| 1.1 |
9.0 |
GO:0048625 |
myoblast fate commitment(GO:0048625) |
| 0.5 |
2.6 |
GO:0042997 |
negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.5 |
5.5 |
GO:0042572 |
retinol metabolic process(GO:0042572) |
| 0.5 |
1.5 |
GO:0072204 |
cell-cell signaling involved in kidney development(GO:0060995) Wnt signaling pathway involved in kidney development(GO:0061289) canonical Wnt signaling pathway involved in metanephric kidney development(GO:0061290) cell-cell signaling involved in metanephros development(GO:0072204) |
| 0.4 |
2.5 |
GO:0035469 |
determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.4 |
1.3 |
GO:0060023 |
soft palate development(GO:0060023) |
| 0.4 |
1.2 |
GO:0046552 |
eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 0.4 |
1.8 |
GO:0061074 |
regulation of neural retina development(GO:0061074) |
| 0.3 |
1.0 |
GO:0090327 |
negative regulation of locomotion involved in locomotory behavior(GO:0090327) |
| 0.3 |
1.0 |
GO:0030862 |
neuroblast division in subventricular zone(GO:0021849) regulation of polarized epithelial cell differentiation(GO:0030860) positive regulation of polarized epithelial cell differentiation(GO:0030862) |
| 0.3 |
4.7 |
GO:0042759 |
long-chain fatty acid biosynthetic process(GO:0042759) |
| 0.3 |
0.9 |
GO:1904706 |
negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.3 |
0.8 |
GO:0060364 |
frontal suture morphogenesis(GO:0060364) |
| 0.3 |
0.8 |
GO:0002513 |
tolerance induction to self antigen(GO:0002513) |
| 0.2 |
1.2 |
GO:0090292 |
nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.2 |
0.7 |
GO:1903795 |
regulation of inorganic anion transmembrane transport(GO:1903795) |
| 0.2 |
0.9 |
GO:0097168 |
condensed mesenchymal cell proliferation(GO:0072137) mesenchymal stem cell proliferation(GO:0097168) |
| 0.2 |
0.7 |
GO:0016256 |
N-glycan processing to lysosome(GO:0016256) |
| 0.2 |
0.2 |
GO:0003134 |
BMP signaling pathway involved in heart induction(GO:0003130) endodermal-mesodermal cell signaling(GO:0003133) endodermal-mesodermal cell signaling involved in heart induction(GO:0003134) |
| 0.2 |
1.7 |
GO:2000809 |
neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) positive regulation of synaptic vesicle clustering(GO:2000809) |
| 0.2 |
1.0 |
GO:0070306 |
lens fiber cell differentiation(GO:0070306) |
| 0.2 |
1.2 |
GO:0050861 |
positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.2 |
1.1 |
GO:0000056 |
ribosomal small subunit export from nucleus(GO:0000056) |
| 0.2 |
0.5 |
GO:0043456 |
regulation of pentose-phosphate shunt(GO:0043456) |
| 0.2 |
0.5 |
GO:1903998 |
regulation of eating behavior(GO:1903998) |
| 0.1 |
0.4 |
GO:2001012 |
mesenchymal cell differentiation involved in kidney development(GO:0072161) mesenchymal cell differentiation involved in renal system development(GO:2001012) |
| 0.1 |
0.4 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.1 |
1.3 |
GO:0060346 |
bone trabecula formation(GO:0060346) |
| 0.1 |
0.7 |
GO:0050847 |
progesterone receptor signaling pathway(GO:0050847) |
| 0.1 |
1.9 |
GO:0006699 |
bile acid biosynthetic process(GO:0006699) |
| 0.1 |
0.4 |
GO:0001561 |
fatty acid alpha-oxidation(GO:0001561) |
| 0.1 |
0.7 |
GO:0043383 |
negative T cell selection(GO:0043383) negative thymic T cell selection(GO:0045060) |
| 0.1 |
0.4 |
GO:0036500 |
ATF6-mediated unfolded protein response(GO:0036500) |
| 0.1 |
0.2 |
GO:0030240 |
skeletal muscle thin filament assembly(GO:0030240) |
| 0.1 |
0.5 |
GO:0035743 |
CD4-positive, alpha-beta T cell cytokine production(GO:0035743) T-helper 2 cell cytokine production(GO:0035745) |
| 0.1 |
1.7 |
GO:0007252 |
I-kappaB phosphorylation(GO:0007252) |
| 0.1 |
1.8 |
GO:0060736 |
positive regulation of glial cell proliferation(GO:0060252) prostate gland growth(GO:0060736) |
| 0.1 |
0.2 |
GO:0019835 |
cytolysis(GO:0019835) |
| 0.1 |
0.9 |
GO:0045541 |
negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.1 |
0.9 |
GO:0006265 |
DNA topological change(GO:0006265) |
| 0.1 |
0.4 |
GO:0060083 |
smooth muscle contraction involved in micturition(GO:0060083) |
| 0.1 |
0.3 |
GO:0043988 |
histone H3-S28 phosphorylation(GO:0043988) |
| 0.1 |
0.8 |
GO:0018026 |
peptidyl-lysine monomethylation(GO:0018026) |
| 0.1 |
0.5 |
GO:0001778 |
plasma membrane repair(GO:0001778) |
| 0.1 |
1.3 |
GO:0038063 |
collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.1 |
0.3 |
GO:0010845 |
positive regulation of reciprocal meiotic recombination(GO:0010845) |
| 0.1 |
0.9 |
GO:0051574 |
positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.1 |
0.4 |
GO:0002069 |
columnar/cuboidal epithelial cell maturation(GO:0002069) |
| 0.1 |
0.5 |
GO:1905049 |
negative regulation of metalloendopeptidase activity(GO:1904684) negative regulation of metallopeptidase activity(GO:1905049) |
| 0.1 |
0.3 |
GO:0032915 |
positive regulation of transforming growth factor beta2 production(GO:0032915) |
| 0.1 |
0.3 |
GO:1903225 |
negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.1 |
1.3 |
GO:0045187 |
regulation of circadian sleep/wake cycle(GO:0042749) regulation of circadian sleep/wake cycle, sleep(GO:0045187) |
| 0.1 |
0.5 |
GO:2001054 |
negative regulation of mesenchymal cell apoptotic process(GO:2001054) |
| 0.1 |
0.6 |
GO:0071732 |
cellular response to nitric oxide(GO:0071732) |
| 0.1 |
1.0 |
GO:0046697 |
decidualization(GO:0046697) |
| 0.1 |
0.8 |
GO:0051561 |
positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
| 0.1 |
0.8 |
GO:0019227 |
neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.1 |
0.4 |
GO:1904936 |
cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 0.1 |
0.4 |
GO:0006108 |
malate metabolic process(GO:0006108) |
| 0.1 |
0.3 |
GO:0044268 |
multicellular organismal protein metabolic process(GO:0044268) |
| 0.1 |
1.1 |
GO:0036010 |
protein localization to endosome(GO:0036010) |
| 0.1 |
1.6 |
GO:0035855 |
megakaryocyte development(GO:0035855) |
| 0.1 |
0.6 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 0.1 |
0.8 |
GO:0060394 |
negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 0.1 |
1.1 |
GO:0045475 |
locomotor rhythm(GO:0045475) |
| 0.1 |
0.5 |
GO:0010459 |
negative regulation of heart rate(GO:0010459) |
| 0.1 |
0.2 |
GO:0097298 |
regulation of nucleus size(GO:0097298) |
| 0.0 |
1.1 |
GO:0006491 |
N-glycan processing(GO:0006491) |
| 0.0 |
0.9 |
GO:0007413 |
axonal fasciculation(GO:0007413) |
| 0.0 |
1.2 |
GO:0010172 |
embryonic body morphogenesis(GO:0010172) |
| 0.0 |
0.5 |
GO:0090073 |
positive regulation of protein homodimerization activity(GO:0090073) |
| 0.0 |
0.2 |
GO:1903898 |
positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
| 0.0 |
0.4 |
GO:0075522 |
IRES-dependent viral translational initiation(GO:0075522) |
| 0.0 |
0.1 |
GO:1901509 |
branch elongation involved in ureteric bud branching(GO:0060681) regulation of endothelial tube morphogenesis(GO:1901509) |
| 0.0 |
0.2 |
GO:0003223 |
ventricular compact myocardium morphogenesis(GO:0003223) proprioception(GO:0019230) |
| 0.0 |
1.5 |
GO:0032728 |
positive regulation of interferon-beta production(GO:0032728) |
| 0.0 |
0.2 |
GO:0038108 |
negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
| 0.0 |
0.3 |
GO:0006488 |
dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.0 |
3.5 |
GO:0050885 |
neuromuscular process controlling balance(GO:0050885) |
| 0.0 |
0.4 |
GO:0006610 |
ribosomal protein import into nucleus(GO:0006610) |
| 0.0 |
0.7 |
GO:0045116 |
protein neddylation(GO:0045116) |
| 0.0 |
0.3 |
GO:0017196 |
N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 |
0.1 |
GO:0006547 |
histidine metabolic process(GO:0006547) |
| 0.0 |
0.1 |
GO:0002901 |
mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 0.0 |
0.4 |
GO:0019886 |
antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
| 0.0 |
0.3 |
GO:1904894 |
positive regulation of JAK-STAT cascade(GO:0046427) positive regulation of STAT cascade(GO:1904894) |
| 0.0 |
0.1 |
GO:0001951 |
intestinal D-glucose absorption(GO:0001951) terminal web assembly(GO:1902896) |
| 0.0 |
0.3 |
GO:0060218 |
hematopoietic stem cell differentiation(GO:0060218) |
| 0.0 |
0.6 |
GO:0031958 |
corticosteroid receptor signaling pathway(GO:0031958) |
| 0.0 |
0.1 |
GO:0051964 |
negative regulation of synapse assembly(GO:0051964) |
| 0.0 |
0.1 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.0 |
0.2 |
GO:0005513 |
detection of calcium ion(GO:0005513) |
| 0.0 |
1.0 |
GO:0033014 |
porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
| 0.0 |
0.2 |
GO:0035095 |
behavioral response to nicotine(GO:0035095) |
| 0.0 |
0.4 |
GO:0016973 |
poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.0 |
1.9 |
GO:0045638 |
negative regulation of myeloid cell differentiation(GO:0045638) |
| 0.0 |
0.2 |
GO:0015862 |
uridine transport(GO:0015862) |
| 0.0 |
0.7 |
GO:0007218 |
neuropeptide signaling pathway(GO:0007218) |
| 0.0 |
0.2 |
GO:0048520 |
positive regulation of behavior(GO:0048520) |
| 0.0 |
1.4 |
GO:0014066 |
regulation of phosphatidylinositol 3-kinase signaling(GO:0014066) |
| 0.0 |
0.1 |
GO:0007288 |
sperm axoneme assembly(GO:0007288) |
| 0.0 |
0.4 |
GO:0006767 |
water-soluble vitamin metabolic process(GO:0006767) |
| 0.0 |
0.1 |
GO:0000707 |
meiotic DNA recombinase assembly(GO:0000707) |
| 0.0 |
0.3 |
GO:0051131 |
chaperone-mediated protein complex assembly(GO:0051131) |
| 0.0 |
0.2 |
GO:0043084 |
penile erection(GO:0043084) |
| 0.0 |
1.0 |
GO:0006749 |
glutathione metabolic process(GO:0006749) |
| 0.0 |
0.1 |
GO:0060576 |
intestinal epithelial cell development(GO:0060576) |
| 0.0 |
0.2 |
GO:1900745 |
positive regulation of p38MAPK cascade(GO:1900745) |
| 0.0 |
0.0 |
GO:0002447 |
eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
| 0.0 |
0.2 |
GO:0035493 |
SNARE complex assembly(GO:0035493) |
| 0.0 |
0.3 |
GO:0060236 |
regulation of mitotic spindle organization(GO:0060236) |
| 0.0 |
0.2 |
GO:0071447 |
cellular response to hydroperoxide(GO:0071447) |
| 0.0 |
0.1 |
GO:0072344 |
rescue of stalled ribosome(GO:0072344) |
| 0.0 |
0.2 |
GO:0034453 |
microtubule anchoring(GO:0034453) |
| 0.0 |
0.0 |
GO:0032792 |
negative regulation of CREB transcription factor activity(GO:0032792) regulation of determination of dorsal identity(GO:2000015) |
| 0.0 |
0.2 |
GO:0015693 |
magnesium ion transport(GO:0015693) |
| 0.0 |
0.8 |
GO:0061077 |
chaperone-mediated protein folding(GO:0061077) |
| 0.0 |
0.2 |
GO:0051044 |
positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.0 |
0.4 |
GO:0006739 |
NADP metabolic process(GO:0006739) |
| 0.0 |
0.1 |
GO:0006020 |
inositol metabolic process(GO:0006020) |
| 0.0 |
1.1 |
GO:0006334 |
nucleosome assembly(GO:0006334) |
| 0.0 |
0.6 |
GO:0043268 |
positive regulation of potassium ion transport(GO:0043268) |
| 0.0 |
0.0 |
GO:0045163 |
clustering of voltage-gated potassium channels(GO:0045163) |
| 0.0 |
0.2 |
GO:0033327 |
Leydig cell differentiation(GO:0033327) |
| 0.0 |
0.7 |
GO:1904893 |
negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
| 0.0 |
0.8 |
GO:0006821 |
chloride transport(GO:0006821) |
| 0.0 |
1.4 |
GO:0050714 |
positive regulation of protein secretion(GO:0050714) |
| 0.0 |
0.3 |
GO:0006801 |
superoxide metabolic process(GO:0006801) |
