Motif ID: Zbtb33_Chd2
Z-value: 1.829


Transcription factors associated with Zbtb33_Chd2:
Gene Symbol | Entrez ID | Gene Name |
---|---|---|
Chd2 | ENSMUSG00000078671.4 | Chd2 |
Zbtb33 | ENSMUSG00000048047.3 | Zbtb33 |
Activity-expression correlation:
Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Chd2 | mm10_v2_chr7_-_73541738_73541758 | 0.27 | 2.4e-02 | Click! |
Zbtb33 | mm10_v2_chrX_+_38189780_38189826 | 0.10 | 4.0e-01 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
4.3 | 21.4 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
3.4 | 13.8 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
2.8 | 19.8 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
2.3 | 6.9 | GO:0072554 | arterial endothelial cell fate commitment(GO:0060844) blood vessel endothelial cell fate commitment(GO:0060846) endothelial cell fate specification(GO:0060847) Notch signaling pathway involved in arterial endothelial cell fate commitment(GO:0060853) blood vessel lumenization(GO:0072554) blood vessel endothelial cell fate specification(GO:0097101) regulation of canonical Wnt signaling pathway involved in cardiac muscle cell fate commitment(GO:1901295) positive regulation of heart induction(GO:1901321) regulation of canonical Wnt signaling pathway involved in heart development(GO:1905066) |
2.3 | 11.4 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
1.7 | 29.4 | GO:0071459 | protein localization to chromosome, centromeric region(GO:0071459) |
1.5 | 6.1 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
1.4 | 11.1 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
1.3 | 3.8 | GO:0090274 | positive regulation of somatostatin secretion(GO:0090274) |
1.2 | 3.5 | GO:0048208 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
1.2 | 11.5 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
1.1 | 5.5 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) proprioception(GO:0019230) |
1.0 | 3.0 | GO:0032877 | positive regulation of DNA endoreduplication(GO:0032877) |
0.9 | 5.5 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.9 | 2.6 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
0.8 | 6.7 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.8 | 3.3 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
0.8 | 2.5 | GO:0070844 | misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
0.8 | 5.7 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.8 | 13.1 | GO:0030953 | astral microtubule organization(GO:0030953) |
0.8 | 3.9 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
0.8 | 2.3 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.7 | 3.7 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.7 | 3.5 | GO:0048478 | replication fork protection(GO:0048478) |
0.7 | 2.6 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.7 | 4.6 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
0.6 | 4.5 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.6 | 1.9 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
0.6 | 3.1 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
0.6 | 1.8 | GO:0034476 | U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) |
0.6 | 2.3 | GO:0035606 | peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
0.6 | 10.5 | GO:0031297 | replication fork processing(GO:0031297) DNA-dependent DNA replication maintenance of fidelity(GO:0045005) |
0.6 | 14.4 | GO:0019430 | removal of superoxide radicals(GO:0019430) |
0.6 | 1.7 | GO:2000314 | negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
0.6 | 2.8 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
0.5 | 3.2 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
0.5 | 2.1 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.5 | 3.1 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.5 | 3.6 | GO:0001842 | neural fold formation(GO:0001842) |
0.5 | 5.5 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
0.5 | 2.4 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
0.4 | 2.1 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.4 | 2.0 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
0.4 | 1.2 | GO:0036500 | ATF6-mediated unfolded protein response(GO:0036500) |
0.4 | 5.6 | GO:0030261 | chromosome condensation(GO:0030261) |
0.4 | 1.1 | GO:1904569 | regulation of selenocysteine incorporation(GO:1904569) |
0.4 | 1.1 | GO:1903722 | endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) multivesicular body assembly(GO:0036258) regulation of centriole elongation(GO:1903722) |
0.4 | 1.5 | GO:0071449 | cellular response to lipid hydroperoxide(GO:0071449) |
0.4 | 1.1 | GO:0042505 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
0.4 | 9.5 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.3 | 5.6 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.3 | 1.0 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
0.3 | 10.4 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.3 | 3.7 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.3 | 1.9 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
0.3 | 1.3 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
0.3 | 0.9 | GO:0030321 | transepithelial chloride transport(GO:0030321) transepithelial ammonium transport(GO:0070634) |
0.3 | 2.7 | GO:0070475 | rRNA base methylation(GO:0070475) |
0.3 | 2.1 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.3 | 6.2 | GO:0045722 | positive regulation of gluconeogenesis(GO:0045722) |
0.3 | 0.8 | GO:0042420 | dopamine catabolic process(GO:0042420) |
0.3 | 1.0 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.3 | 1.0 | GO:1903251 | multi-ciliated epithelial cell differentiation(GO:1903251) |
0.2 | 0.7 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.2 | 9.4 | GO:0035329 | hippo signaling(GO:0035329) |
0.2 | 4.0 | GO:0071392 | cellular response to estradiol stimulus(GO:0071392) |
0.2 | 2.6 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.2 | 2.1 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
0.2 | 1.9 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.2 | 1.0 | GO:0033762 | response to glucagon(GO:0033762) |
0.2 | 1.9 | GO:1903298 | regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) |
0.2 | 0.8 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
0.2 | 3.9 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.2 | 1.0 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.2 | 1.7 | GO:0002643 | regulation of tolerance induction(GO:0002643) |
0.2 | 0.4 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
0.2 | 0.8 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.2 | 0.9 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.2 | 1.9 | GO:0006560 | proline metabolic process(GO:0006560) |
0.2 | 1.8 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.2 | 1.8 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.2 | 4.1 | GO:0071425 | hematopoietic stem cell proliferation(GO:0071425) |
0.2 | 12.6 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
0.2 | 0.5 | GO:0051593 | response to folic acid(GO:0051593) |
0.2 | 0.5 | GO:2000819 | regulation of nucleotide-excision repair(GO:2000819) |
0.2 | 4.9 | GO:0007094 | mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
0.2 | 1.6 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
0.2 | 0.9 | GO:0048254 | snoRNA localization(GO:0048254) |
0.2 | 1.5 | GO:0001675 | acrosome assembly(GO:0001675) |
0.2 | 0.8 | GO:1904690 | adenosine to inosine editing(GO:0006382) regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
0.2 | 1.2 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.1 | 0.4 | GO:2000983 | regulation of ATP citrate synthase activity(GO:2000983) negative regulation of ATP citrate synthase activity(GO:2000984) |
0.1 | 10.2 | GO:2000179 | positive regulation of neural precursor cell proliferation(GO:2000179) |
0.1 | 0.3 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.1 | 1.1 | GO:1990173 | regulation of establishment of protein localization to telomere(GO:0070203) protein localization to nuclear body(GO:1903405) positive regulation of establishment of protein localization to telomere(GO:1904851) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
0.1 | 1.1 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.1 | 1.0 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.1 | 1.9 | GO:0006337 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
0.1 | 0.8 | GO:0006108 | malate metabolic process(GO:0006108) |
0.1 | 1.6 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
0.1 | 2.0 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.1 | 1.7 | GO:0010225 | response to UV-C(GO:0010225) |
0.1 | 3.5 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
0.1 | 2.4 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.1 | 1.5 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
0.1 | 1.5 | GO:0031268 | pseudopodium organization(GO:0031268) |
0.1 | 1.3 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.1 | 1.4 | GO:0046349 | amino sugar biosynthetic process(GO:0046349) |
0.1 | 0.4 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.1 | 1.6 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
0.1 | 0.7 | GO:0051096 | regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
0.1 | 0.6 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
0.1 | 0.3 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.1 | 0.7 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.1 | 0.5 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.1 | 0.4 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.1 | 3.3 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.1 | 0.8 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.1 | 0.9 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.1 | 1.3 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.1 | 1.1 | GO:0006309 | apoptotic DNA fragmentation(GO:0006309) |
0.1 | 11.9 | GO:0031109 | microtubule polymerization or depolymerization(GO:0031109) |
0.1 | 1.6 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
0.1 | 2.5 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.1 | 0.7 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
0.1 | 0.6 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.1 | 0.9 | GO:0071428 | rRNA-containing ribonucleoprotein complex export from nucleus(GO:0071428) |
0.1 | 0.5 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
0.1 | 1.0 | GO:2000144 | positive regulation of DNA-templated transcription, initiation(GO:2000144) |
0.1 | 0.3 | GO:0039530 | MDA-5 signaling pathway(GO:0039530) |
0.1 | 2.1 | GO:0006783 | heme biosynthetic process(GO:0006783) |
0.1 | 0.4 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
0.1 | 0.3 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.1 | 0.9 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
0.1 | 1.4 | GO:0006907 | pinocytosis(GO:0006907) |
0.1 | 1.6 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
0.1 | 2.0 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.1 | 0.6 | GO:0051797 | regulation of hair follicle development(GO:0051797) |
0.1 | 0.5 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.1 | 2.6 | GO:0031572 | G2 DNA damage checkpoint(GO:0031572) |
0.1 | 1.2 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) |
0.1 | 0.8 | GO:0032506 | cytokinetic process(GO:0032506) |
0.1 | 0.6 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
0.1 | 2.5 | GO:0032835 | glomerulus development(GO:0032835) |
0.0 | 0.8 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
0.0 | 0.8 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
0.0 | 1.4 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
0.0 | 0.2 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
0.0 | 0.4 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
0.0 | 2.1 | GO:2000134 | negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
0.0 | 0.1 | GO:0072204 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) cell-cell signaling involved in kidney development(GO:0060995) Wnt signaling pathway involved in kidney development(GO:0061289) canonical Wnt signaling pathway involved in metanephric kidney development(GO:0061290) nephric duct formation(GO:0072179) cell-cell signaling involved in metanephros development(GO:0072204) |
0.0 | 1.3 | GO:0045860 | positive regulation of protein kinase activity(GO:0045860) |
0.0 | 1.3 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.0 | 0.5 | GO:0030238 | male sex determination(GO:0030238) Leydig cell differentiation(GO:0033327) |
0.0 | 0.6 | GO:0016926 | protein desumoylation(GO:0016926) |
0.0 | 0.1 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.0 | 0.7 | GO:0051290 | protein heterotetramerization(GO:0051290) |
0.0 | 3.3 | GO:0021954 | central nervous system neuron development(GO:0021954) |
0.0 | 0.1 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
0.0 | 0.4 | GO:0051451 | myoblast migration(GO:0051451) |
0.0 | 1.1 | GO:0034605 | cellular response to heat(GO:0034605) |
0.0 | 0.4 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.0 | 0.6 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
0.0 | 0.7 | GO:0035886 | vascular smooth muscle cell differentiation(GO:0035886) |
0.0 | 3.6 | GO:0098780 | mitophagy in response to mitochondrial depolarization(GO:0098779) response to mitochondrial depolarisation(GO:0098780) |
0.0 | 0.8 | GO:0043666 | regulation of phosphoprotein phosphatase activity(GO:0043666) |
0.0 | 0.1 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.0 | 0.5 | GO:0010883 | regulation of lipid storage(GO:0010883) |
0.0 | 1.4 | GO:0032204 | regulation of telomere maintenance(GO:0032204) |
0.0 | 0.3 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
0.0 | 0.7 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
0.0 | 3.4 | GO:0042787 | protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0042787) |
0.0 | 0.2 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
0.0 | 0.8 | GO:0030317 | sperm motility(GO:0030317) |
0.0 | 0.2 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
0.0 | 0.9 | GO:0070373 | negative regulation of ERK1 and ERK2 cascade(GO:0070373) |
0.0 | 0.1 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
0.0 | 2.8 | GO:0007266 | Rho protein signal transduction(GO:0007266) |
0.0 | 4.4 | GO:0007067 | mitotic nuclear division(GO:0007067) |
0.0 | 0.2 | GO:0043550 | regulation of lipid kinase activity(GO:0043550) |
0.0 | 0.9 | GO:0016579 | protein deubiquitination(GO:0016579) |
0.0 | 1.2 | GO:0001935 | endothelial cell proliferation(GO:0001935) |
0.0 | 1.3 | GO:0016197 | endosomal transport(GO:0016197) |
0.0 | 0.6 | GO:0018105 | peptidyl-serine phosphorylation(GO:0018105) |
0.0 | 0.9 | GO:0043066 | negative regulation of apoptotic process(GO:0043066) |
0.0 | 0.2 | GO:1900087 | positive regulation of G1/S transition of mitotic cell cycle(GO:1900087) |
0.0 | 0.1 | GO:0060363 | cranial suture morphogenesis(GO:0060363) |
0.0 | 0.5 | GO:0032088 | negative regulation of NF-kappaB transcription factor activity(GO:0032088) |
0.0 | 0.6 | GO:0002181 | cytoplasmic translation(GO:0002181) |
0.0 | 0.2 | GO:0030033 | microvillus assembly(GO:0030033) |
0.0 | 0.1 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
0.0 | 0.3 | GO:0045773 | positive regulation of axon extension(GO:0045773) |
Gene overrepresentation in cellular_component category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
5.0 | 35.0 | GO:0000796 | condensin complex(GO:0000796) |
3.0 | 9.1 | GO:0033186 | CAF-1 complex(GO:0033186) |
2.2 | 6.6 | GO:0002944 | cyclin K-CDK12 complex(GO:0002944) |
2.1 | 27.5 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
1.4 | 6.9 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
1.2 | 3.7 | GO:1990423 | RZZ complex(GO:1990423) |
1.2 | 6.1 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
1.0 | 6.2 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
1.0 | 5.1 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
1.0 | 5.8 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.9 | 3.6 | GO:0090537 | CERF complex(GO:0090537) |
0.8 | 3.4 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.8 | 25.6 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
0.8 | 4.5 | GO:0001740 | Barr body(GO:0001740) |
0.7 | 10.3 | GO:0042555 | MCM complex(GO:0042555) |
0.7 | 5.4 | GO:0016589 | NURF complex(GO:0016589) |
0.6 | 2.5 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.6 | 5.9 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.6 | 2.9 | GO:0001652 | granular component(GO:0001652) |
0.5 | 1.6 | GO:0031417 | NatC complex(GO:0031417) |
0.5 | 3.1 | GO:0030870 | Mre11 complex(GO:0030870) |
0.5 | 3.5 | GO:0005827 | polar microtubule(GO:0005827) |
0.5 | 1.5 | GO:0005940 | septin ring(GO:0005940) |
0.5 | 2.9 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
0.5 | 12.4 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.4 | 11.3 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.4 | 12.1 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.4 | 1.6 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.3 | 1.0 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.3 | 2.3 | GO:0097452 | GAIT complex(GO:0097452) |
0.3 | 1.3 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.3 | 0.6 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.3 | 0.9 | GO:0034455 | t-UTP complex(GO:0034455) |
0.3 | 6.4 | GO:0005685 | U1 snRNP(GO:0005685) |
0.3 | 4.7 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.2 | 3.6 | GO:0031011 | Ino80 complex(GO:0031011) |
0.2 | 3.5 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.2 | 1.2 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.2 | 1.1 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.2 | 0.9 | GO:0034709 | methylosome(GO:0034709) |
0.2 | 0.9 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.2 | 0.8 | GO:0032807 | DNA ligase IV complex(GO:0032807) |
0.2 | 1.1 | GO:0090543 | Flemming body(GO:0090543) |
0.2 | 0.9 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.2 | 0.6 | GO:0060187 | cell pole(GO:0060187) |
0.2 | 3.1 | GO:0035869 | ciliary transition zone(GO:0035869) |
0.1 | 1.0 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.1 | 2.2 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.1 | 1.9 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.1 | 0.3 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.1 | 4.5 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.1 | 2.6 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.1 | 0.4 | GO:1990037 | Lewy body core(GO:1990037) |
0.1 | 1.0 | GO:0098536 | deuterosome(GO:0098536) |
0.1 | 0.6 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.1 | 8.7 | GO:0005643 | nuclear pore(GO:0005643) |
0.1 | 0.8 | GO:0036396 | MIS complex(GO:0036396) mRNA editing complex(GO:0045293) |
0.1 | 1.4 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.1 | 1.1 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.1 | 3.6 | GO:0090544 | BAF-type complex(GO:0090544) |
0.1 | 2.7 | GO:0034451 | centriolar satellite(GO:0034451) |
0.1 | 2.1 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.1 | 10.8 | GO:0045111 | intermediate filament cytoskeleton(GO:0045111) |
0.1 | 1.3 | GO:0071203 | WASH complex(GO:0071203) |
0.1 | 0.5 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
0.1 | 1.5 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.1 | 0.9 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.1 | 2.6 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.1 | 0.9 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.1 | 0.8 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.1 | 0.8 | GO:0030478 | actin cap(GO:0030478) |
0.1 | 0.3 | GO:0031251 | PAN complex(GO:0031251) |
0.1 | 3.7 | GO:0031941 | filamentous actin(GO:0031941) |
0.1 | 4.9 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.1 | 2.5 | GO:0016235 | aggresome(GO:0016235) |
0.1 | 0.9 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.1 | 0.9 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
0.1 | 0.8 | GO:0070938 | contractile ring(GO:0070938) |
0.1 | 0.3 | GO:0071942 | XPC complex(GO:0071942) |
0.1 | 0.8 | GO:0044447 | axoneme part(GO:0044447) |
0.1 | 3.7 | GO:0005871 | kinesin complex(GO:0005871) |
0.1 | 0.5 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.1 | 0.4 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.1 | 4.8 | GO:0000922 | spindle pole(GO:0000922) |
0.1 | 0.4 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.1 | 0.5 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.0 | 3.5 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.0 | 1.6 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.0 | 0.5 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.0 | 0.6 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.0 | 0.5 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
0.0 | 0.7 | GO:0005839 | proteasome core complex(GO:0005839) |
0.0 | 1.6 | GO:0005844 | polysome(GO:0005844) |
0.0 | 15.5 | GO:0005813 | centrosome(GO:0005813) |
0.0 | 0.2 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.0 | 1.8 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
0.0 | 0.8 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.0 | 2.1 | GO:0005815 | microtubule organizing center(GO:0005815) |
0.0 | 2.2 | GO:0044815 | DNA packaging complex(GO:0044815) |
0.0 | 0.3 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.0 | 0.4 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.0 | 0.7 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.0 | 0.2 | GO:0045277 | respiratory chain complex IV(GO:0045277) |
0.0 | 0.2 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
0.0 | 1.1 | GO:0000785 | chromatin(GO:0000785) |
0.0 | 5.7 | GO:0000790 | nuclear chromatin(GO:0000790) |
0.0 | 0.2 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
0.0 | 0.6 | GO:0000792 | heterochromatin(GO:0000792) |
0.0 | 0.3 | GO:0000421 | autophagosome membrane(GO:0000421) |
0.0 | 0.8 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.0 | 0.9 | GO:0005778 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.0 | 0.2 | GO:0031932 | TORC2 complex(GO:0031932) |
0.0 | 0.2 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.0 | 0.8 | GO:0045178 | basal part of cell(GO:0045178) |
0.0 | 0.1 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.0 | 0.7 | GO:0000502 | proteasome complex(GO:0000502) |
0.0 | 0.2 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.0 | 3.1 | GO:0045177 | apical part of cell(GO:0045177) |
Gene overrepresentation in molecular_function category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
4.8 | 19.2 | GO:0043515 | kinetochore binding(GO:0043515) |
1.9 | 11.4 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
1.3 | 3.9 | GO:0030350 | iron-responsive element binding(GO:0030350) |
1.2 | 3.5 | GO:0031208 | POZ domain binding(GO:0031208) |
1.1 | 9.1 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
1.1 | 4.4 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
1.1 | 12.6 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
1.0 | 6.1 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.8 | 5.8 | GO:0034452 | dynactin binding(GO:0034452) |
0.8 | 2.3 | GO:0035605 | peptidyl-cysteine S-nitrosylase activity(GO:0035605) |
0.6 | 5.1 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.6 | 2.5 | GO:0042903 | tubulin deacetylase activity(GO:0042903) |
0.6 | 2.5 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
0.5 | 3.0 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.5 | 2.8 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
0.4 | 2.1 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.4 | 5.0 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.4 | 3.1 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.4 | 2.6 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.4 | 1.1 | GO:0004531 | deoxyribonuclease II activity(GO:0004531) |
0.4 | 3.5 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.3 | 6.6 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.3 | 3.1 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
0.3 | 4.0 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.3 | 1.1 | GO:0035877 | death effector domain binding(GO:0035877) caspase binding(GO:0089720) |
0.3 | 1.0 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.2 | 2.1 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.2 | 3.5 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.2 | 2.9 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.2 | 1.6 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.2 | 6.1 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.2 | 9.2 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.2 | 6.9 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.2 | 1.0 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.2 | 12.1 | GO:0031491 | nucleosome binding(GO:0031491) |
0.2 | 1.8 | GO:0001228 | transcriptional activator activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001228) |
0.2 | 9.5 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
0.2 | 0.8 | GO:0051378 | primary amine oxidase activity(GO:0008131) serotonin binding(GO:0051378) |
0.2 | 0.6 | GO:0033883 | pyridoxal phosphatase activity(GO:0033883) |
0.2 | 0.9 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
0.2 | 1.3 | GO:1990446 | U1 snRNP binding(GO:1990446) |
0.2 | 0.8 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.2 | 3.6 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.2 | 4.6 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.2 | 0.6 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.2 | 0.6 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.2 | 2.1 | GO:0070034 | telomerase RNA binding(GO:0070034) |
0.2 | 27.3 | GO:0004386 | helicase activity(GO:0004386) |
0.1 | 1.0 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.1 | 0.4 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
0.1 | 0.4 | GO:0030249 | guanylate cyclase regulator activity(GO:0030249) |
0.1 | 14.0 | GO:0019905 | syntaxin binding(GO:0019905) |
0.1 | 1.2 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
0.1 | 2.5 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.1 | 0.9 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
0.1 | 0.5 | GO:0004104 | cholinesterase activity(GO:0004104) choline binding(GO:0033265) |
0.1 | 1.3 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.1 | 1.4 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.1 | 0.5 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
0.1 | 2.3 | GO:0008242 | omega peptidase activity(GO:0008242) |
0.1 | 0.6 | GO:0097016 | L27 domain binding(GO:0097016) |
0.1 | 0.9 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.1 | 3.1 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
0.1 | 6.4 | GO:0035064 | methylated histone binding(GO:0035064) |
0.1 | 1.0 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.1 | 4.9 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.1 | 0.5 | GO:0008808 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
0.1 | 2.3 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.1 | 2.0 | GO:0052890 | oxidoreductase activity, acting on the CH-CH group of donors, with a flavin as acceptor(GO:0052890) |
0.1 | 1.4 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.1 | 0.9 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.1 | 0.7 | GO:0031419 | cobalamin binding(GO:0031419) |
0.1 | 1.9 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.1 | 0.6 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.1 | 0.7 | GO:0000182 | rDNA binding(GO:0000182) |
0.1 | 1.2 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.1 | 1.7 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
0.1 | 1.0 | GO:0005123 | death receptor binding(GO:0005123) |
0.1 | 0.4 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.1 | 3.4 | GO:0070888 | E-box binding(GO:0070888) |
0.1 | 0.3 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.1 | 0.9 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.1 | 1.5 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.1 | 3.8 | GO:0008528 | G-protein coupled peptide receptor activity(GO:0008528) |
0.1 | 0.8 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.1 | 3.9 | GO:0003725 | double-stranded RNA binding(GO:0003725) |
0.1 | 1.2 | GO:0071949 | FAD binding(GO:0071949) |
0.1 | 2.6 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
0.1 | 2.3 | GO:0008748 | N-ethylmaleimide reductase activity(GO:0008748) reduced coenzyme F420 dehydrogenase activity(GO:0043738) sulfur oxygenase reductase activity(GO:0043826) malolactic enzyme activity(GO:0043883) NADPH:sulfur oxidoreductase activity(GO:0043914) epoxyqueuosine reductase activity(GO:0052693) |
0.1 | 0.4 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
0.1 | 0.9 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.1 | 0.3 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.1 | 1.1 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
0.1 | 1.7 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.1 | 1.8 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.1 | 0.8 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
0.1 | 3.7 | GO:0003777 | microtubule motor activity(GO:0003777) |
0.1 | 2.8 | GO:0031593 | polyubiquitin binding(GO:0031593) |
0.1 | 2.6 | GO:0043621 | protein self-association(GO:0043621) |
0.1 | 0.2 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.1 | 3.0 | GO:0003743 | translation initiation factor activity(GO:0003743) |
0.0 | 0.4 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.0 | 1.5 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.0 | 7.5 | GO:0003729 | mRNA binding(GO:0003729) |
0.0 | 0.6 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
0.0 | 0.2 | GO:0034602 | oxoglutarate dehydrogenase (NAD+) activity(GO:0034602) |
0.0 | 0.3 | GO:0004525 | ribonuclease III activity(GO:0004525) bidentate ribonuclease III activity(GO:0016443) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
0.0 | 6.7 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) |
0.0 | 0.9 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.0 | 0.9 | GO:0008536 | Ran GTPase binding(GO:0008536) |
0.0 | 0.7 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 1.3 | GO:0009055 | electron carrier activity(GO:0009055) |
0.0 | 3.7 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
0.0 | 1.0 | GO:0034945 | dihydrolipoamide branched chain acyltransferase activity(GO:0004147) palmitoleoyl [acyl-carrier-protein]-dependent acyltransferase activity(GO:0008951) serine O-acyltransferase activity(GO:0016412) O-succinyltransferase activity(GO:0016750) sinapoyltransferase activity(GO:0016752) O-sinapoyltransferase activity(GO:0016753) peptidyl-lysine N6-myristoyltransferase activity(GO:0018030) peptidyl-lysine N6-palmitoyltransferase activity(GO:0018031) benzoyl acetate-CoA thiolase activity(GO:0018711) 3-hydroxybutyryl-CoA thiolase activity(GO:0018712) 3-ketopimelyl-CoA thiolase activity(GO:0018713) N-palmitoyltransferase activity(GO:0019105) acyl-CoA N-acyltransferase activity(GO:0019186) protein-cysteine S-myristoyltransferase activity(GO:0019705) dihydrolipoamide S-acyltransferase activity(GO:0030523) glucosaminyl-phosphotidylinositol O-acyltransferase activity(GO:0032216) ergosterol O-acyltransferase activity(GO:0034737) lanosterol O-acyltransferase activity(GO:0034738) naphthyl-2-oxomethyl-succinyl-CoA succinyl transferase activity(GO:0034848) 2,4,4-trimethyl-3-oxopentanoyl-CoA 2-C-propanoyl transferase activity(GO:0034851) 2-methylhexanoyl-CoA C-acetyltransferase activity(GO:0034915) butyryl-CoA 2-C-propionyltransferase activity(GO:0034919) 2,6-dimethyl-5-methylene-3-oxo-heptanoyl-CoA C-acetyltransferase activity(GO:0034945) L-2-aminoadipate N-acetyltransferase activity(GO:0043741) keto acid formate lyase activity(GO:0043806) azetidine-2-carboxylic acid acetyltransferase activity(GO:0046941) peptidyl-lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0052858) acetyl-CoA:L-lysine N6-acetyltransferase(GO:0090595) |
0.0 | 1.9 | GO:0019209 | kinase activator activity(GO:0019209) |
0.0 | 0.5 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.0 | 0.7 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
0.0 | 1.0 | GO:0044824 | integrase activity(GO:0008907) T/G mismatch-specific endonuclease activity(GO:0043765) retroviral integrase activity(GO:0044823) retroviral 3' processing activity(GO:0044824) |
0.0 | 1.0 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
0.0 | 0.8 | GO:0031490 | chromatin DNA binding(GO:0031490) |
0.0 | 0.5 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.0 | 0.8 | GO:0018602 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
0.0 | 1.0 | GO:0070851 | growth factor receptor binding(GO:0070851) |
0.0 | 1.0 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
0.0 | 1.2 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
0.0 | 0.2 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.0 | 0.3 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.0 | 1.5 | GO:0042393 | histone binding(GO:0042393) |
0.0 | 0.3 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.0 | 0.2 | GO:0070300 | phosphatidic acid binding(GO:0070300) |