Motif ID: Sox14
Z-value: 1.142
Transcription factors associated with Sox14:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| Sox14 | ENSMUSG00000053747.8 | Sox14 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Sox14 | mm10_v2_chr9_-_99876147_99876193 | 0.04 | 8.6e-01 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.9 | 11.2 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 1.4 | 1.4 | GO:0060769 | positive regulation of epithelial cell proliferation involved in prostate gland development(GO:0060769) |
| 0.9 | 2.7 | GO:0003096 | renal sodium ion transport(GO:0003096) |
| 0.8 | 2.3 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
| 0.7 | 3.5 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) proprioception(GO:0019230) |
| 0.6 | 1.8 | GO:0030070 | insulin processing(GO:0030070) |
| 0.6 | 1.7 | GO:0002669 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 0.5 | 1.6 | GO:0070315 | G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 0.5 | 2.2 | GO:0021812 | neuronal-glial interaction involved in cerebral cortex radial glia guided migration(GO:0021812) |
| 0.5 | 1.6 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 0.5 | 12.2 | GO:0008340 | determination of adult lifespan(GO:0008340) |
| 0.5 | 1.4 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.4 | 3.0 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.4 | 3.3 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 0.4 | 2.5 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.3 | 1.6 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.3 | 2.9 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.3 | 1.3 | GO:0035795 | negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 0.3 | 3.1 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
| 0.3 | 2.0 | GO:0051461 | protein import into peroxisome matrix, docking(GO:0016560) regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.3 | 1.1 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
| 0.3 | 1.1 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
| 0.3 | 0.8 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.2 | 0.7 | GO:0046098 | regulation of primitive erythrocyte differentiation(GO:0010725) guanine metabolic process(GO:0046098) |
| 0.2 | 1.6 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.2 | 2.5 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
| 0.2 | 0.7 | GO:0015882 | L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
| 0.2 | 1.1 | GO:0043314 | negative regulation of neutrophil degranulation(GO:0043314) negative regulation of blood vessel remodeling(GO:0060313) |
| 0.2 | 1.5 | GO:0001842 | neural fold formation(GO:0001842) |
| 0.2 | 0.6 | GO:0070428 | regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) |
| 0.2 | 0.7 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
| 0.2 | 1.4 | GO:0032625 | interleukin-21 production(GO:0032625) interleukin-21 secretion(GO:0072619) |
| 0.2 | 0.7 | GO:2000484 | hyaluronan catabolic process(GO:0030214) positive regulation of interleukin-8 secretion(GO:2000484) |
| 0.2 | 1.0 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.2 | 0.7 | GO:0051582 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.2 | 0.8 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
| 0.2 | 1.3 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.2 | 0.8 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.1 | 0.4 | GO:1900365 | positive regulation of mRNA polyadenylation(GO:1900365) |
| 0.1 | 1.9 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.1 | 0.6 | GO:0006742 | NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
| 0.1 | 1.9 | GO:1901898 | negative regulation of relaxation of muscle(GO:1901078) negative regulation of relaxation of cardiac muscle(GO:1901898) |
| 0.1 | 0.6 | GO:0010288 | response to lead ion(GO:0010288) |
| 0.1 | 0.4 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
| 0.1 | 3.0 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
| 0.1 | 0.8 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.1 | 1.5 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.1 | 0.7 | GO:1904690 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.1 | 0.6 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.1 | 1.5 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.1 | 0.5 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.1 | 0.2 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
| 0.1 | 0.4 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
| 0.1 | 0.3 | GO:1903054 | lysosomal membrane organization(GO:0097212) negative regulation of extracellular matrix organization(GO:1903054) positive regulation of protein folding(GO:1903334) |
| 0.1 | 0.4 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.1 | 0.7 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.1 | 1.1 | GO:0060539 | diaphragm development(GO:0060539) |
| 0.1 | 0.6 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.1 | 0.9 | GO:0021794 | thalamus development(GO:0021794) |
| 0.1 | 1.2 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
| 0.1 | 0.3 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
| 0.1 | 0.3 | GO:1904154 | trimming of terminal mannose on B branch(GO:0036509) positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.1 | 1.0 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.1 | 0.4 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) |
| 0.1 | 0.3 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
| 0.1 | 1.0 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.1 | 2.0 | GO:0007340 | acrosome reaction(GO:0007340) |
| 0.1 | 0.8 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.1 | 3.9 | GO:0045599 | negative regulation of fat cell differentiation(GO:0045599) |
| 0.1 | 0.4 | GO:1901837 | negative regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901837) |
| 0.1 | 0.8 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.1 | 0.4 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
| 0.1 | 0.9 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.1 | 0.6 | GO:0015697 | quaternary ammonium group transport(GO:0015697) |
| 0.1 | 0.4 | GO:1904217 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.1 | 0.3 | GO:0090234 | regulation of kinetochore assembly(GO:0090234) |
| 0.1 | 0.3 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 0.1 | 0.6 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 0.0 | 0.5 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
| 0.0 | 2.2 | GO:0071300 | cellular response to retinoic acid(GO:0071300) |
| 0.0 | 0.9 | GO:0043552 | positive regulation of phosphatidylinositol 3-kinase activity(GO:0043552) |
| 0.0 | 0.2 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
| 0.0 | 0.2 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
| 0.0 | 1.3 | GO:0003301 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 | 0.4 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
| 0.0 | 2.6 | GO:0070613 | regulation of protein processing(GO:0070613) |
| 0.0 | 0.2 | GO:0050908 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.0 | 0.1 | GO:2000383 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 0.0 | 0.1 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.0 | 1.0 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
| 0.0 | 0.5 | GO:0030238 | male sex determination(GO:0030238) |
| 0.0 | 1.1 | GO:0060325 | face morphogenesis(GO:0060325) |
| 0.0 | 0.8 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 | 5.3 | GO:0008360 | regulation of cell shape(GO:0008360) |
| 0.0 | 1.4 | GO:0030317 | sperm motility(GO:0030317) |
| 0.0 | 0.3 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.0 | 0.1 | GO:2001045 | closure of optic fissure(GO:0061386) negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 0.0 | 0.2 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.0 | 0.2 | GO:0046085 | adenosine metabolic process(GO:0046085) |
| 0.0 | 0.5 | GO:0006379 | mRNA cleavage(GO:0006379) |
| 0.0 | 0.9 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.0 | 0.4 | GO:0060009 | Sertoli cell development(GO:0060009) |
| 0.0 | 0.3 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
| 0.0 | 0.2 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.0 | 0.9 | GO:0007626 | locomotory behavior(GO:0007626) |
| 0.0 | 0.2 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.0 | 0.6 | GO:0045739 | positive regulation of DNA repair(GO:0045739) |
| 0.0 | 0.6 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
| 0.0 | 1.6 | GO:0006342 | chromatin silencing(GO:0006342) |
| 0.0 | 1.1 | GO:0051225 | spindle assembly(GO:0051225) |
| 0.0 | 0.1 | GO:0006527 | arginine catabolic process(GO:0006527) |
| 0.0 | 1.5 | GO:0045137 | development of primary sexual characteristics(GO:0045137) |
| 0.0 | 0.9 | GO:0006334 | nucleosome assembly(GO:0006334) |
| 0.0 | 0.8 | GO:0014065 | phosphatidylinositol 3-kinase signaling(GO:0014065) |
| 0.0 | 0.5 | GO:2001244 | positive regulation of intrinsic apoptotic signaling pathway(GO:2001244) |
| 0.0 | 0.3 | GO:0007608 | sensory perception of smell(GO:0007608) |
| 0.0 | 1.7 | GO:0042787 | protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0042787) |
| 0.0 | 0.7 | GO:0030032 | lamellipodium assembly(GO:0030032) |
| 0.0 | 0.7 | GO:0034763 | negative regulation of transmembrane transport(GO:0034763) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 2.2 | GO:0043259 | laminin-1 complex(GO:0005606) laminin-10 complex(GO:0043259) |
| 0.5 | 2.0 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
| 0.5 | 0.9 | GO:0042585 | germinal vesicle(GO:0042585) |
| 0.5 | 2.3 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.4 | 1.5 | GO:0090537 | CERF complex(GO:0090537) |
| 0.3 | 1.0 | GO:0031680 | G-protein beta/gamma-subunit complex(GO:0031680) |
| 0.3 | 1.5 | GO:0008623 | CHRAC(GO:0008623) |
| 0.2 | 3.7 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.2 | 2.0 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.1 | 1.3 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.1 | 0.6 | GO:1990761 | growth cone lamellipodium(GO:1990761) growth cone filopodium(GO:1990812) |
| 0.1 | 0.6 | GO:0001652 | granular component(GO:0001652) |
| 0.1 | 0.8 | GO:0060293 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
| 0.1 | 0.6 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.1 | 0.8 | GO:0070688 | MLL5-L complex(GO:0070688) |
| 0.1 | 0.3 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.1 | 1.9 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.1 | 0.8 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.1 | 0.2 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.1 | 1.4 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.1 | 2.5 | GO:0043034 | costamere(GO:0043034) |
| 0.1 | 0.7 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
| 0.1 | 1.5 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.1 | 0.4 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.1 | 5.3 | GO:0016363 | nuclear matrix(GO:0016363) |
| 0.0 | 1.5 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.0 | 2.7 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 1.8 | GO:0031941 | filamentous actin(GO:0031941) |
| 0.0 | 4.0 | GO:0005884 | actin filament(GO:0005884) |
| 0.0 | 0.3 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.0 | 0.5 | GO:0010369 | chromocenter(GO:0010369) |
| 0.0 | 1.0 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 2.2 | GO:0001669 | acrosomal vesicle(GO:0001669) |
| 0.0 | 0.2 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
| 0.0 | 0.5 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.0 | 1.1 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.0 | 0.4 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.0 | 0.4 | GO:0097386 | glial cell projection(GO:0097386) |
| 0.0 | 0.1 | GO:0030905 | retromer, tubulation complex(GO:0030905) |
| 0.0 | 2.3 | GO:0043204 | perikaryon(GO:0043204) |
| 0.0 | 0.2 | GO:0031672 | A band(GO:0031672) |
| 0.0 | 1.2 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.0 | 0.9 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.0 | 0.2 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.0 | 0.7 | GO:0009925 | basal plasma membrane(GO:0009925) |
| 0.0 | 1.1 | GO:0030018 | Z disc(GO:0030018) |
| 0.0 | 0.9 | GO:0001725 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
| 0.0 | 0.2 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.2 | 3.5 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.5 | 1.4 | GO:0008515 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.4 | 2.0 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.4 | 1.1 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
| 0.4 | 2.5 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.3 | 2.3 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 0.3 | 1.4 | GO:0005113 | patched binding(GO:0005113) |
| 0.3 | 2.2 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 0.3 | 1.3 | GO:0008865 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.3 | 1.0 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
| 0.2 | 5.0 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 0.2 | 0.7 | GO:0070890 | L-ascorbate:sodium symporter activity(GO:0008520) L-ascorbic acid transporter activity(GO:0015229) sodium-dependent L-ascorbate transmembrane transporter activity(GO:0070890) |
| 0.2 | 1.6 | GO:0031432 | titin binding(GO:0031432) |
| 0.2 | 0.8 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 0.2 | 1.1 | GO:0019841 | retinol binding(GO:0019841) |
| 0.2 | 0.7 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
| 0.2 | 2.0 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.2 | 1.9 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.2 | 0.7 | GO:0030292 | hyalurononglucosaminidase activity(GO:0004415) protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.1 | 0.4 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.1 | 0.9 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.1 | 2.9 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.1 | 0.8 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.1 | 0.5 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.1 | 0.3 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
| 0.1 | 2.9 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.1 | 1.2 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.1 | 1.3 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.1 | 0.6 | GO:0015651 | quaternary ammonium group transmembrane transporter activity(GO:0015651) |
| 0.1 | 0.7 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.1 | 0.4 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.1 | 3.5 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.1 | 0.3 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
| 0.1 | 1.1 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.1 | 0.7 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.1 | 3.0 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.1 | 3.5 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.1 | 1.0 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.1 | 0.8 | GO:0005522 | profilin binding(GO:0005522) |
| 0.1 | 1.5 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.1 | 0.7 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.1 | 0.6 | GO:0002039 | p53 binding(GO:0002039) |
| 0.1 | 0.7 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.1 | 0.8 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
| 0.1 | 1.9 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.1 | 0.3 | GO:0004984 | olfactory receptor activity(GO:0004984) |
| 0.1 | 10.9 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
| 0.1 | 4.0 | GO:0005080 | protein kinase C binding(GO:0005080) |
| 0.1 | 3.6 | GO:0035064 | methylated histone binding(GO:0035064) |
| 0.1 | 0.8 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.0 | 0.8 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
| 0.0 | 0.7 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.0 | 0.2 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.0 | 0.2 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.0 | 0.2 | GO:0004105 | choline-phosphate cytidylyltransferase activity(GO:0004105) |
| 0.0 | 1.1 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.0 | 0.4 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.0 | 0.8 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.0 | 2.6 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.0 | 0.2 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.0 | 0.7 | GO:0043747 | protein-N-terminal asparagine amidohydrolase activity(GO:0008418) UDP-3-O-[3-hydroxymyristoyl] N-acetylglucosamine deacetylase activity(GO:0008759) iprodione amidohydrolase activity(GO:0018748) (3,5-dichlorophenylurea)acetate amidohydrolase activity(GO:0018749) 4'-(2-hydroxyisopropyl)phenylurea amidohydrolase activity(GO:0034571) didemethylisoproturon amidohydrolase activity(GO:0034573) N-isopropylacetanilide amidohydrolase activity(GO:0034576) N-cyclohexylformamide amidohydrolase activity(GO:0034781) isonicotinic acid hydrazide hydrolase activity(GO:0034876) cis-aconitamide amidase activity(GO:0034882) gamma-N-formylaminovinylacetate hydrolase activity(GO:0034885) N2-acetyl-L-lysine deacetylase activity(GO:0043747) O-succinylbenzoate synthase activity(GO:0043748) indoleacetamide hydrolase activity(GO:0043864) N-acetylcitrulline deacetylase activity(GO:0043909) N-acetylgalactosamine-6-phosphate deacetylase activity(GO:0047419) diacetylchitobiose deacetylase activity(GO:0052773) chitooligosaccharide deacetylase activity(GO:0052790) |
| 0.0 | 1.0 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
| 0.0 | 0.2 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
| 0.0 | 0.3 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.0 | 0.7 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.0 | 0.2 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
| 0.0 | 0.2 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.0 | 3.7 | GO:0051015 | actin filament binding(GO:0051015) |
| 0.0 | 0.5 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
| 0.0 | 1.4 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
| 0.0 | 0.2 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.0 | 0.3 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.0 | 0.2 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) |
| 0.0 | 0.1 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.0 | 1.7 | GO:0042393 | histone binding(GO:0042393) |
| 0.0 | 0.3 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.0 | 0.6 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.0 | 0.9 | GO:0001158 | enhancer sequence-specific DNA binding(GO:0001158) |
| 0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.0 | 3.2 | GO:0000978 | RNA polymerase II core promoter proximal region sequence-specific DNA binding(GO:0000978) |
| 0.0 | 0.8 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.0 | 0.1 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.0 | 0.7 | GO:0035591 | signaling adaptor activity(GO:0035591) |
| 0.0 | 1.0 | GO:0003682 | chromatin binding(GO:0003682) |
| 0.0 | 0.2 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.0 | 0.4 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
| 0.0 | 5.5 | GO:0004842 | ubiquitin-protein transferase activity(GO:0004842) |
| 0.0 | 0.2 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.0 | 0.2 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.0 | 0.3 | GO:0001671 | ATPase activator activity(GO:0001671) |
