| 13.2 |
79.3 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 12.0 |
36.1 |
GO:0021557 |
oculomotor nerve development(GO:0021557) ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
| 11.2 |
33.6 |
GO:0021759 |
globus pallidus development(GO:0021759) |
| 10.5 |
52.3 |
GO:0015671 |
oxygen transport(GO:0015671) |
| 8.5 |
25.6 |
GO:0045819 |
positive regulation of glycogen catabolic process(GO:0045819) |
| 7.7 |
23.2 |
GO:0045659 |
regulation of neutrophil differentiation(GO:0045658) negative regulation of neutrophil differentiation(GO:0045659) |
| 7.3 |
36.5 |
GO:0030951 |
establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 7.1 |
42.8 |
GO:0071699 |
olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
| 7.0 |
62.8 |
GO:0048619 |
embryonic hindgut morphogenesis(GO:0048619) |
| 7.0 |
27.9 |
GO:0072675 |
osteoclast fusion(GO:0072675) |
| 6.8 |
20.4 |
GO:2000620 |
positive regulation of histone H4-K16 acetylation(GO:2000620) |
| 6.4 |
19.2 |
GO:0002053 |
positive regulation of mesenchymal cell proliferation(GO:0002053) regulation of mesenchymal cell proliferation(GO:0010464) |
| 6.1 |
18.4 |
GO:0072076 |
nephrogenic mesenchyme development(GO:0072076) |
| 6.0 |
66.2 |
GO:0061032 |
visceral serous pericardium development(GO:0061032) |
| 6.0 |
17.9 |
GO:0090425 |
hepatocyte cell migration(GO:0002194) branching involved in pancreas morphogenesis(GO:0061114) acinar cell differentiation(GO:0090425) positive regulation of forebrain neuron differentiation(GO:2000979) |
| 5.8 |
93.0 |
GO:0048387 |
negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 5.6 |
22.4 |
GO:2000271 |
positive regulation of fibroblast apoptotic process(GO:2000271) |
| 5.6 |
100.2 |
GO:0051988 |
regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 5.5 |
16.5 |
GO:1904879 |
positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 5.4 |
26.8 |
GO:1900170 |
negative regulation of glucocorticoid mediated signaling pathway(GO:1900170) |
| 4.9 |
24.3 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 4.8 |
90.9 |
GO:0030213 |
hyaluronan biosynthetic process(GO:0030213) |
| 4.8 |
14.3 |
GO:0042320 |
regulation of circadian sleep/wake cycle, REM sleep(GO:0042320) circadian sleep/wake cycle, REM sleep(GO:0042747) positive regulation of circadian sleep/wake cycle, sleep(GO:0045938) |
| 4.7 |
14.1 |
GO:0042908 |
xenobiotic transport(GO:0042908) |
| 4.7 |
14.0 |
GO:0001869 |
regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
| 4.6 |
13.8 |
GO:0003278 |
apoptotic process involved in heart morphogenesis(GO:0003278) |
| 4.6 |
13.7 |
GO:1903225 |
negative regulation of endodermal cell differentiation(GO:1903225) |
| 4.4 |
17.6 |
GO:0021698 |
cerebellar cortex structural organization(GO:0021698) |
| 4.2 |
55.0 |
GO:0006268 |
DNA unwinding involved in DNA replication(GO:0006268) |
| 4.1 |
12.4 |
GO:0035574 |
histone H4-K20 demethylation(GO:0035574) |
| 4.1 |
16.5 |
GO:0010510 |
regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 4.1 |
4.1 |
GO:0014016 |
neuroblast differentiation(GO:0014016) |
| 4.0 |
12.1 |
GO:0036388 |
pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 4.0 |
8.0 |
GO:0010957 |
negative regulation of vitamin D biosynthetic process(GO:0010957) negative regulation of vitamin metabolic process(GO:0046137) |
| 4.0 |
44.0 |
GO:2000741 |
positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
| 3.9 |
15.6 |
GO:2000427 |
positive regulation of apoptotic cell clearance(GO:2000427) |
| 3.9 |
7.8 |
GO:0060842 |
arterial endothelial cell differentiation(GO:0060842) |
| 3.8 |
18.9 |
GO:0001561 |
fatty acid alpha-oxidation(GO:0001561) |
| 3.8 |
15.1 |
GO:0043490 |
malate-aspartate shuttle(GO:0043490) |
| 3.7 |
48.1 |
GO:0034501 |
protein localization to kinetochore(GO:0034501) |
| 3.6 |
40.0 |
GO:0007221 |
positive regulation of transcription of Notch receptor target(GO:0007221) |
| 3.6 |
39.5 |
GO:0060539 |
diaphragm development(GO:0060539) |
| 3.5 |
10.4 |
GO:0015938 |
coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) |
| 3.4 |
13.8 |
GO:0097070 |
ductus arteriosus closure(GO:0097070) |
| 3.3 |
10.0 |
GO:1902524 |
negative regulation of interferon-alpha production(GO:0032687) interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) negative regulation of interferon-beta biosynthetic process(GO:0045358) positive regulation of protein K48-linked ubiquitination(GO:1902524) |
| 3.3 |
10.0 |
GO:0006285 |
base-excision repair, AP site formation(GO:0006285) |
| 3.3 |
13.3 |
GO:1900169 |
regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 3.2 |
16.0 |
GO:0021914 |
negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 3.1 |
15.6 |
GO:2000668 |
dendritic cell apoptotic process(GO:0097048) regulation of dendritic cell apoptotic process(GO:2000668) |
| 3.1 |
9.3 |
GO:2000739 |
regulation of mesenchymal stem cell differentiation(GO:2000739) |
| 3.1 |
15.4 |
GO:0048133 |
germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 3.1 |
18.3 |
GO:0006287 |
base-excision repair, gap-filling(GO:0006287) |
| 3.0 |
15.2 |
GO:0046602 |
regulation of mitotic centrosome separation(GO:0046602) |
| 3.0 |
65.0 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 2.9 |
8.8 |
GO:0071105 |
response to interleukin-9(GO:0071104) response to interleukin-11(GO:0071105) |
| 2.9 |
5.9 |
GO:1902219 |
regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 2.9 |
11.7 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 2.9 |
8.6 |
GO:0060854 |
patterning of lymph vessels(GO:0060854) |
| 2.8 |
11.4 |
GO:0031052 |
programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
| 2.8 |
11.3 |
GO:0070425 |
negative regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070425) negative regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070433) |
| 2.8 |
11.3 |
GO:0002339 |
B cell selection(GO:0002339) |
| 2.8 |
8.4 |
GO:0007521 |
regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003256) muscle cell fate determination(GO:0007521) mammary placode formation(GO:0060596) |
| 2.7 |
13.6 |
GO:0034441 |
plasma lipoprotein particle oxidation(GO:0034441) |
| 2.7 |
24.3 |
GO:0006977 |
DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
| 2.7 |
5.3 |
GO:1905005 |
regulation of epithelial to mesenchymal transition involved in endocardial cushion formation(GO:1905005) |
| 2.6 |
21.0 |
GO:0032264 |
IMP salvage(GO:0032264) |
| 2.6 |
23.4 |
GO:0002318 |
myeloid progenitor cell differentiation(GO:0002318) |
| 2.6 |
7.8 |
GO:0006030 |
chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 2.5 |
10.2 |
GO:0014846 |
esophagus smooth muscle contraction(GO:0014846) |
| 2.5 |
7.5 |
GO:1990034 |
calcium ion export from cell(GO:1990034) |
| 2.4 |
7.3 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 2.4 |
7.2 |
GO:0044778 |
meiotic DNA integrity checkpoint(GO:0044778) |
| 2.4 |
9.5 |
GO:2000675 |
negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 2.3 |
11.5 |
GO:0070125 |
mitochondrial translational elongation(GO:0070125) |
| 2.3 |
4.6 |
GO:0045409 |
negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
| 2.3 |
11.5 |
GO:0070171 |
negative regulation of tooth mineralization(GO:0070171) |
| 2.3 |
11.5 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 2.3 |
57.2 |
GO:0007638 |
mechanosensory behavior(GO:0007638) |
| 2.3 |
18.3 |
GO:0015074 |
DNA integration(GO:0015074) |
| 2.3 |
11.4 |
GO:0002667 |
lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) negative regulation of protein kinase C signaling(GO:0090038) |
| 2.3 |
11.4 |
GO:0035022 |
positive regulation of Rac protein signal transduction(GO:0035022) |
| 2.2 |
9.0 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 2.2 |
8.9 |
GO:0060032 |
notochord regression(GO:0060032) |
| 2.2 |
6.6 |
GO:1902071 |
regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
| 2.2 |
11.0 |
GO:0036151 |
phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 2.2 |
6.6 |
GO:0006001 |
fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 2.2 |
6.5 |
GO:1904211 |
membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
| 2.1 |
36.5 |
GO:0040034 |
regulation of development, heterochronic(GO:0040034) |
| 2.1 |
8.5 |
GO:0006776 |
vitamin A metabolic process(GO:0006776) |
| 2.1 |
10.4 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 2.1 |
18.7 |
GO:0051574 |
positive regulation of histone H3-K9 methylation(GO:0051574) |
| 2.1 |
6.2 |
GO:0001866 |
NK T cell proliferation(GO:0001866) |
| 2.1 |
8.2 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 2.0 |
26.6 |
GO:0007076 |
mitotic chromosome condensation(GO:0007076) |
| 2.0 |
6.0 |
GO:0006269 |
DNA replication, synthesis of RNA primer(GO:0006269) |
| 2.0 |
10.0 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 2.0 |
5.9 |
GO:1904729 |
regulation of intestinal cholesterol absorption(GO:0030300) regulation of intestinal absorption(GO:1904478) regulation of intestinal lipid absorption(GO:1904729) |
| 2.0 |
3.9 |
GO:0036292 |
DNA rewinding(GO:0036292) |
| 1.9 |
9.7 |
GO:0072429 |
response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 1.9 |
5.8 |
GO:0030223 |
neutrophil differentiation(GO:0030223) |
| 1.9 |
21.3 |
GO:0008608 |
attachment of spindle microtubules to kinetochore(GO:0008608) |
| 1.9 |
7.6 |
GO:0043415 |
positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 1.9 |
41.9 |
GO:0001967 |
suckling behavior(GO:0001967) |
| 1.8 |
5.5 |
GO:1903054 |
negative regulation of extracellular matrix organization(GO:1903054) |
| 1.8 |
7.3 |
GO:0060266 |
negative regulation of respiratory burst involved in inflammatory response(GO:0060266) negative regulation of respiratory burst(GO:0060268) |
| 1.8 |
9.0 |
GO:0034080 |
CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 1.8 |
24.8 |
GO:0051451 |
myoblast migration(GO:0051451) |
| 1.8 |
12.3 |
GO:0072257 |
metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 1.7 |
26.1 |
GO:2001224 |
positive regulation of neuron migration(GO:2001224) |
| 1.7 |
5.2 |
GO:0021546 |
rhombomere development(GO:0021546) |
| 1.7 |
17.3 |
GO:0046036 |
GTP biosynthetic process(GO:0006183) CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
| 1.7 |
10.3 |
GO:0060836 |
lymphatic endothelial cell differentiation(GO:0060836) |
| 1.7 |
22.0 |
GO:0048642 |
negative regulation of skeletal muscle tissue development(GO:0048642) |
| 1.6 |
8.2 |
GO:2000255 |
negative regulation of male germ cell proliferation(GO:2000255) |
| 1.6 |
9.6 |
GO:1903441 |
protein localization to ciliary membrane(GO:1903441) |
| 1.6 |
1.6 |
GO:0045084 |
positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 1.6 |
4.8 |
GO:0006166 |
purine ribonucleoside salvage(GO:0006166) |
| 1.6 |
26.6 |
GO:0032060 |
bleb assembly(GO:0032060) |
| 1.6 |
3.1 |
GO:0002765 |
immune response-inhibiting signal transduction(GO:0002765) |
| 1.5 |
7.7 |
GO:0003383 |
apical constriction(GO:0003383) |
| 1.5 |
3.1 |
GO:0010908 |
regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) canonical Wnt signaling pathway involved in positive regulation of epithelial to mesenchymal transition(GO:0044334) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 1.5 |
9.2 |
GO:0097368 |
establishment of Sertoli cell barrier(GO:0097368) |
| 1.5 |
18.3 |
GO:0060159 |
regulation of dopamine receptor signaling pathway(GO:0060159) |
| 1.5 |
12.1 |
GO:0015669 |
gas transport(GO:0015669) |
| 1.5 |
4.4 |
GO:0014012 |
peripheral nervous system axon regeneration(GO:0014012) |
| 1.5 |
17.5 |
GO:0051150 |
regulation of smooth muscle cell differentiation(GO:0051150) |
| 1.5 |
2.9 |
GO:0060687 |
regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
| 1.5 |
4.4 |
GO:2001139 |
negative regulation of postsynaptic membrane organization(GO:1901627) negative regulation of dendritic spine maintenance(GO:1902951) regulation of phospholipid efflux(GO:1902994) positive regulation of phospholipid efflux(GO:1902995) negative regulation of phospholipid efflux(GO:1902999) regulation of lipid transport across blood brain barrier(GO:1903000) negative regulation of lipid transport across blood brain barrier(GO:1903001) positive regulation of lipid transport across blood brain barrier(GO:1903002) negative regulation of phospholipid transport(GO:2001139) |
| 1.4 |
11.5 |
GO:0060179 |
male mating behavior(GO:0060179) |
| 1.4 |
4.3 |
GO:0006553 |
lysine metabolic process(GO:0006553) |
| 1.4 |
7.1 |
GO:0000237 |
leptotene(GO:0000237) |
| 1.4 |
4.2 |
GO:0060681 |
branch elongation involved in ureteric bud branching(GO:0060681) |
| 1.4 |
5.6 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 1.4 |
6.8 |
GO:0002553 |
histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 1.4 |
6.8 |
GO:2000298 |
regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
| 1.4 |
6.8 |
GO:0072539 |
T-helper 17 cell differentiation(GO:0072539) |
| 1.3 |
6.7 |
GO:0031860 |
telomeric 3' overhang formation(GO:0031860) |
| 1.3 |
11.9 |
GO:0035988 |
chondrocyte proliferation(GO:0035988) |
| 1.3 |
1.3 |
GO:2000642 |
negative regulation of early endosome to late endosome transport(GO:2000642) |
| 1.3 |
3.9 |
GO:1902310 |
positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 1.3 |
22.7 |
GO:0046685 |
response to arsenic-containing substance(GO:0046685) |
| 1.3 |
3.8 |
GO:2000832 |
protein-chromophore linkage(GO:0018298) negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
| 1.2 |
6.2 |
GO:0046501 |
protoporphyrinogen IX metabolic process(GO:0046501) |
| 1.2 |
6.2 |
GO:0042997 |
negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 1.2 |
13.4 |
GO:0019985 |
translesion synthesis(GO:0019985) |
| 1.2 |
3.6 |
GO:0021940 |
positive regulation of cerebellar granule cell precursor proliferation(GO:0021940) |
| 1.2 |
3.6 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 1.2 |
3.6 |
GO:1902044 |
regulation of Fas signaling pathway(GO:1902044) negative regulation of Fas signaling pathway(GO:1902045) |
| 1.2 |
2.4 |
GO:0019343 |
cysteine biosynthetic process via cystathionine(GO:0019343) cysteine biosynthetic process(GO:0019344) |
| 1.2 |
16.9 |
GO:0015937 |
coenzyme A biosynthetic process(GO:0015937) |
| 1.2 |
4.8 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 1.2 |
7.2 |
GO:0034587 |
piRNA metabolic process(GO:0034587) |
| 1.2 |
3.6 |
GO:0006566 |
threonine metabolic process(GO:0006566) |
| 1.2 |
2.4 |
GO:0072592 |
oxygen metabolic process(GO:0072592) |
| 1.1 |
9.1 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 1.1 |
4.5 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 1.1 |
7.9 |
GO:2000124 |
regulation of endocannabinoid signaling pathway(GO:2000124) |
| 1.1 |
35.9 |
GO:0042462 |
eye photoreceptor cell development(GO:0042462) |
| 1.1 |
3.4 |
GO:0042938 |
dipeptide transport(GO:0042938) |
| 1.1 |
7.7 |
GO:0043922 |
negative regulation by host of viral transcription(GO:0043922) |
| 1.1 |
8.8 |
GO:0009954 |
proximal/distal pattern formation(GO:0009954) |
| 1.1 |
4.4 |
GO:0019230 |
proprioception(GO:0019230) |
| 1.1 |
2.1 |
GO:0006545 |
glycine biosynthetic process(GO:0006545) |
| 1.1 |
3.2 |
GO:2000852 |
regulation of corticosterone secretion(GO:2000852) |
| 1.1 |
1.1 |
GO:0071921 |
establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 1.1 |
5.3 |
GO:1904721 |
regulation of mRNA cleavage(GO:0031437) negative regulation of mRNA cleavage(GO:0031438) negative regulation of immunoglobulin secretion(GO:0051025) negative regulation of ribonuclease activity(GO:0060701) negative regulation of endoribonuclease activity(GO:0060702) regulation of mRNA endonucleolytic cleavage involved in unfolded protein response(GO:1904720) negative regulation of mRNA endonucleolytic cleavage involved in unfolded protein response(GO:1904721) |
| 1.1 |
5.3 |
GO:0046654 |
tetrahydrofolate biosynthetic process(GO:0046654) |
| 1.1 |
9.5 |
GO:0045719 |
negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 1.1 |
11.6 |
GO:0048664 |
neuron fate determination(GO:0048664) |
| 1.0 |
3.1 |
GO:0048352 |
neural plate mediolateral regionalization(GO:0021998) mesoderm structural organization(GO:0048338) paraxial mesoderm structural organization(GO:0048352) |
| 1.0 |
4.1 |
GO:2001271 |
negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 1.0 |
11.2 |
GO:0090435 |
protein localization to nuclear envelope(GO:0090435) |
| 1.0 |
7.1 |
GO:0042095 |
interferon-gamma biosynthetic process(GO:0042095) |
| 1.0 |
5.0 |
GO:0098700 |
aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 1.0 |
4.0 |
GO:0043973 |
histone H3-K4 acetylation(GO:0043973) |
| 1.0 |
8.8 |
GO:0035729 |
response to hepatocyte growth factor(GO:0035728) cellular response to hepatocyte growth factor stimulus(GO:0035729) |
| 1.0 |
4.8 |
GO:0071557 |
histone H3-K27 demethylation(GO:0071557) |
| 1.0 |
20.2 |
GO:0034508 |
centromere complex assembly(GO:0034508) |
| 1.0 |
7.6 |
GO:0002011 |
morphogenesis of an epithelial sheet(GO:0002011) |
| 0.9 |
2.8 |
GO:1990481 |
snoRNA guided rRNA pseudouridine synthesis(GO:0000454) snRNA pseudouridine synthesis(GO:0031120) mRNA pseudouridine synthesis(GO:1990481) |
| 0.9 |
21.7 |
GO:1904355 |
positive regulation of telomere capping(GO:1904355) |
| 0.9 |
6.6 |
GO:0035726 |
common myeloid progenitor cell proliferation(GO:0035726) |
| 0.9 |
1.9 |
GO:0090220 |
meiotic telomere clustering(GO:0045141) chromosome localization to nuclear envelope involved in homologous chromosome segregation(GO:0090220) |
| 0.9 |
2.8 |
GO:0090258 |
negative regulation of mitochondrial fission(GO:0090258) |
| 0.9 |
2.8 |
GO:0032918 |
polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
| 0.9 |
5.6 |
GO:0035469 |
determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.9 |
13.9 |
GO:0042407 |
cristae formation(GO:0042407) |
| 0.9 |
2.8 |
GO:0035582 |
sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.9 |
3.6 |
GO:1901165 |
positive regulation of trophoblast cell migration(GO:1901165) |
| 0.9 |
5.4 |
GO:0008611 |
ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
| 0.9 |
5.2 |
GO:0071294 |
cellular response to zinc ion(GO:0071294) |
| 0.9 |
9.4 |
GO:0021796 |
cerebral cortex regionalization(GO:0021796) |
| 0.8 |
3.4 |
GO:0071139 |
resolution of recombination intermediates(GO:0071139) |
| 0.8 |
2.5 |
GO:0033566 |
gamma-tubulin complex localization(GO:0033566) |
| 0.8 |
2.5 |
GO:1902202 |
regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
| 0.8 |
25.8 |
GO:0045746 |
negative regulation of Notch signaling pathway(GO:0045746) |
| 0.8 |
1.7 |
GO:0090071 |
negative regulation of ribosome biogenesis(GO:0090071) |
| 0.8 |
8.1 |
GO:0033210 |
leptin-mediated signaling pathway(GO:0033210) |
| 0.8 |
4.8 |
GO:0045625 |
regulation of T-helper 1 cell differentiation(GO:0045625) positive regulation of T-helper 2 cell differentiation(GO:0045630) |
| 0.8 |
2.4 |
GO:0015014 |
heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.8 |
3.2 |
GO:1904714 |
chaperone-mediated autophagy(GO:0061684) regulation of chaperone-mediated autophagy(GO:1904714) negative regulation of chaperone-mediated autophagy(GO:1904715) |
| 0.8 |
3.2 |
GO:2001054 |
negative regulation of mesenchymal cell apoptotic process(GO:2001054) |
| 0.8 |
2.3 |
GO:0006428 |
isoleucyl-tRNA aminoacylation(GO:0006428) |
| 0.8 |
3.8 |
GO:0010359 |
regulation of anion channel activity(GO:0010359) |
| 0.8 |
10.5 |
GO:0031297 |
replication fork processing(GO:0031297) |
| 0.7 |
2.2 |
GO:1903903 |
striated muscle atrophy(GO:0014891) positive regulation of keratinocyte apoptotic process(GO:1902174) regulation of establishment of T cell polarity(GO:1903903) |
| 0.7 |
3.6 |
GO:0030091 |
protein repair(GO:0030091) |
| 0.7 |
1.5 |
GO:0045359 |
positive regulation of interferon-beta biosynthetic process(GO:0045359) |
| 0.7 |
2.2 |
GO:0070269 |
pyroptosis(GO:0070269) |
| 0.7 |
1.4 |
GO:0060392 |
negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.7 |
5.8 |
GO:0036158 |
outer dynein arm assembly(GO:0036158) |
| 0.7 |
2.1 |
GO:1902065 |
response to L-glutamate(GO:1902065) |
| 0.7 |
2.1 |
GO:0009812 |
flavonoid metabolic process(GO:0009812) flavonoid biosynthetic process(GO:0009813) flavonoid glucuronidation(GO:0052696) |
| 0.7 |
27.8 |
GO:2000134 |
negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
| 0.7 |
2.8 |
GO:0048539 |
mature ribosome assembly(GO:0042256) bone marrow development(GO:0048539) |
| 0.7 |
0.7 |
GO:0042776 |
mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.7 |
25.1 |
GO:0030071 |
regulation of mitotic metaphase/anaphase transition(GO:0030071) regulation of metaphase/anaphase transition of cell cycle(GO:1902099) |
| 0.7 |
6.8 |
GO:2000643 |
positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.7 |
21.0 |
GO:0006284 |
base-excision repair(GO:0006284) |
| 0.7 |
4.0 |
GO:0060235 |
lens induction in camera-type eye(GO:0060235) |
| 0.7 |
3.3 |
GO:0051984 |
positive regulation of chromosome segregation(GO:0051984) |
| 0.7 |
10.6 |
GO:0010569 |
regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.7 |
2.6 |
GO:0045039 |
protein import into mitochondrial inner membrane(GO:0045039) |
| 0.7 |
4.6 |
GO:0031119 |
tRNA pseudouridine synthesis(GO:0031119) |
| 0.7 |
6.5 |
GO:0090557 |
establishment of endothelial intestinal barrier(GO:0090557) |
| 0.6 |
3.9 |
GO:0051461 |
corticotropin secretion(GO:0051458) regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.6 |
16.8 |
GO:0051225 |
spindle assembly(GO:0051225) |
| 0.6 |
2.5 |
GO:1901837 |
negative regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901837) |
| 0.6 |
6.7 |
GO:0097034 |
mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.6 |
2.4 |
GO:0010745 |
negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
| 0.6 |
6.0 |
GO:0045899 |
positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.6 |
3.6 |
GO:0060013 |
righting reflex(GO:0060013) |
| 0.6 |
11.3 |
GO:0006767 |
water-soluble vitamin metabolic process(GO:0006767) |
| 0.6 |
3.5 |
GO:0009162 |
deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
| 0.6 |
4.6 |
GO:0071168 |
protein localization to chromatin(GO:0071168) |
| 0.6 |
2.3 |
GO:2001032 |
positive regulation of double-strand break repair(GO:2000781) regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.6 |
12.7 |
GO:0034724 |
DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
| 0.6 |
2.3 |
GO:0032463 |
negative regulation of protein homooligomerization(GO:0032463) |
| 0.6 |
2.3 |
GO:1902036 |
regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.6 |
2.8 |
GO:0032836 |
glomerular basement membrane development(GO:0032836) |
| 0.6 |
4.5 |
GO:0018344 |
protein geranylgeranylation(GO:0018344) |
| 0.6 |
10.0 |
GO:0035855 |
megakaryocyte development(GO:0035855) |
| 0.6 |
17.1 |
GO:0042168 |
heme metabolic process(GO:0042168) |
| 0.5 |
1.6 |
GO:0044828 |
negative regulation by host of viral genome replication(GO:0044828) |
| 0.5 |
3.8 |
GO:0019254 |
carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.5 |
10.9 |
GO:1901522 |
positive regulation of transcription from RNA polymerase II promoter involved in cellular response to chemical stimulus(GO:1901522) |
| 0.5 |
4.3 |
GO:0018026 |
peptidyl-lysine monomethylation(GO:0018026) |
| 0.5 |
11.3 |
GO:0045663 |
positive regulation of myoblast differentiation(GO:0045663) |
| 0.5 |
2.1 |
GO:0030224 |
monocyte differentiation(GO:0030224) |
| 0.5 |
2.1 |
GO:0006842 |
tricarboxylic acid transport(GO:0006842) succinate transport(GO:0015744) citrate transport(GO:0015746) |
| 0.5 |
2.6 |
GO:0050747 |
positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.5 |
8.7 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.5 |
3.0 |
GO:0071732 |
cellular response to nitric oxide(GO:0071732) |
| 0.5 |
7.5 |
GO:0048368 |
lateral mesoderm development(GO:0048368) |
| 0.5 |
1.5 |
GO:0015772 |
disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.5 |
4.0 |
GO:0010587 |
miRNA catabolic process(GO:0010587) |
| 0.5 |
1.0 |
GO:0000733 |
DNA strand renaturation(GO:0000733) |
| 0.5 |
4.5 |
GO:0072010 |
renal filtration cell differentiation(GO:0061318) glomerular epithelium development(GO:0072010) glomerular visceral epithelial cell differentiation(GO:0072112) glomerular epithelial cell differentiation(GO:0072311) |
| 0.5 |
1.5 |
GO:0045601 |
regulation of endothelial cell differentiation(GO:0045601) |
| 0.5 |
1.5 |
GO:0009174 |
UMP biosynthetic process(GO:0006222) pyrimidine nucleoside monophosphate metabolic process(GO:0009129) pyrimidine nucleoside monophosphate biosynthetic process(GO:0009130) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
| 0.5 |
2.0 |
GO:0033580 |
protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
| 0.5 |
2.0 |
GO:0034975 |
protein folding in endoplasmic reticulum(GO:0034975) |
| 0.5 |
2.0 |
GO:2000483 |
negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.5 |
3.9 |
GO:0043242 |
negative regulation of protein complex disassembly(GO:0043242) negative regulation of protein depolymerization(GO:1901880) |
| 0.5 |
1.0 |
GO:1902513 |
regulation of organelle transport along microtubule(GO:1902513) |
| 0.5 |
2.4 |
GO:0006573 |
valine metabolic process(GO:0006573) |
| 0.5 |
9.5 |
GO:0006825 |
copper ion transport(GO:0006825) |
| 0.5 |
7.6 |
GO:0015693 |
magnesium ion transport(GO:0015693) |
| 0.5 |
2.4 |
GO:0060051 |
negative regulation of protein glycosylation(GO:0060051) |
| 0.5 |
13.6 |
GO:0000070 |
mitotic sister chromatid segregation(GO:0000070) |
| 0.5 |
0.9 |
GO:1904017 |
response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.5 |
1.8 |
GO:0002741 |
positive regulation of cytokine secretion involved in immune response(GO:0002741) |
| 0.4 |
3.6 |
GO:0033564 |
anterior/posterior axon guidance(GO:0033564) |
| 0.4 |
2.2 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 0.4 |
2.7 |
GO:0006662 |
glycerol ether metabolic process(GO:0006662) ether metabolic process(GO:0018904) |
| 0.4 |
4.9 |
GO:0032367 |
intracellular cholesterol transport(GO:0032367) |
| 0.4 |
1.8 |
GO:1903026 |
negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
| 0.4 |
2.6 |
GO:0000056 |
ribosomal small subunit export from nucleus(GO:0000056) |
| 0.4 |
7.0 |
GO:0070816 |
phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.4 |
0.9 |
GO:0006348 |
chromatin silencing at telomere(GO:0006348) |
| 0.4 |
7.7 |
GO:0030217 |
T cell differentiation(GO:0030217) |
| 0.4 |
1.3 |
GO:0008228 |
opsonization(GO:0008228) |
| 0.4 |
1.7 |
GO:1903715 |
regulation of aerobic respiration(GO:1903715) |
| 0.4 |
2.5 |
GO:0060390 |
regulation of SMAD protein import into nucleus(GO:0060390) positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.4 |
5.3 |
GO:0038063 |
collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.4 |
1.6 |
GO:0097011 |
cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
| 0.4 |
6.9 |
GO:0000028 |
ribosomal small subunit assembly(GO:0000028) |
| 0.4 |
6.4 |
GO:0032981 |
NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.4 |
7.5 |
GO:0032291 |
central nervous system myelination(GO:0022010) axon ensheathment in central nervous system(GO:0032291) |
| 0.4 |
3.1 |
GO:0009109 |
coenzyme catabolic process(GO:0009109) cofactor catabolic process(GO:0051187) |
| 0.4 |
2.3 |
GO:0060406 |
positive regulation of penile erection(GO:0060406) |
| 0.4 |
14.4 |
GO:0006940 |
regulation of smooth muscle contraction(GO:0006940) |
| 0.4 |
4.3 |
GO:0046597 |
negative regulation of viral entry into host cell(GO:0046597) |
| 0.4 |
1.6 |
GO:0071494 |
cellular response to UV-C(GO:0071494) |
| 0.4 |
3.9 |
GO:0098751 |
bone cell development(GO:0098751) |
| 0.4 |
1.2 |
GO:1900060 |
negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.4 |
4.6 |
GO:0000463 |
maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.4 |
2.3 |
GO:0001980 |
regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
| 0.4 |
2.7 |
GO:0060766 |
negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.4 |
4.5 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.4 |
3.3 |
GO:0022613 |
ribonucleoprotein complex biogenesis(GO:0022613) |
| 0.4 |
3.3 |
GO:0046686 |
response to cadmium ion(GO:0046686) |
| 0.4 |
3.7 |
GO:0010574 |
regulation of vascular endothelial growth factor production(GO:0010574) |
| 0.4 |
3.7 |
GO:0050860 |
negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.4 |
9.9 |
GO:0050873 |
brown fat cell differentiation(GO:0050873) |
| 0.4 |
3.6 |
GO:0071803 |
positive regulation of podosome assembly(GO:0071803) |
| 0.4 |
1.8 |
GO:0006532 |
aspartate biosynthetic process(GO:0006532) |
| 0.4 |
1.8 |
GO:0038166 |
angiotensin-activated signaling pathway(GO:0038166) |
| 0.4 |
1.1 |
GO:0050904 |
diapedesis(GO:0050904) |
| 0.4 |
5.0 |
GO:0009191 |
ribonucleoside diphosphate catabolic process(GO:0009191) |
| 0.4 |
7.4 |
GO:0045907 |
positive regulation of vasoconstriction(GO:0045907) |
| 0.4 |
1.8 |
GO:0070574 |
cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.3 |
17.5 |
GO:0007052 |
mitotic spindle organization(GO:0007052) |
| 0.3 |
2.1 |
GO:0045915 |
positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
| 0.3 |
17.9 |
GO:0051289 |
protein homotetramerization(GO:0051289) |
| 0.3 |
3.4 |
GO:0046784 |
viral mRNA export from host cell nucleus(GO:0046784) |
| 0.3 |
1.4 |
GO:0016479 |
negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
| 0.3 |
2.4 |
GO:0009404 |
toxin metabolic process(GO:0009404) |
| 0.3 |
2.0 |
GO:0042866 |
pyruvate biosynthetic process(GO:0042866) |
| 0.3 |
1.4 |
GO:0042905 |
9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.3 |
13.2 |
GO:0019915 |
lipid storage(GO:0019915) |
| 0.3 |
2.7 |
GO:0006122 |
mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.3 |
1.3 |
GO:0016259 |
serine family amino acid biosynthetic process(GO:0009070) selenocysteine metabolic process(GO:0016259) |
| 0.3 |
1.7 |
GO:0010991 |
regulation of SMAD protein complex assembly(GO:0010990) negative regulation of SMAD protein complex assembly(GO:0010991) |
| 0.3 |
12.3 |
GO:0032611 |
interleukin-1 beta production(GO:0032611) |
| 0.3 |
4.8 |
GO:0006516 |
glycoprotein catabolic process(GO:0006516) |
| 0.3 |
2.2 |
GO:0001711 |
endodermal cell fate commitment(GO:0001711) |
| 0.3 |
1.0 |
GO:0060333 |
interferon-gamma-mediated signaling pathway(GO:0060333) |
| 0.3 |
3.2 |
GO:0034244 |
negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.3 |
5.0 |
GO:0001779 |
natural killer cell differentiation(GO:0001779) |
| 0.3 |
1.2 |
GO:0038163 |
thrombopoietin-mediated signaling pathway(GO:0038163) |
| 0.3 |
14.2 |
GO:0009060 |
aerobic respiration(GO:0009060) |
| 0.3 |
8.3 |
GO:0051310 |
metaphase plate congression(GO:0051310) |
| 0.3 |
6.4 |
GO:0045604 |
regulation of epidermal cell differentiation(GO:0045604) |
| 0.3 |
3.6 |
GO:0003301 |
physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.3 |
1.2 |
GO:0006438 |
valyl-tRNA aminoacylation(GO:0006438) |
| 0.3 |
2.4 |
GO:2000381 |
negative regulation of mesoderm development(GO:2000381) |
| 0.3 |
15.0 |
GO:0006261 |
DNA-dependent DNA replication(GO:0006261) |
| 0.3 |
3.3 |
GO:0070935 |
3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.3 |
1.5 |
GO:0016188 |
synaptic vesicle maturation(GO:0016188) |
| 0.3 |
10.3 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.3 |
1.4 |
GO:0015803 |
branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
| 0.3 |
2.4 |
GO:0019369 |
arachidonic acid metabolic process(GO:0019369) |
| 0.3 |
1.1 |
GO:0032790 |
ribosome disassembly(GO:0032790) |
| 0.3 |
0.3 |
GO:0045085 |
negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.3 |
2.0 |
GO:0035999 |
tetrahydrofolate interconversion(GO:0035999) |
| 0.3 |
1.5 |
GO:0033299 |
secretion of lysosomal enzymes(GO:0033299) |
| 0.3 |
1.8 |
GO:0019348 |
dolichol metabolic process(GO:0019348) |
| 0.3 |
3.3 |
GO:0034394 |
protein localization to cell surface(GO:0034394) |
| 0.2 |
8.2 |
GO:0042060 |
wound healing(GO:0042060) |
| 0.2 |
0.2 |
GO:0007113 |
endomitotic cell cycle(GO:0007113) |
| 0.2 |
1.9 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.2 |
3.8 |
GO:0000470 |
maturation of LSU-rRNA(GO:0000470) |
| 0.2 |
1.4 |
GO:0009249 |
protein lipoylation(GO:0009249) |
| 0.2 |
2.6 |
GO:0031498 |
nucleosome disassembly(GO:0006337) chromatin disassembly(GO:0031498) protein-DNA complex disassembly(GO:0032986) |
| 0.2 |
1.4 |
GO:0048661 |
positive regulation of smooth muscle cell proliferation(GO:0048661) |
| 0.2 |
1.8 |
GO:0050852 |
T cell receptor signaling pathway(GO:0050852) |
| 0.2 |
1.3 |
GO:0035405 |
histone-threonine phosphorylation(GO:0035405) |
| 0.2 |
1.1 |
GO:0032196 |
transposition(GO:0032196) |
| 0.2 |
2.6 |
GO:0015781 |
nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
| 0.2 |
2.6 |
GO:0006851 |
mitochondrial calcium ion transport(GO:0006851) |
| 0.2 |
0.6 |
GO:2000858 |
mineralocorticoid secretion(GO:0035931) aldosterone secretion(GO:0035932) regulation of mineralocorticoid secretion(GO:2000855) positive regulation of mineralocorticoid secretion(GO:2000857) regulation of aldosterone secretion(GO:2000858) positive regulation of aldosterone secretion(GO:2000860) |
| 0.2 |
1.5 |
GO:1990403 |
embryonic brain development(GO:1990403) |
| 0.2 |
0.2 |
GO:0032240 |
negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.2 |
2.3 |
GO:0001731 |
formation of translation preinitiation complex(GO:0001731) |
| 0.2 |
1.2 |
GO:0033353 |
S-adenosylmethionine cycle(GO:0033353) |
| 0.2 |
1.6 |
GO:0010719 |
negative regulation of epithelial to mesenchymal transition(GO:0010719) |
| 0.2 |
6.3 |
GO:0035315 |
hair cell differentiation(GO:0035315) |
| 0.2 |
1.2 |
GO:0060837 |
blood vessel endothelial cell differentiation(GO:0060837) |
| 0.2 |
1.4 |
GO:0043249 |
erythrocyte maturation(GO:0043249) |
| 0.2 |
3.1 |
GO:0032402 |
melanosome transport(GO:0032402) pigment granule transport(GO:0051904) |
| 0.2 |
1.3 |
GO:0046477 |
glycosylceramide catabolic process(GO:0046477) |
| 0.2 |
0.4 |
GO:0050847 |
progesterone receptor signaling pathway(GO:0050847) |
| 0.2 |
1.1 |
GO:0019886 |
antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
| 0.2 |
6.5 |
GO:0015804 |
neutral amino acid transport(GO:0015804) |
| 0.2 |
3.7 |
GO:0016486 |
peptide hormone processing(GO:0016486) |
| 0.2 |
1.3 |
GO:0051967 |
negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.2 |
3.3 |
GO:0002088 |
lens development in camera-type eye(GO:0002088) |
| 0.2 |
3.6 |
GO:0061028 |
establishment of endothelial barrier(GO:0061028) |
| 0.2 |
0.9 |
GO:2000623 |
regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.2 |
0.9 |
GO:0061042 |
vascular wound healing(GO:0061042) |
| 0.2 |
0.4 |
GO:0046479 |
oligosaccharide catabolic process(GO:0009313) glycosphingolipid catabolic process(GO:0046479) |
| 0.2 |
0.5 |
GO:0021691 |
cerebellar Purkinje cell layer maturation(GO:0021691) |
| 0.2 |
4.1 |
GO:1902808 |
positive regulation of cell cycle G1/S phase transition(GO:1902808) |
| 0.2 |
0.9 |
GO:0033147 |
negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.2 |
1.0 |
GO:0006384 |
transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.2 |
1.2 |
GO:2000051 |
negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.2 |
0.7 |
GO:0061052 |
negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.2 |
1.5 |
GO:0046415 |
urate metabolic process(GO:0046415) |
| 0.2 |
1.9 |
GO:0099625 |
regulation of ventricular cardiac muscle cell membrane repolarization(GO:0060307) ventricular cardiac muscle cell membrane repolarization(GO:0099625) |
| 0.2 |
2.6 |
GO:0030033 |
microvillus assembly(GO:0030033) |
| 0.2 |
1.6 |
GO:0043403 |
skeletal muscle tissue regeneration(GO:0043403) |
| 0.2 |
0.8 |
GO:1905098 |
negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) response to amino acid starvation(GO:1990928) |
| 0.2 |
2.9 |
GO:0051084 |
'de novo' protein folding(GO:0006458) 'de novo' posttranslational protein folding(GO:0051084) |
| 0.2 |
3.9 |
GO:0042058 |
regulation of epidermal growth factor receptor signaling pathway(GO:0042058) |
| 0.2 |
2.7 |
GO:0006349 |
regulation of gene expression by genetic imprinting(GO:0006349) |
| 0.1 |
5.7 |
GO:0048663 |
neuron fate commitment(GO:0048663) |
| 0.1 |
2.1 |
GO:0006388 |
tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.1 |
1.6 |
GO:0007398 |
ectoderm development(GO:0007398) |
| 0.1 |
0.7 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.1 |
1.4 |
GO:0006048 |
UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.1 |
2.7 |
GO:0048873 |
homeostasis of number of cells within a tissue(GO:0048873) |
| 0.1 |
1.0 |
GO:0045721 |
negative regulation of gluconeogenesis(GO:0045721) |
| 0.1 |
1.3 |
GO:0030212 |
hyaluronan metabolic process(GO:0030212) |
| 0.1 |
6.1 |
GO:0043268 |
positive regulation of potassium ion transport(GO:0043268) |
| 0.1 |
1.0 |
GO:0006363 |
termination of RNA polymerase I transcription(GO:0006363) |
| 0.1 |
1.8 |
GO:0050819 |
negative regulation of coagulation(GO:0050819) |
| 0.1 |
8.2 |
GO:0009062 |
fatty acid catabolic process(GO:0009062) |
| 0.1 |
6.8 |
GO:0048864 |
stem cell development(GO:0048864) |
| 0.1 |
0.8 |
GO:0051304 |
chromosome separation(GO:0051304) |
| 0.1 |
4.5 |
GO:0007257 |
activation of JUN kinase activity(GO:0007257) |
| 0.1 |
2.4 |
GO:0002455 |
humoral immune response mediated by circulating immunoglobulin(GO:0002455) |
| 0.1 |
0.8 |
GO:1900364 |
negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.1 |
0.8 |
GO:0015838 |
amino-acid betaine transport(GO:0015838) carnitine transport(GO:0015879) |
| 0.1 |
2.8 |
GO:0043171 |
peptide catabolic process(GO:0043171) |
| 0.1 |
1.3 |
GO:0018206 |
peptidyl-methionine modification(GO:0018206) |
| 0.1 |
2.3 |
GO:0035058 |
nonmotile primary cilium assembly(GO:0035058) |
| 0.1 |
2.7 |
GO:0045880 |
positive regulation of smoothened signaling pathway(GO:0045880) |
| 0.1 |
1.0 |
GO:0006610 |
ribosomal protein import into nucleus(GO:0006610) |
| 0.1 |
2.6 |
GO:1902043 |
positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.1 |
0.3 |
GO:0001887 |
selenium compound metabolic process(GO:0001887) |
| 0.1 |
0.9 |
GO:0016074 |
snoRNA metabolic process(GO:0016074) snoRNA processing(GO:0043144) |
| 0.1 |
0.5 |
GO:0008298 |
intracellular mRNA localization(GO:0008298) |
| 0.1 |
1.4 |
GO:0002377 |
immunoglobulin production(GO:0002377) |
| 0.1 |
0.9 |
GO:0071318 |
cellular response to ATP(GO:0071318) |
| 0.1 |
0.3 |
GO:0030202 |
heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.1 |
0.3 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 0.1 |
1.3 |
GO:0061371 |
determination of heart left/right asymmetry(GO:0061371) |
| 0.1 |
2.4 |
GO:0030514 |
negative regulation of BMP signaling pathway(GO:0030514) |
| 0.1 |
0.3 |
GO:0031590 |
wybutosine metabolic process(GO:0031590) wybutosine biosynthetic process(GO:0031591) |
| 0.1 |
0.7 |
GO:0015868 |
purine ribonucleotide transport(GO:0015868) |
| 0.1 |
3.1 |
GO:0061077 |
chaperone-mediated protein folding(GO:0061077) |
| 0.1 |
1.1 |
GO:0006607 |
NLS-bearing protein import into nucleus(GO:0006607) |
| 0.1 |
2.3 |
GO:0030901 |
midbrain development(GO:0030901) |
| 0.1 |
0.9 |
GO:0000301 |
retrograde transport, vesicle recycling within Golgi(GO:0000301) |
| 0.1 |
2.9 |
GO:0001959 |
regulation of cytokine-mediated signaling pathway(GO:0001959) |
| 0.1 |
2.3 |
GO:0070534 |
protein K63-linked ubiquitination(GO:0070534) |
| 0.1 |
3.8 |
GO:0006406 |
mRNA export from nucleus(GO:0006406) mRNA-containing ribonucleoprotein complex export from nucleus(GO:0071427) |
| 0.1 |
0.3 |
GO:0006432 |
phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 |
0.9 |
GO:0002227 |
innate immune response in mucosa(GO:0002227) |
| 0.1 |
5.7 |
GO:0006302 |
double-strand break repair(GO:0006302) |
| 0.1 |
1.0 |
GO:0070670 |
response to interleukin-4(GO:0070670) |
| 0.1 |
2.5 |
GO:0031960 |
response to corticosteroid(GO:0031960) response to glucocorticoid(GO:0051384) |
| 0.1 |
2.9 |
GO:0007029 |
endoplasmic reticulum organization(GO:0007029) |
| 0.1 |
0.7 |
GO:0006120 |
mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.1 |
0.8 |
GO:0032922 |
circadian regulation of gene expression(GO:0032922) |
| 0.1 |
2.9 |
GO:0045454 |
cell redox homeostasis(GO:0045454) |
| 0.1 |
0.9 |
GO:2000060 |
positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
| 0.1 |
0.6 |
GO:0071260 |
cellular response to mechanical stimulus(GO:0071260) |
| 0.1 |
3.3 |
GO:0051028 |
mRNA transport(GO:0051028) |
| 0.1 |
0.6 |
GO:0000184 |
nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.1 |
2.3 |
GO:0001837 |
epithelial to mesenchymal transition(GO:0001837) |
| 0.1 |
0.7 |
GO:0010955 |
negative regulation of protein processing(GO:0010955) negative regulation of protein maturation(GO:1903318) |
| 0.1 |
1.1 |
GO:0002181 |
cytoplasmic translation(GO:0002181) |
| 0.1 |
0.4 |
GO:1904407 |
positive regulation of nitric oxide biosynthetic process(GO:0045429) positive regulation of nitric oxide metabolic process(GO:1904407) |
| 0.1 |
0.5 |
GO:0002091 |
negative regulation of receptor internalization(GO:0002091) |
| 0.0 |
1.0 |
GO:0003341 |
cilium movement(GO:0003341) |
| 0.0 |
0.2 |
GO:0001504 |
neurotransmitter uptake(GO:0001504) |
| 0.0 |
1.8 |
GO:0006418 |
tRNA aminoacylation for protein translation(GO:0006418) |
| 0.0 |
0.6 |
GO:0042832 |
defense response to protozoan(GO:0042832) |
| 0.0 |
1.2 |
GO:0045197 |
establishment or maintenance of epithelial cell apical/basal polarity(GO:0045197) |
| 0.0 |
0.1 |
GO:0002408 |
dendritic cell chemotaxis(GO:0002407) myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.0 |
0.5 |
GO:0010388 |
protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
| 0.0 |
0.3 |
GO:0019730 |
antimicrobial humoral response(GO:0019730) |
| 0.0 |
0.4 |
GO:0043567 |
regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.0 |
0.2 |
GO:0008063 |
Toll signaling pathway(GO:0008063) |
| 0.0 |
0.1 |
GO:0035990 |
tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
| 0.0 |
0.1 |
GO:0010764 |
negative regulation of fibroblast migration(GO:0010764) |
| 0.0 |
0.4 |
GO:0007249 |
I-kappaB kinase/NF-kappaB signaling(GO:0007249) |
| 0.0 |
0.1 |
GO:0000491 |
small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.0 |
1.0 |
GO:0006506 |
GPI anchor biosynthetic process(GO:0006506) |
| 0.0 |
1.0 |
GO:0042274 |
ribosomal small subunit biogenesis(GO:0042274) |
| 0.0 |
0.6 |
GO:0032233 |
positive regulation of actin filament bundle assembly(GO:0032233) |
| 0.0 |
0.5 |
GO:0046856 |
phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.0 |
0.5 |
GO:0003073 |
regulation of systemic arterial blood pressure(GO:0003073) |
| 0.0 |
0.0 |
GO:0060528 |
secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.0 |
0.3 |
GO:0016226 |
iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 |
0.2 |
GO:0022904 |
respiratory electron transport chain(GO:0022904) |
| 0.0 |
0.2 |
GO:0007274 |
neuromuscular synaptic transmission(GO:0007274) |
| 0.0 |
0.3 |
GO:2000279 |
negative regulation of DNA biosynthetic process(GO:2000279) |
| 0.0 |
0.1 |
GO:0090201 |
negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
| 0.0 |
0.1 |
GO:0032515 |
negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
| 0.0 |
0.4 |
GO:0006888 |
ER to Golgi vesicle-mediated transport(GO:0006888) |
| 0.0 |
0.8 |
GO:1903955 |
positive regulation of protein targeting to mitochondrion(GO:1903955) |
| 0.0 |
0.1 |
GO:1901223 |
negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
