| 0.4 |
1.8 |
GO:2000546 |
positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
| 0.3 |
0.9 |
GO:0033159 |
negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 0.2 |
0.4 |
GO:0035701 |
hematopoietic stem cell migration(GO:0035701) |
| 0.2 |
0.8 |
GO:0003223 |
ventricular compact myocardium morphogenesis(GO:0003223) proprioception(GO:0019230) |
| 0.1 |
0.7 |
GO:0060838 |
lymphatic endothelial cell fate commitment(GO:0060838) regulation of transcription involved in lymphatic endothelial cell fate commitment(GO:0060849) |
| 0.1 |
1.0 |
GO:0019370 |
leukotriene biosynthetic process(GO:0019370) |
| 0.1 |
0.6 |
GO:0051835 |
positive regulation of synapse structural plasticity(GO:0051835) |
| 0.1 |
0.5 |
GO:2000313 |
fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
| 0.1 |
0.9 |
GO:0021937 |
cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
| 0.1 |
0.3 |
GO:0070315 |
G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 0.1 |
0.3 |
GO:0001928 |
regulation of exocyst assembly(GO:0001928) |
| 0.1 |
1.1 |
GO:0060159 |
regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.1 |
0.2 |
GO:2000224 |
testosterone biosynthetic process(GO:0061370) regulation of testosterone biosynthetic process(GO:2000224) |
| 0.1 |
0.4 |
GO:0006447 |
regulation of translational initiation by iron(GO:0006447) positive regulation of translational initiation by iron(GO:0045994) |
| 0.1 |
0.5 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.1 |
0.4 |
GO:0030951 |
establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.1 |
0.5 |
GO:0051461 |
protein import into peroxisome matrix, docking(GO:0016560) regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.1 |
0.2 |
GO:0046122 |
purine deoxyribonucleoside metabolic process(GO:0046122) |
| 0.1 |
0.3 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 0.1 |
0.6 |
GO:0035090 |
maintenance of apical/basal cell polarity(GO:0035090) |
| 0.1 |
0.1 |
GO:1903351 |
response to dopamine(GO:1903350) cellular response to dopamine(GO:1903351) |
| 0.1 |
0.5 |
GO:0033572 |
transferrin transport(GO:0033572) |
| 0.1 |
0.2 |
GO:0061537 |
glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.0 |
0.9 |
GO:0045653 |
negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.0 |
0.2 |
GO:0070966 |
nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.0 |
0.4 |
GO:0048681 |
negative regulation of axon regeneration(GO:0048681) |
| 0.0 |
0.4 |
GO:0006610 |
ribosomal protein import into nucleus(GO:0006610) |
| 0.0 |
0.3 |
GO:0008635 |
activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.0 |
0.1 |
GO:0009298 |
GDP-mannose biosynthetic process(GO:0009298) |
| 0.0 |
0.1 |
GO:0000389 |
mRNA 3'-splice site recognition(GO:0000389) |
| 0.0 |
0.1 |
GO:0032241 |
positive regulation of nucleobase-containing compound transport(GO:0032241) |
| 0.0 |
0.2 |
GO:0006003 |
fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.0 |
0.3 |
GO:0033690 |
positive regulation of osteoblast proliferation(GO:0033690) |
| 0.0 |
0.1 |
GO:0034476 |
U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) |
| 0.0 |
0.1 |
GO:0046103 |
ADP biosynthetic process(GO:0006172) inosine metabolic process(GO:0046102) inosine biosynthetic process(GO:0046103) |
| 0.0 |
0.1 |
GO:0032417 |
positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 0.0 |
0.3 |
GO:0048387 |
negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.0 |
0.1 |
GO:2000623 |
regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.0 |
0.9 |
GO:0006284 |
base-excision repair(GO:0006284) |
| 0.0 |
0.1 |
GO:0060023 |
soft palate development(GO:0060023) |
| 0.0 |
0.6 |
GO:0048384 |
retinoic acid receptor signaling pathway(GO:0048384) |
| 0.0 |
0.1 |
GO:0044861 |
protein transport into plasma membrane raft(GO:0044861) |
| 0.0 |
0.3 |
GO:0048368 |
lateral mesoderm development(GO:0048368) |
| 0.0 |
0.1 |
GO:0075525 |
viral translational termination-reinitiation(GO:0075525) |
| 0.0 |
0.1 |
GO:0055071 |
cellular manganese ion homeostasis(GO:0030026) Golgi calcium ion homeostasis(GO:0032468) manganese ion homeostasis(GO:0055071) |
| 0.0 |
0.4 |
GO:0000413 |
protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 |
0.1 |
GO:0045657 |
positive regulation of monocyte differentiation(GO:0045657) cellular response to potassium ion starvation(GO:0051365) |
| 0.0 |
0.0 |
GO:0036072 |
intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 0.0 |
0.3 |
GO:0031295 |
lymphocyte costimulation(GO:0031294) T cell costimulation(GO:0031295) |
| 0.0 |
0.2 |
GO:0031115 |
negative regulation of microtubule polymerization(GO:0031115) |
| 0.0 |
0.2 |
GO:0043968 |
histone H2A acetylation(GO:0043968) |
| 0.0 |
0.1 |
GO:0060481 |
lobar bronchus epithelium development(GO:0060481) |
| 0.0 |
0.2 |
GO:0016180 |
snRNA processing(GO:0016180) |
| 0.0 |
0.2 |
GO:0010758 |
regulation of macrophage chemotaxis(GO:0010758) |
| 0.0 |
0.1 |
GO:0032020 |
ISG15-protein conjugation(GO:0032020) |
