| 8.1 |
56.9 |
GO:0031536 |
positive regulation of exit from mitosis(GO:0031536) |
| 6.3 |
19.0 |
GO:0030421 |
defecation(GO:0030421) |
| 6.0 |
6.0 |
GO:0048672 |
positive regulation of collateral sprouting(GO:0048672) |
| 5.9 |
29.6 |
GO:0010032 |
meiotic chromosome condensation(GO:0010032) |
| 5.6 |
22.4 |
GO:0060032 |
notochord regression(GO:0060032) |
| 5.5 |
27.5 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 5.5 |
22.0 |
GO:0003360 |
brainstem development(GO:0003360) |
| 5.4 |
16.2 |
GO:0060364 |
frontal suture morphogenesis(GO:0060364) |
| 5.3 |
26.3 |
GO:0061314 |
Notch signaling involved in heart development(GO:0061314) |
| 4.9 |
14.8 |
GO:0048496 |
maintenance of organ identity(GO:0048496) |
| 4.9 |
14.8 |
GO:1901420 |
negative regulation of response to alcohol(GO:1901420) |
| 4.9 |
29.5 |
GO:0071499 |
response to laminar fluid shear stress(GO:0034616) cellular response to laminar fluid shear stress(GO:0071499) |
| 4.9 |
19.6 |
GO:0046469 |
platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 4.8 |
14.3 |
GO:0061743 |
motor learning(GO:0061743) |
| 4.7 |
14.1 |
GO:0061144 |
alveolar secondary septum development(GO:0061144) |
| 4.6 |
13.9 |
GO:0006578 |
amino-acid betaine biosynthetic process(GO:0006578) |
| 4.3 |
12.9 |
GO:0009177 |
deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
| 4.3 |
12.8 |
GO:0021529 |
spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 4.0 |
12.1 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 3.9 |
11.8 |
GO:1904457 |
positive regulation of neuronal action potential(GO:1904457) |
| 3.9 |
23.3 |
GO:0060718 |
chorionic trophoblast cell differentiation(GO:0060718) |
| 3.8 |
15.3 |
GO:0015888 |
thiamine transport(GO:0015888) |
| 3.8 |
15.1 |
GO:0046836 |
glycolipid transport(GO:0046836) |
| 3.7 |
11.2 |
GO:0060598 |
dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
| 3.7 |
14.9 |
GO:0043490 |
malate-aspartate shuttle(GO:0043490) |
| 3.7 |
18.6 |
GO:0048133 |
germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 3.7 |
11.1 |
GO:0072034 |
renal vesicle induction(GO:0072034) |
| 3.6 |
7.2 |
GO:0060129 |
thyroid-stimulating hormone-secreting cell differentiation(GO:0060129) |
| 3.5 |
10.5 |
GO:1904395 |
positive regulation of receptor clustering(GO:1903911) regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
| 3.5 |
3.5 |
GO:1904030 |
negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
| 3.5 |
6.9 |
GO:0072076 |
nephrogenic mesenchyme development(GO:0072076) |
| 3.5 |
3.5 |
GO:0060994 |
regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 3.4 |
17.1 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 3.4 |
6.7 |
GO:1990705 |
cholangiocyte proliferation(GO:1990705) |
| 3.3 |
9.9 |
GO:0007223 |
Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 3.3 |
6.6 |
GO:0010248 |
B cell negative selection(GO:0002352) establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 3.3 |
9.9 |
GO:0021893 |
cerebral cortex GABAergic interneuron fate commitment(GO:0021893) |
| 3.3 |
9.9 |
GO:0086017 |
Purkinje myocyte action potential(GO:0086017) |
| 3.3 |
9.8 |
GO:0006682 |
galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 3.2 |
6.5 |
GO:0042939 |
glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
| 3.1 |
12.4 |
GO:0071449 |
cellular response to lipid hydroperoxide(GO:0071449) |
| 3.1 |
18.6 |
GO:0021984 |
adenohypophysis development(GO:0021984) |
| 3.1 |
15.4 |
GO:0034441 |
plasma lipoprotein particle oxidation(GO:0034441) |
| 3.0 |
3.0 |
GO:0072223 |
metanephric glomerular mesangium development(GO:0072223) metanephric glomerular mesangial cell proliferation involved in metanephros development(GO:0072262) |
| 3.0 |
9.1 |
GO:0006083 |
acetate metabolic process(GO:0006083) |
| 3.0 |
6.0 |
GO:2001027 |
negative regulation of endothelial cell chemotaxis(GO:2001027) |
| 3.0 |
15.0 |
GO:1904667 |
negative regulation of ubiquitin protein ligase activity(GO:1904667) |
| 3.0 |
11.9 |
GO:0016340 |
calcium-dependent cell-matrix adhesion(GO:0016340) |
| 2.9 |
14.7 |
GO:0061181 |
regulation of chondrocyte development(GO:0061181) |
| 2.9 |
14.7 |
GO:0015705 |
iodide transport(GO:0015705) |
| 2.9 |
2.9 |
GO:0060762 |
regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
| 2.9 |
11.6 |
GO:0038163 |
thrombopoietin-mediated signaling pathway(GO:0038163) |
| 2.9 |
8.6 |
GO:0036292 |
DNA rewinding(GO:0036292) |
| 2.8 |
11.4 |
GO:0070318 |
positive regulation of G0 to G1 transition(GO:0070318) |
| 2.8 |
8.5 |
GO:0006285 |
base-excision repair, AP site formation(GO:0006285) |
| 2.8 |
14.1 |
GO:0034372 |
very-low-density lipoprotein particle remodeling(GO:0034372) |
| 2.8 |
13.9 |
GO:0010668 |
ectodermal cell differentiation(GO:0010668) |
| 2.8 |
11.1 |
GO:0042276 |
error-prone translesion synthesis(GO:0042276) |
| 2.8 |
16.5 |
GO:0060242 |
contact inhibition(GO:0060242) |
| 2.7 |
10.8 |
GO:2000271 |
positive regulation of fibroblast apoptotic process(GO:2000271) |
| 2.7 |
13.5 |
GO:0060754 |
positive regulation of mast cell chemotaxis(GO:0060754) |
| 2.7 |
32.3 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 2.7 |
10.7 |
GO:0072385 |
minus-end-directed organelle transport along microtubule(GO:0072385) |
| 2.7 |
21.3 |
GO:0048625 |
myoblast fate commitment(GO:0048625) |
| 2.7 |
10.6 |
GO:1903519 |
apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
| 2.6 |
13.2 |
GO:0002317 |
plasma cell differentiation(GO:0002317) |
| 2.6 |
10.4 |
GO:0006776 |
vitamin A metabolic process(GO:0006776) |
| 2.6 |
7.8 |
GO:0046655 |
glycine biosynthetic process(GO:0006545) folic acid metabolic process(GO:0046655) |
| 2.6 |
7.7 |
GO:0014028 |
notochord formation(GO:0014028) |
| 2.6 |
10.3 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 2.5 |
7.6 |
GO:0035519 |
protein K29-linked ubiquitination(GO:0035519) |
| 2.5 |
2.5 |
GO:0006097 |
glyoxylate cycle(GO:0006097) glyoxylate metabolic process(GO:0046487) |
| 2.5 |
2.5 |
GO:2000297 |
negative regulation of synapse maturation(GO:2000297) |
| 2.5 |
10.0 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 2.5 |
7.5 |
GO:0035604 |
fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) coronal suture morphogenesis(GO:0060365) squamous basal epithelial stem cell differentiation involved in prostate gland acinus development(GO:0060529) |
| 2.5 |
12.3 |
GO:0007089 |
traversing start control point of mitotic cell cycle(GO:0007089) |
| 2.5 |
7.4 |
GO:0021759 |
globus pallidus development(GO:0021759) |
| 2.5 |
7.4 |
GO:1902566 |
regulation of eosinophil activation(GO:1902566) |
| 2.5 |
7.4 |
GO:0071898 |
regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 2.4 |
34.2 |
GO:0030903 |
notochord development(GO:0030903) |
| 2.4 |
7.3 |
GO:0042908 |
xenobiotic transport(GO:0042908) |
| 2.4 |
12.1 |
GO:0034421 |
post-translational protein acetylation(GO:0034421) |
| 2.4 |
9.6 |
GO:2000065 |
negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) regulation of cortisol biosynthetic process(GO:2000064) negative regulation of cortisol biosynthetic process(GO:2000065) |
| 2.4 |
21.6 |
GO:2000051 |
negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 2.4 |
7.1 |
GO:0045590 |
negative regulation of regulatory T cell differentiation(GO:0045590) |
| 2.4 |
2.4 |
GO:0070884 |
regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 2.4 |
9.4 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 2.4 |
33.0 |
GO:0060579 |
ventral spinal cord interneuron fate commitment(GO:0060579) cell fate commitment involved in pattern specification(GO:0060581) |
| 2.4 |
9.4 |
GO:2001045 |
negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 2.3 |
2.3 |
GO:0048619 |
embryonic hindgut morphogenesis(GO:0048619) |
| 2.3 |
6.9 |
GO:0019343 |
cysteine biosynthetic process via cystathionine(GO:0019343) cysteine biosynthetic process(GO:0019344) |
| 2.3 |
2.3 |
GO:0042660 |
positive regulation of cell fate specification(GO:0042660) |
| 2.3 |
4.6 |
GO:0038091 |
VEGF-activated platelet-derived growth factor receptor signaling pathway(GO:0038086) positive regulation of cell proliferation by VEGF-activated platelet derived growth factor receptor signaling pathway(GO:0038091) |
| 2.3 |
15.8 |
GO:0016127 |
cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 2.3 |
15.8 |
GO:0032825 |
positive regulation of natural killer cell differentiation(GO:0032825) |
| 2.3 |
15.8 |
GO:1902459 |
positive regulation of stem cell population maintenance(GO:1902459) |
| 2.2 |
11.2 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 2.2 |
8.8 |
GO:0043569 |
negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 2.2 |
17.6 |
GO:2000781 |
positive regulation of double-strand break repair(GO:2000781) |
| 2.2 |
8.8 |
GO:0032901 |
positive regulation of neurotrophin production(GO:0032901) |
| 2.2 |
10.9 |
GO:0003420 |
regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
| 2.2 |
13.1 |
GO:1903847 |
regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
| 2.2 |
2.2 |
GO:0061642 |
chemoattraction of axon(GO:0061642) |
| 2.2 |
8.6 |
GO:0048852 |
diencephalon morphogenesis(GO:0048852) |
| 2.2 |
12.9 |
GO:0006452 |
translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 2.1 |
10.7 |
GO:0035022 |
positive regulation of Rac protein signal transduction(GO:0035022) |
| 2.1 |
6.4 |
GO:0009812 |
flavonoid metabolic process(GO:0009812) flavonoid biosynthetic process(GO:0009813) flavonoid glucuronidation(GO:0052696) |
| 2.1 |
2.1 |
GO:0035330 |
regulation of hippo signaling(GO:0035330) |
| 2.1 |
4.2 |
GO:0021553 |
olfactory nerve development(GO:0021553) |
| 2.1 |
6.2 |
GO:0097402 |
neuroblast migration(GO:0097402) |
| 2.1 |
10.4 |
GO:0060923 |
cardiac muscle cell fate commitment(GO:0060923) |
| 2.1 |
16.5 |
GO:0030174 |
regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 2.1 |
22.7 |
GO:0060252 |
positive regulation of glial cell proliferation(GO:0060252) |
| 2.1 |
20.6 |
GO:0006105 |
succinate metabolic process(GO:0006105) |
| 2.1 |
41.1 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 2.0 |
8.0 |
GO:1903288 |
regulation of potassium ion import(GO:1903286) positive regulation of potassium ion import(GO:1903288) |
| 2.0 |
4.0 |
GO:0071394 |
cellular response to testosterone stimulus(GO:0071394) |
| 2.0 |
6.0 |
GO:0014826 |
vein smooth muscle contraction(GO:0014826) |
| 2.0 |
5.9 |
GO:0006065 |
UDP-glucuronate biosynthetic process(GO:0006065) |
| 2.0 |
3.9 |
GO:0035880 |
embryonic nail plate morphogenesis(GO:0035880) |
| 2.0 |
7.9 |
GO:0036151 |
phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 1.9 |
7.8 |
GO:0055099 |
response to high density lipoprotein particle(GO:0055099) |
| 1.9 |
5.8 |
GO:0014891 |
striated muscle atrophy(GO:0014891) |
| 1.9 |
13.6 |
GO:0042538 |
hyperosmotic salinity response(GO:0042538) |
| 1.9 |
9.6 |
GO:0051365 |
cellular response to potassium ion starvation(GO:0051365) |
| 1.9 |
5.8 |
GO:0048319 |
axial mesoderm morphogenesis(GO:0048319) |
| 1.9 |
5.8 |
GO:0060066 |
oviduct development(GO:0060066) |
| 1.9 |
5.8 |
GO:1904685 |
positive regulation of metalloendopeptidase activity(GO:1904685) |
| 1.9 |
13.4 |
GO:0000320 |
re-entry into mitotic cell cycle(GO:0000320) |
| 1.9 |
17.2 |
GO:0048386 |
positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 1.9 |
3.8 |
GO:0046104 |
thymidine metabolic process(GO:0046104) |
| 1.9 |
3.8 |
GO:0035426 |
extracellular matrix-cell signaling(GO:0035426) |
| 1.9 |
7.6 |
GO:0072137 |
condensed mesenchymal cell proliferation(GO:0072137) |
| 1.9 |
1.9 |
GO:0043652 |
engulfment of apoptotic cell(GO:0043652) |
| 1.9 |
19.1 |
GO:0030388 |
fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 1.9 |
11.4 |
GO:0000920 |
cell separation after cytokinesis(GO:0000920) |
| 1.9 |
11.4 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 1.9 |
5.7 |
GO:0034241 |
positive regulation of macrophage fusion(GO:0034241) |
| 1.9 |
3.8 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 1.9 |
3.8 |
GO:0035162 |
embryonic hemopoiesis(GO:0035162) |
| 1.9 |
9.4 |
GO:0060591 |
chondroblast differentiation(GO:0060591) |
| 1.9 |
5.6 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 1.9 |
7.5 |
GO:0046121 |
deoxyribonucleoside catabolic process(GO:0046121) |
| 1.9 |
9.3 |
GO:1903553 |
positive regulation of extracellular exosome assembly(GO:1903553) |
| 1.8 |
3.7 |
GO:0003199 |
endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
| 1.8 |
3.7 |
GO:0014063 |
negative regulation of serotonin secretion(GO:0014063) |
| 1.8 |
1.8 |
GO:0007354 |
zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 1.8 |
1.8 |
GO:0046900 |
tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 1.8 |
7.3 |
GO:2000427 |
positive regulation of apoptotic cell clearance(GO:2000427) |
| 1.8 |
9.1 |
GO:0031946 |
regulation of glucocorticoid biosynthetic process(GO:0031946) |
| 1.8 |
3.6 |
GO:0038027 |
apolipoprotein A-I-mediated signaling pathway(GO:0038027) |
| 1.8 |
1.8 |
GO:0070094 |
positive regulation of glucagon secretion(GO:0070094) |
| 1.8 |
3.6 |
GO:0043415 |
positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 1.8 |
7.1 |
GO:2000675 |
negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 1.8 |
17.8 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 1.8 |
16.0 |
GO:0061299 |
retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 1.8 |
7.1 |
GO:0035606 |
peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 1.8 |
58.1 |
GO:0008608 |
attachment of spindle microtubules to kinetochore(GO:0008608) |
| 1.8 |
5.3 |
GO:0071649 |
regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) |
| 1.8 |
19.3 |
GO:0060539 |
diaphragm development(GO:0060539) |
| 1.8 |
5.3 |
GO:0036166 |
phenotypic switching(GO:0036166) |
| 1.8 |
1.8 |
GO:0006172 |
ADP biosynthetic process(GO:0006172) |
| 1.7 |
1.7 |
GO:0035878 |
nail development(GO:0035878) |
| 1.7 |
5.2 |
GO:0030167 |
proteoglycan catabolic process(GO:0030167) |
| 1.7 |
8.6 |
GO:0006348 |
chromatin silencing at telomere(GO:0006348) |
| 1.7 |
6.9 |
GO:0070459 |
prolactin secretion(GO:0070459) |
| 1.7 |
5.1 |
GO:0042732 |
D-xylose metabolic process(GO:0042732) |
| 1.7 |
1.7 |
GO:0098908 |
regulation of neuronal action potential(GO:0098908) |
| 1.7 |
1.7 |
GO:0070315 |
G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 1.7 |
13.6 |
GO:0072202 |
cell differentiation involved in metanephros development(GO:0072202) |
| 1.7 |
5.1 |
GO:0060489 |
establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) orthogonal dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060488) planar dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060489) lateral sprouting involved in lung morphogenesis(GO:0060490) |
| 1.7 |
5.1 |
GO:0048382 |
neural plate mediolateral regionalization(GO:0021998) mesoderm structural organization(GO:0048338) paraxial mesoderm structural organization(GO:0048352) mesendoderm development(GO:0048382) |
| 1.7 |
6.7 |
GO:0071139 |
resolution of recombination intermediates(GO:0071139) |
| 1.7 |
11.7 |
GO:0060026 |
convergent extension(GO:0060026) |
| 1.7 |
6.7 |
GO:0002036 |
regulation of L-glutamate transport(GO:0002036) |
| 1.7 |
6.6 |
GO:1904565 |
response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 1.6 |
8.2 |
GO:0006447 |
regulation of translational initiation by iron(GO:0006447) positive regulation of translational initiation by iron(GO:0045994) |
| 1.6 |
8.1 |
GO:0042167 |
heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 1.6 |
3.2 |
GO:0008582 |
regulation of synaptic growth at neuromuscular junction(GO:0008582) |
| 1.6 |
4.9 |
GO:2000383 |
regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 1.6 |
6.5 |
GO:0060266 |
negative regulation of respiratory burst involved in inflammatory response(GO:0060266) negative regulation of respiratory burst(GO:0060268) |
| 1.6 |
4.9 |
GO:0003177 |
pulmonary valve development(GO:0003177) pulmonary valve morphogenesis(GO:0003184) |
| 1.6 |
8.1 |
GO:0033085 |
negative regulation of T cell differentiation in thymus(GO:0033085) |
| 1.6 |
25.7 |
GO:0035873 |
lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 1.6 |
4.8 |
GO:0070782 |
phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 1.6 |
1.6 |
GO:0046544 |
development of secondary male sexual characteristics(GO:0046544) |
| 1.6 |
4.7 |
GO:0030214 |
hyaluronan catabolic process(GO:0030214) |
| 1.6 |
1.6 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 1.6 |
3.1 |
GO:0006507 |
GPI anchor release(GO:0006507) |
| 1.6 |
7.8 |
GO:0044791 |
modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
| 1.5 |
17.0 |
GO:2000392 |
regulation of lamellipodium morphogenesis(GO:2000392) |
| 1.5 |
4.6 |
GO:0015910 |
peroxisomal long-chain fatty acid import(GO:0015910) |
| 1.5 |
4.6 |
GO:0000087 |
mitotic M phase(GO:0000087) |
| 1.5 |
35.6 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 1.5 |
12.4 |
GO:0060272 |
embryonic skeletal joint morphogenesis(GO:0060272) |
| 1.5 |
1.5 |
GO:0016115 |
terpenoid catabolic process(GO:0016115) |
| 1.5 |
4.6 |
GO:0070844 |
misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 1.5 |
4.6 |
GO:0014809 |
regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014809) |
| 1.5 |
7.6 |
GO:0044829 |
positive regulation by host of viral genome replication(GO:0044829) |
| 1.5 |
4.6 |
GO:0015889 |
cobalamin transport(GO:0015889) |
| 1.5 |
10.6 |
GO:0033567 |
DNA replication, Okazaki fragment processing(GO:0033567) |
| 1.5 |
13.6 |
GO:0048096 |
chromatin-mediated maintenance of transcription(GO:0048096) |
| 1.5 |
7.4 |
GO:1901724 |
positive regulation of cell proliferation involved in kidney development(GO:1901724) |
| 1.5 |
5.9 |
GO:0090244 |
Wnt signaling pathway involved in somitogenesis(GO:0090244) |
| 1.5 |
1.5 |
GO:0002339 |
B cell selection(GO:0002339) |
| 1.5 |
1.5 |
GO:0090272 |
negative regulation of fibroblast growth factor production(GO:0090272) |
| 1.5 |
39.8 |
GO:0006346 |
methylation-dependent chromatin silencing(GO:0006346) |
| 1.5 |
1.5 |
GO:0060279 |
positive regulation of ovulation(GO:0060279) |
| 1.5 |
13.2 |
GO:0032286 |
central nervous system myelin maintenance(GO:0032286) |
| 1.5 |
7.3 |
GO:2001185 |
regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
| 1.5 |
1.5 |
GO:1904996 |
positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 1.5 |
8.8 |
GO:1902373 |
negative regulation of mRNA catabolic process(GO:1902373) |
| 1.5 |
11.7 |
GO:0060059 |
embryonic retina morphogenesis in camera-type eye(GO:0060059) |
| 1.4 |
4.3 |
GO:0090324 |
negative regulation of oxidative phosphorylation(GO:0090324) |
| 1.4 |
1.4 |
GO:0002901 |
mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 1.4 |
1.4 |
GO:0010725 |
regulation of primitive erythrocyte differentiation(GO:0010725) |
| 1.4 |
5.7 |
GO:1904451 |
regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904451) positive regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904453) |
| 1.4 |
1.4 |
GO:1902174 |
positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 1.4 |
5.6 |
GO:0060068 |
vagina development(GO:0060068) |
| 1.4 |
5.6 |
GO:2000346 |
negative regulation of hepatocyte proliferation(GO:2000346) |
| 1.4 |
4.2 |
GO:0046601 |
positive regulation of centriole replication(GO:0046601) |
| 1.4 |
14.0 |
GO:0061158 |
3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 1.4 |
2.8 |
GO:0034384 |
high-density lipoprotein particle clearance(GO:0034384) |
| 1.4 |
4.2 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 1.4 |
4.2 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 1.4 |
1.4 |
GO:0010533 |
regulation of activation of Janus kinase activity(GO:0010533) regulation of activation of JAK2 kinase activity(GO:0010534) |
| 1.4 |
4.1 |
GO:0060217 |
hemangioblast cell differentiation(GO:0060217) |
| 1.4 |
4.1 |
GO:0090187 |
positive regulation of pancreatic juice secretion(GO:0090187) |
| 1.4 |
1.4 |
GO:0030916 |
otic vesicle formation(GO:0030916) |
| 1.4 |
4.1 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 1.4 |
5.5 |
GO:0007039 |
protein catabolic process in the vacuole(GO:0007039) |
| 1.3 |
12.1 |
GO:0001977 |
renal system process involved in regulation of blood volume(GO:0001977) |
| 1.3 |
2.7 |
GO:0051295 |
establishment of meiotic spindle localization(GO:0051295) |
| 1.3 |
4.0 |
GO:0019659 |
glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
| 1.3 |
1.3 |
GO:0048478 |
replication fork protection(GO:0048478) |
| 1.3 |
12.1 |
GO:0043567 |
regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 1.3 |
4.0 |
GO:1903984 |
positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 1.3 |
14.7 |
GO:0033234 |
negative regulation of protein sumoylation(GO:0033234) |
| 1.3 |
8.0 |
GO:0046459 |
short-chain fatty acid metabolic process(GO:0046459) |
| 1.3 |
4.0 |
GO:0015938 |
coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) |
| 1.3 |
6.6 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 1.3 |
2.6 |
GO:0051541 |
elastin metabolic process(GO:0051541) |
| 1.3 |
2.6 |
GO:0010757 |
negative regulation of plasminogen activation(GO:0010757) |
| 1.3 |
2.6 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 1.3 |
5.2 |
GO:0070561 |
vitamin D receptor signaling pathway(GO:0070561) |
| 1.3 |
6.5 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 1.3 |
3.9 |
GO:0006601 |
creatine biosynthetic process(GO:0006601) |
| 1.3 |
2.6 |
GO:2000343 |
positive regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000343) |
| 1.3 |
1.3 |
GO:1900157 |
regulation of bone mineralization involved in bone maturation(GO:1900157) |
| 1.3 |
3.8 |
GO:0002088 |
lens development in camera-type eye(GO:0002088) |
| 1.3 |
20.5 |
GO:0070935 |
3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 1.3 |
3.8 |
GO:0060708 |
spongiotrophoblast differentiation(GO:0060708) |
| 1.3 |
2.6 |
GO:0043696 |
dedifferentiation(GO:0043696) cell dedifferentiation(GO:0043697) |
| 1.3 |
3.8 |
GO:2001032 |
regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 1.3 |
2.5 |
GO:0036302 |
atrioventricular canal development(GO:0036302) |
| 1.3 |
1.3 |
GO:0046628 |
positive regulation of insulin receptor signaling pathway(GO:0046628) |
| 1.3 |
5.1 |
GO:0061032 |
visceral serous pericardium development(GO:0061032) |
| 1.3 |
8.8 |
GO:0001842 |
neural fold formation(GO:0001842) |
| 1.3 |
3.8 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 1.3 |
1.3 |
GO:1900673 |
olefin metabolic process(GO:1900673) |
| 1.3 |
7.5 |
GO:0007076 |
mitotic chromosome condensation(GO:0007076) |
| 1.3 |
6.3 |
GO:0072383 |
plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 1.3 |
1.3 |
GO:0003415 |
chondrocyte hypertrophy(GO:0003415) |
| 1.2 |
6.2 |
GO:0061687 |
detoxification of inorganic compound(GO:0061687) |
| 1.2 |
1.2 |
GO:0006842 |
tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 1.2 |
19.8 |
GO:0045793 |
positive regulation of cell size(GO:0045793) |
| 1.2 |
8.6 |
GO:0006297 |
nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 1.2 |
4.9 |
GO:0031652 |
positive regulation of heat generation(GO:0031652) |
| 1.2 |
4.9 |
GO:0097527 |
necroptotic signaling pathway(GO:0097527) |
| 1.2 |
1.2 |
GO:1901796 |
regulation of signal transduction by p53 class mediator(GO:1901796) |
| 1.2 |
3.6 |
GO:0019405 |
alditol catabolic process(GO:0019405) |
| 1.2 |
3.6 |
GO:1901563 |
response to camptothecin(GO:1901563) |
| 1.2 |
10.9 |
GO:0032211 |
negative regulation of telomere maintenance via telomerase(GO:0032211) |
| 1.2 |
3.6 |
GO:0072203 |
cell proliferation involved in metanephros development(GO:0072203) |
| 1.2 |
10.9 |
GO:0046826 |
negative regulation of protein export from nucleus(GO:0046826) |
| 1.2 |
1.2 |
GO:0014016 |
neuroblast differentiation(GO:0014016) |
| 1.2 |
6.0 |
GO:0035413 |
positive regulation of catenin import into nucleus(GO:0035413) |
| 1.2 |
3.6 |
GO:1904936 |
cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 1.2 |
1.2 |
GO:0043465 |
fermentation(GO:0006113) regulation of fermentation(GO:0043465) negative regulation of fermentation(GO:1901003) |
| 1.2 |
4.7 |
GO:0071459 |
protein localization to chromosome, centromeric region(GO:0071459) |
| 1.2 |
3.5 |
GO:0019441 |
tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) kynurenine metabolic process(GO:0070189) |
| 1.2 |
8.2 |
GO:0009950 |
dorsal/ventral axis specification(GO:0009950) |
| 1.2 |
3.5 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 1.2 |
24.4 |
GO:0046325 |
negative regulation of glucose import(GO:0046325) |
| 1.2 |
1.2 |
GO:1902744 |
negative regulation of lamellipodium organization(GO:1902744) |
| 1.2 |
3.5 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 1.2 |
3.5 |
GO:0019676 |
ammonia assimilation cycle(GO:0019676) |
| 1.2 |
5.8 |
GO:0001561 |
fatty acid alpha-oxidation(GO:0001561) |
| 1.2 |
3.5 |
GO:1901675 |
negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 1.2 |
1.2 |
GO:0090209 |
negative regulation of triglyceride metabolic process(GO:0090209) |
| 1.1 |
11.4 |
GO:0048199 |
vesicle targeting, to, from or within Golgi(GO:0048199) |
| 1.1 |
4.6 |
GO:0007406 |
negative regulation of neuroblast proliferation(GO:0007406) |
| 1.1 |
3.4 |
GO:0018214 |
peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 1.1 |
5.7 |
GO:0032367 |
intracellular cholesterol transport(GO:0032367) |
| 1.1 |
2.3 |
GO:0070973 |
protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 1.1 |
11.3 |
GO:2000353 |
positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 1.1 |
4.5 |
GO:2001271 |
negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 1.1 |
2.3 |
GO:0010961 |
cellular magnesium ion homeostasis(GO:0010961) |
| 1.1 |
3.4 |
GO:0061537 |
glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 1.1 |
2.2 |
GO:0002678 |
positive regulation of chronic inflammatory response(GO:0002678) |
| 1.1 |
3.4 |
GO:0001951 |
intestinal D-glucose absorption(GO:0001951) terminal web assembly(GO:1902896) |
| 1.1 |
3.3 |
GO:0014005 |
microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 1.1 |
3.3 |
GO:1903225 |
negative regulation of endodermal cell differentiation(GO:1903225) |
| 1.1 |
3.3 |
GO:0032962 |
positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
| 1.1 |
3.3 |
GO:0045404 |
positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
| 1.1 |
7.7 |
GO:1902166 |
negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
| 1.1 |
4.4 |
GO:0015744 |
succinate transport(GO:0015744) |
| 1.1 |
3.3 |
GO:1903334 |
positive regulation of protein folding(GO:1903334) |
| 1.1 |
3.3 |
GO:0032053 |
ciliary basal body organization(GO:0032053) |
| 1.1 |
2.2 |
GO:0060800 |
regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 1.1 |
3.3 |
GO:0044793 |
negative regulation by host of viral process(GO:0044793) |
| 1.1 |
1.1 |
GO:0071600 |
otic vesicle morphogenesis(GO:0071600) |
| 1.1 |
7.6 |
GO:0006729 |
tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 1.1 |
3.3 |
GO:2000042 |
negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
| 1.1 |
4.3 |
GO:1903251 |
multi-ciliated epithelial cell differentiation(GO:1903251) |
| 1.1 |
1.1 |
GO:1903960 |
negative regulation of anion transmembrane transport(GO:1903960) |
| 1.1 |
28.2 |
GO:0034508 |
centromere complex assembly(GO:0034508) |
| 1.1 |
6.5 |
GO:0002326 |
B cell lineage commitment(GO:0002326) |
| 1.1 |
1.1 |
GO:0014722 |
regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 1.1 |
6.5 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 1.1 |
1.1 |
GO:0010899 |
regulation of phosphatidylcholine catabolic process(GO:0010899) |
| 1.1 |
4.3 |
GO:0014012 |
peripheral nervous system axon regeneration(GO:0014012) |
| 1.1 |
4.3 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 1.1 |
19.1 |
GO:0060236 |
regulation of mitotic spindle organization(GO:0060236) regulation of spindle organization(GO:0090224) |
| 1.1 |
3.2 |
GO:0048255 |
mRNA stabilization(GO:0048255) |
| 1.1 |
15.8 |
GO:0030213 |
hyaluronan biosynthetic process(GO:0030213) |
| 1.0 |
2.1 |
GO:0050765 |
negative regulation of phagocytosis(GO:0050765) |
| 1.0 |
2.1 |
GO:0019230 |
proprioception(GO:0019230) |
| 1.0 |
8.4 |
GO:0032525 |
somite rostral/caudal axis specification(GO:0032525) |
| 1.0 |
6.3 |
GO:0035428 |
hexose transmembrane transport(GO:0035428) |
| 1.0 |
6.2 |
GO:0071493 |
cellular response to UV-B(GO:0071493) |
| 1.0 |
7.3 |
GO:1904668 |
positive regulation of ubiquitin protein ligase activity(GO:1904668) |
| 1.0 |
3.1 |
GO:0042362 |
fat-soluble vitamin biosynthetic process(GO:0042362) |
| 1.0 |
29.8 |
GO:0050873 |
brown fat cell differentiation(GO:0050873) |
| 1.0 |
1.0 |
GO:0001306 |
age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
| 1.0 |
2.1 |
GO:0060391 |
positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 1.0 |
4.1 |
GO:0070858 |
negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 1.0 |
2.0 |
GO:0032493 |
response to bacterial lipoprotein(GO:0032493) |
| 1.0 |
1.0 |
GO:0002693 |
positive regulation of cellular extravasation(GO:0002693) |
| 1.0 |
13.1 |
GO:0006516 |
glycoprotein catabolic process(GO:0006516) |
| 1.0 |
3.0 |
GO:0045819 |
positive regulation of glycogen catabolic process(GO:0045819) |
| 1.0 |
3.0 |
GO:1902498 |
regulation of protein autoubiquitination(GO:1902498) |
| 1.0 |
3.0 |
GO:0097152 |
mesenchymal cell apoptotic process(GO:0097152) |
| 1.0 |
3.0 |
GO:0048696 |
regulation of collateral sprouting in absence of injury(GO:0048696) |
| 1.0 |
5.9 |
GO:0030212 |
hyaluronan metabolic process(GO:0030212) |
| 1.0 |
5.9 |
GO:0009256 |
10-formyltetrahydrofolate metabolic process(GO:0009256) |
| 1.0 |
2.0 |
GO:0046084 |
adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
| 1.0 |
3.9 |
GO:0090467 |
L-arginine import(GO:0043091) arginine import(GO:0090467) L-arginine transport(GO:1902023) |
| 1.0 |
3.9 |
GO:0046600 |
negative regulation of centriole replication(GO:0046600) |
| 1.0 |
2.0 |
GO:0014719 |
skeletal muscle satellite cell activation(GO:0014719) |
| 1.0 |
3.9 |
GO:0046391 |
5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 1.0 |
9.7 |
GO:0003197 |
endocardial cushion development(GO:0003197) |
| 1.0 |
6.8 |
GO:0035999 |
tetrahydrofolate interconversion(GO:0035999) |
| 1.0 |
3.9 |
GO:0046602 |
regulation of mitotic centrosome separation(GO:0046602) |
| 1.0 |
5.8 |
GO:0043518 |
negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 1.0 |
5.8 |
GO:0048934 |
peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 1.0 |
4.8 |
GO:0036089 |
cleavage furrow formation(GO:0036089) |
| 1.0 |
1.9 |
GO:0043586 |
tongue development(GO:0043586) |
| 1.0 |
5.8 |
GO:0071883 |
activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
| 1.0 |
25.9 |
GO:0051310 |
metaphase plate congression(GO:0051310) |
| 1.0 |
11.4 |
GO:0046697 |
decidualization(GO:0046697) |
| 1.0 |
1.0 |
GO:0035701 |
hematopoietic stem cell migration(GO:0035701) |
| 1.0 |
2.9 |
GO:0035582 |
sequestering of BMP in extracellular matrix(GO:0035582) |
| 1.0 |
1.0 |
GO:0003162 |
atrioventricular node development(GO:0003162) |
| 0.9 |
2.8 |
GO:0061298 |
retina vasculature development in camera-type eye(GO:0061298) |
| 0.9 |
2.8 |
GO:0033689 |
negative regulation of osteoblast proliferation(GO:0033689) |
| 0.9 |
2.8 |
GO:0048633 |
positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.9 |
0.9 |
GO:1902083 |
negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.9 |
1.9 |
GO:0002765 |
immune response-inhibiting signal transduction(GO:0002765) |
| 0.9 |
0.9 |
GO:0090035 |
regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
| 0.9 |
1.9 |
GO:0070425 |
negative regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070425) negative regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070433) |
| 0.9 |
7.5 |
GO:0060710 |
chorio-allantoic fusion(GO:0060710) |
| 0.9 |
7.5 |
GO:0006004 |
fucose metabolic process(GO:0006004) |
| 0.9 |
6.5 |
GO:0045003 |
DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.9 |
4.7 |
GO:0030091 |
protein repair(GO:0030091) |
| 0.9 |
7.4 |
GO:0021983 |
pituitary gland development(GO:0021983) |
| 0.9 |
14.8 |
GO:0006851 |
mitochondrial calcium ion transport(GO:0006851) |
| 0.9 |
2.8 |
GO:0042574 |
retinal metabolic process(GO:0042574) |
| 0.9 |
2.8 |
GO:0051661 |
maintenance of centrosome location(GO:0051661) |
| 0.9 |
5.5 |
GO:0035087 |
siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.9 |
1.8 |
GO:0007290 |
spermatid nucleus elongation(GO:0007290) |
| 0.9 |
2.8 |
GO:0006001 |
fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 0.9 |
5.5 |
GO:0033089 |
positive regulation of T cell differentiation in thymus(GO:0033089) positive regulation of thymocyte aggregation(GO:2000400) |
| 0.9 |
4.6 |
GO:0014009 |
glial cell proliferation(GO:0014009) |
| 0.9 |
1.8 |
GO:0030222 |
eosinophil differentiation(GO:0030222) |
| 0.9 |
5.5 |
GO:0097368 |
establishment of Sertoli cell barrier(GO:0097368) |
| 0.9 |
1.8 |
GO:0071285 |
cellular response to lithium ion(GO:0071285) |
| 0.9 |
3.6 |
GO:0042754 |
negative regulation of circadian rhythm(GO:0042754) |
| 0.9 |
9.1 |
GO:0006020 |
inositol metabolic process(GO:0006020) |
| 0.9 |
2.7 |
GO:0010636 |
positive regulation of mitochondrial fusion(GO:0010636) |
| 0.9 |
1.8 |
GO:1901896 |
positive regulation of calcium-transporting ATPase activity(GO:1901896) |
| 0.9 |
18.0 |
GO:0045880 |
positive regulation of smoothened signaling pathway(GO:0045880) |
| 0.9 |
27.0 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.9 |
3.6 |
GO:0070589 |
cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule metabolic process(GO:0044036) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) cell wall organization or biogenesis(GO:0071554) |
| 0.9 |
2.7 |
GO:0070634 |
transepithelial ammonium transport(GO:0070634) |
| 0.9 |
0.9 |
GO:0006538 |
glutamate catabolic process(GO:0006538) |
| 0.9 |
6.2 |
GO:2000653 |
regulation of genetic imprinting(GO:2000653) |
| 0.9 |
2.7 |
GO:0051933 |
amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
| 0.9 |
1.8 |
GO:1903998 |
regulation of eating behavior(GO:1903998) |
| 0.9 |
1.8 |
GO:0060050 |
positive regulation of protein glycosylation(GO:0060050) |
| 0.9 |
2.6 |
GO:0097461 |
ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
| 0.9 |
5.2 |
GO:0016925 |
protein sumoylation(GO:0016925) |
| 0.9 |
8.7 |
GO:0044872 |
lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.9 |
2.6 |
GO:1904894 |
positive regulation of JAK-STAT cascade(GO:0046427) positive regulation of STAT cascade(GO:1904894) |
| 0.9 |
3.4 |
GO:0021780 |
oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.9 |
5.2 |
GO:2000811 |
negative regulation of anoikis(GO:2000811) |
| 0.9 |
3.4 |
GO:0043973 |
histone H3-K4 acetylation(GO:0043973) |
| 0.9 |
7.7 |
GO:0090205 |
positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
| 0.9 |
1.7 |
GO:0045876 |
positive regulation of sister chromatid cohesion(GO:0045876) |
| 0.9 |
1.7 |
GO:0043504 |
mitochondrial DNA repair(GO:0043504) |
| 0.9 |
2.6 |
GO:0032474 |
otolith morphogenesis(GO:0032474) |
| 0.9 |
4.3 |
GO:0071896 |
protein localization to adherens junction(GO:0071896) |
| 0.9 |
2.6 |
GO:0031120 |
snRNA pseudouridine synthesis(GO:0031120) |
| 0.8 |
2.5 |
GO:0009446 |
putrescine biosynthetic process(GO:0009446) |
| 0.8 |
1.7 |
GO:0043162 |
ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.8 |
9.3 |
GO:0051451 |
myoblast migration(GO:0051451) |
| 0.8 |
2.5 |
GO:0033566 |
gamma-tubulin complex localization(GO:0033566) |
| 0.8 |
1.7 |
GO:0009169 |
purine nucleoside monophosphate catabolic process(GO:0009128) ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
| 0.8 |
5.9 |
GO:0045603 |
positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.8 |
3.3 |
GO:0030202 |
heparin metabolic process(GO:0030202) |
| 0.8 |
4.2 |
GO:0046135 |
pyrimidine nucleoside catabolic process(GO:0046135) |
| 0.8 |
11.6 |
GO:0021516 |
dorsal spinal cord development(GO:0021516) |
| 0.8 |
1.7 |
GO:0006268 |
DNA unwinding involved in DNA replication(GO:0006268) |
| 0.8 |
3.3 |
GO:0006166 |
purine ribonucleoside salvage(GO:0006166) |
| 0.8 |
4.9 |
GO:0036120 |
response to platelet-derived growth factor(GO:0036119) cellular response to platelet-derived growth factor stimulus(GO:0036120) |
| 0.8 |
2.5 |
GO:0071699 |
olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
| 0.8 |
6.5 |
GO:0043923 |
positive regulation by host of viral transcription(GO:0043923) |
| 0.8 |
2.4 |
GO:0006011 |
UDP-glucose metabolic process(GO:0006011) |
| 0.8 |
9.0 |
GO:0042573 |
retinoic acid metabolic process(GO:0042573) |
| 0.8 |
3.2 |
GO:0071157 |
negative regulation of cell cycle arrest(GO:0071157) |
| 0.8 |
4.1 |
GO:0090261 |
positive regulation of inclusion body assembly(GO:0090261) |
| 0.8 |
2.4 |
GO:0035928 |
rRNA import into mitochondrion(GO:0035928) |
| 0.8 |
3.2 |
GO:0072539 |
T-helper 17 cell differentiation(GO:0072539) |
| 0.8 |
1.6 |
GO:0008635 |
activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.8 |
2.4 |
GO:0045578 |
negative regulation of B cell differentiation(GO:0045578) |
| 0.8 |
2.4 |
GO:0048312 |
intracellular distribution of mitochondria(GO:0048312) |
| 0.8 |
3.2 |
GO:0042795 |
snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.8 |
4.8 |
GO:0090037 |
positive regulation of protein kinase C signaling(GO:0090037) |
| 0.8 |
3.2 |
GO:0030576 |
Cajal body organization(GO:0030576) |
| 0.8 |
1.6 |
GO:0040031 |
snRNA modification(GO:0040031) |
| 0.8 |
1.6 |
GO:1903011 |
negative regulation of bone development(GO:1903011) |
| 0.8 |
2.4 |
GO:2001137 |
positive regulation of endocytic recycling(GO:2001137) |
| 0.8 |
1.6 |
GO:0034134 |
toll-like receptor 2 signaling pathway(GO:0034134) |
| 0.8 |
7.9 |
GO:0060441 |
epithelial tube branching involved in lung morphogenesis(GO:0060441) |
| 0.8 |
11.0 |
GO:0051764 |
actin crosslink formation(GO:0051764) |
| 0.8 |
4.7 |
GO:0006384 |
transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.8 |
2.3 |
GO:0035567 |
non-canonical Wnt signaling pathway(GO:0035567) |
| 0.8 |
1.6 |
GO:0042178 |
xenobiotic catabolic process(GO:0042178) |
| 0.8 |
5.4 |
GO:0006534 |
cysteine metabolic process(GO:0006534) |
| 0.8 |
0.8 |
GO:0046125 |
pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.8 |
4.6 |
GO:0008343 |
adult feeding behavior(GO:0008343) |
| 0.8 |
4.6 |
GO:0010815 |
bradykinin catabolic process(GO:0010815) |
| 0.8 |
7.7 |
GO:1902043 |
positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.8 |
3.1 |
GO:0060872 |
semicircular canal development(GO:0060872) |
| 0.8 |
3.1 |
GO:0038128 |
ERBB2 signaling pathway(GO:0038128) |
| 0.8 |
5.4 |
GO:0009181 |
purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
| 0.8 |
3.1 |
GO:0050861 |
positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.8 |
2.3 |
GO:1901970 |
positive regulation of mitotic sister chromatid separation(GO:1901970) |
| 0.8 |
5.3 |
GO:0060179 |
male mating behavior(GO:0060179) |
| 0.8 |
0.8 |
GO:0045909 |
regulation of vasodilation(GO:0042312) positive regulation of vasodilation(GO:0045909) |
| 0.8 |
2.3 |
GO:0044778 |
meiotic DNA integrity checkpoint(GO:0044778) |
| 0.8 |
3.0 |
GO:0009449 |
gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 0.8 |
1.5 |
GO:0006059 |
hexitol metabolic process(GO:0006059) |
| 0.7 |
3.7 |
GO:0051971 |
positive regulation of transmission of nerve impulse(GO:0051971) |
| 0.7 |
2.2 |
GO:0060766 |
negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.7 |
3.0 |
GO:0032439 |
endosome localization(GO:0032439) |
| 0.7 |
3.7 |
GO:2000301 |
negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.7 |
3.7 |
GO:0010587 |
miRNA catabolic process(GO:0010587) |
| 0.7 |
0.7 |
GO:0010944 |
negative regulation of transcription by competitive promoter binding(GO:0010944) |
| 0.7 |
3.0 |
GO:0048706 |
embryonic skeletal system development(GO:0048706) |
| 0.7 |
5.2 |
GO:0006703 |
estrogen biosynthetic process(GO:0006703) |
| 0.7 |
4.4 |
GO:0002315 |
marginal zone B cell differentiation(GO:0002315) |
| 0.7 |
11.7 |
GO:0033260 |
nuclear DNA replication(GO:0033260) |
| 0.7 |
1.5 |
GO:0034729 |
histone H3-K79 methylation(GO:0034729) |
| 0.7 |
1.5 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 0.7 |
1.5 |
GO:0045084 |
positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.7 |
2.2 |
GO:0006116 |
NADH oxidation(GO:0006116) |
| 0.7 |
5.8 |
GO:0045005 |
DNA-dependent DNA replication maintenance of fidelity(GO:0045005) |
| 0.7 |
2.9 |
GO:0021847 |
ventricular zone neuroblast division(GO:0021847) |
| 0.7 |
22.5 |
GO:0034605 |
cellular response to heat(GO:0034605) |
| 0.7 |
0.7 |
GO:0001978 |
regulation of systemic arterial blood pressure by carotid sinus baroreceptor feedback(GO:0001978) |
| 0.7 |
5.8 |
GO:0051574 |
positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.7 |
0.7 |
GO:0009957 |
epidermal cell fate specification(GO:0009957) |
| 0.7 |
7.2 |
GO:0021889 |
olfactory bulb interneuron differentiation(GO:0021889) |
| 0.7 |
0.7 |
GO:0009156 |
nucleoside monophosphate biosynthetic process(GO:0009124) ribonucleoside monophosphate biosynthetic process(GO:0009156) |
| 0.7 |
3.6 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.7 |
2.9 |
GO:0045738 |
negative regulation of DNA repair(GO:0045738) |
| 0.7 |
4.3 |
GO:0006344 |
maintenance of chromatin silencing(GO:0006344) |
| 0.7 |
5.7 |
GO:0070836 |
caveola assembly(GO:0070836) |
| 0.7 |
8.6 |
GO:0009437 |
amino-acid betaine metabolic process(GO:0006577) carnitine metabolic process(GO:0009437) |
| 0.7 |
2.1 |
GO:0033314 |
mitotic DNA replication checkpoint(GO:0033314) |
| 0.7 |
2.8 |
GO:0002553 |
histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.7 |
0.7 |
GO:0048739 |
cardiac muscle fiber development(GO:0048739) |
| 0.7 |
9.3 |
GO:0006924 |
activation-induced cell death of T cells(GO:0006924) |
| 0.7 |
2.1 |
GO:0048304 |
positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.7 |
2.8 |
GO:0071294 |
cellular response to zinc ion(GO:0071294) |
| 0.7 |
4.3 |
GO:0016584 |
nucleosome positioning(GO:0016584) |
| 0.7 |
2.1 |
GO:0036092 |
phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.7 |
0.7 |
GO:0090435 |
protein localization to nuclear envelope(GO:0090435) |
| 0.7 |
4.9 |
GO:1902231 |
positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.7 |
1.4 |
GO:0001935 |
endothelial cell proliferation(GO:0001935) |
| 0.7 |
1.4 |
GO:1903204 |
negative regulation of oxidative stress-induced neuron death(GO:1903204) |
| 0.7 |
2.1 |
GO:0018094 |
protein polyglycylation(GO:0018094) |
| 0.7 |
9.6 |
GO:0003334 |
keratinocyte development(GO:0003334) |
| 0.7 |
0.7 |
GO:0045198 |
establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.7 |
2.1 |
GO:0046061 |
dATP catabolic process(GO:0046061) |
| 0.7 |
8.9 |
GO:0038063 |
collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) collagen-activated signaling pathway(GO:0038065) |
| 0.7 |
6.1 |
GO:0009404 |
toxin metabolic process(GO:0009404) |
| 0.7 |
1.4 |
GO:0060282 |
positive regulation of oocyte development(GO:0060282) |
| 0.7 |
8.2 |
GO:0000188 |
inactivation of MAPK activity(GO:0000188) |
| 0.7 |
0.7 |
GO:0006573 |
valine metabolic process(GO:0006573) |
| 0.7 |
2.0 |
GO:0045656 |
negative regulation of monocyte differentiation(GO:0045656) |
| 0.7 |
2.7 |
GO:0035188 |
blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 0.7 |
0.7 |
GO:0001839 |
neural plate morphogenesis(GO:0001839) |
| 0.7 |
2.7 |
GO:0018158 |
protein oxidation(GO:0018158) |
| 0.7 |
8.6 |
GO:0014823 |
response to activity(GO:0014823) |
| 0.7 |
4.0 |
GO:0060033 |
anatomical structure regression(GO:0060033) |
| 0.7 |
14.6 |
GO:0006730 |
one-carbon metabolic process(GO:0006730) |
| 0.7 |
7.3 |
GO:0010574 |
regulation of vascular endothelial growth factor production(GO:0010574) |
| 0.7 |
2.0 |
GO:0070172 |
positive regulation of tooth mineralization(GO:0070172) |
| 0.7 |
4.0 |
GO:0006108 |
malate metabolic process(GO:0006108) |
| 0.7 |
0.7 |
GO:2001015 |
negative regulation of skeletal muscle cell differentiation(GO:2001015) |
| 0.7 |
0.7 |
GO:0030656 |
regulation of vitamin metabolic process(GO:0030656) |
| 0.7 |
4.6 |
GO:1900262 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.7 |
1.3 |
GO:0032058 |
positive regulation of translational initiation in response to stress(GO:0032058) |
| 0.7 |
33.8 |
GO:0050830 |
defense response to Gram-positive bacterium(GO:0050830) |
| 0.6 |
3.2 |
GO:0006369 |
termination of RNA polymerase II transcription(GO:0006369) |
| 0.6 |
0.6 |
GO:0043489 |
RNA stabilization(GO:0043489) |
| 0.6 |
5.2 |
GO:0006013 |
mannose metabolic process(GO:0006013) |
| 0.6 |
3.2 |
GO:0048702 |
embryonic neurocranium morphogenesis(GO:0048702) |
| 0.6 |
1.3 |
GO:0000720 |
pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.6 |
0.6 |
GO:0016332 |
establishment or maintenance of polarity of embryonic epithelium(GO:0016332) |
| 0.6 |
2.6 |
GO:0048548 |
regulation of pinocytosis(GO:0048548) |
| 0.6 |
1.3 |
GO:0060192 |
negative regulation of lipase activity(GO:0060192) |
| 0.6 |
7.0 |
GO:0010664 |
negative regulation of striated muscle cell apoptotic process(GO:0010664) |
| 0.6 |
15.2 |
GO:0002011 |
morphogenesis of an epithelial sheet(GO:0002011) |
| 0.6 |
5.0 |
GO:1903298 |
regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
| 0.6 |
1.9 |
GO:0003337 |
mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003337) |
| 0.6 |
16.9 |
GO:0006284 |
base-excision repair(GO:0006284) |
| 0.6 |
1.9 |
GO:0097070 |
ductus arteriosus closure(GO:0097070) |
| 0.6 |
1.2 |
GO:0072697 |
protein localization to cell cortex(GO:0072697) |
| 0.6 |
1.2 |
GO:0007161 |
calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.6 |
1.2 |
GO:0018076 |
N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.6 |
8.0 |
GO:0045672 |
positive regulation of osteoclast differentiation(GO:0045672) |
| 0.6 |
5.5 |
GO:2000254 |
regulation of male germ cell proliferation(GO:2000254) |
| 0.6 |
1.2 |
GO:0071670 |
smooth muscle cell chemotaxis(GO:0071670) |
| 0.6 |
0.6 |
GO:0072376 |
protein activation cascade(GO:0072376) |
| 0.6 |
1.8 |
GO:0070303 |
negative regulation of stress-activated MAPK cascade(GO:0032873) negative regulation of stress-activated protein kinase signaling cascade(GO:0070303) |
| 0.6 |
1.2 |
GO:1903275 |
positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
| 0.6 |
1.8 |
GO:0072675 |
multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.6 |
3.7 |
GO:0001501 |
skeletal system development(GO:0001501) |
| 0.6 |
1.2 |
GO:1905049 |
negative regulation of metalloendopeptidase activity(GO:1904684) negative regulation of metallopeptidase activity(GO:1905049) |
| 0.6 |
9.7 |
GO:0006613 |
cotranslational protein targeting to membrane(GO:0006613) |
| 0.6 |
2.4 |
GO:0043383 |
negative T cell selection(GO:0043383) negative thymic T cell selection(GO:0045060) |
| 0.6 |
1.8 |
GO:0090271 |
positive regulation of fibroblast growth factor production(GO:0090271) |
| 0.6 |
3.6 |
GO:2000380 |
regulation of mesoderm development(GO:2000380) negative regulation of mesoderm development(GO:2000381) |
| 0.6 |
7.3 |
GO:0048546 |
digestive tract morphogenesis(GO:0048546) |
| 0.6 |
2.4 |
GO:0048861 |
leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.6 |
0.6 |
GO:0002374 |
cytokine secretion involved in immune response(GO:0002374) regulation of cytokine secretion involved in immune response(GO:0002739) positive regulation of cytokine secretion involved in immune response(GO:0002741) |
| 0.6 |
4.8 |
GO:2000779 |
regulation of double-strand break repair(GO:2000779) |
| 0.6 |
1.8 |
GO:0071360 |
cellular response to exogenous dsRNA(GO:0071360) |
| 0.6 |
10.8 |
GO:0030901 |
midbrain development(GO:0030901) |
| 0.6 |
3.0 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.6 |
2.4 |
GO:0045217 |
cell-cell junction maintenance(GO:0045217) |
| 0.6 |
5.9 |
GO:0032060 |
bleb assembly(GO:0032060) |
| 0.6 |
1.2 |
GO:1902947 |
regulation of tau-protein kinase activity(GO:1902947) |
| 0.6 |
1.8 |
GO:0045830 |
positive regulation of isotype switching(GO:0045830) |
| 0.6 |
2.4 |
GO:0019321 |
pentose metabolic process(GO:0019321) |
| 0.6 |
0.6 |
GO:0042772 |
DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) DNA damage response, signal transduction resulting in transcription(GO:0042772) |
| 0.6 |
2.9 |
GO:0050434 |
positive regulation of viral transcription(GO:0050434) |
| 0.6 |
4.1 |
GO:0070458 |
detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 0.6 |
11.7 |
GO:0003301 |
physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.6 |
8.2 |
GO:0010388 |
cullin deneddylation(GO:0010388) |
| 0.6 |
1.7 |
GO:2000768 |
glomerular parietal epithelial cell differentiation(GO:0072139) positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) positive regulation of nephron tubule epithelial cell differentiation(GO:2000768) |
| 0.6 |
2.3 |
GO:0035795 |
negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 0.6 |
2.3 |
GO:1901550 |
regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
| 0.6 |
1.7 |
GO:0060426 |
lung vasculature development(GO:0060426) |
| 0.6 |
2.9 |
GO:0007100 |
mitotic centrosome separation(GO:0007100) |
| 0.6 |
1.7 |
GO:0034476 |
U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) nuclear polyadenylation-dependent mRNA catabolic process(GO:0071042) polyadenylation-dependent mRNA catabolic process(GO:0071047) |
| 0.6 |
0.6 |
GO:0050847 |
progesterone receptor signaling pathway(GO:0050847) |
| 0.6 |
6.2 |
GO:0033327 |
Leydig cell differentiation(GO:0033327) |
| 0.6 |
7.9 |
GO:0035269 |
protein O-linked mannosylation(GO:0035269) |
| 0.6 |
2.8 |
GO:0090136 |
epithelial cell-cell adhesion(GO:0090136) |
| 0.6 |
0.6 |
GO:0006702 |
androgen biosynthetic process(GO:0006702) |
| 0.6 |
1.7 |
GO:1901165 |
positive regulation of trophoblast cell migration(GO:1901165) |
| 0.6 |
2.2 |
GO:0033690 |
positive regulation of osteoblast proliferation(GO:0033690) |
| 0.6 |
2.2 |
GO:0000379 |
tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.6 |
1.7 |
GO:0009414 |
response to water deprivation(GO:0009414) |
| 0.6 |
2.2 |
GO:0002523 |
leukocyte migration involved in inflammatory response(GO:0002523) |
| 0.5 |
7.1 |
GO:0001913 |
T cell mediated cytotoxicity(GO:0001913) |
| 0.5 |
3.3 |
GO:0043403 |
skeletal muscle tissue regeneration(GO:0043403) |
| 0.5 |
3.3 |
GO:0042711 |
maternal behavior(GO:0042711) |
| 0.5 |
1.6 |
GO:0019236 |
response to pheromone(GO:0019236) |
| 0.5 |
1.1 |
GO:0006526 |
arginine biosynthetic process(GO:0006526) |
| 0.5 |
0.5 |
GO:0051023 |
regulation of immunoglobulin secretion(GO:0051023) |
| 0.5 |
4.9 |
GO:0071257 |
cellular response to electrical stimulus(GO:0071257) |
| 0.5 |
1.1 |
GO:0009125 |
nucleoside monophosphate catabolic process(GO:0009125) |
| 0.5 |
0.5 |
GO:0021523 |
somatic motor neuron differentiation(GO:0021523) |
| 0.5 |
0.5 |
GO:2000637 |
positive regulation of gene silencing by miRNA(GO:2000637) |
| 0.5 |
8.7 |
GO:0060351 |
cartilage development involved in endochondral bone morphogenesis(GO:0060351) |
| 0.5 |
3.8 |
GO:0042730 |
fibrinolysis(GO:0042730) |
| 0.5 |
7.0 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.5 |
2.2 |
GO:0019276 |
UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.5 |
4.3 |
GO:0042744 |
hydrogen peroxide catabolic process(GO:0042744) |
| 0.5 |
4.3 |
GO:0015868 |
purine ribonucleotide transport(GO:0015868) |
| 0.5 |
2.1 |
GO:2001239 |
regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001239) |
| 0.5 |
1.6 |
GO:0051660 |
cortical microtubule organization(GO:0043622) establishment of centrosome localization(GO:0051660) |
| 0.5 |
3.2 |
GO:1902416 |
positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
| 0.5 |
0.5 |
GO:0050689 |
negative regulation of defense response to virus by host(GO:0050689) |
| 0.5 |
2.1 |
GO:0032836 |
glomerular basement membrane development(GO:0032836) |
| 0.5 |
0.5 |
GO:0002200 |
somatic diversification of immune receptors(GO:0002200) |
| 0.5 |
20.3 |
GO:0071230 |
cellular response to amino acid stimulus(GO:0071230) |
| 0.5 |
1.0 |
GO:0052428 |
modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.5 |
3.1 |
GO:0036342 |
post-anal tail morphogenesis(GO:0036342) |
| 0.5 |
1.6 |
GO:0071985 |
multivesicular body sorting pathway(GO:0071985) |
| 0.5 |
1.0 |
GO:0000715 |
nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.5 |
7.7 |
GO:0050909 |
sensory perception of taste(GO:0050909) |
| 0.5 |
3.6 |
GO:0010862 |
positive regulation of pathway-restricted SMAD protein phosphorylation(GO:0010862) |
| 0.5 |
1.0 |
GO:0019740 |
nitrogen utilization(GO:0019740) |
| 0.5 |
15.4 |
GO:0048661 |
positive regulation of smooth muscle cell proliferation(GO:0048661) |
| 0.5 |
3.1 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.5 |
3.0 |
GO:0036158 |
outer dynein arm assembly(GO:0036158) |
| 0.5 |
1.5 |
GO:1903048 |
regulation of acetylcholine-gated cation channel activity(GO:1903048) |
| 0.5 |
0.5 |
GO:0071166 |
ribonucleoprotein complex localization(GO:0071166) ribonucleoprotein complex export from nucleus(GO:0071426) |
| 0.5 |
14.1 |
GO:0038061 |
NIK/NF-kappaB signaling(GO:0038061) |
| 0.5 |
1.5 |
GO:0006167 |
AMP biosynthetic process(GO:0006167) |
| 0.5 |
7.0 |
GO:0032467 |
positive regulation of cytokinesis(GO:0032467) |
| 0.5 |
2.5 |
GO:0031053 |
primary miRNA processing(GO:0031053) |
| 0.5 |
3.0 |
GO:0030953 |
astral microtubule organization(GO:0030953) |
| 0.5 |
3.5 |
GO:0045647 |
negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.5 |
2.5 |
GO:0035137 |
hindlimb morphogenesis(GO:0035137) |
| 0.5 |
0.5 |
GO:0071824 |
protein-DNA complex subunit organization(GO:0071824) |
| 0.5 |
2.0 |
GO:0042632 |
cholesterol homeostasis(GO:0042632) sterol homeostasis(GO:0055092) |
| 0.5 |
1.9 |
GO:0006107 |
oxaloacetate metabolic process(GO:0006107) |
| 0.5 |
8.7 |
GO:0000303 |
response to superoxide(GO:0000303) |
| 0.5 |
3.4 |
GO:0070493 |
thrombin receptor signaling pathway(GO:0070493) |
| 0.5 |
5.3 |
GO:0030261 |
chromosome condensation(GO:0030261) |
| 0.5 |
1.0 |
GO:0042938 |
dipeptide transport(GO:0042938) |
| 0.5 |
2.4 |
GO:0045616 |
regulation of keratinocyte differentiation(GO:0045616) |
| 0.5 |
0.5 |
GO:0036228 |
protein targeting to nuclear inner membrane(GO:0036228) |
| 0.5 |
3.8 |
GO:0006388 |
tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.5 |
0.9 |
GO:0032000 |
positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.5 |
0.5 |
GO:0060135 |
maternal process involved in female pregnancy(GO:0060135) |
| 0.5 |
0.5 |
GO:0070813 |
hydrogen sulfide metabolic process(GO:0070813) |
| 0.5 |
2.8 |
GO:0050872 |
white fat cell differentiation(GO:0050872) |
| 0.5 |
1.4 |
GO:0010694 |
positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.5 |
1.9 |
GO:0006338 |
chromatin remodeling(GO:0006338) |
| 0.5 |
0.9 |
GO:2000505 |
regulation of energy homeostasis(GO:2000505) |
| 0.5 |
0.9 |
GO:0035934 |
corticosterone secretion(GO:0035934) |
| 0.5 |
2.3 |
GO:0014886 |
transition between slow and fast fiber(GO:0014886) |
| 0.5 |
1.4 |
GO:0006030 |
chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.5 |
3.6 |
GO:0015074 |
DNA integration(GO:0015074) |
| 0.5 |
0.5 |
GO:0071863 |
regulation of cell proliferation in bone marrow(GO:0071863) |
| 0.5 |
0.5 |
GO:0051299 |
centrosome separation(GO:0051299) |
| 0.5 |
5.9 |
GO:0006907 |
pinocytosis(GO:0006907) |
| 0.5 |
3.6 |
GO:0035437 |
maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.5 |
0.9 |
GO:0010878 |
cholesterol storage(GO:0010878) |
| 0.4 |
3.1 |
GO:0035019 |
somatic stem cell population maintenance(GO:0035019) |
| 0.4 |
1.3 |
GO:0051292 |
nuclear pore complex assembly(GO:0051292) |
| 0.4 |
2.2 |
GO:0051461 |
regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.4 |
7.1 |
GO:0045662 |
negative regulation of myoblast differentiation(GO:0045662) |
| 0.4 |
1.8 |
GO:0032515 |
negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
| 0.4 |
3.5 |
GO:0051127 |
positive regulation of actin nucleation(GO:0051127) |
| 0.4 |
1.3 |
GO:0072577 |
endothelial cell apoptotic process(GO:0072577) |
| 0.4 |
4.0 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.4 |
1.3 |
GO:0060468 |
prevention of polyspermy(GO:0060468) |
| 0.4 |
3.9 |
GO:0043249 |
erythrocyte maturation(GO:0043249) |
| 0.4 |
0.9 |
GO:0060216 |
definitive hemopoiesis(GO:0060216) |
| 0.4 |
1.7 |
GO:0097428 |
protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.4 |
3.9 |
GO:0006560 |
proline metabolic process(GO:0006560) |
| 0.4 |
0.4 |
GO:0051639 |
actin filament network formation(GO:0051639) |
| 0.4 |
2.1 |
GO:0051131 |
chaperone-mediated protein complex assembly(GO:0051131) |
| 0.4 |
0.9 |
GO:0006419 |
alanyl-tRNA aminoacylation(GO:0006419) |
| 0.4 |
3.0 |
GO:0003084 |
positive regulation of systemic arterial blood pressure(GO:0003084) |
| 0.4 |
0.9 |
GO:0030647 |
polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.4 |
1.3 |
GO:0043649 |
dicarboxylic acid catabolic process(GO:0043649) |
| 0.4 |
4.2 |
GO:0051044 |
positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.4 |
1.3 |
GO:0006551 |
leucine metabolic process(GO:0006551) |
| 0.4 |
2.9 |
GO:0036265 |
RNA (guanine-N7)-methylation(GO:0036265) |
| 0.4 |
0.4 |
GO:0006529 |
asparagine metabolic process(GO:0006528) asparagine biosynthetic process(GO:0006529) |
| 0.4 |
2.5 |
GO:0046909 |
intermembrane transport(GO:0046909) |
| 0.4 |
0.8 |
GO:1904749 |
regulation of protein localization to nucleolus(GO:1904749) positive regulation of protein localization to nucleolus(GO:1904751) |
| 0.4 |
1.6 |
GO:0030224 |
monocyte differentiation(GO:0030224) |
| 0.4 |
1.6 |
GO:0050747 |
positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.4 |
0.8 |
GO:0043366 |
beta selection(GO:0043366) |
| 0.4 |
0.4 |
GO:0036462 |
TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.4 |
1.2 |
GO:0001946 |
lymphangiogenesis(GO:0001946) lymph vessel morphogenesis(GO:0036303) |
| 0.4 |
1.6 |
GO:0045653 |
negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.4 |
0.8 |
GO:1990034 |
calcium ion export from cell(GO:1990034) |
| 0.4 |
0.8 |
GO:0006547 |
histidine metabolic process(GO:0006547) |
| 0.4 |
2.0 |
GO:0060136 |
embryonic process involved in female pregnancy(GO:0060136) |
| 0.4 |
1.2 |
GO:0089700 |
protein kinase D signaling(GO:0089700) |
| 0.4 |
1.2 |
GO:0035358 |
regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035358) positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
| 0.4 |
1.6 |
GO:0038030 |
non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) |
| 0.4 |
2.0 |
GO:0010457 |
centriole-centriole cohesion(GO:0010457) |
| 0.4 |
0.4 |
GO:1901187 |
regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.4 |
3.5 |
GO:0051290 |
protein heterotetramerization(GO:0051290) |
| 0.4 |
1.9 |
GO:0043200 |
response to amino acid(GO:0043200) |
| 0.4 |
1.5 |
GO:1902047 |
polyamine transport(GO:0015846) polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
| 0.4 |
0.4 |
GO:0060334 |
regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
| 0.4 |
2.3 |
GO:0045187 |
regulation of circadian sleep/wake cycle, sleep(GO:0045187) |
| 0.4 |
3.0 |
GO:0034773 |
histone H4-K20 trimethylation(GO:0034773) |
| 0.4 |
1.5 |
GO:0044253 |
positive regulation of collagen metabolic process(GO:0010714) positive regulation of collagen biosynthetic process(GO:0032967) positive regulation of multicellular organismal metabolic process(GO:0044253) |
| 0.4 |
0.7 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.4 |
0.7 |
GO:0090501 |
RNA phosphodiester bond hydrolysis(GO:0090501) |
| 0.4 |
1.9 |
GO:0038166 |
angiotensin-activated signaling pathway(GO:0038166) |
| 0.4 |
24.4 |
GO:0006073 |
glycogen metabolic process(GO:0005977) cellular glucan metabolic process(GO:0006073) glucan metabolic process(GO:0044042) |
| 0.4 |
1.8 |
GO:0051697 |
protein delipidation(GO:0051697) |
| 0.4 |
2.6 |
GO:0016480 |
negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.4 |
0.7 |
GO:0035989 |
tendon development(GO:0035989) |
| 0.4 |
1.1 |
GO:0048566 |
embryonic digestive tract development(GO:0048566) |
| 0.4 |
2.2 |
GO:0003062 |
regulation of heart rate by chemical signal(GO:0003062) positive regulation of heart rate by epinephrine(GO:0003065) |
| 0.4 |
7.2 |
GO:0060325 |
face morphogenesis(GO:0060325) |
| 0.4 |
1.4 |
GO:0019509 |
L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.4 |
1.8 |
GO:0045040 |
protein import into mitochondrial outer membrane(GO:0045040) |
| 0.4 |
1.8 |
GO:0002591 |
antigen processing and presentation of peptide antigen via MHC class Ib(GO:0002428) antigen processing and presentation of endogenous peptide antigen via MHC class Ib(GO:0002476) antigen processing and presentation of exogenous peptide antigen via MHC class Ib(GO:0002477) antigen processing and presentation of exogenous protein antigen via MHC class Ib, TAP-dependent(GO:0002481) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway(GO:0002484) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway, TAP-dependent(GO:0002485) antigen processing and presentation of endogenous peptide antigen via MHC class Ib via ER pathway(GO:0002488) antigen processing and presentation of endogenous peptide antigen via MHC class Ib via ER pathway, TAP-dependent(GO:0002489) positive regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002591) |
| 0.4 |
5.7 |
GO:0071539 |
protein localization to centrosome(GO:0071539) |
| 0.4 |
6.4 |
GO:0071594 |
T cell differentiation in thymus(GO:0033077) thymocyte aggregation(GO:0071594) |
| 0.4 |
2.1 |
GO:0070475 |
rRNA base methylation(GO:0070475) |
| 0.4 |
0.7 |
GO:0060023 |
soft palate development(GO:0060023) |
| 0.4 |
0.4 |
GO:0006282 |
regulation of DNA repair(GO:0006282) |
| 0.4 |
0.7 |
GO:0031665 |
negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.4 |
6.3 |
GO:0001522 |
pseudouridine synthesis(GO:0001522) |
| 0.4 |
0.7 |
GO:0034382 |
chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 0.3 |
2.4 |
GO:1903608 |
protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.3 |
0.7 |
GO:0006975 |
DNA damage induced protein phosphorylation(GO:0006975) |
| 0.3 |
0.3 |
GO:0010499 |
proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.3 |
1.0 |
GO:0043456 |
regulation of pentose-phosphate shunt(GO:0043456) |
| 0.3 |
1.7 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 0.3 |
0.7 |
GO:0010835 |
regulation of protein ADP-ribosylation(GO:0010835) nitric oxide homeostasis(GO:0033484) |
| 0.3 |
1.0 |
GO:0006432 |
phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.3 |
1.4 |
GO:0070537 |
histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.3 |
1.7 |
GO:0000056 |
ribosomal small subunit export from nucleus(GO:0000056) |
| 0.3 |
3.7 |
GO:0060134 |
prepulse inhibition(GO:0060134) |
| 0.3 |
0.7 |
GO:0003351 |
epithelial cilium movement(GO:0003351) |
| 0.3 |
1.0 |
GO:0032780 |
negative regulation of ATPase activity(GO:0032780) |
| 0.3 |
2.0 |
GO:0009068 |
aspartate family amino acid catabolic process(GO:0009068) |
| 0.3 |
3.0 |
GO:0018065 |
protein-cofactor linkage(GO:0018065) |
| 0.3 |
0.7 |
GO:0061035 |
regulation of cartilage development(GO:0061035) |
| 0.3 |
8.0 |
GO:0006783 |
heme biosynthetic process(GO:0006783) |
| 0.3 |
1.3 |
GO:0048747 |
muscle fiber development(GO:0048747) |
| 0.3 |
2.0 |
GO:0032463 |
negative regulation of protein homooligomerization(GO:0032463) |
| 0.3 |
0.7 |
GO:0060648 |
mammary gland bud morphogenesis(GO:0060648) |
| 0.3 |
1.0 |
GO:0034724 |
DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
| 0.3 |
0.7 |
GO:0002385 |
organ or tissue specific immune response(GO:0002251) mucosal immune response(GO:0002385) |
| 0.3 |
1.3 |
GO:0097062 |
dendritic spine maintenance(GO:0097062) |
| 0.3 |
3.6 |
GO:0034498 |
early endosome to Golgi transport(GO:0034498) |
| 0.3 |
11.2 |
GO:2000134 |
negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
| 0.3 |
1.3 |
GO:0006590 |
thyroid hormone generation(GO:0006590) |
| 0.3 |
1.6 |
GO:0060501 |
positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.3 |
1.0 |
GO:0046716 |
muscle cell cellular homeostasis(GO:0046716) |
| 0.3 |
2.6 |
GO:0006450 |
regulation of translational fidelity(GO:0006450) |
| 0.3 |
1.0 |
GO:0002457 |
T cell antigen processing and presentation(GO:0002457) |
| 0.3 |
0.3 |
GO:0002086 |
diaphragm contraction(GO:0002086) |
| 0.3 |
1.9 |
GO:0031936 |
negative regulation of chromatin silencing(GO:0031936) |
| 0.3 |
1.0 |
GO:0001980 |
regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
| 0.3 |
1.0 |
GO:1902528 |
regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 0.3 |
1.9 |
GO:0034377 |
plasma lipoprotein particle assembly(GO:0034377) |
| 0.3 |
5.3 |
GO:0032781 |
positive regulation of ATPase activity(GO:0032781) |
| 0.3 |
0.3 |
GO:0031440 |
regulation of mRNA 3'-end processing(GO:0031440) |
| 0.3 |
0.6 |
GO:0034393 |
positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.3 |
4.0 |
GO:0035493 |
SNARE complex assembly(GO:0035493) |
| 0.3 |
1.5 |
GO:0033210 |
leptin-mediated signaling pathway(GO:0033210) |
| 0.3 |
0.9 |
GO:0042246 |
tissue regeneration(GO:0042246) |
| 0.3 |
0.6 |
GO:2000646 |
positive regulation of receptor catabolic process(GO:2000646) |
| 0.3 |
1.2 |
GO:0006564 |
L-serine biosynthetic process(GO:0006564) |
| 0.3 |
0.3 |
GO:0060689 |
cell differentiation involved in salivary gland development(GO:0060689) |
| 0.3 |
1.2 |
GO:0019731 |
antibacterial humoral response(GO:0019731) |
| 0.3 |
0.9 |
GO:0035095 |
behavioral response to nicotine(GO:0035095) |
| 0.3 |
2.7 |
GO:0006337 |
nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
| 0.3 |
0.6 |
GO:0032532 |
regulation of microvillus length(GO:0032532) |
| 0.3 |
2.1 |
GO:0035881 |
amacrine cell differentiation(GO:0035881) |
| 0.3 |
4.7 |
GO:1903077 |
negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
| 0.3 |
3.5 |
GO:0046782 |
regulation of viral transcription(GO:0046782) |
| 0.3 |
0.9 |
GO:0060903 |
positive regulation of meiosis I(GO:0060903) |
| 0.3 |
2.6 |
GO:2000677 |
regulation of transcription regulatory region DNA binding(GO:2000677) |
| 0.3 |
0.6 |
GO:0090032 |
negative regulation of steroid hormone biosynthetic process(GO:0090032) |
| 0.3 |
2.9 |
GO:0034244 |
negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.3 |
0.6 |
GO:0090195 |
chemokine secretion(GO:0090195) regulation of chemokine secretion(GO:0090196) positive regulation of chemokine secretion(GO:0090197) |
| 0.3 |
0.9 |
GO:0085020 |
protein K6-linked ubiquitination(GO:0085020) |
| 0.3 |
1.4 |
GO:0000447 |
endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.3 |
6.8 |
GO:0070206 |
protein trimerization(GO:0070206) |
| 0.3 |
0.8 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.3 |
2.8 |
GO:0042346 |
positive regulation of NF-kappaB import into nucleus(GO:0042346) |
| 0.3 |
0.3 |
GO:0007143 |
female meiotic division(GO:0007143) |
| 0.3 |
1.4 |
GO:0032911 |
negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.3 |
1.1 |
GO:0032511 |
late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.3 |
0.8 |
GO:0000350 |
generation of catalytic spliceosome for second transesterification step(GO:0000350) |
| 0.3 |
0.3 |
GO:2000323 |
negative regulation of glucocorticoid receptor signaling pathway(GO:2000323) |
| 0.3 |
0.3 |
GO:0033762 |
response to glucagon(GO:0033762) |
| 0.3 |
1.4 |
GO:0061087 |
positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.3 |
1.1 |
GO:1900017 |
positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.3 |
0.5 |
GO:0090071 |
negative regulation of ribosome biogenesis(GO:0090071) |
| 0.3 |
0.8 |
GO:0033615 |
mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.3 |
2.2 |
GO:0044342 |
type B pancreatic cell proliferation(GO:0044342) |
| 0.3 |
0.5 |
GO:0006610 |
ribosomal protein import into nucleus(GO:0006610) |
| 0.3 |
1.3 |
GO:0009109 |
coenzyme catabolic process(GO:0009109) |
| 0.3 |
2.1 |
GO:0001937 |
negative regulation of endothelial cell proliferation(GO:0001937) |
| 0.3 |
3.7 |
GO:0000028 |
ribosomal small subunit assembly(GO:0000028) |
| 0.3 |
3.1 |
GO:0015825 |
L-serine transport(GO:0015825) |
| 0.3 |
0.3 |
GO:1902475 |
L-glutamate transmembrane transport(GO:0089711) L-alpha-amino acid transmembrane transport(GO:1902475) |
| 0.3 |
0.8 |
GO:0015819 |
lysine transport(GO:0015819) |
| 0.3 |
4.7 |
GO:0015701 |
bicarbonate transport(GO:0015701) |
| 0.3 |
0.8 |
GO:0046368 |
GDP-L-fucose metabolic process(GO:0046368) |
| 0.3 |
1.8 |
GO:0015840 |
urea transport(GO:0015840) urea transmembrane transport(GO:0071918) |
| 0.3 |
2.1 |
GO:0046784 |
viral mRNA export from host cell nucleus(GO:0046784) |
| 0.3 |
0.5 |
GO:1904879 |
positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.3 |
1.0 |
GO:0032465 |
regulation of cytokinesis(GO:0032465) |
| 0.3 |
1.3 |
GO:0046548 |
retinal rod cell development(GO:0046548) |
| 0.3 |
2.3 |
GO:0032968 |
positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.3 |
11.6 |
GO:0046847 |
filopodium assembly(GO:0046847) |
| 0.3 |
0.8 |
GO:1904469 |
positive regulation of tumor necrosis factor secretion(GO:1904469) |
| 0.3 |
0.8 |
GO:0036093 |
germ cell proliferation(GO:0036093) |
| 0.3 |
1.8 |
GO:0001658 |
branching involved in ureteric bud morphogenesis(GO:0001658) |
| 0.3 |
2.3 |
GO:0046051 |
UTP metabolic process(GO:0046051) |
| 0.3 |
3.0 |
GO:0040034 |
regulation of development, heterochronic(GO:0040034) |
| 0.3 |
2.0 |
GO:0000395 |
mRNA 5'-splice site recognition(GO:0000395) |
| 0.3 |
0.3 |
GO:0030327 |
prenylated protein catabolic process(GO:0030327) |
| 0.2 |
3.2 |
GO:0034389 |
lipid particle organization(GO:0034389) |
| 0.2 |
2.2 |
GO:0051156 |
glucose 6-phosphate metabolic process(GO:0051156) |
| 0.2 |
0.2 |
GO:0016321 |
female meiosis chromosome segregation(GO:0016321) |
| 0.2 |
1.7 |
GO:0060976 |
coronary vasculature development(GO:0060976) |
| 0.2 |
0.2 |
GO:0060324 |
face development(GO:0060324) |
| 0.2 |
0.5 |
GO:0035886 |
vascular smooth muscle cell differentiation(GO:0035886) |
| 0.2 |
0.7 |
GO:0042572 |
retinol metabolic process(GO:0042572) |
| 0.2 |
0.2 |
GO:0042264 |
peptidyl-aspartic acid modification(GO:0018197) peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.2 |
1.2 |
GO:0035947 |
regulation of gluconeogenesis by regulation of transcription from RNA polymerase II promoter(GO:0035947) |
| 0.2 |
0.5 |
GO:0061101 |
neuroendocrine cell differentiation(GO:0061101) |
| 0.2 |
0.5 |
GO:0071340 |
skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
| 0.2 |
0.5 |
GO:0060024 |
rhythmic synaptic transmission(GO:0060024) |
| 0.2 |
1.9 |
GO:0070574 |
cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.2 |
0.2 |
GO:1901072 |
N-acetylglucosamine catabolic process(GO:0006046) glucosamine-containing compound catabolic process(GO:1901072) |
| 0.2 |
1.2 |
GO:0071894 |
histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.2 |
0.7 |
GO:0001828 |
inner cell mass cell fate commitment(GO:0001827) inner cell mass cellular morphogenesis(GO:0001828) |
| 0.2 |
2.4 |
GO:0010225 |
response to UV-C(GO:0010225) |
| 0.2 |
1.7 |
GO:0030866 |
cortical actin cytoskeleton organization(GO:0030866) |
| 0.2 |
0.7 |
GO:0031424 |
keratinization(GO:0031424) |
| 0.2 |
2.6 |
GO:0019368 |
fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.2 |
1.4 |
GO:0031065 |
positive regulation of histone deacetylation(GO:0031065) |
| 0.2 |
4.0 |
GO:0048384 |
retinoic acid receptor signaling pathway(GO:0048384) |
| 0.2 |
0.9 |
GO:0071364 |
response to epidermal growth factor(GO:0070849) cellular response to epidermal growth factor stimulus(GO:0071364) |
| 0.2 |
3.0 |
GO:1902622 |
regulation of neutrophil migration(GO:1902622) |
| 0.2 |
0.7 |
GO:0033313 |
meiotic cell cycle checkpoint(GO:0033313) |
| 0.2 |
1.6 |
GO:0097084 |
vascular smooth muscle cell development(GO:0097084) |
| 0.2 |
0.9 |
GO:0006968 |
cellular defense response(GO:0006968) |
| 0.2 |
3.5 |
GO:0070816 |
phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.2 |
0.9 |
GO:0070886 |
positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.2 |
3.2 |
GO:0030199 |
collagen fibril organization(GO:0030199) |
| 0.2 |
0.5 |
GO:0010259 |
multicellular organism aging(GO:0010259) |
| 0.2 |
0.5 |
GO:0071260 |
cellular response to mechanical stimulus(GO:0071260) |
| 0.2 |
0.7 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.2 |
7.8 |
GO:0030490 |
maturation of SSU-rRNA(GO:0030490) |
| 0.2 |
0.4 |
GO:0061042 |
vascular wound healing(GO:0061042) |
| 0.2 |
1.1 |
GO:1903504 |
regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
| 0.2 |
1.8 |
GO:0061000 |
negative regulation of dendritic spine development(GO:0061000) |
| 0.2 |
3.6 |
GO:0006474 |
N-terminal protein amino acid acetylation(GO:0006474) |
| 0.2 |
2.4 |
GO:0046597 |
negative regulation of viral entry into host cell(GO:0046597) |
| 0.2 |
2.4 |
GO:0042753 |
positive regulation of circadian rhythm(GO:0042753) |
| 0.2 |
0.7 |
GO:0090086 |
negative regulation of protein deubiquitination(GO:0090086) |
| 0.2 |
0.7 |
GO:0031953 |
negative regulation of protein autophosphorylation(GO:0031953) |
| 0.2 |
0.4 |
GO:0015675 |
nickel cation transport(GO:0015675) |
| 0.2 |
0.7 |
GO:1902807 |
negative regulation of cell cycle G1/S phase transition(GO:1902807) |
| 0.2 |
0.4 |
GO:0071474 |
cellular hyperosmotic response(GO:0071474) |
| 0.2 |
3.5 |
GO:0010633 |
negative regulation of epithelial cell migration(GO:0010633) |
| 0.2 |
0.4 |
GO:1903887 |
motile primary cilium assembly(GO:1903887) |
| 0.2 |
2.2 |
GO:1904293 |
negative regulation of ERAD pathway(GO:1904293) |
| 0.2 |
0.9 |
GO:0023035 |
CD40 signaling pathway(GO:0023035) regulation of CD40 signaling pathway(GO:2000348) |
| 0.2 |
1.1 |
GO:0045723 |
positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.2 |
1.1 |
GO:2000680 |
regulation of rubidium ion transport(GO:2000680) |
| 0.2 |
1.7 |
GO:0036065 |
fucosylation(GO:0036065) |
| 0.2 |
1.7 |
GO:0043488 |
regulation of mRNA stability(GO:0043488) |
| 0.2 |
1.1 |
GO:0006543 |
glutamine catabolic process(GO:0006543) |
| 0.2 |
1.7 |
GO:0043666 |
regulation of phosphoprotein phosphatase activity(GO:0043666) |
| 0.2 |
1.3 |
GO:0097284 |
hepatocyte apoptotic process(GO:0097284) |
| 0.2 |
0.4 |
GO:0006824 |
cobalt ion transport(GO:0006824) |
| 0.2 |
1.7 |
GO:0090557 |
establishment of endothelial intestinal barrier(GO:0090557) |
| 0.2 |
1.1 |
GO:0071359 |
cellular response to dsRNA(GO:0071359) |
| 0.2 |
0.8 |
GO:0016266 |
O-glycan processing(GO:0016266) |
| 0.2 |
0.4 |
GO:1903020 |
positive regulation of glycoprotein metabolic process(GO:1903020) |
| 0.2 |
0.2 |
GO:0002636 |
positive regulation of germinal center formation(GO:0002636) |
| 0.2 |
0.8 |
GO:0007144 |
female meiosis I(GO:0007144) |
| 0.2 |
0.6 |
GO:0042420 |
dopamine catabolic process(GO:0042420) |
| 0.2 |
0.6 |
GO:0001952 |
regulation of cell-matrix adhesion(GO:0001952) |
| 0.2 |
0.6 |
GO:0070166 |
tooth mineralization(GO:0034505) enamel mineralization(GO:0070166) |
| 0.2 |
1.7 |
GO:0070979 |
protein K11-linked ubiquitination(GO:0070979) |
| 0.2 |
0.8 |
GO:1903846 |
positive regulation of transforming growth factor beta receptor signaling pathway(GO:0030511) positive regulation of cellular response to transforming growth factor beta stimulus(GO:1903846) |
| 0.2 |
3.9 |
GO:0033539 |
fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.2 |
0.6 |
GO:0009062 |
fatty acid catabolic process(GO:0009062) |
| 0.2 |
0.8 |
GO:0046668 |
regulation of retinal cell programmed cell death(GO:0046668) |
| 0.2 |
0.6 |
GO:0034035 |
purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
| 0.2 |
0.4 |
GO:0061179 |
negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.2 |
3.6 |
GO:0046677 |
response to antibiotic(GO:0046677) |
| 0.2 |
16.4 |
GO:0008033 |
tRNA processing(GO:0008033) |
| 0.2 |
1.4 |
GO:0060159 |
regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.2 |
1.4 |
GO:1902745 |
positive regulation of lamellipodium assembly(GO:0010592) positive regulation of lamellipodium organization(GO:1902745) |
| 0.2 |
1.2 |
GO:0045292 |
mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.2 |
16.2 |
GO:0043123 |
positive regulation of I-kappaB kinase/NF-kappaB signaling(GO:0043123) |
| 0.2 |
1.4 |
GO:0009954 |
proximal/distal pattern formation(GO:0009954) |
| 0.2 |
0.4 |
GO:0045583 |
regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.2 |
0.6 |
GO:1900147 |
Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) positive regulation of Schwann cell migration(GO:1900149) positive regulation of glial cell migration(GO:1903977) |
| 0.2 |
0.2 |
GO:0031077 |
post-embryonic camera-type eye development(GO:0031077) |
| 0.2 |
0.8 |
GO:0071376 |
response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.2 |
0.2 |
GO:0010666 |
positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.2 |
2.9 |
GO:0006493 |
protein O-linked glycosylation(GO:0006493) |
| 0.2 |
0.2 |
GO:0060037 |
pharyngeal system development(GO:0060037) |
| 0.2 |
1.5 |
GO:0048642 |
negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.2 |
5.1 |
GO:0000027 |
ribosomal large subunit assembly(GO:0000027) |
| 0.2 |
0.4 |
GO:0046015 |
regulation of transcription by glucose(GO:0046015) |
| 0.2 |
0.8 |
GO:0036506 |
maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.2 |
0.9 |
GO:0071361 |
cellular response to ethanol(GO:0071361) |
| 0.2 |
0.7 |
GO:0097494 |
regulation of vesicle size(GO:0097494) |
| 0.2 |
2.6 |
GO:0051084 |
'de novo' protein folding(GO:0006458) 'de novo' posttranslational protein folding(GO:0051084) |
| 0.2 |
8.3 |
GO:0048736 |
appendage development(GO:0048736) limb development(GO:0060173) |
| 0.2 |
15.2 |
GO:0051028 |
mRNA transport(GO:0051028) |
| 0.2 |
0.9 |
GO:0006681 |
galactosylceramide metabolic process(GO:0006681) galactolipid metabolic process(GO:0019374) |
| 0.2 |
0.4 |
GO:0033632 |
regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
| 0.2 |
0.9 |
GO:0007197 |
adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 0.2 |
0.2 |
GO:0010989 |
negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.2 |
0.4 |
GO:0019336 |
phenol-containing compound catabolic process(GO:0019336) |
| 0.2 |
0.5 |
GO:0006953 |
acute-phase response(GO:0006953) |
| 0.2 |
0.2 |
GO:0031914 |
negative regulation of synaptic plasticity(GO:0031914) |
| 0.2 |
2.0 |
GO:0030514 |
negative regulation of BMP signaling pathway(GO:0030514) |
| 0.2 |
0.2 |
GO:0034392 |
negative regulation of smooth muscle cell apoptotic process(GO:0034392) |
| 0.2 |
2.2 |
GO:0007160 |
cell-matrix adhesion(GO:0007160) |
| 0.2 |
0.4 |
GO:0045760 |
positive regulation of action potential(GO:0045760) |
| 0.2 |
1.8 |
GO:0046349 |
amino sugar biosynthetic process(GO:0046349) |
| 0.2 |
0.4 |
GO:0048680 |
positive regulation of axon regeneration(GO:0048680) positive regulation of neuron projection regeneration(GO:0070572) |
| 0.2 |
0.7 |
GO:0045124 |
regulation of bone resorption(GO:0045124) positive regulation of bone resorption(GO:0045780) positive regulation of bone remodeling(GO:0046852) |
| 0.2 |
3.8 |
GO:0007498 |
mesoderm development(GO:0007498) |
| 0.2 |
2.5 |
GO:0019369 |
arachidonic acid metabolic process(GO:0019369) |
| 0.2 |
1.9 |
GO:0007099 |
centriole replication(GO:0007099) |
| 0.2 |
0.4 |
GO:0045086 |
positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.2 |
0.9 |
GO:0080111 |
DNA demethylation(GO:0080111) |
| 0.2 |
0.5 |
GO:1902188 |
positive regulation of viral release from host cell(GO:1902188) |
| 0.2 |
0.5 |
GO:1902310 |
positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.2 |
0.2 |
GO:1901857 |
positive regulation of cellular respiration(GO:1901857) |
| 0.2 |
3.7 |
GO:0006911 |
phagocytosis, engulfment(GO:0006911) |
| 0.2 |
0.2 |
GO:0060821 |
inactivation of X chromosome by DNA methylation(GO:0060821) |
| 0.2 |
0.3 |
GO:0042762 |
regulation of sulfur metabolic process(GO:0042762) |
| 0.2 |
2.2 |
GO:0048240 |
sperm capacitation(GO:0048240) |
| 0.2 |
0.3 |
GO:0098754 |
detoxification(GO:0098754) |
| 0.2 |
0.5 |
GO:0055094 |
response to lipoprotein particle(GO:0055094) |
| 0.2 |
0.5 |
GO:0048211 |
Golgi vesicle docking(GO:0048211) |
| 0.2 |
0.3 |
GO:0044380 |
protein localization to cytoskeleton(GO:0044380) |
| 0.2 |
1.0 |
GO:0035520 |
monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.2 |
0.6 |
GO:2000178 |
negative regulation of neural precursor cell proliferation(GO:2000178) |
| 0.2 |
0.5 |
GO:0019065 |
receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.2 |
6.6 |
GO:0006505 |
GPI anchor metabolic process(GO:0006505) |
| 0.2 |
0.6 |
GO:0042268 |
regulation of cytolysis(GO:0042268) negative regulation of cytolysis(GO:0045918) |
| 0.2 |
1.3 |
GO:0045445 |
myoblast differentiation(GO:0045445) |
| 0.2 |
0.2 |
GO:0032497 |
detection of lipopolysaccharide(GO:0032497) |
| 0.2 |
4.1 |
GO:0034314 |
Arp2/3 complex-mediated actin nucleation(GO:0034314) |
| 0.2 |
1.4 |
GO:0019800 |
peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.2 |
0.2 |
GO:0010155 |
regulation of proton transport(GO:0010155) |
| 0.2 |
3.9 |
GO:0007229 |
integrin-mediated signaling pathway(GO:0007229) |
| 0.2 |
1.4 |
GO:0016339 |
calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.2 |
0.6 |
GO:0045987 |
positive regulation of smooth muscle contraction(GO:0045987) |
| 0.2 |
0.6 |
GO:1904714 |
chaperone-mediated autophagy(GO:0061684) regulation of chaperone-mediated autophagy(GO:1904714) |
| 0.2 |
0.3 |
GO:0048254 |
snoRNA localization(GO:0048254) |
| 0.2 |
0.9 |
GO:0051016 |
barbed-end actin filament capping(GO:0051016) |
| 0.2 |
0.3 |
GO:0007398 |
ectoderm development(GO:0007398) |
| 0.2 |
1.4 |
GO:0031274 |
positive regulation of pseudopodium assembly(GO:0031274) |
| 0.2 |
0.6 |
GO:1904407 |
positive regulation of nitric oxide biosynthetic process(GO:0045429) positive regulation of nitric oxide metabolic process(GO:1904407) |
| 0.2 |
0.3 |
GO:0006269 |
DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.2 |
0.6 |
GO:0001834 |
trophectodermal cell proliferation(GO:0001834) |
| 0.2 |
1.4 |
GO:2000001 |
regulation of DNA damage checkpoint(GO:2000001) |
| 0.1 |
0.1 |
GO:0034162 |
toll-like receptor 9 signaling pathway(GO:0034162) |
| 0.1 |
0.3 |
GO:0061180 |
mammary gland epithelium development(GO:0061180) |
| 0.1 |
0.6 |
GO:0006398 |
mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.1 |
1.2 |
GO:0006309 |
apoptotic DNA fragmentation(GO:0006309) |
| 0.1 |
1.5 |
GO:0021978 |
telencephalon regionalization(GO:0021978) |
| 0.1 |
0.7 |
GO:0090286 |
cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.1 |
2.9 |
GO:0031146 |
SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.1 |
0.4 |
GO:2000983 |
regulation of ATP citrate synthase activity(GO:2000983) negative regulation of ATP citrate synthase activity(GO:2000984) |
| 0.1 |
0.4 |
GO:0042590 |
antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.1 |
0.7 |
GO:0031670 |
cellular response to nutrient(GO:0031670) |
| 0.1 |
2.3 |
GO:0031529 |
ruffle organization(GO:0031529) |
| 0.1 |
1.4 |
GO:0007588 |
excretion(GO:0007588) |
| 0.1 |
0.3 |
GO:0048102 |
autophagic cell death(GO:0048102) |
| 0.1 |
1.1 |
GO:0022617 |
extracellular matrix disassembly(GO:0022617) |
| 0.1 |
0.3 |
GO:0061300 |
cerebellum vasculature development(GO:0061300) |
| 0.1 |
1.5 |
GO:1904355 |
positive regulation of telomere capping(GO:1904355) |
| 0.1 |
0.8 |
GO:0006122 |
mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.1 |
0.8 |
GO:0043247 |
telomere maintenance in response to DNA damage(GO:0043247) |
| 0.1 |
0.4 |
GO:0036233 |
glycine import(GO:0036233) |
| 0.1 |
0.4 |
GO:0032534 |
regulation of microvillus organization(GO:0032530) regulation of microvillus assembly(GO:0032534) |
| 0.1 |
0.1 |
GO:0019249 |
lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
| 0.1 |
0.4 |
GO:0099624 |
regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) atrial cardiac muscle cell membrane repolarization(GO:0099624) |
| 0.1 |
0.4 |
GO:0006361 |
transcription initiation from RNA polymerase I promoter(GO:0006361) |
| 0.1 |
2.8 |
GO:0032922 |
circadian regulation of gene expression(GO:0032922) |
| 0.1 |
0.1 |
GO:0043950 |
positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.1 |
0.5 |
GO:1903975 |
regulation of glial cell migration(GO:1903975) |
| 0.1 |
1.3 |
GO:0000413 |
protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.1 |
2.1 |
GO:0007026 |
negative regulation of microtubule depolymerization(GO:0007026) |
| 0.1 |
0.3 |
GO:0090344 |
negative regulation of cell aging(GO:0090344) |
| 0.1 |
2.4 |
GO:0043968 |
histone H2A acetylation(GO:0043968) |
| 0.1 |
0.3 |
GO:1902965 |
protein localization to early endosome(GO:1902946) regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 0.1 |
0.1 |
GO:1904357 |
negative regulation of telomere maintenance via telomere lengthening(GO:1904357) |
| 0.1 |
4.1 |
GO:0051225 |
spindle assembly(GO:0051225) |
| 0.1 |
0.8 |
GO:0032927 |
positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.1 |
0.1 |
GO:0072498 |
embryonic skeletal joint development(GO:0072498) |
| 0.1 |
2.1 |
GO:0033865 |
coenzyme A metabolic process(GO:0015936) nucleoside bisphosphate metabolic process(GO:0033865) ribonucleoside bisphosphate metabolic process(GO:0033875) purine nucleoside bisphosphate metabolic process(GO:0034032) |
| 0.1 |
0.4 |
GO:0071453 |
cellular response to decreased oxygen levels(GO:0036294) cellular response to oxygen levels(GO:0071453) |
| 0.1 |
3.8 |
GO:0009636 |
response to toxic substance(GO:0009636) |
| 0.1 |
0.1 |
GO:0016479 |
negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
| 0.1 |
0.1 |
GO:0070102 |
interleukin-6-mediated signaling pathway(GO:0070102) |
| 0.1 |
0.1 |
GO:0045815 |
positive regulation of gene expression, epigenetic(GO:0045815) |
| 0.1 |
1.0 |
GO:0010631 |
epithelial cell migration(GO:0010631) |
| 0.1 |
0.2 |
GO:0010847 |
regulation of chromatin assembly(GO:0010847) |
| 0.1 |
0.1 |
GO:0060830 |
ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.1 |
1.6 |
GO:0032435 |
negative regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032435) |
| 0.1 |
0.4 |
GO:0033005 |
positive regulation of mast cell activation(GO:0033005) positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
| 0.1 |
0.1 |
GO:0008054 |
negative regulation of cyclin-dependent protein serine/threonine kinase by cyclin degradation(GO:0008054) |
| 0.1 |
0.4 |
GO:0036344 |
platelet morphogenesis(GO:0036344) |
| 0.1 |
0.1 |
GO:0033860 |
regulation of NAD(P)H oxidase activity(GO:0033860) |
| 0.1 |
0.5 |
GO:0030225 |
macrophage differentiation(GO:0030225) |
| 0.1 |
0.5 |
GO:0035036 |
binding of sperm to zona pellucida(GO:0007339) sperm-egg recognition(GO:0035036) |
| 0.1 |
1.3 |
GO:0006366 |
transcription from RNA polymerase II promoter(GO:0006366) |
| 0.1 |
13.2 |
GO:0007059 |
chromosome segregation(GO:0007059) |
| 0.1 |
0.5 |
GO:1902261 |
positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.1 |
1.3 |
GO:0030150 |
protein import into mitochondrial matrix(GO:0030150) |
| 0.1 |
0.2 |
GO:0040016 |
embryonic cleavage(GO:0040016) |
| 0.1 |
0.9 |
GO:0070940 |
dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.1 |
0.2 |
GO:0045839 |
negative regulation of mitotic nuclear division(GO:0045839) |
| 0.1 |
3.9 |
GO:0008584 |
male gonad development(GO:0008584) development of primary male sexual characteristics(GO:0046546) |
| 0.1 |
0.3 |
GO:0035020 |
regulation of Rac protein signal transduction(GO:0035020) |
| 0.1 |
0.8 |
GO:0042219 |
cellular modified amino acid catabolic process(GO:0042219) |
| 0.1 |
4.7 |
GO:0009142 |
nucleoside triphosphate biosynthetic process(GO:0009142) |
| 0.1 |
0.5 |
GO:0048733 |
sebaceous gland development(GO:0048733) |
| 0.1 |
2.0 |
GO:0016073 |
snRNA metabolic process(GO:0016073) snRNA processing(GO:0016180) |
| 0.1 |
1.0 |
GO:0044381 |
glucose import in response to insulin stimulus(GO:0044381) regulation of glucose import in response to insulin stimulus(GO:2001273) |
| 0.1 |
2.3 |
GO:0002224 |
toll-like receptor signaling pathway(GO:0002224) |
| 0.1 |
0.3 |
GO:0009313 |
oligosaccharide catabolic process(GO:0009313) |
| 0.1 |
0.1 |
GO:0000389 |
mRNA 3'-splice site recognition(GO:0000389) |
| 0.1 |
0.4 |
GO:0007217 |
tachykinin receptor signaling pathway(GO:0007217) |
| 0.1 |
1.0 |
GO:0010907 |
positive regulation of glucose metabolic process(GO:0010907) |
| 0.1 |
0.2 |
GO:0000055 |
ribosomal large subunit export from nucleus(GO:0000055) |
| 0.1 |
0.1 |
GO:0045091 |
single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) negative regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045869) |
| 0.1 |
0.3 |
GO:0032790 |
ribosome disassembly(GO:0032790) |
| 0.1 |
0.2 |
GO:0016095 |
polyprenol catabolic process(GO:0016095) |
| 0.1 |
8.3 |
GO:0007030 |
Golgi organization(GO:0007030) |
| 0.1 |
0.5 |
GO:0006123 |
mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.1 |
0.4 |
GO:0019287 |
isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) isopentenyl diphosphate metabolic process(GO:0046490) |
| 0.1 |
0.3 |
GO:0030330 |
DNA damage response, signal transduction by p53 class mediator(GO:0030330) |
| 0.1 |
1.1 |
GO:0000463 |
maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.1 |
0.5 |
GO:0042274 |
ribosomal small subunit biogenesis(GO:0042274) |
| 0.1 |
2.7 |
GO:0006959 |
humoral immune response(GO:0006959) |
| 0.1 |
0.4 |
GO:0048251 |
elastic fiber assembly(GO:0048251) |
| 0.1 |
0.4 |
GO:0010739 |
positive regulation of protein kinase A signaling(GO:0010739) |
| 0.1 |
0.2 |
GO:0055070 |
copper ion homeostasis(GO:0055070) |
| 0.1 |
0.2 |
GO:0075525 |
viral translational termination-reinitiation(GO:0075525) |
| 0.1 |
0.1 |
GO:0099515 |
actin filament-based transport(GO:0099515) |
| 0.1 |
0.5 |
GO:0042481 |
regulation of odontogenesis(GO:0042481) |
| 0.1 |
0.7 |
GO:0045580 |
regulation of T cell differentiation(GO:0045580) |
| 0.1 |
0.1 |
GO:0090199 |
regulation of release of cytochrome c from mitochondria(GO:0090199) |
| 0.1 |
0.2 |
GO:0060075 |
regulation of resting membrane potential(GO:0060075) |
| 0.1 |
1.3 |
GO:0042407 |
cristae formation(GO:0042407) |
| 0.1 |
0.6 |
GO:0043374 |
CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.1 |
2.6 |
GO:0042273 |
ribosomal large subunit biogenesis(GO:0042273) |
| 0.1 |
0.2 |
GO:0051031 |
tRNA transport(GO:0051031) |
| 0.1 |
0.2 |
GO:0006477 |
protein sulfation(GO:0006477) |
| 0.1 |
0.1 |
GO:0034383 |
low-density lipoprotein particle clearance(GO:0034383) |
| 0.1 |
1.5 |
GO:0070584 |
mitochondrion morphogenesis(GO:0070584) |
| 0.1 |
0.4 |
GO:0051967 |
negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.1 |
0.3 |
GO:0000291 |
nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
| 0.1 |
0.3 |
GO:0019471 |
4-hydroxyproline metabolic process(GO:0019471) |
| 0.1 |
0.6 |
GO:0039703 |
viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.1 |
0.5 |
GO:0048701 |
embryonic cranial skeleton morphogenesis(GO:0048701) |
| 0.1 |
0.4 |
GO:0010324 |
membrane invagination(GO:0010324) |
| 0.1 |
0.2 |
GO:1901097 |
negative regulation of autophagosome maturation(GO:1901097) |
| 0.1 |
0.3 |
GO:0071205 |
protein localization to juxtaparanode region of axon(GO:0071205) |
| 0.1 |
0.2 |
GO:0010452 |
histone H3-K36 methylation(GO:0010452) |
| 0.1 |
3.2 |
GO:0002181 |
cytoplasmic translation(GO:0002181) |
| 0.1 |
0.2 |
GO:0070269 |
pyroptosis(GO:0070269) |
| 0.1 |
0.3 |
GO:0015721 |
bile acid and bile salt transport(GO:0015721) |
| 0.1 |
0.2 |
GO:0000290 |
deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 |
0.9 |
GO:0006379 |
mRNA cleavage(GO:0006379) |
| 0.1 |
0.4 |
GO:0006691 |
leukotriene metabolic process(GO:0006691) |
| 0.1 |
0.3 |
GO:0070125 |
mitochondrial translational elongation(GO:0070125) |
| 0.1 |
1.3 |
GO:0043171 |
peptide catabolic process(GO:0043171) |
| 0.1 |
0.2 |
GO:0034982 |
mitochondrial protein processing(GO:0034982) |
| 0.1 |
1.5 |
GO:0045137 |
development of primary sexual characteristics(GO:0045137) |
| 0.1 |
0.2 |
GO:0061073 |
ciliary body morphogenesis(GO:0061073) |
| 0.1 |
0.2 |
GO:0003215 |
cardiac right ventricle morphogenesis(GO:0003215) |
| 0.1 |
0.2 |
GO:0070966 |
nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.1 |
0.6 |
GO:0032526 |
response to retinoic acid(GO:0032526) |
| 0.1 |
0.2 |
GO:0010332 |
response to gamma radiation(GO:0010332) |
| 0.1 |
0.9 |
GO:0006353 |
DNA-templated transcription, termination(GO:0006353) |
| 0.1 |
0.4 |
GO:0050892 |
intestinal absorption(GO:0050892) |
| 0.1 |
1.7 |
GO:0007368 |
determination of left/right symmetry(GO:0007368) |
| 0.1 |
0.9 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.1 |
0.5 |
GO:0007549 |
dosage compensation(GO:0007549) |
| 0.1 |
0.4 |
GO:0009235 |
cobalamin metabolic process(GO:0009235) |
| 0.1 |
0.3 |
GO:0032784 |
regulation of DNA-templated transcription, elongation(GO:0032784) |
| 0.1 |
0.4 |
GO:0090383 |
phagosome acidification(GO:0090383) |
| 0.1 |
0.2 |
GO:0006428 |
isoleucyl-tRNA aminoacylation(GO:0006428) |
| 0.1 |
1.0 |
GO:0043094 |
cellular metabolic compound salvage(GO:0043094) |
| 0.1 |
2.8 |
GO:0000245 |
spliceosomal complex assembly(GO:0000245) |
| 0.1 |
0.1 |
GO:0007113 |
endomitotic cell cycle(GO:0007113) |
| 0.1 |
0.6 |
GO:0016568 |
chromatin modification(GO:0016568) |
| 0.1 |
0.1 |
GO:0039530 |
MDA-5 signaling pathway(GO:0039530) |
| 0.1 |
0.2 |
GO:0046835 |
carbohydrate phosphorylation(GO:0046835) |
| 0.1 |
0.5 |
GO:0030322 |
stabilization of membrane potential(GO:0030322) |
| 0.1 |
0.9 |
GO:0043550 |
regulation of lipid kinase activity(GO:0043550) |
| 0.1 |
0.2 |
GO:0003365 |
establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
| 0.1 |
0.9 |
GO:0010501 |
RNA secondary structure unwinding(GO:0010501) |
| 0.1 |
0.6 |
GO:0006368 |
transcription elongation from RNA polymerase II promoter(GO:0006368) |
| 0.1 |
0.1 |
GO:0045053 |
protein retention in Golgi apparatus(GO:0045053) |
| 0.1 |
1.2 |
GO:0045600 |
positive regulation of fat cell differentiation(GO:0045600) |
| 0.1 |
0.1 |
GO:2000738 |
positive regulation of stem cell differentiation(GO:2000738) |
| 0.1 |
0.6 |
GO:2001022 |
positive regulation of response to DNA damage stimulus(GO:2001022) |
| 0.1 |
2.2 |
GO:0001578 |
microtubule bundle formation(GO:0001578) |
| 0.0 |
0.0 |
GO:0097049 |
motor neuron apoptotic process(GO:0097049) regulation of motor neuron apoptotic process(GO:2000671) |
| 0.0 |
0.1 |
GO:0006517 |
protein deglycosylation(GO:0006517) |
| 0.0 |
0.3 |
GO:0009143 |
nucleoside triphosphate catabolic process(GO:0009143) |
| 0.0 |
0.1 |
GO:0045974 |
miRNA mediated inhibition of translation(GO:0035278) negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
| 0.0 |
0.0 |
GO:0060693 |
regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
| 0.0 |
0.9 |
GO:0032527 |
protein exit from endoplasmic reticulum(GO:0032527) |
| 0.0 |
0.8 |
GO:0016575 |
histone deacetylation(GO:0016575) |
| 0.0 |
0.2 |
GO:0045948 |
positive regulation of translational initiation(GO:0045948) |
| 0.0 |
0.2 |
GO:0051189 |
Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.0 |
1.2 |
GO:0090288 |
negative regulation of cellular response to growth factor stimulus(GO:0090288) |
| 0.0 |
0.4 |
GO:0030575 |
nuclear body organization(GO:0030575) |
| 0.0 |
0.3 |
GO:0014013 |
regulation of gliogenesis(GO:0014013) |
| 0.0 |
0.1 |
GO:0045668 |
negative regulation of osteoblast differentiation(GO:0045668) |
| 0.0 |
0.0 |
GO:0043654 |
recognition of apoptotic cell(GO:0043654) |
| 0.0 |
0.3 |
GO:0016226 |
iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 |
0.2 |
GO:1902042 |
negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
| 0.0 |
0.0 |
GO:0015677 |
copper ion import(GO:0015677) |
| 0.0 |
0.1 |
GO:0061037 |
negative regulation of chondrocyte differentiation(GO:0032331) negative regulation of cartilage development(GO:0061037) |
| 0.0 |
0.3 |
GO:0060261 |
positive regulation of transcription initiation from RNA polymerase II promoter(GO:0060261) |
| 0.0 |
0.0 |
GO:2000189 |
positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.0 |
0.2 |
GO:0000271 |
polysaccharide biosynthetic process(GO:0000271) |
| 0.0 |
0.1 |
GO:0032204 |
regulation of telomere maintenance(GO:0032204) |
| 0.0 |
0.1 |
GO:2000059 |
negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.0 |
0.2 |
GO:0018206 |
peptidyl-methionine modification(GO:0018206) |
| 0.0 |
0.4 |
GO:0030520 |
intracellular estrogen receptor signaling pathway(GO:0030520) |
| 0.0 |
0.0 |
GO:0043278 |
response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
| 0.0 |
0.3 |
GO:0008299 |
isoprenoid biosynthetic process(GO:0008299) |
| 0.0 |
0.1 |
GO:0046415 |
urate metabolic process(GO:0046415) |
| 0.0 |
0.1 |
GO:0090303 |
positive regulation of wound healing(GO:0090303) |
| 0.0 |
0.1 |
GO:0046208 |
spermine catabolic process(GO:0046208) |
| 0.0 |
0.4 |
GO:0031648 |
protein destabilization(GO:0031648) |
| 0.0 |
1.3 |
GO:0043966 |
histone H3 acetylation(GO:0043966) |
| 0.0 |
0.2 |
GO:0032801 |
receptor catabolic process(GO:0032801) |
| 0.0 |
0.1 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.0 |
0.4 |
GO:0019216 |
regulation of lipid metabolic process(GO:0019216) |
| 0.0 |
0.3 |
GO:1900383 |
regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.0 |
0.1 |
GO:1901642 |
purine nucleoside transmembrane transport(GO:0015860) purine-containing compound transmembrane transport(GO:0072530) nucleoside transmembrane transport(GO:1901642) |
| 0.0 |
0.1 |
GO:0018026 |
peptidyl-lysine monomethylation(GO:0018026) |
| 0.0 |
0.1 |
GO:0014866 |
skeletal myofibril assembly(GO:0014866) |
| 0.0 |
0.4 |
GO:0006635 |
fatty acid beta-oxidation(GO:0006635) |
| 0.0 |
0.0 |
GO:0010764 |
negative regulation of fibroblast migration(GO:0010764) |
| 0.0 |
0.0 |
GO:0045652 |
regulation of megakaryocyte differentiation(GO:0045652) positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.0 |
1.1 |
GO:0006413 |
translational initiation(GO:0006413) |
| 0.0 |
0.0 |
GO:1902749 |
regulation of cell cycle G2/M phase transition(GO:1902749) |
| 0.0 |
0.4 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.0 |
0.1 |
GO:1904031 |
positive regulation of cyclin-dependent protein kinase activity(GO:1904031) |
| 0.0 |
0.0 |
GO:2000642 |
negative regulation of early endosome to late endosome transport(GO:2000642) |
| 0.0 |
0.0 |
GO:0048875 |
chemical homeostasis within a tissue(GO:0048875) |
| 0.0 |
0.1 |
GO:0006825 |
copper ion transport(GO:0006825) |
| 0.0 |
0.1 |
GO:1902224 |
cellular ketone body metabolic process(GO:0046950) ketone body metabolic process(GO:1902224) |
| 0.0 |
0.1 |
GO:0044243 |
collagen catabolic process(GO:0030574) multicellular organism catabolic process(GO:0044243) |
| 0.0 |
0.2 |
GO:0032088 |
negative regulation of NF-kappaB transcription factor activity(GO:0032088) |
| 0.0 |
0.0 |
GO:0002082 |
regulation of oxidative phosphorylation(GO:0002082) |
| 0.0 |
0.0 |
GO:0033683 |
nucleotide-excision repair, DNA incision(GO:0033683) |
| 0.0 |
0.1 |
GO:0018279 |
peptidyl-asparagine modification(GO:0018196) protein N-linked glycosylation via asparagine(GO:0018279) |
| 0.0 |
0.1 |
GO:0000183 |
chromatin silencing at rDNA(GO:0000183) |
| 0.0 |
0.0 |
GO:0007320 |
insemination(GO:0007320) |
| 0.0 |
0.0 |
GO:0007000 |
nucleolus organization(GO:0007000) |
| 0.0 |
0.1 |
GO:0048477 |
oogenesis(GO:0048477) |
| 0.0 |
0.1 |
GO:0006120 |
mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.0 |
0.0 |
GO:0006289 |
nucleotide-excision repair(GO:0006289) |
| 0.0 |
0.1 |
GO:0034308 |
primary alcohol metabolic process(GO:0034308) |
