ENCODE cell lines, expression (Ernst 2011)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
PAX5
|
ENSG00000196092.8 | PAX5 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| PAX5 | hg19_v2_chr9_-_37034028_37034157 | 0.67 | 4.7e-03 | Click! |
| Promoter | Score | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr22_+_22930626 | 5.11 |
ENST00000390302.2 |
IGLV2-33 |
immunoglobulin lambda variable 2-33 (non-functional) |
| chr22_+_23040274 | 4.54 |
ENST00000390306.2 |
IGLV2-23 |
immunoglobulin lambda variable 2-23 |
| chr22_+_23077065 | 4.01 |
ENST00000390310.2 |
IGLV2-18 |
immunoglobulin lambda variable 2-18 |
| chr22_+_23165153 | 3.94 |
ENST00000390317.2 |
IGLV2-8 |
immunoglobulin lambda variable 2-8 |
| chr22_+_23101182 | 3.91 |
ENST00000390312.2 |
IGLV2-14 |
immunoglobulin lambda variable 2-14 |
| chr1_-_27961720 | 3.11 |
ENST00000545953.1 ENST00000374005.3 |
FGR |
feline Gardner-Rasheed sarcoma viral oncogene homolog |
| chr14_-_106069247 | 2.97 |
ENST00000479229.1 |
RP11-731F5.1 |
RP11-731F5.1 |
| chr7_-_100239132 | 2.70 |
ENST00000223051.3 ENST00000431692.1 |
TFR2 |
transferrin receptor 2 |
| chr1_-_9132311 | 2.69 |
ENST00000474145.1 |
SLC2A5 |
solute carrier family 2 (facilitated glucose/fructose transporter), member 5 |
| chr16_+_85942594 | 2.69 |
ENST00000566369.1 |
IRF8 |
interferon regulatory factor 8 |
| chr22_+_23264766 | 2.68 |
ENST00000390331.2 |
IGLC7 |
immunoglobulin lambda constant 7 |
| chr22_+_23134974 | 2.66 |
ENST00000390314.2 |
IGLV2-11 |
immunoglobulin lambda variable 2-11 |
| chr21_-_15918618 | 2.43 |
ENST00000400564.1 ENST00000400566.1 |
SAMSN1 |
SAM domain, SH3 domain and nuclear localization signals 1 |
| chr22_-_37882395 | 2.42 |
ENST00000416983.3 ENST00000424765.2 ENST00000356998.3 |
MFNG |
MFNG O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase |
| chr12_-_53601000 | 2.28 |
ENST00000338737.4 ENST00000549086.2 |
ITGB7 |
integrin, beta 7 |
| chr19_-_39826639 | 2.26 |
ENST00000602185.1 ENST00000598034.1 ENST00000601387.1 ENST00000595636.1 ENST00000253054.8 ENST00000594700.1 ENST00000597595.1 |
GMFG |
glia maturation factor, gamma |
| chr17_-_62084241 | 2.23 |
ENST00000449662.2 |
ICAM2 |
intercellular adhesion molecule 2 |
| chr1_+_111415757 | 2.22 |
ENST00000429072.2 ENST00000271324.5 |
CD53 |
CD53 molecule |
| chr6_+_89674246 | 2.21 |
ENST00000369474.1 |
AL079342.1 |
Uncharacterized protein; cDNA FLJ27030 fis, clone SLV07741 |
| chr3_+_186330712 | 2.19 |
ENST00000411641.2 ENST00000273784.5 |
AHSG |
alpha-2-HS-glycoprotein |
| chr1_-_9131776 | 2.19 |
ENST00000484798.1 |
SLC2A5 |
solute carrier family 2 (facilitated glucose/fructose transporter), member 5 |
| chr14_-_106539557 | 2.17 |
ENST00000390599.2 |
IGHV1-8 |
immunoglobulin heavy variable 1-8 |
| chr20_+_46130671 | 2.13 |
ENST00000371998.3 ENST00000371997.3 |
NCOA3 |
nuclear receptor coactivator 3 |
| chr22_+_23241661 | 2.09 |
ENST00000390322.2 |
IGLJ2 |
immunoglobulin lambda joining 2 |
| chr1_-_111743285 | 2.07 |
ENST00000357640.4 |
DENND2D |
DENN/MADD domain containing 2D |
| chr10_+_114133773 | 2.05 |
ENST00000354655.4 |
ACSL5 |
acyl-CoA synthetase long-chain family member 5 |
| chr9_+_71320596 | 2.01 |
ENST00000265382.3 |
PIP5K1B |
phosphatidylinositol-4-phosphate 5-kinase, type I, beta |
| chr14_-_106174960 | 2.01 |
ENST00000390547.2 |
IGHA1 |
immunoglobulin heavy constant alpha 1 |
| chr20_+_46130601 | 1.99 |
ENST00000341724.6 |
NCOA3 |
nuclear receptor coactivator 3 |
| chr2_-_21266935 | 1.96 |
ENST00000233242.1 |
APOB |
apolipoprotein B |
| chr16_+_23847339 | 1.93 |
ENST00000303531.7 |
PRKCB |
protein kinase C, beta |
| chr6_-_29595779 | 1.91 |
ENST00000355973.3 ENST00000377012.4 |
GABBR1 |
gamma-aminobutyric acid (GABA) B receptor, 1 |
| chr13_-_99959641 | 1.90 |
ENST00000376414.4 |
GPR183 |
G protein-coupled receptor 183 |
| chr14_-_106963409 | 1.89 |
ENST00000390621.2 |
IGHV1-45 |
immunoglobulin heavy variable 1-45 |
| chr6_-_32634425 | 1.89 |
ENST00000399082.3 ENST00000399079.3 ENST00000374943.4 ENST00000434651.2 |
HLA-DQB1 |
major histocompatibility complex, class II, DQ beta 1 |
| chr17_-_28618948 | 1.88 |
ENST00000261714.6 |
BLMH |
bleomycin hydrolase |
| chr16_+_57392684 | 1.84 |
ENST00000219235.4 |
CCL22 |
chemokine (C-C motif) ligand 22 |
| chr1_+_32716857 | 1.76 |
ENST00000482949.1 ENST00000495610.2 |
LCK |
lymphocyte-specific protein tyrosine kinase |
| chr17_-_28618867 | 1.76 |
ENST00000394819.3 ENST00000577623.1 |
BLMH |
bleomycin hydrolase |
| chr6_+_32407619 | 1.76 |
ENST00000395388.2 ENST00000374982.5 |
HLA-DRA |
major histocompatibility complex, class II, DR alpha |
| chr11_+_60223225 | 1.74 |
ENST00000524807.1 ENST00000345732.4 |
MS4A1 |
membrane-spanning 4-domains, subfamily A, member 1 |
| chr11_+_60223312 | 1.73 |
ENST00000532491.1 ENST00000532073.1 ENST00000534668.1 ENST00000528313.1 ENST00000533306.1 |
MS4A1 |
membrane-spanning 4-domains, subfamily A, member 1 |
| chr1_-_230850043 | 1.71 |
ENST00000366667.4 |
AGT |
angiotensinogen (serpin peptidase inhibitor, clade A, member 8) |
| chr19_-_2702681 | 1.69 |
ENST00000382159.3 |
GNG7 |
guanine nucleotide binding protein (G protein), gamma 7 |
| chr9_-_123676827 | 1.68 |
ENST00000546084.1 |
TRAF1 |
TNF receptor-associated factor 1 |
| chr20_+_46130619 | 1.67 |
ENST00000372004.3 |
NCOA3 |
nuclear receptor coactivator 3 |
| chr10_-_64576105 | 1.66 |
ENST00000242480.3 ENST00000411732.1 |
EGR2 |
early growth response 2 |
| chr15_-_79237433 | 1.66 |
ENST00000220166.5 |
CTSH |
cathepsin H |
| chr1_-_161193349 | 1.65 |
ENST00000469730.2 ENST00000463273.1 ENST00000464492.1 ENST00000367990.3 ENST00000470459.2 ENST00000468465.1 ENST00000463812.1 |
APOA2 |
apolipoprotein A-II |
| chr3_+_52828805 | 1.65 |
ENST00000416872.2 ENST00000449956.2 |
ITIH3 |
inter-alpha-trypsin inhibitor heavy chain 3 |
| chr12_+_69742121 | 1.63 |
ENST00000261267.2 ENST00000549690.1 ENST00000548839.1 |
LYZ |
lysozyme |
| chr1_-_24194771 | 1.63 |
ENST00000374479.3 |
FUCA1 |
fucosidase, alpha-L- 1, tissue |
| chr13_-_47012325 | 1.63 |
ENST00000409879.2 |
KIAA0226L |
KIAA0226-like |
| chr12_-_53601055 | 1.58 |
ENST00000552972.1 ENST00000422257.3 ENST00000267082.5 |
ITGB7 |
integrin, beta 7 |
| chr2_-_27558270 | 1.58 |
ENST00000454704.1 |
GTF3C2 |
general transcription factor IIIC, polypeptide 2, beta 110kDa |
| chr14_-_23288930 | 1.58 |
ENST00000554517.1 ENST00000285850.7 ENST00000397529.2 ENST00000555702.1 |
SLC7A7 |
solute carrier family 7 (amino acid transporter light chain, y+L system), member 7 |
| chr14_-_106322288 | 1.57 |
ENST00000390559.2 |
IGHM |
immunoglobulin heavy constant mu |
| chr11_-_116708302 | 1.57 |
ENST00000375320.1 ENST00000359492.2 ENST00000375329.2 ENST00000375323.1 |
APOA1 |
apolipoprotein A-I |
| chr8_+_28174649 | 1.55 |
ENST00000301908.3 |
PNOC |
prepronociceptin |
| chr1_-_154842741 | 1.55 |
ENST00000271915.4 |
KCNN3 |
potassium intermediate/small conductance calcium-activated channel, subfamily N, member 3 |
| chr3_+_169629354 | 1.53 |
ENST00000428432.2 ENST00000335556.3 |
SAMD7 |
sterile alpha motif domain containing 7 |
| chr1_+_249132462 | 1.52 |
ENST00000306562.3 |
ZNF672 |
zinc finger protein 672 |
| chr12_-_117537240 | 1.52 |
ENST00000392545.4 ENST00000541210.1 ENST00000335209.7 |
TESC |
tescalcin |
| chr17_-_34417479 | 1.50 |
ENST00000225245.5 |
CCL3 |
chemokine (C-C motif) ligand 3 |
| chr16_-_89007491 | 1.49 |
ENST00000327483.5 ENST00000564416.1 |
CBFA2T3 |
core-binding factor, runt domain, alpha subunit 2; translocated to, 3 |
| chr12_+_7023735 | 1.49 |
ENST00000538763.1 ENST00000544774.1 ENST00000545045.2 |
ENO2 |
enolase 2 (gamma, neuronal) |
| chr2_+_33701286 | 1.46 |
ENST00000403687.3 |
RASGRP3 |
RAS guanyl releasing protein 3 (calcium and DAG-regulated) |
| chrX_-_100641155 | 1.46 |
ENST00000372880.1 ENST00000308731.7 |
BTK |
Bruton agammaglobulinemia tyrosine kinase |
| chr7_-_87505658 | 1.45 |
ENST00000341119.5 |
SLC25A40 |
solute carrier family 25, member 40 |
| chrX_-_152486108 | 1.44 |
ENST00000356661.5 |
MAGEA1 |
melanoma antigen family A, 1 (directs expression of antigen MZ2-E) |
| chr17_-_64216748 | 1.44 |
ENST00000585162.1 |
APOH |
apolipoprotein H (beta-2-glycoprotein I) |
| chr5_-_150603679 | 1.44 |
ENST00000355417.2 |
CCDC69 |
coiled-coil domain containing 69 |
| chr8_+_56014949 | 1.43 |
ENST00000327381.6 |
XKR4 |
XK, Kell blood group complex subunit-related family, member 4 |
| chr1_+_32716840 | 1.43 |
ENST00000336890.5 |
LCK |
lymphocyte-specific protein tyrosine kinase |
| chr11_-_33913708 | 1.42 |
ENST00000257818.2 |
LMO2 |
LIM domain only 2 (rhombotin-like 1) |
| chr1_-_159046617 | 1.41 |
ENST00000368130.4 |
AIM2 |
absent in melanoma 2 |
| chr5_-_149792295 | 1.41 |
ENST00000518797.1 ENST00000524315.1 ENST00000009530.7 ENST00000377795.3 |
CD74 |
CD74 molecule, major histocompatibility complex, class II invariant chain |
| chr14_-_55369525 | 1.41 |
ENST00000543643.2 ENST00000536224.2 ENST00000395514.1 ENST00000491895.2 |
GCH1 |
GTP cyclohydrolase 1 |
| chr15_+_89181974 | 1.40 |
ENST00000306072.5 |
ISG20 |
interferon stimulated exonuclease gene 20kDa |
| chr1_+_32739733 | 1.39 |
ENST00000333070.4 |
LCK |
lymphocyte-specific protein tyrosine kinase |
| chr9_+_71320557 | 1.39 |
ENST00000541509.1 |
PIP5K1B |
phosphatidylinositol-4-phosphate 5-kinase, type I, beta |
| chr19_-_10445399 | 1.39 |
ENST00000592945.1 |
ICAM3 |
intercellular adhesion molecule 3 |
| chr11_-_5276008 | 1.39 |
ENST00000336906.4 |
HBG2 |
hemoglobin, gamma G |
| chr17_-_46507567 | 1.37 |
ENST00000584924.1 |
SKAP1 |
src kinase associated phosphoprotein 1 |
| chrX_-_70331298 | 1.36 |
ENST00000456850.2 ENST00000473378.1 ENST00000487883.1 ENST00000374202.2 |
IL2RG |
interleukin 2 receptor, gamma |
| chr11_+_22688150 | 1.36 |
ENST00000454584.2 |
GAS2 |
growth arrest-specific 2 |
| chr19_+_49838653 | 1.36 |
ENST00000598095.1 ENST00000426897.2 ENST00000323906.4 ENST00000535669.2 ENST00000597602.1 ENST00000595660.1 |
CD37 |
CD37 molecule |
| chr2_+_209130965 | 1.33 |
ENST00000392202.3 ENST00000264380.4 ENST00000407449.1 ENST00000308862.6 |
PIKFYVE |
phosphoinositide kinase, FYVE finger containing |
| chr11_-_46142948 | 1.33 |
ENST00000257821.4 |
PHF21A |
PHD finger protein 21A |
| chr2_-_216946500 | 1.33 |
ENST00000265322.7 |
PECR |
peroxisomal trans-2-enoyl-CoA reductase |
| chr17_-_7082668 | 1.32 |
ENST00000573083.1 ENST00000574388.1 |
ASGR1 |
asialoglycoprotein receptor 1 |
| chr7_+_73623717 | 1.32 |
ENST00000344995.5 ENST00000460943.1 |
LAT2 |
linker for activation of T cells family, member 2 |
| chr15_+_89182156 | 1.31 |
ENST00000379224.5 |
ISG20 |
interferon stimulated exonuclease gene 20kDa |
| chr2_+_65216462 | 1.31 |
ENST00000234256.3 |
SLC1A4 |
solute carrier family 1 (glutamate/neutral amino acid transporter), member 4 |
| chr6_+_31583761 | 1.30 |
ENST00000376049.4 |
AIF1 |
allograft inflammatory factor 1 |
| chr2_+_163200848 | 1.29 |
ENST00000233612.4 |
GCA |
grancalcin, EF-hand calcium binding protein |
| chrX_+_151867214 | 1.29 |
ENST00000329342.5 ENST00000412733.1 ENST00000457643.1 |
MAGEA6 |
melanoma antigen family A, 6 |
| chr14_-_106733624 | 1.29 |
ENST00000390610.2 |
IGHV1-24 |
immunoglobulin heavy variable 1-24 |
| chr6_-_32908792 | 1.28 |
ENST00000418107.2 |
HLA-DMB |
major histocompatibility complex, class II, DM beta |
| chr19_-_36297348 | 1.28 |
ENST00000589835.1 |
PRODH2 |
proline dehydrogenase (oxidase) 2 |
| chr15_+_89182178 | 1.28 |
ENST00000559876.1 |
ISG20 |
interferon stimulated exonuclease gene 20kDa |
| chr2_-_89157161 | 1.27 |
ENST00000390237.2 |
IGKC |
immunoglobulin kappa constant |
| chr17_+_27369918 | 1.27 |
ENST00000323372.4 |
PIPOX |
pipecolic acid oxidase |
| chr17_+_65821636 | 1.26 |
ENST00000544778.2 |
BPTF |
bromodomain PHD finger transcription factor |
| chr14_-_106054659 | 1.26 |
ENST00000390539.2 |
IGHA2 |
immunoglobulin heavy constant alpha 2 (A2m marker) |
| chr16_+_28943260 | 1.26 |
ENST00000538922.1 ENST00000324662.3 ENST00000567541.1 |
CD19 |
CD19 molecule |
| chr19_+_18284477 | 1.25 |
ENST00000407280.3 |
IFI30 |
interferon, gamma-inducible protein 30 |
| chr12_-_63328817 | 1.25 |
ENST00000228705.6 |
PPM1H |
protein phosphatase, Mg2+/Mn2+ dependent, 1H |
| chr15_+_64443905 | 1.23 |
ENST00000325881.4 |
SNX22 |
sorting nexin 22 |
| chr17_-_46507537 | 1.23 |
ENST00000336915.6 |
SKAP1 |
src kinase associated phosphoprotein 1 |
| chr12_+_7023491 | 1.23 |
ENST00000541477.1 ENST00000229277.1 |
ENO2 |
enolase 2 (gamma, neuronal) |
| chr16_+_68119247 | 1.23 |
ENST00000575270.1 |
NFATC3 |
nuclear factor of activated T-cells, cytoplasmic, calcineurin-dependent 3 |
| chr15_-_45480153 | 1.22 |
ENST00000560471.1 ENST00000560540.1 |
SHF |
Src homology 2 domain containing F |
| chr16_+_69599861 | 1.21 |
ENST00000354436.2 |
NFAT5 |
nuclear factor of activated T-cells 5, tonicity-responsive |
| chr6_+_32605195 | 1.21 |
ENST00000374949.2 |
HLA-DQA1 |
major histocompatibility complex, class II, DQ alpha 1 |
| chr7_+_87505544 | 1.20 |
ENST00000265728.1 |
DBF4 |
DBF4 homolog (S. cerevisiae) |
| chr7_+_75609672 | 1.20 |
ENST00000545601.1 ENST00000450476.1 |
POR |
P450 (cytochrome) oxidoreductase |
| chr19_+_18208603 | 1.20 |
ENST00000262811.6 |
MAST3 |
microtubule associated serine/threonine kinase 3 |
| chr22_-_18256742 | 1.19 |
ENST00000317361.7 |
BID |
BH3 interacting domain death agonist |
| chr15_+_41057818 | 1.19 |
ENST00000558467.1 |
GCHFR |
GTP cyclohydrolase I feedback regulator |
| chr8_-_101348408 | 1.17 |
ENST00000519527.1 ENST00000522369.1 |
RNF19A |
ring finger protein 19A, RBR E3 ubiquitin protein ligase |
| chr8_+_11351876 | 1.17 |
ENST00000529894.1 |
BLK |
B lymphoid tyrosine kinase |
| chr12_-_54689532 | 1.16 |
ENST00000540264.2 ENST00000312156.4 |
NFE2 |
nuclear factor, erythroid 2 |
| chr16_+_68119764 | 1.14 |
ENST00000570212.1 ENST00000562926.1 |
NFATC3 |
nuclear factor of activated T-cells, cytoplasmic, calcineurin-dependent 3 |
| chr19_+_3178736 | 1.14 |
ENST00000246115.3 |
S1PR4 |
sphingosine-1-phosphate receptor 4 |
| chr3_+_44840679 | 1.14 |
ENST00000425755.1 |
KIF15 |
kinesin family member 15 |
| chr11_+_117857063 | 1.14 |
ENST00000227752.3 ENST00000541785.1 ENST00000545409.1 |
IL10RA |
interleukin 10 receptor, alpha |
| chr4_+_89378261 | 1.13 |
ENST00000264350.3 |
HERC5 |
HECT and RLD domain containing E3 ubiquitin protein ligase 5 |
| chr22_+_22712087 | 1.13 |
ENST00000390294.2 |
IGLV1-47 |
immunoglobulin lambda variable 1-47 |
| chr17_-_7080801 | 1.12 |
ENST00000572879.1 |
ASGR1 |
asialoglycoprotein receptor 1 |
| chr2_-_170430366 | 1.12 |
ENST00000453153.2 ENST00000445210.1 |
FASTKD1 |
FAST kinase domains 1 |
| chr20_+_30640004 | 1.12 |
ENST00000520553.1 ENST00000518730.1 ENST00000375852.2 |
HCK |
hemopoietic cell kinase |
| chr16_+_69599899 | 1.11 |
ENST00000567239.1 |
NFAT5 |
nuclear factor of activated T-cells 5, tonicity-responsive |
| chr11_+_75526212 | 1.11 |
ENST00000356136.3 |
UVRAG |
UV radiation resistance associated |
| chr16_+_202686 | 1.10 |
ENST00000252951.2 |
HBZ |
hemoglobin, zeta |
| chr17_-_7082861 | 1.10 |
ENST00000269299.3 |
ASGR1 |
asialoglycoprotein receptor 1 |
| chr14_-_95942173 | 1.10 |
ENST00000334258.5 ENST00000557275.1 ENST00000553340.1 |
SYNE3 |
spectrin repeat containing, nuclear envelope family member 3 |
| chr2_+_11696464 | 1.10 |
ENST00000234142.5 |
GREB1 |
growth regulation by estrogen in breast cancer 1 |
| chr22_+_21128167 | 1.10 |
ENST00000215727.5 |
SERPIND1 |
serpin peptidase inhibitor, clade D (heparin cofactor), member 1 |
| chr19_-_7764281 | 1.09 |
ENST00000360067.4 |
FCER2 |
Fc fragment of IgE, low affinity II, receptor for (CD23) |
| chr20_+_30639991 | 1.09 |
ENST00000534862.1 ENST00000538448.1 ENST00000375862.2 |
HCK |
hemopoietic cell kinase |
| chr9_+_35673853 | 1.09 |
ENST00000378357.4 |
CA9 |
carbonic anhydrase IX |
| chr19_-_7766991 | 1.09 |
ENST00000597921.1 ENST00000346664.5 |
FCER2 |
Fc fragment of IgE, low affinity II, receptor for (CD23) |
| chr7_-_22234381 | 1.09 |
ENST00000458533.1 |
RAPGEF5 |
Rap guanine nucleotide exchange factor (GEF) 5 |
| chr7_+_102715315 | 1.09 |
ENST00000428183.2 ENST00000323716.3 ENST00000441711.2 ENST00000454559.1 ENST00000425331.1 ENST00000541300.1 |
ARMC10 |
armadillo repeat containing 10 |
| chrX_-_133119895 | 1.09 |
ENST00000370818.3 |
GPC3 |
glypican 3 |
| chr8_+_28196157 | 1.08 |
ENST00000522209.1 |
PNOC |
prepronociceptin |
| chr17_-_26695013 | 1.08 |
ENST00000555059.2 |
CTB-96E2.2 |
Homeobox protein SEBOX |
| chr5_+_130599735 | 1.08 |
ENST00000503291.1 ENST00000360515.3 ENST00000505065.1 |
CDC42SE2 |
CDC42 small effector 2 |
| chr19_+_4229495 | 1.08 |
ENST00000221847.5 |
EBI3 |
Epstein-Barr virus induced 3 |
| chr7_-_29234802 | 1.07 |
ENST00000449801.1 ENST00000409850.1 |
CPVL |
carboxypeptidase, vitellogenic-like |
| chr12_-_53594227 | 1.07 |
ENST00000550743.2 |
ITGB7 |
integrin, beta 7 |
| chr15_-_20193370 | 1.07 |
ENST00000558565.2 |
IGHV3OR15-7 |
immunoglobulin heavy variable 3/OR15-7 (pseudogene) |
| chr3_+_121554046 | 1.07 |
ENST00000273668.2 ENST00000451944.2 |
EAF2 |
ELL associated factor 2 |
| chr14_-_106642049 | 1.07 |
ENST00000390605.2 |
IGHV1-18 |
immunoglobulin heavy variable 1-18 |
| chr7_+_138145145 | 1.06 |
ENST00000415680.2 |
TRIM24 |
tripartite motif containing 24 |
| chr17_+_34431212 | 1.06 |
ENST00000394495.1 |
CCL4 |
chemokine (C-C motif) ligand 4 |
| chr11_+_111945011 | 1.06 |
ENST00000532163.1 ENST00000280352.9 ENST00000530104.1 ENST00000526879.1 ENST00000393047.3 ENST00000525785.1 |
C11orf57 |
chromosome 11 open reading frame 57 |
| chr17_-_7081435 | 1.05 |
ENST00000380920.4 |
ASGR1 |
asialoglycoprotein receptor 1 |
| chr17_-_26694979 | 1.04 |
ENST00000438614.1 |
VTN |
vitronectin |
| chr1_-_51425902 | 1.04 |
ENST00000396153.2 |
FAF1 |
Fas (TNFRSF6) associated factor 1 |
| chr5_-_168006591 | 1.04 |
ENST00000239231.6 |
PANK3 |
pantothenate kinase 3 |
| chr13_+_50202435 | 1.04 |
ENST00000282026.1 |
ARL11 |
ADP-ribosylation factor-like 11 |
| chr1_-_32801825 | 1.04 |
ENST00000329421.7 |
MARCKSL1 |
MARCKS-like 1 |
| chr2_+_89901292 | 1.03 |
ENST00000448155.2 |
IGKV1D-39 |
immunoglobulin kappa variable 1D-39 |
| chr2_-_175547571 | 1.03 |
ENST00000409415.3 ENST00000359761.3 ENST00000272746.5 |
WIPF1 |
WAS/WASL interacting protein family, member 1 |
| chr6_+_13272904 | 1.02 |
ENST00000379335.3 ENST00000379329.1 |
PHACTR1 |
phosphatase and actin regulator 1 |
| chrX_-_151903184 | 1.02 |
ENST00000357916.4 ENST00000393869.3 |
MAGEA12 |
melanoma antigen family A, 12 |
| chr6_-_32920794 | 1.01 |
ENST00000395305.3 ENST00000395303.3 ENST00000374843.4 ENST00000429234.1 |
HLA-DMA XXbac-BPG181M17.5 |
major histocompatibility complex, class II, DM alpha Uncharacterized protein |
| chr1_+_160709029 | 1.01 |
ENST00000444090.2 ENST00000441662.2 |
SLAMF7 |
SLAM family member 7 |
| chr2_+_163200598 | 1.01 |
ENST00000437150.2 ENST00000453113.2 |
GCA |
grancalcin, EF-hand calcium binding protein |
| chr17_+_41003166 | 1.01 |
ENST00000308423.2 |
AOC3 |
amine oxidase, copper containing 3 |
| chr16_+_69600058 | 1.01 |
ENST00000393742.2 |
NFAT5 |
nuclear factor of activated T-cells 5, tonicity-responsive |
| chr2_-_85839146 | 1.01 |
ENST00000306336.5 ENST00000409734.3 |
C2orf68 |
chromosome 2 open reading frame 68 |
| chr16_+_33605231 | 1.01 |
ENST00000570121.2 |
IGHV3OR16-12 |
immunoglobulin heavy variable 3/OR16-12 (non-functional) |
| chr17_-_26903900 | 1.00 |
ENST00000395319.3 ENST00000581807.1 ENST00000584086.1 ENST00000395321.2 |
ALDOC |
aldolase C, fructose-bisphosphate |
| chr15_+_81475047 | 0.99 |
ENST00000559388.1 |
IL16 |
interleukin 16 |
| chr6_-_35888905 | 0.99 |
ENST00000510290.1 ENST00000423325.2 ENST00000373822.1 |
SRPK1 |
SRSF protein kinase 1 |
| chrX_-_151903101 | 0.99 |
ENST00000393900.3 |
MAGEA12 |
melanoma antigen family A, 12 |
| chr1_-_51425772 | 0.99 |
ENST00000371778.4 |
FAF1 |
Fas (TNFRSF6) associated factor 1 |
| chr12_+_6554021 | 0.99 |
ENST00000266557.3 |
CD27 |
CD27 molecule |
| chr19_+_45417504 | 0.99 |
ENST00000588750.1 ENST00000588802.1 |
APOC1 |
apolipoprotein C-I |
| chr2_-_170430277 | 0.98 |
ENST00000438035.1 ENST00000453929.2 |
FASTKD1 |
FAST kinase domains 1 |
| chr17_-_38574169 | 0.98 |
ENST00000423485.1 |
TOP2A |
topoisomerase (DNA) II alpha 170kDa |
| chr8_+_6565854 | 0.98 |
ENST00000285518.6 |
AGPAT5 |
1-acylglycerol-3-phosphate O-acyltransferase 5 |
| chr16_+_23847267 | 0.97 |
ENST00000321728.7 |
PRKCB |
protein kinase C, beta |
| chrX_-_152760934 | 0.97 |
ENST00000370210.1 ENST00000421080.2 |
HAUS7 |
HAUS augmin-like complex, subunit 7 |
| chr1_+_160709055 | 0.97 |
ENST00000368043.3 ENST00000368042.3 ENST00000458602.2 ENST00000458104.2 |
SLAMF7 |
SLAM family member 7 |
| chr7_+_26332645 | 0.97 |
ENST00000396376.1 |
SNX10 |
sorting nexin 10 |
| chr1_+_11751748 | 0.97 |
ENST00000294485.5 |
DRAXIN |
dorsal inhibitory axon guidance protein |
| chr19_+_30302805 | 0.97 |
ENST00000262643.3 ENST00000575243.1 ENST00000357943.5 |
CCNE1 |
cyclin E1 |
| chr16_-_89043605 | 0.96 |
ENST00000268679.4 |
CBFA2T3 |
core-binding factor, runt domain, alpha subunit 2; translocated to, 3 |
| chr19_+_1077393 | 0.96 |
ENST00000590577.1 |
HMHA1 |
histocompatibility (minor) HA-1 |
| chr7_+_73624327 | 0.96 |
ENST00000361082.3 ENST00000275635.7 ENST00000470709.1 |
LAT2 |
linker for activation of T cells family, member 2 |
| chr1_-_150738261 | 0.96 |
ENST00000448301.2 ENST00000368985.3 |
CTSS |
cathepsin S |
| chr6_+_13182751 | 0.96 |
ENST00000415087.1 |
PHACTR1 |
phosphatase and actin regulator 1 |
| chr21_-_46340884 | 0.96 |
ENST00000302347.5 ENST00000517819.1 |
ITGB2 |
integrin, beta 2 (complement component 3 receptor 3 and 4 subunit) |
| chr1_-_39407450 | 0.95 |
ENST00000372990.1 |
RHBDL2 |
rhomboid, veinlet-like 2 (Drosophila) |
| chrX_+_151903207 | 0.95 |
ENST00000370287.3 |
CSAG1 |
chondrosarcoma associated gene 1 |
| chrX_+_151903253 | 0.95 |
ENST00000452779.2 ENST00000370291.2 |
CSAG1 |
chondrosarcoma associated gene 1 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.3 | 4.0 | GO:0008859 | exoribonuclease II activity(GO:0008859) |
| 1.1 | 4.5 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 1.1 | 3.3 | GO:0052810 | 1-phosphatidylinositol-5-kinase activity(GO:0052810) |
| 1.0 | 2.9 | GO:0035403 | histone kinase activity (H3-T6 specific)(GO:0035403) |
| 0.9 | 2.7 | GO:0044549 | GTP cyclohydrolase binding(GO:0044549) |
| 0.9 | 2.7 | GO:0016992 | lipoate synthase activity(GO:0016992) radical SAM enzyme activity(GO:0070283) |
| 0.8 | 3.4 | GO:0004998 | transferrin receptor activity(GO:0004998) |
| 0.8 | 6.7 | GO:0004873 | asialoglycoprotein receptor activity(GO:0004873) |
| 0.8 | 3.1 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.8 | 4.6 | GO:0042610 | CD8 receptor binding(GO:0042610) |
| 0.7 | 1.5 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
| 0.7 | 4.9 | GO:0005353 | fructose transmembrane transporter activity(GO:0005353) |
| 0.6 | 2.5 | GO:0035473 | lipase binding(GO:0035473) |
| 0.6 | 1.8 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.6 | 2.5 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
| 0.6 | 2.4 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.6 | 2.9 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.6 | 1.7 | GO:0046921 | glycoprotein 6-alpha-L-fucosyltransferase activity(GO:0008424) alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
| 0.6 | 1.7 | GO:0016708 | nitric oxide dioxygenase activity(GO:0008941) oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of two atoms of oxygen into one donor(GO:0016708) iron-cytochrome-c reductase activity(GO:0047726) |
| 0.6 | 1.7 | GO:0004464 | leukotriene-C4 synthase activity(GO:0004464) |
| 0.6 | 7.8 | GO:0032395 | MHC class II receptor activity(GO:0032395) |
| 0.5 | 2.0 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
| 0.5 | 2.0 | GO:0060422 | peptidyl-dipeptidase inhibitor activity(GO:0060422) |
| 0.5 | 1.5 | GO:0047150 | betaine-homocysteine S-methyltransferase activity(GO:0047150) |
| 0.5 | 1.9 | GO:0004657 | proline dehydrogenase activity(GO:0004657) |
| 0.5 | 1.4 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 0.5 | 2.8 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.5 | 1.4 | GO:1902122 | chenodeoxycholic acid binding(GO:1902122) |
| 0.5 | 1.4 | GO:0004913 | interleukin-4 receptor activity(GO:0004913) |
| 0.4 | 3.1 | GO:0015186 | L-glutamine transmembrane transporter activity(GO:0015186) |
| 0.4 | 1.3 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.4 | 3.1 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.4 | 0.4 | GO:0032551 | pyrimidine nucleoside binding(GO:0001884) UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
| 0.4 | 21.9 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.4 | 1.3 | GO:0033188 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
| 0.4 | 2.4 | GO:0047685 | amine sulfotransferase activity(GO:0047685) |
| 0.4 | 5.2 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.4 | 1.2 | GO:0052594 | tryptamine:oxygen oxidoreductase (deaminating) activity(GO:0052593) aminoacetone:oxygen oxidoreductase(deaminating) activity(GO:0052594) aliphatic-amine oxidase activity(GO:0052595) phenethylamine:oxygen oxidoreductase (deaminating) activity(GO:0052596) |
| 0.4 | 1.9 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.4 | 2.3 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
| 0.4 | 6.2 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.4 | 1.5 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.4 | 1.1 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
| 0.3 | 1.0 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
| 0.3 | 1.4 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.3 | 1.0 | GO:1990404 | protein ADP-ribosylase activity(GO:1990404) |
| 0.3 | 1.0 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.3 | 9.2 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.3 | 0.9 | GO:0008798 | beta-aspartyl-peptidase activity(GO:0008798) |
| 0.3 | 0.9 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.3 | 1.7 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
| 0.3 | 0.8 | GO:0004914 | interleukin-5 receptor activity(GO:0004914) |
| 0.3 | 2.0 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.3 | 1.1 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
| 0.3 | 0.8 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.3 | 2.7 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
| 0.3 | 1.6 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.3 | 0.8 | GO:0016749 | 5-aminolevulinate synthase activity(GO:0003870) N-succinyltransferase activity(GO:0016749) |
| 0.3 | 0.8 | GO:0004119 | cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) |
| 0.3 | 1.1 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 0.3 | 0.8 | GO:0004347 | glucose-6-phosphate isomerase activity(GO:0004347) |
| 0.3 | 4.7 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.3 | 0.8 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 0.3 | 1.5 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.3 | 1.3 | GO:0004485 | methylcrotonoyl-CoA carboxylase activity(GO:0004485) |
| 0.3 | 0.8 | GO:0004819 | glutamine-tRNA ligase activity(GO:0004819) |
| 0.2 | 1.0 | GO:0008940 | nitrate reductase activity(GO:0008940) |
| 0.2 | 1.5 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.2 | 1.4 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.2 | 0.7 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.2 | 1.7 | GO:0030369 | ICAM-3 receptor activity(GO:0030369) |
| 0.2 | 1.7 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 0.2 | 1.9 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.2 | 3.3 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
| 0.2 | 1.4 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
| 0.2 | 0.7 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
| 0.2 | 4.2 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.2 | 0.9 | GO:0015433 | peptide antigen-transporting ATPase activity(GO:0015433) |
| 0.2 | 0.7 | GO:0004362 | glutathione-disulfide reductase activity(GO:0004362) |
| 0.2 | 0.7 | GO:0000406 | heteroduplex DNA loop binding(GO:0000404) double-strand/single-strand DNA junction binding(GO:0000406) dinucleotide repeat insertion binding(GO:0032181) |
| 0.2 | 0.7 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.2 | 1.3 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.2 | 0.4 | GO:0004906 | interferon-gamma receptor activity(GO:0004906) |
| 0.2 | 0.2 | GO:0050436 | microfibril binding(GO:0050436) |
| 0.2 | 0.7 | GO:0017082 | mineralocorticoid receptor activity(GO:0017082) |
| 0.2 | 3.7 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.2 | 1.5 | GO:0047894 | flavonol 3-sulfotransferase activity(GO:0047894) |
| 0.2 | 0.6 | GO:0050613 | delta14-sterol reductase activity(GO:0050613) |
| 0.2 | 0.8 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.2 | 0.6 | GO:0017130 | poly(C) RNA binding(GO:0017130) |
| 0.2 | 3.7 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.2 | 1.0 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.2 | 1.0 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
| 0.2 | 0.8 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) |
| 0.2 | 1.2 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
| 0.2 | 0.6 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.2 | 0.6 | GO:0015218 | pyrimidine nucleotide transmembrane transporter activity(GO:0015218) |
| 0.2 | 0.4 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
| 0.2 | 0.6 | GO:0016781 | selenide, water dikinase activity(GO:0004756) phosphotransferase activity, paired acceptors(GO:0016781) |
| 0.2 | 0.8 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
| 0.2 | 1.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.2 | 1.3 | GO:0004793 | glycine hydroxymethyltransferase activity(GO:0004372) threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.2 | 0.6 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
| 0.2 | 0.7 | GO:0047066 | phospholipid-hydroperoxide glutathione peroxidase activity(GO:0047066) |
| 0.2 | 1.3 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.2 | 1.1 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.2 | 0.7 | GO:0032406 | MutLbeta complex binding(GO:0032406) MutSbeta complex binding(GO:0032408) |
| 0.2 | 1.6 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.2 | 1.3 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.2 | 0.4 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 0.2 | 1.1 | GO:0008296 | 3'-5'-exodeoxyribonuclease activity(GO:0008296) |
| 0.2 | 1.1 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.2 | 0.5 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.2 | 0.5 | GO:0031731 | CCR6 chemokine receptor binding(GO:0031731) |
| 0.2 | 1.4 | GO:0019863 | IgE binding(GO:0019863) |
| 0.2 | 2.1 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.2 | 0.5 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.2 | 0.5 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.2 | 0.9 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
| 0.2 | 1.2 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
| 0.2 | 1.2 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.2 | 2.2 | GO:0032393 | MHC class I receptor activity(GO:0032393) |
| 0.2 | 0.7 | GO:0004727 | prenylated protein tyrosine phosphatase activity(GO:0004727) |
| 0.2 | 7.6 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.2 | 0.5 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
| 0.2 | 0.8 | GO:0033857 | diphosphoinositol-pentakisphosphate kinase activity(GO:0033857) |
| 0.2 | 0.6 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) azole transporter activity(GO:0045118) |
| 0.2 | 27.3 | GO:0003823 | antigen binding(GO:0003823) |
| 0.2 | 0.5 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.2 | 1.1 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
| 0.2 | 0.6 | GO:0019862 | IgA binding(GO:0019862) |
| 0.2 | 0.3 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.2 | 0.5 | GO:0004324 | ferredoxin-NADP+ reductase activity(GO:0004324) NADPH-adrenodoxin reductase activity(GO:0015039) oxidoreductase activity, acting on iron-sulfur proteins as donors(GO:0016730) oxidoreductase activity, acting on iron-sulfur proteins as donors, NAD or NADP as acceptor(GO:0016731) |
| 0.2 | 0.5 | GO:0016314 | phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase activity(GO:0016314) |
| 0.2 | 0.5 | GO:0003883 | CTP synthase activity(GO:0003883) |
| 0.2 | 0.8 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
| 0.1 | 0.4 | GO:0004951 | cholecystokinin receptor activity(GO:0004951) |
| 0.1 | 0.4 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
| 0.1 | 0.4 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
| 0.1 | 0.6 | GO:0004874 | aryl hydrocarbon receptor activity(GO:0004874) |
| 0.1 | 0.9 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.1 | 0.3 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
| 0.1 | 0.9 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.1 | 1.6 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.1 | 1.0 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.1 | 0.6 | GO:0016639 | oxidoreductase activity, acting on the CH-NH2 group of donors, NAD or NADP as acceptor(GO:0016639) |
| 0.1 | 0.6 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
| 0.1 | 1.4 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.1 | 0.4 | GO:0015131 | thiosulfate transmembrane transporter activity(GO:0015117) oxaloacetate transmembrane transporter activity(GO:0015131) succinate transmembrane transporter activity(GO:0015141) |
| 0.1 | 0.4 | GO:0015526 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.1 | 0.7 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) procollagen-proline dioxygenase activity(GO:0019798) |
| 0.1 | 0.7 | GO:0060175 | brain-derived neurotrophic factor-activated receptor activity(GO:0060175) |
| 0.1 | 0.8 | GO:0089720 | caspase binding(GO:0089720) |
| 0.1 | 0.8 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.1 | 1.4 | GO:0055104 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.1 | 1.8 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.1 | 0.3 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
| 0.1 | 0.7 | GO:0004066 | asparagine synthase (glutamine-hydrolyzing) activity(GO:0004066) |
| 0.1 | 2.7 | GO:0045028 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
| 0.1 | 0.5 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.1 | 0.7 | GO:0052740 | 1-acyl-2-lysophosphatidylserine acylhydrolase activity(GO:0052740) |
| 0.1 | 0.7 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.1 | 0.4 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
| 0.1 | 1.2 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
| 0.1 | 0.9 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.1 | 1.0 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.1 | 0.7 | GO:0004771 | sterol esterase activity(GO:0004771) methylumbelliferyl-acetate deacetylase activity(GO:0047374) |
| 0.1 | 1.6 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.1 | 0.4 | GO:0000995 | transcription factor activity, core RNA polymerase III binding(GO:0000995) |
| 0.1 | 4.9 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.1 | 0.4 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.1 | 0.9 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
| 0.1 | 1.8 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.1 | 0.5 | GO:0035243 | protein-arginine omega-N symmetric methyltransferase activity(GO:0035243) |
| 0.1 | 0.3 | GO:0000403 | Y-form DNA binding(GO:0000403) |
| 0.1 | 2.3 | GO:0005522 | profilin binding(GO:0005522) |
| 0.1 | 0.9 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.1 | 0.5 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.1 | 0.6 | GO:0031491 | nucleosome binding(GO:0031491) |
| 0.1 | 0.6 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.1 | 0.6 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.1 | 2.2 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
| 0.1 | 0.5 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 0.1 | 0.2 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
| 0.1 | 0.2 | GO:0001003 | polymerase III regulatory region sequence-specific DNA binding(GO:0000992) RNA polymerase III type 1 promoter sequence-specific DNA binding(GO:0001002) RNA polymerase III type 2 promoter sequence-specific DNA binding(GO:0001003) |
| 0.1 | 0.4 | GO:0004137 | deoxycytidine kinase activity(GO:0004137) |
| 0.1 | 0.5 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.1 | 0.4 | GO:0032090 | Pyrin domain binding(GO:0032090) |
| 0.1 | 1.8 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.1 | 1.8 | GO:0030247 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.1 | 0.5 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.1 | 0.6 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.1 | 0.7 | GO:0042608 | T cell receptor binding(GO:0042608) |
| 0.1 | 4.7 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.1 | 0.3 | GO:0045155 | electron transporter, transferring electrons from CoQH2-cytochrome c reductase complex and cytochrome c oxidase complex activity(GO:0045155) |
| 0.1 | 1.1 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.1 | 2.2 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.1 | 0.5 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.1 | 0.3 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.1 | 2.6 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.1 | 0.6 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.1 | 0.3 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.1 | 0.1 | GO:0001855 | complement component C4b binding(GO:0001855) |
| 0.1 | 0.3 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 0.1 | 0.1 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.1 | 1.2 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
| 0.1 | 0.5 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
| 0.1 | 0.2 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.1 | 0.2 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 0.1 | 0.3 | GO:0043559 | insulin binding(GO:0043559) |
| 0.1 | 0.3 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.1 | 1.3 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.1 | 6.2 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.1 | 0.7 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.1 | 0.3 | GO:0016434 | rRNA (cytosine) methyltransferase activity(GO:0016434) |
| 0.1 | 0.4 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.1 | 0.3 | GO:0004853 | uroporphyrinogen decarboxylase activity(GO:0004853) |
| 0.1 | 0.3 | GO:0016534 | cyclin-dependent protein kinase 5 activator activity(GO:0016534) |
| 0.1 | 0.4 | GO:0004356 | glutamate-ammonia ligase activity(GO:0004356) ammonia ligase activity(GO:0016211) acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.1 | 0.4 | GO:0032038 | myosin II heavy chain binding(GO:0032038) |
| 0.1 | 0.4 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
| 0.1 | 1.0 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.1 | 0.4 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
| 0.1 | 0.7 | GO:0015926 | glucosidase activity(GO:0015926) |
| 0.1 | 0.5 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
| 0.1 | 1.7 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
| 0.1 | 0.7 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 0.1 | 0.8 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.1 | 0.3 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
| 0.1 | 0.7 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.1 | 0.6 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.1 | 0.3 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.1 | 1.6 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 0.1 | 0.9 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.1 | 0.4 | GO:0004660 | protein farnesyltransferase activity(GO:0004660) |
| 0.1 | 1.2 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.1 | 1.4 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.1 | 0.4 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 0.1 | 1.8 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.1 | 0.5 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
| 0.1 | 0.3 | GO:0047325 | inositol tetrakisphosphate 1-kinase activity(GO:0047325) inositol tetrakisphosphate kinase activity(GO:0051765) inositol-1,3,4-trisphosphate 6-kinase activity(GO:0052725) inositol-1,3,4-trisphosphate 5-kinase activity(GO:0052726) inositol-1,3,4,5,6-pentakisphosphate 1-phosphatase activity(GO:0052825) inositol-1,3,4,6-tetrakisphosphate 6-phosphatase activity(GO:0052830) inositol-1,3,4,6-tetrakisphosphate 1-phosphatase activity(GO:0052831) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) |
| 0.1 | 0.8 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.1 | 1.8 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.1 | 1.7 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.1 | 1.2 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.1 | 0.8 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.1 | 0.5 | GO:0001851 | complement component C3b binding(GO:0001851) |
| 0.1 | 2.3 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.1 | 0.4 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.1 | 0.4 | GO:0090554 | phosphatidylcholine-translocating ATPase activity(GO:0090554) |
| 0.1 | 0.3 | GO:0019205 | nucleobase-containing compound kinase activity(GO:0019205) |
| 0.1 | 1.1 | GO:0030284 | estrogen receptor activity(GO:0030284) |
| 0.1 | 0.3 | GO:0097506 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
| 0.1 | 0.2 | GO:0016435 | rRNA (guanine) methyltransferase activity(GO:0016435) |
| 0.1 | 0.3 | GO:0050211 | procollagen galactosyltransferase activity(GO:0050211) |
| 0.1 | 0.7 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
| 0.1 | 0.3 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
| 0.1 | 0.3 | GO:0034353 | RNA pyrophosphohydrolase activity(GO:0034353) |
| 0.1 | 0.2 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 0.1 | 0.3 | GO:0016900 | oxidoreductase activity, acting on the CH-OH group of donors, disulfide as acceptor(GO:0016900) vitamin-K-epoxide reductase (warfarin-sensitive) activity(GO:0047057) |
| 0.1 | 2.5 | GO:0070034 | telomerase RNA binding(GO:0070034) |
| 0.1 | 0.3 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
| 0.1 | 0.4 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.1 | 0.3 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
| 0.1 | 0.3 | GO:0004170 | dUTP diphosphatase activity(GO:0004170) |
| 0.1 | 0.8 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
| 0.1 | 0.4 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.1 | 0.1 | GO:0048256 | flap endonuclease activity(GO:0048256) |
| 0.1 | 0.8 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.1 | 0.2 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.1 | 0.7 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.1 | 1.2 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.1 | 1.9 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
| 0.1 | 2.3 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.1 | 0.2 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.1 | 0.3 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.1 | 0.2 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
| 0.1 | 0.4 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.1 | 0.9 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.1 | 0.5 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
| 0.1 | 0.1 | GO:0097643 | amylin receptor activity(GO:0097643) |
| 0.1 | 0.5 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 0.1 | 0.6 | GO:0043139 | 5'-3' DNA helicase activity(GO:0043139) |
| 0.1 | 0.2 | GO:0102007 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 0.1 | 0.5 | GO:0004996 | thyroid-stimulating hormone receptor activity(GO:0004996) |
| 0.1 | 0.2 | GO:0005333 | norepinephrine transmembrane transporter activity(GO:0005333) |
| 0.1 | 0.2 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.1 | 0.9 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.1 | 2.0 | GO:0005123 | death receptor binding(GO:0005123) |
| 0.1 | 1.2 | GO:0022884 | macromolecule transmembrane transporter activity(GO:0022884) |
| 0.1 | 0.4 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.1 | 0.3 | GO:0003867 | 4-aminobutyrate transaminase activity(GO:0003867) succinate-semialdehyde dehydrogenase binding(GO:0032145) (S)-3-amino-2-methylpropionate transaminase activity(GO:0047298) |
| 0.1 | 2.1 | GO:0015248 | sterol transporter activity(GO:0015248) |
| 0.1 | 0.5 | GO:0046790 | virion binding(GO:0046790) |
| 0.1 | 1.2 | GO:0032451 | demethylase activity(GO:0032451) |
| 0.1 | 0.4 | GO:0017159 | pantetheine hydrolase activity(GO:0017159) |
| 0.1 | 0.6 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 0.1 | 3.6 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.1 | 0.4 | GO:0047820 | D-glutamate cyclase activity(GO:0047820) |
| 0.1 | 5.1 | GO:0008094 | DNA-dependent ATPase activity(GO:0008094) |
| 0.1 | 0.6 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.1 | 0.3 | GO:0050309 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.1 | 0.1 | GO:0047223 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase activity(GO:0047223) |
| 0.1 | 0.4 | GO:0045569 | TRAIL binding(GO:0045569) |
| 0.1 | 0.8 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.1 | 1.6 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.1 | 0.8 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.1 | 3.7 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
| 0.1 | 0.9 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.1 | 0.3 | GO:0016728 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.1 | 0.5 | GO:0015501 | glutamate:sodium symporter activity(GO:0015501) |
| 0.1 | 1.4 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.1 | 0.3 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.1 | 0.2 | GO:0001181 | transcription factor activity, core RNA polymerase I binding(GO:0001181) |
| 0.1 | 0.3 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.1 | 0.8 | GO:0030371 | translation repressor activity(GO:0030371) |
| 0.1 | 0.4 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
| 0.1 | 0.7 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.1 | 2.4 | GO:0004180 | carboxypeptidase activity(GO:0004180) |
| 0.1 | 0.3 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.1 | 0.5 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.1 | 0.2 | GO:0003978 | UDP-N-acetylglucosamine 4-epimerase activity(GO:0003974) UDP-glucose 4-epimerase activity(GO:0003978) |
| 0.1 | 0.2 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.1 | 0.3 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.1 | 0.4 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.1 | 0.1 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.1 | 1.4 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.1 | 0.3 | GO:0001163 | RNA polymerase I regulatory region DNA binding(GO:0001013) RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
| 0.1 | 0.4 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.1 | 0.3 | GO:0008263 | pyrimidine-specific mismatch base pair DNA N-glycosylase activity(GO:0008263) |
| 0.1 | 0.3 | GO:0016289 | CoA hydrolase activity(GO:0016289) |
| 0.1 | 0.6 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.1 | 0.5 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.1 | 0.7 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.1 | 0.2 | GO:0004102 | choline O-acetyltransferase activity(GO:0004102) |
| 0.1 | 0.4 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
| 0.1 | 4.0 | GO:0070035 | ATP-dependent helicase activity(GO:0008026) purine NTP-dependent helicase activity(GO:0070035) |
| 0.1 | 0.3 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.1 | 2.4 | GO:0050699 | WW domain binding(GO:0050699) |
| 0.1 | 0.2 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.1 | 0.4 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.1 | 1.6 | GO:0050664 | oxidoreductase activity, acting on NAD(P)H, oxygen as acceptor(GO:0050664) |
| 0.1 | 0.1 | GO:0034618 | arginine binding(GO:0034618) |
| 0.1 | 0.5 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.1 | 0.2 | GO:0051733 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.1 | 0.2 | GO:0070735 | protein-glycine ligase activity(GO:0070735) |
| 0.1 | 0.3 | GO:0015056 | corticotrophin-releasing factor receptor activity(GO:0015056) |
| 0.1 | 0.6 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.1 | 1.2 | GO:0001848 | complement binding(GO:0001848) |
| 0.1 | 0.6 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.1 | 0.2 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
| 0.1 | 0.1 | GO:0035173 | histone kinase activity(GO:0035173) |
| 0.1 | 0.2 | GO:0016411 | acylglycerol O-acyltransferase activity(GO:0016411) |
| 0.1 | 0.2 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
| 0.1 | 0.1 | GO:0017129 | triglyceride binding(GO:0017129) |
| 0.1 | 0.2 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
| 0.1 | 0.2 | GO:0004960 | thromboxane receptor activity(GO:0004960) thromboxane A2 receptor activity(GO:0004961) |
| 0.1 | 0.4 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.1 | 0.3 | GO:0004522 | ribonuclease A activity(GO:0004522) |
| 0.1 | 0.1 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.1 | 0.6 | GO:0051430 | corticotropin-releasing hormone receptor binding(GO:0051429) corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
| 0.1 | 0.5 | GO:1990380 | Lys63-specific deubiquitinase activity(GO:0061578) Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.1 | 0.4 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.1 | 0.2 | GO:0015235 | cobalamin transporter activity(GO:0015235) |
| 0.1 | 0.2 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
| 0.1 | 0.2 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
| 0.1 | 0.2 | GO:0042020 | interleukin-23 binding(GO:0042019) interleukin-23 receptor activity(GO:0042020) |
| 0.1 | 1.2 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.1 | 0.9 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.1 | 0.4 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
| 0.1 | 0.1 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.1 | 0.4 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.1 | 0.5 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.1 | 0.4 | GO:0019534 | toxin transporter activity(GO:0019534) |
| 0.1 | 0.2 | GO:0033981 | D-dopachrome decarboxylase activity(GO:0033981) |
| 0.1 | 0.1 | GO:0005026 | transforming growth factor beta receptor activity, type II(GO:0005026) |
| 0.1 | 0.7 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.1 | 1.4 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.1 | 1.3 | GO:0034062 | DNA-directed RNA polymerase activity(GO:0003899) RNA polymerase activity(GO:0034062) |
| 0.0 | 0.1 | GO:0004536 | deoxyribonuclease activity(GO:0004536) |
| 0.0 | 0.3 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.3 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 0.0 | 0.8 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.0 | 0.3 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.0 | 0.7 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.0 | 0.3 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.0 | 0.1 | GO:0004531 | deoxyribonuclease II activity(GO:0004531) |
| 0.0 | 0.5 | GO:0016918 | retinal binding(GO:0016918) |
| 0.0 | 0.2 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.0 | 0.3 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
| 0.0 | 0.1 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
| 0.0 | 0.3 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.0 | 0.2 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.0 | 0.1 | GO:0016019 | peptidoglycan receptor activity(GO:0016019) |
| 0.0 | 0.1 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
| 0.0 | 0.2 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.0 | 0.2 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.0 | 0.2 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.0 | 0.2 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 0.0 | 0.2 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
| 0.0 | 2.7 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
| 0.0 | 0.1 | GO:0033878 | hormone-sensitive lipase activity(GO:0033878) |
| 0.0 | 0.6 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
| 0.0 | 0.2 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
| 0.0 | 0.6 | GO:0008175 | tRNA methyltransferase activity(GO:0008175) |
| 0.0 | 1.2 | GO:0016811 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amides(GO:0016811) |
| 0.0 | 0.1 | GO:0097259 | tocopherol omega-hydroxylase activity(GO:0052870) alpha-tocopherol omega-hydroxylase activity(GO:0052871) 20-hydroxy-leukotriene B4 omega oxidase activity(GO:0097258) 20-aldehyde-leukotriene B4 20-monooxygenase activity(GO:0097259) |
| 0.0 | 0.2 | GO:1901375 | acetylcholine transmembrane transporter activity(GO:0005277) acetate ester transmembrane transporter activity(GO:1901375) |
| 0.0 | 0.2 | GO:0002046 | opsin binding(GO:0002046) |
| 0.0 | 0.1 | GO:0004603 | phenylethanolamine N-methyltransferase activity(GO:0004603) |
| 0.0 | 0.2 | GO:0032810 | sterol response element binding(GO:0032810) |
| 0.0 | 0.1 | GO:0004775 | succinate-CoA ligase (ADP-forming) activity(GO:0004775) |
| 0.0 | 0.6 | GO:0010181 | FMN binding(GO:0010181) |
| 0.0 | 0.5 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.0 | 0.1 | GO:0004911 | interleukin-2 receptor activity(GO:0004911) interleukin-2 binding(GO:0019976) |
| 0.0 | 0.2 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.0 | 0.5 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
| 0.0 | 1.6 | GO:0044390 | ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
| 0.0 | 0.3 | GO:0004518 | nuclease activity(GO:0004518) |
| 0.0 | 0.1 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.0 | 0.3 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.0 | 0.3 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
| 0.0 | 0.2 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
| 0.0 | 0.1 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.0 | 0.7 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.0 | 0.5 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.0 | 0.2 | GO:0042287 | MHC protein binding(GO:0042287) |
| 0.0 | 0.1 | GO:0030337 | DNA polymerase processivity factor activity(GO:0030337) |
| 0.0 | 0.5 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
| 0.0 | 0.2 | GO:0038025 | reelin receptor activity(GO:0038025) |
| 0.0 | 0.2 | GO:0030020 | extracellular matrix structural constituent conferring tensile strength(GO:0030020) |
| 0.0 | 0.4 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.0 | 1.2 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 0.0 | 0.3 | GO:0008649 | rRNA methyltransferase activity(GO:0008649) |
| 0.0 | 0.2 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
| 0.0 | 0.2 | GO:0032052 | bile acid binding(GO:0032052) |
| 0.0 | 0.4 | GO:0030515 | snoRNA binding(GO:0030515) |
| 0.0 | 3.2 | GO:0000980 | RNA polymerase II distal enhancer sequence-specific DNA binding(GO:0000980) |
| 0.0 | 2.9 | GO:0101005 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
| 0.0 | 0.2 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.0 | 1.5 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 0.0 | 0.6 | GO:0004527 | exonuclease activity(GO:0004527) |
| 0.0 | 2.1 | GO:0019843 | rRNA binding(GO:0019843) |
| 0.0 | 0.3 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 0.2 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.0 | 1.0 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.0 | 0.3 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.0 | 0.1 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 0.0 | 0.2 | GO:0004815 | aspartate-tRNA ligase activity(GO:0004815) |
| 0.0 | 0.2 | GO:0005343 | organic acid:sodium symporter activity(GO:0005343) |
| 0.0 | 0.2 | GO:0030548 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
| 0.0 | 0.3 | GO:0005057 | receptor signaling protein activity(GO:0005057) |
| 0.0 | 0.2 | GO:0004084 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
| 0.0 | 0.1 | GO:0051120 | hepoxilin A3 synthase activity(GO:0051120) |
| 0.0 | 0.4 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.0 | 0.4 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.0 | 0.9 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.0 | 0.1 | GO:0034038 | deoxyhypusine synthase activity(GO:0034038) |
| 0.0 | 0.1 | GO:0051916 | granulocyte colony-stimulating factor binding(GO:0051916) |
| 0.0 | 1.1 | GO:0015026 | coreceptor activity(GO:0015026) |
| 0.0 | 0.5 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.0 | 0.2 | GO:0004925 | prolactin receptor activity(GO:0004925) |
| 0.0 | 0.2 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.0 | 0.2 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.0 | 0.2 | GO:0004368 | glycerol-3-phosphate dehydrogenase activity(GO:0004368) oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
| 0.0 | 0.1 | GO:0001632 | leukotriene B4 receptor activity(GO:0001632) |
| 0.0 | 0.4 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.0 | 0.3 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.0 | 0.7 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.0 | 0.1 | GO:0003990 | acetylcholinesterase activity(GO:0003990) |
| 0.0 | 0.9 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.0 | 0.9 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.2 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
| 0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.9 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
| 0.0 | 0.3 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.0 | 1.0 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.0 | 1.0 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.0 | 0.2 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
| 0.0 | 0.1 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
| 0.0 | 0.1 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.0 | 0.1 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.0 | 0.3 | GO:0099583 | neurotransmitter receptor activity involved in regulation of postsynaptic cytosolic calcium ion concentration(GO:0099583) |
| 0.0 | 3.5 | GO:0042393 | histone binding(GO:0042393) |
| 0.0 | 5.5 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.2 | GO:0050682 | AF-2 domain binding(GO:0050682) |
| 0.0 | 0.1 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.0 | 0.2 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.0 | 0.1 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
| 0.0 | 0.4 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.0 | 0.2 | GO:0005372 | water transmembrane transporter activity(GO:0005372) |
| 0.0 | 1.7 | GO:0004540 | ribonuclease activity(GO:0004540) |
| 0.0 | 0.1 | GO:0080130 | L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.0 | 0.7 | GO:0030971 | receptor tyrosine kinase binding(GO:0030971) |
| 0.0 | 0.2 | GO:0015288 | porin activity(GO:0015288) |
| 0.0 | 0.1 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 0.0 | 0.4 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.0 | 0.4 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.0 | 0.0 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
| 0.0 | 0.3 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.0 | 0.1 | GO:0052795 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
| 0.0 | 0.1 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.0 | 0.1 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 0.0 | 0.1 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.0 | 0.5 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.0 | 0.0 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 0.0 | 0.1 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.0 | 0.2 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.0 | 0.1 | GO:0044736 | acid-sensing ion channel activity(GO:0044736) |
| 0.0 | 0.3 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
| 0.0 | 0.3 | GO:0004970 | ionotropic glutamate receptor activity(GO:0004970) |
| 0.0 | 0.2 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.0 | 0.1 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.0 | 0.7 | GO:0004386 | helicase activity(GO:0004386) |
| 0.0 | 0.4 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.0 | 1.4 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 0.0 | 0.1 | GO:0030197 | extracellular matrix constituent, lubricant activity(GO:0030197) |
| 0.0 | 0.6 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.0 | 0.4 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.0 | 0.0 | GO:0004909 | interleukin-1, Type I, activating receptor activity(GO:0004909) |
| 0.0 | 0.3 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
| 0.0 | 0.2 | GO:0008430 | selenium binding(GO:0008430) |
| 0.0 | 0.3 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.0 | 0.2 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) cardiolipin binding(GO:1901612) |
| 0.0 | 0.1 | GO:0043175 | RNA polymerase core enzyme binding(GO:0043175) |
| 0.0 | 0.3 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.0 | 0.1 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.0 | 1.8 | GO:0008565 | protein transporter activity(GO:0008565) |
| 0.0 | 0.3 | GO:0008374 | O-acyltransferase activity(GO:0008374) |
| 0.0 | 1.5 | GO:0001618 | virus receptor activity(GO:0001618) |
| 0.0 | 0.3 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
| 0.0 | 0.1 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.0 | 0.1 | GO:0004963 | follicle-stimulating hormone receptor activity(GO:0004963) |
| 0.0 | 0.1 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.0 | 0.3 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.0 | 0.4 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.0 | 0.0 | GO:0032356 | oxidized DNA binding(GO:0032356) oxidized purine DNA binding(GO:0032357) |
| 0.0 | 0.3 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.0 | 0.1 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.0 | 0.1 | GO:0031208 | POZ domain binding(GO:0031208) |
| 0.0 | 9.0 | GO:0000978 | RNA polymerase II core promoter proximal region sequence-specific DNA binding(GO:0000978) |
| 0.0 | 0.1 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.0 | 0.1 | GO:0005151 | interleukin-1, Type II receptor binding(GO:0005151) |
| 0.0 | 0.2 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.0 | 0.7 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
| 0.0 | 0.7 | GO:0005319 | lipid transporter activity(GO:0005319) |
| 0.0 | 0.4 | GO:0043495 | protein anchor(GO:0043495) |
| 0.0 | 0.1 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
| 0.0 | 0.9 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.0 | 0.2 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.0 | 0.1 | GO:0004692 | cGMP-dependent protein kinase activity(GO:0004692) |
| 0.0 | 0.5 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.0 | 0.0 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 0.0 | 0.2 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.0 | 0.1 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
| 0.0 | 0.1 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
| 0.0 | 0.1 | GO:0030553 | cGMP binding(GO:0030553) |
| 0.0 | 0.2 | GO:0005112 | Notch binding(GO:0005112) |
| 0.0 | 0.7 | GO:0030295 | protein kinase activator activity(GO:0030295) |
| 0.0 | 0.2 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.0 | 0.0 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
| 0.0 | 0.1 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.0 | 0.2 | GO:0008391 | arachidonic acid monooxygenase activity(GO:0008391) arachidonic acid epoxygenase activity(GO:0008392) |
| 0.0 | 0.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.0 | 0.1 | GO:0039552 | RIG-I binding(GO:0039552) |
| 0.0 | 0.1 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.0 | 0.1 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.0 | 0.3 | GO:0070330 | aromatase activity(GO:0070330) |
| 0.0 | 0.5 | GO:0016675 | oxidoreductase activity, acting on a heme group of donors(GO:0016675) |
| 0.0 | 0.1 | GO:0004958 | prostaglandin F receptor activity(GO:0004958) |
| 0.0 | 0.1 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
| 0.0 | 0.1 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
| 0.0 | 0.1 | GO:0009374 | biotin binding(GO:0009374) |
| 0.0 | 0.1 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
| 0.0 | 0.1 | GO:0004802 | transketolase activity(GO:0004802) |
| 0.0 | 0.1 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 0.0 | 0.2 | GO:0043176 | amine binding(GO:0043176) serotonin binding(GO:0051378) |
| 0.0 | 0.1 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
| 0.0 | 0.2 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.0 | 0.1 | GO:0015923 | mannosidase activity(GO:0015923) |
| 0.0 | 0.4 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.0 | 0.2 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.0 | 0.1 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 0.0 | 0.1 | GO:0004321 | fatty-acyl-CoA synthase activity(GO:0004321) |
| 0.0 | 0.0 | GO:0035671 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) steroid dehydrogenase activity, acting on the CH-CH group of donors(GO:0033765) enone reductase activity(GO:0035671) cholestenone 5-alpha-reductase activity(GO:0047751) |
| 0.0 | 0.1 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.0 | 0.0 | GO:0005497 | androgen binding(GO:0005497) |
| 0.0 | 0.1 | GO:0016594 | glycine binding(GO:0016594) |
| 0.0 | 0.0 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
| 0.0 | 0.1 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.0 | 0.1 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
| 0.0 | 0.8 | GO:0052813 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) phosphatidylinositol bisphosphate kinase activity(GO:0052813) |
| 0.0 | 0.3 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
| 0.0 | 0.0 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.0 | 1.2 | GO:0005179 | hormone activity(GO:0005179) |
| 0.0 | 0.1 | GO:0005534 | galactose binding(GO:0005534) |
| 0.0 | 0.1 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.0 | 0.1 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
| 0.0 | 0.1 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.0 | 20.9 | GO:0003677 | DNA binding(GO:0003677) |
| 0.0 | 0.1 | GO:0004064 | arylesterase activity(GO:0004064) |
| 0.0 | 0.2 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
| 0.0 | 0.1 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.0 | 0.0 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.0 | 0.1 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.0 | 0.1 | GO:0060229 | phospholipase activator activity(GO:0016004) lipase activator activity(GO:0060229) |
| 0.0 | 0.0 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
| 0.0 | 0.1 | GO:0016657 | GMP reductase activity(GO:0003920) oxidoreductase activity, acting on NAD(P)H, nitrogenous group as acceptor(GO:0016657) |
| 0.0 | 0.1 | GO:0004340 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.0 | 0.3 | GO:0043394 | proteoglycan binding(GO:0043394) |
| 0.0 | 0.1 | GO:0005537 | mannose binding(GO:0005537) |
| 0.0 | 0.1 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
| 0.0 | 0.3 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
| 0.0 | 0.1 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
| 0.0 | 0.1 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
| 0.0 | 0.4 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 7.9 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
| 0.4 | 8.8 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.4 | 1.1 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.3 | 5.2 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.2 | 6.8 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.2 | 6.6 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.2 | 4.8 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.2 | 5.0 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.2 | 3.4 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.2 | 4.6 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.2 | 1.9 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.2 | 5.2 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.2 | 7.5 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.2 | 3.1 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.2 | 2.5 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.2 | 4.0 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.2 | 1.6 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
| 0.2 | 0.2 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
| 0.2 | 2.0 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
| 0.2 | 0.5 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.2 | 3.2 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.2 | 3.5 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.1 | 4.2 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
| 0.1 | 4.6 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 0.1 | 3.8 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.1 | 4.1 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
| 0.1 | 11.5 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.1 | 2.9 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.1 | 5.6 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.1 | 0.4 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.1 | 0.2 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.1 | 4.8 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.1 | 1.7 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.1 | 1.1 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
| 0.1 | 2.4 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
| 0.1 | 1.1 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.1 | 1.7 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.1 | 1.6 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.1 | 1.9 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.1 | 1.2 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
| 0.1 | 6.8 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.1 | 1.5 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.1 | 1.5 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.1 | 2.6 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.1 | 7.1 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.1 | 1.0 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
| 0.1 | 0.1 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.1 | 5.7 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.1 | 1.6 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.1 | 7.4 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.1 | 2.7 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
| 0.1 | 1.3 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.1 | 0.4 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 0.1 | 1.7 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.1 | 2.5 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
| 0.1 | 0.6 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.1 | 0.7 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.1 | 0.2 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
| 0.1 | 1.2 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
| 0.1 | 0.2 | REACTOME IL 2 SIGNALING | Genes involved in Interleukin-2 signaling |
| 0.1 | 1.9 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
| 0.1 | 1.7 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.1 | 0.4 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
| 0.1 | 1.2 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.1 | 0.4 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.1 | 0.8 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.1 | 2.1 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.1 | 0.9 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.1 | 2.1 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
| 0.1 | 1.3 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.1 | 0.8 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.1 | 1.2 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
| 0.1 | 0.5 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
| 0.1 | 1.0 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.1 | 0.1 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.1 | 1.7 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.1 | 1.1 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.1 | 0.3 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.1 | 1.1 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.1 | 2.3 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.1 | 1.3 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
| 0.1 | 1.9 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.1 | 5.6 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.1 | 1.1 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.1 | 1.7 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.1 | 0.3 | REACTOME CLEAVAGE OF GROWING TRANSCRIPT IN THE TERMINATION REGION | Genes involved in Cleavage of Growing Transcript in the Termination Region |
| 0.1 | 0.9 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.1 | 1.3 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.1 | 0.1 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.1 | 0.6 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.1 | 0.9 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.0 | 0.9 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.0 | 1.3 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
| 0.0 | 0.2 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
| 0.0 | 0.8 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.0 | 0.5 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.0 | 1.0 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.0 | 1.1 | REACTOME GLUCAGON SIGNALING IN METABOLIC REGULATION | Genes involved in Glucagon signaling in metabolic regulation |
| 0.0 | 0.4 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.0 | 1.6 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.0 | 0.6 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 0.0 | 0.6 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.0 | 1.2 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
| 0.0 | 0.2 | REACTOME FORMATION OF RNA POL II ELONGATION COMPLEX | Genes involved in Formation of RNA Pol II elongation complex |
| 0.0 | 4.2 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.0 | 0.8 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.0 | 1.0 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.0 | 0.3 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.0 | 2.0 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.0 | 0.9 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 0.4 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.0 | 0.7 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.0 | 0.3 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.0 | 0.8 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.0 | 0.4 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.0 | 0.5 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.0 | 0.4 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
| 0.0 | 1.3 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.0 | 1.4 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.0 | 0.7 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.0 | 0.4 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.0 | 0.1 | REACTOME METABOLISM OF LIPIDS AND LIPOPROTEINS | Genes involved in Metabolism of lipids and lipoproteins |
| 0.0 | 0.8 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 0.2 | REACTOME PRE NOTCH EXPRESSION AND PROCESSING | Genes involved in Pre-NOTCH Expression and Processing |
| 0.0 | 0.5 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
| 0.0 | 0.2 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 0.0 | 1.5 | REACTOME RIG I MDA5 MEDIATED INDUCTION OF IFN ALPHA BETA PATHWAYS | Genes involved in RIG-I/MDA5 mediated induction of IFN-alpha/beta pathways |
| 0.0 | 0.2 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.0 | 0.4 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.0 | 0.4 | REACTOME SIGNALLING TO RAS | Genes involved in Signalling to RAS |
| 0.0 | 0.8 | REACTOME INTEGRIN ALPHAIIB BETA3 SIGNALING | Genes involved in Integrin alphaIIb beta3 signaling |
| 0.0 | 0.5 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
| 0.0 | 0.4 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.0 | 0.4 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.0 | 0.2 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.0 | 2.2 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.0 | 0.5 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.0 | 0.6 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF CYCLIN B | Genes involved in APC/C:Cdc20 mediated degradation of Cyclin B |
| 0.0 | 0.6 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.0 | 0.3 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.0 | 0.2 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
| 0.0 | 3.0 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
| 0.0 | 8.3 | REACTOME GENERIC TRANSCRIPTION PATHWAY | Genes involved in Generic Transcription Pathway |
| 0.0 | 0.4 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
| 0.0 | 0.2 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
| 0.0 | 1.6 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.0 | 0.1 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.0 | 0.5 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.0 | 0.4 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
| 0.0 | 0.1 | REACTOME PIP3 ACTIVATES AKT SIGNALING | Genes involved in PIP3 activates AKT signaling |
| 0.0 | 0.2 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
| 0.0 | 0.1 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.0 | 0.7 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
| 0.0 | 0.3 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
| 0.0 | 0.3 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
| 0.0 | 0.1 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.0 | 0.2 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.0 | 0.1 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.0 | 0.3 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
| 0.0 | 0.1 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
| 0.0 | 0.2 | REACTOME GLUCAGON TYPE LIGAND RECEPTORS | Genes involved in Glucagon-type ligand receptors |
| 0.0 | 0.4 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.0 | 0.2 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.0 | 0.1 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.0 | 2.5 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.0 | 0.0 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.0 | 0.0 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 0.0 | 0.1 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
| 0.0 | 1.2 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.0 | 0.1 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.3 | 4.0 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
| 1.2 | 5.0 | GO:0002503 | peptide antigen assembly with MHC class II protein complex(GO:0002503) |
| 1.2 | 4.9 | GO:0003366 | cell-matrix adhesion involved in ameboidal cell migration(GO:0003366) |
| 1.1 | 4.5 | GO:0010903 | negative regulation of very-low-density lipoprotein particle remodeling(GO:0010903) |
| 1.0 | 2.9 | GO:0035408 | histone H3-T6 phosphorylation(GO:0035408) |
| 0.9 | 2.7 | GO:0043105 | regulation of GTP cyclohydrolase I activity(GO:0043095) negative regulation of GTP cyclohydrolase I activity(GO:0043105) |
| 0.9 | 2.7 | GO:0009107 | lipoate biosynthetic process(GO:0009107) |
| 0.8 | 5.8 | GO:0035624 | receptor transactivation(GO:0035624) |
| 0.7 | 1.4 | GO:0019827 | stem cell population maintenance(GO:0019827) maintenance of cell number(GO:0098727) |
| 0.7 | 0.7 | GO:0001845 | phagolysosome assembly(GO:0001845) phagosome-lysosome fusion(GO:0090385) |
| 0.7 | 4.9 | GO:0097319 | fructose transport(GO:0015755) fructose import(GO:0032445) carbohydrate import into cell(GO:0097319) carbohydrate import across plasma membrane(GO:0098704) fructose import across plasma membrane(GO:1990539) |
| 0.7 | 2.1 | GO:0002522 | leukocyte migration involved in immune response(GO:0002522) |
| 0.7 | 2.6 | GO:0071226 | response to molecule of fungal origin(GO:0002238) cellular response to molecule of fungal origin(GO:0071226) |
| 0.6 | 3.2 | GO:0002925 | positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 0.6 | 0.6 | GO:0002625 | regulation of T cell antigen processing and presentation(GO:0002625) |
| 0.6 | 3.6 | GO:0043418 | homocysteine catabolic process(GO:0043418) |
| 0.6 | 0.6 | GO:0043103 | hypoxanthine salvage(GO:0043103) |
| 0.6 | 1.8 | GO:0021571 | rhombomere 5 development(GO:0021571) |
| 0.6 | 1.7 | GO:0036071 | N-glycan fucosylation(GO:0036071) |
| 0.6 | 1.7 | GO:0034226 | lysine import(GO:0034226) L-lysine import(GO:0061461) L-lysine import into cell(GO:1903410) |
| 0.6 | 1.7 | GO:0046210 | nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) |
| 0.6 | 1.7 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
| 0.5 | 2.2 | GO:0060697 | positive regulation of phospholipid catabolic process(GO:0060697) |
| 0.5 | 1.6 | GO:0045588 | positive regulation of gamma-delta T cell differentiation(GO:0045588) |
| 0.5 | 2.1 | GO:0010585 | glutamine secretion(GO:0010585) L-glutamine import(GO:0036229) L-glutamine import into cell(GO:1903803) |
| 0.5 | 1.0 | GO:2001187 | positive regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000566) positive regulation of CD8-positive, alpha-beta T cell activation(GO:2001187) |
| 0.5 | 2.1 | GO:0034371 | chylomicron remodeling(GO:0034371) |
| 0.5 | 1.5 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
| 0.5 | 2.5 | GO:1902724 | positive regulation of skeletal muscle satellite cell proliferation(GO:1902724) positive regulation of growth factor dependent skeletal muscle satellite cell proliferation(GO:1902728) |
| 0.5 | 2.0 | GO:2000670 | positive regulation of dendritic cell apoptotic process(GO:2000670) |
| 0.5 | 0.5 | GO:0010039 | response to iron ion(GO:0010039) |
| 0.5 | 2.0 | GO:0072180 | mesonephric duct morphogenesis(GO:0072180) |
| 0.5 | 1.4 | GO:0051066 | dihydrobiopterin metabolic process(GO:0051066) |
| 0.5 | 1.4 | GO:0038185 | nitrogen catabolite regulation of transcription from RNA polymerase II promoter(GO:0001079) nitrogen catabolite activation of transcription from RNA polymerase II promoter(GO:0001080) regulation of urea metabolic process(GO:0034255) intracellular bile acid receptor signaling pathway(GO:0038185) interleukin-17 secretion(GO:0072615) nitrogen catabolite regulation of transcription(GO:0090293) nitrogen catabolite activation of transcription(GO:0090294) regulation of nitrogen cycle metabolic process(GO:1903314) positive regulation of glutamate metabolic process(GO:2000213) regulation of ammonia assimilation cycle(GO:2001248) positive regulation of ammonia assimilation cycle(GO:2001250) |
| 0.5 | 2.7 | GO:0097460 | ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
| 0.4 | 1.8 | GO:0072139 | glomerular parietal epithelial cell differentiation(GO:0072139) |
| 0.4 | 1.3 | GO:1902303 | negative regulation of potassium ion export(GO:1902303) |
| 0.4 | 3.1 | GO:0008218 | bioluminescence(GO:0008218) |
| 0.4 | 0.4 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.4 | 0.4 | GO:0071630 | nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
| 0.4 | 3.1 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.4 | 2.6 | GO:1990822 | basic amino acid transmembrane transport(GO:1990822) |
| 0.4 | 1.7 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
| 0.4 | 0.4 | GO:0090100 | positive regulation of transmembrane receptor protein serine/threonine kinase signaling pathway(GO:0090100) |
| 0.4 | 2.5 | GO:0046940 | nucleoside monophosphate phosphorylation(GO:0046940) |
| 0.4 | 2.0 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.4 | 1.6 | GO:0010900 | negative regulation of phosphatidylcholine catabolic process(GO:0010900) |
| 0.4 | 1.2 | GO:0021919 | BMP signaling pathway involved in spinal cord dorsal/ventral patterning(GO:0021919) |
| 0.4 | 2.4 | GO:0070560 | protein secretion by platelet(GO:0070560) |
| 0.4 | 0.8 | GO:0002924 | negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
| 0.4 | 1.9 | GO:0002455 | humoral immune response mediated by circulating immunoglobulin(GO:0002455) |
| 0.4 | 5.6 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.4 | 0.7 | GO:0032639 | TRAIL production(GO:0032639) regulation of TRAIL production(GO:0032679) positive regulation of TRAIL production(GO:0032759) |
| 0.4 | 1.1 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.4 | 1.5 | GO:0051754 | meiotic sister chromatid cohesion, centromeric(GO:0051754) |
| 0.4 | 5.8 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.4 | 0.4 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
| 0.4 | 2.5 | GO:0070269 | pyroptosis(GO:0070269) |
| 0.3 | 1.7 | GO:0061143 | alveolar primary septum development(GO:0061143) |
| 0.3 | 1.0 | GO:0019477 | L-lysine catabolic process to acetyl-CoA(GO:0019474) L-lysine catabolic process(GO:0019477) L-lysine metabolic process(GO:0046440) |
| 0.3 | 0.7 | GO:1904252 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.3 | 2.4 | GO:0098989 | NMDA selective glutamate receptor signaling pathway(GO:0098989) |
| 0.3 | 0.3 | GO:0010508 | positive regulation of autophagy(GO:0010508) |
| 0.3 | 1.0 | GO:0018312 | peptidyl-serine ADP-ribosylation(GO:0018312) |
| 0.3 | 0.7 | GO:0071072 | negative regulation of phospholipid biosynthetic process(GO:0071072) |
| 0.3 | 1.0 | GO:0002906 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 0.3 | 1.3 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.3 | 1.0 | GO:1902299 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 0.3 | 49.4 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
| 0.3 | 1.0 | GO:0007057 | spindle assembly involved in female meiosis I(GO:0007057) |
| 0.3 | 1.9 | GO:0010133 | proline catabolic process to glutamate(GO:0010133) |
| 0.3 | 0.3 | GO:0043400 | cortisol secretion(GO:0043400) regulation of cortisol secretion(GO:0051462) |
| 0.3 | 2.2 | GO:0042791 | 5S class rRNA transcription from RNA polymerase III type 1 promoter(GO:0042791) tRNA transcription from RNA polymerase III promoter(GO:0042797) |
| 0.3 | 1.2 | GO:0097089 | methyl-branched fatty acid metabolic process(GO:0097089) |
| 0.3 | 1.5 | GO:0016998 | cell wall macromolecule catabolic process(GO:0016998) |
| 0.3 | 0.9 | GO:0048203 | vesicle targeting, trans-Golgi to endosome(GO:0048203) |
| 0.3 | 0.9 | GO:0031133 | regulation of axon diameter(GO:0031133) |
| 0.3 | 1.5 | GO:0015811 | L-cystine transport(GO:0015811) |
| 0.3 | 0.9 | GO:0051182 | coenzyme transport(GO:0051182) |
| 0.3 | 0.9 | GO:0045402 | interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
| 0.3 | 1.5 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
| 0.3 | 0.6 | GO:0046452 | dihydrofolate metabolic process(GO:0046452) |
| 0.3 | 1.5 | GO:0033590 | response to cobalamin(GO:0033590) |
| 0.3 | 0.9 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.3 | 0.9 | GO:1903925 | signal transduction involved in intra-S DNA damage checkpoint(GO:0072428) response to bisphenol A(GO:1903925) cellular response to bisphenol A(GO:1903926) |
| 0.3 | 0.3 | GO:0046514 | ceramide catabolic process(GO:0046514) |
| 0.3 | 0.3 | GO:0045976 | negative regulation of mitotic cell cycle, embryonic(GO:0045976) |
| 0.3 | 1.2 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
| 0.3 | 0.3 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
| 0.3 | 0.8 | GO:0038043 | interleukin-5-mediated signaling pathway(GO:0038043) |
| 0.3 | 0.8 | GO:1901656 | glycoside transport(GO:1901656) |
| 0.3 | 0.8 | GO:0048104 | establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 0.3 | 0.8 | GO:1904303 | positive regulation of neutrophil degranulation(GO:0043315) cellular response to gravity(GO:0071258) positive regulation of neutrophil activation(GO:1902565) regulation of transcytosis(GO:1904298) positive regulation of transcytosis(GO:1904300) regulation of maternal process involved in parturition(GO:1904301) positive regulation of maternal process involved in parturition(GO:1904303) response to 2-O-acetyl-1-O-hexadecyl-sn-glycero-3-phosphocholine(GO:1904316) cellular response to 2-O-acetyl-1-O-hexadecyl-sn-glycero-3-phosphocholine(GO:1904317) |
| 0.3 | 2.7 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
| 0.3 | 1.3 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
| 0.3 | 1.8 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
| 0.3 | 0.8 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.3 | 0.8 | GO:0019242 | methylglyoxal biosynthetic process(GO:0019242) |
| 0.3 | 1.6 | GO:0090235 | regulation of metaphase plate congression(GO:0090235) |
| 0.3 | 0.8 | GO:1900239 | phenotypic switching(GO:0036166) regulation of phenotypic switching(GO:1900239) |
| 0.3 | 1.3 | GO:0071672 | regulation of muscle hyperplasia(GO:0014738) negative regulation of smooth muscle cell chemotaxis(GO:0071672) |
| 0.3 | 0.3 | GO:0051177 | meiotic sister chromatid cohesion(GO:0051177) |
| 0.3 | 0.5 | GO:0051450 | myoblast proliferation(GO:0051450) |
| 0.3 | 0.8 | GO:0006425 | glutaminyl-tRNA aminoacylation(GO:0006425) |
| 0.3 | 2.8 | GO:0033227 | dsRNA transport(GO:0033227) |
| 0.3 | 0.8 | GO:0070510 | regulation of histone H4-K20 methylation(GO:0070510) positive regulation of histone H4-K20 methylation(GO:0070512) |
| 0.3 | 0.8 | GO:0035938 | estrogen secretion(GO:0035937) estradiol secretion(GO:0035938) regulation of estrogen secretion(GO:2000861) regulation of estradiol secretion(GO:2000864) |
| 0.3 | 1.5 | GO:1904044 | response to aldosterone(GO:1904044) |
| 0.3 | 0.3 | GO:0031627 | telomeric loop formation(GO:0031627) |
| 0.2 | 0.2 | GO:0006880 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.2 | 3.0 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.2 | 0.5 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.2 | 1.5 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
| 0.2 | 2.5 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.2 | 1.2 | GO:2000638 | regulation of SREBP signaling pathway(GO:2000638) negative regulation of SREBP signaling pathway(GO:2000639) |
| 0.2 | 1.0 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) retinal blood vessel morphogenesis(GO:0061304) |
| 0.2 | 0.7 | GO:1900104 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.2 | 0.7 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
| 0.2 | 1.2 | GO:1902659 | regulation of glucose mediated signaling pathway(GO:1902659) |
| 0.2 | 0.7 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) |
| 0.2 | 0.7 | GO:0033364 | mast cell secretory granule organization(GO:0033364) |
| 0.2 | 1.4 | GO:0032092 | positive regulation of protein binding(GO:0032092) |
| 0.2 | 0.7 | GO:0035509 | negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.2 | 1.3 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.2 | 0.7 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.2 | 0.9 | GO:0090202 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 0.2 | 0.7 | GO:0030264 | nuclear fragmentation involved in apoptotic nuclear change(GO:0030264) mineralocorticoid receptor signaling pathway(GO:0031959) positive regulation of cardiac vascular smooth muscle cell differentiation(GO:2000724) |
| 0.2 | 2.0 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.2 | 0.4 | GO:0030101 | natural killer cell activation(GO:0030101) |
| 0.2 | 1.1 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.2 | 0.9 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
| 0.2 | 0.9 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
| 0.2 | 0.8 | GO:0015911 | plasma membrane long-chain fatty acid transport(GO:0015911) |
| 0.2 | 2.3 | GO:0044130 | negative regulation of growth of symbiont in host(GO:0044130) |
| 0.2 | 2.7 | GO:0043306 | positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
| 0.2 | 0.2 | GO:0035992 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
| 0.2 | 0.6 | GO:0044537 | regulation of circulating fibrinogen levels(GO:0044537) |
| 0.2 | 2.0 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.2 | 1.8 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.2 | 0.6 | GO:1902809 | skeletal muscle fiber differentiation(GO:0098528) regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.2 | 2.0 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
| 0.2 | 1.0 | GO:1901093 | regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
| 0.2 | 1.8 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
| 0.2 | 3.6 | GO:0007289 | spermatid nucleus differentiation(GO:0007289) |
| 0.2 | 1.2 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.2 | 0.6 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.2 | 0.4 | GO:0035878 | nail development(GO:0035878) |
| 0.2 | 1.0 | GO:0070092 | regulation of glucagon secretion(GO:0070092) |
| 0.2 | 0.8 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
| 0.2 | 2.6 | GO:0045820 | negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
| 0.2 | 0.6 | GO:0006864 | pyrimidine nucleotide transport(GO:0006864) mitochondrial pyrimidine nucleotide import(GO:1990519) |
| 0.2 | 3.3 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
| 0.2 | 0.6 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
| 0.2 | 0.4 | GO:1904996 | positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 0.2 | 0.4 | GO:0061038 | uterus morphogenesis(GO:0061038) |
| 0.2 | 0.6 | GO:0016260 | selenocysteine biosynthetic process(GO:0016260) |
| 0.2 | 1.0 | GO:0030070 | insulin processing(GO:0030070) |
| 0.2 | 0.6 | GO:0019556 | histidine catabolic process to glutamate and formamide(GO:0019556) histidine catabolic process to glutamate and formate(GO:0019557) formamide metabolic process(GO:0043606) |
| 0.2 | 0.9 | GO:0070383 | DNA cytosine deamination(GO:0070383) |
| 0.2 | 1.5 | GO:0006545 | glycine biosynthetic process(GO:0006545) |
| 0.2 | 0.4 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.2 | 0.9 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.2 | 1.3 | GO:0038110 | interleukin-2-mediated signaling pathway(GO:0038110) |
| 0.2 | 0.9 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
| 0.2 | 2.4 | GO:0051307 | meiotic chromosome separation(GO:0051307) |
| 0.2 | 4.1 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
| 0.2 | 0.6 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
| 0.2 | 0.6 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.2 | 1.1 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.2 | 0.6 | GO:0045425 | regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045423) positive regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045425) |
| 0.2 | 0.2 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
| 0.2 | 1.1 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.2 | 0.7 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.2 | 0.7 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.2 | 3.2 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.2 | 0.9 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.2 | 0.5 | GO:2000612 | thyroid-stimulating hormone secretion(GO:0070460) regulation of thyroid-stimulating hormone secretion(GO:2000612) |
| 0.2 | 2.3 | GO:0006782 | protoporphyrinogen IX biosynthetic process(GO:0006782) |
| 0.2 | 0.7 | GO:0046627 | negative regulation of insulin receptor signaling pathway(GO:0046627) |
| 0.2 | 0.5 | GO:0032730 | positive regulation of interleukin-1 alpha production(GO:0032730) |
| 0.2 | 0.7 | GO:0032053 | ciliary basal body organization(GO:0032053) |
| 0.2 | 0.9 | GO:0048880 | sensory system development(GO:0048880) |
| 0.2 | 1.4 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.2 | 0.9 | GO:0071422 | succinate transport(GO:0015744) succinate transmembrane transport(GO:0071422) |
| 0.2 | 0.2 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.2 | 0.9 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.2 | 0.5 | GO:0000354 | cis assembly of pre-catalytic spliceosome(GO:0000354) |
| 0.2 | 2.1 | GO:0006004 | fucose metabolic process(GO:0006004) |
| 0.2 | 0.5 | GO:0043974 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
| 0.2 | 0.2 | GO:0045950 | negative regulation of mitotic recombination(GO:0045950) |
| 0.2 | 4.1 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
| 0.2 | 0.2 | GO:0051140 | regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
| 0.2 | 2.7 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.2 | 0.7 | GO:0070981 | L-asparagine biosynthetic process(GO:0070981) L-asparagine metabolic process(GO:0070982) |
| 0.2 | 1.7 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
| 0.2 | 0.7 | GO:0021896 | forebrain astrocyte differentiation(GO:0021896) forebrain astrocyte development(GO:0021897) |
| 0.2 | 0.7 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.2 | 1.2 | GO:1903433 | regulation of constitutive secretory pathway(GO:1903433) |
| 0.2 | 1.3 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.2 | 1.5 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
| 0.2 | 0.5 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) detection of triacyl bacterial lipopeptide(GO:0042495) detection of bacterial lipopeptide(GO:0070340) |
| 0.2 | 0.3 | GO:0036295 | cellular response to increased oxygen levels(GO:0036295) response to increased oxygen levels(GO:0036296) |
| 0.2 | 0.3 | GO:0002436 | immune complex clearance(GO:0002434) immune complex clearance by monocytes and macrophages(GO:0002436) regulation of immune complex clearance by monocytes and macrophages(GO:0090264) |
| 0.2 | 0.3 | GO:0048867 | stem cell fate determination(GO:0048867) |
| 0.2 | 0.6 | GO:0034378 | chylomicron assembly(GO:0034378) |
| 0.2 | 0.8 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.2 | 0.5 | GO:1990834 | response to odorant(GO:1990834) |
| 0.2 | 1.4 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
| 0.2 | 0.5 | GO:0010700 | negative regulation of norepinephrine secretion(GO:0010700) |
| 0.2 | 0.5 | GO:0070105 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) positive regulation of interleukin-6-mediated signaling pathway(GO:0070105) |
| 0.2 | 0.5 | GO:0000973 | posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
| 0.2 | 0.2 | GO:0046520 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) sphingoid biosynthetic process(GO:0046520) |
| 0.2 | 0.3 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
| 0.2 | 0.2 | GO:0060926 | atrioventricular node development(GO:0003162) cardiac pacemaker cell differentiation(GO:0060920) cardiac pacemaker cell development(GO:0060926) |
| 0.2 | 0.6 | GO:0048254 | snoRNA localization(GO:0048254) |
| 0.2 | 0.5 | GO:0044878 | mitotic cytokinesis checkpoint(GO:0044878) |
| 0.2 | 0.8 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.2 | 0.6 | GO:0035711 | plasmacytoid dendritic cell activation(GO:0002270) T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) regulation of restriction endodeoxyribonuclease activity(GO:0032072) T-helper 1 cell activation(GO:0035711) negative regulation of apoptotic cell clearance(GO:2000426) |
| 0.2 | 0.6 | GO:0006668 | sphinganine-1-phosphate metabolic process(GO:0006668) |
| 0.2 | 2.5 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
| 0.2 | 0.5 | GO:0044210 | 'de novo' CTP biosynthetic process(GO:0044210) |
| 0.2 | 0.5 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
| 0.2 | 1.4 | GO:1902101 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
| 0.1 | 0.6 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
| 0.1 | 0.1 | GO:0072643 | interferon-gamma secretion(GO:0072643) |
| 0.1 | 0.4 | GO:0038188 | cholecystokinin signaling pathway(GO:0038188) |
| 0.1 | 0.6 | GO:0044026 | DNA hypermethylation(GO:0044026) hypermethylation of CpG island(GO:0044027) |
| 0.1 | 1.3 | GO:0045059 | positive thymic T cell selection(GO:0045059) |
| 0.1 | 0.4 | GO:1904647 | response to rotenone(GO:1904647) |
| 0.1 | 2.4 | GO:0002820 | negative regulation of adaptive immune response(GO:0002820) |
| 0.1 | 0.9 | GO:0051342 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
| 0.1 | 0.4 | GO:1902769 | regulation of choline O-acetyltransferase activity(GO:1902769) positive regulation of choline O-acetyltransferase activity(GO:1902771) negative regulation of tau-protein kinase activity(GO:1902948) positive regulation of early endosome to recycling endosome transport(GO:1902955) negative regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902960) negative regulation of neurofibrillary tangle assembly(GO:1902997) negative regulation of aspartic-type peptidase activity(GO:1905246) |
| 0.1 | 0.4 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
| 0.1 | 1.5 | GO:0034197 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.1 | 1.3 | GO:0006552 | leucine catabolic process(GO:0006552) |
| 0.1 | 0.7 | GO:0072719 | cellular response to cisplatin(GO:0072719) |
| 0.1 | 0.1 | GO:1905064 | negative regulation of vascular smooth muscle cell differentiation(GO:1905064) |
| 0.1 | 0.7 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
| 0.1 | 0.7 | GO:0010793 | regulation of mRNA export from nucleus(GO:0010793) |
| 0.1 | 3.4 | GO:0006337 | nucleosome disassembly(GO:0006337) |
| 0.1 | 0.3 | GO:1903719 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.1 | 0.3 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
| 0.1 | 0.3 | GO:0002883 | regulation of hypersensitivity(GO:0002883) |
| 0.1 | 0.6 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
| 0.1 | 0.1 | GO:0046626 | regulation of insulin receptor signaling pathway(GO:0046626) |
| 0.1 | 0.7 | GO:0061198 | fungiform papilla formation(GO:0061198) |
| 0.1 | 0.3 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
| 0.1 | 0.6 | GO:0042536 | gamma-delta T cell activation involved in immune response(GO:0002290) negative regulation of interferon-beta secretion(GO:0035548) negative regulation of tumor necrosis factor biosynthetic process(GO:0042536) negative regulation of CD8-positive, alpha-beta T cell activation(GO:2001186) regulation of gamma-delta T cell activation involved in immune response(GO:2001191) positive regulation of gamma-delta T cell activation involved in immune response(GO:2001193) |
| 0.1 | 0.6 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.1 | 0.8 | GO:0035965 | cardiolipin acyl-chain remodeling(GO:0035965) |
| 0.1 | 0.7 | GO:0001866 | NK T cell proliferation(GO:0001866) |
| 0.1 | 0.4 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.1 | 5.6 | GO:0043486 | histone exchange(GO:0043486) |
| 0.1 | 0.1 | GO:0060157 | urinary bladder development(GO:0060157) |
| 0.1 | 0.4 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
| 0.1 | 0.7 | GO:0099540 | synaptic signaling via neuropeptide(GO:0099538) trans-synaptic signaling by neuropeptide(GO:0099540) trans-synaptic signaling by neuropeptide, modulating synaptic transmission(GO:0099551) |
| 0.1 | 0.4 | GO:0006014 | D-ribose metabolic process(GO:0006014) |
| 0.1 | 1.1 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.1 | 0.1 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 0.1 | 0.1 | GO:1902938 | regulation of intracellular calcium activated chloride channel activity(GO:1902938) |
| 0.1 | 0.8 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.1 | 0.3 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.1 | 0.4 | GO:0023016 | signal transduction by trans-phosphorylation(GO:0023016) |
| 0.1 | 0.1 | GO:0046619 | optic placode formation involved in camera-type eye formation(GO:0046619) |
| 0.1 | 0.8 | GO:0072553 | terminal button organization(GO:0072553) |
| 0.1 | 0.3 | GO:0090135 | actin filament branching(GO:0090135) |
| 0.1 | 0.1 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
| 0.1 | 0.1 | GO:1901147 | pronephric field specification(GO:0039003) pattern specification involved in pronephros development(GO:0039017) kidney rudiment formation(GO:0072003) kidney field specification(GO:0072004) regulation of mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:0072039) negative regulation of mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:0072040) metanephric nephron tubule formation(GO:0072289) regulation of mesenchymal cell apoptotic process involved in metanephric nephron morphogenesis(GO:0072304) negative regulation of mesenchymal cell apoptotic process involved in metanephric nephron morphogenesis(GO:0072305) mesenchymal stem cell maintenance involved in metanephric nephron morphogenesis(GO:0072309) mesenchymal cell apoptotic process involved in metanephros development(GO:1900200) apoptotic process involved in metanephric collecting duct development(GO:1900204) apoptotic process involved in metanephric nephron tubule development(GO:1900205) regulation of mesenchymal cell apoptotic process involved in metanephros development(GO:1900211) negative regulation of mesenchymal cell apoptotic process involved in metanephros development(GO:1900212) regulation of apoptotic process involved in metanephric collecting duct development(GO:1900214) negative regulation of apoptotic process involved in metanephric collecting duct development(GO:1900215) regulation of apoptotic process involved in metanephric nephron tubule development(GO:1900217) negative regulation of apoptotic process involved in metanephric nephron tubule development(GO:1900218) mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:1901145) mesenchymal cell apoptotic process involved in metanephric nephron morphogenesis(GO:1901147) negative regulation of somatic stem cell population maintenance(GO:1904673) regulation of metanephric DCT cell differentiation(GO:2000592) positive regulation of metanephric DCT cell differentiation(GO:2000594) |
| 0.1 | 0.5 | GO:0072343 | pancreatic stellate cell proliferation(GO:0072343) response to metformin(GO:1901558) regulation of pancreatic stellate cell proliferation(GO:2000229) negative regulation of pancreatic stellate cell proliferation(GO:2000230) |
| 0.1 | 0.8 | GO:0036109 | alpha-linolenic acid metabolic process(GO:0036109) |
| 0.1 | 0.3 | GO:0007193 | adenylate cyclase-inhibiting G-protein coupled receptor signaling pathway(GO:0007193) |
| 0.1 | 0.3 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
| 0.1 | 0.7 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
| 0.1 | 0.5 | GO:0061098 | positive regulation of protein tyrosine kinase activity(GO:0061098) |
| 0.1 | 7.7 | GO:0050853 | B cell receptor signaling pathway(GO:0050853) |
| 0.1 | 0.1 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.1 | 0.1 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
| 0.1 | 0.9 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.1 | 0.4 | GO:0061760 | antifungal innate immune response(GO:0061760) |
| 0.1 | 0.4 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.1 | 0.3 | GO:0002581 | negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) |
| 0.1 | 0.1 | GO:0031126 | snoRNA 3'-end processing(GO:0031126) |
| 0.1 | 0.5 | GO:0019918 | peptidyl-arginine methylation, to symmetrical-dimethyl arginine(GO:0019918) |
| 0.1 | 1.5 | GO:0072540 | T-helper 17 cell lineage commitment(GO:0072540) |
| 0.1 | 0.6 | GO:1902775 | mitochondrial ribosome assembly(GO:0061668) mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.1 | 0.4 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.1 | 1.6 | GO:0009068 | aspartate family amino acid catabolic process(GO:0009068) |
| 0.1 | 0.5 | GO:0036228 | protein targeting to nuclear inner membrane(GO:0036228) |
| 0.1 | 0.5 | GO:0045648 | positive regulation of erythrocyte differentiation(GO:0045648) |
| 0.1 | 0.5 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.1 | 0.1 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
| 0.1 | 0.5 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 0.1 | 0.2 | GO:0045819 | positive regulation of glycogen catabolic process(GO:0045819) |
| 0.1 | 1.4 | GO:0045579 | positive regulation of B cell differentiation(GO:0045579) |
| 0.1 | 1.4 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) sphingolipid mediated signaling pathway(GO:0090520) |
| 0.1 | 1.1 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
| 0.1 | 0.4 | GO:0032203 | telomere formation via telomerase(GO:0032203) |
| 0.1 | 0.5 | GO:0000430 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) positive regulation of transcription by glucose(GO:0046016) |
| 0.1 | 0.9 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
| 0.1 | 0.4 | GO:1904924 | negative regulation of mitophagy in response to mitochondrial depolarization(GO:1904924) |
| 0.1 | 2.9 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
| 0.1 | 0.6 | GO:0071233 | cellular response to leucine(GO:0071233) |
| 0.1 | 1.0 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.1 | 1.6 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.1 | 0.1 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
| 0.1 | 0.6 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.1 | 0.7 | GO:1904550 | chemotaxis to arachidonic acid(GO:0034670) response to arachidonic acid(GO:1904550) |
| 0.1 | 1.8 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.1 | 1.2 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
| 0.1 | 0.5 | GO:2000435 | regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
| 0.1 | 0.5 | GO:0035879 | plasma membrane lactate transport(GO:0035879) |
| 0.1 | 0.5 | GO:0042256 | mature ribosome assembly(GO:0042256) |
| 0.1 | 0.6 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.1 | 0.8 | GO:0003340 | negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) |
| 0.1 | 0.8 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.1 | 0.4 | GO:0050960 | detection of temperature stimulus involved in thermoception(GO:0050960) response to capsazepine(GO:1901594) |
| 0.1 | 0.5 | GO:0042026 | protein refolding(GO:0042026) |
| 0.1 | 0.3 | GO:0071848 | regulation of fever generation by regulation of prostaglandin secretion(GO:0071810) positive regulation of fever generation by positive regulation of prostaglandin secretion(GO:0071812) positive regulation of ERK1 and ERK2 cascade via TNFSF11-mediated signaling(GO:0071848) regulation of fever generation by prostaglandin secretion(GO:0100009) |
| 0.1 | 0.1 | GO:0009299 | mRNA transcription(GO:0009299) endocardium formation(GO:0060214) |
| 0.1 | 0.7 | GO:1903758 | regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903756) negative regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903758) |
| 0.1 | 0.3 | GO:0090427 | activation of meiosis(GO:0090427) |
| 0.1 | 0.1 | GO:0045144 | meiotic sister chromatid segregation(GO:0045144) |
| 0.1 | 0.2 | GO:0045994 | positive regulation of translational initiation by iron(GO:0045994) |
| 0.1 | 0.3 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
| 0.1 | 2.6 | GO:0035338 | long-chain fatty-acyl-CoA biosynthetic process(GO:0035338) |
| 0.1 | 0.1 | GO:0060632 | regulation of microtubule-based movement(GO:0060632) |
| 0.1 | 0.7 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
| 0.1 | 0.7 | GO:0034379 | very-low-density lipoprotein particle assembly(GO:0034379) |
| 0.1 | 0.6 | GO:0006015 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.1 | 0.1 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.1 | 0.2 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) |
| 0.1 | 0.3 | GO:0018894 | dibenzo-p-dioxin metabolic process(GO:0018894) |
| 0.1 | 0.8 | GO:0045007 | depurination(GO:0045007) |
| 0.1 | 0.2 | GO:0032431 | activation of phospholipase A2 activity(GO:0032431) |
| 0.1 | 2.4 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
| 0.1 | 1.3 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.1 | 1.1 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.1 | 1.2 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.1 | 0.4 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.1 | 1.2 | GO:0014041 | regulation of neuron maturation(GO:0014041) |
| 0.1 | 0.3 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 0.1 | 1.6 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.1 | 0.5 | GO:0090280 | positive regulation of calcium ion import(GO:0090280) |
| 0.1 | 6.1 | GO:0018196 | peptidyl-asparagine modification(GO:0018196) protein N-linked glycosylation via asparagine(GO:0018279) |
| 0.1 | 0.2 | GO:0034398 | telomere tethering at nuclear periphery(GO:0034398) meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.1 | 2.1 | GO:0097320 | membrane tubulation(GO:0097320) |
| 0.1 | 0.5 | GO:0021759 | globus pallidus development(GO:0021759) |
| 0.1 | 0.4 | GO:0036343 | psychomotor behavior(GO:0036343) |
| 0.1 | 0.1 | GO:0015917 | aminophospholipid transport(GO:0015917) |
| 0.1 | 0.5 | GO:0071477 | hypotonic salinity response(GO:0042539) cellular hypotonic salinity response(GO:0071477) |
| 0.1 | 0.6 | GO:0072520 | seminiferous tubule development(GO:0072520) |
| 0.1 | 0.3 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.1 | 0.4 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.1 | 0.1 | GO:0042346 | positive regulation of NF-kappaB import into nucleus(GO:0042346) |
| 0.1 | 0.2 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.1 | 0.8 | GO:0031935 | regulation of chromatin silencing(GO:0031935) |
| 0.1 | 0.3 | GO:0045414 | regulation of interleukin-8 biosynthetic process(GO:0045414) |
| 0.1 | 0.3 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.1 | 0.5 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.1 | 0.3 | GO:0021722 | superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
| 0.1 | 1.2 | GO:0070070 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.1 | 0.5 | GO:0002032 | desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
| 0.1 | 0.3 | GO:1904251 | regulation of bile acid metabolic process(GO:1904251) |
| 0.1 | 0.4 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.1 | 1.0 | GO:0002244 | hematopoietic progenitor cell differentiation(GO:0002244) |
| 0.1 | 2.1 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.1 | 0.4 | GO:0034982 | mitochondrial protein processing(GO:0034982) |
| 0.1 | 0.2 | GO:0072177 | mesonephric duct development(GO:0072177) |
| 0.1 | 0.1 | GO:0048263 | determination of dorsal/ventral asymmetry(GO:0048262) determination of dorsal identity(GO:0048263) |
| 0.1 | 0.7 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.1 | 0.7 | GO:0060481 | lobar bronchus epithelium development(GO:0060481) |
| 0.1 | 1.0 | GO:0071265 | amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
| 0.1 | 0.5 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
| 0.1 | 1.0 | GO:0019885 | antigen processing and presentation of endogenous peptide antigen(GO:0002483) antigen processing and presentation of endogenous peptide antigen via MHC class I(GO:0019885) |
| 0.1 | 0.5 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
| 0.1 | 0.6 | GO:0036111 | very long-chain fatty-acyl-CoA metabolic process(GO:0036111) |
| 0.1 | 0.2 | GO:0046013 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.1 | 0.2 | GO:0036010 | protein localization to endosome(GO:0036010) |
| 0.1 | 0.3 | GO:0019074 | viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
| 0.1 | 0.4 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
| 0.1 | 0.5 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
| 0.1 | 0.1 | GO:1903626 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
| 0.1 | 0.5 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) |
| 0.1 | 0.3 | GO:0032380 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.1 | 0.3 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.1 | 0.4 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) positive regulation of metalloendopeptidase activity(GO:1904685) |
| 0.1 | 2.6 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.1 | 1.6 | GO:0045005 | DNA-dependent DNA replication maintenance of fidelity(GO:0045005) |
| 0.1 | 0.2 | GO:0045917 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.1 | 1.1 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.1 | 1.6 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.1 | 3.8 | GO:0006409 | tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.1 | 0.2 | GO:0008045 | motor neuron axon guidance(GO:0008045) |
| 0.1 | 0.4 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.1 | 0.1 | GO:1903401 | L-lysine transmembrane transport(GO:1903401) |
| 0.1 | 2.9 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.1 | 1.0 | GO:1901739 | skeletal muscle atrophy(GO:0014732) regulation of myoblast fusion(GO:1901739) |
| 0.1 | 0.2 | GO:1901143 | insulin catabolic process(GO:1901143) |
| 0.1 | 0.6 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.1 | 0.4 | GO:1902990 | mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
| 0.1 | 0.6 | GO:0030421 | defecation(GO:0030421) |
| 0.1 | 1.4 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
| 0.1 | 0.5 | GO:0043129 | surfactant homeostasis(GO:0043129) |
| 0.1 | 0.9 | GO:0042428 | serotonin metabolic process(GO:0042428) |
| 0.1 | 0.3 | GO:0051685 | maintenance of ER location(GO:0051685) |
| 0.1 | 0.8 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.1 | 0.8 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
| 0.1 | 0.5 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
| 0.1 | 0.2 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
| 0.1 | 0.5 | GO:0090649 | response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
| 0.1 | 1.0 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.1 | 0.1 | GO:0009093 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
| 0.1 | 0.5 | GO:0046642 | negative regulation of alpha-beta T cell proliferation(GO:0046642) |
| 0.1 | 0.4 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.1 | 0.1 | GO:0038129 | ERBB3 signaling pathway(GO:0038129) |
| 0.1 | 0.9 | GO:0033623 | regulation of integrin activation(GO:0033623) |
| 0.1 | 0.2 | GO:1902075 | cellular response to salt(GO:1902075) |
| 0.1 | 1.5 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
| 0.1 | 0.2 | GO:0005985 | sucrose metabolic process(GO:0005985) |
| 0.1 | 0.3 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
| 0.1 | 0.5 | GO:0009146 | purine nucleoside triphosphate catabolic process(GO:0009146) |
| 0.1 | 1.7 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
| 0.1 | 0.3 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 0.1 | 0.1 | GO:1902310 | positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.1 | 2.2 | GO:0006699 | bile acid biosynthetic process(GO:0006699) |
| 0.1 | 0.5 | GO:0032782 | bile acid secretion(GO:0032782) |
| 0.1 | 0.3 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
| 0.1 | 0.3 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
| 0.1 | 1.0 | GO:0016446 | somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.1 | 1.8 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.1 | 0.4 | GO:1902667 | regulation of axon guidance(GO:1902667) |
| 0.1 | 0.4 | GO:0006071 | glycerol metabolic process(GO:0006071) |
| 0.1 | 0.4 | GO:0000079 | regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0000079) |
| 0.1 | 0.3 | GO:0090034 | regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
| 0.1 | 0.6 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.1 | 0.3 | GO:1902023 | L-arginine import(GO:0043091) arginine import(GO:0090467) L-arginine transport(GO:1902023) |
| 0.1 | 0.2 | GO:0007500 | mesodermal cell fate determination(GO:0007500) |
| 0.1 | 3.4 | GO:0006734 | NADH metabolic process(GO:0006734) |
| 0.1 | 0.2 | GO:0019348 | dolichol metabolic process(GO:0019348) |
| 0.1 | 0.8 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.1 | 0.2 | GO:0016999 | antibiotic metabolic process(GO:0016999) |
| 0.1 | 0.3 | GO:0009113 | purine nucleobase biosynthetic process(GO:0009113) |
| 0.1 | 0.2 | GO:1904798 | positive regulation of core promoter binding(GO:1904798) |
| 0.1 | 0.8 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
| 0.1 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.3 | GO:0046081 | dUTP metabolic process(GO:0046080) dUTP catabolic process(GO:0046081) |
| 0.1 | 6.1 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.1 | 0.5 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.1 | 0.1 | GO:0003099 | positive regulation of the force of heart contraction by chemical signal(GO:0003099) |
| 0.1 | 0.7 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.1 | 0.7 | GO:0006188 | IMP biosynthetic process(GO:0006188) |
| 0.1 | 0.3 | GO:0009224 | CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) CMP metabolic process(GO:0046035) |
| 0.1 | 0.2 | GO:0035565 | regulation of pronephros size(GO:0035565) renal glucose absorption(GO:0035623) |
| 0.1 | 0.7 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.1 | 0.6 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
| 0.1 | 0.2 | GO:0071351 | interleukin-18-mediated signaling pathway(GO:0035655) cellular response to interleukin-18(GO:0071351) |
| 0.1 | 0.2 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
| 0.1 | 0.9 | GO:1901387 | positive regulation of voltage-gated calcium channel activity(GO:1901387) |
| 0.1 | 0.2 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
| 0.1 | 0.6 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) |
| 0.1 | 1.1 | GO:0051255 | spindle midzone assembly(GO:0051255) |
| 0.1 | 0.7 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
| 0.1 | 0.5 | GO:1904381 | Golgi apparatus mannose trimming(GO:1904381) |
| 0.1 | 0.3 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
| 0.1 | 0.2 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
| 0.1 | 0.2 | GO:0021873 | forebrain neuroblast division(GO:0021873) |
| 0.1 | 0.5 | GO:0051712 | positive regulation of killing of cells of other organism(GO:0051712) |
| 0.1 | 1.0 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.1 | 1.4 | GO:0007141 | male meiosis I(GO:0007141) |
| 0.1 | 0.5 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
| 0.1 | 0.5 | GO:0007140 | male meiosis(GO:0007140) |
| 0.1 | 0.8 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.1 | 0.2 | GO:0002774 | Fc receptor mediated inhibitory signaling pathway(GO:0002774) |
| 0.1 | 0.8 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
| 0.1 | 0.2 | GO:0060467 | negative regulation of fertilization(GO:0060467) |
| 0.1 | 0.7 | GO:0021513 | spinal cord dorsal/ventral patterning(GO:0021513) |
| 0.1 | 0.1 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 0.1 | 0.7 | GO:0019375 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.1 | 0.2 | GO:1902714 | negative regulation of interferon-gamma secretion(GO:1902714) |
| 0.1 | 0.5 | GO:0015074 | DNA integration(GO:0015074) |
| 0.1 | 0.1 | GO:0002181 | cytoplasmic translation(GO:0002181) |
| 0.1 | 0.4 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
| 0.1 | 0.4 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
| 0.1 | 0.6 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
| 0.1 | 0.2 | GO:0070306 | lens fiber cell differentiation(GO:0070306) |
| 0.1 | 0.2 | GO:0034445 | regulation of plasma lipoprotein particle oxidation(GO:0034444) negative regulation of plasma lipoprotein particle oxidation(GO:0034445) |
| 0.1 | 0.2 | GO:2000412 | activation of MAPK activity involved in innate immune response(GO:0035419) positive regulation of tumor necrosis factor (ligand) superfamily member 11 production(GO:2000309) positive regulation of thymocyte migration(GO:2000412) |
| 0.1 | 0.3 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.1 | 0.4 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.1 | 0.2 | GO:0008628 | hormone-mediated apoptotic signaling pathway(GO:0008628) |
| 0.1 | 0.8 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.1 | 0.5 | GO:0070875 | positive regulation of glycogen metabolic process(GO:0070875) |
| 0.1 | 0.6 | GO:0032494 | response to peptidoglycan(GO:0032494) |
| 0.1 | 0.3 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) |
| 0.1 | 0.5 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.1 | 0.1 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
| 0.1 | 0.2 | GO:1904886 | beta-catenin destruction complex disassembly(GO:1904886) |
| 0.1 | 0.3 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.1 | 0.4 | GO:0016075 | rRNA catabolic process(GO:0016075) |
| 0.1 | 1.1 | GO:0016024 | CDP-diacylglycerol biosynthetic process(GO:0016024) |
| 0.1 | 0.1 | GO:0031929 | TOR signaling(GO:0031929) |
| 0.1 | 0.8 | GO:0010623 | programmed cell death involved in cell development(GO:0010623) |
| 0.1 | 0.2 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.1 | 0.7 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.1 | 0.4 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
| 0.1 | 1.4 | GO:0033006 | regulation of mast cell activation involved in immune response(GO:0033006) regulation of mast cell degranulation(GO:0043304) |
| 0.1 | 0.3 | GO:0051354 | negative regulation of oxidoreductase activity(GO:0051354) |
| 0.1 | 0.9 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.1 | 0.1 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.1 | 1.0 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
| 0.1 | 0.3 | GO:0001189 | RNA polymerase I transcriptional preinitiation complex assembly(GO:0001188) RNA polymerase I transcriptional preinitiation complex assembly at the promoter for the nuclear large rRNA transcript(GO:0001189) |
| 0.1 | 0.4 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
| 0.1 | 0.4 | GO:2000825 | positive regulation of androgen receptor activity(GO:2000825) |
| 0.1 | 0.5 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.1 | 0.7 | GO:0048853 | forebrain morphogenesis(GO:0048853) |
| 0.1 | 1.4 | GO:0097421 | liver regeneration(GO:0097421) |
| 0.1 | 0.8 | GO:0042474 | middle ear morphogenesis(GO:0042474) |
| 0.1 | 0.2 | GO:2000078 | glandular epithelial cell maturation(GO:0002071) type B pancreatic cell maturation(GO:0072560) positive regulation of type B pancreatic cell development(GO:2000078) |
| 0.1 | 0.3 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 | 0.9 | GO:0097202 | activation of cysteine-type endopeptidase activity(GO:0097202) |
| 0.1 | 0.6 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.1 | 1.1 | GO:1902001 | carnitine shuttle(GO:0006853) fatty acid transmembrane transport(GO:1902001) |
| 0.1 | 0.3 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.1 | 0.1 | GO:0034124 | regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034124) |
| 0.1 | 0.3 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
| 0.1 | 3.2 | GO:0006383 | transcription from RNA polymerase III promoter(GO:0006383) |
| 0.1 | 0.2 | GO:0032581 | ER-dependent peroxisome organization(GO:0032581) |
| 0.1 | 0.3 | GO:0045056 | transcytosis(GO:0045056) |
| 0.1 | 0.6 | GO:0060872 | semicircular canal morphogenesis(GO:0048752) semicircular canal development(GO:0060872) |
| 0.1 | 0.3 | GO:0042126 | nitrate metabolic process(GO:0042126) |
| 0.1 | 0.8 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.1 | 0.2 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.1 | 2.1 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 0.1 | 1.8 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.1 | 7.5 | GO:0002377 | immunoglobulin production(GO:0002377) |
| 0.1 | 0.9 | GO:0046653 | tetrahydrofolate metabolic process(GO:0046653) |
| 0.1 | 0.8 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.1 | 0.8 | GO:0042738 | exogenous drug catabolic process(GO:0042738) |
| 0.1 | 0.6 | GO:0060523 | prostate epithelial cord elongation(GO:0060523) prostate gland morphogenetic growth(GO:0060737) |
| 0.1 | 0.6 | GO:0042940 | D-amino acid transport(GO:0042940) |
| 0.1 | 0.3 | GO:0090301 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of neural crest formation(GO:0090299) negative regulation of neural crest formation(GO:0090301) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
| 0.1 | 0.1 | GO:0090170 | regulation of Golgi inheritance(GO:0090170) |
| 0.1 | 0.3 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
| 0.1 | 0.6 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.1 | 0.5 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
| 0.1 | 0.3 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
| 0.1 | 0.8 | GO:1903830 | magnesium ion transmembrane transport(GO:1903830) |
| 0.1 | 1.0 | GO:0034375 | high-density lipoprotein particle remodeling(GO:0034375) |
| 0.1 | 0.5 | GO:1902570 | protein localization to nucleolus(GO:1902570) |
| 0.1 | 0.4 | GO:0008595 | tripartite regional subdivision(GO:0007351) anterior/posterior axis specification, embryo(GO:0008595) |
| 0.1 | 0.2 | GO:0001180 | transcription initiation from RNA polymerase I promoter for nuclear large rRNA transcript(GO:0001180) |
| 0.1 | 1.2 | GO:0097242 | beta-amyloid clearance(GO:0097242) |
| 0.1 | 0.3 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.1 | 0.9 | GO:0043101 | purine-containing compound salvage(GO:0043101) |
| 0.1 | 0.5 | GO:1990035 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
| 0.1 | 0.9 | GO:0046069 | cGMP catabolic process(GO:0046069) |
| 0.1 | 0.3 | GO:0060372 | regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) |
| 0.1 | 0.1 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
| 0.1 | 5.7 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
| 0.1 | 0.9 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.1 | 1.0 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.1 | 0.1 | GO:0042746 | regulation of circadian sleep/wake cycle, wakefulness(GO:0010840) circadian sleep/wake cycle, wakefulness(GO:0042746) |
| 0.1 | 0.3 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.1 | 0.3 | GO:0051974 | negative regulation of telomerase activity(GO:0051974) |
| 0.1 | 0.3 | GO:0010867 | positive regulation of triglyceride biosynthetic process(GO:0010867) |
| 0.1 | 0.2 | GO:0060285 | cilium-dependent cell motility(GO:0060285) |
| 0.1 | 0.4 | GO:0072641 | type I interferon secretion(GO:0072641) interferon-alpha secretion(GO:0072642) regulation of interferon-alpha secretion(GO:1902739) positive regulation of interferon-alpha secretion(GO:1902741) |
| 0.1 | 0.2 | GO:1903031 | regulation of microtubule plus-end binding(GO:1903031) positive regulation of microtubule plus-end binding(GO:1903033) positive regulation of microtubule binding(GO:1904528) |
| 0.1 | 0.1 | GO:0006524 | alanine metabolic process(GO:0006522) alanine catabolic process(GO:0006524) pyruvate family amino acid metabolic process(GO:0009078) pyruvate family amino acid catabolic process(GO:0009080) |
| 0.1 | 0.6 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.1 | 0.2 | GO:0060534 | trachea cartilage development(GO:0060534) |
| 0.1 | 0.2 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.1 | 1.4 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.1 | 0.2 | GO:0007000 | nucleolus organization(GO:0007000) |
| 0.1 | 0.3 | GO:0098856 | intestinal cholesterol absorption(GO:0030299) intestinal lipid absorption(GO:0098856) |
| 0.1 | 0.6 | GO:0022010 | central nervous system myelination(GO:0022010) axon ensheathment in central nervous system(GO:0032291) |
| 0.1 | 0.2 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.1 | 0.2 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
| 0.1 | 0.6 | GO:0010225 | response to UV-C(GO:0010225) |
| 0.1 | 0.4 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.1 | 0.2 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.1 | 0.4 | GO:0010731 | protein glutathionylation(GO:0010731) regulation of protein glutathionylation(GO:0010732) negative regulation of protein glutathionylation(GO:0010734) |
| 0.1 | 0.7 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.1 | 1.0 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
| 0.1 | 0.7 | GO:0006228 | UTP biosynthetic process(GO:0006228) UTP metabolic process(GO:0046051) |
| 0.1 | 0.5 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.1 | 1.5 | GO:0050779 | RNA destabilization(GO:0050779) |
| 0.1 | 0.1 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
| 0.1 | 0.1 | GO:0042439 | ethanolamine-containing compound metabolic process(GO:0042439) |
| 0.1 | 0.5 | GO:0060770 | epithelial cell proliferation involved in prostate gland development(GO:0060767) regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.1 | 0.1 | GO:2000197 | regulation of ribonucleoprotein complex localization(GO:2000197) |
| 0.1 | 0.4 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 0.1 | 1.6 | GO:0071391 | cellular response to estrogen stimulus(GO:0071391) |
| 0.1 | 0.5 | GO:0098780 | response to mitochondrial depolarisation(GO:0098780) |
| 0.1 | 0.2 | GO:0032479 | regulation of type I interferon production(GO:0032479) |
| 0.1 | 3.2 | GO:0006953 | acute-phase response(GO:0006953) |
| 0.1 | 0.4 | GO:0045002 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) double-strand break repair via single-strand annealing(GO:0045002) |
| 0.1 | 0.4 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.1 | 0.3 | GO:0008343 | adult feeding behavior(GO:0008343) |
| 0.1 | 0.2 | GO:1902896 | terminal web assembly(GO:1902896) |
| 0.1 | 0.1 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
| 0.1 | 0.7 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
| 0.1 | 0.5 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
| 0.1 | 0.1 | GO:0043605 | cellular amide catabolic process(GO:0043605) |
| 0.1 | 1.0 | GO:0033866 | coenzyme A biosynthetic process(GO:0015937) nucleoside bisphosphate biosynthetic process(GO:0033866) ribonucleoside bisphosphate biosynthetic process(GO:0034030) purine nucleoside bisphosphate biosynthetic process(GO:0034033) |
| 0.1 | 1.4 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.1 | 0.2 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.1 | 0.3 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
| 0.1 | 0.4 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
| 0.1 | 1.1 | GO:0007131 | reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
| 0.1 | 0.2 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.1 | 0.2 | GO:0038193 | thromboxane A2 signaling pathway(GO:0038193) |
| 0.1 | 0.6 | GO:0002021 | response to dietary excess(GO:0002021) |
| 0.1 | 0.2 | GO:0061366 | negative regulation of growth hormone secretion(GO:0060125) behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
| 0.1 | 0.1 | GO:0042048 | olfactory behavior(GO:0042048) |
| 0.1 | 0.3 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.1 | 0.5 | GO:0019240 | citrulline biosynthetic process(GO:0019240) |
| 0.1 | 0.8 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.1 | 0.3 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.1 | 0.2 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
| 0.1 | 0.1 | GO:0042551 | neuron maturation(GO:0042551) |
| 0.1 | 0.6 | GO:0007173 | epidermal growth factor receptor signaling pathway(GO:0007173) |
| 0.1 | 1.0 | GO:1901663 | ubiquinone metabolic process(GO:0006743) ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.1 | 0.5 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.1 | 0.3 | GO:2001275 | positive regulation of glucose import in response to insulin stimulus(GO:2001275) |
| 0.1 | 0.1 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
| 0.1 | 0.3 | GO:2000489 | hepatic stellate cell activation(GO:0035733) fibroblast activation(GO:0072537) regulation of hepatic stellate cell activation(GO:2000489) positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.1 | 2.7 | GO:0006400 | tRNA modification(GO:0006400) |
| 0.1 | 0.7 | GO:0035456 | response to interferon-beta(GO:0035456) |
| 0.1 | 0.2 | GO:0061088 | regulation of sequestering of zinc ion(GO:0061088) |
| 0.1 | 0.6 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.1 | 0.3 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 0.1 | 4.0 | GO:0050852 | T cell receptor signaling pathway(GO:0050852) |
| 0.1 | 0.2 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
| 0.1 | 0.3 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.1 | 0.2 | GO:2000143 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) negative regulation of DNA-templated transcription, initiation(GO:2000143) |
| 0.1 | 0.2 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.1 | 1.8 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
| 0.1 | 1.3 | GO:0001580 | detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
| 0.1 | 1.3 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
| 0.1 | 0.7 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
| 0.1 | 0.1 | GO:0021684 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.1 | 0.5 | GO:0042904 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.1 | 0.2 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
| 0.1 | 1.2 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 | 0.5 | GO:0007379 | segment specification(GO:0007379) |
| 0.0 | 0.1 | GO:0043449 | cellular alkene metabolic process(GO:0043449) |
| 0.0 | 0.2 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
| 0.0 | 0.1 | GO:2000823 | regulation of androgen receptor activity(GO:2000823) |
| 0.0 | 0.0 | GO:0007494 | midgut development(GO:0007494) |
| 0.0 | 1.0 | GO:0016254 | preassembly of GPI anchor in ER membrane(GO:0016254) |
| 0.0 | 0.4 | GO:0071318 | cellular response to ATP(GO:0071318) |
| 0.0 | 0.4 | GO:0050718 | positive regulation of interleukin-1 secretion(GO:0050716) positive regulation of interleukin-1 beta secretion(GO:0050718) |
| 0.0 | 0.6 | GO:0070988 | demethylation(GO:0070988) |
| 0.0 | 2.0 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.0 | 0.2 | GO:0046543 | thelarche(GO:0042695) development of secondary female sexual characteristics(GO:0046543) mammary gland branching involved in thelarche(GO:0060744) |
| 0.0 | 0.0 | GO:0090070 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.0 | 0.2 | GO:0006574 | valine catabolic process(GO:0006574) |
| 0.0 | 0.2 | GO:0045577 | regulation of B cell differentiation(GO:0045577) |
| 0.0 | 0.3 | GO:0071816 | tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.0 | 0.6 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
| 0.0 | 0.2 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.0 | 0.1 | GO:0030241 | skeletal muscle myosin thick filament assembly(GO:0030241) |
| 0.0 | 0.4 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.0 | 0.8 | GO:2000479 | regulation of cAMP-dependent protein kinase activity(GO:2000479) |
| 0.0 | 0.3 | GO:0015939 | pantothenate metabolic process(GO:0015939) |
| 0.0 | 0.1 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
| 0.0 | 0.2 | GO:0051132 | NK T cell activation(GO:0051132) |
| 0.0 | 0.9 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.0 | 0.1 | GO:0045212 | negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) neurotransmitter receptor metabolic process(GO:0045213) |
| 0.0 | 0.2 | GO:0072302 | visceral serous pericardium development(GO:0061032) negative regulation of glomerular mesangial cell proliferation(GO:0072125) posterior mesonephric tubule development(GO:0072166) negative regulation of metanephric glomerulus development(GO:0072299) negative regulation of metanephric glomerular mesangial cell proliferation(GO:0072302) negative regulation of glomerulus development(GO:0090194) |
| 0.0 | 0.1 | GO:0097476 | spinal cord motor neuron migration(GO:0097476) lateral motor column neuron migration(GO:0097477) |
| 0.0 | 0.3 | GO:1903358 | regulation of Golgi organization(GO:1903358) |
| 0.0 | 3.3 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.0 | 0.4 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.0 | 0.5 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.0 | 0.1 | GO:0033685 | negative regulation of luteinizing hormone secretion(GO:0033685) |
| 0.0 | 1.4 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
| 0.0 | 0.0 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
| 0.0 | 0.2 | GO:0002084 | protein depalmitoylation(GO:0002084) |
| 0.0 | 0.2 | GO:0015961 | diadenosine polyphosphate catabolic process(GO:0015961) diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
| 0.0 | 0.8 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
| 0.0 | 0.0 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.0 | 0.4 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.0 | 0.5 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
| 0.0 | 0.1 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.0 | 0.5 | GO:0045475 | locomotor rhythm(GO:0045475) |
| 0.0 | 0.3 | GO:0045840 | positive regulation of mitotic nuclear division(GO:0045840) |
| 0.0 | 1.6 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.0 | 2.9 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
| 0.0 | 0.4 | GO:0045730 | respiratory burst(GO:0045730) |
| 0.0 | 0.5 | GO:0016246 | RNA interference(GO:0016246) |
| 0.0 | 0.1 | GO:0070781 | response to biotin(GO:0070781) |
| 0.0 | 0.2 | GO:0010891 | regulation of sequestering of triglyceride(GO:0010889) negative regulation of sequestering of triglyceride(GO:0010891) sequestering of triglyceride(GO:0030730) |
| 0.0 | 0.1 | GO:1902992 | negative regulation of amyloid precursor protein catabolic process(GO:1902992) |
| 0.0 | 0.2 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.0 | 0.9 | GO:0071277 | cellular response to calcium ion(GO:0071277) |
| 0.0 | 0.1 | GO:0072093 | ureteric bud invasion(GO:0072092) metanephric renal vesicle formation(GO:0072093) |
| 0.0 | 0.2 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.0 | 0.4 | GO:0035815 | positive regulation of renal sodium excretion(GO:0035815) |
| 0.0 | 0.4 | GO:1904380 | endoplasmic reticulum mannose trimming(GO:1904380) |
| 0.0 | 0.4 | GO:0045143 | homologous chromosome segregation(GO:0045143) |
| 0.0 | 0.7 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
| 0.0 | 0.1 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
| 0.0 | 0.2 | GO:0009048 | dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.0 | 0.2 | GO:0097033 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.0 | 0.1 | GO:0048631 | regulation of skeletal muscle tissue growth(GO:0048631) |
| 0.0 | 0.6 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
| 0.0 | 0.1 | GO:0036100 | leukotriene catabolic process(GO:0036100) leukotriene B4 catabolic process(GO:0036101) leukotriene B4 metabolic process(GO:0036102) icosanoid catabolic process(GO:1901523) fatty acid derivative catabolic process(GO:1901569) |
| 0.0 | 0.0 | GO:0014005 | microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.0 | 0.1 | GO:0021815 | modulation of microtubule cytoskeleton involved in cerebral cortex radial glia guided migration(GO:0021815) |
| 0.0 | 0.4 | GO:0060148 | positive regulation of posttranscriptional gene silencing(GO:0060148) positive regulation of gene silencing by miRNA(GO:2000637) |
| 0.0 | 0.7 | GO:0007080 | mitotic metaphase plate congression(GO:0007080) |
| 0.0 | 1.7 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
| 0.0 | 0.1 | GO:0030238 | male sex determination(GO:0030238) |
| 0.0 | 0.3 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.0 | 0.3 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.0 | 0.4 | GO:0032695 | negative regulation of interleukin-12 production(GO:0032695) |
| 0.0 | 0.3 | GO:0097154 | cerebral cortex GABAergic interneuron differentiation(GO:0021892) cerebral cortex GABAergic interneuron development(GO:0021894) GABAergic neuron differentiation(GO:0097154) |
| 0.0 | 0.2 | GO:1901475 | pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
| 0.0 | 0.2 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 0.0 | 0.2 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
| 0.0 | 0.6 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
| 0.0 | 1.1 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
| 0.0 | 0.1 | GO:0045132 | meiotic chromosome segregation(GO:0045132) |
| 0.0 | 0.2 | GO:0045835 | negative regulation of meiotic nuclear division(GO:0045835) |
| 0.0 | 0.2 | GO:0036376 | sodium ion export from cell(GO:0036376) |
| 0.0 | 0.2 | GO:0015862 | uridine transport(GO:0015862) |
| 0.0 | 0.0 | GO:0042116 | macrophage activation(GO:0042116) |
| 0.0 | 0.0 | GO:1903895 | negative regulation of IRE1-mediated unfolded protein response(GO:1903895) |
| 0.0 | 0.3 | GO:0022401 | desensitization of G-protein coupled receptor protein signaling pathway(GO:0002029) negative adaptation of signaling pathway(GO:0022401) |
| 0.0 | 0.1 | GO:0021846 | cell proliferation in forebrain(GO:0021846) |
| 0.0 | 0.2 | GO:0006551 | leucine metabolic process(GO:0006551) |
| 0.0 | 0.3 | GO:0033540 | fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
| 0.0 | 0.3 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
| 0.0 | 0.3 | GO:0043435 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.0 | 0.2 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
| 0.0 | 1.3 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
| 0.0 | 0.1 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
| 0.0 | 0.1 | GO:0046852 | positive regulation of bone resorption(GO:0045780) positive regulation of bone remodeling(GO:0046852) |
| 0.0 | 0.8 | GO:0045652 | regulation of megakaryocyte differentiation(GO:0045652) |
| 0.0 | 0.3 | GO:0030261 | chromosome condensation(GO:0030261) |
| 0.0 | 0.1 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.0 | 0.1 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.0 | 1.2 | GO:0042100 | B cell proliferation(GO:0042100) |
| 0.0 | 0.1 | GO:0048708 | astrocyte differentiation(GO:0048708) |
| 0.0 | 0.7 | GO:0033574 | response to testosterone(GO:0033574) |
| 0.0 | 0.8 | GO:0071427 | mRNA export from nucleus(GO:0006406) mRNA-containing ribonucleoprotein complex export from nucleus(GO:0071427) |
| 0.0 | 0.4 | GO:0036148 | phosphatidylglycerol acyl-chain remodeling(GO:0036148) |
| 0.0 | 0.1 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.0 | 0.6 | GO:0006298 | mismatch repair(GO:0006298) |
| 0.0 | 0.4 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.0 | 0.1 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
| 0.0 | 1.0 | GO:1904358 | regulation of telomere maintenance via telomere lengthening(GO:1904356) positive regulation of telomere maintenance via telomere lengthening(GO:1904358) |
| 0.0 | 0.2 | GO:0070458 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 0.0 | 0.0 | GO:0031065 | positive regulation of histone deacetylation(GO:0031065) |
| 0.0 | 0.5 | GO:0060338 | regulation of type I interferon-mediated signaling pathway(GO:0060338) |
| 0.0 | 0.2 | GO:0060397 | JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
| 0.0 | 0.1 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
| 0.0 | 0.1 | GO:2000191 | regulation of fatty acid transport(GO:2000191) |
| 0.0 | 0.0 | GO:0034442 | regulation of lipoprotein oxidation(GO:0034442) negative regulation of lipoprotein oxidation(GO:0034443) |
| 0.0 | 0.2 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.0 | 0.1 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.0 | 0.5 | GO:0006284 | base-excision repair(GO:0006284) |
| 0.0 | 0.3 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.0 | 0.1 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.0 | 0.3 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.0 | 0.2 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
| 0.0 | 0.1 | GO:1900154 | regulation of bone trabecula formation(GO:1900154) negative regulation of bone trabecula formation(GO:1900155) |
| 0.0 | 0.2 | GO:0071371 | cellular response to gonadotropin stimulus(GO:0071371) |
| 0.0 | 0.1 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
| 0.0 | 0.2 | GO:0019388 | galactose catabolic process(GO:0019388) |
| 0.0 | 0.0 | GO:0032490 | detection of molecule of bacterial origin(GO:0032490) |
| 0.0 | 0.2 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.0 | 0.1 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.0 | 0.3 | GO:0006598 | polyamine catabolic process(GO:0006598) |
| 0.0 | 0.1 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
| 0.0 | 0.7 | GO:0051703 | social behavior(GO:0035176) intraspecies interaction between organisms(GO:0051703) |
| 0.0 | 0.1 | GO:0045901 | translational frameshifting(GO:0006452) positive regulation of translational elongation(GO:0045901) positive regulation of translational termination(GO:0045905) |
| 0.0 | 0.1 | GO:0048169 | regulation of long-term neuronal synaptic plasticity(GO:0048169) |
| 0.0 | 0.4 | GO:0033233 | regulation of protein sumoylation(GO:0033233) |
| 0.0 | 0.1 | GO:0046968 | peptide antigen transport(GO:0046968) |
| 0.0 | 0.1 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
| 0.0 | 0.1 | GO:1990416 | cellular response to brain-derived neurotrophic factor stimulus(GO:1990416) |
| 0.0 | 2.5 | GO:0006338 | chromatin remodeling(GO:0006338) |
| 0.0 | 0.5 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.0 | 0.1 | GO:0099566 | regulation of postsynaptic cytosolic calcium ion concentration(GO:0099566) |
| 0.0 | 0.5 | GO:0046599 | regulation of centriole replication(GO:0046599) |
| 0.0 | 0.3 | GO:0045008 | depyrimidination(GO:0045008) |
| 0.0 | 0.6 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
| 0.0 | 0.1 | GO:0006183 | GTP biosynthetic process(GO:0006183) |
| 0.0 | 0.3 | GO:0045824 | negative regulation of innate immune response(GO:0045824) |
| 0.0 | 0.4 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
| 0.0 | 0.2 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.0 | 0.1 | GO:0050913 | sensory perception of bitter taste(GO:0050913) |
| 0.0 | 0.1 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
| 0.0 | 0.1 | GO:0016185 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) synaptic vesicle budding(GO:0070142) |
| 0.0 | 0.1 | GO:0030242 | pexophagy(GO:0030242) |
| 0.0 | 0.2 | GO:0061081 | positive regulation of myeloid leukocyte cytokine production involved in immune response(GO:0061081) |
| 0.0 | 0.2 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.0 | 0.1 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
| 0.0 | 0.1 | GO:0017198 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.0 | 0.1 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
| 0.0 | 0.3 | GO:0050974 | detection of mechanical stimulus involved in sensory perception(GO:0050974) |
| 0.0 | 0.4 | GO:1990118 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.0 | 0.1 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.0 | 0.1 | GO:0051085 | 'de novo' posttranslational protein folding(GO:0051084) chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.0 | 3.9 | GO:0002223 | stimulatory C-type lectin receptor signaling pathway(GO:0002223) |
| 0.0 | 0.1 | GO:0007320 | insemination(GO:0007320) |
| 0.0 | 0.2 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.0 | 0.1 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.0 | 0.2 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.0 | 0.2 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.0 | 0.2 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
| 0.0 | 0.2 | GO:0000394 | RNA splicing, via endonucleolytic cleavage and ligation(GO:0000394) tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.0 | 0.2 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.0 | 0.2 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
| 0.0 | 0.1 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.0 | 0.1 | GO:0006422 | aspartyl-tRNA aminoacylation(GO:0006422) |
| 0.0 | 0.1 | GO:0009750 | response to fructose(GO:0009750) |
| 0.0 | 0.1 | GO:0072538 | T-helper 17 type immune response(GO:0072538) T-helper 17 cell differentiation(GO:0072539) |
| 0.0 | 0.1 | GO:0042756 | drinking behavior(GO:0042756) |
| 0.0 | 0.1 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.0 | 0.4 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.0 | 0.1 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
| 0.0 | 0.2 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.0 | 0.2 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
| 0.0 | 0.0 | GO:0070370 | heat acclimation(GO:0010286) cellular heat acclimation(GO:0070370) |
| 0.0 | 0.4 | GO:0050775 | positive regulation of dendrite morphogenesis(GO:0050775) |
| 0.0 | 0.2 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
| 0.0 | 0.2 | GO:0006983 | ER overload response(GO:0006983) |
| 0.0 | 0.1 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.0 | 0.3 | GO:0006570 | tyrosine metabolic process(GO:0006570) |
| 0.0 | 0.1 | GO:0001692 | histamine metabolic process(GO:0001692) |
| 0.0 | 0.1 | GO:0034505 | tooth mineralization(GO:0034505) |
| 0.0 | 0.1 | GO:0071380 | cellular response to prostaglandin E stimulus(GO:0071380) |
| 0.0 | 0.4 | GO:0051299 | mitotic centrosome separation(GO:0007100) centrosome separation(GO:0051299) |
| 0.0 | 0.1 | GO:1902993 | positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
| 0.0 | 0.1 | GO:0048261 | negative regulation of receptor-mediated endocytosis(GO:0048261) |
| 0.0 | 0.2 | GO:0003338 | metanephros morphogenesis(GO:0003338) |
| 0.0 | 0.4 | GO:0042340 | keratan sulfate catabolic process(GO:0042340) |
| 0.0 | 0.4 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 0.0 | 0.1 | GO:0051012 | microtubule sliding(GO:0051012) |
| 0.0 | 0.1 | GO:1901673 | regulation of mitotic spindle assembly(GO:1901673) |
| 0.0 | 0.2 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.0 | 0.2 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.0 | 0.1 | GO:0036058 | filtration diaphragm assembly(GO:0036058) slit diaphragm assembly(GO:0036060) negative regulation of retinal ganglion cell axon guidance(GO:0090260) |
| 0.0 | 0.0 | GO:0070585 | protein localization to mitochondrion(GO:0070585) |
| 0.0 | 0.1 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
| 0.0 | 0.1 | GO:0042414 | epinephrine metabolic process(GO:0042414) epinephrine biosynthetic process(GO:0042418) |
| 0.0 | 0.6 | GO:0033762 | response to glucagon(GO:0033762) |
| 0.0 | 0.1 | GO:0010447 | response to acidic pH(GO:0010447) |
| 0.0 | 0.2 | GO:0060348 | bone development(GO:0060348) |
| 0.0 | 0.6 | GO:0030183 | B cell differentiation(GO:0030183) |
| 0.0 | 0.2 | GO:0008211 | glucocorticoid metabolic process(GO:0008211) |
| 0.0 | 0.3 | GO:0021692 | cerebellar Purkinje cell layer morphogenesis(GO:0021692) |
| 0.0 | 0.1 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 0.0 | 0.1 | GO:0009125 | nucleoside monophosphate catabolic process(GO:0009125) |
| 0.0 | 0.1 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.0 | 0.2 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
| 0.0 | 0.3 | GO:0060292 | long term synaptic depression(GO:0060292) |
| 0.0 | 0.1 | GO:1904994 | regulation of leukocyte adhesion to vascular endothelial cell(GO:1904994) |
| 0.0 | 1.6 | GO:0006687 | glycosphingolipid metabolic process(GO:0006687) |
| 0.0 | 0.3 | GO:0099500 | synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
| 0.0 | 0.0 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
| 0.0 | 0.4 | GO:0098743 | cell aggregation(GO:0098743) |
| 0.0 | 0.1 | GO:0021675 | nerve development(GO:0021675) |
| 0.0 | 0.3 | GO:0071539 | protein localization to centrosome(GO:0071539) |
| 0.0 | 0.2 | GO:1901800 | positive regulation of proteasomal protein catabolic process(GO:1901800) |
| 0.0 | 0.3 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
| 0.0 | 0.1 | GO:0097680 | cellular hyperosmotic salinity response(GO:0071475) double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.0 | 0.7 | GO:0051436 | negative regulation of ubiquitin-protein ligase activity involved in mitotic cell cycle(GO:0051436) regulation of ubiquitin-protein ligase activity involved in mitotic cell cycle(GO:0051439) |
| 0.0 | 0.1 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.0 | 0.5 | GO:0031572 | G2 DNA damage checkpoint(GO:0031572) |
| 0.0 | 0.1 | GO:0021871 | forebrain regionalization(GO:0021871) |
| 0.0 | 0.1 | GO:0060041 | retina development in camera-type eye(GO:0060041) |
| 0.0 | 0.8 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
| 0.0 | 1.3 | GO:0051092 | positive regulation of NF-kappaB transcription factor activity(GO:0051092) |
| 0.0 | 0.6 | GO:0030317 | sperm motility(GO:0030317) |
| 0.0 | 0.6 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
| 0.0 | 0.1 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
| 0.0 | 0.1 | GO:0034447 | very-low-density lipoprotein particle clearance(GO:0034447) |
| 0.0 | 0.7 | GO:0016575 | histone deacetylation(GO:0016575) |
| 0.0 | 0.1 | GO:0060252 | positive regulation of glial cell proliferation(GO:0060252) |
| 0.0 | 0.6 | GO:0043966 | histone H3 acetylation(GO:0043966) |
| 0.0 | 1.1 | GO:0051225 | spindle assembly(GO:0051225) |
| 0.0 | 0.0 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
| 0.0 | 0.1 | GO:0001880 | Mullerian duct regression(GO:0001880) |
| 0.0 | 0.1 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.0 | 0.0 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
| 0.0 | 0.0 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
| 0.0 | 0.1 | GO:0006434 | seryl-tRNA aminoacylation(GO:0006434) selenocysteinyl-tRNA(Sec) biosynthetic process(GO:0097056) |
| 0.0 | 0.1 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 0.0 | 0.1 | GO:0034389 | lipid particle organization(GO:0034389) |
| 0.0 | 0.3 | GO:0060080 | inhibitory postsynaptic potential(GO:0060080) |
| 0.0 | 0.1 | GO:0006857 | oligopeptide transport(GO:0006857) |
| 0.0 | 0.1 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.0 | 0.2 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.0 | 0.1 | GO:0014823 | response to activity(GO:0014823) |
| 0.0 | 0.1 | GO:0051438 | regulation of ubiquitin-protein transferase activity(GO:0051438) |
| 0.0 | 0.1 | GO:0048266 | behavioral response to pain(GO:0048266) |
| 0.0 | 0.0 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.0 | 0.1 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.0 | 0.2 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.0 | 0.1 | GO:0006750 | glutathione biosynthetic process(GO:0006750) nonribosomal peptide biosynthetic process(GO:0019184) |
| 0.0 | 0.2 | GO:0090004 | positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
| 0.0 | 0.5 | GO:0046037 | GMP metabolic process(GO:0046037) |
| 0.0 | 0.1 | GO:2000394 | positive regulation of lamellipodium morphogenesis(GO:2000394) |
| 0.0 | 0.0 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
| 0.0 | 0.1 | GO:0006007 | glucose catabolic process(GO:0006007) |
| 0.0 | 0.1 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.0 | 0.2 | GO:0051443 | positive regulation of ubiquitin-protein transferase activity(GO:0051443) |
| 0.0 | 0.2 | GO:0006198 | cAMP catabolic process(GO:0006198) |
| 0.0 | 0.0 | GO:0006011 | UDP-glucose metabolic process(GO:0006011) |
| 0.0 | 0.2 | GO:0021904 | dorsal/ventral neural tube patterning(GO:0021904) |
| 0.0 | 0.1 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.0 | 0.1 | GO:0051083 | 'de novo' cotranslational protein folding(GO:0051083) |
| 0.0 | 0.1 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.0 | 0.0 | GO:0035774 | positive regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0035774) |
| 0.0 | 0.1 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
| 0.0 | 0.2 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
| 0.0 | 0.0 | GO:0009181 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
| 0.0 | 0.5 | GO:0045197 | establishment or maintenance of epithelial cell apical/basal polarity(GO:0045197) |
| 0.0 | 0.1 | GO:1901018 | positive regulation of potassium ion transmembrane transporter activity(GO:1901018) |
| 0.0 | 0.1 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.0 | 0.0 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.0 | 0.3 | GO:0046677 | response to antibiotic(GO:0046677) |
| 0.0 | 0.2 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.0 | 0.2 | GO:0007616 | long-term memory(GO:0007616) |
| 0.0 | 0.1 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
| 0.0 | 0.1 | GO:0015871 | choline transport(GO:0015871) |
| 0.0 | 0.0 | GO:0007538 | primary sex determination(GO:0007538) |
| 0.0 | 0.2 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.0 | 0.0 | GO:0050655 | dermatan sulfate metabolic process(GO:0030205) dermatan sulfate biosynthetic process(GO:0030208) dermatan sulfate proteoglycan biosynthetic process(GO:0050651) dermatan sulfate proteoglycan metabolic process(GO:0050655) |
| 0.0 | 0.1 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.0 | 1.7 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.0 | 0.1 | GO:0033489 | cholesterol biosynthetic process via desmosterol(GO:0033489) cholesterol biosynthetic process via lathosterol(GO:0033490) |
| 0.0 | 0.1 | GO:0003091 | renal water homeostasis(GO:0003091) |
| 0.0 | 0.2 | GO:0042573 | retinoic acid metabolic process(GO:0042573) |
| 0.0 | 0.1 | GO:0048147 | negative regulation of fibroblast proliferation(GO:0048147) |
| 0.0 | 0.0 | GO:0003072 | regulation of blood vessel size by renin-angiotensin(GO:0002034) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) |
| 0.0 | 0.0 | GO:0048733 | sebaceous gland development(GO:0048733) |
| 0.0 | 0.0 | GO:0072610 | interleukin-12 secretion(GO:0072610) regulation of interleukin-12 secretion(GO:2001182) |
| 0.0 | 0.1 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.0 | 0.2 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) phosphatidylethanolamine metabolic process(GO:0046337) |
| 0.0 | 0.2 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
| 0.0 | 0.1 | GO:0099624 | membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) atrial cardiac muscle cell membrane repolarization(GO:0099624) |
| 0.0 | 0.1 | GO:0009410 | xenobiotic metabolic process(GO:0006805) response to xenobiotic stimulus(GO:0009410) cellular response to xenobiotic stimulus(GO:0071466) |
| 0.0 | 0.0 | GO:0021590 | cerebellum maturation(GO:0021590) cerebellar Purkinje cell layer maturation(GO:0021691) cerebellar cortex maturation(GO:0021699) |
| 0.0 | 0.0 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
| 0.0 | 0.1 | GO:0048311 | mitochondrion distribution(GO:0048311) |
| 0.0 | 0.0 | GO:0030201 | heparan sulfate proteoglycan metabolic process(GO:0030201) |
| 0.0 | 0.1 | GO:0042059 | negative regulation of epidermal growth factor receptor signaling pathway(GO:0042059) |
| 0.0 | 0.5 | GO:0042795 | snRNA transcription(GO:0009301) snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.0 | 0.1 | GO:0006940 | regulation of smooth muscle contraction(GO:0006940) |
| 0.0 | 0.0 | GO:0006726 | eye pigment biosynthetic process(GO:0006726) eye pigment metabolic process(GO:0042441) pigment metabolic process involved in developmental pigmentation(GO:0043324) pigment metabolic process involved in pigmentation(GO:0043474) |
| 0.0 | 0.3 | GO:0006099 | tricarboxylic acid cycle(GO:0006099) |
| 0.0 | 0.0 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
| 0.0 | 0.0 | GO:0007625 | grooming behavior(GO:0007625) |
| 0.0 | 0.0 | GO:1904874 | positive regulation of telomerase RNA localization to Cajal body(GO:1904874) |
| 0.0 | 0.1 | GO:0070307 | lens fiber cell development(GO:0070307) |
| 0.0 | 0.1 | GO:1902236 | negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
| 0.0 | 0.1 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
| 0.0 | 0.1 | GO:0015865 | purine nucleotide transport(GO:0015865) purine ribonucleotide transport(GO:0015868) |
| 0.0 | 0.1 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
| 0.0 | 0.1 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.0 | 0.2 | GO:0006342 | chromatin silencing(GO:0006342) |
| 0.0 | 0.0 | GO:0030903 | notochord development(GO:0030903) |
| 0.0 | 0.0 | GO:1905069 | negative regulation of mononuclear cell migration(GO:0071676) allantois development(GO:1905069) |
| 0.0 | 0.1 | GO:0030157 | pancreatic juice secretion(GO:0030157) |
| 0.0 | 0.0 | GO:1902224 | ketone body metabolic process(GO:1902224) |
| 0.0 | 0.1 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.0 | 0.6 | GO:0006968 | cellular defense response(GO:0006968) |
| 0.0 | 0.1 | GO:0044331 | cell-cell adhesion mediated by cadherin(GO:0044331) |
| 0.0 | 0.1 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
| 0.0 | 0.1 | GO:0061436 | establishment of skin barrier(GO:0061436) |
| 0.0 | 0.1 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.0 | 0.1 | GO:1901374 | acetate ester transport(GO:1901374) |
| 0.0 | 0.1 | GO:0000038 | very long-chain fatty acid metabolic process(GO:0000038) |
| 0.0 | 0.0 | GO:0043335 | protein unfolding(GO:0043335) |
| 0.0 | 0.1 | GO:0046426 | negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
| 0.0 | 0.1 | GO:0014066 | regulation of phosphatidylinositol 3-kinase signaling(GO:0014066) |
| 0.0 | 0.3 | GO:0006487 | protein N-linked glycosylation(GO:0006487) |
| 0.0 | 0.1 | GO:0051497 | negative regulation of actin filament bundle assembly(GO:0032232) negative regulation of stress fiber assembly(GO:0051497) |
| 0.0 | 0.0 | GO:1902081 | regulation of calcium ion import into sarcoplasmic reticulum(GO:1902080) negative regulation of calcium ion import into sarcoplasmic reticulum(GO:1902081) |
| 0.0 | 0.2 | GO:0030218 | erythrocyte differentiation(GO:0030218) |
| 0.0 | 0.1 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.0 | 0.0 | GO:0016233 | telomere capping(GO:0016233) |
| 0.0 | 0.1 | GO:0002115 | store-operated calcium entry(GO:0002115) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.2 | 4.9 | GO:0034669 | integrin alpha4-beta7 complex(GO:0034669) |
| 1.1 | 3.4 | GO:0071751 | IgA immunoglobulin complex(GO:0071745) IgA immunoglobulin complex, circulating(GO:0071746) monomeric IgA immunoglobulin complex(GO:0071748) polymeric IgA immunoglobulin complex(GO:0071749) secretory IgA immunoglobulin complex(GO:0071751) |
| 0.8 | 6.4 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 0.7 | 1.4 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.7 | 0.7 | GO:0030136 | clathrin-coated vesicle(GO:0030136) |
| 0.6 | 1.8 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
| 0.6 | 12.4 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.5 | 1.6 | GO:0005873 | plus-end kinesin complex(GO:0005873) |
| 0.5 | 2.6 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.5 | 2.8 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.4 | 3.0 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.4 | 2.9 | GO:0016589 | NURF complex(GO:0016589) |
| 0.4 | 2.1 | GO:0034688 | integrin alphaM-beta2 complex(GO:0034688) |
| 0.4 | 18.5 | GO:0042571 | immunoglobulin complex, circulating(GO:0042571) |
| 0.4 | 1.5 | GO:0071062 | alphav-beta3 integrin-vitronectin complex(GO:0071062) |
| 0.4 | 1.1 | GO:0097134 | cyclin E1-CDK2 complex(GO:0097134) |
| 0.4 | 8.1 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.3 | 2.4 | GO:0043196 | varicosity(GO:0043196) |
| 0.3 | 0.7 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
| 0.3 | 3.0 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.3 | 1.0 | GO:0005656 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
| 0.3 | 5.3 | GO:0042627 | chylomicron(GO:0042627) |
| 0.3 | 1.0 | GO:0009330 | DNA topoisomerase complex (ATP-hydrolyzing)(GO:0009330) |
| 0.3 | 2.2 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.3 | 4.3 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.3 | 0.9 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.3 | 1.5 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.3 | 0.9 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.3 | 1.4 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.3 | 0.8 | GO:0060187 | cell pole(GO:0060187) |
| 0.3 | 1.1 | GO:0000811 | GINS complex(GO:0000811) |
| 0.3 | 3.4 | GO:0042555 | MCM complex(GO:0042555) |
| 0.3 | 1.0 | GO:0031436 | BRCA1-BARD1 complex(GO:0031436) |
| 0.3 | 1.3 | GO:0002169 | 3-methylcrotonyl-CoA carboxylase complex, mitochondrial(GO:0002169) methylcrotonoyl-CoA carboxylase complex(GO:1905202) |
| 0.2 | 2.9 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.2 | 4.6 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.2 | 0.2 | GO:0001740 | X chromosome(GO:0000805) Barr body(GO:0001740) |
| 0.2 | 0.7 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.2 | 0.5 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.2 | 0.7 | GO:0032302 | MutSbeta complex(GO:0032302) |
| 0.2 | 2.5 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.2 | 1.6 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
| 0.2 | 0.7 | GO:0000939 | condensed chromosome inner kinetochore(GO:0000939) |
| 0.2 | 0.9 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.2 | 2.7 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.2 | 2.2 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
| 0.2 | 1.2 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.2 | 0.8 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.2 | 0.8 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.2 | 4.3 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.2 | 0.6 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.2 | 0.7 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
| 0.2 | 1.5 | GO:0032010 | phagolysosome(GO:0032010) |
| 0.2 | 2.2 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.2 | 0.2 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.2 | 0.5 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.2 | 0.5 | GO:1990876 | cytoplasmic side of nuclear pore(GO:1990876) |
| 0.2 | 1.2 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.2 | 0.5 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.2 | 0.7 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.2 | 1.7 | GO:0097486 | multivesicular body lumen(GO:0097486) |
| 0.2 | 1.5 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.2 | 0.5 | GO:0035354 | Toll-like receptor 1-Toll-like receptor 2 protein complex(GO:0035354) |
| 0.2 | 0.2 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.2 | 0.5 | GO:0000780 | condensed nuclear chromosome, centromeric region(GO:0000780) |
| 0.2 | 3.4 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.2 | 0.5 | GO:0070695 | FHF complex(GO:0070695) |
| 0.2 | 0.3 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.2 | 3.1 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
| 0.2 | 0.5 | GO:0005715 | late recombination nodule(GO:0005715) |
| 0.2 | 1.2 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.2 | 0.9 | GO:0042825 | TAP complex(GO:0042825) |
| 0.1 | 0.6 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.1 | 1.5 | GO:0030897 | HOPS complex(GO:0030897) |
| 0.1 | 0.4 | GO:0031523 | Myb complex(GO:0031523) |
| 0.1 | 1.1 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.1 | 0.8 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
| 0.1 | 1.0 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.1 | 0.3 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
| 0.1 | 0.5 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
| 0.1 | 0.4 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.1 | 0.7 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.1 | 1.8 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.1 | 0.5 | GO:1990031 | pinceau fiber(GO:1990031) |
| 0.1 | 3.0 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.1 | 0.4 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.1 | 0.6 | GO:0030905 | retromer, tubulation complex(GO:0030905) |
| 0.1 | 4.5 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.1 | 0.4 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.1 | 1.0 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.1 | 2.0 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.1 | 3.1 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.1 | 1.0 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
| 0.1 | 1.8 | GO:0033202 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 0.1 | 1.1 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.1 | 1.1 | GO:0032039 | integrator complex(GO:0032039) |
| 0.1 | 0.3 | GO:0002139 | stereocilia coupling link(GO:0002139) |
| 0.1 | 1.6 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.1 | 0.6 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.1 | 0.6 | GO:0032009 | early phagosome(GO:0032009) |
| 0.1 | 0.3 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.1 | 0.5 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.1 | 0.5 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.1 | 1.5 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.1 | 0.6 | GO:0005802 | trans-Golgi network(GO:0005802) |
| 0.1 | 0.3 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
| 0.1 | 0.8 | GO:0032437 | cuticular plate(GO:0032437) |
| 0.1 | 1.0 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.1 | 2.0 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.1 | 1.7 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.1 | 4.2 | GO:0005762 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.1 | 0.7 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.1 | 0.3 | GO:0000438 | core TFIIH complex portion of holo TFIIH complex(GO:0000438) |
| 0.1 | 0.2 | GO:0031213 | RSF complex(GO:0031213) |
| 0.1 | 0.3 | GO:0060076 | excitatory synapse(GO:0060076) |
| 0.1 | 0.7 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
| 0.1 | 2.7 | GO:0051233 | spindle midzone(GO:0051233) |
| 0.1 | 0.4 | GO:0071565 | nBAF complex(GO:0071565) |
| 0.1 | 0.4 | GO:0000799 | nuclear condensin complex(GO:0000799) |
| 0.1 | 0.1 | GO:0031527 | filopodium membrane(GO:0031527) |
| 0.1 | 0.4 | GO:0032044 | DSIF complex(GO:0032044) |
| 0.1 | 1.1 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.1 | 0.4 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
| 0.1 | 3.2 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.1 | 0.6 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
| 0.1 | 1.7 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.1 | 0.5 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.1 | 0.4 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
| 0.1 | 1.0 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.1 | 0.2 | GO:0005674 | transcription factor TFIIF complex(GO:0005674) |
| 0.1 | 0.8 | GO:0016013 | syntrophin complex(GO:0016013) |
| 0.1 | 0.3 | GO:0031045 | dense core granule(GO:0031045) |
| 0.1 | 0.8 | GO:0008091 | spectrin(GO:0008091) |
| 0.1 | 2.3 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.1 | 0.3 | GO:0071159 | NF-kappaB complex(GO:0071159) |
| 0.1 | 0.6 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
| 0.1 | 0.5 | GO:0005811 | lipid particle(GO:0005811) |
| 0.1 | 5.4 | GO:0015030 | Cajal body(GO:0015030) |
| 0.1 | 0.3 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.1 | 0.2 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
| 0.1 | 0.3 | GO:0034455 | t-UTP complex(GO:0034455) |
| 0.1 | 0.3 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
| 0.1 | 0.7 | GO:0031089 | platelet dense granule lumen(GO:0031089) |
| 0.1 | 0.8 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.1 | 0.3 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.1 | 0.5 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.1 | 0.8 | GO:0070187 | telosome(GO:0070187) |
| 0.1 | 0.8 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.1 | 0.5 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.1 | 0.5 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.1 | 0.2 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 0.1 | 0.3 | GO:1990391 | DNA repair complex(GO:1990391) |
| 0.1 | 0.3 | GO:0032144 | 4-aminobutyrate transaminase complex(GO:0032144) |
| 0.1 | 0.4 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.1 | 0.9 | GO:0044327 | dendritic spine head(GO:0044327) |
| 0.1 | 0.6 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.1 | 0.4 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.1 | 0.7 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
| 0.1 | 0.3 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.1 | 3.7 | GO:0016235 | aggresome(GO:0016235) |
| 0.1 | 2.1 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.1 | 2.0 | GO:0005768 | endosome(GO:0005768) |
| 0.1 | 0.5 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.1 | 0.3 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.1 | 0.3 | GO:1990769 | proximal neuron projection(GO:1990769) |
| 0.1 | 0.3 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.1 | 1.0 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.1 | 0.7 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.1 | 0.1 | GO:0098592 | cytoplasmic side of apical plasma membrane(GO:0098592) |
| 0.1 | 0.3 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.1 | 0.3 | GO:0043296 | bicellular tight junction(GO:0005923) apical junction complex(GO:0043296) occluding junction(GO:0070160) |
| 0.1 | 0.4 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.1 | 0.8 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.1 | 0.2 | GO:0070288 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
| 0.1 | 0.9 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.1 | 0.4 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.1 | 0.3 | GO:0045272 | plasma membrane respiratory chain complex I(GO:0045272) |
| 0.1 | 0.2 | GO:1990578 | perinuclear endoplasmic reticulum membrane(GO:1990578) |
| 0.1 | 0.4 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.1 | 0.2 | GO:0034657 | GID complex(GO:0034657) |
| 0.1 | 0.5 | GO:0000782 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
| 0.1 | 0.5 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.1 | 0.4 | GO:0036021 | endolysosome lumen(GO:0036021) |
| 0.1 | 7.2 | GO:0016605 | PML body(GO:0016605) |
| 0.1 | 0.5 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
| 0.1 | 1.4 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.1 | 0.3 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.1 | 0.9 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.1 | 0.2 | GO:1990298 | mitotic checkpoint complex(GO:0033597) bub1-bub3 complex(GO:1990298) |
| 0.1 | 0.2 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.1 | 0.6 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.1 | 0.7 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
| 0.1 | 0.3 | GO:0035370 | UBC13-UEV1A complex(GO:0035370) |
| 0.1 | 3.1 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.1 | 1.9 | GO:0031672 | A band(GO:0031672) |
| 0.1 | 0.8 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
| 0.1 | 0.4 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.1 | 0.2 | GO:0072536 | interleukin-23 receptor complex(GO:0072536) |
| 0.1 | 0.2 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.1 | 0.9 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.1 | 0.5 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.1 | 0.8 | GO:0009925 | basal plasma membrane(GO:0009925) |
| 0.1 | 5.3 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.1 | 1.0 | GO:0000145 | exocyst(GO:0000145) |
| 0.1 | 0.7 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.1 | 0.4 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.1 | 0.2 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.1 | 0.2 | GO:0005819 | spindle(GO:0005819) |
| 0.0 | 0.3 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.0 | 0.2 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.0 | 0.3 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
| 0.0 | 0.9 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.0 | 0.1 | GO:0030906 | retromer, cargo-selective complex(GO:0030906) |
| 0.0 | 0.2 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.0 | 0.3 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.0 | 0.5 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
| 0.0 | 0.1 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) |
| 0.0 | 0.6 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.0 | 0.3 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.0 | 0.3 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.0 | 0.7 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.0 | 0.1 | GO:0016514 | SWI/SNF complex(GO:0016514) |
| 0.0 | 3.0 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.0 | 0.9 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.0 | 0.1 | GO:0005687 | U4 snRNP(GO:0005687) |
| 0.0 | 1.0 | GO:0005794 | Golgi apparatus(GO:0005794) |
| 0.0 | 0.2 | GO:0098843 | postsynaptic endocytic zone(GO:0098843) |
| 0.0 | 0.2 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.0 | 0.2 | GO:1990393 | 3M complex(GO:1990393) |
| 0.0 | 0.5 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.0 | 0.3 | GO:0045179 | apical cortex(GO:0045179) |
| 0.0 | 0.2 | GO:0031905 | early endosome lumen(GO:0031905) |
| 0.0 | 0.4 | GO:0035859 | Seh1-associated complex(GO:0035859) |
| 0.0 | 0.9 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.0 | 0.4 | GO:0005587 | collagen type IV trimer(GO:0005587) |
| 0.0 | 0.2 | GO:1990357 | terminal web(GO:1990357) |
| 0.0 | 0.3 | GO:0033063 | DNA recombinase mediator complex(GO:0033061) Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.0 | 1.4 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.0 | 0.6 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.9 | GO:0070822 | Sin3-type complex(GO:0070822) |
| 0.0 | 1.3 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.0 | 0.1 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
| 0.0 | 0.8 | GO:0032420 | stereocilium(GO:0032420) |
| 0.0 | 0.2 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.0 | 0.0 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.0 | 0.1 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.0 | 0.4 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.0 | 0.1 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.0 | 0.2 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.0 | 8.1 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
| 0.0 | 0.5 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 0.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.0 | 0.2 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 0.0 | 0.7 | GO:0072686 | mitotic spindle(GO:0072686) |
| 0.0 | 0.4 | GO:0044447 | axoneme part(GO:0044447) |
| 0.0 | 0.2 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.0 | 0.2 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.0 | 0.9 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.0 | 0.3 | GO:0098559 | cytoplasmic side of early endosome membrane(GO:0098559) |
| 0.0 | 0.2 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.0 | 0.2 | GO:0033270 | paranode region of axon(GO:0033270) |
| 0.0 | 0.1 | GO:0030895 | apolipoprotein B mRNA editing enzyme complex(GO:0030895) |
| 0.0 | 3.2 | GO:0035578 | azurophil granule lumen(GO:0035578) |
| 0.0 | 1.3 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 0.0 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.0 | 1.5 | GO:0000794 | condensed nuclear chromosome(GO:0000794) |
| 0.0 | 0.4 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.0 | 0.3 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.0 | 0.1 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
| 0.0 | 1.0 | GO:0005902 | microvillus(GO:0005902) |
| 0.0 | 1.7 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
| 0.0 | 0.2 | GO:1990037 | Lewy body core(GO:1990037) |
| 0.0 | 0.2 | GO:0035976 | AP1 complex(GO:0035976) |
| 0.0 | 0.2 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
| 0.0 | 0.1 | GO:0038038 | G-protein coupled receptor homodimeric complex(GO:0038038) |
| 0.0 | 1.1 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.0 | 0.1 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.0 | 0.3 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.0 | 1.2 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.0 | 0.2 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.0 | 2.0 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.0 | 0.9 | GO:0000781 | chromosome, telomeric region(GO:0000781) |
| 0.0 | 1.0 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.0 | 0.1 | GO:0030891 | VCB complex(GO:0030891) |
| 0.0 | 0.3 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.0 | 8.4 | GO:0031965 | nuclear membrane(GO:0031965) |
| 0.0 | 0.3 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.0 | 1.0 | GO:0035579 | specific granule membrane(GO:0035579) |
| 0.0 | 1.9 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
| 0.0 | 0.3 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.0 | 0.2 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.0 | 0.1 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.0 | 0.1 | GO:0010369 | chromocenter(GO:0010369) |
| 0.0 | 7.8 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
| 0.0 | 0.4 | GO:0031674 | I band(GO:0031674) |
| 0.0 | 0.4 | GO:0001726 | ruffle(GO:0001726) |
| 0.0 | 0.1 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.0 | 0.2 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.0 | 0.3 | GO:0002102 | podosome(GO:0002102) |
| 0.0 | 2.6 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.0 | 0.1 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.0 | 0.2 | GO:0001669 | acrosomal vesicle(GO:0001669) |
| 0.0 | 0.9 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.0 | 0.4 | GO:0101002 | ficolin-1-rich granule(GO:0101002) ficolin-1-rich granule lumen(GO:1904813) |
| 0.0 | 0.5 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.0 | 0.1 | GO:0061695 | transferase complex, transferring phosphorus-containing groups(GO:0061695) |
| 0.0 | 0.1 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.0 | 0.4 | GO:0044298 | neuronal cell body membrane(GO:0032809) cell body membrane(GO:0044298) |
| 0.0 | 0.1 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| 0.0 | 0.2 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.0 | 0.6 | GO:0000786 | nucleosome(GO:0000786) |
| 0.0 | 0.0 | GO:0044306 | neuron projection terminus(GO:0044306) |
| 0.0 | 0.0 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.0 | 0.3 | GO:0036038 | MKS complex(GO:0036038) |
| 0.0 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.0 | 1.2 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
| 0.0 | 3.6 | GO:0000790 | nuclear chromatin(GO:0000790) |
| 0.0 | 0.1 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
| 0.0 | 0.2 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.0 | 0.2 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.0 | 0.5 | GO:0030684 | preribosome(GO:0030684) |
| 0.0 | 0.1 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.0 | 0.3 | GO:0033268 | node of Ranvier(GO:0033268) |
| 0.0 | 0.7 | GO:0005814 | centriole(GO:0005814) |
| 0.0 | 0.1 | GO:0031515 | tRNA (m1A) methyltransferase complex(GO:0031515) |
| 0.0 | 0.1 | GO:0031415 | NatA complex(GO:0031415) |
| 0.0 | 0.1 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.0 | 0.3 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.0 | 0.3 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
| 0.0 | 0.1 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.0 | 0.0 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.0 | 0.8 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 0.8 | GO:0016328 | lateral plasma membrane(GO:0016328) |
| 0.0 | 0.2 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.0 | 0.4 | GO:0000793 | condensed chromosome(GO:0000793) |
| 0.0 | 0.3 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.0 | 0.1 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.0 | 1.6 | GO:0072562 | blood microparticle(GO:0072562) |
| 0.0 | 0.1 | GO:0005871 | kinesin complex(GO:0005871) |
| 0.0 | 3.0 | GO:0009897 | external side of plasma membrane(GO:0009897) |
| 0.0 | 0.2 | GO:0031105 | septin complex(GO:0031105) |
| 0.0 | 0.1 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.0 | 0.0 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.0 | 0.8 | GO:0015935 | small ribosomal subunit(GO:0015935) |
| 0.0 | 0.9 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.0 | 0.1 | GO:0034709 | methylosome(GO:0034709) |
| 0.0 | 0.1 | GO:1902560 | GMP reductase complex(GO:1902560) |
| 0.0 | 0.1 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.0 | 0.4 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.0 | 0.1 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.0 | 0.7 | GO:0043204 | perikaryon(GO:0043204) |
| 0.0 | 0.1 | GO:0030663 | COPI-coated vesicle membrane(GO:0030663) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 1.2 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.5 | 1.4 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.3 | 0.3 | PID MYC PATHWAY | C-MYC pathway |
| 0.3 | 0.3 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.3 | 14.0 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.3 | 6.1 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.3 | 1.0 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.2 | 4.2 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.2 | 3.0 | ST STAT3 PATHWAY | STAT3 Pathway |
| 0.2 | 0.4 | PID S1P S1P2 PATHWAY | S1P2 pathway |
| 0.2 | 2.2 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
| 0.2 | 6.9 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.1 | 9.3 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
| 0.1 | 8.8 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.1 | 0.5 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.1 | 6.0 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
| 0.1 | 2.0 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.1 | 5.7 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.1 | 0.6 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.1 | 0.3 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.1 | 6.5 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.1 | 1.3 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.1 | 0.8 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.1 | 2.4 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.1 | 4.3 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
| 0.1 | 3.1 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.1 | 6.9 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.1 | 5.1 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.1 | 3.1 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.1 | 5.3 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| 0.1 | 3.4 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.1 | 2.5 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.1 | 0.8 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.1 | 0.8 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.1 | 0.3 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.1 | 2.1 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.1 | 0.8 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
| 0.1 | 0.2 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.1 | 1.0 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.1 | 0.6 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.1 | 1.7 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.1 | 2.9 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.1 | 1.0 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
| 0.1 | 0.3 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.1 | 2.4 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.1 | 1.3 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.1 | 0.1 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.1 | 1.7 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.1 | 0.9 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.0 | 0.2 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.0 | 2.5 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.0 | 0.9 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.0 | 0.4 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
| 0.0 | 2.7 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.0 | 0.8 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.0 | 3.1 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.0 | 0.5 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.0 | 1.6 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.0 | 2.4 | PID BMP PATHWAY | BMP receptor signaling |
| 0.0 | 1.9 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.0 | 0.8 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 0.2 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.0 | 0.2 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.0 | 0.3 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.0 | 0.2 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 0.5 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.0 | 0.2 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.0 | 3.1 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 1.4 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 0.5 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.0 | 0.3 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.0 | 1.0 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.0 | 0.8 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.0 | 0.2 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.0 | 2.9 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.0 | 0.2 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.0 | 1.0 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.0 | 1.0 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.0 | 0.4 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 0.2 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.0 | 0.9 | PID SHP2 PATHWAY | SHP2 signaling |
| 0.0 | 0.1 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.0 | 0.4 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.0 | 0.0 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.0 | 1.0 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.0 | 0.2 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
| 0.0 | 0.5 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
| 0.0 | 0.5 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 0.0 | 0.1 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.0 | 0.2 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.0 | 0.3 | PID FOXO PATHWAY | FoxO family signaling |
| 0.0 | 0.1 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
| 0.0 | 0.1 | ST ADRENERGIC | Adrenergic Pathway |
| 0.0 | 0.1 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 0.5 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |