ENCODE cell lines, expression (Ernst 2011)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
TFDP1
|
ENSG00000198176.8 | TFDP1 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| TFDP1 | hg19_v2_chr13_+_114239588_114239752 | 0.56 | 2.5e-02 | Click! |
| Promoter | Score | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr6_+_135502408 | 3.38 |
ENST00000341911.5 ENST00000442647.2 ENST00000316528.8 |
MYB |
v-myb avian myeloblastosis viral oncogene homolog |
| chr6_+_135502466 | 3.31 |
ENST00000367814.4 |
MYB |
v-myb avian myeloblastosis viral oncogene homolog |
| chr11_-_19263145 | 2.93 |
ENST00000532666.1 ENST00000527884.1 |
E2F8 |
E2F transcription factor 8 |
| chrX_-_137793826 | 2.72 |
ENST00000315930.6 |
FGF13 |
fibroblast growth factor 13 |
| chr6_+_37137939 | 2.66 |
ENST00000373509.5 |
PIM1 |
pim-1 oncogene |
| chr4_-_83351005 | 2.43 |
ENST00000295470.5 |
HNRNPDL |
heterogeneous nuclear ribonucleoprotein D-like |
| chr6_+_27806319 | 2.31 |
ENST00000606613.1 ENST00000396980.3 |
HIST1H2BN |
histone cluster 1, H2bn |
| chr7_-_150675372 | 2.15 |
ENST00000262186.5 |
KCNH2 |
potassium voltage-gated channel, subfamily H (eag-related), member 2 |
| chr14_+_101193164 | 1.92 |
ENST00000341267.4 |
DLK1 |
delta-like 1 homolog (Drosophila) |
| chr17_-_42276574 | 1.91 |
ENST00000589805.1 |
ATXN7L3 |
ataxin 7-like 3 |
| chr14_+_101193246 | 1.89 |
ENST00000331224.6 |
DLK1 |
delta-like 1 homolog (Drosophila) |
| chr4_-_57301748 | 1.88 |
ENST00000264220.2 |
PPAT |
phosphoribosyl pyrophosphate amidotransferase |
| chr1_-_92351769 | 1.81 |
ENST00000212355.4 |
TGFBR3 |
transforming growth factor, beta receptor III |
| chr11_+_85955787 | 1.80 |
ENST00000528180.1 |
EED |
embryonic ectoderm development |
| chr6_+_20403997 | 1.79 |
ENST00000535432.1 |
E2F3 |
E2F transcription factor 3 |
| chr1_+_27022485 | 1.73 |
ENST00000324856.7 |
ARID1A |
AT rich interactive domain 1A (SWI-like) |
| chr6_+_26124373 | 1.69 |
ENST00000377791.2 ENST00000602637.1 |
HIST1H2AC |
histone cluster 1, H2ac |
| chr11_-_33891362 | 1.63 |
ENST00000395833.3 |
LMO2 |
LIM domain only 2 (rhombotin-like 1) |
| chr7_+_150756657 | 1.63 |
ENST00000413384.2 |
SLC4A2 |
solute carrier family 4 (anion exchanger), member 2 |
| chr6_+_135502501 | 1.62 |
ENST00000527615.1 ENST00000420123.2 ENST00000525369.1 ENST00000528774.1 ENST00000534121.1 ENST00000534044.1 ENST00000533624.1 |
MYB |
v-myb avian myeloblastosis viral oncogene homolog |
| chr1_-_52870104 | 1.60 |
ENST00000371568.3 |
ORC1 |
origin recognition complex, subunit 1 |
| chr8_-_37756972 | 1.59 |
ENST00000330843.4 ENST00000522727.1 ENST00000287263.4 |
RAB11FIP1 |
RAB11 family interacting protein 1 (class I) |
| chr1_+_27022839 | 1.53 |
ENST00000457599.2 |
ARID1A |
AT rich interactive domain 1A (SWI-like) |
| chr1_-_52870059 | 1.52 |
ENST00000371566.1 |
ORC1 |
origin recognition complex, subunit 1 |
| chr11_+_63706444 | 1.46 |
ENST00000377793.4 ENST00000456907.2 ENST00000539656.1 |
NAA40 |
N(alpha)-acetyltransferase 40, NatD catalytic subunit |
| chr1_+_100818156 | 1.42 |
ENST00000336454.3 |
CDC14A |
cell division cycle 14A |
| chr15_+_40733387 | 1.42 |
ENST00000416165.1 |
BAHD1 |
bromo adjacent homology domain containing 1 |
| chr14_-_65346555 | 1.38 |
ENST00000542895.1 ENST00000556626.1 |
SPTB |
spectrin, beta, erythrocytic |
| chr17_-_42296855 | 1.36 |
ENST00000436088.1 |
UBTF |
upstream binding transcription factor, RNA polymerase I |
| chr15_-_58357932 | 1.34 |
ENST00000347587.3 |
ALDH1A2 |
aldehyde dehydrogenase 1 family, member A2 |
| chr18_-_5296001 | 1.34 |
ENST00000357006.4 |
ZBTB14 |
zinc finger and BTB domain containing 14 |
| chr6_-_86352642 | 1.33 |
ENST00000355238.6 |
SYNCRIP |
synaptotagmin binding, cytoplasmic RNA interacting protein |
| chr6_+_26597155 | 1.33 |
ENST00000274849.1 |
ABT1 |
activator of basal transcription 1 |
| chr5_+_133450365 | 1.31 |
ENST00000342854.5 ENST00000321603.6 ENST00000321584.4 ENST00000378564.1 ENST00000395029.1 |
TCF7 |
transcription factor 7 (T-cell specific, HMG-box) |
| chrX_-_129244655 | 1.31 |
ENST00000335997.7 |
ELF4 |
E74-like factor 4 (ets domain transcription factor) |
| chr1_+_228645796 | 1.30 |
ENST00000369160.2 |
HIST3H2BB |
histone cluster 3, H2bb |
| chr12_+_93772402 | 1.28 |
ENST00000546925.1 |
NUDT4 |
nudix (nucleoside diphosphate linked moiety X)-type motif 4 |
| chr16_+_85645007 | 1.22 |
ENST00000405402.2 |
GSE1 |
Gse1 coiled-coil protein |
| chr6_-_27100529 | 1.20 |
ENST00000607124.1 ENST00000339812.2 ENST00000541790.1 |
HIST1H2BJ |
histone cluster 1, H2bj |
| chr9_+_101569944 | 1.16 |
ENST00000375011.3 |
GALNT12 |
UDP-N-acetyl-alpha-D-galactosamine:polypeptide N-acetylgalactosaminyltransferase 12 (GalNAc-T12) |
| chr1_+_110881945 | 1.16 |
ENST00000602849.1 ENST00000487146.2 |
RBM15 |
RNA binding motif protein 15 |
| chr6_-_39197226 | 1.15 |
ENST00000359534.3 |
KCNK5 |
potassium channel, subfamily K, member 5 |
| chr6_+_117996621 | 1.15 |
ENST00000368494.3 |
NUS1 |
nuclear undecaprenyl pyrophosphate synthase 1 homolog (S. cerevisiae) |
| chr11_-_46142948 | 1.14 |
ENST00000257821.4 |
PHF21A |
PHD finger protein 21A |
| chr12_+_98909260 | 1.14 |
ENST00000556029.1 |
TMPO |
thymopoietin |
| chr10_+_105127704 | 1.14 |
ENST00000369839.3 ENST00000351396.4 |
TAF5 |
TAF5 RNA polymerase II, TATA box binding protein (TBP)-associated factor, 100kDa |
| chr6_+_34204642 | 1.14 |
ENST00000347617.6 ENST00000401473.3 ENST00000311487.5 ENST00000447654.1 ENST00000395004.3 |
HMGA1 |
high mobility group AT-hook 1 |
| chr12_+_98909351 | 1.13 |
ENST00000343315.5 ENST00000266732.4 ENST00000393053.2 |
TMPO |
thymopoietin |
| chr1_-_246670519 | 1.13 |
ENST00000388985.4 ENST00000490107.1 |
SMYD3 |
SET and MYND domain containing 3 |
| chr5_+_176853669 | 1.10 |
ENST00000355472.5 |
GRK6 |
G protein-coupled receptor kinase 6 |
| chr7_+_26331541 | 1.09 |
ENST00000416246.1 ENST00000338523.4 ENST00000412416.1 |
SNX10 |
sorting nexin 10 |
| chr3_+_38495333 | 1.08 |
ENST00000352511.4 |
ACVR2B |
activin A receptor, type IIB |
| chr1_+_62902308 | 1.08 |
ENST00000339950.4 |
USP1 |
ubiquitin specific peptidase 1 |
| chrX_-_129244454 | 1.07 |
ENST00000308167.5 |
ELF4 |
E74-like factor 4 (ets domain transcription factor) |
| chr12_+_118454500 | 1.04 |
ENST00000537315.1 ENST00000229043.3 ENST00000484086.2 ENST00000420967.1 ENST00000454402.2 ENST00000392542.2 ENST00000535092.1 |
RFC5 |
replication factor C (activator 1) 5, 36.5kDa |
| chr1_+_179923873 | 1.03 |
ENST00000367607.3 ENST00000491495.2 |
CEP350 |
centrosomal protein 350kDa |
| chr1_+_26798955 | 1.01 |
ENST00000361427.5 |
HMGN2 |
high mobility group nucleosomal binding domain 2 |
| chr4_-_83295103 | 1.00 |
ENST00000313899.7 ENST00000352301.4 ENST00000509107.1 ENST00000353341.4 ENST00000541060.1 |
HNRNPD |
heterogeneous nuclear ribonucleoprotein D (AU-rich element RNA binding protein 1, 37kDa) |
| chr1_+_100818009 | 0.99 |
ENST00000370125.2 ENST00000361544.6 ENST00000370124.3 |
CDC14A |
cell division cycle 14A |
| chr6_+_24775641 | 0.99 |
ENST00000378054.2 ENST00000476555.1 |
GMNN |
geminin, DNA replication inhibitor |
| chr20_+_31350184 | 0.99 |
ENST00000328111.2 ENST00000353855.2 ENST00000348286.2 |
DNMT3B |
DNA (cytosine-5-)-methyltransferase 3 beta |
| chr8_-_103136481 | 0.98 |
ENST00000524209.1 ENST00000517822.1 ENST00000523923.1 ENST00000521599.1 ENST00000521964.1 ENST00000311028.3 ENST00000518166.1 |
NCALD |
neurocalcin delta |
| chrX_-_39956656 | 0.97 |
ENST00000397354.3 ENST00000378444.4 |
BCOR |
BCL6 corepressor |
| chr14_-_23451467 | 0.96 |
ENST00000555074.1 ENST00000361265.4 |
RP11-298I3.5 AJUBA |
RP11-298I3.5 ajuba LIM protein |
| chr1_-_32403903 | 0.95 |
ENST00000344035.6 ENST00000356536.3 |
PTP4A2 |
protein tyrosine phosphatase type IVA, member 2 |
| chr7_-_103629963 | 0.95 |
ENST00000428762.1 ENST00000343529.5 ENST00000424685.2 |
RELN |
reelin |
| chr22_+_19419425 | 0.95 |
ENST00000333130.3 |
MRPL40 |
mitochondrial ribosomal protein L40 |
| chr6_+_26183958 | 0.94 |
ENST00000356530.3 |
HIST1H2BE |
histone cluster 1, H2be |
| chr3_-_113465065 | 0.94 |
ENST00000497255.1 ENST00000478020.1 ENST00000240922.3 ENST00000493900.1 |
NAA50 |
N(alpha)-acetyltransferase 50, NatE catalytic subunit |
| chr1_-_150208320 | 0.94 |
ENST00000534220.1 |
ANP32E |
acidic (leucine-rich) nuclear phosphoprotein 32 family, member E |
| chr4_+_57301896 | 0.94 |
ENST00000514888.1 ENST00000264221.2 ENST00000505164.1 |
PAICS |
phosphoribosylaminoimidazole carboxylase, phosphoribosylaminoimidazole succinocarboxamide synthetase |
| chr15_+_50474385 | 0.94 |
ENST00000267842.5 |
SLC27A2 |
solute carrier family 27 (fatty acid transporter), member 2 |
| chr15_+_41786065 | 0.94 |
ENST00000260386.5 |
ITPKA |
inositol-trisphosphate 3-kinase A |
| chr15_-_58357866 | 0.94 |
ENST00000537372.1 |
ALDH1A2 |
aldehyde dehydrogenase 1 family, member A2 |
| chr5_+_61602055 | 0.93 |
ENST00000381103.2 |
KIF2A |
kinesin heavy chain member 2A |
| chr1_+_46049706 | 0.93 |
ENST00000527470.1 ENST00000525515.1 ENST00000537798.1 ENST00000402363.3 ENST00000528238.1 ENST00000350030.3 ENST00000470768.1 ENST00000372052.4 ENST00000351223.3 |
NASP |
nuclear autoantigenic sperm protein (histone-binding) |
| chr17_-_42297092 | 0.93 |
ENST00000393606.3 |
UBTF |
upstream binding transcription factor, RNA polymerase I |
| chr2_+_32288725 | 0.93 |
ENST00000315285.3 |
SPAST |
spastin |
| chr9_+_130547958 | 0.93 |
ENST00000421939.1 ENST00000373265.2 |
CDK9 |
cyclin-dependent kinase 9 |
| chr5_+_133861790 | 0.92 |
ENST00000395003.1 |
PHF15 |
jade family PHD finger 2 |
| chr5_+_176853702 | 0.91 |
ENST00000507633.1 ENST00000393576.3 ENST00000355958.5 ENST00000528793.1 ENST00000512684.1 |
GRK6 |
G protein-coupled receptor kinase 6 |
| chr8_-_8751068 | 0.91 |
ENST00000276282.6 |
MFHAS1 |
malignant fibrous histiocytoma amplified sequence 1 |
| chr7_+_138145145 | 0.91 |
ENST00000415680.2 |
TRIM24 |
tripartite motif containing 24 |
| chr6_+_26251835 | 0.91 |
ENST00000356350.2 |
HIST1H2BH |
histone cluster 1, H2bh |
| chr7_+_138145076 | 0.90 |
ENST00000343526.4 |
TRIM24 |
tripartite motif containing 24 |
| chrX_-_11445856 | 0.90 |
ENST00000380736.1 |
ARHGAP6 |
Rho GTPase activating protein 6 |
| chr1_-_150208291 | 0.89 |
ENST00000533654.1 |
ANP32E |
acidic (leucine-rich) nuclear phosphoprotein 32 family, member E |
| chr13_-_31039375 | 0.88 |
ENST00000399494.1 |
HMGB1 |
high mobility group box 1 |
| chr15_+_50474412 | 0.88 |
ENST00000380902.4 |
SLC27A2 |
solute carrier family 27 (fatty acid transporter), member 2 |
| chr2_+_172778952 | 0.88 |
ENST00000392584.1 ENST00000264108.4 |
HAT1 |
histone acetyltransferase 1 |
| chr1_+_91966384 | 0.88 |
ENST00000430031.2 ENST00000234626.6 |
CDC7 |
cell division cycle 7 |
| chr12_-_54694807 | 0.87 |
ENST00000435572.2 |
NFE2 |
nuclear factor, erythroid 2 |
| chr9_+_132597722 | 0.86 |
ENST00000372429.3 ENST00000315480.4 ENST00000358355.1 |
USP20 |
ubiquitin specific peptidase 20 |
| chr1_-_115053781 | 0.86 |
ENST00000358465.2 ENST00000369543.2 |
TRIM33 |
tripartite motif containing 33 |
| chr1_+_26856236 | 0.85 |
ENST00000374168.2 ENST00000374166.4 |
RPS6KA1 |
ribosomal protein S6 kinase, 90kDa, polypeptide 1 |
| chr17_-_61920280 | 0.85 |
ENST00000448276.2 ENST00000577990.1 |
SMARCD2 |
SWI/SNF related, matrix associated, actin dependent regulator of chromatin, subfamily d, member 2 |
| chr12_-_54694758 | 0.84 |
ENST00000553070.1 |
NFE2 |
nuclear factor, erythroid 2 |
| chr10_-_103543145 | 0.84 |
ENST00000370110.5 |
NPM3 |
nucleophosmin/nucleoplasmin 3 |
| chr6_+_26273144 | 0.84 |
ENST00000377733.2 |
HIST1H2BI |
histone cluster 1, H2bi |
| chr10_-_23003460 | 0.84 |
ENST00000376573.4 |
PIP4K2A |
phosphatidylinositol-5-phosphate 4-kinase, type II, alpha |
| chr10_-_11653753 | 0.84 |
ENST00000609104.1 |
USP6NL |
USP6 N-terminal like |
| chr1_-_32801825 | 0.83 |
ENST00000329421.7 |
MARCKSL1 |
MARCKS-like 1 |
| chr2_+_97481974 | 0.83 |
ENST00000377060.3 ENST00000305510.3 |
CNNM3 |
cyclin M3 |
| chr1_+_167190066 | 0.83 |
ENST00000367866.2 ENST00000429375.2 ENST00000452019.1 ENST00000420254.3 ENST00000541643.3 |
POU2F1 |
POU class 2 homeobox 1 |
| chr22_+_21771656 | 0.82 |
ENST00000407464.2 |
HIC2 |
hypermethylated in cancer 2 |
| chr2_-_172750733 | 0.82 |
ENST00000392592.4 ENST00000422440.2 |
SLC25A12 |
solute carrier family 25 (aspartate/glutamate carrier), member 12 |
| chr12_+_52445191 | 0.82 |
ENST00000243050.1 ENST00000394825.1 ENST00000550763.1 ENST00000394824.2 ENST00000548232.1 ENST00000562373.1 |
NR4A1 |
nuclear receptor subfamily 4, group A, member 1 |
| chr17_+_36861735 | 0.81 |
ENST00000378137.5 ENST00000325718.7 |
MLLT6 |
myeloid/lymphoid or mixed-lineage leukemia (trithorax homolog, Drosophila); translocated to, 6 |
| chr1_-_26185844 | 0.80 |
ENST00000538789.1 ENST00000374298.3 |
AUNIP |
aurora kinase A and ninein interacting protein |
| chr16_-_51185172 | 0.80 |
ENST00000251020.4 |
SALL1 |
spalt-like transcription factor 1 |
| chr14_-_91884150 | 0.79 |
ENST00000553403.1 |
CCDC88C |
coiled-coil domain containing 88C |
| chr4_-_73434498 | 0.79 |
ENST00000286657.4 |
ADAMTS3 |
ADAM metallopeptidase with thrombospondin type 1 motif, 3 |
| chr1_+_91966656 | 0.78 |
ENST00000428239.1 ENST00000426137.1 |
CDC7 |
cell division cycle 7 |
| chr17_+_37824411 | 0.78 |
ENST00000269582.2 |
PNMT |
phenylethanolamine N-methyltransferase |
| chr9_+_131218698 | 0.78 |
ENST00000434106.3 ENST00000546203.1 ENST00000446274.1 ENST00000421776.2 ENST00000432065.2 |
ODF2 |
outer dense fiber of sperm tails 2 |
| chr12_+_94542459 | 0.77 |
ENST00000258526.4 |
PLXNC1 |
plexin C1 |
| chr12_+_93772326 | 0.77 |
ENST00000550056.1 ENST00000549992.1 ENST00000548662.1 ENST00000547014.1 |
NUDT4 |
nudix (nucleoside diphosphate linked moiety X)-type motif 4 |
| chr9_+_131451480 | 0.77 |
ENST00000322030.8 |
SET |
SET nuclear oncogene |
| chr5_+_133451254 | 0.76 |
ENST00000517851.1 ENST00000521639.1 ENST00000522375.1 ENST00000378560.4 ENST00000432532.2 ENST00000520958.1 ENST00000518915.1 ENST00000395023.1 |
TCF7 |
transcription factor 7 (T-cell specific, HMG-box) |
| chr16_-_3030283 | 0.76 |
ENST00000572619.1 ENST00000574415.1 ENST00000440027.2 ENST00000572059.1 |
PKMYT1 |
protein kinase, membrane associated tyrosine/threonine 1 |
| chrX_-_48776292 | 0.76 |
ENST00000376509.4 |
PIM2 |
pim-2 oncogene |
| chr1_-_245027833 | 0.75 |
ENST00000444376.2 |
HNRNPU |
heterogeneous nuclear ribonucleoprotein U (scaffold attachment factor A) |
| chr6_+_47445467 | 0.75 |
ENST00000359314.5 |
CD2AP |
CD2-associated protein |
| chr1_+_16174280 | 0.74 |
ENST00000375759.3 |
SPEN |
spen family transcriptional repressor |
| chr1_-_150208363 | 0.74 |
ENST00000436748.2 |
ANP32E |
acidic (leucine-rich) nuclear phosphoprotein 32 family, member E |
| chr16_+_67596310 | 0.74 |
ENST00000264010.4 ENST00000401394.1 |
CTCF |
CCCTC-binding factor (zinc finger protein) |
| chr2_-_208634287 | 0.74 |
ENST00000295417.3 |
FZD5 |
frizzled family receptor 5 |
| chr6_+_16129308 | 0.74 |
ENST00000356840.3 ENST00000349606.4 |
MYLIP |
myosin regulatory light chain interacting protein |
| chrX_+_24711997 | 0.73 |
ENST00000379068.3 ENST00000379059.3 |
POLA1 |
polymerase (DNA directed), alpha 1, catalytic subunit |
| chr8_-_80680078 | 0.73 |
ENST00000337919.5 ENST00000354724.3 |
HEY1 |
hes-related family bHLH transcription factor with YRPW motif 1 |
| chr5_+_43121607 | 0.73 |
ENST00000509156.1 ENST00000508259.1 ENST00000306938.4 ENST00000399534.1 |
ZNF131 |
zinc finger protein 131 |
| chr14_-_21493649 | 0.73 |
ENST00000553442.1 ENST00000555869.1 ENST00000556457.1 ENST00000397844.2 ENST00000554415.1 |
NDRG2 |
NDRG family member 2 |
| chr9_+_131218408 | 0.73 |
ENST00000351030.3 ENST00000604420.1 ENST00000535026.1 ENST00000448249.3 ENST00000393527.3 |
ODF2 |
outer dense fiber of sperm tails 2 |
| chrX_-_70474499 | 0.73 |
ENST00000353904.2 |
ZMYM3 |
zinc finger, MYM-type 3 |
| chr16_+_68119247 | 0.73 |
ENST00000575270.1 |
NFATC3 |
nuclear factor of activated T-cells, cytoplasmic, calcineurin-dependent 3 |
| chr16_-_56459354 | 0.73 |
ENST00000290649.5 |
AMFR |
autocrine motility factor receptor, E3 ubiquitin protein ligase |
| chr6_+_157802165 | 0.72 |
ENST00000414563.2 ENST00000359775.5 |
ZDHHC14 |
zinc finger, DHHC-type containing 14 |
| chr9_-_115095883 | 0.72 |
ENST00000450374.1 ENST00000374255.2 ENST00000334318.6 ENST00000374257.1 |
PTBP3 |
polypyrimidine tract binding protein 3 |
| chr17_-_47841485 | 0.71 |
ENST00000506156.1 ENST00000240364.2 |
FAM117A |
family with sequence similarity 117, member A |
| chr19_+_30302805 | 0.71 |
ENST00000262643.3 ENST00000575243.1 ENST00000357943.5 |
CCNE1 |
cyclin E1 |
| chr17_+_58677539 | 0.71 |
ENST00000305921.3 |
PPM1D |
protein phosphatase, Mg2+/Mn2+ dependent, 1D |
| chr1_-_54303949 | 0.71 |
ENST00000234725.8 |
NDC1 |
NDC1 transmembrane nucleoporin |
| chr1_-_32403370 | 0.71 |
ENST00000534796.1 |
PTP4A2 |
protein tyrosine phosphatase type IVA, member 2 |
| chr18_+_29672573 | 0.71 |
ENST00000578107.1 ENST00000257190.5 ENST00000580499.1 |
RNF138 |
ring finger protein 138, E3 ubiquitin protein ligase |
| chr3_-_141868293 | 0.71 |
ENST00000317104.7 ENST00000494358.1 |
TFDP2 |
transcription factor Dp-2 (E2F dimerization partner 2) |
| chr22_-_29138386 | 0.71 |
ENST00000544772.1 |
CHEK2 |
checkpoint kinase 2 |
| chr12_-_63328817 | 0.71 |
ENST00000228705.6 |
PPM1H |
protein phosphatase, Mg2+/Mn2+ dependent, 1H |
| chr17_+_45728427 | 0.71 |
ENST00000540627.1 |
KPNB1 |
karyopherin (importin) beta 1 |
| chr8_-_95908902 | 0.70 |
ENST00000520509.1 |
CCNE2 |
cyclin E2 |
| chr13_-_31040060 | 0.70 |
ENST00000326004.4 ENST00000341423.5 |
HMGB1 |
high mobility group box 1 |
| chr21_+_37757668 | 0.70 |
ENST00000314103.5 |
CHAF1B |
chromatin assembly factor 1, subunit B (p60) |
| chr3_-_141868357 | 0.70 |
ENST00000489671.1 ENST00000475734.1 ENST00000467072.1 ENST00000499676.2 |
TFDP2 |
transcription factor Dp-2 (E2F dimerization partner 2) |
| chr12_-_31479045 | 0.70 |
ENST00000539409.1 ENST00000395766.1 |
FAM60A |
family with sequence similarity 60, member A |
| chr7_-_150864635 | 0.69 |
ENST00000297537.4 |
GBX1 |
gastrulation brain homeobox 1 |
| chr9_-_124991124 | 0.69 |
ENST00000394319.4 ENST00000340587.3 |
LHX6 |
LIM homeobox 6 |
| chr20_+_47662805 | 0.69 |
ENST00000262982.2 ENST00000542325.1 |
CSE1L |
CSE1 chromosome segregation 1-like (yeast) |
| chr20_+_44657845 | 0.69 |
ENST00000243964.3 |
SLC12A5 |
solute carrier family 12 (potassium/chloride transporter), member 5 |
| chrX_-_153363125 | 0.69 |
ENST00000407218.1 ENST00000453960.2 |
MECP2 |
methyl CpG binding protein 2 (Rett syndrome) |
| chr17_-_56595196 | 0.69 |
ENST00000579921.1 ENST00000579925.1 ENST00000323456.5 |
MTMR4 |
myotubularin related protein 4 |
| chr6_+_26104104 | 0.69 |
ENST00000377803.2 |
HIST1H4C |
histone cluster 1, H4c |
| chr1_-_245027766 | 0.69 |
ENST00000283179.9 |
HNRNPU |
heterogeneous nuclear ribonucleoprotein U (scaffold attachment factor A) |
| chr17_+_64961026 | 0.68 |
ENST00000262138.3 |
CACNG4 |
calcium channel, voltage-dependent, gamma subunit 4 |
| chr14_-_77279153 | 0.68 |
ENST00000251089.2 |
ANGEL1 |
angel homolog 1 (Drosophila) |
| chr4_+_54243798 | 0.68 |
ENST00000337488.6 ENST00000358575.5 ENST00000507922.1 |
FIP1L1 |
factor interacting with PAPOLA and CPSF1 |
| chr10_+_14920843 | 0.67 |
ENST00000433779.1 ENST00000378325.3 ENST00000354919.6 ENST00000313519.5 ENST00000420416.1 |
SUV39H2 |
suppressor of variegation 3-9 homolog 2 (Drosophila) |
| chr7_-_23510086 | 0.67 |
ENST00000258729.3 |
IGF2BP3 |
insulin-like growth factor 2 mRNA binding protein 3 |
| chr8_+_61591337 | 0.67 |
ENST00000423902.2 |
CHD7 |
chromodomain helicase DNA binding protein 7 |
| chr3_+_184079492 | 0.67 |
ENST00000456318.1 ENST00000412877.1 ENST00000438240.1 |
POLR2H |
polymerase (RNA) II (DNA directed) polypeptide H |
| chr4_-_2965052 | 0.67 |
ENST00000398071.4 ENST00000502735.1 ENST00000314262.6 ENST00000416614.2 |
NOP14 |
NOP14 nucleolar protein |
| chr16_+_56225248 | 0.67 |
ENST00000262493.6 |
GNAO1 |
guanine nucleotide binding protein (G protein), alpha activating activity polypeptide O |
| chr1_-_54304212 | 0.67 |
ENST00000540001.1 |
NDC1 |
NDC1 transmembrane nucleoporin |
| chr4_+_54243862 | 0.67 |
ENST00000306932.6 |
FIP1L1 |
factor interacting with PAPOLA and CPSF1 |
| chr6_-_153304697 | 0.66 |
ENST00000367241.3 |
FBXO5 |
F-box protein 5 |
| chr6_-_27114577 | 0.66 |
ENST00000356950.1 ENST00000396891.4 |
HIST1H2BK |
histone cluster 1, H2bk |
| chr2_-_61765315 | 0.66 |
ENST00000406957.1 ENST00000401558.2 |
XPO1 |
exportin 1 (CRM1 homolog, yeast) |
| chr6_-_26124138 | 0.66 |
ENST00000314332.5 ENST00000396984.1 |
HIST1H2BC |
histone cluster 1, H2bc |
| chr16_+_2039946 | 0.66 |
ENST00000248121.2 ENST00000568896.1 |
SYNGR3 |
synaptogyrin 3 |
| chr10_-_103874692 | 0.66 |
ENST00000361198.5 |
LDB1 |
LIM domain binding 1 |
| chr16_-_20911641 | 0.66 |
ENST00000564349.1 ENST00000324344.4 |
ERI2 DCUN1D3 |
ERI1 exoribonuclease family member 2 DCN1, defective in cullin neddylation 1, domain containing 3 |
| chr17_-_46703826 | 0.66 |
ENST00000550387.1 ENST00000311177.5 |
HOXB9 |
homeobox B9 |
| chr16_+_46723552 | 0.66 |
ENST00000219097.2 ENST00000568364.2 |
ORC6 |
origin recognition complex, subunit 6 |
| chr18_+_9913977 | 0.66 |
ENST00000400000.2 ENST00000340541.4 |
VAPA |
VAMP (vesicle-associated membrane protein)-associated protein A, 33kDa |
| chr1_-_53018654 | 0.65 |
ENST00000257177.4 ENST00000355809.4 ENST00000528642.1 ENST00000470626.1 ENST00000371544.3 |
ZCCHC11 |
zinc finger, CCHC domain containing 11 |
| chr8_-_120868078 | 0.65 |
ENST00000313655.4 |
DSCC1 |
DNA replication and sister chromatid cohesion 1 |
| chr2_-_200322723 | 0.65 |
ENST00000417098.1 |
SATB2 |
SATB homeobox 2 |
| chr17_-_28618948 | 0.65 |
ENST00000261714.6 |
BLMH |
bleomycin hydrolase |
| chr17_-_28618867 | 0.64 |
ENST00000394819.3 ENST00000577623.1 |
BLMH |
bleomycin hydrolase |
| chr3_-_48229846 | 0.64 |
ENST00000302506.3 ENST00000351231.3 ENST00000437972.1 |
CDC25A |
cell division cycle 25A |
| chr1_+_109792641 | 0.64 |
ENST00000271332.3 |
CELSR2 |
cadherin, EGF LAG seven-pass G-type receptor 2 |
| chr20_+_306221 | 0.64 |
ENST00000342665.2 |
SOX12 |
SRY (sex determining region Y)-box 12 |
| chr4_-_109090106 | 0.64 |
ENST00000379951.2 |
LEF1 |
lymphoid enhancer-binding factor 1 |
| chr1_+_65775204 | 0.64 |
ENST00000371069.4 |
DNAJC6 |
DnaJ (Hsp40) homolog, subfamily C, member 6 |
| chr2_+_32288657 | 0.64 |
ENST00000345662.1 |
SPAST |
spastin |
| chr1_-_51425902 | 0.64 |
ENST00000396153.2 |
FAF1 |
Fas (TNFRSF6) associated factor 1 |
| chr2_+_26915584 | 0.64 |
ENST00000302909.3 |
KCNK3 |
potassium channel, subfamily K, member 3 |
| chr7_-_128694927 | 0.63 |
ENST00000471166.1 ENST00000265388.5 |
TNPO3 |
transportin 3 |
| chr11_-_67888881 | 0.63 |
ENST00000356135.5 |
CHKA |
choline kinase alpha |
| chr1_+_28995231 | 0.63 |
ENST00000373816.1 |
GMEB1 |
glucocorticoid modulatory element binding protein 1 |
| chr22_-_39268308 | 0.63 |
ENST00000407418.3 |
CBX6 |
chromobox homolog 6 |
| chr2_-_74692473 | 0.62 |
ENST00000535045.1 ENST00000409065.1 ENST00000414701.1 ENST00000448666.1 ENST00000233616.4 ENST00000452063.2 |
MOGS |
mannosyl-oligosaccharide glucosidase |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 6.0 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.3 | 16.3 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.2 | 0.7 | REACTOME G2 M CHECKPOINTS | Genes involved in G2/M Checkpoints |
| 0.2 | 1.3 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 0.2 | 7.0 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
| 0.2 | 2.6 | REACTOME LAGGING STRAND SYNTHESIS | Genes involved in Lagging Strand Synthesis |
| 0.2 | 3.3 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.2 | 0.8 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.2 | 1.8 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.1 | 1.5 | REACTOME RAF MAP KINASE CASCADE | Genes involved in RAF/MAP kinase cascade |
| 0.1 | 2.6 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.1 | 0.3 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
| 0.1 | 3.0 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.1 | 0.3 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.1 | 1.0 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.1 | 0.4 | REACTOME DNA STRAND ELONGATION | Genes involved in DNA strand elongation |
| 0.1 | 3.3 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.1 | 0.7 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.1 | 2.0 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.1 | 2.6 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.1 | 1.9 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.1 | 1.4 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.1 | 1.4 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.1 | 2.5 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.1 | 0.7 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.1 | 2.9 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.1 | 1.1 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.1 | 8.3 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.1 | 1.2 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
| 0.1 | 2.0 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.0 | 0.7 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.0 | 1.2 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.0 | 1.8 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.0 | 0.5 | REACTOME ACTIVATION OF ATR IN RESPONSE TO REPLICATION STRESS | Genes involved in Activation of ATR in response to replication stress |
| 0.0 | 1.5 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.0 | 1.2 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.0 | 0.7 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 0.7 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.0 | 1.0 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.0 | 0.5 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.0 | 0.7 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
| 0.0 | 1.2 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.0 | 1.5 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
| 0.0 | 2.0 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.0 | 0.6 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.0 | 0.2 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.0 | 4.5 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 0.0 | 0.6 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.0 | 0.0 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
| 0.0 | 0.3 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
| 0.0 | 0.6 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.0 | 0.5 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.0 | 0.8 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.0 | 0.1 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
| 0.0 | 0.6 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.0 | 0.4 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.0 | 0.9 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.0 | 0.1 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 0.0 | 0.8 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.0 | 0.4 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.0 | 0.6 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.0 | 1.1 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.0 | 0.7 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.0 | 1.0 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF RAS | Genes involved in CREB phosphorylation through the activation of Ras |
| 0.0 | 1.0 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.0 | 0.7 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
| 0.0 | 0.5 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.0 | 0.5 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.0 | 0.6 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.0 | 0.6 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.0 | 0.4 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.0 | 0.3 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
| 0.0 | 1.5 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.0 | 0.5 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.0 | 0.3 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.0 | 0.2 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
| 0.0 | 0.9 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
| 0.0 | 0.3 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.0 | 1.2 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.0 | 0.3 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.0 | 0.7 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 0.2 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.0 | 0.1 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.0 | 0.2 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
| 0.0 | 0.2 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
| 0.0 | 0.8 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
| 0.0 | 0.3 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.0 | 0.5 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.0 | 1.1 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.0 | 1.5 | REACTOME ACTIVATION OF THE MRNA UPON BINDING OF THE CAP BINDING COMPLEX AND EIFS AND SUBSEQUENT BINDING TO 43S | Genes involved in Activation of the mRNA upon binding of the cap-binding complex and eIFs, and subsequent binding to 43S |
| 0.0 | 0.3 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.0 | 0.3 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.0 | 0.2 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.0 | 0.6 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
| 0.0 | 0.3 | REACTOME GRB2 EVENTS IN ERBB2 SIGNALING | Genes involved in GRB2 events in ERBB2 signaling |
| 0.0 | 0.5 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 0.0 | 0.5 | REACTOME LIPOPROTEIN METABOLISM | Genes involved in Lipoprotein metabolism |
| 0.0 | 0.6 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.0 | 0.6 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.0 | 0.1 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.0 | 0.1 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.0 | 0.2 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.0 | 0.2 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.0 | 0.2 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.0 | 0.2 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
| 0.0 | 0.3 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.0 | 1.0 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
| 0.0 | 0.3 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 0.4 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 1.6 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
| 0.2 | 9.5 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.1 | 0.6 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.1 | 2.8 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.1 | 2.8 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.1 | 0.1 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.1 | 9.7 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
| 0.1 | 1.5 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.1 | 1.0 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.1 | 1.8 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.1 | 5.6 | PID NOTCH PATHWAY | Notch signaling pathway |
| 0.1 | 6.6 | PID E2F PATHWAY | E2F transcription factor network |
| 0.1 | 3.4 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.1 | 2.4 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.1 | 1.3 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.1 | 5.4 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.1 | 3.4 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.1 | 1.7 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.1 | 1.4 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.1 | 2.1 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.1 | 2.2 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.1 | 0.4 | PID FOXO PATHWAY | FoxO family signaling |
| 0.0 | 2.0 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.0 | 0.9 | PID AP1 PATHWAY | AP-1 transcription factor network |
| 0.0 | 0.4 | PID RAS PATHWAY | Regulation of Ras family activation |
| 0.0 | 0.6 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.0 | 0.5 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.0 | 2.3 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.0 | 2.8 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
| 0.0 | 0.3 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 0.3 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.0 | 2.3 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.0 | 0.6 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 2.7 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 1.1 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.0 | 1.5 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 0.8 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.0 | 0.7 | PID ATR PATHWAY | ATR signaling pathway |
| 0.0 | 0.5 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 0.1 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.0 | 1.3 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.0 | 0.1 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
| 0.0 | 1.2 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.0 | 0.3 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.0 | 0.2 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.0 | 0.4 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
| 0.0 | 0.3 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.0 | 0.5 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.0 | 0.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.0 | 0.3 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.0 | 0.2 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.0 | 0.3 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.0 | 0.2 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.0 | 0.2 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.0 | 0.8 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
| 0.0 | 0.6 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.0 | 0.2 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.8 | 8.3 | GO:1904899 | regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 0.8 | 4.1 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
| 0.7 | 2.2 | GO:1902303 | negative regulation of potassium ion export(GO:1902303) |
| 0.7 | 2.0 | GO:0000472 | endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
| 0.7 | 3.3 | GO:0003408 | optic cup formation involved in camera-type eye development(GO:0003408) |
| 0.6 | 1.9 | GO:0051300 | spindle pole body duplication(GO:0030474) spindle pole body organization(GO:0051300) spindle pole body localization(GO:0070631) establishment of spindle pole body localization(GO:0070632) spindle pole body localization to nuclear envelope(GO:0071789) establishment of spindle pole body localization to nuclear envelope(GO:0071790) |
| 0.6 | 1.8 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.5 | 2.7 | GO:1990834 | response to odorant(GO:1990834) |
| 0.5 | 1.4 | GO:0070171 | negative regulation of tooth mineralization(GO:0070171) |
| 0.5 | 1.8 | GO:0097089 | methyl-branched fatty acid metabolic process(GO:0097089) |
| 0.4 | 1.8 | GO:2000820 | negative regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000820) |
| 0.4 | 1.8 | GO:0006272 | leading strand elongation(GO:0006272) |
| 0.4 | 1.7 | GO:0002270 | plasmacytoid dendritic cell activation(GO:0002270) T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) regulation of restriction endodeoxyribonuclease activity(GO:0032072) negative regulation of apoptotic cell clearance(GO:2000426) |
| 0.4 | 2.1 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
| 0.4 | 2.1 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
| 0.4 | 2.1 | GO:0015961 | diadenosine polyphosphate catabolic process(GO:0015961) diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
| 0.4 | 2.0 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.4 | 3.7 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.4 | 4.0 | GO:0070561 | vitamin D receptor signaling pathway(GO:0070561) |
| 0.4 | 1.8 | GO:0021553 | olfactory nerve development(GO:0021553) |
| 0.4 | 1.1 | GO:0019858 | cytosine metabolic process(GO:0019858) |
| 0.3 | 1.7 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.3 | 2.1 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.3 | 1.4 | GO:2001166 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.3 | 4.1 | GO:1902659 | regulation of glucose mediated signaling pathway(GO:1902659) |
| 0.3 | 1.0 | GO:1901355 | response to rapamycin(GO:1901355) |
| 0.3 | 1.3 | GO:0097476 | spinal cord motor neuron migration(GO:0097476) lateral motor column neuron migration(GO:0097477) |
| 0.3 | 1.0 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
| 0.3 | 1.3 | GO:0042418 | epinephrine biosynthetic process(GO:0042418) |
| 0.3 | 1.2 | GO:0090402 | oncogene-induced cell senescence(GO:0090402) |
| 0.3 | 1.5 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
| 0.3 | 1.5 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
| 0.3 | 0.9 | GO:0016185 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
| 0.3 | 1.1 | GO:1903438 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 0.3 | 1.1 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
| 0.3 | 0.8 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.3 | 2.7 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.3 | 0.8 | GO:1904772 | hepatocyte homeostasis(GO:0036333) response to tetrachloromethane(GO:1904772) |
| 0.3 | 1.9 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.3 | 1.6 | GO:0071163 | DNA replication preinitiation complex assembly(GO:0071163) |
| 0.3 | 1.6 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.3 | 0.8 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.2 | 1.0 | GO:0090116 | C-5 methylation of cytosine(GO:0090116) |
| 0.2 | 0.2 | GO:0036388 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 0.2 | 2.4 | GO:0001866 | NK T cell proliferation(GO:0001866) |
| 0.2 | 0.7 | GO:0072428 | signal transduction involved in intra-S DNA damage checkpoint(GO:0072428) response to bisphenol A(GO:1903925) cellular response to bisphenol A(GO:1903926) |
| 0.2 | 0.7 | GO:0070407 | oxidation-dependent protein catabolic process(GO:0070407) |
| 0.2 | 1.9 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.2 | 0.9 | GO:0060717 | chorion development(GO:0060717) |
| 0.2 | 0.7 | GO:0019230 | proprioception(GO:0019230) |
| 0.2 | 0.7 | GO:1904247 | positive regulation of polynucleotide adenylyltransferase activity(GO:1904247) |
| 0.2 | 1.1 | GO:0019348 | dolichol metabolic process(GO:0019348) |
| 0.2 | 1.6 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.2 | 0.2 | GO:0044208 | 'de novo' AMP biosynthetic process(GO:0044208) |
| 0.2 | 0.4 | GO:2001038 | regulation of cellular response to drug(GO:2001038) |
| 0.2 | 8.9 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.2 | 0.7 | GO:0007057 | spindle assembly involved in female meiosis I(GO:0007057) |
| 0.2 | 0.7 | GO:0030901 | midbrain development(GO:0030901) |
| 0.2 | 1.5 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.2 | 0.7 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
| 0.2 | 0.6 | GO:1900104 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.2 | 1.3 | GO:0043418 | homocysteine catabolic process(GO:0043418) |
| 0.2 | 0.9 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.2 | 2.3 | GO:0042905 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.2 | 0.2 | GO:0035616 | histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.2 | 1.0 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.2 | 0.2 | GO:0017055 | negative regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0017055) |
| 0.2 | 0.4 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
| 0.2 | 0.6 | GO:0000960 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.2 | 2.9 | GO:0051256 | mitotic spindle midzone assembly(GO:0051256) |
| 0.2 | 0.8 | GO:0036496 | regulation of translational initiation by eIF2 alpha dephosphorylation(GO:0036496) |
| 0.2 | 0.6 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
| 0.2 | 0.6 | GO:0060168 | positive regulation of adenosine receptor signaling pathway(GO:0060168) |
| 0.2 | 0.8 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.2 | 0.6 | GO:0061074 | regulation of neural retina development(GO:0061074) regulation of retina development in camera-type eye(GO:1902866) |
| 0.2 | 0.7 | GO:0097010 | eukaryotic translation initiation factor 4F complex assembly(GO:0097010) |
| 0.2 | 0.6 | GO:0021919 | BMP signaling pathway involved in spinal cord dorsal/ventral patterning(GO:0021919) |
| 0.2 | 0.5 | GO:0044205 | 'de novo' UMP biosynthetic process(GO:0044205) |
| 0.2 | 0.5 | GO:0043105 | regulation of GTP cyclohydrolase I activity(GO:0043095) negative regulation of GTP cyclohydrolase I activity(GO:0043105) |
| 0.2 | 0.5 | GO:0042137 | sequestering of neurotransmitter(GO:0042137) |
| 0.2 | 0.7 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.2 | 0.5 | GO:0007206 | phospholipase C-activating G-protein coupled glutamate receptor signaling pathway(GO:0007206) |
| 0.2 | 0.3 | GO:0030949 | positive regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030949) |
| 0.2 | 1.9 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.2 | 3.0 | GO:0006337 | nucleosome disassembly(GO:0006337) |
| 0.2 | 1.0 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
| 0.2 | 1.8 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.2 | 0.5 | GO:0045659 | regulation of eosinophil differentiation(GO:0045643) positive regulation of eosinophil differentiation(GO:0045645) regulation of neutrophil differentiation(GO:0045658) negative regulation of neutrophil differentiation(GO:0045659) |
| 0.2 | 0.7 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.2 | 0.6 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.2 | 2.7 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
| 0.2 | 1.0 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
| 0.2 | 0.2 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.2 | 0.5 | GO:2000705 | dense core granule biogenesis(GO:0061110) regulation of dense core granule biogenesis(GO:2000705) |
| 0.2 | 0.5 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.2 | 0.9 | GO:1904627 | response to phorbol 13-acetate 12-myristate(GO:1904627) cellular response to phorbol 13-acetate 12-myristate(GO:1904628) |
| 0.2 | 0.2 | GO:0070585 | protein localization to mitochondrion(GO:0070585) |
| 0.1 | 1.0 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.1 | 0.4 | GO:1904800 | negative regulation of dendrite extension(GO:1903860) regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.1 | 1.6 | GO:0031507 | heterochromatin assembly(GO:0031507) |
| 0.1 | 1.5 | GO:0051096 | positive regulation of helicase activity(GO:0051096) |
| 0.1 | 0.6 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.1 | 0.6 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.1 | 0.3 | GO:0002268 | follicular dendritic cell differentiation(GO:0002268) |
| 0.1 | 0.7 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
| 0.1 | 2.5 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
| 0.1 | 0.3 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 0.1 | 1.0 | GO:1901314 | negative regulation of histone ubiquitination(GO:0033183) negative regulation of protein K63-linked ubiquitination(GO:1900045) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.1 | 0.4 | GO:0052031 | induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) |
| 0.1 | 0.4 | GO:1903033 | regulation of microtubule plus-end binding(GO:1903031) positive regulation of microtubule plus-end binding(GO:1903033) |
| 0.1 | 1.2 | GO:0017038 | protein import(GO:0017038) |
| 0.1 | 0.4 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.1 | 0.7 | GO:0006740 | NADPH regeneration(GO:0006740) |
| 0.1 | 0.4 | GO:0018312 | peptidyl-serine ADP-ribosylation(GO:0018312) |
| 0.1 | 0.7 | GO:0070370 | heat acclimation(GO:0010286) cellular heat acclimation(GO:0070370) |
| 0.1 | 3.4 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
| 0.1 | 0.4 | GO:0030307 | positive regulation of cell growth(GO:0030307) |
| 0.1 | 0.1 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.1 | 0.4 | GO:0001544 | initiation of primordial ovarian follicle growth(GO:0001544) |
| 0.1 | 1.2 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
| 0.1 | 0.9 | GO:2001300 | lipoxin metabolic process(GO:2001300) |
| 0.1 | 1.4 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.1 | 0.9 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.1 | 0.4 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.1 | 1.4 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
| 0.1 | 0.6 | GO:0015862 | uridine transport(GO:0015862) |
| 0.1 | 5.5 | GO:0043486 | histone exchange(GO:0043486) |
| 0.1 | 0.4 | GO:0051083 | 'de novo' cotranslational protein folding(GO:0051083) |
| 0.1 | 0.4 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.1 | 1.1 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
| 0.1 | 0.5 | GO:0019856 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.1 | 0.7 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.1 | 0.2 | GO:0010621 | negative regulation of transcription by transcription factor localization(GO:0010621) |
| 0.1 | 0.2 | GO:0098727 | maintenance of cell number(GO:0098727) |
| 0.1 | 2.6 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.1 | 1.5 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.1 | 0.4 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
| 0.1 | 0.6 | GO:0072719 | cellular response to cisplatin(GO:0072719) |
| 0.1 | 0.7 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.1 | 0.5 | GO:0044467 | glial cell-derived neurotrophic factor secretion(GO:0044467) regulation of glial cell-derived neurotrophic factor secretion(GO:1900166) positive regulation of glial cell-derived neurotrophic factor secretion(GO:1900168) |
| 0.1 | 2.4 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.1 | 0.2 | GO:0043633 | polyadenylation-dependent RNA catabolic process(GO:0043633) polyadenylation-dependent ncRNA catabolic process(GO:0043634) |
| 0.1 | 0.3 | GO:1903660 | negative regulation of complement-dependent cytotoxicity(GO:1903660) |
| 0.1 | 0.6 | GO:0098728 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.1 | 0.4 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.1 | 0.4 | GO:1901858 | regulation of mitochondrial DNA replication(GO:0090296) regulation of mitochondrial DNA metabolic process(GO:1901858) |
| 0.1 | 0.4 | GO:0060947 | cardiac vascular smooth muscle cell differentiation(GO:0060947) |
| 0.1 | 0.2 | GO:0042026 | protein refolding(GO:0042026) |
| 0.1 | 0.4 | GO:0002159 | desmosome assembly(GO:0002159) |
| 0.1 | 0.8 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
| 0.1 | 0.2 | GO:0045607 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.1 | 0.2 | GO:0044340 | canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
| 0.1 | 0.8 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.1 | 0.8 | GO:1904690 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.1 | 0.4 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
| 0.1 | 0.3 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
| 0.1 | 1.5 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.1 | 0.2 | GO:0045905 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.1 | 0.3 | GO:0099552 | trans-synaptic signaling by lipid, modulating synaptic transmission(GO:0099552) trans-synaptic signaling by endocannabinoid, modulating synaptic transmission(GO:0099553) |
| 0.1 | 0.2 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
| 0.1 | 0.1 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.1 | 0.5 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
| 0.1 | 0.7 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.1 | 0.2 | GO:1900078 | positive regulation of cellular response to insulin stimulus(GO:1900078) |
| 0.1 | 0.4 | GO:0018352 | protein-pyridoxal-5-phosphate linkage(GO:0018352) |
| 0.1 | 0.3 | GO:0044376 | RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
| 0.1 | 0.2 | GO:0021529 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.1 | 0.2 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
| 0.1 | 0.3 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
| 0.1 | 0.8 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
| 0.1 | 1.5 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.1 | 0.5 | GO:0021877 | forebrain neuron fate commitment(GO:0021877) |
| 0.1 | 0.1 | GO:0060031 | mediolateral intercalation(GO:0060031) planar cell polarity pathway involved in gastrula mediolateral intercalation(GO:0060775) |
| 0.1 | 0.7 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.1 | 0.5 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.1 | 0.5 | GO:0070092 | regulation of glucagon secretion(GO:0070092) |
| 0.1 | 0.8 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
| 0.1 | 1.7 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
| 0.1 | 1.5 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.1 | 0.2 | GO:0021846 | cell proliferation in forebrain(GO:0021846) forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.1 | 0.6 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) |
| 0.1 | 0.6 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.1 | 0.2 | GO:2000303 | positive regulation of lipid biosynthetic process(GO:0046889) regulation of sphingolipid biosynthetic process(GO:0090153) regulation of membrane lipid metabolic process(GO:1905038) regulation of ceramide biosynthetic process(GO:2000303) |
| 0.1 | 0.3 | GO:1904744 | regulation of single-stranded telomeric DNA binding(GO:0060380) positive regulation of single-stranded telomeric DNA binding(GO:0060381) positive regulation of telomeric DNA binding(GO:1904744) |
| 0.1 | 0.5 | GO:0021853 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 0.1 | 0.3 | GO:0035283 | rhombomere 5 development(GO:0021571) central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| 0.1 | 0.8 | GO:0061469 | response to corticotropin-releasing hormone(GO:0043435) regulation of type B pancreatic cell proliferation(GO:0061469) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.1 | 0.2 | GO:0002874 | regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) |
| 0.1 | 0.2 | GO:1902576 | negative regulation of nuclear cell cycle DNA replication(GO:1902576) |
| 0.1 | 0.4 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 0.1 | 0.4 | GO:0021997 | neural plate axis specification(GO:0021997) |
| 0.1 | 0.5 | GO:0046831 | regulation of RNA export from nucleus(GO:0046831) |
| 0.1 | 0.4 | GO:1902775 | mitochondrial ribosome assembly(GO:0061668) mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.1 | 0.3 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.1 | 0.3 | GO:0019072 | viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
| 0.1 | 0.6 | GO:0016075 | rRNA catabolic process(GO:0016075) |
| 0.1 | 0.3 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
| 0.1 | 0.3 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
| 0.1 | 1.1 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.1 | 0.4 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.1 | 0.7 | GO:0043555 | regulation of translation in response to stress(GO:0043555) |
| 0.1 | 0.2 | GO:0033504 | floor plate development(GO:0033504) |
| 0.1 | 0.2 | GO:1900060 | glucosylceramide biosynthetic process(GO:0006679) negative regulation of sphingolipid biosynthetic process(GO:0090155) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.1 | 0.4 | GO:2000630 | positive regulation of miRNA metabolic process(GO:2000630) |
| 0.1 | 0.7 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.1 | 0.8 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
| 0.1 | 0.4 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.1 | 0.4 | GO:0001315 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 0.1 | 0.3 | GO:2001295 | malonyl-CoA biosynthetic process(GO:2001295) |
| 0.1 | 0.2 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.1 | 0.2 | GO:0021722 | superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
| 0.1 | 0.2 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
| 0.1 | 1.9 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.1 | 0.2 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
| 0.1 | 0.2 | GO:0051066 | dihydrobiopterin metabolic process(GO:0051066) |
| 0.1 | 0.3 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.1 | 0.2 | GO:0030860 | regulation of polarized epithelial cell differentiation(GO:0030860) |
| 0.1 | 5.3 | GO:0006334 | nucleosome assembly(GO:0006334) |
| 0.1 | 0.4 | GO:0090625 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing by siRNA(GO:0090625) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.1 | 0.4 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
| 0.1 | 0.2 | GO:0021650 | vestibulocochlear nerve formation(GO:0021650) |
| 0.1 | 0.4 | GO:0071816 | tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.1 | 0.4 | GO:0072642 | interferon-alpha secretion(GO:0072642) regulation of interferon-alpha secretion(GO:1902739) positive regulation of interferon-alpha secretion(GO:1902741) |
| 0.1 | 0.7 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.1 | 0.8 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.1 | 0.4 | GO:0071105 | response to interleukin-11(GO:0071105) |
| 0.1 | 0.4 | GO:0021759 | globus pallidus development(GO:0021759) |
| 0.1 | 0.4 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.1 | 0.2 | GO:0016260 | selenocysteine biosynthetic process(GO:0016260) |
| 0.1 | 0.9 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
| 0.1 | 1.4 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.1 | 0.3 | GO:0031291 | Ran protein signal transduction(GO:0031291) |
| 0.1 | 0.2 | GO:0007518 | myoblast fate determination(GO:0007518) |
| 0.1 | 0.3 | GO:0021896 | forebrain astrocyte differentiation(GO:0021896) forebrain astrocyte development(GO:0021897) |
| 0.1 | 0.1 | GO:0046100 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
| 0.1 | 0.2 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.1 | 0.7 | GO:0048703 | embryonic viscerocranium morphogenesis(GO:0048703) |
| 0.1 | 0.3 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.1 | 0.2 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.1 | 0.5 | GO:0010993 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
| 0.1 | 0.2 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) retinal blood vessel morphogenesis(GO:0061304) |
| 0.1 | 1.0 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.1 | 0.3 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.1 | 0.7 | GO:0006188 | IMP biosynthetic process(GO:0006188) IMP salvage(GO:0032264) |
| 0.1 | 0.2 | GO:0060633 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) |
| 0.1 | 0.1 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
| 0.1 | 0.2 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
| 0.1 | 1.9 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.1 | 0.3 | GO:0002755 | MyD88-dependent toll-like receptor signaling pathway(GO:0002755) |
| 0.1 | 0.2 | GO:0061113 | signal transduction downstream of smoothened(GO:0007227) ventral midline development(GO:0007418) smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) pancreas morphogenesis(GO:0061113) |
| 0.1 | 1.5 | GO:0001702 | gastrulation with mouth forming second(GO:0001702) |
| 0.1 | 0.5 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
| 0.1 | 0.1 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
| 0.1 | 0.8 | GO:0070072 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.1 | 0.6 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
| 0.1 | 0.2 | GO:2000374 | regulation of oxygen metabolic process(GO:2000374) |
| 0.1 | 3.7 | GO:0045814 | negative regulation of gene expression, epigenetic(GO:0045814) |
| 0.1 | 0.1 | GO:2000291 | myoblast proliferation(GO:0051450) regulation of myoblast proliferation(GO:2000291) |
| 0.1 | 0.1 | GO:1902822 | regulation of late endosome to lysosome transport(GO:1902822) |
| 0.1 | 0.4 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.1 | 0.4 | GO:0060252 | positive regulation of glial cell proliferation(GO:0060252) |
| 0.1 | 0.2 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.1 | 0.3 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.1 | 0.8 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
| 0.1 | 0.7 | GO:0032310 | prostaglandin secretion(GO:0032310) |
| 0.1 | 0.2 | GO:0015808 | L-alanine transport(GO:0015808) |
| 0.1 | 0.9 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.1 | 0.2 | GO:0009258 | 10-formyltetrahydrofolate catabolic process(GO:0009258) |
| 0.1 | 0.4 | GO:1902963 | regulation of metalloendopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902962) negative regulation of metalloendopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902963) |
| 0.1 | 0.2 | GO:0010586 | miRNA metabolic process(GO:0010586) |
| 0.1 | 0.3 | GO:0030070 | insulin processing(GO:0030070) |
| 0.1 | 0.5 | GO:0015074 | DNA integration(GO:0015074) |
| 0.1 | 1.0 | GO:0071539 | protein localization to centrosome(GO:0071539) |
| 0.1 | 2.2 | GO:0033119 | negative regulation of RNA splicing(GO:0033119) |
| 0.1 | 0.3 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.1 | 0.8 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.1 | 0.2 | GO:0061536 | glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.1 | 0.5 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
| 0.1 | 0.2 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
| 0.1 | 0.5 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.1 | 0.3 | GO:0016191 | synaptic vesicle uncoating(GO:0016191) |
| 0.1 | 0.8 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.1 | 0.2 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
| 0.1 | 0.3 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.1 | 0.2 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.1 | 0.2 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
| 0.1 | 0.4 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 0.1 | 0.3 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.1 | 0.3 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
| 0.1 | 0.1 | GO:1900155 | regulation of bone trabecula formation(GO:1900154) negative regulation of bone trabecula formation(GO:1900155) |
| 0.1 | 0.3 | GO:0061088 | regulation of sequestering of zinc ion(GO:0061088) |
| 0.1 | 0.2 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.1 | 0.3 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.1 | 1.9 | GO:0050855 | regulation of B cell receptor signaling pathway(GO:0050855) |
| 0.1 | 0.1 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.1 | 0.4 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.1 | 0.1 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
| 0.1 | 0.8 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.1 | 0.8 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.1 | 0.1 | GO:2001293 | malonyl-CoA metabolic process(GO:2001293) |
| 0.0 | 0.2 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.0 | 0.4 | GO:0010225 | response to UV-C(GO:0010225) |
| 0.0 | 0.1 | GO:0033385 | geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
| 0.0 | 0.2 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.0 | 0.2 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
| 0.0 | 0.2 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.0 | 0.2 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
| 0.0 | 0.7 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
| 0.0 | 1.2 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.0 | 0.2 | GO:0070945 | neutrophil mediated killing of gram-negative bacterium(GO:0070945) |
| 0.0 | 0.3 | GO:1903748 | negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
| 0.0 | 0.4 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
| 0.0 | 0.4 | GO:0001711 | endodermal cell fate commitment(GO:0001711) |
| 0.0 | 3.7 | GO:0035722 | interleukin-12-mediated signaling pathway(GO:0035722) cellular response to interleukin-12(GO:0071349) |
| 0.0 | 0.5 | GO:0016246 | RNA interference(GO:0016246) |
| 0.0 | 0.3 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.0 | 0.3 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.0 | 0.2 | GO:1901798 | positive regulation of signal transduction by p53 class mediator(GO:1901798) |
| 0.0 | 0.1 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
| 0.0 | 0.7 | GO:0033197 | response to vitamin E(GO:0033197) |
| 0.0 | 0.6 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
| 0.0 | 0.1 | GO:0035621 | ER to Golgi ceramide transport(GO:0035621) |
| 0.0 | 0.7 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.0 | 0.3 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
| 0.0 | 0.1 | GO:0072014 | proximal tubule development(GO:0072014) |
| 0.0 | 0.1 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.0 | 0.4 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
| 0.0 | 0.1 | GO:0042823 | pyridoxal phosphate metabolic process(GO:0042822) pyridoxal phosphate biosynthetic process(GO:0042823) |
| 0.0 | 0.3 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.0 | 0.7 | GO:0070911 | global genome nucleotide-excision repair(GO:0070911) |
| 0.0 | 0.4 | GO:0034356 | NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
| 0.0 | 0.3 | GO:0034670 | chemotaxis to arachidonic acid(GO:0034670) response to arachidonic acid(GO:1904550) |
| 0.0 | 0.3 | GO:0019079 | viral genome replication(GO:0019079) |
| 0.0 | 0.4 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
| 0.0 | 0.0 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
| 0.0 | 0.4 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.0 | 0.3 | GO:0044380 | protein localization to cytoskeleton(GO:0044380) |
| 0.0 | 0.5 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
| 0.0 | 0.1 | GO:0002032 | desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
| 0.0 | 0.1 | GO:0050885 | neuromuscular process controlling balance(GO:0050885) |
| 0.0 | 0.0 | GO:0099545 | trans-synaptic signaling by trans-synaptic complex(GO:0099545) |
| 0.0 | 0.0 | GO:0031133 | regulation of axon diameter(GO:0031133) |
| 0.0 | 0.3 | GO:0007549 | dosage compensation(GO:0007549) |
| 0.0 | 0.5 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
| 0.0 | 1.0 | GO:0008053 | mitochondrial fusion(GO:0008053) |
| 0.0 | 0.8 | GO:0097369 | sodium ion import(GO:0097369) |
| 0.0 | 0.3 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
| 0.0 | 0.5 | GO:0075713 | establishment of integrated proviral latency(GO:0075713) |
| 0.0 | 0.1 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
| 0.0 | 0.2 | GO:0051321 | meiotic cell cycle(GO:0051321) |
| 0.0 | 0.1 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) |
| 0.0 | 0.2 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.0 | 1.3 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.0 | 0.1 | GO:0038030 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.0 | 0.4 | GO:0007051 | spindle organization(GO:0007051) |
| 0.0 | 0.2 | GO:0030252 | growth hormone secretion(GO:0030252) |
| 0.0 | 0.2 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
| 0.0 | 0.3 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 | 0.7 | GO:1990001 | inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.0 | 0.2 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
| 0.0 | 0.1 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.0 | 0.1 | GO:0050893 | sensory processing(GO:0050893) |
| 0.0 | 0.3 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
| 0.0 | 0.8 | GO:0009303 | rRNA transcription(GO:0009303) |
| 0.0 | 0.2 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.0 | 0.3 | GO:0010265 | SCF complex assembly(GO:0010265) |
| 0.0 | 0.1 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.0 | 0.3 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
| 0.0 | 0.2 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.0 | 0.1 | GO:0030242 | pexophagy(GO:0030242) |
| 0.0 | 0.1 | GO:0080009 | mRNA methylation(GO:0080009) |
| 0.0 | 0.3 | GO:0006882 | cellular zinc ion homeostasis(GO:0006882) zinc ion homeostasis(GO:0055069) |
| 0.0 | 0.8 | GO:0010470 | regulation of gastrulation(GO:0010470) |
| 0.0 | 0.3 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.0 | 0.2 | GO:0052405 | negative regulation by host of symbiont molecular function(GO:0052405) |
| 0.0 | 0.1 | GO:2000824 | negative regulation of androgen receptor activity(GO:2000824) |
| 0.0 | 0.2 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.0 | 0.3 | GO:0021794 | thalamus development(GO:0021794) |
| 0.0 | 0.2 | GO:0042631 | cellular response to water deprivation(GO:0042631) |
| 0.0 | 0.2 | GO:0098501 | polynucleotide dephosphorylation(GO:0098501) |
| 0.0 | 0.2 | GO:0035063 | nuclear speck organization(GO:0035063) |
| 0.0 | 0.3 | GO:0060088 | auditory receptor cell stereocilium organization(GO:0060088) |
| 0.0 | 0.1 | GO:0071492 | response to mycotoxin(GO:0010046) cellular response to UV-A(GO:0071492) |
| 0.0 | 0.4 | GO:0034453 | microtubule anchoring(GO:0034453) |
| 0.0 | 0.4 | GO:0010826 | negative regulation of centrosome duplication(GO:0010826) |
| 0.0 | 0.1 | GO:2000114 | regulation of establishment or maintenance of cell polarity(GO:0032878) regulation of establishment of cell polarity(GO:2000114) |
| 0.0 | 0.1 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.0 | 0.4 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.0 | 1.7 | GO:0015701 | bicarbonate transport(GO:0015701) |
| 0.0 | 0.1 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
| 0.0 | 0.2 | GO:0070235 | regulation of activation-induced cell death of T cells(GO:0070235) negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.0 | 0.5 | GO:0006333 | chromatin assembly or disassembly(GO:0006333) |
| 0.0 | 0.1 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.0 | 0.1 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
| 0.0 | 0.3 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.0 | 0.8 | GO:1903392 | negative regulation of focal adhesion assembly(GO:0051895) negative regulation of adherens junction organization(GO:1903392) |
| 0.0 | 0.1 | GO:0032868 | response to insulin(GO:0032868) |
| 0.0 | 0.6 | GO:0007020 | microtubule nucleation(GO:0007020) |
| 0.0 | 0.3 | GO:0014029 | neural crest formation(GO:0014029) |
| 0.0 | 0.3 | GO:0010259 | multicellular organism aging(GO:0010259) |
| 0.0 | 0.1 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
| 0.0 | 0.6 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
| 0.0 | 0.4 | GO:0006970 | response to osmotic stress(GO:0006970) |
| 0.0 | 0.2 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
| 0.0 | 0.4 | GO:0016579 | protein deubiquitination(GO:0016579) protein modification by small protein removal(GO:0070646) |
| 0.0 | 0.1 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
| 0.0 | 0.5 | GO:0006383 | transcription from RNA polymerase III promoter(GO:0006383) |
| 0.0 | 0.1 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.0 | 0.1 | GO:1902669 | positive regulation of axon guidance(GO:1902669) |
| 0.0 | 0.4 | GO:0006206 | pyrimidine nucleobase metabolic process(GO:0006206) |
| 0.0 | 0.3 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
| 0.0 | 0.5 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
| 0.0 | 0.1 | GO:0002188 | formation of cytoplasmic translation initiation complex(GO:0001732) translation reinitiation(GO:0002188) |
| 0.0 | 2.1 | GO:0007286 | spermatid development(GO:0007286) |
| 0.0 | 0.5 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
| 0.0 | 0.2 | GO:0031297 | replication fork processing(GO:0031297) |
| 0.0 | 1.0 | GO:0031640 | killing of cells of other organism(GO:0031640) disruption of cells of other organism(GO:0044364) |
| 0.0 | 0.2 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.0 | 0.0 | GO:0048515 | spermatid differentiation(GO:0048515) |
| 0.0 | 0.2 | GO:0051168 | nuclear export(GO:0051168) |
| 0.0 | 0.0 | GO:0006288 | base-excision repair, DNA ligation(GO:0006288) |
| 0.0 | 1.4 | GO:0000079 | regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0000079) |
| 0.0 | 1.1 | GO:0060976 | coronary vasculature development(GO:0060976) |
| 0.0 | 0.3 | GO:0060707 | trophoblast giant cell differentiation(GO:0060707) |
| 0.0 | 0.3 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.0 | 0.0 | GO:1901993 | meiotic cell cycle phase transition(GO:0044771) regulation of meiotic cell cycle phase transition(GO:1901993) negative regulation of meiotic cell cycle phase transition(GO:1901994) |
| 0.0 | 1.7 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.0 | 0.3 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
| 0.0 | 0.3 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.0 | 0.2 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.0 | 0.3 | GO:0031122 | cytoplasmic microtubule organization(GO:0031122) |
| 0.0 | 0.2 | GO:0006109 | regulation of carbohydrate metabolic process(GO:0006109) |
| 0.0 | 0.4 | GO:1901663 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.0 | 0.1 | GO:0021978 | telencephalon regionalization(GO:0021978) |
| 0.0 | 0.1 | GO:0055072 | iron ion homeostasis(GO:0055072) |
| 0.0 | 0.2 | GO:0006379 | mRNA cleavage(GO:0006379) |
| 0.0 | 0.1 | GO:0071168 | protein localization to chromatin(GO:0071168) |
| 0.0 | 0.4 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
| 0.0 | 0.2 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
| 0.0 | 0.2 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
| 0.0 | 0.4 | GO:0051568 | histone H3-K4 methylation(GO:0051568) |
| 0.0 | 0.2 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.0 | 0.5 | GO:0008211 | glucocorticoid metabolic process(GO:0008211) |
| 0.0 | 0.2 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
| 0.0 | 0.1 | GO:0070781 | response to biotin(GO:0070781) |
| 0.0 | 0.2 | GO:0008655 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
| 0.0 | 0.2 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
| 0.0 | 0.4 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
| 0.0 | 0.3 | GO:1903830 | magnesium ion transmembrane transport(GO:1903830) |
| 0.0 | 0.1 | GO:0008344 | adult locomotory behavior(GO:0008344) |
| 0.0 | 0.6 | GO:0006839 | mitochondrial transport(GO:0006839) |
| 0.0 | 0.2 | GO:0042267 | natural killer cell mediated cytotoxicity(GO:0042267) |
| 0.0 | 0.1 | GO:0009409 | response to cold(GO:0009409) |
| 0.0 | 0.0 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.0 | 0.0 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
| 0.0 | 0.9 | GO:0016575 | histone deacetylation(GO:0016575) |
| 0.0 | 0.9 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.0 | 0.9 | GO:0009301 | snRNA transcription(GO:0009301) snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.0 | 0.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.0 | 0.2 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.0 | 0.2 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.0 | 0.1 | GO:0010663 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.0 | 0.2 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.0 | 0.3 | GO:0010803 | regulation of tumor necrosis factor-mediated signaling pathway(GO:0010803) |
| 0.0 | 0.3 | GO:0033209 | tumor necrosis factor-mediated signaling pathway(GO:0033209) |
| 0.0 | 0.1 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.0 | 0.1 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.0 | 0.9 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
| 0.0 | 0.0 | GO:0007184 | SMAD protein import into nucleus(GO:0007184) |
| 0.0 | 0.2 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.0 | 0.0 | GO:0009994 | oocyte differentiation(GO:0009994) |
| 0.0 | 0.3 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.0 | 0.2 | GO:0090036 | regulation of protein kinase C signaling(GO:0090036) |
| 0.0 | 0.5 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.0 | 0.2 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) glycosylceramide biosynthetic process(GO:0046476) |
| 0.0 | 0.2 | GO:0045815 | positive regulation of gene expression, epigenetic(GO:0045815) |
| 0.0 | 0.2 | GO:0019054 | modulation by virus of host process(GO:0019054) |
| 0.0 | 0.1 | GO:0015870 | acetylcholine transport(GO:0015870) |
| 0.0 | 0.3 | GO:0098703 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
| 0.0 | 0.0 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
| 0.0 | 0.3 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
| 0.0 | 0.0 | GO:0072537 | fibroblast activation(GO:0072537) |
| 0.0 | 0.1 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
| 0.0 | 0.1 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
| 0.0 | 0.1 | GO:2000400 | positive regulation of T cell differentiation in thymus(GO:0033089) positive regulation of thymocyte aggregation(GO:2000400) |
| 0.0 | 0.1 | GO:0015939 | pantothenate metabolic process(GO:0015939) |
| 0.0 | 0.2 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.0 | 0.2 | GO:0015886 | heme transport(GO:0015886) |
| 0.0 | 0.1 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.0 | 0.1 | GO:0098914 | membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
| 0.0 | 0.1 | GO:0070528 | protein kinase C signaling(GO:0070528) |
| 0.0 | 0.2 | GO:1904814 | regulation of protein localization to chromosome, telomeric region(GO:1904814) positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
| 0.0 | 0.1 | GO:0045903 | positive regulation of translational fidelity(GO:0045903) |
| 0.0 | 0.1 | GO:0046465 | dolichyl diphosphate biosynthetic process(GO:0006489) dolichyl diphosphate metabolic process(GO:0046465) |
| 0.0 | 0.0 | GO:0001777 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.0 | 0.1 | GO:0036269 | swimming behavior(GO:0036269) |
| 0.0 | 0.1 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
| 0.0 | 0.1 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
| 0.0 | 0.3 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.0 | 0.1 | GO:0001556 | oocyte maturation(GO:0001556) |
| 0.0 | 0.1 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.0 | 0.2 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
| 0.0 | 0.2 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
| 0.0 | 0.2 | GO:0033617 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.0 | 0.2 | GO:0072348 | sulfur compound transport(GO:0072348) |
| 0.0 | 0.4 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.0 | 0.1 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
| 0.0 | 0.0 | GO:1903691 | positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
| 0.0 | 0.2 | GO:0006929 | substrate-dependent cell migration(GO:0006929) |
| 0.0 | 0.1 | GO:0072502 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.0 | 0.5 | GO:0065004 | protein-DNA complex assembly(GO:0065004) |
| 0.0 | 0.2 | GO:0001510 | RNA methylation(GO:0001510) |
| 0.0 | 0.2 | GO:0033622 | integrin activation(GO:0033622) |
| 0.0 | 0.2 | GO:0044786 | cell cycle DNA replication(GO:0044786) |
| 0.0 | 0.4 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.0 | 0.0 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
| 0.0 | 0.2 | GO:0071425 | hematopoietic stem cell proliferation(GO:0071425) |
| 0.0 | 0.1 | GO:0044597 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.0 | 0.0 | GO:2000366 | regulation of STAT protein import into nucleus(GO:2000364) positive regulation of STAT protein import into nucleus(GO:2000366) |
| 0.0 | 0.1 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
| 0.0 | 0.0 | GO:1903028 | positive regulation of opsonization(GO:1903028) |
| 0.0 | 0.1 | GO:0051451 | myoblast migration(GO:0051451) |
| 0.0 | 0.0 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.0 | 0.0 | GO:0043174 | nucleoside salvage(GO:0043174) |
| 0.0 | 0.1 | GO:0060174 | limb bud formation(GO:0060174) |
| 0.0 | 0.1 | GO:1902961 | regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902959) positive regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902961) regulation of aspartic-type peptidase activity(GO:1905245) positive regulation of aspartic-type peptidase activity(GO:1905247) |
| 0.0 | 0.2 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.0 | 0.1 | GO:0015865 | purine nucleotide transport(GO:0015865) purine ribonucleotide transport(GO:0015868) gap junction assembly(GO:0016264) |
| 0.0 | 0.2 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
| 0.0 | 0.2 | GO:0043552 | positive regulation of phosphatidylinositol 3-kinase activity(GO:0043552) |
| 0.0 | 0.2 | GO:0043488 | regulation of mRNA stability(GO:0043488) |
| 0.0 | 0.1 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) DNA-templated transcriptional preinitiation complex assembly(GO:0070897) |
| 0.0 | 0.1 | GO:0036342 | post-anal tail morphogenesis(GO:0036342) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 1.9 | GO:0070762 | nuclear pore transmembrane ring(GO:0070762) |
| 0.5 | 0.9 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
| 0.5 | 1.8 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.4 | 2.2 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.4 | 0.4 | GO:0001740 | Barr body(GO:0001740) |
| 0.4 | 2.9 | GO:0060091 | kinocilium(GO:0060091) |
| 0.4 | 1.2 | GO:0097134 | cyclin E1-CDK2 complex(GO:0097134) |
| 0.4 | 1.5 | GO:0032301 | MutSalpha complex(GO:0032301) |
| 0.4 | 1.8 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.4 | 1.4 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.3 | 2.1 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.3 | 2.0 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.3 | 4.0 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.3 | 2.2 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.3 | 0.8 | GO:0043291 | RAVE complex(GO:0043291) |
| 0.3 | 1.5 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.2 | 2.3 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.2 | 0.7 | GO:0098536 | deuterosome(GO:0098536) |
| 0.2 | 5.3 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.2 | 0.7 | GO:0030689 | Noc complex(GO:0030689) |
| 0.2 | 0.7 | GO:0002945 | cyclin K-CDK13 complex(GO:0002945) |
| 0.2 | 1.5 | GO:0031415 | NatA complex(GO:0031415) |
| 0.2 | 0.8 | GO:0016514 | SWI/SNF complex(GO:0016514) |
| 0.2 | 4.1 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.2 | 0.6 | GO:0009330 | DNA topoisomerase complex (ATP-hydrolyzing)(GO:0009330) |
| 0.2 | 0.6 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
| 0.2 | 1.1 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.2 | 9.8 | GO:0000786 | nucleosome(GO:0000786) |
| 0.2 | 1.4 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.2 | 2.0 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.2 | 1.2 | GO:0090544 | BAF-type complex(GO:0090544) |
| 0.2 | 0.6 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
| 0.2 | 0.5 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.2 | 1.4 | GO:0032039 | integrator complex(GO:0032039) |
| 0.1 | 1.0 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.1 | 0.6 | GO:1990423 | RZZ complex(GO:1990423) |
| 0.1 | 1.5 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.1 | 0.4 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.1 | 1.0 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.1 | 1.3 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.1 | 1.6 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.1 | 1.7 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.1 | 1.3 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.1 | 0.6 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.1 | 1.0 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.1 | 1.2 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.1 | 0.8 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.1 | 0.9 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.1 | 0.9 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.1 | 1.6 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.1 | 1.0 | GO:0042555 | MCM complex(GO:0042555) |
| 0.1 | 0.4 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.1 | 1.2 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.1 | 1.7 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.1 | 0.7 | GO:0030893 | meiotic cohesin complex(GO:0030893) |
| 0.1 | 0.4 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.1 | 1.6 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
| 0.1 | 0.4 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.1 | 1.4 | GO:0008091 | spectrin(GO:0008091) |
| 0.1 | 0.4 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.1 | 1.3 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.1 | 2.9 | GO:0070461 | SAGA-type complex(GO:0070461) |
| 0.1 | 0.9 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.1 | 0.3 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.1 | 0.7 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.1 | 1.0 | GO:0045120 | pronucleus(GO:0045120) |
| 0.1 | 0.5 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.1 | 0.8 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.1 | 1.3 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.1 | 0.4 | GO:0001652 | granular component(GO:0001652) |
| 0.1 | 2.0 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
| 0.1 | 0.3 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.1 | 0.3 | GO:0016939 | kinesin II complex(GO:0016939) |
| 0.1 | 0.2 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 0.1 | 0.5 | GO:0030864 | cortical actin cytoskeleton(GO:0030864) |
| 0.1 | 10.0 | GO:0016363 | nuclear matrix(GO:0016363) |
| 0.1 | 0.2 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.1 | 3.5 | GO:0000792 | heterochromatin(GO:0000792) |
| 0.1 | 0.2 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.1 | 0.7 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.1 | 0.5 | GO:0070187 | telosome(GO:0070187) |
| 0.1 | 0.3 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.1 | 0.5 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.1 | 1.2 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.1 | 0.2 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) |
| 0.1 | 0.5 | GO:0005688 | U6 snRNP(GO:0005688) |
| 0.1 | 0.8 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.1 | 4.4 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.1 | 0.2 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.1 | 0.2 | GO:0030906 | retromer, cargo-selective complex(GO:0030906) |
| 0.1 | 0.9 | GO:0032059 | bleb(GO:0032059) |
| 0.1 | 0.2 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.1 | 5.9 | GO:0016605 | PML body(GO:0016605) |
| 0.1 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.1 | 0.4 | GO:0060203 | clathrin-sculpted glutamate transport vesicle(GO:0060199) clathrin-sculpted glutamate transport vesicle membrane(GO:0060203) |
| 0.1 | 0.4 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
| 0.1 | 1.2 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.1 | 0.4 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.0 | 0.4 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.0 | 0.2 | GO:0005846 | nuclear cap binding complex(GO:0005846) |
| 0.0 | 0.5 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.0 | 0.6 | GO:0033202 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 0.0 | 1.2 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.0 | 0.4 | GO:0044815 | DNA packaging complex(GO:0044815) |
| 0.0 | 0.4 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
| 0.0 | 0.8 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) |
| 0.0 | 0.1 | GO:0036396 | MIS complex(GO:0036396) mRNA editing complex(GO:0045293) |
| 0.0 | 0.7 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.0 | 2.1 | GO:0016235 | aggresome(GO:0016235) |
| 0.0 | 0.4 | GO:0061202 | clathrin-sculpted gamma-aminobutyric acid transport vesicle(GO:0061200) clathrin-sculpted gamma-aminobutyric acid transport vesicle membrane(GO:0061202) |
| 0.0 | 2.4 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.0 | 0.2 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.0 | 0.0 | GO:0010369 | chromocenter(GO:0010369) |
| 0.0 | 0.2 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.0 | 0.6 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.0 | 0.2 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.0 | 1.2 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.0 | 0.3 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.0 | 0.2 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.0 | 1.9 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 0.3 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.0 | 1.2 | GO:0045121 | membrane raft(GO:0045121) membrane microdomain(GO:0098857) |
| 0.0 | 1.6 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.0 | 0.6 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.0 | 0.1 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.0 | 1.2 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.0 | 0.2 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.0 | 0.4 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.0 | 0.2 | GO:0032807 | DNA ligase IV complex(GO:0032807) |
| 0.0 | 0.5 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.0 | 0.5 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.0 | 0.0 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.0 | 0.9 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.0 | 0.1 | GO:0031523 | Myb complex(GO:0031523) |
| 0.0 | 0.2 | GO:0071203 | WASH complex(GO:0071203) |
| 0.0 | 0.2 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.0 | 0.9 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.0 | 0.2 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
| 0.0 | 0.3 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.0 | 0.2 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.0 | 0.9 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.0 | 0.6 | GO:0032420 | stereocilium(GO:0032420) |
| 0.0 | 0.2 | GO:0097227 | sperm annulus(GO:0097227) |
| 0.0 | 0.3 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.0 | 8.0 | GO:0000785 | chromatin(GO:0000785) |
| 0.0 | 0.1 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.0 | 0.4 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.0 | 0.1 | GO:0089701 | U2AF(GO:0089701) |
| 0.0 | 0.9 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.0 | 0.4 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.0 | 0.4 | GO:0072686 | mitotic spindle(GO:0072686) |
| 0.0 | 0.2 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.0 | 0.2 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.0 | 0.9 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.0 | 0.6 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.0 | 0.2 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
| 0.0 | 0.3 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.0 | 0.2 | GO:0000109 | nucleotide-excision repair complex(GO:0000109) |
| 0.0 | 1.0 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.0 | 0.9 | GO:0032587 | ruffle membrane(GO:0032587) |
| 0.0 | 1.2 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.0 | 0.4 | GO:0005922 | connexon complex(GO:0005922) |
| 0.0 | 1.8 | GO:0099501 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
| 0.0 | 0.4 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.0 | 0.4 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.0 | 0.3 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.0 | 0.4 | GO:0030667 | secretory granule membrane(GO:0030667) |
| 0.0 | 0.1 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.0 | 0.6 | GO:0031901 | early endosome membrane(GO:0031901) |
| 0.0 | 0.8 | GO:0005844 | polysome(GO:0005844) |
| 0.0 | 0.1 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.0 | 1.4 | GO:0005643 | nuclear pore(GO:0005643) |
| 0.0 | 0.1 | GO:0005652 | lamin filament(GO:0005638) nuclear lamina(GO:0005652) |
| 0.0 | 0.2 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.0 | 0.1 | GO:0097449 | astrocyte projection(GO:0097449) |
| 0.0 | 0.8 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.0 | 0.2 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.0 | 0.2 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.0 | 0.4 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.0 | 0.8 | GO:0032993 | protein-DNA complex(GO:0032993) |
| 0.0 | 0.1 | GO:0045272 | plasma membrane respiratory chain complex I(GO:0045272) |
| 0.0 | 0.2 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.0 | 0.1 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.0 | 0.2 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.0 | 12.8 | GO:0005730 | nucleolus(GO:0005730) |
| 0.0 | 0.1 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.0 | 0.4 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.0 | 1.1 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
| 0.0 | 0.5 | GO:0045335 | phagocytic vesicle(GO:0045335) |
| 0.0 | 0.1 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.0 | 0.9 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.0 | 0.9 | GO:0005814 | centriole(GO:0005814) |
| 0.0 | 0.1 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.0 | 0.1 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.0 | 0.2 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.0 | 0.2 | GO:0005930 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
| 0.0 | 0.4 | GO:1902711 | GABA-A receptor complex(GO:1902711) |
| 0.0 | 0.4 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
| 0.0 | 0.0 | GO:0031213 | RSF complex(GO:0031213) |
| 0.0 | 0.0 | GO:0043296 | apical junction complex(GO:0043296) |
| 0.0 | 0.1 | GO:0097433 | dense body(GO:0097433) |
| 0.0 | 2.8 | GO:0031965 | nuclear membrane(GO:0031965) |
| 0.0 | 0.1 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.0 | 0.1 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
| 0.0 | 0.1 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.0 | 0.4 | GO:0034707 | chloride channel complex(GO:0034707) |
| 0.0 | 0.1 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.0 | 0.6 | GO:0030426 | growth cone(GO:0030426) |
| 0.0 | 0.1 | GO:0032280 | symmetric synapse(GO:0032280) |
| 0.0 | 0.1 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.7 | 2.0 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
| 0.5 | 3.4 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.5 | 5.3 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.4 | 4.0 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.4 | 0.9 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.4 | 1.3 | GO:0004603 | phenylethanolamine N-methyltransferase activity(GO:0004603) |
| 0.4 | 1.7 | GO:0004727 | prenylated protein tyrosine phosphatase activity(GO:0004727) |
| 0.4 | 2.1 | GO:0000298 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) inositol diphosphate tetrakisphosphate diphosphatase activity(GO:0052840) inositol bisdiphosphate tetrakisphosphate diphosphatase activity(GO:0052841) inositol diphosphate pentakisphosphate diphosphatase activity(GO:0052842) inositol-1-diphosphate-2,3,4,5,6-pentakisphosphate diphosphatase activity(GO:0052843) inositol-3-diphosphate-1,2,4,5,6-pentakisphosphate diphosphatase activity(GO:0052844) inositol-5-diphosphate-1,2,3,4,6-pentakisphosphate diphosphatase activity(GO:0052845) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 1-diphosphatase activity(GO:0052846) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052847) inositol-3,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052848) |
| 0.4 | 2.0 | GO:0004306 | ethanolamine-phosphate cytidylyltransferase activity(GO:0004306) |
| 0.4 | 1.1 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.4 | 1.5 | GO:0032143 | single thymine insertion binding(GO:0032143) |
| 0.3 | 1.4 | GO:0016404 | 15-hydroxyprostaglandin dehydrogenase (NAD+) activity(GO:0016404) |
| 0.3 | 2.0 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.3 | 0.9 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.3 | 1.5 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) |
| 0.3 | 0.3 | GO:0030955 | potassium ion binding(GO:0030955) |
| 0.3 | 2.0 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.3 | 1.7 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
| 0.3 | 1.6 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.3 | 0.8 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.2 | 3.4 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.2 | 0.7 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.2 | 0.7 | GO:0070364 | mitochondrial light strand promoter anti-sense binding(GO:0070361) mitochondrial heavy strand promoter anti-sense binding(GO:0070362) mitochondrial heavy strand promoter sense binding(GO:0070364) |
| 0.2 | 1.4 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.2 | 0.7 | GO:0033149 | FFAT motif binding(GO:0033149) |
| 0.2 | 1.5 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.2 | 0.6 | GO:0004103 | choline kinase activity(GO:0004103) |
| 0.2 | 0.8 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.2 | 2.1 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
| 0.2 | 2.3 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.2 | 0.8 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.2 | 0.2 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.2 | 0.6 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.2 | 0.6 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.2 | 0.6 | GO:0001034 | RNA polymerase III transcription factor activity, sequence-specific DNA binding(GO:0001034) |
| 0.2 | 1.9 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.2 | 2.0 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.2 | 0.5 | GO:0004088 | carbamoyl-phosphate synthase (ammonia) activity(GO:0004087) carbamoyl-phosphate synthase (glutamine-hydrolyzing) activity(GO:0004088) |
| 0.2 | 0.5 | GO:0044549 | GTP cyclohydrolase binding(GO:0044549) |
| 0.2 | 1.0 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.2 | 1.4 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.2 | 0.8 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.2 | 1.0 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.2 | 0.8 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.2 | 0.2 | GO:0050682 | AF-2 domain binding(GO:0050682) |
| 0.2 | 0.7 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
| 0.2 | 1.1 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.2 | 2.2 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.2 | 2.3 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.2 | 1.4 | GO:0033613 | activating transcription factor binding(GO:0033613) |
| 0.1 | 0.4 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.1 | 3.8 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.1 | 0.4 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.1 | 0.4 | GO:0097158 | pre-mRNA intronic pyrimidine-rich binding(GO:0097158) |
| 0.1 | 0.6 | GO:0038025 | reelin receptor activity(GO:0038025) |
| 0.1 | 2.0 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
| 0.1 | 0.6 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.1 | 0.4 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
| 0.1 | 0.4 | GO:1990404 | protein ADP-ribosylase activity(GO:1990404) |
| 0.1 | 0.9 | GO:0003910 | DNA ligase (ATP) activity(GO:0003910) |
| 0.1 | 0.4 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
| 0.1 | 0.4 | GO:0015039 | ferredoxin-NADP+ reductase activity(GO:0004324) NADPH-adrenodoxin reductase activity(GO:0015039) oxidoreductase activity, acting on iron-sulfur proteins as donors(GO:0016730) oxidoreductase activity, acting on iron-sulfur proteins as donors, NAD or NADP as acceptor(GO:0016731) |
| 0.1 | 0.5 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
| 0.1 | 1.8 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.1 | 0.5 | GO:0044378 | non-sequence-specific DNA binding, bending(GO:0044378) |
| 0.1 | 1.1 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.1 | 0.4 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.1 | 2.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.1 | 3.4 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.1 | 0.6 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
| 0.1 | 0.5 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.1 | 0.8 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.1 | 0.8 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
| 0.1 | 0.5 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.1 | 1.3 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.1 | 0.6 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.1 | 1.8 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.1 | 0.4 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
| 0.1 | 0.3 | GO:0099580 | ion antiporter activity involved in regulation of postsynaptic membrane potential(GO:0099580) |
| 0.1 | 0.3 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.1 | 1.2 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.1 | 0.6 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
| 0.1 | 0.4 | GO:0016728 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.1 | 0.4 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
| 0.1 | 0.3 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
| 0.1 | 0.6 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 0.1 | 4.2 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.1 | 0.3 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.1 | 1.0 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.1 | 1.2 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.1 | 0.4 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.1 | 0.3 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.1 | 1.6 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
| 0.1 | 0.2 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
| 0.1 | 0.5 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
| 0.1 | 0.4 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.1 | 1.9 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.1 | 0.2 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.1 | 2.9 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.1 | 0.3 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.1 | 1.4 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
| 0.1 | 0.9 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.1 | 0.2 | GO:0047322 | [hydroxymethylglutaryl-CoA reductase (NADPH)] kinase activity(GO:0047322) [acetyl-CoA carboxylase] kinase activity(GO:0050405) |
| 0.1 | 0.1 | GO:0004672 | protein kinase activity(GO:0004672) |
| 0.1 | 1.8 | GO:0004659 | prenyltransferase activity(GO:0004659) |
| 0.1 | 0.5 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
| 0.1 | 1.2 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.1 | 1.0 | GO:0015926 | glucosidase activity(GO:0015926) |
| 0.1 | 0.8 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.1 | 0.3 | GO:0003989 | acetyl-CoA carboxylase activity(GO:0003989) |
| 0.1 | 0.6 | GO:0030284 | estrogen receptor activity(GO:0030284) |
| 0.1 | 0.3 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.1 | 0.2 | GO:0015180 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
| 0.1 | 1.0 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.1 | 0.2 | GO:0016534 | cyclin-dependent protein kinase 5 activator activity(GO:0016534) |
| 0.1 | 0.5 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.1 | 0.5 | GO:0043047 | single-stranded telomeric DNA binding(GO:0043047) G-rich strand telomeric DNA binding(GO:0098505) |
| 0.1 | 0.5 | GO:0043548 | phosphatidylinositol 3-kinase binding(GO:0043548) |
| 0.1 | 0.2 | GO:0015275 | stretch-activated, cation-selective, calcium channel activity(GO:0015275) |
| 0.1 | 2.1 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.1 | 4.0 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
| 0.1 | 0.4 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.1 | 0.7 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.1 | 0.2 | GO:0004756 | selenide, water dikinase activity(GO:0004756) phosphotransferase activity, paired acceptors(GO:0016781) |
| 0.1 | 0.2 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.1 | 0.4 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
| 0.1 | 0.6 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.1 | 2.7 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 0.1 | 0.3 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.1 | 0.2 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.1 | 0.4 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
| 0.1 | 5.9 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
| 0.1 | 0.4 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.1 | 0.3 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
| 0.1 | 1.8 | GO:0005521 | lamin binding(GO:0005521) |
| 0.1 | 1.5 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.1 | 0.2 | GO:0051139 | metal ion:proton antiporter activity(GO:0051139) |
| 0.1 | 0.3 | GO:0003696 | satellite DNA binding(GO:0003696) |
| 0.1 | 0.7 | GO:0055104 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.1 | 0.6 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.1 | 0.2 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
| 0.1 | 0.5 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.1 | 0.3 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 0.1 | 0.7 | GO:0019826 | oxygen sensor activity(GO:0019826) |
| 0.1 | 1.6 | GO:0070034 | telomerase RNA binding(GO:0070034) |
| 0.1 | 0.7 | GO:0031386 | protein tag(GO:0031386) |
| 0.1 | 0.2 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.1 | 0.3 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.1 | 0.7 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.1 | 0.3 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.1 | 1.0 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
| 0.1 | 0.9 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.1 | 2.4 | GO:0004407 | histone deacetylase activity(GO:0004407) |
| 0.1 | 1.5 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.1 | 0.2 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.1 | 0.4 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.1 | 1.8 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.1 | 2.9 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.1 | 0.6 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.1 | 0.7 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.1 | 0.8 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 0.1 | 0.2 | GO:0016155 | formyltetrahydrofolate dehydrogenase activity(GO:0016155) |
| 0.1 | 0.2 | GO:0004525 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
| 0.1 | 0.4 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.1 | 0.1 | GO:0061628 | H3K27me3 modified histone binding(GO:0061628) |
| 0.1 | 0.8 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.1 | 0.2 | GO:0034041 | sterol-transporting ATPase activity(GO:0034041) |
| 0.1 | 0.2 | GO:0004137 | deoxycytidine kinase activity(GO:0004137) |
| 0.1 | 0.6 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
| 0.1 | 1.7 | GO:0016896 | 3'-5'-exoribonuclease activity(GO:0000175) exoribonuclease activity, producing 5'-phosphomonoesters(GO:0016896) |
| 0.1 | 0.9 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.1 | 0.5 | GO:0035173 | histone kinase activity(GO:0035173) |
| 0.1 | 0.5 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.1 | 0.6 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.1 | 0.6 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.1 | 0.9 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.1 | 1.2 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.1 | 0.4 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.1 | 0.5 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.0 | 1.1 | GO:0031369 | translation initiation factor binding(GO:0031369) |
| 0.0 | 3.7 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
| 0.0 | 0.7 | GO:0030515 | snoRNA binding(GO:0030515) |
| 0.0 | 0.2 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.0 | 0.9 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.0 | 0.7 | GO:0031491 | nucleosome binding(GO:0031491) |
| 0.0 | 0.2 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.0 | 0.2 | GO:0008237 | metallopeptidase activity(GO:0008237) |
| 0.0 | 1.7 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.0 | 0.5 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.0 | 1.3 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
| 0.0 | 0.1 | GO:0004802 | transketolase activity(GO:0004802) |
| 0.0 | 0.4 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.0 | 0.2 | GO:0070404 | NADH binding(GO:0070404) |
| 0.0 | 0.3 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.0 | 0.4 | GO:0050693 | LBD domain binding(GO:0050693) |
| 0.0 | 0.2 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 0.0 | 0.5 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.0 | 0.4 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.0 | 0.4 | GO:0015386 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
| 0.0 | 6.8 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
| 0.0 | 5.1 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
| 0.0 | 1.4 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.0 | 0.5 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.0 | 0.1 | GO:0031762 | alpha-1A adrenergic receptor binding(GO:0031691) follicle-stimulating hormone receptor binding(GO:0031762) platelet activating factor receptor binding(GO:0031859) |
| 0.0 | 0.2 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
| 0.0 | 0.7 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
| 0.0 | 0.3 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.0 | 0.2 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
| 0.0 | 0.4 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
| 0.0 | 0.1 | GO:0031177 | oleoyl-[acyl-carrier-protein] hydrolase activity(GO:0004320) myristoyl-[acyl-carrier-protein] hydrolase activity(GO:0016295) palmitoyl-[acyl-carrier-protein] hydrolase activity(GO:0016296) acyl-[acyl-carrier-protein] hydrolase activity(GO:0016297) S-acetyltransferase activity(GO:0016418) phosphopantetheine binding(GO:0031177) |
| 0.0 | 3.4 | GO:0003727 | single-stranded RNA binding(GO:0003727) |
| 0.0 | 0.2 | GO:0019237 | centromeric DNA binding(GO:0019237) |
| 0.0 | 0.3 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.0 | 0.1 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
| 0.0 | 0.3 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.0 | 4.5 | GO:0042393 | histone binding(GO:0042393) |
| 0.0 | 0.2 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.0 | 0.2 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.0 | 0.4 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.0 | 0.5 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
| 0.0 | 0.5 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.0 | 0.8 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.0 | 0.0 | GO:0032810 | sterol response element binding(GO:0032810) |
| 0.0 | 0.1 | GO:0000989 | transcription factor activity, transcription factor binding(GO:0000989) |
| 0.0 | 0.1 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.0 | 0.1 | GO:0004613 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 0.0 | 0.2 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.0 | 0.3 | GO:1990763 | arrestin family protein binding(GO:1990763) |
| 0.0 | 0.2 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) |
| 0.0 | 0.4 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.0 | 0.2 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.0 | 0.7 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.0 | 0.4 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.0 | 0.3 | GO:0019534 | toxin transporter activity(GO:0019534) |
| 0.0 | 0.1 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.0 | 0.2 | GO:0001190 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
| 0.0 | 0.7 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
| 0.0 | 0.3 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
| 0.0 | 0.6 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.0 | 0.1 | GO:0016934 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
| 0.0 | 0.5 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.0 | 0.4 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.0 | 0.7 | GO:0030275 | LRR domain binding(GO:0030275) |
| 0.0 | 0.1 | GO:0044213 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) intronic transcription regulatory region DNA binding(GO:0044213) |
| 0.0 | 0.7 | GO:0042166 | acetylcholine binding(GO:0042166) |
| 0.0 | 0.3 | GO:0001042 | RNA polymerase I core binding(GO:0001042) |
| 0.0 | 0.4 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.0 | 0.5 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.0 | 1.1 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.0 | 0.1 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.0 | 0.0 | GO:0003909 | DNA ligase activity(GO:0003909) |
| 0.0 | 1.9 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.0 | 0.2 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.0 | 0.4 | GO:0005328 | neurotransmitter:sodium symporter activity(GO:0005328) |
| 0.0 | 0.4 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.0 | 0.2 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.0 | 0.1 | GO:0005326 | neurotransmitter transporter activity(GO:0005326) |
| 0.0 | 0.3 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 0.0 | 0.2 | GO:0042301 | phosphate ion binding(GO:0042301) |
| 0.0 | 0.1 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
| 0.0 | 0.1 | GO:0015235 | cobalamin transporter activity(GO:0015235) |
| 0.0 | 0.2 | GO:0050694 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.0 | 0.3 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.0 | 0.1 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.2 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) RNA polymerase activity(GO:0034062) |
| 0.0 | 0.1 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.0 | 0.2 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.0 | 0.1 | GO:0005113 | patched binding(GO:0005113) |
| 0.0 | 0.2 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.0 | 0.2 | GO:0099529 | neurotransmitter receptor activity involved in regulation of postsynaptic membrane potential(GO:0099529) transmitter-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1904315) |
| 0.0 | 0.2 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.0 | 0.1 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.0 | 0.1 | GO:0004119 | cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) |
| 0.0 | 0.1 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.0 | 0.3 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.0 | 0.1 | GO:0051998 | carboxyl-O-methyltransferase activity(GO:0010340) protein carboxyl O-methyltransferase activity(GO:0051998) |
| 0.0 | 0.1 | GO:0052725 | inositol tetrakisphosphate 1-kinase activity(GO:0047325) inositol tetrakisphosphate kinase activity(GO:0051765) inositol-1,3,4-trisphosphate 6-kinase activity(GO:0052725) inositol-1,3,4-trisphosphate 5-kinase activity(GO:0052726) inositol-1,3,4,5,6-pentakisphosphate 1-phosphatase activity(GO:0052825) inositol-1,3,4,6-tetrakisphosphate 6-phosphatase activity(GO:0052830) inositol-1,3,4,6-tetrakisphosphate 1-phosphatase activity(GO:0052831) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) |
| 0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.0 | 0.1 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.0 | 0.2 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.0 | 0.2 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.4 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
| 0.0 | 0.2 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
| 0.0 | 0.4 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.0 | 0.3 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.0 | 0.1 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.0 | 0.1 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.0 | 0.2 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.0 | 0.2 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.0 | 0.3 | GO:0005537 | mannose binding(GO:0005537) |
| 0.0 | 0.2 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
| 0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.0 | 1.0 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.0 | 0.5 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.0 | 0.1 | GO:0016531 | copper chaperone activity(GO:0016531) |
| 0.0 | 0.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.0 | 0.1 | GO:0002039 | p53 binding(GO:0002039) |
| 0.0 | 0.1 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.0 | 0.6 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
| 0.0 | 0.1 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.0 | 0.1 | GO:0033857 | inositol-1,3,4,5,6-pentakisphosphate kinase activity(GO:0000827) inositol hexakisphosphate kinase activity(GO:0000828) inositol heptakisphosphate kinase activity(GO:0000829) inositol hexakisphosphate 5-kinase activity(GO:0000832) diphosphoinositol-pentakisphosphate kinase activity(GO:0033857) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.0 | 0.3 | GO:0008175 | tRNA methyltransferase activity(GO:0008175) |
| 0.0 | 0.2 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.0 | 0.1 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.0 | 0.2 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
| 0.0 | 0.2 | GO:0030331 | estrogen receptor binding(GO:0030331) |
| 0.0 | 0.2 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.0 | 0.1 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.0 | 0.2 | GO:0005522 | profilin binding(GO:0005522) |
| 0.0 | 0.1 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
| 0.0 | 0.0 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.0 | 0.1 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.0 | 0.2 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.0 | 0.1 | GO:0005234 | extracellular-glutamate-gated ion channel activity(GO:0005234) |
| 0.0 | 0.1 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) |
| 0.0 | 0.9 | GO:0004386 | helicase activity(GO:0004386) |
| 0.0 | 0.8 | GO:0043130 | ubiquitin binding(GO:0043130) |
| 0.0 | 0.1 | GO:0016641 | oxidoreductase activity, acting on the CH-NH2 group of donors, oxygen as acceptor(GO:0016641) |
| 0.0 | 0.4 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.0 | 0.3 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
| 0.0 | 0.0 | GO:0001054 | RNA polymerase I activity(GO:0001054) |