| 3.8 |
11.4 |
GO:0050975 |
sensory perception of touch(GO:0050975) |
| 3.5 |
10.6 |
GO:2000852 |
regulation of corticosterone secretion(GO:2000852) |
| 3.1 |
12.5 |
GO:0090238 |
positive regulation of arachidonic acid secretion(GO:0090238) |
| 3.0 |
8.9 |
GO:1903048 |
regulation of acetylcholine-gated cation channel activity(GO:1903048) |
| 2.8 |
8.5 |
GO:0051902 |
negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
| 2.7 |
8.2 |
GO:0016332 |
establishment or maintenance of polarity of embryonic epithelium(GO:0016332) |
| 2.7 |
8.1 |
GO:0060010 |
Sertoli cell fate commitment(GO:0060010) |
| 2.7 |
10.7 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 2.6 |
2.6 |
GO:1990379 |
lipid transport across blood brain barrier(GO:1990379) |
| 2.6 |
10.6 |
GO:0044330 |
canonical Wnt signaling pathway involved in positive regulation of wound healing(GO:0044330) lactic acid secretion(GO:0046722) regulation of metanephric cap mesenchymal cell proliferation(GO:0090095) positive regulation of metanephric cap mesenchymal cell proliferation(GO:0090096) |
| 2.6 |
7.9 |
GO:1901731 |
calcium-mediated signaling using extracellular calcium source(GO:0035585) positive regulation of platelet aggregation(GO:1901731) |
| 2.5 |
7.5 |
GO:0010512 |
negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
| 2.3 |
11.7 |
GO:0043314 |
negative regulation of neutrophil degranulation(GO:0043314) negative regulation of blood vessel remodeling(GO:0060313) |
| 2.3 |
6.9 |
GO:1901552 |
positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 2.2 |
6.7 |
GO:0060478 |
acrosomal vesicle exocytosis(GO:0060478) |
| 2.1 |
2.1 |
GO:0031638 |
zymogen activation(GO:0031638) |
| 2.1 |
6.2 |
GO:0051892 |
negative regulation of cardioblast differentiation(GO:0051892) |
| 2.1 |
8.3 |
GO:0014846 |
esophagus smooth muscle contraction(GO:0014846) |
| 2.1 |
6.2 |
GO:0014738 |
regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
| 2.0 |
6.1 |
GO:0032513 |
negative regulation of protein phosphatase type 2B activity(GO:0032513) |
| 2.0 |
12.0 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 2.0 |
8.0 |
GO:0031133 |
regulation of axon diameter(GO:0031133) |
| 2.0 |
9.9 |
GO:0045163 |
clustering of voltage-gated potassium channels(GO:0045163) |
| 2.0 |
2.0 |
GO:0035793 |
cell migration involved in metanephros development(GO:0035788) metanephric mesenchymal cell migration(GO:0035789) positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) regulation of metanephric mesenchymal cell migration(GO:2000589) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
| 1.9 |
7.7 |
GO:0006529 |
asparagine biosynthetic process(GO:0006529) |
| 1.9 |
5.7 |
GO:0046022 |
regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
| 1.9 |
7.5 |
GO:0051582 |
positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 1.8 |
5.5 |
GO:0021893 |
cerebral cortex GABAergic interneuron fate commitment(GO:0021893) |
| 1.8 |
3.7 |
GO:0036166 |
phenotypic switching(GO:0036166) |
| 1.8 |
5.4 |
GO:0003278 |
apoptotic process involved in heart morphogenesis(GO:0003278) |
| 1.8 |
7.2 |
GO:0061526 |
acetylcholine secretion, neurotransmission(GO:0014055) regulation of acetylcholine secretion, neurotransmission(GO:0014056) acetylcholine secretion(GO:0061526) |
| 1.8 |
3.5 |
GO:0045760 |
positive regulation of action potential(GO:0045760) |
| 1.7 |
1.7 |
GO:0072048 |
pattern specification involved in kidney development(GO:0061004) renal system pattern specification(GO:0072048) |
| 1.7 |
1.7 |
GO:0097491 |
trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) neural crest cell migration involved in autonomic nervous system development(GO:1901166) |
| 1.7 |
5.1 |
GO:0030827 |
negative regulation of cGMP metabolic process(GO:0030824) negative regulation of cGMP biosynthetic process(GO:0030827) negative regulation of guanylate cyclase activity(GO:0031283) |
| 1.7 |
8.4 |
GO:0002457 |
T cell antigen processing and presentation(GO:0002457) |
| 1.7 |
1.7 |
GO:0048715 |
negative regulation of oligodendrocyte differentiation(GO:0048715) |
| 1.6 |
4.9 |
GO:0007621 |
negative regulation of female receptivity(GO:0007621) |
| 1.6 |
6.4 |
GO:1902512 |
positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
| 1.6 |
4.8 |
GO:0070346 |
positive regulation of fat cell proliferation(GO:0070346) |
| 1.6 |
3.1 |
GO:0071336 |
regulation of hair follicle cell proliferation(GO:0071336) positive regulation of hair follicle cell proliferation(GO:0071338) |
| 1.6 |
4.7 |
GO:0021577 |
hindbrain structural organization(GO:0021577) cerebellum structural organization(GO:0021589) |
| 1.6 |
3.1 |
GO:0060710 |
chorio-allantoic fusion(GO:0060710) |
| 1.5 |
7.7 |
GO:0015671 |
oxygen transport(GO:0015671) |
| 1.5 |
10.7 |
GO:0060666 |
dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 1.5 |
9.1 |
GO:0006452 |
translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 1.5 |
4.4 |
GO:0003032 |
detection of oxygen(GO:0003032) |
| 1.5 |
4.4 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 1.5 |
4.4 |
GO:0072180 |
mesonephric duct development(GO:0072177) mesonephric duct morphogenesis(GO:0072180) |
| 1.5 |
8.8 |
GO:1902847 |
macrophage proliferation(GO:0061517) microglial cell proliferation(GO:0061518) regulation of neuronal signal transduction(GO:1902847) positive regulation of tau-protein kinase activity(GO:1902949) |
| 1.5 |
5.8 |
GO:0002924 |
negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
| 1.4 |
8.7 |
GO:0021894 |
cerebral cortex GABAergic interneuron development(GO:0021894) |
| 1.4 |
2.8 |
GO:2000344 |
positive regulation of acrosome reaction(GO:2000344) |
| 1.4 |
4.2 |
GO:0016115 |
terpenoid catabolic process(GO:0016115) |
| 1.4 |
6.9 |
GO:0002024 |
diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
| 1.4 |
6.9 |
GO:1900748 |
positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 1.4 |
1.4 |
GO:0042487 |
regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
| 1.4 |
1.4 |
GO:0031508 |
pericentric heterochromatin assembly(GO:0031508) |
| 1.4 |
1.4 |
GO:0031117 |
positive regulation of microtubule depolymerization(GO:0031117) |
| 1.4 |
1.4 |
GO:0035934 |
corticosterone secretion(GO:0035934) |
| 1.3 |
5.4 |
GO:0060265 |
positive regulation of respiratory burst involved in inflammatory response(GO:0060265) |
| 1.3 |
6.7 |
GO:1902683 |
regulation of receptor localization to synapse(GO:1902683) |
| 1.3 |
9.3 |
GO:0031536 |
positive regulation of exit from mitosis(GO:0031536) |
| 1.3 |
3.9 |
GO:0019405 |
alditol catabolic process(GO:0019405) |
| 1.3 |
3.8 |
GO:0035880 |
embryonic nail plate morphogenesis(GO:0035880) |
| 1.3 |
14.0 |
GO:1900121 |
negative regulation of receptor binding(GO:1900121) |
| 1.3 |
3.8 |
GO:1901097 |
negative regulation of autophagosome maturation(GO:1901097) |
| 1.3 |
1.3 |
GO:0009404 |
toxin metabolic process(GO:0009404) |
| 1.3 |
3.8 |
GO:0070366 |
regulation of hepatocyte differentiation(GO:0070366) |
| 1.2 |
5.0 |
GO:1990035 |
calcium ion import into cell(GO:1990035) |
| 1.2 |
3.7 |
GO:2000304 |
positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 1.2 |
3.6 |
GO:0010989 |
negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 1.2 |
12.0 |
GO:0048681 |
negative regulation of axon regeneration(GO:0048681) |
| 1.2 |
4.8 |
GO:0032439 |
endosome localization(GO:0032439) |
| 1.2 |
3.6 |
GO:1902219 |
regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 1.2 |
2.4 |
GO:0060166 |
olfactory pit development(GO:0060166) |
| 1.2 |
1.2 |
GO:0045113 |
regulation of integrin biosynthetic process(GO:0045113) |
| 1.2 |
1.2 |
GO:0010455 |
positive regulation of cell fate commitment(GO:0010455) regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
| 1.2 |
3.5 |
GO:0051866 |
general adaptation syndrome(GO:0051866) |
| 1.2 |
2.3 |
GO:0033762 |
response to glucagon(GO:0033762) |
| 1.2 |
3.5 |
GO:0070172 |
positive regulation of tooth mineralization(GO:0070172) |
| 1.2 |
3.5 |
GO:1902310 |
positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 1.2 |
3.5 |
GO:0090274 |
positive regulation of somatostatin secretion(GO:0090274) |
| 1.2 |
1.2 |
GO:0045602 |
negative regulation of endothelial cell differentiation(GO:0045602) |
| 1.2 |
2.3 |
GO:0090187 |
positive regulation of pancreatic juice secretion(GO:0090187) |
| 1.1 |
3.4 |
GO:0001830 |
trophectodermal cell fate commitment(GO:0001830) |
| 1.1 |
3.4 |
GO:2000562 |
negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 1.1 |
1.1 |
GO:0033024 |
mast cell homeostasis(GO:0033023) mast cell apoptotic process(GO:0033024) regulation of mast cell apoptotic process(GO:0033025) |
| 1.1 |
3.4 |
GO:0046671 |
negative regulation of retinal cell programmed cell death(GO:0046671) |
| 1.1 |
4.5 |
GO:0071280 |
cellular response to copper ion(GO:0071280) |
| 1.1 |
1.1 |
GO:1901030 |
positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
| 1.1 |
4.5 |
GO:0051708 |
intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) cytosol to ER transport(GO:0046967) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 1.1 |
1.1 |
GO:1903525 |
regulation of membrane tubulation(GO:1903525) |
| 1.1 |
1.1 |
GO:2000346 |
negative regulation of hepatocyte proliferation(GO:2000346) |
| 1.1 |
1.1 |
GO:0032847 |
regulation of cellular pH reduction(GO:0032847) |
| 1.1 |
5.6 |
GO:0040032 |
post-embryonic body morphogenesis(GO:0040032) |
| 1.1 |
4.5 |
GO:0039536 |
negative regulation of RIG-I signaling pathway(GO:0039536) |
| 1.1 |
3.4 |
GO:0070315 |
G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 1.1 |
2.2 |
GO:0070459 |
prolactin secretion(GO:0070459) |
| 1.1 |
7.8 |
GO:2000124 |
regulation of endocannabinoid signaling pathway(GO:2000124) |
| 1.1 |
3.3 |
GO:0060392 |
negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 1.1 |
12.2 |
GO:0061179 |
negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 1.1 |
4.4 |
GO:0023041 |
neuronal signal transduction(GO:0023041) |
| 1.1 |
3.3 |
GO:0002940 |
tRNA N2-guanine methylation(GO:0002940) |
| 1.1 |
3.3 |
GO:0051835 |
positive regulation of synapse structural plasticity(GO:0051835) |
| 1.1 |
2.2 |
GO:0033128 |
negative regulation of histone phosphorylation(GO:0033128) |
| 1.1 |
3.3 |
GO:0033159 |
negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 1.1 |
1.1 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 1.1 |
5.4 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 1.1 |
3.3 |
GO:2000501 |
natural killer cell chemotaxis(GO:0035747) regulation of natural killer cell chemotaxis(GO:2000501) |
| 1.1 |
2.2 |
GO:1900186 |
negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 1.1 |
7.6 |
GO:0061002 |
negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 1.1 |
8.6 |
GO:0033601 |
positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 1.1 |
5.4 |
GO:0006564 |
L-serine biosynthetic process(GO:0006564) |
| 1.1 |
8.6 |
GO:0060732 |
positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
| 1.1 |
3.2 |
GO:1903984 |
positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 1.1 |
1.1 |
GO:0090194 |
negative regulation of glomerular mesangial cell proliferation(GO:0072125) negative regulation of glomerulus development(GO:0090194) |
| 1.0 |
5.2 |
GO:0002121 |
inter-male aggressive behavior(GO:0002121) |
| 1.0 |
3.1 |
GO:0030070 |
insulin processing(GO:0030070) |
| 1.0 |
2.1 |
GO:0030538 |
embryonic genitalia morphogenesis(GO:0030538) |
| 1.0 |
5.2 |
GO:0018002 |
N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 1.0 |
6.2 |
GO:1901979 |
regulation of inward rectifier potassium channel activity(GO:1901979) |
| 1.0 |
1.0 |
GO:1904008 |
response to monosodium glutamate(GO:1904008) cellular response to monosodium glutamate(GO:1904009) |
| 1.0 |
2.1 |
GO:2000813 |
negative regulation of barbed-end actin filament capping(GO:2000813) |
| 1.0 |
5.2 |
GO:1900109 |
regulation of histone H3-K9 dimethylation(GO:1900109) |
| 1.0 |
13.4 |
GO:0007190 |
activation of adenylate cyclase activity(GO:0007190) |
| 1.0 |
6.2 |
GO:0032796 |
uropod organization(GO:0032796) |
| 1.0 |
3.1 |
GO:0086017 |
Purkinje myocyte action potential(GO:0086017) |
| 1.0 |
2.1 |
GO:2001027 |
negative regulation of endothelial cell chemotaxis(GO:2001027) |
| 1.0 |
8.2 |
GO:0006477 |
protein sulfation(GO:0006477) |
| 1.0 |
8.2 |
GO:2001214 |
positive regulation of vasculogenesis(GO:2001214) |
| 1.0 |
2.1 |
GO:0010248 |
B cell negative selection(GO:0002352) establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 1.0 |
3.1 |
GO:0051342 |
regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
| 1.0 |
4.1 |
GO:0060272 |
embryonic skeletal joint morphogenesis(GO:0060272) |
| 1.0 |
2.0 |
GO:0001787 |
natural killer cell proliferation(GO:0001787) |
| 1.0 |
2.0 |
GO:0061181 |
regulation of chondrocyte development(GO:0061181) |
| 1.0 |
3.0 |
GO:0048050 |
post-embryonic eye morphogenesis(GO:0048050) |
| 1.0 |
4.0 |
GO:0072369 |
regulation of lipid transport by positive regulation of transcription from RNA polymerase II promoter(GO:0072369) |
| 1.0 |
3.0 |
GO:0009298 |
GDP-mannose biosynthetic process(GO:0009298) |
| 1.0 |
6.0 |
GO:1900029 |
positive regulation of ruffle assembly(GO:1900029) |
| 1.0 |
4.0 |
GO:0035606 |
peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 1.0 |
4.0 |
GO:0071104 |
response to interleukin-9(GO:0071104) |
| 1.0 |
1.0 |
GO:0071374 |
cellular response to parathyroid hormone stimulus(GO:0071374) |
| 1.0 |
3.0 |
GO:2000832 |
negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
| 1.0 |
5.9 |
GO:0048170 |
positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
| 1.0 |
2.9 |
GO:0045659 |
regulation of neutrophil differentiation(GO:0045658) negative regulation of neutrophil differentiation(GO:0045659) |
| 1.0 |
9.8 |
GO:0090232 |
positive regulation of spindle checkpoint(GO:0090232) |
| 1.0 |
1.0 |
GO:0071169 |
establishment of protein localization to chromatin(GO:0071169) |
| 1.0 |
7.8 |
GO:0045603 |
positive regulation of endothelial cell differentiation(GO:0045603) |
| 1.0 |
3.9 |
GO:0033499 |
galactose catabolic process via UDP-galactose(GO:0033499) glycolytic process from galactose(GO:0061623) |
| 1.0 |
2.9 |
GO:0051490 |
negative regulation of filopodium assembly(GO:0051490) |
| 1.0 |
1.0 |
GO:0021557 |
oculomotor nerve development(GO:0021557) |
| 1.0 |
2.9 |
GO:0033029 |
regulation of neutrophil apoptotic process(GO:0033029) |
| 1.0 |
11.5 |
GO:0048484 |
enteric nervous system development(GO:0048484) |
| 1.0 |
4.8 |
GO:0045918 |
negative regulation of cytolysis(GO:0045918) |
| 1.0 |
5.7 |
GO:0006123 |
mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.9 |
1.9 |
GO:0000189 |
MAPK import into nucleus(GO:0000189) |
| 0.9 |
2.8 |
GO:0016561 |
protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.9 |
0.9 |
GO:2000981 |
negative regulation of mechanoreceptor differentiation(GO:0045632) negative regulation of inner ear receptor cell differentiation(GO:2000981) |
| 0.9 |
2.8 |
GO:0061144 |
alveolar secondary septum development(GO:0061144) |
| 0.9 |
0.9 |
GO:1903377 |
negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.9 |
0.9 |
GO:0021814 |
cell motility involved in cerebral cortex radial glia guided migration(GO:0021814) |
| 0.9 |
2.8 |
GO:0001193 |
maintenance of transcriptional fidelity during DNA-templated transcription elongation(GO:0001192) maintenance of transcriptional fidelity during DNA-templated transcription elongation from RNA polymerase II promoter(GO:0001193) |
| 0.9 |
4.6 |
GO:1903504 |
regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
| 0.9 |
4.6 |
GO:0034372 |
very-low-density lipoprotein particle remodeling(GO:0034372) |
| 0.9 |
3.6 |
GO:0046689 |
response to mercury ion(GO:0046689) |
| 0.9 |
2.7 |
GO:0031290 |
retinal ganglion cell axon guidance(GO:0031290) |
| 0.9 |
6.3 |
GO:0032471 |
negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
| 0.9 |
9.8 |
GO:0042711 |
maternal behavior(GO:0042711) |
| 0.9 |
6.2 |
GO:2001199 |
negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.9 |
5.3 |
GO:0006012 |
galactose metabolic process(GO:0006012) |
| 0.9 |
3.6 |
GO:0007412 |
axon target recognition(GO:0007412) |
| 0.9 |
1.8 |
GO:0045213 |
neurotransmitter receptor metabolic process(GO:0045213) |
| 0.9 |
16.8 |
GO:0000028 |
ribosomal small subunit assembly(GO:0000028) |
| 0.9 |
5.3 |
GO:1900028 |
negative regulation of ruffle assembly(GO:1900028) |
| 0.9 |
2.7 |
GO:0035582 |
sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.9 |
3.5 |
GO:0043973 |
histone H3-K4 acetylation(GO:0043973) |
| 0.9 |
4.4 |
GO:0030644 |
cellular chloride ion homeostasis(GO:0030644) |
| 0.9 |
3.5 |
GO:0018343 |
protein farnesylation(GO:0018343) |
| 0.9 |
1.8 |
GO:0010643 |
cell communication by chemical coupling(GO:0010643) |
| 0.9 |
3.5 |
GO:0075136 |
response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
| 0.9 |
0.9 |
GO:0072103 |
renal system vasculature morphogenesis(GO:0061438) kidney vasculature morphogenesis(GO:0061439) glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) |
| 0.9 |
6.1 |
GO:2000598 |
regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
| 0.9 |
5.2 |
GO:0032811 |
negative regulation of epinephrine secretion(GO:0032811) |
| 0.9 |
1.7 |
GO:0045915 |
positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
| 0.9 |
3.4 |
GO:0010273 |
detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.9 |
0.9 |
GO:2000670 |
positive regulation of dendritic cell apoptotic process(GO:2000670) |
| 0.9 |
0.9 |
GO:0061304 |
retinal blood vessel morphogenesis(GO:0061304) |
| 0.9 |
1.7 |
GO:0008631 |
intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0008631) |
| 0.8 |
1.7 |
GO:0061055 |
myotome development(GO:0061055) |
| 0.8 |
7.6 |
GO:0007042 |
lysosomal lumen acidification(GO:0007042) |
| 0.8 |
4.2 |
GO:2001025 |
positive regulation of response to drug(GO:2001025) |
| 0.8 |
1.7 |
GO:0046101 |
hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
| 0.8 |
1.7 |
GO:0019401 |
alditol biosynthetic process(GO:0019401) |
| 0.8 |
3.4 |
GO:0015959 |
diadenosine polyphosphate metabolic process(GO:0015959) |
| 0.8 |
15.1 |
GO:0021516 |
dorsal spinal cord development(GO:0021516) |
| 0.8 |
1.7 |
GO:1903596 |
regulation of gap junction assembly(GO:1903596) |
| 0.8 |
0.8 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.8 |
2.5 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.8 |
2.5 |
GO:0010958 |
regulation of amino acid import(GO:0010958) regulation of L-arginine import(GO:0010963) |
| 0.8 |
2.5 |
GO:1902109 |
negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
| 0.8 |
2.5 |
GO:2000744 |
anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 0.8 |
2.5 |
GO:0019043 |
establishment of viral latency(GO:0019043) |
| 0.8 |
5.8 |
GO:0032725 |
positive regulation of granulocyte macrophage colony-stimulating factor production(GO:0032725) |
| 0.8 |
3.3 |
GO:0003360 |
brainstem development(GO:0003360) |
| 0.8 |
0.8 |
GO:0002309 |
T cell proliferation involved in immune response(GO:0002309) |
| 0.8 |
8.2 |
GO:0030388 |
fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.8 |
1.6 |
GO:0061043 |
regulation of vascular wound healing(GO:0061043) |
| 0.8 |
2.5 |
GO:0009223 |
pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
| 0.8 |
0.8 |
GO:0007521 |
muscle cell fate determination(GO:0007521) |
| 0.8 |
3.3 |
GO:0018158 |
protein oxidation(GO:0018158) |
| 0.8 |
0.8 |
GO:0060453 |
regulation of gastric acid secretion(GO:0060453) |
| 0.8 |
2.4 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 0.8 |
12.1 |
GO:0042492 |
gamma-delta T cell differentiation(GO:0042492) |
| 0.8 |
2.4 |
GO:1902174 |
positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.8 |
5.7 |
GO:0061000 |
negative regulation of dendritic spine development(GO:0061000) |
| 0.8 |
0.8 |
GO:0071072 |
negative regulation of phospholipid biosynthetic process(GO:0071072) |
| 0.8 |
4.8 |
GO:0002317 |
plasma cell differentiation(GO:0002317) |
| 0.8 |
3.2 |
GO:0070278 |
extracellular matrix constituent secretion(GO:0070278) |
| 0.8 |
0.8 |
GO:0014050 |
negative regulation of glutamate secretion(GO:0014050) |
| 0.8 |
3.2 |
GO:0003105 |
negative regulation of glomerular filtration(GO:0003105) |
| 0.8 |
4.8 |
GO:0006177 |
GMP biosynthetic process(GO:0006177) |
| 0.8 |
3.2 |
GO:0015786 |
UDP-glucose transport(GO:0015786) |
| 0.8 |
2.4 |
GO:0002922 |
positive regulation of humoral immune response(GO:0002922) |
| 0.8 |
1.6 |
GO:0044351 |
macropinocytosis(GO:0044351) |
| 0.8 |
0.8 |
GO:0072061 |
inner medullary collecting duct development(GO:0072061) |
| 0.8 |
10.3 |
GO:0006857 |
oligopeptide transport(GO:0006857) |
| 0.8 |
3.2 |
GO:1901837 |
negative regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901837) |
| 0.8 |
6.3 |
GO:0030578 |
PML body organization(GO:0030578) |
| 0.8 |
3.2 |
GO:1902608 |
regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
| 0.8 |
7.9 |
GO:0051482 |
positive regulation of cytosolic calcium ion concentration involved in phospholipase C-activating G-protein coupled signaling pathway(GO:0051482) |
| 0.8 |
0.8 |
GO:1905065 |
positive regulation of vascular smooth muscle cell differentiation(GO:1905065) |
| 0.8 |
3.9 |
GO:1902856 |
negative regulation of nonmotile primary cilium assembly(GO:1902856) |
| 0.8 |
3.9 |
GO:0002536 |
respiratory burst involved in inflammatory response(GO:0002536) |
| 0.8 |
2.4 |
GO:0034447 |
very-low-density lipoprotein particle clearance(GO:0034447) |
| 0.8 |
5.5 |
GO:0000103 |
sulfate assimilation(GO:0000103) |
| 0.8 |
3.1 |
GO:1900533 |
medium-chain fatty-acyl-CoA catabolic process(GO:0036114) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
| 0.8 |
2.3 |
GO:0045014 |
carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 0.8 |
5.4 |
GO:0043951 |
negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.8 |
3.1 |
GO:0032914 |
positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.8 |
4.6 |
GO:0098734 |
protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
| 0.8 |
2.3 |
GO:0048865 |
stem cell fate commitment(GO:0048865) stem cell fate specification(GO:0048866) |
| 0.8 |
2.3 |
GO:1902415 |
regulation of mRNA binding(GO:1902415) positive regulation of mRNA binding(GO:1902416) regulation of RNA binding(GO:1905214) positive regulation of RNA binding(GO:1905216) |
| 0.8 |
1.5 |
GO:0006011 |
UDP-glucose metabolic process(GO:0006011) |
| 0.8 |
6.9 |
GO:0019800 |
peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.8 |
2.3 |
GO:0019676 |
ammonia assimilation cycle(GO:0019676) |
| 0.8 |
5.3 |
GO:0061436 |
establishment of skin barrier(GO:0061436) |
| 0.8 |
2.3 |
GO:0046341 |
CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.8 |
2.3 |
GO:2000983 |
regulation of ATP citrate synthase activity(GO:2000983) negative regulation of ATP citrate synthase activity(GO:2000984) |
| 0.8 |
0.8 |
GO:0006113 |
fermentation(GO:0006113) |
| 0.8 |
2.3 |
GO:1903800 |
positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.7 |
2.2 |
GO:0006682 |
galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.7 |
3.0 |
GO:0006438 |
valyl-tRNA aminoacylation(GO:0006438) |
| 0.7 |
3.0 |
GO:2000822 |
regulation of fear response(GO:1903365) positive regulation of fear response(GO:1903367) regulation of behavioral fear response(GO:2000822) positive regulation of behavioral fear response(GO:2000987) |
| 0.7 |
1.5 |
GO:0033634 |
positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.7 |
5.2 |
GO:0016480 |
negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.7 |
2.2 |
GO:1901536 |
regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
| 0.7 |
1.5 |
GO:0055064 |
chloride ion homeostasis(GO:0055064) |
| 0.7 |
13.3 |
GO:2000311 |
regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.7 |
10.3 |
GO:0002031 |
G-protein coupled receptor internalization(GO:0002031) |
| 0.7 |
2.9 |
GO:0003430 |
growth plate cartilage chondrocyte growth(GO:0003430) |
| 0.7 |
3.7 |
GO:1901164 |
negative regulation of trophoblast cell migration(GO:1901164) |
| 0.7 |
8.8 |
GO:0060159 |
regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.7 |
5.1 |
GO:0070458 |
detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 0.7 |
2.2 |
GO:0006097 |
glyoxylate cycle(GO:0006097) |
| 0.7 |
2.2 |
GO:0006106 |
fumarate metabolic process(GO:0006106) |
| 0.7 |
1.4 |
GO:0060024 |
rhythmic synaptic transmission(GO:0060024) |
| 0.7 |
2.2 |
GO:1903244 |
positive regulation of cardiac muscle adaptation(GO:0010615) positive regulation of cardiac muscle hypertrophy in response to stress(GO:1903244) |
| 0.7 |
2.9 |
GO:0042364 |
water-soluble vitamin biosynthetic process(GO:0042364) |
| 0.7 |
5.0 |
GO:0006995 |
cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.7 |
2.9 |
GO:0015669 |
gas transport(GO:0015669) carbon dioxide transport(GO:0015670) |
| 0.7 |
2.1 |
GO:0072488 |
nitrogen utilization(GO:0019740) ammonium transmembrane transport(GO:0072488) |
| 0.7 |
1.4 |
GO:0035928 |
RNA import into mitochondrion(GO:0035927) rRNA import into mitochondrion(GO:0035928) |
| 0.7 |
0.7 |
GO:0061188 |
regulation of chromatin silencing at rDNA(GO:0061187) negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 0.7 |
0.7 |
GO:0042268 |
regulation of cytolysis(GO:0042268) |
| 0.7 |
2.1 |
GO:0030167 |
proteoglycan catabolic process(GO:0030167) |
| 0.7 |
2.1 |
GO:0072356 |
chromosome passenger complex localization to kinetochore(GO:0072356) |
| 0.7 |
2.1 |
GO:0006434 |
seryl-tRNA aminoacylation(GO:0006434) |
| 0.7 |
0.7 |
GO:0007341 |
penetration of zona pellucida(GO:0007341) |
| 0.7 |
3.5 |
GO:1902031 |
regulation of NADP metabolic process(GO:1902031) |
| 0.7 |
4.2 |
GO:0031145 |
anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.7 |
2.1 |
GO:1903054 |
negative regulation of extracellular matrix organization(GO:1903054) |
| 0.7 |
4.2 |
GO:0038166 |
angiotensin-activated signaling pathway(GO:0038166) |
| 0.7 |
3.5 |
GO:0061051 |
positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
| 0.7 |
0.7 |
GO:2001198 |
regulation of dendritic cell differentiation(GO:2001198) |
| 0.7 |
1.4 |
GO:0051798 |
positive regulation of hair cycle(GO:0042635) positive regulation of hair follicle development(GO:0051798) |
| 0.7 |
0.7 |
GO:0046037 |
GMP metabolic process(GO:0046037) |
| 0.7 |
3.5 |
GO:0031424 |
keratinization(GO:0031424) |
| 0.7 |
4.2 |
GO:0045618 |
positive regulation of keratinocyte differentiation(GO:0045618) |
| 0.7 |
9.0 |
GO:0033211 |
adiponectin-activated signaling pathway(GO:0033211) |
| 0.7 |
0.7 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.7 |
4.1 |
GO:0033623 |
regulation of integrin activation(GO:0033623) |
| 0.7 |
2.1 |
GO:0032713 |
negative regulation of interleukin-4 production(GO:0032713) |
| 0.7 |
2.8 |
GO:1903181 |
regulation of dopamine biosynthetic process(GO:1903179) positive regulation of dopamine biosynthetic process(GO:1903181) |
| 0.7 |
4.8 |
GO:0036072 |
intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 0.7 |
0.7 |
GO:0048319 |
axial mesoderm morphogenesis(GO:0048319) |
| 0.7 |
4.1 |
GO:0060373 |
regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.7 |
6.1 |
GO:0090166 |
Golgi disassembly(GO:0090166) |
| 0.7 |
1.4 |
GO:1902498 |
regulation of protein autoubiquitination(GO:1902498) |
| 0.7 |
5.5 |
GO:1900262 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.7 |
2.7 |
GO:0042535 |
positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
| 0.7 |
0.7 |
GO:0003096 |
renal sodium ion transport(GO:0003096) |
| 0.7 |
8.2 |
GO:0045217 |
cell-cell junction maintenance(GO:0045217) |
| 0.7 |
0.7 |
GO:1902473 |
regulation of protein localization to synapse(GO:1902473) |
| 0.7 |
2.0 |
GO:0009182 |
purine deoxyribonucleoside diphosphate metabolic process(GO:0009182) dGDP metabolic process(GO:0046066) GDP metabolic process(GO:0046710) |
| 0.7 |
1.3 |
GO:0010533 |
regulation of activation of Janus kinase activity(GO:0010533) regulation of activation of JAK2 kinase activity(GO:0010534) |
| 0.7 |
9.4 |
GO:0050832 |
defense response to fungus(GO:0050832) |
| 0.7 |
2.7 |
GO:0046552 |
eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 0.7 |
7.3 |
GO:0050951 |
sensory perception of temperature stimulus(GO:0050951) |
| 0.7 |
4.0 |
GO:0007253 |
cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.7 |
1.3 |
GO:0050930 |
induction of positive chemotaxis(GO:0050930) |
| 0.7 |
2.7 |
GO:0000491 |
small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.7 |
5.3 |
GO:0019835 |
cytolysis(GO:0019835) |
| 0.7 |
4.0 |
GO:0034969 |
histone arginine methylation(GO:0034969) |
| 0.7 |
4.6 |
GO:0005981 |
regulation of glycogen catabolic process(GO:0005981) |
| 0.7 |
18.4 |
GO:0045746 |
negative regulation of Notch signaling pathway(GO:0045746) |
| 0.7 |
3.9 |
GO:0032493 |
response to bacterial lipoprotein(GO:0032493) |
| 0.7 |
5.2 |
GO:0031645 |
negative regulation of neurological system process(GO:0031645) |
| 0.7 |
9.8 |
GO:0051451 |
myoblast migration(GO:0051451) |
| 0.7 |
2.0 |
GO:0008612 |
peptidyl-lysine modification to peptidyl-hypusine(GO:0008612) |
| 0.7 |
0.7 |
GO:0032241 |
positive regulation of nucleobase-containing compound transport(GO:0032241) |
| 0.7 |
4.6 |
GO:0043615 |
astrocyte cell migration(GO:0043615) |
| 0.6 |
1.9 |
GO:0034384 |
high-density lipoprotein particle clearance(GO:0034384) |
| 0.6 |
1.9 |
GO:0061626 |
pharyngeal arch artery morphogenesis(GO:0061626) |
| 0.6 |
7.8 |
GO:0002227 |
innate immune response in mucosa(GO:0002227) |
| 0.6 |
3.2 |
GO:2000325 |
regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 0.6 |
2.6 |
GO:0019673 |
GDP-mannose metabolic process(GO:0019673) |
| 0.6 |
1.3 |
GO:0042993 |
positive regulation of transcription factor import into nucleus(GO:0042993) |
| 0.6 |
2.6 |
GO:0070317 |
negative regulation of G0 to G1 transition(GO:0070317) |
| 0.6 |
0.6 |
GO:0036115 |
fatty-acyl-CoA catabolic process(GO:0036115) |
| 0.6 |
7.7 |
GO:0050765 |
negative regulation of phagocytosis(GO:0050765) |
| 0.6 |
2.6 |
GO:0035461 |
vitamin transmembrane transport(GO:0035461) |
| 0.6 |
1.9 |
GO:1903795 |
regulation of inorganic anion transmembrane transport(GO:1903795) |
| 0.6 |
5.8 |
GO:2000467 |
positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.6 |
8.3 |
GO:0071392 |
cellular response to estradiol stimulus(GO:0071392) |
| 0.6 |
7.0 |
GO:1990173 |
protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
| 0.6 |
0.6 |
GO:1902188 |
positive regulation of viral release from host cell(GO:1902188) |
| 0.6 |
1.9 |
GO:0009414 |
response to water deprivation(GO:0009414) |
| 0.6 |
1.3 |
GO:0002538 |
arachidonic acid metabolite production involved in inflammatory response(GO:0002538) |
| 0.6 |
0.6 |
GO:0097475 |
motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
| 0.6 |
7.5 |
GO:0000244 |
spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.6 |
2.5 |
GO:0035814 |
negative regulation of renal sodium excretion(GO:0035814) |
| 0.6 |
0.6 |
GO:2000646 |
positive regulation of receptor catabolic process(GO:2000646) |
| 0.6 |
1.9 |
GO:0000430 |
regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
| 0.6 |
5.6 |
GO:0060613 |
fat pad development(GO:0060613) |
| 0.6 |
1.8 |
GO:1903279 |
regulation of calcium:sodium antiporter activity(GO:1903279) |
| 0.6 |
1.2 |
GO:0050703 |
interleukin-1 alpha production(GO:0032610) interleukin-1 alpha secretion(GO:0050703) |
| 0.6 |
2.4 |
GO:0021586 |
pons maturation(GO:0021586) |
| 0.6 |
0.6 |
GO:0035799 |
ureter maturation(GO:0035799) |
| 0.6 |
2.4 |
GO:0031509 |
telomeric heterochromatin assembly(GO:0031509) negative regulation of chromosome condensation(GO:1902340) |
| 0.6 |
0.6 |
GO:1903624 |
regulation of apoptotic DNA fragmentation(GO:1902510) regulation of DNA catabolic process(GO:1903624) |
| 0.6 |
0.6 |
GO:0009153 |
purine deoxyribonucleotide biosynthetic process(GO:0009153) |
| 0.6 |
1.8 |
GO:0097401 |
synaptic vesicle lumen acidification(GO:0097401) |
| 0.6 |
12.1 |
GO:0032897 |
negative regulation of viral transcription(GO:0032897) |
| 0.6 |
3.0 |
GO:2000491 |
positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.6 |
1.2 |
GO:0043486 |
histone exchange(GO:0043486) |
| 0.6 |
1.8 |
GO:0042699 |
follicle-stimulating hormone signaling pathway(GO:0042699) |
| 0.6 |
1.2 |
GO:0006507 |
GPI anchor release(GO:0006507) |
| 0.6 |
1.2 |
GO:1900126 |
negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.6 |
1.8 |
GO:0034124 |
regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034124) |
| 0.6 |
2.4 |
GO:0002337 |
B-1a B cell differentiation(GO:0002337) |
| 0.6 |
1.2 |
GO:0048711 |
positive regulation of astrocyte differentiation(GO:0048711) |
| 0.6 |
1.2 |
GO:0008626 |
granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.6 |
2.4 |
GO:0019287 |
isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) isopentenyl diphosphate metabolic process(GO:0046490) |
| 0.6 |
2.4 |
GO:0051725 |
protein de-ADP-ribosylation(GO:0051725) |
| 0.6 |
0.6 |
GO:0042182 |
ketone catabolic process(GO:0042182) |
| 0.6 |
1.8 |
GO:0007035 |
vacuolar acidification(GO:0007035) |
| 0.6 |
1.2 |
GO:0031077 |
post-embryonic camera-type eye development(GO:0031077) |
| 0.6 |
0.6 |
GO:0010458 |
exit from mitosis(GO:0010458) |
| 0.6 |
16.6 |
GO:0015985 |
energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.6 |
0.6 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.6 |
3.0 |
GO:0019249 |
lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
| 0.6 |
1.8 |
GO:0070844 |
misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 0.6 |
0.6 |
GO:0060994 |
regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 0.6 |
1.2 |
GO:0045085 |
negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.6 |
1.8 |
GO:0010814 |
substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.6 |
0.6 |
GO:0010637 |
negative regulation of mitochondrial fusion(GO:0010637) |
| 0.6 |
1.2 |
GO:0021759 |
globus pallidus development(GO:0021759) |
| 0.6 |
0.6 |
GO:0008054 |
negative regulation of cyclin-dependent protein serine/threonine kinase by cyclin degradation(GO:0008054) |
| 0.6 |
1.2 |
GO:0003418 |
growth plate cartilage chondrocyte differentiation(GO:0003418) |
| 0.6 |
0.6 |
GO:0015870 |
acetylcholine transport(GO:0015870) acetate ester transport(GO:1901374) |
| 0.6 |
0.6 |
GO:0072008 |
glomerular mesangial cell differentiation(GO:0072008) glomerular mesangial cell development(GO:0072144) |
| 0.6 |
0.6 |
GO:0043096 |
purine nucleobase salvage(GO:0043096) |
| 0.6 |
8.0 |
GO:0045063 |
T-helper 1 cell differentiation(GO:0045063) |
| 0.6 |
1.1 |
GO:2001268 |
negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
| 0.6 |
0.6 |
GO:0016264 |
gap junction assembly(GO:0016264) |
| 0.6 |
1.7 |
GO:0070889 |
platelet alpha granule organization(GO:0070889) |
| 0.6 |
6.8 |
GO:0015816 |
glycine transport(GO:0015816) |
| 0.6 |
2.3 |
GO:1904529 |
regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
| 0.6 |
2.8 |
GO:1902309 |
regulation of peptidyl-serine dephosphorylation(GO:1902308) negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.6 |
1.1 |
GO:1902534 |
single-organism membrane invagination(GO:1902534) |
| 0.6 |
1.7 |
GO:0048611 |
ectodermal digestive tract development(GO:0007439) embryonic ectodermal digestive tract development(GO:0048611) |
| 0.6 |
2.3 |
GO:0046294 |
formaldehyde catabolic process(GO:0046294) |
| 0.6 |
2.3 |
GO:0007023 |
post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.6 |
1.7 |
GO:0072385 |
minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.6 |
0.6 |
GO:0071035 |
polyadenylation-dependent ncRNA catabolic process(GO:0043634) nuclear ncRNA surveillance(GO:0071029) nuclear polyadenylation-dependent rRNA catabolic process(GO:0071035) nuclear polyadenylation-dependent ncRNA catabolic process(GO:0071046) |
| 0.6 |
0.6 |
GO:0043173 |
nucleotide salvage(GO:0043173) |
| 0.6 |
1.7 |
GO:0060598 |
dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
| 0.6 |
0.6 |
GO:0036118 |
hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.6 |
0.6 |
GO:0060179 |
male mating behavior(GO:0060179) |
| 0.6 |
4.5 |
GO:0032020 |
ISG15-protein conjugation(GO:0032020) |
| 0.6 |
0.6 |
GO:0003219 |
cardiac right ventricle formation(GO:0003219) |
| 0.6 |
1.1 |
GO:0071224 |
detection of peptidoglycan(GO:0032499) response to lipoteichoic acid(GO:0070391) cellular response to lipoteichoic acid(GO:0071223) cellular response to peptidoglycan(GO:0071224) |
| 0.6 |
3.3 |
GO:0044829 |
positive regulation by host of viral genome replication(GO:0044829) |
| 0.6 |
2.2 |
GO:0019346 |
homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
| 0.6 |
2.2 |
GO:1902268 |
negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.6 |
0.6 |
GO:0031990 |
mRNA export from nucleus in response to heat stress(GO:0031990) |
| 0.5 |
1.1 |
GO:0072531 |
pyrimidine-containing compound transmembrane transport(GO:0072531) |
| 0.5 |
11.0 |
GO:0050650 |
chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
| 0.5 |
5.5 |
GO:0006654 |
phosphatidic acid biosynthetic process(GO:0006654) phosphatidic acid metabolic process(GO:0046473) |
| 0.5 |
1.1 |
GO:1904879 |
positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.5 |
1.1 |
GO:0046084 |
adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
| 0.5 |
4.4 |
GO:0005513 |
detection of calcium ion(GO:0005513) |
| 0.5 |
3.8 |
GO:0045647 |
negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.5 |
1.1 |
GO:0001771 |
immunological synapse formation(GO:0001771) |
| 0.5 |
2.7 |
GO:0006348 |
chromatin silencing at telomere(GO:0006348) |
| 0.5 |
8.1 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.5 |
1.6 |
GO:0016259 |
selenocysteine metabolic process(GO:0016259) |
| 0.5 |
1.6 |
GO:0009051 |
pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.5 |
2.1 |
GO:0010807 |
regulation of synaptic vesicle priming(GO:0010807) |
| 0.5 |
3.2 |
GO:0060164 |
regulation of timing of neuron differentiation(GO:0060164) |
| 0.5 |
3.7 |
GO:0097421 |
liver regeneration(GO:0097421) |
| 0.5 |
2.7 |
GO:2000255 |
negative regulation of male germ cell proliferation(GO:2000255) |
| 0.5 |
2.6 |
GO:0048227 |
plasma membrane to endosome transport(GO:0048227) |
| 0.5 |
1.1 |
GO:0001922 |
B-1 B cell homeostasis(GO:0001922) |
| 0.5 |
2.1 |
GO:0006848 |
pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
| 0.5 |
0.5 |
GO:0002679 |
respiratory burst involved in defense response(GO:0002679) |
| 0.5 |
4.7 |
GO:0030049 |
muscle filament sliding(GO:0030049) |
| 0.5 |
4.7 |
GO:0090042 |
tubulin deacetylation(GO:0090042) |
| 0.5 |
5.7 |
GO:0060716 |
labyrinthine layer blood vessel development(GO:0060716) |
| 0.5 |
2.6 |
GO:0070125 |
mitochondrial translational elongation(GO:0070125) |
| 0.5 |
0.5 |
GO:0097154 |
GABAergic neuron differentiation(GO:0097154) |
| 0.5 |
19.7 |
GO:0045806 |
negative regulation of endocytosis(GO:0045806) |
| 0.5 |
1.6 |
GO:0070086 |
ubiquitin-dependent endocytosis(GO:0070086) |
| 0.5 |
0.5 |
GO:0043516 |
regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043516) |
| 0.5 |
2.6 |
GO:0060242 |
contact inhibition(GO:0060242) |
| 0.5 |
4.6 |
GO:0042136 |
neurotransmitter biosynthetic process(GO:0042136) |
| 0.5 |
1.0 |
GO:2000551 |
regulation of T-helper 2 cell cytokine production(GO:2000551) positive regulation of T-helper 2 cell cytokine production(GO:2000553) |
| 0.5 |
1.0 |
GO:0035617 |
ribonucleoprotein complex disassembly(GO:0032988) stress granule disassembly(GO:0035617) |
| 0.5 |
1.5 |
GO:0007619 |
courtship behavior(GO:0007619) |
| 0.5 |
9.3 |
GO:0006879 |
cellular iron ion homeostasis(GO:0006879) |
| 0.5 |
1.0 |
GO:0010752 |
regulation of cGMP-mediated signaling(GO:0010752) |
| 0.5 |
1.5 |
GO:0097374 |
sensory neuron axon guidance(GO:0097374) |
| 0.5 |
0.5 |
GO:0003376 |
sphingosine-1-phosphate signaling pathway(GO:0003376) sphingolipid mediated signaling pathway(GO:0090520) |
| 0.5 |
0.5 |
GO:0036482 |
neuron intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036482) positive regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902958) regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903383) negative regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903384) |
| 0.5 |
10.2 |
GO:0016226 |
iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.5 |
1.5 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.5 |
0.5 |
GO:0061615 |
glycolytic process through fructose-6-phosphate(GO:0061615) |
| 0.5 |
1.5 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.5 |
5.6 |
GO:2000060 |
positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
| 0.5 |
0.5 |
GO:2000508 |
regulation of dendritic cell chemotaxis(GO:2000508) positive regulation of dendritic cell chemotaxis(GO:2000510) |
| 0.5 |
2.0 |
GO:0003263 |
cardioblast proliferation(GO:0003263) regulation of cardioblast proliferation(GO:0003264) regulation of secondary heart field cardioblast proliferation(GO:0003266) positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.5 |
0.5 |
GO:0007181 |
transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.5 |
0.5 |
GO:0044872 |
lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.5 |
5.1 |
GO:0070050 |
neuron cellular homeostasis(GO:0070050) |
| 0.5 |
1.0 |
GO:0032423 |
regulation of mismatch repair(GO:0032423) |
| 0.5 |
6.6 |
GO:0071353 |
response to interleukin-4(GO:0070670) cellular response to interleukin-4(GO:0071353) |
| 0.5 |
2.5 |
GO:0002283 |
neutrophil activation involved in immune response(GO:0002283) |
| 0.5 |
5.5 |
GO:0042744 |
hydrogen peroxide catabolic process(GO:0042744) |
| 0.5 |
2.5 |
GO:0051967 |
negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.5 |
1.0 |
GO:0042534 |
tumor necrosis factor biosynthetic process(GO:0042533) regulation of tumor necrosis factor biosynthetic process(GO:0042534) |
| 0.5 |
0.5 |
GO:0055095 |
lipoprotein particle mediated signaling(GO:0055095) low-density lipoprotein particle mediated signaling(GO:0055096) |
| 0.5 |
2.5 |
GO:0002862 |
negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.5 |
1.0 |
GO:0010626 |
negative regulation of Schwann cell proliferation(GO:0010626) |
| 0.5 |
3.9 |
GO:2001135 |
regulation of endocytic recycling(GO:2001135) |
| 0.5 |
0.5 |
GO:0061154 |
endothelial tube morphogenesis(GO:0061154) |
| 0.5 |
6.4 |
GO:0016486 |
peptide hormone processing(GO:0016486) |
| 0.5 |
0.5 |
GO:0048388 |
endosomal lumen acidification(GO:0048388) |
| 0.5 |
1.0 |
GO:0046015 |
regulation of transcription by glucose(GO:0046015) |
| 0.5 |
1.5 |
GO:0090201 |
negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
| 0.5 |
1.5 |
GO:0038003 |
opioid receptor signaling pathway(GO:0038003) regulation of opioid receptor signaling pathway(GO:2000474) |
| 0.5 |
7.3 |
GO:0031115 |
negative regulation of microtubule polymerization(GO:0031115) |
| 0.5 |
3.4 |
GO:0010544 |
negative regulation of platelet activation(GO:0010544) |
| 0.5 |
1.5 |
GO:0006669 |
sphinganine-1-phosphate biosynthetic process(GO:0006669) |
| 0.5 |
1.5 |
GO:0097274 |
urea homeostasis(GO:0097274) |
| 0.5 |
1.5 |
GO:0015772 |
disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.5 |
1.5 |
GO:0098915 |
membrane repolarization during ventricular cardiac muscle cell action potential(GO:0098915) |
| 0.5 |
0.5 |
GO:0032066 |
nucleolus to nucleoplasm transport(GO:0032066) |
| 0.5 |
0.5 |
GO:2001015 |
negative regulation of skeletal muscle cell differentiation(GO:2001015) |
| 0.5 |
1.4 |
GO:0006680 |
glucosylceramide catabolic process(GO:0006680) |
| 0.5 |
1.4 |
GO:0019478 |
D-amino acid catabolic process(GO:0019478) |
| 0.5 |
4.3 |
GO:0042573 |
retinoic acid metabolic process(GO:0042573) |
| 0.5 |
5.3 |
GO:0001780 |
neutrophil homeostasis(GO:0001780) |
| 0.5 |
1.4 |
GO:0002014 |
vasoconstriction of artery involved in ischemic response to lowering of systemic arterial blood pressure(GO:0002014) |
| 0.5 |
1.4 |
GO:0007171 |
activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.5 |
3.8 |
GO:0071816 |
protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.5 |
3.8 |
GO:0071493 |
cellular response to UV-B(GO:0071493) |
| 0.5 |
1.9 |
GO:1903223 |
positive regulation of oxidative stress-induced neuron death(GO:1903223) positive regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903378) |
| 0.5 |
0.5 |
GO:2000398 |
regulation of T cell differentiation in thymus(GO:0033081) regulation of thymocyte aggregation(GO:2000398) |
| 0.5 |
0.5 |
GO:0001732 |
formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.5 |
1.4 |
GO:0021933 |
radial glia guided migration of cerebellar granule cell(GO:0021933) |
| 0.5 |
4.8 |
GO:0090385 |
phagosome-lysosome fusion(GO:0090385) |
| 0.5 |
8.6 |
GO:0095500 |
acetylcholine receptor signaling pathway(GO:0095500) postsynaptic signal transduction(GO:0098926) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
| 0.5 |
1.9 |
GO:0006780 |
uroporphyrinogen III biosynthetic process(GO:0006780) |
| 0.5 |
4.7 |
GO:0032060 |
bleb assembly(GO:0032060) |
| 0.5 |
3.3 |
GO:0006363 |
termination of RNA polymerase I transcription(GO:0006363) |
| 0.5 |
0.9 |
GO:0032689 |
negative regulation of interferon-gamma production(GO:0032689) |
| 0.5 |
0.9 |
GO:0009125 |
nucleoside monophosphate catabolic process(GO:0009125) |
| 0.5 |
0.5 |
GO:2000468 |
regulation of peroxidase activity(GO:2000468) |
| 0.5 |
1.9 |
GO:1902455 |
negative regulation of stem cell population maintenance(GO:1902455) |
| 0.5 |
1.4 |
GO:0060158 |
phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.5 |
6.1 |
GO:0030150 |
protein import into mitochondrial matrix(GO:0030150) |
| 0.5 |
0.9 |
GO:0002407 |
dendritic cell chemotaxis(GO:0002407) |
| 0.5 |
2.3 |
GO:0032782 |
bile acid secretion(GO:0032782) |
| 0.5 |
1.9 |
GO:0006102 |
isocitrate metabolic process(GO:0006102) |
| 0.5 |
0.5 |
GO:0009264 |
deoxyribonucleotide catabolic process(GO:0009264) |
| 0.5 |
10.7 |
GO:0048791 |
calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.5 |
1.4 |
GO:0050915 |
sensory perception of sour taste(GO:0050915) |
| 0.5 |
3.2 |
GO:0006621 |
protein retention in ER lumen(GO:0006621) |
| 0.5 |
1.8 |
GO:0030576 |
Cajal body organization(GO:0030576) |
| 0.5 |
5.5 |
GO:0060052 |
neurofilament cytoskeleton organization(GO:0060052) |
| 0.5 |
4.6 |
GO:0048172 |
regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.5 |
0.5 |
GO:0032829 |
regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) |
| 0.5 |
1.8 |
GO:0072318 |
clathrin coat disassembly(GO:0072318) |
| 0.5 |
2.3 |
GO:0046826 |
negative regulation of protein export from nucleus(GO:0046826) |
| 0.5 |
0.5 |
GO:0031498 |
chromatin disassembly(GO:0031498) |
| 0.5 |
6.4 |
GO:0010388 |
cullin deneddylation(GO:0010388) |
| 0.5 |
3.2 |
GO:0033567 |
DNA replication, Okazaki fragment processing(GO:0033567) |
| 0.5 |
10.1 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.5 |
0.9 |
GO:0090343 |
positive regulation of cell aging(GO:0090343) positive regulation of cellular senescence(GO:2000774) |
| 0.5 |
1.8 |
GO:1902224 |
cellular ketone body metabolic process(GO:0046950) ketone body metabolic process(GO:1902224) |
| 0.5 |
1.4 |
GO:0090285 |
negative regulation of protein glycosylation in Golgi(GO:0090285) |
| 0.5 |
6.8 |
GO:0009134 |
nucleoside diphosphate catabolic process(GO:0009134) |
| 0.5 |
1.8 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 0.5 |
1.8 |
GO:0000447 |
endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.5 |
0.5 |
GO:2000823 |
regulation of androgen receptor activity(GO:2000823) |
| 0.5 |
0.9 |
GO:2000097 |
regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 0.5 |
1.4 |
GO:0061300 |
cerebellum vasculature development(GO:0061300) |
| 0.5 |
2.3 |
GO:0018364 |
peptidyl-glutamine methylation(GO:0018364) |
| 0.5 |
0.9 |
GO:1903861 |
regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
| 0.5 |
2.3 |
GO:0032079 |
positive regulation of endodeoxyribonuclease activity(GO:0032079) |
| 0.5 |
3.2 |
GO:0032525 |
somite rostral/caudal axis specification(GO:0032525) |
| 0.5 |
0.9 |
GO:0010561 |
negative regulation of glycoprotein biosynthetic process(GO:0010561) |
| 0.5 |
2.3 |
GO:0045650 |
negative regulation of macrophage differentiation(GO:0045650) |
| 0.4 |
0.4 |
GO:0034144 |
negative regulation of toll-like receptor 4 signaling pathway(GO:0034144) |
| 0.4 |
2.7 |
GO:0014824 |
artery smooth muscle contraction(GO:0014824) |
| 0.4 |
1.3 |
GO:0006189 |
'de novo' IMP biosynthetic process(GO:0006189) |
| 0.4 |
0.4 |
GO:0032077 |
positive regulation of deoxyribonuclease activity(GO:0032077) |
| 0.4 |
2.2 |
GO:0000185 |
activation of MAPKKK activity(GO:0000185) |
| 0.4 |
0.4 |
GO:1902548 |
negative regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902548) |
| 0.4 |
0.9 |
GO:0060050 |
positive regulation of protein glycosylation(GO:0060050) |
| 0.4 |
6.7 |
GO:0016339 |
calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.4 |
6.2 |
GO:0008535 |
respiratory chain complex IV assembly(GO:0008535) |
| 0.4 |
0.4 |
GO:0010359 |
regulation of anion channel activity(GO:0010359) |
| 0.4 |
2.2 |
GO:0070327 |
thyroid hormone transport(GO:0070327) |
| 0.4 |
18.9 |
GO:0006414 |
translational elongation(GO:0006414) |
| 0.4 |
0.9 |
GO:0036289 |
peptidyl-serine autophosphorylation(GO:0036289) |
| 0.4 |
2.6 |
GO:0036444 |
calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.4 |
0.4 |
GO:0070474 |
positive regulation of uterine smooth muscle contraction(GO:0070474) |
| 0.4 |
0.4 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 0.4 |
3.9 |
GO:0021854 |
hypothalamus development(GO:0021854) |
| 0.4 |
9.2 |
GO:0048268 |
clathrin coat assembly(GO:0048268) |
| 0.4 |
2.6 |
GO:0046103 |
inosine biosynthetic process(GO:0046103) |
| 0.4 |
1.7 |
GO:0031649 |
heat generation(GO:0031649) |
| 0.4 |
1.3 |
GO:0051030 |
snRNA transport(GO:0051030) |
| 0.4 |
3.0 |
GO:0010572 |
positive regulation of platelet activation(GO:0010572) |
| 0.4 |
0.9 |
GO:0033091 |
positive regulation of immature T cell proliferation(GO:0033091) |
| 0.4 |
0.9 |
GO:0046598 |
positive regulation of viral entry into host cell(GO:0046598) |
| 0.4 |
1.7 |
GO:0045039 |
protein import into mitochondrial inner membrane(GO:0045039) |
| 0.4 |
1.3 |
GO:0034476 |
U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) |
| 0.4 |
3.9 |
GO:0001990 |
regulation of systemic arterial blood pressure by hormone(GO:0001990) |
| 0.4 |
1.7 |
GO:0014049 |
positive regulation of glutamate secretion(GO:0014049) |
| 0.4 |
1.7 |
GO:0031584 |
activation of phospholipase D activity(GO:0031584) |
| 0.4 |
4.3 |
GO:2000653 |
regulation of genetic imprinting(GO:2000653) |
| 0.4 |
0.9 |
GO:0047484 |
regulation of response to osmotic stress(GO:0047484) |
| 0.4 |
1.3 |
GO:0070314 |
G1 to G0 transition(GO:0070314) |
| 0.4 |
1.7 |
GO:0019370 |
leukotriene biosynthetic process(GO:0019370) |
| 0.4 |
1.3 |
GO:0090241 |
negative regulation of histone H4 acetylation(GO:0090241) |
| 0.4 |
3.9 |
GO:0046036 |
CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
| 0.4 |
0.9 |
GO:0007210 |
serotonin receptor signaling pathway(GO:0007210) |
| 0.4 |
4.3 |
GO:0043537 |
negative regulation of blood vessel endothelial cell migration(GO:0043537) |
| 0.4 |
0.4 |
GO:0034427 |
nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.4 |
0.4 |
GO:0045716 |
positive regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045716) |
| 0.4 |
2.1 |
GO:0075525 |
viral translational termination-reinitiation(GO:0075525) |
| 0.4 |
2.1 |
GO:0030091 |
protein repair(GO:0030091) |
| 0.4 |
0.4 |
GO:0006538 |
glutamate catabolic process(GO:0006538) |
| 0.4 |
1.7 |
GO:0046688 |
response to copper ion(GO:0046688) |
| 0.4 |
0.8 |
GO:0009106 |
lipoate metabolic process(GO:0009106) |
| 0.4 |
0.4 |
GO:1990441 |
negative regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990441) |
| 0.4 |
8.0 |
GO:0006910 |
phagocytosis, recognition(GO:0006910) |
| 0.4 |
1.7 |
GO:0042756 |
drinking behavior(GO:0042756) |
| 0.4 |
3.0 |
GO:0007220 |
Notch receptor processing(GO:0007220) |
| 0.4 |
0.4 |
GO:0090035 |
regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
| 0.4 |
0.8 |
GO:0071673 |
positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
| 0.4 |
0.4 |
GO:0070886 |
positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.4 |
1.3 |
GO:0001661 |
conditioned taste aversion(GO:0001661) |
| 0.4 |
2.1 |
GO:2000650 |
negative regulation of sodium ion transmembrane transport(GO:1902306) negative regulation of sodium ion transmembrane transporter activity(GO:2000650) |
| 0.4 |
0.4 |
GO:0046607 |
positive regulation of centrosome cycle(GO:0046607) |
| 0.4 |
1.3 |
GO:0000460 |
maturation of 5.8S rRNA(GO:0000460) |
| 0.4 |
2.1 |
GO:0032225 |
regulation of synaptic transmission, dopaminergic(GO:0032225) |
| 0.4 |
0.8 |
GO:0016344 |
meiotic chromosome movement towards spindle pole(GO:0016344) |
| 0.4 |
0.4 |
GO:0014028 |
notochord formation(GO:0014028) |
| 0.4 |
2.9 |
GO:0043589 |
skin morphogenesis(GO:0043589) |
| 0.4 |
1.2 |
GO:0030300 |
regulation of intestinal cholesterol absorption(GO:0030300) |
| 0.4 |
0.4 |
GO:0018307 |
enzyme active site formation(GO:0018307) |
| 0.4 |
0.8 |
GO:0044068 |
modulation by symbiont of host cellular process(GO:0044068) |
| 0.4 |
0.4 |
GO:0070417 |
cellular response to cold(GO:0070417) |
| 0.4 |
4.9 |
GO:0035414 |
negative regulation of catenin import into nucleus(GO:0035414) |
| 0.4 |
1.2 |
GO:0051004 |
regulation of lipoprotein lipase activity(GO:0051004) |
| 0.4 |
0.4 |
GO:0009142 |
nucleoside triphosphate biosynthetic process(GO:0009142) |
| 0.4 |
1.2 |
GO:0042982 |
amyloid precursor protein metabolic process(GO:0042982) |
| 0.4 |
0.4 |
GO:0002447 |
eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil activation(GO:0043307) eosinophil degranulation(GO:0043308) |
| 0.4 |
21.2 |
GO:0009060 |
aerobic respiration(GO:0009060) |
| 0.4 |
1.6 |
GO:0001834 |
trophectodermal cell proliferation(GO:0001834) |
| 0.4 |
2.0 |
GO:0001765 |
membrane raft assembly(GO:0001765) |
| 0.4 |
2.4 |
GO:0060923 |
muscle cell fate commitment(GO:0042693) cardiac muscle cell fate commitment(GO:0060923) |
| 0.4 |
0.4 |
GO:0060914 |
heart formation(GO:0060914) |
| 0.4 |
3.6 |
GO:0070389 |
chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.4 |
11.7 |
GO:0033014 |
porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
| 0.4 |
0.4 |
GO:0046166 |
glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 0.4 |
0.4 |
GO:0035795 |
negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 0.4 |
2.0 |
GO:0097411 |
hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.4 |
0.4 |
GO:0042726 |
flavin-containing compound metabolic process(GO:0042726) |
| 0.4 |
0.8 |
GO:0051124 |
synaptic growth at neuromuscular junction(GO:0051124) |
| 0.4 |
2.0 |
GO:0050774 |
negative regulation of dendrite morphogenesis(GO:0050774) |
| 0.4 |
1.2 |
GO:0016321 |
female meiosis chromosome segregation(GO:0016321) |
| 0.4 |
1.6 |
GO:0000379 |
tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.4 |
0.4 |
GO:1903975 |
regulation of glial cell migration(GO:1903975) |
| 0.4 |
0.4 |
GO:0048739 |
cardiac muscle fiber development(GO:0048739) |
| 0.4 |
0.4 |
GO:0014829 |
vascular smooth muscle contraction(GO:0014829) |
| 0.4 |
9.5 |
GO:0048011 |
neurotrophin TRK receptor signaling pathway(GO:0048011) |
| 0.4 |
2.4 |
GO:1903755 |
regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.4 |
1.2 |
GO:0009838 |
abscission(GO:0009838) |
| 0.4 |
0.4 |
GO:0018916 |
nitrobenzene metabolic process(GO:0018916) |
| 0.4 |
3.2 |
GO:2000353 |
positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.4 |
1.2 |
GO:0070166 |
enamel mineralization(GO:0070166) |
| 0.4 |
2.0 |
GO:2000210 |
positive regulation of anoikis(GO:2000210) |
| 0.4 |
0.8 |
GO:0023019 |
signal transduction involved in regulation of gene expression(GO:0023019) |
| 0.4 |
3.1 |
GO:0033280 |
response to vitamin D(GO:0033280) |
| 0.4 |
2.4 |
GO:0016255 |
attachment of GPI anchor to protein(GO:0016255) |
| 0.4 |
0.8 |
GO:0060012 |
synaptic transmission, glycinergic(GO:0060012) |
| 0.4 |
2.3 |
GO:0071712 |
ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.4 |
0.4 |
GO:1902592 |
viral budding(GO:0046755) multi-organism organelle organization(GO:1902590) multi-organism membrane budding(GO:1902592) |
| 0.4 |
2.0 |
GO:1903025 |
regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.4 |
1.6 |
GO:0010804 |
negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.4 |
4.7 |
GO:0000463 |
maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.4 |
2.7 |
GO:0008343 |
adult feeding behavior(GO:0008343) |
| 0.4 |
5.8 |
GO:0034260 |
negative regulation of GTPase activity(GO:0034260) |
| 0.4 |
1.5 |
GO:0052490 |
suppression by virus of host apoptotic process(GO:0019050) negative regulation by symbiont of host apoptotic process(GO:0033668) modulation by virus of host apoptotic process(GO:0039526) response to cycloheximide(GO:0046898) negative regulation by symbiont of host programmed cell death(GO:0052041) negative regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052490) |
| 0.4 |
1.2 |
GO:0032202 |
telomere assembly(GO:0032202) |
| 0.4 |
1.2 |
GO:0060670 |
branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.4 |
0.4 |
GO:0070266 |
necroptotic process(GO:0070266) |
| 0.4 |
1.9 |
GO:0060837 |
blood vessel endothelial cell differentiation(GO:0060837) |
| 0.4 |
1.2 |
GO:0036509 |
trimming of terminal mannose on B branch(GO:0036509) |
| 0.4 |
0.8 |
GO:0090500 |
endocardial cushion to mesenchymal transition(GO:0090500) |
| 0.4 |
1.2 |
GO:0001980 |
regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
| 0.4 |
1.9 |
GO:0034227 |
tRNA thio-modification(GO:0034227) |
| 0.4 |
1.1 |
GO:0043117 |
positive regulation of vascular permeability(GO:0043117) |
| 0.4 |
14.8 |
GO:0022900 |
electron transport chain(GO:0022900) |
| 0.4 |
1.1 |
GO:0032474 |
otolith morphogenesis(GO:0032474) |
| 0.4 |
1.9 |
GO:1904721 |
regulation of mRNA cleavage(GO:0031437) negative regulation of mRNA cleavage(GO:0031438) negative regulation of immunoglobulin secretion(GO:0051025) negative regulation of ribonuclease activity(GO:0060701) negative regulation of endoribonuclease activity(GO:0060702) regulation of mRNA endonucleolytic cleavage involved in unfolded protein response(GO:1904720) negative regulation of mRNA endonucleolytic cleavage involved in unfolded protein response(GO:1904721) |
| 0.4 |
0.4 |
GO:2000668 |
dendritic cell apoptotic process(GO:0097048) regulation of dendritic cell apoptotic process(GO:2000668) |
| 0.4 |
2.6 |
GO:2000310 |
regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
| 0.4 |
0.7 |
GO:1902953 |
positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
| 0.4 |
2.2 |
GO:0071494 |
cellular response to UV-C(GO:0071494) |
| 0.4 |
1.8 |
GO:0018401 |
peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.4 |
2.9 |
GO:0042401 |
amine biosynthetic process(GO:0009309) cellular biogenic amine biosynthetic process(GO:0042401) |
| 0.4 |
1.1 |
GO:0060056 |
mammary gland involution(GO:0060056) |
| 0.4 |
1.1 |
GO:0001920 |
negative regulation of receptor recycling(GO:0001920) |
| 0.4 |
1.5 |
GO:2000628 |
regulation of miRNA metabolic process(GO:2000628) |
| 0.4 |
2.5 |
GO:1900119 |
positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.4 |
1.1 |
GO:0090315 |
negative regulation of protein targeting to membrane(GO:0090315) |
| 0.4 |
4.4 |
GO:0001731 |
formation of translation preinitiation complex(GO:0001731) |
| 0.4 |
1.5 |
GO:2001168 |
regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.4 |
2.9 |
GO:0006488 |
dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.4 |
0.4 |
GO:0097212 |
lysosomal membrane organization(GO:0097212) |
| 0.4 |
2.5 |
GO:0045200 |
establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
| 0.4 |
0.7 |
GO:0051541 |
elastin metabolic process(GO:0051541) |
| 0.4 |
1.1 |
GO:0071468 |
cellular response to acidic pH(GO:0071468) |
| 0.4 |
0.4 |
GO:1903215 |
negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.4 |
1.4 |
GO:0045624 |
positive regulation of T-helper cell differentiation(GO:0045624) |
| 0.4 |
0.7 |
GO:1901857 |
positive regulation of cellular respiration(GO:1901857) |
| 0.4 |
0.7 |
GO:0060334 |
regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
| 0.4 |
1.4 |
GO:0006957 |
complement activation, alternative pathway(GO:0006957) |
| 0.3 |
0.7 |
GO:1903772 |
regulation of viral budding via host ESCRT complex(GO:1903772) |
| 0.3 |
0.7 |
GO:0061314 |
Notch signaling involved in heart development(GO:0061314) |
| 0.3 |
2.4 |
GO:1900107 |
regulation of nodal signaling pathway(GO:1900107) |
| 0.3 |
1.0 |
GO:0006285 |
base-excision repair, AP site formation(GO:0006285) |
| 0.3 |
1.0 |
GO:0000087 |
mitotic M phase(GO:0000087) mitotic cell cycle phase(GO:0098763) |
| 0.3 |
1.0 |
GO:0015803 |
branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
| 0.3 |
0.3 |
GO:0009193 |
pyrimidine ribonucleoside diphosphate metabolic process(GO:0009193) UDP metabolic process(GO:0046048) |
| 0.3 |
0.7 |
GO:0060023 |
soft palate development(GO:0060023) |
| 0.3 |
1.4 |
GO:0030046 |
parallel actin filament bundle assembly(GO:0030046) |
| 0.3 |
3.5 |
GO:0030322 |
stabilization of membrane potential(GO:0030322) |
| 0.3 |
0.7 |
GO:0071492 |
cellular response to UV-A(GO:0071492) |
| 0.3 |
1.0 |
GO:2000114 |
regulation of establishment of cell polarity(GO:2000114) |
| 0.3 |
0.7 |
GO:2000152 |
regulation of protein K48-linked deubiquitination(GO:1903093) negative regulation of protein K48-linked deubiquitination(GO:1903094) regulation of ubiquitin-specific protease activity(GO:2000152) negative regulation of ubiquitin-specific protease activity(GO:2000157) |
| 0.3 |
0.7 |
GO:0071873 |
response to norepinephrine(GO:0071873) |
| 0.3 |
1.4 |
GO:0050689 |
negative regulation of defense response to virus by host(GO:0050689) |
| 0.3 |
0.7 |
GO:2001241 |
positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.3 |
0.3 |
GO:1904058 |
positive regulation of sensory perception of pain(GO:1904058) |
| 0.3 |
0.7 |
GO:0000957 |
mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.3 |
1.0 |
GO:0071544 |
diphosphoinositol polyphosphate metabolic process(GO:0071543) diphosphoinositol polyphosphate catabolic process(GO:0071544) |
| 0.3 |
0.7 |
GO:0035372 |
protein localization to microtubule(GO:0035372) |
| 0.3 |
1.7 |
GO:0039703 |
viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.3 |
1.0 |
GO:0060672 |
epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.3 |
0.3 |
GO:0002710 |
negative regulation of T cell mediated immunity(GO:0002710) |
| 0.3 |
0.3 |
GO:0000320 |
re-entry into mitotic cell cycle(GO:0000320) |
| 0.3 |
1.0 |
GO:0046902 |
regulation of mitochondrial membrane permeability(GO:0046902) |
| 0.3 |
1.3 |
GO:0015744 |
succinate transport(GO:0015744) |
| 0.3 |
0.3 |
GO:0006356 |
regulation of transcription from RNA polymerase I promoter(GO:0006356) |
| 0.3 |
0.7 |
GO:0015938 |
coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) |
| 0.3 |
1.0 |
GO:0033008 |
positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
| 0.3 |
1.3 |
GO:0033580 |
protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
| 0.3 |
0.7 |
GO:0032511 |
late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.3 |
1.7 |
GO:0032298 |
positive regulation of DNA-dependent DNA replication initiation(GO:0032298) |
| 0.3 |
1.3 |
GO:0010796 |
regulation of multivesicular body size(GO:0010796) |
| 0.3 |
0.7 |
GO:1904457 |
positive regulation of neuronal action potential(GO:1904457) |
| 0.3 |
1.0 |
GO:0043950 |
positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.3 |
11.5 |
GO:0006890 |
retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
| 0.3 |
19.0 |
GO:0042273 |
ribosomal large subunit biogenesis(GO:0042273) |
| 0.3 |
1.6 |
GO:1900016 |
negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.3 |
3.3 |
GO:2000009 |
negative regulation of protein localization to cell surface(GO:2000009) |
| 0.3 |
0.3 |
GO:0046013 |
regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.3 |
0.3 |
GO:1903203 |
neuron death in response to oxidative stress(GO:0036475) regulation of oxidative stress-induced neuron death(GO:1903203) |
| 0.3 |
3.6 |
GO:0006465 |
signal peptide processing(GO:0006465) |
| 0.3 |
1.3 |
GO:0050819 |
negative regulation of coagulation(GO:0050819) |
| 0.3 |
0.6 |
GO:0035435 |
phosphate ion transmembrane transport(GO:0035435) |
| 0.3 |
0.3 |
GO:0000965 |
mitochondrial RNA 3'-end processing(GO:0000965) |
| 0.3 |
1.0 |
GO:0016082 |
synaptic vesicle priming(GO:0016082) |
| 0.3 |
3.2 |
GO:0030213 |
hyaluronan biosynthetic process(GO:0030213) |
| 0.3 |
2.3 |
GO:0060134 |
prepulse inhibition(GO:0060134) |
| 0.3 |
0.6 |
GO:0003245 |
cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
| 0.3 |
5.8 |
GO:0002931 |
response to ischemia(GO:0002931) |
| 0.3 |
1.0 |
GO:0045671 |
negative regulation of osteoclast differentiation(GO:0045671) |
| 0.3 |
1.6 |
GO:0046085 |
adenosine metabolic process(GO:0046085) |
| 0.3 |
1.0 |
GO:1904526 |
regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
| 0.3 |
1.3 |
GO:0014835 |
myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.3 |
1.3 |
GO:1903251 |
multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.3 |
0.3 |
GO:0072321 |
chaperone-mediated protein transport(GO:0072321) |
| 0.3 |
0.6 |
GO:1904177 |
regulation of adipose tissue development(GO:1904177) |
| 0.3 |
0.6 |
GO:0021529 |
spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 0.3 |
2.2 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.3 |
1.9 |
GO:0006729 |
tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.3 |
0.3 |
GO:0006166 |
purine ribonucleoside salvage(GO:0006166) |
| 0.3 |
1.2 |
GO:0031665 |
negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.3 |
0.9 |
GO:0045056 |
transcytosis(GO:0045056) |
| 0.3 |
1.2 |
GO:0002523 |
leukocyte migration involved in inflammatory response(GO:0002523) |
| 0.3 |
1.2 |
GO:0070262 |
peptidyl-serine dephosphorylation(GO:0070262) |
| 0.3 |
0.9 |
GO:0071929 |
alpha-tubulin acetylation(GO:0071929) |
| 0.3 |
0.3 |
GO:0021849 |
neuroblast division in subventricular zone(GO:0021849) |
| 0.3 |
0.6 |
GO:0072610 |
interleukin-12 secretion(GO:0072610) regulation of interleukin-12 secretion(GO:2001182) positive regulation of interleukin-12 secretion(GO:2001184) |
| 0.3 |
1.2 |
GO:0044794 |
positive regulation by host of viral process(GO:0044794) |
| 0.3 |
0.6 |
GO:0061588 |
calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylserine scrambling(GO:0061589) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) |
| 0.3 |
4.2 |
GO:0000920 |
cell separation after cytokinesis(GO:0000920) |
| 0.3 |
0.9 |
GO:2000392 |
regulation of lamellipodium morphogenesis(GO:2000392) positive regulation of lamellipodium morphogenesis(GO:2000394) |
| 0.3 |
1.2 |
GO:0018065 |
protein-cofactor linkage(GO:0018065) |
| 0.3 |
0.6 |
GO:0010225 |
response to UV-C(GO:0010225) |
| 0.3 |
0.6 |
GO:0060046 |
regulation of acrosome reaction(GO:0060046) |
| 0.3 |
0.3 |
GO:0014831 |
gastro-intestinal system smooth muscle contraction(GO:0014831) |
| 0.3 |
0.3 |
GO:0002339 |
B cell selection(GO:0002339) |
| 0.3 |
0.3 |
GO:0045472 |
response to ether(GO:0045472) |
| 0.3 |
1.8 |
GO:0022615 |
protein to membrane docking(GO:0022615) |
| 0.3 |
0.6 |
GO:0030997 |
regulation of centriole-centriole cohesion(GO:0030997) |
| 0.3 |
7.1 |
GO:0033108 |
mitochondrial respiratory chain complex assembly(GO:0033108) |
| 0.3 |
0.6 |
GO:0006566 |
threonine metabolic process(GO:0006566) |
| 0.3 |
3.8 |
GO:0051016 |
barbed-end actin filament capping(GO:0051016) |
| 0.3 |
3.2 |
GO:0006337 |
nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
| 0.3 |
0.3 |
GO:0060368 |
regulation of Fc receptor mediated stimulatory signaling pathway(GO:0060368) |
| 0.3 |
1.2 |
GO:1903553 |
positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.3 |
0.6 |
GO:0086069 |
bundle of His cell to Purkinje myocyte communication(GO:0086069) |
| 0.3 |
0.6 |
GO:0030423 |
targeting of mRNA for destruction involved in RNA interference(GO:0030423) |
| 0.3 |
1.7 |
GO:2000209 |
regulation of anoikis(GO:2000209) |
| 0.3 |
1.2 |
GO:0006432 |
phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.3 |
1.2 |
GO:0002347 |
response to tumor cell(GO:0002347) |
| 0.3 |
2.3 |
GO:0032233 |
positive regulation of actin filament bundle assembly(GO:0032233) |
| 0.3 |
3.5 |
GO:0019262 |
N-acetylneuraminate catabolic process(GO:0019262) |
| 0.3 |
0.6 |
GO:0006528 |
asparagine metabolic process(GO:0006528) |
| 0.3 |
0.6 |
GO:0060263 |
regulation of respiratory burst(GO:0060263) |
| 0.3 |
5.8 |
GO:0006096 |
glycolytic process(GO:0006096) ATP generation from ADP(GO:0006757) |
| 0.3 |
0.6 |
GO:1902260 |
negative regulation of delayed rectifier potassium channel activity(GO:1902260) negative regulation of voltage-gated potassium channel activity(GO:1903817) |
| 0.3 |
0.3 |
GO:0018195 |
peptidyl-arginine modification(GO:0018195) |
| 0.3 |
2.0 |
GO:0043518 |
negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.3 |
1.4 |
GO:0014886 |
transition between slow and fast fiber(GO:0014886) |
| 0.3 |
1.1 |
GO:0001550 |
ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.3 |
0.3 |
GO:0006419 |
alanyl-tRNA aminoacylation(GO:0006419) |
| 0.3 |
1.1 |
GO:0051205 |
protein insertion into membrane(GO:0051205) |
| 0.3 |
3.7 |
GO:0007200 |
phospholipase C-activating G-protein coupled receptor signaling pathway(GO:0007200) |
| 0.3 |
3.9 |
GO:0035873 |
lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.3 |
0.6 |
GO:0045741 |
positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
| 0.3 |
2.2 |
GO:0032776 |
DNA methylation on cytosine within a CG sequence(GO:0010424) DNA methylation on cytosine(GO:0032776) |
| 0.3 |
1.4 |
GO:0009146 |
purine nucleoside triphosphate catabolic process(GO:0009146) |
| 0.3 |
1.1 |
GO:0032469 |
endoplasmic reticulum calcium ion homeostasis(GO:0032469) |
| 0.3 |
0.3 |
GO:0036324 |
vascular endothelial growth factor receptor-2 signaling pathway(GO:0036324) |
| 0.3 |
0.3 |
GO:0046499 |
S-adenosylmethioninamine metabolic process(GO:0046499) |
| 0.3 |
0.8 |
GO:0006659 |
phosphatidylserine biosynthetic process(GO:0006659) |
| 0.3 |
5.0 |
GO:1902230 |
negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
| 0.3 |
1.6 |
GO:0097070 |
ductus arteriosus closure(GO:0097070) |
| 0.3 |
1.1 |
GO:0006207 |
'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.3 |
2.2 |
GO:0006677 |
glycosylceramide metabolic process(GO:0006677) |
| 0.3 |
0.3 |
GO:0046098 |
guanine metabolic process(GO:0046098) |
| 0.3 |
1.6 |
GO:0034472 |
snRNA 3'-end processing(GO:0034472) |
| 0.3 |
0.5 |
GO:0033088 |
negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 0.3 |
0.5 |
GO:0046668 |
regulation of retinal cell programmed cell death(GO:0046668) |
| 0.3 |
0.5 |
GO:2000348 |
regulation of CD40 signaling pathway(GO:2000348) |
| 0.3 |
1.4 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.3 |
0.5 |
GO:0030878 |
thyroid gland development(GO:0030878) |
| 0.3 |
0.3 |
GO:0007343 |
egg activation(GO:0007343) |
| 0.3 |
0.8 |
GO:1901722 |
regulation of cell proliferation involved in kidney development(GO:1901722) |
| 0.3 |
1.4 |
GO:0035774 |
positive regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0035774) |
| 0.3 |
1.1 |
GO:0072675 |
osteoclast fusion(GO:0072675) |
| 0.3 |
1.3 |
GO:0060528 |
secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.3 |
11.6 |
GO:0032543 |
mitochondrial translation(GO:0032543) |
| 0.3 |
0.8 |
GO:0006558 |
L-phenylalanine metabolic process(GO:0006558) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) |
| 0.3 |
0.8 |
GO:0019933 |
cAMP-mediated signaling(GO:0019933) |
| 0.3 |
0.3 |
GO:0032464 |
positive regulation of protein homooligomerization(GO:0032464) |
| 0.3 |
1.1 |
GO:0006689 |
ganglioside catabolic process(GO:0006689) |
| 0.3 |
0.8 |
GO:0001845 |
phagolysosome assembly(GO:0001845) |
| 0.3 |
4.8 |
GO:0015991 |
energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
| 0.3 |
3.5 |
GO:0006754 |
ATP biosynthetic process(GO:0006754) |
| 0.3 |
0.5 |
GO:0048631 |
regulation of skeletal muscle tissue growth(GO:0048631) |
| 0.3 |
0.5 |
GO:0010815 |
bradykinin catabolic process(GO:0010815) |
| 0.3 |
0.8 |
GO:0036035 |
osteoclast development(GO:0036035) |
| 0.3 |
5.8 |
GO:0070979 |
protein K11-linked ubiquitination(GO:0070979) |
| 0.3 |
1.9 |
GO:0006000 |
fructose metabolic process(GO:0006000) |
| 0.3 |
0.3 |
GO:0002484 |
antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway(GO:0002484) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway, TAP-dependent(GO:0002485) |
| 0.3 |
1.3 |
GO:0042745 |
circadian sleep/wake cycle(GO:0042745) |
| 0.3 |
0.3 |
GO:0051026 |
chiasma assembly(GO:0051026) |
| 0.3 |
2.9 |
GO:0051764 |
actin crosslink formation(GO:0051764) |
| 0.3 |
0.3 |
GO:0010873 |
positive regulation of cholesterol esterification(GO:0010873) |
| 0.3 |
0.8 |
GO:0001869 |
regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
| 0.3 |
0.3 |
GO:0044828 |
negative regulation by host of viral genome replication(GO:0044828) |
| 0.3 |
0.3 |
GO:0045648 |
positive regulation of erythrocyte differentiation(GO:0045648) |
| 0.3 |
0.8 |
GO:0032095 |
regulation of response to food(GO:0032095) negative regulation of response to food(GO:0032096) negative regulation of appetite(GO:0032099) |
| 0.3 |
0.3 |
GO:0043457 |
regulation of cellular respiration(GO:0043457) |
| 0.3 |
0.5 |
GO:1901419 |
regulation of response to alcohol(GO:1901419) |
| 0.3 |
4.1 |
GO:1902235 |
regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902235) |
| 0.3 |
0.3 |
GO:0042228 |
interleukin-8 biosynthetic process(GO:0042228) |
| 0.3 |
0.8 |
GO:0097089 |
methyl-branched fatty acid metabolic process(GO:0097089) |
| 0.3 |
1.3 |
GO:1905098 |
negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
| 0.3 |
0.8 |
GO:1904995 |
negative regulation of leukocyte tethering or rolling(GO:1903237) negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
| 0.3 |
0.3 |
GO:0032792 |
negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.3 |
1.0 |
GO:0048308 |
organelle inheritance(GO:0048308) Golgi inheritance(GO:0048313) |
| 0.3 |
0.8 |
GO:0033599 |
regulation of mammary gland epithelial cell proliferation(GO:0033599) |
| 0.3 |
0.8 |
GO:0038203 |
TORC2 signaling(GO:0038203) |
| 0.2 |
2.2 |
GO:0048672 |
positive regulation of collateral sprouting(GO:0048672) |
| 0.2 |
1.2 |
GO:0006586 |
tryptophan metabolic process(GO:0006568) indolalkylamine metabolic process(GO:0006586) |
| 0.2 |
0.2 |
GO:1903431 |
positive regulation of cell maturation(GO:1903431) |
| 0.2 |
2.5 |
GO:0007616 |
long-term memory(GO:0007616) |
| 0.2 |
1.0 |
GO:0098903 |
regulation of membrane repolarization during action potential(GO:0098903) |
| 0.2 |
0.5 |
GO:0048211 |
Golgi vesicle docking(GO:0048211) |
| 0.2 |
3.4 |
GO:0051974 |
negative regulation of telomerase activity(GO:0051974) |
| 0.2 |
1.2 |
GO:0043162 |
ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.2 |
0.2 |
GO:0036506 |
maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.2 |
1.2 |
GO:0001516 |
prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
| 0.2 |
0.5 |
GO:0070966 |
nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.2 |
0.2 |
GO:0046006 |
regulation of activated T cell proliferation(GO:0046006) |
| 0.2 |
1.2 |
GO:0090073 |
positive regulation of protein homodimerization activity(GO:0090073) |
| 0.2 |
0.5 |
GO:0009957 |
epidermal cell fate specification(GO:0009957) |
| 0.2 |
1.2 |
GO:1901841 |
regulation of high voltage-gated calcium channel activity(GO:1901841) |
| 0.2 |
1.7 |
GO:0032927 |
positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.2 |
0.2 |
GO:1901187 |
regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.2 |
1.2 |
GO:0045578 |
negative regulation of B cell differentiation(GO:0045578) |
| 0.2 |
0.2 |
GO:0006271 |
DNA strand elongation involved in DNA replication(GO:0006271) |
| 0.2 |
0.5 |
GO:0015675 |
nickel cation transport(GO:0015675) |
| 0.2 |
1.4 |
GO:0044375 |
regulation of peroxisome size(GO:0044375) |
| 0.2 |
0.5 |
GO:0006415 |
translational termination(GO:0006415) |
| 0.2 |
3.7 |
GO:0060074 |
synapse maturation(GO:0060074) |
| 0.2 |
1.2 |
GO:0006048 |
UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.2 |
0.2 |
GO:2000642 |
negative regulation of early endosome to late endosome transport(GO:2000642) |
| 0.2 |
0.2 |
GO:0034638 |
phosphatidylcholine catabolic process(GO:0034638) |
| 0.2 |
1.4 |
GO:0031639 |
plasminogen activation(GO:0031639) |
| 0.2 |
0.7 |
GO:0006449 |
regulation of translational termination(GO:0006449) |
| 0.2 |
7.1 |
GO:0070527 |
platelet aggregation(GO:0070527) |
| 0.2 |
0.7 |
GO:0002318 |
myeloid progenitor cell differentiation(GO:0002318) |
| 0.2 |
1.6 |
GO:0031119 |
tRNA pseudouridine synthesis(GO:0031119) |
| 0.2 |
0.9 |
GO:0050913 |
sensory perception of bitter taste(GO:0050913) |
| 0.2 |
0.7 |
GO:2000254 |
regulation of male germ cell proliferation(GO:2000254) |
| 0.2 |
0.4 |
GO:0046618 |
drug export(GO:0046618) |
| 0.2 |
0.9 |
GO:0032211 |
negative regulation of telomere maintenance via telomerase(GO:0032211) |
| 0.2 |
2.9 |
GO:0060481 |
lobar bronchus epithelium development(GO:0060481) |
| 0.2 |
2.7 |
GO:0032785 |
negative regulation of DNA-templated transcription, elongation(GO:0032785) |
| 0.2 |
1.1 |
GO:0046685 |
response to arsenic-containing substance(GO:0046685) |
| 0.2 |
2.4 |
GO:0001937 |
negative regulation of endothelial cell proliferation(GO:0001937) |
| 0.2 |
0.9 |
GO:0042373 |
vitamin K metabolic process(GO:0042373) |
| 0.2 |
1.7 |
GO:0006388 |
tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.2 |
0.4 |
GO:0072592 |
oxygen metabolic process(GO:0072592) |
| 0.2 |
0.2 |
GO:0090526 |
regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.2 |
1.5 |
GO:0071557 |
histone H3-K27 demethylation(GO:0071557) |
| 0.2 |
0.6 |
GO:0090155 |
negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) |
| 0.2 |
0.9 |
GO:0019400 |
glycerol metabolic process(GO:0006071) alditol metabolic process(GO:0019400) |
| 0.2 |
1.9 |
GO:0071801 |
regulation of podosome assembly(GO:0071801) |
| 0.2 |
0.4 |
GO:0039532 |
negative regulation of viral-induced cytoplasmic pattern recognition receptor signaling pathway(GO:0039532) |
| 0.2 |
6.3 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.2 |
1.5 |
GO:0010992 |
ubiquitin homeostasis(GO:0010992) |
| 0.2 |
0.4 |
GO:0000715 |
nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.2 |
0.4 |
GO:0051045 |
negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
| 0.2 |
0.6 |
GO:2000020 |
positive regulation of male gonad development(GO:2000020) |
| 0.2 |
0.8 |
GO:0006624 |
vacuolar protein processing(GO:0006624) |
| 0.2 |
0.4 |
GO:0034312 |
diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) sphingoid biosynthetic process(GO:0046520) |
| 0.2 |
0.2 |
GO:0051562 |
negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.2 |
0.6 |
GO:0031017 |
exocrine pancreas development(GO:0031017) |
| 0.2 |
1.9 |
GO:0042168 |
heme metabolic process(GO:0042168) |
| 0.2 |
0.6 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 0.2 |
2.5 |
GO:0005978 |
glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
| 0.2 |
0.4 |
GO:1903071 |
positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.2 |
0.4 |
GO:0046654 |
tetrahydrofolate biosynthetic process(GO:0046654) |
| 0.2 |
0.8 |
GO:0060081 |
membrane hyperpolarization(GO:0060081) |
| 0.2 |
0.4 |
GO:0042448 |
progesterone metabolic process(GO:0042448) |
| 0.2 |
1.0 |
GO:1901029 |
negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.2 |
1.2 |
GO:0030168 |
platelet activation(GO:0030168) |
| 0.2 |
0.2 |
GO:0097500 |
receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.2 |
1.0 |
GO:0045686 |
negative regulation of glial cell differentiation(GO:0045686) |
| 0.2 |
0.4 |
GO:0033566 |
gamma-tubulin complex localization(GO:0033566) |
| 0.2 |
0.2 |
GO:1903358 |
regulation of Golgi organization(GO:1903358) |
| 0.2 |
3.0 |
GO:2001244 |
positive regulation of intrinsic apoptotic signaling pathway(GO:2001244) |
| 0.2 |
1.0 |
GO:0006287 |
base-excision repair, gap-filling(GO:0006287) |
| 0.2 |
1.6 |
GO:0006004 |
fucose metabolic process(GO:0006004) |
| 0.2 |
0.2 |
GO:0009206 |
ribonucleoside triphosphate biosynthetic process(GO:0009201) purine ribonucleoside triphosphate biosynthetic process(GO:0009206) |
| 0.2 |
0.8 |
GO:0036151 |
phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.2 |
0.6 |
GO:0051152 |
positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.2 |
1.0 |
GO:0090502 |
RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.2 |
0.6 |
GO:0060715 |
syncytiotrophoblast cell differentiation involved in labyrinthine layer development(GO:0060715) |
| 0.2 |
5.1 |
GO:0070206 |
protein trimerization(GO:0070206) |
| 0.2 |
0.2 |
GO:2000343 |
positive regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000343) |
| 0.2 |
0.4 |
GO:0045956 |
positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
| 0.2 |
0.6 |
GO:1902277 |
pancreatic amylase secretion(GO:0036395) negative regulation of growth hormone secretion(GO:0060125) regulation of pancreatic amylase secretion(GO:1902276) negative regulation of pancreatic amylase secretion(GO:1902277) |
| 0.2 |
0.8 |
GO:0046836 |
glycolipid transport(GO:0046836) |
| 0.2 |
0.4 |
GO:0014046 |
dopamine secretion(GO:0014046) regulation of dopamine secretion(GO:0014059) |
| 0.2 |
0.6 |
GO:0043461 |
proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 0.2 |
0.8 |
GO:0009227 |
UDP-N-acetylglucosamine catabolic process(GO:0006049) nucleotide-sugar catabolic process(GO:0009227) |
| 0.2 |
0.4 |
GO:0032780 |
negative regulation of ATPase activity(GO:0032780) |
| 0.2 |
0.2 |
GO:0043101 |
purine-containing compound salvage(GO:0043101) |
| 0.2 |
0.4 |
GO:0002920 |
regulation of humoral immune response(GO:0002920) |
| 0.2 |
2.7 |
GO:0045104 |
intermediate filament cytoskeleton organization(GO:0045104) |
| 0.2 |
2.1 |
GO:2000480 |
negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.2 |
0.2 |
GO:2001274 |
negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.2 |
0.2 |
GO:0071985 |
multivesicular body sorting pathway(GO:0071985) |
| 0.2 |
0.8 |
GO:0018202 |
peptidyl-histidine modification(GO:0018202) |
| 0.2 |
0.6 |
GO:0002184 |
cytoplasmic translational termination(GO:0002184) |
| 0.2 |
0.2 |
GO:0010899 |
regulation of phosphatidylcholine catabolic process(GO:0010899) |
| 0.2 |
0.8 |
GO:0016559 |
peroxisome fission(GO:0016559) |
| 0.2 |
0.2 |
GO:0040038 |
polar body extrusion after meiotic divisions(GO:0040038) |
| 0.2 |
0.6 |
GO:0016093 |
polyprenol metabolic process(GO:0016093) |
| 0.2 |
0.6 |
GO:0016540 |
protein autoprocessing(GO:0016540) |
| 0.2 |
1.7 |
GO:0007130 |
synaptonemal complex assembly(GO:0007130) |
| 0.2 |
0.9 |
GO:1902259 |
regulation of delayed rectifier potassium channel activity(GO:1902259) |
| 0.2 |
0.9 |
GO:0060547 |
negative regulation of necrotic cell death(GO:0060547) |
| 0.2 |
0.6 |
GO:0000707 |
meiotic DNA recombinase assembly(GO:0000707) |
| 0.2 |
0.4 |
GO:0007250 |
activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.2 |
1.9 |
GO:0045899 |
positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.2 |
0.2 |
GO:0032055 |
negative regulation of translation in response to stress(GO:0032055) |
| 0.2 |
1.3 |
GO:0006362 |
transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.2 |
0.2 |
GO:0035726 |
common myeloid progenitor cell proliferation(GO:0035726) |
| 0.2 |
0.6 |
GO:0032692 |
negative regulation of interleukin-1 production(GO:0032692) |
| 0.2 |
0.2 |
GO:0045103 |
intermediate filament-based process(GO:0045103) |
| 0.2 |
0.9 |
GO:0002021 |
response to dietary excess(GO:0002021) |
| 0.2 |
1.1 |
GO:0051084 |
'de novo' protein folding(GO:0006458) 'de novo' posttranslational protein folding(GO:0051084) |
| 0.2 |
1.3 |
GO:0030238 |
male sex determination(GO:0030238) |
| 0.2 |
7.1 |
GO:0042274 |
ribosomal small subunit biogenesis(GO:0042274) |
| 0.2 |
4.4 |
GO:0035456 |
response to interferon-beta(GO:0035456) |
| 0.2 |
2.4 |
GO:0006346 |
methylation-dependent chromatin silencing(GO:0006346) |
| 0.2 |
2.2 |
GO:0007007 |
inner mitochondrial membrane organization(GO:0007007) |
| 0.2 |
1.1 |
GO:0023021 |
termination of signal transduction(GO:0023021) |
| 0.2 |
1.1 |
GO:0043983 |
histone H4-K12 acetylation(GO:0043983) |
| 0.2 |
2.3 |
GO:0038063 |
collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) collagen-activated signaling pathway(GO:0038065) |
| 0.2 |
0.5 |
GO:0070589 |
cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule metabolic process(GO:0044036) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) cell wall organization or biogenesis(GO:0071554) |
| 0.2 |
0.2 |
GO:0007006 |
mitochondrial membrane organization(GO:0007006) |
| 0.2 |
0.7 |
GO:1904715 |
negative regulation of chaperone-mediated autophagy(GO:1904715) |
| 0.2 |
0.2 |
GO:0018125 |
peptidyl-cysteine methylation(GO:0018125) |
| 0.2 |
1.2 |
GO:0006532 |
aspartate biosynthetic process(GO:0006532) |
| 0.2 |
0.5 |
GO:0016338 |
calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.2 |
0.5 |
GO:0035021 |
negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.2 |
0.2 |
GO:0031547 |
brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.2 |
2.1 |
GO:0010996 |
response to auditory stimulus(GO:0010996) |
| 0.2 |
1.2 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 0.2 |
0.2 |
GO:0002314 |
germinal center B cell differentiation(GO:0002314) |
| 0.2 |
1.4 |
GO:0042104 |
positive regulation of activated T cell proliferation(GO:0042104) |
| 0.2 |
0.7 |
GO:0045607 |
regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.2 |
0.9 |
GO:0071474 |
cellular hyperosmotic response(GO:0071474) |
| 0.2 |
0.5 |
GO:0050779 |
RNA destabilization(GO:0050779) |
| 0.2 |
0.3 |
GO:0045943 |
positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.2 |
0.5 |
GO:1904294 |
positive regulation of ERAD pathway(GO:1904294) |
| 0.2 |
0.3 |
GO:0050884 |
neuromuscular process controlling posture(GO:0050884) |
| 0.2 |
2.4 |
GO:0009303 |
rRNA transcription(GO:0009303) |
| 0.2 |
1.0 |
GO:0045947 |
negative regulation of translational initiation(GO:0045947) |
| 0.2 |
0.3 |
GO:0080111 |
DNA demethylation(GO:0080111) |
| 0.2 |
4.0 |
GO:0032011 |
ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.2 |
1.0 |
GO:0035092 |
sperm chromatin condensation(GO:0035092) |
| 0.2 |
0.3 |
GO:0006481 |
C-terminal protein methylation(GO:0006481) |
| 0.2 |
1.0 |
GO:0010662 |
regulation of striated muscle cell apoptotic process(GO:0010662) |
| 0.2 |
0.7 |
GO:0044539 |
long-chain fatty acid import(GO:0044539) |
| 0.2 |
3.2 |
GO:0042551 |
neuron maturation(GO:0042551) |
| 0.2 |
0.3 |
GO:0070625 |
zymogen granule exocytosis(GO:0070625) |
| 0.2 |
0.5 |
GO:0002082 |
regulation of oxidative phosphorylation(GO:0002082) |
| 0.2 |
0.5 |
GO:0019236 |
response to pheromone(GO:0019236) |
| 0.2 |
0.5 |
GO:0035584 |
calcium-mediated signaling using intracellular calcium source(GO:0035584) |
| 0.2 |
0.3 |
GO:0032693 |
negative regulation of interleukin-10 production(GO:0032693) |
| 0.2 |
1.0 |
GO:0055070 |
copper ion homeostasis(GO:0055070) |
| 0.2 |
2.5 |
GO:0032008 |
positive regulation of TOR signaling(GO:0032008) |
| 0.2 |
0.2 |
GO:0045646 |
regulation of erythrocyte differentiation(GO:0045646) |
| 0.2 |
0.3 |
GO:0010726 |
positive regulation of hydrogen peroxide metabolic process(GO:0010726) |
| 0.2 |
0.2 |
GO:0046900 |
tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.2 |
0.2 |
GO:0000720 |
pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.2 |
0.5 |
GO:0070236 |
negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.2 |
0.2 |
GO:0060055 |
angiogenesis involved in wound healing(GO:0060055) |
| 0.2 |
0.3 |
GO:0002175 |
protein localization to paranode region of axon(GO:0002175) |
| 0.2 |
0.5 |
GO:0042275 |
error-free postreplication DNA repair(GO:0042275) |
| 0.2 |
1.1 |
GO:0048169 |
regulation of long-term neuronal synaptic plasticity(GO:0048169) |
| 0.2 |
0.8 |
GO:0051503 |
adenine nucleotide transport(GO:0051503) |
| 0.2 |
0.2 |
GO:0015919 |
peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
| 0.2 |
1.9 |
GO:0060632 |
regulation of microtubule-based movement(GO:0060632) |
| 0.2 |
0.2 |
GO:0007161 |
calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.2 |
2.2 |
GO:0044342 |
type B pancreatic cell proliferation(GO:0044342) |
| 0.2 |
0.2 |
GO:0016553 |
adenosine to inosine editing(GO:0006382) base conversion or substitution editing(GO:0016553) |
| 0.2 |
0.8 |
GO:0045003 |
DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.2 |
0.2 |
GO:0072217 |
regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003339) negative regulation of metanephros development(GO:0072217) |
| 0.2 |
0.5 |
GO:0010666 |
positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.2 |
1.3 |
GO:0016198 |
axon choice point recognition(GO:0016198) |
| 0.2 |
0.2 |
GO:0002371 |
dendritic cell cytokine production(GO:0002371) regulation of dendritic cell cytokine production(GO:0002730) |
| 0.2 |
0.3 |
GO:0061073 |
ciliary body morphogenesis(GO:0061073) |
| 0.2 |
0.9 |
GO:0021555 |
midbrain-hindbrain boundary morphogenesis(GO:0021555) |
| 0.2 |
1.5 |
GO:0048280 |
vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.2 |
0.3 |
GO:0002455 |
humoral immune response mediated by circulating immunoglobulin(GO:0002455) |
| 0.2 |
1.2 |
GO:0032715 |
negative regulation of interleukin-6 production(GO:0032715) |
| 0.2 |
0.8 |
GO:1902600 |
hydrogen ion transmembrane transport(GO:1902600) |
| 0.2 |
0.5 |
GO:0002673 |
regulation of acute inflammatory response(GO:0002673) |
| 0.2 |
2.4 |
GO:0006613 |
cotranslational protein targeting to membrane(GO:0006613) |
| 0.1 |
10.5 |
GO:1903749 |
positive regulation of establishment of protein localization to mitochondrion(GO:1903749) positive regulation of protein targeting to mitochondrion(GO:1903955) |
| 0.1 |
0.4 |
GO:0008216 |
spermidine metabolic process(GO:0008216) |
| 0.1 |
0.3 |
GO:0019852 |
L-ascorbic acid metabolic process(GO:0019852) |
| 0.1 |
0.1 |
GO:0035426 |
extracellular matrix-cell signaling(GO:0035426) |
| 0.1 |
0.1 |
GO:0046070 |
dGTP metabolic process(GO:0046070) purine deoxyribonucleoside metabolic process(GO:0046122) |
| 0.1 |
0.1 |
GO:0042754 |
negative regulation of circadian rhythm(GO:0042754) |
| 0.1 |
0.1 |
GO:0034694 |
response to prostaglandin(GO:0034694) response to prostaglandin E(GO:0034695) |
| 0.1 |
4.8 |
GO:0002181 |
cytoplasmic translation(GO:0002181) |
| 0.1 |
0.3 |
GO:0042524 |
negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
| 0.1 |
0.1 |
GO:0006625 |
protein targeting to peroxisome(GO:0006625) peroxisomal transport(GO:0043574) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
| 0.1 |
0.3 |
GO:1903299 |
regulation of glucokinase activity(GO:0033131) regulation of hexokinase activity(GO:1903299) |
| 0.1 |
0.7 |
GO:1902175 |
regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902175) |
| 0.1 |
1.2 |
GO:0050995 |
negative regulation of lipid catabolic process(GO:0050995) |
| 0.1 |
0.1 |
GO:0097531 |
mast cell migration(GO:0097531) |
| 0.1 |
0.6 |
GO:1904451 |
regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904451) positive regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904453) |
| 0.1 |
7.0 |
GO:0008637 |
apoptotic mitochondrial changes(GO:0008637) |
| 0.1 |
0.4 |
GO:0006269 |
DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.1 |
0.6 |
GO:0040016 |
embryonic cleavage(GO:0040016) |
| 0.1 |
1.6 |
GO:0046185 |
aldehyde catabolic process(GO:0046185) |
| 0.1 |
3.4 |
GO:0006446 |
regulation of translational initiation(GO:0006446) |
| 0.1 |
1.6 |
GO:2001240 |
negative regulation of signal transduction in absence of ligand(GO:1901099) negative regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001240) |
| 0.1 |
0.7 |
GO:0090527 |
actin filament reorganization(GO:0090527) |
| 0.1 |
4.8 |
GO:0007157 |
heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
| 0.1 |
0.3 |
GO:0051148 |
negative regulation of muscle cell differentiation(GO:0051148) |
| 0.1 |
3.5 |
GO:0006284 |
base-excision repair(GO:0006284) |
| 0.1 |
0.3 |
GO:0070244 |
negative regulation of thymocyte apoptotic process(GO:0070244) |
| 0.1 |
0.4 |
GO:0042255 |
ribosome assembly(GO:0042255) |
| 0.1 |
0.1 |
GO:0045601 |
regulation of endothelial cell differentiation(GO:0045601) |
| 0.1 |
0.3 |
GO:0030647 |
polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.1 |
0.7 |
GO:2001223 |
negative regulation of neuron migration(GO:2001223) |
| 0.1 |
0.8 |
GO:0007258 |
JUN phosphorylation(GO:0007258) |
| 0.1 |
0.1 |
GO:0010447 |
response to acidic pH(GO:0010447) |
| 0.1 |
1.0 |
GO:0018230 |
peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.1 |
1.0 |
GO:0009988 |
cell-cell recognition(GO:0009988) |
| 0.1 |
0.4 |
GO:0033962 |
cytoplasmic mRNA processing body assembly(GO:0033962) |
| 0.1 |
0.3 |
GO:0035964 |
COPI-coated vesicle budding(GO:0035964) |
| 0.1 |
0.5 |
GO:0090110 |
cargo loading into COPII-coated vesicle(GO:0090110) regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.1 |
1.1 |
GO:0010669 |
epithelial structure maintenance(GO:0010669) |
| 0.1 |
1.2 |
GO:0006516 |
glycoprotein catabolic process(GO:0006516) |
| 0.1 |
0.3 |
GO:0060025 |
regulation of synaptic activity(GO:0060025) |
| 0.1 |
0.9 |
GO:0070995 |
NADPH oxidation(GO:0070995) |
| 0.1 |
0.3 |
GO:0034729 |
histone H3-K79 methylation(GO:0034729) |
| 0.1 |
2.4 |
GO:0048026 |
positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
| 0.1 |
0.9 |
GO:1901223 |
negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.1 |
0.5 |
GO:0000060 |
protein import into nucleus, translocation(GO:0000060) |
| 0.1 |
0.3 |
GO:0060830 |
ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.1 |
0.7 |
GO:0042989 |
sequestering of actin monomers(GO:0042989) |
| 0.1 |
0.4 |
GO:0042891 |
antibiotic transport(GO:0042891) |
| 0.1 |
0.1 |
GO:0021914 |
negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 0.1 |
0.1 |
GO:0051953 |
negative regulation of amine transport(GO:0051953) |
| 0.1 |
0.6 |
GO:0006047 |
UDP-N-acetylglucosamine metabolic process(GO:0006047) |
| 0.1 |
0.4 |
GO:0010940 |
positive regulation of necrotic cell death(GO:0010940) |
| 0.1 |
0.1 |
GO:0035459 |
cargo loading into vesicle(GO:0035459) |
| 0.1 |
3.2 |
GO:0032091 |
negative regulation of protein binding(GO:0032091) |
| 0.1 |
1.5 |
GO:0072376 |
protein activation cascade(GO:0072376) |
| 0.1 |
0.4 |
GO:0034214 |
protein hexamerization(GO:0034214) |
| 0.1 |
0.1 |
GO:0014016 |
neuroblast differentiation(GO:0014016) |
| 0.1 |
0.1 |
GO:0042421 |
norepinephrine biosynthetic process(GO:0042421) |
| 0.1 |
0.4 |
GO:0006421 |
asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.1 |
0.6 |
GO:0035542 |
regulation of SNARE complex assembly(GO:0035542) |
| 0.1 |
1.9 |
GO:0033198 |
response to ATP(GO:0033198) |
| 0.1 |
0.2 |
GO:2000465 |
regulation of glycogen (starch) synthase activity(GO:2000465) |
| 0.1 |
0.4 |
GO:1902902 |
negative regulation of autophagosome assembly(GO:1902902) |
| 0.1 |
0.5 |
GO:0090136 |
epithelial cell-cell adhesion(GO:0090136) |
| 0.1 |
0.7 |
GO:0008063 |
Toll signaling pathway(GO:0008063) |
| 0.1 |
0.5 |
GO:0019509 |
L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.1 |
2.9 |
GO:0034605 |
cellular response to heat(GO:0034605) |
| 0.1 |
0.1 |
GO:0002087 |
regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
| 0.1 |
1.1 |
GO:0047496 |
vesicle transport along microtubule(GO:0047496) |
| 0.1 |
0.6 |
GO:2000270 |
negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.1 |
0.8 |
GO:0006498 |
N-terminal protein lipidation(GO:0006498) |
| 0.1 |
0.2 |
GO:0072176 |
nephric duct development(GO:0072176) nephric duct morphogenesis(GO:0072178) |
| 0.1 |
0.2 |
GO:0007320 |
insemination(GO:0007320) |
| 0.1 |
0.4 |
GO:0003011 |
involuntary skeletal muscle contraction(GO:0003011) vacuolar sequestering(GO:0043181) |
| 0.1 |
0.9 |
GO:0032482 |
Rab protein signal transduction(GO:0032482) |
| 0.1 |
0.2 |
GO:0042822 |
vitamin B6 metabolic process(GO:0042816) pyridoxal phosphate metabolic process(GO:0042822) pyridoxal phosphate biosynthetic process(GO:0042823) |
| 0.1 |
0.7 |
GO:0051014 |
actin filament severing(GO:0051014) |
| 0.1 |
0.6 |
GO:0001913 |
T cell mediated cytotoxicity(GO:0001913) |
| 0.1 |
0.2 |
GO:0001779 |
natural killer cell differentiation(GO:0001779) |
| 0.1 |
0.3 |
GO:1900027 |
regulation of ruffle assembly(GO:1900027) |
| 0.1 |
0.6 |
GO:0006515 |
misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
| 0.1 |
0.3 |
GO:0000389 |
mRNA 3'-splice site recognition(GO:0000389) |
| 0.1 |
0.1 |
GO:0090114 |
COPII-coated vesicle budding(GO:0090114) |
| 0.1 |
1.0 |
GO:0007212 |
dopamine receptor signaling pathway(GO:0007212) |
| 0.1 |
0.2 |
GO:0007182 |
common-partner SMAD protein phosphorylation(GO:0007182) |
| 0.1 |
0.3 |
GO:0070544 |
histone H3-K36 demethylation(GO:0070544) |
| 0.1 |
0.2 |
GO:1902570 |
protein localization to nucleolus(GO:1902570) |
| 0.1 |
0.8 |
GO:0050728 |
negative regulation of inflammatory response(GO:0050728) |
| 0.1 |
0.8 |
GO:2000601 |
positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.1 |
0.9 |
GO:0045719 |
negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 0.1 |
2.9 |
GO:0061077 |
chaperone-mediated protein folding(GO:0061077) |
| 0.1 |
0.9 |
GO:0051290 |
protein heterotetramerization(GO:0051290) |
| 0.1 |
0.4 |
GO:0043496 |
regulation of protein homodimerization activity(GO:0043496) |
| 0.1 |
0.4 |
GO:0042670 |
retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
| 0.1 |
0.6 |
GO:0001921 |
positive regulation of receptor recycling(GO:0001921) |
| 0.1 |
0.3 |
GO:0001887 |
selenium compound metabolic process(GO:0001887) |
| 0.1 |
0.3 |
GO:0006685 |
sphingomyelin catabolic process(GO:0006685) |
| 0.1 |
0.6 |
GO:0043277 |
apoptotic cell clearance(GO:0043277) |
| 0.1 |
0.6 |
GO:0031507 |
heterochromatin assembly(GO:0031507) |
| 0.1 |
3.2 |
GO:0006413 |
translational initiation(GO:0006413) |
| 0.1 |
0.3 |
GO:0046322 |
negative regulation of fatty acid oxidation(GO:0046322) |
| 0.1 |
0.4 |
GO:0042590 |
antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.1 |
0.9 |
GO:0070935 |
3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.1 |
0.3 |
GO:0046381 |
CMP-N-acetylneuraminate metabolic process(GO:0046381) |
| 0.1 |
0.9 |
GO:0019884 |
antigen processing and presentation of exogenous antigen(GO:0019884) |
| 0.1 |
0.1 |
GO:1990481 |
mRNA pseudouridine synthesis(GO:1990481) |
| 0.1 |
0.7 |
GO:0002275 |
myeloid cell activation involved in immune response(GO:0002275) |
| 0.1 |
0.4 |
GO:0060294 |
cilium movement involved in cell motility(GO:0060294) |
| 0.1 |
3.2 |
GO:0045727 |
positive regulation of translation(GO:0045727) |
| 0.1 |
0.3 |
GO:0034316 |
negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
| 0.1 |
0.7 |
GO:0051127 |
positive regulation of actin nucleation(GO:0051127) |
| 0.1 |
0.3 |
GO:0001696 |
gastric acid secretion(GO:0001696) |
| 0.1 |
0.1 |
GO:1904467 |
regulation of tumor necrosis factor secretion(GO:1904467) positive regulation of tumor necrosis factor secretion(GO:1904469) tumor necrosis factor secretion(GO:1990774) |
| 0.1 |
0.3 |
GO:0072643 |
interferon-gamma secretion(GO:0072643) |
| 0.1 |
0.1 |
GO:0021562 |
vestibulocochlear nerve development(GO:0021562) |
| 0.1 |
0.1 |
GO:0032497 |
detection of lipopolysaccharide(GO:0032497) |
| 0.1 |
0.3 |
GO:0031666 |
positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.1 |
0.4 |
GO:0061052 |
negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.1 |
0.2 |
GO:0060261 |
positive regulation of transcription initiation from RNA polymerase II promoter(GO:0060261) |
| 0.1 |
0.4 |
GO:0097152 |
mesenchymal cell apoptotic process(GO:0097152) |
| 0.1 |
2.1 |
GO:0006749 |
glutathione metabolic process(GO:0006749) |
| 0.1 |
0.4 |
GO:0001865 |
NK T cell differentiation(GO:0001865) regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
| 0.1 |
1.1 |
GO:0046855 |
phosphorylated carbohydrate dephosphorylation(GO:0046838) inositol phosphate dephosphorylation(GO:0046855) inositol phosphate catabolic process(GO:0071545) |
| 0.1 |
0.1 |
GO:0019042 |
viral latency(GO:0019042) |
| 0.1 |
0.2 |
GO:0033364 |
mast cell secretory granule organization(GO:0033364) |
| 0.1 |
1.8 |
GO:2000785 |
regulation of autophagosome assembly(GO:2000785) |
| 0.1 |
1.4 |
GO:0050830 |
defense response to Gram-positive bacterium(GO:0050830) |
| 0.1 |
0.9 |
GO:0030953 |
astral microtubule organization(GO:0030953) |
| 0.1 |
0.4 |
GO:0046909 |
intermembrane transport(GO:0046909) |
| 0.1 |
0.3 |
GO:0009143 |
nucleoside triphosphate catabolic process(GO:0009143) |
| 0.1 |
0.2 |
GO:1900037 |
regulation of cellular response to hypoxia(GO:1900037) |
| 0.1 |
0.3 |
GO:0046133 |
pyrimidine ribonucleoside catabolic process(GO:0046133) |
| 0.1 |
0.3 |
GO:0030224 |
monocyte differentiation(GO:0030224) |
| 0.1 |
0.6 |
GO:0006384 |
transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.1 |
0.7 |
GO:0014067 |
negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
| 0.1 |
1.1 |
GO:0045026 |
plasma membrane fusion(GO:0045026) |
| 0.1 |
0.7 |
GO:0001706 |
endoderm formation(GO:0001706) |
| 0.1 |
0.2 |
GO:0010724 |
regulation of definitive erythrocyte differentiation(GO:0010724) |
| 0.1 |
0.5 |
GO:0051958 |
methotrexate transport(GO:0051958) reduced folate transmembrane transport(GO:0098838) |
| 0.1 |
6.2 |
GO:0098792 |
xenophagy(GO:0098792) |
| 0.1 |
0.1 |
GO:0032695 |
negative regulation of interleukin-12 production(GO:0032695) |
| 0.1 |
0.1 |
GO:0071880 |
adenylate cyclase-activating adrenergic receptor signaling pathway(GO:0071880) |
| 0.1 |
0.2 |
GO:0040031 |
snRNA modification(GO:0040031) |
| 0.1 |
0.1 |
GO:0061101 |
neuroendocrine cell differentiation(GO:0061101) |
| 0.1 |
0.2 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 |
0.4 |
GO:0034142 |
toll-like receptor 4 signaling pathway(GO:0034142) |
| 0.1 |
0.3 |
GO:0003150 |
muscular septum morphogenesis(GO:0003150) |
| 0.1 |
1.6 |
GO:0008593 |
regulation of Notch signaling pathway(GO:0008593) |
| 0.1 |
1.6 |
GO:0007020 |
microtubule nucleation(GO:0007020) |
| 0.1 |
1.9 |
GO:0051310 |
metaphase plate congression(GO:0051310) |
| 0.1 |
0.3 |
GO:0061756 |
leukocyte tethering or rolling(GO:0050901) leukocyte adhesion to vascular endothelial cell(GO:0061756) |
| 0.1 |
0.1 |
GO:0032308 |
positive regulation of prostaglandin secretion(GO:0032308) |
| 0.1 |
0.1 |
GO:0035751 |
regulation of lysosomal lumen pH(GO:0035751) |
| 0.1 |
0.2 |
GO:0031573 |
intra-S DNA damage checkpoint(GO:0031573) |
| 0.1 |
0.4 |
GO:0070365 |
hepatocyte differentiation(GO:0070365) |
| 0.1 |
1.0 |
GO:0034497 |
protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.1 |
0.3 |
GO:0019355 |
nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process(GO:0034627) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.1 |
0.1 |
GO:0072205 |
metanephric collecting duct development(GO:0072205) |
| 0.1 |
0.2 |
GO:0030916 |
otic vesicle formation(GO:0030916) |
| 0.1 |
0.5 |
GO:0035428 |
hexose transmembrane transport(GO:0035428) |
| 0.1 |
1.5 |
GO:0010107 |
potassium ion import(GO:0010107) |
| 0.1 |
1.2 |
GO:0046677 |
response to antibiotic(GO:0046677) |
| 0.1 |
1.4 |
GO:1903078 |
positive regulation of protein localization to plasma membrane(GO:1903078) positive regulation of protein localization to cell periphery(GO:1904377) |
| 0.1 |
1.1 |
GO:0034063 |
stress granule assembly(GO:0034063) |
| 0.1 |
0.5 |
GO:0060539 |
diaphragm development(GO:0060539) |
| 0.1 |
0.1 |
GO:0006551 |
leucine metabolic process(GO:0006551) |
| 0.1 |
0.1 |
GO:0008300 |
isoprenoid catabolic process(GO:0008300) |
| 0.1 |
0.4 |
GO:0098700 |
aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.1 |
0.3 |
GO:0046415 |
urate metabolic process(GO:0046415) |
| 0.1 |
0.7 |
GO:0001893 |
maternal placenta development(GO:0001893) |
| 0.1 |
0.2 |
GO:0010677 |
negative regulation of cellular carbohydrate metabolic process(GO:0010677) |
| 0.1 |
0.1 |
GO:0048262 |
determination of dorsal/ventral asymmetry(GO:0048262) determination of dorsal identity(GO:0048263) |
| 0.1 |
0.2 |
GO:0051351 |
positive regulation of ligase activity(GO:0051351) |
| 0.1 |
0.1 |
GO:0001955 |
blood vessel maturation(GO:0001955) |
| 0.1 |
0.4 |
GO:0045123 |
cellular extravasation(GO:0045123) |
| 0.1 |
0.2 |
GO:0048478 |
replication fork protection(GO:0048478) |
| 0.1 |
0.2 |
GO:0030259 |
lipid glycosylation(GO:0030259) |
| 0.1 |
0.2 |
GO:0006667 |
sphinganine metabolic process(GO:0006667) |
| 0.1 |
0.1 |
GO:0044058 |
regulation of digestive system process(GO:0044058) |
| 0.1 |
0.1 |
GO:0030575 |
nuclear body organization(GO:0030575) |
| 0.1 |
0.1 |
GO:0033210 |
leptin-mediated signaling pathway(GO:0033210) |
| 0.1 |
0.3 |
GO:0018344 |
protein geranylgeranylation(GO:0018344) |
| 0.1 |
0.1 |
GO:1901386 |
negative regulation of voltage-gated calcium channel activity(GO:1901386) |
| 0.1 |
0.1 |
GO:2000171 |
negative regulation of dendrite development(GO:2000171) |
| 0.1 |
0.1 |
GO:0006002 |
fructose 6-phosphate metabolic process(GO:0006002) |
| 0.1 |
0.5 |
GO:0009083 |
branched-chain amino acid catabolic process(GO:0009083) |
| 0.1 |
1.0 |
GO:0033233 |
regulation of protein sumoylation(GO:0033233) |
| 0.1 |
0.4 |
GO:1990564 |
protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.1 |
0.4 |
GO:0030212 |
hyaluronan metabolic process(GO:0030212) |
| 0.1 |
1.4 |
GO:2000649 |
regulation of sodium ion transmembrane transporter activity(GO:2000649) |
| 0.1 |
0.1 |
GO:1990253 |
cellular response to leucine starvation(GO:1990253) |
| 0.1 |
0.1 |
GO:0046600 |
negative regulation of centriole replication(GO:0046600) |
| 0.1 |
0.6 |
GO:0003416 |
endochondral bone growth(GO:0003416) |
| 0.1 |
0.4 |
GO:0042126 |
nitrate metabolic process(GO:0042126) |
| 0.1 |
0.4 |
GO:0033013 |
tetrapyrrole metabolic process(GO:0033013) |
| 0.1 |
0.3 |
GO:0014742 |
positive regulation of cardiac muscle hypertrophy(GO:0010613) positive regulation of muscle hypertrophy(GO:0014742) |
| 0.1 |
0.6 |
GO:0032506 |
cytokinetic process(GO:0032506) |
| 0.1 |
0.2 |
GO:0018094 |
protein polyglycylation(GO:0018094) |
| 0.1 |
0.5 |
GO:0045824 |
negative regulation of innate immune response(GO:0045824) |
| 0.1 |
0.1 |
GO:1904059 |
regulation of locomotor rhythm(GO:1904059) |
| 0.1 |
0.1 |
GO:0051898 |
negative regulation of protein kinase B signaling(GO:0051898) |
| 0.1 |
0.1 |
GO:0045793 |
positive regulation of cell size(GO:0045793) |
| 0.1 |
0.1 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.1 |
0.2 |
GO:0071569 |
protein ufmylation(GO:0071569) |
| 0.1 |
0.1 |
GO:0042908 |
xenobiotic transport(GO:0042908) |
| 0.1 |
2.4 |
GO:0030838 |
positive regulation of actin filament polymerization(GO:0030838) |
| 0.1 |
1.0 |
GO:0045116 |
protein neddylation(GO:0045116) |
| 0.1 |
0.6 |
GO:0071806 |
intracellular protein transmembrane transport(GO:0065002) protein transmembrane transport(GO:0071806) |
| 0.1 |
0.2 |
GO:0015865 |
purine nucleotide transport(GO:0015865) |
| 0.1 |
0.1 |
GO:0097494 |
regulation of vesicle size(GO:0097494) |
| 0.1 |
0.6 |
GO:0003073 |
regulation of systemic arterial blood pressure(GO:0003073) |
| 0.1 |
0.3 |
GO:0006907 |
pinocytosis(GO:0006907) |
| 0.1 |
0.2 |
GO:0097186 |
amelogenesis(GO:0097186) |
| 0.1 |
0.2 |
GO:0035511 |
oxidative DNA demethylation(GO:0035511) |
| 0.1 |
0.3 |
GO:0009312 |
oligosaccharide biosynthetic process(GO:0009312) |
| 0.1 |
0.1 |
GO:0009651 |
response to salt stress(GO:0009651) |
| 0.1 |
0.2 |
GO:0060312 |
regulation of blood vessel remodeling(GO:0060312) |
| 0.1 |
0.2 |
GO:1900017 |
positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.1 |
0.4 |
GO:0007566 |
embryo implantation(GO:0007566) |
| 0.1 |
0.2 |
GO:0043415 |
positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.1 |
0.1 |
GO:0032286 |
central nervous system myelin maintenance(GO:0032286) |
| 0.1 |
0.3 |
GO:0032467 |
positive regulation of cytokinesis(GO:0032467) |
| 0.1 |
0.2 |
GO:0090164 |
asymmetric Golgi ribbon formation(GO:0090164) |
| 0.1 |
0.1 |
GO:0033003 |
regulation of mast cell activation(GO:0033003) |
| 0.1 |
0.1 |
GO:0010961 |
cellular magnesium ion homeostasis(GO:0010961) |
| 0.1 |
0.5 |
GO:0099517 |
anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
| 0.1 |
0.1 |
GO:0018216 |
peptidyl-arginine methylation(GO:0018216) |
| 0.0 |
0.0 |
GO:0021593 |
rhombomere development(GO:0021546) rhombomere morphogenesis(GO:0021593) |
| 0.0 |
0.2 |
GO:0051601 |
exocyst localization(GO:0051601) |
| 0.0 |
11.0 |
GO:0006412 |
translation(GO:0006412) |
| 0.0 |
0.5 |
GO:0040034 |
regulation of development, heterochronic(GO:0040034) |
| 0.0 |
0.3 |
GO:0009185 |
ribonucleoside diphosphate metabolic process(GO:0009185) |
| 0.0 |
0.1 |
GO:0006953 |
acute-phase response(GO:0006953) |
| 0.0 |
0.1 |
GO:1902895 |
positive regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902895) |
| 0.0 |
0.0 |
GO:0061117 |
negative regulation of cardiac muscle tissue growth(GO:0055022) negative regulation of heart growth(GO:0061117) |
| 0.0 |
0.5 |
GO:0030513 |
positive regulation of BMP signaling pathway(GO:0030513) |
| 0.0 |
0.4 |
GO:0010867 |
positive regulation of triglyceride biosynthetic process(GO:0010867) |
| 0.0 |
0.1 |
GO:0030889 |
negative regulation of B cell proliferation(GO:0030889) |
| 0.0 |
0.0 |
GO:0060290 |
transdifferentiation(GO:0060290) |
| 0.0 |
0.9 |
GO:0050873 |
brown fat cell differentiation(GO:0050873) |
| 0.0 |
0.1 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 0.0 |
0.4 |
GO:0035335 |
peptidyl-tyrosine dephosphorylation(GO:0035335) |
| 0.0 |
0.4 |
GO:0035269 |
protein O-linked mannosylation(GO:0035269) |
| 0.0 |
0.3 |
GO:0000305 |
response to oxygen radical(GO:0000305) |
| 0.0 |
0.3 |
GO:0006044 |
N-acetylglucosamine metabolic process(GO:0006044) |
| 0.0 |
0.4 |
GO:0043949 |
regulation of cAMP-mediated signaling(GO:0043949) |
| 0.0 |
0.1 |
GO:0045445 |
myoblast differentiation(GO:0045445) |
| 0.0 |
0.1 |
GO:1901970 |
positive regulation of mitotic sister chromatid separation(GO:1901970) |
| 0.0 |
0.3 |
GO:0070940 |
dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.0 |
0.2 |
GO:0043043 |
peptide biosynthetic process(GO:0043043) |
| 0.0 |
0.1 |
GO:0034629 |
cellular protein complex localization(GO:0034629) |
| 0.0 |
0.3 |
GO:0045932 |
negative regulation of muscle contraction(GO:0045932) |
| 0.0 |
0.0 |
GO:0019511 |
peptidyl-proline hydroxylation(GO:0019511) |
| 0.0 |
0.1 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.0 |
0.2 |
GO:0035948 |
positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) |
| 0.0 |
0.1 |
GO:0006657 |
CDP-choline pathway(GO:0006657) |
| 0.0 |
0.2 |
GO:0033006 |
regulation of mast cell activation involved in immune response(GO:0033006) regulation of mast cell degranulation(GO:0043304) |
| 0.0 |
0.4 |
GO:0000045 |
autophagosome assembly(GO:0000045) |
| 0.0 |
0.4 |
GO:0046173 |
polyol biosynthetic process(GO:0046173) |
| 0.0 |
0.4 |
GO:0048661 |
positive regulation of smooth muscle cell proliferation(GO:0048661) |
| 0.0 |
0.1 |
GO:0042990 |
regulation of transcription factor import into nucleus(GO:0042990) |
| 0.0 |
0.4 |
GO:0000188 |
inactivation of MAPK activity(GO:0000188) |
| 0.0 |
0.1 |
GO:0033299 |
secretion of lysosomal enzymes(GO:0033299) |
| 0.0 |
0.1 |
GO:0036462 |
TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.0 |
0.0 |
GO:2000271 |
positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.0 |
0.2 |
GO:0006501 |
C-terminal protein lipidation(GO:0006501) |
| 0.0 |
0.2 |
GO:0006561 |
proline biosynthetic process(GO:0006561) |
| 0.0 |
0.2 |
GO:0048251 |
elastic fiber assembly(GO:0048251) |
| 0.0 |
0.1 |
GO:0098869 |
cellular oxidant detoxification(GO:0098869) |
| 0.0 |
0.1 |
GO:0038083 |
peptidyl-tyrosine autophosphorylation(GO:0038083) |
| 0.0 |
0.0 |
GO:0030913 |
paranodal junction assembly(GO:0030913) |
| 0.0 |
0.0 |
GO:0043278 |
response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
| 0.0 |
0.0 |
GO:2000269 |
regulation of fibroblast apoptotic process(GO:2000269) |
| 0.0 |
0.0 |
GO:0039530 |
MDA-5 signaling pathway(GO:0039530) |
| 0.0 |
0.1 |
GO:0071442 |
positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.0 |
0.0 |
GO:1901798 |
positive regulation of signal transduction by p53 class mediator(GO:1901798) |
| 0.0 |
0.1 |
GO:2000672 |
negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.0 |
0.1 |
GO:0051031 |
tRNA transport(GO:0051031) |
| 0.0 |
0.0 |
GO:0070989 |
oxidative demethylation(GO:0070989) |
| 0.0 |
0.0 |
GO:2000623 |
regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.0 |
0.2 |
GO:0003254 |
regulation of membrane depolarization(GO:0003254) |
| 0.0 |
0.3 |
GO:0010718 |
positive regulation of epithelial to mesenchymal transition(GO:0010718) |
| 0.0 |
0.0 |
GO:0030656 |
regulation of vitamin metabolic process(GO:0030656) |
| 0.0 |
0.1 |
GO:0006119 |
oxidative phosphorylation(GO:0006119) |
| 0.0 |
0.6 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 0.0 |
0.2 |
GO:0006818 |
hydrogen transport(GO:0006818) |
| 0.0 |
0.0 |
GO:0006627 |
protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.0 |
0.2 |
GO:0042753 |
positive regulation of circadian rhythm(GO:0042753) |
| 0.0 |
0.0 |
GO:0042088 |
T-helper 1 type immune response(GO:0042088) |
| 0.0 |
0.3 |
GO:0010862 |
positive regulation of pathway-restricted SMAD protein phosphorylation(GO:0010862) |
| 0.0 |
0.1 |
GO:0006308 |
DNA catabolic process(GO:0006308) |
| 0.0 |
0.1 |
GO:0046034 |
ATP metabolic process(GO:0046034) |
| 0.0 |
0.5 |
GO:0031532 |
actin cytoskeleton reorganization(GO:0031532) |
| 0.0 |
0.1 |
GO:0006013 |
mannose metabolic process(GO:0006013) |
| 0.0 |
0.1 |
GO:0042780 |
tRNA 3'-end processing(GO:0042780) |
| 0.0 |
0.1 |
GO:0052695 |
cellular glucuronidation(GO:0052695) |
| 0.0 |
0.1 |
GO:0035887 |
aortic smooth muscle cell differentiation(GO:0035887) |
| 0.0 |
0.1 |
GO:0048730 |
epidermis morphogenesis(GO:0048730) |
| 0.0 |
0.0 |
GO:0090038 |
negative regulation of protein kinase C signaling(GO:0090038) |
| 0.0 |
0.0 |
GO:0046719 |
regulation by virus of viral protein levels in host cell(GO:0046719) |
| 0.0 |
0.2 |
GO:0045540 |
regulation of cholesterol biosynthetic process(GO:0045540) |
| 0.0 |
0.1 |
GO:0009396 |
folic acid-containing compound biosynthetic process(GO:0009396) |
| 0.0 |
0.0 |
GO:2000643 |
positive regulation of vacuolar transport(GO:1903337) positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.0 |
0.1 |
GO:0051123 |
RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) DNA-templated transcriptional preinitiation complex assembly(GO:0070897) |
| 0.0 |
0.0 |
GO:0048239 |
negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
| 0.0 |
0.0 |
GO:0035988 |
chondrocyte proliferation(GO:0035988) |
