO:0051446) |
| 0.0 | 0.1 | GO:0021534 | cell proliferation in hindbrain(GO:0021534) cell proliferation in external granule layer(GO:0021924) cerebellar granule cell precursor proliferation(GO:0021930) |
| 0.0 | 0.2 | GO:0045048 | protein insertion into ER membrane(GO:0045048) |
| 0.0 | 0.1 | GO:0060842 | arterial endothelial cell differentiation(GO:0060842) |
| 0.0 | 0.1 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
| 0.0 | 0.1 | GO:0044240 | multicellular organism lipid catabolic process(GO:0044240) |
| 0.0 | 0.1 | GO:1990022 | RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
| 0.0 | 0.2 | GO:0031282 | regulation of guanylate cyclase activity(GO:0031282) |
| 0.0 | 0.1 | GO:0071459 | protein localization to chromosome, centromeric region(GO:0071459) |
| 0.0 | 0.1 | GO:0042357 | thiamine diphosphate metabolic process(GO:0042357) |
| 0.0 | 0.1 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.0 | 0.2 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.0 | 0.1 | GO:0072512 | ferric iron transport(GO:0015682) transferrin transport(GO:0033572) trivalent inorganic cation transport(GO:0072512) |
| 0.0 | 0.8 | GO:1903959 | regulation of anion transmembrane transport(GO:1903959) |
| 0.0 | 0.3 | GO:1904380 | endoplasmic reticulum mannose trimming(GO:1904380) |
| 0.0 | 0.3 | GO:0042354 | fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
| 0.0 | 0.2 | GO:0060285 | cilium-dependent cell motility(GO:0060285) |
| 0.0 | 0.0 | GO:0050666 | regulation of sulfur amino acid metabolic process(GO:0031335) regulation of homocysteine metabolic process(GO:0050666) |
| 0.0 | 0.1 | GO:0039526 | suppression by virus of host apoptotic process(GO:0019050) modulation by virus of host apoptotic process(GO:0039526) |
| 0.0 | 0.2 | GO:0061049 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 | 0.2 | GO:0090520 | sphingosine-1-phosphate signaling pathway(GO:0003376) sphingolipid mediated signaling pathway(GO:0090520) |
| 0.0 | 0.5 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.0 | 0.0 | GO:0051295 | establishment of meiotic spindle localization(GO:0051295) |
| 0.0 | 0.0 | GO:0035963 | cellular response to interleukin-13(GO:0035963) |
| 0.0 | 0.0 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
| 0.0 | 0.3 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.0 | 0.3 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
| 0.0 | 0.1 | GO:0003351 | epithelial cilium movement(GO:0003351) |
| 0.0 | 0.0 | GO:0090205 | positive regulation of cholesterol metabolic process(GO:0090205) |
| 0.0 | 0.0 | GO:0040037 | negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
| 0.0 | 0.0 | GO:0071609 | chemokine (C-C motif) ligand 5 production(GO:0071609) |
| 0.0 | 0.1 | GO:0035754 | B cell chemotaxis(GO:0035754) |
| 0.0 | 0.1 | GO:1990403 | embryonic brain development(GO:1990403) |
| 0.0 | 0.2 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
| 0.0 | 0.1 | GO:0042695 | thelarche(GO:0042695) development of secondary female sexual characteristics(GO:0046543) mammary gland branching involved in thelarche(GO:0060744) |
| 0.0 | 0.1 | GO:0032203 | telomere formation via telomerase(GO:0032203) |
| 0.0 | 0.1 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.0 | 0.1 | GO:0001694 | histamine biosynthetic process(GO:0001694) |
| 0.0 | 0.1 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
| 0.0 | 0.0 | GO:0031064 | negative regulation of histone deacetylation(GO:0031064) |
| 0.0 | 0.5 | GO:0006413 | translational initiation(GO:0006413) |
| 0.0 | 0.1 | GO:0045006 | DNA deamination(GO:0045006) |
| 0.0 | 0.0 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
| 0.0 | 0.5 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
| 0.0 | 0.1 | GO:0018262 | isopeptide cross-linking via N6-(L-isoglutamyl)-L-lysine(GO:0018153) isopeptide cross-linking(GO:0018262) |
| 0.0 | 0.1 | GO:0042756 | drinking behavior(GO:0042756) |
| 0.0 | 0.1 | GO:0071550 | death-inducing signaling complex assembly(GO:0071550) |
| 0.0 | 0.4 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
| 0.0 | 0.6 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 0.0 | 0.1 | GO:1901160 | primary amino compound metabolic process(GO:1901160) |
| 0.0 | 0.1 | GO:0019417 | sulfur oxidation(GO:0019417) |
| 0.0 | 0.0 | GO:0051349 | positive regulation of lyase activity(GO:0051349) |
| 0.0 | 0.1 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
| 0.0 | 0.0 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
| 0.0 | 0.0 | GO:0030575 | nuclear body organization(GO:0030575) nuclear speck organization(GO:0035063) |
| 0.0 | 0.2 | GO:0002347 | response to tumor cell(GO:0002347) |
| 0.0 | 0.1 | GO:0046349 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) amino sugar biosynthetic process(GO:0046349) |
| 0.0 | 0.5 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
| 0.0 | 0.3 | GO:0006826 | iron ion transport(GO:0006826) |
| 0.0 | 0.1 | GO:0098838 | methotrexate transport(GO:0051958) reduced folate transmembrane transport(GO:0098838) |
| 0.0 | 0.1 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
| 0.0 | 0.1 | GO:1903070 | negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
| 0.0 | 0.1 | GO:0009048 | dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.0 | 0.0 | GO:0010934 | macrophage cytokine production(GO:0010934) regulation of macrophage cytokine production(GO:0010935) negative regulation of macrophage cytokine production(GO:0010936) |
| 0.0 | 0.1 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.0 | 0.4 | GO:0007520 | myoblast fusion(GO:0007520) |
| 0.0 | 0.0 | GO:0071910 | determination of pancreatic left/right asymmetry(GO:0035469) determination of digestive tract left/right asymmetry(GO:0071907) determination of liver left/right asymmetry(GO:0071910) |
| 0.0 | 0.3 | GO:0071470 | cellular response to osmotic stress(GO:0071470) |
| 0.0 | 0.2 | GO:1903963 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
| 0.0 | 0.1 | GO:1902775 | mitochondrial ribosome assembly(GO:0061668) mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.0 | 0.2 | GO:0007588 | excretion(GO:0007588) |
| 0.0 | 1.8 | GO:0051443 | positive regulation of ubiquitin-protein transferase activity(GO:0051443) |
| 0.0 | 0.3 | GO:0030199 | collagen fibril organization(GO:0030199) |
| 0.0 | 0.0 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.0 | 0.1 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) |
| 0.0 | 0.2 | GO:0051386 | regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
| 0.0 | 0.0 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) |
| 0.0 | 0.1 | GO:0015705 | iodide transport(GO:0015705) |
| 0.0 | 0.0 | GO:0060168 | regulation of adenosine receptor signaling pathway(GO:0060167) positive regulation of adenosine receptor signaling pathway(GO:0060168) |
| 0.0 | 0.0 | GO:1901894 | regulation of calcium-transporting ATPase activity(GO:1901894) positive regulation of calcium-transporting ATPase activity(GO:1901896) |
| 0.0 | 0.0 | GO:0060314 | regulation of ryanodine-sensitive calcium-release channel activity(GO:0060314) |
| 0.0 | 0.0 | GO:0002589 | regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) negative regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002590) |
| 0.0 | 0.1 | GO:1904647 | response to rotenone(GO:1904647) |
| 0.0 | 0.1 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.0 | 0.0 | GO:0090650 | response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
| 0.0 | 0.1 | GO:0009113 | purine nucleobase biosynthetic process(GO:0009113) |
| 0.0 | 0.1 | GO:1904751 | positive regulation of protein localization to nucleolus(GO:1904751) |
| 0.0 | 0.1 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.0 | 0.3 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
| 0.0 | 0.0 | GO:0038109 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
| 0.0 | 0.1 | GO:0045760 | positive regulation of action potential(GO:0045760) |
| 0.0 | 0.1 | GO:0002115 | store-operated calcium entry(GO:0002115) |
| 0.0 | 0.1 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) double-strand break repair via single-strand annealing(GO:0045002) |
| 0.0 | 0.0 | GO:0001302 | replicative cell aging(GO:0001302) |
| 0.0 | 0.0 | GO:0044805 | late nucleophagy(GO:0044805) |
| 0.0 | 0.7 | GO:0043171 | peptide catabolic process(GO:0043171) |
| 0.0 | 0.1 | GO:1900025 | negative regulation of substrate adhesion-dependent cell spreading(GO:1900025) |
| 0.0 | 0.1 | GO:1901970 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
| 0.0 | 0.2 | GO:1901379 | regulation of potassium ion transmembrane transport(GO:1901379) |
| 0.0 | 0.1 | GO:0009146 | purine nucleoside triphosphate catabolic process(GO:0009146) |
| 0.0 | 0.2 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
| 0.0 | 0.1 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
| 0.0 | 0.1 | GO:0044091 | membrane biogenesis(GO:0044091) |
| 0.0 | 0.2 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) membrane docking(GO:0022406) |
| 0.0 | 0.3 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
| 0.0 | 0.0 | GO:0072071 | mesangial cell differentiation(GO:0072007) glomerular mesangial cell differentiation(GO:0072008) kidney interstitial fibroblast differentiation(GO:0072071) mesangial cell development(GO:0072143) glomerular mesangial cell development(GO:0072144) |
| 0.0 | 0.1 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
| 0.0 | 0.1 | GO:0010529 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.0 | 0.0 | GO:0098779 | mitophagy in response to mitochondrial depolarization(GO:0098779) response to mitochondrial depolarisation(GO:0098780) |
| 0.0 | 0.1 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
| 0.0 | 0.4 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.0 | 0.3 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.0 | 0.0 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.0 | 0.0 | GO:1904783 | positive regulation of NMDA glutamate receptor activity(GO:1904783) |
| 0.0 | 0.1 | GO:0000354 | cis assembly of pre-catalytic spliceosome(GO:0000354) |
| 0.0 | 0.0 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
| 0.0 | 0.1 | GO:0032703 | negative regulation of interleukin-2 production(GO:0032703) |
| 0.0 | 0.3 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.0 | 0.0 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.0 | 0.1 | GO:0033137 | negative regulation of peptidyl-serine phosphorylation(GO:0033137) |
| 0.0 | 0.0 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.0 | 1.2 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.0 | 0.6 | GO:0051865 | protein autoubiquitination(GO:0051865) |
| 0.0 | 0.2 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.0 | 0.0 | GO:0043615 | astrocyte cell migration(GO:0043615) |
| 0.0 | 0.1 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.0 | 0.0 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.0 | 0.1 | GO:0032377 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.0 | 0.2 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
| 0.0 | 0.1 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.0 | 0.0 | GO:0032510 | endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
| 0.0 | 0.1 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
| 0.0 | 0.1 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
| 0.0 | 0.1 | GO:0050961 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
| 0.0 | 0.3 | GO:0044458 | motile cilium assembly(GO:0044458) |
| 0.0 | 0.4 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.0 | 0.1 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.0 | 0.0 | GO:1990418 | response to insulin-like growth factor stimulus(GO:1990418) |
| 0.0 | 0.1 | GO:0031935 | regulation of chromatin silencing(GO:0031935) |
| 0.0 | 0.0 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.0 | 0.1 | GO:0006127 | glycerophosphate shuttle(GO:0006127) |
| 0.0 | 0.0 | GO:0000076 | DNA replication checkpoint(GO:0000076) |
| 0.0 | 0.0 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.0 | 0.2 | GO:0000281 | mitotic cytokinesis(GO:0000281) |
| 0.0 | 0.0 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
| 0.0 | 0.0 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.0 | 0.2 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.0 | 0.0 | GO:0018317 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.0 | 0.1 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
| 0.0 | 0.0 | GO:2000765 | regulation of cytoplasmic translation(GO:2000765) |
| 0.0 | 0.0 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.0 | 0.0 | GO:0036060 | filtration diaphragm assembly(GO:0036058) slit diaphragm assembly(GO:0036060) negative regulation of retinal ganglion cell axon guidance(GO:0090260) |
| 0.0 | 0.1 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
| 0.0 | 0.1 | GO:1904903 | ESCRT complex disassembly(GO:1904896) ESCRT III complex disassembly(GO:1904903) |
| 0.0 | 0.1 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.0 | 0.1 | GO:0071493 | cellular response to UV-B(GO:0071493) |
| 0.0 | 0.0 | GO:2000195 | negative regulation of female gonad development(GO:2000195) |
| 0.0 | 0.0 | GO:0021860 | pyramidal neuron differentiation(GO:0021859) pyramidal neuron development(GO:0021860) |
| 0.0 | 0.0 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) Golgi transport vesicle coating(GO:0048200) COPI coating of Golgi vesicle(GO:0048205) |
| 0.0 | 0.1 | GO:0045329 | carnitine biosynthetic process(GO:0045329) |
| 0.0 | 0.0 | GO:0045730 | respiratory burst(GO:0045730) |
| 0.0 | 0.9 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.0 | 0.0 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) regulation of ubiquitin-dependent endocytosis(GO:2000395) positive regulation of ubiquitin-dependent endocytosis(GO:2000397) |
| 0.0 | 0.1 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
| 0.0 | 0.0 | GO:0045725 | positive regulation of glycogen biosynthetic process(GO:0045725) |
| 0.0 | 0.5 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
| 0.0 | 0.1 | GO:0006105 | succinate metabolic process(GO:0006105) |
| 0.0 | 0.1 | GO:0042532 | negative regulation of tyrosine phosphorylation of STAT protein(GO:0042532) |
| 0.0 | 0.2 | GO:0006893 | Golgi to plasma membrane transport(GO:0006893) |
| 0.0 | 0.0 | GO:1901409 | positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.0 | 0.0 | GO:0046851 | negative regulation of bone resorption(GO:0045779) negative regulation of bone remodeling(GO:0046851) |
| 0.0 | 0.0 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.0 | 0.1 | GO:0048853 | forebrain morphogenesis(GO:0048853) |
| 0.0 | 0.0 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.0 | 0.1 | GO:0035246 | peptidyl-arginine N-methylation(GO:0035246) |
| 0.0 | 0.0 | GO:0098930 | anterograde axonal transport(GO:0008089) axonal transport(GO:0098930) |
| 0.0 | 0.0 | GO:0090345 | cellular organohalogen metabolic process(GO:0090345) cellular organofluorine metabolic process(GO:0090346) |
| 0.0 | 0.0 | GO:0021718 | pons maturation(GO:0021586) superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
| 0.0 | 0.0 | GO:1900453 | negative regulation of long term synaptic depression(GO:1900453) |
| 0.0 | 0.0 | GO:1902766 | skeletal muscle satellite cell migration(GO:1902766) |
| 0.0 | 0.0 | GO:0015793 | glycerol transport(GO:0015793) |
| 0.0 | 0.0 | GO:2001138 | regulation of phospholipid transport(GO:2001138) positive regulation of phospholipid transport(GO:2001140) |
| 0.0 | 0.3 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.0 | 0.0 | GO:0038169 | somatostatin receptor signaling pathway(GO:0038169) somatostatin signaling pathway(GO:0038170) |
| 0.0 | 0.0 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.0 | 0.0 | GO:0006983 | ER overload response(GO:0006983) |
| 0.0 | 0.0 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
| 0.0 | 0.2 | GO:0015949 | nucleobase-containing small molecule interconversion(GO:0015949) |
| 0.0 | 0.1 | GO:0035813 | renal sodium excretion(GO:0035812) regulation of renal sodium excretion(GO:0035813) regulation of excretion(GO:0044062) |
| 0.0 | 0.2 | GO:0003091 | renal water homeostasis(GO:0003091) |
| 0.0 | 0.1 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
| 0.0 | 0.0 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
| 0.0 | 0.0 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
| 0.0 | 0.0 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.0 | 0.2 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
| 0.0 | 0.1 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.0 | 0.0 | GO:0070673 | response to interleukin-18(GO:0070673) |
| 0.0 | 0.0 | GO:0002266 | follicular dendritic cell activation(GO:0002266) follicular dendritic cell differentiation(GO:0002268) |
| 0.0 | 0.0 | GO:0002669 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 0.0 | 0.0 | GO:1903817 | negative regulation of voltage-gated potassium channel activity(GO:1903817) |
| 0.0 | 0.1 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.0 | 0.1 | GO:0060397 | JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
| 0.0 | 0.1 | GO:0046677 | response to antibiotic(GO:0046677) |
| 0.0 | 0.0 | GO:0003162 | atrioventricular node development(GO:0003162) |
| 0.0 | 0.1 | GO:1904977 | lymphatic endothelial cell migration(GO:1904977) |
| 0.0 | 0.2 | GO:0051438 | regulation of ubiquitin-protein transferase activity(GO:0051438) |
| 0.0 | 0.2 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
| 0.0 | 0.1 | GO:0046329 | negative regulation of JNK cascade(GO:0046329) |
| 0.0 | 0.1 | GO:0048305 | immunoglobulin secretion(GO:0048305) |
| 0.0 | 0.0 | GO:0031034 | myosin filament assembly(GO:0031034) |
| 0.0 | 1.2 | GO:0006661 | phosphatidylinositol biosynthetic process(GO:0006661) |
| 0.0 | 0.0 | GO:0048821 | erythrocyte development(GO:0048821) |
| 0.0 | 0.8 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
| 0.0 | 0.4 | GO:0030032 | lamellipodium assembly(GO:0030032) |
| 0.0 | 0.0 | GO:0002752 | leukocyte chemotaxis involved in inflammatory response(GO:0002232) cell surface pattern recognition receptor signaling pathway(GO:0002752) |
| 0.0 | 0.1 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.0 | 0.1 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.0 | 0.0 | GO:1901475 | pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
| 0.0 | 0.1 | GO:0099515 | vesicle transport along actin filament(GO:0030050) actin filament-based transport(GO:0099515) |
| 0.0 | 0.0 | GO:0051984 | positive regulation of chromosome segregation(GO:0051984) |
| 0.0 | 0.0 | GO:0015743 | thiosulfate transport(GO:0015709) oxaloacetate transport(GO:0015729) malate transport(GO:0015743) malate transmembrane transport(GO:0071423) oxaloacetate(2-) transmembrane transport(GO:1902356) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 13.0 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.2 | 1.5 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.2 | 11.5 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.2 | 4.2 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.2 | 1.3 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.2 | 10.1 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.2 | 0.5 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.2 | 0.3 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.2 | 2.9 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.2 | 8.6 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.1 | 0.6 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.1 | 6.9 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.1 | 0.1 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.1 | 11.2 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.1 | 1.0 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.1 | 0.1 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.1 | 1.9 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.1 | 7.6 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
| 0.1 | 0.8 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.1 | 0.2 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
| 0.1 | 0.6 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.1 | 0.4 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.1 | 3.6 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.1 | 6.3 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.1 | 0.9 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.1 | 1.3 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.1 | 1.2 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.1 | 2.3 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.1 | 4.3 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.1 | 3.7 | PID ATM PATHWAY | ATM pathway |
| 0.1 | 2.6 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.1 | 0.1 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.1 | 0.9 | PID BMP PATHWAY | BMP receptor signaling |
| 0.1 | 0.7 | PID FOXO PATHWAY | FoxO family signaling |
| 0.1 | 2.0 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.1 | 3.0 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.1 | 3.1 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.1 | 0.9 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.1 | 3.1 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
| 0.1 | 2.6 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.1 | 1.7 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.1 | 1.3 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.1 | 2.9 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.1 | 1.6 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.1 | 0.9 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.1 | 2.7 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
| 0.1 | 0.4 | PID RAS PATHWAY | Regulation of Ras family activation |
| 0.1 | 2.2 | PID FGF PATHWAY | FGF signaling pathway |
| 0.1 | 2.6 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.1 | 1.2 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.0 | 0.1 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
| 0.0 | 1.0 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.0 | 0.2 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.0 | 1.0 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 0.1 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.0 | 0.4 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.0 | 1.4 | ST GA13 PATHWAY | G alpha 13 Pathway |
| 0.0 | 0.7 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.0 | 0.3 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 1.5 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.0 | 0.2 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
| 0.0 | 0.9 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 0.6 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.0 | 0.5 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.0 | 1.1 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.0 | 0.5 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.0 | 2.2 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.0 | 0.6 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.0 | 2.1 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.0 | 1.6 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.0 | 0.4 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.0 | 0.1 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.0 | 0.5 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
| 0.0 | 0.3 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 1.2 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.0 | 0.5 | PID SHP2 PATHWAY | SHP2 signaling |
| 0.0 | 0.2 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.0 | 0.9 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
| 0.0 | 2.2 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 0.4 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 0.4 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.0 | 0.5 | PID ATR PATHWAY | ATR signaling pathway |
| 0.0 | 0.2 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.0 | 0.4 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 0.1 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.0 | 0.1 | PID S1P S1P2 PATHWAY | S1P2 pathway |
| 0.0 | 0.2 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.0 | 0.0 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.0 | 0.3 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.0 | 0.4 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
| 0.0 | 0.0 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.0 | 0.3 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
| 0.0 | 0.4 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
| 0.0 | 0.1 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.1 | 13.8 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.8 | 12.7 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.7 | 3.6 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.7 | 9.7 | GO:0098647 | collagen type VI trimer(GO:0005589) collagen beaded filament(GO:0098647) |
| 0.6 | 3.6 | GO:0070381 | endosome to plasma membrane transport vesicle(GO:0070381) |
| 0.5 | 3.7 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.5 | 10.5 | GO:0005861 | troponin complex(GO:0005861) |
| 0.5 | 3.1 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.5 | 4.5 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.4 | 1.3 | GO:1990622 | CHOP-ATF3 complex(GO:1990622) |
| 0.3 | 1.0 | GO:0043291 | RAVE complex(GO:0043291) |
| 0.3 | 1.6 | GO:0042643 | actomyosin, actin portion(GO:0042643) |
| 0.3 | 0.9 | GO:0000109 | nucleotide-excision repair complex(GO:0000109) |
| 0.3 | 1.7 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.3 | 0.5 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.2 | 2.5 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.2 | 0.2 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.2 | 3.3 | GO:0008091 | spectrin(GO:0008091) |
| 0.2 | 8.3 | GO:0005859 | muscle myosin complex(GO:0005859) |
| 0.2 | 0.2 | GO:0019034 | viral replication complex(GO:0019034) |
| 0.2 | 3.4 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.2 | 1.1 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.2 | 1.6 | GO:1990589 | ATF4-CREB1 transcription factor complex(GO:1990589) |
| 0.2 | 0.9 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 0.2 | 0.7 | GO:0036387 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
| 0.2 | 0.7 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.2 | 1.7 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.2 | 0.9 | GO:0031673 | H zone(GO:0031673) |
| 0.2 | 4.6 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.2 | 2.6 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.2 | 1.0 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.2 | 1.0 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.2 | 0.8 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.2 | 0.4 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
| 0.2 | 0.5 | GO:0070195 | growth hormone receptor complex(GO:0070195) |
| 0.2 | 15.9 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.2 | 0.7 | GO:0030891 | VCB complex(GO:0030891) |
| 0.2 | 1.0 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 0.2 | 0.2 | GO:0034665 | integrin alpha1-beta1 complex(GO:0034665) |
| 0.2 | 0.7 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.2 | 0.5 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.2 | 0.6 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.2 | 2.9 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.1 | 0.4 | GO:1990876 | cytoplasmic side of nuclear pore(GO:1990876) |
| 0.1 | 0.1 | GO:0043292 | contractile fiber(GO:0043292) |
| 0.1 | 0.6 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
| 0.1 | 1.4 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.1 | 2.8 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.1 | 0.6 | GO:0032301 | MutSalpha complex(GO:0032301) |
| 0.1 | 1.2 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.1 | 0.7 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.1 | 1.0 | GO:0034704 | calcium channel complex(GO:0034704) |
| 0.1 | 0.4 | GO:0031523 | Myb complex(GO:0031523) |
| 0.1 | 1.9 | GO:0042575 | DNA polymerase complex(GO:0042575) |
| 0.1 | 1.2 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
| 0.1 | 2.1 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.1 | 0.8 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 0.1 | 0.1 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.1 | 1.0 | GO:0014802 | terminal cisterna(GO:0014802) |
| 0.1 | 0.6 | GO:0002169 | 3-methylcrotonyl-CoA carboxylase complex, mitochondrial(GO:0002169) methylcrotonoyl-CoA carboxylase complex(GO:1905202) |
| 0.1 | 1.4 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.1 | 0.4 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.1 | 0.6 | GO:0009368 | endopeptidase Clp complex(GO:0009368) |
| 0.1 | 1.4 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.1 | 2.8 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.1 | 0.5 | GO:0034669 | integrin alpha4-beta7 complex(GO:0034669) |
| 0.1 | 0.8 | GO:0071203 | WASH complex(GO:0071203) |
| 0.1 | 1.0 | GO:0033018 | sarcoplasmic reticulum lumen(GO:0033018) |
| 0.1 | 0.3 | GO:0072563 | endothelial microparticle(GO:0072563) |
| 0.1 | 3.1 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.1 | 0.5 | GO:0044308 | axonal spine(GO:0044308) |
| 0.1 | 0.2 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.1 | 0.3 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.1 | 0.3 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.1 | 0.4 | GO:0038038 | G-protein coupled receptor homodimeric complex(GO:0038038) |
| 0.1 | 0.4 | GO:0051286 | cell tip(GO:0051286) |
| 0.1 | 0.3 | GO:0031213 | RSF complex(GO:0031213) |
| 0.1 | 0.2 | GO:0032806 | carboxy-terminal domain protein kinase complex(GO:0032806) |
| 0.1 | 0.5 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.1 | 3.5 | GO:0097346 | INO80-type complex(GO:0097346) |
| 0.1 | 0.3 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.1 | 0.7 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
| 0.1 | 0.9 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.1 | 0.9 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.1 | 0.8 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.1 | 0.3 | GO:0000438 | core TFIIH complex portion of holo TFIIH complex(GO:0000438) |
| 0.1 | 0.6 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.1 | 0.1 | GO:0019908 | nuclear cyclin-dependent protein kinase holoenzyme complex(GO:0019908) |
| 0.1 | 2.5 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
| 0.1 | 0.7 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.1 | 0.1 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.1 | 0.3 | GO:0030663 | COPI-coated vesicle membrane(GO:0030663) |
| 0.1 | 0.3 | GO:0070288 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
| 0.1 | 0.7 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.1 | 0.9 | GO:0097486 | multivesicular body lumen(GO:0097486) |
| 0.1 | 0.3 | GO:0045283 | mitochondrial respiratory chain complex II, succinate dehydrogenase complex (ubiquinone)(GO:0005749) succinate dehydrogenase complex (ubiquinone)(GO:0045257) respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) fumarate reductase complex(GO:0045283) |
| 0.1 | 2.4 | GO:0031304 | intrinsic component of mitochondrial inner membrane(GO:0031304) integral component of mitochondrial inner membrane(GO:0031305) |
| 0.1 | 0.1 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.1 | 0.6 | GO:0098575 | lumenal side of lysosomal membrane(GO:0098575) |
| 0.1 | 2.3 | GO:0033268 | node of Ranvier(GO:0033268) |
| 0.1 | 0.2 | GO:1990015 | mesaxon(GO:0097453) ensheathing process(GO:1990015) |
| 0.1 | 2.0 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
| 0.1 | 0.6 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.1 | 0.6 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) |
| 0.1 | 0.2 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.1 | 0.6 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.1 | 0.9 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.1 | 1.3 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.1 | 0.5 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.1 | 0.5 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) DNA ligase IV complex(GO:0032807) |
| 0.1 | 1.7 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.1 | 0.5 | GO:0031415 | NatA complex(GO:0031415) |
| 0.1 | 0.3 | GO:0097442 | CA3 pyramidal cell dendrite(GO:0097442) |
| 0.1 | 0.5 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.1 | 0.5 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
| 0.1 | 0.5 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.1 | 0.4 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) |
| 0.1 | 0.4 | GO:0097165 | nuclear stress granule(GO:0097165) |
| 0.1 | 0.4 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.1 | 0.4 | GO:0001652 | granular component(GO:0001652) |
| 0.1 | 0.1 | GO:0060201 | clathrin-sculpted acetylcholine transport vesicle(GO:0060200) clathrin-sculpted acetylcholine transport vesicle membrane(GO:0060201) |
| 0.1 | 1.5 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) nuclear membrane part(GO:0044453) |
| 0.1 | 0.1 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
| 0.1 | 0.3 | GO:0055087 | Ski complex(GO:0055087) |
| 0.1 | 1.1 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
| 0.1 | 0.2 | GO:0033565 | ESCRT-0 complex(GO:0033565) |
| 0.1 | 0.4 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.1 | 0.2 | GO:0060187 | cell pole(GO:0060187) |
| 0.1 | 0.1 | GO:0098839 | postsynaptic density membrane(GO:0098839) |
| 0.1 | 3.5 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.1 | 0.8 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.1 | 0.3 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
| 0.1 | 0.7 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.1 | 0.3 | GO:0031436 | BRCA1-BARD1 complex(GO:0031436) |
| 0.1 | 0.5 | GO:0097227 | sperm annulus(GO:0097227) |
| 0.1 | 1.3 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.1 | 0.2 | GO:0031372 | UBC13-MMS2 complex(GO:0031372) |
| 0.1 | 1.6 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.1 | 0.2 | GO:0097441 | basilar dendrite(GO:0097441) |
| 0.1 | 0.4 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.1 | 0.3 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.1 | 0.2 | GO:0044305 | calyx of Held(GO:0044305) |
| 0.1 | 2.3 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.1 | 0.2 | GO:0002945 | cyclin K-CDK13 complex(GO:0002945) |
| 0.1 | 0.4 | GO:0034464 | BBSome(GO:0034464) |
| 0.1 | 0.4 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.1 | 1.1 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.1 | 1.2 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
| 0.1 | 0.4 | GO:0032982 | myosin filament(GO:0032982) |
| 0.1 | 1.6 | GO:0031430 | M band(GO:0031430) |
| 0.1 | 1.2 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.1 | 0.4 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.1 | 0.2 | GO:1990423 | RZZ complex(GO:1990423) |
| 0.1 | 0.8 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.1 | 0.2 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.1 | 0.5 | GO:0031105 | septin complex(GO:0031105) |
| 0.1 | 1.0 | GO:0005884 | actin filament(GO:0005884) |
| 0.1 | 0.5 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.1 | 1.2 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
| 0.1 | 0.5 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.1 | 0.5 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.1 | 0.5 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.1 | 0.1 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.1 | 0.7 | GO:0101003 | ficolin-1-rich granule membrane(GO:0101003) |
| 0.1 | 0.7 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.1 | 0.8 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.1 | 1.2 | GO:0043218 | compact myelin(GO:0043218) |
| 0.1 | 1.0 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.1 | 0.2 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
| 0.1 | 0.4 | GO:0098559 | cytoplasmic side of early endosome membrane(GO:0098559) |
| 0.1 | 0.8 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.1 | 0.4 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.1 | 0.3 | GO:0031429 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) box H/ACA scaRNP complex(GO:0072589) box H/ACA telomerase RNP complex(GO:0090661) |
| 0.1 | 6.4 | GO:0016605 | PML body(GO:0016605) |
| 0.1 | 0.7 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.1 | 21.1 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.1 | 0.4 | GO:0033643 | host cell part(GO:0033643) |
| 0.1 | 0.2 | GO:0000818 | nuclear MIS12/MIND complex(GO:0000818) |
| 0.1 | 0.5 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
| 0.1 | 0.6 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.0 | 1.6 | GO:0015030 | Cajal body(GO:0015030) |
| 0.0 | 1.0 | GO:0000145 | exocyst(GO:0000145) |
| 0.0 | 0.4 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.0 | 0.5 | GO:0032585 | multivesicular body membrane(GO:0032585) |
| 0.0 | 0.3 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.0 | 1.9 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 0.0 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.0 | 0.1 | GO:0016234 | inclusion body(GO:0016234) |
| 0.0 | 0.2 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.0 | 0.3 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.0 | 0.3 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.0 | 0.2 | GO:0033503 | HULC complex(GO:0033503) |
| 0.0 | 0.1 | GO:0048269 | methionine adenosyltransferase complex(GO:0048269) |
| 0.0 | 0.7 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.0 | 0.3 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.0 | 3.7 | GO:0042641 | actomyosin(GO:0042641) |
| 0.0 | 0.2 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.0 | 1.1 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.0 | 0.2 | GO:0030678 | mitochondrial ribonuclease P complex(GO:0030678) |
| 0.0 | 0.2 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.0 | 0.2 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.0 | 0.7 | GO:0031089 | platelet dense granule lumen(GO:0031089) |
| 0.0 | 0.5 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.0 | 0.3 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.0 | 0.8 | GO:0030864 | cortical actin cytoskeleton(GO:0030864) |
| 0.0 | 0.2 | GO:0071565 | nBAF complex(GO:0071565) |
| 0.0 | 0.4 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.0 | 0.2 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.0 | 0.2 | GO:0034688 | integrin alphaM-beta2 complex(GO:0034688) |
| 0.0 | 0.2 | GO:0032044 | DSIF complex(GO:0032044) |
| 0.0 | 2.2 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.0 | 0.3 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.0 | 0.3 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.0 | 0.9 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 0.7 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.0 | 0.5 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
| 0.0 | 0.2 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.0 | 0.3 | GO:0016011 | dystroglycan complex(GO:0016011) |
| 0.0 | 0.1 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.0 | 0.0 | GO:0032302 | MutSbeta complex(GO:0032302) |
| 0.0 | 0.2 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.0 | 0.3 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.0 | 0.3 | GO:0005638 | lamin filament(GO:0005638) |
| 0.0 | 0.9 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.0 | 0.1 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
| 0.0 | 0.2 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.0 | 1.2 | GO:0043198 | dendritic shaft(GO:0043198) |
| 0.0 | 0.1 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.0 | 0.1 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.0 | 0.2 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.0 | 0.2 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.0 | 13.1 | GO:0016607 | nuclear speck(GO:0016607) |
| 0.0 | 0.3 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.0 | 0.2 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.0 | 0.2 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.0 | 0.4 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
| 0.0 | 0.3 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.0 | 0.2 | GO:1990769 | proximal neuron projection(GO:1990769) |
| 0.0 | 0.0 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.0 | 0.1 | GO:0032279 | asymmetric synapse(GO:0032279) |
| 0.0 | 0.2 | GO:0042584 | chromaffin granule membrane(GO:0042584) |
| 0.0 | 0.3 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.0 | 0.2 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 0.0 | 0.0 | GO:0098573 | intrinsic component of mitochondrial membrane(GO:0098573) |
| 0.0 | 0.1 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.0 | 0.8 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.0 | 0.7 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.0 | 0.4 | GO:0051233 | spindle midzone(GO:0051233) |
| 0.0 | 0.2 | GO:0070554 | synaptobrevin 2-SNAP-25-syntaxin-3-complexin complex(GO:0070554) |
| 0.0 | 0.2 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.0 | 0.1 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.0 | 0.2 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.0 | 0.2 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.0 | 0.9 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 0.1 | GO:0070083 | clathrin-sculpted monoamine transport vesicle(GO:0070081) clathrin-sculpted monoamine transport vesicle membrane(GO:0070083) |
| 0.0 | 0.3 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| 0.0 | 0.4 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.0 | 0.1 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.0 | 0.4 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.0 | 0.4 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.0 | 0.1 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.0 | 0.1 | GO:0036021 | endolysosome lumen(GO:0036021) |
| 0.0 | 0.1 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.0 | 0.1 | GO:0005846 | nuclear cap binding complex(GO:0005846) |
| 0.0 | 0.1 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
| 0.0 | 0.1 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.0 | 0.2 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.0 | 0.2 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
| 0.0 | 0.0 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.0 | 0.1 | GO:1990357 | terminal web(GO:1990357) |
| 0.0 | 0.2 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.0 | 0.2 | GO:0005818 | astral microtubule(GO:0000235) aster(GO:0005818) |
| 0.0 | 0.3 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.0 | 0.1 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.0 | 0.1 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.0 | 0.0 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.0 | 2.4 | GO:0034705 | voltage-gated potassium channel complex(GO:0008076) potassium channel complex(GO:0034705) |
| 0.0 | 0.7 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.0 | 0.1 | GO:0070470 | plasma membrane respiratory chain complex I(GO:0045272) plasma membrane respiratory chain(GO:0070470) |
| 0.0 | 1.3 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.0 | 0.1 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.0 | 0.3 | GO:0097433 | dense body(GO:0097433) |
| 0.0 | 0.0 | GO:0060171 | stereocilium membrane(GO:0060171) |
| 0.0 | 0.1 | GO:0035267 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
| 0.0 | 0.5 | GO:0043596 | nuclear replication fork(GO:0043596) |
| 0.0 | 1.1 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 0.6 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
| 0.0 | 0.0 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.0 | 0.8 | GO:0030133 | transport vesicle(GO:0030133) |
| 0.0 | 1.5 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.0 | 0.2 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.0 | 0.2 | GO:0043196 | varicosity(GO:0043196) |
| 0.0 | 0.1 | GO:0032389 | MutLalpha complex(GO:0032389) |
| 0.0 | 0.5 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
| 0.0 | 0.0 | GO:0000243 | commitment complex(GO:0000243) |
| 0.0 | 0.1 | GO:0044455 | mitochondrial membrane part(GO:0044455) |
| 0.0 | 2.2 | GO:0030496 | midbody(GO:0030496) |
| 0.0 | 0.2 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.0 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.0 | 0.2 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.0 | 0.1 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
| 0.0 | 0.4 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.0 | 0.2 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.0 | 0.0 | GO:0000153 | cytoplasmic ubiquitin ligase complex(GO:0000153) |
| 0.0 | 0.1 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
| 0.0 | 0.1 | GO:0070938 | contractile ring(GO:0070938) |
| 0.0 | 0.0 | GO:0009330 | DNA topoisomerase complex (ATP-hydrolyzing)(GO:0009330) |
| 0.0 | 1.1 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
| 0.0 | 0.2 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.0 | 0.8 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
| 0.0 | 0.1 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.0 | 0.1 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.0 | 0.1 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) |
| 0.0 | 0.4 | GO:0031904 | endosome lumen(GO:0031904) |
| 0.0 | 0.0 | GO:1990425 | ryanodine receptor complex(GO:1990425) |
| 0.0 | 0.1 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.0 | 1.0 | GO:0000794 | condensed nuclear chromosome(GO:0000794) |
| 0.0 | 1.9 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.0 | 0.9 | GO:0005746 | mitochondrial respiratory chain(GO:0005746) |
| 0.0 | 0.4 | GO:0008305 | integrin complex(GO:0008305) |
| 0.0 | 0.5 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.0 | 0.1 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.0 | 0.1 | GO:0060091 | kinocilium(GO:0060091) |
| 0.0 | 0.2 | GO:0097546 | ciliary base(GO:0097546) |
| 0.0 | 0.0 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
| 0.0 | 0.1 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.0 | 0.1 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
| 0.0 | 0.1 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
| 0.0 | 0.2 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 0.3 | GO:0000786 | nucleosome(GO:0000786) |
| 0.0 | 0.0 | GO:0097134 | cyclin E1-CDK2 complex(GO:0097134) |
| 0.0 | 0.4 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.0 | 0.0 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.0 | 0.5 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.0 | 0.0 | GO:0016935 | glycine-gated chloride channel complex(GO:0016935) |
| 0.0 | 0.3 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.0 | 0.1 | GO:0072686 | mitotic spindle(GO:0072686) |
| 0.0 | 0.1 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.0 | 0.2 | GO:0030904 | retromer complex(GO:0030904) |
| 0.0 | 0.1 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.0 | 1.0 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.0 | 0.2 | GO:0034709 | methylosome(GO:0034709) |
| 0.0 | 0.0 | GO:0032009 | early phagosome(GO:0032009) |
| 0.0 | 1.0 | GO:0097014 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
| 0.0 | 0.1 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 0.1 | GO:0032021 | NELF complex(GO:0032021) |
| 0.0 | 0.9 | GO:0048475 | membrane coat(GO:0030117) coated membrane(GO:0048475) |
| 0.0 | 0.1 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.0 | 0.1 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.0 | 1.0 | GO:0005875 | microtubule associated complex(GO:0005875) |
| 0.0 | 0.7 | GO:0005903 | brush border(GO:0005903) |
| 0.0 | 0.2 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
| 0.0 | 0.2 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.0 | 0.2 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.0 | 9.7 | GO:0005730 | nucleolus(GO:0005730) |
| 0.0 | 0.1 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.0 | 1.8 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
| 0.0 | 0.1 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
| 0.0 | 0.1 | GO:0030863 | cortical cytoskeleton(GO:0030863) |
| 0.0 | 0.1 | GO:0032059 | bleb(GO:0032059) |
| 0.0 | 0.1 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.0 | 0.1 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.0 | 1.4 | GO:0000790 | nuclear chromatin(GO:0000790) |
| 0.0 | 0.1 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.0 | 0.0 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
| 0.0 | 0.7 | GO:0005814 | centriole(GO:0005814) |
| 0.0 | 0.2 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.0 | 0.0 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
| 0.0 | 0.9 | GO:0005681 | spliceosomal complex(GO:0005681) |
| 0.0 | 0.4 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
| 0.0 | 0.2 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.6 | 9.6 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 0.9 | 10.3 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.8 | 2.5 | GO:0035403 | histone kinase activity (H3-T6 specific)(GO:0035403) |
| 0.7 | 3.4 | GO:0016403 | dimethylargininase activity(GO:0016403) |
| 0.7 | 0.7 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
| 0.7 | 2.0 | GO:0098809 | cystathionine beta-synthase activity(GO:0004122) oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) nitrite reductase (NO-forming) activity(GO:0050421) carbon monoxide binding(GO:0070025) nitrite reductase activity(GO:0098809) |
| 0.6 | 8.7 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.6 | 1.2 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.6 | 2.4 | GO:0008112 | nicotinamide N-methyltransferase activity(GO:0008112) pyridine N-methyltransferase activity(GO:0030760) |
| 0.6 | 3.4 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.5 | 2.1 | GO:0004998 | transferrin receptor activity(GO:0004998) |
| 0.5 | 3.1 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.4 | 7.4 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.4 | 13.1 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.4 | 2.9 | GO:0060072 | large conductance calcium-activated potassium channel activity(GO:0060072) |
| 0.4 | 1.2 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.4 | 1.2 | GO:0005169 | neurotrophin TRKB receptor binding(GO:0005169) |
| 0.4 | 2.4 | GO:0030172 | troponin C binding(GO:0030172) |
| 0.4 | 1.1 | GO:0015333 | peptide:proton symporter activity(GO:0015333) proton-dependent peptide secondary active transmembrane transporter activity(GO:0022897) |
| 0.4 | 1.4 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.3 | 1.3 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
| 0.3 | 3.8 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.3 | 1.9 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.3 | 1.9 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.3 | 1.8 | GO:0052655 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
| 0.3 | 0.9 | GO:0031896 | V2 vasopressin receptor binding(GO:0031896) |
| 0.3 | 5.5 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.3 | 2.7 | GO:0001225 | RNA polymerase II transcription coactivator binding(GO:0001225) |
| 0.3 | 2.4 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.3 | 1.4 | GO:0004337 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
| 0.3 | 2.8 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.3 | 2.2 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.3 | 4.1 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.3 | 0.8 | GO:0052810 | 1-phosphatidylinositol-5-kinase activity(GO:0052810) |
| 0.3 | 1.6 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.3 | 0.8 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
| 0.3 | 1.1 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 0.3 | 1.6 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.3 | 1.0 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.2 | 0.7 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
| 0.2 | 2.2 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.2 | 2.2 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.2 | 1.2 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 0.2 | 0.7 | GO:0035379 | carbon dioxide transmembrane transporter activity(GO:0035379) |
| 0.2 | 1.7 | GO:0016167 | glial cell-derived neurotrophic factor receptor activity(GO:0016167) |
| 0.2 | 0.7 | GO:0004603 | phenylethanolamine N-methyltransferase activity(GO:0004603) |
| 0.2 | 0.7 | GO:0098770 | FBXO family protein binding(GO:0098770) |
| 0.2 | 0.7 | GO:0005260 | channel-conductance-controlling ATPase activity(GO:0005260) |
| 0.2 | 0.5 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.2 | 2.5 | GO:0004568 | chitinase activity(GO:0004568) chitin binding(GO:0008061) |
| 0.2 | 1.3 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.2 | 0.2 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.2 | 0.7 | GO:0004779 | adenylylsulfate kinase activity(GO:0004020) sulfate adenylyltransferase activity(GO:0004779) sulfate adenylyltransferase (ATP) activity(GO:0004781) |
| 0.2 | 0.9 | GO:0004132 | dCMP deaminase activity(GO:0004132) |
| 0.2 | 0.7 | GO:0004853 | uroporphyrinogen decarboxylase activity(GO:0004853) |
| 0.2 | 9.1 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.2 | 0.6 | GO:0047322 | [hydroxymethylglutaryl-CoA reductase (NADPH)] kinase activity(GO:0047322) [acetyl-CoA carboxylase] kinase activity(GO:0050405) |
| 0.2 | 0.9 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.2 | 0.8 | GO:0061714 | folic acid receptor activity(GO:0061714) |
| 0.2 | 2.3 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.2 | 1.0 | GO:0046592 | polyamine oxidase activity(GO:0046592) spermine:oxygen oxidoreductase (spermidine-forming) activity(GO:0052901) |
| 0.2 | 1.8 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.2 | 1.6 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.2 | 0.4 | GO:0043398 | HLH domain binding(GO:0043398) |
| 0.2 | 2.0 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
| 0.2 | 3.9 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
| 0.2 | 2.9 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.2 | 0.6 | GO:0032427 | GBD domain binding(GO:0032427) |
| 0.2 | 1.0 | GO:0004692 | cGMP-dependent protein kinase activity(GO:0004692) |
| 0.2 | 1.0 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.2 | 0.8 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
| 0.2 | 2.6 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
| 0.2 | 0.7 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.2 | 0.9 | GO:0033857 | diphosphoinositol-pentakisphosphate kinase activity(GO:0033857) |
| 0.2 | 0.2 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
| 0.2 | 1.1 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
| 0.2 | 0.4 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
| 0.2 | 0.7 | GO:0004727 | prenylated protein tyrosine phosphatase activity(GO:0004727) |
| 0.2 | 0.5 | GO:0042799 | histone methyltransferase activity (H4-K20 specific)(GO:0042799) |
| 0.2 | 1.2 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) L-lactate dehydrogenase activity(GO:0004459) |
| 0.2 | 1.0 | GO:0004118 | cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) |
| 0.2 | 0.5 | GO:1904455 | ubiquitin-specific protease activity involved in negative regulation of ERAD pathway(GO:1904455) |
| 0.2 | 0.9 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 0.2 | 0.9 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.2 | 0.5 | GO:0004917 | interleukin-7 receptor activity(GO:0004917) |
| 0.2 | 2.2 | GO:0001011 | transcription factor activity, sequence-specific DNA binding, RNA polymerase recruiting(GO:0001011) transcription factor activity, TFIIB-class binding(GO:0001087) |
| 0.2 | 1.3 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.2 | 0.7 | GO:0032810 | sterol response element binding(GO:0032810) |
| 0.2 | 0.5 | GO:0004961 | thromboxane receptor activity(GO:0004960) thromboxane A2 receptor activity(GO:0004961) |
| 0.2 | 1.6 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.2 | 0.6 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
| 0.2 | 1.0 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.2 | 0.8 | GO:0004066 | asparagine synthase (glutamine-hydrolyzing) activity(GO:0004066) |
| 0.2 | 0.6 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
| 0.2 | 0.5 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.2 | 0.9 | GO:0043426 | MRF binding(GO:0043426) |
| 0.2 | 0.9 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
| 0.2 | 1.4 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
| 0.2 | 1.5 | GO:0089720 | caspase binding(GO:0089720) |
| 0.1 | 1.6 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.1 | 0.6 | GO:0038047 | beta-endorphin receptor activity(GO:0004979) morphine receptor activity(GO:0038047) |
| 0.1 | 0.6 | GO:0047066 | phospholipid-hydroperoxide glutathione peroxidase activity(GO:0047066) |
| 0.1 | 1.0 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.1 | 0.9 | GO:0004882 | androgen receptor activity(GO:0004882) |
| 0.1 | 0.3 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.1 | 1.6 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.1 | 0.9 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.1 | 3.0 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.1 | 1.1 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.1 | 0.7 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
| 0.1 | 0.6 | GO:0032143 | single thymine insertion binding(GO:0032143) |
| 0.1 | 0.5 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
| 0.1 | 0.7 | GO:0052842 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) inositol diphosphate tetrakisphosphate diphosphatase activity(GO:0052840) inositol bisdiphosphate tetrakisphosphate diphosphatase activity(GO:0052841) inositol diphosphate pentakisphosphate diphosphatase activity(GO:0052842) inositol-1-diphosphate-2,3,4,5,6-pentakisphosphate diphosphatase activity(GO:0052843) inositol-3-diphosphate-1,2,4,5,6-pentakisphosphate diphosphatase activity(GO:0052844) inositol-5-diphosphate-1,2,3,4,6-pentakisphosphate diphosphatase activity(GO:0052845) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 1-diphosphatase activity(GO:0052846) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052847) inositol-3,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052848) |
| 0.1 | 0.8 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.1 | 0.4 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.1 | 0.8 | GO:0034485 | phosphatidylinositol-3,4,5-trisphosphate 5-phosphatase activity(GO:0034485) |
| 0.1 | 1.5 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.1 | 0.5 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.1 | 0.4 | GO:0003883 | CTP synthase activity(GO:0003883) |
| 0.1 | 0.7 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.1 | 1.4 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.1 | 0.4 | GO:0042954 | lipoprotein transporter activity(GO:0042954) |
| 0.1 | 0.6 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.1 | 0.9 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.1 | 0.5 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.1 | 0.9 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.1 | 0.5 | GO:0030197 | extracellular matrix constituent, lubricant activity(GO:0030197) |
| 0.1 | 0.6 | GO:0044736 | acid-sensing ion channel activity(GO:0044736) |
| 0.1 | 0.4 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.1 | 0.6 | GO:0004485 | methylcrotonoyl-CoA carboxylase activity(GO:0004485) |
| 0.1 | 0.2 | GO:0001228 | transcriptional activator activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001228) |
| 0.1 | 3.5 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.1 | 0.6 | GO:0015056 | corticotrophin-releasing factor receptor activity(GO:0015056) |
| 0.1 | 0.9 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.1 | 1.3 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.1 | 0.6 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.1 | 0.1 | GO:0032551 | pyrimidine nucleoside binding(GO:0001884) UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
| 0.1 | 0.3 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.1 | 0.3 | GO:0051538 | 3 iron, 4 sulfur cluster binding(GO:0051538) |
| 0.1 | 1.9 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.1 | 0.5 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.1 | 0.9 | GO:0099583 | neurotransmitter receptor activity involved in regulation of postsynaptic cytosolic calcium ion concentration(GO:0099583) |
| 0.1 | 0.3 | GO:0016749 | 5-aminolevulinate synthase activity(GO:0003870) N-succinyltransferase activity(GO:0016749) |
| 0.1 | 6.5 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 0.1 | 0.8 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.1 | 0.4 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.1 | 0.7 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.1 | 0.2 | GO:0070363 | mitochondrial light strand promoter sense binding(GO:0070363) |
| 0.1 | 4.5 | GO:0070888 | E-box binding(GO:0070888) |
| 0.1 | 0.8 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.1 | 0.6 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 0.1 | 0.2 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.1 | 1.0 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.1 | 0.4 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
| 0.1 | 1.4 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.1 | 0.3 | GO:0015275 | stretch-activated, cation-selective, calcium channel activity(GO:0015275) |
| 0.1 | 0.4 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.1 | 0.7 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.1 | 0.1 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.1 | 0.4 | GO:0016972 | flavin-linked sulfhydryl oxidase activity(GO:0016971) thiol oxidase activity(GO:0016972) |
| 0.1 | 0.3 | GO:0015235 | cobalamin transporter activity(GO:0015235) |
| 0.1 | 0.8 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.1 | 0.1 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
| 0.1 | 0.4 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.1 | 2.7 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 0.1 | 0.3 | GO:0015439 | heme-transporting ATPase activity(GO:0015439) |
| 0.1 | 1.6 | GO:0005522 | profilin binding(GO:0005522) |
| 0.1 | 0.4 | GO:0019826 | oxygen sensor activity(GO:0019826) |
| 0.1 | 0.3 | GO:0030627 | pre-mRNA 5'-splice site binding(GO:0030627) |
| 0.1 | 3.3 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.1 | 0.9 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.1 | 0.4 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.1 | 0.3 | GO:0050613 | delta14-sterol reductase activity(GO:0050613) |
| 0.1 | 0.3 | GO:0017129 | triglyceride binding(GO:0017129) |
| 0.1 | 0.3 | GO:0005046 | KDEL sequence binding(GO:0005046) |
| 0.1 | 1.0 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.1 | 5.1 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
| 0.1 | 0.2 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.1 | 0.5 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.1 | 0.6 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
| 0.1 | 0.3 | GO:0030492 | hemoglobin binding(GO:0030492) |
| 0.1 | 1.4 | GO:0031005 | filamin binding(GO:0031005) |
| 0.1 | 0.3 | GO:0050698 | proteoglycan sulfotransferase activity(GO:0050698) |
| 0.1 | 0.3 | GO:0016404 | 15-hydroxyprostaglandin dehydrogenase (NAD+) activity(GO:0016404) |
| 0.1 | 0.3 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.1 | 1.8 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 0.1 | 0.5 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
| 0.1 | 0.3 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.1 | 0.2 | GO:0097158 | pre-mRNA intronic pyrimidine-rich binding(GO:0097158) |
| 0.1 | 2.0 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.1 | 0.3 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.1 | 0.2 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
| 0.1 | 1.6 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 0.1 | 0.6 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.1 | 1.0 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 0.1 | 0.4 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.1 | 0.3 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 0.1 | 0.1 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.1 | 1.7 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
| 0.1 | 0.2 | GO:0008798 | beta-aspartyl-peptidase activity(GO:0008798) |
| 0.1 | 0.1 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
| 0.1 | 0.2 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.1 | 0.3 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.1 | 0.2 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.1 | 0.9 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.1 | 0.9 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
| 0.1 | 0.5 | GO:0030911 | TPR domain binding(GO:0030911) |
| 0.1 | 0.3 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 0.1 | 0.2 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.1 | 0.4 | GO:0044213 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) intronic transcription regulatory region DNA binding(GO:0044213) |
| 0.1 | 0.2 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.1 | 0.1 | GO:0035276 | ethanol binding(GO:0035276) |
| 0.1 | 0.3 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
| 0.1 | 0.4 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.1 | 0.8 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.1 | 3.8 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.1 | 0.2 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.1 | 0.3 | GO:0005026 | transforming growth factor beta receptor activity, type II(GO:0005026) |
| 0.1 | 0.3 | GO:0004102 | choline O-acetyltransferase activity(GO:0004102) |
| 0.1 | 0.3 | GO:0031491 | nucleosome binding(GO:0031491) |
| 0.1 | 0.4 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.1 | 1.5 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.1 | 0.5 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 0.1 | 0.2 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.1 | 0.2 | GO:0033188 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
| 0.1 | 0.6 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.1 | 7.7 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
| 0.1 | 0.3 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.1 | 0.1 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) |
| 0.1 | 0.1 | GO:0044388 | small protein activating enzyme binding(GO:0044388) |
| 0.1 | 0.2 | GO:0034041 | sterol-transporting ATPase activity(GO:0034041) |
| 0.1 | 0.3 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.1 | 1.8 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.1 | 0.5 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.1 | 1.8 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.1 | 2.0 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.1 | 0.8 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
| 0.1 | 1.0 | GO:0030553 | cGMP binding(GO:0030553) |
| 0.1 | 0.2 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.1 | 0.2 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
| 0.1 | 0.2 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 0.1 | 0.8 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.1 | 0.2 | GO:0098640 | integrin binding involved in cell-matrix adhesion(GO:0098640) |
| 0.1 | 3.7 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
| 0.1 | 0.2 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.1 | 5.3 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.1 | 2.6 | GO:0004407 | histone deacetylase activity(GO:0004407) |
| 0.1 | 0.9 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.1 | 0.3 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.1 | 1.3 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.1 | 0.2 | GO:0004797 | thymidine kinase activity(GO:0004797) |
| 0.1 | 0.3 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.1 | 2.3 | GO:0070063 | RNA polymerase binding(GO:0070063) |
| 0.1 | 0.9 | GO:0050780 | dopamine receptor binding(GO:0050780) |
| 0.1 | 0.4 | GO:0015101 | organic cation transmembrane transporter activity(GO:0015101) |
| 0.1 | 0.8 | GO:0031386 | protein tag(GO:0031386) |
| 0.1 | 0.3 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
| 0.1 | 0.2 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.1 | 1.8 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.1 | 0.1 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.1 | 0.4 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.1 | 0.1 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.1 | 1.1 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
| 0.1 | 0.4 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.1 | 0.5 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
| 0.1 | 0.5 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.1 | 1.0 | GO:0004675 | transmembrane receptor protein serine/threonine kinase activity(GO:0004675) |
| 0.1 | 0.9 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
| 0.1 | 0.3 | GO:0016402 | pristanoyl-CoA oxidase activity(GO:0016402) |
| 0.1 | 0.2 | GO:0031716 | calcitonin receptor binding(GO:0031716) |
| 0.1 | 0.3 | GO:0004883 | glucocorticoid receptor activity(GO:0004883) glucocorticoid-activated RNA polymerase II transcription factor binding transcription factor activity(GO:0038051) |
| 0.1 | 0.2 | GO:0004951 | cholecystokinin receptor activity(GO:0004951) |
| 0.1 | 0.8 | GO:0043422 | protein kinase B binding(GO:0043422) |
| 0.1 | 0.8 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.1 | 1.5 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.1 | 1.9 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.1 | 0.2 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) NAD(P)+ nucleosidase activity(GO:0050135) |
| 0.1 | 6.4 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.1 | 0.4 | GO:1990239 | steroid hormone binding(GO:1990239) |
| 0.1 | 0.3 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.1 | 0.2 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.1 | 0.3 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
| 0.1 | 0.2 | GO:0015361 | low-affinity sodium:dicarboxylate symporter activity(GO:0015361) |
| 0.1 | 0.2 | GO:0015616 | DNA translocase activity(GO:0015616) |
| 0.1 | 0.1 | GO:0001034 | RNA polymerase III transcription factor activity, sequence-specific DNA binding(GO:0001034) |
| 0.1 | 0.2 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
| 0.1 | 0.4 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
| 0.1 | 0.6 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.1 | 0.7 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 0.1 | 2.2 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
| 0.1 | 0.7 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.1 | 0.2 | GO:0001596 | angiotensin type I receptor activity(GO:0001596) |
| 0.1 | 0.3 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
| 0.1 | 0.2 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.1 | 0.5 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
| 0.1 | 0.6 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.1 | 0.5 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.1 | 2.4 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
| 0.1 | 0.6 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.1 | 0.7 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
| 0.1 | 0.2 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.1 | 2.5 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
| 0.1 | 0.4 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.1 | 0.3 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
| 0.1 | 0.3 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.1 | 0.5 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.1 | 0.5 | GO:0001671 | ATPase activator activity(GO:0001671) |
| 0.1 | 0.3 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
| 0.1 | 1.0 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.1 | 1.0 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
| 0.1 | 0.1 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
| 0.1 | 6.0 | GO:0005262 | calcium channel activity(GO:0005262) |
| 0.1 | 0.3 | GO:0008430 | selenium binding(GO:0008430) |
| 0.1 | 0.3 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
| 0.1 | 0.1 | GO:0043559 | insulin binding(GO:0043559) |
| 0.0 | 0.1 | GO:0005148 | prolactin receptor binding(GO:0005148) |
| 0.0 | 0.1 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.0 | 0.0 | GO:0009008 | DNA-methyltransferase activity(GO:0009008) |
| 0.0 | 1.0 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.0 | 0.3 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 0.0 | 0.1 | GO:0005459 | UDP-galactose transmembrane transporter activity(GO:0005459) |
| 0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.0 | 0.3 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.0 | 0.1 | GO:0004756 | selenide, water dikinase activity(GO:0004756) phosphotransferase activity, paired acceptors(GO:0016781) |
| 0.0 | 1.1 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
| 0.0 | 0.4 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.0 | 0.3 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 0.0 | 0.3 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 0.0 | 1.0 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.0 | 0.3 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.0 | 0.2 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.0 | 0.3 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
| 0.0 | 0.6 | GO:0001223 | transcription coactivator binding(GO:0001223) |
| 0.0 | 0.6 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.0 | 0.2 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.0 | 0.5 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.0 | 0.1 | GO:0004103 | choline kinase activity(GO:0004103) |
| 0.0 | 0.7 | GO:0016918 | retinal binding(GO:0016918) |
| 0.0 | 0.2 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
| 0.0 | 0.4 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.0 | 0.6 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.0 | 0.1 | GO:0000035 | acyl binding(GO:0000035) |
| 0.0 | 0.8 | GO:0043295 | glutathione binding(GO:0043295) |
| 0.0 | 0.6 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.0 | 1.1 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
| 0.0 | 0.3 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.0 | 0.1 | GO:0019961 | interferon binding(GO:0019961) |
| 0.0 | 1.5 | GO:0036002 | pre-mRNA binding(GO:0036002) |
| 0.0 | 0.4 | GO:0050786 | RAGE receptor binding(GO:0050786) |
| 0.0 | 0.2 | GO:0004991 | parathyroid hormone receptor activity(GO:0004991) |
| 0.0 | 0.1 | GO:0004819 | glutamine-tRNA ligase activity(GO:0004819) valine-tRNA ligase activity(GO:0004832) |
| 0.0 | 0.3 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
| 0.0 | 0.7 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.0 | 0.1 | GO:0004660 | protein farnesyltransferase activity(GO:0004660) |
| 0.0 | 0.5 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.0 | 0.2 | GO:0050262 | ribosylnicotinamide kinase activity(GO:0050262) ribosylnicotinate kinase activity(GO:0061769) |
| 0.0 | 1.0 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.0 | 0.1 | GO:0034353 | RNA pyrophosphohydrolase activity(GO:0034353) |
| 0.0 | 0.2 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.0 | 0.2 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.0 | 0.2 | GO:0005534 | galactose binding(GO:0005534) |
| 0.0 | 0.7 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.0 | 0.3 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.0 | 0.4 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.0 | 0.2 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.0 | 0.5 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.0 | 0.1 | GO:0019211 | phosphatase activator activity(GO:0019211) |
| 0.0 | 0.2 | GO:0047708 | biotinidase activity(GO:0047708) |
| 0.0 | 0.3 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.0 | 0.4 | GO:0001221 | transcription cofactor binding(GO:0001221) |
| 0.0 | 0.2 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) |
| 0.0 | 0.1 | GO:0019237 | centromeric DNA binding(GO:0019237) |
| 0.0 | 0.1 | GO:0004324 | ferredoxin-NADP+ reductase activity(GO:0004324) NADPH-adrenodoxin reductase activity(GO:0015039) oxidoreductase activity, acting on iron-sulfur proteins as donors(GO:0016730) oxidoreductase activity, acting on iron-sulfur proteins as donors, NAD or NADP as acceptor(GO:0016731) |
| 0.0 | 0.7 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.0 | 0.4 | GO:0015266 | protein channel activity(GO:0015266) |
| 0.0 | 0.1 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
| 0.0 | 0.5 | GO:1905030 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
| 0.0 | 0.3 | GO:0004738 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.0 | 0.1 | GO:0016639 | oxidoreductase activity, acting on the CH-NH2 group of donors, NAD or NADP as acceptor(GO:0016639) |
| 0.0 | 0.7 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.0 | 0.2 | GO:0060175 | brain-derived neurotrophic factor-activated receptor activity(GO:0060175) |
| 0.0 | 0.3 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.0 | 0.3 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.0 | 0.6 | GO:0005504 | fatty acid binding(GO:0005504) |
| 0.0 | 0.2 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.0 | 0.1 | GO:0031369 | translation initiation factor binding(GO:0031369) |
| 0.0 | 0.7 | GO:0022848 | acetylcholine-gated cation channel activity(GO:0022848) |
| 0.0 | 4.1 | GO:0047485 | protein N-terminus binding(GO:0047485) |
| 0.0 | 0.1 | GO:0004515 | nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.0 | 0.6 | GO:0005521 | lamin binding(GO:0005521) |
| 0.0 | 0.2 | GO:0048039 | ubiquinone binding(GO:0048039) |
| 0.0 | 0.3 | GO:0004954 | prostanoid receptor activity(GO:0004954) prostaglandin receptor activity(GO:0004955) |
| 0.0 | 0.2 | GO:0070892 | lipoteichoic acid receptor activity(GO:0070892) |
| 0.0 | 0.0 | GO:0035473 | lipase binding(GO:0035473) |
| 0.0 | 0.2 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.0 | 2.0 | GO:0042826 | histone deacetylase binding(GO:0042826) |
| 0.0 | 0.3 | GO:0019863 | IgE binding(GO:0019863) |
| 0.0 | 0.1 | GO:1990763 | arrestin family protein binding(GO:1990763) |
| 0.0 | 0.1 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
| 0.0 | 0.3 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.0 | 0.5 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.0 | 1.3 | GO:0004402 | histone acetyltransferase activity(GO:0004402) peptide-lysine-N-acetyltransferase activity(GO:0061733) |
| 0.0 | 0.3 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.0 | 0.5 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
| 0.0 | 0.1 | GO:0045155 | electron transporter, transferring electrons from CoQH2-cytochrome c reductase complex and cytochrome c oxidase complex activity(GO:0045155) |
| 0.0 | 0.2 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.0 | 0.1 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.0 | 0.1 | GO:0070905 | serine binding(GO:0070905) |
| 0.0 | 0.5 | GO:0070513 | death domain binding(GO:0070513) |
| 0.0 | 0.3 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.0 | 0.1 | GO:0004775 | succinate-CoA ligase (ADP-forming) activity(GO:0004775) |
| 0.0 | 0.1 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
| 0.0 | 0.2 | GO:0043532 | angiostatin binding(GO:0043532) |
| 0.0 | 0.1 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.0 | 0.2 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.0 | 0.7 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
| 0.0 | 0.4 | GO:0016641 | oxidoreductase activity, acting on the CH-NH2 group of donors, oxygen as acceptor(GO:0016641) |
| 0.0 | 0.7 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
| 0.0 | 0.1 | GO:0008336 | gamma-butyrobetaine dioxygenase activity(GO:0008336) |
| 0.0 | 0.9 | GO:0018024 | histone-lysine N-methyltransferase activity(GO:0018024) |
| 0.0 | 0.2 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.0 | 0.2 | GO:0042610 | CD8 receptor binding(GO:0042610) |
| 0.0 | 0.2 | GO:0015065 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
| 0.0 | 0.1 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.0 | 0.2 | GO:0005353 | fructose transmembrane transporter activity(GO:0005353) |
| 0.0 | 0.2 | GO:0030369 | ICAM-3 receptor activity(GO:0030369) |
| 0.0 | 1.4 | GO:0019888 | protein phosphatase regulator activity(GO:0019888) |
| 0.0 | 0.1 | GO:0031962 | mineralocorticoid receptor binding(GO:0031962) |
| 0.0 | 0.1 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
| 0.0 | 0.2 | GO:0035800 | deubiquitinase activator activity(GO:0035800) |
| 0.0 | 0.5 | GO:0008266 | poly-pyrimidine tract binding(GO:0008187) poly(U) RNA binding(GO:0008266) |
| 0.0 | 0.2 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.0 | 0.1 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
| 0.0 | 0.1 | GO:0008410 | CoA-transferase activity(GO:0008410) |
| 0.0 | 0.4 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 0.0 | 0.4 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.0 | 0.1 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
| 0.0 | 0.1 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.0 | 0.1 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.0 | 0.1 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.0 | 0.1 | GO:0099602 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
| 0.0 | 0.2 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.0 | 0.1 | GO:0033149 | FFAT motif binding(GO:0033149) |
| 0.0 | 0.1 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.0 | 0.1 | GO:0004815 | aspartate-tRNA ligase activity(GO:0004815) |
| 0.0 | 0.3 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 0.0 | 0.7 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.0 | 0.3 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
| 0.0 | 0.1 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| 0.0 | 0.1 | GO:0019976 | interleukin-2 receptor activity(GO:0004911) interleukin-2 binding(GO:0019976) |
| 0.0 | 0.2 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.0 | 0.7 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.0 | 0.0 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
| 0.0 | 0.1 | GO:0017018 | myosin phosphatase activity(GO:0017018) |
| 0.0 | 0.3 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.0 | 0.1 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
| 0.0 | 0.1 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
| 0.0 | 0.1 | GO:0001733 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.0 | 0.2 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.0 | 0.1 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
| 0.0 | 0.1 | GO:0008424 | glycoprotein 6-alpha-L-fucosyltransferase activity(GO:0008424) alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
| 0.0 | 0.1 | GO:0004803 | transposase activity(GO:0004803) |
| 0.0 | 0.4 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.0 | 0.2 | GO:0005497 | androgen binding(GO:0005497) |
| 0.0 | 0.4 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.0 | 1.0 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) |
| 0.0 | 0.2 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
| 0.0 | 0.1 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
| 0.0 | 0.7 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.0 | 0.2 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.0 | 3.7 | GO:0008201 | heparin binding(GO:0008201) |
| 0.0 | 0.2 | GO:0030249 | cyclase regulator activity(GO:0010851) guanylate cyclase regulator activity(GO:0030249) |
| 0.0 | 0.5 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
| 0.0 | 0.1 | GO:0008518 | reduced folate carrier activity(GO:0008518) methotrexate transporter activity(GO:0015350) |
| 0.0 | 0.1 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
| 0.0 | 0.2 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.0 | 0.6 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.1 | GO:0099580 | ion antiporter activity involved in regulation of postsynaptic membrane potential(GO:0099580) |
| 0.0 | 1.2 | GO:0019003 | GDP binding(GO:0019003) |
| 0.0 | 0.1 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.0 | 0.1 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.0 | 0.1 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
| 0.0 | 0.0 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.0 | 0.7 | GO:0035326 | enhancer binding(GO:0035326) |
| 0.0 | 0.1 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.0 | 0.0 | GO:0047223 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase activity(GO:0047223) |
| 0.0 | 0.1 | GO:0052590 | sn-glycerol-3-phosphate:ubiquinone oxidoreductase activity(GO:0052590) sn-glycerol-3-phosphate:ubiquinone-8 oxidoreductase activity(GO:0052591) |
| 0.0 | 0.5 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.0 | 0.4 | GO:0051018 | protein kinase A binding(GO:0051018) |
| 0.0 | 0.1 | GO:0031208 | POZ domain binding(GO:0031208) |
| 0.0 | 0.2 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
| 0.0 | 0.1 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.0 | 0.3 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.0 | 0.2 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
| 0.0 | 0.1 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
| 0.0 | 0.3 | GO:0044769 | ATPase activity, coupled to transmembrane movement of ions, rotational mechanism(GO:0044769) proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.0 | 0.8 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 0.0 | 0.3 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
| 0.0 | 0.2 | GO:0004576 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 0.3 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.0 | 0.1 | GO:0033981 | D-dopachrome decarboxylase activity(GO:0033981) |
| 0.0 | 0.3 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.0 | 0.2 | GO:1990459 | transferrin receptor binding(GO:1990459) |
| 0.0 | 1.0 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
| 0.0 | 0.4 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.0 | 0.1 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 0.0 | 0.9 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.0 | 0.1 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
| 0.0 | 0.6 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.0 | 0.1 | GO:0004470 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) oxaloacetate decarboxylase activity(GO:0008948) |
| 0.0 | 0.2 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.0 | 0.2 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.0 | 0.8 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.0 | 0.4 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.0 | 0.1 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.0 | 0.1 | GO:0051393 | alpha-actinin binding(GO:0051393) |
| 0.0 | 0.1 | GO:0048256 | flap endonuclease activity(GO:0048256) |
| 0.0 | 0.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.0 | 0.1 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.0 | 0.3 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.0 | 0.1 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
| 0.0 | 0.1 | GO:0016274 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
| 0.0 | 0.1 | GO:1990948 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.0 | 0.0 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
| 0.0 | 0.4 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.0 | 0.0 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.0 | 0.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.0 | 0.3 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.0 | 0.0 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
| 0.0 | 0.1 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.0 | 0.6 | GO:0034062 | DNA-directed RNA polymerase activity(GO:0003899) RNA polymerase activity(GO:0034062) |
| 0.0 | 0.3 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.0 | 0.1 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.0 | 0.1 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
| 0.0 | 0.4 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.0 | 0.0 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.0 | 0.3 | GO:0016859 | cis-trans isomerase activity(GO:0016859) |
| 0.0 | 0.1 | GO:0019798 | procollagen-proline 4-dioxygenase activity(GO:0004656) procollagen-proline dioxygenase activity(GO:0019798) |
| 0.0 | 0.0 | GO:0030247 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.0 | 0.1 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
| 0.0 | 0.3 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.0 | 0.0 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.0 | 0.2 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.0 | 0.4 | GO:0005158 | insulin receptor binding(GO:0005158) |
| 0.0 | 0.1 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.0 | 0.5 | GO:0015078 | hydrogen ion transmembrane transporter activity(GO:0015078) |
| 0.0 | 0.3 | GO:0043021 | ribonucleoprotein complex binding(GO:0043021) |
| 0.0 | 0.0 | GO:0008378 | galactosyltransferase activity(GO:0008378) |
| 0.0 | 0.2 | GO:0004875 | complement receptor activity(GO:0004875) |
| 0.0 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.0 | 0.1 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 2.6 | GO:0015631 | tubulin binding(GO:0015631) |
| 0.0 | 0.1 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.0 | 0.1 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.0 | 0.2 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.0 | 0.1 | GO:0016775 | phosphotransferase activity, nitrogenous group as acceptor(GO:0016775) |
| 0.0 | 0.3 | GO:0001972 | retinoic acid binding(GO:0001972) |
| 0.0 | 0.0 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
| 0.0 | 0.1 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
| 0.0 | 0.0 | GO:0004465 | lipoprotein lipase activity(GO:0004465) |
| 0.0 | 0.0 | GO:0004766 | spermidine synthase activity(GO:0004766) |
| 0.0 | 0.2 | GO:0008483 | transaminase activity(GO:0008483) |
| 0.0 | 0.0 | GO:0015131 | thiosulfate transmembrane transporter activity(GO:0015117) oxaloacetate transmembrane transporter activity(GO:0015131) |
| 0.0 | 0.1 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.0 | 0.1 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
| 0.0 | 0.3 | GO:0005048 | signal sequence binding(GO:0005048) |