| 0.2 |
1.0 |
GO:0015671 |
oxygen transport(GO:0015671) |
| 0.2 |
0.5 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.1 |
1.3 |
GO:0090232 |
positive regulation of spindle checkpoint(GO:0090232) |
| 0.1 |
0.3 |
GO:0006106 |
fumarate metabolic process(GO:0006106) aspartate catabolic process(GO:0006533) |
| 0.1 |
0.5 |
GO:1904529 |
regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
| 0.1 |
0.4 |
GO:0003223 |
ventricular compact myocardium morphogenesis(GO:0003223) proprioception(GO:0019230) |
| 0.1 |
1.7 |
GO:0001574 |
ganglioside biosynthetic process(GO:0001574) |
| 0.1 |
0.2 |
GO:0090202 |
transcriptional activation by promoter-enhancer looping(GO:0071733) regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 0.1 |
1.0 |
GO:0060837 |
blood vessel endothelial cell differentiation(GO:0060837) |
| 0.1 |
0.2 |
GO:0001978 |
regulation of systemic arterial blood pressure by carotid sinus baroreceptor feedback(GO:0001978) |
| 0.1 |
0.7 |
GO:0030322 |
stabilization of membrane potential(GO:0030322) |
| 0.1 |
0.2 |
GO:0036092 |
phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.1 |
0.2 |
GO:2000211 |
regulation of glutamate metabolic process(GO:2000211) |
| 0.1 |
0.2 |
GO:1904694 |
negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.0 |
0.1 |
GO:0010512 |
negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
| 0.0 |
0.1 |
GO:0033184 |
positive regulation of histone ubiquitination(GO:0033184) |
| 0.0 |
0.6 |
GO:0043508 |
negative regulation of JUN kinase activity(GO:0043508) |
| 0.0 |
0.7 |
GO:0050774 |
negative regulation of dendrite morphogenesis(GO:0050774) |
| 0.0 |
0.3 |
GO:0060907 |
positive regulation of macrophage cytokine production(GO:0060907) |
| 0.0 |
0.3 |
GO:0051204 |
protein insertion into mitochondrial membrane(GO:0051204) |
| 0.0 |
0.1 |
GO:1901030 |
positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
| 0.0 |
0.3 |
GO:0033690 |
positive regulation of osteoblast proliferation(GO:0033690) |
| 0.0 |
0.2 |
GO:0061052 |
negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.0 |
1.3 |
GO:0010501 |
RNA secondary structure unwinding(GO:0010501) |
| 0.0 |
0.1 |
GO:2000210 |
positive regulation of anoikis(GO:2000210) |
| 0.0 |
0.2 |
GO:0008298 |
intracellular mRNA localization(GO:0008298) |
| 0.0 |
0.3 |
GO:0036376 |
sodium ion export from cell(GO:0036376) |
| 0.0 |
0.1 |
GO:0009838 |
abscission(GO:0009838) |
| 0.0 |
1.0 |
GO:0006378 |
mRNA polyadenylation(GO:0006378) |
| 0.0 |
0.2 |
GO:2000628 |
regulation of miRNA metabolic process(GO:2000628) |
| 0.0 |
0.1 |
GO:0032417 |
positive regulation of sodium:proton antiporter activity(GO:0032417) negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
| 0.0 |
0.3 |
GO:0015937 |
coenzyme A biosynthetic process(GO:0015937) |
| 0.0 |
0.1 |
GO:0009249 |
protein lipoylation(GO:0009249) |
| 0.0 |
0.2 |
GO:0042359 |
vitamin D metabolic process(GO:0042359) |
| 0.0 |
0.1 |
GO:0046784 |
viral mRNA export from host cell nucleus(GO:0046784) |
| 0.0 |
0.2 |
GO:0045792 |
negative regulation of cell size(GO:0045792) |
| 0.0 |
0.2 |
GO:0030953 |
astral microtubule organization(GO:0030953) |
| 0.0 |
0.7 |
GO:0005978 |
glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
| 0.0 |
0.3 |
GO:0030262 |
cellular component disassembly involved in execution phase of apoptosis(GO:0006921) apoptotic nuclear changes(GO:0030262) |
| 0.0 |
0.1 |
GO:1901799 |
negative regulation of proteasomal protein catabolic process(GO:1901799) |
| 0.0 |
0.5 |
GO:0060135 |
maternal process involved in female pregnancy(GO:0060135) |
| 0.0 |
0.2 |
GO:0000042 |
protein targeting to Golgi(GO:0000042) |
| 0.0 |
0.1 |
GO:0071578 |
zinc II ion transmembrane import(GO:0071578) |
| 0.0 |
0.3 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-dependent nucleosome organization(GO:0034723) DNA replication-independent nucleosome organization(GO:0034724) |
| 0.0 |
0.1 |
GO:0002315 |
marginal zone B cell differentiation(GO:0002315) |
