Motif ID: Dmc1
Z-value: 1.138
Transcription factors associated with Dmc1:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| Dmc1 | ENSMUSG00000022429.10 | Dmc1 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Dmc1 | mm10_v2_chr15_-_79605084_79605114 | 0.22 | 4.9e-02 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.5 | 9.9 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 1.6 | 4.8 | GO:0016998 | cell wall macromolecule catabolic process(GO:0016998) |
| 1.3 | 3.8 | GO:0051464 | positive regulation of cortisol secretion(GO:0051464) |
| 1.0 | 3.9 | GO:0006710 | androgen catabolic process(GO:0006710) |
| 0.7 | 3.7 | GO:0052428 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.7 | 2.1 | GO:2001187 | positive regulation of CD8-positive, alpha-beta T cell activation(GO:2001187) |
| 0.7 | 2.6 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
| 0.7 | 4.0 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.7 | 2.0 | GO:0042196 | dichloromethane metabolic process(GO:0018900) chlorinated hydrocarbon metabolic process(GO:0042196) halogenated hydrocarbon metabolic process(GO:0042197) |
| 0.6 | 3.2 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
| 0.6 | 1.9 | GO:0032632 | interleukin-3 production(GO:0032632) |
| 0.6 | 2.5 | GO:0002428 | antigen processing and presentation of peptide antigen via MHC class Ib(GO:0002428) antigen processing and presentation of exogenous peptide antigen via MHC class Ib(GO:0002477) antigen processing and presentation of exogenous protein antigen via MHC class Ib, TAP-dependent(GO:0002481) regulation of iron ion transport(GO:0034756) regulation of iron ion transmembrane transport(GO:0034759) |
| 0.5 | 3.3 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.4 | 2.2 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
| 0.4 | 2.2 | GO:0010025 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.4 | 1.2 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
| 0.4 | 2.4 | GO:0098707 | ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
| 0.4 | 2.3 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 0.4 | 3.5 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.4 | 7.2 | GO:0002495 | antigen processing and presentation of peptide antigen via MHC class II(GO:0002495) |
| 0.4 | 1.1 | GO:0032240 | RNA import into nucleus(GO:0006404) mRNA export from nucleus in response to heat stress(GO:0031990) negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.4 | 1.8 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
| 0.4 | 1.8 | GO:0000019 | regulation of mitotic recombination(GO:0000019) telomeric 3' overhang formation(GO:0031860) |
| 0.4 | 1.1 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.4 | 2.1 | GO:0006590 | thyroid hormone generation(GO:0006590) |
| 0.4 | 5.3 | GO:0033623 | regulation of integrin activation(GO:0033623) |
| 0.3 | 1.0 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.3 | 9.9 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.3 | 11.4 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
| 0.3 | 0.9 | GO:0015910 | peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.3 | 0.9 | GO:0050925 | negative regulation of negative chemotaxis(GO:0050925) |
| 0.3 | 3.4 | GO:0046512 | sphingosine biosynthetic process(GO:0046512) sphingoid biosynthetic process(GO:0046520) |
| 0.3 | 0.9 | GO:0002182 | cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
| 0.3 | 2.4 | GO:0000050 | urea cycle(GO:0000050) urea metabolic process(GO:0019627) |
| 0.3 | 5.2 | GO:0030574 | collagen catabolic process(GO:0030574) |
| 0.3 | 1.2 | GO:0046947 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.3 | 1.2 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.3 | 2.5 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.3 | 3.5 | GO:0045741 | positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
| 0.3 | 1.1 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.3 | 0.8 | GO:0051771 | negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
| 0.3 | 1.5 | GO:1903275 | positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
| 0.2 | 0.2 | GO:0036023 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
| 0.2 | 1.4 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.2 | 0.9 | GO:2000319 | negative regulation of T-helper 17 type immune response(GO:2000317) regulation of T-helper 17 cell differentiation(GO:2000319) negative regulation of T-helper 17 cell differentiation(GO:2000320) |
| 0.2 | 1.4 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
| 0.2 | 4.2 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.2 | 1.4 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.2 | 1.5 | GO:0019348 | dolichol metabolic process(GO:0019348) |
| 0.2 | 0.6 | GO:0006011 | UDP-glucose metabolic process(GO:0006011) |
| 0.2 | 2.5 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.2 | 0.6 | GO:0070649 | meiotic chromosome movement towards spindle pole(GO:0016344) formin-nucleated actin cable assembly(GO:0070649) |
| 0.2 | 0.4 | GO:0002730 | regulation of dendritic cell cytokine production(GO:0002730) |
| 0.2 | 2.5 | GO:0070842 | aggresome assembly(GO:0070842) |
| 0.2 | 2.6 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 0.2 | 2.7 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.2 | 0.9 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.2 | 0.8 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
| 0.2 | 0.8 | GO:0008355 | olfactory learning(GO:0008355) |
| 0.2 | 0.5 | GO:0071336 | regulation of hair follicle cell proliferation(GO:0071336) positive regulation of hair follicle cell proliferation(GO:0071338) |
| 0.2 | 1.6 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.2 | 0.9 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
| 0.2 | 1.7 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
| 0.1 | 0.6 | GO:0097494 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) regulation of vesicle size(GO:0097494) |
| 0.1 | 0.6 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.1 | 1.5 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
| 0.1 | 0.5 | GO:0051593 | response to folic acid(GO:0051593) |
| 0.1 | 1.7 | GO:2001135 | regulation of endocytic recycling(GO:2001135) |
| 0.1 | 2.4 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.1 | 1.8 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.1 | 0.7 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.1 | 1.3 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.1 | 0.4 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.6 | GO:0097343 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
| 0.1 | 0.6 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.1 | 1.1 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.1 | 1.3 | GO:0042572 | retinol metabolic process(GO:0042572) |
| 0.1 | 0.9 | GO:0021984 | adenohypophysis development(GO:0021984) |
| 0.1 | 0.3 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
| 0.1 | 1.4 | GO:0001711 | endodermal cell fate commitment(GO:0001711) |
| 0.1 | 3.2 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
| 0.1 | 0.7 | GO:0031424 | keratinization(GO:0031424) |
| 0.1 | 0.4 | GO:0046519 | sphingoid metabolic process(GO:0046519) |
| 0.1 | 0.5 | GO:0002553 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.1 | 1.5 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.1 | 15.7 | GO:0007416 | synapse assembly(GO:0007416) |
| 0.1 | 3.5 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
| 0.1 | 0.4 | GO:0043247 | telomere maintenance in response to DNA damage(GO:0043247) |
| 0.1 | 0.6 | GO:2000819 | regulation of nucleotide-excision repair(GO:2000819) |
| 0.1 | 0.5 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 0.1 | 0.9 | GO:0006544 | glycine metabolic process(GO:0006544) |
| 0.1 | 0.4 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.1 | 0.7 | GO:1901162 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
| 0.1 | 0.2 | GO:0006295 | nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) |
| 0.1 | 0.3 | GO:0032229 | negative regulation of synaptic transmission, GABAergic(GO:0032229) |
| 0.1 | 0.5 | GO:0042045 | epithelial fluid transport(GO:0042045) |
| 0.1 | 0.2 | GO:0038044 | transforming growth factor-beta secretion(GO:0038044) |
| 0.1 | 1.3 | GO:0060219 | camera-type eye photoreceptor cell differentiation(GO:0060219) |
| 0.1 | 0.2 | GO:0046077 | dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate metabolic process(GO:0009138) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
| 0.1 | 1.4 | GO:0036010 | protein localization to endosome(GO:0036010) |
| 0.1 | 1.6 | GO:0031297 | replication fork processing(GO:0031297) |
| 0.1 | 0.5 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
| 0.1 | 1.5 | GO:0007097 | nuclear migration(GO:0007097) establishment of nucleus localization(GO:0040023) |
| 0.1 | 2.1 | GO:0043171 | peptide catabolic process(GO:0043171) |
| 0.1 | 0.6 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.1 | 1.4 | GO:1900449 | regulation of glutamate receptor signaling pathway(GO:1900449) |
| 0.1 | 1.3 | GO:0097435 | fibril organization(GO:0097435) |
| 0.1 | 0.7 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
| 0.1 | 0.8 | GO:0044872 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.1 | 1.6 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.1 | 0.1 | GO:1902527 | positive regulation of protein monoubiquitination(GO:1902527) |
| 0.1 | 3.1 | GO:0045773 | positive regulation of axon extension(GO:0045773) |
| 0.1 | 0.5 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.1 | 2.7 | GO:0031102 | neuron projection regeneration(GO:0031102) |
| 0.1 | 0.3 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.1 | 0.5 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.1 | 2.5 | GO:0046825 | regulation of protein export from nucleus(GO:0046825) |
| 0.1 | 1.3 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
| 0.1 | 0.6 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.1 | 2.7 | GO:0007606 | sensory perception of chemical stimulus(GO:0007606) |
| 0.1 | 3.0 | GO:0080171 | lysosome organization(GO:0007040) lytic vacuole organization(GO:0080171) |
| 0.1 | 4.0 | GO:0030032 | lamellipodium assembly(GO:0030032) |
| 0.1 | 4.2 | GO:0007601 | visual perception(GO:0007601) |
| 0.0 | 0.3 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.0 | 0.3 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.0 | 0.1 | GO:0002925 | positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 0.0 | 0.5 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.0 | 0.7 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
| 0.0 | 0.8 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
| 0.0 | 0.4 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.0 | 0.2 | GO:0051096 | maintenance of DNA repeat elements(GO:0043570) positive regulation of helicase activity(GO:0051096) |
| 0.0 | 0.5 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.0 | 1.5 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 0.0 | 0.2 | GO:2000258 | negative regulation of complement activation(GO:0045916) negative regulation of protein activation cascade(GO:2000258) |
| 0.0 | 1.6 | GO:0043620 | regulation of DNA-templated transcription in response to stress(GO:0043620) |
| 0.0 | 0.3 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.0 | 0.1 | GO:1905245 | regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902959) positive regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902961) regulation of aspartic-type peptidase activity(GO:1905245) positive regulation of aspartic-type peptidase activity(GO:1905247) |
| 0.0 | 1.6 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
| 0.0 | 0.7 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
| 0.0 | 1.4 | GO:0006360 | transcription from RNA polymerase I promoter(GO:0006360) |
| 0.0 | 0.5 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
| 0.0 | 1.7 | GO:0009063 | cellular amino acid catabolic process(GO:0009063) |
| 0.0 | 0.3 | GO:1990403 | embryonic brain development(GO:1990403) |
| 0.0 | 0.9 | GO:0034605 | cellular response to heat(GO:0034605) |
| 0.0 | 0.4 | GO:0031960 | response to corticosteroid(GO:0031960) response to glucocorticoid(GO:0051384) |
| 0.0 | 0.2 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.0 | 0.2 | GO:0060019 | radial glial cell differentiation(GO:0060019) |
| 0.0 | 0.3 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
| 0.0 | 0.9 | GO:2000272 | negative regulation of receptor activity(GO:2000272) |
| 0.0 | 0.1 | GO:0021554 | optic nerve development(GO:0021554) |
| 0.0 | 0.3 | GO:0099563 | modification of synaptic structure(GO:0099563) |
| 0.0 | 0.2 | GO:0007141 | male meiosis I(GO:0007141) |
| 0.0 | 0.2 | GO:0034308 | primary alcohol metabolic process(GO:0034308) |
| 0.0 | 0.2 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.0 | 0.6 | GO:0030514 | negative regulation of BMP signaling pathway(GO:0030514) |
| 0.0 | 0.4 | GO:0008299 | isoprenoid biosynthetic process(GO:0008299) |
| 0.0 | 0.7 | GO:0072527 | pyrimidine-containing compound metabolic process(GO:0072527) |
| 0.0 | 0.8 | GO:0045744 | negative regulation of G-protein coupled receptor protein signaling pathway(GO:0045744) |
| 0.0 | 0.2 | GO:1904294 | positive regulation of ERAD pathway(GO:1904294) |
| 0.0 | 0.2 | GO:0071467 | cellular response to pH(GO:0071467) |
| 0.0 | 0.4 | GO:2001240 | negative regulation of signal transduction in absence of ligand(GO:1901099) negative regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001240) |
| 0.0 | 0.6 | GO:0001825 | blastocyst formation(GO:0001825) |
| 0.0 | 0.4 | GO:0007094 | mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
| 0.0 | 0.5 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
| 0.0 | 0.0 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.0 | 0.4 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.0 | 0.1 | GO:1900364 | negative regulation of mRNA 3'-end processing(GO:0031441) negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.0 | 0.9 | GO:0032436 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032436) |
| 0.0 | 0.3 | GO:0060395 | SMAD protein signal transduction(GO:0060395) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.3 | 9.9 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 1.0 | 4.8 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.9 | 2.8 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
| 0.9 | 2.8 | GO:0044299 | C-fiber(GO:0044299) |
| 0.5 | 1.6 | GO:1903095 | microprocessor complex(GO:0070877) ribonuclease III complex(GO:1903095) |
| 0.5 | 4.9 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.4 | 1.9 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) tertiary granule(GO:0070820) |
| 0.4 | 1.5 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.3 | 1.0 | GO:1990075 | kinesin II complex(GO:0016939) periciliary membrane compartment(GO:1990075) |
| 0.3 | 1.8 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.3 | 1.4 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.3 | 0.3 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.3 | 0.8 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
| 0.3 | 1.6 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.3 | 3.1 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.2 | 1.5 | GO:0070695 | FHF complex(GO:0070695) |
| 0.2 | 6.7 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.2 | 1.1 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 0.2 | 3.2 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
| 0.2 | 0.5 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.2 | 2.1 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.2 | 2.8 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.2 | 1.7 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.1 | 0.7 | GO:0001533 | cornified envelope(GO:0001533) |
| 0.1 | 0.9 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.1 | 1.0 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.1 | 1.4 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.1 | 1.2 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.1 | 0.6 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
| 0.1 | 1.3 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
| 0.1 | 0.5 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.1 | 2.2 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.1 | 1.8 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.1 | 9.6 | GO:0001725 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
| 0.1 | 1.4 | GO:0036038 | MKS complex(GO:0036038) |
| 0.1 | 0.7 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.1 | 2.2 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
| 0.1 | 1.2 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.1 | 0.5 | GO:0042581 | primary lysosome(GO:0005766) specific granule(GO:0042581) azurophil granule(GO:0042582) |
| 0.1 | 1.3 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.1 | 0.5 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.1 | 0.8 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.1 | 2.7 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.1 | 1.1 | GO:0042588 | zymogen granule(GO:0042588) |
| 0.1 | 4.9 | GO:0005811 | lipid particle(GO:0005811) |
| 0.1 | 1.4 | GO:0005605 | basal lamina(GO:0005605) |
| 0.1 | 11.2 | GO:0010008 | endosome membrane(GO:0010008) |
| 0.1 | 0.8 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
| 0.1 | 0.4 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.1 | 1.2 | GO:0042641 | actomyosin(GO:0042641) |
| 0.1 | 0.4 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.1 | 0.6 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
| 0.1 | 0.2 | GO:0034684 | integrin alphav-beta5 complex(GO:0034684) |
| 0.1 | 0.9 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.0 | 0.5 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.0 | 0.3 | GO:0031105 | septin complex(GO:0031105) |
| 0.0 | 0.9 | GO:0030673 | axolemma(GO:0030673) |
| 0.0 | 0.6 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.0 | 0.8 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.0 | 0.6 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.0 | 0.7 | GO:0008305 | integrin complex(GO:0008305) protein complex involved in cell adhesion(GO:0098636) |
| 0.0 | 0.5 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.0 | 1.4 | GO:0032590 | dendrite membrane(GO:0032590) |
| 0.0 | 0.7 | GO:0014704 | intercalated disc(GO:0014704) |
| 0.0 | 0.1 | GO:0070381 | endosome to plasma membrane transport vesicle(GO:0070381) |
| 0.0 | 30.3 | GO:0005887 | integral component of plasma membrane(GO:0005887) |
| 0.0 | 0.4 | GO:0031045 | dense core granule(GO:0031045) |
| 0.0 | 0.2 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.0 | 0.2 | GO:0032300 | mismatch repair complex(GO:0032300) |
| 0.0 | 1.0 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
| 0.0 | 1.8 | GO:0030136 | clathrin-coated vesicle(GO:0030136) |
| 0.0 | 1.5 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 3.7 | GO:0008021 | synaptic vesicle(GO:0008021) |
| 0.0 | 3.4 | GO:0045211 | postsynaptic membrane(GO:0045211) |
| 0.0 | 0.9 | GO:0005778 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.0 | 0.8 | GO:0016235 | aggresome(GO:0016235) |
| 0.0 | 1.8 | GO:0042383 | sarcolemma(GO:0042383) |
| 0.0 | 1.2 | GO:0005604 | basement membrane(GO:0005604) |
| 0.0 | 0.2 | GO:0060170 | ciliary membrane(GO:0060170) |
| 0.0 | 0.5 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.0 | 1.4 | GO:0045111 | intermediate filament cytoskeleton(GO:0045111) |
| 0.0 | 0.2 | GO:0005675 | DNA replication factor A complex(GO:0005662) holo TFIIH complex(GO:0005675) |
| 0.0 | 0.3 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.0 | 0.6 | GO:0015030 | Cajal body(GO:0015030) |
| 0.0 | 0.1 | GO:0005921 | gap junction(GO:0005921) |
| 0.0 | 0.3 | GO:0031672 | A band(GO:0031672) |
| 0.0 | 0.1 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.0 | 1.5 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
| 0.0 | 0.5 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
| 0.0 | 4.5 | GO:0005764 | lytic vacuole(GO:0000323) lysosome(GO:0005764) |
| 0.0 | 0.6 | GO:0005902 | microvillus(GO:0005902) |
| 0.0 | 0.2 | GO:0070382 | exocytic vesicle(GO:0070382) |
| 0.0 | 0.1 | GO:0097342 | ripoptosome(GO:0097342) |
| 0.0 | 1.3 | GO:0005923 | bicellular tight junction(GO:0005923) occluding junction(GO:0070160) |
| 0.0 | 1.9 | GO:0031965 | nuclear membrane(GO:0031965) |
| 0.0 | 0.3 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.0 | 0.2 | GO:0030686 | 90S preribosome(GO:0030686) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.6 | 4.8 | GO:0003796 | lysozyme activity(GO:0003796) |
| 1.4 | 4.1 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 1.3 | 6.4 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 0.9 | 3.8 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.9 | 12.8 | GO:0005537 | mannose binding(GO:0005537) |
| 0.8 | 3.4 | GO:0017050 | sphinganine kinase activity(GO:0008481) D-erythro-sphingosine kinase activity(GO:0017050) |
| 0.8 | 4.2 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 0.7 | 0.7 | GO:0004998 | transferrin receptor activity(GO:0004998) |
| 0.7 | 2.7 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
| 0.7 | 2.6 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.7 | 2.0 | GO:0019120 | hydrolase activity, acting on acid halide bonds(GO:0016824) hydrolase activity, acting on acid halide bonds, in C-halide compounds(GO:0019120) alkylhalidase activity(GO:0047651) |
| 0.6 | 3.9 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
| 0.6 | 7.2 | GO:0001846 | opsonin binding(GO:0001846) |
| 0.5 | 2.1 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 0.5 | 2.0 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
| 0.5 | 4.2 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.4 | 2.2 | GO:0080019 | fatty-acyl-CoA reductase (alcohol-forming) activity(GO:0080019) |
| 0.4 | 1.2 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.4 | 5.3 | GO:0031005 | filamin binding(GO:0031005) |
| 0.4 | 1.1 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.4 | 1.4 | GO:1990269 | RNA polymerase II C-terminal domain phosphoserine binding(GO:1990269) |
| 0.3 | 9.9 | GO:0019707 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.3 | 1.6 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
| 0.3 | 1.6 | GO:0004525 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
| 0.3 | 1.8 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
| 0.3 | 7.2 | GO:0042287 | MHC protein binding(GO:0042287) |
| 0.3 | 1.2 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
| 0.3 | 1.5 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
| 0.3 | 0.8 | GO:0042954 | lipoprotein transporter activity(GO:0042954) |
| 0.3 | 0.8 | GO:0004660 | protein farnesyltransferase activity(GO:0004660) |
| 0.3 | 0.8 | GO:0004534 | transcription termination site sequence-specific DNA binding(GO:0001147) transcription termination site DNA binding(GO:0001160) 5'-3' exoribonuclease activity(GO:0004534) |
| 0.2 | 2.2 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.2 | 1.7 | GO:0015091 | ferric iron transmembrane transporter activity(GO:0015091) trivalent inorganic cation transmembrane transporter activity(GO:0072510) |
| 0.2 | 6.1 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.2 | 0.9 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.2 | 0.7 | GO:0004510 | tryptophan 5-monooxygenase activity(GO:0004510) |
| 0.2 | 0.7 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.2 | 1.3 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
| 0.2 | 2.6 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
| 0.2 | 1.4 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.2 | 0.9 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.2 | 2.8 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
| 0.2 | 0.9 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.2 | 1.9 | GO:0015299 | solute:proton antiporter activity(GO:0015299) |
| 0.2 | 0.6 | GO:0000832 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.1 | 3.2 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.1 | 1.0 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.1 | 1.4 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.1 | 0.6 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.1 | 9.9 | GO:0004714 | transmembrane receptor protein tyrosine kinase activity(GO:0004714) |
| 0.1 | 0.5 | GO:0004104 | cholinesterase activity(GO:0004104) choline binding(GO:0033265) |
| 0.1 | 0.8 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
| 0.1 | 1.6 | GO:0008517 | folic acid transporter activity(GO:0008517) |
| 0.1 | 0.5 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 0.1 | 0.5 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.1 | 0.8 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.1 | 0.3 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
| 0.1 | 0.4 | GO:0050347 | trans-hexaprenyltranstransferase activity(GO:0000010) trans-octaprenyltranstransferase activity(GO:0050347) |
| 0.1 | 0.3 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
| 0.1 | 3.5 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.1 | 2.4 | GO:0005521 | lamin binding(GO:0005521) |
| 0.1 | 0.9 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.1 | 1.5 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 0.1 | 0.5 | GO:0001010 | transcription factor activity, sequence-specific DNA binding transcription factor recruiting(GO:0001010) |
| 0.1 | 2.1 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.1 | 0.4 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
| 0.1 | 0.5 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
| 0.1 | 0.7 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.1 | 1.8 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.1 | 0.6 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
| 0.1 | 0.8 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.1 | 1.9 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
| 0.1 | 0.2 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) single guanine insertion binding(GO:0032142) |
| 0.1 | 0.2 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.1 | 0.9 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.1 | 3.4 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.1 | 1.2 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.1 | 0.2 | GO:0009041 | uridylate kinase activity(GO:0009041) |
| 0.1 | 1.4 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.1 | 0.4 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.1 | 0.5 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.1 | 0.9 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.1 | 3.1 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) |
| 0.1 | 3.6 | GO:0051018 | protein kinase A binding(GO:0051018) |
| 0.1 | 0.4 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
| 0.1 | 1.0 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
| 0.1 | 1.7 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.1 | 0.6 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
| 0.1 | 0.7 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.1 | 0.2 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
| 0.1 | 1.6 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.1 | 5.5 | GO:0005125 | cytokine activity(GO:0005125) |
| 0.1 | 2.5 | GO:0050840 | extracellular matrix binding(GO:0050840) |
| 0.1 | 0.4 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.1 | 2.2 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
| 0.1 | 0.5 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.1 | 0.2 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.1 | 0.4 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
| 0.0 | 0.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.0 | 1.9 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
| 0.0 | 0.8 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.0 | 2.9 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.0 | 0.1 | GO:0019863 | IgE binding(GO:0019863) |
| 0.0 | 0.1 | GO:0070892 | lipoteichoic acid receptor activity(GO:0070892) |
| 0.0 | 3.4 | GO:0005178 | integrin binding(GO:0005178) |
| 0.0 | 3.1 | GO:0008201 | heparin binding(GO:0008201) |
| 0.0 | 0.6 | GO:0070403 | NAD+ binding(GO:0070403) |
| 0.0 | 0.9 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.0 | 1.6 | GO:0070888 | E-box binding(GO:0070888) |
| 0.0 | 0.2 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.0 | 0.6 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.0 | 1.0 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.0 | 0.5 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
| 0.0 | 3.4 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.0 | 1.5 | GO:0036002 | pre-mRNA binding(GO:0036002) |
| 0.0 | 0.6 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.0 | 3.2 | GO:0030165 | PDZ domain binding(GO:0030165) |
| 0.0 | 1.3 | GO:0016627 | oxidoreductase activity, acting on the CH-CH group of donors(GO:0016627) |
| 0.0 | 0.3 | GO:0045503 | dynein light chain binding(GO:0045503) |
| 0.0 | 0.5 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
| 0.0 | 0.5 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.0 | 9.0 | GO:0005509 | calcium ion binding(GO:0005509) |
| 0.0 | 0.9 | GO:0030295 | protein kinase activator activity(GO:0030295) |
| 0.0 | 3.4 | GO:0001047 | core promoter binding(GO:0001047) |
| 0.0 | 2.4 | GO:0008168 | methyltransferase activity(GO:0008168) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 5.1 | PID_S1P_S1P1_PATHWAY | S1P1 pathway |
| 0.2 | 10.6 | PID_TCPTP_PATHWAY | Signaling events mediated by TCPTP |
| 0.2 | 2.6 | PID_ERBB_NETWORK_PATHWAY | ErbB receptor signaling network |
| 0.1 | 5.1 | PID_FRA_PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.1 | 3.5 | ST_ADRENERGIC | Adrenergic Pathway |
| 0.1 | 2.9 | PID_TOLL_ENDOGENOUS_PATHWAY | Endogenous TLR signaling |
| 0.1 | 2.0 | ST_G_ALPHA_S_PATHWAY | G alpha s Pathway |
| 0.1 | 0.5 | PID_S1P_S1P4_PATHWAY | S1P4 pathway |
| 0.1 | 3.5 | PID_ATM_PATHWAY | ATM pathway |
| 0.1 | 4.8 | PID_MYC_REPRESS_PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.1 | 1.0 | PID_SYNDECAN_3_PATHWAY | Syndecan-3-mediated signaling events |
| 0.1 | 0.7 | PID_IL27_PATHWAY | IL27-mediated signaling events |
| 0.1 | 1.6 | PID_ARF6_PATHWAY | Arf6 signaling events |
| 0.1 | 2.4 | PID_AJDISS_2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.1 | 0.8 | PID_LPA4_PATHWAY | LPA4-mediated signaling events |
| 0.1 | 2.2 | PID_CD8_TCR_DOWNSTREAM_PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 7.1 | NABA_ECM_GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.0 | 6.3 | NABA_ECM_REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.0 | 0.8 | SA_PROGRAMMED_CELL_DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.0 | 0.9 | PID_CXCR3_PATHWAY | CXCR3-mediated signaling events |
| 0.0 | 1.1 | PID_EPHRINB_REV_PATHWAY | Ephrin B reverse signaling |
| 0.0 | 0.5 | PID_TAP63_PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.0 | 0.5 | PID_CIRCADIAN_PATHWAY | Circadian rhythm pathway |
| 0.0 | 0.8 | PID_LIS1_PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.0 | 0.4 | PID_NFKAPPAB_CANONICAL_PATHWAY | Canonical NF-kappaB pathway |
| 0.0 | 0.7 | PID_ATF2_PATHWAY | ATF-2 transcription factor network |
| 0.0 | 1.2 | PID_CDC42_PATHWAY | CDC42 signaling events |
| 0.0 | 0.2 | PID_FAS_PATHWAY | FAS (CD95) signaling pathway |
| 0.0 | 0.5 | PID_SYNDECAN_1_PATHWAY | Syndecan-1-mediated signaling events |
| 0.0 | 0.4 | PID_HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.0 | 1.0 | PID_ERA_GENOMIC_PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.0 | 0.6 | PID_BMP_PATHWAY | BMP receptor signaling |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.6 | 7.7 | REACTOME_ENDOSOMAL_VACUOLAR_PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.5 | 3.3 | REACTOME_CREATION_OF_C4_AND_C2_ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 0.3 | 2.6 | REACTOME_BILE_SALT_AND_ORGANIC_ANION_SLC_TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.2 | 1.4 | REACTOME_SYNTHESIS_SECRETION_AND_DEACYLATION_OF_GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.2 | 4.5 | REACTOME_CHONDROITIN_SULFATE_BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.2 | 5.7 | REACTOME_DCC_MEDIATED_ATTRACTIVE_SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.2 | 4.9 | REACTOME_LATENT_INFECTION_OF_HOMO_SAPIENS_WITH_MYCOBACTERIUM_TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.2 | 4.3 | REACTOME_CHEMOKINE_RECEPTORS_BIND_CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.2 | 7.9 | REACTOME_CROSS_PRESENTATION_OF_SOLUBLE_EXOGENOUS_ANTIGENS_ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
| 0.1 | 3.6 | REACTOME_CELL_EXTRACELLULAR_MATRIX_INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.1 | 1.6 | REACTOME_VEGF_LIGAND_RECEPTOR_INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.1 | 3.2 | REACTOME_RAS_ACTIVATION_UOPN_CA2_INFUX_THROUGH_NMDA_RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.1 | 4.5 | REACTOME_ASSOCIATION_OF_TRIC_CCT_WITH_TARGET_PROTEINS_DURING_BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.1 | 1.8 | REACTOME_HOMOLOGOUS_RECOMBINATION_REPAIR_OF_REPLICATION_INDEPENDENT_DOUBLE_STRAND_BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.1 | 1.5 | REACTOME_SYNTHESIS_OF_SUBSTRATES_IN_N_GLYCAN_BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.1 | 1.4 | REACTOME_METABOLISM_OF_POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.1 | 0.5 | REACTOME_REGULATION_OF_ORNITHINE_DECARBOXYLASE_ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.1 | 0.9 | REACTOME_ACTIVATION_OF_RAC | Genes involved in Activation of Rac |
| 0.1 | 2.7 | REACTOME_INTERFERON_ALPHA_BETA_SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.1 | 0.8 | REACTOME_ADENYLATE_CYCLASE_ACTIVATING_PATHWAY | Genes involved in Adenylate cyclase activating pathway |
| 0.1 | 0.7 | REACTOME_AMINE_DERIVED_HORMONES | Genes involved in Amine-derived hormones |
| 0.1 | 1.0 | REACTOME_GLYCOGEN_BREAKDOWN_GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.1 | 1.1 | REACTOME_SIGNALING_BY_BMP | Genes involved in Signaling by BMP |
| 0.1 | 0.4 | REACTOME_ENDOGENOUS_STEROLS | Genes involved in Endogenous sterols |
| 0.1 | 1.4 | REACTOME_RNA_POL_I_TRANSCRIPTION_TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
| 0.1 | 1.3 | REACTOME_STRIATED_MUSCLE_CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.0 | 0.4 | REACTOME_TRAFFICKING_AND_PROCESSING_OF_ENDOSOMAL_TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.0 | 1.6 | REACTOME_ADHERENS_JUNCTIONS_INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.0 | 1.0 | REACTOME_HS_GAG_DEGRADATION | Genes involved in HS-GAG degradation |
| 0.0 | 0.8 | REACTOME_DESTABILIZATION_OF_MRNA_BY_TRISTETRAPROLIN_TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.0 | 0.6 | REACTOME_REGULATION_OF_PYRUVATE_DEHYDROGENASE_PDH_COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.0 | 0.9 | REACTOME_GLUTAMATE_NEUROTRANSMITTER_RELEASE_CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.0 | 0.4 | REACTOME_DOUBLE_STRAND_BREAK_REPAIR | Genes involved in Double-Strand Break Repair |
| 0.0 | 0.3 | REACTOME_NA_CL_DEPENDENT_NEUROTRANSMITTER_TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.0 | 0.5 | REACTOME_ZINC_TRANSPORTERS | Genes involved in Zinc transporters |
| 0.0 | 1.0 | REACTOME_REGULATION_OF_GLUCOKINASE_BY_GLUCOKINASE_REGULATORY_PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
| 0.0 | 0.7 | REACTOME_OTHER_SEMAPHORIN_INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.0 | 0.2 | REACTOME_FORMATION_OF_INCISION_COMPLEX_IN_GG_NER | Genes involved in Formation of incision complex in GG-NER |
| 0.0 | 0.3 | REACTOME_METABOLISM_OF_STEROID_HORMONES_AND_VITAMINS_A_AND_D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
| 0.0 | 0.2 | REACTOME_MEIOTIC_RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.0 | 0.5 | REACTOME_GLUTATHIONE_CONJUGATION | Genes involved in Glutathione conjugation |
| 0.0 | 0.8 | REACTOME_INTRINSIC_PATHWAY_FOR_APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.0 | 0.3 | REACTOME_RNA_POL_III_CHAIN_ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
| 0.0 | 1.4 | REACTOME_TRANSPORT_OF_INORGANIC_CATIONS_ANIONS_AND_AMINO_ACIDS_OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 0.0 | 0.2 | REACTOME_PECAM1_INTERACTIONS | Genes involved in PECAM1 interactions |
| 0.0 | 0.4 | REACTOME_NOD1_2_SIGNALING_PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.0 | 0.5 | REACTOME_VOLTAGE_GATED_POTASSIUM_CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.0 | 0.5 | REACTOME_BMAL1_CLOCK_NPAS2_ACTIVATES_CIRCADIAN_EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
