ENCODE cell lines, expression (Ernst 2011)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
SIN3A
|
ENSG00000169375.11 | SIN3A |
|
CHD1
|
ENSG00000153922.6 | CHD1 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| CHD1 | hg19_v2_chr5_-_98262240_98262240 | 0.80 | 1.9e-04 | Click! |
| SIN3A | hg19_v2_chr15_-_75743991_75744011 | 0.60 | 1.3e-02 | Click! |
| Promoter | Score | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr20_+_57466629 | 6.32 |
ENST00000371081.1 ENST00000338783.6 |
GNAS |
GNAS complex locus |
| chr16_-_58231782 | 4.64 |
ENST00000565188.1 ENST00000262506.3 |
CSNK2A2 |
casein kinase 2, alpha prime polypeptide |
| chr9_-_92112953 | 4.17 |
ENST00000339861.4 ENST00000422704.2 ENST00000455551.2 |
SEMA4D |
sema domain, immunoglobulin domain (Ig), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 4D |
| chr16_-_89007491 | 4.09 |
ENST00000327483.5 ENST00000564416.1 |
CBFA2T3 |
core-binding factor, runt domain, alpha subunit 2; translocated to, 3 |
| chr18_+_55102917 | 4.05 |
ENST00000491143.2 |
ONECUT2 |
one cut homeobox 2 |
| chr11_-_46142948 | 3.87 |
ENST00000257821.4 |
PHF21A |
PHD finger protein 21A |
| chr16_+_23847267 | 3.84 |
ENST00000321728.7 |
PRKCB |
protein kinase C, beta |
| chr15_-_45480153 | 3.74 |
ENST00000560471.1 ENST00000560540.1 |
SHF |
Src homology 2 domain containing F |
| chr3_+_157823609 | 3.73 |
ENST00000480820.1 |
RSRC1 |
arginine/serine-rich coiled-coil 1 |
| chr11_-_33891362 | 3.68 |
ENST00000395833.3 |
LMO2 |
LIM domain only 2 (rhombotin-like 1) |
| chr9_+_137218362 | 3.66 |
ENST00000481739.1 |
RXRA |
retinoid X receptor, alpha |
| chr1_+_27022839 | 3.07 |
ENST00000457599.2 |
ARID1A |
AT rich interactive domain 1A (SWI-like) |
| chr8_-_57123815 | 3.05 |
ENST00000316981.3 ENST00000423799.2 ENST00000429357.2 |
PLAG1 |
pleiomorphic adenoma gene 1 |
| chr8_+_61591337 | 3.01 |
ENST00000423902.2 |
CHD7 |
chromodomain helicase DNA binding protein 7 |
| chr16_+_23847339 | 3.00 |
ENST00000303531.7 |
PRKCB |
protein kinase C, beta |
| chr11_-_67888671 | 2.93 |
ENST00000265689.4 |
CHKA |
choline kinase alpha |
| chr8_+_56014949 | 2.83 |
ENST00000327381.6 |
XKR4 |
XK, Kell blood group complex subunit-related family, member 4 |
| chr6_-_29595779 | 2.68 |
ENST00000355973.3 ENST00000377012.4 |
GABBR1 |
gamma-aminobutyric acid (GABA) B receptor, 1 |
| chr19_+_30302805 | 2.66 |
ENST00000262643.3 ENST00000575243.1 ENST00000357943.5 |
CCNE1 |
cyclin E1 |
| chr1_-_32403370 | 2.57 |
ENST00000534796.1 |
PTP4A2 |
protein tyrosine phosphatase type IVA, member 2 |
| chr15_-_61521495 | 2.56 |
ENST00000335670.6 |
RORA |
RAR-related orphan receptor A |
| chr19_+_35759824 | 2.55 |
ENST00000343550.5 |
USF2 |
upstream transcription factor 2, c-fos interacting |
| chr5_-_94620239 | 2.54 |
ENST00000515393.1 |
MCTP1 |
multiple C2 domains, transmembrane 1 |
| chr8_-_101322132 | 2.52 |
ENST00000523481.1 |
RNF19A |
ring finger protein 19A, RBR E3 ubiquitin protein ligase |
| chr10_+_22610124 | 2.48 |
ENST00000376663.3 |
BMI1 |
BMI1 polycomb ring finger oncogene |
| chr11_-_93276582 | 2.45 |
ENST00000298966.2 |
SMCO4 |
single-pass membrane protein with coiled-coil domains 4 |
| chr18_-_60987220 | 2.42 |
ENST00000398117.1 |
BCL2 |
B-cell CLL/lymphoma 2 |
| chr17_+_36861735 | 2.35 |
ENST00000378137.5 ENST00000325718.7 |
MLLT6 |
myeloid/lymphoid or mixed-lineage leukemia (trithorax homolog, Drosophila); translocated to, 6 |
| chr1_-_32801825 | 2.34 |
ENST00000329421.7 |
MARCKSL1 |
MARCKS-like 1 |
| chr2_-_61697862 | 2.33 |
ENST00000398571.2 |
USP34 |
ubiquitin specific peptidase 34 |
| chr12_+_7023735 | 2.28 |
ENST00000538763.1 ENST00000544774.1 ENST00000545045.2 |
ENO2 |
enolase 2 (gamma, neuronal) |
| chr16_+_29817841 | 2.25 |
ENST00000322945.6 ENST00000562337.1 ENST00000566906.2 ENST00000563402.1 ENST00000219782.6 |
MAZ |
MYC-associated zinc finger protein (purine-binding transcription factor) |
| chr20_+_19193269 | 2.25 |
ENST00000328041.6 |
SLC24A3 |
solute carrier family 24 (sodium/potassium/calcium exchanger), member 3 |
| chrX_+_131157290 | 2.24 |
ENST00000394334.2 |
MST4 |
Serine/threonine-protein kinase MST4 |
| chrX_+_131157322 | 2.20 |
ENST00000481105.1 ENST00000354719.6 ENST00000394335.2 |
MST4 |
Serine/threonine-protein kinase MST4 |
| chr8_+_126442563 | 2.20 |
ENST00000311922.3 |
TRIB1 |
tribbles pseudokinase 1 |
| chr9_-_120177216 | 2.18 |
ENST00000373996.3 ENST00000313400.4 ENST00000361477.3 |
ASTN2 |
astrotactin 2 |
| chr8_-_80680078 | 2.18 |
ENST00000337919.5 ENST00000354724.3 |
HEY1 |
hes-related family bHLH transcription factor with YRPW motif 1 |
| chr2_-_172017343 | 2.17 |
ENST00000431350.2 ENST00000360843.3 |
TLK1 |
tousled-like kinase 1 |
| chr11_-_67888881 | 2.15 |
ENST00000356135.5 |
CHKA |
choline kinase alpha |
| chr7_+_26331541 | 2.15 |
ENST00000416246.1 ENST00000338523.4 ENST00000412416.1 |
SNX10 |
sorting nexin 10 |
| chr16_+_29817399 | 2.14 |
ENST00000545521.1 |
MAZ |
MYC-associated zinc finger protein (purine-binding transcription factor) |
| chr1_+_27022485 | 2.14 |
ENST00000324856.7 |
ARID1A |
AT rich interactive domain 1A (SWI-like) |
| chr2_+_105471969 | 2.13 |
ENST00000361360.2 |
POU3F3 |
POU class 3 homeobox 3 |
| chr13_-_77900814 | 2.12 |
ENST00000544440.2 |
MYCBP2 |
MYC binding protein 2, E3 ubiquitin protein ligase |
| chr6_-_31864977 | 2.10 |
ENST00000395728.3 ENST00000375528.4 |
EHMT2 |
euchromatic histone-lysine N-methyltransferase 2 |
| chr6_+_12012536 | 2.09 |
ENST00000379388.2 |
HIVEP1 |
human immunodeficiency virus type I enhancer binding protein 1 |
| chr14_+_60716159 | 2.06 |
ENST00000325658.3 |
PPM1A |
protein phosphatase, Mg2+/Mn2+ dependent, 1A |
| chr9_-_132805430 | 2.04 |
ENST00000446176.2 ENST00000355681.3 ENST00000420781.1 |
FNBP1 |
formin binding protein 1 |
| chr16_+_2039946 | 2.03 |
ENST00000248121.2 ENST00000568896.1 |
SYNGR3 |
synaptogyrin 3 |
| chr1_-_25256368 | 2.02 |
ENST00000308873.6 |
RUNX3 |
runt-related transcription factor 3 |
| chr4_-_105416039 | 2.01 |
ENST00000394767.2 |
CXXC4 |
CXXC finger protein 4 |
| chr6_-_34664612 | 2.01 |
ENST00000374023.3 ENST00000374026.3 |
C6orf106 |
chromosome 6 open reading frame 106 |
| chr4_-_74124502 | 2.00 |
ENST00000358602.4 ENST00000330838.6 ENST00000561029.1 |
ANKRD17 |
ankyrin repeat domain 17 |
| chr6_-_99797522 | 2.00 |
ENST00000389677.5 |
FAXC |
failed axon connections homolog (Drosophila) |
| chr5_-_88178964 | 1.98 |
ENST00000513252.1 ENST00000508569.1 ENST00000510942.1 ENST00000506554.1 |
MEF2C |
myocyte enhancer factor 2C |
| chr6_-_79787902 | 1.97 |
ENST00000275034.4 |
PHIP |
pleckstrin homology domain interacting protein |
| chr2_-_174828892 | 1.96 |
ENST00000418194.2 |
SP3 |
Sp3 transcription factor |
| chr8_+_86089619 | 1.96 |
ENST00000256117.5 ENST00000416274.2 |
E2F5 |
E2F transcription factor 5, p130-binding |
| chr7_+_138145145 | 1.96 |
ENST00000415680.2 |
TRIM24 |
tripartite motif containing 24 |
| chr6_-_90121938 | 1.95 |
ENST00000369415.4 |
RRAGD |
Ras-related GTP binding D |
| chr13_-_31039375 | 1.93 |
ENST00000399494.1 |
HMGB1 |
high mobility group box 1 |
| chr17_-_38721711 | 1.92 |
ENST00000578085.1 ENST00000246657.2 |
CCR7 |
chemokine (C-C motif) receptor 7 |
| chr1_-_151431647 | 1.91 |
ENST00000368863.2 ENST00000409503.1 ENST00000491586.1 ENST00000533351.1 ENST00000540984.1 |
POGZ |
pogo transposable element with ZNF domain |
| chr8_+_86089460 | 1.90 |
ENST00000418930.2 |
E2F5 |
E2F transcription factor 5, p130-binding |
| chr17_+_76164639 | 1.89 |
ENST00000225777.3 ENST00000585591.1 ENST00000589711.1 ENST00000588282.1 ENST00000589168.1 |
SYNGR2 |
synaptogyrin 2 |
| chr14_+_101193164 | 1.88 |
ENST00000341267.4 |
DLK1 |
delta-like 1 homolog (Drosophila) |
| chr10_+_12391481 | 1.88 |
ENST00000378847.3 |
CAMK1D |
calcium/calmodulin-dependent protein kinase ID |
| chrX_+_198129 | 1.88 |
ENST00000381663.3 |
PLCXD1 |
phosphatidylinositol-specific phospholipase C, X domain containing 1 |
| chr14_+_101193246 | 1.87 |
ENST00000331224.6 |
DLK1 |
delta-like 1 homolog (Drosophila) |
| chr7_-_139876812 | 1.86 |
ENST00000397560.2 |
JHDM1D |
lysine (K)-specific demethylase 7A |
| chr2_-_64371546 | 1.85 |
ENST00000358912.4 |
PELI1 |
pellino E3 ubiquitin protein ligase 1 |
| chr14_-_21566731 | 1.82 |
ENST00000360947.3 |
ZNF219 |
zinc finger protein 219 |
| chr22_-_43583079 | 1.82 |
ENST00000216129.6 |
TTLL12 |
tubulin tyrosine ligase-like family, member 12 |
| chr14_+_103243813 | 1.80 |
ENST00000560371.1 ENST00000347662.4 ENST00000392745.2 ENST00000539721.1 ENST00000560463.1 |
TRAF3 |
TNF receptor-associated factor 3 |
| chr19_+_35759968 | 1.80 |
ENST00000222305.3 ENST00000595068.1 ENST00000379134.3 ENST00000594064.1 ENST00000598058.1 |
USF2 |
upstream transcription factor 2, c-fos interacting |
| chr1_+_211432593 | 1.79 |
ENST00000367006.4 |
RCOR3 |
REST corepressor 3 |
| chr16_-_52580920 | 1.79 |
ENST00000219746.9 |
TOX3 |
TOX high mobility group box family member 3 |
| chr3_-_157823839 | 1.79 |
ENST00000425436.3 ENST00000389589.4 ENST00000441443.2 |
SHOX2 |
short stature homeobox 2 |
| chr16_+_87636474 | 1.77 |
ENST00000284262.2 |
JPH3 |
junctophilin 3 |
| chr17_-_60142609 | 1.77 |
ENST00000397786.2 |
MED13 |
mediator complex subunit 13 |
| chr14_+_102228123 | 1.77 |
ENST00000422945.2 ENST00000554442.1 ENST00000556260.2 ENST00000328724.5 ENST00000557268.1 |
PPP2R5C |
protein phosphatase 2, regulatory subunit B', gamma |
| chr16_-_70472946 | 1.75 |
ENST00000342907.2 |
ST3GAL2 |
ST3 beta-galactoside alpha-2,3-sialyltransferase 2 |
| chr16_+_28943260 | 1.73 |
ENST00000538922.1 ENST00000324662.3 ENST00000567541.1 |
CD19 |
CD19 molecule |
| chr5_-_88179302 | 1.71 |
ENST00000504921.2 |
MEF2C |
myocyte enhancer factor 2C |
| chr6_-_13711773 | 1.71 |
ENST00000011619.3 |
RANBP9 |
RAN binding protein 9 |
| chr16_+_50187556 | 1.69 |
ENST00000561678.1 ENST00000357464.3 |
PAPD5 |
PAP associated domain containing 5 |
| chr12_+_7023491 | 1.69 |
ENST00000541477.1 ENST00000229277.1 |
ENO2 |
enolase 2 (gamma, neuronal) |
| chr19_-_46476791 | 1.68 |
ENST00000263257.5 |
NOVA2 |
neuro-oncological ventral antigen 2 |
| chr19_+_42746927 | 1.68 |
ENST00000378108.1 |
AC006486.1 |
AC006486.1 |
| chr8_-_22550815 | 1.64 |
ENST00000317216.2 |
EGR3 |
early growth response 3 |
| chr3_-_196159268 | 1.62 |
ENST00000381887.3 ENST00000535858.1 ENST00000428095.1 ENST00000296328.4 |
UBXN7 |
UBX domain protein 7 |
| chr13_+_111767650 | 1.62 |
ENST00000449979.1 ENST00000370623.3 |
ARHGEF7 |
Rho guanine nucleotide exchange factor (GEF) 7 |
| chr9_+_100745615 | 1.62 |
ENST00000339399.4 |
ANP32B |
acidic (leucine-rich) nuclear phosphoprotein 32 family, member B |
| chr12_-_63328817 | 1.60 |
ENST00000228705.6 |
PPM1H |
protein phosphatase, Mg2+/Mn2+ dependent, 1H |
| chr1_+_167190066 | 1.59 |
ENST00000367866.2 ENST00000429375.2 ENST00000452019.1 ENST00000420254.3 ENST00000541643.3 |
POU2F1 |
POU class 2 homeobox 1 |
| chr7_+_138145076 | 1.59 |
ENST00000343526.4 |
TRIM24 |
tripartite motif containing 24 |
| chr6_+_6588902 | 1.59 |
ENST00000230568.4 |
LY86 |
lymphocyte antigen 86 |
| chr16_+_68119247 | 1.58 |
ENST00000575270.1 |
NFATC3 |
nuclear factor of activated T-cells, cytoplasmic, calcineurin-dependent 3 |
| chr9_-_120177342 | 1.57 |
ENST00000361209.2 |
ASTN2 |
astrotactin 2 |
| chr16_+_29818857 | 1.57 |
ENST00000567444.1 |
MAZ |
MYC-associated zinc finger protein (purine-binding transcription factor) |
| chr10_+_72164135 | 1.57 |
ENST00000373218.4 |
EIF4EBP2 |
eukaryotic translation initiation factor 4E binding protein 2 |
| chrX_+_23352133 | 1.56 |
ENST00000379361.4 |
PTCHD1 |
patched domain containing 1 |
| chr10_+_28822236 | 1.55 |
ENST00000347934.4 ENST00000354911.4 |
WAC |
WW domain containing adaptor with coiled-coil |
| chr2_-_172017393 | 1.55 |
ENST00000442919.2 |
TLK1 |
tousled-like kinase 1 |
| chr19_-_49576198 | 1.55 |
ENST00000221444.1 |
KCNA7 |
potassium voltage-gated channel, shaker-related subfamily, member 7 |
| chr12_-_117537240 | 1.54 |
ENST00000392545.4 ENST00000541210.1 ENST00000335209.7 |
TESC |
tescalcin |
| chr3_+_14989186 | 1.54 |
ENST00000435454.1 ENST00000323373.6 |
NR2C2 |
nuclear receptor subfamily 2, group C, member 2 |
| chr17_+_65821780 | 1.54 |
ENST00000321892.4 ENST00000335221.5 ENST00000306378.6 |
BPTF |
bromodomain PHD finger transcription factor |
| chr5_+_110559784 | 1.53 |
ENST00000282356.4 |
CAMK4 |
calcium/calmodulin-dependent protein kinase IV |
| chr14_+_33408449 | 1.52 |
ENST00000346562.2 ENST00000341321.4 ENST00000548645.1 ENST00000356141.4 ENST00000357798.5 |
NPAS3 |
neuronal PAS domain protein 3 |
| chr1_-_54872059 | 1.51 |
ENST00000371320.3 |
SSBP3 |
single stranded DNA binding protein 3 |
| chr17_-_76124711 | 1.51 |
ENST00000306591.7 ENST00000590602.1 |
TMC6 |
transmembrane channel-like 6 |
| chr9_+_130547958 | 1.51 |
ENST00000421939.1 ENST00000373265.2 |
CDK9 |
cyclin-dependent kinase 9 |
| chr9_-_124991124 | 1.50 |
ENST00000394319.4 ENST00000340587.3 |
LHX6 |
LIM homeobox 6 |
| chr2_+_85198216 | 1.50 |
ENST00000456682.1 ENST00000409785.4 |
KCMF1 |
potassium channel modulatory factor 1 |
| chr1_-_200992827 | 1.49 |
ENST00000332129.2 ENST00000422435.2 |
KIF21B |
kinesin family member 21B |
| chr19_+_589893 | 1.49 |
ENST00000251287.2 |
HCN2 |
hyperpolarization activated cyclic nucleotide-gated potassium channel 2 |
| chr5_-_88179017 | 1.48 |
ENST00000514028.1 ENST00000514015.1 ENST00000503075.1 ENST00000437473.2 |
MEF2C |
myocyte enhancer factor 2C |
| chr10_+_28821674 | 1.48 |
ENST00000526722.1 ENST00000375646.1 |
WAC |
WW domain containing adaptor with coiled-coil |
| chr12_+_66218598 | 1.48 |
ENST00000541363.1 |
HMGA2 |
high mobility group AT-hook 2 |
| chr5_+_126112794 | 1.48 |
ENST00000261366.5 ENST00000395354.1 |
LMNB1 |
lamin B1 |
| chr10_+_28822636 | 1.47 |
ENST00000442148.1 ENST00000448193.1 |
WAC |
WW domain containing adaptor with coiled-coil |
| chr22_-_31741757 | 1.47 |
ENST00000215919.3 |
PATZ1 |
POZ (BTB) and AT hook containing zinc finger 1 |
| chr6_-_43337180 | 1.46 |
ENST00000318149.3 ENST00000361428.2 |
ZNF318 |
zinc finger protein 318 |
| chr17_+_5185552 | 1.46 |
ENST00000262477.6 ENST00000408982.2 ENST00000575991.1 ENST00000537505.1 ENST00000546142.2 |
RABEP1 |
rabaptin, RAB GTPase binding effector protein 1 |
| chr10_-_23003460 | 1.45 |
ENST00000376573.4 |
PIP4K2A |
phosphatidylinositol-5-phosphate 4-kinase, type II, alpha |
| chr1_-_32403903 | 1.43 |
ENST00000344035.6 ENST00000356536.3 |
PTP4A2 |
protein tyrosine phosphatase type IVA, member 2 |
| chr12_+_94542459 | 1.43 |
ENST00000258526.4 |
PLXNC1 |
plexin C1 |
| chr17_+_30813576 | 1.43 |
ENST00000313401.3 |
CDK5R1 |
cyclin-dependent kinase 5, regulatory subunit 1 (p35) |
| chr1_+_11751748 | 1.42 |
ENST00000294485.5 |
DRAXIN |
dorsal inhibitory axon guidance protein |
| chr15_-_50647274 | 1.42 |
ENST00000543881.1 |
GABPB1 |
GA binding protein transcription factor, beta subunit 1 |
| chr7_-_150864635 | 1.42 |
ENST00000297537.4 |
GBX1 |
gastrulation brain homeobox 1 |
| chr13_-_77901177 | 1.42 |
ENST00000407578.2 ENST00000357337.6 ENST00000360084.5 |
MYCBP2 |
MYC binding protein 2, E3 ubiquitin protein ligase |
| chr17_+_7155343 | 1.41 |
ENST00000573513.1 ENST00000354429.2 ENST00000574255.1 ENST00000396627.2 ENST00000356683.2 |
ELP5 |
elongator acetyltransferase complex subunit 5 |
| chr2_+_234263120 | 1.41 |
ENST00000264057.2 ENST00000427930.1 |
DGKD |
diacylglycerol kinase, delta 130kDa |
| chr14_+_61788429 | 1.41 |
ENST00000332981.5 |
PRKCH |
protein kinase C, eta |
| chr7_-_140178726 | 1.40 |
ENST00000480552.1 |
MKRN1 |
makorin ring finger protein 1 |
| chr7_-_148581251 | 1.40 |
ENST00000478654.1 ENST00000460911.1 ENST00000350995.2 |
EZH2 |
enhancer of zeste homolog 2 (Drosophila) |
| chr10_+_28822417 | 1.40 |
ENST00000428935.1 ENST00000420266.1 |
WAC |
WW domain containing adaptor with coiled-coil |
| chr1_+_211433275 | 1.40 |
ENST00000367005.4 |
RCOR3 |
REST corepressor 3 |
| chr2_+_176972000 | 1.39 |
ENST00000249504.5 |
HOXD11 |
homeobox D11 |
| chr9_+_126773880 | 1.39 |
ENST00000373615.4 |
LHX2 |
LIM homeobox 2 |
| chr2_-_200322723 | 1.39 |
ENST00000417098.1 |
SATB2 |
SATB homeobox 2 |
| chr17_-_76124812 | 1.38 |
ENST00000592063.1 ENST00000589271.1 ENST00000322933.4 ENST00000589553.1 |
TMC6 |
transmembrane channel-like 6 |
| chr12_-_121342170 | 1.37 |
ENST00000353487.2 |
SPPL3 |
signal peptide peptidase like 3 |
| chr15_+_85525205 | 1.36 |
ENST00000394553.1 ENST00000339708.5 |
PDE8A |
phosphodiesterase 8A |
| chr19_+_1285890 | 1.36 |
ENST00000344663.3 |
MUM1 |
melanoma associated antigen (mutated) 1 |
| chr20_+_35974532 | 1.36 |
ENST00000373578.2 |
SRC |
v-src avian sarcoma (Schmidt-Ruppin A-2) viral oncogene homolog |
| chr13_-_41635512 | 1.35 |
ENST00000405737.2 |
ELF1 |
E74-like factor 1 (ets domain transcription factor) |
| chr6_+_161412759 | 1.34 |
ENST00000366919.2 ENST00000392142.4 ENST00000366920.2 ENST00000348824.7 |
MAP3K4 |
mitogen-activated protein kinase kinase kinase 4 |
| chr5_+_102594403 | 1.34 |
ENST00000319933.2 |
C5orf30 |
chromosome 5 open reading frame 30 |
| chr9_-_6645628 | 1.34 |
ENST00000321612.6 |
GLDC |
glycine dehydrogenase (decarboxylating) |
| chr8_-_103136481 | 1.34 |
ENST00000524209.1 ENST00000517822.1 ENST00000523923.1 ENST00000521599.1 ENST00000521964.1 ENST00000311028.3 ENST00000518166.1 |
NCALD |
neurocalcin delta |
| chr20_-_60640866 | 1.33 |
ENST00000252996.4 |
TAF4 |
TAF4 RNA polymerase II, TATA box binding protein (TBP)-associated factor, 135kDa |
| chr3_-_47205457 | 1.33 |
ENST00000409792.3 |
SETD2 |
SET domain containing 2 |
| chr6_-_90121789 | 1.32 |
ENST00000359203.3 |
RRAGD |
Ras-related GTP binding D |
| chr1_-_114355083 | 1.32 |
ENST00000261441.5 |
RSBN1 |
round spermatid basic protein 1 |
| chr5_+_127419449 | 1.32 |
ENST00000262461.2 ENST00000343225.4 |
SLC12A2 |
solute carrier family 12 (sodium/potassium/chloride transporter), member 2 |
| chr8_-_72756667 | 1.32 |
ENST00000325509.4 |
MSC |
musculin |
| chr19_+_10982336 | 1.31 |
ENST00000344150.4 |
CARM1 |
coactivator-associated arginine methyltransferase 1 |
| chr10_+_21823079 | 1.31 |
ENST00000377100.3 ENST00000377072.3 ENST00000446906.2 |
MLLT10 |
myeloid/lymphoid or mixed-lineage leukemia (trithorax homolog, Drosophila); translocated to, 10 |
| chr22_+_39853258 | 1.30 |
ENST00000341184.6 |
MGAT3 |
mannosyl (beta-1,4-)-glycoprotein beta-1,4-N-acetylglucosaminyltransferase |
| chr5_-_78809950 | 1.30 |
ENST00000334082.6 |
HOMER1 |
homer homolog 1 (Drosophila) |
| chr11_+_48002076 | 1.30 |
ENST00000418331.2 ENST00000440289.2 |
PTPRJ |
protein tyrosine phosphatase, receptor type, J |
| chr17_+_65821636 | 1.29 |
ENST00000544778.2 |
BPTF |
bromodomain PHD finger transcription factor |
| chr2_+_191513959 | 1.29 |
ENST00000337386.5 ENST00000357215.5 |
NAB1 |
NGFI-A binding protein 1 (EGR1 binding protein 1) |
| chr11_+_118307179 | 1.29 |
ENST00000534358.1 ENST00000531904.2 ENST00000389506.5 ENST00000354520.4 |
KMT2A |
lysine (K)-specific methyltransferase 2A |
| chr6_+_14117872 | 1.29 |
ENST00000379153.3 |
CD83 |
CD83 molecule |
| chr6_-_32157947 | 1.28 |
ENST00000375050.4 |
PBX2 |
pre-B-cell leukemia homeobox 2 |
| chr20_-_4804244 | 1.27 |
ENST00000379400.3 |
RASSF2 |
Ras association (RalGDS/AF-6) domain family member 2 |
| chr15_-_60884706 | 1.27 |
ENST00000449337.2 |
RORA |
RAR-related orphan receptor A |
| chr8_-_133493200 | 1.26 |
ENST00000388996.4 |
KCNQ3 |
potassium voltage-gated channel, KQT-like subfamily, member 3 |
| chr10_+_76585303 | 1.26 |
ENST00000372725.1 |
KAT6B |
K(lysine) acetyltransferase 6B |
| chr1_+_116915855 | 1.26 |
ENST00000295598.5 |
ATP1A1 |
ATPase, Na+/K+ transporting, alpha 1 polypeptide |
| chr7_-_148581360 | 1.25 |
ENST00000320356.2 ENST00000541220.1 ENST00000483967.1 ENST00000536783.1 |
EZH2 |
enhancer of zeste homolog 2 (Drosophila) |
| chr4_-_109090106 | 1.25 |
ENST00000379951.2 |
LEF1 |
lymphoid enhancer-binding factor 1 |
| chr4_+_3768075 | 1.25 |
ENST00000509482.1 ENST00000330055.5 |
ADRA2C |
adrenoceptor alpha 2C |
| chr15_-_50647370 | 1.24 |
ENST00000558970.1 ENST00000396464.3 ENST00000560825.1 |
GABPB1 |
GA binding protein transcription factor, beta subunit 1 |
| chrX_-_70329118 | 1.24 |
ENST00000374188.3 |
IL2RG |
interleukin 2 receptor, gamma |
| chr2_+_191513789 | 1.24 |
ENST00000409581.1 |
NAB1 |
NGFI-A binding protein 1 (EGR1 binding protein 1) |
| chr3_+_155588375 | 1.24 |
ENST00000295920.7 |
GMPS |
guanine monphosphate synthase |
| chr6_-_170124027 | 1.24 |
ENST00000366780.4 ENST00000339209.4 |
PHF10 |
PHD finger protein 10 |
| chr8_-_101321584 | 1.24 |
ENST00000523167.1 |
RNF19A |
ring finger protein 19A, RBR E3 ubiquitin protein ligase |
| chrX_+_147582228 | 1.23 |
ENST00000342251.3 |
AFF2 |
AF4/FMR2 family, member 2 |
| chr4_-_153457197 | 1.23 |
ENST00000281708.4 |
FBXW7 |
F-box and WD repeat domain containing 7, E3 ubiquitin protein ligase |
| chr21_-_15918618 | 1.23 |
ENST00000400564.1 ENST00000400566.1 |
SAMSN1 |
SAM domain, SH3 domain and nuclear localization signals 1 |
| chr17_+_30264014 | 1.22 |
ENST00000322652.5 ENST00000580398.1 |
SUZ12 |
SUZ12 polycomb repressive complex 2 subunit |
| chr2_+_86668464 | 1.22 |
ENST00000409064.1 |
KDM3A |
lysine (K)-specific demethylase 3A |
| chr17_+_7155556 | 1.22 |
ENST00000570500.1 ENST00000574993.1 ENST00000396628.2 ENST00000573657.1 |
ELP5 |
elongator acetyltransferase complex subunit 5 |
| chr14_+_100705322 | 1.22 |
ENST00000262238.4 |
YY1 |
YY1 transcription factor |
| chr1_+_162039558 | 1.22 |
ENST00000530878.1 ENST00000361897.5 |
NOS1AP |
nitric oxide synthase 1 (neuronal) adaptor protein |
| chr19_-_2702681 | 1.22 |
ENST00000382159.3 |
GNG7 |
guanine nucleotide binding protein (G protein), gamma 7 |
| chr20_+_34742650 | 1.21 |
ENST00000373945.1 ENST00000338074.2 |
EPB41L1 |
erythrocyte membrane protein band 4.1-like 1 |
| chr15_-_38856836 | 1.21 |
ENST00000450598.2 ENST00000559830.1 ENST00000558164.1 ENST00000310803.5 |
RASGRP1 |
RAS guanyl releasing protein 1 (calcium and DAG-regulated) |
| chr16_+_69599861 | 1.21 |
ENST00000354436.2 |
NFAT5 |
nuclear factor of activated T-cells 5, tonicity-responsive |
| chr22_+_25960786 | 1.20 |
ENST00000324198.6 |
ADRBK2 |
adrenergic, beta, receptor kinase 2 |
| chr9_-_115095883 | 1.20 |
ENST00000450374.1 ENST00000374255.2 ENST00000334318.6 ENST00000374257.1 |
PTBP3 |
polypyrimidine tract binding protein 3 |
| chr6_-_41703296 | 1.19 |
ENST00000373033.1 |
TFEB |
transcription factor EB |
| chr16_+_85645007 | 1.19 |
ENST00000405402.2 |
GSE1 |
Gse1 coiled-coil protein |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.1 | 6.4 | GO:0035403 | histone kinase activity (H3-T6 specific)(GO:0035403) |
| 1.6 | 4.9 | GO:0004103 | choline kinase activity(GO:0004103) |
| 1.1 | 4.5 | GO:0004727 | prenylated protein tyrosine phosphatase activity(GO:0004727) |
| 1.0 | 3.0 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.9 | 7.8 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.8 | 3.4 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.8 | 9.2 | GO:0051430 | corticotropin-releasing hormone receptor binding(GO:0051429) corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
| 0.8 | 2.3 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 0.8 | 2.3 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 0.7 | 4.0 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.7 | 4.6 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.6 | 1.8 | GO:0016534 | cyclin-dependent protein kinase 5 activator activity(GO:0016534) |
| 0.6 | 2.4 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.6 | 2.8 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.6 | 4.0 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.5 | 2.2 | GO:0038025 | reelin receptor activity(GO:0038025) |
| 0.5 | 3.2 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.5 | 1.5 | GO:0052810 | 1-phosphatidylinositol-5-kinase activity(GO:0052810) |
| 0.5 | 2.5 | GO:0004905 | type I interferon receptor activity(GO:0004905) |
| 0.5 | 5.4 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.5 | 2.5 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.5 | 1.4 | GO:0052811 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) |
| 0.5 | 1.4 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.5 | 1.8 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.4 | 2.2 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
| 0.4 | 7.5 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.4 | 0.4 | GO:1904455 | ubiquitin-specific protease activity involved in negative regulation of ERAD pathway(GO:1904455) |
| 0.4 | 1.2 | GO:0004917 | interleukin-7 receptor activity(GO:0004917) |
| 0.4 | 1.2 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
| 0.4 | 1.2 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.4 | 1.6 | GO:0004356 | glutamate-ammonia ligase activity(GO:0004356) ammonia ligase activity(GO:0016211) acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.4 | 2.7 | GO:0005353 | fructose transmembrane transporter activity(GO:0005353) |
| 0.4 | 3.1 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.4 | 1.5 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.4 | 1.1 | GO:0016314 | phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase activity(GO:0016314) |
| 0.4 | 9.9 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.4 | 1.4 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
| 0.4 | 1.1 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.3 | 1.4 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.3 | 1.7 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.3 | 2.6 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.3 | 1.3 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
| 0.3 | 0.9 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
| 0.3 | 0.9 | GO:0004122 | cystathionine beta-synthase activity(GO:0004122) oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) nitrite reductase (NO-forming) activity(GO:0050421) carbon monoxide binding(GO:0070025) nitrite reductase activity(GO:0098809) |
| 0.3 | 3.4 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.3 | 0.9 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.3 | 4.8 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.3 | 1.2 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.3 | 1.8 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.3 | 3.2 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.3 | 2.0 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
| 0.3 | 0.9 | GO:0004603 | phenylethanolamine N-methyltransferase activity(GO:0004603) |
| 0.3 | 0.6 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.3 | 0.8 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.3 | 0.3 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.3 | 8.2 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.3 | 1.1 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
| 0.3 | 0.8 | GO:0047493 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
| 0.3 | 0.8 | GO:0004756 | selenide, water dikinase activity(GO:0004756) phosphotransferase activity, paired acceptors(GO:0016781) |
| 0.3 | 3.7 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.3 | 0.8 | GO:0036134 | thromboxane-A synthase activity(GO:0004796) 12-hydroxyheptadecatrienoic acid synthase activity(GO:0036134) |
| 0.3 | 1.0 | GO:0044378 | non-sequence-specific DNA binding, bending(GO:0044378) |
| 0.3 | 0.8 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.3 | 1.3 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.3 | 8.1 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.3 | 1.5 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.3 | 1.0 | GO:0047057 | oxidoreductase activity, acting on the CH-OH group of donors, disulfide as acceptor(GO:0016900) vitamin-K-epoxide reductase (warfarin-sensitive) activity(GO:0047057) |
| 0.3 | 1.8 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.2 | 0.7 | GO:0008424 | glycoprotein 6-alpha-L-fucosyltransferase activity(GO:0008424) alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
| 0.2 | 0.7 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.2 | 1.2 | GO:0004306 | ethanolamine-phosphate cytidylyltransferase activity(GO:0004306) |
| 0.2 | 0.7 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.2 | 2.3 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
| 0.2 | 0.9 | GO:0016784 | 3-mercaptopyruvate sulfurtransferase activity(GO:0016784) |
| 0.2 | 0.7 | GO:0031859 | platelet activating factor receptor binding(GO:0031859) |
| 0.2 | 9.2 | GO:0044390 | ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
| 0.2 | 1.8 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.2 | 1.6 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.2 | 0.7 | GO:0031692 | alpha-1A adrenergic receptor binding(GO:0031691) alpha-1B adrenergic receptor binding(GO:0031692) follicle-stimulating hormone receptor binding(GO:0031762) V2 vasopressin receptor binding(GO:0031896) |
| 0.2 | 0.9 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 0.2 | 1.4 | GO:0023025 | MHC class Ib protein complex binding(GO:0023025) MHC class Ib protein binding, via antigen binding groove(GO:0023030) |
| 0.2 | 0.7 | GO:0070362 | mitochondrial light strand promoter anti-sense binding(GO:0070361) mitochondrial heavy strand promoter anti-sense binding(GO:0070362) mitochondrial heavy strand promoter sense binding(GO:0070364) |
| 0.2 | 0.7 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
| 0.2 | 1.3 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.2 | 2.4 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.2 | 0.9 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.2 | 1.1 | GO:0070404 | NADH binding(GO:0070404) |
| 0.2 | 0.8 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.2 | 1.7 | GO:0030284 | estrogen receptor activity(GO:0030284) |
| 0.2 | 0.6 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.2 | 2.9 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.2 | 10.7 | GO:0004407 | histone deacetylase activity(GO:0004407) |
| 0.2 | 1.8 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.2 | 0.8 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
| 0.2 | 0.8 | GO:0034057 | RNA strand-exchange activity(GO:0034057) |
| 0.2 | 0.4 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.2 | 1.8 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.2 | 1.2 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.2 | 1.0 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 0.2 | 2.8 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.2 | 1.4 | GO:0071253 | connexin binding(GO:0071253) |
| 0.2 | 0.6 | GO:0015275 | stretch-activated, cation-selective, calcium channel activity(GO:0015275) |
| 0.2 | 1.0 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.2 | 0.6 | GO:0003883 | CTP synthase activity(GO:0003883) |
| 0.2 | 1.7 | GO:0001225 | RNA polymerase II transcription coactivator binding(GO:0001225) |
| 0.2 | 0.4 | GO:0045118 | azole transporter activity(GO:0045118) |
| 0.2 | 1.7 | GO:0070888 | E-box binding(GO:0070888) |
| 0.2 | 2.3 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.2 | 3.8 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
| 0.2 | 3.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.2 | 0.7 | GO:0042954 | lipoprotein transporter activity(GO:0042954) |
| 0.2 | 2.0 | GO:0051434 | BH3 domain binding(GO:0051434) |
| 0.2 | 2.9 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.2 | 3.1 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.2 | 1.1 | GO:0032558 | adenyl deoxyribonucleotide binding(GO:0032558) dATP binding(GO:0032564) |
| 0.2 | 0.9 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) |
| 0.2 | 0.2 | GO:0061628 | H3K27me3 modified histone binding(GO:0061628) |
| 0.2 | 0.2 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
| 0.2 | 3.2 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.2 | 0.9 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
| 0.2 | 0.5 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.2 | 0.5 | GO:0004730 | pseudouridylate synthase activity(GO:0004730) |
| 0.2 | 2.3 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
| 0.2 | 0.5 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.2 | 0.5 | GO:0015218 | pyrimidine nucleotide transmembrane transporter activity(GO:0015218) |
| 0.2 | 0.7 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.2 | 1.0 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.2 | 0.7 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.2 | 2.0 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
| 0.2 | 0.3 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
| 0.2 | 0.8 | GO:0046592 | polyamine oxidase activity(GO:0046592) spermine:oxygen oxidoreductase (spermidine-forming) activity(GO:0052901) |
| 0.2 | 0.3 | GO:0043559 | insulin binding(GO:0043559) |
| 0.2 | 0.2 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
| 0.2 | 1.4 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.2 | 0.6 | GO:0060422 | peptidyl-dipeptidase inhibitor activity(GO:0060422) |
| 0.2 | 0.6 | GO:0004998 | transferrin receptor activity(GO:0004998) |
| 0.2 | 0.9 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.2 | 0.5 | GO:0008941 | nitric oxide dioxygenase activity(GO:0008941) oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of two atoms of oxygen into one donor(GO:0016708) iron-cytochrome-c reductase activity(GO:0047726) |
| 0.2 | 0.5 | GO:0052830 | inositol tetrakisphosphate 1-kinase activity(GO:0047325) inositol tetrakisphosphate kinase activity(GO:0051765) inositol-1,3,4-trisphosphate 6-kinase activity(GO:0052725) inositol-1,3,4-trisphosphate 5-kinase activity(GO:0052726) inositol-1,3,4,5,6-pentakisphosphate 1-phosphatase activity(GO:0052825) inositol-1,3,4,6-tetrakisphosphate 6-phosphatase activity(GO:0052830) inositol-1,3,4,6-tetrakisphosphate 1-phosphatase activity(GO:0052831) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) |
| 0.2 | 0.5 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.2 | 0.5 | GO:0004119 | cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) |
| 0.2 | 8.2 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
| 0.2 | 0.8 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.2 | 0.5 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.2 | 2.3 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.2 | 0.5 | GO:0031877 | somatostatin receptor binding(GO:0031877) |
| 0.2 | 0.6 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.1 | 5.5 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.1 | 0.9 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
| 0.1 | 1.0 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.1 | 0.6 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.1 | 3.9 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.1 | 0.4 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
| 0.1 | 0.3 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
| 0.1 | 0.4 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
| 0.1 | 1.0 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.1 | 0.1 | GO:0005277 | acetylcholine transmembrane transporter activity(GO:0005277) acetate ester transmembrane transporter activity(GO:1901375) |
| 0.1 | 0.7 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.1 | 0.4 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
| 0.1 | 1.0 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
| 0.1 | 1.0 | GO:0030369 | ICAM-3 receptor activity(GO:0030369) |
| 0.1 | 1.0 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.1 | 4.1 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
| 0.1 | 0.4 | GO:0005260 | channel-conductance-controlling ATPase activity(GO:0005260) |
| 0.1 | 0.5 | GO:0032143 | single thymine insertion binding(GO:0032143) |
| 0.1 | 2.7 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.1 | 0.4 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
| 0.1 | 0.4 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.1 | 0.8 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
| 0.1 | 0.6 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
| 0.1 | 0.9 | GO:0015501 | glutamate:sodium symporter activity(GO:0015501) |
| 0.1 | 1.6 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.1 | 0.4 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
| 0.1 | 0.4 | GO:0098770 | FBXO family protein binding(GO:0098770) |
| 0.1 | 0.9 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.1 | 0.4 | GO:0051379 | epinephrine binding(GO:0051379) |
| 0.1 | 0.2 | GO:0003870 | 5-aminolevulinate synthase activity(GO:0003870) N-succinyltransferase activity(GO:0016749) |
| 0.1 | 1.0 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.1 | 1.1 | GO:0030618 | transforming growth factor beta receptor, pathway-specific cytoplasmic mediator activity(GO:0030618) |
| 0.1 | 0.7 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
| 0.1 | 3.8 | GO:0030371 | translation repressor activity(GO:0030371) |
| 0.1 | 1.6 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
| 0.1 | 1.7 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.1 | 0.6 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
| 0.1 | 2.2 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.1 | 0.2 | GO:0030348 | syntaxin-3 binding(GO:0030348) |
| 0.1 | 0.5 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.1 | 0.4 | GO:0004914 | interleukin-5 receptor activity(GO:0004914) |
| 0.1 | 0.8 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.1 | 1.0 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.1 | 0.2 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
| 0.1 | 0.3 | GO:0008267 | poly-glutamine tract binding(GO:0008267) |
| 0.1 | 1.3 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.1 | 0.3 | GO:0008798 | beta-aspartyl-peptidase activity(GO:0008798) |
| 0.1 | 6.1 | GO:0030145 | manganese ion binding(GO:0030145) |
| 0.1 | 0.5 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.1 | 0.8 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.1 | 1.3 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 0.1 | 0.1 | GO:0004461 | lactose synthase activity(GO:0004461) |
| 0.1 | 0.2 | GO:0003678 | DNA helicase activity(GO:0003678) |
| 0.1 | 0.6 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.1 | 1.1 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.1 | 2.9 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.1 | 0.4 | GO:0032408 | MutLbeta complex binding(GO:0032406) MutSbeta complex binding(GO:0032408) |
| 0.1 | 0.3 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
| 0.1 | 0.8 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.1 | 1.1 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
| 0.1 | 0.3 | GO:0015230 | FAD transmembrane transporter activity(GO:0015230) coenzyme transporter activity(GO:0051185) |
| 0.1 | 0.5 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
| 0.1 | 0.8 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.1 | 5.8 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.1 | 0.6 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
| 0.1 | 1.7 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.1 | 0.4 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.1 | 0.4 | GO:0090554 | phosphatidylcholine-translocating ATPase activity(GO:0090554) |
| 0.1 | 0.7 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 0.1 | 0.4 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.1 | 0.3 | GO:0098640 | integrin binding involved in cell-matrix adhesion(GO:0098640) |
| 0.1 | 2.3 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
| 0.1 | 1.0 | GO:0046790 | virion binding(GO:0046790) |
| 0.1 | 0.3 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.1 | 0.4 | GO:0031208 | POZ domain binding(GO:0031208) |
| 0.1 | 0.8 | GO:0008504 | dopamine transmembrane transporter activity(GO:0005329) monoamine transmembrane transporter activity(GO:0008504) |
| 0.1 | 0.3 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.1 | 0.2 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.1 | 0.4 | GO:0004104 | cholinesterase activity(GO:0004104) |
| 0.1 | 0.5 | GO:0015056 | corticotrophin-releasing factor receptor activity(GO:0015056) |
| 0.1 | 4.1 | GO:0034212 | peptide N-acetyltransferase activity(GO:0034212) |
| 0.1 | 1.3 | GO:0043121 | neurotrophin binding(GO:0043121) |
| 0.1 | 1.7 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.1 | 3.4 | GO:0008408 | 3'-5' exonuclease activity(GO:0008408) |
| 0.1 | 0.7 | GO:0001158 | enhancer sequence-specific DNA binding(GO:0001158) |
| 0.1 | 6.6 | GO:0036459 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
| 0.1 | 0.5 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
| 0.1 | 0.6 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.1 | 0.5 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
| 0.1 | 0.4 | GO:0004803 | transposase activity(GO:0004803) |
| 0.1 | 1.4 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.1 | 1.7 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.1 | 0.3 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
| 0.1 | 0.7 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.1 | 0.7 | GO:0032452 | histone demethylase activity(GO:0032452) |
| 0.1 | 0.4 | GO:0034594 | phosphatidylinositol trisphosphate phosphatase activity(GO:0034594) |
| 0.1 | 0.4 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
| 0.1 | 0.9 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.1 | 0.3 | GO:0015361 | low-affinity sodium:dicarboxylate symporter activity(GO:0015361) |
| 0.1 | 1.1 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.1 | 0.6 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.1 | 0.4 | GO:0016531 | copper chaperone activity(GO:0016531) |
| 0.1 | 0.2 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.1 | 2.3 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.1 | 0.4 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) potassium-transporting ATPase activity(GO:0008556) |
| 0.1 | 1.6 | GO:0005522 | profilin binding(GO:0005522) |
| 0.1 | 0.5 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.1 | 1.0 | GO:1990239 | steroid hormone binding(GO:1990239) |
| 0.1 | 0.1 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.1 | 0.1 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
| 0.1 | 0.4 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.1 | 1.2 | GO:0016594 | glycine binding(GO:0016594) |
| 0.1 | 0.3 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
| 0.1 | 0.6 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
| 0.1 | 0.5 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.1 | 2.9 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.1 | 0.5 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.1 | 1.8 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.1 | 0.3 | GO:0035473 | lipase binding(GO:0035473) |
| 0.1 | 0.3 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 0.1 | 0.6 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.1 | 0.3 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.1 | 0.6 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.1 | 0.3 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.1 | 0.6 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
| 0.1 | 0.1 | GO:0004620 | phospholipase activity(GO:0004620) lipase activity(GO:0016298) |
| 0.1 | 3.8 | GO:0008094 | DNA-dependent ATPase activity(GO:0008094) |
| 0.1 | 0.2 | GO:0004936 | alpha-adrenergic receptor activity(GO:0004936) alpha1-adrenergic receptor activity(GO:0004937) |
| 0.1 | 0.8 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.1 | 2.0 | GO:0030515 | snoRNA binding(GO:0030515) |
| 0.1 | 1.4 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.1 | 1.3 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
| 0.1 | 0.6 | GO:0003720 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
| 0.1 | 0.8 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.1 | 0.2 | GO:0000026 | alpha-1,2-mannosyltransferase activity(GO:0000026) |
| 0.1 | 0.3 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.1 | 0.5 | GO:0030020 | extracellular matrix structural constituent conferring tensile strength(GO:0030020) |
| 0.1 | 0.9 | GO:0098847 | sequence-specific single stranded DNA binding(GO:0098847) |
| 0.1 | 7.7 | GO:0043130 | ubiquitin binding(GO:0043130) |
| 0.1 | 1.7 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
| 0.1 | 0.3 | GO:0051734 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.1 | 0.5 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.1 | 0.5 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.1 | 0.9 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.1 | 3.3 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.1 | 2.0 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.1 | 1.7 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.1 | 0.7 | GO:0015288 | porin activity(GO:0015288) |
| 0.1 | 0.5 | GO:0070492 | oligosaccharide binding(GO:0070492) |
| 0.1 | 2.1 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.1 | 0.8 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.1 | 2.3 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.1 | 0.3 | GO:0004793 | glycine hydroxymethyltransferase activity(GO:0004372) threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.1 | 0.2 | GO:0004935 | adrenergic receptor activity(GO:0004935) |
| 0.1 | 0.5 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.1 | 0.1 | GO:0097677 | STAT family protein binding(GO:0097677) |
| 0.1 | 0.6 | GO:0004873 | asialoglycoprotein receptor activity(GO:0004873) |
| 0.1 | 0.2 | GO:0030272 | 5-formyltetrahydrofolate cyclo-ligase activity(GO:0030272) |
| 0.1 | 0.3 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
| 0.1 | 0.1 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.1 | 0.5 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
| 0.1 | 1.1 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
| 0.1 | 3.6 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.1 | 0.4 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.1 | 0.9 | GO:0031491 | nucleosome binding(GO:0031491) |
| 0.1 | 8.6 | GO:0042393 | histone binding(GO:0042393) |
| 0.1 | 0.6 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.1 | 1.0 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
| 0.1 | 0.8 | GO:0050780 | dopamine receptor binding(GO:0050780) |
| 0.1 | 3.5 | GO:0000980 | RNA polymerase II distal enhancer sequence-specific DNA binding(GO:0000980) |
| 0.1 | 0.3 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.1 | 0.3 | GO:0052740 | 1-acyl-2-lysophosphatidylserine acylhydrolase activity(GO:0052740) |
| 0.1 | 0.4 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.1 | 0.4 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
| 0.1 | 0.2 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
| 0.1 | 0.2 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.1 | 0.4 | GO:0052655 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
| 0.1 | 0.6 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.1 | 1.5 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.1 | 0.2 | GO:0047322 | [hydroxymethylglutaryl-CoA reductase (NADPH)] kinase activity(GO:0047322) [acetyl-CoA carboxylase] kinase activity(GO:0050405) |
| 0.1 | 0.7 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.1 | 0.4 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.1 | 0.5 | GO:0016796 | exonuclease activity, active with either ribo- or deoxyribonucleic acids and producing 5'-phosphomonoesters(GO:0016796) |
| 0.1 | 0.5 | GO:0015926 | glucosidase activity(GO:0015926) |
| 0.1 | 0.4 | GO:0015166 | polyol transmembrane transporter activity(GO:0015166) |
| 0.1 | 0.2 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.1 | 0.9 | GO:0033613 | activating transcription factor binding(GO:0033613) |
| 0.1 | 0.8 | GO:0036002 | pre-mRNA binding(GO:0036002) |
| 0.1 | 0.1 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.1 | 0.6 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.1 | 0.9 | GO:0018024 | histone-lysine N-methyltransferase activity(GO:0018024) |
| 0.1 | 0.1 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
| 0.1 | 0.4 | GO:0039552 | RIG-I binding(GO:0039552) |
| 0.1 | 0.8 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.1 | 0.4 | GO:0044213 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) intronic transcription regulatory region DNA binding(GO:0044213) |
| 0.1 | 0.4 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.1 | 0.4 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.1 | 0.2 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.1 | 0.2 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 0.1 | 23.6 | GO:0000987 | core promoter proximal region sequence-specific DNA binding(GO:0000987) |
| 0.1 | 0.4 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
| 0.1 | 0.6 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.1 | 2.2 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.1 | 0.3 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.1 | 0.4 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.1 | 0.4 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.1 | 2.2 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
| 0.1 | 2.8 | GO:0001047 | core promoter binding(GO:0001047) |
| 0.1 | 0.6 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.1 | 0.2 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.1 | 0.2 | GO:0005471 | ATP:ADP antiporter activity(GO:0005471) adenine transmembrane transporter activity(GO:0015207) |
| 0.1 | 0.2 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.1 | 1.5 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.1 | 0.6 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.1 | 1.2 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
| 0.1 | 0.2 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
| 0.1 | 0.2 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 0.1 | 0.1 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
| 0.1 | 0.4 | GO:0015385 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
| 0.1 | 0.2 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 0.1 | 0.2 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.1 | 0.9 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.1 | 1.5 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
| 0.1 | 1.1 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.1 | 1.8 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.1 | 0.5 | GO:0042054 | histone methyltransferase activity(GO:0042054) |
| 0.1 | 0.4 | GO:0042978 | ornithine decarboxylase activator activity(GO:0042978) |
| 0.1 | 2.0 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.1 | 0.3 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 0.1 | 0.2 | GO:0005113 | patched binding(GO:0005113) |
| 0.1 | 1.0 | GO:0016769 | transferase activity, transferring nitrogenous groups(GO:0016769) |
| 0.1 | 3.4 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
| 0.1 | 0.4 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.1 | 0.2 | GO:0008940 | nitrate reductase activity(GO:0008940) |
| 0.1 | 0.3 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.1 | 0.6 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.1 | 0.1 | GO:0015235 | cobalamin transporter activity(GO:0015235) |
| 0.0 | 0.1 | GO:0016418 | S-acetyltransferase activity(GO:0016418) |
| 0.0 | 0.2 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 0.0 | 4.3 | GO:0043565 | sequence-specific DNA binding(GO:0043565) |
| 0.0 | 0.5 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
| 0.0 | 0.6 | GO:0019843 | rRNA binding(GO:0019843) |
| 0.0 | 0.2 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
| 0.0 | 0.4 | GO:0035173 | histone kinase activity(GO:0035173) |
| 0.0 | 0.2 | GO:0044736 | acid-sensing ion channel activity(GO:0044736) |
| 0.0 | 0.4 | GO:0019534 | toxin transporter activity(GO:0019534) |
| 0.0 | 0.5 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.0 | 0.1 | GO:0004137 | deoxycytidine kinase activity(GO:0004137) |
| 0.0 | 0.4 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
| 0.0 | 0.4 | GO:0047144 | 2-acylglycerol-3-phosphate O-acyltransferase activity(GO:0047144) |
| 0.0 | 0.2 | GO:0030170 | pyridoxal phosphate binding(GO:0030170) |
| 0.0 | 0.7 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
| 0.0 | 0.3 | GO:0050682 | AF-2 domain binding(GO:0050682) |
| 0.0 | 0.5 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.0 | 0.1 | GO:0032810 | sterol response element binding(GO:0032810) |
| 0.0 | 0.1 | GO:0052595 | tryptamine:oxygen oxidoreductase (deaminating) activity(GO:0052593) aminoacetone:oxygen oxidoreductase(deaminating) activity(GO:0052594) aliphatic-amine oxidase activity(GO:0052595) phenethylamine:oxygen oxidoreductase (deaminating) activity(GO:0052596) |
| 0.0 | 0.5 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
| 0.0 | 0.3 | GO:0017018 | myosin phosphatase activity(GO:0017018) |
| 0.0 | 1.4 | GO:0042826 | histone deacetylase binding(GO:0042826) |
| 0.0 | 0.4 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
| 0.0 | 0.6 | GO:0051184 | cofactor transporter activity(GO:0051184) |
| 0.0 | 0.5 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
| 0.0 | 0.9 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.0 | 0.7 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.0 | 0.1 | GO:0030911 | TPR domain binding(GO:0030911) |
| 0.0 | 0.2 | GO:0043175 | RNA polymerase core enzyme binding(GO:0043175) |
| 0.0 | 0.2 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 0.0 | 0.1 | GO:0003978 | UDP-N-acetylglucosamine 4-epimerase activity(GO:0003974) UDP-glucose 4-epimerase activity(GO:0003978) |
| 0.0 | 0.2 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
| 0.0 | 3.1 | GO:0047485 | protein N-terminus binding(GO:0047485) |
| 0.0 | 0.5 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.0 | 0.1 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
| 0.0 | 1.5 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
| 0.0 | 0.1 | GO:0034041 | sterol-transporting ATPase activity(GO:0034041) |
| 0.0 | 0.2 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.0 | 0.3 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.0 | 0.2 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.0 | 0.1 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.0 | 0.2 | GO:0098960 | postsynaptic neurotransmitter receptor activity(GO:0098960) |
| 0.0 | 1.2 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 0.0 | 0.3 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.0 | 0.9 | GO:0005123 | death receptor binding(GO:0005123) |
| 0.0 | 0.6 | GO:0001671 | ATPase activator activity(GO:0001671) |
| 0.0 | 0.1 | GO:0008476 | protein-tyrosine sulfotransferase activity(GO:0008476) |
| 0.0 | 0.4 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
| 0.0 | 0.1 | GO:0004320 | oleoyl-[acyl-carrier-protein] hydrolase activity(GO:0004320) myristoyl-[acyl-carrier-protein] hydrolase activity(GO:0016295) palmitoyl-[acyl-carrier-protein] hydrolase activity(GO:0016296) acyl-[acyl-carrier-protein] hydrolase activity(GO:0016297) |
| 0.0 | 0.4 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.0 | 0.6 | GO:0051183 | vitamin transporter activity(GO:0051183) |
| 0.0 | 0.5 | GO:0004970 | ionotropic glutamate receptor activity(GO:0004970) extracellular-glutamate-gated ion channel activity(GO:0005234) |
| 0.0 | 0.4 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.0 | 1.0 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.0 | 0.5 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
| 0.0 | 1.8 | GO:0004180 | carboxypeptidase activity(GO:0004180) |
| 0.0 | 0.2 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.0 | 0.8 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.0 | 0.1 | GO:0071566 | UFM1 activating enzyme activity(GO:0071566) |
| 0.0 | 0.1 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.0 | 0.8 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.0 | 0.1 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
| 0.0 | 0.2 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.0 | 0.3 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.0 | 0.1 | GO:0005497 | androgen binding(GO:0005497) |
| 0.0 | 0.1 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.0 | 0.1 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.0 | 0.2 | GO:0001641 | group II metabotropic glutamate receptor activity(GO:0001641) |
| 0.0 | 0.3 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.0 | 0.5 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
| 0.0 | 0.0 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.0 | 2.5 | GO:0000149 | SNARE binding(GO:0000149) |
| 0.0 | 0.5 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.0 | 0.1 | GO:0004170 | dUTP diphosphatase activity(GO:0004170) |
| 0.0 | 0.8 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
| 0.0 | 0.6 | GO:0019213 | deacetylase activity(GO:0019213) |
| 0.0 | 0.5 | GO:0003993 | acid phosphatase activity(GO:0003993) |
| 0.0 | 1.0 | GO:0016676 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.0 | 0.2 | GO:0042301 | phosphate ion binding(GO:0042301) |
| 0.0 | 0.1 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.0 | 0.7 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.0 | 0.1 | GO:0004819 | glutamine-tRNA ligase activity(GO:0004819) |
| 0.0 | 0.1 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.0 | 0.4 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.0 | 0.1 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.0 | 0.1 | GO:0019826 | oxygen sensor activity(GO:0019826) |
| 0.0 | 2.3 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.0 | 0.5 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
| 0.0 | 1.1 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.0 | 1.2 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.0 | 0.1 | GO:0004961 | thromboxane receptor activity(GO:0004960) thromboxane A2 receptor activity(GO:0004961) |
| 0.0 | 0.2 | GO:0003916 | DNA topoisomerase activity(GO:0003916) DNA topoisomerase type I activity(GO:0003917) |
| 0.0 | 0.2 | GO:0017159 | pantetheine hydrolase activity(GO:0017159) |
| 0.0 | 0.4 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.0 | 0.3 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
| 0.0 | 0.6 | GO:0008242 | omega peptidase activity(GO:0008242) |
| 0.0 | 0.1 | GO:0016972 | flavin-linked sulfhydryl oxidase activity(GO:0016971) thiol oxidase activity(GO:0016972) |
| 0.0 | 0.3 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
| 0.0 | 0.2 | GO:0051766 | inositol trisphosphate kinase activity(GO:0051766) |
| 0.0 | 0.1 | GO:0030627 | pre-mRNA 5'-splice site binding(GO:0030627) |
| 0.0 | 0.2 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 0.0 | 0.5 | GO:0030331 | estrogen receptor binding(GO:0030331) |
| 0.0 | 0.1 | GO:0015526 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.0 | 0.4 | GO:0070063 | RNA polymerase binding(GO:0070063) |
| 0.0 | 0.2 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.0 | 0.4 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
| 0.0 | 0.4 | GO:0051378 | amine binding(GO:0043176) serotonin binding(GO:0051378) |
| 0.0 | 0.2 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.0 | 0.1 | GO:0009008 | DNA-methyltransferase activity(GO:0009008) |
| 0.0 | 0.6 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.0 | 0.1 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.0 | 0.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.0 | 0.3 | GO:0016279 | lysine N-methyltransferase activity(GO:0016278) protein-lysine N-methyltransferase activity(GO:0016279) |
| 0.0 | 0.1 | GO:0032038 | myosin II heavy chain binding(GO:0032038) |
| 0.0 | 0.1 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.0 | 0.1 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.0 | 0.8 | GO:0019894 | kinesin binding(GO:0019894) |
| 0.0 | 0.4 | GO:0019707 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.0 | 0.3 | GO:0004536 | deoxyribonuclease activity(GO:0004536) |
| 0.0 | 0.2 | GO:0008235 | metalloexopeptidase activity(GO:0008235) |
| 0.0 | 0.5 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.0 | 1.5 | GO:0003727 | single-stranded RNA binding(GO:0003727) |
| 0.0 | 0.1 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.0 | 0.1 | GO:0004619 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 0.0 | 0.2 | GO:0001221 | transcription cofactor binding(GO:0001221) |
| 0.0 | 1.3 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.0 | 0.1 | GO:0004485 | methylcrotonoyl-CoA carboxylase activity(GO:0004485) |
| 0.0 | 0.6 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
| 0.0 | 0.1 | GO:0004910 | interleukin-1, Type II, blocking receptor activity(GO:0004910) |
| 0.0 | 0.1 | GO:0030197 | extracellular matrix constituent, lubricant activity(GO:0030197) |
| 0.0 | 0.4 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.0 | 0.5 | GO:0042166 | acetylcholine binding(GO:0042166) |
| 0.0 | 0.3 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.0 | 0.9 | GO:0008009 | chemokine activity(GO:0008009) |
| 0.0 | 0.1 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
| 0.0 | 0.0 | GO:0016417 | S-acyltransferase activity(GO:0016417) |
| 0.0 | 0.1 | GO:0070513 | death domain binding(GO:0070513) |
| 0.0 | 0.1 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.0 | 0.2 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
| 0.0 | 0.4 | GO:0045028 | G-protein coupled nucleotide receptor activity(GO:0001608) purinergic nucleotide receptor activity(GO:0001614) nucleotide receptor activity(GO:0016502) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
| 0.0 | 0.0 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.3 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.0 | 0.1 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
| 0.0 | 14.2 | GO:0003700 | nucleic acid binding transcription factor activity(GO:0001071) transcription factor activity, sequence-specific DNA binding(GO:0003700) |
| 0.0 | 0.0 | GO:0050211 | procollagen galactosyltransferase activity(GO:0050211) |
| 0.0 | 0.1 | GO:0038047 | beta-endorphin receptor activity(GO:0004979) morphine receptor activity(GO:0038047) |
| 0.0 | 0.1 | GO:0016004 | phospholipase activator activity(GO:0016004) |
| 0.0 | 0.4 | GO:0001191 | transcriptional repressor activity, RNA polymerase II transcription factor binding(GO:0001191) |
| 0.0 | 0.1 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
| 0.0 | 0.1 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
| 0.0 | 0.1 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
| 0.0 | 0.3 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.0 | 1.6 | GO:0008565 | protein transporter activity(GO:0008565) |
| 0.0 | 0.0 | GO:0015368 | calcium:cation antiporter activity(GO:0015368) |
| 0.0 | 0.1 | GO:0003920 | GMP reductase activity(GO:0003920) oxidoreductase activity, acting on NAD(P)H, nitrogenous group as acceptor(GO:0016657) |
| 0.0 | 0.8 | GO:0015179 | L-amino acid transmembrane transporter activity(GO:0015179) |
| 0.0 | 0.1 | GO:0047685 | amine sulfotransferase activity(GO:0047685) |
| 0.0 | 0.1 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
| 0.0 | 0.1 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) |
| 0.0 | 0.3 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.0 | 0.2 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
| 0.0 | 0.3 | GO:0070405 | ammonium ion binding(GO:0070405) |
| 0.0 | 0.5 | GO:0004521 | endoribonuclease activity(GO:0004521) |
| 0.0 | 0.1 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.0 | 0.1 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.0 | 0.1 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
| 0.0 | 0.1 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
| 0.0 | 0.1 | GO:0042608 | T cell receptor binding(GO:0042608) |
| 0.0 | 0.1 | GO:0033691 | sialic acid binding(GO:0033691) |
| 0.0 | 0.2 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
| 0.0 | 0.1 | GO:0031490 | chromatin DNA binding(GO:0031490) |
| 0.0 | 0.1 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
| 0.0 | 0.1 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.0 | 0.0 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.0 | 0.3 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.0 | 0.1 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.0 | 0.4 | GO:0051393 | alpha-actinin binding(GO:0051393) |
| 0.0 | 0.1 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.0 | 0.1 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.0 | 0.0 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.0 | 3.3 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.2 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.0 | 0.1 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.0 | 0.3 | GO:0034061 | DNA polymerase activity(GO:0034061) |
| 0.0 | 0.2 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.0 | 0.0 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
| 0.0 | 0.1 | GO:0050664 | oxidoreductase activity, acting on NAD(P)H, oxygen as acceptor(GO:0050664) |
| 0.0 | 0.3 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
| 0.0 | 0.1 | GO:0016639 | oxidoreductase activity, acting on the CH-NH2 group of donors, NAD or NADP as acceptor(GO:0016639) |
| 0.0 | 0.1 | GO:0042019 | interleukin-23 binding(GO:0042019) interleukin-23 receptor activity(GO:0042020) |
| 0.0 | 0.1 | GO:0019958 | C-X-C chemokine binding(GO:0019958) |
| 0.0 | 0.2 | GO:0005537 | mannose binding(GO:0005537) |
| 0.0 | 0.1 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 0.0 | 0.1 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.0 | 1.3 | GO:0035591 | signaling adaptor activity(GO:0035591) |
| 0.0 | 0.1 | GO:0030955 | potassium ion binding(GO:0030955) |
| 0.0 | 0.1 | GO:0010181 | FMN binding(GO:0010181) |
| 0.0 | 0.2 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.0 | 0.2 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.0 | 0.1 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.0 | 0.0 | GO:0016434 | rRNA (cytosine) methyltransferase activity(GO:0016434) |
| 0.0 | 0.1 | GO:0015278 | calcium-release channel activity(GO:0015278) ligand-gated calcium channel activity(GO:0099604) |
| 0.0 | 0.0 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.0 | 0.0 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
| 0.0 | 0.3 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.0 | 0.1 | GO:0005230 | extracellular ligand-gated ion channel activity(GO:0005230) |
| 0.0 | 0.2 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.0 | 0.1 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.0 | 0.5 | GO:0051117 | ATPase binding(GO:0051117) |
| 0.0 | 0.1 | GO:0019215 | intermediate filament binding(GO:0019215) |
| 0.0 | 0.2 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
| 0.0 | 0.1 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.0 | 0.1 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.0 | 0.1 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.0 | 0.1 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 12.1 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.3 | 1.1 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.3 | 25.8 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.3 | 0.5 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.2 | 4.4 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.2 | 10.9 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.2 | 0.5 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.2 | 6.0 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.2 | 3.7 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.2 | 3.5 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.2 | 10.0 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
| 0.2 | 0.8 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
| 0.2 | 7.1 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.2 | 4.4 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.2 | 0.6 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.1 | 7.6 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.1 | 2.0 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.1 | 1.2 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.1 | 2.2 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.1 | 6.2 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.1 | 4.4 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.1 | 3.2 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.1 | 2.7 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.1 | 1.1 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
| 0.1 | 5.8 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.1 | 3.6 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.1 | 2.9 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
| 0.1 | 2.4 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.1 | 0.6 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.1 | 5.1 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| 0.1 | 6.2 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.1 | 3.9 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.1 | 0.6 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.1 | 0.5 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.1 | 0.4 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.1 | 3.4 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.1 | 3.5 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
| 0.1 | 0.6 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.1 | 0.3 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.1 | 3.6 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.1 | 0.7 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.1 | 1.2 | ST GAQ PATHWAY | G alpha q Pathway |
| 0.1 | 1.8 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
| 0.1 | 1.9 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.1 | 1.2 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.1 | 4.7 | PID E2F PATHWAY | E2F transcription factor network |
| 0.1 | 2.3 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
| 0.0 | 2.0 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.0 | 1.7 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.0 | 0.2 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.0 | 0.6 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.0 | 1.6 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.0 | 1.6 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.0 | 0.7 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 1.0 | PID ATR PATHWAY | ATR signaling pathway |
| 0.0 | 1.5 | PID ATM PATHWAY | ATM pathway |
| 0.0 | 0.5 | PID FGF PATHWAY | FGF signaling pathway |
| 0.0 | 1.7 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
| 0.0 | 0.6 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.0 | 0.5 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
| 0.0 | 2.4 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.0 | 0.8 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.0 | 0.1 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.0 | 0.6 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.0 | 0.5 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 2.8 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 0.9 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.0 | 0.1 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.0 | 1.6 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 0.1 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.0 | 1.0 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.0 | 0.1 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.0 | 1.1 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.0 | 0.1 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.0 | 0.4 | PID SHP2 PATHWAY | SHP2 signaling |
| 0.0 | 0.5 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 0.5 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.0 | 0.3 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.0 | 0.1 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
| 0.0 | 0.3 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
| 0.0 | 0.2 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.0 | 0.2 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.0 | 0.3 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.0 | 0.1 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.0 | 0.5 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.0 | 0.2 | PID FOXO PATHWAY | FoxO family signaling |
| 0.0 | 0.1 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.0 | 0.4 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
| 0.0 | 0.0 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.0 | 0.5 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.1 | 6.4 | GO:0035408 | histone H3-T6 phosphorylation(GO:0035408) |
| 1.5 | 4.6 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 1.5 | 5.9 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 1.4 | 5.5 | GO:0000432 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
| 1.3 | 5.2 | GO:0003172 | primary heart field specification(GO:0003138) sinoatrial valve development(GO:0003172) sinoatrial valve morphogenesis(GO:0003185) |
| 1.2 | 3.7 | GO:0045994 | positive regulation of translational initiation by iron(GO:0045994) |
| 1.2 | 8.3 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) |
| 1.1 | 3.3 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 0.9 | 6.4 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
| 0.9 | 2.7 | GO:0021919 | BMP signaling pathway involved in spinal cord dorsal/ventral patterning(GO:0021919) |
| 0.9 | 2.7 | GO:1904772 | hepatocyte homeostasis(GO:0036333) response to tetrachloromethane(GO:1904772) |
| 0.8 | 2.4 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
| 0.7 | 2.2 | GO:1902499 | positive regulation of protein autoubiquitination(GO:1902499) |
| 0.7 | 2.2 | GO:0045658 | regulation of eosinophil differentiation(GO:0045643) positive regulation of eosinophil differentiation(GO:0045645) regulation of neutrophil differentiation(GO:0045658) negative regulation of neutrophil differentiation(GO:0045659) |
| 0.7 | 2.1 | GO:1904799 | negative regulation of dendrite extension(GO:1903860) regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.7 | 2.8 | GO:0043375 | negative regulation of cellular pH reduction(GO:0032848) CD8-positive, alpha-beta T cell lineage commitment(GO:0043375) negative regulation of retinal cell programmed cell death(GO:0046671) |
| 0.7 | 2.8 | GO:2000820 | negative regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000820) |
| 0.7 | 2.0 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
| 0.7 | 3.4 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.7 | 2.6 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.6 | 1.9 | GO:1904899 | regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 0.6 | 1.9 | GO:2000547 | dendritic cell dendrite assembly(GO:0097026) regulation of dendritic cell dendrite assembly(GO:2000547) |
| 0.6 | 2.5 | GO:2001168 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.6 | 3.7 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.6 | 2.4 | GO:0002840 | plasmacytoid dendritic cell activation(GO:0002270) T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) regulation of restriction endodeoxyribonuclease activity(GO:0032072) negative regulation of apoptotic cell clearance(GO:2000426) |
| 0.6 | 1.8 | GO:0021722 | superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
| 0.6 | 5.6 | GO:0019695 | choline metabolic process(GO:0019695) |
| 0.6 | 3.3 | GO:0071233 | cellular response to leucine(GO:0071233) |
| 0.6 | 2.8 | GO:0003420 | regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
| 0.5 | 0.5 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
| 0.5 | 3.6 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
| 0.5 | 1.5 | GO:0007206 | phospholipase C-activating G-protein coupled glutamate receptor signaling pathway(GO:0007206) |
| 0.5 | 2.0 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.5 | 2.5 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
| 0.5 | 3.4 | GO:0035624 | receptor transactivation(GO:0035624) |
| 0.5 | 2.5 | GO:0072069 | DCT cell differentiation(GO:0072069) metanephric DCT cell differentiation(GO:0072240) |
| 0.5 | 0.5 | GO:2000670 | positive regulation of dendritic cell apoptotic process(GO:2000670) |
| 0.5 | 1.5 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
| 0.5 | 0.5 | GO:0000429 | carbon catabolite regulation of transcription from RNA polymerase II promoter(GO:0000429) carbon catabolite activation of transcription from RNA polymerase II promoter(GO:0000436) |
| 0.5 | 1.9 | GO:0003366 | cell-matrix adhesion involved in ameboidal cell migration(GO:0003366) |
| 0.5 | 3.8 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.5 | 1.4 | GO:0019230 | proprioception(GO:0019230) |
| 0.5 | 0.9 | GO:0014016 | neuroblast differentiation(GO:0014016) |
| 0.5 | 1.4 | GO:1901674 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
| 0.5 | 0.9 | GO:1900239 | phenotypic switching(GO:0036166) regulation of phenotypic switching(GO:1900239) |
| 0.5 | 0.5 | GO:0072661 | protein targeting to plasma membrane(GO:0072661) |
| 0.5 | 4.1 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.4 | 3.6 | GO:0060235 | lens induction in camera-type eye(GO:0060235) |
| 0.4 | 1.3 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.4 | 0.9 | GO:0051972 | regulation of telomerase activity(GO:0051972) |
| 0.4 | 1.3 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.4 | 2.1 | GO:0007070 | negative regulation of transcription during mitosis(GO:0007068) negative regulation of transcription from RNA polymerase II promoter during mitosis(GO:0007070) |
| 0.4 | 2.1 | GO:0035063 | nuclear speck organization(GO:0035063) |
| 0.4 | 1.7 | GO:0010900 | negative regulation of phosphatidylcholine catabolic process(GO:0010900) |
| 0.4 | 2.1 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.4 | 2.1 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.4 | 2.1 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.4 | 1.2 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
| 0.4 | 1.2 | GO:0019827 | stem cell population maintenance(GO:0019827) |
| 0.4 | 0.4 | GO:0001845 | phagolysosome assembly(GO:0001845) phagosome-lysosome fusion(GO:0090385) |
| 0.4 | 0.8 | GO:0030101 | natural killer cell activation(GO:0030101) |
| 0.4 | 3.2 | GO:0030917 | midbrain-hindbrain boundary development(GO:0030917) |
| 0.4 | 1.6 | GO:1904048 | regulation of spontaneous neurotransmitter secretion(GO:1904048) |
| 0.4 | 1.6 | GO:0006542 | glutamine biosynthetic process(GO:0006542) |
| 0.4 | 2.7 | GO:1990539 | fructose transport(GO:0015755) fructose import(GO:0032445) carbohydrate import into cell(GO:0097319) carbohydrate import across plasma membrane(GO:0098704) fructose import across plasma membrane(GO:1990539) |
| 0.4 | 2.3 | GO:0043418 | homocysteine catabolic process(GO:0043418) |
| 0.4 | 1.2 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
| 0.4 | 1.9 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.4 | 2.3 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.4 | 1.5 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.4 | 1.5 | GO:0097676 | histone H3-K36 dimethylation(GO:0097676) |
| 0.4 | 1.9 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.4 | 0.7 | GO:1905064 | negative regulation of vascular smooth muscle cell differentiation(GO:1905064) |
| 0.4 | 0.7 | GO:0015920 | lipopolysaccharide transport(GO:0015920) |
| 0.4 | 1.8 | GO:2000638 | regulation of SREBP signaling pathway(GO:2000638) negative regulation of SREBP signaling pathway(GO:2000639) |
| 0.4 | 0.7 | GO:0060268 | negative regulation of respiratory burst(GO:0060268) |
| 0.4 | 1.4 | GO:1904844 | response to L-glutamine(GO:1904844) cellular response to L-glutamine(GO:1904845) |
| 0.4 | 2.2 | GO:0007352 | zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.4 | 1.8 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
| 0.4 | 4.3 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
| 0.4 | 1.4 | GO:0071393 | cellular response to progesterone stimulus(GO:0071393) |
| 0.3 | 0.3 | GO:0032416 | negative regulation of sodium:proton antiporter activity(GO:0032416) |
| 0.3 | 1.4 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) |
| 0.3 | 4.5 | GO:0021694 | cerebellar Purkinje cell layer formation(GO:0021694) cerebellar Purkinje cell differentiation(GO:0021702) |
| 0.3 | 1.4 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
| 0.3 | 2.3 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.3 | 4.0 | GO:0007379 | segment specification(GO:0007379) |
| 0.3 | 4.6 | GO:0060252 | positive regulation of glial cell proliferation(GO:0060252) |
| 0.3 | 0.3 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
| 0.3 | 1.0 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 0.3 | 0.3 | GO:0045648 | positive regulation of erythrocyte differentiation(GO:0045648) |
| 0.3 | 1.3 | GO:0000255 | allantoin metabolic process(GO:0000255) |
| 0.3 | 1.6 | GO:1902659 | regulation of glucose mediated signaling pathway(GO:1902659) |
| 0.3 | 3.2 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 0.3 | 1.0 | GO:0046732 | induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) |
| 0.3 | 1.9 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.3 | 0.3 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
| 0.3 | 0.9 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
| 0.3 | 1.2 | GO:0007538 | primary sex determination(GO:0007538) |
| 0.3 | 0.3 | GO:0072174 | metanephric tubule formation(GO:0072174) |
| 0.3 | 2.1 | GO:0043634 | polyadenylation-dependent ncRNA catabolic process(GO:0043634) |
| 0.3 | 1.2 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
| 0.3 | 2.1 | GO:0010452 | regulation of histone H3-K36 methylation(GO:0000414) histone H3-K36 methylation(GO:0010452) |
| 0.3 | 2.1 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) |
| 0.3 | 1.8 | GO:0090116 | C-5 methylation of cytosine(GO:0090116) |
| 0.3 | 1.8 | GO:0071321 | cellular response to cGMP(GO:0071321) |
| 0.3 | 7.5 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.3 | 1.1 | GO:0035616 | histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.3 | 2.3 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.3 | 2.0 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.3 | 1.1 | GO:0050850 | positive regulation of calcium-mediated signaling(GO:0050850) positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.3 | 0.6 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.3 | 0.6 | GO:0061010 | gall bladder development(GO:0061010) |
| 0.3 | 0.5 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
| 0.3 | 0.8 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.3 | 0.8 | GO:0009447 | putrescine catabolic process(GO:0009447) |
| 0.3 | 3.5 | GO:0021894 | cerebral cortex GABAergic interneuron development(GO:0021894) |
| 0.3 | 1.3 | GO:0019464 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.3 | 1.1 | GO:0021897 | forebrain astrocyte differentiation(GO:0021896) forebrain astrocyte development(GO:0021897) |
| 0.3 | 0.8 | GO:1903691 | positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
| 0.3 | 0.5 | GO:0061056 | sclerotome development(GO:0061056) |
| 0.3 | 0.8 | GO:0016260 | selenocysteine biosynthetic process(GO:0016260) |
| 0.3 | 1.6 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.3 | 0.5 | GO:1902866 | regulation of neural retina development(GO:0061074) regulation of retina development in camera-type eye(GO:1902866) |
| 0.3 | 0.8 | GO:0061188 | negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 0.3 | 0.8 | GO:0000967 | endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
| 0.3 | 1.3 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.2 | 0.5 | GO:0046886 | positive regulation of hormone biosynthetic process(GO:0046886) |
| 0.2 | 3.2 | GO:0051382 | kinetochore assembly(GO:0051382) |
| 0.2 | 0.7 | GO:0036071 | N-glycan fucosylation(GO:0036071) |
| 0.2 | 0.7 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.2 | 0.5 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.2 | 2.4 | GO:0002371 | dendritic cell cytokine production(GO:0002371) |
| 0.2 | 0.2 | GO:0060584 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
| 0.2 | 1.2 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.2 | 1.7 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
| 0.2 | 0.7 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.2 | 1.4 | GO:0046940 | nucleoside monophosphate phosphorylation(GO:0046940) |
| 0.2 | 1.2 | GO:0048539 | bone marrow development(GO:0048539) |
| 0.2 | 1.7 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
| 0.2 | 1.0 | GO:0046778 | modification by virus of host mRNA processing(GO:0046778) |
| 0.2 | 0.5 | GO:0072040 | regulation of mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:0072039) negative regulation of mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:0072040) mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:1901145) negative regulation of somatic stem cell population maintenance(GO:1904673) |
| 0.2 | 0.7 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
| 0.2 | 0.7 | GO:1990108 | protein linear deubiquitination(GO:1990108) |
| 0.2 | 3.3 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
| 0.2 | 0.2 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
| 0.2 | 0.5 | GO:0060061 | Spemann organizer formation(GO:0060061) |
| 0.2 | 1.6 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 0.2 | 0.7 | GO:0031938 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) regulation of chromatin silencing at telomere(GO:0031938) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 0.2 | 0.2 | GO:0010911 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
| 0.2 | 0.5 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.2 | 0.5 | GO:0048382 | mesendoderm development(GO:0048382) |
| 0.2 | 2.2 | GO:1904424 | regulation of GTP binding(GO:1904424) |
| 0.2 | 0.7 | GO:0070407 | oxidation-dependent protein catabolic process(GO:0070407) |
| 0.2 | 1.3 | GO:0030421 | defecation(GO:0030421) |
| 0.2 | 0.7 | GO:0061101 | neuroendocrine cell differentiation(GO:0061101) |
| 0.2 | 0.9 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
| 0.2 | 0.9 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
| 0.2 | 0.9 | GO:0021997 | response to chlorate(GO:0010157) neural plate axis specification(GO:0021997) |
| 0.2 | 0.2 | GO:0045736 | negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
| 0.2 | 1.3 | GO:0035709 | memory T cell activation(GO:0035709) regulation of memory T cell activation(GO:2000567) positive regulation of memory T cell activation(GO:2000568) |
| 0.2 | 4.5 | GO:0050855 | regulation of B cell receptor signaling pathway(GO:0050855) |
| 0.2 | 1.7 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.2 | 0.9 | GO:0042414 | epinephrine metabolic process(GO:0042414) epinephrine biosynthetic process(GO:0042418) |
| 0.2 | 1.9 | GO:0050847 | progesterone receptor signaling pathway(GO:0050847) |
| 0.2 | 0.6 | GO:1901993 | meiotic cell cycle phase transition(GO:0044771) regulation of meiotic cell cycle phase transition(GO:1901993) negative regulation of meiotic cell cycle phase transition(GO:1901994) |
| 0.2 | 1.5 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.2 | 0.4 | GO:0060168 | positive regulation of adenosine receptor signaling pathway(GO:0060168) |
| 0.2 | 2.3 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.2 | 0.9 | GO:0043697 | dedifferentiation(GO:0043696) cell dedifferentiation(GO:0043697) |
| 0.2 | 1.3 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.2 | 0.6 | GO:0019858 | cytosine metabolic process(GO:0019858) |
| 0.2 | 4.4 | GO:0042789 | mRNA transcription from RNA polymerase II promoter(GO:0042789) |
| 0.2 | 0.6 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.2 | 0.4 | GO:0072017 | distal tubule development(GO:0072017) |
| 0.2 | 2.3 | GO:0046831 | regulation of RNA export from nucleus(GO:0046831) |
| 0.2 | 0.6 | GO:0099553 | trans-synaptic signaling by lipid, modulating synaptic transmission(GO:0099552) trans-synaptic signaling by endocannabinoid, modulating synaptic transmission(GO:0099553) |
| 0.2 | 0.6 | GO:0043666 | regulation of phosphoprotein phosphatase activity(GO:0043666) |
| 0.2 | 0.4 | GO:0016458 | gene silencing(GO:0016458) |
| 0.2 | 0.8 | GO:0072093 | metanephric renal vesicle formation(GO:0072093) |
| 0.2 | 0.6 | GO:1900127 | positive regulation of hyaluronan biosynthetic process(GO:1900127) |
| 0.2 | 1.8 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.2 | 0.2 | GO:0008355 | olfactory learning(GO:0008355) |
| 0.2 | 0.8 | GO:0032898 | neurotrophin production(GO:0032898) |
| 0.2 | 0.4 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
| 0.2 | 0.8 | GO:0097010 | eukaryotic translation initiation factor 4F complex assembly(GO:0097010) |
| 0.2 | 0.2 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
| 0.2 | 2.0 | GO:0042940 | D-amino acid transport(GO:0042940) |
| 0.2 | 1.0 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.2 | 1.8 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.2 | 0.2 | GO:1903626 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
| 0.2 | 1.9 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.2 | 2.5 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
| 0.2 | 0.4 | GO:0097327 | response to antineoplastic agent(GO:0097327) |
| 0.2 | 0.6 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.2 | 0.8 | GO:0009224 | CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) CMP metabolic process(GO:0046035) |
| 0.2 | 0.6 | GO:0044210 | 'de novo' CTP biosynthetic process(GO:0044210) |
| 0.2 | 0.8 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
| 0.2 | 1.3 | GO:0021978 | telencephalon regionalization(GO:0021978) |
| 0.2 | 0.4 | GO:0033029 | regulation of neutrophil apoptotic process(GO:0033029) |
| 0.2 | 1.5 | GO:0006600 | creatine metabolic process(GO:0006600) |
| 0.2 | 0.9 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.2 | 0.2 | GO:0045742 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) |
| 0.2 | 0.7 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.2 | 2.1 | GO:0033227 | dsRNA transport(GO:0033227) |
| 0.2 | 0.6 | GO:0000973 | posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
| 0.2 | 0.9 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
| 0.2 | 0.4 | GO:0003099 | positive regulation of the force of heart contraction by chemical signal(GO:0003099) |
| 0.2 | 1.5 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
| 0.2 | 0.6 | GO:0100009 | regulation of fever generation by regulation of prostaglandin secretion(GO:0071810) positive regulation of fever generation by positive regulation of prostaglandin secretion(GO:0071812) positive regulation of ERK1 and ERK2 cascade via TNFSF11-mediated signaling(GO:0071848) regulation of fever generation by prostaglandin secretion(GO:0100009) |
| 0.2 | 0.7 | GO:1904504 | regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
| 0.2 | 0.2 | GO:0003241 | growth involved in heart morphogenesis(GO:0003241) |
| 0.2 | 2.0 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.2 | 0.9 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 0.2 | 0.4 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.2 | 8.9 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.2 | 0.5 | GO:0006333 | chromatin assembly or disassembly(GO:0006333) |
| 0.2 | 0.9 | GO:0009440 | cyanate metabolic process(GO:0009439) cyanate catabolic process(GO:0009440) |
| 0.2 | 0.4 | GO:1902724 | positive regulation of skeletal muscle cell proliferation(GO:0014858) positive regulation of skeletal muscle satellite cell proliferation(GO:1902724) positive regulation of growth factor dependent skeletal muscle satellite cell proliferation(GO:1902728) |
| 0.2 | 1.2 | GO:0038110 | interleukin-2-mediated signaling pathway(GO:0038110) |
| 0.2 | 1.9 | GO:0042023 | regulation of DNA endoreduplication(GO:0032875) DNA endoreduplication(GO:0042023) |
| 0.2 | 0.2 | GO:0070914 | UV-damage excision repair(GO:0070914) |
| 0.2 | 0.7 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.2 | 0.4 | GO:0021529 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.2 | 0.2 | GO:0045349 | interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) |
| 0.2 | 0.3 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.2 | 0.3 | GO:0014040 | positive regulation of Schwann cell differentiation(GO:0014040) |
| 0.2 | 1.2 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
| 0.2 | 0.7 | GO:0002032 | desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
| 0.2 | 0.7 | GO:0048254 | snoRNA localization(GO:0048254) |
| 0.2 | 0.2 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.2 | 1.0 | GO:0051036 | regulation of endosome size(GO:0051036) |
| 0.2 | 0.9 | GO:1901094 | regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
| 0.2 | 0.5 | GO:1904886 | beta-catenin destruction complex disassembly(GO:1904886) |
| 0.2 | 0.2 | GO:0010868 | negative regulation of triglyceride biosynthetic process(GO:0010868) |
| 0.2 | 0.5 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.2 | 0.5 | GO:0070902 | mitochondrial tRNA pseudouridine synthesis(GO:0070902) |
| 0.2 | 6.6 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.2 | 0.5 | GO:0006864 | pyrimidine nucleotide transport(GO:0006864) mitochondrial pyrimidine nucleotide import(GO:1990519) |
| 0.2 | 1.2 | GO:0048105 | establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 0.2 | 2.0 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.2 | 0.7 | GO:0050830 | defense response to Gram-positive bacterium(GO:0050830) |
| 0.2 | 1.5 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
| 0.2 | 0.5 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.2 | 0.3 | GO:0021650 | vestibulocochlear nerve formation(GO:0021650) |
| 0.2 | 0.2 | GO:1990167 | protein K27-linked deubiquitination(GO:1990167) |
| 0.2 | 2.1 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.2 | 0.3 | GO:1901143 | insulin catabolic process(GO:1901143) |
| 0.2 | 0.5 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
| 0.2 | 0.6 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
| 0.2 | 0.6 | GO:0072138 | mesenchymal cell proliferation involved in ureteric bud development(GO:0072138) mesonephric duct morphogenesis(GO:0072180) |
| 0.2 | 0.6 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.2 | 0.5 | GO:0002184 | cytoplasmic translational termination(GO:0002184) |
| 0.2 | 0.5 | GO:1903697 | negative regulation of microvillus assembly(GO:1903697) |
| 0.2 | 0.3 | GO:0035947 | regulation of gluconeogenesis by regulation of transcription from RNA polymerase II promoter(GO:0035947) |
| 0.2 | 0.9 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
| 0.2 | 0.5 | GO:0036058 | filtration diaphragm assembly(GO:0036058) slit diaphragm assembly(GO:0036060) |
| 0.2 | 0.3 | GO:0060166 | olfactory pit development(GO:0060166) |
| 0.2 | 0.5 | GO:0008050 | female courtship behavior(GO:0008050) |
| 0.2 | 0.6 | GO:1903566 | positive regulation of protein localization to cilium(GO:1903566) |
| 0.2 | 3.0 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
| 0.2 | 0.5 | GO:0050894 | determination of affect(GO:0050894) |
| 0.2 | 0.8 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 0.2 | 0.5 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.2 | 0.2 | GO:0051057 | positive regulation of small GTPase mediated signal transduction(GO:0051057) |
| 0.2 | 0.8 | GO:0071630 | nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
| 0.2 | 0.5 | GO:1902303 | negative regulation of potassium ion export(GO:1902303) |
| 0.1 | 0.4 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.1 | 1.0 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.1 | 0.4 | GO:0072709 | cellular response to sorbitol(GO:0072709) |
| 0.1 | 0.6 | GO:0050766 | positive regulation of phagocytosis(GO:0050766) |
| 0.1 | 1.0 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.1 | 0.6 | GO:0098703 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
| 0.1 | 0.1 | GO:0098923 | retrograde trans-synaptic signaling by soluble gas(GO:0098923) trans-synaptic signaling by soluble gas(GO:0099543) |
| 0.1 | 0.3 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
| 0.1 | 0.6 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) |
| 0.1 | 0.3 | GO:0031062 | positive regulation of histone methylation(GO:0031062) |
| 0.1 | 0.1 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
| 0.1 | 0.7 | GO:0001550 | ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.1 | 0.9 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.1 | 0.4 | GO:0042137 | sequestering of neurotransmitter(GO:0042137) |
| 0.1 | 0.3 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.1 | 0.1 | GO:1902850 | microtubule cytoskeleton organization involved in mitosis(GO:1902850) |
| 0.1 | 0.3 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
| 0.1 | 0.1 | GO:0045409 | negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
| 0.1 | 0.1 | GO:0060633 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) |
| 0.1 | 0.4 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
| 0.1 | 0.8 | GO:0031022 | nuclear migration along microfilament(GO:0031022) |
| 0.1 | 0.1 | GO:0015870 | acetylcholine transport(GO:0015870) |
| 0.1 | 0.4 | GO:1903033 | regulation of microtubule plus-end binding(GO:1903031) positive regulation of microtubule plus-end binding(GO:1903033) positive regulation of microtubule binding(GO:1904528) |
| 0.1 | 0.4 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.1 | 0.8 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
| 0.1 | 1.3 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
| 0.1 | 1.0 | GO:0090650 | response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
| 0.1 | 0.8 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.1 | 0.6 | GO:0033206 | meiotic cytokinesis(GO:0033206) |
| 0.1 | 11.1 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.1 | 0.5 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.1 | 0.7 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.1 | 2.6 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.1 | 0.4 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
| 0.1 | 0.4 | GO:1902161 | positive regulation of cyclic nucleotide-gated ion channel activity(GO:1902161) |
| 0.1 | 0.8 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
| 0.1 | 1.9 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
| 0.1 | 0.5 | GO:0071481 | cellular response to X-ray(GO:0071481) |
| 0.1 | 0.1 | GO:0010730 | negative regulation of hydrogen peroxide biosynthetic process(GO:0010730) |
| 0.1 | 5.5 | GO:0045841 | negative regulation of mitotic metaphase/anaphase transition(GO:0045841) negative regulation of metaphase/anaphase transition of cell cycle(GO:1902100) |
| 0.1 | 0.7 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.1 | 0.3 | GO:0072364 | regulation of cellular ketone metabolic process by regulation of transcription from RNA polymerase II promoter(GO:0072364) |
| 0.1 | 0.3 | GO:0021986 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.1 | 1.5 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.1 | 1.1 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 0.1 | 0.8 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.1 | 1.6 | GO:0021794 | thalamus development(GO:0021794) |
| 0.1 | 0.9 | GO:0044351 | macropinocytosis(GO:0044351) |
| 0.1 | 0.3 | GO:0014038 | regulation of Schwann cell differentiation(GO:0014038) |
| 0.1 | 0.5 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.1 | 2.0 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
| 0.1 | 0.1 | GO:0021877 | forebrain neuron fate commitment(GO:0021877) |
| 0.1 | 0.4 | GO:0045212 | negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 0.1 | 0.8 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.1 | 0.7 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.1 | 0.4 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.1 | 0.5 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 0.1 | 0.4 | GO:0010956 | negative regulation of calcidiol 1-monooxygenase activity(GO:0010956) |
| 0.1 | 1.4 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.1 | 2.7 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.1 | 2.1 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.1 | 0.6 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.1 | 0.3 | GO:0001782 | B cell homeostasis(GO:0001782) |
| 0.1 | 0.9 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
| 0.1 | 0.5 | GO:0072301 | regulation of metanephric glomerular mesangial cell proliferation(GO:0072301) |
| 0.1 | 0.6 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing by siRNA(GO:0090625) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.1 | 0.8 | GO:0048703 | embryonic viscerocranium morphogenesis(GO:0048703) |
| 0.1 | 0.9 | GO:0035585 | calcium-mediated signaling using extracellular calcium source(GO:0035585) |
| 0.1 | 1.5 | GO:0045475 | locomotor rhythm(GO:0045475) |
| 0.1 | 1.9 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
| 0.1 | 1.0 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.1 | 1.2 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
| 0.1 | 0.2 | GO:2000270 | regulation of fibroblast apoptotic process(GO:2000269) negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.1 | 0.1 | GO:1901796 | regulation of signal transduction by p53 class mediator(GO:1901796) |
| 0.1 | 0.4 | GO:0002316 | follicular B cell differentiation(GO:0002316) regulation of cytotoxic T cell degranulation(GO:0043317) negative regulation of cytotoxic T cell degranulation(GO:0043318) |
| 0.1 | 0.5 | GO:0060242 | contact inhibition(GO:0060242) |
| 0.1 | 0.5 | GO:0002326 | B cell lineage commitment(GO:0002326) |
| 0.1 | 0.4 | GO:1902230 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
| 0.1 | 0.4 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.1 | 1.2 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
| 0.1 | 4.0 | GO:0018146 | keratan sulfate biosynthetic process(GO:0018146) |
| 0.1 | 0.2 | GO:2001242 | regulation of intrinsic apoptotic signaling pathway(GO:2001242) |
| 0.1 | 2.2 | GO:0071539 | protein localization to centrosome(GO:0071539) |
| 0.1 | 0.2 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.1 | 0.2 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.1 | 0.4 | GO:0038043 | interleukin-5-mediated signaling pathway(GO:0038043) |
| 0.1 | 0.5 | GO:0061762 | CAMKK-AMPK signaling cascade(GO:0061762) |
| 0.1 | 0.2 | GO:1901098 | regulation of autophagosome maturation(GO:1901096) positive regulation of autophagosome maturation(GO:1901098) |
| 0.1 | 1.9 | GO:0060134 | prepulse inhibition(GO:0060134) |
| 0.1 | 3.7 | GO:0035456 | response to interferon-beta(GO:0035456) |
| 0.1 | 0.7 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 | 0.1 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
| 0.1 | 0.2 | GO:2001190 | positive regulation of T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:2001190) |
| 0.1 | 0.3 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
| 0.1 | 0.3 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.1 | 1.2 | GO:0021511 | spinal cord patterning(GO:0021511) |
| 0.1 | 1.5 | GO:0043555 | regulation of translation in response to stress(GO:0043555) |
| 0.1 | 0.8 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.1 | 0.7 | GO:0006561 | proline biosynthetic process(GO:0006561) L-proline biosynthetic process(GO:0055129) |
| 0.1 | 0.1 | GO:0010266 | response to vitamin B1(GO:0010266) |
| 0.1 | 1.2 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
| 0.1 | 0.3 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.1 | 0.6 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
| 0.1 | 0.1 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) type B pancreatic cell maturation(GO:0072560) |
| 0.1 | 1.9 | GO:0031498 | chromatin disassembly(GO:0031498) |
| 0.1 | 1.6 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.1 | 0.3 | GO:0043132 | FAD transport(GO:0015883) FAD transmembrane transport(GO:0035350) NAD transport(GO:0043132) |
| 0.1 | 0.4 | GO:0030853 | negative regulation of granulocyte differentiation(GO:0030853) |
| 0.1 | 0.2 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.1 | 2.1 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
| 0.1 | 0.6 | GO:0035865 | cellular response to potassium ion(GO:0035865) |
| 0.1 | 0.9 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
| 0.1 | 1.2 | GO:0031935 | regulation of chromatin silencing(GO:0031935) |
| 0.1 | 0.8 | GO:1904996 | positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 0.1 | 0.4 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
| 0.1 | 0.1 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
| 0.1 | 0.1 | GO:2001187 | positive regulation of CD8-positive, alpha-beta T cell activation(GO:2001187) |
| 0.1 | 0.5 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.1 | 0.9 | GO:0030851 | granulocyte differentiation(GO:0030851) |
| 0.1 | 0.9 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.1 | 0.3 | GO:0043615 | astrocyte cell migration(GO:0043615) |
| 0.1 | 0.6 | GO:0098707 | ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
| 0.1 | 0.6 | GO:0042428 | serotonin metabolic process(GO:0042428) |
| 0.1 | 0.8 | GO:0043631 | RNA polyadenylation(GO:0043631) |
| 0.1 | 0.5 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.1 | 1.4 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.1 | 1.1 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.1 | 0.4 | GO:0048536 | spleen development(GO:0048536) |
| 0.1 | 0.4 | GO:0097089 | methyl-branched fatty acid metabolic process(GO:0097089) |
| 0.1 | 0.1 | GO:0002644 | negative regulation of tolerance induction(GO:0002644) |
| 0.1 | 0.4 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
| 0.1 | 0.9 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
| 0.1 | 0.5 | GO:1902775 | mitochondrial ribosome assembly(GO:0061668) mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.1 | 0.1 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.1 | 0.3 | GO:0039656 | modulation by virus of host gene expression(GO:0039656) |
| 0.1 | 0.2 | GO:1990737 | response to manganese-induced endoplasmic reticulum stress(GO:1990737) |
| 0.1 | 0.2 | GO:0045905 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.1 | 0.2 | GO:0035712 | T-helper 2 cell activation(GO:0035712) regulation of T-helper 2 cell activation(GO:2000569) positive regulation of T-helper 2 cell activation(GO:2000570) |
| 0.1 | 0.4 | GO:0006850 | mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
| 0.1 | 0.6 | GO:0097396 | response to interleukin-17(GO:0097396) cellular response to interleukin-17(GO:0097398) |
| 0.1 | 0.3 | GO:0034371 | chylomicron remodeling(GO:0034371) |
| 0.1 | 0.6 | GO:0070375 | ERK5 cascade(GO:0070375) |
| 0.1 | 0.5 | GO:0006379 | mRNA cleavage(GO:0006379) |
| 0.1 | 0.3 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
| 0.1 | 1.2 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.1 | 0.2 | GO:0046166 | glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 0.1 | 4.1 | GO:0006735 | NADH regeneration(GO:0006735) canonical glycolysis(GO:0061621) glucose catabolic process to pyruvate(GO:0061718) |
| 0.1 | 0.4 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
| 0.1 | 0.8 | GO:0030279 | negative regulation of ossification(GO:0030279) |
| 0.1 | 0.3 | GO:0051342 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
| 0.1 | 3.8 | GO:0043486 | histone exchange(GO:0043486) |
| 0.1 | 0.2 | GO:1900138 | negative regulation of icosanoid secretion(GO:0032304) negative regulation of phospholipase A2 activity(GO:1900138) |
| 0.1 | 0.4 | GO:0036496 | regulation of translational initiation by eIF2 alpha dephosphorylation(GO:0036496) |
| 0.1 | 1.7 | GO:0050965 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
| 0.1 | 1.1 | GO:0007289 | spermatid nucleus differentiation(GO:0007289) |
| 0.1 | 0.7 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.1 | 2.4 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.1 | 0.2 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
| 0.1 | 0.2 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.1 | 0.8 | GO:2001300 | lipoxin metabolic process(GO:2001300) |
| 0.1 | 0.4 | GO:1904251 | regulation of bile acid metabolic process(GO:1904251) |
| 0.1 | 0.3 | GO:0050902 | leukocyte adhesive activation(GO:0050902) |
| 0.1 | 0.8 | GO:0001866 | NK T cell proliferation(GO:0001866) |
| 0.1 | 1.2 | GO:1901522 | positive regulation of transcription from RNA polymerase II promoter involved in cellular response to chemical stimulus(GO:1901522) |
| 0.1 | 0.1 | GO:0021747 | cochlear nucleus development(GO:0021747) |
| 0.1 | 0.6 | GO:0010265 | SCF complex assembly(GO:0010265) |
| 0.1 | 0.6 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.1 | 0.4 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.1 | 0.5 | GO:0072079 | nephron tubule formation(GO:0072079) |
| 0.1 | 0.3 | GO:0044208 | 'de novo' AMP biosynthetic process(GO:0044208) |
| 0.1 | 0.2 | GO:0031622 | positive regulation of fever generation(GO:0031622) |
| 0.1 | 3.1 | GO:0007020 | microtubule nucleation(GO:0007020) |
| 0.1 | 1.1 | GO:1904380 | endoplasmic reticulum mannose trimming(GO:1904380) |
| 0.1 | 0.1 | GO:0001743 | optic placode formation(GO:0001743) |
| 0.1 | 1.5 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
| 0.1 | 0.2 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
| 0.1 | 1.6 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.1 | 0.1 | GO:0051459 | regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.1 | 0.9 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) |
| 0.1 | 0.8 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.1 | 5.9 | GO:0050853 | B cell receptor signaling pathway(GO:0050853) |
| 0.1 | 0.4 | GO:1904029 | regulation of cyclin-dependent protein kinase activity(GO:1904029) |
| 0.1 | 0.4 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
| 0.1 | 0.4 | GO:0010867 | positive regulation of triglyceride biosynthetic process(GO:0010867) |
| 0.1 | 0.7 | GO:1904152 | regulation of retrograde protein transport, ER to cytosol(GO:1904152) |
| 0.1 | 0.8 | GO:0072520 | seminiferous tubule development(GO:0072520) |
| 0.1 | 0.2 | GO:0043144 | snoRNA processing(GO:0043144) |
| 0.1 | 1.1 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.1 | 0.5 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
| 0.1 | 0.1 | GO:0071372 | cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
| 0.1 | 0.3 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
| 0.1 | 4.0 | GO:0046677 | response to antibiotic(GO:0046677) |
| 0.1 | 0.6 | GO:0050729 | positive regulation of inflammatory response(GO:0050729) |
| 0.1 | 0.3 | GO:0070384 | Harderian gland development(GO:0070384) |
| 0.1 | 0.2 | GO:0097503 | sialylation(GO:0097503) |
| 0.1 | 0.4 | GO:0061088 | regulation of sequestering of zinc ion(GO:0061088) |
| 0.1 | 0.7 | GO:0090199 | regulation of release of cytochrome c from mitochondria(GO:0090199) |
| 0.1 | 0.3 | GO:0021691 | cerebellum maturation(GO:0021590) cerebellar Purkinje cell layer maturation(GO:0021691) cerebellar cortex maturation(GO:0021699) |
| 0.1 | 0.3 | GO:0015917 | aminophospholipid transport(GO:0015917) |
| 0.1 | 1.7 | GO:0039529 | RIG-I signaling pathway(GO:0039529) |
| 0.1 | 0.2 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.1 | 0.4 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
| 0.1 | 0.8 | GO:0002755 | MyD88-dependent toll-like receptor signaling pathway(GO:0002755) |
| 0.1 | 1.3 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
| 0.1 | 0.2 | GO:0042938 | dipeptide transport(GO:0042938) |
| 0.1 | 1.2 | GO:0060148 | positive regulation of posttranscriptional gene silencing(GO:0060148) positive regulation of gene silencing by miRNA(GO:2000637) |
| 0.1 | 0.5 | GO:0010579 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
| 0.1 | 0.5 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.1 | 0.2 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
| 0.1 | 0.3 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
| 0.1 | 1.2 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.1 | 0.4 | GO:0046425 | regulation of JAK-STAT cascade(GO:0046425) regulation of STAT cascade(GO:1904892) |
| 0.1 | 1.9 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.1 | 0.2 | GO:1903660 | negative regulation of complement-dependent cytotoxicity(GO:1903660) |
| 0.1 | 0.3 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.1 | 0.3 | GO:0051353 | positive regulation of oxidoreductase activity(GO:0051353) |
| 0.1 | 1.3 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.1 | 0.4 | GO:0080009 | mRNA methylation(GO:0080009) |
| 0.1 | 0.2 | GO:0070901 | mitochondrial tRNA methylation(GO:0070901) |
| 0.1 | 0.2 | GO:2000824 | negative regulation of androgen receptor activity(GO:2000824) |
| 0.1 | 0.2 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.1 | 1.8 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.1 | 0.2 | GO:0021571 | rhombomere 5 development(GO:0021571) |
| 0.1 | 0.5 | GO:0002249 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 0.1 | 0.5 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
| 0.1 | 0.3 | GO:0046452 | dihydrofolate metabolic process(GO:0046452) |
| 0.1 | 0.6 | GO:0019896 | axonal transport of mitochondrion(GO:0019896) |
| 0.1 | 1.1 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
| 0.1 | 0.2 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.1 | 0.2 | GO:1903019 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) negative regulation of glycoprotein metabolic process(GO:1903019) |
| 0.1 | 0.2 | GO:0030300 | regulation of intestinal cholesterol absorption(GO:0030300) regulation of intestinal lipid absorption(GO:1904729) |
| 0.1 | 0.5 | GO:1903297 | regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
| 0.1 | 0.2 | GO:0051085 | 'de novo' posttranslational protein folding(GO:0051084) chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.1 | 0.1 | GO:0032785 | negative regulation of DNA-templated transcription, elongation(GO:0032785) negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.1 | 0.2 | GO:0046368 | GDP-L-fucose biosynthetic process(GO:0042350) 'de novo' GDP-L-fucose biosynthetic process(GO:0042351) GDP-L-fucose metabolic process(GO:0046368) |
| 0.1 | 0.2 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.1 | 0.8 | GO:1903943 | regulation of hepatocyte apoptotic process(GO:1903943) negative regulation of hepatocyte apoptotic process(GO:1903944) |
| 0.1 | 0.5 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
| 0.1 | 0.8 | GO:0070072 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.1 | 1.1 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
| 0.1 | 0.4 | GO:0006354 | DNA-templated transcription, elongation(GO:0006354) |
| 0.1 | 0.2 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
| 0.1 | 0.1 | GO:0072300 | positive regulation of metanephric glomerulus development(GO:0072300) |
| 0.1 | 0.2 | GO:0086048 | membrane depolarization during bundle of His cell action potential(GO:0086048) |
| 0.1 | 0.6 | GO:0051096 | positive regulation of helicase activity(GO:0051096) |
| 0.1 | 0.1 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
| 0.1 | 0.1 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
| 0.1 | 0.6 | GO:0034453 | microtubule anchoring(GO:0034453) |
| 0.1 | 0.1 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) |
| 0.1 | 0.4 | GO:0021759 | globus pallidus development(GO:0021759) |
| 0.1 | 1.2 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 0.1 | 0.2 | GO:0009636 | response to toxic substance(GO:0009636) |
| 0.1 | 0.4 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.1 | 0.4 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
| 0.1 | 0.3 | GO:0051383 | kinetochore organization(GO:0051383) |
| 0.1 | 0.9 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
| 0.1 | 0.4 | GO:0072502 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.1 | 0.3 | GO:0050966 | detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
| 0.1 | 0.1 | GO:0048668 | collateral sprouting(GO:0048668) |
| 0.1 | 0.1 | GO:1903378 | positive regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903378) |
| 0.1 | 0.3 | GO:0006740 | NADPH regeneration(GO:0006740) |
| 0.1 | 4.9 | GO:0006334 | nucleosome assembly(GO:0006334) |
| 0.1 | 1.1 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
| 0.1 | 0.4 | GO:0060896 | neural plate pattern specification(GO:0060896) |
| 0.1 | 0.2 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.1 | 0.1 | GO:0033024 | serotonin production involved in inflammatory response(GO:0002351) serotonin secretion involved in inflammatory response(GO:0002442) serotonin secretion by platelet(GO:0002554) mast cell homeostasis(GO:0033023) mast cell apoptotic process(GO:0033024) regulation of mast cell apoptotic process(GO:0033025) |
| 0.1 | 0.6 | GO:0070314 | G1 to G0 transition(GO:0070314) |
| 0.1 | 1.3 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
| 0.1 | 1.0 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
| 0.1 | 0.4 | GO:0006015 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.1 | 0.1 | GO:0009620 | response to fungus(GO:0009620) |
| 0.1 | 0.1 | GO:0072528 | pyrimidine-containing compound biosynthetic process(GO:0072528) |
| 0.1 | 0.4 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
| 0.1 | 1.6 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
| 0.1 | 0.1 | GO:0048147 | negative regulation of fibroblast proliferation(GO:0048147) |
| 0.1 | 0.3 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.1 | 0.3 | GO:1903748 | negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
| 0.1 | 0.1 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.1 | 0.2 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
| 0.1 | 0.6 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.1 | 1.0 | GO:0016246 | RNA interference(GO:0016246) |
| 0.1 | 0.3 | GO:0070669 | response to interleukin-2(GO:0070669) |
| 0.1 | 0.1 | GO:0003383 | apical constriction(GO:0003383) |
| 0.1 | 0.3 | GO:0035815 | positive regulation of renal sodium excretion(GO:0035815) |
| 0.1 | 0.3 | GO:0060013 | righting reflex(GO:0060013) |
| 0.1 | 0.2 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.1 | 0.4 | GO:0009099 | branched-chain amino acid biosynthetic process(GO:0009082) leucine biosynthetic process(GO:0009098) valine biosynthetic process(GO:0009099) |
| 0.1 | 0.1 | GO:0060467 | negative regulation of fertilization(GO:0060467) |
| 0.1 | 1.1 | GO:0090659 | walking behavior(GO:0090659) |
| 0.1 | 0.3 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
| 0.1 | 0.3 | GO:0033182 | regulation of histone ubiquitination(GO:0033182) |
| 0.1 | 0.6 | GO:0032264 | IMP salvage(GO:0032264) |
| 0.1 | 0.6 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
| 0.1 | 0.1 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 0.1 | 0.7 | GO:1990845 | adaptive thermogenesis(GO:1990845) |
| 0.1 | 0.2 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.1 | 0.3 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.1 | 0.7 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
| 0.1 | 0.8 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.1 | 1.0 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.1 | 0.5 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.1 | 0.9 | GO:0038092 | nodal signaling pathway(GO:0038092) |
| 0.1 | 0.4 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
| 0.1 | 0.2 | GO:0046929 | negative regulation of neurotransmitter secretion(GO:0046929) |
| 0.1 | 0.9 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
| 0.1 | 0.5 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.1 | 0.2 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 0.1 | 0.3 | GO:1900154 | regulation of bone trabecula formation(GO:1900154) negative regulation of bone trabecula formation(GO:1900155) |
| 0.1 | 0.3 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
| 0.1 | 0.2 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.1 | 0.1 | GO:0070459 | prolactin secretion(GO:0070459) |
| 0.1 | 1.0 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
| 0.1 | 0.4 | GO:0045007 | depurination(GO:0045007) |
| 0.1 | 0.1 | GO:0044806 | G-quadruplex DNA unwinding(GO:0044806) |
| 0.1 | 0.8 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.1 | 0.1 | GO:0051866 | general adaptation syndrome(GO:0051866) |
| 0.1 | 2.8 | GO:0034968 | histone lysine methylation(GO:0034968) |
| 0.1 | 0.3 | GO:0035879 | plasma membrane lactate transport(GO:0035879) |
| 0.1 | 1.6 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.1 | 0.6 | GO:0032740 | positive regulation of interleukin-17 production(GO:0032740) |
| 0.1 | 0.4 | GO:0042045 | epithelial fluid transport(GO:0042045) |
| 0.1 | 0.2 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
| 0.1 | 0.2 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.1 | 1.0 | GO:0045199 | maintenance of apical/basal cell polarity(GO:0035090) maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.1 | 0.2 | GO:0070900 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
| 0.1 | 0.4 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.1 | 0.4 | GO:0032480 | negative regulation of type I interferon production(GO:0032480) |
| 0.1 | 0.6 | GO:0033623 | regulation of integrin activation(GO:0033623) |
| 0.1 | 0.2 | GO:2000781 | positive regulation of double-strand break repair(GO:2000781) |
| 0.1 | 0.2 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.1 | 0.4 | GO:0039528 | cytoplasmic pattern recognition receptor signaling pathway in response to virus(GO:0039528) |
| 0.1 | 0.3 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.1 | 0.2 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.1 | 1.3 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.1 | 0.2 | GO:0035621 | ER to Golgi ceramide transport(GO:0035621) |
| 0.1 | 0.3 | GO:0019348 | dolichol metabolic process(GO:0019348) |
| 0.1 | 0.2 | GO:0018198 | protein nitrosylation(GO:0017014) peptidyl-cysteine S-nitrosylation(GO:0018119) peptidyl-cysteine modification(GO:0018198) regulation of peptidyl-cysteine S-nitrosylation(GO:2000169) |
| 0.1 | 0.4 | GO:0070235 | regulation of activation-induced cell death of T cells(GO:0070235) negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.1 | 0.2 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.1 | 0.3 | GO:0045006 | DNA deamination(GO:0045006) DNA cytosine deamination(GO:0070383) |
| 0.1 | 0.2 | GO:0008584 | male gonad development(GO:0008584) development of primary male sexual characteristics(GO:0046546) |
| 0.1 | 0.3 | GO:0036115 | fatty-acyl-CoA catabolic process(GO:0036115) |
| 0.1 | 0.8 | GO:0001504 | neurotransmitter uptake(GO:0001504) |
| 0.1 | 0.2 | GO:1903236 | regulation of leukocyte tethering or rolling(GO:1903236) negative regulation of leukocyte tethering or rolling(GO:1903237) |
| 0.1 | 0.5 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 0.1 | 0.2 | GO:0016240 | autophagosome docking(GO:0016240) |
| 0.1 | 0.1 | GO:1901079 | positive regulation of relaxation of muscle(GO:1901079) |
| 0.1 | 0.5 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.1 | 0.2 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) |
| 0.1 | 1.4 | GO:0051602 | response to electrical stimulus(GO:0051602) |
| 0.1 | 0.5 | GO:0014809 | regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014809) |
| 0.1 | 0.3 | GO:0015862 | uridine transport(GO:0015862) |
| 0.1 | 0.1 | GO:0034976 | response to endoplasmic reticulum stress(GO:0034976) |
| 0.1 | 1.0 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.1 | 0.5 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.1 | 0.2 | GO:0060372 | regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) |
| 0.1 | 0.5 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
| 0.1 | 0.3 | GO:1990822 | basic amino acid transmembrane transport(GO:1990822) |
| 0.1 | 0.3 | GO:1902896 | terminal web assembly(GO:1902896) |
| 0.1 | 0.3 | GO:0043316 | cytotoxic T cell degranulation(GO:0043316) |
| 0.1 | 0.1 | GO:0051560 | mitochondrial calcium ion homeostasis(GO:0051560) |
| 0.1 | 4.2 | GO:0070126 | mitochondrial translational elongation(GO:0070125) mitochondrial translational termination(GO:0070126) |
| 0.1 | 0.9 | GO:1904816 | positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
| 0.1 | 0.1 | GO:0007185 | transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
| 0.1 | 0.1 | GO:0005988 | lactose metabolic process(GO:0005988) lactose biosynthetic process(GO:0005989) |
| 0.1 | 0.8 | GO:0055090 | acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
| 0.1 | 1.2 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
| 0.1 | 0.2 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.1 | 0.4 | GO:0015791 | polyol transport(GO:0015791) |
| 0.1 | 0.3 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
| 0.1 | 0.1 | GO:1903721 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.1 | 0.6 | GO:0051451 | myoblast migration(GO:0051451) |
| 0.1 | 0.2 | GO:0042539 | hypotonic salinity response(GO:0042539) cellular hypotonic salinity response(GO:0071477) |
| 0.1 | 2.0 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
| 0.1 | 0.3 | GO:0007571 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 0.1 | 3.1 | GO:0035722 | interleukin-12-mediated signaling pathway(GO:0035722) cellular response to interleukin-12(GO:0071349) |
| 0.1 | 0.2 | GO:0060481 | lobar bronchus epithelium development(GO:0060481) |
| 0.1 | 0.9 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.1 | 0.4 | GO:0060371 | regulation of atrial cardiac muscle cell membrane depolarization(GO:0060371) |
| 0.1 | 0.1 | GO:0003220 | left ventricular cardiac muscle tissue morphogenesis(GO:0003220) |
| 0.1 | 0.4 | GO:1990118 | sodium ion import(GO:0097369) sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.1 | 0.3 | GO:0030070 | insulin processing(GO:0030070) |
| 0.1 | 0.1 | GO:0010533 | regulation of activation of Janus kinase activity(GO:0010533) |
| 0.1 | 1.1 | GO:0032011 | ARF protein signal transduction(GO:0032011) |
| 0.1 | 0.5 | GO:0042474 | middle ear morphogenesis(GO:0042474) |
| 0.1 | 0.2 | GO:1904978 | regulation of endosome organization(GO:1904978) |
| 0.1 | 0.1 | GO:0010559 | regulation of glycoprotein biosynthetic process(GO:0010559) amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.1 | 0.7 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.1 | 0.3 | GO:2000825 | positive regulation of androgen receptor activity(GO:2000825) |
| 0.1 | 0.2 | GO:0021680 | cerebellar Purkinje cell layer development(GO:0021680) |
| 0.1 | 0.2 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.1 | 0.2 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.1 | 0.2 | GO:0033385 | geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
| 0.1 | 0.5 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
| 0.1 | 0.3 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.1 | 0.3 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.1 | 0.4 | GO:0060117 | auditory receptor cell development(GO:0060117) |
| 0.1 | 0.1 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.1 | 0.3 | GO:0034311 | sphingosine metabolic process(GO:0006670) diol metabolic process(GO:0034311) |
| 0.1 | 0.1 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) |
| 0.1 | 0.3 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.1 | 0.1 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
| 0.1 | 0.3 | GO:1990403 | embryonic brain development(GO:1990403) |
| 0.1 | 0.4 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.1 | 0.2 | GO:0010165 | response to X-ray(GO:0010165) |
| 0.1 | 0.2 | GO:0007198 | adenylate cyclase-inhibiting serotonin receptor signaling pathway(GO:0007198) |
| 0.1 | 0.2 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.1 | 1.1 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
| 0.1 | 0.3 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.1 | 0.5 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.1 | 0.1 | GO:0006425 | glutaminyl-tRNA aminoacylation(GO:0006425) |
| 0.1 | 4.5 | GO:0016925 | protein sumoylation(GO:0016925) |
| 0.1 | 0.3 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
| 0.1 | 0.5 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.1 | 0.2 | GO:0072539 | T-helper 17 cell differentiation(GO:0072539) |
| 0.1 | 0.3 | GO:0071625 | vocalization behavior(GO:0071625) |
| 0.0 | 0.3 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.0 | 0.4 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) |
| 0.0 | 0.2 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
| 0.0 | 0.1 | GO:1903595 | positive regulation of histamine secretion by mast cell(GO:1903595) |
| 0.0 | 0.6 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
| 0.0 | 0.5 | GO:0046599 | regulation of centriole replication(GO:0046599) |
| 0.0 | 0.8 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
| 0.0 | 1.5 | GO:0006198 | cAMP catabolic process(GO:0006198) |
| 0.0 | 0.1 | GO:0032847 | regulation of cellular pH reduction(GO:0032847) |
| 0.0 | 0.1 | GO:0009409 | response to cold(GO:0009409) |
| 0.0 | 0.7 | GO:0000291 | nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
| 0.0 | 0.1 | GO:1904688 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.0 | 0.1 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.0 | 0.5 | GO:0006782 | protoporphyrinogen IX biosynthetic process(GO:0006782) |
| 0.0 | 0.1 | GO:0001766 | membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) membrane raft localization(GO:0051665) |
| 0.0 | 0.4 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
| 0.0 | 0.0 | GO:0055026 | negative regulation of cardiac muscle tissue development(GO:0055026) |
| 0.0 | 0.7 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.0 | 0.1 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
| 0.0 | 0.1 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
| 0.0 | 0.4 | GO:0007512 | adult heart development(GO:0007512) |
| 0.0 | 0.2 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 0.0 | 2.1 | GO:0016575 | histone deacetylation(GO:0016575) |
| 0.0 | 1.1 | GO:0035640 | exploration behavior(GO:0035640) |
| 0.0 | 0.5 | GO:0006069 | ethanol oxidation(GO:0006069) |
| 0.0 | 0.7 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.0 | 0.1 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.0 | 0.1 | GO:0042756 | drinking behavior(GO:0042756) |
| 0.0 | 0.3 | GO:0042797 | 5S class rRNA transcription from RNA polymerase III type 1 promoter(GO:0042791) tRNA transcription from RNA polymerase III promoter(GO:0042797) |
| 0.0 | 0.4 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
| 0.0 | 0.0 | GO:0060535 | lobar bronchus development(GO:0060482) trachea cartilage morphogenesis(GO:0060535) renal inner medulla development(GO:0072053) renal outer medulla development(GO:0072054) |
| 0.0 | 0.3 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.0 | 0.1 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.0 | 0.5 | GO:0010666 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.0 | 0.2 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
| 0.0 | 0.1 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
| 0.0 | 0.0 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
| 0.0 | 0.2 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
| 0.0 | 3.6 | GO:0065004 | protein-DNA complex assembly(GO:0065004) |
| 0.0 | 0.2 | GO:0072367 | regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) |
| 0.0 | 0.0 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
| 0.0 | 0.6 | GO:0097034 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.0 | 0.0 | GO:1990481 | mRNA pseudouridine synthesis(GO:1990481) |
| 0.0 | 0.3 | GO:0007631 | feeding behavior(GO:0007631) |
| 0.0 | 0.2 | GO:0007625 | grooming behavior(GO:0007625) |
| 0.0 | 0.3 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.0 | 0.3 | GO:2000696 | regulation of epithelial cell differentiation involved in kidney development(GO:2000696) |
| 0.0 | 0.6 | GO:0006342 | chromatin silencing(GO:0006342) |
| 0.0 | 0.2 | GO:0006668 | sphinganine-1-phosphate metabolic process(GO:0006668) |
| 0.0 | 0.2 | GO:0009048 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.0 | 0.2 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.0 | 0.1 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.0 | 0.0 | GO:0098905 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) regulation of bundle of His cell action potential(GO:0098905) |
| 0.0 | 0.1 | GO:0032776 | DNA methylation on cytosine(GO:0032776) |
| 0.0 | 0.1 | GO:0044782 | cilium organization(GO:0044782) |
| 0.0 | 0.1 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.0 | 0.2 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
| 0.0 | 0.4 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.0 | 0.1 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
| 0.0 | 0.1 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
| 0.0 | 0.5 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.0 | 0.3 | GO:0019043 | establishment of viral latency(GO:0019043) |
| 0.0 | 0.9 | GO:0032878 | regulation of establishment or maintenance of cell polarity(GO:0032878) |
| 0.0 | 0.5 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) mitotic G2/M transition checkpoint(GO:0044818) |
| 0.0 | 0.4 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
| 0.0 | 0.1 | GO:0006478 | peptidyl-tyrosine sulfation(GO:0006478) |
| 0.0 | 0.4 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.0 | 0.3 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
| 0.0 | 0.0 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
| 0.0 | 0.1 | GO:0006581 | acetylcholine catabolic process in synaptic cleft(GO:0001507) acetylcholine catabolic process(GO:0006581) |
| 0.0 | 0.0 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
| 0.0 | 0.4 | GO:0039694 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.0 | 0.6 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
| 0.0 | 0.1 | GO:0032053 | ciliary basal body organization(GO:0032053) cerebrospinal fluid secretion(GO:0033326) |
| 0.0 | 0.4 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.0 | 0.2 | GO:0006402 | mRNA catabolic process(GO:0006402) |
| 0.0 | 0.1 | GO:0071806 | intracellular protein transmembrane transport(GO:0065002) protein transmembrane transport(GO:0071806) |
| 0.0 | 0.2 | GO:0098734 | macromolecule depalmitoylation(GO:0098734) |
| 0.0 | 3.2 | GO:0006687 | glycosphingolipid metabolic process(GO:0006687) |
| 0.0 | 0.2 | GO:0042346 | positive regulation of NF-kappaB import into nucleus(GO:0042346) |
| 0.0 | 0.2 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
| 0.0 | 0.1 | GO:0048631 | regulation of skeletal muscle tissue growth(GO:0048631) |
| 0.0 | 0.8 | GO:0032508 | DNA duplex unwinding(GO:0032508) |
| 0.0 | 0.4 | GO:0006183 | GTP biosynthetic process(GO:0006183) |
| 0.0 | 0.0 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
| 0.0 | 0.2 | GO:0035878 | nail development(GO:0035878) |
| 0.0 | 0.2 | GO:0021924 | cell proliferation in external granule layer(GO:0021924) cerebellar granule cell precursor proliferation(GO:0021930) |
| 0.0 | 0.2 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.0 | 0.6 | GO:1901985 | positive regulation of protein acetylation(GO:1901985) |
| 0.0 | 0.1 | GO:0099624 | atrial cardiac muscle cell membrane repolarization(GO:0099624) |
| 0.0 | 0.2 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.0 | 0.5 | GO:0033119 | negative regulation of RNA splicing(GO:0033119) |
| 0.0 | 0.3 | GO:0008213 | protein methylation(GO:0006479) protein alkylation(GO:0008213) |
| 0.0 | 0.1 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
| 0.0 | 0.7 | GO:0019722 | calcium-mediated signaling(GO:0019722) |
| 0.0 | 0.1 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 | 0.3 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.0 | 0.1 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.0 | 0.2 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.0 | 0.3 | GO:1903351 | response to dopamine(GO:1903350) cellular response to dopamine(GO:1903351) |
| 0.0 | 0.2 | GO:0006538 | glutamate catabolic process(GO:0006538) |
| 0.0 | 0.1 | GO:0070424 | regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 0.0 | 0.1 | GO:0052055 | modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.0 | 0.2 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.0 | 0.1 | GO:1903725 | regulation of phospholipid metabolic process(GO:1903725) |
| 0.0 | 0.1 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.0 | 0.1 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
| 0.0 | 0.2 | GO:0001976 | neurological system process involved in regulation of systemic arterial blood pressure(GO:0001976) |
| 0.0 | 0.1 | GO:0060126 | somatotropin secreting cell differentiation(GO:0060126) |
| 0.0 | 0.1 | GO:0046081 | dUTP metabolic process(GO:0046080) dUTP catabolic process(GO:0046081) |
| 0.0 | 0.3 | GO:1900153 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.0 | 0.1 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) |
| 0.0 | 0.5 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
| 0.0 | 0.0 | GO:0014004 | microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.0 | 0.0 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
| 0.0 | 0.4 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.0 | 0.2 | GO:0002115 | store-operated calcium entry(GO:0002115) |
| 0.0 | 0.7 | GO:0016254 | preassembly of GPI anchor in ER membrane(GO:0016254) |
| 0.0 | 0.4 | GO:0006972 | hyperosmotic response(GO:0006972) |
| 0.0 | 0.4 | GO:0071545 | inositol phosphate catabolic process(GO:0071545) |
| 0.0 | 0.6 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
| 0.0 | 0.1 | GO:0070781 | response to biotin(GO:0070781) |
| 0.0 | 0.1 | GO:0002467 | germinal center formation(GO:0002467) |
| 0.0 | 0.5 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.0 | 0.5 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.0 | 0.5 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.0 | 0.2 | GO:0071318 | cellular response to ATP(GO:0071318) |
| 0.0 | 0.2 | GO:0008277 | regulation of G-protein coupled receptor protein signaling pathway(GO:0008277) |
| 0.0 | 0.8 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
| 0.0 | 0.5 | GO:0002523 | leukocyte migration involved in inflammatory response(GO:0002523) |
| 0.0 | 0.1 | GO:0045780 | positive regulation of bone resorption(GO:0045780) positive regulation of bone remodeling(GO:0046852) |
| 0.0 | 0.1 | GO:0075044 | autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
| 0.0 | 0.2 | GO:0014029 | neural crest formation(GO:0014029) |
| 0.0 | 0.1 | GO:1902570 | protein localization to nucleolus(GO:1902570) |
| 0.0 | 0.1 | GO:0097210 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.0 | 0.8 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.0 | 0.1 | GO:0006409 | tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.0 | 0.6 | GO:0050796 | regulation of insulin secretion(GO:0050796) |
| 0.0 | 0.1 | GO:0038193 | thromboxane A2 signaling pathway(GO:0038193) |
| 0.0 | 0.1 | GO:0035564 | regulation of kidney size(GO:0035564) |
| 0.0 | 0.1 | GO:0033344 | cholesterol efflux(GO:0033344) |
| 0.0 | 0.3 | GO:0000466 | maturation of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000466) |
| 0.0 | 0.3 | GO:0042355 | fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
| 0.0 | 0.1 | GO:0021510 | spinal cord development(GO:0021510) |
| 0.0 | 0.0 | GO:0001767 | establishment of lymphocyte polarity(GO:0001767) |
| 0.0 | 0.1 | GO:0007602 | phototransduction(GO:0007602) |
| 0.0 | 0.1 | GO:0048073 | regulation of eye pigmentation(GO:0048073) positive regulation of eye pigmentation(GO:0048075) |
| 0.0 | 0.3 | GO:0018022 | peptidyl-lysine methylation(GO:0018022) |
| 0.0 | 0.2 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
| 0.0 | 0.1 | GO:0006273 | lagging strand elongation(GO:0006273) |
| 0.0 | 1.0 | GO:0046473 | phosphatidic acid metabolic process(GO:0046473) |
| 0.0 | 0.0 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
| 0.0 | 0.3 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
| 0.0 | 0.2 | GO:1903861 | positive regulation of dendrite extension(GO:1903861) |
| 0.0 | 0.2 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.0 | 0.3 | GO:0072584 | caveolin-mediated endocytosis(GO:0072584) |
| 0.0 | 0.6 | GO:0035338 | long-chain fatty-acyl-CoA biosynthetic process(GO:0035338) |
| 0.0 | 0.2 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
| 0.0 | 0.0 | GO:0046137 | negative regulation of vitamin D biosynthetic process(GO:0010957) negative regulation of vitamin metabolic process(GO:0046137) |
| 0.0 | 0.1 | GO:0035799 | ureter maturation(GO:0035799) |
| 0.0 | 0.1 | GO:0032380 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.0 | 0.5 | GO:0046513 | ceramide biosynthetic process(GO:0046513) |
| 0.0 | 0.2 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.0 | 0.1 | GO:0030242 | pexophagy(GO:0030242) |
| 0.0 | 0.1 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
| 0.0 | 0.3 | GO:0015781 | pyrimidine nucleotide-sugar transport(GO:0015781) |
| 0.0 | 0.0 | GO:1904398 | positive regulation of neuromuscular junction development(GO:1904398) |
| 0.0 | 0.0 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 0.0 | 0.2 | GO:0070673 | response to interleukin-18(GO:0070673) |
| 0.0 | 0.3 | GO:0010960 | magnesium ion homeostasis(GO:0010960) |
| 0.0 | 0.1 | GO:0002865 | negative regulation of acute inflammatory response to antigenic stimulus(GO:0002865) |
| 0.0 | 0.1 | GO:0001510 | RNA methylation(GO:0001510) |
| 0.0 | 0.1 | GO:0044805 | late nucleophagy(GO:0044805) |
| 0.0 | 0.1 | GO:0002026 | regulation of the force of heart contraction(GO:0002026) |
| 0.0 | 0.2 | GO:1900426 | positive regulation of defense response to bacterium(GO:1900426) |
| 0.0 | 0.5 | GO:0051983 | regulation of chromosome segregation(GO:0051983) |
| 0.0 | 0.4 | GO:0007131 | reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
| 0.0 | 0.1 | GO:0043306 | positive regulation of mast cell activation(GO:0033005) positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
| 0.0 | 0.1 | GO:0033137 | negative regulation of peptidyl-serine phosphorylation(GO:0033137) |
| 0.0 | 0.1 | GO:0030860 | regulation of polarized epithelial cell differentiation(GO:0030860) |
| 0.0 | 0.1 | GO:0047496 | vesicle transport along microtubule(GO:0047496) |
| 0.0 | 0.2 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.0 | 0.2 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.0 | 0.2 | GO:0055003 | cardiac myofibril assembly(GO:0055003) |
| 0.0 | 0.7 | GO:1902475 | L-alpha-amino acid transmembrane transport(GO:1902475) |
| 0.0 | 0.1 | GO:0000469 | cleavage involved in rRNA processing(GO:0000469) |
| 0.0 | 0.4 | GO:0035307 | positive regulation of dephosphorylation(GO:0035306) positive regulation of protein dephosphorylation(GO:0035307) |
| 0.0 | 0.3 | GO:0051290 | protein heterotetramerization(GO:0051290) |
| 0.0 | 0.1 | GO:0031427 | response to methotrexate(GO:0031427) |
| 0.0 | 0.2 | GO:0021670 | lateral ventricle development(GO:0021670) |
| 0.0 | 0.1 | GO:0048278 | vesicle docking(GO:0048278) |
| 0.0 | 0.1 | GO:0030520 | intracellular estrogen receptor signaling pathway(GO:0030520) |
| 0.0 | 0.1 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.0 | 0.0 | GO:0048733 | sebaceous gland development(GO:0048733) |
| 0.0 | 1.3 | GO:0032436 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032436) |
| 0.0 | 0.2 | GO:0048484 | enteric nervous system development(GO:0048484) |
| 0.0 | 0.1 | GO:0061756 | leukocyte adhesion to vascular endothelial cell(GO:0061756) |
| 0.0 | 1.6 | GO:0051225 | spindle assembly(GO:0051225) |
| 0.0 | 0.6 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.0 | 0.1 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
| 0.0 | 2.0 | GO:0051438 | regulation of ubiquitin-protein transferase activity(GO:0051438) |
| 0.0 | 0.3 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
| 0.0 | 0.1 | GO:1903319 | positive regulation of protein maturation(GO:1903319) |
| 0.0 | 0.2 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.0 | 0.2 | GO:0015886 | heme transport(GO:0015886) |
| 0.0 | 0.3 | GO:0045954 | positive regulation of natural killer cell mediated cytotoxicity(GO:0045954) |
| 0.0 | 0.2 | GO:0071391 | cellular response to estrogen stimulus(GO:0071391) |
| 0.0 | 2.1 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
| 0.0 | 0.1 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.0 | 0.1 | GO:0045059 | positive thymic T cell selection(GO:0045059) |
| 0.0 | 0.1 | GO:0048296 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) positive regulation of isotype switching to IgA isotypes(GO:0048298) |
| 0.0 | 0.1 | GO:0071569 | protein ufmylation(GO:0071569) |
| 0.0 | 0.1 | GO:0006983 | ER overload response(GO:0006983) |
| 0.0 | 0.1 | GO:0015865 | purine nucleotide transport(GO:0015865) purine ribonucleotide transport(GO:0015868) |
| 0.0 | 0.1 | GO:0036269 | swimming behavior(GO:0036269) |
| 0.0 | 0.1 | GO:0036229 | glutamine secretion(GO:0010585) L-glutamine import(GO:0036229) L-glutamine import into cell(GO:1903803) |
| 0.0 | 0.1 | GO:0071317 | adenylate cyclase-inhibiting opioid receptor signaling pathway(GO:0031635) negative regulation of Wnt protein secretion(GO:0061358) cellular response to morphine(GO:0071315) cellular response to isoquinoline alkaloid(GO:0071317) |
| 0.0 | 0.1 | GO:0043320 | natural killer cell degranulation(GO:0043320) |
| 0.0 | 0.1 | GO:0006734 | NADH metabolic process(GO:0006734) |
| 0.0 | 0.2 | GO:0019985 | translesion synthesis(GO:0019985) |
| 0.0 | 0.3 | GO:0043101 | purine-containing compound salvage(GO:0043101) |
| 0.0 | 0.1 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
| 0.0 | 0.0 | GO:0038162 | erythropoietin-mediated signaling pathway(GO:0038162) |
| 0.0 | 0.1 | GO:0001180 | transcription initiation from RNA polymerase I promoter for nuclear large rRNA transcript(GO:0001180) |
| 0.0 | 0.6 | GO:0006099 | tricarboxylic acid cycle(GO:0006099) |
| 0.0 | 0.2 | GO:0061418 | regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061418) |
| 0.0 | 0.1 | GO:0070166 | enamel mineralization(GO:0070166) |
| 0.0 | 0.1 | GO:0060155 | platelet dense granule organization(GO:0060155) |
| 0.0 | 0.5 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.0 | 0.1 | GO:0021988 | olfactory lobe development(GO:0021988) |
| 0.0 | 0.0 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
| 0.0 | 0.0 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
| 0.0 | 0.1 | GO:0000394 | RNA splicing, via endonucleolytic cleavage and ligation(GO:0000394) tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.0 | 0.4 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 | 0.0 | GO:0015853 | adenine transport(GO:0015853) |
| 0.0 | 0.1 | GO:0050686 | negative regulation of mRNA processing(GO:0050686) |
| 0.0 | 0.3 | GO:0051321 | meiotic cell cycle(GO:0051321) |
| 0.0 | 0.1 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
| 0.0 | 0.2 | GO:0010881 | regulation of cardiac muscle contraction by regulation of the release of sequestered calcium ion(GO:0010881) |
| 0.0 | 0.1 | GO:0042532 | negative regulation of tyrosine phosphorylation of STAT protein(GO:0042532) |
| 0.0 | 0.0 | GO:0032354 | response to follicle-stimulating hormone(GO:0032354) |
| 0.0 | 0.0 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 0.0 | 0.1 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.0 | 0.1 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 0.0 | 0.1 | GO:2000291 | regulation of myoblast proliferation(GO:2000291) |
| 0.0 | 0.0 | GO:0038170 | somatostatin receptor signaling pathway(GO:0038169) somatostatin signaling pathway(GO:0038170) |
| 0.0 | 0.5 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.0 | 1.1 | GO:0007286 | spermatid development(GO:0007286) |
| 0.0 | 0.1 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.0 | 0.1 | GO:0009137 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
| 0.0 | 0.3 | GO:0051497 | negative regulation of stress fiber assembly(GO:0051497) |
| 0.0 | 0.5 | GO:0005980 | glycogen catabolic process(GO:0005980) |
| 0.0 | 0.2 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
| 0.0 | 0.1 | GO:0002429 | immune response-activating cell surface receptor signaling pathway(GO:0002429) |
| 0.0 | 0.0 | GO:2001138 | regulation of phospholipid transport(GO:2001138) positive regulation of phospholipid transport(GO:2001140) |
| 0.0 | 0.3 | GO:0016051 | carbohydrate biosynthetic process(GO:0016051) |
| 0.0 | 0.1 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
| 0.0 | 0.2 | GO:0021522 | spinal cord motor neuron differentiation(GO:0021522) |
| 0.0 | 0.0 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.0 | 0.1 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
| 0.0 | 0.1 | GO:0042753 | positive regulation of circadian rhythm(GO:0042753) |
| 0.0 | 0.0 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
| 0.0 | 0.1 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.0 | 0.1 | GO:0071231 | cellular response to folic acid(GO:0071231) |
| 0.0 | 0.1 | GO:0017062 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.0 | 0.1 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
| 0.0 | 0.2 | GO:1902993 | positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
| 0.0 | 0.0 | GO:0045622 | regulation of T-helper cell differentiation(GO:0045622) positive regulation of T-helper cell differentiation(GO:0045624) |
| 0.0 | 0.1 | GO:0019388 | galactose catabolic process(GO:0019388) |
| 0.0 | 0.1 | GO:0006633 | fatty acid biosynthetic process(GO:0006633) |
| 0.0 | 0.9 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
| 0.0 | 0.3 | GO:0006284 | base-excision repair(GO:0006284) |
| 0.0 | 0.1 | GO:0044070 | regulation of anion transport(GO:0044070) |
| 0.0 | 0.0 | GO:0006475 | internal protein amino acid acetylation(GO:0006475) |
| 0.0 | 0.0 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
| 0.0 | 0.1 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.0 | 0.5 | GO:0008033 | tRNA processing(GO:0008033) |
| 0.0 | 0.1 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.0 | 0.2 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
| 0.0 | 0.0 | GO:0005997 | xylulose metabolic process(GO:0005997) |
| 0.0 | 0.3 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
| 0.0 | 0.1 | GO:0001771 | immunological synapse formation(GO:0001771) |
| 0.0 | 0.0 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
| 0.0 | 0.2 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
| 0.0 | 0.0 | GO:0033572 | transferrin transport(GO:0033572) |
| 0.0 | 0.1 | GO:0051195 | negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
| 0.0 | 0.1 | GO:0097484 | dendrite extension(GO:0097484) |
| 0.0 | 0.1 | GO:0010573 | vascular endothelial growth factor production(GO:0010573) |
| 0.0 | 0.1 | GO:0043584 | nose development(GO:0043584) |
| 0.0 | 0.1 | GO:1902236 | negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
| 0.0 | 0.1 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.0 | 0.1 | GO:0048662 | negative regulation of smooth muscle cell proliferation(GO:0048662) |
| 0.0 | 0.1 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
| 0.0 | 0.2 | GO:0006751 | glutathione catabolic process(GO:0006751) leukotriene D4 metabolic process(GO:1901748) leukotriene D4 biosynthetic process(GO:1901750) |
| 0.0 | 0.3 | GO:0035428 | hexose transmembrane transport(GO:0035428) glucose transmembrane transport(GO:1904659) |
| 0.0 | 0.1 | GO:0030261 | chromosome condensation(GO:0030261) |
| 0.0 | 0.0 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.0 | 0.1 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
| 0.0 | 0.1 | GO:0071376 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.0 | 0.1 | GO:0006552 | leucine catabolic process(GO:0006552) |
| 0.0 | 0.1 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.0 | 0.1 | GO:0060285 | cilium-dependent cell motility(GO:0060285) |
| 0.0 | 2.4 | GO:0042254 | ribosome biogenesis(GO:0042254) |
| 0.0 | 0.8 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
| 0.0 | 0.1 | GO:0010507 | negative regulation of autophagy(GO:0010507) |
| 0.0 | 0.3 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.0 | 0.0 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.0 | 0.1 | GO:1900004 | negative regulation of serine-type endopeptidase activity(GO:1900004) negative regulation of serine-type peptidase activity(GO:1902572) |
| 0.0 | 0.0 | GO:0036148 | phosphatidylglycerol acyl-chain remodeling(GO:0036148) |
| 0.0 | 0.1 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.0 | 0.0 | GO:0030241 | skeletal muscle myosin thick filament assembly(GO:0030241) |
| 0.0 | 0.3 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
| 0.0 | 0.0 | GO:0046541 | carbon dioxide transport(GO:0015670) saliva secretion(GO:0046541) |
| 0.0 | 0.1 | GO:0036500 | ATF6-mediated unfolded protein response(GO:0036500) |
| 0.0 | 0.0 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.0 | 0.1 | GO:0015889 | cobalamin transport(GO:0015889) |
| 0.0 | 0.1 | GO:0090263 | positive regulation of canonical Wnt signaling pathway(GO:0090263) |
| 0.0 | 0.1 | GO:0019885 | antigen processing and presentation of endogenous peptide antigen(GO:0002483) antigen processing and presentation of endogenous peptide antigen via MHC class I(GO:0019885) |
| 0.0 | 0.0 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.0 | 0.3 | GO:0018279 | peptidyl-asparagine modification(GO:0018196) protein N-linked glycosylation via asparagine(GO:0018279) |
| 0.0 | 0.1 | GO:0021591 | ventricular system development(GO:0021591) |
| 0.0 | 0.7 | GO:0042775 | ATP synthesis coupled electron transport(GO:0042773) mitochondrial ATP synthesis coupled electron transport(GO:0042775) |
| 0.0 | 0.0 | GO:0044205 | 'de novo' UMP biosynthetic process(GO:0044205) |
| 0.0 | 0.0 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
| 0.0 | 0.2 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
| 0.0 | 0.0 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
| 0.0 | 0.4 | GO:0051289 | protein homotetramerization(GO:0051289) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 0.5 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.3 | 9.8 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.3 | 6.1 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.3 | 8.3 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
| 0.3 | 8.7 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.3 | 10.3 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.2 | 2.6 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.2 | 6.7 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.2 | 0.9 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
| 0.2 | 5.6 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.2 | 1.2 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
| 0.2 | 0.4 | REACTOME GLUCAGON SIGNALING IN METABOLIC REGULATION | Genes involved in Glucagon signaling in metabolic regulation |
| 0.2 | 3.8 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.2 | 4.3 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.2 | 0.2 | REACTOME PI3K CASCADE | Genes involved in PI3K Cascade |
| 0.2 | 11.4 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.2 | 9.3 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.2 | 2.9 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.2 | 1.5 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.2 | 3.0 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.2 | 3.6 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.2 | 1.5 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
| 0.2 | 6.9 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.2 | 2.4 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.2 | 2.6 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.1 | 2.1 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.1 | 0.9 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.1 | 1.6 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.1 | 6.0 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.1 | 5.4 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.1 | 2.4 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.1 | 2.8 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.1 | 3.1 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
| 0.1 | 1.2 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.1 | 0.4 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.1 | 5.6 | REACTOME INTEGRIN ALPHAIIB BETA3 SIGNALING | Genes involved in Integrin alphaIIb beta3 signaling |
| 0.1 | 2.2 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
| 0.1 | 0.2 | REACTOME 3 UTR MEDIATED TRANSLATIONAL REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
| 0.1 | 2.6 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
| 0.1 | 1.0 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.1 | 2.1 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.1 | 0.6 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 0.1 | 2.5 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.1 | 0.7 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.1 | 4.5 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.1 | 3.0 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.1 | 2.3 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.1 | 0.8 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.1 | 0.1 | REACTOME SIGNALING BY NOTCH4 | Genes involved in Signaling by NOTCH4 |
| 0.1 | 1.3 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |
| 0.1 | 0.1 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
| 0.1 | 2.0 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.1 | 3.2 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
| 0.1 | 4.2 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.1 | 0.3 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
| 0.1 | 1.1 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
| 0.1 | 0.5 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.1 | 2.2 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.1 | 2.9 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.1 | 1.0 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.1 | 2.3 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.1 | 0.7 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.1 | 0.9 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.1 | 0.4 | REACTOME INHIBITION OF THE PROTEOLYTIC ACTIVITY OF APC C REQUIRED FOR THE ONSET OF ANAPHASE BY MITOTIC SPINDLE CHECKPOINT COMPONENTS | Genes involved in Inhibition of the proteolytic activity of APC/C required for the onset of anaphase by mitotic spindle checkpoint components |
| 0.1 | 0.2 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.1 | 1.0 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
| 0.1 | 2.3 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
| 0.1 | 1.1 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.1 | 0.5 | REACTOME DNA STRAND ELONGATION | Genes involved in DNA strand elongation |
| 0.1 | 0.2 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
| 0.1 | 0.9 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.1 | 0.7 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.1 | 0.5 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
| 0.1 | 1.5 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.1 | 1.2 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.1 | 7.0 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 0.1 | 0.4 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.1 | 0.2 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.1 | 1.3 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.1 | 0.2 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 0.1 | 0.4 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.1 | 0.4 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 0.1 | 0.1 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
| 0.1 | 2.1 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.0 | 0.6 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.0 | 0.3 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
| 0.0 | 0.5 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 3.0 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.0 | 6.4 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.0 | 0.7 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.0 | 0.2 | REACTOME SIGNALING BY FGFR MUTANTS | Genes involved in Signaling by FGFR mutants |
| 0.0 | 4.9 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.0 | 0.9 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.0 | 0.5 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.0 | 0.8 | REACTOME TRANSLATION | Genes involved in Translation |
| 0.0 | 1.6 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
| 0.0 | 1.6 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
| 0.0 | 0.7 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.0 | 0.9 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.0 | 1.0 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.0 | 1.3 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 0.0 | 3.5 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
| 0.0 | 1.6 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
| 0.0 | 0.7 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.0 | 0.5 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.0 | 1.1 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.0 | 0.1 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
| 0.0 | 0.4 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.0 | 0.5 | REACTOME ACTIVATION OF ATR IN RESPONSE TO REPLICATION STRESS | Genes involved in Activation of ATR in response to replication stress |
| 0.0 | 0.4 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.0 | 0.4 | REACTOME PHOSPHOLIPASE C MEDIATED CASCADE | Genes involved in Phospholipase C-mediated cascade |
| 0.0 | 0.8 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 0.7 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.0 | 0.6 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.0 | 2.2 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
| 0.0 | 2.3 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
| 0.0 | 0.8 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.0 | 0.5 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.0 | 0.4 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.0 | 0.2 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
| 0.0 | 0.1 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.0 | 1.5 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 0.2 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.0 | 0.5 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
| 0.0 | 0.4 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.0 | 0.7 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.0 | 0.3 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.0 | 3.3 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.0 | 1.8 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.0 | 0.2 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.0 | 0.1 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.0 | 0.5 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.0 | 1.4 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.0 | 2.2 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.0 | 0.3 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
| 0.0 | 0.3 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.0 | 0.1 | REACTOME CLEAVAGE OF GROWING TRANSCRIPT IN THE TERMINATION REGION | Genes involved in Cleavage of Growing Transcript in the Termination Region |
| 0.0 | 0.3 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.0 | 0.9 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.0 | 0.2 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.0 | 0.8 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
| 0.0 | 0.3 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| 0.0 | 0.4 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.0 | 0.2 | REACTOME CHROMOSOME MAINTENANCE | Genes involved in Chromosome Maintenance |
| 0.0 | 0.2 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.0 | 0.2 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.0 | 0.1 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.0 | 1.4 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.0 | 0.9 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 0.0 | 0.2 | REACTOME DOWNSTREAM SIGNALING OF ACTIVATED FGFR | Genes involved in Downstream signaling of activated FGFR |
| 0.0 | 0.2 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.0 | 0.2 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.0 | 0.1 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.3 | 3.8 | GO:0060187 | cell pole(GO:0060187) |
| 1.0 | 3.0 | GO:0097134 | cyclin E1-CDK2 complex(GO:0097134) |
| 1.0 | 3.0 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
| 0.8 | 3.8 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.7 | 4.0 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.5 | 1.5 | GO:0002945 | cyclin K-CDK13 complex(GO:0002945) |
| 0.5 | 1.9 | GO:0034669 | integrin alpha4-beta7 complex(GO:0034669) |
| 0.4 | 1.3 | GO:0005960 | glycine cleavage complex(GO:0005960) |
| 0.4 | 1.8 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.4 | 3.0 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
| 0.4 | 1.7 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.4 | 5.5 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.4 | 9.8 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.4 | 1.2 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.4 | 1.9 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.4 | 2.3 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.4 | 2.3 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.4 | 3.0 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.4 | 2.9 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.4 | 0.7 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.3 | 3.0 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.3 | 2.5 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.3 | 2.6 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.3 | 2.0 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.3 | 0.8 | GO:1990622 | CHOP-ATF3 complex(GO:1990622) |
| 0.3 | 2.0 | GO:0098559 | cytoplasmic side of early endosome membrane(GO:0098559) |
| 0.3 | 1.3 | GO:0000938 | GARP complex(GO:0000938) |
| 0.2 | 1.2 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.2 | 1.7 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.2 | 0.7 | GO:0019034 | viral replication complex(GO:0019034) |
| 0.2 | 0.7 | GO:0001740 | Barr body(GO:0001740) |
| 0.2 | 0.7 | GO:0005873 | plus-end kinesin complex(GO:0005873) |
| 0.2 | 1.0 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
| 0.2 | 15.8 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.2 | 1.4 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
| 0.2 | 0.5 | GO:0070603 | SWI/SNF superfamily-type complex(GO:0070603) |
| 0.2 | 0.7 | GO:0005656 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
| 0.2 | 1.6 | GO:0032437 | cuticular plate(GO:0032437) |
| 0.2 | 3.1 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.2 | 0.7 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
| 0.2 | 0.6 | GO:0030689 | Noc complex(GO:0030689) |
| 0.2 | 0.6 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) |
| 0.2 | 1.2 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
| 0.2 | 0.2 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
| 0.2 | 15.3 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.2 | 0.2 | GO:0043291 | RAVE complex(GO:0043291) |
| 0.2 | 0.2 | GO:0045293 | MIS complex(GO:0036396) mRNA editing complex(GO:0045293) |
| 0.2 | 0.2 | GO:0000791 | euchromatin(GO:0000791) |
| 0.2 | 0.4 | GO:0034686 | integrin alphav-beta8 complex(GO:0034686) |
| 0.2 | 3.7 | GO:0033202 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 0.2 | 0.5 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.2 | 0.5 | GO:0031372 | UBC13-MMS2 complex(GO:0031372) |
| 0.2 | 1.5 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.2 | 2.0 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.2 | 0.7 | GO:0070695 | FHF complex(GO:0070695) |
| 0.2 | 0.7 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.2 | 1.0 | GO:0034687 | integrin alphaL-beta2 complex(GO:0034687) |
| 0.2 | 1.5 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.2 | 0.5 | GO:0018444 | translation release factor complex(GO:0018444) |
| 0.2 | 1.6 | GO:0001741 | XY body(GO:0001741) |
| 0.2 | 8.4 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.2 | 0.8 | GO:0071565 | nBAF complex(GO:0071565) |
| 0.2 | 0.2 | GO:0044094 | host cell nucleus(GO:0042025) host cell nuclear part(GO:0044094) |
| 0.1 | 1.0 | GO:0060091 | kinocilium(GO:0060091) |
| 0.1 | 2.1 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.1 | 0.4 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
| 0.1 | 1.9 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
| 0.1 | 0.7 | GO:0005943 | phosphatidylinositol 3-kinase complex, class IA(GO:0005943) |
| 0.1 | 0.1 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 0.1 | 0.4 | GO:0070195 | growth hormone receptor complex(GO:0070195) |
| 0.1 | 1.3 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.1 | 1.8 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.1 | 1.2 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.1 | 0.4 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.1 | 1.2 | GO:0032039 | integrator complex(GO:0032039) |
| 0.1 | 0.5 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.1 | 0.5 | GO:0032301 | MutSalpha complex(GO:0032301) |
| 0.1 | 0.5 | GO:0019867 | outer membrane(GO:0019867) |
| 0.1 | 0.8 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
| 0.1 | 0.4 | GO:0031523 | Myb complex(GO:0031523) |
| 0.1 | 0.5 | GO:0000811 | GINS complex(GO:0000811) DNA replication preinitiation complex(GO:0031261) |
| 0.1 | 1.6 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.1 | 0.5 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
| 0.1 | 1.8 | GO:0042575 | DNA polymerase complex(GO:0042575) |
| 0.1 | 0.7 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
| 0.1 | 0.4 | GO:0097447 | dendritic tree(GO:0097447) |
| 0.1 | 1.3 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.1 | 0.8 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 0.1 | 1.0 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.1 | 1.0 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.1 | 2.1 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.1 | 0.6 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.1 | 0.9 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.1 | 0.4 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
| 0.1 | 1.0 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.1 | 0.4 | GO:1990298 | mitotic checkpoint complex(GO:0033597) bub1-bub3 complex(GO:1990298) |
| 0.1 | 0.2 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
| 0.1 | 0.8 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.1 | 5.6 | GO:0016235 | aggresome(GO:0016235) |
| 0.1 | 0.8 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
| 0.1 | 0.7 | GO:0032009 | early phagosome(GO:0032009) |
| 0.1 | 2.7 | GO:0046930 | pore complex(GO:0046930) |
| 0.1 | 1.0 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.1 | 1.2 | GO:0042555 | MCM complex(GO:0042555) |
| 0.1 | 0.1 | GO:0005839 | proteasome core complex(GO:0005839) |
| 0.1 | 2.7 | GO:0042627 | chylomicron(GO:0042627) |
| 0.1 | 1.5 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.1 | 0.3 | GO:0001652 | granular component(GO:0001652) |
| 0.1 | 3.9 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.1 | 0.5 | GO:0008021 | synaptic vesicle(GO:0008021) |
| 0.1 | 0.7 | GO:0098574 | cytoplasmic side of lysosomal membrane(GO:0098574) |
| 0.1 | 0.3 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.1 | 0.8 | GO:0034385 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
| 0.1 | 0.6 | GO:0090544 | BAF-type complex(GO:0090544) |
| 0.1 | 1.0 | GO:0030897 | HOPS complex(GO:0030897) |
| 0.1 | 0.7 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.1 | 0.3 | GO:0034657 | GID complex(GO:0034657) |
| 0.1 | 0.8 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.1 | 1.6 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.1 | 0.9 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.1 | 0.5 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.1 | 0.4 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.1 | 1.6 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.1 | 0.9 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.1 | 0.7 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.1 | 0.8 | GO:0005638 | lamin filament(GO:0005638) |
| 0.1 | 0.2 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.1 | 0.4 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.1 | 0.4 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.1 | 2.0 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.1 | 0.5 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.1 | 0.8 | GO:0016013 | syntrophin complex(GO:0016013) |
| 0.1 | 0.8 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.1 | 1.4 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.1 | 1.3 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.1 | 0.3 | GO:0000438 | core TFIIH complex portion of holo TFIIH complex(GO:0000438) |
| 0.1 | 0.5 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.1 | 0.6 | GO:0044326 | dendritic spine neck(GO:0044326) |
| 0.1 | 0.6 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
| 0.1 | 0.4 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.1 | 0.6 | GO:0031415 | NatA complex(GO:0031415) |
| 0.1 | 0.8 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
| 0.1 | 1.1 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.1 | 0.7 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
| 0.1 | 0.1 | GO:0031527 | filopodium membrane(GO:0031527) |
| 0.1 | 0.2 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.1 | 0.3 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.1 | 3.1 | GO:0005762 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.1 | 1.5 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.1 | 21.3 | GO:0000790 | nuclear chromatin(GO:0000790) |
| 0.1 | 0.2 | GO:0000799 | nuclear condensin complex(GO:0000799) |
| 0.1 | 0.5 | GO:0031095 | platelet dense tubular network membrane(GO:0031095) |
| 0.1 | 0.3 | GO:0042584 | chromaffin granule membrane(GO:0042584) |
| 0.1 | 6.3 | GO:0099501 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
| 0.1 | 0.9 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.1 | 0.8 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.1 | 1.1 | GO:0032156 | septin cytoskeleton(GO:0032156) |
| 0.1 | 0.4 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.1 | 0.1 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.1 | 1.2 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.1 | 0.6 | GO:0070081 | clathrin-sculpted monoamine transport vesicle(GO:0070081) clathrin-sculpted monoamine transport vesicle membrane(GO:0070083) |
| 0.1 | 0.2 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.1 | 0.4 | GO:0089701 | U2AF(GO:0089701) |
| 0.1 | 0.3 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.1 | 0.7 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.1 | 0.1 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.1 | 2.2 | GO:1902711 | GABA-A receptor complex(GO:1902711) |
| 0.1 | 1.0 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.1 | 2.0 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.1 | 0.3 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.1 | 0.1 | GO:0030891 | VCB complex(GO:0030891) |
| 0.1 | 2.0 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.1 | 8.2 | GO:0016605 | PML body(GO:0016605) |
| 0.1 | 1.3 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.1 | 1.5 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.1 | 0.1 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.1 | 0.4 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.1 | 0.6 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.1 | 0.1 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.1 | 1.0 | GO:0032809 | neuronal cell body membrane(GO:0032809) cell body membrane(GO:0044298) |
| 0.1 | 0.6 | GO:0043596 | nuclear replication fork(GO:0043596) |
| 0.1 | 6.1 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.1 | 1.1 | GO:0008328 | ionotropic glutamate receptor complex(GO:0008328) neurotransmitter receptor complex(GO:0098878) |
| 0.1 | 2.3 | GO:0016592 | mediator complex(GO:0016592) |
| 0.1 | 0.3 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
| 0.1 | 1.8 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.1 | 0.7 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.1 | 0.9 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.1 | 0.3 | GO:0045272 | plasma membrane respiratory chain complex I(GO:0045272) |
| 0.1 | 0.6 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.1 | 0.2 | GO:0031436 | BRCA1-BARD1 complex(GO:0031436) |
| 0.1 | 0.5 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.1 | 1.1 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.1 | 0.1 | GO:0061200 | clathrin-sculpted vesicle(GO:0060198) clathrin-sculpted gamma-aminobutyric acid transport vesicle(GO:0061200) clathrin-sculpted gamma-aminobutyric acid transport vesicle membrane(GO:0061202) |
| 0.1 | 0.4 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.1 | 0.8 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
| 0.1 | 1.8 | GO:0032993 | protein-DNA complex(GO:0032993) |
| 0.1 | 0.4 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.1 | 0.2 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.1 | 1.0 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.1 | 6.9 | GO:0000785 | chromatin(GO:0000785) |
| 0.1 | 0.3 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.1 | 0.3 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.1 | 0.2 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.1 | 0.9 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.1 | 0.7 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.1 | 0.4 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.1 | 0.1 | GO:0032302 | MutSbeta complex(GO:0032302) |
| 0.1 | 1.3 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.1 | 0.4 | GO:0000228 | nuclear chromosome(GO:0000228) |
| 0.1 | 0.1 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 0.1 | 0.5 | GO:0032420 | stereocilium(GO:0032420) |
| 0.1 | 1.3 | GO:0033268 | node of Ranvier(GO:0033268) |
| 0.1 | 0.2 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.1 | 8.4 | GO:0000793 | condensed chromosome(GO:0000793) |
| 0.1 | 4.9 | GO:0016363 | nuclear matrix(GO:0016363) |
| 0.1 | 0.4 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.1 | 0.3 | GO:0097125 | cyclin B1-CDK1 complex(GO:0097125) |
| 0.1 | 0.2 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.1 | 17.7 | GO:0016607 | nuclear speck(GO:0016607) |
| 0.1 | 0.5 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
| 0.0 | 0.2 | GO:0051286 | cell tip(GO:0051286) |
| 0.0 | 0.6 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.0 | 0.3 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.0 | 0.5 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.0 | 0.1 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
| 0.0 | 0.1 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
| 0.0 | 0.2 | GO:0030678 | mitochondrial ribonuclease P complex(GO:0030678) |
| 0.0 | 0.6 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
| 0.0 | 0.3 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.0 | 0.9 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.0 | 1.5 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
| 0.0 | 0.6 | GO:0005844 | polysome(GO:0005844) |
| 0.0 | 2.3 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 0.1 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.0 | 1.0 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
| 0.0 | 0.3 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.0 | 0.4 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
| 0.0 | 0.2 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.0 | 0.3 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 0.1 | GO:0097059 | CNTFR-CLCF1 complex(GO:0097059) |
| 0.0 | 0.3 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.0 | 0.5 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.0 | 0.2 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.0 | 0.2 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.0 | 0.2 | GO:0032280 | symmetric synapse(GO:0032280) |
| 0.0 | 0.0 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.0 | 1.7 | GO:0005871 | kinesin complex(GO:0005871) |
| 0.0 | 0.9 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
| 0.0 | 0.1 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.0 | 0.2 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.0 | 0.5 | GO:0030136 | clathrin-coated vesicle(GO:0030136) |
| 0.0 | 0.1 | GO:0097165 | nuclear stress granule(GO:0097165) |
| 0.0 | 0.2 | GO:0038038 | G-protein coupled receptor homodimeric complex(GO:0038038) |
| 0.0 | 2.1 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.0 | 0.6 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
| 0.0 | 0.4 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.0 | 0.1 | GO:0036398 | TCR signalosome(GO:0036398) |
| 0.0 | 0.4 | GO:0005775 | vacuolar lumen(GO:0005775) |
| 0.0 | 0.0 | GO:1990769 | proximal neuron projection(GO:1990769) |
| 0.0 | 1.5 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 0.2 | GO:0017102 | methionyl glutamyl tRNA synthetase complex(GO:0017102) |
| 0.0 | 0.2 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.0 | 0.9 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.0 | 0.3 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.0 | 0.3 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
| 0.0 | 0.1 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.0 | 0.1 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.0 | 0.7 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.0 | 0.4 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.0 | 0.7 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.0 | 0.1 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
| 0.0 | 0.1 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.0 | 1.3 | GO:0000781 | chromosome, telomeric region(GO:0000781) |
| 0.0 | 0.9 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
| 0.0 | 0.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.0 | 0.4 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.0 | 0.6 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) nuclear membrane part(GO:0044453) |
| 0.0 | 1.0 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.0 | 0.3 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.0 | 8.1 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.0 | 0.2 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
| 0.0 | 7.8 | GO:0031965 | nuclear membrane(GO:0031965) |
| 0.0 | 0.2 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 0.1 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
| 0.0 | 0.2 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.0 | 0.1 | GO:0043293 | apoptosome(GO:0043293) |
| 0.0 | 0.1 | GO:0000243 | commitment complex(GO:0000243) |
| 0.0 | 0.1 | GO:0014802 | terminal cisterna(GO:0014802) |
| 0.0 | 1.9 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.0 | 0.2 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.0 | 1.2 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.0 | 0.2 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 0.0 | 0.2 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.0 | 1.5 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.0 | 0.2 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 0.0 | 5.3 | GO:0000151 | ubiquitin ligase complex(GO:0000151) |
| 0.0 | 0.1 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
| 0.0 | 1.3 | GO:0019814 | immunoglobulin complex(GO:0019814) |
| 0.0 | 0.1 | GO:0002169 | 3-methylcrotonyl-CoA carboxylase complex, mitochondrial(GO:0002169) methylcrotonoyl-CoA carboxylase complex(GO:1905202) |
| 0.0 | 0.2 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.0 | 2.1 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.0 | 0.3 | GO:0031594 | neuromuscular junction(GO:0031594) |
| 0.0 | 0.1 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.0 | 0.4 | GO:0030673 | axolemma(GO:0030673) |
| 0.0 | 1.6 | GO:0005814 | centriole(GO:0005814) |
| 0.0 | 0.1 | GO:0044391 | ribosomal subunit(GO:0044391) |
| 0.0 | 0.1 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) |
| 0.0 | 1.3 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.0 | 0.1 | GO:0031085 | BLOC-3 complex(GO:0031085) |
| 0.0 | 0.2 | GO:0005770 | late endosome(GO:0005770) |
| 0.0 | 0.1 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.0 | 0.5 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.0 | 0.1 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 0.2 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.0 | 0.3 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.0 | 0.1 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
| 0.0 | 0.2 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.0 | 0.1 | GO:1902560 | GMP reductase complex(GO:1902560) |
| 0.0 | 0.1 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 1.5 | GO:0043204 | perikaryon(GO:0043204) |
| 0.0 | 0.1 | GO:0098687 | chromosomal region(GO:0098687) |
| 0.0 | 0.0 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.0 | 0.1 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| 0.0 | 0.1 | GO:0005684 | U2-type spliceosomal complex(GO:0005684) |
| 0.0 | 0.1 | GO:0034706 | sodium channel complex(GO:0034706) |
| 0.0 | 11.2 | GO:0005730 | nucleolus(GO:0005730) |
| 0.0 | 0.1 | GO:0030286 | dynein complex(GO:0030286) |
| 0.0 | 0.0 | GO:0000109 | nucleotide-excision repair complex(GO:0000109) |
| 0.0 | 0.1 | GO:0035859 | Seh1-associated complex(GO:0035859) |
| 0.0 | 0.1 | GO:0005771 | multivesicular body(GO:0005771) |
| 0.0 | 0.0 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.0 | 0.6 | GO:0032587 | ruffle membrane(GO:0032587) |
| 0.0 | 0.3 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.0 | 0.2 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
| 0.0 | 0.0 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.0 | 0.1 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
| 0.0 | 0.1 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.0 | 0.0 | GO:0031941 | filamentous actin(GO:0031941) |
| 0.0 | 0.1 | GO:0072536 | interleukin-23 receptor complex(GO:0072536) |
| 0.0 | 0.3 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.0 | 0.1 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.0 | 0.2 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.0 | 0.1 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.0 | 0.1 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.0 | 0.0 | GO:0005883 | neurofilament(GO:0005883) |
| 0.0 | 0.2 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
| 0.0 | 0.1 | GO:0016460 | myosin II complex(GO:0016460) |
| 0.0 | 0.1 | GO:0036020 | endolysosome membrane(GO:0036020) |
| 0.0 | 0.2 | GO:0070069 | cytochrome complex(GO:0070069) |
| 0.0 | 0.0 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.0 | 0.1 | GO:0005819 | spindle(GO:0005819) |
| 0.0 | 0.2 | GO:0042611 | MHC protein complex(GO:0042611) MHC class II protein complex(GO:0042613) |
| 0.0 | 3.0 | GO:0019866 | mitochondrial inner membrane(GO:0005743) organelle inner membrane(GO:0019866) |
| 0.0 | 0.1 | GO:0034709 | methylosome(GO:0034709) |