| 1.2 |
6.1 |
GO:2000255 |
negative regulation of male germ cell proliferation(GO:2000255) |
| 1.0 |
2.0 |
GO:0090027 |
negative regulation of monocyte chemotaxis(GO:0090027) |
| 0.9 |
2.8 |
GO:0021893 |
cerebral cortex GABAergic interneuron fate commitment(GO:0021893) |
| 0.9 |
2.7 |
GO:1901552 |
positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.6 |
1.2 |
GO:0090191 |
negative regulation of branching involved in ureteric bud morphogenesis(GO:0090191) |
| 0.6 |
2.9 |
GO:0006167 |
AMP biosynthetic process(GO:0006167) |
| 0.6 |
1.7 |
GO:1902460 |
regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.6 |
2.3 |
GO:0003376 |
sphingosine-1-phosphate signaling pathway(GO:0003376) sphingolipid mediated signaling pathway(GO:0090520) |
| 0.5 |
1.6 |
GO:0006001 |
fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 0.5 |
2.1 |
GO:2000525 |
regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.5 |
1.9 |
GO:0010593 |
negative regulation of lamellipodium assembly(GO:0010593) |
| 0.5 |
1.9 |
GO:0006538 |
glutamate catabolic process(GO:0006538) |
| 0.5 |
1.8 |
GO:0006842 |
tricarboxylic acid transport(GO:0006842) succinate transport(GO:0015744) citrate transport(GO:0015746) |
| 0.4 |
1.8 |
GO:0038145 |
macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.4 |
0.4 |
GO:0061153 |
trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.4 |
3.9 |
GO:0002484 |
antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway(GO:0002484) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway, TAP-dependent(GO:0002485) |
| 0.4 |
2.5 |
GO:0045650 |
negative regulation of macrophage differentiation(GO:0045650) |
| 0.4 |
0.8 |
GO:0072103 |
glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) |
| 0.4 |
1.2 |
GO:0008228 |
opsonization(GO:0008228) |
| 0.4 |
2.0 |
GO:0046864 |
retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) alveolar primary septum development(GO:0061143) |
| 0.4 |
3.5 |
GO:0015721 |
bile acid and bile salt transport(GO:0015721) |
| 0.4 |
1.5 |
GO:0015793 |
glycerol transport(GO:0015793) |
| 0.4 |
0.8 |
GO:0071603 |
endothelial cell-cell adhesion(GO:0071603) |
| 0.4 |
1.9 |
GO:0021905 |
pancreatic A cell development(GO:0003322) forebrain-midbrain boundary formation(GO:0021905) somatic motor neuron fate commitment(GO:0021917) regulation of transcription from RNA polymerase II promoter involved in somatic motor neuron fate commitment(GO:0021918) |
| 0.4 |
2.5 |
GO:0010273 |
detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.4 |
1.1 |
GO:0046881 |
positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
| 0.3 |
1.0 |
GO:0046104 |
thymidine metabolic process(GO:0046104) |
| 0.3 |
1.4 |
GO:1903416 |
response to glycoside(GO:1903416) |
| 0.3 |
1.0 |
GO:0010533 |
regulation of activation of Janus kinase activity(GO:0010533) regulation of activation of JAK2 kinase activity(GO:0010534) |
| 0.3 |
1.0 |
GO:0072180 |
mesonephric duct development(GO:0072177) mesonephric duct morphogenesis(GO:0072180) |
| 0.3 |
1.3 |
GO:0061626 |
pharyngeal arch artery morphogenesis(GO:0061626) |
| 0.3 |
1.0 |
GO:2000983 |
regulation of ATP citrate synthase activity(GO:2000983) negative regulation of ATP citrate synthase activity(GO:2000984) |
| 0.3 |
1.0 |
GO:0009992 |
cellular water homeostasis(GO:0009992) |
| 0.3 |
0.3 |
GO:0032829 |
regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) |
| 0.3 |
1.2 |
GO:0048143 |
astrocyte activation(GO:0048143) |
| 0.3 |
1.9 |
GO:0071499 |
response to laminar fluid shear stress(GO:0034616) cellular response to laminar fluid shear stress(GO:0071499) |
| 0.3 |
0.6 |
GO:0035771 |
interleukin-4-mediated signaling pathway(GO:0035771) |
| 0.3 |
0.9 |
GO:0035621 |
ER to Golgi ceramide transport(GO:0035621) ceramide transport(GO:0035627) |
| 0.3 |
0.9 |
GO:0032650 |
regulation of interleukin-1 alpha production(GO:0032650) positive regulation of interleukin-1 alpha production(GO:0032730) interleukin-1 alpha secretion(GO:0050703) |
| 0.3 |
0.3 |
GO:0010748 |
negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) |
| 0.3 |
0.3 |
GO:2000562 |
negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.3 |
2.8 |
GO:2001214 |
positive regulation of vasculogenesis(GO:2001214) |
| 0.3 |
1.1 |
GO:0003430 |
tolerance induction to self antigen(GO:0002513) growth plate cartilage chondrocyte growth(GO:0003430) |
| 0.3 |
0.8 |
GO:0086046 |
membrane depolarization during SA node cell action potential(GO:0086046) |
| 0.3 |
1.7 |
GO:0019695 |
choline metabolic process(GO:0019695) |
| 0.3 |
0.5 |
GO:1903225 |
negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.3 |
0.8 |
GO:0035701 |
hematopoietic stem cell migration(GO:0035701) |
| 0.3 |
0.3 |
GO:0002488 |
antigen processing and presentation of endogenous peptide antigen via MHC class Ib via ER pathway(GO:0002488) antigen processing and presentation of endogenous peptide antigen via MHC class Ib via ER pathway, TAP-dependent(GO:0002489) |
| 0.3 |
1.4 |
GO:0032911 |
negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.3 |
0.8 |
GO:0006601 |
creatine biosynthetic process(GO:0006601) |
| 0.3 |
0.3 |
GO:0006533 |
aspartate catabolic process(GO:0006533) |
| 0.3 |
1.1 |
GO:0031284 |
positive regulation of guanylate cyclase activity(GO:0031284) |
| 0.3 |
1.0 |
GO:0033600 |
negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
| 0.3 |
0.8 |
GO:0035799 |
ureter maturation(GO:0035799) |
| 0.2 |
1.0 |
GO:0071449 |
cellular response to lipid hydroperoxide(GO:0071449) |
| 0.2 |
0.2 |
GO:1903960 |
negative regulation of anion transmembrane transport(GO:1903960) |
| 0.2 |
0.7 |
GO:0010898 |
positive regulation of triglyceride catabolic process(GO:0010898) |
| 0.2 |
1.0 |
GO:0060155 |
platelet dense granule organization(GO:0060155) |
| 0.2 |
1.4 |
GO:2000672 |
negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.2 |
1.4 |
GO:0071635 |
negative regulation of transforming growth factor beta production(GO:0071635) |
| 0.2 |
0.9 |
GO:0014043 |
negative regulation of neuron maturation(GO:0014043) |
| 0.2 |
0.2 |
GO:0001836 |
release of cytochrome c from mitochondria(GO:0001836) |
| 0.2 |
0.9 |
GO:0010701 |
positive regulation of norepinephrine secretion(GO:0010701) |
| 0.2 |
0.7 |
GO:0089700 |
protein kinase D signaling(GO:0089700) |
| 0.2 |
0.9 |
GO:1900426 |
positive regulation of defense response to bacterium(GO:1900426) |
| 0.2 |
1.4 |
GO:0061304 |
retinal blood vessel morphogenesis(GO:0061304) |
| 0.2 |
1.1 |
GO:0060353 |
regulation of cell adhesion molecule production(GO:0060353) positive regulation of cell adhesion molecule production(GO:0060355) |
| 0.2 |
1.5 |
GO:0071732 |
cellular response to nitric oxide(GO:0071732) |
| 0.2 |
0.9 |
GO:0090467 |
L-arginine import(GO:0043091) arginine import(GO:0090467) L-arginine transport(GO:1902023) |
| 0.2 |
0.2 |
GO:0090194 |
negative regulation of glomerular mesangial cell proliferation(GO:0072125) negative regulation of glomerulus development(GO:0090194) |
| 0.2 |
0.4 |
GO:0036118 |
hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.2 |
1.1 |
GO:0072015 |
glomerular visceral epithelial cell development(GO:0072015) glomerular epithelial cell development(GO:0072310) |
| 0.2 |
1.1 |
GO:0038018 |
Wnt receptor catabolic process(GO:0038018) |
| 0.2 |
0.2 |
GO:0098535 |
de novo centriole assembly(GO:0098535) |
| 0.2 |
0.8 |
GO:0051562 |
negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.2 |
1.2 |
GO:0048069 |
eye pigmentation(GO:0048069) |
| 0.2 |
1.0 |
GO:1903012 |
positive regulation of bone development(GO:1903012) |
| 0.2 |
1.2 |
GO:0001980 |
regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
| 0.2 |
0.6 |
GO:1903726 |
negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) negative regulation of lipid kinase activity(GO:0090219) negative regulation of phospholipid metabolic process(GO:1903726) |
| 0.2 |
0.8 |
GO:0009068 |
aspartate family amino acid catabolic process(GO:0009068) |
| 0.2 |
0.8 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 0.2 |
1.2 |
GO:1901979 |
regulation of inward rectifier potassium channel activity(GO:1901979) |
| 0.2 |
0.6 |
GO:0090271 |
positive regulation of fibroblast growth factor production(GO:0090271) |
| 0.2 |
1.0 |
GO:0045347 |
negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.2 |
0.8 |
GO:0035989 |
tendon development(GO:0035989) |
| 0.2 |
0.2 |
GO:0032902 |
nerve growth factor production(GO:0032902) |
| 0.2 |
0.6 |
GO:0032713 |
negative regulation of interleukin-4 production(GO:0032713) |
| 0.2 |
0.9 |
GO:0042758 |
long-chain fatty acid catabolic process(GO:0042758) |
| 0.2 |
0.8 |
GO:0007039 |
protein catabolic process in the vacuole(GO:0007039) |
| 0.2 |
1.1 |
GO:0015879 |
carnitine transport(GO:0015879) |
| 0.2 |
0.6 |
GO:0032430 |
positive regulation of phospholipase A2 activity(GO:0032430) |
| 0.2 |
0.6 |
GO:0006558 |
L-phenylalanine metabolic process(GO:0006558) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) |
| 0.2 |
0.2 |
GO:0048739 |
cardiac muscle fiber development(GO:0048739) |
| 0.2 |
1.6 |
GO:0043206 |
extracellular fibril organization(GO:0043206) |
| 0.2 |
1.9 |
GO:0035988 |
chondrocyte proliferation(GO:0035988) |
| 0.2 |
0.3 |
GO:0070103 |
regulation of interleukin-6-mediated signaling pathway(GO:0070103) negative regulation of interleukin-6-mediated signaling pathway(GO:0070104) |
| 0.2 |
0.7 |
GO:1904451 |
regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904451) positive regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904453) |
| 0.2 |
0.9 |
GO:0010835 |
regulation of protein ADP-ribosylation(GO:0010835) |
| 0.2 |
0.7 |
GO:0002086 |
diaphragm contraction(GO:0002086) |
| 0.2 |
0.5 |
GO:0060754 |
positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.2 |
0.3 |
GO:1900158 |
regulation of bone mineralization involved in bone maturation(GO:1900157) negative regulation of bone mineralization involved in bone maturation(GO:1900158) |
| 0.2 |
0.2 |
GO:0031069 |
hair follicle morphogenesis(GO:0031069) |
| 0.2 |
0.5 |
GO:0015712 |
hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.2 |
0.7 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.2 |
0.8 |
GO:0060178 |
regulation of exocyst localization(GO:0060178) |
| 0.2 |
0.5 |
GO:1903795 |
regulation of inorganic anion transmembrane transport(GO:1903795) |
| 0.2 |
0.2 |
GO:0060753 |
regulation of mast cell chemotaxis(GO:0060753) |
| 0.2 |
0.5 |
GO:0035880 |
embryonic nail plate morphogenesis(GO:0035880) |
| 0.2 |
0.6 |
GO:0060032 |
notochord regression(GO:0060032) |
| 0.2 |
0.5 |
GO:0060854 |
patterning of lymph vessels(GO:0060854) |
| 0.2 |
0.8 |
GO:2000504 |
positive regulation of blood vessel remodeling(GO:2000504) |
| 0.2 |
2.1 |
GO:0060579 |
ventral spinal cord interneuron fate commitment(GO:0060579) cell fate commitment involved in pattern specification(GO:0060581) |
| 0.2 |
0.8 |
GO:0045743 |
positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.2 |
0.5 |
GO:0019043 |
establishment of viral latency(GO:0019043) |
| 0.1 |
1.0 |
GO:0006729 |
tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.1 |
0.6 |
GO:0007066 |
female meiosis sister chromatid cohesion(GO:0007066) |
| 0.1 |
0.3 |
GO:2000157 |
regulation of protein K48-linked deubiquitination(GO:1903093) negative regulation of protein K48-linked deubiquitination(GO:1903094) negative regulation of ubiquitin-specific protease activity(GO:2000157) |
| 0.1 |
0.3 |
GO:0014063 |
negative regulation of serotonin secretion(GO:0014063) |
| 0.1 |
0.3 |
GO:0070278 |
extracellular matrix constituent secretion(GO:0070278) |
| 0.1 |
0.7 |
GO:0042511 |
positive regulation of tyrosine phosphorylation of Stat1 protein(GO:0042511) |
| 0.1 |
0.4 |
GO:0060763 |
mammary duct terminal end bud growth(GO:0060763) transepithelial ammonium transport(GO:0070634) |
| 0.1 |
0.3 |
GO:0032817 |
regulation of natural killer cell proliferation(GO:0032817) positive regulation of natural killer cell proliferation(GO:0032819) |
| 0.1 |
0.4 |
GO:2000314 |
negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
| 0.1 |
0.6 |
GO:0071072 |
negative regulation of phospholipid biosynthetic process(GO:0071072) |
| 0.1 |
0.4 |
GO:1902083 |
negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.1 |
0.4 |
GO:0060406 |
positive regulation of penile erection(GO:0060406) |
| 0.1 |
0.3 |
GO:0071680 |
response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 0.1 |
2.0 |
GO:0050966 |
detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
| 0.1 |
0.7 |
GO:0090269 |
fibroblast growth factor production(GO:0090269) regulation of fibroblast growth factor production(GO:0090270) |
| 0.1 |
0.3 |
GO:0097494 |
regulation of vesicle size(GO:0097494) |
| 0.1 |
1.1 |
GO:0006477 |
protein sulfation(GO:0006477) |
| 0.1 |
0.4 |
GO:0032877 |
positive regulation of DNA endoreduplication(GO:0032877) |
| 0.1 |
0.7 |
GO:0050847 |
progesterone receptor signaling pathway(GO:0050847) |
| 0.1 |
0.4 |
GO:0036166 |
phenotypic switching(GO:0036166) |
| 0.1 |
0.4 |
GO:1903847 |
regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
| 0.1 |
0.4 |
GO:0002351 |
type III hypersensitivity(GO:0001802) regulation of type III hypersensitivity(GO:0001803) positive regulation of type III hypersensitivity(GO:0001805) serotonin production involved in inflammatory response(GO:0002351) serotonin secretion involved in inflammatory response(GO:0002442) serotonin secretion by platelet(GO:0002554) positive regulation of mast cell cytokine production(GO:0032765) |
| 0.1 |
0.4 |
GO:0036092 |
phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.1 |
1.1 |
GO:0002315 |
marginal zone B cell differentiation(GO:0002315) |
| 0.1 |
0.4 |
GO:0042196 |
dichloromethane metabolic process(GO:0018900) chlorinated hydrocarbon metabolic process(GO:0042196) halogenated hydrocarbon metabolic process(GO:0042197) |
| 0.1 |
0.4 |
GO:0035106 |
operant conditioning(GO:0035106) |
| 0.1 |
0.4 |
GO:0000087 |
mitotic M phase(GO:0000087) |
| 0.1 |
0.6 |
GO:0031033 |
myosin filament organization(GO:0031033) |
| 0.1 |
0.6 |
GO:0034421 |
post-translational protein acetylation(GO:0034421) |
| 0.1 |
1.1 |
GO:0009404 |
toxin metabolic process(GO:0009404) |
| 0.1 |
0.4 |
GO:0003278 |
apoptotic process involved in heart morphogenesis(GO:0003278) |
| 0.1 |
1.5 |
GO:2000353 |
positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.1 |
0.1 |
GO:0006119 |
oxidative phosphorylation(GO:0006119) |
| 0.1 |
0.2 |
GO:0060166 |
olfactory pit development(GO:0060166) |
| 0.1 |
0.8 |
GO:0006621 |
protein retention in ER lumen(GO:0006621) |
| 0.1 |
0.4 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.1 |
0.1 |
GO:1903525 |
regulation of membrane tubulation(GO:1903525) |
| 0.1 |
0.9 |
GO:0006691 |
leukotriene metabolic process(GO:0006691) |
| 0.1 |
2.1 |
GO:0006958 |
complement activation, classical pathway(GO:0006958) |
| 0.1 |
0.2 |
GO:0098528 |
skeletal muscle fiber differentiation(GO:0098528) |
| 0.1 |
0.2 |
GO:0015920 |
lipopolysaccharide transport(GO:0015920) |
| 0.1 |
0.5 |
GO:1902669 |
positive regulation of axon extension involved in axon guidance(GO:0048842) positive regulation of axon guidance(GO:1902669) |
| 0.1 |
0.5 |
GO:0051599 |
response to hydrostatic pressure(GO:0051599) |
| 0.1 |
0.6 |
GO:0097503 |
sialylation(GO:0097503) |
| 0.1 |
0.5 |
GO:0046469 |
platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.1 |
0.6 |
GO:0010032 |
meiotic chromosome condensation(GO:0010032) |
| 0.1 |
0.6 |
GO:2001170 |
negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.1 |
0.2 |
GO:0034141 |
positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
| 0.1 |
0.7 |
GO:0070447 |
positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
| 0.1 |
0.9 |
GO:0061298 |
retina vasculature development in camera-type eye(GO:0061298) |
| 0.1 |
0.7 |
GO:0007406 |
negative regulation of neuroblast proliferation(GO:0007406) |
| 0.1 |
0.2 |
GO:0051342 |
regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
| 0.1 |
0.3 |
GO:0035696 |
monocyte extravasation(GO:0035696) regulation of monocyte extravasation(GO:2000437) |
| 0.1 |
0.6 |
GO:0006027 |
glycosaminoglycan catabolic process(GO:0006027) |
| 0.1 |
0.7 |
GO:0071699 |
olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
| 0.1 |
0.1 |
GO:0001787 |
natural killer cell proliferation(GO:0001787) |
| 0.1 |
0.6 |
GO:0044034 |
negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.1 |
0.5 |
GO:0036159 |
inner dynein arm assembly(GO:0036159) |
| 0.1 |
0.3 |
GO:0060821 |
inactivation of X chromosome by DNA methylation(GO:0060821) |
| 0.1 |
2.0 |
GO:0032757 |
positive regulation of interleukin-8 production(GO:0032757) |
| 0.1 |
0.2 |
GO:0006600 |
creatine metabolic process(GO:0006600) |
| 0.1 |
0.2 |
GO:0035166 |
post-embryonic hemopoiesis(GO:0035166) |
| 0.1 |
0.8 |
GO:0018401 |
peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.1 |
0.7 |
GO:0021869 |
forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.1 |
0.3 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.1 |
0.5 |
GO:0035095 |
behavioral response to nicotine(GO:0035095) |
| 0.1 |
1.6 |
GO:0070050 |
neuron cellular homeostasis(GO:0070050) |
| 0.1 |
0.8 |
GO:0061436 |
establishment of skin barrier(GO:0061436) |
| 0.1 |
0.4 |
GO:0046398 |
UDP-N-acetylgalactosamine metabolic process(GO:0019276) UDP-glucuronate metabolic process(GO:0046398) |
| 0.1 |
0.1 |
GO:0010891 |
negative regulation of sequestering of triglyceride(GO:0010891) |
| 0.1 |
0.4 |
GO:0090324 |
negative regulation of oxidative phosphorylation(GO:0090324) |
| 0.1 |
0.4 |
GO:0070305 |
response to cGMP(GO:0070305) cellular response to cGMP(GO:0071321) |
| 0.1 |
0.2 |
GO:0007262 |
STAT protein import into nucleus(GO:0007262) |
| 0.1 |
0.1 |
GO:0032805 |
positive regulation of low-density lipoprotein particle receptor catabolic process(GO:0032805) |
| 0.1 |
0.3 |
GO:1904879 |
positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.1 |
2.3 |
GO:0060445 |
branching involved in salivary gland morphogenesis(GO:0060445) |
| 0.1 |
0.8 |
GO:0043312 |
neutrophil degranulation(GO:0043312) |
| 0.1 |
0.1 |
GO:0032095 |
regulation of response to food(GO:0032095) negative regulation of response to food(GO:0032096) negative regulation of appetite(GO:0032099) |
| 0.1 |
0.1 |
GO:0042420 |
dopamine catabolic process(GO:0042420) |
| 0.1 |
0.1 |
GO:2001015 |
negative regulation of skeletal muscle cell differentiation(GO:2001015) |
| 0.1 |
0.7 |
GO:2000194 |
regulation of female gonad development(GO:2000194) |
| 0.1 |
0.4 |
GO:0042891 |
antibiotic transport(GO:0042891) |
| 0.1 |
0.3 |
GO:2000973 |
regulation of pro-B cell differentiation(GO:2000973) |
| 0.1 |
2.6 |
GO:1901522 |
positive regulation of transcription from RNA polymerase II promoter involved in cellular response to chemical stimulus(GO:1901522) |
| 0.1 |
0.6 |
GO:0015812 |
gamma-aminobutyric acid transport(GO:0015812) |
| 0.1 |
0.5 |
GO:0010991 |
negative regulation of SMAD protein complex assembly(GO:0010991) |
| 0.1 |
0.6 |
GO:1902261 |
positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.1 |
0.2 |
GO:0097531 |
mast cell migration(GO:0097531) |
| 0.1 |
0.2 |
GO:0070375 |
ERK5 cascade(GO:0070375) |
| 0.1 |
0.4 |
GO:0007216 |
G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 0.1 |
0.3 |
GO:0009446 |
putrescine biosynthetic process(GO:0009446) |
| 0.1 |
0.6 |
GO:0006046 |
N-acetylglucosamine catabolic process(GO:0006046) |
| 0.1 |
0.2 |
GO:0042045 |
epithelial fluid transport(GO:0042045) |
| 0.1 |
0.5 |
GO:0021984 |
adenohypophysis development(GO:0021984) |
| 0.1 |
0.5 |
GO:0044331 |
cell-cell adhesion mediated by cadherin(GO:0044331) |
| 0.1 |
0.3 |
GO:1902528 |
regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 0.1 |
0.3 |
GO:0033262 |
regulation of nuclear cell cycle DNA replication(GO:0033262) |
| 0.1 |
0.2 |
GO:0035729 |
response to hepatocyte growth factor(GO:0035728) cellular response to hepatocyte growth factor stimulus(GO:0035729) |
| 0.1 |
0.3 |
GO:0070589 |
cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule metabolic process(GO:0044036) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) cell wall organization or biogenesis(GO:0071554) |
| 0.1 |
0.4 |
GO:0060050 |
positive regulation of protein glycosylation(GO:0060050) |
| 0.1 |
0.6 |
GO:0071712 |
ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.1 |
0.3 |
GO:0070973 |
protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.1 |
0.1 |
GO:0006532 |
aspartate biosynthetic process(GO:0006532) |
| 0.1 |
0.4 |
GO:0002710 |
negative regulation of T cell mediated immunity(GO:0002710) |
| 0.1 |
0.3 |
GO:0035814 |
negative regulation of renal sodium excretion(GO:0035814) |
| 0.1 |
0.6 |
GO:0051503 |
adenine nucleotide transport(GO:0051503) |
| 0.1 |
0.2 |
GO:0046391 |
5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.1 |
0.7 |
GO:1904707 |
positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.1 |
0.6 |
GO:0045607 |
regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.1 |
0.6 |
GO:1903861 |
regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
| 0.1 |
0.3 |
GO:0035609 |
C-terminal protein deglutamylation(GO:0035609) |
| 0.1 |
0.3 |
GO:0044565 |
dendritic cell proliferation(GO:0044565) |
| 0.1 |
0.2 |
GO:0046533 |
regulation of photoreceptor cell differentiation(GO:0046532) negative regulation of photoreceptor cell differentiation(GO:0046533) |
| 0.1 |
1.3 |
GO:0019369 |
arachidonic acid metabolic process(GO:0019369) |
| 0.1 |
1.0 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 0.1 |
0.6 |
GO:0051639 |
actin filament network formation(GO:0051639) |
| 0.1 |
0.9 |
GO:1902993 |
positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
| 0.1 |
1.2 |
GO:0032060 |
bleb assembly(GO:0032060) |
| 0.1 |
0.1 |
GO:0006702 |
androgen biosynthetic process(GO:0006702) |
| 0.1 |
0.5 |
GO:1900029 |
positive regulation of ruffle assembly(GO:1900029) |
| 0.1 |
0.7 |
GO:0070574 |
cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.1 |
0.2 |
GO:0008612 |
peptidyl-lysine modification to peptidyl-hypusine(GO:0008612) |
| 0.1 |
0.2 |
GO:0014873 |
response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
| 0.1 |
0.2 |
GO:0031394 |
regulation of prostaglandin biosynthetic process(GO:0031392) positive regulation of prostaglandin biosynthetic process(GO:0031394) regulation of unsaturated fatty acid biosynthetic process(GO:2001279) positive regulation of unsaturated fatty acid biosynthetic process(GO:2001280) |
| 0.1 |
0.8 |
GO:0034498 |
early endosome to Golgi transport(GO:0034498) |
| 0.1 |
0.2 |
GO:0060437 |
lung growth(GO:0060437) |
| 0.1 |
0.1 |
GO:0090045 |
positive regulation of deacetylase activity(GO:0090045) |
| 0.1 |
0.5 |
GO:1903301 |
positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
| 0.1 |
0.3 |
GO:0071316 |
positive regulation of interleukin-12 biosynthetic process(GO:0045084) cellular response to nicotine(GO:0071316) positive regulation of miRNA metabolic process(GO:2000630) |
| 0.1 |
0.1 |
GO:0050859 |
negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.1 |
0.1 |
GO:0071895 |
odontoblast differentiation(GO:0071895) |
| 0.1 |
0.7 |
GO:0010459 |
negative regulation of heart rate(GO:0010459) |
| 0.1 |
0.4 |
GO:0071294 |
cellular response to zinc ion(GO:0071294) |
| 0.1 |
0.3 |
GO:0032901 |
positive regulation of neurotrophin production(GO:0032901) |
| 0.1 |
0.3 |
GO:0015886 |
heme transport(GO:0015886) |
| 0.1 |
0.9 |
GO:0034497 |
protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.1 |
0.2 |
GO:1990481 |
mRNA pseudouridine synthesis(GO:1990481) |
| 0.1 |
0.2 |
GO:0090370 |
negative regulation of cholesterol efflux(GO:0090370) |
| 0.1 |
0.5 |
GO:0006686 |
sphingomyelin biosynthetic process(GO:0006686) |
| 0.1 |
0.3 |
GO:0034392 |
negative regulation of smooth muscle cell apoptotic process(GO:0034392) |
| 0.1 |
0.5 |
GO:0021891 |
olfactory bulb interneuron development(GO:0021891) |
| 0.1 |
0.2 |
GO:0032815 |
negative regulation of natural killer cell activation(GO:0032815) |
| 0.1 |
1.5 |
GO:0034315 |
regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
| 0.1 |
0.1 |
GO:0035360 |
positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
| 0.1 |
0.6 |
GO:0014850 |
response to muscle activity(GO:0014850) |
| 0.1 |
0.2 |
GO:2000774 |
positive regulation of cellular senescence(GO:2000774) |
| 0.1 |
0.3 |
GO:0018126 |
protein hydroxylation(GO:0018126) |
| 0.1 |
0.4 |
GO:0046628 |
positive regulation of insulin receptor signaling pathway(GO:0046628) |
| 0.1 |
0.4 |
GO:0061087 |
positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.1 |
0.3 |
GO:0045799 |
positive regulation of chromatin assembly or disassembly(GO:0045799) |
| 0.1 |
0.2 |
GO:0038203 |
TORC2 signaling(GO:0038203) |
| 0.1 |
0.4 |
GO:0032483 |
regulation of Rab protein signal transduction(GO:0032483) |
| 0.1 |
0.2 |
GO:0000289 |
nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 0.1 |
0.3 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 0.1 |
0.3 |
GO:1901341 |
activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.1 |
0.6 |
GO:0044381 |
glucose import in response to insulin stimulus(GO:0044381) regulation of glucose import in response to insulin stimulus(GO:2001273) |
| 0.1 |
0.3 |
GO:0033085 |
negative regulation of T cell differentiation in thymus(GO:0033085) |
| 0.1 |
0.5 |
GO:0019532 |
oxalate transport(GO:0019532) |
| 0.1 |
0.5 |
GO:0034380 |
high-density lipoprotein particle assembly(GO:0034380) |
| 0.1 |
0.2 |
GO:0051006 |
positive regulation of lipoprotein lipase activity(GO:0051006) |
| 0.1 |
0.3 |
GO:0014050 |
negative regulation of glutamate secretion(GO:0014050) |
| 0.1 |
1.7 |
GO:0002474 |
antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 0.1 |
1.1 |
GO:0051044 |
positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.1 |
0.1 |
GO:1902953 |
positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
| 0.1 |
0.4 |
GO:0071260 |
cellular response to mechanical stimulus(GO:0071260) |
| 0.1 |
0.4 |
GO:0006172 |
ADP biosynthetic process(GO:0006172) |
| 0.1 |
0.1 |
GO:0034123 |
positive regulation of toll-like receptor signaling pathway(GO:0034123) |
| 0.1 |
0.3 |
GO:0010808 |
positive regulation of synaptic vesicle priming(GO:0010808) positive regulation of synaptic vesicle exocytosis(GO:2000302) |
| 0.1 |
0.1 |
GO:1903393 |
positive regulation of adherens junction organization(GO:1903393) |
| 0.1 |
0.1 |
GO:0021759 |
globus pallidus development(GO:0021759) |
| 0.1 |
0.4 |
GO:0032229 |
negative regulation of synaptic transmission, GABAergic(GO:0032229) |
| 0.1 |
0.7 |
GO:2000480 |
negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.1 |
0.4 |
GO:2000051 |
negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.1 |
1.0 |
GO:0090161 |
Golgi ribbon formation(GO:0090161) |
| 0.1 |
2.1 |
GO:0098661 |
inorganic anion transmembrane transport(GO:0098661) |
| 0.1 |
0.2 |
GO:0030210 |
heparin biosynthetic process(GO:0030210) |
| 0.1 |
1.0 |
GO:0032287 |
peripheral nervous system myelin maintenance(GO:0032287) |
| 0.1 |
0.7 |
GO:0032331 |
negative regulation of chondrocyte differentiation(GO:0032331) |
| 0.1 |
0.1 |
GO:0010700 |
negative regulation of norepinephrine secretion(GO:0010700) |
| 0.1 |
0.2 |
GO:0006049 |
UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.1 |
0.2 |
GO:0042560 |
10-formyltetrahydrofolate catabolic process(GO:0009258) folic acid-containing compound catabolic process(GO:0009397) pteridine-containing compound catabolic process(GO:0042560) |
| 0.1 |
0.3 |
GO:0060575 |
intestinal epithelial cell differentiation(GO:0060575) |
| 0.1 |
0.3 |
GO:0016557 |
peroxisome membrane biogenesis(GO:0016557) |
| 0.1 |
0.2 |
GO:0042905 |
9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.1 |
2.9 |
GO:0033692 |
cellular polysaccharide biosynthetic process(GO:0033692) |
| 0.1 |
0.2 |
GO:0006624 |
vacuolar protein processing(GO:0006624) |
| 0.1 |
0.3 |
GO:0060346 |
bone trabecula formation(GO:0060346) |
| 0.1 |
0.2 |
GO:0021940 |
positive regulation of cerebellar granule cell precursor proliferation(GO:0021940) |
| 0.1 |
0.5 |
GO:0033603 |
positive regulation of dopamine secretion(GO:0033603) |
| 0.1 |
0.2 |
GO:0097500 |
receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.1 |
0.4 |
GO:0007221 |
positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.1 |
0.1 |
GO:0060060 |
post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
| 0.1 |
0.3 |
GO:0045578 |
negative regulation of B cell differentiation(GO:0045578) |
| 0.1 |
0.3 |
GO:0060330 |
regulation of response to interferon-gamma(GO:0060330) |
| 0.1 |
0.3 |
GO:0009449 |
gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 0.1 |
0.3 |
GO:1990928 |
response to amino acid starvation(GO:1990928) |
| 0.1 |
0.2 |
GO:0002339 |
B cell selection(GO:0002339) |
| 0.1 |
0.5 |
GO:0032967 |
positive regulation of collagen biosynthetic process(GO:0032967) |
| 0.1 |
0.2 |
GO:0070459 |
prolactin secretion(GO:0070459) |
| 0.1 |
0.2 |
GO:0016480 |
negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.1 |
0.2 |
GO:2000483 |
negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.1 |
0.2 |
GO:0045659 |
negative regulation of interleukin-6 biosynthetic process(GO:0045409) regulation of neutrophil differentiation(GO:0045658) negative regulation of neutrophil differentiation(GO:0045659) |
| 0.1 |
0.6 |
GO:0044406 |
adhesion of symbiont to host(GO:0044406) |
| 0.1 |
0.2 |
GO:0006556 |
S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.1 |
0.1 |
GO:0035964 |
COPI-coated vesicle budding(GO:0035964) |
| 0.1 |
0.3 |
GO:0006855 |
drug transmembrane transport(GO:0006855) |
| 0.1 |
0.2 |
GO:0006646 |
phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.1 |
0.3 |
GO:0016127 |
cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.1 |
0.4 |
GO:0010587 |
miRNA catabolic process(GO:0010587) |
| 0.1 |
0.7 |
GO:0090136 |
epithelial cell-cell adhesion(GO:0090136) |
| 0.1 |
0.2 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.1 |
0.3 |
GO:0032460 |
negative regulation of protein oligomerization(GO:0032460) regulation of protein homooligomerization(GO:0032462) negative regulation of protein homooligomerization(GO:0032463) |
| 0.0 |
0.3 |
GO:0070914 |
UV-damage excision repair(GO:0070914) |
| 0.0 |
0.3 |
GO:0000022 |
mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
| 0.0 |
0.0 |
GO:1900377 |
negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 0.0 |
0.6 |
GO:0048240 |
sperm capacitation(GO:0048240) |
| 0.0 |
0.4 |
GO:0034219 |
carbohydrate transmembrane transport(GO:0034219) |
| 0.0 |
0.1 |
GO:0032466 |
negative regulation of cytokinesis(GO:0032466) |
| 0.0 |
0.8 |
GO:0046597 |
negative regulation of viral entry into host cell(GO:0046597) |
| 0.0 |
0.1 |
GO:1902260 |
negative regulation of delayed rectifier potassium channel activity(GO:1902260) negative regulation of voltage-gated potassium channel activity(GO:1903817) |
| 0.0 |
0.1 |
GO:1904996 |
positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 0.0 |
0.3 |
GO:0007253 |
cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.0 |
0.1 |
GO:0045054 |
constitutive secretory pathway(GO:0045054) |
| 0.0 |
0.1 |
GO:0042362 |
fat-soluble vitamin biosynthetic process(GO:0042362) |
| 0.0 |
0.1 |
GO:0016191 |
synaptic vesicle uncoating(GO:0016191) regulation of endosome organization(GO:1904978) positive regulation of endosome organization(GO:1904980) |
| 0.0 |
0.4 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.0 |
0.3 |
GO:1901386 |
negative regulation of voltage-gated calcium channel activity(GO:1901386) |
| 0.0 |
0.3 |
GO:0002347 |
response to tumor cell(GO:0002347) |
| 0.0 |
0.2 |
GO:0071475 |
cellular hyperosmotic salinity response(GO:0071475) |
| 0.0 |
0.6 |
GO:0018149 |
peptide cross-linking(GO:0018149) |
| 0.0 |
0.3 |
GO:0044344 |
cellular response to fibroblast growth factor stimulus(GO:0044344) |
| 0.0 |
0.3 |
GO:1903025 |
regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.0 |
0.2 |
GO:0032484 |
Ral protein signal transduction(GO:0032484) |
| 0.0 |
0.6 |
GO:0042541 |
hemoglobin biosynthetic process(GO:0042541) |
| 0.0 |
0.1 |
GO:0021523 |
somatic motor neuron differentiation(GO:0021523) |
| 0.0 |
0.2 |
GO:0036158 |
outer dynein arm assembly(GO:0036158) |
| 0.0 |
0.9 |
GO:0007214 |
gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.0 |
0.3 |
GO:0030382 |
sperm mitochondrion organization(GO:0030382) |
| 0.0 |
0.5 |
GO:0055070 |
copper ion homeostasis(GO:0055070) |
| 0.0 |
0.3 |
GO:0001844 |
protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:0001844) |
| 0.0 |
0.8 |
GO:1900153 |
regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.0 |
0.2 |
GO:1903887 |
motile primary cilium assembly(GO:1903887) |
| 0.0 |
0.1 |
GO:0019471 |
4-hydroxyproline metabolic process(GO:0019471) |
| 0.0 |
1.0 |
GO:0030199 |
collagen fibril organization(GO:0030199) |
| 0.0 |
0.0 |
GO:2001274 |
negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.0 |
0.2 |
GO:0045053 |
protein retention in Golgi apparatus(GO:0045053) |
| 0.0 |
0.3 |
GO:1901162 |
serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
| 0.0 |
0.2 |
GO:0050747 |
positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.0 |
0.3 |
GO:1990118 |
sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.0 |
1.1 |
GO:0045838 |
positive regulation of membrane potential(GO:0045838) |
| 0.0 |
0.1 |
GO:0046501 |
protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.0 |
0.1 |
GO:0061669 |
spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
| 0.0 |
0.1 |
GO:0035526 |
retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.0 |
0.2 |
GO:0042985 |
negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.0 |
0.6 |
GO:0030212 |
hyaluronan metabolic process(GO:0030212) |
| 0.0 |
0.2 |
GO:0000733 |
DNA strand renaturation(GO:0000733) |
| 0.0 |
0.1 |
GO:0036500 |
ATF6-mediated unfolded protein response(GO:0036500) |
| 0.0 |
0.5 |
GO:0006283 |
transcription-coupled nucleotide-excision repair(GO:0006283) |
| 0.0 |
0.3 |
GO:0071435 |
potassium ion export(GO:0071435) |
| 0.0 |
0.6 |
GO:0050434 |
positive regulation of viral transcription(GO:0050434) |
| 0.0 |
0.1 |
GO:2000645 |
negative regulation of receptor catabolic process(GO:2000645) |
| 0.0 |
0.1 |
GO:0010920 |
negative regulation of inositol phosphate biosynthetic process(GO:0010920) |
| 0.0 |
1.0 |
GO:0035518 |
histone H2A monoubiquitination(GO:0035518) |
| 0.0 |
0.5 |
GO:0001913 |
T cell mediated cytotoxicity(GO:0001913) |
| 0.0 |
1.1 |
GO:0036075 |
endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.0 |
0.4 |
GO:0070842 |
aggresome assembly(GO:0070842) |
| 0.0 |
0.4 |
GO:1902287 |
semaphorin-plexin signaling pathway involved in axon guidance(GO:1902287) |
| 0.0 |
0.0 |
GO:0070627 |
ferrous iron import(GO:0070627) |
| 0.0 |
0.5 |
GO:2000001 |
regulation of DNA damage checkpoint(GO:2000001) |
| 0.0 |
0.2 |
GO:0050716 |
positive regulation of interleukin-1 secretion(GO:0050716) positive regulation of interleukin-1 beta secretion(GO:0050718) |
| 0.0 |
0.1 |
GO:0032471 |
negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
| 0.0 |
0.3 |
GO:0006654 |
phosphatidic acid biosynthetic process(GO:0006654) phosphatidic acid metabolic process(GO:0046473) |
| 0.0 |
0.2 |
GO:0044336 |
canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.0 |
0.3 |
GO:0031339 |
negative regulation of vesicle fusion(GO:0031339) |
| 0.0 |
0.3 |
GO:0045956 |
positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
| 0.0 |
0.3 |
GO:0060033 |
anatomical structure regression(GO:0060033) |
| 0.0 |
0.3 |
GO:0098532 |
histone H3-K27 trimethylation(GO:0098532) |
| 0.0 |
0.4 |
GO:0090084 |
negative regulation of inclusion body assembly(GO:0090084) |
| 0.0 |
0.2 |
GO:0035542 |
regulation of SNARE complex assembly(GO:0035542) |
| 0.0 |
0.2 |
GO:0019236 |
response to pheromone(GO:0019236) |
| 0.0 |
0.1 |
GO:1902310 |
positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.0 |
0.3 |
GO:0060219 |
camera-type eye photoreceptor cell differentiation(GO:0060219) |
| 0.0 |
1.5 |
GO:0019882 |
antigen processing and presentation(GO:0019882) |
| 0.0 |
0.6 |
GO:0031065 |
positive regulation of histone deacetylation(GO:0031065) |
| 0.0 |
0.3 |
GO:0043552 |
positive regulation of phosphatidylinositol 3-kinase activity(GO:0043552) |
| 0.0 |
0.1 |
GO:1902416 |
positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
| 0.0 |
0.2 |
GO:0016255 |
attachment of GPI anchor to protein(GO:0016255) |
| 0.0 |
0.0 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 0.0 |
0.1 |
GO:0043456 |
regulation of pentose-phosphate shunt(GO:0043456) |
| 0.0 |
0.2 |
GO:0090527 |
actin filament reorganization(GO:0090527) |
| 0.0 |
0.1 |
GO:0046013 |
T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.0 |
0.1 |
GO:0007161 |
calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.0 |
0.1 |
GO:0061537 |
glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.0 |
0.2 |
GO:0071894 |
histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.0 |
0.3 |
GO:0072010 |
renal filtration cell differentiation(GO:0061318) glomerular epithelium development(GO:0072010) glomerular visceral epithelial cell differentiation(GO:0072112) glomerular epithelial cell differentiation(GO:0072311) |
| 0.0 |
0.7 |
GO:0070584 |
mitochondrion morphogenesis(GO:0070584) |
| 0.0 |
0.1 |
GO:1902965 |
protein localization to early endosome(GO:1902946) regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 0.0 |
0.1 |
GO:0001951 |
intestinal D-glucose absorption(GO:0001951) terminal web assembly(GO:1902896) |
| 0.0 |
0.1 |
GO:0060011 |
Sertoli cell proliferation(GO:0060011) |
| 0.0 |
0.3 |
GO:0022401 |
desensitization of G-protein coupled receptor protein signaling pathway(GO:0002029) negative adaptation of signaling pathway(GO:0022401) |
| 0.0 |
0.1 |
GO:0097167 |
circadian regulation of translation(GO:0097167) |
| 0.0 |
0.1 |
GO:0034766 |
negative regulation of ion transmembrane transport(GO:0034766) |
| 0.0 |
0.2 |
GO:2000858 |
mineralocorticoid secretion(GO:0035931) aldosterone secretion(GO:0035932) regulation of mineralocorticoid secretion(GO:2000855) positive regulation of mineralocorticoid secretion(GO:2000857) regulation of aldosterone secretion(GO:2000858) positive regulation of aldosterone secretion(GO:2000860) |
| 0.0 |
0.1 |
GO:0006097 |
glyoxylate cycle(GO:0006097) glyoxylate metabolic process(GO:0046487) |
| 0.0 |
0.2 |
GO:0090385 |
phagosome-lysosome fusion(GO:0090385) |
| 0.0 |
0.2 |
GO:0006689 |
ganglioside catabolic process(GO:0006689) oligosaccharide catabolic process(GO:0009313) |
| 0.0 |
0.1 |
GO:0042276 |
error-prone translesion synthesis(GO:0042276) |
| 0.0 |
0.2 |
GO:0070458 |
detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 0.0 |
0.3 |
GO:0034314 |
Arp2/3 complex-mediated actin nucleation(GO:0034314) |
| 0.0 |
1.3 |
GO:0043666 |
regulation of phosphoprotein phosphatase activity(GO:0043666) |
| 0.0 |
0.0 |
GO:0001977 |
renal system process involved in regulation of blood volume(GO:0001977) |
| 0.0 |
0.1 |
GO:0000491 |
small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.0 |
0.1 |
GO:0045085 |
negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.0 |
0.1 |
GO:0010739 |
positive regulation of protein kinase A signaling(GO:0010739) |
| 0.0 |
0.9 |
GO:0051497 |
negative regulation of stress fiber assembly(GO:0051497) |
| 0.0 |
0.3 |
GO:0045907 |
positive regulation of vasoconstriction(GO:0045907) |
| 0.0 |
0.1 |
GO:0042640 |
anagen(GO:0042640) |
| 0.0 |
0.1 |
GO:0033136 |
serine phosphorylation of STAT3 protein(GO:0033136) serine phosphorylation of STAT protein(GO:0042501) |
| 0.0 |
0.1 |
GO:0006369 |
termination of RNA polymerase II transcription(GO:0006369) |
| 0.0 |
0.3 |
GO:1901741 |
positive regulation of myoblast fusion(GO:1901741) |
| 0.0 |
0.1 |
GO:0000079 |
regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0000079) regulation of cyclin-dependent protein kinase activity(GO:1904029) |
| 0.0 |
0.4 |
GO:0061098 |
positive regulation of protein tyrosine kinase activity(GO:0061098) |
| 0.0 |
0.0 |
GO:0042135 |
neurotransmitter catabolic process(GO:0042135) |
| 0.0 |
0.2 |
GO:0006362 |
transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.0 |
0.1 |
GO:0033580 |
protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
| 0.0 |
0.5 |
GO:0042474 |
middle ear morphogenesis(GO:0042474) |
| 0.0 |
0.1 |
GO:2001258 |
negative regulation of cation channel activity(GO:2001258) |
| 0.0 |
0.1 |
GO:0044130 |
negative regulation of growth of symbiont in host(GO:0044130) negative regulation of growth of symbiont involved in interaction with host(GO:0044146) |
| 0.0 |
0.1 |
GO:0050861 |
positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.0 |
0.1 |
GO:0030327 |
prenylated protein catabolic process(GO:0030327) |
| 0.0 |
0.1 |
GO:0071677 |
positive regulation of mononuclear cell migration(GO:0071677) |
| 0.0 |
0.1 |
GO:0018008 |
N-terminal peptidyl-glycine N-myristoylation(GO:0018008) peptidyl-glycine modification(GO:0018201) |
| 0.0 |
0.2 |
GO:0006953 |
acute-phase response(GO:0006953) |
| 0.0 |
0.0 |
GO:0018208 |
peptidyl-proline modification(GO:0018208) |
| 0.0 |
0.1 |
GO:0034080 |
CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.0 |
1.4 |
GO:0045454 |
cell redox homeostasis(GO:0045454) |
| 0.0 |
0.1 |
GO:1904425 |
negative regulation of GTP binding(GO:1904425) |
| 0.0 |
0.1 |
GO:0010839 |
negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.0 |
0.2 |
GO:0097421 |
liver regeneration(GO:0097421) |
| 0.0 |
0.1 |
GO:0071361 |
cellular response to ethanol(GO:0071361) |
| 0.0 |
0.2 |
GO:0030813 |
positive regulation of nucleotide catabolic process(GO:0030813) positive regulation of glycolytic process(GO:0045821) positive regulation of cofactor metabolic process(GO:0051194) positive regulation of coenzyme metabolic process(GO:0051197) |
| 0.0 |
0.2 |
GO:0042832 |
defense response to protozoan(GO:0042832) |
| 0.0 |
0.1 |
GO:0042822 |
vitamin B6 metabolic process(GO:0042816) pyridoxal phosphate metabolic process(GO:0042822) pyridoxal phosphate biosynthetic process(GO:0042823) |
| 0.0 |
0.2 |
GO:0048873 |
homeostasis of number of cells within a tissue(GO:0048873) |
| 0.0 |
0.2 |
GO:0042347 |
negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.0 |
0.1 |
GO:0033299 |
secretion of lysosomal enzymes(GO:0033299) |
| 0.0 |
0.1 |
GO:0032511 |
late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.0 |
0.6 |
GO:0000413 |
protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 |
0.3 |
GO:0010591 |
regulation of lamellipodium assembly(GO:0010591) |
| 0.0 |
0.9 |
GO:0032755 |
positive regulation of interleukin-6 production(GO:0032755) |
| 0.0 |
0.1 |
GO:0006528 |
asparagine metabolic process(GO:0006528) |
| 0.0 |
0.4 |
GO:0048791 |
calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.0 |
0.5 |
GO:0006491 |
N-glycan processing(GO:0006491) |
| 0.0 |
1.1 |
GO:0009063 |
cellular amino acid catabolic process(GO:0009063) |
| 0.0 |
0.1 |
GO:0036509 |
trimming of terminal mannose on B branch(GO:0036509) |
| 0.0 |
0.2 |
GO:0035994 |
response to muscle stretch(GO:0035994) |
| 0.0 |
0.0 |
GO:0032222 |
regulation of synaptic transmission, cholinergic(GO:0032222) positive regulation of synaptic transmission, cholinergic(GO:0032224) |
| 0.0 |
0.3 |
GO:0035025 |
positive regulation of Rho protein signal transduction(GO:0035025) |
| 0.0 |
0.5 |
GO:0050873 |
brown fat cell differentiation(GO:0050873) |
| 0.0 |
0.2 |
GO:0048642 |
negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.0 |
0.1 |
GO:0000447 |
endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.0 |
0.2 |
GO:0045909 |
positive regulation of vasodilation(GO:0045909) |
| 0.0 |
0.0 |
GO:0045014 |
carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) carbon catabolite regulation of transcription(GO:0045990) |
| 0.0 |
0.1 |
GO:0006531 |
aspartate metabolic process(GO:0006531) |
| 0.0 |
0.1 |
GO:0032289 |
central nervous system myelin formation(GO:0032289) cardiac cell fate specification(GO:0060912) |
| 0.0 |
0.1 |
GO:0042535 |
positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
| 0.0 |
0.2 |
GO:0003215 |
cardiac right ventricle morphogenesis(GO:0003215) |
| 0.0 |
0.0 |
GO:1990034 |
calcium ion export from cell(GO:1990034) |
| 0.0 |
0.2 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.0 |
0.3 |
GO:0043046 |
DNA methylation involved in gamete generation(GO:0043046) |
| 0.0 |
0.2 |
GO:0000042 |
protein targeting to Golgi(GO:0000042) |
| 0.0 |
0.1 |
GO:0036228 |
protein targeting to nuclear inner membrane(GO:0036228) |
| 0.0 |
0.0 |
GO:0032375 |
negative regulation of sterol transport(GO:0032372) negative regulation of cholesterol transport(GO:0032375) |
| 0.0 |
0.1 |
GO:0042138 |
meiotic DNA double-strand break formation(GO:0042138) |
| 0.0 |
0.1 |
GO:0015868 |
purine nucleotide transport(GO:0015865) purine ribonucleotide transport(GO:0015868) |
| 0.0 |
0.3 |
GO:2000772 |
regulation of cellular senescence(GO:2000772) |
| 0.0 |
0.7 |
GO:0061077 |
chaperone-mediated protein folding(GO:0061077) |
| 0.0 |
0.1 |
GO:0051958 |
methotrexate transport(GO:0051958) reduced folate transmembrane transport(GO:0098838) |
| 0.0 |
0.2 |
GO:0031937 |
positive regulation of chromatin silencing(GO:0031937) |
| 0.0 |
0.1 |
GO:0050651 |
dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
| 0.0 |
0.3 |
GO:0001945 |
lymph vessel development(GO:0001945) |
| 0.0 |
0.0 |
GO:0048227 |
plasma membrane to endosome transport(GO:0048227) |
| 0.0 |
0.2 |
GO:0002087 |
regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
| 0.0 |
0.0 |
GO:0006488 |
dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.0 |
0.1 |
GO:0042573 |
retinoic acid metabolic process(GO:0042573) |
| 0.0 |
0.2 |
GO:0033564 |
anterior/posterior axon guidance(GO:0033564) |
| 0.0 |
0.1 |
GO:0070476 |
rRNA (guanine-N7)-methylation(GO:0070476) |
| 0.0 |
0.1 |
GO:0002082 |
regulation of oxidative phosphorylation(GO:0002082) |
| 0.0 |
0.2 |
GO:2000009 |
negative regulation of protein localization to cell surface(GO:2000009) |
| 0.0 |
0.1 |
GO:0042795 |
snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.0 |
0.1 |
GO:0018002 |
N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.0 |
0.1 |
GO:0046929 |
negative regulation of neurotransmitter secretion(GO:0046929) |
| 0.0 |
0.1 |
GO:0060394 |
negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 0.0 |
0.1 |
GO:2000678 |
negative regulation of transcription regulatory region DNA binding(GO:2000678) |
| 0.0 |
0.0 |
GO:0060672 |
epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.0 |
0.1 |
GO:0097428 |
protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.0 |
0.1 |
GO:0071218 |
cellular response to misfolded protein(GO:0071218) |
| 0.0 |
0.2 |
GO:1901223 |
negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.0 |
0.2 |
GO:0031954 |
positive regulation of protein autophosphorylation(GO:0031954) |
| 0.0 |
0.1 |
GO:0010694 |
positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.0 |
0.3 |
GO:0006882 |
cellular zinc ion homeostasis(GO:0006882) zinc ion homeostasis(GO:0055069) |
| 0.0 |
0.0 |
GO:0034138 |
toll-like receptor 3 signaling pathway(GO:0034138) |
| 0.0 |
0.3 |
GO:1903077 |
negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
| 0.0 |
0.1 |
GO:0014037 |
Schwann cell differentiation(GO:0014037) |
| 0.0 |
0.0 |
GO:0002438 |
acute inflammatory response to antigenic stimulus(GO:0002438) |
| 0.0 |
0.2 |
GO:0043970 |
histone H3-K9 acetylation(GO:0043970) |
| 0.0 |
0.1 |
GO:0070344 |
fat cell proliferation(GO:0070341) regulation of fat cell proliferation(GO:0070344) negative regulation of fat cell proliferation(GO:0070345) |
| 0.0 |
0.1 |
GO:0000393 |
generation of catalytic spliceosome for second transesterification step(GO:0000350) spliceosomal conformational changes to generate catalytic conformation(GO:0000393) |
| 0.0 |
0.8 |
GO:0007229 |
integrin-mediated signaling pathway(GO:0007229) |
| 0.0 |
0.3 |
GO:0035458 |
cellular response to interferon-beta(GO:0035458) |
| 0.0 |
0.1 |
GO:0042026 |
protein refolding(GO:0042026) |
| 0.0 |
0.2 |
GO:2000010 |
positive regulation of protein localization to cell surface(GO:2000010) |
| 0.0 |
0.1 |
GO:0032482 |
Rab protein signal transduction(GO:0032482) |
| 0.0 |
0.4 |
GO:0010761 |
fibroblast migration(GO:0010761) |
| 0.0 |
0.2 |
GO:0071470 |
cellular response to osmotic stress(GO:0071470) |
| 0.0 |
0.0 |
GO:0030049 |
muscle filament sliding(GO:0030049) |
| 0.0 |
0.0 |
GO:0007210 |
serotonin receptor signaling pathway(GO:0007210) |
| 0.0 |
0.2 |
GO:0046470 |
phosphatidylcholine metabolic process(GO:0046470) |
| 0.0 |
0.2 |
GO:0071480 |
cellular response to gamma radiation(GO:0071480) |
| 0.0 |
0.3 |
GO:1902668 |
regulation of axon extension involved in axon guidance(GO:0048841) negative regulation of axon extension involved in axon guidance(GO:0048843) regulation of axon guidance(GO:1902667) negative regulation of axon guidance(GO:1902668) |
| 0.0 |
0.2 |
GO:0034244 |
negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.0 |
0.3 |
GO:0006744 |
ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.0 |
0.2 |
GO:0043982 |
histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
| 0.0 |
0.2 |
GO:0051560 |
mitochondrial calcium ion homeostasis(GO:0051560) |
| 0.0 |
0.3 |
GO:0052646 |
alditol phosphate metabolic process(GO:0052646) |
| 0.0 |
0.1 |
GO:0051152 |
positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.0 |
0.1 |
GO:0006627 |
protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.0 |
0.5 |
GO:0007218 |
neuropeptide signaling pathway(GO:0007218) |
| 0.0 |
0.6 |
GO:0071230 |
cellular response to amino acid stimulus(GO:0071230) |
| 0.0 |
0.1 |
GO:0006681 |
galactosylceramide metabolic process(GO:0006681) galactolipid metabolic process(GO:0019374) |
| 0.0 |
0.1 |
GO:0032461 |
positive regulation of protein oligomerization(GO:0032461) |
| 0.0 |
0.0 |
GO:0035457 |
cellular response to interferon-alpha(GO:0035457) |
| 0.0 |
0.0 |
GO:0030242 |
pexophagy(GO:0030242) |
| 0.0 |
0.1 |
GO:0090140 |
regulation of mitochondrial fission(GO:0090140) |
| 0.0 |
0.3 |
GO:1901985 |
positive regulation of protein acetylation(GO:1901985) |
| 0.0 |
0.4 |
GO:0035082 |
axoneme assembly(GO:0035082) |
| 0.0 |
0.1 |
GO:0031053 |
primary miRNA processing(GO:0031053) |
| 0.0 |
0.0 |
GO:0035624 |
receptor transactivation(GO:0035624) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
| 0.0 |
0.3 |
GO:0048701 |
embryonic cranial skeleton morphogenesis(GO:0048701) |
| 0.0 |
0.1 |
GO:0031274 |
positive regulation of pseudopodium assembly(GO:0031274) |
| 0.0 |
0.1 |
GO:0045583 |
regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.0 |
1.0 |
GO:0007601 |
visual perception(GO:0007601) |
| 0.0 |
0.2 |
GO:0034340 |
response to type I interferon(GO:0034340) |
| 0.0 |
0.2 |
GO:0050909 |
sensory perception of taste(GO:0050909) |
| 0.0 |
0.6 |
GO:0042475 |
odontogenesis of dentin-containing tooth(GO:0042475) |
| 0.0 |
0.1 |
GO:0071157 |
negative regulation of cell cycle arrest(GO:0071157) |
| 0.0 |
0.0 |
GO:0043353 |
enucleate erythrocyte differentiation(GO:0043353) |
| 0.0 |
0.7 |
GO:0030968 |
endoplasmic reticulum unfolded protein response(GO:0030968) |
| 0.0 |
0.1 |
GO:0051930 |
regulation of sensory perception of pain(GO:0051930) regulation of sensory perception(GO:0051931) |
| 0.0 |
0.1 |
GO:0071318 |
cellular response to ATP(GO:0071318) |
| 0.0 |
0.1 |
GO:0018344 |
protein geranylgeranylation(GO:0018344) |
| 0.0 |
0.1 |
GO:0010728 |
regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
| 0.0 |
0.1 |
GO:0016446 |
somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.0 |
0.1 |
GO:2000781 |
positive regulation of double-strand break repair(GO:2000781) |
| 0.0 |
0.2 |
GO:0006541 |
glutamine metabolic process(GO:0006541) |
| 0.0 |
0.1 |
GO:0035767 |
endothelial cell chemotaxis(GO:0035767) |
| 0.0 |
0.3 |
GO:0045739 |
positive regulation of DNA repair(GO:0045739) |
| 0.0 |
0.0 |
GO:0018199 |
peptidyl-glutamine modification(GO:0018199) |
| 0.0 |
0.0 |
GO:0007020 |
microtubule nucleation(GO:0007020) |
| 0.0 |
0.0 |
GO:1902415 |
histone arginine methylation(GO:0034969) regulation of mRNA binding(GO:1902415) regulation of RNA binding(GO:1905214) |
| 0.0 |
0.0 |
GO:0016598 |
protein arginylation(GO:0016598) |
| 0.0 |
0.1 |
GO:0000712 |
resolution of meiotic recombination intermediates(GO:0000712) |
| 0.0 |
0.1 |
GO:0003341 |
cilium movement(GO:0003341) |
| 0.0 |
0.1 |
GO:0010820 |
positive regulation of T cell chemotaxis(GO:0010820) |
| 0.0 |
0.1 |
GO:0036093 |
germ cell proliferation(GO:0036093) |
| 0.0 |
0.1 |
GO:0071985 |
multivesicular body sorting pathway(GO:0071985) |
| 0.0 |
0.1 |
GO:0006390 |
transcription from mitochondrial promoter(GO:0006390) |
| 0.0 |
0.1 |
GO:1902683 |
regulation of receptor localization to synapse(GO:1902683) |
| 0.0 |
0.1 |
GO:0016479 |
negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
| 0.0 |
0.1 |
GO:0031167 |
rRNA methylation(GO:0031167) |
| 0.0 |
0.2 |
GO:0010666 |
positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.0 |
0.1 |
GO:0033127 |
regulation of histone phosphorylation(GO:0033127) positive regulation of histone phosphorylation(GO:0033129) |
| 0.0 |
0.1 |
GO:0097034 |
mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.0 |
0.1 |
GO:0007398 |
ectoderm development(GO:0007398) |
| 0.0 |
0.1 |
GO:0046784 |
viral mRNA export from host cell nucleus(GO:0046784) |
| 0.0 |
0.0 |
GO:0071787 |
endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.0 |
0.0 |
GO:2000286 |
receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.0 |
0.2 |
GO:0000731 |
DNA synthesis involved in DNA repair(GO:0000731) |
| 0.0 |
0.5 |
GO:0008542 |
visual learning(GO:0008542) |
| 0.0 |
0.1 |
GO:0034551 |
respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.0 |
0.1 |
GO:2000060 |
positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
| 0.0 |
0.0 |
GO:0006434 |
seryl-tRNA aminoacylation(GO:0006434) |
| 0.0 |
0.1 |
GO:0043568 |
positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.0 |
0.1 |
GO:0061003 |
positive regulation of dendritic spine morphogenesis(GO:0061003) |
| 0.0 |
0.1 |
GO:0001886 |
endothelial cell morphogenesis(GO:0001886) |
| 0.0 |
0.1 |
GO:0019368 |
fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.0 |
0.1 |
GO:0006012 |
galactose metabolic process(GO:0006012) |
| 0.0 |
0.0 |
GO:0038128 |
ERBB2 signaling pathway(GO:0038128) |
| 0.0 |
0.0 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.0 |
0.3 |
GO:0006749 |
glutathione metabolic process(GO:0006749) |
| 0.0 |
0.0 |
GO:0006083 |
acetate metabolic process(GO:0006083) |
| 0.0 |
0.1 |
GO:0006968 |
cellular defense response(GO:0006968) |
| 0.0 |
0.1 |
GO:0008053 |
mitochondrial fusion(GO:0008053) |
| 0.0 |
0.0 |
GO:0034384 |
high-density lipoprotein particle clearance(GO:0034384) |
| 0.0 |
0.1 |
GO:0051574 |
positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.0 |
0.3 |
GO:0048025 |
negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
| 0.0 |
0.1 |
GO:0000185 |
activation of MAPKKK activity(GO:0000185) |
| 0.0 |
0.1 |
GO:0030866 |
cortical actin cytoskeleton organization(GO:0030866) |
| 0.0 |
0.1 |
GO:0032836 |
glomerular basement membrane development(GO:0032836) |
| 0.0 |
0.0 |
GO:0070935 |
3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.0 |
0.0 |
GO:0045988 |
negative regulation of striated muscle contraction(GO:0045988) |
