Motif ID: Ebf1
Z-value: 1.358
Transcription factors associated with Ebf1:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| Ebf1 | ENSMUSG00000078561.3 | Ebf1 |
| Ebf1 | ENSMUSG00000057098.8 | Ebf1 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Ebf1 | mm10_v2_chr11_+_44617310_44617336 | 0.30 | 7.4e-03 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 6.9 | 20.7 | GO:0060598 | dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
| 3.0 | 3.0 | GO:0007044 | cell-substrate junction assembly(GO:0007044) |
| 3.0 | 9.0 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) terminal web assembly(GO:1902896) |
| 3.0 | 9.0 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
| 2.9 | 14.5 | GO:0046864 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) alveolar primary septum development(GO:0061143) |
| 2.8 | 33.2 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 2.7 | 18.7 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 2.4 | 7.3 | GO:1902460 | transforming growth factor beta activation(GO:0036363) regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 2.3 | 9.3 | GO:0002484 | antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway(GO:0002484) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway, TAP-dependent(GO:0002485) |
| 2.3 | 11.5 | GO:0021905 | pancreatic A cell development(GO:0003322) forebrain-midbrain boundary formation(GO:0021905) somatic motor neuron fate commitment(GO:0021917) regulation of transcription from RNA polymerase II promoter involved in somatic motor neuron fate commitment(GO:0021918) sensory neuron migration(GO:1904937) |
| 2.3 | 6.8 | GO:0044208 | 'de novo' AMP biosynthetic process(GO:0044208) |
| 2.2 | 6.5 | GO:2000620 | positive regulation of histone H4-K16 acetylation(GO:2000620) |
| 2.1 | 2.1 | GO:2001198 | regulation of dendritic cell differentiation(GO:2001198) |
| 2.0 | 8.0 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 1.9 | 1.9 | GO:0060032 | notochord regression(GO:0060032) |
| 1.9 | 5.6 | GO:0060489 | orthogonal dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060488) planar dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060489) lateral sprouting involved in lung morphogenesis(GO:0060490) |
| 1.8 | 7.4 | GO:0051316 | attachment of spindle microtubules to kinetochore involved in meiotic chromosome segregation(GO:0051316) |
| 1.8 | 7.2 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) cellular response to lipid hydroperoxide(GO:0071449) |
| 1.8 | 7.2 | GO:0060857 | establishment of glial blood-brain barrier(GO:0060857) |
| 1.8 | 7.1 | GO:0050904 | diapedesis(GO:0050904) |
| 1.7 | 6.6 | GO:2000256 | endomitotic cell cycle(GO:0007113) thrombopoietin-mediated signaling pathway(GO:0038163) positive regulation of male germ cell proliferation(GO:2000256) |
| 1.6 | 3.2 | GO:0034382 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 1.6 | 6.3 | GO:0015793 | glycerol transport(GO:0015793) |
| 1.6 | 6.3 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 1.5 | 4.5 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
| 1.4 | 7.2 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
| 1.4 | 11.4 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 1.4 | 5.7 | GO:0070829 | heterochromatin maintenance(GO:0070829) |
| 1.4 | 4.2 | GO:1904395 | positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
| 1.4 | 2.8 | GO:0032817 | regulation of natural killer cell proliferation(GO:0032817) positive regulation of natural killer cell proliferation(GO:0032819) |
| 1.4 | 2.7 | GO:0036166 | phenotypic switching(GO:0036166) |
| 1.4 | 2.7 | GO:0010273 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 1.4 | 4.1 | GO:0072139 | glomerular parietal epithelial cell differentiation(GO:0072139) |
| 1.3 | 3.9 | GO:0036118 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 1.3 | 2.6 | GO:0060579 | ventral spinal cord interneuron fate commitment(GO:0060579) cell fate commitment involved in pattern specification(GO:0060581) |
| 1.3 | 1.3 | GO:0090191 | negative regulation of branching involved in ureteric bud morphogenesis(GO:0090191) |
| 1.2 | 6.2 | GO:0048682 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
| 1.2 | 5.0 | GO:2001045 | closure of optic fissure(GO:0061386) negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 1.2 | 1.2 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
| 1.2 | 3.6 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 1.2 | 3.5 | GO:1905066 | regulation of canonical Wnt signaling pathway involved in cardiac muscle cell fate commitment(GO:1901295) positive regulation of heart induction(GO:1901321) regulation of canonical Wnt signaling pathway involved in heart development(GO:1905066) |
| 1.2 | 4.7 | GO:1903416 | response to glycoside(GO:1903416) |
| 1.2 | 5.8 | GO:0002339 | B cell selection(GO:0002339) |
| 1.1 | 3.4 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
| 1.1 | 6.7 | GO:0003383 | apical constriction(GO:0003383) |
| 1.1 | 1.1 | GO:0002489 | antigen processing and presentation of endogenous peptide antigen via MHC class Ib(GO:0002476) antigen processing and presentation of endogenous peptide antigen via MHC class Ib via ER pathway(GO:0002488) antigen processing and presentation of endogenous peptide antigen via MHC class Ib via ER pathway, TAP-dependent(GO:0002489) |
| 1.1 | 3.2 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
| 1.1 | 3.2 | GO:0072708 | DNA replication preinitiation complex assembly(GO:0071163) response to sorbitol(GO:0072708) |
| 1.1 | 5.3 | GO:1990839 | response to endothelin(GO:1990839) |
| 1.0 | 4.2 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
| 1.0 | 8.3 | GO:0071493 | cellular response to UV-B(GO:0071493) |
| 1.0 | 4.1 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
| 1.0 | 3.0 | GO:1904580 | regulation of polynucleotide adenylyltransferase activity(GO:1904245) regulation of intracellular mRNA localization(GO:1904580) |
| 1.0 | 3.0 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 1.0 | 5.9 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 1.0 | 1.9 | GO:2001187 | positive regulation of CD8-positive, alpha-beta T cell activation(GO:2001187) |
| 0.9 | 3.7 | GO:0032901 | positive regulation of neurotrophin production(GO:0032901) |
| 0.9 | 3.7 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
| 0.9 | 4.6 | GO:1902995 | apolipoprotein A-I-mediated signaling pathway(GO:0038027) regulation of phospholipid efflux(GO:1902994) positive regulation of phospholipid efflux(GO:1902995) positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.9 | 1.8 | GO:0010046 | response to mycotoxin(GO:0010046) |
| 0.9 | 5.3 | GO:0048842 | positive regulation of axon extension involved in axon guidance(GO:0048842) |
| 0.9 | 2.7 | GO:0090324 | negative regulation of oxidative phosphorylation(GO:0090324) |
| 0.9 | 1.8 | GO:0006083 | acetate metabolic process(GO:0006083) |
| 0.9 | 3.5 | GO:0006203 | dGTP catabolic process(GO:0006203) |
| 0.9 | 4.3 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
| 0.9 | 11.2 | GO:0021521 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 0.9 | 6.0 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.9 | 0.9 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) myelin maintenance(GO:0043217) |
| 0.8 | 5.1 | GO:1902965 | regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 0.8 | 3.3 | GO:0006558 | L-phenylalanine metabolic process(GO:0006558) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) |
| 0.8 | 5.0 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
| 0.8 | 5.7 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.8 | 2.4 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.8 | 4.0 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.8 | 0.8 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
| 0.8 | 2.3 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.8 | 1.5 | GO:1903976 | negative regulation of glial cell migration(GO:1903976) |
| 0.8 | 5.3 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
| 0.8 | 3.0 | GO:0010836 | negative regulation of protein ADP-ribosylation(GO:0010836) |
| 0.8 | 4.5 | GO:1903012 | positive regulation of bone development(GO:1903012) |
| 0.8 | 1.5 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.7 | 2.2 | GO:0061198 | fungiform papilla formation(GO:0061198) |
| 0.7 | 5.9 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 0.7 | 2.2 | GO:0060854 | patterning of lymph vessels(GO:0060854) |
| 0.7 | 3.6 | GO:2000157 | regulation of protein K48-linked deubiquitination(GO:1903093) negative regulation of protein K48-linked deubiquitination(GO:1903094) negative regulation of ubiquitin-specific protease activity(GO:2000157) |
| 0.7 | 6.5 | GO:0006105 | succinate metabolic process(GO:0006105) |
| 0.7 | 3.6 | GO:0032962 | positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
| 0.7 | 2.1 | GO:0009446 | putrescine biosynthetic process(GO:0009446) |
| 0.7 | 5.0 | GO:0021780 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.7 | 2.1 | GO:0010725 | regulation of primitive erythrocyte differentiation(GO:0010725) |
| 0.7 | 2.1 | GO:0070543 | response to linoleic acid(GO:0070543) |
| 0.7 | 2.1 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
| 0.7 | 7.5 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.7 | 1.4 | GO:0046881 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
| 0.7 | 3.4 | GO:1900147 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
| 0.7 | 2.0 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.7 | 6.0 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.7 | 2.0 | GO:0036500 | ATF6-mediated unfolded protein response(GO:0036500) |
| 0.7 | 3.3 | GO:0006447 | regulation of translational initiation by iron(GO:0006447) positive regulation of translational initiation by iron(GO:0045994) |
| 0.7 | 1.3 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
| 0.7 | 3.3 | GO:0010593 | negative regulation of lamellipodium assembly(GO:0010593) |
| 0.6 | 3.2 | GO:0052428 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.6 | 3.2 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.6 | 1.9 | GO:0015910 | peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.6 | 2.5 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
| 0.6 | 3.2 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
| 0.6 | 3.7 | GO:0071699 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
| 0.6 | 3.7 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
| 0.6 | 1.2 | GO:0033864 | positive regulation of NAD(P)H oxidase activity(GO:0033864) |
| 0.6 | 1.2 | GO:0090272 | negative regulation of fibroblast growth factor production(GO:0090272) |
| 0.6 | 1.8 | GO:1904170 | regulation of bleb assembly(GO:1904170) |
| 0.6 | 0.6 | GO:0001787 | natural killer cell proliferation(GO:0001787) |
| 0.6 | 1.8 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 0.6 | 1.8 | GO:1902022 | L-lysine transport(GO:1902022) |
| 0.6 | 2.4 | GO:0046947 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.6 | 5.3 | GO:0071732 | cellular response to nitric oxide(GO:0071732) |
| 0.6 | 1.8 | GO:0010519 | negative regulation of phospholipase activity(GO:0010519) |
| 0.6 | 1.8 | GO:0060821 | inactivation of X chromosome by DNA methylation(GO:0060821) |
| 0.6 | 2.9 | GO:0042938 | dipeptide transport(GO:0042938) |
| 0.6 | 4.0 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.6 | 1.2 | GO:0032829 | regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) |
| 0.6 | 1.7 | GO:1903847 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
| 0.6 | 6.2 | GO:0009404 | toxin metabolic process(GO:0009404) |
| 0.6 | 1.7 | GO:0046104 | thymidine metabolic process(GO:0046104) |
| 0.6 | 0.6 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
| 0.6 | 2.8 | GO:0061642 | chemoattraction of axon(GO:0061642) |
| 0.6 | 1.7 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
| 0.6 | 2.8 | GO:0003420 | regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
| 0.5 | 0.5 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.5 | 0.5 | GO:0019062 | virion attachment to host cell(GO:0019062) adhesion of symbiont to host cell(GO:0044650) |
| 0.5 | 1.6 | GO:0072138 | mesenchymal cell proliferation involved in ureteric bud development(GO:0072138) |
| 0.5 | 1.1 | GO:0010533 | regulation of activation of Janus kinase activity(GO:0010533) |
| 0.5 | 5.3 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) |
| 0.5 | 0.5 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
| 0.5 | 1.6 | GO:2000314 | negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
| 0.5 | 0.5 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.5 | 0.5 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.5 | 2.1 | GO:0015744 | succinate transport(GO:0015744) |
| 0.5 | 5.7 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
| 0.5 | 2.6 | GO:0009068 | aspartate family amino acid catabolic process(GO:0009068) |
| 0.5 | 3.6 | GO:1904217 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.5 | 1.0 | GO:0061762 | CAMKK-AMPK signaling cascade(GO:0061762) |
| 0.5 | 2.0 | GO:0010898 | positive regulation of triglyceride catabolic process(GO:0010898) |
| 0.5 | 1.5 | GO:0071649 | regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) |
| 0.5 | 1.0 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
| 0.5 | 2.5 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.5 | 2.0 | GO:0035470 | positive regulation of vascular wound healing(GO:0035470) regulation of vascular wound healing(GO:0061043) |
| 0.5 | 0.5 | GO:0048382 | mesendoderm development(GO:0048382) |
| 0.5 | 1.0 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.5 | 4.5 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.5 | 2.5 | GO:0001842 | neural fold formation(GO:0001842) |
| 0.5 | 0.9 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 0.5 | 1.9 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.5 | 1.4 | GO:1903490 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 0.5 | 2.8 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.5 | 1.9 | GO:0032229 | negative regulation of synaptic transmission, GABAergic(GO:0032229) |
| 0.5 | 0.5 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
| 0.5 | 1.4 | GO:0002326 | B cell lineage commitment(GO:0002326) |
| 0.5 | 2.3 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.5 | 3.2 | GO:2000586 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) |
| 0.5 | 1.8 | GO:0016321 | female meiosis chromosome segregation(GO:0016321) |
| 0.5 | 1.4 | GO:0032627 | interleukin-23 production(GO:0032627) regulation of interleukin-23 production(GO:0032667) positive regulation of interleukin-23 production(GO:0032747) |
| 0.5 | 3.2 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.5 | 1.4 | GO:0003241 | growth involved in heart morphogenesis(GO:0003241) cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
| 0.5 | 4.5 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
| 0.5 | 1.4 | GO:1904975 | response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
| 0.4 | 8.5 | GO:1901522 | positive regulation of transcription from RNA polymerase II promoter involved in cellular response to chemical stimulus(GO:1901522) |
| 0.4 | 3.1 | GO:0001977 | renal system process involved in regulation of blood volume(GO:0001977) |
| 0.4 | 2.7 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.4 | 0.9 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
| 0.4 | 1.8 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.4 | 0.4 | GO:0032632 | interleukin-3 production(GO:0032632) |
| 0.4 | 13.5 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
| 0.4 | 2.2 | GO:0010991 | regulation of SMAD protein complex assembly(GO:0010990) negative regulation of SMAD protein complex assembly(GO:0010991) |
| 0.4 | 2.6 | GO:1901552 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.4 | 0.4 | GO:0045168 | cell-cell signaling involved in cell fate commitment(GO:0045168) |
| 0.4 | 1.7 | GO:0043973 | histone H3-K4 acetylation(GO:0043973) |
| 0.4 | 1.3 | GO:0007262 | STAT protein import into nucleus(GO:0007262) |
| 0.4 | 0.9 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.4 | 4.7 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
| 0.4 | 0.9 | GO:0071499 | response to laminar fluid shear stress(GO:0034616) cellular response to laminar fluid shear stress(GO:0071499) |
| 0.4 | 2.5 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.4 | 1.6 | GO:0019323 | pentose catabolic process(GO:0019323) |
| 0.4 | 1.2 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
| 0.4 | 2.4 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.4 | 3.6 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
| 0.4 | 1.6 | GO:0042535 | positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
| 0.4 | 2.4 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.4 | 1.2 | GO:2001160 | regulation of histone H3-K79 methylation(GO:2001160) |
| 0.4 | 2.8 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.4 | 1.6 | GO:0045950 | negative regulation of mitotic recombination(GO:0045950) |
| 0.4 | 1.2 | GO:0035696 | monocyte extravasation(GO:0035696) regulation of monocyte extravasation(GO:2000437) |
| 0.4 | 1.2 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 0.4 | 1.2 | GO:0048698 | negative regulation of collateral sprouting in absence of injury(GO:0048698) |
| 0.4 | 1.5 | GO:1904451 | regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904451) positive regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904453) |
| 0.4 | 1.1 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
| 0.4 | 1.1 | GO:0060221 | retinal rod cell differentiation(GO:0060221) |
| 0.4 | 0.4 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 0.4 | 0.4 | GO:1903203 | neuron death in response to oxidative stress(GO:0036475) regulation of oxidative stress-induced neuron death(GO:1903203) |
| 0.4 | 2.2 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
| 0.4 | 1.9 | GO:0097503 | sialylation(GO:0097503) |
| 0.4 | 1.1 | GO:0070476 | rRNA (guanine-N7)-methylation(GO:0070476) |
| 0.4 | 4.1 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
| 0.4 | 1.1 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
| 0.4 | 1.1 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.4 | 4.1 | GO:1901250 | regulation of lung goblet cell differentiation(GO:1901249) negative regulation of lung goblet cell differentiation(GO:1901250) |
| 0.4 | 1.5 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
| 0.4 | 2.2 | GO:0097473 | cellular response to light intensity(GO:0071484) cellular response to high light intensity(GO:0071486) retinal rod cell apoptotic process(GO:0097473) |
| 0.4 | 0.7 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.4 | 1.1 | GO:1903984 | regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.4 | 1.1 | GO:2000561 | CD4-positive, alpha-beta T cell proliferation(GO:0035739) regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) |
| 0.4 | 2.9 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
| 0.4 | 4.0 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.4 | 0.4 | GO:0090135 | actin filament branching(GO:0090135) |
| 0.4 | 0.7 | GO:0021759 | globus pallidus development(GO:0021759) |
| 0.4 | 0.4 | GO:0032847 | regulation of cellular pH reduction(GO:0032847) |
| 0.4 | 1.8 | GO:0051593 | response to folic acid(GO:0051593) |
| 0.4 | 0.4 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.4 | 11.8 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 0.4 | 2.8 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
| 0.4 | 1.8 | GO:0046601 | positive regulation of centriole replication(GO:0046601) |
| 0.3 | 1.0 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.3 | 3.8 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.3 | 0.7 | GO:2000851 | cortisol secretion(GO:0043400) regulation of cortisol secretion(GO:0051462) positive regulation of cortisol secretion(GO:0051464) positive regulation of glucocorticoid secretion(GO:2000851) |
| 0.3 | 1.0 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
| 0.3 | 3.4 | GO:0070445 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.3 | 1.0 | GO:0071579 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) regulation of zinc ion transport(GO:0071579) |
| 0.3 | 3.0 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.3 | 1.7 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.3 | 1.3 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
| 0.3 | 1.6 | GO:0030323 | respiratory tube development(GO:0030323) |
| 0.3 | 2.6 | GO:0007229 | integrin-mediated signaling pathway(GO:0007229) |
| 0.3 | 1.6 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) |
| 0.3 | 1.3 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.3 | 2.9 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
| 0.3 | 1.6 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.3 | 0.6 | GO:1904996 | positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 0.3 | 0.9 | GO:0051342 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
| 0.3 | 0.9 | GO:1901550 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
| 0.3 | 2.2 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.3 | 0.6 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
| 0.3 | 1.5 | GO:0086028 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
| 0.3 | 2.8 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
| 0.3 | 0.9 | GO:0051784 | negative regulation of mitotic nuclear division(GO:0045839) negative regulation of nuclear division(GO:0051784) |
| 0.3 | 0.6 | GO:0015675 | nickel cation transport(GO:0015675) |
| 0.3 | 3.3 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.3 | 3.9 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.3 | 1.2 | GO:0042905 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.3 | 0.6 | GO:0035094 | response to nicotine(GO:0035094) |
| 0.3 | 0.3 | GO:0010748 | negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) |
| 0.3 | 4.2 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.3 | 1.2 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.3 | 1.2 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.3 | 3.3 | GO:0060033 | anatomical structure regression(GO:0060033) |
| 0.3 | 2.7 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
| 0.3 | 1.2 | GO:1904778 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
| 0.3 | 1.5 | GO:0044854 | plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) caveola assembly(GO:0070836) |
| 0.3 | 0.9 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.3 | 0.9 | GO:0048010 | vascular endothelial growth factor receptor signaling pathway(GO:0048010) |
| 0.3 | 3.2 | GO:0044406 | adhesion of symbiont to host(GO:0044406) |
| 0.3 | 1.2 | GO:0044331 | cell-cell adhesion mediated by cadherin(GO:0044331) |
| 0.3 | 2.0 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
| 0.3 | 1.7 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.3 | 0.9 | GO:0070141 | response to UV-A(GO:0070141) |
| 0.3 | 0.9 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.3 | 3.7 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
| 0.3 | 0.6 | GO:0060282 | positive regulation of chronic inflammatory response(GO:0002678) positive regulation of oocyte development(GO:0060282) |
| 0.3 | 2.3 | GO:1901162 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
| 0.3 | 1.4 | GO:0046719 | regulation by virus of viral protein levels in host cell(GO:0046719) |
| 0.3 | 1.9 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
| 0.3 | 2.2 | GO:0030539 | male genitalia development(GO:0030539) |
| 0.3 | 1.7 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.3 | 1.7 | GO:0048664 | neuron fate determination(GO:0048664) |
| 0.3 | 1.1 | GO:0030091 | protein repair(GO:0030091) |
| 0.3 | 4.7 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
| 0.3 | 2.7 | GO:0000022 | mitotic spindle elongation(GO:0000022) spindle midzone assembly(GO:0051255) mitotic spindle midzone assembly(GO:0051256) |
| 0.3 | 10.6 | GO:0001658 | branching involved in ureteric bud morphogenesis(GO:0001658) |
| 0.3 | 4.9 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
| 0.3 | 0.5 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
| 0.3 | 1.1 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
| 0.3 | 1.1 | GO:0051503 | adenine nucleotide transport(GO:0051503) |
| 0.3 | 0.5 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.3 | 2.4 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.3 | 1.9 | GO:0033484 | nitric oxide homeostasis(GO:0033484) |
| 0.3 | 1.3 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.3 | 1.0 | GO:1900047 | negative regulation of blood coagulation(GO:0030195) negative regulation of hemostasis(GO:1900047) |
| 0.3 | 0.5 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.3 | 1.8 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.3 | 0.8 | GO:1902310 | positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.3 | 5.5 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 0.3 | 0.8 | GO:0042743 | hydrogen peroxide metabolic process(GO:0042743) |
| 0.3 | 1.3 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.3 | 0.8 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
| 0.3 | 1.5 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.3 | 5.1 | GO:0010667 | negative regulation of cardiac muscle cell apoptotic process(GO:0010667) |
| 0.3 | 0.8 | GO:0097242 | beta-amyloid clearance(GO:0097242) |
| 0.3 | 6.0 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.3 | 1.0 | GO:1904637 | response to lead ion(GO:0010288) response to ionomycin(GO:1904636) cellular response to ionomycin(GO:1904637) |
| 0.2 | 2.5 | GO:1904707 | positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.2 | 3.2 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
| 0.2 | 0.5 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.2 | 1.5 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
| 0.2 | 1.4 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.2 | 0.7 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
| 0.2 | 0.7 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
| 0.2 | 1.0 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
| 0.2 | 6.2 | GO:0006336 | DNA replication-independent nucleosome assembly(GO:0006336) |
| 0.2 | 1.4 | GO:1902373 | negative regulation of mRNA catabolic process(GO:1902373) |
| 0.2 | 1.0 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.2 | 3.3 | GO:0009063 | cellular amino acid catabolic process(GO:0009063) |
| 0.2 | 1.4 | GO:0072615 | interleukin-17 secretion(GO:0072615) |
| 0.2 | 1.4 | GO:0045607 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.2 | 0.7 | GO:1904046 | seryl-tRNA aminoacylation(GO:0006434) negative regulation of vascular endothelial growth factor production(GO:1904046) |
| 0.2 | 0.7 | GO:0034115 | negative regulation of heterotypic cell-cell adhesion(GO:0034115) cell-cell adhesion involved in gastrulation(GO:0070586) regulation of cell-cell adhesion involved in gastrulation(GO:0070587) |
| 0.2 | 0.7 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.2 | 2.4 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.2 | 4.6 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
| 0.2 | 0.2 | GO:0031643 | positive regulation of myelination(GO:0031643) |
| 0.2 | 2.1 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.2 | 1.1 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
| 0.2 | 1.4 | GO:0044130 | negative regulation of growth of symbiont in host(GO:0044130) negative regulation of growth of symbiont involved in interaction with host(GO:0044146) |
| 0.2 | 0.9 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.2 | 1.8 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
| 0.2 | 0.4 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
| 0.2 | 0.7 | GO:1904578 | response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) |
| 0.2 | 2.7 | GO:0003215 | cardiac right ventricle morphogenesis(GO:0003215) |
| 0.2 | 1.8 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
| 0.2 | 1.3 | GO:0070253 | somatostatin secretion(GO:0070253) |
| 0.2 | 1.1 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.2 | 0.2 | GO:1903432 | regulation of TORC1 signaling(GO:1903432) |
| 0.2 | 1.5 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.2 | 2.8 | GO:0048368 | lateral mesoderm development(GO:0048368) |
| 0.2 | 0.6 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
| 0.2 | 2.8 | GO:0045742 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) positive regulation of ERBB signaling pathway(GO:1901186) |
| 0.2 | 0.9 | GO:0034219 | carbohydrate transmembrane transport(GO:0034219) |
| 0.2 | 1.1 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
| 0.2 | 0.2 | GO:0021940 | positive regulation of cerebellar granule cell precursor proliferation(GO:0021940) |
| 0.2 | 1.3 | GO:2000194 | regulation of female gonad development(GO:2000194) |
| 0.2 | 0.6 | GO:0048793 | pronephros development(GO:0048793) |
| 0.2 | 0.2 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
| 0.2 | 0.4 | GO:0001798 | type IIa hypersensitivity(GO:0001794) regulation of type IIa hypersensitivity(GO:0001796) positive regulation of type IIa hypersensitivity(GO:0001798) positive regulation of type I hypersensitivity(GO:0001812) type II hypersensitivity(GO:0002445) positive regulation of hypersensitivity(GO:0002885) regulation of type II hypersensitivity(GO:0002892) positive regulation of type II hypersensitivity(GO:0002894) |
| 0.2 | 1.0 | GO:0072553 | terminal button organization(GO:0072553) |
| 0.2 | 1.0 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
| 0.2 | 1.6 | GO:0000212 | meiotic spindle organization(GO:0000212) |
| 0.2 | 2.7 | GO:0046036 | CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
| 0.2 | 2.9 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.2 | 0.8 | GO:1901642 | purine nucleoside transmembrane transport(GO:0015860) nucleoside transmembrane transport(GO:1901642) |
| 0.2 | 1.6 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.2 | 0.6 | GO:0046013 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.2 | 0.2 | GO:0032902 | nerve growth factor production(GO:0032902) |
| 0.2 | 1.2 | GO:1902622 | regulation of neutrophil chemotaxis(GO:0090022) regulation of neutrophil migration(GO:1902622) |
| 0.2 | 2.0 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.2 | 1.0 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.2 | 0.6 | GO:0036509 | trimming of terminal mannose on B branch(GO:0036509) |
| 0.2 | 1.2 | GO:0042256 | mature ribosome assembly(GO:0042256) |
| 0.2 | 0.6 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
| 0.2 | 1.2 | GO:0070423 | nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
| 0.2 | 0.6 | GO:0046051 | pyrimidine ribonucleoside triphosphate metabolic process(GO:0009208) UTP metabolic process(GO:0046051) |
| 0.2 | 1.4 | GO:0006691 | leukotriene metabolic process(GO:0006691) |
| 0.2 | 1.2 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.2 | 0.6 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.2 | 0.6 | GO:0060425 | lung morphogenesis(GO:0060425) epithelial tube branching involved in lung morphogenesis(GO:0060441) |
| 0.2 | 1.0 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
| 0.2 | 1.3 | GO:0061072 | iris morphogenesis(GO:0061072) |
| 0.2 | 2.9 | GO:0050909 | sensory perception of taste(GO:0050909) |
| 0.2 | 1.1 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.2 | 0.4 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
| 0.2 | 0.8 | GO:0060406 | positive regulation of penile erection(GO:0060406) |
| 0.2 | 0.8 | GO:2001168 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.2 | 1.9 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
| 0.2 | 0.6 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
| 0.2 | 0.7 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.2 | 1.3 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
| 0.2 | 1.9 | GO:0021854 | hypothalamus development(GO:0021854) |
| 0.2 | 0.4 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.2 | 1.1 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
| 0.2 | 0.9 | GO:0032202 | telomere assembly(GO:0032202) |
| 0.2 | 1.3 | GO:0032693 | negative regulation of interleukin-10 production(GO:0032693) |
| 0.2 | 1.7 | GO:1900193 | regulation of oocyte maturation(GO:1900193) negative regulation of oocyte maturation(GO:1900194) |
| 0.2 | 2.6 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
| 0.2 | 2.2 | GO:0019430 | removal of superoxide radicals(GO:0019430) |
| 0.2 | 0.7 | GO:0044565 | dendritic cell proliferation(GO:0044565) |
| 0.2 | 0.4 | GO:0019043 | establishment of viral latency(GO:0019043) |
| 0.2 | 5.6 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.2 | 0.4 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.2 | 0.9 | GO:1901341 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.2 | 1.2 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.2 | 0.7 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
| 0.2 | 1.1 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
| 0.2 | 0.7 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
| 0.2 | 0.5 | GO:1903406 | regulation of sodium:potassium-exchanging ATPase activity(GO:1903406) |
| 0.2 | 0.9 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.2 | 0.7 | GO:0052805 | imidazole-containing compound catabolic process(GO:0052805) |
| 0.2 | 0.7 | GO:0034205 | beta-amyloid formation(GO:0034205) |
| 0.2 | 0.5 | GO:0006669 | sphinganine-1-phosphate biosynthetic process(GO:0006669) |
| 0.2 | 0.7 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.2 | 0.7 | GO:0072365 | regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.2 | 1.0 | GO:1901072 | glucosamine-containing compound catabolic process(GO:1901072) |
| 0.2 | 0.5 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.2 | 1.3 | GO:0035994 | response to muscle stretch(GO:0035994) |
| 0.2 | 0.3 | GO:0014037 | Schwann cell differentiation(GO:0014037) myelination in peripheral nervous system(GO:0022011) peripheral nervous system axon ensheathment(GO:0032292) |
| 0.2 | 1.2 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.2 | 1.3 | GO:0043312 | neutrophil degranulation(GO:0043312) |
| 0.2 | 2.1 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
| 0.2 | 2.1 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.2 | 0.2 | GO:0032415 | regulation of sodium:proton antiporter activity(GO:0032415) |
| 0.2 | 0.5 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.2 | 0.5 | GO:0044778 | meiotic DNA integrity checkpoint(GO:0044778) |
| 0.2 | 0.9 | GO:0015074 | DNA integration(GO:0015074) |
| 0.2 | 1.4 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
| 0.2 | 0.5 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
| 0.2 | 0.3 | GO:0042133 | neurotransmitter metabolic process(GO:0042133) |
| 0.2 | 0.9 | GO:1903273 | regulation of sodium ion export(GO:1903273) positive regulation of sodium ion export(GO:1903275) regulation of sodium ion export from cell(GO:1903276) positive regulation of sodium ion export from cell(GO:1903278) |
| 0.2 | 0.9 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
| 0.2 | 0.6 | GO:0051096 | regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
| 0.2 | 0.8 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) |
| 0.2 | 0.6 | GO:0015825 | L-serine transport(GO:0015825) |
| 0.1 | 0.6 | GO:0080184 | response to stilbenoid(GO:0035634) response to phenylpropanoid(GO:0080184) |
| 0.1 | 1.2 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.1 | 1.3 | GO:0006560 | proline metabolic process(GO:0006560) |
| 0.1 | 0.4 | GO:0021849 | neuroblast division in subventricular zone(GO:0021849) |
| 0.1 | 1.0 | GO:0006833 | water transport(GO:0006833) |
| 0.1 | 2.4 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
| 0.1 | 0.7 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
| 0.1 | 0.3 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.1 | 0.9 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.1 | 1.0 | GO:0048477 | oogenesis(GO:0048477) |
| 0.1 | 1.5 | GO:0051984 | positive regulation of chromosome segregation(GO:0051984) |
| 0.1 | 0.6 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
| 0.1 | 0.3 | GO:0090169 | regulation of spindle assembly(GO:0090169) regulation of mitotic spindle assembly(GO:1901673) |
| 0.1 | 1.5 | GO:0023058 | desensitization of G-protein coupled receptor protein signaling pathway(GO:0002029) negative adaptation of signaling pathway(GO:0022401) adaptation of signaling pathway(GO:0023058) |
| 0.1 | 0.6 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.1 | 0.1 | GO:0007126 | meiotic nuclear division(GO:0007126) |
| 0.1 | 0.7 | GO:0046479 | glycolipid catabolic process(GO:0019377) glycosylceramide catabolic process(GO:0046477) glycosphingolipid catabolic process(GO:0046479) ceramide catabolic process(GO:0046514) |
| 0.1 | 0.1 | GO:0071351 | interleukin-18-mediated signaling pathway(GO:0035655) cellular response to interleukin-18(GO:0071351) |
| 0.1 | 1.8 | GO:0003334 | keratinocyte development(GO:0003334) |
| 0.1 | 2.8 | GO:1902003 | regulation of beta-amyloid formation(GO:1902003) |
| 0.1 | 1.3 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.1 | 2.9 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.1 | 0.6 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.1 | 0.4 | GO:0032877 | positive regulation of DNA endoreduplication(GO:0032877) negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.1 | 1.0 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.1 | 2.5 | GO:0007080 | mitotic metaphase plate congression(GO:0007080) |
| 0.1 | 1.2 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.1 | 0.7 | GO:0042428 | serotonin metabolic process(GO:0042428) |
| 0.1 | 0.3 | GO:0021936 | regulation of cerebellar granule cell precursor proliferation(GO:0021936) |
| 0.1 | 0.4 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.1 | 0.4 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.1 | 1.5 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
| 0.1 | 1.3 | GO:0060219 | camera-type eye photoreceptor cell differentiation(GO:0060219) |
| 0.1 | 1.1 | GO:0050849 | negative regulation of calcium-mediated signaling(GO:0050849) |
| 0.1 | 0.4 | GO:1905000 | regulation of membrane repolarization during atrial cardiac muscle cell action potential(GO:1905000) |
| 0.1 | 1.5 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
| 0.1 | 0.4 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
| 0.1 | 0.4 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.1 | 0.9 | GO:0045072 | regulation of interferon-gamma biosynthetic process(GO:0045072) positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.1 | 0.4 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
| 0.1 | 0.7 | GO:0060768 | epithelial cell proliferation involved in prostate gland development(GO:0060767) regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) |
| 0.1 | 0.4 | GO:0090032 | negative regulation of steroid hormone biosynthetic process(GO:0090032) |
| 0.1 | 1.4 | GO:1901623 | regulation of lymphocyte chemotaxis(GO:1901623) |
| 0.1 | 1.2 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.1 | 1.6 | GO:0031572 | G2 DNA damage checkpoint(GO:0031572) |
| 0.1 | 3.2 | GO:0007520 | myoblast fusion(GO:0007520) |
| 0.1 | 0.6 | GO:0015705 | iodide transport(GO:0015705) |
| 0.1 | 1.1 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.1 | 0.4 | GO:0061009 | common bile duct development(GO:0061009) |
| 0.1 | 0.8 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
| 0.1 | 0.6 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
| 0.1 | 1.9 | GO:0042407 | cristae formation(GO:0042407) |
| 0.1 | 1.2 | GO:0030574 | collagen catabolic process(GO:0030574) |
| 0.1 | 0.6 | GO:0070458 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 0.1 | 0.2 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) sphingolipid mediated signaling pathway(GO:0090520) |
| 0.1 | 0.1 | GO:0003278 | apoptotic process involved in heart morphogenesis(GO:0003278) |
| 0.1 | 2.0 | GO:0060117 | auditory receptor cell development(GO:0060117) |
| 0.1 | 0.5 | GO:0043328 | protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.1 | 0.9 | GO:2001238 | positive regulation of extrinsic apoptotic signaling pathway(GO:2001238) |
| 0.1 | 1.9 | GO:0015701 | bicarbonate transport(GO:0015701) |
| 0.1 | 0.9 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.1 | 0.7 | GO:0044253 | positive regulation of collagen metabolic process(GO:0010714) positive regulation of collagen biosynthetic process(GO:0032967) positive regulation of multicellular organismal metabolic process(GO:0044253) |
| 0.1 | 0.2 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
| 0.1 | 0.9 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
| 0.1 | 0.9 | GO:2000380 | regulation of mesoderm development(GO:2000380) negative regulation of mesoderm development(GO:2000381) |
| 0.1 | 0.7 | GO:0000303 | response to superoxide(GO:0000303) |
| 0.1 | 0.5 | GO:0046294 | formaldehyde catabolic process(GO:0046294) |
| 0.1 | 0.6 | GO:0090168 | Golgi reassembly(GO:0090168) |
| 0.1 | 1.8 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
| 0.1 | 0.5 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) |
| 0.1 | 0.8 | GO:0048102 | autophagic cell death(GO:0048102) |
| 0.1 | 0.7 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.1 | 0.8 | GO:0030813 | positive regulation of nucleotide catabolic process(GO:0030813) positive regulation of glycolytic process(GO:0045821) positive regulation of cofactor metabolic process(GO:0051194) positive regulation of coenzyme metabolic process(GO:0051197) |
| 0.1 | 0.1 | GO:1904938 | dopaminergic neuron axon guidance(GO:0036514) serotonergic neuron axon guidance(GO:0036515) planar cell polarity pathway involved in axon guidance(GO:1904938) |
| 0.1 | 0.6 | GO:0007202 | activation of phospholipase C activity(GO:0007202) positive regulation of phospholipase C activity(GO:0010863) |
| 0.1 | 0.8 | GO:0034312 | diol biosynthetic process(GO:0034312) |
| 0.1 | 4.4 | GO:0032755 | positive regulation of interleukin-6 production(GO:0032755) |
| 0.1 | 0.3 | GO:0000305 | response to oxygen radical(GO:0000305) |
| 0.1 | 3.1 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.1 | 0.2 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
| 0.1 | 1.1 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
| 0.1 | 1.1 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
| 0.1 | 1.4 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.1 | 0.1 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
| 0.1 | 1.8 | GO:0071300 | cellular response to retinoic acid(GO:0071300) |
| 0.1 | 0.3 | GO:0006586 | tryptophan metabolic process(GO:0006568) indolalkylamine metabolic process(GO:0006586) aromatic amino acid family catabolic process(GO:0009074) |
| 0.1 | 2.2 | GO:0000132 | establishment of mitotic spindle orientation(GO:0000132) |
| 0.1 | 1.4 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.1 | 1.0 | GO:0030049 | muscle filament sliding(GO:0030049) |
| 0.1 | 0.4 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.1 | 0.2 | GO:0032717 | negative regulation of interleukin-8 production(GO:0032717) |
| 0.1 | 1.1 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.1 | 2.3 | GO:0046677 | response to antibiotic(GO:0046677) |
| 0.1 | 0.4 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.1 | 0.4 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.1 | 0.9 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) negative regulation of protein homooligomerization(GO:0032463) |
| 0.1 | 0.9 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
| 0.1 | 0.3 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.1 | 0.3 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
| 0.1 | 0.5 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
| 0.1 | 0.4 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
| 0.1 | 0.4 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 0.1 | 0.3 | GO:0097309 | cap1 mRNA methylation(GO:0097309) |
| 0.1 | 1.0 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
| 0.1 | 0.5 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
| 0.1 | 0.3 | GO:0006026 | aminoglycan catabolic process(GO:0006026) glycosaminoglycan catabolic process(GO:0006027) |
| 0.1 | 0.6 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
| 0.1 | 0.4 | GO:0046851 | negative regulation of tissue remodeling(GO:0034104) negative regulation of bone resorption(GO:0045779) negative regulation of bone remodeling(GO:0046851) |
| 0.1 | 0.5 | GO:0045907 | positive regulation of vasoconstriction(GO:0045907) |
| 0.1 | 0.2 | GO:0070459 | prolactin secretion(GO:0070459) |
| 0.1 | 0.2 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
| 0.1 | 4.4 | GO:0005978 | glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
| 0.1 | 1.1 | GO:0002042 | cell migration involved in sprouting angiogenesis(GO:0002042) |
| 0.1 | 0.5 | GO:1903755 | regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.1 | 0.6 | GO:0060330 | regulation of response to interferon-gamma(GO:0060330) |
| 0.1 | 0.3 | GO:1902668 | negative regulation of axon extension involved in axon guidance(GO:0048843) negative regulation of axon guidance(GO:1902668) |
| 0.1 | 0.3 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.5 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.1 | 1.4 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
| 0.1 | 0.5 | GO:0071559 | response to transforming growth factor beta(GO:0071559) |
| 0.1 | 0.4 | GO:0002347 | response to tumor cell(GO:0002347) |
| 0.1 | 0.6 | GO:0045787 | positive regulation of cell cycle(GO:0045787) |
| 0.1 | 0.2 | GO:1902414 | protein localization to cell junction(GO:1902414) |
| 0.1 | 0.2 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.1 | 0.8 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.1 | 0.4 | GO:0006777 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) |
| 0.1 | 0.7 | GO:0042541 | hemoglobin biosynthetic process(GO:0042541) |
| 0.1 | 0.7 | GO:0006337 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
| 0.1 | 0.6 | GO:1903298 | regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
| 0.1 | 1.7 | GO:0051497 | negative regulation of stress fiber assembly(GO:0051497) |
| 0.1 | 0.3 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
| 0.1 | 0.2 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
| 0.1 | 0.4 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.1 | 0.2 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.1 | 0.8 | GO:0030238 | male sex determination(GO:0030238) |
| 0.1 | 0.2 | GO:0035574 | histone H4-K20 demethylation(GO:0035574) |
| 0.1 | 0.9 | GO:0001676 | long-chain fatty acid metabolic process(GO:0001676) |
| 0.1 | 0.4 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
| 0.1 | 0.2 | GO:0086069 | bundle of His cell to Purkinje myocyte communication(GO:0086069) |
| 0.1 | 0.4 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
| 0.1 | 0.2 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
| 0.1 | 2.1 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
| 0.1 | 0.2 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) toll-like receptor 9 signaling pathway(GO:0034162) |
| 0.1 | 0.4 | GO:1904417 | regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
| 0.1 | 0.6 | GO:0030812 | negative regulation of nucleotide catabolic process(GO:0030812) negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
| 0.1 | 0.4 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.1 | 0.2 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
| 0.1 | 0.1 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.1 | 0.5 | GO:0006551 | leucine metabolic process(GO:0006551) |
| 0.1 | 0.4 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.1 | 0.6 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.1 | 0.3 | GO:0097411 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.1 | 0.9 | GO:0045724 | positive regulation of cilium assembly(GO:0045724) |
| 0.1 | 0.1 | GO:0017185 | peptidyl-lysine hydroxylation(GO:0017185) |
| 0.1 | 0.6 | GO:0045840 | positive regulation of mitotic nuclear division(GO:0045840) |
| 0.1 | 0.3 | GO:0035616 | histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.1 | 1.1 | GO:0035411 | catenin import into nucleus(GO:0035411) |
| 0.1 | 0.1 | GO:0048007 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
| 0.1 | 0.4 | GO:0042742 | defense response to bacterium(GO:0042742) |
| 0.1 | 0.1 | GO:0061005 | cell differentiation involved in kidney development(GO:0061005) |
| 0.1 | 0.7 | GO:0034377 | plasma lipoprotein particle assembly(GO:0034377) |
| 0.1 | 0.6 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.1 | 0.2 | GO:0050665 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) hydrogen peroxide biosynthetic process(GO:0050665) |
| 0.1 | 0.5 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.1 | 0.5 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.1 | 0.3 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.1 | 3.2 | GO:0009060 | aerobic respiration(GO:0009060) |
| 0.1 | 0.6 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
| 0.1 | 0.9 | GO:0060351 | cartilage development involved in endochondral bone morphogenesis(GO:0060351) |
| 0.1 | 0.6 | GO:0051092 | positive regulation of NF-kappaB transcription factor activity(GO:0051092) |
| 0.1 | 0.6 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
| 0.1 | 0.3 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
| 0.1 | 0.1 | GO:1900078 | positive regulation of cellular response to insulin stimulus(GO:1900078) |
| 0.1 | 0.3 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.1 | 0.3 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
| 0.1 | 0.5 | GO:1902017 | regulation of cilium assembly(GO:1902017) |
| 0.1 | 1.4 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
| 0.1 | 2.9 | GO:0097194 | execution phase of apoptosis(GO:0097194) |
| 0.1 | 0.3 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
| 0.1 | 0.2 | GO:0015868 | purine nucleotide transport(GO:0015865) purine ribonucleotide transport(GO:0015868) |
| 0.1 | 0.6 | GO:0018195 | peptidyl-arginine modification(GO:0018195) |
| 0.1 | 0.4 | GO:0051451 | myoblast migration(GO:0051451) |
| 0.1 | 0.4 | GO:0032790 | ribosome disassembly(GO:0032790) |
| 0.1 | 0.4 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.1 | 0.7 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
| 0.1 | 1.2 | GO:0045494 | photoreceptor cell maintenance(GO:0045494) |
| 0.1 | 0.6 | GO:1900153 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.1 | 0.2 | GO:0015886 | heme transport(GO:0015886) |
| 0.1 | 0.2 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
| 0.1 | 0.8 | GO:0055070 | copper ion homeostasis(GO:0055070) |
| 0.1 | 0.5 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.1 | 0.3 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.1 | 0.2 | GO:0002002 | regulation of systemic arterial blood pressure by circulatory renin-angiotensin(GO:0001991) regulation of angiotensin levels in blood(GO:0002002) regulation of systemic arterial blood pressure by renin-angiotensin(GO:0003081) regulation of angiotensin metabolic process(GO:0060177) |
| 0.1 | 0.6 | GO:0043982 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
| 0.1 | 0.2 | GO:0030889 | negative regulation of B cell proliferation(GO:0030889) |
| 0.1 | 0.2 | GO:0042267 | natural killer cell mediated immunity(GO:0002228) natural killer cell mediated cytotoxicity(GO:0042267) |
| 0.1 | 0.3 | GO:0006953 | acute-phase response(GO:0006953) |
| 0.1 | 0.2 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.1 | 0.2 | GO:0030576 | Cajal body organization(GO:0030576) |
| 0.1 | 0.3 | GO:1901343 | negative regulation of angiogenesis(GO:0016525) negative regulation of vasculature development(GO:1901343) negative regulation of blood vessel morphogenesis(GO:2000181) |
| 0.1 | 0.2 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
| 0.1 | 0.6 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.1 | 0.3 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 0.1 | 0.2 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.1 | 0.3 | GO:0071267 | amino acid salvage(GO:0043102) L-methionine salvage(GO:0071267) |
| 0.1 | 0.3 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
| 0.1 | 0.6 | GO:0007398 | ectoderm development(GO:0007398) |
| 0.1 | 0.3 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
| 0.1 | 0.3 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.1 | 0.4 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
| 0.1 | 0.8 | GO:0071470 | cellular response to osmotic stress(GO:0071470) |
| 0.1 | 2.6 | GO:0050953 | visual perception(GO:0007601) sensory perception of light stimulus(GO:0050953) |
| 0.1 | 0.2 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.1 | 0.4 | GO:0060307 | regulation of ventricular cardiac muscle cell membrane repolarization(GO:0060307) |
| 0.1 | 0.6 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
| 0.1 | 0.3 | GO:0001980 | regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
| 0.1 | 1.2 | GO:0007129 | synapsis(GO:0007129) |
| 0.1 | 1.3 | GO:0001964 | startle response(GO:0001964) |
| 0.1 | 0.3 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
| 0.1 | 0.1 | GO:0016446 | somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.1 | 0.4 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
| 0.0 | 0.9 | GO:0010972 | negative regulation of G2/M transition of mitotic cell cycle(GO:0010972) |
| 0.0 | 0.3 | GO:0042474 | middle ear morphogenesis(GO:0042474) |
| 0.0 | 0.9 | GO:0050810 | regulation of steroid biosynthetic process(GO:0050810) |
| 0.0 | 0.5 | GO:0061512 | protein localization to cilium(GO:0061512) |
| 0.0 | 0.3 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.0 | 0.5 | GO:0006298 | mismatch repair(GO:0006298) |
| 0.0 | 0.7 | GO:0048741 | skeletal muscle fiber development(GO:0048741) |
| 0.0 | 0.7 | GO:0000394 | RNA splicing, via endonucleolytic cleavage and ligation(GO:0000394) tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.0 | 0.6 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.0 | 0.2 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.0 | 0.4 | GO:2000580 | regulation of microtubule motor activity(GO:2000574) positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
| 0.0 | 0.2 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.0 | 0.1 | GO:0010793 | regulation of mRNA export from nucleus(GO:0010793) |
| 0.0 | 0.8 | GO:0030517 | negative regulation of axon extension(GO:0030517) |
| 0.0 | 0.2 | GO:0042573 | retinoic acid metabolic process(GO:0042573) |
| 0.0 | 0.2 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.0 | 0.3 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
| 0.0 | 1.6 | GO:0043666 | regulation of phosphoprotein phosphatase activity(GO:0043666) |
| 0.0 | 0.1 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
| 0.0 | 0.2 | GO:1902047 | polyamine transport(GO:0015846) polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.0 | 0.4 | GO:0043552 | positive regulation of phosphatidylinositol 3-kinase activity(GO:0043552) |
| 0.0 | 0.5 | GO:0048873 | homeostasis of number of cells within a tissue(GO:0048873) |
| 0.0 | 0.4 | GO:0006090 | pyruvate metabolic process(GO:0006090) |
| 0.0 | 1.0 | GO:0042775 | mitochondrial ATP synthesis coupled electron transport(GO:0042775) |
| 0.0 | 0.3 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.0 | 0.2 | GO:0051693 | actin filament capping(GO:0051693) |
| 0.0 | 0.3 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
| 0.0 | 0.4 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 0.0 | 0.1 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) negative regulation of interleukin-6-mediated signaling pathway(GO:0070104) |
| 0.0 | 0.3 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.0 | 2.4 | GO:0032092 | positive regulation of protein binding(GO:0032092) |
| 0.0 | 1.3 | GO:0000281 | mitotic cytokinesis(GO:0000281) |
| 0.0 | 2.5 | GO:0006635 | fatty acid beta-oxidation(GO:0006635) |
| 0.0 | 0.0 | GO:0042119 | neutrophil activation(GO:0042119) |
| 0.0 | 0.5 | GO:1902230 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
| 0.0 | 0.0 | GO:0032656 | interleukin-13 production(GO:0032616) interleukin-5 production(GO:0032634) regulation of interleukin-13 production(GO:0032656) regulation of interleukin-5 production(GO:0032674) positive regulation of interleukin-13 production(GO:0032736) positive regulation of interleukin-5 production(GO:0032754) |
| 0.0 | 0.3 | GO:0061013 | regulation of mRNA catabolic process(GO:0061013) positive regulation of mRNA catabolic process(GO:0061014) |
| 0.0 | 0.4 | GO:0043407 | negative regulation of MAP kinase activity(GO:0043407) |
| 0.0 | 0.4 | GO:0051383 | kinetochore organization(GO:0051383) |
| 0.0 | 0.2 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
| 0.0 | 0.2 | GO:0019249 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
| 0.0 | 0.2 | GO:0042640 | anagen(GO:0042640) |
| 0.0 | 1.1 | GO:0045737 | positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
| 0.0 | 0.2 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.0 | 0.2 | GO:0043970 | histone H3-K9 acetylation(GO:0043970) |
| 0.0 | 0.3 | GO:0016568 | chromatin modification(GO:0016568) covalent chromatin modification(GO:0016569) |
| 0.0 | 0.2 | GO:0022617 | extracellular matrix disassembly(GO:0022617) |
| 0.0 | 0.9 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.0 | 0.9 | GO:0070527 | platelet aggregation(GO:0070527) |
| 0.0 | 0.1 | GO:0018158 | protein oxidation(GO:0018158) |
| 0.0 | 3.1 | GO:0010466 | negative regulation of peptidase activity(GO:0010466) |
| 0.0 | 1.3 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
| 0.0 | 0.1 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.0 | 0.3 | GO:0006968 | cellular defense response(GO:0006968) |
| 0.0 | 0.1 | GO:0033580 | protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
| 0.0 | 0.4 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.0 | 0.3 | GO:0015879 | carnitine transport(GO:0015879) |
| 0.0 | 0.5 | GO:0048536 | spleen development(GO:0048536) |
| 0.0 | 0.1 | GO:0006295 | nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
| 0.0 | 0.4 | GO:0030513 | positive regulation of BMP signaling pathway(GO:0030513) |
| 0.0 | 0.2 | GO:0019884 | antigen processing and presentation of exogenous antigen(GO:0019884) |
| 0.0 | 0.3 | GO:0019369 | arachidonic acid metabolic process(GO:0019369) |
| 0.0 | 1.1 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.0 | 0.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.0 | 0.1 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.0 | 0.3 | GO:2000178 | negative regulation of neural precursor cell proliferation(GO:2000178) |
| 0.0 | 2.6 | GO:0006334 | nucleosome assembly(GO:0006334) |
| 0.0 | 0.2 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.0 | 0.3 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.0 | 0.1 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.0 | 0.1 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) |
| 0.0 | 0.2 | GO:0036003 | positive regulation of transcription from RNA polymerase II promoter in response to stress(GO:0036003) |
| 0.0 | 0.1 | GO:1903975 | regulation of glial cell migration(GO:1903975) |
| 0.0 | 0.1 | GO:0006824 | cobalt ion transport(GO:0006824) |
| 0.0 | 0.1 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.0 | 0.4 | GO:0034315 | regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
| 0.0 | 0.1 | GO:0098700 | neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.0 | 0.1 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
| 0.0 | 0.2 | GO:0071549 | response to dexamethasone(GO:0071548) cellular response to dexamethasone stimulus(GO:0071549) |
| 0.0 | 0.1 | GO:0050919 | negative chemotaxis(GO:0050919) |
| 0.0 | 0.1 | GO:0030473 | nucleokinesis involved in cell motility in cerebral cortex radial glia guided migration(GO:0021817) nuclear migration along microtubule(GO:0030473) nuclear migration along microfilament(GO:0031022) |
| 0.0 | 0.1 | GO:1990034 | calcium ion export(GO:1901660) calcium ion export from cell(GO:1990034) |
| 0.0 | 0.3 | GO:2000772 | regulation of cellular senescence(GO:2000772) |
| 0.0 | 0.1 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
| 0.0 | 0.4 | GO:1902235 | regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902235) |
| 0.0 | 0.1 | GO:0042772 | DNA damage response, signal transduction resulting in transcription(GO:0042772) |
| 0.0 | 0.2 | GO:0044458 | motile cilium assembly(GO:0044458) |
| 0.0 | 0.2 | GO:0036296 | cellular response to increased oxygen levels(GO:0036295) response to increased oxygen levels(GO:0036296) |
| 0.0 | 0.3 | GO:0031497 | chromatin assembly(GO:0031497) |
| 0.0 | 0.6 | GO:0030278 | regulation of ossification(GO:0030278) |
| 0.0 | 0.2 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.0 | 0.6 | GO:0007588 | excretion(GO:0007588) |
| 0.0 | 0.2 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.0 | 0.6 | GO:0032933 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
| 0.0 | 0.3 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.0 | 0.3 | GO:0045646 | regulation of erythrocyte differentiation(GO:0045646) |
| 0.0 | 0.6 | GO:0060325 | face morphogenesis(GO:0060325) |
| 0.0 | 0.8 | GO:0043484 | regulation of RNA splicing(GO:0043484) |
| 0.0 | 0.1 | GO:0060074 | synapse maturation(GO:0060074) |
| 0.0 | 0.3 | GO:2000757 | negative regulation of peptidyl-lysine acetylation(GO:2000757) |
| 0.0 | 0.5 | GO:0033209 | tumor necrosis factor-mediated signaling pathway(GO:0033209) |
| 0.0 | 0.7 | GO:0051351 | positive regulation of ligase activity(GO:0051351) |
| 0.0 | 0.4 | GO:0003301 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 | 0.2 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
| 0.0 | 0.6 | GO:0006739 | NADP metabolic process(GO:0006739) |
| 0.0 | 0.4 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 | 0.0 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.0 | 0.7 | GO:0043525 | positive regulation of neuron apoptotic process(GO:0043525) |
| 0.0 | 0.1 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
| 0.0 | 0.2 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.0 | 0.6 | GO:0006284 | base-excision repair(GO:0006284) |
| 0.0 | 0.3 | GO:0009299 | mRNA transcription(GO:0009299) |
| 0.0 | 0.4 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.0 | 0.1 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
| 0.0 | 0.1 | GO:0015808 | L-alanine transport(GO:0015808) |
| 0.0 | 0.5 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
| 0.0 | 0.3 | GO:0030111 | regulation of Wnt signaling pathway(GO:0030111) |
| 0.0 | 0.4 | GO:1903845 | negative regulation of cellular response to transforming growth factor beta stimulus(GO:1903845) |
| 0.0 | 0.2 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
| 0.0 | 0.1 | GO:0060736 | prostate gland growth(GO:0060736) |
| 0.0 | 1.0 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
| 0.0 | 0.1 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.0 | 0.1 | GO:0036075 | endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.0 | 0.0 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.0 | 0.1 | GO:0060122 | inner ear receptor stereocilium organization(GO:0060122) |
| 0.0 | 0.5 | GO:0031960 | response to corticosteroid(GO:0031960) response to glucocorticoid(GO:0051384) |
| 0.0 | 0.0 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.0 | 0.1 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
| 0.0 | 0.3 | GO:0006493 | protein O-linked glycosylation(GO:0006493) |
| 0.0 | 0.5 | GO:0006749 | glutathione metabolic process(GO:0006749) |
| 0.0 | 0.5 | GO:0017148 | negative regulation of translation(GO:0017148) |
| 0.0 | 0.0 | GO:0090201 | negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
| 0.0 | 0.1 | GO:0046883 | regulation of hormone secretion(GO:0046883) |
| 0.0 | 0.3 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
| 0.0 | 0.2 | GO:0070207 | protein homotrimerization(GO:0070207) |
| 0.0 | 0.1 | GO:0030199 | collagen fibril organization(GO:0030199) |
| 0.0 | 0.1 | GO:0008543 | fibroblast growth factor receptor signaling pathway(GO:0008543) |
| 0.0 | 0.1 | GO:0045176 | apical protein localization(GO:0045176) |
| 0.0 | 0.1 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.0 | 0.1 | GO:0090199 | regulation of release of cytochrome c from mitochondria(GO:0090199) |
| 0.0 | 0.1 | GO:0019915 | lipid storage(GO:0019915) |
| 0.0 | 0.1 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
| 0.0 | 0.1 | GO:0050687 | negative regulation of defense response to virus(GO:0050687) |
| 0.0 | 0.1 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
| 0.0 | 0.1 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.0 | 0.0 | GO:1900377 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 0.0 | 0.8 | GO:0007519 | skeletal muscle tissue development(GO:0007519) |
| 0.0 | 0.1 | GO:0045739 | positive regulation of DNA repair(GO:0045739) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.1 | 9.2 | GO:0098592 | cytoplasmic side of apical plasma membrane(GO:0098592) |
| 2.8 | 11.3 | GO:0043259 | laminin-10 complex(GO:0043259) |
| 1.9 | 7.7 | GO:0000939 | condensed chromosome inner kinetochore(GO:0000939) |
| 1.8 | 5.3 | GO:0031680 | G-protein beta/gamma-subunit complex(GO:0031680) |
| 1.7 | 5.0 | GO:0071953 | elastic fiber(GO:0071953) |
| 1.6 | 7.8 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 1.5 | 17.7 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 1.4 | 4.3 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 1.4 | 8.5 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 1.4 | 4.1 | GO:0071914 | prominosome(GO:0071914) |
| 1.2 | 7.3 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 1.1 | 6.7 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 1.1 | 3.2 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
| 1.1 | 2.1 | GO:0043256 | laminin complex(GO:0043256) |
| 1.1 | 7.4 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 1.0 | 3.0 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 1.0 | 3.8 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.9 | 2.7 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.9 | 2.7 | GO:0071149 | TEAD-2-YAP complex(GO:0071149) |
| 0.8 | 3.3 | GO:0032127 | dense core granule membrane(GO:0032127) |
| 0.8 | 6.6 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.8 | 2.4 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 0.8 | 3.8 | GO:0005587 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
| 0.8 | 4.5 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.7 | 2.1 | GO:0038045 | large latent transforming growth factor-beta complex(GO:0038045) |
| 0.7 | 5.6 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.7 | 2.8 | GO:0032437 | cuticular plate(GO:0032437) |
| 0.7 | 2.1 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
| 0.7 | 3.3 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.6 | 4.7 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.6 | 5.9 | GO:0000796 | condensin complex(GO:0000796) |
| 0.6 | 2.3 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.6 | 5.8 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
| 0.6 | 5.1 | GO:0030478 | actin cap(GO:0030478) |
| 0.6 | 1.1 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.5 | 3.8 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.5 | 2.5 | GO:0098560 | cytoplasmic side of late endosome membrane(GO:0098560) |
| 0.5 | 2.0 | GO:0090537 | CERF complex(GO:0090537) |
| 0.5 | 3.4 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.5 | 4.1 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.4 | 3.0 | GO:0070187 | telosome(GO:0070187) |
| 0.4 | 5.5 | GO:0005605 | basal lamina(GO:0005605) |
| 0.4 | 3.7 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.4 | 2.0 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
| 0.4 | 3.2 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.4 | 1.5 | GO:0097574 | lateral part of cell(GO:0097574) basolateral part of cell(GO:1990794) rod bipolar cell terminal bouton(GO:1990795) |
| 0.4 | 6.1 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.4 | 2.3 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
| 0.4 | 1.9 | GO:0097513 | myosin II filament(GO:0097513) |
| 0.4 | 7.8 | GO:0008305 | integrin complex(GO:0008305) protein complex involved in cell adhesion(GO:0098636) |
| 0.4 | 6.9 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.4 | 2.2 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.4 | 1.4 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.4 | 2.2 | GO:0098536 | deuterosome(GO:0098536) |
| 0.4 | 1.4 | GO:0031983 | vesicle lumen(GO:0031983) |
| 0.3 | 4.8 | GO:0005922 | connexon complex(GO:0005922) |
| 0.3 | 1.0 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
| 0.3 | 1.4 | GO:0043511 | inhibin complex(GO:0043511) |
| 0.3 | 3.0 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.3 | 4.3 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.3 | 4.2 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.3 | 4.8 | GO:0070938 | contractile ring(GO:0070938) |
| 0.3 | 1.5 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.3 | 1.2 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.3 | 1.8 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.3 | 4.7 | GO:0010369 | chromocenter(GO:0010369) |
| 0.3 | 4.6 | GO:0032156 | septin cytoskeleton(GO:0032156) |
| 0.3 | 2.3 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.3 | 15.1 | GO:0000791 | euchromatin(GO:0000791) |
| 0.3 | 1.4 | GO:0005861 | troponin complex(GO:0005861) |
| 0.3 | 3.6 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 0.3 | 1.9 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.3 | 18.6 | GO:0005604 | basement membrane(GO:0005604) |
| 0.3 | 2.1 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 0.3 | 1.3 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.3 | 1.0 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
| 0.3 | 2.3 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.3 | 0.5 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.3 | 1.0 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.2 | 1.2 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.2 | 1.0 | GO:0045283 | mitochondrial respiratory chain complex II, succinate dehydrogenase complex (ubiquinone)(GO:0005749) succinate dehydrogenase complex (ubiquinone)(GO:0045257) respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) fumarate reductase complex(GO:0045283) |
| 0.2 | 1.5 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.2 | 2.4 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.2 | 3.8 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.2 | 4.2 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.2 | 1.5 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.2 | 1.5 | GO:0060293 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
| 0.2 | 0.8 | GO:0032021 | NELF complex(GO:0032021) |
| 0.2 | 0.8 | GO:0060187 | cell pole(GO:0060187) |
| 0.2 | 2.7 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.2 | 0.6 | GO:0033193 | Lsd1/2 complex(GO:0033193) |
| 0.2 | 0.6 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
| 0.2 | 1.2 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.2 | 0.9 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
| 0.2 | 3.3 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.2 | 1.8 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.2 | 4.0 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.2 | 1.4 | GO:0043205 | microfibril(GO:0001527) fibril(GO:0043205) |
| 0.2 | 1.1 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 0.2 | 0.5 | GO:0044753 | amphisome(GO:0044753) |
| 0.2 | 7.5 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.2 | 0.5 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.2 | 2.2 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.2 | 7.1 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
| 0.2 | 0.2 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
| 0.2 | 0.9 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.2 | 0.6 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.1 | 1.3 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
| 0.1 | 0.1 | GO:0045179 | apical cortex(GO:0045179) |
| 0.1 | 7.1 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.1 | 1.0 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.1 | 1.3 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.1 | 10.4 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.1 | 4.2 | GO:0030990 | intraciliary transport particle(GO:0030990) |
| 0.1 | 1.1 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.1 | 1.4 | GO:0016589 | NURF complex(GO:0016589) |
| 0.1 | 1.0 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.1 | 0.7 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.1 | 1.8 | GO:0045095 | keratin filament(GO:0045095) |
| 0.1 | 0.4 | GO:0042827 | platelet dense granule(GO:0042827) |
| 0.1 | 2.1 | GO:0042555 | MCM complex(GO:0042555) |
| 0.1 | 2.1 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.1 | 1.7 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.1 | 1.5 | GO:0034464 | BBSome(GO:0034464) |
| 0.1 | 1.6 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.1 | 1.9 | GO:0045180 | basal cortex(GO:0045180) |
| 0.1 | 0.5 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.1 | 1.3 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.1 | 0.9 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.1 | 1.6 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.1 | 3.7 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
| 0.1 | 0.5 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| 0.1 | 0.9 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.1 | 0.3 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.1 | 4.6 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
| 0.1 | 1.8 | GO:0036038 | MKS complex(GO:0036038) |
| 0.1 | 1.5 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.1 | 42.1 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.1 | 1.1 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.1 | 7.1 | GO:0001669 | acrosomal vesicle(GO:0001669) |
| 0.1 | 0.6 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.1 | 0.4 | GO:0031523 | Myb complex(GO:0031523) |
| 0.1 | 1.2 | GO:0030673 | axolemma(GO:0030673) |
| 0.1 | 0.5 | GO:0031902 | late endosome membrane(GO:0031902) |
| 0.1 | 11.2 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
| 0.1 | 0.7 | GO:0071012 | catalytic step 1 spliceosome(GO:0071012) |
| 0.1 | 2.3 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.1 | 1.0 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.1 | 2.5 | GO:0030904 | retromer complex(GO:0030904) |
| 0.1 | 1.3 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.1 | 1.5 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
| 0.1 | 1.9 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.1 | 15.7 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
| 0.1 | 0.1 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.1 | 5.0 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.1 | 8.0 | GO:0005814 | centriole(GO:0005814) |
| 0.1 | 0.5 | GO:1990356 | sumoylated E2 ligase complex(GO:1990356) |
| 0.1 | 0.4 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.1 | 0.7 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.1 | 5.1 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.1 | 0.9 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.1 | 1.3 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.1 | 1.1 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.1 | 0.4 | GO:0043218 | compact myelin(GO:0043218) |
| 0.1 | 0.6 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
| 0.1 | 0.1 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.1 | 0.6 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.1 | 5.7 | GO:0005746 | mitochondrial respiratory chain(GO:0005746) |
| 0.1 | 0.5 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.1 | 0.8 | GO:0051286 | cell tip(GO:0051286) |
| 0.1 | 3.3 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
| 0.1 | 1.2 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.1 | 0.4 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.1 | 0.7 | GO:0089701 | U2AF(GO:0089701) |
| 0.1 | 0.8 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.1 | 0.4 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.1 | 3.8 | GO:0005844 | polysome(GO:0005844) |
| 0.1 | 0.4 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.1 | 0.3 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.1 | 7.0 | GO:0022626 | cytosolic ribosome(GO:0022626) |
| 0.1 | 8.1 | GO:0032993 | protein-DNA complex(GO:0032993) |
| 0.1 | 0.4 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.1 | 2.2 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.1 | 0.3 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.1 | 0.4 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.1 | 2.1 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.1 | 0.3 | GO:1990037 | Lewy body core(GO:1990037) |
| 0.1 | 0.3 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.1 | 0.2 | GO:0043540 | 6-phosphofructo-2-kinase/fructose-2,6-biphosphatase complex(GO:0043540) |
| 0.1 | 0.9 | GO:0000800 | lateral element(GO:0000800) |
| 0.1 | 0.4 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.1 | 8.1 | GO:0031012 | extracellular matrix(GO:0031012) |
| 0.1 | 1.3 | GO:0005901 | caveola(GO:0005901) |
| 0.1 | 13.4 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
| 0.1 | 1.2 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.1 | 1.8 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
| 0.1 | 0.2 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.1 | 0.2 | GO:0048269 | methionine adenosyltransferase complex(GO:0048269) |
| 0.1 | 16.4 | GO:0005925 | focal adhesion(GO:0005925) |
| 0.1 | 16.3 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
| 0.1 | 0.9 | GO:0032039 | integrator complex(GO:0032039) |
| 0.1 | 0.5 | GO:0042571 | immunoglobulin complex(GO:0019814) immunoglobulin complex, circulating(GO:0042571) |
| 0.1 | 1.6 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.1 | 1.9 | GO:0036126 | sperm flagellum(GO:0036126) |
| 0.1 | 0.7 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.1 | 0.4 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.1 | 3.4 | GO:0005923 | bicellular tight junction(GO:0005923) occluding junction(GO:0070160) |
| 0.1 | 1.3 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.0 | 0.3 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.0 | 1.1 | GO:0016459 | myosin complex(GO:0016459) |
| 0.0 | 5.8 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.0 | 0.3 | GO:0090543 | Flemming body(GO:0090543) |
| 0.0 | 0.1 | GO:1990812 | growth cone filopodium(GO:1990812) |
| 0.0 | 1.5 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.0 | 6.5 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
| 0.0 | 6.6 | GO:0000790 | nuclear chromatin(GO:0000790) |
| 0.0 | 0.3 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.0 | 2.8 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.0 | 0.5 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.0 | 2.6 | GO:0016324 | apical plasma membrane(GO:0016324) |
| 0.0 | 0.8 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.0 | 0.2 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.0 | 0.2 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.0 | 0.8 | GO:0016592 | mediator complex(GO:0016592) |
| 0.0 | 0.5 | GO:0097546 | ciliary base(GO:0097546) |
| 0.0 | 0.9 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.0 | 0.2 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.0 | 1.5 | GO:0016605 | PML body(GO:0016605) |
| 0.0 | 0.3 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.0 | 0.1 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.0 | 0.2 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.0 | 0.4 | GO:0030175 | filopodium(GO:0030175) |
| 0.0 | 0.3 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.0 | 0.7 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.0 | 0.1 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.0 | 45.2 | GO:1903561 | extracellular vesicle(GO:1903561) |
| 0.0 | 0.9 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
| 0.0 | 2.6 | GO:0005911 | cell-cell junction(GO:0005911) |
| 0.0 | 0.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.0 | 0.4 | GO:1990391 | DNA repair complex(GO:1990391) |
| 0.0 | 2.6 | GO:0005681 | spliceosomal complex(GO:0005681) |
| 0.0 | 1.6 | GO:0005819 | spindle(GO:0005819) |
| 0.0 | 0.1 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.0 | 0.2 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.0 | 0.5 | GO:0000781 | chromosome, telomeric region(GO:0000781) |
| 0.0 | 0.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.0 | 0.1 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.0 | 0.1 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.7 | 33.3 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
| 2.4 | 7.3 | GO:0030226 | apolipoprotein receptor activity(GO:0030226) apolipoprotein A-I receptor activity(GO:0034188) phosphatidylserine-translocating ATPase activity(GO:0090556) |
| 2.4 | 7.2 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 2.0 | 9.8 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
| 1.9 | 5.8 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 1.8 | 7.1 | GO:0003844 | 1,4-alpha-glucan branching enzyme activity(GO:0003844) |
| 1.6 | 4.8 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 1.5 | 19.7 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
| 1.4 | 7.1 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
| 1.4 | 4.2 | GO:0071936 | coreceptor activity involved in Wnt signaling pathway(GO:0071936) |
| 1.4 | 5.6 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 1.4 | 4.2 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 1.3 | 6.3 | GO:0015166 | polyol transmembrane transporter activity(GO:0015166) glycerol transmembrane transporter activity(GO:0015168) |
| 1.3 | 17.6 | GO:0016641 | oxidoreductase activity, acting on the CH-NH2 group of donors, oxygen as acceptor(GO:0016641) |
| 1.2 | 3.7 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
| 1.2 | 8.6 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 1.2 | 5.9 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 1.2 | 18.6 | GO:0003680 | AT DNA binding(GO:0003680) |
| 1.1 | 3.4 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 1.1 | 10.9 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 1.1 | 3.2 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 1.1 | 5.3 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 1.1 | 3.2 | GO:0030549 | acetylcholine receptor activator activity(GO:0030549) |
| 1.0 | 3.1 | GO:0036132 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
| 1.0 | 15.1 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 1.0 | 3.0 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 1.0 | 4.0 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 1.0 | 3.0 | GO:0004454 | ketohexokinase activity(GO:0004454) |
| 1.0 | 3.9 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 1.0 | 3.8 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
| 1.0 | 2.9 | GO:0042936 | dipeptide transporter activity(GO:0042936) |
| 0.9 | 6.4 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
| 0.9 | 11.6 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.9 | 3.5 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
| 0.9 | 3.5 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.9 | 3.4 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.8 | 3.4 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.8 | 10.9 | GO:0042605 | peptide antigen binding(GO:0042605) |
| 0.8 | 3.2 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.8 | 3.9 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.7 | 3.0 | GO:0035473 | lipase binding(GO:0035473) |
| 0.7 | 2.2 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
| 0.7 | 2.2 | GO:0001225 | RNA polymerase II transcription coactivator binding(GO:0001225) |
| 0.7 | 2.2 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
| 0.7 | 1.4 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.7 | 2.1 | GO:0070892 | lipoteichoic acid receptor activity(GO:0070892) |
| 0.7 | 2.1 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
| 0.7 | 4.8 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.7 | 2.0 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.7 | 3.4 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.7 | 3.4 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.7 | 5.4 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.7 | 1.3 | GO:0055102 | phospholipase inhibitor activity(GO:0004859) phospholipase A2 inhibitor activity(GO:0019834) lipase inhibitor activity(GO:0055102) |
| 0.6 | 12.3 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.6 | 1.3 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) peptide transmembrane transporter activity(GO:1904680) |
| 0.6 | 1.9 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.6 | 3.2 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
| 0.6 | 1.8 | GO:0051378 | serotonin binding(GO:0051378) |
| 0.6 | 0.6 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
| 0.6 | 2.4 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
| 0.6 | 1.8 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.6 | 1.7 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
| 0.6 | 2.2 | GO:0008391 | arachidonic acid monooxygenase activity(GO:0008391) |
| 0.6 | 2.2 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
| 0.5 | 11.5 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
| 0.5 | 1.6 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
| 0.5 | 3.1 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.5 | 1.5 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
| 0.5 | 3.0 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
| 0.5 | 3.0 | GO:0019956 | chemokine binding(GO:0019956) |
| 0.5 | 5.4 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.5 | 1.5 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
| 0.5 | 2.4 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) RNA polymerase II transcription corepressor binding(GO:0001226) |
| 0.5 | 3.3 | GO:0046790 | virion binding(GO:0046790) |
| 0.5 | 0.9 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
| 0.5 | 3.7 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.5 | 1.8 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.4 | 6.6 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 0.4 | 2.2 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.4 | 2.6 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
| 0.4 | 3.4 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
| 0.4 | 5.8 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.4 | 1.2 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.4 | 36.4 | GO:0000980 | RNA polymerase II distal enhancer sequence-specific DNA binding(GO:0000980) |
| 0.4 | 3.7 | GO:1990239 | steroid hormone binding(GO:1990239) |
| 0.4 | 4.9 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
| 0.4 | 5.2 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
| 0.4 | 3.2 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.4 | 1.2 | GO:0051870 | methotrexate binding(GO:0051870) |
| 0.4 | 1.5 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.4 | 4.2 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.4 | 2.3 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.4 | 1.1 | GO:0009383 | rRNA (cytosine-C5-)-methyltransferase activity(GO:0009383) |
| 0.4 | 1.1 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.4 | 1.1 | GO:0003977 | UDP-N-acetylglucosamine diphosphorylase activity(GO:0003977) |
| 0.4 | 1.8 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.4 | 0.4 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
| 0.4 | 1.1 | GO:0046964 | 3'-phosphoadenosine 5'-phosphosulfate transmembrane transporter activity(GO:0046964) |
| 0.4 | 1.4 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.4 | 4.2 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.4 | 12.0 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.4 | 4.6 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
| 0.4 | 1.1 | GO:0005118 | sevenless binding(GO:0005118) |
| 0.4 | 1.4 | GO:0086038 | calcium:sodium antiporter activity involved in regulation of cardiac muscle cell membrane potential(GO:0086038) |
| 0.4 | 1.4 | GO:0003883 | CTP synthase activity(GO:0003883) |
| 0.4 | 1.1 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
| 0.3 | 5.6 | GO:0005044 | scavenger receptor activity(GO:0005044) |
| 0.3 | 1.0 | GO:0019002 | GMP binding(GO:0019002) |
| 0.3 | 6.6 | GO:0005003 | ephrin receptor activity(GO:0005003) |
| 0.3 | 1.0 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 0.3 | 2.0 | GO:0043426 | MRF binding(GO:0043426) |
| 0.3 | 2.4 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.3 | 2.7 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.3 | 1.0 | GO:0001729 | ceramide kinase activity(GO:0001729) |
| 0.3 | 1.3 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.3 | 2.0 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.3 | 7.6 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.3 | 1.3 | GO:2001069 | glycogen binding(GO:2001069) |
| 0.3 | 1.0 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.3 | 2.0 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.3 | 3.8 | GO:0005355 | glucose transmembrane transporter activity(GO:0005355) |
| 0.3 | 1.3 | GO:0015250 | water channel activity(GO:0015250) |
| 0.3 | 1.9 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
| 0.3 | 0.6 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.3 | 1.5 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
| 0.3 | 0.6 | GO:0015087 | cobalt ion transmembrane transporter activity(GO:0015087) nickel cation transmembrane transporter activity(GO:0015099) |
| 0.3 | 1.2 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
| 0.3 | 4.2 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.3 | 1.2 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 0.3 | 1.2 | GO:0036468 | aromatic-L-amino-acid decarboxylase activity(GO:0004058) L-dopa decarboxylase activity(GO:0036468) |
| 0.3 | 0.9 | GO:0031779 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
| 0.3 | 2.3 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.3 | 2.8 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.3 | 0.8 | GO:0008311 | double-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008311) |
| 0.3 | 2.2 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
| 0.3 | 0.8 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
| 0.3 | 0.5 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
| 0.3 | 2.2 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.3 | 2.2 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.3 | 1.4 | GO:0004342 | glucosamine-6-phosphate deaminase activity(GO:0004342) |
| 0.3 | 1.3 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) O-palmitoyltransferase activity(GO:0016416) |
| 0.3 | 1.1 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.3 | 11.7 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.3 | 6.8 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.3 | 1.3 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.3 | 1.8 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.3 | 0.8 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
| 0.3 | 7.2 | GO:0051183 | vitamin transporter activity(GO:0051183) |
| 0.3 | 1.3 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.3 | 0.3 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.3 | 0.8 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
| 0.2 | 1.0 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 0.2 | 1.2 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.2 | 3.4 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.2 | 1.9 | GO:0016618 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.2 | 0.7 | GO:0036313 | phosphatidylinositol 3-kinase catalytic subunit binding(GO:0036313) |
| 0.2 | 3.3 | GO:0033764 | steroid dehydrogenase activity, acting on the CH-OH group of donors, NAD or NADP as acceptor(GO:0033764) |
| 0.2 | 0.7 | GO:0016748 | succinyltransferase activity(GO:0016748) |
| 0.2 | 0.7 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
| 0.2 | 0.7 | GO:0016501 | prostacyclin receptor activity(GO:0016501) |
| 0.2 | 1.2 | GO:1990188 | euchromatin binding(GO:1990188) |
| 0.2 | 0.7 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
| 0.2 | 1.2 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 0.2 | 3.0 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
| 0.2 | 4.8 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.2 | 4.1 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.2 | 3.4 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.2 | 16.8 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.2 | 0.5 | GO:0019211 | phosphatase activator activity(GO:0019211) |
| 0.2 | 1.8 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
| 0.2 | 2.9 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
| 0.2 | 1.1 | GO:0070412 | R-SMAD binding(GO:0070412) |
| 0.2 | 8.6 | GO:0050840 | extracellular matrix binding(GO:0050840) |
| 0.2 | 0.8 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.2 | 1.5 | GO:0031432 | titin binding(GO:0031432) |
| 0.2 | 1.3 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.2 | 15.1 | GO:0005080 | protein kinase C binding(GO:0005080) |
| 0.2 | 2.5 | GO:0051861 | glycolipid binding(GO:0051861) |
| 0.2 | 0.6 | GO:0070330 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen(GO:0016712) aromatase activity(GO:0070330) |
| 0.2 | 1.0 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
| 0.2 | 0.6 | GO:0004104 | cholinesterase activity(GO:0004104) choline binding(GO:0033265) |
| 0.2 | 0.6 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
| 0.2 | 0.8 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.2 | 9.0 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.2 | 3.1 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 0.2 | 0.4 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.2 | 2.1 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.2 | 2.1 | GO:0015211 | purine nucleoside transmembrane transporter activity(GO:0015211) |
| 0.2 | 0.8 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.2 | 1.5 | GO:0050693 | LBD domain binding(GO:0050693) |
| 0.2 | 0.7 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.2 | 1.1 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.2 | 1.1 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.2 | 0.5 | GO:0004382 | guanosine-diphosphatase activity(GO:0004382) |
| 0.2 | 1.3 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.2 | 2.7 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.2 | 1.4 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
| 0.2 | 3.6 | GO:0001223 | transcription coactivator binding(GO:0001223) |
| 0.2 | 1.1 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
| 0.2 | 0.9 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.2 | 1.4 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.2 | 1.0 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.2 | 1.0 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
| 0.2 | 0.7 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.2 | 1.4 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.2 | 1.0 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.2 | 0.5 | GO:0003996 | acyl-CoA ligase activity(GO:0003996) |
| 0.2 | 1.6 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
| 0.2 | 3.1 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
| 0.2 | 2.1 | GO:0001848 | complement binding(GO:0001848) |
| 0.2 | 0.6 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.2 | 1.3 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.2 | 1.3 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
| 0.2 | 0.5 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.2 | 1.3 | GO:0015929 | hexosaminidase activity(GO:0015929) |
| 0.2 | 1.3 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.2 | 0.5 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.2 | 0.8 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.2 | 3.9 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.2 | 2.6 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.2 | 1.5 | GO:0022848 | acetylcholine-gated cation channel activity(GO:0022848) |
| 0.2 | 0.6 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.2 | 0.5 | GO:0018738 | S-formylglutathione hydrolase activity(GO:0018738) |
| 0.2 | 0.9 | GO:0002054 | nucleobase binding(GO:0002054) |
| 0.1 | 1.3 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.1 | 0.4 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
| 0.1 | 6.5 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.1 | 1.4 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.1 | 2.6 | GO:0001158 | enhancer sequence-specific DNA binding(GO:0001158) |
| 0.1 | 0.6 | GO:0016708 | nitric oxide dioxygenase activity(GO:0008941) oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of two atoms of oxygen into one donor(GO:0016708) iron-cytochrome-c reductase activity(GO:0047726) |
| 0.1 | 5.5 | GO:0016836 | hydro-lyase activity(GO:0016836) |
| 0.1 | 4.9 | GO:0005507 | copper ion binding(GO:0005507) |
| 0.1 | 0.6 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
| 0.1 | 0.7 | GO:0032554 | deoxyribonucleotide binding(GO:0032552) purine deoxyribonucleotide binding(GO:0032554) |
| 0.1 | 3.9 | GO:0019789 | SUMO transferase activity(GO:0019789) |
| 0.1 | 1.1 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.1 | 0.5 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.1 | 4.2 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.1 | 1.9 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.1 | 0.4 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.1 | 1.7 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.1 | 1.5 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.1 | 0.4 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.1 | 9.2 | GO:0005178 | integrin binding(GO:0005178) |
| 0.1 | 1.3 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
| 0.1 | 2.0 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.1 | 0.3 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.1 | 1.6 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.1 | 7.0 | GO:0016879 | ligase activity, forming carbon-nitrogen bonds(GO:0016879) |
| 0.1 | 0.4 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.1 | 0.2 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.1 | 1.1 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.1 | 4.7 | GO:0004896 | cytokine receptor activity(GO:0004896) |
| 0.1 | 1.0 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.1 | 0.4 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.1 | 5.3 | GO:0001046 | core promoter sequence-specific DNA binding(GO:0001046) |
| 0.1 | 0.6 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
| 0.1 | 5.7 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 0.1 | 0.1 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
| 0.1 | 0.8 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.1 | 0.3 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.1 | 0.5 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
| 0.1 | 0.6 | GO:0016803 | ether hydrolase activity(GO:0016803) |
| 0.1 | 1.5 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
| 0.1 | 0.6 | GO:0070320 | inward rectifier potassium channel inhibitor activity(GO:0070320) |
| 0.1 | 1.9 | GO:0098631 | protein binding involved in cell adhesion(GO:0098631) |
| 0.1 | 5.0 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.1 | 0.7 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.1 | 0.8 | GO:0008430 | selenium binding(GO:0008430) |
| 0.1 | 0.7 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.1 | 0.3 | GO:0030619 | U1 snRNA binding(GO:0030619) |
| 0.1 | 0.4 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.1 | 2.5 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.1 | 3.1 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.1 | 0.3 | GO:0030172 | troponin C binding(GO:0030172) |
| 0.1 | 2.2 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.1 | 0.5 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.1 | 0.7 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
| 0.1 | 0.3 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.1 | 0.6 | GO:0004659 | prenyltransferase activity(GO:0004659) |
| 0.1 | 0.4 | GO:0008227 | G-protein coupled amine receptor activity(GO:0008227) |
| 0.1 | 2.6 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.1 | 0.5 | GO:0015464 | acetylcholine receptor activity(GO:0015464) |
| 0.1 | 1.0 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.1 | 1.3 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.1 | 0.6 | GO:0016835 | carbon-oxygen lyase activity(GO:0016835) |
| 0.1 | 0.2 | GO:0001047 | core promoter binding(GO:0001047) |
| 0.1 | 0.5 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 0.1 | 0.5 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
| 0.1 | 0.2 | GO:0048019 | receptor antagonist activity(GO:0048019) |
| 0.1 | 0.3 | GO:0036004 | GAF domain binding(GO:0036004) |
| 0.1 | 1.0 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.1 | 0.7 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.1 | 0.4 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.1 | 0.3 | GO:0052740 | phosphatidylserine 1-acylhydrolase activity(GO:0052739) 1-acyl-2-lysophosphatidylserine acylhydrolase activity(GO:0052740) |
| 0.1 | 0.8 | GO:0042165 | neurotransmitter binding(GO:0042165) |
| 0.1 | 1.9 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.1 | 0.3 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 0.1 | 3.0 | GO:0003678 | DNA helicase activity(GO:0003678) |
| 0.1 | 1.2 | GO:0005123 | death receptor binding(GO:0005123) |
| 0.1 | 2.0 | GO:0042805 | actinin binding(GO:0042805) |
| 0.1 | 4.0 | GO:0003684 | damaged DNA binding(GO:0003684) |
| 0.1 | 0.2 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.1 | 0.6 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.1 | 2.4 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.1 | 0.4 | GO:0001032 | RNA polymerase III type 3 promoter DNA binding(GO:0001032) |
| 0.1 | 0.3 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.1 | 0.4 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.1 | 0.6 | GO:0016004 | phospholipase activator activity(GO:0016004) lipase activator activity(GO:0060229) |
| 0.1 | 0.2 | GO:0035575 | histone demethylase activity (H4-K20 specific)(GO:0035575) |
| 0.1 | 0.8 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.1 | 2.0 | GO:0033613 | activating transcription factor binding(GO:0033613) |
| 0.1 | 0.2 | GO:0004180 | carboxypeptidase activity(GO:0004180) |
| 0.1 | 1.9 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.1 | 0.4 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.1 | 3.2 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
| 0.1 | 0.2 | GO:0034211 | GTP-dependent protein kinase activity(GO:0034211) |
| 0.1 | 9.4 | GO:0003714 | transcription corepressor activity(GO:0003714) |
| 0.1 | 10.2 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
| 0.1 | 0.4 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
| 0.1 | 0.3 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.1 | 0.3 | GO:0004483 | mRNA (nucleoside-2'-O-)-methyltransferase activity(GO:0004483) |
| 0.1 | 0.3 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
| 0.1 | 0.3 | GO:0008802 | betaine-aldehyde dehydrogenase activity(GO:0008802) |
| 0.1 | 0.7 | GO:0015114 | phosphate ion transmembrane transporter activity(GO:0015114) |
| 0.1 | 0.7 | GO:0043495 | protein anchor(GO:0043495) |
| 0.1 | 3.5 | GO:0005179 | hormone activity(GO:0005179) |
| 0.1 | 0.5 | GO:0019215 | intermediate filament binding(GO:0019215) |
| 0.1 | 0.7 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.1 | 0.2 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.1 | 4.8 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.1 | 26.0 | GO:0000977 | RNA polymerase II regulatory region sequence-specific DNA binding(GO:0000977) |
| 0.1 | 0.7 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.1 | 0.3 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.1 | 0.7 | GO:0019531 | secondary active sulfate transmembrane transporter activity(GO:0008271) sulfate transmembrane transporter activity(GO:0015116) oxalate transmembrane transporter activity(GO:0019531) |
| 0.1 | 0.4 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.1 | 1.1 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
| 0.1 | 0.6 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.1 | 0.5 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
| 0.1 | 1.3 | GO:0016675 | oxidoreductase activity, acting on a heme group of donors(GO:0016675) |
| 0.1 | 1.1 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.1 | 0.6 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.1 | 0.4 | GO:0048101 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
| 0.1 | 0.6 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.1 | 0.5 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
| 0.1 | 1.0 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.1 | 0.2 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.1 | 1.4 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
| 0.1 | 0.2 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.1 | 0.6 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.1 | 1.7 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.1 | 0.9 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.1 | 0.4 | GO:0008094 | DNA-dependent ATPase activity(GO:0008094) |
| 0.1 | 0.4 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.1 | 0.2 | GO:0031720 | haptoglobin binding(GO:0031720) |
| 0.1 | 0.3 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.1 | 1.8 | GO:0051287 | NAD binding(GO:0051287) |
| 0.1 | 0.6 | GO:0030553 | cGMP binding(GO:0030553) |
| 0.1 | 0.5 | GO:0016860 | intramolecular oxidoreductase activity(GO:0016860) |
| 0.1 | 2.4 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 0.1 | 0.2 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.1 | 1.0 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.0 | 0.1 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
| 0.0 | 0.1 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 0.0 | 0.4 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) peptidase activator activity involved in apoptotic process(GO:0016505) |
| 0.0 | 0.2 | GO:0003998 | acylphosphatase activity(GO:0003998) |
| 0.0 | 0.2 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.0 | 0.8 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.0 | 0.3 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.0 | 3.2 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.0 | 0.8 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) anion:anion antiporter activity(GO:0015301) |
| 0.0 | 0.9 | GO:0043394 | proteoglycan binding(GO:0043394) |
| 0.0 | 0.3 | GO:0005047 | signal recognition particle binding(GO:0005047) 7S RNA binding(GO:0008312) |
| 0.0 | 0.6 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.0 | 1.1 | GO:0005112 | Notch binding(GO:0005112) |
| 0.0 | 0.9 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.0 | 0.2 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.0 | 0.2 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.0 | 0.3 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.0 | 0.1 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.0 | 0.3 | GO:0008242 | omega peptidase activity(GO:0008242) |
| 0.0 | 7.0 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.3 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.0 | 0.9 | GO:0036442 | hydrogen-exporting ATPase activity(GO:0036442) |
| 0.0 | 5.6 | GO:0042393 | histone binding(GO:0042393) |
| 0.0 | 0.1 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
| 0.0 | 0.0 | GO:0001129 | transcription factor activity, RNA polymerase II basal transcription factor binding(GO:0001083) RNA polymerase II transcription factor activity, TBP-class protein binding, involved in preinitiation complex assembly(GO:0001129) RNA polymerase II transcription factor activity, TBP-class protein binding(GO:0001132) |
| 0.0 | 0.2 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 0.0 | 0.4 | GO:0005537 | mannose binding(GO:0005537) |
| 0.0 | 0.6 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.0 | 0.3 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.0 | 0.1 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.0 | 0.1 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
| 0.0 | 1.6 | GO:0016776 | phosphotransferase activity, phosphate group as acceptor(GO:0016776) |
| 0.0 | 0.3 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.0 | 0.4 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.0 | 0.2 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.0 | 0.5 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.0 | 0.9 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.0 | 0.1 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
| 0.0 | 0.1 | GO:0051184 | cofactor transporter activity(GO:0051184) |
| 0.0 | 0.8 | GO:0008080 | N-acetyltransferase activity(GO:0008080) |
| 0.0 | 0.2 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.0 | 0.2 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.0 | 0.3 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.0 | 2.8 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
| 0.0 | 1.2 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
| 0.0 | 0.4 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.0 | 0.5 | GO:0018024 | histone-lysine N-methyltransferase activity(GO:0018024) |
| 0.0 | 0.2 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
| 0.0 | 0.3 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.0 | 0.2 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.0 | 0.1 | GO:0004103 | choline kinase activity(GO:0004103) |
| 0.0 | 4.3 | GO:0043565 | sequence-specific DNA binding(GO:0043565) |
| 0.0 | 0.2 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.0 | 0.1 | GO:0008527 | taste receptor activity(GO:0008527) |
| 0.0 | 0.2 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.0 | 0.6 | GO:0008757 | S-adenosylmethionine-dependent methyltransferase activity(GO:0008757) |
| 0.0 | 0.1 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.0 | 0.1 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.0 | 0.2 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
| 0.0 | 0.2 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.0 | 0.2 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.0 | 0.5 | GO:0016645 | oxidoreductase activity, acting on the CH-NH group of donors(GO:0016645) |
| 0.0 | 0.0 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.0 | 1.1 | GO:0004197 | cysteine-type endopeptidase activity(GO:0004197) |
| 0.0 | 0.2 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.0 | 0.0 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.0 | 0.1 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.0 | 1.7 | GO:0004386 | helicase activity(GO:0004386) |
| 0.0 | 0.2 | GO:0070034 | telomerase RNA binding(GO:0070034) |
| 0.0 | 0.0 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
| 0.0 | 0.3 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
| 0.0 | 0.5 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
| 0.0 | 0.6 | GO:0002039 | p53 binding(GO:0002039) |
| 0.0 | 0.0 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.0 | 0.1 | GO:0004984 | olfactory receptor activity(GO:0004984) |
| 0.0 | 0.1 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
| 0.0 | 0.1 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.0 | 0.2 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
| 0.0 | 0.9 | GO:0030165 | PDZ domain binding(GO:0030165) |
| 0.0 | 0.4 | GO:0061134 | peptidase regulator activity(GO:0061134) |
| 0.0 | 0.0 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 0.0 | 0.3 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.9 | 15.1 | PID_INTEGRIN4_PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 1.3 | 11.6 | SA_G2_AND_M_PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.7 | 0.7 | PID_P38_GAMMA_DELTA_PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.6 | 10.4 | PID_INTEGRIN_CS_PATHWAY | Integrin family cell surface interactions |
| 0.5 | 7.0 | PID_INSULIN_GLUCOSE_PATHWAY | Insulin-mediated glucose transport |
| 0.4 | 0.9 | PID_AMB2_NEUTROPHILS_PATHWAY | amb2 Integrin signaling |
| 0.4 | 19.4 | PID_AURORA_B_PATHWAY | Aurora B signaling |
| 0.4 | 2.8 | PID_IL5_PATHWAY | IL5-mediated signaling events |
| 0.4 | 2.7 | ST_PAC1_RECEPTOR_PATHWAY | PAC1 Receptor Pathway |
| 0.4 | 17.5 | NABA_COLLAGENS | Genes encoding collagen proteins |
| 0.4 | 9.2 | PID_PRL_SIGNALING_EVENTS_PATHWAY | Signaling events mediated by PRL |
| 0.3 | 6.2 | PID_SYNDECAN_2_PATHWAY | Syndecan-2-mediated signaling events |
| 0.3 | 17.2 | PID_TAP63_PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.3 | 2.1 | PID_SYNDECAN_4_PATHWAY | Syndecan-4-mediated signaling events |
| 0.3 | 3.3 | ST_INTERFERON_GAMMA_PATHWAY | Interferon gamma pathway. |
| 0.3 | 6.5 | ST_INTERLEUKIN_4_PATHWAY | Interleukin 4 (IL-4) Pathway |
| 0.3 | 2.6 | PID_INTEGRIN2_PATHWAY | Beta2 integrin cell surface interactions |
| 0.2 | 1.5 | ST_JAK_STAT_PATHWAY | Jak-STAT Pathway |
| 0.2 | 2.2 | SA_MMP_CYTOKINE_CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.2 | 3.1 | PID_S1P_S1P3_PATHWAY | S1P3 pathway |
| 0.2 | 8.4 | PID_RXR_VDR_PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.2 | 3.4 | PID_S1P_S1P1_PATHWAY | S1P1 pathway |
| 0.2 | 30.9 | NABA_ECM_GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.2 | 7.8 | PID_BARD1_PATHWAY | BARD1 signaling events |
| 0.2 | 9.3 | PID_NFAT_TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.2 | 7.3 | PID_HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.2 | 1.6 | PID_AVB3_INTEGRIN_PATHWAY | Integrins in angiogenesis |
| 0.2 | 1.2 | PID_S1P_S1P2_PATHWAY | S1P2 pathway |
| 0.2 | 2.3 | PID_INTEGRIN1_PATHWAY | Beta1 integrin cell surface interactions |
| 0.2 | 2.0 | PID_ANTHRAX_PATHWAY | Cellular roles of Anthrax toxin |
| 0.2 | 6.2 | NABA_CORE_MATRISOME | Ensemble of genes encoding core extracellular matrix including ECM glycoproteins, collagens and proteoglycans |
| 0.2 | 10.9 | PID_HEDGEHOG_GLI_PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.2 | 2.8 | PID_IL23_PATHWAY | IL23-mediated signaling events |
| 0.2 | 1.4 | PID_FCER1_PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.2 | 7.1 | PID_PS1_PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.2 | 4.5 | PID_EPHRINB_REV_PATHWAY | Ephrin B reverse signaling |
| 0.2 | 22.1 | NABA_ECM_REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.2 | 9.3 | PID_NOTCH_PATHWAY | Notch signaling pathway |
| 0.2 | 4.4 | PID_ATR_PATHWAY | ATR signaling pathway |
| 0.2 | 3.3 | PID_WNT_SIGNALING_PATHWAY | Wnt signaling network |
| 0.2 | 2.0 | ST_P38_MAPK_PATHWAY | p38 MAPK Pathway |
| 0.2 | 1.1 | PID_INTEGRIN_A9B1_PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.1 | 0.6 | PID_TCR_JNK_PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.1 | 2.6 | PID_ER_NONGENOMIC_PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.1 | 2.9 | PID_HDAC_CLASSIII_PATHWAY | Signaling events mediated by HDAC Class III |
| 0.1 | 4.0 | PID_P38_MK2_PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.1 | 9.1 | PID_CDC42_PATHWAY | CDC42 signaling events |
| 0.1 | 1.5 | PID_ALK2_PATHWAY | ALK2 signaling events |
| 0.1 | 0.4 | ST_WNT_CA2_CYCLIC_GMP_PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.1 | 1.1 | PID_RHODOPSIN_PATHWAY | Visual signal transduction: Rods |
| 0.1 | 0.7 | SA_REG_CASCADE_OF_CYCLIN_EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.1 | 1.3 | ST_GRANULE_CELL_SURVIVAL_PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.1 | 1.5 | ST_G_ALPHA_S_PATHWAY | G alpha s Pathway |
| 0.1 | 5.5 | PID_PLK1_PATHWAY | PLK1 signaling events |
| 0.1 | 1.6 | PID_PDGFRA_PATHWAY | PDGFR-alpha signaling pathway |
| 0.1 | 1.7 | PID_GLYPICAN_1PATHWAY | Glypican 1 network |
| 0.1 | 0.5 | ST_G_ALPHA_I_PATHWAY | G alpha i Pathway |
| 0.1 | 1.7 | PID_FOXM1_PATHWAY | FOXM1 transcription factor network |
| 0.1 | 0.2 | SIG_IL4RECEPTOR_IN_B_LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.1 | 7.7 | PID_AR_PATHWAY | Coregulation of Androgen receptor activity |
| 0.1 | 0.5 | PID_ERB_GENOMIC_PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.1 | 1.0 | PID_ECADHERIN_KERATINOCYTE_PATHWAY | E-cadherin signaling in keratinocytes |
| 0.1 | 4.3 | PID_P73PATHWAY | p73 transcription factor network |
| 0.1 | 2.2 | ST_JNK_MAPK_PATHWAY | JNK MAPK Pathway |
| 0.1 | 2.9 | SIG_INSULIN_RECEPTOR_PATHWAY_IN_CARDIAC_MYOCYTES | Genes related to the insulin receptor pathway |
| 0.1 | 0.9 | PID_THROMBIN_PAR1_PATHWAY | PAR1-mediated thrombin signaling events |
| 0.1 | 1.5 | PID_TOLL_ENDOGENOUS_PATHWAY | Endogenous TLR signaling |
| 0.1 | 0.8 | PID_NEPHRIN_NEPH1_PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.1 | 0.1 | ST_GA12_PATHWAY | G alpha 12 Pathway |
| 0.1 | 0.5 | PID_S1P_META_PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.1 | 3.4 | PID_HDAC_CLASSI_PATHWAY | Signaling events mediated by HDAC Class I |
| 0.1 | 1.0 | PID_TRAIL_PATHWAY | TRAIL signaling pathway |
| 0.1 | 0.4 | PID_A6B1_A6B4_INTEGRIN_PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.1 | 0.9 | PID_MYC_PATHWAY | C-MYC pathway |
| 0.1 | 0.2 | PID_BETA_CATENIN_DEG_PATHWAY | Degradation of beta catenin |
| 0.1 | 1.1 | SIG_PIP3_SIGNALING_IN_B_LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.1 | 7.3 | NABA_ECM_AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.1 | 0.7 | ST_GA13_PATHWAY | G alpha 13 Pathway |
| 0.1 | 2.5 | PID_P53_REGULATION_PATHWAY | p53 pathway |
| 0.1 | 1.4 | PID_ERBB4_PATHWAY | ErbB4 signaling events |
| 0.1 | 2.2 | PID_E2F_PATHWAY | E2F transcription factor network |
| 0.1 | 1.1 | PID_ILK_PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 0.3 | PID_VEGFR1_PATHWAY | VEGFR1 specific signals |
| 0.0 | 1.4 | PID_FGF_PATHWAY | FGF signaling pathway |
| 0.0 | 0.3 | PID_PTP1B_PATHWAY | Signaling events mediated by PTP1B |
| 0.0 | 0.2 | ST_TYPE_I_INTERFERON_PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.0 | 0.7 | PID_IL4_2PATHWAY | IL4-mediated signaling events |
| 0.0 | 0.7 | PID_DELTA_NP63_PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.0 | 0.7 | PID_TNF_PATHWAY | TNF receptor signaling pathway |
| 0.0 | 0.5 | PID_ATF2_PATHWAY | ATF-2 transcription factor network |
| 0.0 | 0.4 | PID_WNT_NONCANONICAL_PATHWAY | Noncanonical Wnt signaling pathway |
| 0.0 | 0.3 | PID_IL3_PATHWAY | IL3-mediated signaling events |
| 0.0 | 1.5 | PID_CMYB_PATHWAY | C-MYB transcription factor network |
| 0.0 | 0.2 | PID_SHP2_PATHWAY | SHP2 signaling |
| 0.0 | 1.3 | PID_RHOA_REG_PATHWAY | Regulation of RhoA activity |
| 0.0 | 0.6 | PID_HNF3B_PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.0 | 0.6 | PID_CASPASE_PATHWAY | Caspase cascade in apoptosis |
| 0.0 | 0.2 | PID_IL6_7_PATHWAY | IL6-mediated signaling events |
| 0.0 | 0.1 | PID_PI3KCI_PATHWAY | Class I PI3K signaling events |
| 0.0 | 0.3 | PID_RAC1_REG_PATHWAY | Regulation of RAC1 activity |
| 0.0 | 0.1 | PID_SMAD2_3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 0.3 | PID_TGFBR_PATHWAY | TGF-beta receptor signaling |
| 0.0 | 0.3 | PID_MYC_REPRESS_PATHWAY | Validated targets of C-MYC transcriptional repression |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.4 | 1.4 | REACTOME_INTERACTIONS_OF_VPR_WITH_HOST_CELLULAR_PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 1.1 | 8.9 | REACTOME_PASSIVE_TRANSPORT_BY_AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.8 | 0.8 | REACTOME_LATENT_INFECTION_OF_HOMO_SAPIENS_WITH_MYCOBACTERIUM_TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.8 | 11.4 | REACTOME_SYNTHESIS_SECRETION_AND_INACTIVATION_OF_GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.7 | 3.0 | REACTOME_ETHANOL_OXIDATION | Genes involved in Ethanol oxidation |
| 0.7 | 1.3 | REACTOME_SIGNALING_BY_FGFR_IN_DISEASE | Genes involved in Signaling by FGFR in disease |
| 0.6 | 4.1 | REACTOME_ENDOGENOUS_STEROLS | Genes involved in Endogenous sterols |
| 0.6 | 8.7 | REACTOME_DEGRADATION_OF_THE_EXTRACELLULAR_MATRIX | Genes involved in Degradation of the extracellular matrix |
| 0.6 | 9.0 | REACTOME_PRE_NOTCH_PROCESSING_IN_GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.6 | 5.6 | REACTOME_HYALURONAN_UPTAKE_AND_DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 0.5 | 0.5 | REACTOME_YAP1_AND_WWTR1_TAZ_STIMULATED_GENE_EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.5 | 8.6 | REACTOME_CYCLIN_A_B1_ASSOCIATED_EVENTS_DURING_G2_M_TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.5 | 5.4 | REACTOME_PROLACTIN_RECEPTOR_SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.5 | 8.8 | REACTOME_HOMOLOGOUS_RECOMBINATION_REPAIR_OF_REPLICATION_INDEPENDENT_DOUBLE_STRAND_BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.5 | 2.7 | REACTOME_INCRETIN_SYNTHESIS_SECRETION_AND_INACTIVATION | Genes involved in Incretin Synthesis, Secretion, and Inactivation |
| 0.4 | 4.9 | REACTOME_AMINE_DERIVED_HORMONES | Genes involved in Amine-derived hormones |
| 0.4 | 7.1 | REACTOME_APOPTOSIS_INDUCED_DNA_FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.4 | 0.9 | REACTOME_SHC1_EVENTS_IN_EGFR_SIGNALING | Genes involved in SHC1 events in EGFR signaling |
| 0.4 | 4.8 | REACTOME_GAP_JUNCTION_ASSEMBLY | Genes involved in Gap junction assembly |
| 0.4 | 5.1 | REACTOME_HDL_MEDIATED_LIPID_TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.4 | 0.4 | REACTOME_BOTULINUM_NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
| 0.4 | 4.3 | REACTOME_REGULATION_OF_IFNG_SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.4 | 9.9 | REACTOME_STRIATED_MUSCLE_CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.4 | 6.1 | REACTOME_G1_S_SPECIFIC_TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.3 | 5.9 | REACTOME_MITOCHONDRIAL_FATTY_ACID_BETA_OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.3 | 1.4 | REACTOME_PEPTIDE_HORMONE_BIOSYNTHESIS | Genes involved in Peptide hormone biosynthesis |
| 0.3 | 7.8 | REACTOME_TRAF6_MEDIATED_NFKB_ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.3 | 1.9 | REACTOME_REMOVAL_OF_THE_FLAP_INTERMEDIATE_FROM_THE_C_STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 0.3 | 27.0 | REACTOME_INTEGRIN_CELL_SURFACE_INTERACTIONS | Genes involved in Integrin cell surface interactions |
| 0.3 | 0.9 | REACTOME_ANTIGEN_ACTIVATES_B_CELL_RECEPTOR_LEADING_TO_GENERATION_OF_SECOND_MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.3 | 31.0 | REACTOME_MITOTIC_PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.3 | 4.7 | REACTOME_P38MAPK_EVENTS | Genes involved in p38MAPK events |
| 0.3 | 5.8 | REACTOME_MUSCLE_CONTRACTION | Genes involved in Muscle contraction |
| 0.3 | 7.4 | REACTOME_GLUTATHIONE_CONJUGATION | Genes involved in Glutathione conjugation |
| 0.3 | 3.0 | REACTOME_CS_DS_DEGRADATION | Genes involved in CS/DS degradation |
| 0.3 | 3.8 | REACTOME_NOTCH_HLH_TRANSCRIPTION_PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.3 | 3.7 | REACTOME_PURINE_RIBONUCLEOSIDE_MONOPHOSPHATE_BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.3 | 5.6 | REACTOME_CITRIC_ACID_CYCLE_TCA_CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.3 | 3.0 | REACTOME_G0_AND_EARLY_G1 | Genes involved in G0 and Early G1 |
| 0.2 | 2.1 | REACTOME_TERMINATION_OF_O_GLYCAN_BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.2 | 2.2 | REACTOME_NEGATIVE_REGULATION_OF_THE_PI3K_AKT_NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.2 | 9.7 | REACTOME_RECYCLING_PATHWAY_OF_L1 | Genes involved in Recycling pathway of L1 |
| 0.2 | 4.8 | REACTOME_TGF_BETA_RECEPTOR_SIGNALING_IN_EMT_EPITHELIAL_TO_MESENCHYMAL_TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.2 | 0.8 | REACTOME_INFLUENZA_LIFE_CYCLE | Genes involved in Influenza Life Cycle |
| 0.2 | 1.0 | REACTOME_SYNTHESIS_OF_BILE_ACIDS_AND_BILE_SALTS_VIA_24_HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.2 | 10.3 | REACTOME_COLLAGEN_FORMATION | Genes involved in Collagen formation |
| 0.2 | 1.0 | REACTOME_FORMATION_OF_TRANSCRIPTION_COUPLED_NER_TC_NER_REPAIR_COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 0.2 | 1.4 | REACTOME_TRAF6_MEDIATED_IRF7_ACTIVATION_IN_TLR7_8_OR_9_SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.2 | 3.1 | REACTOME_PHASE1_FUNCTIONALIZATION_OF_COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
| 0.2 | 5.8 | REACTOME_G1_PHASE | Genes involved in G1 Phase |
| 0.2 | 1.7 | REACTOME_PYRIMIDINE_CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.2 | 1.2 | REACTOME_REGULATION_OF_ORNITHINE_DECARBOXYLASE_ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.2 | 3.1 | REACTOME_CONVERSION_FROM_APC_C_CDC20_TO_APC_C_CDH1_IN_LATE_ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.2 | 4.0 | REACTOME_SYNTHESIS_AND_INTERCONVERSION_OF_NUCLEOTIDE_DI_AND_TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.2 | 2.3 | REACTOME_IONOTROPIC_ACTIVITY_OF_KAINATE_RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.2 | 2.8 | REACTOME_EARLY_PHASE_OF_HIV_LIFE_CYCLE | Genes involved in Early Phase of HIV Life Cycle |
| 0.2 | 5.6 | REACTOME_AMINO_ACID_TRANSPORT_ACROSS_THE_PLASMA_MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.2 | 1.5 | REACTOME_SIGNALING_BY_ACTIVATED_POINT_MUTANTS_OF_FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 0.1 | 1.6 | REACTOME_FACILITATIVE_NA_INDEPENDENT_GLUCOSE_TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.1 | 0.7 | REACTOME_IRAK2_MEDIATED_ACTIVATION_OF_TAK1_COMPLEX_UPON_TLR7_8_OR_9_STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.1 | 0.3 | REACTOME_SOS_MEDIATED_SIGNALLING | Genes involved in SOS-mediated signalling |
| 0.1 | 2.1 | REACTOME_UNWINDING_OF_DNA | Genes involved in Unwinding of DNA |
| 0.1 | 1.6 | REACTOME_SHC_MEDIATED_SIGNALLING | Genes involved in SHC-mediated signalling |
| 0.1 | 1.4 | REACTOME_PRE_NOTCH_EXPRESSION_AND_PROCESSING | Genes involved in Pre-NOTCH Expression and Processing |
| 0.1 | 0.9 | REACTOME_ERKS_ARE_INACTIVATED | Genes involved in ERKs are inactivated |
| 0.1 | 3.8 | REACTOME_G_BETA_GAMMA_SIGNALLING_THROUGH_PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
| 0.1 | 1.4 | REACTOME_SIGNALING_BY_NODAL | Genes involved in Signaling by NODAL |
| 0.1 | 1.5 | REACTOME_EXTRINSIC_PATHWAY_FOR_APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.1 | 1.4 | REACTOME_DESTABILIZATION_OF_MRNA_BY_AUF1_HNRNP_D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.1 | 2.3 | REACTOME_ABCA_TRANSPORTERS_IN_LIPID_HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.1 | 0.7 | REACTOME_THE_NLRP3_INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.1 | 1.0 | REACTOME_OXYGEN_DEPENDENT_PROLINE_HYDROXYLATION_OF_HYPOXIA_INDUCIBLE_FACTOR_ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.1 | 1.8 | REACTOME_DESTABILIZATION_OF_MRNA_BY_TRISTETRAPROLIN_TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.1 | 1.0 | REACTOME_TRYPTOPHAN_CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.1 | 1.0 | REACTOME_IL_7_SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.1 | 0.7 | REACTOME_REGULATION_OF_IFNA_SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.1 | 2.4 | REACTOME_OTHER_SEMAPHORIN_INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.1 | 1.5 | REACTOME_REGULATION_OF_INSULIN_LIKE_GROWTH_FACTOR_IGF_ACTIVITY_BY_INSULIN_LIKE_GROWTH_FACTOR_BINDING_PROTEINS_IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.1 | 3.7 | REACTOME_GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.1 | 2.0 | REACTOME_MITOTIC_M_M_G1_PHASES | Genes involved in Mitotic M-M/G1 phases |
| 0.1 | 6.4 | REACTOME_NUCLEAR_RECEPTOR_TRANSCRIPTION_PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.1 | 9.3 | REACTOME_METABOLISM_OF_AMINO_ACIDS_AND_DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.1 | 6.6 | REACTOME_ANTIGEN_PROCESSING_CROSS_PRESENTATION | Genes involved in Antigen processing-Cross presentation |
| 0.1 | 1.6 | REACTOME_KERATAN_SULFATE_BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
| 0.1 | 0.7 | REACTOME_RECEPTOR_LIGAND_BINDING_INITIATES_THE_SECOND_PROTEOLYTIC_CLEAVAGE_OF_NOTCH_RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.1 | 3.0 | REACTOME_PACKAGING_OF_TELOMERE_ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.1 | 0.8 | REACTOME_SIGNALING_BY_NOTCH2 | Genes involved in Signaling by NOTCH2 |
| 0.1 | 4.3 | REACTOME_ACTIVATION_OF_CHAPERONE_GENES_BY_XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.1 | 0.9 | REACTOME_THROMBIN_SIGNALLING_THROUGH_PROTEINASE_ACTIVATED_RECEPTORS_PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.1 | 0.9 | REACTOME_EXTENSION_OF_TELOMERES | Genes involved in Extension of Telomeres |
| 0.1 | 0.6 | REACTOME_SIGNALING_BY_WNT | Genes involved in Signaling by Wnt |
| 0.1 | 0.6 | REACTOME_SYNTHESIS_SECRETION_AND_DEACYLATION_OF_GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.1 | 6.2 | REACTOME_RESPIRATORY_ELECTRON_TRANSPORT_ATP_SYNTHESIS_BY_CHEMIOSMOTIC_COUPLING_AND_HEAT_PRODUCTION_BY_UNCOUPLING_PROTEINS_ | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.1 | 0.3 | REACTOME_ARMS_MEDIATED_ACTIVATION | Genes involved in ARMS-mediated activation |
| 0.1 | 1.3 | REACTOME_CREB_PHOSPHORYLATION_THROUGH_THE_ACTIVATION_OF_CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
| 0.1 | 0.6 | REACTOME_CALNEXIN_CALRETICULIN_CYCLE | Genes involved in Calnexin/calreticulin cycle |
| 0.1 | 1.1 | REACTOME_IL1_SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.1 | 0.4 | REACTOME_PROSTACYCLIN_SIGNALLING_THROUGH_PROSTACYCLIN_RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
| 0.1 | 1.1 | REACTOME_HS_GAG_DEGRADATION | Genes involved in HS-GAG degradation |
| 0.1 | 0.5 | REACTOME_PRESYNAPTIC_NICOTINIC_ACETYLCHOLINE_RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
| 0.1 | 0.2 | REACTOME_DESTABILIZATION_OF_MRNA_BY_KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.1 | 0.7 | REACTOME_REGULATION_OF_INSULIN_SECRETION_BY_GLUCAGON_LIKE_PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
| 0.1 | 1.6 | REACTOME_ELONGATION_ARREST_AND_RECOVERY | Genes involved in Elongation arrest and recovery |
| 0.1 | 1.3 | REACTOME_TRANSFERRIN_ENDOCYTOSIS_AND_RECYCLING | Genes involved in Transferrin endocytosis and recycling |
| 0.1 | 1.2 | REACTOME_METABOLISM_OF_PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.1 | 0.2 | REACTOME_NUCLEAR_EVENTS_KINASE_AND_TRANSCRIPTION_FACTOR_ACTIVATION | Genes involved in Nuclear Events (kinase and transcription factor activation) |
| 0.0 | 1.3 | REACTOME_DOWNREGULATION_OF_SMAD2_3_SMAD4_TRANSCRIPTIONAL_ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.0 | 0.8 | REACTOME_SYNTHESIS_OF_PIPS_AT_THE_GOLGI_MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
| 0.0 | 0.6 | REACTOME_NUCLEAR_SIGNALING_BY_ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.0 | 0.3 | REACTOME_ORGANIC_CATION_ANION_ZWITTERION_TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.0 | 0.3 | REACTOME_SYNTHESIS_OF_PIPS_AT_THE_EARLY_ENDOSOME_MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
| 0.0 | 0.8 | REACTOME_PIP3_ACTIVATES_AKT_SIGNALING | Genes involved in PIP3 activates AKT signaling |
| 0.0 | 1.1 | REACTOME_METAL_ION_SLC_TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.0 | 1.3 | REACTOME_GLYCOSPHINGOLIPID_METABOLISM | Genes involved in Glycosphingolipid metabolism |
| 0.0 | 0.2 | REACTOME_PYRUVATE_METABOLISM | Genes involved in Pyruvate metabolism |
| 0.0 | 0.8 | REACTOME_MITOCHONDRIAL_TRNA_AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 1.1 | REACTOME_MYOGENESIS | Genes involved in Myogenesis |
| 0.0 | 0.6 | REACTOME_HORMONE_SENSITIVE_LIPASE_HSL_MEDIATED_TRIACYLGLYCEROL_HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.0 | 0.4 | REACTOME_STEROID_HORMONES | Genes involved in Steroid hormones |
| 0.0 | 0.3 | REACTOME_TRANSPORT_OF_ORGANIC_ANIONS | Genes involved in Transport of organic anions |
| 0.0 | 0.5 | REACTOME_REGULATION_OF_BETA_CELL_DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.0 | 0.3 | REACTOME_A_TETRASACCHARIDE_LINKER_SEQUENCE_IS_REQUIRED_FOR_GAG_SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
| 0.0 | 3.4 | REACTOME_PEPTIDE_CHAIN_ELONGATION | Genes involved in Peptide chain elongation |
| 0.0 | 0.6 | REACTOME_RNA_POL_I_PROMOTER_OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.0 | 0.4 | REACTOME_MRNA_DECAY_BY_5_TO_3_EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 0.8 | REACTOME_O_LINKED_GLYCOSYLATION_OF_MUCINS | Genes involved in O-linked glycosylation of mucins |
| 0.0 | 5.0 | REACTOME_ANTIGEN_PROCESSING_UBIQUITINATION_PROTEASOME_DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.0 | 0.3 | REACTOME_ACTIVATION_OF_GENES_BY_ATF4 | Genes involved in Activation of Genes by ATF4 |
| 0.0 | 0.2 | REACTOME_BASIGIN_INTERACTIONS | Genes involved in Basigin interactions |
| 0.0 | 0.5 | REACTOME_ANTIVIRAL_MECHANISM_BY_IFN_STIMULATED_GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.0 | 0.4 | REACTOME_METABOLISM_OF_NON_CODING_RNA | Genes involved in Metabolism of non-coding RNA |
| 0.0 | 1.2 | REACTOME_DNA_REPAIR | Genes involved in DNA Repair |
| 0.0 | 0.2 | REACTOME_MTORC1_MEDIATED_SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.0 | 0.8 | REACTOME_TRANSPORT_OF_VITAMINS_NUCLEOSIDES_AND_RELATED_MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.0 | 0.1 | REACTOME_METABOLISM_OF_STEROID_HORMONES_AND_VITAMINS_A_AND_D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
| 0.0 | 0.4 | REACTOME_AMINE_COMPOUND_SLC_TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.0 | 0.2 | REACTOME_ACTIVATION_OF_ATR_IN_RESPONSE_TO_REPLICATION_STRESS | Genes involved in Activation of ATR in response to replication stress |
| 0.0 | 0.5 | REACTOME_POST_TRANSLATIONAL_MODIFICATION_SYNTHESIS_OF_GPI_ANCHORED_PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.0 | 0.2 | REACTOME_FRS2_MEDIATED_CASCADE | Genes involved in FRS2-mediated cascade |
| 0.0 | 0.5 | REACTOME_BIOSYNTHESIS_OF_THE_N_GLYCAN_PRECURSOR_DOLICHOL_LIPID_LINKED_OLIGOSACCHARIDE_LLO_AND_TRANSFER_TO_A_NASCENT_PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.0 | 0.1 | REACTOME_IL_6_SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.0 | 0.1 | REACTOME_REGULATION_OF_PYRUVATE_DEHYDROGENASE_PDH_COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.0 | 0.4 | REACTOME_NOTCH1_INTRACELLULAR_DOMAIN_REGULATES_TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
