Motif ID: E2f2_E2f5
Z-value: 2.361
Transcription factors associated with E2f2_E2f5:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| E2f2 | ENSMUSG00000018983.9 | E2f2 |
| E2f5 | ENSMUSG00000027552.8 | E2f5 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| E2f2 | mm10_v2_chr4_+_136172367_136172395 | 0.73 | 8.6e-05 | Click! |
| E2f5 | mm10_v2_chr3_+_14578609_14578687 | 0.66 | 6.7e-04 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.7 | 29.6 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
| 3.6 | 10.7 | GO:0032877 | positive regulation of DNA endoreduplication(GO:0032877) |
| 1.6 | 11.1 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 1.4 | 11.1 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 1.4 | 5.4 | GO:0007056 | spindle assembly involved in female meiosis(GO:0007056) |
| 1.3 | 5.0 | GO:0071139 | resolution of recombination intermediates(GO:0071139) |
| 1.2 | 12.2 | GO:0009186 | deoxyribonucleoside diphosphate metabolic process(GO:0009186) |
| 1.1 | 9.1 | GO:0033504 | floor plate development(GO:0033504) |
| 1.0 | 3.0 | GO:0010512 | negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
| 0.9 | 8.0 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.9 | 3.4 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
| 0.8 | 2.5 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
| 0.8 | 8.3 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
| 0.8 | 4.6 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
| 0.7 | 3.7 | GO:0019230 | proprioception(GO:0019230) |
| 0.6 | 1.9 | GO:0036388 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 0.6 | 2.6 | GO:0044330 | canonical Wnt signaling pathway involved in positive regulation of wound healing(GO:0044330) lactic acid secretion(GO:0046722) regulation of metanephric cap mesenchymal cell proliferation(GO:0090095) positive regulation of metanephric cap mesenchymal cell proliferation(GO:0090096) |
| 0.6 | 3.1 | GO:0035984 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
| 0.6 | 2.4 | GO:0090069 | regulation of ribosome biogenesis(GO:0090069) |
| 0.6 | 2.9 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.6 | 3.5 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
| 0.6 | 2.3 | GO:0072369 | regulation of lipid transport by positive regulation of transcription from RNA polymerase II promoter(GO:0072369) |
| 0.6 | 2.3 | GO:0046655 | glycine biosynthetic process(GO:0006545) folic acid metabolic process(GO:0046655) |
| 0.5 | 2.1 | GO:0060266 | negative regulation of respiratory burst involved in inflammatory response(GO:0060266) negative regulation of respiratory burst(GO:0060268) |
| 0.5 | 1.5 | GO:0038093 | hematopoietic stem cell migration(GO:0035701) Fc receptor signaling pathway(GO:0038093) regulation of vascular smooth muscle cell differentiation(GO:1905063) positive regulation of vascular smooth muscle cell differentiation(GO:1905065) |
| 0.5 | 5.9 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
| 0.5 | 2.4 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
| 0.5 | 1.8 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.5 | 1.4 | GO:1901254 | positive regulation of intracellular transport of viral material(GO:1901254) |
| 0.4 | 2.6 | GO:0000212 | meiotic spindle organization(GO:0000212) |
| 0.4 | 1.7 | GO:0000076 | DNA replication checkpoint(GO:0000076) |
| 0.4 | 2.0 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
| 0.4 | 3.1 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.4 | 5.3 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
| 0.4 | 1.5 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.4 | 1.5 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.4 | 1.1 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.4 | 2.1 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.3 | 2.4 | GO:0019985 | translesion synthesis(GO:0019985) |
| 0.3 | 2.6 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
| 0.3 | 3.2 | GO:0015884 | positive regulation of platelet activation(GO:0010572) folic acid transport(GO:0015884) |
| 0.3 | 1.9 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 0.3 | 15.7 | GO:0008156 | negative regulation of DNA replication(GO:0008156) |
| 0.3 | 2.1 | GO:0060923 | cardiac muscle cell fate commitment(GO:0060923) |
| 0.3 | 0.3 | GO:0051311 | meiotic metaphase plate congression(GO:0051311) |
| 0.3 | 0.8 | GO:0045819 | positive regulation of glycogen catabolic process(GO:0045819) |
| 0.3 | 1.1 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.3 | 2.6 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.3 | 1.0 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.2 | 0.9 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
| 0.2 | 1.1 | GO:0036337 | Fas signaling pathway(GO:0036337) |
| 0.2 | 0.6 | GO:0060821 | inactivation of X chromosome by DNA methylation(GO:0060821) |
| 0.2 | 2.9 | GO:0060013 | righting reflex(GO:0060013) |
| 0.2 | 0.6 | GO:0002184 | cytoplasmic translational termination(GO:0002184) |
| 0.2 | 0.6 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
| 0.2 | 1.1 | GO:0048102 | autophagic cell death(GO:0048102) |
| 0.2 | 0.6 | GO:0070375 | ERK5 cascade(GO:0070375) |
| 0.2 | 0.9 | GO:0044791 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) negative regulation by host of viral genome replication(GO:0044828) |
| 0.2 | 1.6 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.2 | 2.1 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
| 0.2 | 2.2 | GO:0046628 | positive regulation of insulin receptor signaling pathway(GO:0046628) |
| 0.2 | 1.9 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
| 0.2 | 1.6 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.2 | 0.6 | GO:1904008 | cellular response to salt(GO:1902075) response to monosodium glutamate(GO:1904008) cellular response to monosodium glutamate(GO:1904009) |
| 0.2 | 0.6 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.2 | 1.4 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.2 | 0.5 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
| 0.1 | 0.4 | GO:0031990 | mRNA export from nucleus in response to heat stress(GO:0031990) |
| 0.1 | 0.4 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
| 0.1 | 0.8 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.1 | 0.9 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 0.1 | 0.4 | GO:0051026 | chiasma assembly(GO:0051026) |
| 0.1 | 4.8 | GO:0043550 | regulation of lipid kinase activity(GO:0043550) |
| 0.1 | 0.7 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
| 0.1 | 3.0 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
| 0.1 | 0.6 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.1 | 0.7 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 0.1 | 1.9 | GO:0002021 | response to dietary excess(GO:0002021) |
| 0.1 | 0.3 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
| 0.1 | 1.3 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.1 | 1.5 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.1 | 1.9 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
| 0.1 | 6.4 | GO:0030512 | negative regulation of transforming growth factor beta receptor signaling pathway(GO:0030512) negative regulation of cellular response to transforming growth factor beta stimulus(GO:1903845) |
| 0.1 | 1.1 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.1 | 2.1 | GO:0034453 | microtubule anchoring(GO:0034453) |
| 0.1 | 2.0 | GO:0043486 | histone exchange(GO:0043486) |
| 0.1 | 3.1 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.1 | 1.7 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.1 | 0.8 | GO:0051573 | negative regulation of histone H3-K9 methylation(GO:0051573) |
| 0.1 | 1.4 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
| 0.1 | 1.4 | GO:1904816 | positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
| 0.1 | 0.5 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
| 0.1 | 0.3 | GO:0036228 | protein targeting to nuclear inner membrane(GO:0036228) |
| 0.1 | 0.6 | GO:0009249 | protein lipoylation(GO:0009249) |
| 0.1 | 0.3 | GO:0086017 | Purkinje myocyte action potential(GO:0086017) Purkinje myocyte to ventricular cardiac muscle cell signaling(GO:0086029) Purkinje myocyte to ventricular cardiac muscle cell communication(GO:0086068) |
| 0.1 | 5.9 | GO:0006334 | nucleosome assembly(GO:0006334) |
| 0.1 | 0.6 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.1 | 1.0 | GO:0014051 | gamma-aminobutyric acid secretion(GO:0014051) |
| 0.1 | 2.5 | GO:0071480 | cellular response to gamma radiation(GO:0071480) |
| 0.1 | 1.9 | GO:0007340 | acrosome reaction(GO:0007340) |
| 0.1 | 1.1 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
| 0.1 | 0.6 | GO:0046607 | positive regulation of centrosome cycle(GO:0046607) |
| 0.1 | 0.5 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
| 0.1 | 0.9 | GO:0003281 | ventricular septum development(GO:0003281) |
| 0.1 | 0.7 | GO:0061088 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
| 0.1 | 0.7 | GO:0010826 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 0.1 | 1.9 | GO:0002455 | humoral immune response mediated by circulating immunoglobulin(GO:0002455) |
| 0.1 | 0.4 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.1 | 1.9 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.1 | 0.6 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
| 0.1 | 0.4 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
| 0.1 | 0.6 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
| 0.1 | 0.3 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
| 0.1 | 0.9 | GO:0042407 | cristae formation(GO:0042407) |
| 0.1 | 2.3 | GO:0032781 | positive regulation of ATPase activity(GO:0032781) |
| 0.1 | 0.3 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
| 0.1 | 1.0 | GO:0014049 | positive regulation of glutamate secretion(GO:0014049) |
| 0.1 | 0.5 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.1 | 1.6 | GO:0040037 | negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
| 0.1 | 0.9 | GO:0060134 | prepulse inhibition(GO:0060134) |
| 0.1 | 1.3 | GO:0007099 | centriole replication(GO:0007099) |
| 0.1 | 0.2 | GO:0007020 | microtubule nucleation(GO:0007020) |
| 0.1 | 1.6 | GO:2000249 | regulation of actin cytoskeleton reorganization(GO:2000249) |
| 0.1 | 1.8 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.1 | 0.2 | GO:0098763 | mitotic cell cycle phase(GO:0098763) |
| 0.1 | 0.2 | GO:0033092 | positive regulation of immature T cell proliferation in thymus(GO:0033092) |
| 0.0 | 0.3 | GO:0070561 | vitamin D receptor signaling pathway(GO:0070561) |
| 0.0 | 1.7 | GO:0090004 | positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
| 0.0 | 0.3 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.0 | 0.4 | GO:1901030 | positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
| 0.0 | 1.0 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
| 0.0 | 0.4 | GO:0006367 | transcription initiation from RNA polymerase II promoter(GO:0006367) |
| 0.0 | 0.7 | GO:0061157 | mRNA destabilization(GO:0061157) |
| 0.0 | 0.3 | GO:0016331 | morphogenesis of embryonic epithelium(GO:0016331) |
| 0.0 | 0.3 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.0 | 0.5 | GO:0044818 | mitotic G2/M transition checkpoint(GO:0044818) |
| 0.0 | 0.8 | GO:1900452 | regulation of long term synaptic depression(GO:1900452) |
| 0.0 | 0.1 | GO:0030242 | pexophagy(GO:0030242) |
| 0.0 | 0.3 | GO:2000279 | negative regulation of DNA biosynthetic process(GO:2000279) |
| 0.0 | 0.8 | GO:0021511 | spinal cord patterning(GO:0021511) |
| 0.0 | 0.9 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
| 0.0 | 0.4 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.0 | 0.3 | GO:0010225 | response to UV-C(GO:0010225) |
| 0.0 | 0.5 | GO:0031572 | G2 DNA damage checkpoint(GO:0031572) |
| 0.0 | 2.2 | GO:0000086 | G2/M transition of mitotic cell cycle(GO:0000086) |
| 0.0 | 0.6 | GO:0019430 | removal of superoxide radicals(GO:0019430) |
| 0.0 | 1.6 | GO:0000725 | double-strand break repair via homologous recombination(GO:0000724) recombinational repair(GO:0000725) |
| 0.0 | 0.7 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.0 | 0.3 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
| 0.0 | 0.2 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.0 | 0.7 | GO:0001885 | endothelial cell development(GO:0001885) |
| 0.0 | 4.6 | GO:0007018 | microtubule-based movement(GO:0007018) |
| 0.0 | 0.1 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.0 | 0.3 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
| 0.0 | 0.3 | GO:0040034 | regulation of development, heterochronic(GO:0040034) |
| 0.0 | 1.2 | GO:0051225 | spindle assembly(GO:0051225) |
| 0.0 | 0.1 | GO:0072395 | signal transduction involved in cell cycle checkpoint(GO:0072395) signal transduction involved in DNA integrity checkpoint(GO:0072401) signal transduction involved in DNA damage checkpoint(GO:0072422) |
| 0.0 | 0.1 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.0 | 0.8 | GO:0021510 | spinal cord development(GO:0021510) |
| 0.0 | 2.5 | GO:0035023 | regulation of Rho protein signal transduction(GO:0035023) |
| 0.0 | 0.3 | GO:0060416 | response to growth hormone(GO:0060416) |
| 0.0 | 1.7 | GO:0030010 | establishment of cell polarity(GO:0030010) |
| 0.0 | 0.1 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
| 0.0 | 0.2 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.0 | 0.0 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
| 0.0 | 0.2 | GO:0006221 | pyrimidine nucleotide biosynthetic process(GO:0006221) |
| 0.0 | 0.1 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.0 | 0.3 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.0 | 0.8 | GO:0007286 | spermatid development(GO:0007286) |
| 0.0 | 0.0 | GO:0034182 | regulation of maintenance of sister chromatid cohesion(GO:0034091) positive regulation of maintenance of sister chromatid cohesion(GO:0034093) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) positive regulation of sister chromatid cohesion(GO:0045876) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.6 | 12.9 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 1.2 | 7.1 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 1.1 | 3.2 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.9 | 0.9 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.8 | 2.3 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.8 | 3.8 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 0.6 | 1.9 | GO:0036387 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
| 0.6 | 6.4 | GO:0000800 | lateral element(GO:0000800) |
| 0.6 | 3.2 | GO:0000308 | cytoplasmic cyclin-dependent protein kinase holoenzyme complex(GO:0000308) |
| 0.5 | 2.4 | GO:0001651 | dense fibrillar component(GO:0001651) |
| 0.5 | 1.4 | GO:0042025 | viral replication complex(GO:0019034) host cell nucleus(GO:0042025) host cell nuclear part(GO:0044094) |
| 0.4 | 2.8 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.4 | 3.5 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 0.4 | 2.9 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.3 | 3.5 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.3 | 1.4 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
| 0.2 | 7.4 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.2 | 0.6 | GO:0031261 | DNA replication preinitiation complex(GO:0031261) |
| 0.2 | 2.6 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
| 0.2 | 0.6 | GO:0001740 | Barr body(GO:0001740) |
| 0.2 | 0.6 | GO:0018444 | translation release factor complex(GO:0018444) |
| 0.2 | 2.0 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.2 | 0.6 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
| 0.2 | 0.8 | GO:0016012 | sarcoglycan complex(GO:0016012) |
| 0.2 | 0.8 | GO:0001652 | granular component(GO:0001652) |
| 0.2 | 3.3 | GO:0001741 | XY body(GO:0001741) |
| 0.2 | 1.3 | GO:0098536 | deuterosome(GO:0098536) |
| 0.2 | 1.0 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.2 | 0.5 | GO:0000785 | chromatin(GO:0000785) |
| 0.2 | 1.2 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.1 | 8.7 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.1 | 3.1 | GO:0045120 | pronucleus(GO:0045120) |
| 0.1 | 1.9 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.1 | 0.7 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.1 | 0.4 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.1 | 6.4 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
| 0.1 | 0.8 | GO:0070187 | telosome(GO:0070187) |
| 0.1 | 7.5 | GO:0005871 | kinesin complex(GO:0005871) |
| 0.1 | 10.8 | GO:0005814 | centriole(GO:0005814) |
| 0.1 | 1.6 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.1 | 0.9 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.1 | 1.1 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.1 | 0.6 | GO:0005638 | lamin filament(GO:0005638) |
| 0.1 | 0.4 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.1 | 3.1 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.1 | 1.5 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.1 | 0.9 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.1 | 5.2 | GO:0001669 | acrosomal vesicle(GO:0001669) |
| 0.1 | 0.1 | GO:0030893 | meiotic cohesin complex(GO:0030893) |
| 0.1 | 0.3 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.1 | 0.4 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.1 | 0.9 | GO:0071565 | nBAF complex(GO:0071565) |
| 0.1 | 2.0 | GO:0000786 | nucleosome(GO:0000786) |
| 0.1 | 0.4 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
| 0.1 | 0.9 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.1 | 0.2 | GO:0034709 | methylosome(GO:0034709) |
| 0.0 | 0.3 | GO:0070695 | FHF complex(GO:0070695) |
| 0.0 | 0.7 | GO:0036038 | MKS complex(GO:0036038) |
| 0.0 | 0.8 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 2.6 | GO:0072686 | mitotic spindle(GO:0072686) |
| 0.0 | 5.2 | GO:0045111 | intermediate filament cytoskeleton(GO:0045111) |
| 0.0 | 0.5 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.0 | 3.4 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.0 | 0.5 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.0 | 16.8 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.0 | 2.6 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.0 | 1.6 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.0 | 3.0 | GO:0005902 | microvillus(GO:0005902) |
| 0.0 | 0.2 | GO:0030677 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
| 0.0 | 0.3 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.0 | 0.7 | GO:0002102 | podosome(GO:0002102) |
| 0.0 | 4.9 | GO:0000790 | nuclear chromatin(GO:0000790) |
| 0.0 | 2.0 | GO:0016363 | nuclear matrix(GO:0016363) |
| 0.0 | 0.9 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.0 | 1.9 | GO:0016605 | PML body(GO:0016605) |
| 0.0 | 0.3 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.0 | 3.2 | GO:0005923 | bicellular tight junction(GO:0005923) |
| 0.0 | 0.3 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.0 | 1.8 | GO:0030175 | filopodium(GO:0030175) |
| 0.0 | 1.5 | GO:0000793 | condensed chromosome(GO:0000793) |
| 0.0 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.0 | 1.9 | GO:0045211 | postsynaptic membrane(GO:0045211) |
| 0.0 | 0.2 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.0 | 0.1 | GO:0030057 | desmosome(GO:0030057) |
| 0.0 | 1.5 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
| 0.0 | 0.9 | GO:0005776 | autophagosome(GO:0005776) |
| 0.0 | 0.1 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.0 | 1.1 | GO:0005778 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.0 | 1.4 | GO:0005819 | spindle(GO:0005819) |
| 0.0 | 0.3 | GO:0035770 | ribonucleoprotein granule(GO:0035770) |
| 0.0 | 1.8 | GO:0014069 | postsynaptic density(GO:0014069) postsynaptic specialization(GO:0099572) |
| 0.0 | 0.9 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.0 | 0.4 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.0 | 1.0 | GO:0016607 | nuclear speck(GO:0016607) |
| 0.0 | 0.2 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.6 | 12.9 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 2.0 | 5.9 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 1.9 | 11.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.8 | 3.1 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.8 | 2.3 | GO:0051870 | methotrexate binding(GO:0051870) |
| 0.7 | 6.0 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.6 | 1.9 | GO:0016934 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
| 0.6 | 2.5 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.6 | 2.3 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.5 | 3.8 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.5 | 2.4 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.5 | 1.9 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
| 0.4 | 5.3 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.4 | 1.7 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
| 0.4 | 8.4 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.4 | 2.9 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.4 | 2.4 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.4 | 2.3 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.4 | 1.1 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.4 | 3.2 | GO:0008517 | folic acid transporter activity(GO:0008517) |
| 0.3 | 2.3 | GO:0003896 | DNA primase activity(GO:0003896) |
| 0.3 | 0.9 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
| 0.3 | 3.1 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.3 | 1.5 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.3 | 0.3 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
| 0.3 | 4.5 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.3 | 2.9 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.3 | 0.8 | GO:0000402 | open form four-way junction DNA binding(GO:0000401) crossed form four-way junction DNA binding(GO:0000402) |
| 0.3 | 1.0 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
| 0.2 | 1.2 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.2 | 2.8 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.2 | 1.6 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.2 | 1.9 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.2 | 1.0 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.2 | 3.0 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.2 | 0.6 | GO:0030337 | DNA polymerase processivity factor activity(GO:0030337) |
| 0.2 | 1.5 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.2 | 13.6 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
| 0.2 | 2.2 | GO:0031386 | protein tag(GO:0031386) |
| 0.2 | 1.1 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.1 | 0.4 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 0.1 | 23.7 | GO:0001047 | core promoter binding(GO:0001047) |
| 0.1 | 0.8 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
| 0.1 | 1.4 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.1 | 0.8 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.1 | 7.5 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.1 | 25.7 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
| 0.1 | 1.1 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.1 | 0.5 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.1 | 1.1 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.1 | 3.2 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.1 | 0.1 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.1 | 3.4 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.1 | 0.5 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.1 | 0.9 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
| 0.1 | 0.6 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.1 | 0.5 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
| 0.1 | 0.6 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
| 0.1 | 0.5 | GO:1990446 | U1 snRNP binding(GO:1990446) |
| 0.1 | 1.3 | GO:0070888 | E-box binding(GO:0070888) |
| 0.1 | 0.4 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.1 | 0.6 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.1 | 4.9 | GO:0005249 | voltage-gated potassium channel activity(GO:0005249) |
| 0.1 | 11.2 | GO:0042393 | histone binding(GO:0042393) |
| 0.1 | 1.1 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.1 | 0.3 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
| 0.1 | 1.9 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 0.0 | 0.7 | GO:0031005 | filamin binding(GO:0031005) |
| 0.0 | 1.4 | GO:0036002 | pre-mRNA binding(GO:0036002) |
| 0.0 | 0.3 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.0 | 1.7 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.0 | 0.3 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
| 0.0 | 0.3 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.0 | 0.4 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.0 | 0.9 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.0 | 0.3 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.0 | 1.9 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
| 0.0 | 11.7 | GO:0005096 | GTPase activator activity(GO:0005096) |
| 0.0 | 1.0 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.0 | 1.3 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.0 | 0.7 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.0 | 3.5 | GO:0001228 | transcriptional activator activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001228) |
| 0.0 | 0.2 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.0 | 0.6 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.0 | 0.5 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
| 0.0 | 1.7 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
| 0.0 | 17.1 | GO:0043565 | sequence-specific DNA binding(GO:0043565) |
| 0.0 | 0.3 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.0 | 2.5 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.0 | 0.8 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.0 | 0.9 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.0 | 1.2 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
| 0.0 | 1.1 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.0 | 2.6 | GO:0017124 | SH3 domain binding(GO:0017124) |
| 0.0 | 0.4 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.0 | 1.9 | GO:0003714 | transcription corepressor activity(GO:0003714) |
| 0.0 | 0.3 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
| 0.0 | 1.2 | GO:0004197 | cysteine-type endopeptidase activity(GO:0004197) |
| 0.0 | 0.4 | GO:0016676 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.0 | 0.3 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.0 | 1.1 | GO:0051219 | phosphoprotein binding(GO:0051219) |
| 0.0 | 0.8 | GO:0002039 | p53 binding(GO:0002039) |
| 0.0 | 1.0 | GO:0008186 | ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
| 0.0 | 1.5 | GO:0031072 | heat shock protein binding(GO:0031072) |
| 0.0 | 0.4 | GO:0031369 | translation initiation factor binding(GO:0031369) |
| 0.0 | 0.8 | GO:0051082 | unfolded protein binding(GO:0051082) |
| 0.0 | 0.4 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
| 0.0 | 0.2 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
| 0.0 | 2.0 | GO:0031625 | ubiquitin protein ligase binding(GO:0031625) |
|
|
|