| 4.1 |
16.4 |
GO:0045091 |
regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) |
| 4.0 |
12.1 |
GO:0021577 |
hindbrain structural organization(GO:0021577) cerebellum structural organization(GO:0021589) |
| 3.8 |
26.4 |
GO:0031536 |
positive regulation of exit from mitosis(GO:0031536) |
| 3.6 |
7.2 |
GO:0097477 |
lateral motor column neuron migration(GO:0097477) |
| 3.5 |
63.6 |
GO:0051988 |
regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 3.5 |
10.5 |
GO:0002014 |
vasoconstriction of artery involved in ischemic response to lowering of systemic arterial blood pressure(GO:0002014) |
| 3.3 |
9.9 |
GO:0035519 |
protein K29-linked ubiquitination(GO:0035519) |
| 3.2 |
6.5 |
GO:0002669 |
positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 2.9 |
14.7 |
GO:2000325 |
regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 2.9 |
8.8 |
GO:0060282 |
positive regulation of oocyte development(GO:0060282) |
| 2.9 |
14.5 |
GO:0003199 |
endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
| 2.9 |
8.7 |
GO:0016321 |
female meiosis chromosome segregation(GO:0016321) |
| 2.8 |
8.5 |
GO:0000087 |
mitotic M phase(GO:0000087) |
| 2.6 |
7.8 |
GO:0030300 |
regulation of intestinal cholesterol absorption(GO:0030300) |
| 2.5 |
7.6 |
GO:0032877 |
positive regulation of DNA endoreduplication(GO:0032877) |
| 2.4 |
7.3 |
GO:0071930 |
negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 2.4 |
33.4 |
GO:0071459 |
protein localization to chromosome, centromeric region(GO:0071459) |
| 2.3 |
9.1 |
GO:0021937 |
cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
| 2.3 |
6.8 |
GO:0036388 |
pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 2.2 |
6.7 |
GO:0061588 |
calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylserine scrambling(GO:0061589) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) |
| 2.2 |
24.6 |
GO:0010826 |
negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 2.1 |
6.3 |
GO:0019401 |
alditol biosynthetic process(GO:0019401) |
| 2.0 |
6.1 |
GO:0046368 |
GDP-L-fucose metabolic process(GO:0046368) |
| 2.0 |
2.0 |
GO:0045876 |
positive regulation of sister chromatid cohesion(GO:0045876) |
| 2.0 |
19.5 |
GO:0007100 |
mitotic centrosome separation(GO:0007100) |
| 1.9 |
5.8 |
GO:1903334 |
positive regulation of protein folding(GO:1903334) |
| 1.9 |
5.8 |
GO:1900060 |
negative regulation of ceramide biosynthetic process(GO:1900060) |
| 1.9 |
5.8 |
GO:0030327 |
prenylated protein catabolic process(GO:0030327) |
| 1.9 |
9.4 |
GO:0051661 |
maintenance of centrosome location(GO:0051661) |
| 1.9 |
7.5 |
GO:0002924 |
negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
| 1.9 |
5.6 |
GO:0010814 |
substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 1.8 |
12.8 |
GO:0045654 |
positive regulation of megakaryocyte differentiation(GO:0045654) |
| 1.8 |
56.1 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 1.8 |
51.5 |
GO:0008299 |
isoprenoid biosynthetic process(GO:0008299) |
| 1.8 |
14.1 |
GO:0033504 |
floor plate development(GO:0033504) |
| 1.7 |
5.0 |
GO:0002302 |
CD8-positive, alpha-beta T cell differentiation involved in immune response(GO:0002302) |
| 1.7 |
11.8 |
GO:1904668 |
positive regulation of ubiquitin protein ligase activity(GO:1904668) |
| 1.6 |
4.9 |
GO:0045819 |
positive regulation of glycogen catabolic process(GO:0045819) |
| 1.6 |
25.5 |
GO:0030953 |
astral microtubule organization(GO:0030953) |
| 1.6 |
9.4 |
GO:0051304 |
chromosome separation(GO:0051304) |
| 1.6 |
3.1 |
GO:2000744 |
anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 1.5 |
4.6 |
GO:2000834 |
androgen secretion(GO:0035935) testosterone secretion(GO:0035936) negative regulation of glucagon secretion(GO:0070093) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) regulation of testosterone secretion(GO:2000843) positive regulation of testosterone secretion(GO:2000845) |
| 1.5 |
4.5 |
GO:0030070 |
insulin processing(GO:0030070) |
| 1.4 |
5.6 |
GO:0046836 |
glycolipid transport(GO:0046836) |
| 1.4 |
5.6 |
GO:0061055 |
myotome development(GO:0061055) |
| 1.4 |
1.4 |
GO:0007056 |
spindle assembly involved in female meiosis(GO:0007056) |
| 1.4 |
5.5 |
GO:0060266 |
negative regulation of respiratory burst involved in inflammatory response(GO:0060266) negative regulation of respiratory burst(GO:0060268) |
| 1.4 |
4.1 |
GO:0042726 |
flavin-containing compound metabolic process(GO:0042726) |
| 1.3 |
1.3 |
GO:0051985 |
negative regulation of chromosome segregation(GO:0051985) |
| 1.3 |
4.0 |
GO:0007290 |
spermatid nucleus elongation(GO:0007290) |
| 1.3 |
3.9 |
GO:1900147 |
Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
| 1.3 |
1.3 |
GO:0098763 |
mitotic cell cycle phase(GO:0098763) |
| 1.2 |
13.6 |
GO:0000920 |
cell separation after cytokinesis(GO:0000920) |
| 1.2 |
9.8 |
GO:0033314 |
mitotic DNA replication checkpoint(GO:0033314) |
| 1.2 |
3.6 |
GO:2000508 |
regulation of dendritic cell chemotaxis(GO:2000508) positive regulation of dendritic cell chemotaxis(GO:2000510) |
| 1.2 |
1.2 |
GO:0010957 |
negative regulation of vitamin D biosynthetic process(GO:0010957) negative regulation of vitamin metabolic process(GO:0046137) |
| 1.2 |
25.2 |
GO:0051310 |
metaphase plate congression(GO:0051310) |
| 1.2 |
20.3 |
GO:0060236 |
regulation of mitotic spindle organization(GO:0060236) |
| 1.2 |
14.0 |
GO:0002227 |
innate immune response in mucosa(GO:0002227) |
| 1.2 |
3.5 |
GO:1902174 |
positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 1.1 |
12.6 |
GO:0007076 |
mitotic chromosome condensation(GO:0007076) |
| 1.1 |
3.4 |
GO:0033566 |
gamma-tubulin complex localization(GO:0033566) |
| 1.1 |
10.1 |
GO:0031547 |
brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 1.1 |
3.4 |
GO:2000832 |
protein-chromophore linkage(GO:0018298) negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
| 1.1 |
3.4 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) calcium-independent cell-matrix adhesion(GO:0007161) |
| 1.1 |
4.4 |
GO:0032055 |
negative regulation of translation in response to stress(GO:0032055) |
| 1.1 |
4.4 |
GO:0021586 |
pons maturation(GO:0021586) |
| 1.1 |
5.3 |
GO:0010519 |
negative regulation of phospholipase activity(GO:0010519) |
| 1.0 |
6.1 |
GO:0046985 |
positive regulation of hemoglobin biosynthetic process(GO:0046985) |
| 1.0 |
8.0 |
GO:0005513 |
detection of calcium ion(GO:0005513) |
| 1.0 |
4.9 |
GO:1901970 |
positive regulation of mitotic sister chromatid separation(GO:1901970) |
| 1.0 |
8.8 |
GO:0018230 |
peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 1.0 |
3.9 |
GO:0072369 |
regulation of lipid transport by positive regulation of transcription from RNA polymerase II promoter(GO:0072369) |
| 1.0 |
2.9 |
GO:1990705 |
cholangiocyte proliferation(GO:1990705) |
| 1.0 |
21.3 |
GO:0042744 |
hydrogen peroxide catabolic process(GO:0042744) |
| 1.0 |
13.4 |
GO:0032211 |
negative regulation of telomere maintenance via telomerase(GO:0032211) |
| 1.0 |
2.9 |
GO:0033136 |
serine phosphorylation of STAT3 protein(GO:0033136) |
| 0.9 |
2.8 |
GO:0032474 |
otolith morphogenesis(GO:0032474) |
| 0.9 |
2.8 |
GO:0045659 |
regulation of neutrophil differentiation(GO:0045658) negative regulation of neutrophil differentiation(GO:0045659) |
| 0.9 |
2.8 |
GO:0010989 |
negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.9 |
4.6 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 0.9 |
1.9 |
GO:0048818 |
positive regulation of hair follicle maturation(GO:0048818) positive regulation of catagen(GO:0051795) |
| 0.9 |
1.8 |
GO:0042637 |
catagen(GO:0042637) |
| 0.9 |
2.7 |
GO:0006682 |
galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.9 |
0.9 |
GO:2000481 |
positive regulation of cAMP-dependent protein kinase activity(GO:2000481) |
| 0.9 |
2.6 |
GO:0006990 |
positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.9 |
0.9 |
GO:0072385 |
minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.9 |
10.4 |
GO:0034773 |
histone H4-K20 trimethylation(GO:0034773) |
| 0.9 |
0.9 |
GO:0044333 |
Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.8 |
3.4 |
GO:1904995 |
negative regulation of leukocyte tethering or rolling(GO:1903237) negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
| 0.8 |
2.5 |
GO:0042822 |
water-soluble vitamin biosynthetic process(GO:0042364) vitamin B6 metabolic process(GO:0042816) pyridoxal phosphate metabolic process(GO:0042822) pyridoxal phosphate biosynthetic process(GO:0042823) |
| 0.8 |
1.7 |
GO:0002636 |
positive regulation of germinal center formation(GO:0002636) |
| 0.8 |
3.4 |
GO:0035093 |
spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.8 |
5.0 |
GO:0060017 |
parathyroid gland development(GO:0060017) |
| 0.8 |
2.5 |
GO:1902605 |
heterotrimeric G-protein complex assembly(GO:1902605) |
| 0.8 |
4.1 |
GO:0000022 |
mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
| 0.8 |
2.4 |
GO:0097623 |
potassium ion export across plasma membrane(GO:0097623) regulation of potassium ion export(GO:1902302) |
| 0.8 |
4.1 |
GO:0034421 |
post-translational protein acetylation(GO:0034421) |
| 0.8 |
5.7 |
GO:0097411 |
hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.8 |
4.0 |
GO:0000056 |
ribosomal small subunit export from nucleus(GO:0000056) |
| 0.8 |
2.4 |
GO:0030951 |
establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.8 |
5.6 |
GO:1902416 |
positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
| 0.8 |
4.7 |
GO:0007021 |
tubulin complex assembly(GO:0007021) |
| 0.8 |
4.7 |
GO:0071712 |
ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.8 |
2.4 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.8 |
1.6 |
GO:0031117 |
positive regulation of microtubule depolymerization(GO:0031117) |
| 0.8 |
3.9 |
GO:0043314 |
negative regulation of neutrophil degranulation(GO:0043314) negative regulation of blood vessel remodeling(GO:0060313) |
| 0.8 |
10.2 |
GO:0000185 |
activation of MAPKKK activity(GO:0000185) |
| 0.8 |
3.1 |
GO:0045113 |
regulation of integrin biosynthetic process(GO:0045113) |
| 0.8 |
3.1 |
GO:0035795 |
negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 0.8 |
2.3 |
GO:0090526 |
response to leucine(GO:0043201) cellular response to leucine(GO:0071233) regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.7 |
2.2 |
GO:0043456 |
regulation of pentose-phosphate shunt(GO:0043456) |
| 0.7 |
2.2 |
GO:0006428 |
isoleucyl-tRNA aminoacylation(GO:0006428) |
| 0.7 |
5.8 |
GO:0021796 |
cerebral cortex regionalization(GO:0021796) |
| 0.7 |
2.9 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 0.7 |
7.9 |
GO:0019985 |
translesion synthesis(GO:0019985) |
| 0.7 |
2.9 |
GO:1903215 |
negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.7 |
7.1 |
GO:2000628 |
regulation of miRNA metabolic process(GO:2000628) |
| 0.7 |
3.5 |
GO:0070935 |
3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.7 |
2.8 |
GO:0009957 |
epidermal cell fate specification(GO:0009957) |
| 0.7 |
9.7 |
GO:0021684 |
cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.7 |
2.8 |
GO:2001032 |
regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.7 |
2.1 |
GO:0060010 |
Sertoli cell fate commitment(GO:0060010) |
| 0.7 |
14.2 |
GO:0006607 |
NLS-bearing protein import into nucleus(GO:0006607) |
| 0.7 |
2.0 |
GO:1903984 |
positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.7 |
2.0 |
GO:0051305 |
meiotic chromosome movement towards spindle pole(GO:0016344) chromosome movement towards spindle pole(GO:0051305) |
| 0.7 |
4.7 |
GO:0048102 |
autophagic cell death(GO:0048102) |
| 0.7 |
1.3 |
GO:0034214 |
protein hexamerization(GO:0034214) |
| 0.7 |
8.7 |
GO:0090308 |
regulation of methylation-dependent chromatin silencing(GO:0090308) |
| 0.7 |
6.0 |
GO:0070244 |
negative regulation of thymocyte apoptotic process(GO:0070244) |
| 0.7 |
2.0 |
GO:0042271 |
susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.7 |
12.5 |
GO:0032467 |
positive regulation of cytokinesis(GO:0032467) |
| 0.7 |
1.3 |
GO:0032700 |
negative regulation of interleukin-17 production(GO:0032700) |
| 0.7 |
2.0 |
GO:0097167 |
circadian regulation of translation(GO:0097167) |
| 0.6 |
2.6 |
GO:0046898 |
response to cycloheximide(GO:0046898) |
| 0.6 |
3.9 |
GO:0030644 |
cellular chloride ion homeostasis(GO:0030644) |
| 0.6 |
1.9 |
GO:0007210 |
serotonin receptor signaling pathway(GO:0007210) |
| 0.6 |
3.2 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 0.6 |
1.9 |
GO:0032915 |
positive regulation of transforming growth factor beta2 production(GO:0032915) |
| 0.6 |
1.2 |
GO:0046671 |
negative regulation of retinal cell programmed cell death(GO:0046671) |
| 0.6 |
4.9 |
GO:0045719 |
negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 0.6 |
3.0 |
GO:2000343 |
positive regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000343) |
| 0.6 |
1.8 |
GO:0000707 |
meiotic DNA recombinase assembly(GO:0000707) |
| 0.6 |
1.8 |
GO:0032650 |
regulation of interleukin-1 alpha production(GO:0032650) positive regulation of interleukin-1 alpha production(GO:0032730) cardiac cell fate determination(GO:0060913) |
| 0.6 |
3.0 |
GO:0045627 |
positive regulation of T-helper 1 cell differentiation(GO:0045627) |
| 0.6 |
4.2 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 0.6 |
3.4 |
GO:0016584 |
nucleosome positioning(GO:0016584) |
| 0.6 |
2.2 |
GO:0070836 |
caveola assembly(GO:0070836) |
| 0.6 |
2.2 |
GO:0000733 |
DNA strand renaturation(GO:0000733) |
| 0.6 |
1.7 |
GO:0006011 |
UDP-glucose metabolic process(GO:0006011) |
| 0.6 |
1.1 |
GO:0034508 |
centromere complex assembly(GO:0034508) |
| 0.5 |
5.5 |
GO:0036499 |
PERK-mediated unfolded protein response(GO:0036499) |
| 0.5 |
47.6 |
GO:0006342 |
chromatin silencing(GO:0006342) |
| 0.5 |
3.3 |
GO:0035428 |
hexose transmembrane transport(GO:0035428) |
| 0.5 |
0.5 |
GO:0070885 |
negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
| 0.5 |
1.6 |
GO:0010749 |
regulation of nitric oxide mediated signal transduction(GO:0010749) |
| 0.5 |
2.2 |
GO:1903800 |
positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.5 |
0.5 |
GO:0031052 |
programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
| 0.5 |
4.3 |
GO:0046645 |
positive regulation of gamma-delta T cell differentiation(GO:0045588) positive regulation of gamma-delta T cell activation(GO:0046645) |
| 0.5 |
0.5 |
GO:0034770 |
histone H4-K20 methylation(GO:0034770) |
| 0.5 |
1.6 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.5 |
1.6 |
GO:0019676 |
ammonia assimilation cycle(GO:0019676) |
| 0.5 |
2.1 |
GO:0006933 |
negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.5 |
0.5 |
GO:1902455 |
negative regulation of stem cell population maintenance(GO:1902455) |
| 0.5 |
11.6 |
GO:0007099 |
centriole replication(GO:0007099) |
| 0.5 |
26.7 |
GO:0006334 |
nucleosome assembly(GO:0006334) |
| 0.5 |
1.5 |
GO:0072592 |
oxygen metabolic process(GO:0072592) |
| 0.5 |
11.0 |
GO:0042149 |
cellular response to glucose starvation(GO:0042149) |
| 0.5 |
2.8 |
GO:0001887 |
selenium compound metabolic process(GO:0001887) |
| 0.5 |
2.3 |
GO:2000781 |
positive regulation of double-strand break repair(GO:2000781) |
| 0.5 |
5.0 |
GO:1990173 |
protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
| 0.5 |
2.3 |
GO:0006543 |
glutamine catabolic process(GO:0006543) |
| 0.5 |
14.6 |
GO:0034260 |
negative regulation of GTPase activity(GO:0034260) |
| 0.5 |
2.3 |
GO:0007223 |
Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 0.5 |
0.9 |
GO:0010847 |
regulation of chromatin assembly(GO:0010847) |
| 0.5 |
5.5 |
GO:0051443 |
positive regulation of ubiquitin-protein transferase activity(GO:0051443) |
| 0.5 |
4.1 |
GO:0031639 |
plasminogen activation(GO:0031639) |
| 0.5 |
18.2 |
GO:0008156 |
negative regulation of DNA replication(GO:0008156) |
| 0.5 |
8.1 |
GO:0045116 |
protein neddylation(GO:0045116) |
| 0.4 |
0.4 |
GO:0048631 |
regulation of skeletal muscle tissue growth(GO:0048631) |
| 0.4 |
0.9 |
GO:0002901 |
mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 0.4 |
1.8 |
GO:0010808 |
positive regulation of synaptic vesicle priming(GO:0010808) |
| 0.4 |
1.3 |
GO:0060161 |
positive regulation of dopamine receptor signaling pathway(GO:0060161) |
| 0.4 |
0.9 |
GO:0045806 |
negative regulation of endocytosis(GO:0045806) |
| 0.4 |
2.6 |
GO:0060539 |
diaphragm development(GO:0060539) |
| 0.4 |
2.1 |
GO:0018125 |
peptidyl-cysteine methylation(GO:0018125) |
| 0.4 |
3.0 |
GO:0007221 |
positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.4 |
1.3 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.4 |
1.7 |
GO:0019355 |
nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process(GO:0034627) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.4 |
1.2 |
GO:0090202 |
transcriptional activation by promoter-enhancer looping(GO:0071733) regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 0.4 |
1.2 |
GO:0035672 |
transepithelial chloride transport(GO:0030321) oligopeptide transmembrane transport(GO:0035672) |
| 0.4 |
1.2 |
GO:0006436 |
tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.4 |
1.2 |
GO:1905065 |
positive regulation of vascular smooth muscle cell differentiation(GO:1905065) |
| 0.4 |
2.0 |
GO:2000042 |
negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
| 0.4 |
6.3 |
GO:0007530 |
sex determination(GO:0007530) |
| 0.4 |
1.2 |
GO:2000612 |
positive regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0072108) regulation of mesenchymal cell apoptotic process involved in metanephric nephron morphogenesis(GO:0072304) negative regulation of mesenchymal cell apoptotic process involved in metanephric nephron morphogenesis(GO:0072305) mesenchymal cell apoptotic process involved in metanephros development(GO:1900200) apoptotic process involved in metanephric collecting duct development(GO:1900204) apoptotic process involved in metanephric nephron tubule development(GO:1900205) regulation of mesenchymal cell apoptotic process involved in metanephros development(GO:1900211) negative regulation of mesenchymal cell apoptotic process involved in metanephros development(GO:1900212) regulation of apoptotic process involved in metanephric collecting duct development(GO:1900214) negative regulation of apoptotic process involved in metanephric collecting duct development(GO:1900215) regulation of apoptotic process involved in metanephric nephron tubule development(GO:1900217) negative regulation of apoptotic process involved in metanephric nephron tubule development(GO:1900218) mesenchymal cell apoptotic process involved in metanephric nephron morphogenesis(GO:1901147) regulation of metanephric DCT cell differentiation(GO:2000592) positive regulation of metanephric DCT cell differentiation(GO:2000594) regulation of thyroid hormone generation(GO:2000609) positive regulation of thyroid hormone generation(GO:2000611) regulation of thyroid-stimulating hormone secretion(GO:2000612) |
| 0.4 |
1.5 |
GO:0071394 |
cellular response to testosterone stimulus(GO:0071394) |
| 0.4 |
5.4 |
GO:0001731 |
formation of translation preinitiation complex(GO:0001731) |
| 0.4 |
4.6 |
GO:0036376 |
sodium ion export from cell(GO:0036376) |
| 0.4 |
4.1 |
GO:0045899 |
positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.4 |
5.6 |
GO:0045019 |
negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
| 0.4 |
1.9 |
GO:1903690 |
negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.4 |
1.1 |
GO:0001928 |
regulation of exocyst assembly(GO:0001928) |
| 0.4 |
1.1 |
GO:1904154 |
positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.4 |
1.1 |
GO:0021759 |
globus pallidus development(GO:0021759) |
| 0.4 |
0.7 |
GO:0002865 |
negative regulation of acute inflammatory response to antigenic stimulus(GO:0002865) |
| 0.4 |
0.4 |
GO:2001015 |
negative regulation of skeletal muscle cell differentiation(GO:2001015) |
| 0.4 |
0.7 |
GO:0006269 |
DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.4 |
1.8 |
GO:0051386 |
regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
| 0.4 |
3.6 |
GO:0051451 |
myoblast migration(GO:0051451) |
| 0.4 |
2.5 |
GO:0061635 |
regulation of protein complex stability(GO:0061635) |
| 0.4 |
1.1 |
GO:0007621 |
negative regulation of female receptivity(GO:0007621) |
| 0.4 |
1.4 |
GO:0000076 |
DNA replication checkpoint(GO:0000076) |
| 0.4 |
1.4 |
GO:0098532 |
histone H3-K27 trimethylation(GO:0098532) |
| 0.4 |
2.8 |
GO:0071318 |
cellular response to ATP(GO:0071318) |
| 0.4 |
0.7 |
GO:0046122 |
purine deoxyribonucleoside metabolic process(GO:0046122) |
| 0.3 |
3.1 |
GO:0019886 |
antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
| 0.3 |
1.0 |
GO:0060399 |
follicle-stimulating hormone signaling pathway(GO:0042699) positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.3 |
1.0 |
GO:0071374 |
cellular response to parathyroid hormone stimulus(GO:0071374) |
| 0.3 |
5.7 |
GO:0016556 |
mRNA modification(GO:0016556) |
| 0.3 |
2.0 |
GO:0034587 |
piRNA metabolic process(GO:0034587) |
| 0.3 |
3.0 |
GO:0051085 |
chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.3 |
17.0 |
GO:0007019 |
microtubule depolymerization(GO:0007019) |
| 0.3 |
0.7 |
GO:0046110 |
xanthine metabolic process(GO:0046110) |
| 0.3 |
3.0 |
GO:0051764 |
actin crosslink formation(GO:0051764) |
| 0.3 |
4.3 |
GO:0000188 |
inactivation of MAPK activity(GO:0000188) |
| 0.3 |
3.0 |
GO:2000811 |
negative regulation of anoikis(GO:2000811) |
| 0.3 |
2.0 |
GO:0018377 |
N-terminal protein lipidation(GO:0006498) N-terminal protein myristoylation(GO:0006499) protein myristoylation(GO:0018377) |
| 0.3 |
1.7 |
GO:0071787 |
endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.3 |
10.2 |
GO:0043044 |
ATP-dependent chromatin remodeling(GO:0043044) |
| 0.3 |
7.2 |
GO:0031122 |
cytoplasmic microtubule organization(GO:0031122) |
| 0.3 |
1.6 |
GO:0051012 |
microtubule sliding(GO:0051012) negative regulation of nonmotile primary cilium assembly(GO:1902856) |
| 0.3 |
0.3 |
GO:0002159 |
desmosome assembly(GO:0002159) |
| 0.3 |
2.0 |
GO:0043654 |
recognition of apoptotic cell(GO:0043654) |
| 0.3 |
2.6 |
GO:0018026 |
peptidyl-lysine monomethylation(GO:0018026) |
| 0.3 |
1.3 |
GO:0043353 |
enucleate erythrocyte differentiation(GO:0043353) |
| 0.3 |
7.1 |
GO:0010955 |
negative regulation of protein processing(GO:0010955) negative regulation of protein maturation(GO:1903318) |
| 0.3 |
0.6 |
GO:1903243 |
negative regulation of cardiac muscle hypertrophy in response to stress(GO:1903243) |
| 0.3 |
1.0 |
GO:0006553 |
lysine metabolic process(GO:0006553) |
| 0.3 |
5.4 |
GO:0019835 |
cytolysis(GO:0019835) |
| 0.3 |
5.1 |
GO:0045672 |
positive regulation of osteoclast differentiation(GO:0045672) |
| 0.3 |
1.0 |
GO:0034241 |
positive regulation of macrophage fusion(GO:0034241) |
| 0.3 |
6.0 |
GO:0010763 |
positive regulation of fibroblast migration(GO:0010763) |
| 0.3 |
4.7 |
GO:0060065 |
uterus development(GO:0060065) |
| 0.3 |
6.0 |
GO:0032212 |
positive regulation of telomere maintenance via telomerase(GO:0032212) |
| 0.3 |
1.2 |
GO:0051725 |
protein de-ADP-ribosylation(GO:0051725) |
| 0.3 |
2.1 |
GO:0021521 |
ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 0.3 |
2.1 |
GO:1900107 |
regulation of nodal signaling pathway(GO:1900107) |
| 0.3 |
1.2 |
GO:1903966 |
monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.3 |
0.9 |
GO:0048496 |
maintenance of organ identity(GO:0048496) |
| 0.3 |
8.4 |
GO:0001709 |
cell fate determination(GO:0001709) |
| 0.3 |
0.6 |
GO:0006166 |
purine ribonucleoside salvage(GO:0006166) |
| 0.3 |
0.3 |
GO:0032056 |
positive regulation of translation in response to stress(GO:0032056) positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
| 0.3 |
2.4 |
GO:0061436 |
establishment of skin barrier(GO:0061436) |
| 0.3 |
1.5 |
GO:0034638 |
phosphatidylcholine catabolic process(GO:0034638) |
| 0.3 |
1.2 |
GO:0010804 |
negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.3 |
2.6 |
GO:0070986 |
left/right axis specification(GO:0070986) |
| 0.3 |
2.0 |
GO:0060972 |
left/right pattern formation(GO:0060972) |
| 0.3 |
0.9 |
GO:0009106 |
lipoate metabolic process(GO:0009106) |
| 0.3 |
0.9 |
GO:0050910 |
detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
| 0.3 |
1.7 |
GO:1903755 |
regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.3 |
1.4 |
GO:0060594 |
mammary gland specification(GO:0060594) |
| 0.3 |
90.3 |
GO:0007067 |
mitotic nuclear division(GO:0007067) |
| 0.3 |
7.6 |
GO:0015985 |
energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.3 |
5.2 |
GO:0099517 |
anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
| 0.3 |
3.0 |
GO:0009048 |
dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.3 |
1.4 |
GO:0009052 |
pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.3 |
1.6 |
GO:0006452 |
translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.3 |
0.5 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.3 |
0.8 |
GO:1903244 |
positive regulation of cardiac muscle adaptation(GO:0010615) positive regulation of cardiac muscle hypertrophy in response to stress(GO:1903244) |
| 0.3 |
3.0 |
GO:2000009 |
negative regulation of protein localization to cell surface(GO:2000009) |
| 0.3 |
0.3 |
GO:0031120 |
snRNA pseudouridine synthesis(GO:0031120) |
| 0.3 |
2.7 |
GO:0006301 |
postreplication repair(GO:0006301) |
| 0.3 |
0.8 |
GO:0032914 |
positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.3 |
0.3 |
GO:0032875 |
regulation of DNA endoreduplication(GO:0032875) DNA endoreduplication(GO:0042023) |
| 0.3 |
2.6 |
GO:0051043 |
regulation of membrane protein ectodomain proteolysis(GO:0051043) positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.3 |
1.0 |
GO:1903377 |
negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.3 |
3.3 |
GO:0006415 |
translational termination(GO:0006415) |
| 0.2 |
1.2 |
GO:1900451 |
positive regulation of glutamate receptor signaling pathway(GO:1900451) positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
| 0.2 |
3.5 |
GO:0015937 |
coenzyme A biosynthetic process(GO:0015937) |
| 0.2 |
1.0 |
GO:0031441 |
negative regulation of mRNA 3'-end processing(GO:0031441) |
| 0.2 |
2.2 |
GO:0001833 |
inner cell mass cell proliferation(GO:0001833) |
| 0.2 |
11.9 |
GO:0000725 |
double-strand break repair via homologous recombination(GO:0000724) recombinational repair(GO:0000725) |
| 0.2 |
1.5 |
GO:0060965 |
negative regulation of gene silencing by miRNA(GO:0060965) |
| 0.2 |
0.2 |
GO:0008626 |
granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.2 |
3.1 |
GO:0031987 |
locomotion involved in locomotory behavior(GO:0031987) |
| 0.2 |
2.6 |
GO:0097034 |
mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.2 |
0.7 |
GO:0046084 |
adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
| 0.2 |
1.6 |
GO:2001198 |
regulation of dendritic cell differentiation(GO:2001198) negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.2 |
1.8 |
GO:0006477 |
protein sulfation(GO:0006477) |
| 0.2 |
1.3 |
GO:0006108 |
malate metabolic process(GO:0006108) |
| 0.2 |
0.2 |
GO:0006404 |
RNA import into nucleus(GO:0006404) |
| 0.2 |
2.2 |
GO:0097237 |
cellular response to toxic substance(GO:0097237) |
| 0.2 |
0.7 |
GO:1901509 |
positive regulation of cAMP-mediated signaling(GO:0043950) regulation of endothelial tube morphogenesis(GO:1901509) |
| 0.2 |
0.9 |
GO:0003415 |
chondrocyte hypertrophy(GO:0003415) |
| 0.2 |
1.5 |
GO:0045589 |
regulation of regulatory T cell differentiation(GO:0045589) |
| 0.2 |
1.9 |
GO:2000001 |
regulation of DNA damage checkpoint(GO:2000001) |
| 0.2 |
2.6 |
GO:0006582 |
melanin metabolic process(GO:0006582) melanin biosynthetic process(GO:0042438) |
| 0.2 |
0.4 |
GO:0009051 |
pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.2 |
0.4 |
GO:0070973 |
protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.2 |
1.3 |
GO:0070561 |
vitamin D receptor signaling pathway(GO:0070561) cellular response to vitamin D(GO:0071305) |
| 0.2 |
1.9 |
GO:0033234 |
negative regulation of protein sumoylation(GO:0033234) |
| 0.2 |
1.2 |
GO:0002021 |
response to dietary excess(GO:0002021) |
| 0.2 |
0.6 |
GO:1902474 |
positive regulation of protein localization to synapse(GO:1902474) |
| 0.2 |
0.2 |
GO:0002036 |
regulation of L-glutamate transport(GO:0002036) |
| 0.2 |
0.6 |
GO:0006434 |
seryl-tRNA aminoacylation(GO:0006434) |
| 0.2 |
0.6 |
GO:0042264 |
peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.2 |
2.6 |
GO:0014049 |
positive regulation of glutamate secretion(GO:0014049) |
| 0.2 |
0.2 |
GO:0031914 |
negative regulation of synaptic plasticity(GO:0031914) |
| 0.2 |
1.0 |
GO:0051490 |
negative regulation of filopodium assembly(GO:0051490) |
| 0.2 |
1.3 |
GO:1904017 |
positive regulation of female receptivity(GO:0045925) response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.2 |
9.5 |
GO:0006406 |
mRNA export from nucleus(GO:0006406) mRNA-containing ribonucleoprotein complex export from nucleus(GO:0071427) |
| 0.2 |
1.5 |
GO:0002318 |
myeloid progenitor cell differentiation(GO:0002318) |
| 0.2 |
0.6 |
GO:0007341 |
penetration of zona pellucida(GO:0007341) |
| 0.2 |
0.4 |
GO:0000965 |
mitochondrial RNA 3'-end processing(GO:0000965) |
| 0.2 |
0.6 |
GO:0036508 |
protein deglycosylation involved in glycoprotein catabolic process(GO:0035977) protein demannosylation(GO:0036507) protein alpha-1,2-demannosylation(GO:0036508) mannose trimming involved in glycoprotein ERAD pathway(GO:1904382) |
| 0.2 |
1.6 |
GO:0042760 |
very long-chain fatty acid catabolic process(GO:0042760) |
| 0.2 |
0.9 |
GO:0008635 |
activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.2 |
4.9 |
GO:0000077 |
DNA damage checkpoint(GO:0000077) |
| 0.2 |
0.5 |
GO:0006419 |
alanyl-tRNA aminoacylation(GO:0006419) |
| 0.2 |
1.0 |
GO:0048254 |
snoRNA localization(GO:0048254) |
| 0.2 |
2.4 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.2 |
1.4 |
GO:0001956 |
positive regulation of neurotransmitter secretion(GO:0001956) |
| 0.2 |
1.9 |
GO:0070979 |
protein K11-linked ubiquitination(GO:0070979) |
| 0.2 |
1.4 |
GO:0070389 |
chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.2 |
2.1 |
GO:0006388 |
tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.2 |
1.0 |
GO:0040016 |
embryonic cleavage(GO:0040016) |
| 0.2 |
2.4 |
GO:0048671 |
negative regulation of collateral sprouting(GO:0048671) |
| 0.2 |
0.3 |
GO:0000212 |
meiotic spindle organization(GO:0000212) |
| 0.2 |
2.0 |
GO:0060009 |
Sertoli cell development(GO:0060009) |
| 0.2 |
0.8 |
GO:0032472 |
Golgi calcium ion transport(GO:0032472) |
| 0.2 |
0.7 |
GO:0050689 |
targeting of mRNA for destruction involved in RNA interference(GO:0030423) negative regulation of defense response to virus by host(GO:0050689) |
| 0.2 |
0.7 |
GO:0006337 |
nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
| 0.2 |
0.5 |
GO:0034393 |
positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.2 |
3.2 |
GO:0003301 |
physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.2 |
0.5 |
GO:0046381 |
CMP-N-acetylneuraminate metabolic process(GO:0046381) |
| 0.2 |
0.2 |
GO:0034238 |
macrophage fusion(GO:0034238) regulation of macrophage fusion(GO:0034239) |
| 0.2 |
1.3 |
GO:0031274 |
positive regulation of pseudopodium assembly(GO:0031274) |
| 0.2 |
1.7 |
GO:0045648 |
positive regulation of erythrocyte differentiation(GO:0045648) |
| 0.2 |
0.5 |
GO:0006407 |
rRNA export from nucleus(GO:0006407) |
| 0.2 |
0.5 |
GO:0060056 |
mammary gland involution(GO:0060056) |
| 0.2 |
1.4 |
GO:1902913 |
positive regulation of melanocyte differentiation(GO:0045636) positive regulation of developmental pigmentation(GO:0048087) positive regulation of pigment cell differentiation(GO:0050942) positive regulation of neuroepithelial cell differentiation(GO:1902913) |
| 0.1 |
0.7 |
GO:1903361 |
protein localization to basolateral plasma membrane(GO:1903361) |
| 0.1 |
0.6 |
GO:0035469 |
determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.1 |
1.8 |
GO:0060716 |
labyrinthine layer blood vessel development(GO:0060716) |
| 0.1 |
0.1 |
GO:0032792 |
negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.1 |
0.9 |
GO:0090051 |
negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
| 0.1 |
0.8 |
GO:0042984 |
amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.1 |
0.4 |
GO:0072139 |
glomerular parietal epithelial cell differentiation(GO:0072139) |
| 0.1 |
0.6 |
GO:0031648 |
protein destabilization(GO:0031648) |
| 0.1 |
0.8 |
GO:1904491 |
protein localization to ciliary transition zone(GO:1904491) |
| 0.1 |
1.7 |
GO:1900037 |
regulation of cellular response to hypoxia(GO:1900037) |
| 0.1 |
0.5 |
GO:0034975 |
protein folding in endoplasmic reticulum(GO:0034975) |
| 0.1 |
0.4 |
GO:2001137 |
positive regulation of endocytic recycling(GO:2001137) |
| 0.1 |
1.4 |
GO:0060973 |
cell migration involved in heart development(GO:0060973) |
| 0.1 |
3.1 |
GO:0007638 |
mechanosensory behavior(GO:0007638) |
| 0.1 |
3.1 |
GO:0045104 |
intermediate filament cytoskeleton organization(GO:0045104) |
| 0.1 |
0.4 |
GO:0006189 |
'de novo' IMP biosynthetic process(GO:0006189) |
| 0.1 |
0.8 |
GO:0043517 |
positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.1 |
1.0 |
GO:0036158 |
outer dynein arm assembly(GO:0036158) |
| 0.1 |
1.8 |
GO:2000300 |
regulation of synaptic vesicle exocytosis(GO:2000300) |
| 0.1 |
1.2 |
GO:0060670 |
branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.1 |
0.5 |
GO:0045900 |
negative regulation of translational elongation(GO:0045900) |
| 0.1 |
0.6 |
GO:2000491 |
positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.1 |
1.4 |
GO:0006654 |
phosphatidic acid biosynthetic process(GO:0006654) phosphatidic acid metabolic process(GO:0046473) |
| 0.1 |
0.4 |
GO:0042998 |
positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
| 0.1 |
0.7 |
GO:0032465 |
regulation of cytokinesis(GO:0032465) |
| 0.1 |
0.2 |
GO:0000720 |
pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.1 |
1.5 |
GO:0007213 |
G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
| 0.1 |
1.1 |
GO:0021957 |
corticospinal tract morphogenesis(GO:0021957) |
| 0.1 |
0.9 |
GO:0035520 |
monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.1 |
0.6 |
GO:0042756 |
drinking behavior(GO:0042756) |
| 0.1 |
0.1 |
GO:0043985 |
histone H4-R3 methylation(GO:0043985) |
| 0.1 |
0.4 |
GO:0001306 |
age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
| 0.1 |
1.1 |
GO:0033235 |
positive regulation of protein sumoylation(GO:0033235) |
| 0.1 |
19.8 |
GO:0044772 |
mitotic cell cycle phase transition(GO:0044772) |
| 0.1 |
1.1 |
GO:0021542 |
dentate gyrus development(GO:0021542) |
| 0.1 |
0.5 |
GO:0071549 |
response to dexamethasone(GO:0071548) cellular response to dexamethasone stimulus(GO:0071549) |
| 0.1 |
1.1 |
GO:0021511 |
spinal cord patterning(GO:0021511) |
| 0.1 |
0.4 |
GO:0090168 |
intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036481) Golgi reassembly(GO:0090168) |
| 0.1 |
1.0 |
GO:0007602 |
phototransduction(GO:0007602) |
| 0.1 |
1.0 |
GO:0043276 |
anoikis(GO:0043276) |
| 0.1 |
0.4 |
GO:1903553 |
positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.1 |
0.2 |
GO:0006435 |
threonyl-tRNA aminoacylation(GO:0006435) |
| 0.1 |
0.1 |
GO:0008616 |
queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.1 |
0.2 |
GO:0003418 |
growth plate cartilage chondrocyte differentiation(GO:0003418) |
| 0.1 |
3.4 |
GO:0010501 |
RNA secondary structure unwinding(GO:0010501) |
| 0.1 |
0.5 |
GO:0060290 |
transdifferentiation(GO:0060290) |
| 0.1 |
1.4 |
GO:0050832 |
defense response to fungus(GO:0050832) |
| 0.1 |
0.3 |
GO:0006566 |
threonine metabolic process(GO:0006566) |
| 0.1 |
0.8 |
GO:0051930 |
regulation of sensory perception of pain(GO:0051930) regulation of sensory perception(GO:0051931) |
| 0.1 |
0.3 |
GO:1903336 |
negative regulation of vacuolar transport(GO:1903336) |
| 0.1 |
1.5 |
GO:0070050 |
neuron cellular homeostasis(GO:0070050) |
| 0.1 |
0.4 |
GO:0042769 |
DNA damage response, detection of DNA damage(GO:0042769) |
| 0.1 |
2.3 |
GO:0097352 |
autophagosome maturation(GO:0097352) |
| 0.1 |
0.2 |
GO:0002679 |
respiratory burst involved in defense response(GO:0002679) |
| 0.1 |
0.6 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 |
1.1 |
GO:0045063 |
T-helper 1 cell differentiation(GO:0045063) |
| 0.1 |
0.6 |
GO:0048096 |
chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.1 |
0.4 |
GO:0097428 |
protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.1 |
0.3 |
GO:0061086 |
negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.1 |
3.0 |
GO:0033120 |
positive regulation of RNA splicing(GO:0033120) |
| 0.1 |
1.5 |
GO:0045292 |
mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.1 |
0.2 |
GO:2000338 |
response to molecule of fungal origin(GO:0002238) positive regulation of interleukin-23 production(GO:0032747) chemokine (C-X-C motif) ligand 1 production(GO:0072566) regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000338) |
| 0.1 |
0.4 |
GO:0090073 |
negative regulation of glial cell apoptotic process(GO:0034351) positive regulation of protein homodimerization activity(GO:0090073) positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.1 |
0.9 |
GO:0071786 |
endoplasmic reticulum tubular network organization(GO:0071786) |
| 0.1 |
0.4 |
GO:1902268 |
negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.1 |
0.4 |
GO:0035617 |
stress granule disassembly(GO:0035617) plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.1 |
0.8 |
GO:0030836 |
positive regulation of actin filament depolymerization(GO:0030836) positive regulation of protein depolymerization(GO:1901881) |
| 0.1 |
0.2 |
GO:0090494 |
catecholamine uptake(GO:0090493) dopamine uptake(GO:0090494) |
| 0.1 |
1.0 |
GO:0006516 |
glycoprotein catabolic process(GO:0006516) |
| 0.1 |
1.4 |
GO:0006103 |
2-oxoglutarate metabolic process(GO:0006103) |
| 0.1 |
2.6 |
GO:0043242 |
negative regulation of protein complex disassembly(GO:0043242) negative regulation of protein depolymerization(GO:1901880) |
| 0.1 |
0.4 |
GO:0043137 |
DNA replication, removal of RNA primer(GO:0043137) |
| 0.1 |
0.1 |
GO:0009838 |
abscission(GO:0009838) |
| 0.1 |
0.7 |
GO:1902236 |
negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
| 0.1 |
0.8 |
GO:0030049 |
muscle filament sliding(GO:0030049) |
| 0.1 |
2.6 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.1 |
1.9 |
GO:0042771 |
intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
| 0.1 |
0.2 |
GO:0001978 |
regulation of systemic arterial blood pressure by carotid sinus baroreceptor feedback(GO:0001978) |
| 0.1 |
0.6 |
GO:1903441 |
protein localization to ciliary membrane(GO:1903441) |
| 0.1 |
0.9 |
GO:0050884 |
neuromuscular process controlling posture(GO:0050884) |
| 0.1 |
0.6 |
GO:2000124 |
regulation of endocannabinoid signaling pathway(GO:2000124) |
| 0.1 |
0.3 |
GO:0007144 |
female meiosis I(GO:0007144) |
| 0.1 |
0.9 |
GO:0009263 |
deoxyribonucleotide biosynthetic process(GO:0009263) |
| 0.1 |
0.9 |
GO:0061371 |
determination of heart left/right asymmetry(GO:0061371) |
| 0.1 |
1.8 |
GO:0090004 |
positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
| 0.1 |
0.9 |
GO:0015697 |
quaternary ammonium group transport(GO:0015697) |
| 0.1 |
0.3 |
GO:0009249 |
protein lipoylation(GO:0009249) |
| 0.1 |
0.2 |
GO:2000418 |
positive regulation of eosinophil migration(GO:2000418) |
| 0.1 |
0.3 |
GO:1901029 |
negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.1 |
0.8 |
GO:0009143 |
nucleoside triphosphate catabolic process(GO:0009143) |
| 0.1 |
0.6 |
GO:0070940 |
dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.1 |
0.5 |
GO:0098700 |
aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.1 |
1.7 |
GO:0000154 |
rRNA modification(GO:0000154) |
| 0.1 |
0.9 |
GO:0003334 |
keratinocyte development(GO:0003334) |
| 0.1 |
0.1 |
GO:0090240 |
positive regulation of histone H4 acetylation(GO:0090240) |
| 0.1 |
0.1 |
GO:0046101 |
hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
| 0.1 |
1.3 |
GO:1900273 |
positive regulation of long-term synaptic potentiation(GO:1900273) |
| 0.1 |
0.4 |
GO:0071569 |
protein ufmylation(GO:0071569) |
| 0.1 |
2.0 |
GO:0045214 |
sarcomere organization(GO:0045214) |
| 0.1 |
2.2 |
GO:0035058 |
nonmotile primary cilium assembly(GO:0035058) |
| 0.1 |
0.3 |
GO:0050995 |
negative regulation of lipid catabolic process(GO:0050995) |
| 0.1 |
0.2 |
GO:0019441 |
tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) kynurenine metabolic process(GO:0070189) |
| 0.1 |
0.8 |
GO:0032094 |
response to food(GO:0032094) |
| 0.1 |
0.5 |
GO:0035881 |
amacrine cell differentiation(GO:0035881) |
| 0.1 |
0.4 |
GO:0048505 |
regulation of timing of cell differentiation(GO:0048505) |
| 0.1 |
1.0 |
GO:0043277 |
apoptotic cell clearance(GO:0043277) |
| 0.1 |
0.3 |
GO:0071361 |
cellular response to ethanol(GO:0071361) |
| 0.1 |
0.6 |
GO:0061179 |
negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.1 |
0.4 |
GO:0034453 |
microtubule anchoring(GO:0034453) |
| 0.1 |
0.7 |
GO:0043162 |
ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.1 |
0.4 |
GO:0030035 |
microspike assembly(GO:0030035) |
| 0.1 |
1.2 |
GO:0003016 |
respiratory system process(GO:0003016) |
| 0.1 |
1.5 |
GO:0045022 |
early endosome to late endosome transport(GO:0045022) |
| 0.1 |
0.4 |
GO:0048733 |
sebaceous gland development(GO:0048733) |
| 0.1 |
0.9 |
GO:0035873 |
lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.1 |
0.5 |
GO:0015813 |
L-glutamate transport(GO:0015813) |
| 0.1 |
0.5 |
GO:0006699 |
bile acid biosynthetic process(GO:0006699) |
| 0.1 |
1.5 |
GO:1902653 |
cholesterol biosynthetic process(GO:0006695) secondary alcohol biosynthetic process(GO:1902653) |
| 0.1 |
0.2 |
GO:0005981 |
regulation of glycogen catabolic process(GO:0005981) |
| 0.1 |
1.2 |
GO:0043388 |
positive regulation of DNA binding(GO:0043388) |
| 0.1 |
0.5 |
GO:0051220 |
cytoplasmic sequestering of protein(GO:0051220) |
| 0.1 |
1.1 |
GO:0016180 |
snRNA processing(GO:0016180) |
| 0.1 |
0.3 |
GO:0071044 |
histone mRNA catabolic process(GO:0071044) |
| 0.1 |
1.0 |
GO:0031062 |
positive regulation of histone methylation(GO:0031062) |
| 0.1 |
0.6 |
GO:0043631 |
mRNA polyadenylation(GO:0006378) RNA polyadenylation(GO:0043631) |
| 0.1 |
0.2 |
GO:0019065 |
receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.1 |
0.4 |
GO:0007035 |
vacuolar acidification(GO:0007035) |
| 0.1 |
2.3 |
GO:0008306 |
associative learning(GO:0008306) |
| 0.1 |
0.4 |
GO:1990440 |
positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
| 0.1 |
0.4 |
GO:0055025 |
positive regulation of cardiac muscle tissue development(GO:0055025) |
| 0.0 |
0.3 |
GO:0033260 |
nuclear DNA replication(GO:0033260) |
| 0.0 |
0.1 |
GO:0018065 |
protein-cofactor linkage(GO:0018065) |
| 0.0 |
1.2 |
GO:0045761 |
regulation of adenylate cyclase activity(GO:0045761) |
| 0.0 |
0.7 |
GO:0042407 |
cristae formation(GO:0042407) |
| 0.0 |
0.2 |
GO:0048227 |
plasma membrane to endosome transport(GO:0048227) |
| 0.0 |
0.5 |
GO:2000821 |
synaptic vesicle maturation(GO:0016188) regulation of grooming behavior(GO:2000821) |
| 0.0 |
0.7 |
GO:0018345 |
protein palmitoylation(GO:0018345) |
| 0.0 |
0.2 |
GO:0051409 |
response to nitrosative stress(GO:0051409) |
| 0.0 |
0.1 |
GO:0010739 |
positive regulation of protein kinase A signaling(GO:0010739) |
| 0.0 |
11.4 |
GO:0008380 |
RNA splicing(GO:0008380) |
| 0.0 |
0.1 |
GO:1903960 |
negative regulation of anion transmembrane transport(GO:1903960) |
| 0.0 |
0.0 |
GO:0048539 |
bone marrow development(GO:0048539) |
| 0.0 |
0.1 |
GO:0051030 |
snRNA transport(GO:0051030) |
| 0.0 |
0.3 |
GO:1902187 |
negative regulation of viral release from host cell(GO:1902187) |
| 0.0 |
0.3 |
GO:0022900 |
electron transport chain(GO:0022900) |
| 0.0 |
0.2 |
GO:0046208 |
spermine catabolic process(GO:0046208) |
| 0.0 |
0.8 |
GO:0061003 |
positive regulation of dendritic spine morphogenesis(GO:0061003) |
| 0.0 |
0.7 |
GO:0016925 |
protein sumoylation(GO:0016925) |
| 0.0 |
0.1 |
GO:0042523 |
positive regulation of tyrosine phosphorylation of Stat5 protein(GO:0042523) |
| 0.0 |
0.1 |
GO:0006421 |
asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.0 |
0.1 |
GO:0006848 |
pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
| 0.0 |
0.4 |
GO:0007250 |
activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.0 |
0.5 |
GO:0010388 |
protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
| 0.0 |
0.7 |
GO:0046856 |
phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.0 |
0.1 |
GO:0035459 |
cargo loading into vesicle(GO:0035459) cargo loading into COPII-coated vesicle(GO:0090110) regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.0 |
0.4 |
GO:0045777 |
positive regulation of blood pressure(GO:0045777) |
| 0.0 |
0.1 |
GO:0021691 |
cerebellar Purkinje cell layer maturation(GO:0021691) |
| 0.0 |
0.2 |
GO:0042989 |
sequestering of actin monomers(GO:0042989) |
| 0.0 |
1.2 |
GO:0043154 |
negative regulation of cysteine-type endopeptidase activity involved in apoptotic process(GO:0043154) negative regulation of cysteine-type endopeptidase activity(GO:2000117) |
| 0.0 |
0.4 |
GO:2000311 |
regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.0 |
1.0 |
GO:0035329 |
hippo signaling(GO:0035329) |
| 0.0 |
0.2 |
GO:0014742 |
positive regulation of cardiac muscle hypertrophy(GO:0010613) positive regulation of muscle hypertrophy(GO:0014742) |
| 0.0 |
0.2 |
GO:0007168 |
receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.0 |
0.6 |
GO:0006044 |
N-acetylglucosamine metabolic process(GO:0006044) |
| 0.0 |
0.4 |
GO:0095500 |
acetylcholine receptor signaling pathway(GO:0095500) postsynaptic signal transduction(GO:0098926) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
| 0.0 |
0.2 |
GO:0015692 |
vanadium ion transport(GO:0015676) lead ion transport(GO:0015692) |
| 0.0 |
0.2 |
GO:0019585 |
uronic acid metabolic process(GO:0006063) glucuronate metabolic process(GO:0019585) cellular glucuronidation(GO:0052695) |
| 0.0 |
0.1 |
GO:0043461 |
proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 0.0 |
0.2 |
GO:0006627 |
protein processing involved in protein targeting to mitochondrion(GO:0006627) mitochondrial protein processing(GO:0034982) |
| 0.0 |
0.1 |
GO:0048069 |
eye pigmentation(GO:0048069) |
| 0.0 |
0.5 |
GO:0043949 |
regulation of cAMP-mediated signaling(GO:0043949) |
| 0.0 |
0.8 |
GO:0046626 |
regulation of insulin receptor signaling pathway(GO:0046626) |
| 0.0 |
0.2 |
GO:0075522 |
IRES-dependent viral translational initiation(GO:0075522) |
| 0.0 |
0.1 |
GO:0030422 |
production of siRNA involved in RNA interference(GO:0030422) |
| 0.0 |
0.2 |
GO:0055013 |
cardiac muscle cell development(GO:0055013) |
| 0.0 |
0.1 |
GO:0010561 |
negative regulation of glycoprotein biosynthetic process(GO:0010561) negative regulation of glycoprotein metabolic process(GO:1903019) |
| 0.0 |
0.3 |
GO:0006907 |
pinocytosis(GO:0006907) |
| 0.0 |
0.3 |
GO:0060395 |
SMAD protein signal transduction(GO:0060395) |
| 0.0 |
0.1 |
GO:0034637 |
cellular carbohydrate biosynthetic process(GO:0034637) |
| 0.0 |
0.2 |
GO:0003170 |
heart valve development(GO:0003170) |
| 0.0 |
0.8 |
GO:1901998 |
toxin transport(GO:1901998) |
| 0.0 |
0.1 |
GO:0046060 |
dATP metabolic process(GO:0046060) |
| 0.0 |
1.2 |
GO:0006506 |
GPI anchor biosynthetic process(GO:0006506) |
| 0.0 |
0.3 |
GO:0048172 |
regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.0 |
0.6 |
GO:0006879 |
cellular iron ion homeostasis(GO:0006879) |
| 0.0 |
0.9 |
GO:0010765 |
positive regulation of sodium ion transport(GO:0010765) |
| 0.0 |
0.2 |
GO:0034219 |
carbohydrate transmembrane transport(GO:0034219) |
| 0.0 |
0.3 |
GO:0031100 |
organ regeneration(GO:0031100) |
| 0.0 |
0.0 |
GO:0086023 |
adrenergic receptor signaling pathway involved in heart process(GO:0086023) G-protein coupled receptor signaling pathway involved in heart process(GO:0086103) |
| 0.0 |
0.3 |
GO:0046597 |
negative regulation of viral entry into host cell(GO:0046597) |
| 0.0 |
0.0 |
GO:0045763 |
negative regulation of cellular amino acid metabolic process(GO:0045763) |
| 0.0 |
0.4 |
GO:2000648 |
positive regulation of stem cell proliferation(GO:2000648) |
| 0.0 |
0.1 |
GO:0010623 |
programmed cell death involved in cell development(GO:0010623) |
| 0.0 |
0.1 |
GO:0006123 |
mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.0 |
1.0 |
GO:0072583 |
clathrin-mediated endocytosis(GO:0072583) |
| 0.0 |
0.0 |
GO:0071158 |
positive regulation of cell cycle arrest(GO:0071158) |
| 0.0 |
0.1 |
GO:0008089 |
anterograde axonal transport(GO:0008089) |
| 0.0 |
0.1 |
GO:0009235 |
cobalamin metabolic process(GO:0009235) |
| 0.0 |
0.4 |
GO:0006418 |
tRNA aminoacylation for protein translation(GO:0006418) |
| 0.0 |
1.2 |
GO:0042273 |
ribosomal large subunit biogenesis(GO:0042273) |
| 0.0 |
0.1 |
GO:0009174 |
UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
| 0.0 |
0.2 |
GO:0034389 |
lipid particle organization(GO:0034389) |
| 0.0 |
0.1 |
GO:0070306 |
lens fiber cell differentiation(GO:0070306) |
| 0.0 |
0.4 |
GO:0032011 |
ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.0 |
0.3 |
GO:0006465 |
signal peptide processing(GO:0006465) |
| 0.0 |
0.2 |
GO:0061154 |
endothelial tube morphogenesis(GO:0061154) |
| 0.0 |
0.1 |
GO:0015959 |
diadenosine polyphosphate metabolic process(GO:0015959) |
| 0.0 |
0.1 |
GO:0042136 |
neurotransmitter biosynthetic process(GO:0042136) |
| 0.0 |
1.3 |
GO:0030041 |
actin filament polymerization(GO:0030041) |
| 0.0 |
0.6 |
GO:0006446 |
regulation of translational initiation(GO:0006446) |
| 0.0 |
0.1 |
GO:0002755 |
MyD88-dependent toll-like receptor signaling pathway(GO:0002755) |
| 0.0 |
0.1 |
GO:0071357 |
type I interferon signaling pathway(GO:0060337) cellular response to type I interferon(GO:0071357) |
| 0.0 |
0.2 |
GO:1900746 |
regulation of vascular endothelial growth factor signaling pathway(GO:1900746) regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902547) |
| 0.0 |
0.2 |
GO:0030890 |
positive regulation of B cell proliferation(GO:0030890) |
| 0.0 |
0.1 |
GO:0007585 |
respiratory gaseous exchange(GO:0007585) |
| 0.0 |
0.5 |
GO:0007613 |
memory(GO:0007613) |
| 0.0 |
0.1 |
GO:0090200 |
positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.0 |
0.2 |
GO:0007218 |
neuropeptide signaling pathway(GO:0007218) |
| 0.0 |
0.0 |
GO:0009062 |
fatty acid catabolic process(GO:0009062) |
| 0.0 |
0.0 |
GO:1903541 |
regulation of exosomal secretion(GO:1903541) positive regulation of exosomal secretion(GO:1903543) |
| 0.0 |
0.1 |
GO:0071166 |
ribonucleoprotein complex localization(GO:0071166) |
