| 5.3 |
15.9 |
GO:0060364 |
frontal suture morphogenesis(GO:0060364) |
| 4.8 |
14.5 |
GO:0003221 |
right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 4.8 |
19.3 |
GO:0003360 |
brainstem development(GO:0003360) |
| 4.6 |
13.8 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 4.6 |
18.2 |
GO:2000974 |
negative regulation of pro-B cell differentiation(GO:2000974) |
| 4.5 |
8.9 |
GO:0061144 |
alveolar secondary septum development(GO:0061144) |
| 4.2 |
4.2 |
GO:0060489 |
establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) orthogonal dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060488) planar dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060489) lateral sprouting involved in lung morphogenesis(GO:0060490) |
| 4.2 |
12.6 |
GO:0035604 |
fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) coronal suture morphogenesis(GO:0060365) squamous basal epithelial stem cell differentiation involved in prostate gland acinus development(GO:0060529) |
| 4.1 |
16.6 |
GO:0046836 |
glycolipid transport(GO:0046836) |
| 4.1 |
12.4 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 4.1 |
16.3 |
GO:0060032 |
notochord regression(GO:0060032) |
| 3.8 |
11.4 |
GO:0032877 |
positive regulation of DNA endoreduplication(GO:0032877) |
| 3.8 |
15.1 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 3.7 |
11.1 |
GO:0021893 |
cerebral cortex GABAergic interneuron fate commitment(GO:0021893) |
| 3.5 |
31.8 |
GO:0045719 |
negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 3.5 |
10.5 |
GO:0046022 |
regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
| 3.5 |
14.0 |
GO:0003150 |
muscular septum morphogenesis(GO:0003150) |
| 3.5 |
17.3 |
GO:0060842 |
arterial endothelial cell differentiation(GO:0060842) |
| 3.4 |
10.3 |
GO:1904395 |
regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
| 3.4 |
17.0 |
GO:0060528 |
secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 3.3 |
23.1 |
GO:0031536 |
positive regulation of exit from mitosis(GO:0031536) |
| 3.3 |
9.8 |
GO:0060598 |
dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
| 3.2 |
12.9 |
GO:1904565 |
response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 3.2 |
12.8 |
GO:0014834 |
skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
| 3.1 |
9.4 |
GO:0021529 |
spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 3.1 |
15.3 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 3.1 |
3.1 |
GO:0060688 |
regulation of morphogenesis of a branching structure(GO:0060688) |
| 3.0 |
6.0 |
GO:0072076 |
nephrogenic mesenchyme development(GO:0072076) |
| 2.9 |
14.7 |
GO:2000382 |
positive regulation of mesoderm development(GO:2000382) |
| 2.8 |
11.3 |
GO:0048382 |
mesendoderm development(GO:0048382) |
| 2.8 |
8.4 |
GO:0010757 |
negative regulation of plasminogen activation(GO:0010757) |
| 2.8 |
27.7 |
GO:0060059 |
embryonic retina morphogenesis in camera-type eye(GO:0060059) |
| 2.8 |
2.8 |
GO:0003162 |
atrioventricular node development(GO:0003162) |
| 2.8 |
2.8 |
GO:2000546 |
positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
| 2.7 |
24.6 |
GO:0046499 |
S-adenosylmethioninamine metabolic process(GO:0046499) |
| 2.5 |
2.5 |
GO:0007354 |
zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 2.5 |
7.4 |
GO:0045819 |
positive regulation of glycogen catabolic process(GO:0045819) |
| 2.4 |
14.4 |
GO:0060242 |
contact inhibition(GO:0060242) |
| 2.4 |
7.1 |
GO:0021759 |
globus pallidus development(GO:0021759) |
| 2.4 |
9.4 |
GO:0086069 |
bundle of His cell to Purkinje myocyte communication(GO:0086069) |
| 2.3 |
9.3 |
GO:0010668 |
ectodermal cell differentiation(GO:0010668) |
| 2.3 |
2.3 |
GO:0097062 |
dendritic spine maintenance(GO:0097062) |
| 2.2 |
10.9 |
GO:0048133 |
germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 2.1 |
4.3 |
GO:0060166 |
olfactory pit development(GO:0060166) |
| 2.1 |
6.4 |
GO:0035878 |
nail development(GO:0035878) |
| 2.1 |
10.7 |
GO:0048318 |
axial mesoderm development(GO:0048318) |
| 2.1 |
2.1 |
GO:0060994 |
regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 2.1 |
6.2 |
GO:0060010 |
Sertoli cell fate commitment(GO:0060010) |
| 2.1 |
6.2 |
GO:1902498 |
regulation of protein autoubiquitination(GO:1902498) |
| 2.0 |
2.0 |
GO:0070094 |
positive regulation of glucagon secretion(GO:0070094) |
| 2.0 |
4.0 |
GO:0009957 |
epidermal cell fate specification(GO:0009957) |
| 2.0 |
2.0 |
GO:0060445 |
branching involved in salivary gland morphogenesis(GO:0060445) |
| 2.0 |
11.8 |
GO:0032488 |
Cdc42 protein signal transduction(GO:0032488) |
| 2.0 |
2.0 |
GO:0003420 |
regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
| 1.9 |
11.7 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 1.9 |
1.9 |
GO:0070366 |
regulation of hepatocyte differentiation(GO:0070366) |
| 1.9 |
9.6 |
GO:2000065 |
negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
| 1.9 |
9.5 |
GO:0071699 |
olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
| 1.9 |
7.5 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 1.9 |
5.6 |
GO:1901420 |
negative regulation of response to alcohol(GO:1901420) |
| 1.9 |
5.6 |
GO:0014738 |
regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
| 1.9 |
3.7 |
GO:0021798 |
forebrain dorsal/ventral pattern formation(GO:0021798) |
| 1.9 |
3.7 |
GO:2000138 |
positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 1.8 |
14.8 |
GO:0048386 |
positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 1.8 |
5.5 |
GO:0097402 |
neuroblast migration(GO:0097402) |
| 1.8 |
1.8 |
GO:0070571 |
negative regulation of neuron projection regeneration(GO:0070571) |
| 1.8 |
7.3 |
GO:0007223 |
Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 1.8 |
1.8 |
GO:0033278 |
cell proliferation in midbrain(GO:0033278) |
| 1.8 |
5.4 |
GO:0032847 |
regulation of cellular pH reduction(GO:0032847) |
| 1.8 |
28.8 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 1.8 |
19.8 |
GO:0051967 |
negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 1.8 |
5.4 |
GO:0051902 |
negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
| 1.8 |
1.8 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 1.8 |
1.8 |
GO:0003415 |
chondrocyte hypertrophy(GO:0003415) |
| 1.7 |
10.4 |
GO:0006452 |
translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 1.7 |
12.0 |
GO:0000320 |
re-entry into mitotic cell cycle(GO:0000320) |
| 1.7 |
12.0 |
GO:0001842 |
neural fold formation(GO:0001842) |
| 1.7 |
3.4 |
GO:0060591 |
chondroblast differentiation(GO:0060591) |
| 1.7 |
5.1 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 1.7 |
8.6 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 1.7 |
1.7 |
GO:0009786 |
regulation of asymmetric cell division(GO:0009786) |
| 1.7 |
1.7 |
GO:0033601 |
positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 1.7 |
16.9 |
GO:0008063 |
Toll signaling pathway(GO:0008063) |
| 1.7 |
5.0 |
GO:0046544 |
development of secondary male sexual characteristics(GO:0046544) |
| 1.7 |
1.7 |
GO:1990379 |
lipid transport across blood brain barrier(GO:1990379) |
| 1.7 |
6.7 |
GO:0032439 |
endosome localization(GO:0032439) |
| 1.6 |
4.9 |
GO:0090271 |
positive regulation of fibroblast growth factor production(GO:0090271) |
| 1.6 |
6.5 |
GO:0016340 |
calcium-dependent cell-matrix adhesion(GO:0016340) |
| 1.6 |
1.6 |
GO:0022028 |
tangential migration from the subventricular zone to the olfactory bulb(GO:0022028) |
| 1.6 |
3.2 |
GO:0033088 |
negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 1.6 |
3.2 |
GO:0072138 |
mesenchymal cell proliferation involved in ureteric bud development(GO:0072138) |
| 1.6 |
3.2 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 1.6 |
4.7 |
GO:0030167 |
proteoglycan catabolic process(GO:0030167) |
| 1.5 |
7.6 |
GO:0061181 |
regulation of chondrocyte development(GO:0061181) |
| 1.5 |
6.0 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 1.5 |
4.5 |
GO:0009177 |
deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
| 1.5 |
4.5 |
GO:1902415 |
regulation of mRNA binding(GO:1902415) positive regulation of mRNA binding(GO:1902416) regulation of RNA binding(GO:1905214) positive regulation of RNA binding(GO:1905216) |
| 1.5 |
6.0 |
GO:0061188 |
regulation of chromatin silencing at rDNA(GO:0061187) negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 1.5 |
14.9 |
GO:0048681 |
negative regulation of axon regeneration(GO:0048681) |
| 1.5 |
3.0 |
GO:0003100 |
regulation of systemic arterial blood pressure by endothelin(GO:0003100) |
| 1.5 |
5.8 |
GO:0072137 |
condensed mesenchymal cell proliferation(GO:0072137) |
| 1.4 |
5.7 |
GO:0000415 |
negative regulation of histone H3-K36 methylation(GO:0000415) |
| 1.4 |
2.8 |
GO:0014028 |
notochord formation(GO:0014028) |
| 1.4 |
2.8 |
GO:2000744 |
anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 1.4 |
6.9 |
GO:0038031 |
non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 1.4 |
6.9 |
GO:1904667 |
negative regulation of ubiquitin protein ligase activity(GO:1904667) |
| 1.4 |
4.1 |
GO:0006348 |
chromatin silencing at telomere(GO:0006348) |
| 1.4 |
17.9 |
GO:0021521 |
ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 1.4 |
4.1 |
GO:0035519 |
protein K29-linked ubiquitination(GO:0035519) |
| 1.4 |
2.7 |
GO:0034454 |
microtubule anchoring at centrosome(GO:0034454) microtubule anchoring at microtubule organizing center(GO:0072393) |
| 1.4 |
12.2 |
GO:0051639 |
actin filament network formation(GO:0051639) |
| 1.3 |
2.7 |
GO:0021520 |
spinal cord motor neuron cell fate specification(GO:0021520) |
| 1.3 |
4.0 |
GO:0030421 |
defecation(GO:0030421) |
| 1.3 |
6.6 |
GO:0046601 |
positive regulation of centriole replication(GO:0046601) |
| 1.3 |
1.3 |
GO:2000338 |
chemokine (C-X-C motif) ligand 1 production(GO:0072566) regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000338) |
| 1.3 |
3.9 |
GO:0000087 |
mitotic M phase(GO:0000087) |
| 1.3 |
1.3 |
GO:0042323 |
negative regulation of circadian sleep/wake cycle, non-REM sleep(GO:0042323) negative regulation of mucus secretion(GO:0070256) |
| 1.3 |
3.9 |
GO:1903225 |
negative regulation of endodermal cell differentiation(GO:1903225) |
| 1.3 |
6.5 |
GO:0009449 |
gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 1.3 |
6.5 |
GO:0007089 |
traversing start control point of mitotic cell cycle(GO:0007089) |
| 1.3 |
5.2 |
GO:1904996 |
positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 1.3 |
3.9 |
GO:0044332 |
Wnt signaling pathway involved in dorsal/ventral axis specification(GO:0044332) |
| 1.3 |
1.3 |
GO:0033122 |
regulation of purine nucleotide catabolic process(GO:0033121) negative regulation of purine nucleotide catabolic process(GO:0033122) |
| 1.3 |
3.8 |
GO:0072356 |
chromosome passenger complex localization to kinetochore(GO:0072356) |
| 1.3 |
8.9 |
GO:2000124 |
regulation of endocannabinoid signaling pathway(GO:2000124) |
| 1.3 |
10.1 |
GO:1900262 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 1.3 |
1.3 |
GO:0061198 |
fungiform papilla development(GO:0061196) fungiform papilla morphogenesis(GO:0061197) fungiform papilla formation(GO:0061198) |
| 1.3 |
7.5 |
GO:0006287 |
base-excision repair, gap-filling(GO:0006287) |
| 1.3 |
1.3 |
GO:0001787 |
natural killer cell proliferation(GO:0001787) |
| 1.2 |
3.7 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 1.2 |
3.7 |
GO:1990705 |
cholangiocyte proliferation(GO:1990705) |
| 1.2 |
3.7 |
GO:0097212 |
lysosomal membrane organization(GO:0097212) |
| 1.2 |
3.7 |
GO:0032474 |
otolith morphogenesis(GO:0032474) |
| 1.2 |
3.6 |
GO:0036089 |
cleavage furrow formation(GO:0036089) |
| 1.2 |
3.6 |
GO:1903048 |
regulation of acetylcholine-gated cation channel activity(GO:1903048) |
| 1.2 |
2.4 |
GO:0051892 |
negative regulation of cardioblast differentiation(GO:0051892) |
| 1.2 |
7.2 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 1.2 |
2.4 |
GO:0070346 |
positive regulation of fat cell proliferation(GO:0070346) |
| 1.2 |
2.4 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 1.2 |
2.4 |
GO:0060221 |
retinal rod cell differentiation(GO:0060221) |
| 1.2 |
4.7 |
GO:2001271 |
negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 1.2 |
3.5 |
GO:0014809 |
regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014809) |
| 1.2 |
2.3 |
GO:0072194 |
kidney smooth muscle tissue development(GO:0072194) |
| 1.2 |
2.3 |
GO:0048296 |
isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) |
| 1.2 |
1.2 |
GO:0060026 |
convergent extension(GO:0060026) convergent extension involved in gastrulation(GO:0060027) |
| 1.2 |
13.9 |
GO:0007100 |
mitotic centrosome separation(GO:0007100) |
| 1.2 |
5.8 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 1.1 |
12.6 |
GO:0030903 |
notochord development(GO:0030903) |
| 1.1 |
5.7 |
GO:0070561 |
vitamin D receptor signaling pathway(GO:0070561) |
| 1.1 |
4.5 |
GO:0015705 |
iodide transport(GO:0015705) |
| 1.1 |
1.1 |
GO:1903203 |
neuron death in response to oxidative stress(GO:0036475) regulation of oxidative stress-induced neuron death(GO:1903203) |
| 1.1 |
12.4 |
GO:0060539 |
diaphragm development(GO:0060539) |
| 1.1 |
5.6 |
GO:0060024 |
rhythmic synaptic transmission(GO:0060024) |
| 1.1 |
11.3 |
GO:0090136 |
epithelial cell-cell adhesion(GO:0090136) |
| 1.1 |
6.8 |
GO:0006344 |
maintenance of chromatin silencing(GO:0006344) |
| 1.1 |
13.5 |
GO:0048096 |
chromatin-mediated maintenance of transcription(GO:0048096) |
| 1.1 |
3.4 |
GO:0006083 |
acetate metabolic process(GO:0006083) |
| 1.1 |
1.1 |
GO:0072282 |
metanephric nephron tubule morphogenesis(GO:0072282) |
| 1.1 |
5.6 |
GO:0010032 |
meiotic chromosome condensation(GO:0010032) |
| 1.1 |
3.4 |
GO:0045472 |
response to ether(GO:0045472) |
| 1.1 |
2.2 |
GO:0030916 |
otic vesicle formation(GO:0030916) |
| 1.1 |
1.1 |
GO:2000780 |
negative regulation of DNA repair(GO:0045738) negative regulation of double-strand break repair(GO:2000780) |
| 1.1 |
2.2 |
GO:0048852 |
diencephalon morphogenesis(GO:0048852) |
| 1.1 |
3.3 |
GO:1901675 |
negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 1.1 |
4.4 |
GO:0035795 |
negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 1.1 |
3.3 |
GO:0042908 |
xenobiotic transport(GO:0042908) |
| 1.1 |
1.1 |
GO:0061511 |
centriole elongation(GO:0061511) |
| 1.1 |
2.2 |
GO:1900133 |
renin secretion into blood stream(GO:0002001) regulation of renin secretion into blood stream(GO:1900133) |
| 1.1 |
3.2 |
GO:0015772 |
disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 1.1 |
1.1 |
GO:0003245 |
cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
| 1.1 |
4.3 |
GO:0043490 |
malate-aspartate shuttle(GO:0043490) |
| 1.1 |
18.1 |
GO:0021889 |
olfactory bulb interneuron differentiation(GO:0021889) |
| 1.1 |
9.6 |
GO:0060501 |
positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 1.1 |
1.1 |
GO:1903463 |
regulation of mitotic cell cycle DNA replication(GO:1903463) |
| 1.1 |
1.1 |
GO:0043585 |
nose morphogenesis(GO:0043585) |
| 1.1 |
5.3 |
GO:1900029 |
positive regulation of ruffle assembly(GO:1900029) |
| 1.1 |
8.4 |
GO:0060272 |
embryonic skeletal joint morphogenesis(GO:0060272) |
| 1.0 |
3.1 |
GO:1902969 |
mitotic DNA replication(GO:1902969) |
| 1.0 |
3.1 |
GO:1904059 |
regulation of locomotor rhythm(GO:1904059) |
| 1.0 |
34.5 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 1.0 |
4.1 |
GO:0014846 |
esophagus smooth muscle contraction(GO:0014846) |
| 1.0 |
3.1 |
GO:0006059 |
hexitol metabolic process(GO:0006059) |
| 1.0 |
4.1 |
GO:0002337 |
B-1a B cell differentiation(GO:0002337) |
| 1.0 |
5.1 |
GO:0046654 |
tetrahydrofolate biosynthetic process(GO:0046654) |
| 1.0 |
1.0 |
GO:1903779 |
regulation of cardiac conduction(GO:1903779) |
| 1.0 |
7.1 |
GO:0007296 |
vitellogenesis(GO:0007296) |
| 1.0 |
3.0 |
GO:1902396 |
protein localization to bicellular tight junction(GO:1902396) |
| 1.0 |
4.0 |
GO:0072675 |
osteoclast fusion(GO:0072675) |
| 1.0 |
2.0 |
GO:0006610 |
ribosomal protein import into nucleus(GO:0006610) |
| 1.0 |
2.0 |
GO:0060216 |
definitive hemopoiesis(GO:0060216) |
| 1.0 |
4.9 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 1.0 |
3.9 |
GO:0031016 |
pancreas development(GO:0031016) |
| 1.0 |
2.9 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 1.0 |
4.8 |
GO:0046600 |
negative regulation of centriole replication(GO:0046600) |
| 1.0 |
2.9 |
GO:0060558 |
regulation of calcidiol 1-monooxygenase activity(GO:0060558) |
| 1.0 |
6.7 |
GO:0000022 |
mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
| 1.0 |
1.0 |
GO:0061046 |
regulation of branching involved in lung morphogenesis(GO:0061046) |
| 0.9 |
0.9 |
GO:2000170 |
positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
| 0.9 |
3.8 |
GO:0072385 |
minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.9 |
8.3 |
GO:0060136 |
embryonic process involved in female pregnancy(GO:0060136) |
| 0.9 |
12.0 |
GO:0040034 |
regulation of development, heterochronic(GO:0040034) |
| 0.9 |
2.8 |
GO:0010871 |
negative regulation of receptor biosynthetic process(GO:0010871) |
| 0.9 |
2.8 |
GO:0006189 |
'de novo' IMP biosynthetic process(GO:0006189) |
| 0.9 |
3.7 |
GO:0070829 |
heterochromatin maintenance(GO:0070829) |
| 0.9 |
2.7 |
GO:0001827 |
inner cell mass cell fate commitment(GO:0001827) |
| 0.9 |
3.6 |
GO:1900147 |
Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
| 0.9 |
4.5 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.9 |
5.4 |
GO:0060836 |
lymphatic endothelial cell differentiation(GO:0060836) |
| 0.9 |
6.3 |
GO:0043504 |
mitochondrial DNA repair(GO:0043504) |
| 0.9 |
2.7 |
GO:1901165 |
positive regulation of trophoblast cell migration(GO:1901165) |
| 0.9 |
2.7 |
GO:0089700 |
protein kinase D signaling(GO:0089700) |
| 0.9 |
4.4 |
GO:0003431 |
growth plate cartilage chondrocyte development(GO:0003431) |
| 0.9 |
0.9 |
GO:0044340 |
canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
| 0.9 |
2.6 |
GO:0048478 |
replication fork protection(GO:0048478) |
| 0.9 |
4.4 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.9 |
8.8 |
GO:0048484 |
enteric nervous system development(GO:0048484) |
| 0.9 |
2.6 |
GO:0009446 |
putrescine biosynthetic process(GO:0009446) |
| 0.9 |
6.1 |
GO:0007076 |
mitotic chromosome condensation(GO:0007076) |
| 0.9 |
7.9 |
GO:0010216 |
maintenance of DNA methylation(GO:0010216) |
| 0.9 |
1.7 |
GO:0010961 |
cellular magnesium ion homeostasis(GO:0010961) |
| 0.9 |
1.7 |
GO:0033128 |
negative regulation of histone phosphorylation(GO:0033128) |
| 0.9 |
4.3 |
GO:1902031 |
regulation of NADP metabolic process(GO:1902031) |
| 0.9 |
1.7 |
GO:0060399 |
positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.9 |
6.1 |
GO:0033314 |
mitotic DNA replication checkpoint(GO:0033314) |
| 0.9 |
6.9 |
GO:0061158 |
3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.9 |
3.5 |
GO:0006526 |
arginine biosynthetic process(GO:0006526) |
| 0.9 |
2.6 |
GO:0035426 |
extracellular matrix-cell signaling(GO:0035426) |
| 0.9 |
1.7 |
GO:0003177 |
pulmonary valve development(GO:0003177) pulmonary valve morphogenesis(GO:0003184) |
| 0.9 |
3.4 |
GO:2000256 |
positive regulation of male germ cell proliferation(GO:2000256) |
| 0.9 |
0.9 |
GO:0032240 |
negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.9 |
0.9 |
GO:0014735 |
regulation of muscle atrophy(GO:0014735) |
| 0.8 |
7.6 |
GO:0030206 |
chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.8 |
5.9 |
GO:0008343 |
adult feeding behavior(GO:0008343) |
| 0.8 |
2.5 |
GO:0009812 |
flavonoid metabolic process(GO:0009812) flavonoid biosynthetic process(GO:0009813) flavonoid glucuronidation(GO:0052696) |
| 0.8 |
4.2 |
GO:0072257 |
metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 0.8 |
2.5 |
GO:2000686 |
regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.8 |
13.4 |
GO:0035873 |
lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.8 |
2.5 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.8 |
1.7 |
GO:0048549 |
positive regulation of pinocytosis(GO:0048549) |
| 0.8 |
4.1 |
GO:0042754 |
negative regulation of circadian rhythm(GO:0042754) |
| 0.8 |
4.1 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.8 |
2.5 |
GO:0055099 |
response to high density lipoprotein particle(GO:0055099) |
| 0.8 |
2.5 |
GO:0070318 |
positive regulation of G0 to G1 transition(GO:0070318) |
| 0.8 |
2.5 |
GO:0038165 |
oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.8 |
1.6 |
GO:0050434 |
positive regulation of viral transcription(GO:0050434) |
| 0.8 |
7.3 |
GO:0032525 |
somite rostral/caudal axis specification(GO:0032525) |
| 0.8 |
11.3 |
GO:0007530 |
sex determination(GO:0007530) |
| 0.8 |
1.6 |
GO:2000297 |
negative regulation of synapse maturation(GO:2000297) |
| 0.8 |
5.6 |
GO:0045198 |
establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.8 |
2.4 |
GO:0007290 |
spermatid nucleus elongation(GO:0007290) |
| 0.8 |
1.6 |
GO:1903334 |
positive regulation of protein folding(GO:1903334) |
| 0.8 |
1.6 |
GO:0051315 |
attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.8 |
2.4 |
GO:0007341 |
penetration of zona pellucida(GO:0007341) |
| 0.8 |
1.6 |
GO:0032286 |
central nervous system myelin maintenance(GO:0032286) |
| 0.8 |
4.0 |
GO:1903847 |
regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
| 0.8 |
1.6 |
GO:0019087 |
transformation of host cell by virus(GO:0019087) |
| 0.8 |
0.8 |
GO:0061054 |
dermatome development(GO:0061054) regulation of dermatome development(GO:0061183) |
| 0.8 |
3.1 |
GO:0002036 |
regulation of L-glutamate transport(GO:0002036) |
| 0.8 |
6.3 |
GO:0006105 |
succinate metabolic process(GO:0006105) |
| 0.8 |
6.2 |
GO:0032625 |
interleukin-21 production(GO:0032625) interleukin-21 secretion(GO:0072619) |
| 0.8 |
0.8 |
GO:0003433 |
chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.8 |
0.8 |
GO:1901187 |
regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.8 |
2.3 |
GO:0046061 |
dATP catabolic process(GO:0046061) |
| 0.8 |
2.3 |
GO:0034476 |
U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) |
| 0.8 |
2.3 |
GO:0051933 |
amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
| 0.8 |
2.3 |
GO:0061642 |
chemoattraction of axon(GO:0061642) |
| 0.8 |
0.8 |
GO:0003084 |
positive regulation of systemic arterial blood pressure(GO:0003084) |
| 0.8 |
0.8 |
GO:0072205 |
metanephric collecting duct development(GO:0072205) |
| 0.8 |
0.8 |
GO:0051643 |
endoplasmic reticulum localization(GO:0051643) |
| 0.8 |
0.8 |
GO:0033566 |
gamma-tubulin complex localization(GO:0033566) |
| 0.8 |
2.3 |
GO:0010814 |
substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.8 |
2.3 |
GO:0002302 |
CD8-positive, alpha-beta T cell differentiation involved in immune response(GO:0002302) |
| 0.8 |
3.0 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 0.7 |
3.7 |
GO:0060754 |
positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.7 |
3.7 |
GO:1903553 |
positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.7 |
3.0 |
GO:0070857 |
regulation of bile acid biosynthetic process(GO:0070857) |
| 0.7 |
2.2 |
GO:0018214 |
peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.7 |
2.2 |
GO:0042271 |
susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.7 |
1.5 |
GO:0061343 |
cell adhesion involved in heart morphogenesis(GO:0061343) |
| 0.7 |
2.9 |
GO:0051295 |
establishment of meiotic spindle localization(GO:0051295) |
| 0.7 |
5.0 |
GO:2000051 |
negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.7 |
1.4 |
GO:0007403 |
glial cell fate determination(GO:0007403) |
| 0.7 |
7.1 |
GO:0000183 |
chromatin silencing at rDNA(GO:0000183) |
| 0.7 |
6.4 |
GO:0006346 |
methylation-dependent chromatin silencing(GO:0006346) |
| 0.7 |
5.7 |
GO:0060736 |
prostate gland growth(GO:0060736) |
| 0.7 |
3.5 |
GO:0035087 |
siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.7 |
2.1 |
GO:0045091 |
regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) |
| 0.7 |
4.2 |
GO:2000392 |
regulation of lamellipodium morphogenesis(GO:2000392) positive regulation of lamellipodium morphogenesis(GO:2000394) |
| 0.7 |
0.7 |
GO:2000193 |
positive regulation of fatty acid transport(GO:2000193) |
| 0.7 |
2.1 |
GO:0006682 |
galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.7 |
2.1 |
GO:0010944 |
negative regulation of transcription by competitive promoter binding(GO:0010944) |
| 0.7 |
15.9 |
GO:0045880 |
positive regulation of smoothened signaling pathway(GO:0045880) |
| 0.7 |
3.4 |
GO:0060295 |
regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
| 0.7 |
0.7 |
GO:0007352 |
zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.7 |
11.6 |
GO:0090005 |
negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
| 0.7 |
4.1 |
GO:0016127 |
cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.7 |
2.0 |
GO:0060478 |
acrosomal vesicle exocytosis(GO:0060478) |
| 0.7 |
4.8 |
GO:0045602 |
negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.7 |
2.0 |
GO:0061073 |
ciliary body morphogenesis(GO:0061073) |
| 0.7 |
2.0 |
GO:0019659 |
glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
| 0.7 |
1.4 |
GO:0019676 |
ammonia assimilation cycle(GO:0019676) |
| 0.7 |
0.7 |
GO:0042136 |
neurotransmitter biosynthetic process(GO:0042136) |
| 0.7 |
0.7 |
GO:0060028 |
convergent extension involved in axis elongation(GO:0060028) |
| 0.7 |
9.4 |
GO:0090261 |
positive regulation of inclusion body assembly(GO:0090261) |
| 0.7 |
9.4 |
GO:0051988 |
regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.7 |
2.0 |
GO:0045793 |
positive regulation of cell size(GO:0045793) |
| 0.7 |
2.7 |
GO:0002667 |
lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 0.7 |
2.0 |
GO:0060430 |
lung saccule development(GO:0060430) |
| 0.7 |
3.3 |
GO:0030091 |
protein repair(GO:0030091) |
| 0.7 |
8.0 |
GO:0061029 |
eyelid development in camera-type eye(GO:0061029) |
| 0.7 |
2.0 |
GO:1903984 |
positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.7 |
2.0 |
GO:1902037 |
negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
| 0.7 |
2.6 |
GO:0015744 |
succinate transport(GO:0015744) |
| 0.7 |
1.3 |
GO:0036123 |
histone H3-K9 dimethylation(GO:0036123) |
| 0.7 |
1.3 |
GO:0043696 |
dedifferentiation(GO:0043696) cell dedifferentiation(GO:0043697) |
| 0.7 |
3.3 |
GO:0032825 |
positive regulation of natural killer cell differentiation(GO:0032825) |
| 0.7 |
7.9 |
GO:0001833 |
inner cell mass cell proliferation(GO:0001833) |
| 0.7 |
2.0 |
GO:0014835 |
myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.7 |
3.3 |
GO:0035022 |
positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.7 |
22.2 |
GO:0006284 |
base-excision repair(GO:0006284) |
| 0.6 |
1.3 |
GO:1900275 |
negative regulation of phospholipase C activity(GO:1900275) |
| 0.6 |
1.9 |
GO:0039536 |
negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.6 |
1.3 |
GO:1902459 |
positive regulation of stem cell population maintenance(GO:1902459) |
| 0.6 |
2.6 |
GO:1902570 |
protein localization to nucleolus(GO:1902570) |
| 0.6 |
1.9 |
GO:0045590 |
negative regulation of regulatory T cell differentiation(GO:0045590) |
| 0.6 |
5.1 |
GO:0061525 |
hindgut development(GO:0061525) |
| 0.6 |
1.3 |
GO:0006543 |
glutamine catabolic process(GO:0006543) |
| 0.6 |
1.9 |
GO:1903867 |
chorion development(GO:0060717) extraembryonic membrane development(GO:1903867) |
| 0.6 |
1.9 |
GO:0048696 |
regulation of collateral sprouting in absence of injury(GO:0048696) |
| 0.6 |
3.1 |
GO:1903715 |
regulation of aerobic respiration(GO:1903715) |
| 0.6 |
1.9 |
GO:0016115 |
terpenoid catabolic process(GO:0016115) |
| 0.6 |
1.2 |
GO:2000383 |
regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 0.6 |
0.6 |
GO:0016332 |
establishment or maintenance of polarity of embryonic epithelium(GO:0016332) |
| 0.6 |
3.7 |
GO:2000324 |
positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.6 |
1.2 |
GO:0040038 |
polar body extrusion after meiotic divisions(GO:0040038) |
| 0.6 |
6.2 |
GO:0030388 |
fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.6 |
1.8 |
GO:0001942 |
hair follicle development(GO:0001942) molting cycle process(GO:0022404) hair cycle process(GO:0022405) skin epidermis development(GO:0098773) |
| 0.6 |
0.6 |
GO:0040037 |
negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
| 0.6 |
3.7 |
GO:0061299 |
retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 0.6 |
5.5 |
GO:0045003 |
DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.6 |
3.1 |
GO:0071839 |
apoptotic process in bone marrow(GO:0071839) |
| 0.6 |
1.2 |
GO:0042505 |
tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
| 0.6 |
14.7 |
GO:0072698 |
protein localization to microtubule cytoskeleton(GO:0072698) |
| 0.6 |
4.3 |
GO:0060068 |
vagina development(GO:0060068) |
| 0.6 |
5.5 |
GO:1902231 |
positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.6 |
1.2 |
GO:0072553 |
terminal button organization(GO:0072553) |
| 0.6 |
1.8 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 0.6 |
1.2 |
GO:0060766 |
negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.6 |
2.4 |
GO:0035606 |
peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 0.6 |
7.7 |
GO:0070935 |
3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.6 |
7.1 |
GO:0030948 |
negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.6 |
4.1 |
GO:0061087 |
positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.6 |
15.9 |
GO:0050873 |
brown fat cell differentiation(GO:0050873) |
| 0.6 |
6.5 |
GO:0014842 |
regulation of skeletal muscle satellite cell proliferation(GO:0014842) regulation of skeletal muscle cell proliferation(GO:0014857) |
| 0.6 |
3.5 |
GO:0019336 |
phenol-containing compound catabolic process(GO:0019336) |
| 0.6 |
3.5 |
GO:0000578 |
embryonic axis specification(GO:0000578) |
| 0.6 |
7.0 |
GO:0022027 |
interkinetic nuclear migration(GO:0022027) |
| 0.6 |
0.6 |
GO:0048631 |
regulation of skeletal muscle tissue growth(GO:0048631) |
| 0.6 |
3.5 |
GO:0098700 |
aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.6 |
12.1 |
GO:0006607 |
NLS-bearing protein import into nucleus(GO:0006607) |
| 0.6 |
1.7 |
GO:0021986 |
epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.6 |
0.6 |
GO:0042640 |
anagen(GO:0042640) |
| 0.6 |
3.4 |
GO:1903753 |
negative regulation of p38MAPK cascade(GO:1903753) |
| 0.6 |
5.2 |
GO:0090557 |
establishment of endothelial intestinal barrier(GO:0090557) |
| 0.6 |
2.3 |
GO:0042474 |
middle ear morphogenesis(GO:0042474) |
| 0.6 |
1.1 |
GO:0080111 |
DNA dealkylation(GO:0035510) DNA demethylation(GO:0080111) |
| 0.6 |
1.7 |
GO:0000059 |
protein import into nucleus, docking(GO:0000059) |
| 0.6 |
0.6 |
GO:0003096 |
renal sodium ion transport(GO:0003096) |
| 0.6 |
1.7 |
GO:0030222 |
eosinophil differentiation(GO:0030222) |
| 0.6 |
0.6 |
GO:0042790 |
transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:0042790) |
| 0.6 |
1.7 |
GO:0007498 |
mesoderm development(GO:0007498) |
| 0.6 |
2.8 |
GO:0030951 |
establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.6 |
6.8 |
GO:0032075 |
positive regulation of nuclease activity(GO:0032075) |
| 0.6 |
4.5 |
GO:0006004 |
fucose metabolic process(GO:0006004) |
| 0.6 |
2.2 |
GO:0018076 |
N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.6 |
3.4 |
GO:0002317 |
plasma cell differentiation(GO:0002317) |
| 0.6 |
2.2 |
GO:0044829 |
positive regulation by host of viral genome replication(GO:0044829) |
| 0.6 |
0.6 |
GO:1905065 |
regulation of vascular smooth muscle cell differentiation(GO:1905063) positive regulation of vascular smooth muscle cell differentiation(GO:1905065) |
| 0.6 |
0.6 |
GO:1905050 |
positive regulation of metallopeptidase activity(GO:1905050) |
| 0.6 |
3.9 |
GO:0061000 |
negative regulation of dendritic spine development(GO:0061000) |
| 0.6 |
3.9 |
GO:0001977 |
renal system process involved in regulation of blood volume(GO:0001977) |
| 0.5 |
1.1 |
GO:0060982 |
coronary artery morphogenesis(GO:0060982) |
| 0.5 |
1.6 |
GO:0002326 |
B cell lineage commitment(GO:0002326) |
| 0.5 |
0.5 |
GO:0060017 |
parathyroid gland development(GO:0060017) |
| 0.5 |
0.5 |
GO:0001869 |
regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
| 0.5 |
2.2 |
GO:0010288 |
response to lead ion(GO:0010288) |
| 0.5 |
1.6 |
GO:0045404 |
positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
| 0.5 |
1.1 |
GO:0000715 |
nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.5 |
1.6 |
GO:2000301 |
negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.5 |
3.2 |
GO:1902373 |
negative regulation of mRNA catabolic process(GO:1902373) |
| 0.5 |
7.0 |
GO:0000188 |
inactivation of MAPK activity(GO:0000188) |
| 0.5 |
4.3 |
GO:0046826 |
negative regulation of protein export from nucleus(GO:0046826) |
| 0.5 |
6.4 |
GO:0030213 |
hyaluronan biosynthetic process(GO:0030213) |
| 0.5 |
3.7 |
GO:2000653 |
regulation of genetic imprinting(GO:2000653) |
| 0.5 |
1.1 |
GO:0060135 |
maternal process involved in female pregnancy(GO:0060135) |
| 0.5 |
3.2 |
GO:1904668 |
positive regulation of ubiquitin protein ligase activity(GO:1904668) |
| 0.5 |
0.5 |
GO:1904357 |
negative regulation of telomere maintenance via telomere lengthening(GO:1904357) |
| 0.5 |
1.6 |
GO:0044838 |
cell quiescence(GO:0044838) |
| 0.5 |
2.6 |
GO:0006369 |
termination of RNA polymerase II transcription(GO:0006369) |
| 0.5 |
3.2 |
GO:0046599 |
regulation of centriole replication(GO:0046599) |
| 0.5 |
0.5 |
GO:0032760 |
positive regulation of tumor necrosis factor production(GO:0032760) positive regulation of tumor necrosis factor superfamily cytokine production(GO:1903557) |
| 0.5 |
4.2 |
GO:0018026 |
peptidyl-lysine monomethylation(GO:0018026) |
| 0.5 |
1.6 |
GO:0009174 |
UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
| 0.5 |
2.6 |
GO:0034080 |
CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.5 |
0.5 |
GO:1903998 |
regulation of eating behavior(GO:1903998) |
| 0.5 |
2.6 |
GO:0051764 |
actin crosslink formation(GO:0051764) |
| 0.5 |
2.6 |
GO:0030644 |
cellular chloride ion homeostasis(GO:0030644) |
| 0.5 |
1.0 |
GO:0032486 |
Rap protein signal transduction(GO:0032486) |
| 0.5 |
2.1 |
GO:0019740 |
nitrogen utilization(GO:0019740) |
| 0.5 |
0.5 |
GO:1903337 |
positive regulation of vacuolar transport(GO:1903337) |
| 0.5 |
1.5 |
GO:0071649 |
regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) |
| 0.5 |
1.0 |
GO:0051661 |
maintenance of centrosome location(GO:0051661) |
| 0.5 |
2.6 |
GO:0090267 |
positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 0.5 |
1.5 |
GO:0014911 |
positive regulation of smooth muscle cell migration(GO:0014911) |
| 0.5 |
2.0 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 0.5 |
14.7 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.5 |
5.6 |
GO:0033234 |
negative regulation of protein sumoylation(GO:0033234) |
| 0.5 |
1.5 |
GO:2000501 |
natural killer cell chemotaxis(GO:0035747) regulation of natural killer cell chemotaxis(GO:2000501) |
| 0.5 |
1.5 |
GO:0021747 |
cochlear nucleus development(GO:0021747) |
| 0.5 |
3.0 |
GO:0051461 |
regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.5 |
1.0 |
GO:0016095 |
polyprenol catabolic process(GO:0016095) |
| 0.5 |
1.5 |
GO:2001022 |
positive regulation of response to DNA damage stimulus(GO:2001022) |
| 0.5 |
2.0 |
GO:0008635 |
activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.5 |
5.4 |
GO:0010225 |
response to UV-C(GO:0010225) |
| 0.5 |
0.5 |
GO:2000832 |
negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
| 0.5 |
8.9 |
GO:1902043 |
positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.5 |
1.5 |
GO:0000186 |
activation of MAPKK activity(GO:0000186) |
| 0.5 |
0.5 |
GO:0030225 |
macrophage differentiation(GO:0030225) |
| 0.5 |
1.5 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 0.5 |
1.9 |
GO:0007406 |
negative regulation of neuroblast proliferation(GO:0007406) |
| 0.5 |
1.5 |
GO:0002184 |
cytoplasmic translational termination(GO:0002184) |
| 0.5 |
2.4 |
GO:0060710 |
chorio-allantoic fusion(GO:0060710) |
| 0.5 |
1.0 |
GO:0036518 |
chemorepulsion of dopaminergic neuron axon(GO:0036518) |
| 0.5 |
1.9 |
GO:0046469 |
platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.5 |
1.9 |
GO:0016266 |
O-glycan processing(GO:0016266) |
| 0.5 |
2.4 |
GO:0042758 |
long-chain fatty acid catabolic process(GO:0042758) |
| 0.5 |
4.8 |
GO:0032211 |
negative regulation of telomere maintenance via telomerase(GO:0032211) |
| 0.5 |
7.2 |
GO:0034389 |
lipid particle organization(GO:0034389) |
| 0.5 |
0.5 |
GO:0003289 |
septum primum development(GO:0003284) atrial septum primum morphogenesis(GO:0003289) |
| 0.5 |
2.4 |
GO:0040032 |
post-embryonic body morphogenesis(GO:0040032) |
| 0.5 |
1.4 |
GO:0006706 |
steroid catabolic process(GO:0006706) |
| 0.5 |
6.6 |
GO:0071392 |
cellular response to estradiol stimulus(GO:0071392) |
| 0.5 |
6.1 |
GO:0042772 |
DNA damage response, signal transduction resulting in transcription(GO:0042772) |
| 0.5 |
3.7 |
GO:0071168 |
protein localization to chromatin(GO:0071168) |
| 0.5 |
0.9 |
GO:1902512 |
positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
| 0.5 |
0.9 |
GO:0044828 |
negative regulation by host of viral genome replication(GO:0044828) |
| 0.5 |
3.3 |
GO:0045603 |
positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.5 |
0.5 |
GO:0099624 |
regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) atrial cardiac muscle cell membrane repolarization(GO:0099624) |
| 0.5 |
0.5 |
GO:0046622 |
positive regulation of organ growth(GO:0046622) |
| 0.5 |
3.7 |
GO:0035520 |
monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.5 |
4.2 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 0.5 |
0.5 |
GO:0090526 |
regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.5 |
3.7 |
GO:0034501 |
protein localization to kinetochore(GO:0034501) |
| 0.5 |
0.5 |
GO:0060462 |
lung lobe development(GO:0060462) lung lobe morphogenesis(GO:0060463) |
| 0.5 |
1.4 |
GO:0070459 |
prolactin secretion(GO:0070459) |
| 0.5 |
5.0 |
GO:0046643 |
regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.5 |
3.2 |
GO:0006534 |
cysteine metabolic process(GO:0006534) |
| 0.5 |
0.9 |
GO:2000418 |
positive regulation of eosinophil migration(GO:2000418) |
| 0.5 |
4.5 |
GO:0070836 |
caveola assembly(GO:0070836) |
| 0.5 |
1.4 |
GO:0006597 |
spermine biosynthetic process(GO:0006597) |
| 0.4 |
0.4 |
GO:0016445 |
somatic diversification of immunoglobulins(GO:0016445) |
| 0.4 |
0.9 |
GO:0071361 |
cellular response to ethanol(GO:0071361) |
| 0.4 |
12.1 |
GO:0036075 |
endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.4 |
1.8 |
GO:0043921 |
modulation by host of viral transcription(GO:0043921) positive regulation by host of viral transcription(GO:0043923) modulation of transcription in other organism involved in symbiotic interaction(GO:0052312) modulation by host of symbiont transcription(GO:0052472) |
| 0.4 |
1.8 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.4 |
1.8 |
GO:0034214 |
protein hexamerization(GO:0034214) |
| 0.4 |
1.3 |
GO:0048211 |
Golgi vesicle docking(GO:0048211) |
| 0.4 |
0.4 |
GO:0010838 |
positive regulation of keratinocyte proliferation(GO:0010838) |
| 0.4 |
0.9 |
GO:0090071 |
negative regulation of ribosome biogenesis(GO:0090071) |
| 0.4 |
0.4 |
GO:0070315 |
G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 0.4 |
1.3 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.4 |
1.3 |
GO:0046060 |
dATP metabolic process(GO:0046060) |
| 0.4 |
1.7 |
GO:1903265 |
positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.4 |
1.7 |
GO:0090244 |
Wnt signaling pathway involved in somitogenesis(GO:0090244) |
| 0.4 |
6.5 |
GO:0010569 |
regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.4 |
0.9 |
GO:0007171 |
activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.4 |
1.7 |
GO:0036151 |
phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.4 |
1.3 |
GO:0006657 |
CDP-choline pathway(GO:0006657) |
| 0.4 |
1.7 |
GO:0072365 |
regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.4 |
1.7 |
GO:0030576 |
Cajal body organization(GO:0030576) |
| 0.4 |
1.3 |
GO:1901097 |
negative regulation of autophagosome maturation(GO:1901097) |
| 0.4 |
1.7 |
GO:0018158 |
protein oxidation(GO:0018158) |
| 0.4 |
0.8 |
GO:0001951 |
intestinal D-glucose absorption(GO:0001951) terminal web assembly(GO:1902896) |
| 0.4 |
1.3 |
GO:0006269 |
DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.4 |
4.2 |
GO:0033182 |
regulation of histone ubiquitination(GO:0033182) |
| 0.4 |
0.4 |
GO:0097237 |
cellular response to toxic substance(GO:0097237) |
| 0.4 |
1.2 |
GO:1904948 |
midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.4 |
0.4 |
GO:0032627 |
interleukin-23 production(GO:0032627) regulation of interleukin-23 production(GO:0032667) positive regulation of interleukin-23 production(GO:0032747) |
| 0.4 |
14.5 |
GO:2000134 |
negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
| 0.4 |
1.7 |
GO:0097411 |
hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.4 |
0.4 |
GO:0097274 |
urea homeostasis(GO:0097274) |
| 0.4 |
1.7 |
GO:0002681 |
somatic diversification of T cell receptor genes(GO:0002568) somatic recombination of T cell receptor gene segments(GO:0002681) T cell receptor V(D)J recombination(GO:0033153) |
| 0.4 |
0.8 |
GO:0090187 |
positive regulation of pancreatic juice secretion(GO:0090187) |
| 0.4 |
0.4 |
GO:0032272 |
negative regulation of protein polymerization(GO:0032272) |
| 0.4 |
0.8 |
GO:0048636 |
positive regulation of striated muscle tissue development(GO:0045844) positive regulation of muscle organ development(GO:0048636) positive regulation of muscle tissue development(GO:1901863) |
| 0.4 |
3.7 |
GO:0045445 |
myoblast differentiation(GO:0045445) |
| 0.4 |
1.2 |
GO:0070844 |
misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 0.4 |
1.2 |
GO:0030202 |
heparin metabolic process(GO:0030202) |
| 0.4 |
1.2 |
GO:0097461 |
ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
| 0.4 |
2.8 |
GO:0002087 |
regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
| 0.4 |
0.8 |
GO:0030208 |
dermatan sulfate biosynthetic process(GO:0030208) |
| 0.4 |
1.6 |
GO:0010273 |
detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.4 |
2.0 |
GO:0051352 |
negative regulation of ligase activity(GO:0051352) negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
| 0.4 |
4.4 |
GO:0009263 |
deoxyribonucleotide biosynthetic process(GO:0009263) |
| 0.4 |
6.8 |
GO:0016339 |
calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.4 |
1.2 |
GO:0015871 |
choline transport(GO:0015871) |
| 0.4 |
0.4 |
GO:0001928 |
regulation of exocyst assembly(GO:0001928) |
| 0.4 |
1.6 |
GO:0002924 |
negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
| 0.4 |
0.8 |
GO:0060563 |
neuroepithelial cell differentiation(GO:0060563) |
| 0.4 |
2.0 |
GO:0036289 |
peptidyl-serine autophosphorylation(GO:0036289) |
| 0.4 |
2.0 |
GO:0031860 |
telomeric 3' overhang formation(GO:0031860) |
| 0.4 |
4.3 |
GO:0019368 |
fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.4 |
0.8 |
GO:2000819 |
regulation of nucleotide-excision repair(GO:2000819) |
| 0.4 |
1.2 |
GO:0060217 |
positive regulation of chromatin assembly or disassembly(GO:0045799) hemangioblast cell differentiation(GO:0060217) |
| 0.4 |
1.2 |
GO:0042732 |
D-xylose metabolic process(GO:0042732) |
| 0.4 |
1.9 |
GO:0001561 |
fatty acid alpha-oxidation(GO:0001561) |
| 0.4 |
10.0 |
GO:0044319 |
wound healing, spreading of cells(GO:0044319) epiboly(GO:0090504) epiboly involved in wound healing(GO:0090505) |
| 0.4 |
3.1 |
GO:0008608 |
attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.4 |
0.8 |
GO:0046370 |
fructose biosynthetic process(GO:0046370) |
| 0.4 |
1.1 |
GO:0014005 |
microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.4 |
1.9 |
GO:0070493 |
thrombin receptor signaling pathway(GO:0070493) |
| 0.4 |
0.4 |
GO:2000047 |
regulation of cell-cell adhesion mediated by cadherin(GO:2000047) |
| 0.4 |
0.8 |
GO:0061300 |
cerebellum vasculature development(GO:0061300) |
| 0.4 |
5.3 |
GO:0034377 |
plasma lipoprotein particle assembly(GO:0034377) |
| 0.4 |
4.8 |
GO:0000920 |
cell separation after cytokinesis(GO:0000920) |
| 0.4 |
0.4 |
GO:0043044 |
ATP-dependent chromatin remodeling(GO:0043044) |
| 0.4 |
0.7 |
GO:0021984 |
adenohypophysis development(GO:0021984) |
| 0.4 |
0.7 |
GO:0006297 |
nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.4 |
3.6 |
GO:0060441 |
epithelial tube branching involved in lung morphogenesis(GO:0060441) |
| 0.4 |
4.4 |
GO:0006999 |
nuclear pore organization(GO:0006999) |
| 0.4 |
0.4 |
GO:1990542 |
mitochondrial transmembrane transport(GO:1990542) |
| 0.4 |
0.4 |
GO:0070782 |
phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.4 |
0.7 |
GO:0019405 |
alditol catabolic process(GO:0019405) |
| 0.4 |
0.4 |
GO:0072602 |
interleukin-4 secretion(GO:0072602) |
| 0.4 |
1.1 |
GO:2000642 |
negative regulation of early endosome to late endosome transport(GO:2000642) |
| 0.4 |
0.4 |
GO:1904251 |
regulation of bile acid metabolic process(GO:1904251) |
| 0.4 |
1.4 |
GO:0030050 |
vesicle transport along actin filament(GO:0030050) |
| 0.4 |
2.5 |
GO:0051894 |
positive regulation of focal adhesion assembly(GO:0051894) |
| 0.4 |
1.8 |
GO:1900016 |
negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.4 |
0.4 |
GO:0021593 |
rhombomere morphogenesis(GO:0021593) |
| 0.4 |
2.1 |
GO:0031424 |
keratinization(GO:0031424) |
| 0.4 |
2.5 |
GO:0035584 |
calcium-mediated signaling using intracellular calcium source(GO:0035584) |
| 0.4 |
2.1 |
GO:0000055 |
ribosomal large subunit export from nucleus(GO:0000055) |
| 0.4 |
0.4 |
GO:0032242 |
regulation of nucleoside transport(GO:0032242) |
| 0.3 |
1.0 |
GO:0045743 |
positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.3 |
0.7 |
GO:0033210 |
leptin-mediated signaling pathway(GO:0033210) |
| 0.3 |
1.0 |
GO:2001185 |
regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
| 0.3 |
0.3 |
GO:0070989 |
oxidative demethylation(GO:0070989) |
| 0.3 |
2.4 |
GO:0051561 |
positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
| 0.3 |
2.0 |
GO:0006307 |
DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.3 |
0.3 |
GO:0032472 |
Golgi calcium ion transport(GO:0032472) |
| 0.3 |
3.1 |
GO:0060732 |
positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
| 0.3 |
1.4 |
GO:0072383 |
plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.3 |
0.3 |
GO:0090177 |
establishment of planar polarity involved in neural tube closure(GO:0090177) |
| 0.3 |
1.0 |
GO:0060056 |
mammary gland involution(GO:0060056) |
| 0.3 |
0.3 |
GO:1903377 |
negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.3 |
1.3 |
GO:0000189 |
MAPK import into nucleus(GO:0000189) |
| 0.3 |
0.7 |
GO:0031936 |
negative regulation of chromatin silencing(GO:0031936) |
| 0.3 |
3.7 |
GO:0046597 |
negative regulation of viral entry into host cell(GO:0046597) |
| 0.3 |
1.0 |
GO:0006538 |
glutamate catabolic process(GO:0006538) |
| 0.3 |
0.7 |
GO:0010039 |
response to iron ion(GO:0010039) |
| 0.3 |
2.6 |
GO:0010572 |
positive regulation of platelet activation(GO:0010572) |
| 0.3 |
0.7 |
GO:0060236 |
regulation of mitotic spindle organization(GO:0060236) |
| 0.3 |
1.0 |
GO:0044650 |
virion attachment to host cell(GO:0019062) adhesion of symbiont to host cell(GO:0044650) |
| 0.3 |
1.3 |
GO:0019321 |
pentose metabolic process(GO:0019321) |
| 0.3 |
0.7 |
GO:0048538 |
thymus development(GO:0048538) |
| 0.3 |
1.3 |
GO:0001880 |
Mullerian duct regression(GO:0001880) |
| 0.3 |
1.0 |
GO:1990046 |
positive regulation of mitochondrial DNA replication(GO:0090297) regulation of cardiolipin metabolic process(GO:1900208) positive regulation of cardiolipin metabolic process(GO:1900210) stress-induced mitochondrial fusion(GO:1990046) |
| 0.3 |
3.9 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 0.3 |
0.3 |
GO:1902807 |
negative regulation of cell cycle G1/S phase transition(GO:1902807) |
| 0.3 |
1.3 |
GO:0090132 |
tissue migration(GO:0090130) epithelium migration(GO:0090132) |
| 0.3 |
4.5 |
GO:0071229 |
cellular response to acid chemical(GO:0071229) |
| 0.3 |
2.6 |
GO:0036297 |
interstrand cross-link repair(GO:0036297) |
| 0.3 |
1.6 |
GO:1900748 |
positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.3 |
1.6 |
GO:0060297 |
regulation of sarcomere organization(GO:0060297) |
| 0.3 |
1.3 |
GO:1903288 |
regulation of potassium ion import(GO:1903286) positive regulation of potassium ion import(GO:1903288) |
| 0.3 |
1.9 |
GO:0006384 |
transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.3 |
2.2 |
GO:0042730 |
fibrinolysis(GO:0042730) |
| 0.3 |
1.9 |
GO:0070886 |
positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.3 |
0.6 |
GO:0043586 |
tongue development(GO:0043586) |
| 0.3 |
0.6 |
GO:0052428 |
modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.3 |
0.6 |
GO:0060923 |
cardiac muscle cell fate commitment(GO:0060923) |
| 0.3 |
6.2 |
GO:0035019 |
somatic stem cell population maintenance(GO:0035019) |
| 0.3 |
2.5 |
GO:0000395 |
mRNA 5'-splice site recognition(GO:0000395) |
| 0.3 |
3.1 |
GO:0070940 |
dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.3 |
0.9 |
GO:0019441 |
tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) kynurenine metabolic process(GO:0070189) |
| 0.3 |
1.2 |
GO:0046125 |
pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.3 |
2.8 |
GO:0060009 |
Sertoli cell development(GO:0060009) |
| 0.3 |
1.2 |
GO:0061339 |
establishment of monopolar cell polarity(GO:0061162) establishment or maintenance of monopolar cell polarity(GO:0061339) |
| 0.3 |
0.9 |
GO:0072429 |
response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.3 |
0.9 |
GO:0001830 |
trophectodermal cell fate commitment(GO:0001830) |
| 0.3 |
0.9 |
GO:0033615 |
mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.3 |
0.9 |
GO:1902566 |
regulation of eosinophil activation(GO:1902566) |
| 0.3 |
0.9 |
GO:0021849 |
neuroblast division in subventricular zone(GO:0021849) |
| 0.3 |
0.3 |
GO:0022613 |
ribonucleoprotein complex biogenesis(GO:0022613) |
| 0.3 |
3.6 |
GO:0031290 |
retinal ganglion cell axon guidance(GO:0031290) |
| 0.3 |
1.2 |
GO:0005981 |
regulation of glycogen catabolic process(GO:0005981) |
| 0.3 |
0.9 |
GO:0032053 |
ciliary basal body organization(GO:0032053) |
| 0.3 |
0.6 |
GO:0045041 |
protein import into mitochondrial intermembrane space(GO:0045041) |
| 0.3 |
0.6 |
GO:0071670 |
smooth muscle cell chemotaxis(GO:0071670) |
| 0.3 |
0.6 |
GO:1904569 |
regulation of selenocysteine incorporation(GO:1904569) |
| 0.3 |
1.2 |
GO:0001522 |
pseudouridine synthesis(GO:0001522) |
| 0.3 |
0.6 |
GO:0032532 |
regulation of microvillus length(GO:0032532) |
| 0.3 |
8.3 |
GO:0021591 |
ventricular system development(GO:0021591) |
| 0.3 |
1.8 |
GO:0045723 |
positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.3 |
0.3 |
GO:0034372 |
very-low-density lipoprotein particle remodeling(GO:0034372) |
| 0.3 |
0.6 |
GO:0009199 |
ribonucleoside triphosphate metabolic process(GO:0009199) |
| 0.3 |
5.3 |
GO:0043968 |
histone H2A acetylation(GO:0043968) |
| 0.3 |
28.0 |
GO:0051028 |
mRNA transport(GO:0051028) |
| 0.3 |
2.3 |
GO:0044872 |
lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.3 |
0.6 |
GO:0014816 |
skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.3 |
0.6 |
GO:1901724 |
positive regulation of cell proliferation involved in kidney development(GO:1901724) |
| 0.3 |
0.9 |
GO:0090370 |
negative regulation of cholesterol efflux(GO:0090370) |
| 0.3 |
4.0 |
GO:2000816 |
negative regulation of mitotic metaphase/anaphase transition(GO:0045841) mitotic spindle checkpoint(GO:0071174) negative regulation of metaphase/anaphase transition of cell cycle(GO:1902100) negative regulation of mitotic sister chromatid separation(GO:2000816) |
| 0.3 |
2.0 |
GO:1903298 |
regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
| 0.3 |
1.1 |
GO:0070314 |
G1 to G0 transition(GO:0070314) |
| 0.3 |
1.1 |
GO:0042167 |
heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.3 |
0.3 |
GO:0060762 |
regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
| 0.3 |
1.4 |
GO:0040031 |
snRNA modification(GO:0040031) |
| 0.3 |
0.9 |
GO:0060065 |
uterus development(GO:0060065) |
| 0.3 |
0.8 |
GO:0061537 |
glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.3 |
1.7 |
GO:0032897 |
negative regulation of viral transcription(GO:0032897) |
| 0.3 |
0.3 |
GO:2000508 |
regulation of dendritic cell chemotaxis(GO:2000508) positive regulation of dendritic cell chemotaxis(GO:2000510) |
| 0.3 |
1.1 |
GO:0006438 |
valyl-tRNA aminoacylation(GO:0006438) |
| 0.3 |
0.8 |
GO:0090086 |
negative regulation of protein deubiquitination(GO:0090086) |
| 0.3 |
0.6 |
GO:0035964 |
COPI-coated vesicle budding(GO:0035964) |
| 0.3 |
1.7 |
GO:0035735 |
intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.3 |
0.6 |
GO:0001774 |
microglial cell activation(GO:0001774) |
| 0.3 |
1.1 |
GO:0015888 |
thiamine transport(GO:0015888) |
| 0.3 |
0.3 |
GO:0035413 |
positive regulation of catenin import into nucleus(GO:0035413) |
| 0.3 |
0.8 |
GO:0035616 |
histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.3 |
1.4 |
GO:0034142 |
toll-like receptor 4 signaling pathway(GO:0034142) |
| 0.3 |
0.5 |
GO:0061743 |
motor learning(GO:0061743) |
| 0.3 |
6.0 |
GO:0043171 |
peptide catabolic process(GO:0043171) |
| 0.3 |
1.1 |
GO:0045578 |
negative regulation of B cell differentiation(GO:0045578) |
| 0.3 |
0.8 |
GO:0036444 |
calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.3 |
1.1 |
GO:1900220 |
semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.3 |
2.2 |
GO:0006020 |
inositol metabolic process(GO:0006020) |
| 0.3 |
2.4 |
GO:1900027 |
regulation of ruffle assembly(GO:1900027) |
| 0.3 |
0.8 |
GO:1904936 |
cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 0.3 |
2.9 |
GO:0032060 |
bleb assembly(GO:0032060) |
| 0.3 |
0.3 |
GO:0045089 |
positive regulation of innate immune response(GO:0045089) |
| 0.3 |
0.8 |
GO:0060334 |
regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
| 0.3 |
0.5 |
GO:0033860 |
regulation of NAD(P)H oxidase activity(GO:0033860) |
| 0.3 |
0.8 |
GO:1902895 |
positive regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902895) |
| 0.3 |
0.3 |
GO:1904591 |
positive regulation of protein import(GO:1904591) |
| 0.3 |
4.2 |
GO:0042753 |
positive regulation of circadian rhythm(GO:0042753) |
| 0.3 |
0.5 |
GO:0043615 |
astrocyte cell migration(GO:0043615) |
| 0.3 |
0.8 |
GO:0019065 |
receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.3 |
1.0 |
GO:0002043 |
blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
| 0.3 |
2.1 |
GO:0051574 |
positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.3 |
0.5 |
GO:0051547 |
keratinocyte migration(GO:0051546) regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
| 0.3 |
2.1 |
GO:0042745 |
circadian sleep/wake cycle(GO:0042745) |
| 0.3 |
0.5 |
GO:0002069 |
columnar/cuboidal epithelial cell maturation(GO:0002069) |
| 0.3 |
1.3 |
GO:0050667 |
homocysteine metabolic process(GO:0050667) |
| 0.3 |
0.8 |
GO:0048312 |
intracellular distribution of mitochondria(GO:0048312) |
| 0.3 |
2.1 |
GO:0045019 |
negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
| 0.3 |
0.3 |
GO:0071600 |
otic vesicle morphogenesis(GO:0071600) |
| 0.3 |
0.8 |
GO:1990034 |
calcium ion export from cell(GO:1990034) |
| 0.3 |
0.8 |
GO:0035973 |
aggrephagy(GO:0035973) |
| 0.3 |
2.0 |
GO:0006013 |
mannose metabolic process(GO:0006013) |
| 0.3 |
0.8 |
GO:0006338 |
chromatin remodeling(GO:0006338) |
| 0.3 |
2.3 |
GO:0002011 |
morphogenesis of an epithelial sheet(GO:0002011) |
| 0.3 |
1.8 |
GO:2000811 |
negative regulation of anoikis(GO:2000811) |
| 0.3 |
2.3 |
GO:0097094 |
craniofacial suture morphogenesis(GO:0097094) |
| 0.3 |
0.3 |
GO:0060821 |
inactivation of X chromosome by DNA methylation(GO:0060821) |
| 0.3 |
1.0 |
GO:2000346 |
negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.3 |
1.0 |
GO:0036342 |
post-anal tail morphogenesis(GO:0036342) |
| 0.3 |
1.5 |
GO:0045668 |
negative regulation of osteoblast differentiation(GO:0045668) |
| 0.3 |
5.3 |
GO:0045540 |
regulation of cholesterol biosynthetic process(GO:0045540) |
| 0.3 |
0.5 |
GO:1904879 |
positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.3 |
2.0 |
GO:0000052 |
citrulline metabolic process(GO:0000052) |
| 0.3 |
1.0 |
GO:0007144 |
female meiosis I(GO:0007144) |
| 0.3 |
3.3 |
GO:0042347 |
negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.2 |
1.2 |
GO:0014886 |
transition between slow and fast fiber(GO:0014886) |
| 0.2 |
0.7 |
GO:0031639 |
plasminogen activation(GO:0031639) |
| 0.2 |
0.7 |
GO:0033313 |
meiotic cell cycle checkpoint(GO:0033313) |
| 0.2 |
3.2 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.2 |
1.2 |
GO:0009396 |
folic acid-containing compound biosynthetic process(GO:0009396) |
| 0.2 |
0.2 |
GO:0050862 |
positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.2 |
1.5 |
GO:0007221 |
positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.2 |
11.3 |
GO:0043966 |
histone H3 acetylation(GO:0043966) |
| 0.2 |
1.7 |
GO:0045899 |
positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.2 |
0.5 |
GO:1904154 |
positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.2 |
1.2 |
GO:0048199 |
vesicle targeting, to, from or within Golgi(GO:0048199) |
| 0.2 |
0.7 |
GO:1903251 |
multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.2 |
0.2 |
GO:0046166 |
glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 0.2 |
1.2 |
GO:0032310 |
prostaglandin secretion(GO:0032310) |
| 0.2 |
2.9 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.2 |
3.9 |
GO:0006613 |
cotranslational protein targeting to membrane(GO:0006613) |
| 0.2 |
1.7 |
GO:1903333 |
negative regulation of protein folding(GO:1903333) |
| 0.2 |
0.2 |
GO:0006106 |
fumarate metabolic process(GO:0006106) |
| 0.2 |
0.7 |
GO:0006553 |
lysine metabolic process(GO:0006553) |
| 0.2 |
1.0 |
GO:0035563 |
positive regulation of chromatin binding(GO:0035563) |
| 0.2 |
1.2 |
GO:0048680 |
positive regulation of axon regeneration(GO:0048680) |
| 0.2 |
3.1 |
GO:0043277 |
apoptotic cell clearance(GO:0043277) |
| 0.2 |
0.7 |
GO:2000179 |
positive regulation of neural precursor cell proliferation(GO:2000179) |
| 0.2 |
1.4 |
GO:0006177 |
GMP biosynthetic process(GO:0006177) |
| 0.2 |
0.2 |
GO:1901563 |
response to camptothecin(GO:1901563) |
| 0.2 |
3.3 |
GO:0042059 |
negative regulation of epidermal growth factor receptor signaling pathway(GO:0042059) |
| 0.2 |
0.7 |
GO:0031069 |
hair follicle morphogenesis(GO:0031069) |
| 0.2 |
1.0 |
GO:0006741 |
NADP biosynthetic process(GO:0006741) |
| 0.2 |
0.5 |
GO:0050872 |
white fat cell differentiation(GO:0050872) |
| 0.2 |
0.7 |
GO:0048665 |
neuron fate specification(GO:0048665) |
| 0.2 |
0.7 |
GO:0044381 |
glucose import in response to insulin stimulus(GO:0044381) regulation of glucose import in response to insulin stimulus(GO:2001273) |
| 0.2 |
0.2 |
GO:0030997 |
regulation of centriole-centriole cohesion(GO:0030997) |
| 0.2 |
1.4 |
GO:0006824 |
cobalt ion transport(GO:0006824) |
| 0.2 |
4.9 |
GO:0002088 |
lens development in camera-type eye(GO:0002088) |
| 0.2 |
3.1 |
GO:0006654 |
phosphatidic acid biosynthetic process(GO:0006654) phosphatidic acid metabolic process(GO:0046473) |
| 0.2 |
0.2 |
GO:0035562 |
negative regulation of chromatin binding(GO:0035562) |
| 0.2 |
0.7 |
GO:0048702 |
embryonic neurocranium morphogenesis(GO:0048702) |
| 0.2 |
0.7 |
GO:0019276 |
UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.2 |
1.8 |
GO:2000254 |
regulation of male germ cell proliferation(GO:2000254) |
| 0.2 |
1.1 |
GO:0032506 |
cytokinetic process(GO:0032506) |
| 0.2 |
0.7 |
GO:0021691 |
cerebellar Purkinje cell layer maturation(GO:0021691) |
| 0.2 |
2.1 |
GO:0071260 |
cellular response to mechanical stimulus(GO:0071260) |
| 0.2 |
1.1 |
GO:0002318 |
myeloid progenitor cell differentiation(GO:0002318) |
| 0.2 |
0.2 |
GO:0045627 |
positive regulation of T-helper 1 cell differentiation(GO:0045627) |
| 0.2 |
2.0 |
GO:0009148 |
CTP biosynthetic process(GO:0006241) pyrimidine nucleoside triphosphate metabolic process(GO:0009147) pyrimidine nucleoside triphosphate biosynthetic process(GO:0009148) pyrimidine ribonucleoside triphosphate biosynthetic process(GO:0009209) CTP metabolic process(GO:0046036) |
| 0.2 |
2.2 |
GO:0050942 |
positive regulation of developmental pigmentation(GO:0048087) positive regulation of pigment cell differentiation(GO:0050942) |
| 0.2 |
1.6 |
GO:0000737 |
DNA catabolic process, endonucleolytic(GO:0000737) |
| 0.2 |
0.2 |
GO:0032058 |
positive regulation of translational initiation in response to stress(GO:0032058) |
| 0.2 |
1.8 |
GO:0051451 |
myoblast migration(GO:0051451) |
| 0.2 |
0.9 |
GO:0036506 |
maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.2 |
0.7 |
GO:2001170 |
negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.2 |
1.3 |
GO:0035020 |
regulation of Rac protein signal transduction(GO:0035020) |
| 0.2 |
2.0 |
GO:0010761 |
fibroblast migration(GO:0010761) |
| 0.2 |
3.0 |
GO:0033194 |
response to hydroperoxide(GO:0033194) |
| 0.2 |
0.2 |
GO:0007161 |
calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.2 |
0.6 |
GO:0006578 |
amino-acid betaine biosynthetic process(GO:0006578) |
| 0.2 |
0.4 |
GO:0000098 |
sulfur amino acid catabolic process(GO:0000098) |
| 0.2 |
0.9 |
GO:0061515 |
myeloid cell development(GO:0061515) |
| 0.2 |
0.2 |
GO:0038061 |
NIK/NF-kappaB signaling(GO:0038061) |
| 0.2 |
0.4 |
GO:0045414 |
regulation of interleukin-8 biosynthetic process(GO:0045414) |
| 0.2 |
1.3 |
GO:0046688 |
response to copper ion(GO:0046688) |
| 0.2 |
1.7 |
GO:0015074 |
DNA integration(GO:0015074) |
| 0.2 |
0.4 |
GO:0032066 |
nucleolus to nucleoplasm transport(GO:0032066) |
| 0.2 |
1.7 |
GO:0006924 |
activation-induced cell death of T cells(GO:0006924) |
| 0.2 |
0.6 |
GO:0031086 |
nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.2 |
0.2 |
GO:0040019 |
positive regulation of embryonic development(GO:0040019) |
| 0.2 |
0.6 |
GO:0006627 |
protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.2 |
5.2 |
GO:0034605 |
cellular response to heat(GO:0034605) |
| 0.2 |
2.3 |
GO:0006907 |
pinocytosis(GO:0006907) |
| 0.2 |
0.2 |
GO:2000275 |
regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
| 0.2 |
0.6 |
GO:0014054 |
positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
| 0.2 |
2.3 |
GO:0050000 |
chromosome localization(GO:0050000) |
| 0.2 |
2.4 |
GO:0048642 |
negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.2 |
0.2 |
GO:0032510 |
endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
| 0.2 |
0.4 |
GO:0019255 |
glucose 1-phosphate metabolic process(GO:0019255) |
| 0.2 |
1.8 |
GO:0048747 |
muscle fiber development(GO:0048747) |
| 0.2 |
0.2 |
GO:0003222 |
ventricular trabecula myocardium morphogenesis(GO:0003222) |
| 0.2 |
1.0 |
GO:0070932 |
histone H3 deacetylation(GO:0070932) |
| 0.2 |
0.2 |
GO:0051305 |
meiotic chromosome movement towards spindle pole(GO:0016344) meiotic cytokinesis(GO:0033206) chromosome movement towards spindle pole(GO:0051305) |
| 0.2 |
0.2 |
GO:0000389 |
mRNA 3'-splice site recognition(GO:0000389) |
| 0.2 |
0.8 |
GO:2000601 |
positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.2 |
2.8 |
GO:0046039 |
GTP metabolic process(GO:0046039) |
| 0.2 |
0.2 |
GO:0060084 |
synaptic transmission involved in micturition(GO:0060084) |
| 0.2 |
2.2 |
GO:0042552 |
myelination(GO:0042552) |
| 0.2 |
0.2 |
GO:0061687 |
detoxification of inorganic compound(GO:0061687) |
| 0.2 |
2.0 |
GO:0071257 |
cellular response to electrical stimulus(GO:0071257) |
| 0.2 |
1.4 |
GO:0060340 |
positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
| 0.2 |
0.8 |
GO:1902309 |
negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.2 |
0.2 |
GO:0010557 |
positive regulation of macromolecule biosynthetic process(GO:0010557) |
| 0.2 |
0.4 |
GO:0007056 |
spindle assembly involved in female meiosis(GO:0007056) |
| 0.2 |
0.6 |
GO:0000350 |
generation of catalytic spliceosome for second transesterification step(GO:0000350) |
| 0.2 |
0.2 |
GO:0014722 |
regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.2 |
1.0 |
GO:0097368 |
establishment of Sertoli cell barrier(GO:0097368) |
| 0.2 |
0.4 |
GO:0034393 |
positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.2 |
1.0 |
GO:0051131 |
chaperone-mediated protein complex assembly(GO:0051131) |
| 0.2 |
2.7 |
GO:0000338 |
protein deneddylation(GO:0000338) |
| 0.2 |
1.0 |
GO:0009169 |
purine nucleoside monophosphate catabolic process(GO:0009128) ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
| 0.2 |
5.5 |
GO:0060976 |
coronary vasculature development(GO:0060976) |
| 0.2 |
2.3 |
GO:0018342 |
protein prenylation(GO:0018342) prenylation(GO:0097354) |
| 0.2 |
0.6 |
GO:0051770 |
positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
| 0.2 |
1.4 |
GO:0007099 |
centriole replication(GO:0007099) |
| 0.2 |
1.4 |
GO:0010883 |
regulation of lipid storage(GO:0010883) |
| 0.2 |
0.6 |
GO:2000983 |
regulation of ATP citrate synthase activity(GO:2000983) negative regulation of ATP citrate synthase activity(GO:2000984) |
| 0.2 |
1.7 |
GO:0007252 |
I-kappaB phosphorylation(GO:0007252) |
| 0.2 |
0.2 |
GO:0043517 |
positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.2 |
0.8 |
GO:0006851 |
mitochondrial calcium ion transport(GO:0006851) |
| 0.2 |
5.7 |
GO:0032835 |
glomerulus development(GO:0032835) |
| 0.2 |
1.3 |
GO:0006337 |
nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
| 0.2 |
1.0 |
GO:0001887 |
selenium compound metabolic process(GO:0001887) |
| 0.2 |
0.2 |
GO:0033005 |
positive regulation of mast cell activation(GO:0033005) |
| 0.2 |
1.1 |
GO:0015817 |
histidine transport(GO:0015817) |
| 0.2 |
5.0 |
GO:0018345 |
protein palmitoylation(GO:0018345) |
| 0.2 |
0.4 |
GO:0045583 |
regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.2 |
1.7 |
GO:0010718 |
positive regulation of epithelial to mesenchymal transition(GO:0010718) |
| 0.2 |
0.2 |
GO:0090035 |
regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
| 0.2 |
1.5 |
GO:0080182 |
histone H3-K4 trimethylation(GO:0080182) |
| 0.2 |
0.7 |
GO:0070589 |
cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule metabolic process(GO:0044036) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) cell wall organization or biogenesis(GO:0071554) |
| 0.2 |
0.6 |
GO:0097070 |
ductus arteriosus closure(GO:0097070) |
| 0.2 |
0.2 |
GO:0051306 |
mitotic sister chromatid separation(GO:0051306) |
| 0.2 |
1.6 |
GO:0030901 |
midbrain development(GO:0030901) |
| 0.2 |
0.2 |
GO:0046900 |
tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.2 |
1.1 |
GO:1903755 |
regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.2 |
1.4 |
GO:0046349 |
amino sugar biosynthetic process(GO:0046349) |
| 0.2 |
0.5 |
GO:0001885 |
endothelial cell development(GO:0001885) |
| 0.2 |
0.5 |
GO:0002457 |
T cell antigen processing and presentation(GO:0002457) |
| 0.2 |
0.7 |
GO:1902916 |
positive regulation of protein polyubiquitination(GO:1902916) |
| 0.2 |
3.9 |
GO:1902743 |
regulation of lamellipodium organization(GO:1902743) |
| 0.2 |
0.5 |
GO:0097401 |
synaptic vesicle lumen acidification(GO:0097401) |
| 0.2 |
1.6 |
GO:0051893 |
regulation of focal adhesion assembly(GO:0051893) regulation of cell-substrate junction assembly(GO:0090109) regulation of adherens junction organization(GO:1903391) |
| 0.2 |
0.4 |
GO:0000054 |
ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
| 0.2 |
0.7 |
GO:1903392 |
negative regulation of adherens junction organization(GO:1903392) |
| 0.2 |
1.8 |
GO:0045947 |
negative regulation of translational initiation(GO:0045947) |
| 0.2 |
2.8 |
GO:0010965 |
regulation of mitotic sister chromatid separation(GO:0010965) |
| 0.2 |
4.6 |
GO:0006911 |
phagocytosis, engulfment(GO:0006911) |
| 0.2 |
0.9 |
GO:0033567 |
DNA replication, Okazaki fragment processing(GO:0033567) |
| 0.2 |
0.7 |
GO:0006517 |
protein deglycosylation(GO:0006517) |
| 0.2 |
0.7 |
GO:0042711 |
maternal behavior(GO:0042711) |
| 0.2 |
0.2 |
GO:0002339 |
B cell selection(GO:0002339) |
| 0.2 |
0.5 |
GO:0006435 |
threonyl-tRNA aminoacylation(GO:0006435) |
| 0.2 |
0.7 |
GO:0030316 |
osteoclast differentiation(GO:0030316) |
| 0.2 |
0.2 |
GO:0006702 |
androgen biosynthetic process(GO:0006702) |
| 0.2 |
1.4 |
GO:0006984 |
ER-nucleus signaling pathway(GO:0006984) |
| 0.2 |
1.0 |
GO:0006621 |
protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.2 |
0.2 |
GO:0055118 |
negative regulation of cardiac muscle contraction(GO:0055118) |
| 0.2 |
5.5 |
GO:0010389 |
regulation of G2/M transition of mitotic cell cycle(GO:0010389) |
| 0.2 |
1.5 |
GO:0006415 |
translational termination(GO:0006415) |
| 0.2 |
0.5 |
GO:0043323 |
positive regulation of natural killer cell degranulation(GO:0043323) |
| 0.2 |
0.2 |
GO:2001044 |
regulation of integrin-mediated signaling pathway(GO:2001044) |
| 0.2 |
1.2 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.2 |
0.8 |
GO:0038032 |
termination of G-protein coupled receptor signaling pathway(GO:0038032) |
| 0.2 |
0.8 |
GO:0071157 |
negative regulation of cell cycle arrest(GO:0071157) |
| 0.2 |
0.5 |
GO:0006959 |
humoral immune response(GO:0006959) |
| 0.2 |
1.0 |
GO:0007020 |
microtubule nucleation(GO:0007020) |
| 0.2 |
0.5 |
GO:0046015 |
regulation of transcription by glucose(GO:0046015) |
| 0.2 |
0.8 |
GO:0043518 |
negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.2 |
0.3 |
GO:0033762 |
response to glucagon(GO:0033762) |
| 0.2 |
1.0 |
GO:0016601 |
Rac protein signal transduction(GO:0016601) |
| 0.2 |
1.0 |
GO:0060055 |
angiogenesis involved in wound healing(GO:0060055) |
| 0.2 |
0.5 |
GO:1903966 |
monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.2 |
1.2 |
GO:0000185 |
activation of MAPKKK activity(GO:0000185) |
| 0.2 |
0.5 |
GO:0016078 |
tRNA catabolic process(GO:0016078) |
| 0.2 |
0.5 |
GO:0046381 |
CMP-N-acetylneuraminate metabolic process(GO:0046381) |
| 0.2 |
1.9 |
GO:0045662 |
negative regulation of myoblast differentiation(GO:0045662) |
| 0.2 |
3.2 |
GO:1902850 |
mitotic spindle assembly(GO:0090307) microtubule cytoskeleton organization involved in mitosis(GO:1902850) |
| 0.2 |
0.3 |
GO:0060872 |
semicircular canal development(GO:0060872) |
| 0.2 |
0.8 |
GO:0006681 |
galactosylceramide metabolic process(GO:0006681) galactolipid metabolic process(GO:0019374) |
| 0.2 |
0.5 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.2 |
1.0 |
GO:0016925 |
protein sumoylation(GO:0016925) |
| 0.2 |
5.1 |
GO:0070613 |
regulation of protein processing(GO:0070613) |
| 0.2 |
1.1 |
GO:0001773 |
myeloid dendritic cell activation(GO:0001773) myeloid dendritic cell differentiation(GO:0043011) |
| 0.2 |
2.4 |
GO:1902622 |
regulation of neutrophil migration(GO:1902622) |
| 0.2 |
1.3 |
GO:0031645 |
negative regulation of neurological system process(GO:0031645) |
| 0.2 |
1.0 |
GO:0002467 |
germinal center formation(GO:0002467) |
| 0.2 |
0.5 |
GO:0016540 |
protein autoprocessing(GO:0016540) |
| 0.2 |
0.9 |
GO:0006560 |
proline metabolic process(GO:0006560) |
| 0.2 |
1.3 |
GO:0034122 |
negative regulation of toll-like receptor signaling pathway(GO:0034122) |
| 0.2 |
0.2 |
GO:1900368 |
regulation of RNA interference(GO:1900368) |
| 0.2 |
1.6 |
GO:2001256 |
regulation of store-operated calcium entry(GO:2001256) |
| 0.2 |
0.2 |
GO:2000303 |
regulation of sphingolipid biosynthetic process(GO:0090153) regulation of membrane lipid metabolic process(GO:1905038) regulation of ceramide biosynthetic process(GO:2000303) |
| 0.2 |
2.2 |
GO:0035329 |
hippo signaling(GO:0035329) |
| 0.2 |
1.7 |
GO:0070193 |
synaptonemal complex organization(GO:0070193) |
| 0.2 |
1.1 |
GO:0046697 |
decidualization(GO:0046697) |
| 0.2 |
4.3 |
GO:0006783 |
heme biosynthetic process(GO:0006783) |
| 0.2 |
0.6 |
GO:0071596 |
ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.2 |
1.8 |
GO:1904293 |
negative regulation of ERAD pathway(GO:1904293) |
| 0.2 |
0.9 |
GO:0036158 |
outer dynein arm assembly(GO:0036158) |
| 0.2 |
4.6 |
GO:0006493 |
protein O-linked glycosylation(GO:0006493) |
| 0.2 |
0.3 |
GO:0071476 |
hypotonic response(GO:0006971) cellular hypotonic response(GO:0071476) |
| 0.2 |
1.2 |
GO:1902042 |
negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
| 0.2 |
1.8 |
GO:0000394 |
RNA splicing, via endonucleolytic cleavage and ligation(GO:0000394) |
| 0.2 |
1.4 |
GO:0051127 |
positive regulation of actin nucleation(GO:0051127) |
| 0.2 |
1.4 |
GO:0009303 |
rRNA transcription(GO:0009303) |
| 0.2 |
0.5 |
GO:0035067 |
negative regulation of histone acetylation(GO:0035067) |
| 0.2 |
0.3 |
GO:0031133 |
regulation of axon diameter(GO:0031133) regulation of cell projection size(GO:0032536) intermediate filament bundle assembly(GO:0045110) |
| 0.1 |
0.4 |
GO:0006361 |
transcription initiation from RNA polymerase I promoter(GO:0006361) |
| 0.1 |
0.6 |
GO:0061072 |
iris morphogenesis(GO:0061072) |
| 0.1 |
1.2 |
GO:0033233 |
regulation of protein sumoylation(GO:0033233) |
| 0.1 |
0.6 |
GO:0009950 |
dorsal/ventral axis specification(GO:0009950) |
| 0.1 |
0.3 |
GO:0070601 |
centromeric sister chromatid cohesion(GO:0070601) |
| 0.1 |
3.8 |
GO:0008156 |
negative regulation of DNA replication(GO:0008156) |
| 0.1 |
0.1 |
GO:1902455 |
negative regulation of stem cell population maintenance(GO:1902455) |
| 0.1 |
1.5 |
GO:0006353 |
DNA-templated transcription, termination(GO:0006353) |
| 0.1 |
3.7 |
GO:0051225 |
spindle assembly(GO:0051225) |
| 0.1 |
0.9 |
GO:1990776 |
cellular response to angiotensin(GO:1904385) response to angiotensin(GO:1990776) |
| 0.1 |
0.3 |
GO:0033280 |
response to vitamin D(GO:0033280) |
| 0.1 |
0.6 |
GO:0097494 |
regulation of vesicle size(GO:0097494) |
| 0.1 |
0.6 |
GO:0051790 |
short-chain fatty acid biosynthetic process(GO:0051790) |
| 0.1 |
0.3 |
GO:0001306 |
age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
| 0.1 |
0.1 |
GO:0008611 |
ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
| 0.1 |
0.6 |
GO:0071475 |
cellular hyperosmotic salinity response(GO:0071475) |
| 0.1 |
0.3 |
GO:1902237 |
positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.1 |
1.3 |
GO:0034508 |
centromere complex assembly(GO:0034508) |
| 0.1 |
1.3 |
GO:0007213 |
G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
| 0.1 |
0.1 |
GO:0003094 |
glomerular filtration(GO:0003094) |
| 0.1 |
0.1 |
GO:0046470 |
phosphatidylcholine metabolic process(GO:0046470) |
| 0.1 |
1.7 |
GO:0007266 |
Rho protein signal transduction(GO:0007266) |
| 0.1 |
0.1 |
GO:0090166 |
Golgi disassembly(GO:0090166) |
| 0.1 |
4.4 |
GO:0006446 |
regulation of translational initiation(GO:0006446) |
| 0.1 |
1.4 |
GO:0005980 |
polysaccharide catabolic process(GO:0000272) glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
| 0.1 |
2.6 |
GO:0010842 |
retina layer formation(GO:0010842) |
| 0.1 |
7.6 |
GO:0006413 |
translational initiation(GO:0006413) |
| 0.1 |
0.7 |
GO:0007016 |
cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.1 |
0.6 |
GO:0071391 |
cellular response to estrogen stimulus(GO:0071391) |
| 0.1 |
0.6 |
GO:1903077 |
negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
| 0.1 |
0.7 |
GO:0009235 |
cobalamin metabolic process(GO:0009235) |
| 0.1 |
0.4 |
GO:0001667 |
ameboidal-type cell migration(GO:0001667) |
| 0.1 |
3.4 |
GO:0006073 |
glycogen metabolic process(GO:0005977) cellular glucan metabolic process(GO:0006073) glucan metabolic process(GO:0044042) |
| 0.1 |
1.3 |
GO:0070475 |
rRNA base methylation(GO:0070475) |
| 0.1 |
4.6 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.1 |
1.4 |
GO:0007368 |
determination of left/right symmetry(GO:0007368) |
| 0.1 |
0.1 |
GO:0060023 |
soft palate development(GO:0060023) |
| 0.1 |
0.8 |
GO:0060716 |
labyrinthine layer blood vessel development(GO:0060716) |
| 0.1 |
0.5 |
GO:0046135 |
pyrimidine ribonucleoside metabolic process(GO:0046131) pyrimidine ribonucleoside catabolic process(GO:0046133) pyrimidine nucleoside catabolic process(GO:0046135) |
| 0.1 |
0.8 |
GO:0032463 |
negative regulation of protein homooligomerization(GO:0032463) |
| 0.1 |
1.2 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.1 |
0.3 |
GO:0051252 |
regulation of RNA metabolic process(GO:0051252) |
| 0.1 |
0.3 |
GO:0035280 |
miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) small RNA loading onto RISC(GO:0070922) |
| 0.1 |
0.8 |
GO:0039703 |
viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.1 |
0.5 |
GO:0032511 |
late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.1 |
0.4 |
GO:0006071 |
glycerol metabolic process(GO:0006071) |
| 0.1 |
0.1 |
GO:0010658 |
striated muscle cell apoptotic process(GO:0010658) |
| 0.1 |
0.4 |
GO:1904491 |
protein localization to ciliary transition zone(GO:1904491) |
| 0.1 |
0.4 |
GO:0042574 |
retinal metabolic process(GO:0042574) |
| 0.1 |
0.7 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 |
1.3 |
GO:0034244 |
negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.1 |
0.1 |
GO:0000963 |
mitochondrial RNA processing(GO:0000963) |
| 0.1 |
0.9 |
GO:0034383 |
low-density lipoprotein particle clearance(GO:0034383) |
| 0.1 |
0.5 |
GO:0034720 |
histone H3-K4 demethylation(GO:0034720) |
| 0.1 |
0.3 |
GO:0021698 |
cerebellar cortex structural organization(GO:0021698) |
| 0.1 |
0.9 |
GO:0031065 |
positive regulation of histone deacetylation(GO:0031065) |
| 0.1 |
0.4 |
GO:0097309 |
cap1 mRNA methylation(GO:0097309) |
| 0.1 |
1.4 |
GO:0000463 |
maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.1 |
1.3 |
GO:0050892 |
intestinal absorption(GO:0050892) |
| 0.1 |
0.4 |
GO:0019074 |
viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
| 0.1 |
0.4 |
GO:0001946 |
lymphangiogenesis(GO:0001946) lymph vessel morphogenesis(GO:0036303) |
| 0.1 |
0.7 |
GO:0007263 |
nitric oxide mediated signal transduction(GO:0007263) |
| 0.1 |
2.5 |
GO:0048661 |
positive regulation of smooth muscle cell proliferation(GO:0048661) |
| 0.1 |
0.2 |
GO:0031440 |
regulation of mRNA 3'-end processing(GO:0031440) |
| 0.1 |
0.2 |
GO:0007182 |
common-partner SMAD protein phosphorylation(GO:0007182) |
| 0.1 |
0.2 |
GO:0006278 |
RNA-dependent DNA biosynthetic process(GO:0006278) telomere maintenance via telomerase(GO:0007004) |
| 0.1 |
0.5 |
GO:0006451 |
selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.1 |
0.8 |
GO:0006107 |
oxaloacetate metabolic process(GO:0006107) |
| 0.1 |
0.2 |
GO:0060330 |
regulation of response to interferon-gamma(GO:0060330) |
| 0.1 |
1.2 |
GO:0010603 |
regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
| 0.1 |
2.9 |
GO:0071230 |
cellular response to amino acid stimulus(GO:0071230) |
| 0.1 |
1.0 |
GO:0090435 |
protein localization to nuclear envelope(GO:0090435) |
| 0.1 |
0.4 |
GO:0042275 |
error-free postreplication DNA repair(GO:0042275) |
| 0.1 |
0.4 |
GO:0048254 |
snoRNA localization(GO:0048254) |
| 0.1 |
0.4 |
GO:0046398 |
UDP-glucuronate metabolic process(GO:0046398) |
| 0.1 |
0.6 |
GO:0070125 |
mitochondrial translational elongation(GO:0070125) |
| 0.1 |
0.9 |
GO:0033211 |
adiponectin-activated signaling pathway(GO:0033211) |
| 0.1 |
0.2 |
GO:0071787 |
endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.1 |
0.3 |
GO:0035999 |
tetrahydrofolate interconversion(GO:0035999) |
| 0.1 |
0.5 |
GO:2000678 |
negative regulation of transcription regulatory region DNA binding(GO:2000678) |
| 0.1 |
0.2 |
GO:0070966 |
nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.1 |
0.1 |
GO:0070827 |
chromatin maintenance(GO:0070827) |
| 0.1 |
0.1 |
GO:1901857 |
positive regulation of cellular respiration(GO:1901857) |
| 0.1 |
0.5 |
GO:0038063 |
collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) collagen-activated signaling pathway(GO:0038065) |
| 0.1 |
0.9 |
GO:0048385 |
regulation of retinoic acid receptor signaling pathway(GO:0048385) |
| 0.1 |
1.1 |
GO:1904355 |
positive regulation of telomere capping(GO:1904355) |
| 0.1 |
0.2 |
GO:2000643 |
positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.1 |
0.3 |
GO:0006097 |
glyoxylate cycle(GO:0006097) |
| 0.1 |
0.8 |
GO:0032780 |
negative regulation of ATPase activity(GO:0032780) |
| 0.1 |
0.7 |
GO:0048745 |
smooth muscle tissue development(GO:0048745) |
| 0.1 |
0.5 |
GO:0045830 |
positive regulation of isotype switching(GO:0045830) |
| 0.1 |
0.2 |
GO:2000648 |
positive regulation of stem cell proliferation(GO:2000648) |
| 0.1 |
0.1 |
GO:0072132 |
mesenchyme morphogenesis(GO:0072132) |
| 0.1 |
1.7 |
GO:0016180 |
snRNA processing(GO:0016180) |
| 0.1 |
0.4 |
GO:0044380 |
protein localization to cytoskeleton(GO:0044380) |
| 0.1 |
0.4 |
GO:0051602 |
response to electrical stimulus(GO:0051602) |
| 0.1 |
0.3 |
GO:0002121 |
inter-male aggressive behavior(GO:0002121) |
| 0.1 |
0.2 |
GO:0090501 |
RNA phosphodiester bond hydrolysis(GO:0090501) |
| 0.1 |
1.3 |
GO:0006103 |
2-oxoglutarate metabolic process(GO:0006103) |
| 0.1 |
0.1 |
GO:0015910 |
peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.1 |
0.3 |
GO:0034453 |
microtubule anchoring(GO:0034453) |
| 0.1 |
1.3 |
GO:0034219 |
carbohydrate transmembrane transport(GO:0034219) |
| 0.1 |
0.1 |
GO:0046101 |
hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
| 0.1 |
0.7 |
GO:0033209 |
tumor necrosis factor-mediated signaling pathway(GO:0033209) |
| 0.1 |
0.7 |
GO:0031119 |
tRNA pseudouridine synthesis(GO:0031119) |
| 0.1 |
0.6 |
GO:0000103 |
sulfate assimilation(GO:0000103) |
| 0.1 |
0.1 |
GO:0070813 |
hydrogen sulfide metabolic process(GO:0070813) |
| 0.1 |
0.3 |
GO:0006421 |
asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.1 |
0.3 |
GO:0006428 |
isoleucyl-tRNA aminoacylation(GO:0006428) |
| 0.1 |
0.5 |
GO:0010359 |
regulation of anion channel activity(GO:0010359) |
| 0.1 |
0.1 |
GO:0090329 |
regulation of DNA-dependent DNA replication(GO:0090329) |
| 0.1 |
0.4 |
GO:0038128 |
ERBB2 signaling pathway(GO:0038128) |
| 0.1 |
0.2 |
GO:0042219 |
cellular modified amino acid catabolic process(GO:0042219) |
| 0.1 |
0.3 |
GO:0019673 |
GDP-mannose metabolic process(GO:0019673) |
| 0.1 |
0.2 |
GO:1902715 |
positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.1 |
0.8 |
GO:0033523 |
histone H2B ubiquitination(GO:0033523) |
| 0.1 |
0.2 |
GO:0007217 |
tachykinin receptor signaling pathway(GO:0007217) |
| 0.1 |
1.3 |
GO:0001913 |
T cell mediated cytotoxicity(GO:0001913) |
| 0.1 |
0.3 |
GO:0001937 |
negative regulation of endothelial cell proliferation(GO:0001937) |
| 0.1 |
0.4 |
GO:1900363 |
regulation of mRNA polyadenylation(GO:1900363) |
| 0.1 |
0.4 |
GO:1902224 |
cellular ketone body metabolic process(GO:0046950) ketone body metabolic process(GO:1902224) |
| 0.1 |
0.5 |
GO:0060837 |
blood vessel endothelial cell differentiation(GO:0060837) |
| 0.1 |
0.3 |
GO:1990403 |
embryonic brain development(GO:1990403) |
| 0.1 |
1.1 |
GO:0002385 |
organ or tissue specific immune response(GO:0002251) mucosal immune response(GO:0002385) |
| 0.1 |
0.1 |
GO:0000821 |
regulation of arginine metabolic process(GO:0000821) |
| 0.1 |
0.1 |
GO:0000414 |
regulation of histone H3-K36 methylation(GO:0000414) |
| 0.1 |
0.9 |
GO:0006379 |
mRNA cleavage(GO:0006379) |
| 0.1 |
0.3 |
GO:0097298 |
regulation of nucleus size(GO:0097298) |
| 0.1 |
0.4 |
GO:0045943 |
positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.1 |
0.3 |
GO:0055007 |
cardiac muscle cell differentiation(GO:0055007) |
| 0.1 |
2.8 |
GO:0006414 |
translational elongation(GO:0006414) |
| 0.1 |
1.2 |
GO:0046460 |
triglyceride biosynthetic process(GO:0019432) neutral lipid biosynthetic process(GO:0046460) acylglycerol biosynthetic process(GO:0046463) |
| 0.1 |
0.6 |
GO:0006857 |
oligopeptide transport(GO:0006857) |
| 0.1 |
1.0 |
GO:0031122 |
cytoplasmic microtubule organization(GO:0031122) |
| 0.1 |
0.7 |
GO:0016926 |
protein desumoylation(GO:0016926) |
| 0.1 |
0.1 |
GO:2001013 |
epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.1 |
0.6 |
GO:0002455 |
humoral immune response mediated by circulating immunoglobulin(GO:0002455) |
| 0.1 |
0.2 |
GO:0060391 |
positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.1 |
0.9 |
GO:0009081 |
branched-chain amino acid metabolic process(GO:0009081) |
| 0.1 |
0.4 |
GO:0000012 |
single strand break repair(GO:0000012) |
| 0.1 |
1.4 |
GO:0000303 |
response to superoxide(GO:0000303) |
| 0.1 |
0.1 |
GO:0090324 |
negative regulation of oxidative phosphorylation(GO:0090324) |
| 0.1 |
0.3 |
GO:0006529 |
asparagine biosynthetic process(GO:0006529) |
| 0.1 |
0.4 |
GO:0050860 |
negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.1 |
0.2 |
GO:0042149 |
cellular response to glucose starvation(GO:0042149) |
| 0.1 |
1.7 |
GO:0010633 |
negative regulation of epithelial cell migration(GO:0010633) |
| 0.1 |
0.4 |
GO:0090331 |
negative regulation of platelet aggregation(GO:0090331) |
| 0.1 |
0.9 |
GO:0018206 |
peptidyl-methionine modification(GO:0018206) |
| 0.1 |
0.2 |
GO:0036462 |
TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.1 |
0.2 |
GO:0030497 |
fatty acid elongation(GO:0030497) |
| 0.1 |
1.0 |
GO:0051044 |
positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.1 |
0.5 |
GO:0009249 |
protein lipoylation(GO:0009249) |
| 0.1 |
0.4 |
GO:2000270 |
negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.1 |
0.1 |
GO:1902187 |
negative regulation of viral release from host cell(GO:1902187) |
| 0.1 |
0.5 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 |
0.1 |
GO:0045084 |
positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.1 |
2.1 |
GO:0030326 |
embryonic limb morphogenesis(GO:0030326) embryonic appendage morphogenesis(GO:0035113) |
| 0.1 |
2.3 |
GO:0001892 |
embryonic placenta development(GO:0001892) |
| 0.1 |
3.3 |
GO:0046847 |
filopodium assembly(GO:0046847) |
| 0.1 |
1.0 |
GO:0003301 |
physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.1 |
0.4 |
GO:0071426 |
ribonucleoprotein complex export from nucleus(GO:0071426) |
| 0.1 |
1.0 |
GO:0035335 |
peptidyl-tyrosine dephosphorylation(GO:0035335) |
| 0.1 |
0.8 |
GO:0045070 |
positive regulation of viral genome replication(GO:0045070) |
| 0.1 |
0.3 |
GO:0033580 |
protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
| 0.1 |
0.2 |
GO:1902259 |
regulation of delayed rectifier potassium channel activity(GO:1902259) |
| 0.1 |
0.2 |
GO:0042822 |
vitamin B6 metabolic process(GO:0042816) pyridoxal phosphate metabolic process(GO:0042822) pyridoxal phosphate biosynthetic process(GO:0042823) |
| 0.1 |
0.4 |
GO:0090164 |
asymmetric Golgi ribbon formation(GO:0090164) |
| 0.1 |
0.7 |
GO:0001886 |
endothelial cell morphogenesis(GO:0001886) |
| 0.1 |
0.3 |
GO:0010628 |
positive regulation of gene expression(GO:0010628) |
| 0.1 |
0.1 |
GO:0030836 |
positive regulation of actin filament depolymerization(GO:0030836) |
| 0.1 |
0.2 |
GO:0030252 |
growth hormone secretion(GO:0030252) |
| 0.1 |
0.3 |
GO:0045721 |
negative regulation of gluconeogenesis(GO:0045721) |
| 0.1 |
0.1 |
GO:0046929 |
negative regulation of neurotransmitter secretion(GO:0046929) negative regulation of neurotransmitter transport(GO:0051589) |
| 0.1 |
0.1 |
GO:0051095 |
regulation of helicase activity(GO:0051095) |
| 0.1 |
0.1 |
GO:0031914 |
negative regulation of synaptic plasticity(GO:0031914) |
| 0.1 |
1.8 |
GO:0002181 |
cytoplasmic translation(GO:0002181) |
| 0.1 |
0.8 |
GO:0034498 |
early endosome to Golgi transport(GO:0034498) |
| 0.1 |
0.1 |
GO:0034063 |
stress granule assembly(GO:0034063) |
| 0.1 |
0.1 |
GO:0006842 |
tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.1 |
0.3 |
GO:0030263 |
apoptotic chromosome condensation(GO:0030263) |
| 0.1 |
0.5 |
GO:0006729 |
tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.1 |
0.6 |
GO:0060324 |
face development(GO:0060324) |
| 0.1 |
0.2 |
GO:0001980 |
regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) vasoconstriction of artery involved in ischemic response to lowering of systemic arterial blood pressure(GO:0002014) |
| 0.1 |
0.3 |
GO:0090209 |
negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.1 |
0.2 |
GO:0045040 |
protein import into mitochondrial outer membrane(GO:0045040) |
| 0.1 |
0.7 |
GO:0048384 |
retinoic acid receptor signaling pathway(GO:0048384) |
| 0.1 |
0.7 |
GO:0033622 |
integrin activation(GO:0033622) |
| 0.1 |
0.1 |
GO:0002639 |
positive regulation of immunoglobulin production(GO:0002639) |
| 0.1 |
0.3 |
GO:0007220 |
Notch receptor processing(GO:0007220) |
| 0.1 |
0.8 |
GO:0006261 |
DNA-dependent DNA replication(GO:0006261) |
| 0.1 |
0.8 |
GO:0000910 |
cytokinesis(GO:0000910) |
| 0.1 |
0.1 |
GO:0003418 |
growth plate cartilage chondrocyte differentiation(GO:0003418) |
| 0.1 |
0.1 |
GO:0042362 |
fat-soluble vitamin biosynthetic process(GO:0042362) |
| 0.1 |
1.3 |
GO:0061640 |
cytoskeleton-dependent cytokinesis(GO:0061640) |
| 0.1 |
0.4 |
GO:0043567 |
regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.1 |
0.1 |
GO:0002070 |
epithelial cell maturation(GO:0002070) |
| 0.1 |
0.3 |
GO:1904888 |
cranial skeletal system development(GO:1904888) |
| 0.1 |
0.1 |
GO:0006166 |
purine ribonucleoside salvage(GO:0006166) |
| 0.1 |
1.0 |
GO:0046839 |
phospholipid dephosphorylation(GO:0046839) |
| 0.1 |
2.4 |
GO:0045137 |
development of primary sexual characteristics(GO:0045137) |
| 0.1 |
0.1 |
GO:0032512 |
regulation of protein phosphatase type 2B activity(GO:0032512) negative regulation of protein phosphatase type 2B activity(GO:0032513) |
| 0.1 |
0.1 |
GO:0030224 |
monocyte differentiation(GO:0030224) |
| 0.1 |
0.3 |
GO:2000188 |
regulation of cholesterol homeostasis(GO:2000188) |
| 0.1 |
0.4 |
GO:0006817 |
phosphate ion transport(GO:0006817) |
| 0.1 |
3.3 |
GO:0042274 |
ribosomal small subunit biogenesis(GO:0042274) |
| 0.1 |
0.3 |
GO:0034587 |
piRNA metabolic process(GO:0034587) |
| 0.1 |
1.1 |
GO:0035036 |
binding of sperm to zona pellucida(GO:0007339) sperm-egg recognition(GO:0035036) |
| 0.1 |
0.3 |
GO:0042989 |
sequestering of actin monomers(GO:0042989) |
| 0.1 |
0.4 |
GO:0031124 |
mRNA 3'-end processing(GO:0031124) |
| 0.1 |
0.1 |
GO:0018065 |
protein-cofactor linkage(GO:0018065) |
| 0.1 |
0.2 |
GO:0002092 |
positive regulation of receptor internalization(GO:0002092) |
| 0.1 |
0.5 |
GO:0070208 |
protein heterotrimerization(GO:0070208) |
| 0.1 |
0.1 |
GO:0030854 |
positive regulation of granulocyte differentiation(GO:0030854) |
| 0.1 |
0.4 |
GO:0035542 |
regulation of SNARE complex assembly(GO:0035542) |
| 0.1 |
0.3 |
GO:0033151 |
V(D)J recombination(GO:0033151) |
| 0.1 |
0.1 |
GO:0000305 |
response to oxygen radical(GO:0000305) |
| 0.1 |
0.3 |
GO:0045117 |
azole transport(GO:0045117) |
| 0.1 |
0.3 |
GO:0042168 |
heme metabolic process(GO:0042168) |
| 0.1 |
0.3 |
GO:0045217 |
cell-cell junction maintenance(GO:0045217) |
| 0.1 |
0.1 |
GO:0008616 |
queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.1 |
0.1 |
GO:2000271 |
positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.1 |
0.2 |
GO:0006930 |
substrate-dependent cell migration, cell extension(GO:0006930) |
| 0.1 |
0.5 |
GO:0007051 |
spindle organization(GO:0007051) |
| 0.1 |
0.2 |
GO:0006685 |
sphingomyelin catabolic process(GO:0006685) |
| 0.1 |
0.7 |
GO:0051293 |
establishment of spindle localization(GO:0051293) |
| 0.1 |
1.1 |
GO:0032611 |
interleukin-1 beta production(GO:0032611) |
| 0.1 |
0.2 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 0.0 |
0.2 |
GO:0034975 |
protein folding in endoplasmic reticulum(GO:0034975) |
| 0.0 |
0.1 |
GO:0033158 |
regulation of protein import into nucleus, translocation(GO:0033158) |
| 0.0 |
0.2 |
GO:0019509 |
L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.0 |
0.1 |
GO:0060398 |
regulation of growth hormone receptor signaling pathway(GO:0060398) |
| 0.0 |
0.0 |
GO:0051567 |
histone H3-K9 methylation(GO:0051567) |
| 0.0 |
0.1 |
GO:0045915 |
positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
| 0.0 |
0.3 |
GO:0030261 |
chromosome condensation(GO:0030261) |
| 0.0 |
0.7 |
GO:0000470 |
maturation of LSU-rRNA(GO:0000470) |
| 0.0 |
0.5 |
GO:0030513 |
positive regulation of BMP signaling pathway(GO:0030513) |
| 0.0 |
0.1 |
GO:0060155 |
platelet dense granule organization(GO:0060155) |
| 0.0 |
0.0 |
GO:2000641 |
regulation of early endosome to late endosome transport(GO:2000641) |
| 0.0 |
2.5 |
GO:0050953 |
sensory perception of light stimulus(GO:0050953) |
| 0.0 |
0.1 |
GO:0060052 |
neurofilament cytoskeleton organization(GO:0060052) |
| 0.0 |
0.1 |
GO:0035928 |
rRNA import into mitochondrion(GO:0035928) rRNA transport(GO:0051029) |
| 0.0 |
0.1 |
GO:1990253 |
cellular response to leucine starvation(GO:1990253) |
| 0.0 |
0.1 |
GO:0046874 |
quinolinate metabolic process(GO:0046874) |
| 0.0 |
0.1 |
GO:0010826 |
negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 0.0 |
0.1 |
GO:0003014 |
renal system process(GO:0003014) |
| 0.0 |
0.3 |
GO:0072350 |
tricarboxylic acid metabolic process(GO:0072350) |
| 0.0 |
0.1 |
GO:0042256 |
mature ribosome assembly(GO:0042256) |
| 0.0 |
0.2 |
GO:0090201 |
negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
| 0.0 |
0.1 |
GO:0050687 |
negative regulation of defense response to virus(GO:0050687) |
| 0.0 |
0.4 |
GO:0006471 |
protein ADP-ribosylation(GO:0006471) |
| 0.0 |
0.6 |
GO:0045116 |
protein neddylation(GO:0045116) |
| 0.0 |
0.0 |
GO:0001927 |
exocyst assembly(GO:0001927) |
| 0.0 |
0.1 |
GO:0098734 |
protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
| 0.0 |
0.0 |
GO:0090283 |
regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.0 |
0.3 |
GO:0000154 |
rRNA modification(GO:0000154) |
| 0.0 |
0.9 |
GO:0045600 |
positive regulation of fat cell differentiation(GO:0045600) |
| 0.0 |
0.1 |
GO:0072033 |
renal vesicle formation(GO:0072033) |
| 0.0 |
0.1 |
GO:0010992 |
ubiquitin homeostasis(GO:0010992) |
| 0.0 |
0.1 |
GO:0061732 |
mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.0 |
0.4 |
GO:0051084 |
'de novo' protein folding(GO:0006458) 'de novo' posttranslational protein folding(GO:0051084) |
| 0.0 |
0.0 |
GO:0007398 |
ectoderm development(GO:0007398) |
| 0.0 |
0.1 |
GO:0002693 |
positive regulation of cellular extravasation(GO:0002693) |
| 0.0 |
0.3 |
GO:0042113 |
B cell activation(GO:0042113) |
| 0.0 |
0.1 |
GO:0015882 |
L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
| 0.0 |
0.0 |
GO:0072498 |
embryonic skeletal joint development(GO:0072498) |
| 0.0 |
0.1 |
GO:0035721 |
intraciliary retrograde transport(GO:0035721) |
| 0.0 |
0.2 |
GO:0042866 |
pyruvate biosynthetic process(GO:0042866) |
| 0.0 |
0.1 |
GO:0071294 |
cellular response to zinc ion(GO:0071294) |
| 0.0 |
0.2 |
GO:2000738 |
positive regulation of stem cell differentiation(GO:2000738) |
| 0.0 |
0.1 |
GO:0030220 |
platelet formation(GO:0030220) platelet morphogenesis(GO:0036344) |
| 0.0 |
0.1 |
GO:0006481 |
C-terminal protein methylation(GO:0006481) |
| 0.0 |
0.9 |
GO:0050728 |
negative regulation of inflammatory response(GO:0050728) |
| 0.0 |
0.3 |
GO:0001780 |
neutrophil homeostasis(GO:0001780) |
| 0.0 |
0.3 |
GO:0045760 |
positive regulation of action potential(GO:0045760) |
| 0.0 |
0.2 |
GO:0006398 |
mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.0 |
0.9 |
GO:0000725 |
double-strand break repair via homologous recombination(GO:0000724) recombinational repair(GO:0000725) |
| 0.0 |
0.1 |
GO:0046416 |
D-amino acid catabolic process(GO:0019478) D-amino acid metabolic process(GO:0046416) |
| 0.0 |
0.0 |
GO:0048536 |
spleen development(GO:0048536) |
| 0.0 |
0.4 |
GO:0043984 |
histone H4-K16 acetylation(GO:0043984) |
| 0.0 |
0.1 |
GO:0006591 |
ornithine metabolic process(GO:0006591) |
| 0.0 |
0.3 |
GO:0071578 |
zinc II ion transmembrane import(GO:0071578) |
| 0.0 |
0.5 |
GO:0072164 |
ureteric bud development(GO:0001657) mesonephric epithelium development(GO:0072163) mesonephric tubule development(GO:0072164) |
| 0.0 |
0.3 |
GO:0090004 |
positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
| 0.0 |
0.6 |
GO:0030488 |
tRNA methylation(GO:0030488) |
| 0.0 |
0.3 |
GO:0046827 |
positive regulation of protein export from nucleus(GO:0046827) |
| 0.0 |
0.1 |
GO:0032968 |
positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.0 |
2.1 |
GO:0008033 |
tRNA processing(GO:0008033) |
| 0.0 |
0.3 |
GO:0006220 |
pyrimidine nucleotide metabolic process(GO:0006220) |
| 0.0 |
0.4 |
GO:0045599 |
negative regulation of fat cell differentiation(GO:0045599) |
| 0.0 |
0.2 |
GO:0051156 |
glucose 6-phosphate metabolic process(GO:0051156) |
| 0.0 |
0.7 |
GO:0000027 |
ribosomal large subunit assembly(GO:0000027) |
| 0.0 |
0.1 |
GO:1902230 |
negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
| 0.0 |
2.1 |
GO:0042254 |
ribosome biogenesis(GO:0042254) |
| 0.0 |
0.2 |
GO:0051568 |
histone H3-K4 methylation(GO:0051568) |
| 0.0 |
0.2 |
GO:0070458 |
detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) cellular detoxification(GO:1990748) |
| 0.0 |
0.0 |
GO:0015014 |
heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.0 |
0.1 |
GO:0061436 |
establishment of skin barrier(GO:0061436) |
| 0.0 |
0.1 |
GO:0006265 |
DNA topological change(GO:0006265) |
| 0.0 |
0.0 |
GO:1902953 |
positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
| 0.0 |
0.8 |
GO:0061077 |
chaperone-mediated protein folding(GO:0061077) |
| 0.0 |
0.1 |
GO:0006957 |
complement activation, alternative pathway(GO:0006957) |
| 0.0 |
0.2 |
GO:0045780 |
positive regulation of bone resorption(GO:0045780) positive regulation of bone remodeling(GO:0046852) |
| 0.0 |
0.1 |
GO:0006693 |
prostanoid metabolic process(GO:0006692) prostaglandin metabolic process(GO:0006693) |
| 0.0 |
0.5 |
GO:0016126 |
sterol biosynthetic process(GO:0016126) |
| 0.0 |
0.1 |
GO:2001206 |
positive regulation of osteoclast development(GO:2001206) |
| 0.0 |
0.1 |
GO:0035469 |
determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.0 |
0.1 |
GO:1903055 |
positive regulation of extracellular matrix organization(GO:1903055) |
| 0.0 |
0.0 |
GO:0008300 |
isoprenoid catabolic process(GO:0008300) |
| 0.0 |
0.1 |
GO:2000398 |
regulation of T cell differentiation in thymus(GO:0033081) regulation of thymocyte aggregation(GO:2000398) |
| 0.0 |
0.0 |
GO:0030647 |
polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.0 |
0.2 |
GO:0070206 |
protein trimerization(GO:0070206) |
| 0.0 |
0.2 |
GO:0009143 |
nucleoside triphosphate catabolic process(GO:0009143) |
| 0.0 |
0.2 |
GO:0017144 |
drug metabolic process(GO:0017144) |
| 0.0 |
0.0 |
GO:0021937 |
cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
| 0.0 |
0.0 |
GO:2000773 |
negative regulation of cellular senescence(GO:2000773) |
| 0.0 |
0.2 |
GO:0016568 |
chromatin modification(GO:0016568) |
| 0.0 |
0.1 |
GO:0006436 |
tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.0 |
0.1 |
GO:0010739 |
positive regulation of protein kinase A signaling(GO:0010739) |
| 0.0 |
0.8 |
GO:0006334 |
nucleosome assembly(GO:0006334) |
| 0.0 |
0.0 |
GO:0002538 |
arachidonic acid metabolite production involved in inflammatory response(GO:0002538) |
| 0.0 |
0.0 |
GO:2000018 |
regulation of male gonad development(GO:2000018) |
| 0.0 |
0.0 |
GO:2000574 |
regulation of microtubule motor activity(GO:2000574) |
| 0.0 |
0.0 |
GO:0016074 |
snoRNA metabolic process(GO:0016074) snoRNA processing(GO:0043144) |
| 0.0 |
0.1 |
GO:0001947 |
heart looping(GO:0001947) determination of heart left/right asymmetry(GO:0061371) |
| 0.0 |
0.2 |
GO:0008299 |
isoprenoid biosynthetic process(GO:0008299) |
| 0.0 |
0.0 |
GO:0061055 |
myotome development(GO:0061055) |
| 0.0 |
0.0 |
GO:0071340 |
skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
| 0.0 |
0.2 |
GO:0008053 |
mitochondrial fusion(GO:0008053) |
| 0.0 |
0.1 |
GO:0032467 |
positive regulation of cytokinesis(GO:0032467) |
| 0.0 |
0.1 |
GO:0043200 |
response to amino acid(GO:0043200) |
