Motif ID: Ctcfl_Ctcf
Z-value: 0.681
![logo of Ctcf](../logos/Ctcf.png)
![logo of Ctcfl](../logos/Ctcfl.png)
Transcription factors associated with Ctcfl_Ctcf:
Gene Symbol | Entrez ID | Gene Name |
---|---|---|
Ctcf | ENSMUSG00000005698.9 | Ctcf |
Ctcfl | ENSMUSG00000070495.5 | Ctcfl |
Activity-expression correlation:
Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Ctcfl | mm10_v2_chr2_-_173119402_173119525 | -0.63 | 1.3e-03 | Click! |
Ctcf | mm10_v2_chr8_+_105636509_105636589 | -0.55 | 6.8e-03 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 2.7 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.4 | 1.7 | GO:0014846 | esophagus smooth muscle contraction(GO:0014846) |
0.4 | 1.6 | GO:0032439 | endosome localization(GO:0032439) |
0.4 | 1.9 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.3 | 1.0 | GO:0051892 | negative regulation of cardioblast differentiation(GO:0051892) |
0.3 | 1.3 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
0.3 | 0.9 | GO:0016095 | polyprenol catabolic process(GO:0016095) |
0.3 | 2.2 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
0.3 | 1.1 | GO:0044268 | multicellular organismal protein metabolic process(GO:0044268) |
0.2 | 1.2 | GO:0043314 | negative regulation of neutrophil degranulation(GO:0043314) negative regulation of blood vessel remodeling(GO:0060313) |
0.2 | 0.7 | GO:0002636 | positive regulation of germinal center formation(GO:0002636) |
0.2 | 0.4 | GO:0042323 | negative regulation of circadian sleep/wake cycle, non-REM sleep(GO:0042323) negative regulation of mucus secretion(GO:0070256) |
0.2 | 0.8 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
0.2 | 0.6 | GO:0016256 | N-glycan processing to lysosome(GO:0016256) |
0.2 | 0.6 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
0.2 | 0.5 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
0.2 | 0.5 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.2 | 0.5 | GO:0060598 | dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
0.1 | 0.4 | GO:0046022 | regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
0.1 | 0.6 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.1 | 1.8 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.1 | 0.4 | GO:1904211 | membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
0.1 | 0.5 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
0.1 | 1.0 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.1 | 0.4 | GO:0043181 | vacuolar sequestering(GO:0043181) |
0.1 | 0.4 | GO:0090202 | transcriptional activation by promoter-enhancer looping(GO:0071733) regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
0.1 | 0.7 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.1 | 0.3 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
0.1 | 1.8 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
0.1 | 0.3 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.1 | 1.0 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
0.1 | 0.4 | GO:0008627 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) |
0.1 | 1.8 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.1 | 0.3 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.1 | 1.0 | GO:0032825 | positive regulation of natural killer cell differentiation(GO:0032825) |
0.1 | 1.3 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.1 | 0.3 | GO:0016321 | female meiosis chromosome segregation(GO:0016321) |
0.1 | 0.3 | GO:0072356 | chromosome passenger complex localization to kinetochore(GO:0072356) |
0.1 | 0.4 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
0.1 | 0.3 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
0.1 | 0.3 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
0.1 | 0.9 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
0.1 | 0.2 | GO:2000508 | regulation of dendritic cell chemotaxis(GO:2000508) positive regulation of dendritic cell chemotaxis(GO:2000510) |
0.1 | 1.2 | GO:0014049 | positive regulation of glutamate secretion(GO:0014049) detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
0.1 | 0.5 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.1 | 0.2 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.1 | 0.1 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
0.1 | 0.2 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
0.1 | 0.2 | GO:0009838 | abscission(GO:0009838) positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.1 | 0.4 | GO:0045988 | negative regulation of striated muscle contraction(GO:0045988) |
0.1 | 0.3 | GO:0060266 | positive regulation of respiratory burst involved in inflammatory response(GO:0060265) negative regulation of respiratory burst involved in inflammatory response(GO:0060266) negative regulation of respiratory burst(GO:0060268) |
0.1 | 0.3 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
0.1 | 0.1 | GO:0002432 | granuloma formation(GO:0002432) |
0.1 | 0.4 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.1 | 0.4 | GO:0051547 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
0.1 | 0.5 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.1 | 0.2 | GO:0046898 | response to cycloheximide(GO:0046898) |
0.1 | 0.2 | GO:0006558 | L-phenylalanine metabolic process(GO:0006558) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) |
0.1 | 0.4 | GO:0042095 | interferon-gamma biosynthetic process(GO:0042095) |
0.1 | 0.4 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
0.1 | 0.7 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
0.1 | 0.2 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.1 | 0.4 | GO:0015675 | nickel cation transport(GO:0015675) |
0.1 | 0.2 | GO:0003289 | atrial septum primum morphogenesis(GO:0003289) |
0.1 | 1.1 | GO:0032933 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
0.1 | 0.7 | GO:0043252 | prostaglandin transport(GO:0015732) sodium-independent organic anion transport(GO:0043252) |
0.1 | 0.2 | GO:0035973 | aggrephagy(GO:0035973) |
0.1 | 0.4 | GO:0015808 | L-alanine transport(GO:0015808) |
0.1 | 0.3 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.1 | 0.4 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.1 | 0.2 | GO:0006097 | glyoxylate cycle(GO:0006097) |
0.0 | 0.1 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.0 | 0.1 | GO:0097461 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
0.0 | 0.2 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
0.0 | 0.4 | GO:0090166 | Golgi disassembly(GO:0090166) |
0.0 | 0.1 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.0 | 0.2 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.0 | 0.1 | GO:0019236 | response to pheromone(GO:0019236) |
0.0 | 0.2 | GO:0003420 | regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
0.0 | 0.5 | GO:0014051 | gamma-aminobutyric acid secretion(GO:0014051) |
0.0 | 0.7 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.0 | 1.2 | GO:1902230 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
0.0 | 0.2 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.0 | 0.2 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
0.0 | 0.7 | GO:0001539 | cilium or flagellum-dependent cell motility(GO:0001539) cilium-dependent cell motility(GO:0060285) |
0.0 | 0.2 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.0 | 0.4 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
0.0 | 1.4 | GO:0007212 | dopamine receptor signaling pathway(GO:0007212) |
0.0 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.1 | GO:0070589 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule metabolic process(GO:0044036) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) cell wall organization or biogenesis(GO:0071554) |
0.0 | 0.1 | GO:0060023 | noradrenergic neuron differentiation(GO:0003357) soft palate development(GO:0060023) |
0.0 | 0.3 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.0 | 0.2 | GO:0000469 | cleavage involved in rRNA processing(GO:0000469) |
0.0 | 0.2 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.0 | 1.0 | GO:0042059 | negative regulation of epidermal growth factor receptor signaling pathway(GO:0042059) |
0.0 | 0.2 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
0.0 | 0.3 | GO:0035280 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) |
0.0 | 0.4 | GO:0000479 | endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
0.0 | 0.2 | GO:0072429 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.0 | 0.3 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
0.0 | 0.1 | GO:0050925 | negative regulation of negative chemotaxis(GO:0050925) |
0.0 | 0.2 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.0 | 0.1 | GO:0030827 | negative regulation of cGMP metabolic process(GO:0030824) negative regulation of cGMP biosynthetic process(GO:0030827) negative regulation of guanylate cyclase activity(GO:0031283) |
0.0 | 0.1 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
0.0 | 0.3 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
0.0 | 0.3 | GO:0009186 | deoxyribonucleoside diphosphate metabolic process(GO:0009186) |
0.0 | 0.1 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
0.0 | 0.4 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
0.0 | 0.2 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
0.0 | 0.1 | GO:0032364 | oxygen homeostasis(GO:0032364) |
0.0 | 0.1 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.0 | 0.4 | GO:0034389 | lipid particle organization(GO:0034389) |
0.0 | 0.2 | GO:0061436 | establishment of skin barrier(GO:0061436) |
0.0 | 0.2 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.0 | 0.1 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.0 | 0.3 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.0 | 0.2 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
0.0 | 0.2 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
0.0 | 0.1 | GO:0018343 | protein farnesylation(GO:0018343) |
0.0 | 0.1 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
0.0 | 0.5 | GO:0021535 | cell migration in hindbrain(GO:0021535) |
0.0 | 0.1 | GO:0010248 | B cell negative selection(GO:0002352) establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
0.0 | 0.1 | GO:0008611 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
0.0 | 0.0 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
0.0 | 0.2 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
0.0 | 0.1 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
0.0 | 0.4 | GO:0016180 | snRNA processing(GO:0016180) |
0.0 | 0.1 | GO:0003431 | growth plate cartilage chondrocyte differentiation(GO:0003418) growth plate cartilage chondrocyte development(GO:0003431) |
0.0 | 0.1 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.0 | 0.2 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.0 | 0.1 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.0 | 0.1 | GO:0071816 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
0.0 | 0.1 | GO:0039532 | negative regulation of viral-induced cytoplasmic pattern recognition receptor signaling pathway(GO:0039532) |
0.0 | 1.7 | GO:0014065 | phosphatidylinositol 3-kinase signaling(GO:0014065) |
0.0 | 0.8 | GO:0045773 | positive regulation of axon extension(GO:0045773) |
0.0 | 0.5 | GO:2000249 | regulation of actin cytoskeleton reorganization(GO:2000249) |
0.0 | 0.1 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.0 | 0.3 | GO:0042297 | vocal learning(GO:0042297) imitative learning(GO:0098596) observational learning(GO:0098597) learned vocalization behavior or vocal learning(GO:0098598) |
0.0 | 0.3 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
0.0 | 0.1 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
0.0 | 0.1 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.0 | 0.1 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
0.0 | 0.3 | GO:0032402 | melanosome transport(GO:0032402) |
0.0 | 0.0 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
0.0 | 0.3 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
0.0 | 0.1 | GO:0032026 | response to magnesium ion(GO:0032026) |
0.0 | 0.2 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
0.0 | 0.0 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.0 | 0.1 | GO:0051085 | chaperone mediated protein folding requiring cofactor(GO:0051085) |
0.0 | 0.2 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
0.0 | 0.0 | GO:0001705 | ectoderm formation(GO:0001705) |
0.0 | 0.3 | GO:0060716 | labyrinthine layer blood vessel development(GO:0060716) |
0.0 | 0.1 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
0.0 | 0.1 | GO:0006924 | activation-induced cell death of T cells(GO:0006924) |
0.0 | 0.1 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
0.0 | 0.6 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
0.0 | 0.0 | GO:0015870 | acetylcholine transport(GO:0015870) acetate ester transport(GO:1901374) |
0.0 | 0.3 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
0.0 | 0.3 | GO:0015813 | L-glutamate transport(GO:0015813) |
0.0 | 0.0 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
0.0 | 0.3 | GO:1903146 | regulation of mitophagy(GO:1903146) |
0.0 | 0.1 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
0.0 | 0.4 | GO:0034314 | Arp2/3 complex-mediated actin nucleation(GO:0034314) |
0.0 | 0.1 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
0.0 | 0.1 | GO:0046036 | GTP biosynthetic process(GO:0006183) CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
0.0 | 0.2 | GO:0060765 | regulation of androgen receptor signaling pathway(GO:0060765) |
Gene overrepresentation in cellular_component category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 1.6 | GO:0045179 | apical cortex(GO:0045179) |
0.2 | 1.0 | GO:0005683 | U7 snRNP(GO:0005683) |
0.2 | 2.0 | GO:0045298 | tubulin complex(GO:0045298) |
0.2 | 2.8 | GO:0043196 | varicosity(GO:0043196) |
0.2 | 1.7 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.2 | 0.5 | GO:0043224 | nuclear SCF ubiquitin ligase complex(GO:0043224) |
0.2 | 1.7 | GO:0000812 | Swr1 complex(GO:0000812) |
0.1 | 0.9 | GO:0097433 | dense body(GO:0097433) |
0.1 | 1.2 | GO:0043083 | synaptic cleft(GO:0043083) |
0.1 | 0.5 | GO:0000308 | cytoplasmic cyclin-dependent protein kinase holoenzyme complex(GO:0000308) |
0.1 | 0.7 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.1 | 0.3 | GO:0097233 | lamellar body membrane(GO:0097232) alveolar lamellar body membrane(GO:0097233) |
0.1 | 0.4 | GO:0071556 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
0.1 | 0.9 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.1 | 0.2 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.1 | 0.1 | GO:0031523 | Myb complex(GO:0031523) |
0.1 | 0.3 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.1 | 0.4 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.1 | 1.0 | GO:0016600 | flotillin complex(GO:0016600) |
0.1 | 0.3 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.1 | 0.2 | GO:0048179 | activin receptor complex(GO:0048179) |
0.1 | 0.2 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.0 | 0.1 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.0 | 0.2 | GO:1990130 | Iml1 complex(GO:1990130) |
0.0 | 0.7 | GO:0031512 | motile primary cilium(GO:0031512) |
0.0 | 0.3 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.0 | 0.3 | GO:0097452 | GAIT complex(GO:0097452) |
0.0 | 0.2 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.0 | 0.1 | GO:0016939 | kinesin II complex(GO:0016939) |
0.0 | 0.4 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
0.0 | 0.2 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.0 | 0.2 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.0 | 0.5 | GO:0001527 | microfibril(GO:0001527) |
0.0 | 0.2 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.0 | 0.4 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.0 | 0.3 | GO:0030008 | TRAPP complex(GO:0030008) |
0.0 | 0.1 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
0.0 | 0.2 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.0 | 0.4 | GO:0032279 | asymmetric synapse(GO:0032279) |
0.0 | 0.4 | GO:0032433 | filopodium tip(GO:0032433) |
0.0 | 1.2 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 0.3 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.0 | 0.2 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.0 | 1.1 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
0.0 | 0.2 | GO:0090543 | Flemming body(GO:0090543) |
0.0 | 0.6 | GO:0002102 | podosome(GO:0002102) |
0.0 | 0.3 | GO:0030057 | desmosome(GO:0030057) |
0.0 | 0.4 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.0 | 1.2 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.0 | 0.4 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.0 | 2.5 | GO:0043198 | dendritic shaft(GO:0043198) |
0.0 | 0.4 | GO:0032039 | integrator complex(GO:0032039) |
0.0 | 0.2 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.0 | 0.3 | GO:0070852 | cell body fiber(GO:0070852) |
0.0 | 0.1 | GO:0097361 | CIA complex(GO:0097361) |
0.0 | 0.3 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.0 | 0.3 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.0 | 0.1 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
0.0 | 0.1 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.0 | 0.1 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.0 | 0.0 | GO:0097450 | astrocyte end-foot(GO:0097450) |
0.0 | 0.2 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.0 | 1.5 | GO:0005581 | collagen trimer(GO:0005581) |
0.0 | 0.3 | GO:0005869 | dynactin complex(GO:0005869) |
0.0 | 0.3 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 1.1 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
0.0 | 0.3 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.0 | 0.2 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
0.0 | 0.4 | GO:0070069 | cytochrome complex(GO:0070069) |
0.0 | 0.2 | GO:0046930 | pore complex(GO:0046930) |
0.0 | 0.4 | GO:0071564 | npBAF complex(GO:0071564) |
0.0 | 0.1 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.0 | 0.1 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.0 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
0.0 | 0.8 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.0 | 0.3 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.0 | 0.2 | GO:0031931 | TORC1 complex(GO:0031931) |
0.0 | 0.4 | GO:0033270 | paranode region of axon(GO:0033270) |
0.0 | 0.3 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.0 | 1.5 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
0.0 | 0.0 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
0.0 | 0.3 | GO:0016580 | Sin3 complex(GO:0016580) |
0.0 | 0.1 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.0 | 0.0 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
0.0 | 0.1 | GO:0044327 | dendritic spine head(GO:0044327) |
0.0 | 0.2 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.0 | 0.5 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.0 | 0.3 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.0 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.0 | 0.1 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.0 | 0.1 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.0 | 0.6 | GO:0005905 | clathrin-coated pit(GO:0005905) |
Gene overrepresentation in molecular_function category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.2 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) C-X-C chemokine binding(GO:0019958) |
0.4 | 1.1 | GO:0003989 | acetyl-CoA carboxylase activity(GO:0003989) |
0.3 | 1.0 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.3 | 3.4 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.3 | 1.7 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.3 | 1.3 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
0.3 | 0.9 | GO:0047751 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) enone reductase activity(GO:0035671) cholestenone 5-alpha-reductase activity(GO:0047751) |
0.2 | 1.7 | GO:0030957 | Tat protein binding(GO:0030957) |
0.2 | 0.2 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.2 | 0.6 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.1 | 0.4 | GO:0031755 | endothelial differentiation G-protein coupled receptor binding(GO:0031753) Edg-2 lysophosphatidic acid receptor binding(GO:0031755) |
0.1 | 0.4 | GO:0032450 | oligo-1,6-glucosidase activity(GO:0004574) maltose alpha-glucosidase activity(GO:0032450) |
0.1 | 0.4 | GO:0015173 | hydrogen:amino acid symporter activity(GO:0005280) aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.1 | 0.6 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.1 | 0.5 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.1 | 0.7 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.1 | 0.4 | GO:0035473 | lipase binding(GO:0035473) |
0.1 | 0.7 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.1 | 0.7 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.1 | 2.0 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.1 | 0.2 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.1 | 0.3 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
0.1 | 0.2 | GO:0001888 | glucuronyl-galactosyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0001888) |
0.1 | 0.3 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.1 | 1.0 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
0.1 | 0.5 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.1 | 0.8 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.1 | 0.3 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.1 | 0.3 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
0.1 | 0.9 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.1 | 0.4 | GO:0032795 | G-protein coupled adenosine receptor activity(GO:0001609) heterotrimeric G-protein binding(GO:0032795) |
0.1 | 0.4 | GO:0015099 | nickel cation transmembrane transporter activity(GO:0015099) |
0.1 | 0.3 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.1 | 1.7 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.1 | 0.5 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
0.1 | 0.4 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.1 | 2.2 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.1 | 0.2 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
0.1 | 0.2 | GO:0051747 | cytosine C-5 DNA demethylase activity(GO:0051747) |
0.1 | 0.4 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
0.1 | 0.2 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
0.0 | 0.1 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.0 | 0.1 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.0 | 0.4 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.0 | 0.3 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.0 | 0.1 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.0 | 0.6 | GO:0005536 | glucose binding(GO:0005536) |
0.0 | 0.3 | GO:0033192 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.0 | 0.7 | GO:0023026 | MHC protein complex binding(GO:0023023) MHC class II protein complex binding(GO:0023026) |
0.0 | 0.2 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
0.0 | 0.4 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.0 | 0.3 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
0.0 | 0.2 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.0 | 0.9 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.0 | 0.2 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
0.0 | 0.2 | GO:0030984 | kininogen binding(GO:0030984) |
0.0 | 0.2 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.0 | 0.3 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.0 | 0.2 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.0 | 1.6 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.0 | 0.1 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
0.0 | 1.0 | GO:0034483 | heparan sulfate sulfotransferase activity(GO:0034483) |
0.0 | 0.4 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.0 | 0.3 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.0 | 0.2 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.0 | 0.6 | GO:0050253 | prenylcysteine methylesterase activity(GO:0010296) 1-oxa-2-oxocycloheptane lactonase activity(GO:0018731) sulfolactone hydrolase activity(GO:0018732) butyrolactone hydrolase activity(GO:0018734) endosulfan lactone lactonase activity(GO:0034892) L-ascorbate 6-phosphate lactonase activity(GO:0035460) Ser-tRNA(Thr) hydrolase activity(GO:0043905) Ala-tRNA(Pro) hydrolase activity(GO:0043906) Cys-tRNA(Pro) hydrolase activity(GO:0043907) Ser(Gly)-tRNA(Ala) hydrolase activity(GO:0043908) all-trans-retinyl-palmitate hydrolase, all-trans-retinol forming activity(GO:0047376) retinyl-palmitate esterase activity(GO:0050253) mannosyl-oligosaccharide 1,6-alpha-mannosidase activity(GO:0052767) mannosyl-oligosaccharide 1,3-alpha-mannosidase activity(GO:0052768) methyl indole-3-acetate esterase activity(GO:0080030) methyl salicylate esterase activity(GO:0080031) methyl jasmonate esterase activity(GO:0080032) |
0.0 | 0.3 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 0.1 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) calcium-induced calcium release activity(GO:0048763) |
0.0 | 0.1 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.0 | 0.2 | GO:0000150 | recombinase activity(GO:0000150) |
0.0 | 0.2 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.0 | 0.7 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.0 | 0.1 | GO:0019002 | GMP binding(GO:0019002) |
0.0 | 3.0 | GO:0030165 | PDZ domain binding(GO:0030165) |
0.0 | 0.3 | GO:0042556 | cobinamide kinase activity(GO:0008819) phytol kinase activity(GO:0010276) phenol kinase activity(GO:0018720) cyclin-dependent protein kinase activating kinase regulator activity(GO:0019914) inositol tetrakisphosphate 2-kinase activity(GO:0032942) heptose 7-phosphate kinase activity(GO:0033785) aminoglycoside phosphotransferase activity(GO:0034071) eukaryotic elongation factor-2 kinase regulator activity(GO:0042556) eukaryotic elongation factor-2 kinase activator activity(GO:0042557) LPPG:FO 2-phospho-L-lactate transferase activity(GO:0043743) cytidine kinase activity(GO:0043771) glycerate 2-kinase activity(GO:0043798) (S)-lactate 2-kinase activity(GO:0043841) phosphoserine:homoserine phosphotransferase activity(GO:0043899) L-seryl-tRNA(Sec) kinase activity(GO:0043915) phosphocholine transferase activity(GO:0044605) GTP-dependent polynucleotide kinase activity(GO:0051735) farnesol kinase activity(GO:0052668) CTP:2-trans,-6-trans-farnesol kinase activity(GO:0052669) geraniol kinase activity(GO:0052670) geranylgeraniol kinase activity(GO:0052671) CTP:geranylgeraniol kinase activity(GO:0052672) prenol kinase activity(GO:0052673) 1-phosphatidylinositol-5-kinase activity(GO:0052810) 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
0.0 | 0.1 | GO:0004954 | icosanoid receptor activity(GO:0004953) prostanoid receptor activity(GO:0004954) prostaglandin receptor activity(GO:0004955) |
0.0 | 0.2 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.0 | 1.1 | GO:0015485 | cholesterol binding(GO:0015485) |
0.0 | 0.2 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.0 | 0.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.0 | 0.1 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.0 | 0.1 | GO:0004660 | protein farnesyltransferase activity(GO:0004660) |
0.0 | 0.2 | GO:0008376 | acetylgalactosaminyltransferase activity(GO:0008376) |
0.0 | 0.2 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.0 | 0.1 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.0 | 0.3 | GO:0016653 | oxidoreductase activity, acting on NAD(P)H, heme protein as acceptor(GO:0016653) |
0.0 | 0.3 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.0 | 0.1 | GO:0004488 | methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
0.0 | 2.3 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.0 | 0.3 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.0 | 0.1 | GO:0015288 | porin activity(GO:0015288) |
0.0 | 0.3 | GO:0070034 | telomerase RNA binding(GO:0070034) |
0.0 | 0.1 | GO:0098631 | protein binding involved in cell adhesion(GO:0098631) |
0.0 | 0.3 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.0 | 0.1 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.0 | 0.1 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.0 | 0.3 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
0.0 | 0.2 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.0 | 1.1 | GO:0008186 | ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
0.0 | 0.4 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.0 | 0.3 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.0 | 0.1 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.0 | 0.1 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.0 | 0.4 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
0.0 | 0.1 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.0 | 0.4 | GO:0050681 | androgen receptor binding(GO:0050681) |
0.0 | 0.0 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
0.0 | 0.0 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
0.0 | 0.1 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.0 | 0.1 | GO:0051400 | BH domain binding(GO:0051400) |
0.0 | 0.0 | GO:0009374 | biotin binding(GO:0009374) |
0.0 | 1.3 | GO:0051117 | ATPase binding(GO:0051117) |
0.0 | 0.5 | GO:0045502 | dynein binding(GO:0045502) |
0.0 | 0.2 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.0 | 0.3 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.0 | 0.1 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.0 | 0.6 | GO:0044824 | integrase activity(GO:0008907) T/G mismatch-specific endonuclease activity(GO:0043765) retroviral integrase activity(GO:0044823) retroviral 3' processing activity(GO:0044824) |
0.0 | 0.1 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
0.0 | 0.2 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.0 | 0.0 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.0 | 0.1 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
0.0 | 0.5 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.0 | 0.4 | GO:0004407 | histone deacetylase activity(GO:0004407) |
0.0 | 0.1 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.0 | 0.8 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |