| 15.6 |
46.7 |
GO:0097402 |
neuroblast migration(GO:0097402) |
| 11.2 |
33.5 |
GO:0021893 |
cerebral cortex GABAergic interneuron fate commitment(GO:0021893) |
| 11.0 |
11.0 |
GO:0070366 |
regulation of hepatocyte differentiation(GO:0070366) |
| 9.6 |
28.8 |
GO:0021529 |
spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 9.3 |
9.3 |
GO:0014809 |
regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014809) |
| 9.3 |
27.9 |
GO:0030421 |
defecation(GO:0030421) |
| 8.0 |
32.0 |
GO:0060032 |
notochord regression(GO:0060032) |
| 7.7 |
15.4 |
GO:0072103 |
glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) |
| 7.4 |
22.1 |
GO:0046022 |
regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
| 7.2 |
28.7 |
GO:2000974 |
negative regulation of pro-B cell differentiation(GO:2000974) |
| 6.3 |
12.6 |
GO:0072197 |
ureter morphogenesis(GO:0072197) |
| 6.2 |
6.2 |
GO:0090194 |
negative regulation of glomerular mesangial cell proliferation(GO:0072125) negative regulation of glomerulus development(GO:0090194) |
| 5.8 |
17.4 |
GO:0071898 |
regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 5.7 |
17.2 |
GO:0060244 |
negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 5.7 |
17.0 |
GO:0002302 |
CD8-positive, alpha-beta T cell differentiation involved in immune response(GO:0002302) |
| 5.6 |
5.6 |
GO:0072070 |
loop of Henle development(GO:0072070) metanephric loop of Henle development(GO:0072236) |
| 5.6 |
11.2 |
GO:0021938 |
smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) |
| 5.4 |
5.4 |
GO:0048070 |
regulation of developmental pigmentation(GO:0048070) positive regulation of developmental pigmentation(GO:0048087) positive regulation of pigment cell differentiation(GO:0050942) |
| 5.4 |
16.3 |
GO:0010757 |
negative regulation of plasminogen activation(GO:0010757) |
| 5.3 |
16.0 |
GO:0048352 |
neural plate mediolateral regionalization(GO:0021998) mesoderm structural organization(GO:0048338) paraxial mesoderm structural organization(GO:0048352) |
| 5.3 |
15.9 |
GO:0060994 |
regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 5.2 |
15.7 |
GO:0010248 |
B cell negative selection(GO:0002352) establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 4.9 |
4.9 |
GO:0061642 |
chemoattraction of axon(GO:0061642) |
| 4.8 |
9.5 |
GO:1990705 |
cholangiocyte proliferation(GO:1990705) |
| 4.6 |
13.9 |
GO:1903048 |
regulation of acetylcholine-gated cation channel activity(GO:1903048) |
| 4.6 |
18.4 |
GO:1904996 |
positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 4.6 |
27.4 |
GO:0070094 |
positive regulation of glucagon secretion(GO:0070094) |
| 4.5 |
22.7 |
GO:0015705 |
iodide transport(GO:0015705) |
| 4.5 |
4.5 |
GO:0048382 |
mesendoderm development(GO:0048382) |
| 4.5 |
4.5 |
GO:0032817 |
regulation of natural killer cell proliferation(GO:0032817) positive regulation of natural killer cell proliferation(GO:0032819) |
| 4.5 |
13.5 |
GO:0060762 |
regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
| 4.4 |
13.3 |
GO:0003360 |
brainstem development(GO:0003360) |
| 4.4 |
17.8 |
GO:2000525 |
regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 4.4 |
39.9 |
GO:0021521 |
ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 4.4 |
17.7 |
GO:0003199 |
endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
| 4.3 |
12.8 |
GO:0090187 |
positive regulation of pancreatic juice secretion(GO:0090187) |
| 4.2 |
12.6 |
GO:0090425 |
hepatocyte cell migration(GO:0002194) branching involved in pancreas morphogenesis(GO:0061114) acinar cell differentiation(GO:0090425) positive regulation of forebrain neuron differentiation(GO:2000979) |
| 4.2 |
12.6 |
GO:0014028 |
notochord formation(GO:0014028) |
| 4.1 |
20.5 |
GO:0021553 |
olfactory nerve development(GO:0021553) |
| 4.0 |
4.0 |
GO:0072095 |
regulation of branch elongation involved in ureteric bud branching(GO:0072095) |
| 4.0 |
16.0 |
GO:0021798 |
forebrain dorsal/ventral pattern formation(GO:0021798) |
| 3.9 |
3.9 |
GO:0030916 |
otic vesicle formation(GO:0030916) |
| 3.8 |
15.3 |
GO:1904565 |
response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 3.8 |
11.5 |
GO:0007223 |
Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 3.8 |
3.8 |
GO:0045608 |
inhibition of neuroepithelial cell differentiation(GO:0002085) negative regulation of auditory receptor cell differentiation(GO:0045608) |
| 3.8 |
11.3 |
GO:0014826 |
vein smooth muscle contraction(GO:0014826) |
| 3.8 |
11.3 |
GO:0032877 |
positive regulation of DNA endoreduplication(GO:0032877) |
| 3.6 |
17.9 |
GO:0061181 |
regulation of chondrocyte development(GO:0061181) |
| 3.6 |
17.9 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 3.5 |
7.1 |
GO:0051216 |
cartilage development(GO:0051216) |
| 3.5 |
10.6 |
GO:0060598 |
dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
| 3.5 |
28.0 |
GO:0048852 |
diencephalon morphogenesis(GO:0048852) |
| 3.4 |
13.8 |
GO:0000255 |
allantoin metabolic process(GO:0000255) |
| 3.4 |
30.8 |
GO:0060710 |
chorio-allantoic fusion(GO:0060710) |
| 3.4 |
10.3 |
GO:0070634 |
transepithelial ammonium transport(GO:0070634) |
| 3.4 |
23.8 |
GO:0009449 |
gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 3.4 |
6.7 |
GO:0072223 |
metanephric glomerular mesangium development(GO:0072223) metanephric glomerular mesangial cell proliferation involved in metanephros development(GO:0072262) |
| 3.3 |
23.4 |
GO:0031536 |
positive regulation of exit from mitosis(GO:0031536) |
| 3.3 |
6.6 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 3.3 |
9.8 |
GO:0009177 |
deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
| 3.3 |
9.8 |
GO:0097212 |
lysosomal membrane organization(GO:0097212) |
| 3.3 |
6.5 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 3.3 |
3.3 |
GO:1900025 |
negative regulation of substrate adhesion-dependent cell spreading(GO:1900025) |
| 3.2 |
32.4 |
GO:0048386 |
positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 3.2 |
3.2 |
GO:0034142 |
toll-like receptor 4 signaling pathway(GO:0034142) |
| 3.2 |
15.9 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 3.2 |
25.4 |
GO:0060068 |
vagina development(GO:0060068) |
| 3.2 |
22.2 |
GO:0006105 |
succinate metabolic process(GO:0006105) |
| 3.2 |
12.6 |
GO:0060513 |
prostatic bud formation(GO:0060513) |
| 3.2 |
18.9 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 3.1 |
15.7 |
GO:1900170 |
negative regulation of glucocorticoid mediated signaling pathway(GO:1900170) |
| 3.1 |
6.2 |
GO:0060242 |
contact inhibition(GO:0060242) |
| 3.1 |
28.0 |
GO:0046499 |
S-adenosylmethioninamine metabolic process(GO:0046499) |
| 3.1 |
9.3 |
GO:0019343 |
cysteine biosynthetic process via cystathionine(GO:0019343) cysteine biosynthetic process(GO:0019344) |
| 3.1 |
21.7 |
GO:0007406 |
negative regulation of neuroblast proliferation(GO:0007406) |
| 3.0 |
9.0 |
GO:0060010 |
Sertoli cell fate commitment(GO:0060010) |
| 3.0 |
9.0 |
GO:0014738 |
regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
| 2.9 |
2.9 |
GO:0072076 |
nephrogenic mesenchyme development(GO:0072076) |
| 2.9 |
37.7 |
GO:0014841 |
skeletal muscle satellite cell proliferation(GO:0014841) |
| 2.9 |
11.6 |
GO:0006447 |
regulation of translational initiation by iron(GO:0006447) positive regulation of translational initiation by iron(GO:0045994) |
| 2.9 |
2.9 |
GO:0072282 |
metanephric nephron tubule morphogenesis(GO:0072282) |
| 2.9 |
17.4 |
GO:0032488 |
Cdc42 protein signal transduction(GO:0032488) |
| 2.9 |
14.4 |
GO:0035022 |
positive regulation of Rac protein signal transduction(GO:0035022) |
| 2.9 |
5.7 |
GO:0060437 |
lung growth(GO:0060437) |
| 2.8 |
25.6 |
GO:0097421 |
liver regeneration(GO:0097421) |
| 2.8 |
8.5 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 2.8 |
2.8 |
GO:1904030 |
negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
| 2.8 |
16.7 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 2.8 |
22.2 |
GO:0030538 |
embryonic genitalia morphogenesis(GO:0030538) |
| 2.8 |
8.3 |
GO:0009812 |
flavonoid metabolic process(GO:0009812) flavonoid biosynthetic process(GO:0009813) flavonoid glucuronidation(GO:0052696) |
| 2.7 |
13.5 |
GO:0034374 |
low-density lipoprotein particle remodeling(GO:0034374) |
| 2.7 |
13.3 |
GO:0072257 |
metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 2.6 |
7.9 |
GO:0036091 |
positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 2.6 |
7.9 |
GO:0072356 |
chromosome passenger complex localization to kinetochore(GO:0072356) |
| 2.6 |
7.9 |
GO:0030167 |
proteoglycan catabolic process(GO:0030167) |
| 2.6 |
10.5 |
GO:2000271 |
positive regulation of fibroblast apoptotic process(GO:2000271) |
| 2.6 |
7.8 |
GO:1901420 |
negative regulation of response to alcohol(GO:1901420) |
| 2.6 |
7.7 |
GO:0032847 |
regulation of cellular pH reduction(GO:0032847) |
| 2.5 |
10.0 |
GO:0035606 |
peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 2.5 |
5.0 |
GO:0038030 |
non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 2.5 |
7.4 |
GO:0003245 |
cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
| 2.5 |
7.4 |
GO:0019405 |
alditol catabolic process(GO:0019405) |
| 2.5 |
9.9 |
GO:0046836 |
glycolipid transport(GO:0046836) |
| 2.5 |
24.6 |
GO:0030388 |
fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 2.4 |
2.4 |
GO:0003420 |
regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
| 2.4 |
9.8 |
GO:0035989 |
tendon development(GO:0035989) |
| 2.4 |
14.6 |
GO:0006570 |
tyrosine metabolic process(GO:0006570) |
| 2.4 |
38.7 |
GO:0048385 |
regulation of retinoic acid receptor signaling pathway(GO:0048385) |
| 2.4 |
2.4 |
GO:0014722 |
regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 2.4 |
12.1 |
GO:0014834 |
skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
| 2.4 |
9.7 |
GO:0072137 |
condensed mesenchymal cell proliferation(GO:0072137) |
| 2.4 |
7.2 |
GO:0048133 |
germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 2.4 |
7.2 |
GO:0006682 |
galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 2.4 |
2.4 |
GO:0007494 |
midgut development(GO:0007494) |
| 2.4 |
9.4 |
GO:0090132 |
epithelium migration(GO:0090132) |
| 2.3 |
16.4 |
GO:0042730 |
fibrinolysis(GO:0042730) |
| 2.3 |
7.0 |
GO:0051124 |
synaptic growth at neuromuscular junction(GO:0051124) |
| 2.3 |
2.3 |
GO:0042660 |
positive regulation of cell fate specification(GO:0042660) |
| 2.3 |
16.2 |
GO:0000022 |
mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
| 2.3 |
2.3 |
GO:0007352 |
zygotic specification of dorsal/ventral axis(GO:0007352) |
| 2.3 |
9.2 |
GO:0007056 |
spindle assembly involved in female meiosis(GO:0007056) |
| 2.3 |
11.5 |
GO:0061032 |
visceral serous pericardium development(GO:0061032) |
| 2.3 |
4.6 |
GO:2001022 |
positive regulation of response to DNA damage stimulus(GO:2001022) |
| 2.3 |
9.1 |
GO:1900145 |
regulation of nodal signaling pathway involved in determination of left/right asymmetry(GO:1900145) regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900175) positive regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900224) positive regulation of mesoderm development(GO:2000382) |
| 2.3 |
6.8 |
GO:0061537 |
glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 2.3 |
25.0 |
GO:0060539 |
diaphragm development(GO:0060539) |
| 2.2 |
4.5 |
GO:0043696 |
dedifferentiation(GO:0043696) cell dedifferentiation(GO:0043697) |
| 2.2 |
9.0 |
GO:0098763 |
mitotic cell cycle phase(GO:0098763) |
| 2.2 |
6.7 |
GO:0097461 |
ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
| 2.2 |
6.6 |
GO:0035469 |
determination of pancreatic left/right asymmetry(GO:0035469) |
| 2.2 |
8.8 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 2.2 |
6.6 |
GO:0042732 |
D-xylose metabolic process(GO:0042732) |
| 2.2 |
2.2 |
GO:0048672 |
positive regulation of collateral sprouting(GO:0048672) |
| 2.2 |
4.3 |
GO:0006776 |
vitamin A metabolic process(GO:0006776) |
| 2.1 |
8.6 |
GO:2000427 |
regulation of apoptotic cell clearance(GO:2000425) positive regulation of apoptotic cell clearance(GO:2000427) |
| 2.1 |
2.1 |
GO:0090500 |
endocardial cushion to mesenchymal transition(GO:0090500) |
| 2.1 |
4.3 |
GO:2000040 |
regulation of planar cell polarity pathway involved in axis elongation(GO:2000040) negative regulation of planar cell polarity pathway involved in axis elongation(GO:2000041) |
| 2.1 |
6.4 |
GO:0045819 |
positive regulation of glycogen catabolic process(GO:0045819) |
| 2.1 |
6.4 |
GO:0070172 |
positive regulation of tooth mineralization(GO:0070172) |
| 2.1 |
2.1 |
GO:0048023 |
positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
| 2.1 |
4.3 |
GO:0036166 |
phenotypic switching(GO:0036166) |
| 2.1 |
8.3 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 2.1 |
8.2 |
GO:0046469 |
platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 2.0 |
16.3 |
GO:0043568 |
positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 2.0 |
6.1 |
GO:0045590 |
negative regulation of regulatory T cell differentiation(GO:0045590) |
| 2.0 |
18.1 |
GO:0010216 |
maintenance of DNA methylation(GO:0010216) |
| 2.0 |
6.0 |
GO:0030513 |
positive regulation of BMP signaling pathway(GO:0030513) |
| 2.0 |
2.0 |
GO:0048739 |
cardiac muscle fiber development(GO:0048739) |
| 2.0 |
24.0 |
GO:0021915 |
neural tube development(GO:0021915) |
| 2.0 |
6.0 |
GO:0035880 |
embryonic nail plate morphogenesis(GO:0035880) |
| 2.0 |
6.0 |
GO:0060282 |
positive regulation of oocyte development(GO:0060282) |
| 2.0 |
7.9 |
GO:2001032 |
regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 2.0 |
9.8 |
GO:0045657 |
positive regulation of monocyte differentiation(GO:0045657) |
| 2.0 |
5.9 |
GO:0015889 |
cobalamin transport(GO:0015889) |
| 2.0 |
13.7 |
GO:2000781 |
positive regulation of double-strand break repair(GO:2000781) |
| 2.0 |
2.0 |
GO:0050728 |
negative regulation of inflammatory response(GO:0050728) |
| 2.0 |
2.0 |
GO:0046641 |
positive regulation of alpha-beta T cell proliferation(GO:0046641) |
| 2.0 |
5.9 |
GO:0038203 |
TORC2 signaling(GO:0038203) |
| 2.0 |
5.9 |
GO:0006065 |
UDP-glucuronate biosynthetic process(GO:0006065) |
| 1.9 |
1.9 |
GO:0090594 |
wound healing involved in inflammatory response(GO:0002246) inflammatory response to wounding(GO:0090594) |
| 1.9 |
5.8 |
GO:1902528 |
regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 1.9 |
5.8 |
GO:0006116 |
NADH oxidation(GO:0006116) |
| 1.9 |
1.9 |
GO:0001787 |
natural killer cell proliferation(GO:0001787) |
| 1.9 |
5.7 |
GO:0086017 |
Purkinje myocyte action potential(GO:0086017) |
| 1.9 |
17.2 |
GO:0010587 |
miRNA catabolic process(GO:0010587) |
| 1.9 |
17.2 |
GO:0061302 |
smooth muscle cell-matrix adhesion(GO:0061302) |
| 1.9 |
13.2 |
GO:0048706 |
embryonic skeletal system development(GO:0048706) |
| 1.9 |
7.5 |
GO:2001137 |
positive regulation of endocytic recycling(GO:2001137) |
| 1.9 |
1.9 |
GO:0035878 |
nail development(GO:0035878) |
| 1.9 |
7.5 |
GO:0006344 |
maintenance of chromatin silencing(GO:0006344) |
| 1.9 |
11.2 |
GO:0070307 |
lens fiber cell development(GO:0070307) |
| 1.9 |
7.4 |
GO:0043921 |
modulation by host of viral transcription(GO:0043921) modulation of transcription in other organism involved in symbiotic interaction(GO:0052312) modulation by host of symbiont transcription(GO:0052472) |
| 1.9 |
13.0 |
GO:1902947 |
regulation of tau-protein kinase activity(GO:1902947) |
| 1.8 |
3.7 |
GO:1905005 |
regulation of epithelial to mesenchymal transition involved in endocardial cushion formation(GO:1905005) |
| 1.8 |
7.4 |
GO:0071449 |
cellular response to lipid hydroperoxide(GO:0071449) |
| 1.8 |
1.8 |
GO:0043465 |
regulation of fermentation(GO:0043465) negative regulation of fermentation(GO:1901003) |
| 1.8 |
3.7 |
GO:0006083 |
acetate metabolic process(GO:0006083) |
| 1.8 |
10.9 |
GO:0072539 |
T-helper 17 cell differentiation(GO:0072539) |
| 1.8 |
9.0 |
GO:0015867 |
ATP transport(GO:0015867) |
| 1.8 |
7.1 |
GO:0070425 |
negative regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070425) negative regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070433) |
| 1.8 |
10.7 |
GO:0045198 |
establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 1.8 |
5.3 |
GO:0071361 |
cellular response to ethanol(GO:0071361) |
| 1.8 |
46.0 |
GO:0060441 |
epithelial tube branching involved in lung morphogenesis(GO:0060441) |
| 1.8 |
14.1 |
GO:0044351 |
macropinocytosis(GO:0044351) |
| 1.8 |
10.6 |
GO:0006452 |
translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 1.8 |
8.8 |
GO:0021914 |
negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 1.8 |
3.5 |
GO:0070346 |
positive regulation of fat cell proliferation(GO:0070346) |
| 1.8 |
5.3 |
GO:0019659 |
glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
| 1.7 |
3.5 |
GO:0043415 |
positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 1.7 |
5.2 |
GO:1902566 |
regulation of eosinophil activation(GO:1902566) |
| 1.7 |
8.7 |
GO:0030091 |
protein repair(GO:0030091) |
| 1.7 |
10.4 |
GO:0035428 |
hexose transmembrane transport(GO:0035428) |
| 1.7 |
10.3 |
GO:0043586 |
tongue development(GO:0043586) |
| 1.7 |
6.9 |
GO:0003177 |
pulmonary valve development(GO:0003177) pulmonary valve morphogenesis(GO:0003184) |
| 1.7 |
1.7 |
GO:0044340 |
canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
| 1.7 |
5.1 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 1.7 |
1.7 |
GO:1905050 |
positive regulation of metallopeptidase activity(GO:1905050) |
| 1.7 |
6.8 |
GO:0045578 |
negative regulation of B cell differentiation(GO:0045578) |
| 1.7 |
3.4 |
GO:0090310 |
negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
| 1.7 |
1.7 |
GO:0050862 |
positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 1.7 |
5.1 |
GO:0008228 |
opsonization(GO:0008228) |
| 1.7 |
10.1 |
GO:0000920 |
cell separation after cytokinesis(GO:0000920) |
| 1.7 |
1.7 |
GO:0060426 |
lung vasculature development(GO:0060426) |
| 1.6 |
18.1 |
GO:0070836 |
caveola assembly(GO:0070836) |
| 1.6 |
3.3 |
GO:0030208 |
dermatan sulfate biosynthetic process(GO:0030208) |
| 1.6 |
6.6 |
GO:0035426 |
extracellular matrix-cell signaling(GO:0035426) |
| 1.6 |
3.3 |
GO:0032332 |
positive regulation of chondrocyte differentiation(GO:0032332) |
| 1.6 |
4.9 |
GO:0034241 |
positive regulation of macrophage fusion(GO:0034241) |
| 1.6 |
3.3 |
GO:0036292 |
DNA rewinding(GO:0036292) |
| 1.6 |
4.9 |
GO:0031052 |
programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
| 1.6 |
1.6 |
GO:0003415 |
chondrocyte hypertrophy(GO:0003415) |
| 1.6 |
4.9 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 1.6 |
6.5 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 1.6 |
4.8 |
GO:1903279 |
regulation of calcium:sodium antiporter activity(GO:1903279) |
| 1.6 |
3.2 |
GO:0060579 |
ventral spinal cord interneuron fate commitment(GO:0060579) cell fate commitment involved in pattern specification(GO:0060581) |
| 1.6 |
8.0 |
GO:0006369 |
termination of RNA polymerase II transcription(GO:0006369) |
| 1.6 |
3.2 |
GO:0016115 |
terpenoid catabolic process(GO:0016115) |
| 1.6 |
25.3 |
GO:0050434 |
positive regulation of viral transcription(GO:0050434) |
| 1.6 |
4.7 |
GO:0030222 |
eosinophil differentiation(GO:0030222) |
| 1.6 |
9.4 |
GO:0042711 |
maternal behavior(GO:0042711) |
| 1.6 |
18.8 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 1.6 |
7.8 |
GO:0046598 |
positive regulation of viral entry into host cell(GO:0046598) |
| 1.5 |
6.2 |
GO:0032901 |
positive regulation of neurotrophin production(GO:0032901) |
| 1.5 |
4.6 |
GO:0060217 |
hemangioblast cell differentiation(GO:0060217) |
| 1.5 |
6.2 |
GO:0047484 |
regulation of response to osmotic stress(GO:0047484) |
| 1.5 |
4.6 |
GO:0044778 |
meiotic DNA integrity checkpoint(GO:0044778) |
| 1.5 |
9.2 |
GO:0032825 |
positive regulation of natural killer cell differentiation(GO:0032825) |
| 1.5 |
13.7 |
GO:0060235 |
lens induction in camera-type eye(GO:0060235) |
| 1.5 |
4.6 |
GO:0089700 |
protein kinase D signaling(GO:0089700) |
| 1.5 |
1.5 |
GO:0071166 |
ribonucleoprotein complex localization(GO:0071166) ribonucleoprotein complex export from nucleus(GO:0071426) |
| 1.5 |
6.0 |
GO:2001185 |
regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
| 1.5 |
7.5 |
GO:0060754 |
positive regulation of mast cell chemotaxis(GO:0060754) |
| 1.5 |
22.4 |
GO:0040034 |
regulation of development, heterochronic(GO:0040034) |
| 1.5 |
8.9 |
GO:0046602 |
regulation of mitotic centrosome separation(GO:0046602) |
| 1.5 |
11.9 |
GO:0046643 |
regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 1.5 |
4.4 |
GO:0070315 |
G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 1.5 |
11.8 |
GO:0045603 |
positive regulation of endothelial cell differentiation(GO:0045603) |
| 1.5 |
33.8 |
GO:1902043 |
positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 1.5 |
5.8 |
GO:0097152 |
mesenchymal cell apoptotic process(GO:0097152) |
| 1.5 |
11.7 |
GO:0021796 |
cerebral cortex regionalization(GO:0021796) |
| 1.4 |
4.3 |
GO:0051987 |
positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
| 1.4 |
4.3 |
GO:0033566 |
gamma-tubulin complex localization(GO:0033566) |
| 1.4 |
2.9 |
GO:0032286 |
central nervous system myelin maintenance(GO:0032286) |
| 1.4 |
5.7 |
GO:1903251 |
multi-ciliated epithelial cell differentiation(GO:1903251) |
| 1.4 |
12.8 |
GO:0045719 |
negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 1.4 |
8.5 |
GO:1902373 |
negative regulation of mRNA catabolic process(GO:1902373) |
| 1.4 |
1.4 |
GO:0097168 |
mesenchymal stem cell proliferation(GO:0097168) |
| 1.4 |
4.2 |
GO:0032053 |
ciliary basal body organization(GO:0032053) |
| 1.4 |
2.8 |
GO:0006103 |
2-oxoglutarate metabolic process(GO:0006103) |
| 1.4 |
1.4 |
GO:0036120 |
response to platelet-derived growth factor(GO:0036119) cellular response to platelet-derived growth factor stimulus(GO:0036120) |
| 1.4 |
16.6 |
GO:0046697 |
decidualization(GO:0046697) |
| 1.4 |
6.9 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 1.4 |
8.3 |
GO:0048934 |
peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 1.4 |
5.5 |
GO:0043973 |
histone H3-K4 acetylation(GO:0043973) |
| 1.4 |
6.9 |
GO:0010273 |
detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 1.4 |
1.4 |
GO:0072697 |
protein localization to cell cortex(GO:0072697) |
| 1.4 |
4.1 |
GO:0007262 |
STAT protein import into nucleus(GO:0007262) |
| 1.4 |
1.4 |
GO:0010533 |
regulation of activation of Janus kinase activity(GO:0010533) regulation of activation of JAK2 kinase activity(GO:0010534) |
| 1.3 |
4.0 |
GO:1903519 |
apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
| 1.3 |
4.0 |
GO:1902990 |
telomere maintenance via semi-conservative replication(GO:0032201) mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
| 1.3 |
17.4 |
GO:0009950 |
dorsal/ventral axis specification(GO:0009950) |
| 1.3 |
4.0 |
GO:1901097 |
negative regulation of autophagosome maturation(GO:1901097) |
| 1.3 |
8.0 |
GO:0051660 |
cortical microtubule organization(GO:0043622) establishment of centrosome localization(GO:0051660) |
| 1.3 |
6.6 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 1.3 |
3.9 |
GO:0045359 |
positive regulation of interferon-beta biosynthetic process(GO:0045359) |
| 1.3 |
38.8 |
GO:0045880 |
positive regulation of smoothened signaling pathway(GO:0045880) |
| 1.3 |
1.3 |
GO:0007614 |
short-term memory(GO:0007614) |
| 1.3 |
6.4 |
GO:0001561 |
fatty acid alpha-oxidation(GO:0001561) |
| 1.3 |
1.3 |
GO:0002339 |
B cell selection(GO:0002339) |
| 1.3 |
3.8 |
GO:0061743 |
motor learning(GO:0061743) |
| 1.3 |
2.5 |
GO:0009957 |
epidermal cell fate specification(GO:0009957) |
| 1.3 |
11.4 |
GO:0061158 |
3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 1.3 |
5.1 |
GO:0014816 |
skeletal muscle satellite cell differentiation(GO:0014816) |
| 1.3 |
2.5 |
GO:0010944 |
negative regulation of transcription by competitive promoter binding(GO:0010944) |
| 1.2 |
8.7 |
GO:0071285 |
cellular response to lithium ion(GO:0071285) |
| 1.2 |
3.7 |
GO:0097070 |
ductus arteriosus closure(GO:0097070) |
| 1.2 |
5.0 |
GO:0070459 |
prolactin secretion(GO:0070459) |
| 1.2 |
6.2 |
GO:0014886 |
transition between slow and fast fiber(GO:0014886) |
| 1.2 |
12.4 |
GO:0032875 |
regulation of DNA endoreduplication(GO:0032875) DNA endoreduplication(GO:0042023) |
| 1.2 |
5.0 |
GO:0033580 |
protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
| 1.2 |
3.7 |
GO:2000224 |
testosterone biosynthetic process(GO:0061370) regulation of testosterone biosynthetic process(GO:2000224) |
| 1.2 |
3.7 |
GO:0001980 |
regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
| 1.2 |
2.5 |
GO:0010873 |
positive regulation of cholesterol esterification(GO:0010873) |
| 1.2 |
3.7 |
GO:0021978 |
telencephalon regionalization(GO:0021978) |
| 1.2 |
3.7 |
GO:0045404 |
positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
| 1.2 |
8.5 |
GO:0010815 |
bradykinin catabolic process(GO:0010815) |
| 1.2 |
1.2 |
GO:0010899 |
regulation of phosphatidylcholine catabolic process(GO:0010899) |
| 1.2 |
4.9 |
GO:0072675 |
multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 1.2 |
8.5 |
GO:0001842 |
neural fold formation(GO:0001842) |
| 1.2 |
9.7 |
GO:2000392 |
regulation of lamellipodium morphogenesis(GO:2000392) positive regulation of lamellipodium morphogenesis(GO:2000394) |
| 1.2 |
6.0 |
GO:1903553 |
positive regulation of extracellular exosome assembly(GO:1903553) |
| 1.2 |
3.6 |
GO:0006553 |
lysine metabolic process(GO:0006553) |
| 1.2 |
2.4 |
GO:0051661 |
maintenance of centrosome location(GO:0051661) |
| 1.2 |
2.4 |
GO:2001274 |
negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 1.2 |
4.8 |
GO:0070278 |
extracellular matrix constituent secretion(GO:0070278) |
| 1.2 |
17.8 |
GO:0042772 |
DNA damage response, signal transduction resulting in transcription(GO:0042772) |
| 1.2 |
5.9 |
GO:1904948 |
midbrain dopaminergic neuron differentiation(GO:1904948) |
| 1.2 |
8.2 |
GO:0033567 |
DNA replication, Okazaki fragment processing(GO:0033567) |
| 1.2 |
23.4 |
GO:0030866 |
cortical actin cytoskeleton organization(GO:0030866) |
| 1.2 |
2.3 |
GO:0034380 |
high-density lipoprotein particle assembly(GO:0034380) |
| 1.2 |
3.5 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 1.2 |
4.7 |
GO:2000483 |
negative regulation of interleukin-8 secretion(GO:2000483) |
| 1.2 |
3.5 |
GO:1904879 |
positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 1.2 |
4.6 |
GO:1900109 |
regulation of histone H3-K9 dimethylation(GO:1900109) |
| 1.2 |
3.5 |
GO:0035413 |
positive regulation of catenin import into nucleus(GO:0035413) |
| 1.2 |
5.8 |
GO:0033689 |
negative regulation of osteoblast proliferation(GO:0033689) |
| 1.1 |
4.6 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 1.1 |
5.7 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 1.1 |
5.7 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 1.1 |
5.7 |
GO:0036123 |
histone H3-K9 dimethylation(GO:0036123) |
| 1.1 |
1.1 |
GO:2000193 |
positive regulation of fatty acid transport(GO:2000193) |
| 1.1 |
1.1 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 1.1 |
1.1 |
GO:0060993 |
kidney morphogenesis(GO:0060993) |
| 1.1 |
7.9 |
GO:1902416 |
positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
| 1.1 |
3.4 |
GO:0006578 |
amino-acid betaine biosynthetic process(GO:0006578) |
| 1.1 |
6.7 |
GO:0000056 |
ribosomal small subunit export from nucleus(GO:0000056) |
| 1.1 |
2.2 |
GO:0050854 |
regulation of antigen receptor-mediated signaling pathway(GO:0050854) |
| 1.1 |
5.6 |
GO:0040031 |
snRNA modification(GO:0040031) |
| 1.1 |
3.4 |
GO:0009446 |
putrescine biosynthetic process(GO:0009446) |
| 1.1 |
3.4 |
GO:0045616 |
regulation of keratinocyte differentiation(GO:0045616) |
| 1.1 |
1.1 |
GO:1900157 |
regulation of bone mineralization involved in bone maturation(GO:1900157) |
| 1.1 |
5.6 |
GO:0034080 |
CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 1.1 |
1.1 |
GO:0090274 |
positive regulation of somatostatin secretion(GO:0090274) |
| 1.1 |
1.1 |
GO:0051639 |
actin filament network formation(GO:0051639) |
| 1.1 |
4.4 |
GO:0015819 |
lysine transport(GO:0015819) |
| 1.1 |
7.7 |
GO:0038065 |
collagen-activated signaling pathway(GO:0038065) |
| 1.1 |
2.2 |
GO:0072202 |
cell differentiation involved in metanephros development(GO:0072202) |
| 1.1 |
8.8 |
GO:0031274 |
positive regulation of pseudopodium assembly(GO:0031274) |
| 1.1 |
6.6 |
GO:0031100 |
organ regeneration(GO:0031100) |
| 1.1 |
1.1 |
GO:0000720 |
pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 1.1 |
3.3 |
GO:0019321 |
pentose metabolic process(GO:0019321) |
| 1.1 |
1.1 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 1.1 |
6.5 |
GO:0051461 |
regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 1.1 |
9.7 |
GO:0048103 |
somatic stem cell division(GO:0048103) |
| 1.1 |
6.5 |
GO:0035087 |
siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 1.1 |
4.3 |
GO:0046391 |
5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 1.1 |
3.2 |
GO:0006285 |
base-excision repair, AP site formation(GO:0006285) |
| 1.1 |
1.1 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 1.1 |
3.2 |
GO:0042560 |
10-formyltetrahydrofolate catabolic process(GO:0009258) folic acid-containing compound catabolic process(GO:0009397) pteridine-containing compound catabolic process(GO:0042560) |
| 1.1 |
4.3 |
GO:1904667 |
negative regulation of ubiquitin protein ligase activity(GO:1904667) |
| 1.1 |
6.4 |
GO:2001198 |
regulation of dendritic cell differentiation(GO:2001198) negative regulation of dendritic cell differentiation(GO:2001199) |
| 1.1 |
3.2 |
GO:2000051 |
negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 1.1 |
1.1 |
GO:0061304 |
retinal blood vessel morphogenesis(GO:0061304) |
| 1.1 |
6.3 |
GO:0060736 |
prostate gland growth(GO:0060736) |
| 1.1 |
6.3 |
GO:0014054 |
positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
| 1.0 |
3.1 |
GO:0090271 |
positive regulation of fibroblast growth factor production(GO:0090271) |
| 1.0 |
2.1 |
GO:0042693 |
muscle cell fate commitment(GO:0042693) |
| 1.0 |
9.4 |
GO:0090103 |
cochlea morphogenesis(GO:0090103) |
| 1.0 |
4.2 |
GO:2000507 |
positive regulation of energy homeostasis(GO:2000507) |
| 1.0 |
17.7 |
GO:0001913 |
T cell mediated cytotoxicity(GO:0001913) |
| 1.0 |
3.1 |
GO:0070837 |
dehydroascorbic acid transport(GO:0070837) |
| 1.0 |
8.2 |
GO:0030206 |
chondroitin sulfate biosynthetic process(GO:0030206) |
| 1.0 |
2.0 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 1.0 |
2.0 |
GO:0036342 |
post-anal tail morphogenesis(GO:0036342) |
| 1.0 |
4.1 |
GO:0015868 |
purine ribonucleotide transport(GO:0015868) |
| 1.0 |
3.1 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 1.0 |
4.1 |
GO:0090032 |
negative regulation of steroid hormone biosynthetic process(GO:0090032) |
| 1.0 |
4.1 |
GO:0060266 |
negative regulation of respiratory burst involved in inflammatory response(GO:0060266) negative regulation of respiratory burst(GO:0060268) |
| 1.0 |
2.0 |
GO:0006059 |
hexitol metabolic process(GO:0006059) |
| 1.0 |
5.0 |
GO:0043383 |
negative T cell selection(GO:0043383) negative thymic T cell selection(GO:0045060) |
| 1.0 |
11.0 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 1.0 |
4.0 |
GO:0070561 |
vitamin D receptor signaling pathway(GO:0070561) |
| 1.0 |
1.0 |
GO:0042177 |
negative regulation of protein catabolic process(GO:0042177) |
| 1.0 |
7.0 |
GO:0015840 |
urea transport(GO:0015840) urea transmembrane transport(GO:0071918) |
| 1.0 |
3.0 |
GO:0060708 |
spongiotrophoblast differentiation(GO:0060708) |
| 1.0 |
1.0 |
GO:0046716 |
muscle cell cellular homeostasis(GO:0046716) |
| 1.0 |
2.0 |
GO:0071673 |
positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
| 1.0 |
1.0 |
GO:0070884 |
calcineurin-NFAT signaling cascade(GO:0033173) regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 1.0 |
2.0 |
GO:0042271 |
susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 1.0 |
4.9 |
GO:0048368 |
lateral mesoderm development(GO:0048368) |
| 1.0 |
6.9 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 1.0 |
2.0 |
GO:0060766 |
negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 1.0 |
3.9 |
GO:0071139 |
resolution of recombination intermediates(GO:0071139) |
| 1.0 |
1.9 |
GO:0034184 |
positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 1.0 |
2.9 |
GO:0035582 |
sequestering of BMP in extracellular matrix(GO:0035582) |
| 1.0 |
2.9 |
GO:0048633 |
positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 1.0 |
1.9 |
GO:0001955 |
blood vessel maturation(GO:0001955) |
| 1.0 |
2.9 |
GO:0030202 |
heparin metabolic process(GO:0030202) |
| 1.0 |
2.9 |
GO:2001045 |
negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 0.9 |
19.0 |
GO:0035873 |
lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.9 |
2.8 |
GO:0045409 |
negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
| 0.9 |
1.9 |
GO:0006703 |
estrogen biosynthetic process(GO:0006703) |
| 0.9 |
5.6 |
GO:0035735 |
intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.9 |
0.9 |
GO:0006693 |
prostanoid metabolic process(GO:0006692) prostaglandin metabolic process(GO:0006693) |
| 0.9 |
10.3 |
GO:2000653 |
regulation of genetic imprinting(GO:2000653) |
| 0.9 |
8.4 |
GO:0055059 |
asymmetric neuroblast division(GO:0055059) |
| 0.9 |
8.4 |
GO:0048681 |
negative regulation of axon regeneration(GO:0048681) |
| 0.9 |
2.8 |
GO:0018076 |
N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.9 |
1.9 |
GO:0046084 |
adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
| 0.9 |
0.9 |
GO:0016445 |
somatic diversification of immunoglobulins(GO:0016445) |
| 0.9 |
5.6 |
GO:0035999 |
tetrahydrofolate interconversion(GO:0035999) |
| 0.9 |
0.9 |
GO:0061314 |
Notch signaling involved in heart development(GO:0061314) |
| 0.9 |
1.8 |
GO:1903377 |
negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.9 |
9.2 |
GO:0002052 |
positive regulation of neuroblast proliferation(GO:0002052) |
| 0.9 |
1.8 |
GO:0002326 |
B cell lineage commitment(GO:0002326) |
| 0.9 |
0.9 |
GO:0071600 |
otic vesicle morphogenesis(GO:0071600) |
| 0.9 |
7.3 |
GO:0048096 |
chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.9 |
12.7 |
GO:0051044 |
positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.9 |
7.2 |
GO:0043567 |
regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.9 |
8.9 |
GO:0048199 |
vesicle targeting, to, from or within Golgi(GO:0048199) |
| 0.9 |
1.8 |
GO:0014063 |
negative regulation of serotonin secretion(GO:0014063) |
| 0.9 |
0.9 |
GO:0070813 |
hydrogen sulfide metabolic process(GO:0070813) |
| 0.9 |
1.8 |
GO:0001781 |
neutrophil apoptotic process(GO:0001781) regulation of neutrophil apoptotic process(GO:0033029) negative regulation of neutrophil apoptotic process(GO:0033030) |
| 0.9 |
1.8 |
GO:0007161 |
calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.9 |
0.9 |
GO:0071305 |
cellular response to vitamin D(GO:0071305) |
| 0.9 |
3.5 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.9 |
6.1 |
GO:0010766 |
negative regulation of sodium ion transport(GO:0010766) |
| 0.9 |
7.0 |
GO:0002318 |
myeloid progenitor cell differentiation(GO:0002318) |
| 0.9 |
3.5 |
GO:0021780 |
oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.9 |
2.6 |
GO:0033860 |
regulation of NAD(P)H oxidase activity(GO:0033860) |
| 0.9 |
2.6 |
GO:0036462 |
TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.9 |
6.1 |
GO:0008343 |
adult feeding behavior(GO:0008343) |
| 0.9 |
4.3 |
GO:0045654 |
positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.9 |
9.5 |
GO:0007076 |
mitotic chromosome condensation(GO:0007076) |
| 0.9 |
9.5 |
GO:0021983 |
pituitary gland development(GO:0021983) |
| 0.8 |
2.5 |
GO:0090209 |
negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.8 |
0.8 |
GO:0001978 |
regulation of systemic arterial blood pressure by carotid sinus baroreceptor feedback(GO:0001978) |
| 0.8 |
0.8 |
GO:1903012 |
positive regulation of bone development(GO:1903012) |
| 0.8 |
7.5 |
GO:0090136 |
epithelial cell-cell adhesion(GO:0090136) |
| 0.8 |
1.7 |
GO:2000416 |
regulation of eosinophil migration(GO:2000416) positive regulation of eosinophil migration(GO:2000418) |
| 0.8 |
2.5 |
GO:0009071 |
serine family amino acid catabolic process(GO:0009071) |
| 0.8 |
29.9 |
GO:0051310 |
metaphase plate congression(GO:0051310) |
| 0.8 |
0.8 |
GO:1903181 |
regulation of dopamine biosynthetic process(GO:1903179) positive regulation of dopamine biosynthetic process(GO:1903181) |
| 0.8 |
0.8 |
GO:0050748 |
negative regulation of lipoprotein metabolic process(GO:0050748) |
| 0.8 |
4.9 |
GO:0032534 |
regulation of microvillus assembly(GO:0032534) |
| 0.8 |
3.3 |
GO:0010288 |
response to lead ion(GO:0010288) |
| 0.8 |
4.1 |
GO:0032298 |
positive regulation of DNA-dependent DNA replication initiation(GO:0032298) |
| 0.8 |
1.6 |
GO:0007063 |
regulation of sister chromatid cohesion(GO:0007063) |
| 0.8 |
22.8 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 0.8 |
2.4 |
GO:0019441 |
tryptophan catabolic process(GO:0006569) aromatic amino acid family catabolic process(GO:0009074) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) kynurenine metabolic process(GO:0070189) |
| 0.8 |
3.2 |
GO:0015888 |
thiamine transport(GO:0015888) |
| 0.8 |
3.2 |
GO:0070829 |
heterochromatin maintenance(GO:0070829) |
| 0.8 |
5.6 |
GO:0071168 |
protein localization to chromatin(GO:0071168) |
| 0.8 |
4.0 |
GO:1904936 |
cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 0.8 |
2.4 |
GO:0019676 |
ammonia assimilation cycle(GO:0019676) |
| 0.8 |
5.5 |
GO:0015670 |
carbon dioxide transport(GO:0015670) |
| 0.8 |
6.3 |
GO:0000395 |
mRNA 5'-splice site recognition(GO:0000395) |
| 0.8 |
0.8 |
GO:0014016 |
neuroblast differentiation(GO:0014016) |
| 0.8 |
2.4 |
GO:0014005 |
microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.8 |
3.2 |
GO:0003365 |
establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
| 0.8 |
5.4 |
GO:0010457 |
centriole-centriole cohesion(GO:0010457) |
| 0.8 |
7.0 |
GO:0015816 |
glycine transport(GO:0015816) |
| 0.8 |
7.0 |
GO:0032211 |
negative regulation of telomere maintenance via telomerase(GO:0032211) |
| 0.8 |
1.5 |
GO:1903795 |
regulation of inorganic anion transmembrane transport(GO:1903795) |
| 0.8 |
3.1 |
GO:1900169 |
regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.8 |
6.1 |
GO:0006729 |
tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.8 |
3.1 |
GO:0046061 |
dATP catabolic process(GO:0046061) |
| 0.8 |
1.5 |
GO:0006610 |
ribosomal protein import into nucleus(GO:0006610) |
| 0.8 |
4.5 |
GO:0016127 |
cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.8 |
7.5 |
GO:0071803 |
positive regulation of podosome assembly(GO:0071803) |
| 0.8 |
0.8 |
GO:0003162 |
atrioventricular node development(GO:0003162) |
| 0.8 |
7.5 |
GO:0003084 |
positive regulation of systemic arterial blood pressure(GO:0003084) |
| 0.8 |
2.3 |
GO:1902837 |
amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) amino acid import into cell(GO:1902837) L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
| 0.8 |
3.0 |
GO:0036151 |
phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.7 |
6.7 |
GO:0090557 |
establishment of endothelial intestinal barrier(GO:0090557) |
| 0.7 |
0.7 |
GO:0010002 |
cardioblast differentiation(GO:0010002) |
| 0.7 |
10.4 |
GO:0030213 |
hyaluronan biosynthetic process(GO:0030213) |
| 0.7 |
5.9 |
GO:0030212 |
hyaluronan metabolic process(GO:0030212) |
| 0.7 |
2.2 |
GO:0006001 |
fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 0.7 |
1.5 |
GO:0046877 |
regulation of saliva secretion(GO:0046877) |
| 0.7 |
2.2 |
GO:1990046 |
positive regulation of mitochondrial DNA replication(GO:0090297) regulation of cardiolipin metabolic process(GO:1900208) positive regulation of cardiolipin metabolic process(GO:1900210) stress-induced mitochondrial fusion(GO:1990046) |
| 0.7 |
8.0 |
GO:0032060 |
bleb assembly(GO:0032060) |
| 0.7 |
2.9 |
GO:0046826 |
negative regulation of protein export from nucleus(GO:0046826) |
| 0.7 |
23.7 |
GO:0043297 |
apical junction assembly(GO:0043297) |
| 0.7 |
0.7 |
GO:0045617 |
negative regulation of keratinocyte differentiation(GO:0045617) |
| 0.7 |
1.4 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 0.7 |
3.6 |
GO:0006659 |
phosphatidylserine biosynthetic process(GO:0006659) |
| 0.7 |
17.0 |
GO:0050873 |
brown fat cell differentiation(GO:0050873) |
| 0.7 |
3.5 |
GO:0030224 |
monocyte differentiation(GO:0030224) |
| 0.7 |
2.1 |
GO:2001239 |
regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001239) |
| 0.7 |
1.4 |
GO:0071649 |
regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) |
| 0.7 |
2.1 |
GO:0044872 |
lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.7 |
1.4 |
GO:0060746 |
parental behavior(GO:0060746) |
| 0.7 |
18.1 |
GO:0009649 |
entrainment of circadian clock(GO:0009649) |
| 0.7 |
8.2 |
GO:0043101 |
purine-containing compound salvage(GO:0043101) |
| 0.7 |
4.1 |
GO:0038166 |
angiotensin-activated signaling pathway(GO:0038166) |
| 0.7 |
2.7 |
GO:0019471 |
4-hydroxyproline metabolic process(GO:0019471) |
| 0.7 |
2.1 |
GO:0070844 |
misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 0.7 |
2.0 |
GO:0035567 |
non-canonical Wnt signaling pathway(GO:0035567) |
| 0.7 |
7.5 |
GO:0070935 |
3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.7 |
6.8 |
GO:0035115 |
embryonic forelimb morphogenesis(GO:0035115) |
| 0.7 |
8.8 |
GO:0018126 |
protein hydroxylation(GO:0018126) |
| 0.7 |
0.7 |
GO:0071824 |
protein-DNA complex subunit organization(GO:0071824) |
| 0.7 |
3.4 |
GO:0071474 |
cellular hyperosmotic response(GO:0071474) |
| 0.7 |
1.3 |
GO:2001286 |
regulation of caveolin-mediated endocytosis(GO:2001286) |
| 0.7 |
0.7 |
GO:0071229 |
cellular response to acid chemical(GO:0071229) |
| 0.7 |
4.0 |
GO:0043589 |
skin morphogenesis(GO:0043589) |
| 0.7 |
1.3 |
GO:1901550 |
regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
| 0.7 |
0.7 |
GO:1990379 |
lipid transport across blood brain barrier(GO:1990379) |
| 0.7 |
0.7 |
GO:0060011 |
Sertoli cell proliferation(GO:0060011) |
| 0.7 |
3.3 |
GO:2000179 |
positive regulation of neural precursor cell proliferation(GO:2000179) |
| 0.7 |
2.0 |
GO:0010624 |
regulation of Schwann cell proliferation(GO:0010624) |
| 0.6 |
1.9 |
GO:0018158 |
protein oxidation(GO:0018158) |
| 0.6 |
3.2 |
GO:0046666 |
retinal cell programmed cell death(GO:0046666) |
| 0.6 |
0.6 |
GO:0090086 |
negative regulation of protein deubiquitination(GO:0090086) |
| 0.6 |
1.3 |
GO:0045799 |
positive regulation of chromatin assembly or disassembly(GO:0045799) |
| 0.6 |
0.6 |
GO:0002753 |
cytoplasmic pattern recognition receptor signaling pathway(GO:0002753) |
| 0.6 |
4.5 |
GO:0030865 |
cortical cytoskeleton organization(GO:0030865) |
| 0.6 |
1.9 |
GO:0006011 |
UDP-glucose metabolic process(GO:0006011) |
| 0.6 |
0.6 |
GO:0061687 |
detoxification of inorganic compound(GO:0061687) |
| 0.6 |
25.5 |
GO:2000134 |
negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
| 0.6 |
2.5 |
GO:0001880 |
Mullerian duct regression(GO:0001880) |
| 0.6 |
5.1 |
GO:0034377 |
plasma lipoprotein particle assembly(GO:0034377) |
| 0.6 |
0.6 |
GO:1902807 |
negative regulation of cell cycle G1/S phase transition(GO:1902807) |
| 0.6 |
7.6 |
GO:0001937 |
negative regulation of endothelial cell proliferation(GO:0001937) |
| 0.6 |
6.3 |
GO:0032000 |
positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.6 |
9.4 |
GO:0046597 |
negative regulation of viral entry into host cell(GO:0046597) |
| 0.6 |
1.2 |
GO:1902915 |
negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.6 |
1.9 |
GO:2000569 |
T-helper 2 cell activation(GO:0035712) positive regulation of T-helper 17 type immune response(GO:2000318) regulation of T-helper 2 cell activation(GO:2000569) positive regulation of T-helper 2 cell activation(GO:2000570) |
| 0.6 |
3.1 |
GO:0045930 |
negative regulation of mitotic cell cycle(GO:0045930) |
| 0.6 |
0.6 |
GO:0000715 |
nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.6 |
1.2 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.6 |
1.8 |
GO:0019065 |
receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.6 |
7.4 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.6 |
5.5 |
GO:0009404 |
toxin metabolic process(GO:0009404) |
| 0.6 |
1.2 |
GO:0046121 |
deoxyribonucleoside catabolic process(GO:0046121) |
| 0.6 |
1.2 |
GO:0002741 |
regulation of cytokine secretion involved in immune response(GO:0002739) positive regulation of cytokine secretion involved in immune response(GO:0002741) |
| 0.6 |
1.2 |
GO:0043584 |
nose development(GO:0043584) |
| 0.6 |
9.6 |
GO:0001658 |
branching involved in ureteric bud morphogenesis(GO:0001658) |
| 0.6 |
1.8 |
GO:0040009 |
regulation of growth rate(GO:0040009) |
| 0.6 |
1.8 |
GO:0006167 |
AMP biosynthetic process(GO:0006167) |
| 0.6 |
2.4 |
GO:0002315 |
marginal zone B cell differentiation(GO:0002315) |
| 0.6 |
0.6 |
GO:0097527 |
necroptotic signaling pathway(GO:0097527) |
| 0.6 |
4.7 |
GO:0015074 |
DNA integration(GO:0015074) |
| 0.6 |
1.2 |
GO:0070633 |
transepithelial transport(GO:0070633) |
| 0.6 |
9.4 |
GO:0045662 |
negative regulation of myoblast differentiation(GO:0045662) |
| 0.6 |
2.9 |
GO:0048702 |
embryonic neurocranium morphogenesis(GO:0048702) |
| 0.6 |
2.9 |
GO:0098700 |
aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.6 |
1.2 |
GO:0051541 |
elastin metabolic process(GO:0051541) |
| 0.6 |
2.9 |
GO:0046459 |
short-chain fatty acid metabolic process(GO:0046459) |
| 0.6 |
2.3 |
GO:0010961 |
cellular magnesium ion homeostasis(GO:0010961) |
| 0.6 |
0.6 |
GO:0050847 |
progesterone receptor signaling pathway(GO:0050847) |
| 0.6 |
5.2 |
GO:0001890 |
placenta development(GO:0001890) |
| 0.6 |
2.3 |
GO:0030576 |
Cajal body organization(GO:0030576) |
| 0.6 |
1.1 |
GO:0070973 |
protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.6 |
1.7 |
GO:0060903 |
positive regulation of meiosis I(GO:0060903) |
| 0.6 |
0.6 |
GO:0002295 |
T-helper cell lineage commitment(GO:0002295) CD4-positive, alpha-beta T cell lineage commitment(GO:0043373) |
| 0.6 |
0.6 |
GO:0006681 |
galactosylceramide metabolic process(GO:0006681) galactolipid metabolic process(GO:0019374) |
| 0.6 |
1.7 |
GO:0009101 |
glycoprotein biosynthetic process(GO:0009101) |
| 0.6 |
0.6 |
GO:0007566 |
embryo implantation(GO:0007566) |
| 0.6 |
1.1 |
GO:0001954 |
positive regulation of cell-matrix adhesion(GO:0001954) |
| 0.6 |
5.0 |
GO:0032594 |
protein transport within lipid bilayer(GO:0032594) |
| 0.6 |
3.9 |
GO:0051574 |
positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.6 |
1.1 |
GO:0048873 |
homeostasis of number of cells within a tissue(GO:0048873) |
| 0.6 |
1.7 |
GO:0043651 |
linoleic acid metabolic process(GO:0043651) |
| 0.6 |
3.3 |
GO:0036158 |
outer dynein arm assembly(GO:0036158) |
| 0.6 |
3.9 |
GO:0048251 |
elastic fiber assembly(GO:0048251) |
| 0.6 |
1.1 |
GO:1901165 |
positive regulation of trophoblast cell migration(GO:1901165) |
| 0.5 |
1.6 |
GO:1902109 |
negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
| 0.5 |
1.1 |
GO:0006507 |
GPI anchor release(GO:0006507) |
| 0.5 |
3.3 |
GO:0006661 |
phosphatidylinositol biosynthetic process(GO:0006661) |
| 0.5 |
11.4 |
GO:0030514 |
negative regulation of BMP signaling pathway(GO:0030514) |
| 0.5 |
4.9 |
GO:0010574 |
regulation of vascular endothelial growth factor production(GO:0010574) |
| 0.5 |
1.6 |
GO:1902414 |
protein localization to adherens junction(GO:0071896) protein localization to cell junction(GO:1902414) |
| 0.5 |
1.1 |
GO:0034729 |
histone H3-K79 methylation(GO:0034729) |
| 0.5 |
1.6 |
GO:0002184 |
cytoplasmic translational termination(GO:0002184) |
| 0.5 |
2.7 |
GO:2000680 |
regulation of rubidium ion transport(GO:2000680) |
| 0.5 |
2.2 |
GO:0050857 |
positive regulation of antigen receptor-mediated signaling pathway(GO:0050857) positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.5 |
1.1 |
GO:0003091 |
renal water homeostasis(GO:0003091) |
| 0.5 |
4.8 |
GO:0071459 |
protein localization to chromosome, centromeric region(GO:0071459) |
| 0.5 |
2.6 |
GO:0046135 |
pyrimidine ribonucleoside catabolic process(GO:0046133) pyrimidine nucleoside catabolic process(GO:0046135) |
| 0.5 |
21.5 |
GO:0030326 |
embryonic limb morphogenesis(GO:0030326) embryonic appendage morphogenesis(GO:0035113) |
| 0.5 |
4.7 |
GO:0002862 |
negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.5 |
2.1 |
GO:0006529 |
asparagine biosynthetic process(GO:0006529) |
| 0.5 |
2.6 |
GO:0007100 |
mitotic centrosome separation(GO:0007100) |
| 0.5 |
18.6 |
GO:0070206 |
protein trimerization(GO:0070206) |
| 0.5 |
3.6 |
GO:0006297 |
nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.5 |
2.1 |
GO:2001014 |
regulation of skeletal muscle cell differentiation(GO:2001014) |
| 0.5 |
2.6 |
GO:0040032 |
post-embryonic body morphogenesis(GO:0040032) |
| 0.5 |
6.2 |
GO:1900383 |
regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.5 |
3.1 |
GO:1903689 |
regulation of wound healing, spreading of epidermal cells(GO:1903689) negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.5 |
3.6 |
GO:0051127 |
positive regulation of actin nucleation(GO:0051127) |
| 0.5 |
3.6 |
GO:0016480 |
negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.5 |
3.5 |
GO:0061179 |
negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.5 |
4.0 |
GO:1900262 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.5 |
1.5 |
GO:1901675 |
response to methylglyoxal(GO:0051595) negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 0.5 |
2.0 |
GO:0019287 |
isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) isopentenyl diphosphate metabolic process(GO:0046490) |
| 0.5 |
9.0 |
GO:0046039 |
GTP metabolic process(GO:0046039) |
| 0.5 |
1.0 |
GO:0006278 |
RNA-dependent DNA biosynthetic process(GO:0006278) telomere maintenance via telomerase(GO:0007004) |
| 0.5 |
0.5 |
GO:0071838 |
cell proliferation in bone marrow(GO:0071838) |
| 0.5 |
5.0 |
GO:0007042 |
lysosomal lumen acidification(GO:0007042) |
| 0.5 |
2.5 |
GO:0003433 |
chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.5 |
2.0 |
GO:0043403 |
skeletal muscle tissue regeneration(GO:0043403) |
| 0.5 |
2.0 |
GO:0010528 |
regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.5 |
0.5 |
GO:0042518 |
negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) negative regulation of tyrosine phosphorylation of STAT protein(GO:0042532) |
| 0.5 |
4.9 |
GO:0019985 |
translesion synthesis(GO:0019985) |
| 0.5 |
0.5 |
GO:0038161 |
prolactin signaling pathway(GO:0038161) tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
| 0.5 |
2.9 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.5 |
4.4 |
GO:0032927 |
positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.5 |
1.5 |
GO:0018199 |
peptidyl-glutamine modification(GO:0018199) |
| 0.5 |
0.5 |
GO:0001935 |
endothelial cell proliferation(GO:0001935) |
| 0.5 |
1.4 |
GO:2000768 |
glomerular parietal epithelial cell differentiation(GO:0072139) positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) positive regulation of nephron tubule epithelial cell differentiation(GO:2000768) |
| 0.5 |
1.9 |
GO:0045163 |
clustering of voltage-gated potassium channels(GO:0045163) |
| 0.5 |
1.9 |
GO:2000346 |
negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.5 |
1.4 |
GO:0033615 |
mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.5 |
0.5 |
GO:0002636 |
positive regulation of germinal center formation(GO:0002636) |
| 0.5 |
2.4 |
GO:0009169 |
purine nucleoside monophosphate catabolic process(GO:0009128) ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
| 0.5 |
2.8 |
GO:0007221 |
positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.5 |
1.9 |
GO:0070589 |
cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule metabolic process(GO:0044036) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) cell wall organization or biogenesis(GO:0071554) |
| 0.5 |
0.9 |
GO:0042938 |
dipeptide transport(GO:0042938) |
| 0.5 |
4.2 |
GO:0051451 |
myoblast migration(GO:0051451) |
| 0.5 |
5.6 |
GO:0042474 |
middle ear morphogenesis(GO:0042474) |
| 0.5 |
0.5 |
GO:0072331 |
signal transduction by p53 class mediator(GO:0072331) |
| 0.5 |
1.8 |
GO:2000254 |
regulation of male germ cell proliferation(GO:2000254) |
| 0.5 |
1.8 |
GO:0006346 |
methylation-dependent chromatin silencing(GO:0006346) |
| 0.5 |
0.5 |
GO:0071897 |
DNA biosynthetic process(GO:0071897) |
| 0.5 |
4.1 |
GO:0060391 |
positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.5 |
1.8 |
GO:0032306 |
regulation of prostaglandin secretion(GO:0032306) |
| 0.5 |
0.5 |
GO:0090267 |
positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 0.5 |
9.1 |
GO:0043171 |
peptide catabolic process(GO:0043171) |
| 0.5 |
1.8 |
GO:0030539 |
male genitalia development(GO:0030539) |
| 0.5 |
1.4 |
GO:0060330 |
regulation of response to interferon-gamma(GO:0060330) |
| 0.5 |
0.5 |
GO:0070102 |
interleukin-6-mediated signaling pathway(GO:0070102) |
| 0.5 |
1.4 |
GO:0015910 |
peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.5 |
0.9 |
GO:0070244 |
negative regulation of thymocyte apoptotic process(GO:0070244) |
| 0.4 |
1.8 |
GO:0071294 |
cellular response to zinc ion(GO:0071294) |
| 0.4 |
2.7 |
GO:0007062 |
sister chromatid cohesion(GO:0007062) |
| 0.4 |
2.2 |
GO:0044314 |
protein K27-linked ubiquitination(GO:0044314) |
| 0.4 |
0.4 |
GO:0036228 |
protein targeting to nuclear inner membrane(GO:0036228) |
| 0.4 |
4.4 |
GO:0031146 |
SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.4 |
2.2 |
GO:0044783 |
G1 DNA damage checkpoint(GO:0044783) |
| 0.4 |
12.5 |
GO:0006284 |
base-excision repair(GO:0006284) |
| 0.4 |
5.6 |
GO:0006516 |
glycoprotein catabolic process(GO:0006516) |
| 0.4 |
0.9 |
GO:0043029 |
T cell homeostasis(GO:0043029) |
| 0.4 |
1.3 |
GO:0018094 |
protein polyglycylation(GO:0018094) |
| 0.4 |
0.9 |
GO:0007096 |
regulation of exit from mitosis(GO:0007096) |
| 0.4 |
2.6 |
GO:0042256 |
mature ribosome assembly(GO:0042256) |
| 0.4 |
3.0 |
GO:0001887 |
selenium compound metabolic process(GO:0001887) |
| 0.4 |
3.9 |
GO:0045672 |
positive regulation of osteoclast differentiation(GO:0045672) |
| 0.4 |
2.6 |
GO:0048661 |
positive regulation of smooth muscle cell proliferation(GO:0048661) |
| 0.4 |
13.7 |
GO:0034314 |
Arp2/3 complex-mediated actin nucleation(GO:0034314) |
| 0.4 |
3.0 |
GO:0006621 |
protein retention in ER lumen(GO:0006621) |
| 0.4 |
0.8 |
GO:0033088 |
negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 0.4 |
0.4 |
GO:0035701 |
hematopoietic stem cell migration(GO:0035701) |
| 0.4 |
4.2 |
GO:0010842 |
retina layer formation(GO:0010842) |
| 0.4 |
1.7 |
GO:1900017 |
positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.4 |
0.8 |
GO:0046628 |
positive regulation of insulin receptor signaling pathway(GO:0046628) |
| 0.4 |
0.4 |
GO:0060037 |
pharyngeal system development(GO:0060037) |
| 0.4 |
1.3 |
GO:1901673 |
regulation of mitotic spindle assembly(GO:1901673) |
| 0.4 |
3.7 |
GO:0043249 |
erythrocyte maturation(GO:0043249) |
| 0.4 |
0.4 |
GO:1903334 |
positive regulation of protein folding(GO:1903334) |
| 0.4 |
4.9 |
GO:0060351 |
cartilage development involved in endochondral bone morphogenesis(GO:0060351) |
| 0.4 |
3.3 |
GO:2001224 |
positive regulation of neuron migration(GO:2001224) |
| 0.4 |
0.8 |
GO:2000383 |
regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 0.4 |
2.1 |
GO:2001212 |
regulation of vasculogenesis(GO:2001212) |
| 0.4 |
2.9 |
GO:0090435 |
protein localization to nuclear envelope(GO:0090435) |
| 0.4 |
1.6 |
GO:0072365 |
regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.4 |
1.6 |
GO:0032836 |
glomerular basement membrane development(GO:0032836) |
| 0.4 |
0.8 |
GO:0010835 |
regulation of protein ADP-ribosylation(GO:0010835) nitric oxide homeostasis(GO:0033484) |
| 0.4 |
2.8 |
GO:0032691 |
negative regulation of interleukin-1 beta production(GO:0032691) negative regulation of interleukin-1 production(GO:0032692) |
| 0.4 |
2.4 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.4 |
0.4 |
GO:0070873 |
regulation of glycogen metabolic process(GO:0070873) |
| 0.4 |
5.3 |
GO:0010569 |
regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.4 |
1.6 |
GO:0032439 |
endosome localization(GO:0032439) |
| 0.4 |
3.2 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.4 |
2.0 |
GO:0044342 |
type B pancreatic cell proliferation(GO:0044342) |
| 0.4 |
5.2 |
GO:0006851 |
mitochondrial calcium ion transport(GO:0006851) |
| 0.4 |
4.4 |
GO:0048535 |
lymph node development(GO:0048535) |
| 0.4 |
1.6 |
GO:0016479 |
negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
| 0.4 |
4.8 |
GO:0042347 |
negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.4 |
1.6 |
GO:0006997 |
nucleus organization(GO:0006997) |
| 0.4 |
0.4 |
GO:0032695 |
negative regulation of interleukin-12 production(GO:0032695) |
| 0.4 |
5.8 |
GO:0045737 |
positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
| 0.4 |
0.4 |
GO:0031914 |
negative regulation of synaptic plasticity(GO:0031914) |
| 0.4 |
1.2 |
GO:0006907 |
pinocytosis(GO:0006907) |
| 0.4 |
1.2 |
GO:0043615 |
astrocyte cell migration(GO:0043615) |
| 0.4 |
2.7 |
GO:0002921 |
negative regulation of humoral immune response(GO:0002921) |
| 0.4 |
1.2 |
GO:0006526 |
arginine biosynthetic process(GO:0006526) |
| 0.4 |
1.2 |
GO:0006268 |
DNA unwinding involved in DNA replication(GO:0006268) |
| 0.4 |
0.8 |
GO:0050872 |
white fat cell differentiation(GO:0050872) |
| 0.4 |
2.3 |
GO:0036066 |
protein O-linked fucosylation(GO:0036066) |
| 0.4 |
8.0 |
GO:0046605 |
regulation of centrosome cycle(GO:0046605) |
| 0.4 |
6.5 |
GO:0071577 |
zinc II ion transmembrane transport(GO:0071577) |
| 0.4 |
1.1 |
GO:1903966 |
monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.4 |
2.3 |
GO:0030953 |
astral microtubule organization(GO:0030953) |
| 0.4 |
1.1 |
GO:0034476 |
U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) nuclear polyadenylation-dependent mRNA catabolic process(GO:0071042) polyadenylation-dependent mRNA catabolic process(GO:0071047) |
| 0.4 |
2.3 |
GO:0060706 |
cell differentiation involved in embryonic placenta development(GO:0060706) |
| 0.4 |
7.2 |
GO:0015701 |
bicarbonate transport(GO:0015701) |
| 0.4 |
4.5 |
GO:0006924 |
activation-induced cell death of T cells(GO:0006924) |
| 0.4 |
1.5 |
GO:0002036 |
regulation of L-glutamate transport(GO:0002036) |
| 0.4 |
2.6 |
GO:0045003 |
DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.4 |
2.3 |
GO:0045724 |
positive regulation of cilium assembly(GO:0045724) |
| 0.4 |
3.4 |
GO:0070475 |
rRNA base methylation(GO:0070475) |
| 0.4 |
0.8 |
GO:0021511 |
spinal cord patterning(GO:0021511) |
| 0.4 |
0.8 |
GO:0014832 |
urinary bladder smooth muscle contraction(GO:0014832) |
| 0.4 |
6.7 |
GO:0001522 |
pseudouridine synthesis(GO:0001522) |
| 0.4 |
3.0 |
GO:0030901 |
midbrain development(GO:0030901) |
| 0.4 |
1.5 |
GO:0035563 |
positive regulation of chromatin binding(GO:0035563) |
| 0.4 |
3.4 |
GO:0042219 |
cellular modified amino acid catabolic process(GO:0042219) |
| 0.4 |
1.9 |
GO:0061087 |
positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.4 |
1.1 |
GO:0018214 |
peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.4 |
0.7 |
GO:0055099 |
response to high density lipoprotein particle(GO:0055099) |
| 0.4 |
2.2 |
GO:2000811 |
negative regulation of anoikis(GO:2000811) |
| 0.4 |
1.1 |
GO:0060050 |
positive regulation of protein glycosylation(GO:0060050) |
| 0.4 |
7.0 |
GO:0005978 |
glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
| 0.4 |
1.5 |
GO:1902410 |
mitotic cytokinetic process(GO:1902410) |
| 0.4 |
0.7 |
GO:0045601 |
regulation of endothelial cell differentiation(GO:0045601) |
| 0.4 |
0.4 |
GO:0071425 |
hematopoietic stem cell proliferation(GO:0071425) |
| 0.4 |
1.5 |
GO:0032486 |
Rap protein signal transduction(GO:0032486) |
| 0.4 |
0.4 |
GO:0048711 |
positive regulation of astrocyte differentiation(GO:0048711) |
| 0.4 |
1.5 |
GO:0036265 |
RNA (guanine-N7)-methylation(GO:0036265) |
| 0.4 |
2.2 |
GO:0032460 |
negative regulation of protein oligomerization(GO:0032460) negative regulation of protein homooligomerization(GO:0032463) |
| 0.4 |
3.6 |
GO:0070914 |
UV-damage excision repair(GO:0070914) |
| 0.4 |
1.1 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.4 |
0.4 |
GO:2001023 |
regulation of response to drug(GO:2001023) |
| 0.4 |
1.1 |
GO:0042538 |
hyperosmotic salinity response(GO:0042538) |
| 0.4 |
0.7 |
GO:1900747 |
negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) negative regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902548) |
| 0.4 |
4.6 |
GO:1904293 |
negative regulation of ERAD pathway(GO:1904293) |
| 0.4 |
1.4 |
GO:0016266 |
O-glycan processing(GO:0016266) |
| 0.4 |
1.1 |
GO:1904211 |
membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
| 0.4 |
7.1 |
GO:0006910 |
phagocytosis, recognition(GO:0006910) |
| 0.4 |
1.8 |
GO:0060767 |
epithelial cell proliferation involved in prostate gland development(GO:0060767) |
| 0.4 |
1.4 |
GO:0031509 |
telomeric heterochromatin assembly(GO:0031509) regulation of chromosome condensation(GO:0060623) negative regulation of chromosome condensation(GO:1902340) |
| 0.4 |
1.1 |
GO:0006573 |
valine metabolic process(GO:0006573) |
| 0.4 |
1.1 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.3 |
0.7 |
GO:0034382 |
chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 0.3 |
1.0 |
GO:0006030 |
chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.3 |
1.0 |
GO:0097154 |
GABAergic neuron differentiation(GO:0097154) |
| 0.3 |
0.3 |
GO:0035437 |
maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.3 |
1.7 |
GO:1900364 |
negative regulation of mRNA 3'-end processing(GO:0031441) regulation of mRNA polyadenylation(GO:1900363) negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.3 |
3.7 |
GO:0033327 |
Leydig cell differentiation(GO:0033327) |
| 0.3 |
4.4 |
GO:0000183 |
chromatin silencing at rDNA(GO:0000183) |
| 0.3 |
3.4 |
GO:0044381 |
glucose import in response to insulin stimulus(GO:0044381) regulation of glucose import in response to insulin stimulus(GO:2001273) |
| 0.3 |
2.7 |
GO:0006337 |
nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
| 0.3 |
1.7 |
GO:0036344 |
platelet morphogenesis(GO:0036344) |
| 0.3 |
6.0 |
GO:0006730 |
one-carbon metabolic process(GO:0006730) |
| 0.3 |
1.7 |
GO:0060501 |
positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.3 |
1.3 |
GO:1904426 |
positive regulation of GTP binding(GO:1904426) regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904451) positive regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904453) |
| 0.3 |
2.7 |
GO:2000467 |
positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.3 |
2.0 |
GO:0006384 |
transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.3 |
1.3 |
GO:0034214 |
protein hexamerization(GO:0034214) |
| 0.3 |
1.0 |
GO:0048861 |
leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.3 |
2.3 |
GO:0033234 |
negative regulation of protein sumoylation(GO:0033234) |
| 0.3 |
1.6 |
GO:1902031 |
regulation of NADP metabolic process(GO:1902031) |
| 0.3 |
0.7 |
GO:0032506 |
cytokinetic process(GO:0032506) |
| 0.3 |
2.0 |
GO:0042940 |
D-amino acid transport(GO:0042940) |
| 0.3 |
3.9 |
GO:0019262 |
N-acetylneuraminate catabolic process(GO:0019262) |
| 0.3 |
1.6 |
GO:0070886 |
positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.3 |
1.6 |
GO:1902916 |
positive regulation of protein polyubiquitination(GO:1902916) |
| 0.3 |
1.6 |
GO:0042572 |
retinol metabolic process(GO:0042572) |
| 0.3 |
1.0 |
GO:0070269 |
pyroptosis(GO:0070269) |
| 0.3 |
1.0 |
GO:0006338 |
chromatin remodeling(GO:0006338) |
| 0.3 |
5.1 |
GO:0006613 |
cotranslational protein targeting to membrane(GO:0006613) |
| 0.3 |
1.9 |
GO:0033182 |
regulation of histone ubiquitination(GO:0033182) |
| 0.3 |
1.3 |
GO:0090261 |
positive regulation of inclusion body assembly(GO:0090261) |
| 0.3 |
1.6 |
GO:0090169 |
regulation of spindle assembly(GO:0090169) |
| 0.3 |
5.0 |
GO:0006474 |
N-terminal protein amino acid acetylation(GO:0006474) |
| 0.3 |
4.4 |
GO:0097150 |
neuronal stem cell population maintenance(GO:0097150) |
| 0.3 |
0.3 |
GO:0060693 |
regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
| 0.3 |
3.7 |
GO:0071392 |
cellular response to estradiol stimulus(GO:0071392) |
| 0.3 |
0.3 |
GO:0060718 |
chorionic trophoblast cell differentiation(GO:0060718) |
| 0.3 |
1.6 |
GO:0031648 |
protein destabilization(GO:0031648) |
| 0.3 |
1.2 |
GO:0008635 |
activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.3 |
0.6 |
GO:0048806 |
genitalia development(GO:0048806) |
| 0.3 |
1.2 |
GO:0001831 |
trophectodermal cellular morphogenesis(GO:0001831) |
| 0.3 |
0.3 |
GO:0045084 |
positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.3 |
3.4 |
GO:0010664 |
negative regulation of striated muscle cell apoptotic process(GO:0010664) |
| 0.3 |
0.6 |
GO:0014029 |
neural crest formation(GO:0014029) |
| 0.3 |
0.9 |
GO:0071947 |
protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.3 |
1.5 |
GO:0032467 |
positive regulation of cytokinesis(GO:0032467) |
| 0.3 |
0.6 |
GO:0031645 |
negative regulation of neurological system process(GO:0031645) |
| 0.3 |
1.2 |
GO:0010510 |
regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.3 |
29.3 |
GO:0051028 |
mRNA transport(GO:0051028) |
| 0.3 |
2.7 |
GO:1904407 |
positive regulation of nitric oxide biosynthetic process(GO:0045429) positive regulation of nitric oxide metabolic process(GO:1904407) |
| 0.3 |
4.8 |
GO:0045653 |
negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.3 |
5.4 |
GO:0043968 |
histone H2A acetylation(GO:0043968) |
| 0.3 |
1.5 |
GO:0015808 |
L-alanine transport(GO:0015808) |
| 0.3 |
7.4 |
GO:0032922 |
circadian regulation of gene expression(GO:0032922) |
| 0.3 |
0.9 |
GO:0010712 |
regulation of collagen metabolic process(GO:0010712) |
| 0.3 |
0.3 |
GO:0051036 |
regulation of endosome size(GO:0051036) |
| 0.3 |
3.2 |
GO:0001516 |
prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
| 0.3 |
3.5 |
GO:0006388 |
tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.3 |
7.9 |
GO:0031016 |
pancreas development(GO:0031016) |
| 0.3 |
0.9 |
GO:0071985 |
multivesicular body sorting pathway(GO:0071985) |
| 0.3 |
2.3 |
GO:0000185 |
activation of MAPKKK activity(GO:0000185) |
| 0.3 |
0.6 |
GO:0036006 |
response to macrophage colony-stimulating factor(GO:0036005) cellular response to macrophage colony-stimulating factor stimulus(GO:0036006) |
| 0.3 |
0.9 |
GO:0046016 |
regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) positive regulation of transcription by glucose(GO:0046016) |
| 0.3 |
0.6 |
GO:0097186 |
amelogenesis(GO:0097186) |
| 0.3 |
0.3 |
GO:1901187 |
regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.3 |
0.3 |
GO:2000275 |
regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
| 0.3 |
0.3 |
GO:2000983 |
regulation of ATP citrate synthase activity(GO:2000983) negative regulation of ATP citrate synthase activity(GO:2000984) |
| 0.3 |
0.9 |
GO:0071391 |
cellular response to estrogen stimulus(GO:0071391) |
| 0.3 |
2.3 |
GO:0030261 |
chromosome condensation(GO:0030261) |
| 0.3 |
0.6 |
GO:0007171 |
activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.3 |
1.1 |
GO:0007217 |
tachykinin receptor signaling pathway(GO:0007217) |
| 0.3 |
0.3 |
GO:0008626 |
granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.3 |
0.9 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 0.3 |
1.1 |
GO:0032780 |
negative regulation of ATPase activity(GO:0032780) |
| 0.3 |
1.1 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.3 |
0.3 |
GO:0042482 |
positive regulation of odontogenesis(GO:0042482) |
| 0.3 |
1.1 |
GO:0043518 |
negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.3 |
0.5 |
GO:0010172 |
embryonic body morphogenesis(GO:0010172) |
| 0.3 |
0.5 |
GO:0032914 |
positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.3 |
1.4 |
GO:1904721 |
regulation of mRNA cleavage(GO:0031437) negative regulation of mRNA cleavage(GO:0031438) negative regulation of nuclease activity(GO:0032074) negative regulation of immunoglobulin secretion(GO:0051025) regulation of endoribonuclease activity(GO:0060699) negative regulation of ribonuclease activity(GO:0060701) negative regulation of endoribonuclease activity(GO:0060702) regulation of mRNA endonucleolytic cleavage involved in unfolded protein response(GO:1904720) negative regulation of mRNA endonucleolytic cleavage involved in unfolded protein response(GO:1904721) |
| 0.3 |
1.9 |
GO:0006517 |
protein deglycosylation(GO:0006517) |
| 0.3 |
12.3 |
GO:0006635 |
fatty acid beta-oxidation(GO:0006635) |
| 0.3 |
0.5 |
GO:0030647 |
polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.3 |
2.4 |
GO:0019369 |
arachidonic acid metabolic process(GO:0019369) |
| 0.3 |
0.8 |
GO:0030225 |
macrophage differentiation(GO:0030225) |
| 0.3 |
3.4 |
GO:0070816 |
phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.3 |
7.4 |
GO:0006783 |
heme biosynthetic process(GO:0006783) |
| 0.3 |
1.0 |
GO:0032202 |
telomere assembly(GO:0032202) |
| 0.3 |
0.5 |
GO:0042542 |
response to hydrogen peroxide(GO:0042542) |
| 0.3 |
1.5 |
GO:0042989 |
sequestering of actin monomers(GO:0042989) |
| 0.3 |
2.1 |
GO:0017145 |
stem cell division(GO:0017145) |
| 0.3 |
1.0 |
GO:0032511 |
late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.3 |
2.3 |
GO:0046548 |
retinal rod cell development(GO:0046548) |
| 0.3 |
0.3 |
GO:0061458 |
reproductive system development(GO:0061458) |
| 0.3 |
2.8 |
GO:0034508 |
centromere complex assembly(GO:0034508) |
| 0.3 |
0.8 |
GO:0006013 |
mannose metabolic process(GO:0006013) |
| 0.3 |
3.3 |
GO:0006379 |
mRNA cleavage(GO:0006379) |
| 0.3 |
0.5 |
GO:0046874 |
quinolinate metabolic process(GO:0046874) |
| 0.3 |
8.5 |
GO:0006261 |
DNA-dependent DNA replication(GO:0006261) |
| 0.3 |
1.3 |
GO:0044375 |
regulation of peroxisome size(GO:0044375) |
| 0.2 |
0.2 |
GO:0060821 |
inactivation of X chromosome by DNA methylation(GO:0060821) |
| 0.2 |
8.7 |
GO:0070303 |
negative regulation of stress-activated MAPK cascade(GO:0032873) negative regulation of stress-activated protein kinase signaling cascade(GO:0070303) |
| 0.2 |
0.2 |
GO:2001269 |
positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
| 0.2 |
2.7 |
GO:0019368 |
fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.2 |
0.5 |
GO:1901857 |
positive regulation of cellular respiration(GO:1901857) |
| 0.2 |
0.5 |
GO:2000678 |
negative regulation of transcription regulatory region DNA binding(GO:2000678) |
| 0.2 |
5.7 |
GO:0015985 |
energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.2 |
0.5 |
GO:0097494 |
regulation of vesicle size(GO:0097494) |
| 0.2 |
1.0 |
GO:0060612 |
adipose tissue development(GO:0060612) |
| 0.2 |
0.9 |
GO:0070537 |
histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.2 |
0.9 |
GO:0042246 |
tissue regeneration(GO:0042246) |
| 0.2 |
0.2 |
GO:0030903 |
notochord development(GO:0030903) |
| 0.2 |
1.9 |
GO:2000001 |
regulation of DNA damage checkpoint(GO:2000001) |
| 0.2 |
5.7 |
GO:0045600 |
positive regulation of fat cell differentiation(GO:0045600) |
| 0.2 |
1.7 |
GO:0016926 |
protein desumoylation(GO:0016926) |
| 0.2 |
3.5 |
GO:0008608 |
attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.2 |
0.7 |
GO:0036093 |
germ cell proliferation(GO:0036093) |
| 0.2 |
0.9 |
GO:0038128 |
ERBB2 signaling pathway(GO:0038128) |
| 0.2 |
1.6 |
GO:0032330 |
regulation of chondrocyte differentiation(GO:0032330) |
| 0.2 |
1.4 |
GO:0001501 |
skeletal system development(GO:0001501) |
| 0.2 |
0.2 |
GO:0060689 |
cell differentiation involved in salivary gland development(GO:0060689) |
| 0.2 |
1.4 |
GO:0045907 |
positive regulation of vasoconstriction(GO:0045907) |
| 0.2 |
2.8 |
GO:0060350 |
endochondral bone morphogenesis(GO:0060350) |
| 0.2 |
0.7 |
GO:0090305 |
nucleic acid phosphodiester bond hydrolysis(GO:0090305) |
| 0.2 |
3.2 |
GO:0010388 |
cullin deneddylation(GO:0010388) |
| 0.2 |
2.1 |
GO:0032367 |
intracellular cholesterol transport(GO:0032367) |
| 0.2 |
0.9 |
GO:1902744 |
negative regulation of lamellipodium organization(GO:1902744) |
| 0.2 |
1.4 |
GO:0001996 |
regulation of systemic arterial blood pressure by norepinephrine-epinephrine(GO:0001993) positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) positive regulation of heart rate by epinephrine(GO:0003065) positive regulation of blood pressure by epinephrine-norepinephrine(GO:0003321) |
| 0.2 |
1.6 |
GO:0045740 |
positive regulation of DNA replication(GO:0045740) |
| 0.2 |
0.9 |
GO:0018095 |
protein polyglutamylation(GO:0018095) |
| 0.2 |
1.6 |
GO:0006309 |
apoptotic DNA fragmentation(GO:0006309) |
| 0.2 |
0.7 |
GO:0006919 |
activation of cysteine-type endopeptidase activity involved in apoptotic process(GO:0006919) |
| 0.2 |
0.9 |
GO:0002063 |
chondrocyte development(GO:0002063) |
| 0.2 |
1.1 |
GO:0015695 |
organic cation transport(GO:0015695) |
| 0.2 |
0.7 |
GO:0032788 |
saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
| 0.2 |
1.6 |
GO:1901998 |
toxin transport(GO:1901998) |
| 0.2 |
1.1 |
GO:0052646 |
alditol phosphate metabolic process(GO:0052646) |
| 0.2 |
3.3 |
GO:1903077 |
negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
| 0.2 |
0.2 |
GO:0006402 |
mRNA catabolic process(GO:0006402) |
| 0.2 |
0.6 |
GO:0045743 |
positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.2 |
3.5 |
GO:0032781 |
positive regulation of ATPase activity(GO:0032781) |
| 0.2 |
1.3 |
GO:0002089 |
lens morphogenesis in camera-type eye(GO:0002089) |
| 0.2 |
7.5 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.2 |
7.0 |
GO:0071230 |
cellular response to amino acid stimulus(GO:0071230) |
| 0.2 |
0.9 |
GO:0046835 |
carbohydrate phosphorylation(GO:0046835) |
| 0.2 |
1.7 |
GO:0043489 |
RNA stabilization(GO:0043489) |
| 0.2 |
1.9 |
GO:0034724 |
DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
| 0.2 |
0.6 |
GO:0030049 |
muscle filament sliding(GO:0030049) |
| 0.2 |
2.9 |
GO:0030520 |
intracellular estrogen receptor signaling pathway(GO:0030520) |
| 0.2 |
1.3 |
GO:0045040 |
protein import into mitochondrial outer membrane(GO:0045040) |
| 0.2 |
0.2 |
GO:0048312 |
intracellular distribution of mitochondria(GO:0048312) |
| 0.2 |
1.9 |
GO:0060261 |
positive regulation of transcription initiation from RNA polymerase II promoter(GO:0060261) |
| 0.2 |
0.8 |
GO:0042573 |
retinoic acid metabolic process(GO:0042573) |
| 0.2 |
0.8 |
GO:0098535 |
de novo centriole assembly(GO:0098535) |
| 0.2 |
1.7 |
GO:0008063 |
Toll signaling pathway(GO:0008063) |
| 0.2 |
0.6 |
GO:2000645 |
negative regulation of receptor catabolic process(GO:2000645) |
| 0.2 |
1.2 |
GO:0009083 |
branched-chain amino acid catabolic process(GO:0009083) |
| 0.2 |
1.9 |
GO:0051156 |
glucose 6-phosphate metabolic process(GO:0051156) |
| 0.2 |
1.2 |
GO:0051084 |
'de novo' protein folding(GO:0006458) 'de novo' posttranslational protein folding(GO:0051084) |
| 0.2 |
0.4 |
GO:0048853 |
forebrain morphogenesis(GO:0048853) |
| 0.2 |
0.8 |
GO:1900027 |
regulation of ruffle assembly(GO:1900027) |
| 0.2 |
0.4 |
GO:1902231 |
positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.2 |
0.4 |
GO:0061042 |
vascular wound healing(GO:0061042) |
| 0.2 |
0.8 |
GO:0097368 |
establishment of Sertoli cell barrier(GO:0097368) |
| 0.2 |
0.4 |
GO:0000963 |
mitochondrial RNA processing(GO:0000963) |
| 0.2 |
1.0 |
GO:0071447 |
cellular response to hydroperoxide(GO:0071447) |
| 0.2 |
1.8 |
GO:0000578 |
embryonic axis specification(GO:0000578) |
| 0.2 |
0.6 |
GO:0031076 |
embryonic camera-type eye development(GO:0031076) |
| 0.2 |
2.3 |
GO:0045445 |
myoblast differentiation(GO:0045445) |
| 0.2 |
1.4 |
GO:0043374 |
CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.2 |
1.4 |
GO:0045723 |
positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.2 |
0.4 |
GO:0016095 |
polyprenol catabolic process(GO:0016095) |
| 0.2 |
0.2 |
GO:0007113 |
endomitotic cell cycle(GO:0007113) |
| 0.2 |
0.4 |
GO:1904694 |
negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.2 |
3.3 |
GO:0006607 |
NLS-bearing protein import into nucleus(GO:0006607) |
| 0.2 |
0.2 |
GO:0032687 |
negative regulation of interferon-alpha production(GO:0032687) |
| 0.2 |
0.8 |
GO:0030512 |
negative regulation of transforming growth factor beta receptor signaling pathway(GO:0030512) negative regulation of cellular response to transforming growth factor beta stimulus(GO:1903845) |
| 0.2 |
2.1 |
GO:0001942 |
hair follicle development(GO:0001942) molting cycle process(GO:0022404) hair cycle process(GO:0022405) skin epidermis development(GO:0098773) |
| 0.2 |
1.3 |
GO:2000353 |
positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.2 |
0.2 |
GO:0048050 |
post-embryonic eye morphogenesis(GO:0048050) |
| 0.2 |
0.4 |
GO:0089711 |
L-glutamate transmembrane transport(GO:0089711) |
| 0.2 |
0.6 |
GO:0000389 |
mRNA 3'-splice site recognition(GO:0000389) |
| 0.2 |
0.7 |
GO:0070933 |
histone H4 deacetylation(GO:0070933) |
| 0.2 |
0.7 |
GO:0007064 |
mitotic sister chromatid cohesion(GO:0007064) |
| 0.2 |
0.9 |
GO:0008209 |
androgen metabolic process(GO:0008209) |
| 0.2 |
0.4 |
GO:0060135 |
maternal process involved in female pregnancy(GO:0060135) |
| 0.2 |
0.2 |
GO:0042633 |
molting cycle(GO:0042303) hair cycle(GO:0042633) |
| 0.2 |
1.1 |
GO:1903846 |
positive regulation of transforming growth factor beta receptor signaling pathway(GO:0030511) positive regulation of cellular response to transforming growth factor beta stimulus(GO:1903846) |
| 0.2 |
0.5 |
GO:0019276 |
UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.2 |
3.2 |
GO:0045143 |
homologous chromosome segregation(GO:0045143) |
| 0.2 |
0.2 |
GO:1903960 |
negative regulation of anion transmembrane transport(GO:1903960) |
| 0.2 |
0.5 |
GO:0061436 |
establishment of skin barrier(GO:0061436) |
| 0.2 |
0.2 |
GO:0000966 |
RNA 5'-end processing(GO:0000966) |
| 0.2 |
0.5 |
GO:0032237 |
activation of store-operated calcium channel activity(GO:0032237) |
| 0.2 |
0.2 |
GO:0051031 |
tRNA transport(GO:0051031) |
| 0.2 |
2.3 |
GO:0016568 |
chromatin modification(GO:0016568) |
| 0.2 |
4.5 |
GO:0009855 |
determination of bilateral symmetry(GO:0009855) |
| 0.2 |
1.6 |
GO:0007250 |
activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.2 |
0.5 |
GO:0051043 |
regulation of membrane protein ectodomain proteolysis(GO:0051043) |
| 0.2 |
0.2 |
GO:0030951 |
establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.2 |
0.5 |
GO:0051187 |
cofactor catabolic process(GO:0051187) |
| 0.2 |
0.9 |
GO:0006534 |
cysteine metabolic process(GO:0006534) |
| 0.2 |
1.9 |
GO:0048747 |
muscle fiber development(GO:0048747) |
| 0.2 |
1.5 |
GO:0032329 |
L-serine transport(GO:0015825) serine transport(GO:0032329) |
| 0.2 |
4.8 |
GO:0051304 |
chromosome separation(GO:0051304) |
| 0.2 |
2.0 |
GO:0006353 |
DNA-templated transcription, termination(GO:0006353) |
| 0.2 |
0.3 |
GO:1903748 |
negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
| 0.2 |
0.6 |
GO:0035188 |
blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 0.2 |
0.5 |
GO:0042136 |
neurotransmitter biosynthetic process(GO:0042136) |
| 0.2 |
2.6 |
GO:0006378 |
mRNA polyadenylation(GO:0006378) |
| 0.2 |
0.8 |
GO:0018027 |
peptidyl-lysine dimethylation(GO:0018027) |
| 0.2 |
0.3 |
GO:0045086 |
positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.2 |
0.6 |
GO:0000054 |
ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
| 0.2 |
0.3 |
GO:0071865 |
regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
| 0.2 |
2.1 |
GO:0008589 |
regulation of smoothened signaling pathway(GO:0008589) |
| 0.2 |
1.3 |
GO:0006020 |
inositol metabolic process(GO:0006020) |
| 0.2 |
0.8 |
GO:0080111 |
DNA demethylation(GO:0080111) |
| 0.2 |
1.4 |
GO:2000009 |
negative regulation of protein localization to cell surface(GO:2000009) |
| 0.2 |
0.5 |
GO:0060947 |
cardiac vascular smooth muscle cell differentiation(GO:0060947) |
| 0.2 |
0.3 |
GO:0046125 |
pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.2 |
0.6 |
GO:0043162 |
ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.2 |
0.8 |
GO:0042483 |
negative regulation of odontogenesis(GO:0042483) |
| 0.2 |
3.6 |
GO:0035914 |
skeletal muscle cell differentiation(GO:0035914) |
| 0.2 |
0.5 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.2 |
0.3 |
GO:1905208 |
negative regulation of cardiocyte differentiation(GO:1905208) |
| 0.1 |
0.6 |
GO:0044380 |
protein localization to cytoskeleton(GO:0044380) |
| 0.1 |
0.9 |
GO:0080182 |
histone H3-K4 trimethylation(GO:0080182) |
| 0.1 |
0.3 |
GO:0090502 |
RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.1 |
0.3 |
GO:0070050 |
neuron cellular homeostasis(GO:0070050) |
| 0.1 |
2.9 |
GO:0007569 |
cell aging(GO:0007569) |
| 0.1 |
0.6 |
GO:0046208 |
spermine catabolic process(GO:0046208) |
| 0.1 |
0.3 |
GO:0051771 |
negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
| 0.1 |
0.7 |
GO:0051490 |
negative regulation of filopodium assembly(GO:0051490) |
| 0.1 |
2.1 |
GO:0033233 |
regulation of protein sumoylation(GO:0033233) |
| 0.1 |
0.7 |
GO:0003085 |
negative regulation of systemic arterial blood pressure(GO:0003085) |
| 0.1 |
0.7 |
GO:0032911 |
negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.1 |
0.3 |
GO:1902965 |
regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 0.1 |
1.0 |
GO:0045647 |
negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.1 |
1.1 |
GO:0036065 |
fucosylation(GO:0036065) |
| 0.1 |
0.3 |
GO:0071404 |
cellular response to lipoprotein particle stimulus(GO:0071402) cellular response to low-density lipoprotein particle stimulus(GO:0071404) |
| 0.1 |
1.5 |
GO:0006260 |
DNA replication(GO:0006260) |
| 0.1 |
0.1 |
GO:0006290 |
pyrimidine dimer repair(GO:0006290) |
| 0.1 |
0.1 |
GO:0048669 |
collateral sprouting in absence of injury(GO:0048669) |
| 0.1 |
0.1 |
GO:0009298 |
GDP-mannose biosynthetic process(GO:0009298) |
| 0.1 |
0.4 |
GO:1903715 |
regulation of aerobic respiration(GO:1903715) |
| 0.1 |
1.6 |
GO:0071300 |
cellular response to retinoic acid(GO:0071300) |
| 0.1 |
0.1 |
GO:0048318 |
axial mesoderm development(GO:0048318) |
| 0.1 |
0.4 |
GO:0045006 |
DNA deamination(GO:0045006) |
| 0.1 |
0.3 |
GO:1904357 |
negative regulation of telomere maintenance via telomere lengthening(GO:1904357) |
| 0.1 |
0.3 |
GO:0071260 |
cellular response to mechanical stimulus(GO:0071260) |
| 0.1 |
0.8 |
GO:0016255 |
attachment of GPI anchor to protein(GO:0016255) |
| 0.1 |
2.3 |
GO:0000184 |
nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.1 |
0.3 |
GO:0044387 |
negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
| 0.1 |
0.4 |
GO:0002002 |
regulation of angiotensin levels in blood(GO:0002002) regulation of angiotensin metabolic process(GO:0060177) |
| 0.1 |
0.1 |
GO:0010632 |
regulation of epithelial cell migration(GO:0010632) |
| 0.1 |
0.1 |
GO:0016925 |
protein sumoylation(GO:0016925) |
| 0.1 |
4.4 |
GO:0061077 |
chaperone-mediated protein folding(GO:0061077) |
| 0.1 |
0.6 |
GO:0043983 |
histone H4-K12 acetylation(GO:0043983) |
| 0.1 |
2.1 |
GO:0045070 |
positive regulation of viral genome replication(GO:0045070) |
| 0.1 |
0.4 |
GO:0042270 |
protection from natural killer cell mediated cytotoxicity(GO:0042270) |
| 0.1 |
11.4 |
GO:0008033 |
tRNA processing(GO:0008033) |
| 0.1 |
1.0 |
GO:0071364 |
cellular response to epidermal growth factor stimulus(GO:0071364) |
| 0.1 |
2.5 |
GO:0000413 |
protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.1 |
0.9 |
GO:0070940 |
dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.1 |
3.0 |
GO:0001892 |
embryonic placenta development(GO:0001892) |
| 0.1 |
0.7 |
GO:0051930 |
regulation of sensory perception of pain(GO:0051930) regulation of sensory perception(GO:0051931) |
| 0.1 |
0.5 |
GO:0007512 |
adult heart development(GO:0007512) |
| 0.1 |
0.7 |
GO:0006107 |
oxaloacetate metabolic process(GO:0006107) |
| 0.1 |
0.2 |
GO:0032055 |
negative regulation of translation in response to stress(GO:0032055) |
| 0.1 |
0.2 |
GO:0048875 |
chemical homeostasis within a tissue(GO:0048875) |
| 0.1 |
1.7 |
GO:1904355 |
positive regulation of telomere capping(GO:1904355) |
| 0.1 |
0.6 |
GO:0006543 |
glutamine catabolic process(GO:0006543) |
| 0.1 |
0.5 |
GO:0006451 |
selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.1 |
0.5 |
GO:0006108 |
malate metabolic process(GO:0006108) |
| 0.1 |
4.8 |
GO:0030490 |
maturation of SSU-rRNA(GO:0030490) |
| 0.1 |
0.8 |
GO:0031987 |
locomotion involved in locomotory behavior(GO:0031987) |
| 0.1 |
0.5 |
GO:0010739 |
positive regulation of protein kinase A signaling(GO:0010739) |
| 0.1 |
0.6 |
GO:0090382 |
phagosome maturation(GO:0090382) |
| 0.1 |
0.3 |
GO:0001828 |
inner cell mass cell differentiation(GO:0001826) inner cell mass cell fate commitment(GO:0001827) inner cell mass cellular morphogenesis(GO:0001828) |
| 0.1 |
0.6 |
GO:1902261 |
positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.1 |
0.1 |
GO:0045091 |
single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) negative regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045869) |
| 0.1 |
0.4 |
GO:0090383 |
phagosome acidification(GO:0090383) |
| 0.1 |
1.4 |
GO:0048736 |
appendage development(GO:0048736) limb development(GO:0060173) |
| 0.1 |
0.3 |
GO:0006538 |
glutamate catabolic process(GO:0006538) |
| 0.1 |
0.5 |
GO:0090201 |
negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
| 0.1 |
2.5 |
GO:0006493 |
protein O-linked glycosylation(GO:0006493) |
| 0.1 |
0.4 |
GO:0043267 |
negative regulation of potassium ion transport(GO:0043267) |
| 0.1 |
0.3 |
GO:0032790 |
ribosome disassembly(GO:0032790) |
| 0.1 |
0.8 |
GO:0035542 |
regulation of SNARE complex assembly(GO:0035542) |
| 0.1 |
0.7 |
GO:0070458 |
detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 0.1 |
0.3 |
GO:0006435 |
threonyl-tRNA aminoacylation(GO:0006435) |
| 0.1 |
0.6 |
GO:0006122 |
mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.1 |
1.5 |
GO:0016180 |
snRNA processing(GO:0016180) |
| 0.1 |
2.7 |
GO:0000470 |
maturation of LSU-rRNA(GO:0000470) |
| 0.1 |
0.4 |
GO:0031666 |
positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.1 |
0.4 |
GO:0009299 |
mRNA transcription(GO:0009299) |
| 0.1 |
0.7 |
GO:0007095 |
mitotic G2 DNA damage checkpoint(GO:0007095) |
| 0.1 |
0.3 |
GO:0043950 |
positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.1 |
0.2 |
GO:0097278 |
complement-dependent cytotoxicity(GO:0097278) |
| 0.1 |
1.6 |
GO:0006767 |
water-soluble vitamin metabolic process(GO:0006767) |
| 0.1 |
0.6 |
GO:0048144 |
fibroblast proliferation(GO:0048144) |
| 0.1 |
4.1 |
GO:0043966 |
histone H3 acetylation(GO:0043966) |
| 0.1 |
1.1 |
GO:0002011 |
morphogenesis of an epithelial sheet(GO:0002011) |
| 0.1 |
1.1 |
GO:0044243 |
multicellular organism catabolic process(GO:0044243) |
| 0.1 |
0.6 |
GO:0036297 |
interstrand cross-link repair(GO:0036297) |
| 0.1 |
0.2 |
GO:0009212 |
dTTP biosynthetic process(GO:0006235) deoxyribonucleoside triphosphate biosynthetic process(GO:0009202) pyrimidine deoxyribonucleoside triphosphate metabolic process(GO:0009211) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) dTTP metabolic process(GO:0046075) |
| 0.1 |
1.4 |
GO:0033209 |
tumor necrosis factor-mediated signaling pathway(GO:0033209) |
| 0.1 |
0.7 |
GO:0043487 |
regulation of RNA stability(GO:0043487) |
| 0.1 |
0.4 |
GO:0007035 |
vacuolar acidification(GO:0007035) |
| 0.1 |
0.6 |
GO:0045722 |
positive regulation of gluconeogenesis(GO:0045722) |
| 0.1 |
0.6 |
GO:0060159 |
regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.1 |
0.2 |
GO:0042701 |
progesterone secretion(GO:0042701) |
| 0.1 |
0.3 |
GO:0006953 |
acute-phase response(GO:0006953) |
| 0.1 |
2.5 |
GO:0002181 |
cytoplasmic translation(GO:0002181) |
| 0.1 |
0.3 |
GO:0051561 |
positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
| 0.1 |
0.4 |
GO:0031937 |
positive regulation of chromatin silencing(GO:0031937) |
| 0.1 |
0.3 |
GO:0038018 |
Wnt receptor catabolic process(GO:0038018) |
| 0.1 |
0.4 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 0.1 |
0.1 |
GO:0070233 |
negative regulation of T cell apoptotic process(GO:0070233) |
| 0.1 |
0.6 |
GO:0035520 |
monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.1 |
0.6 |
GO:0048384 |
retinoic acid receptor signaling pathway(GO:0048384) |
| 0.1 |
0.6 |
GO:0090501 |
RNA phosphodiester bond hydrolysis(GO:0090501) |
| 0.1 |
0.3 |
GO:0097428 |
protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.1 |
0.1 |
GO:0019249 |
lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
| 0.1 |
0.4 |
GO:0043276 |
anoikis(GO:0043276) |
| 0.1 |
1.6 |
GO:0006998 |
nuclear envelope organization(GO:0006998) |
| 0.1 |
0.3 |
GO:0042590 |
antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.1 |
0.1 |
GO:0045583 |
regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.1 |
0.2 |
GO:0060216 |
definitive hemopoiesis(GO:0060216) |
| 0.1 |
0.5 |
GO:0000028 |
ribosomal small subunit assembly(GO:0000028) |
| 0.1 |
0.5 |
GO:0009263 |
deoxyribonucleotide biosynthetic process(GO:0009263) |
| 0.1 |
0.2 |
GO:0045830 |
positive regulation of isotype switching(GO:0045830) |
| 0.1 |
0.6 |
GO:0010883 |
regulation of lipid storage(GO:0010883) |
| 0.1 |
0.2 |
GO:1903774 |
positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.1 |
0.8 |
GO:0048286 |
lung alveolus development(GO:0048286) |
| 0.1 |
0.1 |
GO:0043490 |
malate-aspartate shuttle(GO:0043490) |
| 0.1 |
0.1 |
GO:0099515 |
actin filament-based transport(GO:0099515) |
| 0.1 |
0.2 |
GO:1904469 |
positive regulation of tumor necrosis factor secretion(GO:1904469) |
| 0.1 |
0.8 |
GO:0010922 |
positive regulation of phosphatase activity(GO:0010922) |
| 0.1 |
0.3 |
GO:0048642 |
negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.1 |
2.9 |
GO:0045727 |
positive regulation of translation(GO:0045727) |
| 0.1 |
0.3 |
GO:0043046 |
DNA methylation involved in gamete generation(GO:0043046) |
| 0.1 |
0.1 |
GO:0045668 |
negative regulation of osteoblast differentiation(GO:0045668) |
| 0.1 |
0.3 |
GO:1904715 |
negative regulation of chaperone-mediated autophagy(GO:1904715) |
| 0.1 |
0.5 |
GO:0032968 |
positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.1 |
0.4 |
GO:0070203 |
regulation of establishment of protein localization to telomere(GO:0070203) positive regulation of protein localization to chromosome, telomeric region(GO:1904816) positive regulation of establishment of protein localization to telomere(GO:1904851) |
| 0.1 |
0.2 |
GO:0048211 |
Golgi vesicle docking(GO:0048211) |
| 0.1 |
0.3 |
GO:0033299 |
secretion of lysosomal enzymes(GO:0033299) |
| 0.1 |
0.3 |
GO:0006450 |
regulation of translational fidelity(GO:0006450) |
| 0.1 |
0.3 |
GO:0046782 |
regulation of viral transcription(GO:0046782) |
| 0.1 |
4.6 |
GO:0006413 |
translational initiation(GO:0006413) |
| 0.1 |
0.2 |
GO:1904666 |
regulation of ubiquitin protein ligase activity(GO:1904666) |
| 0.1 |
0.1 |
GO:0038089 |
positive regulation of cell migration by vascular endothelial growth factor signaling pathway(GO:0038089) |
| 0.1 |
0.6 |
GO:0010390 |
histone monoubiquitination(GO:0010390) |
| 0.1 |
0.3 |
GO:0060294 |
cilium movement involved in cell motility(GO:0060294) |
| 0.1 |
0.1 |
GO:2000279 |
negative regulation of DNA biosynthetic process(GO:2000279) |
| 0.1 |
0.2 |
GO:0034035 |
purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
| 0.1 |
0.8 |
GO:0006368 |
transcription elongation from RNA polymerase II promoter(GO:0006368) |
| 0.1 |
0.1 |
GO:0043652 |
engulfment of apoptotic cell(GO:0043652) |
| 0.1 |
0.1 |
GO:1902177 |
positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
| 0.1 |
0.4 |
GO:0051131 |
chaperone-mediated protein complex assembly(GO:0051131) |
| 0.1 |
0.2 |
GO:0070966 |
nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.1 |
1.9 |
GO:0042273 |
ribosomal large subunit biogenesis(GO:0042273) |
| 0.1 |
0.6 |
GO:2000060 |
positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
| 0.1 |
0.1 |
GO:0010759 |
positive regulation of macrophage chemotaxis(GO:0010759) |
| 0.1 |
0.2 |
GO:0006741 |
NADP biosynthetic process(GO:0006741) |
| 0.1 |
0.5 |
GO:0009191 |
ribonucleoside diphosphate catabolic process(GO:0009191) |
| 0.1 |
0.2 |
GO:0051898 |
negative regulation of protein kinase B signaling(GO:0051898) |
| 0.1 |
0.1 |
GO:0032303 |
regulation of icosanoid secretion(GO:0032303) |
| 0.1 |
0.5 |
GO:0042168 |
heme metabolic process(GO:0042168) |
| 0.1 |
1.8 |
GO:0051225 |
spindle assembly(GO:0051225) |
| 0.1 |
0.3 |
GO:0046040 |
IMP metabolic process(GO:0046040) |
| 0.1 |
0.3 |
GO:0042274 |
ribosomal small subunit biogenesis(GO:0042274) |
| 0.1 |
0.1 |
GO:0043631 |
RNA polyadenylation(GO:0043631) |
| 0.1 |
0.9 |
GO:0002474 |
antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 0.1 |
0.1 |
GO:0007016 |
cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.1 |
0.1 |
GO:0006432 |
phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 |
0.2 |
GO:2000144 |
positive regulation of DNA-templated transcription, initiation(GO:2000144) |
| 0.1 |
0.3 |
GO:0009650 |
UV protection(GO:0009650) |
| 0.0 |
1.7 |
GO:0006506 |
GPI anchor biosynthetic process(GO:0006506) |
| 0.0 |
0.2 |
GO:0006048 |
UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.0 |
7.5 |
GO:0007067 |
mitotic nuclear division(GO:0007067) |
| 0.0 |
0.1 |
GO:0042832 |
response to protozoan(GO:0001562) defense response to protozoan(GO:0042832) |
| 0.0 |
0.3 |
GO:0018065 |
protein-cofactor linkage(GO:0018065) |
| 0.0 |
0.2 |
GO:0045292 |
mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.0 |
0.2 |
GO:0046475 |
glycerophospholipid catabolic process(GO:0046475) |
| 0.0 |
0.8 |
GO:0006513 |
protein monoubiquitination(GO:0006513) |
| 0.0 |
0.2 |
GO:0035493 |
SNARE complex assembly(GO:0035493) |
| 0.0 |
0.1 |
GO:2000189 |
positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.0 |
0.0 |
GO:0039530 |
MDA-5 signaling pathway(GO:0039530) |
| 0.0 |
0.3 |
GO:0044406 |
adhesion of symbiont to host(GO:0044406) |
| 0.0 |
0.1 |
GO:0034505 |
tooth mineralization(GO:0034505) |
| 0.0 |
0.3 |
GO:0097062 |
dendritic spine maintenance(GO:0097062) |
| 0.0 |
0.1 |
GO:0051967 |
negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 |
0.0 |
GO:0072017 |
distal tubule development(GO:0072017) |
| 0.0 |
0.1 |
GO:0042275 |
error-free postreplication DNA repair(GO:0042275) |
| 0.0 |
0.5 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.0 |
0.5 |
GO:0033119 |
negative regulation of RNA splicing(GO:0033119) |
| 0.0 |
0.1 |
GO:0032369 |
negative regulation of lipid transport(GO:0032369) |
| 0.0 |
0.1 |
GO:0048733 |
sebaceous gland development(GO:0048733) |
| 0.0 |
0.1 |
GO:0019254 |
carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.0 |
0.6 |
GO:0000266 |
mitochondrial fission(GO:0000266) |
| 0.0 |
0.1 |
GO:0006436 |
tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.0 |
0.1 |
GO:0000350 |
generation of catalytic spliceosome for second transesterification step(GO:0000350) |
| 0.0 |
0.4 |
GO:0002227 |
innate immune response in mucosa(GO:0002227) |
| 0.0 |
0.1 |
GO:0060056 |
mammary gland involution(GO:0060056) |
| 0.0 |
0.3 |
GO:0006641 |
triglyceride metabolic process(GO:0006641) |
| 0.0 |
0.0 |
GO:0043278 |
response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
| 0.0 |
0.2 |
GO:0039703 |
viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.0 |
0.1 |
GO:0071816 |
protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.0 |
0.2 |
GO:0006627 |
protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.0 |
0.1 |
GO:0021860 |
pyramidal neuron development(GO:0021860) |
| 0.0 |
0.3 |
GO:0006654 |
phosphatidic acid biosynthetic process(GO:0006654) phosphatidic acid metabolic process(GO:0046473) |
| 0.0 |
0.2 |
GO:2000637 |
positive regulation of gene silencing by miRNA(GO:2000637) |
| 0.0 |
0.5 |
GO:0070527 |
platelet aggregation(GO:0070527) |
| 0.0 |
0.0 |
GO:0035562 |
negative regulation of chromatin binding(GO:0035562) |
| 0.0 |
0.1 |
GO:0010155 |
regulation of proton transport(GO:0010155) |
| 0.0 |
0.0 |
GO:0072498 |
embryonic skeletal joint development(GO:0072498) |
| 0.0 |
0.2 |
GO:0000154 |
rRNA modification(GO:0000154) |
| 0.0 |
0.1 |
GO:0051697 |
protein delipidation(GO:0051697) |
| 0.0 |
0.0 |
GO:0033085 |
negative regulation of T cell differentiation in thymus(GO:0033085) negative regulation of thymocyte aggregation(GO:2000399) |
| 0.0 |
0.2 |
GO:0006490 |
oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
| 0.0 |
0.2 |
GO:0006120 |
mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.0 |
0.1 |
GO:0045217 |
cell-cell junction maintenance(GO:0045217) |
| 0.0 |
0.3 |
GO:0030970 |
retrograde protein transport, ER to cytosol(GO:0030970) |
| 0.0 |
0.0 |
GO:0035280 |
miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) |
| 0.0 |
0.1 |
GO:0035751 |
regulation of lysosomal lumen pH(GO:0035751) |
| 0.0 |
0.0 |
GO:0071594 |
T cell differentiation in thymus(GO:0033077) thymocyte aggregation(GO:0071594) |
| 0.0 |
0.1 |
GO:0042993 |
positive regulation of transcription factor import into nucleus(GO:0042993) |
| 0.0 |
0.0 |
GO:0050667 |
homocysteine metabolic process(GO:0050667) |
| 0.0 |
0.1 |
GO:0050729 |
positive regulation of inflammatory response(GO:0050729) |
| 0.0 |
0.2 |
GO:0071347 |
cellular response to interleukin-1(GO:0071347) |
| 0.0 |
0.3 |
GO:2001238 |
positive regulation of extrinsic apoptotic signaling pathway(GO:2001238) |
| 0.0 |
0.0 |
GO:0048496 |
maintenance of organ identity(GO:0048496) |
| 0.0 |
0.1 |
GO:0006301 |
postreplication repair(GO:0006301) |
| 0.0 |
0.1 |
GO:0042113 |
B cell activation(GO:0042113) |
| 0.0 |
0.2 |
GO:0006911 |
phagocytosis, engulfment(GO:0006911) |
| 0.0 |
0.1 |
GO:0006359 |
regulation of transcription from RNA polymerase III promoter(GO:0006359) |
| 0.0 |
0.3 |
GO:0021591 |
ventricular system development(GO:0021591) |
| 0.0 |
2.9 |
GO:0008380 |
RNA splicing(GO:0008380) |
| 0.0 |
0.1 |
GO:0006000 |
fructose metabolic process(GO:0006000) |
| 0.0 |
0.0 |
GO:0051168 |
nuclear export(GO:0051168) |
| 0.0 |
0.0 |
GO:0010764 |
negative regulation of fibroblast migration(GO:0010764) |
| 0.0 |
0.1 |
GO:0002221 |
pattern recognition receptor signaling pathway(GO:0002221) innate immune response-activating signal transduction(GO:0002758) |
