Motif ID: Hnf4g
Z-value: 1.596
Transcription factors associated with Hnf4g:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| Hnf4g | ENSMUSG00000017688.8 | Hnf4g |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 5.5 | 16.4 | GO:0042196 | dichloromethane metabolic process(GO:0018900) chlorinated hydrocarbon metabolic process(GO:0042196) halogenated hydrocarbon metabolic process(GO:0042197) |
| 4.5 | 22.7 | GO:2000065 | negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
| 4.1 | 16.3 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 2.9 | 14.5 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
| 2.9 | 17.1 | GO:1901552 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 2.8 | 8.5 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
| 2.8 | 8.5 | GO:0061537 | glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 2.6 | 7.9 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 2.5 | 15.2 | GO:0097646 | calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
| 2.4 | 7.1 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
| 2.0 | 10.2 | GO:0036115 | fatty-acyl-CoA catabolic process(GO:0036115) |
| 1.9 | 5.8 | GO:0010752 | signal complex assembly(GO:0007172) regulation of cGMP-mediated signaling(GO:0010752) |
| 1.6 | 6.6 | GO:1904425 | negative regulation of GTP binding(GO:1904425) |
| 1.6 | 4.9 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 1.6 | 4.8 | GO:1903630 | regulation of aminoacyl-tRNA ligase activity(GO:1903630) positive regulation of aminoacyl-tRNA ligase activity(GO:1903632) |
| 1.6 | 3.1 | GO:1901079 | positive regulation of relaxation of muscle(GO:1901079) |
| 1.5 | 9.3 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 1.5 | 7.5 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
| 1.5 | 8.9 | GO:2001204 | regulation of osteoclast development(GO:2001204) |
| 1.4 | 4.3 | GO:1902938 | regulation of intracellular calcium activated chloride channel activity(GO:1902938) |
| 1.4 | 2.9 | GO:0014738 | regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
| 1.4 | 2.8 | GO:2000705 | regulation of dense core granule biogenesis(GO:2000705) |
| 1.4 | 5.6 | GO:0098917 | retrograde trans-synaptic signaling(GO:0098917) |
| 1.4 | 11.0 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
| 1.4 | 6.9 | GO:0070305 | response to cGMP(GO:0070305) cellular response to cGMP(GO:0071321) |
| 1.4 | 8.1 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
| 1.3 | 3.9 | GO:0042823 | pyridoxal phosphate biosynthetic process(GO:0042823) |
| 1.3 | 10.4 | GO:0009181 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
| 1.2 | 6.2 | GO:1901526 | positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
| 1.2 | 4.9 | GO:0015825 | L-serine transport(GO:0015825) |
| 1.2 | 8.5 | GO:0014819 | regulation of skeletal muscle contraction(GO:0014819) |
| 1.2 | 3.6 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
| 1.2 | 2.3 | GO:0042323 | negative regulation of circadian sleep/wake cycle, non-REM sleep(GO:0042323) negative regulation of mucus secretion(GO:0070256) |
| 1.2 | 2.3 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
| 1.2 | 3.5 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
| 1.1 | 5.7 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 1.1 | 9.0 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
| 1.1 | 4.3 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
| 1.0 | 5.2 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
| 1.0 | 4.2 | GO:2000974 | negative regulation of pro-B cell differentiation(GO:2000974) |
| 1.0 | 5.2 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
| 1.0 | 4.1 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 1.0 | 7.1 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
| 1.0 | 2.9 | GO:0043096 | purine nucleobase salvage(GO:0043096) |
| 1.0 | 2.9 | GO:0043181 | vacuolar sequestering(GO:0043181) |
| 1.0 | 3.8 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 1.0 | 3.8 | GO:0006558 | L-phenylalanine metabolic process(GO:0006558) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) |
| 1.0 | 4.8 | GO:0071499 | response to laminar fluid shear stress(GO:0034616) cellular response to laminar fluid shear stress(GO:0071499) |
| 0.9 | 10.3 | GO:0090232 | positive regulation of spindle checkpoint(GO:0090232) |
| 0.9 | 2.8 | GO:0031335 | regulation of sulfur amino acid metabolic process(GO:0031335) |
| 0.9 | 11.1 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.9 | 2.8 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
| 0.9 | 5.5 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.9 | 10.1 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.9 | 4.6 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.9 | 6.4 | GO:0010273 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.9 | 8.2 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.9 | 4.6 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.9 | 0.9 | GO:2000435 | regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
| 0.9 | 2.7 | GO:0010512 | negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
| 0.9 | 0.9 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.9 | 8.0 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.9 | 2.6 | GO:1904580 | regulation of polynucleotide adenylyltransferase activity(GO:1904245) regulation of intracellular mRNA localization(GO:1904580) |
| 0.9 | 2.6 | GO:0031038 | myosin II filament organization(GO:0031038) regulation of myosin II filament organization(GO:0043519) |
| 0.9 | 1.7 | GO:0051541 | elastin metabolic process(GO:0051541) |
| 0.9 | 2.6 | GO:0002447 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) regulation of eosinophil activation(GO:1902566) |
| 0.8 | 3.3 | GO:0090472 | dibasic protein processing(GO:0090472) |
| 0.8 | 4.1 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.8 | 0.8 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
| 0.8 | 3.2 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.8 | 3.2 | GO:1904996 | virion attachment to host cell(GO:0019062) adhesion of symbiont to host cell(GO:0044650) positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 0.8 | 3.1 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) positive regulation of triglyceride catabolic process(GO:0010898) |
| 0.8 | 4.7 | GO:0045919 | positive regulation of cytolysis(GO:0045919) |
| 0.8 | 5.5 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.8 | 3.9 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
| 0.8 | 5.4 | GO:0010359 | regulation of anion channel activity(GO:0010359) |
| 0.8 | 3.1 | GO:0019244 | lactate biosynthetic process from pyruvate(GO:0019244) |
| 0.7 | 1.5 | GO:0061744 | motor behavior(GO:0061744) |
| 0.7 | 2.9 | GO:0099566 | regulation of postsynaptic cytosolic calcium ion concentration(GO:0099566) |
| 0.7 | 2.2 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.7 | 2.1 | GO:0010641 | positive regulation of platelet-derived growth factor receptor signaling pathway(GO:0010641) |
| 0.7 | 7.1 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
| 0.7 | 4.9 | GO:0051958 | methotrexate transport(GO:0051958) |
| 0.7 | 2.1 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
| 0.7 | 1.4 | GO:0071072 | negative regulation of phospholipid biosynthetic process(GO:0071072) |
| 0.7 | 1.4 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.7 | 2.8 | GO:0051933 | amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
| 0.7 | 2.7 | GO:0098884 | postsynaptic neurotransmitter receptor internalization(GO:0098884) |
| 0.7 | 2.0 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.7 | 7.5 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
| 0.7 | 2.0 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
| 0.7 | 2.7 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
| 0.7 | 2.0 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.7 | 4.6 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 0.7 | 2.0 | GO:0035470 | positive regulation of vascular wound healing(GO:0035470) |
| 0.6 | 2.6 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.6 | 3.2 | GO:0015788 | UDP-N-acetylglucosamine transport(GO:0015788) |
| 0.6 | 2.6 | GO:0015744 | succinate transport(GO:0015744) |
| 0.6 | 1.9 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
| 0.6 | 4.5 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.6 | 2.5 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.6 | 4.4 | GO:0015862 | uridine transport(GO:0015862) |
| 0.6 | 2.5 | GO:0035624 | receptor transactivation(GO:0035624) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
| 0.6 | 1.9 | GO:0060217 | positive regulation of chromatin assembly or disassembly(GO:0045799) hemangioblast cell differentiation(GO:0060217) |
| 0.6 | 2.5 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.6 | 1.8 | GO:0007521 | muscle cell fate determination(GO:0007521) mammary placode formation(GO:0060596) |
| 0.6 | 1.8 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.6 | 2.4 | GO:0008078 | mesodermal cell migration(GO:0008078) |
| 0.6 | 0.6 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
| 0.6 | 1.8 | GO:0046168 | glycerol-3-phosphate catabolic process(GO:0046168) |
| 0.6 | 1.8 | GO:0021577 | hindbrain structural organization(GO:0021577) cerebellum structural organization(GO:0021589) |
| 0.6 | 0.6 | GO:0002086 | diaphragm contraction(GO:0002086) |
| 0.6 | 2.9 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.6 | 4.5 | GO:0043615 | astrocyte cell migration(GO:0043615) |
| 0.6 | 2.2 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
| 0.5 | 4.4 | GO:0042167 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.5 | 2.7 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.5 | 1.6 | GO:1904046 | negative regulation of vascular endothelial growth factor production(GO:1904046) |
| 0.5 | 5.4 | GO:0019243 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.5 | 3.2 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.5 | 1.6 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
| 0.5 | 2.1 | GO:0010889 | regulation of sequestering of triglyceride(GO:0010889) positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.5 | 6.3 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.5 | 2.6 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
| 0.5 | 1.6 | GO:0015697 | quaternary ammonium group transport(GO:0015697) |
| 0.5 | 1.5 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
| 0.5 | 2.0 | GO:0061623 | glycolytic process from galactose(GO:0061623) |
| 0.5 | 1.5 | GO:2000551 | regulation of T-helper 2 cell cytokine production(GO:2000551) positive regulation of T-helper 2 cell cytokine production(GO:2000553) |
| 0.5 | 2.9 | GO:0003350 | pulmonary myocardium development(GO:0003350) |
| 0.5 | 3.4 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.5 | 1.0 | GO:0097117 | guanylate kinase-associated protein clustering(GO:0097117) |
| 0.5 | 1.5 | GO:0015910 | peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.5 | 0.5 | GO:0032902 | nerve growth factor production(GO:0032902) |
| 0.5 | 1.4 | GO:0071929 | alpha-tubulin acetylation(GO:0071929) |
| 0.5 | 2.4 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) |
| 0.5 | 1.0 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
| 0.5 | 1.9 | GO:0043461 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 0.5 | 1.9 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.5 | 1.4 | GO:0016553 | base conversion or substitution editing(GO:0016553) |
| 0.5 | 4.6 | GO:0061032 | visceral serous pericardium development(GO:0061032) |
| 0.5 | 2.8 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.5 | 1.4 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.5 | 3.2 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.4 | 1.3 | GO:0006693 | prostanoid metabolic process(GO:0006692) prostaglandin metabolic process(GO:0006693) |
| 0.4 | 2.2 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
| 0.4 | 1.3 | GO:1903294 | regulation of glutamate secretion, neurotransmission(GO:1903294) positive regulation of glutamate secretion, neurotransmission(GO:1903296) |
| 0.4 | 1.3 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
| 0.4 | 2.2 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) |
| 0.4 | 1.3 | GO:0034287 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
| 0.4 | 1.3 | GO:0009174 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
| 0.4 | 2.6 | GO:0032439 | endosome localization(GO:0032439) negative regulation of vacuolar transport(GO:1903336) |
| 0.4 | 1.7 | GO:0019230 | proprioception(GO:0019230) |
| 0.4 | 4.2 | GO:0051901 | positive regulation of mitochondrial depolarization(GO:0051901) |
| 0.4 | 4.6 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.4 | 1.2 | GO:0048298 | positive regulation of isotype switching to IgA isotypes(GO:0048298) |
| 0.4 | 2.8 | GO:0034116 | positive regulation of heterotypic cell-cell adhesion(GO:0034116) |
| 0.4 | 3.9 | GO:0044110 | growth involved in symbiotic interaction(GO:0044110) growth of symbiont involved in interaction with host(GO:0044116) growth of symbiont in host(GO:0044117) regulation of growth of symbiont in host(GO:0044126) modulation of growth of symbiont involved in interaction with host(GO:0044144) |
| 0.4 | 3.5 | GO:0016198 | axon choice point recognition(GO:0016198) |
| 0.4 | 2.0 | GO:0098703 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
| 0.4 | 1.2 | GO:0000448 | cleavage in ITS2 between 5.8S rRNA and LSU-rRNA of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000448) |
| 0.4 | 1.9 | GO:0090234 | regulation of kinetochore assembly(GO:0090234) |
| 0.4 | 2.3 | GO:0051798 | positive regulation of hair follicle development(GO:0051798) |
| 0.4 | 1.5 | GO:0046967 | cytosol to ER transport(GO:0046967) |
| 0.4 | 1.5 | GO:0097527 | necroptotic signaling pathway(GO:0097527) |
| 0.4 | 2.2 | GO:0045002 | double-strand break repair via single-strand annealing(GO:0045002) |
| 0.4 | 1.8 | GO:0090343 | positive regulation of cell aging(GO:0090343) |
| 0.4 | 3.3 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.4 | 2.6 | GO:0071474 | cellular hyperosmotic response(GO:0071474) |
| 0.4 | 2.9 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.4 | 9.1 | GO:0034340 | response to type I interferon(GO:0034340) |
| 0.4 | 5.1 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.4 | 1.1 | GO:0060854 | patterning of lymph vessels(GO:0060854) |
| 0.4 | 2.8 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
| 0.4 | 1.8 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.4 | 0.4 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.4 | 3.5 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.4 | 2.5 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.4 | 2.1 | GO:0046103 | ADP biosynthetic process(GO:0006172) inosine biosynthetic process(GO:0046103) |
| 0.3 | 1.0 | GO:2000170 | positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
| 0.3 | 2.8 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.3 | 1.0 | GO:1901052 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
| 0.3 | 2.1 | GO:0070294 | renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
| 0.3 | 0.7 | GO:0043388 | positive regulation of DNA binding(GO:0043388) |
| 0.3 | 3.8 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
| 0.3 | 2.0 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
| 0.3 | 1.4 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.3 | 2.0 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.3 | 2.0 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.3 | 2.0 | GO:1902998 | macrophage proliferation(GO:0061517) microglial cell proliferation(GO:0061518) regulation of neuronal signal transduction(GO:1902847) positive regulation of neurofibrillary tangle assembly(GO:1902998) |
| 0.3 | 4.3 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.3 | 0.7 | GO:0051006 | positive regulation of lipoprotein lipase activity(GO:0051006) |
| 0.3 | 6.2 | GO:0045793 | positive regulation of cell size(GO:0045793) |
| 0.3 | 1.0 | GO:0070257 | regulation of mucus secretion(GO:0070255) positive regulation of mucus secretion(GO:0070257) |
| 0.3 | 2.9 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
| 0.3 | 1.3 | GO:1900110 | negative regulation of histone H3-K9 dimethylation(GO:1900110) |
| 0.3 | 4.2 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.3 | 1.0 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
| 0.3 | 1.9 | GO:0061092 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.3 | 3.8 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
| 0.3 | 9.4 | GO:1901984 | negative regulation of protein acetylation(GO:1901984) negative regulation of peptidyl-lysine acetylation(GO:2000757) |
| 0.3 | 0.9 | GO:0016256 | N-glycan processing to lysosome(GO:0016256) |
| 0.3 | 7.7 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
| 0.3 | 1.8 | GO:0010884 | positive regulation of lipid storage(GO:0010884) |
| 0.3 | 1.2 | GO:0006207 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.3 | 1.2 | GO:0051593 | response to folic acid(GO:0051593) |
| 0.3 | 1.8 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
| 0.3 | 0.9 | GO:2000002 | negative regulation of DNA damage checkpoint(GO:2000002) |
| 0.3 | 1.8 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.3 | 6.5 | GO:0001913 | T cell mediated cytotoxicity(GO:0001913) |
| 0.3 | 0.9 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.3 | 9.1 | GO:0071480 | cellular response to gamma radiation(GO:0071480) |
| 0.3 | 1.2 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.3 | 1.2 | GO:0002339 | B cell selection(GO:0002339) |
| 0.3 | 1.7 | GO:0090494 | catecholamine uptake(GO:0090493) dopamine uptake(GO:0090494) |
| 0.3 | 1.2 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
| 0.3 | 1.5 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
| 0.3 | 0.3 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.3 | 0.9 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
| 0.3 | 1.1 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
| 0.3 | 0.9 | GO:0090032 | negative regulation of steroid hormone biosynthetic process(GO:0090032) |
| 0.3 | 2.0 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.3 | 1.1 | GO:1900864 | positive regulation of translational fidelity(GO:0045903) mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
| 0.3 | 1.7 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.3 | 3.6 | GO:0046456 | icosanoid biosynthetic process(GO:0046456) fatty acid derivative biosynthetic process(GO:1901570) |
| 0.3 | 1.7 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.3 | 18.1 | GO:0030279 | negative regulation of ossification(GO:0030279) |
| 0.3 | 0.8 | GO:0043921 | modulation by host of viral transcription(GO:0043921) modulation of transcription in other organism involved in symbiotic interaction(GO:0052312) modulation by host of symbiont transcription(GO:0052472) |
| 0.3 | 0.8 | GO:0006550 | isoleucine catabolic process(GO:0006550) |
| 0.3 | 2.5 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
| 0.3 | 1.6 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
| 0.3 | 0.5 | GO:0036166 | phenotypic switching(GO:0036166) |
| 0.3 | 2.7 | GO:0051923 | sulfation(GO:0051923) |
| 0.3 | 9.5 | GO:0000038 | very long-chain fatty acid metabolic process(GO:0000038) |
| 0.3 | 1.1 | GO:0046294 | formaldehyde catabolic process(GO:0046294) |
| 0.3 | 2.9 | GO:0048266 | behavioral response to pain(GO:0048266) |
| 0.3 | 1.1 | GO:0019388 | galactose catabolic process(GO:0019388) |
| 0.3 | 1.6 | GO:1990118 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.3 | 4.8 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
| 0.3 | 5.0 | GO:0070208 | protein heterotrimerization(GO:0070208) |
| 0.3 | 4.5 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.3 | 2.6 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.3 | 0.8 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.3 | 1.0 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.3 | 0.8 | GO:0034035 | sulfate assimilation(GO:0000103) purine ribonucleoside bisphosphate metabolic process(GO:0034035) 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 0.3 | 1.8 | GO:0015919 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
| 0.3 | 1.0 | GO:0006529 | asparagine biosynthetic process(GO:0006529) |
| 0.3 | 2.0 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
| 0.3 | 0.5 | GO:0061324 | regulation of anagen(GO:0051884) positive regulation of epithelial cell proliferation involved in prostate gland development(GO:0060769) fungiform papilla formation(GO:0061198) canonical Wnt signaling pathway involved in positive regulation of cardiac outflow tract cell proliferation(GO:0061324) regulation of centromeric sister chromatid cohesion(GO:0070602) |
| 0.2 | 5.2 | GO:0032288 | myelin assembly(GO:0032288) |
| 0.2 | 3.0 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.2 | 0.7 | GO:0006449 | regulation of translational termination(GO:0006449) |
| 0.2 | 0.7 | GO:0061042 | vascular wound healing(GO:0061042) |
| 0.2 | 1.0 | GO:0002726 | positive regulation of T cell cytokine production(GO:0002726) |
| 0.2 | 1.2 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) chaperone-mediated protein transport(GO:0072321) |
| 0.2 | 1.9 | GO:0060662 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
| 0.2 | 1.4 | GO:0032026 | response to magnesium ion(GO:0032026) |
| 0.2 | 0.9 | GO:0006244 | pyrimidine nucleotide catabolic process(GO:0006244) pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
| 0.2 | 0.7 | GO:0045204 | MAPK export from nucleus(GO:0045204) |
| 0.2 | 1.2 | GO:0032811 | negative regulation of epinephrine secretion(GO:0032811) |
| 0.2 | 2.1 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
| 0.2 | 0.7 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) intermediate filament bundle assembly(GO:0045110) |
| 0.2 | 0.5 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.2 | 1.2 | GO:0019236 | response to pheromone(GO:0019236) |
| 0.2 | 6.3 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.2 | 2.3 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.2 | 3.9 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
| 0.2 | 2.0 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.2 | 0.9 | GO:0046947 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.2 | 1.3 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) |
| 0.2 | 1.1 | GO:1903818 | positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.2 | 0.2 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
| 0.2 | 1.9 | GO:0060768 | epithelial cell proliferation involved in prostate gland development(GO:0060767) regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.2 | 1.5 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
| 0.2 | 0.2 | GO:0032329 | serine transport(GO:0032329) |
| 0.2 | 0.6 | GO:0009838 | abscission(GO:0009838) |
| 0.2 | 2.3 | GO:0016264 | gap junction assembly(GO:0016264) |
| 0.2 | 1.3 | GO:0045061 | thymic T cell selection(GO:0045061) |
| 0.2 | 0.4 | GO:0072675 | osteoclast fusion(GO:0072675) |
| 0.2 | 1.5 | GO:0006621 | protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.2 | 1.9 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) negative regulation of sprouting angiogenesis(GO:1903671) |
| 0.2 | 0.2 | GO:1901228 | positive regulation of transcription from RNA polymerase II promoter involved in heart development(GO:1901228) |
| 0.2 | 3.7 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
| 0.2 | 4.9 | GO:0001937 | negative regulation of endothelial cell proliferation(GO:0001937) |
| 0.2 | 1.4 | GO:0032790 | ribosome disassembly(GO:0032790) |
| 0.2 | 2.6 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
| 0.2 | 0.6 | GO:0046133 | pyrimidine ribonucleoside catabolic process(GO:0046133) |
| 0.2 | 0.6 | GO:0071921 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.2 | 1.4 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 0.2 | 1.4 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.2 | 0.8 | GO:0070086 | protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) ubiquitin-dependent endocytosis(GO:0070086) |
| 0.2 | 2.1 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.2 | 2.1 | GO:0044406 | adhesion of symbiont to host(GO:0044406) |
| 0.2 | 1.3 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.2 | 0.2 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
| 0.2 | 1.7 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
| 0.2 | 0.9 | GO:2001168 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.2 | 0.7 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.2 | 0.6 | GO:1902527 | positive regulation of protein monoubiquitination(GO:1902527) |
| 0.2 | 0.6 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
| 0.2 | 0.2 | GO:0009826 | unidimensional cell growth(GO:0009826) |
| 0.2 | 0.6 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.2 | 0.4 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.2 | 1.3 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 0.2 | 1.5 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.2 | 0.9 | GO:2000325 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 0.2 | 1.6 | GO:0048701 | embryonic cranial skeleton morphogenesis(GO:0048701) |
| 0.2 | 1.1 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.2 | 0.9 | GO:1903719 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.2 | 1.1 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.2 | 0.7 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
| 0.2 | 2.1 | GO:0071260 | cellular response to mechanical stimulus(GO:0071260) |
| 0.2 | 0.9 | GO:0045716 | positive regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045716) |
| 0.2 | 1.6 | GO:0006833 | water transport(GO:0006833) |
| 0.2 | 1.9 | GO:0009642 | response to light intensity(GO:0009642) |
| 0.2 | 0.5 | GO:0060633 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) negative regulation of DNA-templated transcription, initiation(GO:2000143) |
| 0.2 | 0.5 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.2 | 0.7 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 0.2 | 2.4 | GO:0043496 | regulation of protein homodimerization activity(GO:0043496) |
| 0.2 | 2.0 | GO:0060134 | prepulse inhibition(GO:0060134) |
| 0.2 | 0.8 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
| 0.2 | 0.8 | GO:0043314 | negative regulation of neutrophil degranulation(GO:0043314) negative regulation of blood vessel remodeling(GO:0060313) negative regulation of neutrophil activation(GO:1902564) |
| 0.2 | 1.2 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
| 0.2 | 2.5 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.2 | 0.7 | GO:0018201 | peptidyl-glycine modification(GO:0018201) |
| 0.2 | 0.5 | GO:0045346 | regulation of MHC class II biosynthetic process(GO:0045346) negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.2 | 0.5 | GO:0051792 | medium-chain fatty acid biosynthetic process(GO:0051792) |
| 0.2 | 1.5 | GO:0070070 | proton-transporting V-type ATPase complex assembly(GO:0070070) |
| 0.2 | 1.1 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.2 | 0.3 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
| 0.2 | 0.8 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.2 | 0.3 | GO:0017185 | peptidyl-lysine hydroxylation(GO:0017185) |
| 0.2 | 4.9 | GO:0010830 | regulation of myotube differentiation(GO:0010830) |
| 0.2 | 1.1 | GO:0030578 | PML body organization(GO:0030578) |
| 0.2 | 0.6 | GO:0006925 | inflammatory cell apoptotic process(GO:0006925) |
| 0.2 | 1.3 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.2 | 0.3 | GO:1904706 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.2 | 1.7 | GO:0010866 | regulation of triglyceride biosynthetic process(GO:0010866) |
| 0.2 | 0.6 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.2 | 4.2 | GO:2000300 | regulation of synaptic vesicle exocytosis(GO:2000300) |
| 0.2 | 0.8 | GO:0051126 | negative regulation of actin nucleation(GO:0051126) |
| 0.2 | 0.9 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.1 | 0.7 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.1 | 2.4 | GO:0042178 | xenobiotic catabolic process(GO:0042178) |
| 0.1 | 1.6 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
| 0.1 | 0.6 | GO:1904529 | regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
| 0.1 | 2.1 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.1 | 0.6 | GO:0009414 | response to water deprivation(GO:0009414) |
| 0.1 | 3.8 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.1 | 1.3 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.1 | 0.9 | GO:0021521 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 0.1 | 1.1 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
| 0.1 | 1.5 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
| 0.1 | 1.0 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.1 | 1.4 | GO:0042572 | retinol metabolic process(GO:0042572) |
| 0.1 | 0.6 | GO:0046654 | purine nucleobase biosynthetic process(GO:0009113) tetrahydrofolate biosynthetic process(GO:0046654) |
| 0.1 | 1.4 | GO:0007616 | long-term memory(GO:0007616) |
| 0.1 | 4.6 | GO:0034314 | Arp2/3 complex-mediated actin nucleation(GO:0034314) |
| 0.1 | 2.9 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.1 | 0.4 | GO:0043686 | co-translational protein modification(GO:0043686) |
| 0.1 | 0.5 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.1 | 4.5 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
| 0.1 | 0.5 | GO:0009415 | response to water(GO:0009415) regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031657) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031659) response to hydrostatic pressure(GO:0051599) |
| 0.1 | 2.3 | GO:0031214 | biomineral tissue development(GO:0031214) |
| 0.1 | 0.8 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
| 0.1 | 0.5 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.1 | 0.7 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.1 | 0.9 | GO:0032261 | purine nucleotide salvage(GO:0032261) IMP salvage(GO:0032264) |
| 0.1 | 1.1 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.1 | 0.4 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.1 | 1.0 | GO:0071816 | tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.1 | 0.4 | GO:0009446 | putrescine biosynthetic process(GO:0009446) |
| 0.1 | 10.9 | GO:0048709 | oligodendrocyte differentiation(GO:0048709) |
| 0.1 | 1.2 | GO:0097201 | negative regulation of transcription from RNA polymerase II promoter in response to stress(GO:0097201) |
| 0.1 | 1.7 | GO:0016486 | peptide hormone processing(GO:0016486) |
| 0.1 | 0.8 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.1 | 0.8 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
| 0.1 | 1.3 | GO:0098532 | liver regeneration(GO:0097421) histone H3-K27 trimethylation(GO:0098532) |
| 0.1 | 2.9 | GO:0061098 | positive regulation of protein tyrosine kinase activity(GO:0061098) |
| 0.1 | 2.5 | GO:0045824 | negative regulation of innate immune response(GO:0045824) |
| 0.1 | 0.6 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.1 | 0.4 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
| 0.1 | 0.5 | GO:0042891 | antibiotic transport(GO:0042891) |
| 0.1 | 0.2 | GO:0033024 | mast cell homeostasis(GO:0033023) mast cell apoptotic process(GO:0033024) regulation of mast cell apoptotic process(GO:0033025) |
| 0.1 | 0.4 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
| 0.1 | 1.1 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
| 0.1 | 3.3 | GO:0097320 | membrane tubulation(GO:0097320) |
| 0.1 | 1.7 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.1 | 1.6 | GO:0070842 | aggresome assembly(GO:0070842) |
| 0.1 | 0.6 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.1 | 0.4 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
| 0.1 | 0.2 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
| 0.1 | 0.6 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.1 | 0.7 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
| 0.1 | 1.5 | GO:0061036 | positive regulation of cartilage development(GO:0061036) |
| 0.1 | 3.1 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.1 | 0.5 | GO:0010039 | response to iron ion(GO:0010039) |
| 0.1 | 0.9 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
| 0.1 | 0.1 | GO:1903432 | TORC1 signaling(GO:0038202) regulation of TORC1 signaling(GO:1903432) |
| 0.1 | 0.6 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
| 0.1 | 0.6 | GO:0032364 | oxygen homeostasis(GO:0032364) |
| 0.1 | 1.9 | GO:0006308 | DNA catabolic process(GO:0006308) |
| 0.1 | 0.8 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
| 0.1 | 1.2 | GO:2001014 | regulation of skeletal muscle cell differentiation(GO:2001014) |
| 0.1 | 0.7 | GO:1901911 | diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
| 0.1 | 0.3 | GO:1990034 | calcium ion export from cell(GO:1990034) |
| 0.1 | 1.4 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
| 0.1 | 0.2 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
| 0.1 | 0.8 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
| 0.1 | 0.2 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.1 | 1.1 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
| 0.1 | 0.3 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.1 | 4.3 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.1 | 0.7 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.1 | 1.1 | GO:0050965 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
| 0.1 | 1.6 | GO:0030513 | positive regulation of BMP signaling pathway(GO:0030513) |
| 0.1 | 5.4 | GO:0032543 | mitochondrial translation(GO:0032543) |
| 0.1 | 0.5 | GO:0090669 | telomerase RNA stabilization(GO:0090669) |
| 0.1 | 0.6 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
| 0.1 | 0.5 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.1 | 0.5 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
| 0.1 | 0.4 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.1 | 1.1 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.1 | 0.4 | GO:0048102 | autophagic cell death(GO:0048102) |
| 0.1 | 0.4 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 | 0.4 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.1 | 0.7 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.1 | 1.2 | GO:1903020 | positive regulation of glycoprotein metabolic process(GO:1903020) |
| 0.1 | 0.3 | GO:0042256 | mature ribosome assembly(GO:0042256) |
| 0.1 | 0.3 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.1 | 0.6 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
| 0.1 | 2.0 | GO:0048013 | ephrin receptor signaling pathway(GO:0048013) |
| 0.1 | 2.0 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
| 0.1 | 0.7 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.1 | 3.5 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
| 0.1 | 1.2 | GO:0021684 | cerebellar granular layer morphogenesis(GO:0021683) cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.1 | 1.6 | GO:0048240 | sperm capacitation(GO:0048240) |
| 0.1 | 0.3 | GO:0006667 | sphinganine metabolic process(GO:0006667) lipophagy(GO:0061724) regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
| 0.1 | 0.8 | GO:0090003 | regulation of Golgi to plasma membrane protein transport(GO:0042996) regulation of establishment of protein localization to plasma membrane(GO:0090003) |
| 0.1 | 0.4 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.1 | 0.2 | GO:0035696 | monocyte extravasation(GO:0035696) regulation of monocyte extravasation(GO:2000437) |
| 0.1 | 3.8 | GO:0000266 | mitochondrial fission(GO:0000266) |
| 0.1 | 3.0 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.1 | 0.8 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.1 | 0.8 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) |
| 0.1 | 0.3 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.1 | 1.7 | GO:0032438 | melanosome organization(GO:0032438) pigment granule organization(GO:0048753) |
| 0.1 | 1.0 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
| 0.1 | 1.3 | GO:0045026 | plasma membrane fusion(GO:0045026) |
| 0.1 | 0.3 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.1 | 2.4 | GO:0045600 | positive regulation of fat cell differentiation(GO:0045600) |
| 0.1 | 0.7 | GO:0014823 | response to activity(GO:0014823) |
| 0.1 | 4.1 | GO:0038083 | peptidyl-tyrosine autophosphorylation(GO:0038083) |
| 0.1 | 2.4 | GO:0042632 | cholesterol homeostasis(GO:0042632) sterol homeostasis(GO:0055092) |
| 0.1 | 0.5 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.1 | 0.1 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
| 0.1 | 0.2 | GO:0042275 | error-free postreplication DNA repair(GO:0042275) |
| 0.1 | 0.5 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
| 0.1 | 1.8 | GO:0007094 | mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
| 0.1 | 0.8 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
| 0.1 | 0.4 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.1 | 1.0 | GO:0030252 | growth hormone secretion(GO:0030252) |
| 0.1 | 0.1 | GO:0009404 | toxin metabolic process(GO:0009404) |
| 0.1 | 0.4 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.1 | 0.3 | GO:0070314 | G1 to G0 transition(GO:0070314) |
| 0.1 | 1.9 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
| 0.1 | 0.4 | GO:0034214 | protein hexamerization(GO:0034214) |
| 0.1 | 0.8 | GO:0051973 | positive regulation of telomerase activity(GO:0051973) |
| 0.1 | 0.7 | GO:0035767 | endothelial cell chemotaxis(GO:0035767) |
| 0.1 | 0.3 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
| 0.1 | 1.2 | GO:0045648 | positive regulation of erythrocyte differentiation(GO:0045648) |
| 0.1 | 0.9 | GO:0031952 | regulation of protein autophosphorylation(GO:0031952) |
| 0.1 | 0.3 | GO:0032429 | regulation of phospholipase A2 activity(GO:0032429) |
| 0.1 | 1.1 | GO:0030890 | positive regulation of B cell proliferation(GO:0030890) |
| 0.1 | 0.4 | GO:1903358 | regulation of Golgi organization(GO:1903358) |
| 0.1 | 0.3 | GO:0009405 | pathogenesis(GO:0009405) |
| 0.1 | 0.6 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
| 0.1 | 0.6 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.1 | 0.5 | GO:0030539 | male genitalia development(GO:0030539) |
| 0.1 | 0.8 | GO:1901798 | positive regulation of signal transduction by p53 class mediator(GO:1901798) |
| 0.1 | 0.7 | GO:0014887 | muscle hypertrophy in response to stress(GO:0003299) cardiac muscle adaptation(GO:0014887) cardiac muscle hypertrophy in response to stress(GO:0014898) |
| 0.1 | 0.7 | GO:1904294 | positive regulation of ERAD pathway(GO:1904294) |
| 0.1 | 0.4 | GO:0015781 | pyrimidine nucleotide-sugar transport(GO:0015781) |
| 0.1 | 0.1 | GO:0035188 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 0.1 | 0.2 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.1 | 0.5 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.1 | 3.6 | GO:0006487 | protein N-linked glycosylation(GO:0006487) |
| 0.1 | 0.5 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.1 | 1.1 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.1 | 1.3 | GO:0042026 | protein refolding(GO:0042026) |
| 0.1 | 0.7 | GO:0030813 | positive regulation of nucleotide catabolic process(GO:0030813) positive regulation of glycolytic process(GO:0045821) positive regulation of cofactor metabolic process(GO:0051194) positive regulation of coenzyme metabolic process(GO:0051197) |
| 0.1 | 0.2 | GO:0007289 | spermatid nucleus differentiation(GO:0007289) |
| 0.1 | 0.6 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.1 | 1.3 | GO:1904355 | positive regulation of telomere capping(GO:1904355) |
| 0.1 | 0.5 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.1 | 1.0 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
| 0.1 | 0.1 | GO:0015675 | nickel cation transport(GO:0015675) |
| 0.1 | 1.3 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
| 0.1 | 0.6 | GO:0001964 | startle response(GO:0001964) |
| 0.1 | 0.3 | GO:1900364 | negative regulation of mRNA 3'-end processing(GO:0031441) negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.1 | 0.2 | GO:0070197 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.1 | 1.1 | GO:0015844 | monoamine transport(GO:0015844) |
| 0.1 | 0.7 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.1 | 0.5 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.0 | 0.2 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) |
| 0.0 | 5.8 | GO:0007416 | synapse assembly(GO:0007416) |
| 0.0 | 0.3 | GO:0035116 | embryonic hindlimb morphogenesis(GO:0035116) |
| 0.0 | 0.2 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.0 | 0.4 | GO:0006573 | valine metabolic process(GO:0006573) |
| 0.0 | 1.1 | GO:2000036 | regulation of stem cell population maintenance(GO:2000036) |
| 0.0 | 1.5 | GO:0060325 | face morphogenesis(GO:0060325) |
| 0.0 | 0.8 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.0 | 0.5 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.0 | 0.5 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 0.0 | 0.9 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
| 0.0 | 0.3 | GO:0014051 | gamma-aminobutyric acid secretion(GO:0014051) |
| 0.0 | 1.6 | GO:0006414 | translational elongation(GO:0006414) |
| 0.0 | 0.1 | GO:0019530 | taurine metabolic process(GO:0019530) |
| 0.0 | 2.2 | GO:0031338 | regulation of vesicle fusion(GO:0031338) |
| 0.0 | 0.7 | GO:0034629 | cellular protein complex localization(GO:0034629) |
| 0.0 | 1.1 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
| 0.0 | 0.2 | GO:0055098 | response to lipoprotein particle(GO:0055094) response to low-density lipoprotein particle(GO:0055098) |
| 0.0 | 0.3 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
| 0.0 | 0.2 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
| 0.0 | 0.2 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.0 | 0.8 | GO:0000731 | DNA synthesis involved in DNA repair(GO:0000731) |
| 0.0 | 0.0 | GO:0072734 | response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
| 0.0 | 0.8 | GO:0042993 | positive regulation of transcription factor import into nucleus(GO:0042993) |
| 0.0 | 1.0 | GO:0009268 | response to pH(GO:0009268) |
| 0.0 | 1.1 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.0 | 0.2 | GO:0039703 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.0 | 0.1 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.0 | 0.5 | GO:0045191 | regulation of isotype switching(GO:0045191) |
| 0.0 | 0.2 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.0 | 0.5 | GO:0007212 | dopamine receptor signaling pathway(GO:0007212) |
| 0.0 | 0.4 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.0 | 0.3 | GO:0002063 | chondrocyte development(GO:0002063) |
| 0.0 | 0.4 | GO:0000291 | nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
| 0.0 | 0.5 | GO:0000338 | protein deneddylation(GO:0000338) |
| 0.0 | 0.1 | GO:0051150 | regulation of smooth muscle cell differentiation(GO:0051150) |
| 0.0 | 0.3 | GO:0002495 | antigen processing and presentation of peptide antigen via MHC class II(GO:0002495) antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002504) |
| 0.0 | 0.8 | GO:0042990 | regulation of transcription factor import into nucleus(GO:0042990) |
| 0.0 | 0.4 | GO:0048820 | hair follicle maturation(GO:0048820) |
| 0.0 | 0.8 | GO:0045761 | regulation of adenylate cyclase activity(GO:0045761) |
| 0.0 | 0.7 | GO:0097178 | ruffle assembly(GO:0097178) |
| 0.0 | 0.1 | GO:0034698 | response to gonadotropin(GO:0034698) cellular response to gonadotropin stimulus(GO:0071371) |
| 0.0 | 0.1 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.0 | 0.8 | GO:0010507 | negative regulation of autophagy(GO:0010507) |
| 0.0 | 1.7 | GO:1901216 | positive regulation of neuron death(GO:1901216) |
| 0.0 | 0.7 | GO:1900087 | positive regulation of G1/S transition of mitotic cell cycle(GO:1900087) |
| 0.0 | 0.8 | GO:1901799 | negative regulation of proteasomal protein catabolic process(GO:1901799) |
| 0.0 | 0.8 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
| 0.0 | 0.4 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
| 0.0 | 0.4 | GO:0005979 | regulation of glycogen biosynthetic process(GO:0005979) regulation of glucan biosynthetic process(GO:0010962) |
| 0.0 | 1.1 | GO:0043966 | histone H3 acetylation(GO:0043966) |
| 0.0 | 0.6 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
| 0.0 | 0.2 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.0 | 0.5 | GO:0043171 | peptide catabolic process(GO:0043171) |
| 0.0 | 0.7 | GO:0046513 | ceramide biosynthetic process(GO:0046513) |
| 0.0 | 0.6 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 0.0 | 0.6 | GO:0030330 | DNA damage response, signal transduction by p53 class mediator(GO:0030330) |
| 0.0 | 0.3 | GO:0002115 | store-operated calcium entry(GO:0002115) |
| 0.0 | 2.6 | GO:0006626 | protein targeting to mitochondrion(GO:0006626) |
| 0.0 | 0.3 | GO:0001676 | long-chain fatty acid metabolic process(GO:0001676) |
| 0.0 | 0.3 | GO:0032720 | negative regulation of tumor necrosis factor production(GO:0032720) |
| 0.0 | 0.6 | GO:0046329 | negative regulation of JNK cascade(GO:0046329) |
| 0.0 | 0.0 | GO:1900368 | regulation of RNA interference(GO:1900368) |
| 0.0 | 0.3 | GO:0033344 | cholesterol efflux(GO:0033344) |
| 0.0 | 0.7 | GO:0032007 | negative regulation of TOR signaling(GO:0032007) |
| 0.0 | 0.3 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
| 0.0 | 0.3 | GO:0060716 | labyrinthine layer blood vessel development(GO:0060716) |
| 0.0 | 0.4 | GO:0015991 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
| 0.0 | 0.5 | GO:0030500 | regulation of bone mineralization(GO:0030500) |
| 0.0 | 0.4 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
| 0.0 | 1.0 | GO:0016052 | carbohydrate catabolic process(GO:0016052) |
| 0.0 | 0.2 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
| 0.0 | 0.1 | GO:0046834 | lipid phosphorylation(GO:0046834) |
| 0.0 | 0.6 | GO:0006778 | porphyrin-containing compound metabolic process(GO:0006778) |
| 0.0 | 0.5 | GO:0002053 | positive regulation of mesenchymal cell proliferation(GO:0002053) |
| 0.0 | 0.1 | GO:0050832 | defense response to fungus(GO:0050832) |
| 0.0 | 0.1 | GO:0032509 | endosome transport via multivesicular body sorting pathway(GO:0032509) |
| 0.0 | 0.5 | GO:0030968 | endoplasmic reticulum unfolded protein response(GO:0030968) |
| 0.0 | 0.6 | GO:0002181 | cytoplasmic translation(GO:0002181) |
| 0.0 | 0.3 | GO:0031648 | protein destabilization(GO:0031648) |
| 0.0 | 0.2 | GO:0008299 | isoprenoid biosynthetic process(GO:0008299) |
| 0.0 | 0.1 | GO:0010165 | response to X-ray(GO:0010165) |
| 0.0 | 0.2 | GO:0000469 | cleavage involved in rRNA processing(GO:0000469) |
| 0.0 | 0.1 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.0 | 0.2 | GO:0007032 | endosome organization(GO:0007032) |
| 0.0 | 0.0 | GO:0045922 | negative regulation of fatty acid metabolic process(GO:0045922) |
| 0.0 | 0.3 | GO:0034063 | stress granule assembly(GO:0034063) |
| 0.0 | 0.2 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
| 0.0 | 0.4 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 6.1 | 18.3 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 3.0 | 15.2 | GO:1903440 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
| 2.3 | 6.9 | GO:0098855 | HCN channel complex(GO:0098855) |
| 2.0 | 6.0 | GO:0005584 | collagen type I trimer(GO:0005584) |
| 1.5 | 4.4 | GO:0044299 | C-fiber(GO:0044299) |
| 1.5 | 5.8 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 1.3 | 3.8 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 1.0 | 7.1 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.9 | 6.9 | GO:0097433 | dense body(GO:0097433) |
| 0.9 | 2.6 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.8 | 14.1 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
| 0.8 | 12.1 | GO:0097449 | astrocyte projection(GO:0097449) |
| 0.8 | 7.1 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.8 | 3.1 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.8 | 6.8 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.7 | 2.9 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.7 | 1.4 | GO:0000839 | Hrd1p ubiquitin ligase ERAD-L complex(GO:0000839) |
| 0.7 | 2.7 | GO:0098843 | postsynaptic endocytic zone(GO:0098843) |
| 0.7 | 11.1 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.6 | 1.9 | GO:0033193 | Lsd1/2 complex(GO:0033193) |
| 0.6 | 1.9 | GO:0034667 | integrin alpha3-beta1 complex(GO:0034667) |
| 0.6 | 6.8 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
| 0.6 | 2.4 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.6 | 2.9 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.5 | 7.6 | GO:0043203 | axon hillock(GO:0043203) |
| 0.5 | 4.3 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 0.5 | 4.8 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.5 | 3.6 | GO:0005638 | lamin filament(GO:0005638) |
| 0.5 | 4.1 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.5 | 6.6 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.5 | 2.0 | GO:0001651 | dense fibrillar component(GO:0001651) |
| 0.5 | 1.4 | GO:0031983 | vesicle lumen(GO:0031983) |
| 0.5 | 2.3 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
| 0.5 | 2.3 | GO:0071556 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
| 0.5 | 5.4 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.4 | 2.6 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.4 | 0.4 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
| 0.4 | 1.1 | GO:1903095 | microprocessor complex(GO:0070877) ribonuclease III complex(GO:1903095) |
| 0.4 | 1.1 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
| 0.4 | 1.9 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.4 | 1.8 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.3 | 2.8 | GO:0043218 | compact myelin(GO:0043218) |
| 0.3 | 1.0 | GO:0032994 | protein-lipid complex(GO:0032994) |
| 0.3 | 0.7 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.3 | 1.4 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.3 | 1.3 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.3 | 3.5 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.3 | 1.6 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.3 | 3.1 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.3 | 2.7 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.3 | 4.8 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.3 | 1.5 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.3 | 1.2 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
| 0.3 | 22.3 | GO:0005604 | basement membrane(GO:0005604) |
| 0.3 | 5.0 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.3 | 1.2 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.3 | 2.6 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.3 | 2.0 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
| 0.3 | 1.4 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.3 | 19.6 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.3 | 10.4 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.3 | 0.8 | GO:0097342 | ripoptosome(GO:0097342) |
| 0.3 | 20.7 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
| 0.3 | 4.0 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.3 | 2.1 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.3 | 10.7 | GO:0060170 | ciliary membrane(GO:0060170) |
| 0.3 | 1.8 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.3 | 3.9 | GO:0044292 | dendrite terminus(GO:0044292) |
| 0.3 | 4.9 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
| 0.3 | 1.5 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.3 | 3.6 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.3 | 2.3 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.3 | 3.5 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
| 0.3 | 3.3 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
| 0.2 | 1.2 | GO:0032389 | MutLalpha complex(GO:0032389) |
| 0.2 | 1.9 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.2 | 1.2 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.2 | 1.2 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
| 0.2 | 1.4 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.2 | 0.7 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.2 | 2.3 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.2 | 0.7 | GO:0034657 | GID complex(GO:0034657) |
| 0.2 | 0.7 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
| 0.2 | 1.8 | GO:0031415 | NatA complex(GO:0031415) |
| 0.2 | 1.8 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.2 | 2.1 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.2 | 5.0 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.2 | 14.2 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.2 | 1.0 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
| 0.2 | 1.0 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.2 | 1.1 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.2 | 2.0 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.2 | 1.3 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.2 | 7.4 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.2 | 0.7 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.2 | 6.0 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.2 | 0.5 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.2 | 3.1 | GO:0097228 | sperm principal piece(GO:0097228) |
| 0.2 | 2.1 | GO:0020005 | symbiont-containing vacuole membrane(GO:0020005) |
| 0.2 | 2.7 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.2 | 3.5 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.2 | 1.0 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
| 0.2 | 1.6 | GO:0030057 | desmosome(GO:0030057) |
| 0.2 | 1.5 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
| 0.2 | 0.5 | GO:0030689 | Noc complex(GO:0030689) |
| 0.2 | 1.5 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.2 | 2.6 | GO:0043196 | varicosity(GO:0043196) |
| 0.2 | 2.6 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.2 | 0.3 | GO:0099569 | presynaptic cytoskeleton(GO:0099569) |
| 0.2 | 1.0 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.2 | 6.0 | GO:0032420 | stereocilium(GO:0032420) |
| 0.2 | 1.7 | GO:0005688 | U6 snRNP(GO:0005688) |
| 0.2 | 1.9 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.2 | 5.6 | GO:0031201 | SNARE complex(GO:0031201) |
| 0.2 | 0.3 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
| 0.2 | 18.5 | GO:0031225 | anchored component of membrane(GO:0031225) |
| 0.2 | 3.3 | GO:0005798 | Golgi-associated vesicle(GO:0005798) |
| 0.2 | 0.9 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.1 | 0.9 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.1 | 0.6 | GO:0022626 | cytosolic ribosome(GO:0022626) |
| 0.1 | 0.3 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.1 | 4.5 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.1 | 22.5 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
| 0.1 | 0.6 | GO:1990584 | cardiac Troponin complex(GO:1990584) |
| 0.1 | 0.9 | GO:0042825 | TAP complex(GO:0042825) |
| 0.1 | 0.4 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.1 | 5.5 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.1 | 8.5 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
| 0.1 | 3.2 | GO:0031594 | neuromuscular junction(GO:0031594) |
| 0.1 | 0.3 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.1 | 3.8 | GO:0031902 | late endosome membrane(GO:0031902) |
| 0.1 | 8.0 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.1 | 0.5 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.1 | 0.5 | GO:0008091 | spectrin(GO:0008091) cuticular plate(GO:0032437) |
| 0.1 | 0.4 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
| 0.1 | 3.3 | GO:0032589 | neuron projection membrane(GO:0032589) |
| 0.1 | 5.9 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.1 | 0.6 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
| 0.1 | 1.5 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.1 | 0.8 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.1 | 1.7 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.1 | 0.8 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.1 | 0.6 | GO:0097361 | CIA complex(GO:0097361) |
| 0.1 | 1.3 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.1 | 0.4 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
| 0.1 | 0.8 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.1 | 1.4 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.1 | 15.3 | GO:0008021 | synaptic vesicle(GO:0008021) |
| 0.1 | 0.5 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
| 0.1 | 0.6 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.1 | 1.0 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.1 | 0.4 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.1 | 3.0 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.1 | 1.8 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
| 0.1 | 0.9 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.1 | 1.0 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.1 | 2.4 | GO:0071565 | nBAF complex(GO:0071565) |
| 0.1 | 73.5 | GO:0005615 | extracellular space(GO:0005615) |
| 0.1 | 0.8 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.1 | 3.8 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.1 | 3.3 | GO:0009925 | basal plasma membrane(GO:0009925) |
| 0.1 | 0.7 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.1 | 1.6 | GO:0000145 | exocyst(GO:0000145) |
| 0.1 | 0.4 | GO:1990745 | EARP complex(GO:1990745) |
| 0.1 | 0.3 | GO:0031251 | PAN complex(GO:0031251) |
| 0.1 | 0.8 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.1 | 5.6 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
| 0.1 | 0.2 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.1 | 4.7 | GO:0098793 | presynapse(GO:0098793) |
| 0.1 | 4.7 | GO:0005811 | lipid particle(GO:0005811) |
| 0.1 | 0.9 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.1 | 1.9 | GO:0001741 | XY body(GO:0001741) |
| 0.1 | 2.1 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
| 0.1 | 1.9 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
| 0.1 | 0.2 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.1 | 0.4 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.1 | 1.8 | GO:0045335 | phagocytic vesicle(GO:0045335) |
| 0.1 | 0.6 | GO:0089701 | U2AF(GO:0089701) |
| 0.1 | 0.9 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
| 0.1 | 2.7 | GO:0034707 | chloride channel complex(GO:0034707) |
| 0.1 | 1.9 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
| 0.1 | 7.1 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
| 0.1 | 0.3 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.1 | 1.5 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
| 0.1 | 7.7 | GO:0043235 | receptor complex(GO:0043235) |
| 0.1 | 0.7 | GO:0044754 | autolysosome(GO:0044754) |
| 0.1 | 1.5 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.1 | 8.0 | GO:0043197 | dendritic spine(GO:0043197) |
| 0.1 | 0.2 | GO:0043540 | 6-phosphofructo-2-kinase/fructose-2,6-biphosphatase complex(GO:0043540) |
| 0.1 | 0.5 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.1 | 1.7 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.1 | 1.3 | GO:0005903 | brush border(GO:0005903) |
| 0.1 | 1.2 | GO:0005839 | proteasome core complex(GO:0005839) |
| 0.1 | 1.4 | GO:0051233 | spindle midzone(GO:0051233) |
| 0.1 | 0.5 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.0 | 0.6 | GO:0031985 | Golgi cisterna(GO:0031985) |
| 0.0 | 4.0 | GO:0045211 | postsynaptic membrane(GO:0045211) |
| 0.0 | 0.8 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 0.6 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.0 | 0.4 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.0 | 0.6 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.0 | 0.2 | GO:0070382 | exocytic vesicle(GO:0070382) |
| 0.0 | 2.0 | GO:0005770 | late endosome(GO:0005770) |
| 0.0 | 0.2 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.0 | 3.4 | GO:0016363 | nuclear matrix(GO:0016363) |
| 0.0 | 0.5 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.0 | 118.9 | GO:0016021 | integral component of membrane(GO:0016021) |
| 0.0 | 0.3 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.0 | 0.6 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.0 | 0.6 | GO:0031941 | filamentous actin(GO:0031941) |
| 0.0 | 0.2 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
| 0.0 | 4.3 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
| 0.0 | 0.2 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.0 | 2.2 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.0 | 0.2 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
| 0.0 | 3.7 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.0 | 0.2 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.0 | 0.3 | GO:0030139 | endocytic vesicle(GO:0030139) |
| 0.0 | 0.4 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.0 | 0.1 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.0 | 1.2 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
| 0.0 | 0.0 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.0 | 0.0 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 6.5 | 19.5 | GO:0016167 | glial cell-derived neurotrophic factor receptor activity(GO:0016167) |
| 5.5 | 16.4 | GO:0019120 | hydrolase activity, acting on acid halide bonds(GO:0016824) hydrolase activity, acting on acid halide bonds, in C-halide compounds(GO:0019120) alkylhalidase activity(GO:0047651) |
| 3.6 | 14.5 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 3.0 | 15.2 | GO:0097643 | amylin receptor activity(GO:0097643) |
| 2.1 | 8.5 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 1.7 | 6.9 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 1.6 | 11.2 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 1.5 | 6.2 | GO:0034041 | sterol-transporting ATPase activity(GO:0034041) |
| 1.5 | 7.7 | GO:0005534 | galactose binding(GO:0005534) |
| 1.4 | 5.4 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 1.3 | 3.9 | GO:0031403 | lithium ion binding(GO:0031403) |
| 1.3 | 6.4 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 1.2 | 3.7 | GO:0016160 | alpha-amylase activity(GO:0004556) amylase activity(GO:0016160) |
| 1.2 | 3.6 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
| 1.1 | 4.6 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 1.1 | 3.4 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 1.1 | 3.3 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 1.1 | 4.4 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
| 1.1 | 4.4 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
| 1.1 | 8.5 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
| 1.0 | 4.1 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
| 1.0 | 3.1 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
| 1.0 | 3.0 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
| 1.0 | 3.0 | GO:0004155 | 6,7-dihydropteridine reductase activity(GO:0004155) |
| 1.0 | 6.9 | GO:0015091 | ferric iron transmembrane transporter activity(GO:0015091) trivalent inorganic cation transmembrane transporter activity(GO:0072510) |
| 1.0 | 2.9 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
| 1.0 | 6.8 | GO:0031404 | chloride ion binding(GO:0031404) |
| 0.9 | 2.8 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
| 0.9 | 9.3 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
| 0.9 | 2.8 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.9 | 3.7 | GO:0001851 | complement component C3b binding(GO:0001851) |
| 0.9 | 5.5 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.9 | 2.7 | GO:0031798 | type 1 metabotropic glutamate receptor binding(GO:0031798) |
| 0.9 | 2.7 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
| 0.9 | 5.4 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
| 0.9 | 2.7 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.9 | 7.1 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
| 0.9 | 5.2 | GO:0070699 | type II activin receptor binding(GO:0070699) |
| 0.9 | 2.6 | GO:0005118 | sevenless binding(GO:0005118) |
| 0.9 | 2.6 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
| 0.8 | 2.5 | GO:0051379 | epinephrine binding(GO:0051379) |
| 0.8 | 4.2 | GO:0002060 | purine nucleobase binding(GO:0002060) |
| 0.8 | 8.3 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.8 | 3.8 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.8 | 3.1 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 0.8 | 15.8 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.8 | 7.5 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
| 0.7 | 2.2 | GO:0008534 | oxidized purine nucleobase lesion DNA N-glycosylase activity(GO:0008534) |
| 0.7 | 3.0 | GO:0001639 | PLC activating G-protein coupled glutamate receptor activity(GO:0001639) G-protein coupled receptor activity involved in regulation of postsynaptic membrane potential(GO:0099530) |
| 0.7 | 4.4 | GO:0004340 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) |
| 0.7 | 6.5 | GO:1990239 | steroid hormone binding(GO:1990239) |
| 0.7 | 2.9 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.7 | 4.9 | GO:0015350 | methotrexate transporter activity(GO:0015350) |
| 0.7 | 1.4 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.7 | 2.7 | GO:0008410 | CoA-transferase activity(GO:0008410) |
| 0.7 | 2.7 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 0.7 | 2.7 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.7 | 2.0 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.7 | 2.0 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
| 0.6 | 2.6 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 0.6 | 2.5 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.6 | 1.9 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
| 0.6 | 5.0 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.6 | 3.1 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.6 | 6.8 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.6 | 3.1 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 0.6 | 5.4 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.6 | 2.2 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.6 | 2.8 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.5 | 8.5 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 0.5 | 1.6 | GO:0072541 | peroxynitrite reductase activity(GO:0072541) |
| 0.5 | 1.0 | GO:0015651 | quaternary ammonium group transmembrane transporter activity(GO:0015651) |
| 0.5 | 7.7 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.5 | 3.0 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.5 | 2.5 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 0.5 | 5.4 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.5 | 2.9 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.5 | 2.4 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
| 0.5 | 1.4 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
| 0.5 | 3.8 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.5 | 3.7 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.5 | 1.4 | GO:0031896 | V2 vasopressin receptor binding(GO:0031896) |
| 0.4 | 1.3 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
| 0.4 | 5.6 | GO:0070513 | death domain binding(GO:0070513) |
| 0.4 | 1.3 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.4 | 4.6 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.4 | 3.7 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.4 | 1.2 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.4 | 1.6 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.4 | 3.3 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.4 | 2.0 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.4 | 1.2 | GO:0098809 | nitrite reductase activity(GO:0098809) |
| 0.4 | 2.0 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.4 | 3.2 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) phosphatidylinositol bisphosphate kinase activity(GO:0052813) |
| 0.4 | 2.0 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.4 | 8.6 | GO:0005248 | voltage-gated sodium channel activity(GO:0005248) |
| 0.4 | 3.1 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.4 | 6.2 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.4 | 1.9 | GO:0043532 | angiostatin binding(GO:0043532) |
| 0.4 | 5.4 | GO:0008484 | sulfuric ester hydrolase activity(GO:0008484) |
| 0.4 | 3.1 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
| 0.4 | 3.1 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.4 | 1.5 | GO:0015433 | peptide antigen-transporting ATPase activity(GO:0015433) tapasin binding(GO:0046980) |
| 0.4 | 5.6 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.4 | 1.1 | GO:0001888 | glucuronyl-galactosyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0001888) |
| 0.4 | 1.1 | GO:0060072 | large conductance calcium-activated potassium channel activity(GO:0060072) |
| 0.4 | 1.5 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.4 | 1.5 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.4 | 2.5 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.4 | 1.8 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.4 | 1.8 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
| 0.4 | 2.1 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.3 | 1.0 | GO:0071723 | lipopeptide binding(GO:0071723) |
| 0.3 | 1.4 | GO:0050840 | extracellular matrix binding(GO:0050840) |
| 0.3 | 1.0 | GO:0046997 | sarcosine dehydrogenase activity(GO:0008480) oxidoreductase activity, acting on the CH-NH group of donors, flavin as acceptor(GO:0046997) |
| 0.3 | 3.1 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.3 | 1.7 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
| 0.3 | 1.4 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.3 | 1.3 | GO:0004441 | inositol-1,4-bisphosphate 1-phosphatase activity(GO:0004441) |
| 0.3 | 1.3 | GO:1903135 | cupric ion binding(GO:1903135) |
| 0.3 | 12.8 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.3 | 2.0 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.3 | 1.0 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
| 0.3 | 2.6 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.3 | 1.3 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
| 0.3 | 1.0 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.3 | 1.0 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.3 | 7.9 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.3 | 1.2 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
| 0.3 | 1.2 | GO:0032138 | single base insertion or deletion binding(GO:0032138) |
| 0.3 | 1.5 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.3 | 3.9 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.3 | 2.1 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.3 | 0.6 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.3 | 2.0 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
| 0.3 | 0.8 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
| 0.3 | 0.8 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
| 0.3 | 0.8 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.3 | 3.3 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.3 | 1.9 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.3 | 0.5 | GO:0015925 | galactosidase activity(GO:0015925) |
| 0.3 | 2.1 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.3 | 1.3 | GO:0009384 | N-acylmannosamine kinase activity(GO:0009384) |
| 0.3 | 0.8 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
| 0.3 | 3.2 | GO:0016208 | AMP binding(GO:0016208) |
| 0.3 | 1.0 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.3 | 1.3 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 0.3 | 1.8 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.3 | 3.1 | GO:0019956 | chemokine binding(GO:0019956) |
| 0.3 | 2.3 | GO:1990446 | U1 snRNP binding(GO:1990446) |
| 0.3 | 3.1 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.3 | 1.0 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.3 | 1.0 | GO:0004066 | asparagine synthase (glutamine-hydrolyzing) activity(GO:0004066) |
| 0.3 | 1.3 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.2 | 1.0 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.2 | 2.2 | GO:0005328 | neurotransmitter:sodium symporter activity(GO:0005328) |
| 0.2 | 0.5 | GO:0016641 | oxidoreductase activity, acting on the CH-NH2 group of donors, oxygen as acceptor(GO:0016641) |
| 0.2 | 1.4 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.2 | 1.0 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.2 | 6.9 | GO:0019707 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.2 | 0.9 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.2 | 1.1 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.2 | 0.9 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
| 0.2 | 1.8 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.2 | 1.1 | GO:0004525 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
| 0.2 | 2.5 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.2 | 13.7 | GO:0019955 | cytokine binding(GO:0019955) |
| 0.2 | 1.3 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.2 | 1.3 | GO:0033691 | sialic acid binding(GO:0033691) |
| 0.2 | 4.1 | GO:0005003 | ephrin receptor activity(GO:0005003) |
| 0.2 | 1.1 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.2 | 1.7 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.2 | 4.6 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.2 | 1.9 | GO:0015250 | water channel activity(GO:0015250) |
| 0.2 | 1.0 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
| 0.2 | 2.2 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.2 | 0.4 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.2 | 1.4 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
| 0.2 | 13.3 | GO:0005518 | collagen binding(GO:0005518) |
| 0.2 | 2.8 | GO:0048018 | receptor agonist activity(GO:0048018) |
| 0.2 | 1.2 | GO:1990430 | G-protein coupled GABA receptor activity(GO:0004965) extracellular matrix protein binding(GO:1990430) |
| 0.2 | 1.0 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
| 0.2 | 2.5 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.2 | 1.2 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
| 0.2 | 1.9 | GO:0008227 | G-protein coupled amine receptor activity(GO:0008227) |
| 0.2 | 2.1 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.2 | 0.2 | GO:0004637 | phosphoribosylamine-glycine ligase activity(GO:0004637) |
| 0.2 | 1.3 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.2 | 2.4 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.2 | 10.2 | GO:0005179 | hormone activity(GO:0005179) |
| 0.2 | 0.6 | GO:0051747 | cytosine C-5 DNA demethylase activity(GO:0051747) |
| 0.2 | 1.1 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
| 0.2 | 0.9 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
| 0.2 | 0.5 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
| 0.2 | 2.0 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
| 0.2 | 1.3 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
| 0.2 | 14.8 | GO:0005125 | cytokine activity(GO:0005125) |
| 0.2 | 2.3 | GO:0004576 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.2 | 2.1 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.2 | 0.7 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.2 | 1.9 | GO:0046977 | beta-2-microglobulin binding(GO:0030881) TAP binding(GO:0046977) |
| 0.2 | 0.7 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
| 0.2 | 2.0 | GO:0016701 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen(GO:0016701) oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
| 0.2 | 5.7 | GO:0005112 | Notch binding(GO:0005112) |
| 0.2 | 0.7 | GO:0042328 | heparan sulfate N-acetylglucosaminyltransferase activity(GO:0042328) |
| 0.2 | 1.2 | GO:0051731 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) |
| 0.2 | 1.0 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.2 | 0.5 | GO:0004315 | 3-oxoacyl-[acyl-carrier-protein] synthase activity(GO:0004315) |
| 0.2 | 1.9 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.2 | 3.8 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.2 | 2.4 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.2 | 0.5 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
| 0.2 | 2.5 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.2 | 0.6 | GO:0004103 | choline kinase activity(GO:0004103) |
| 0.2 | 4.7 | GO:0042805 | actinin binding(GO:0042805) |
| 0.2 | 2.4 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.2 | 2.1 | GO:0070402 | NADPH binding(GO:0070402) |
| 0.1 | 0.9 | GO:0047617 | acyl-CoA hydrolase activity(GO:0047617) |
| 0.1 | 1.0 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
| 0.1 | 5.2 | GO:0005507 | copper ion binding(GO:0005507) |
| 0.1 | 2.5 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.1 | 3.1 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.1 | 3.2 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
| 0.1 | 0.8 | GO:0052654 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
| 0.1 | 7.0 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.1 | 2.6 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.1 | 5.9 | GO:0016876 | aminoacyl-tRNA ligase activity(GO:0004812) ligase activity, forming carbon-oxygen bonds(GO:0016875) ligase activity, forming aminoacyl-tRNA and related compounds(GO:0016876) |
| 0.1 | 1.3 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.1 | 5.3 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
| 0.1 | 3.2 | GO:0008376 | acetylgalactosaminyltransferase activity(GO:0008376) |
| 0.1 | 0.4 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.1 | 0.9 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.1 | 1.4 | GO:0016151 | nickel cation binding(GO:0016151) |
| 0.1 | 1.4 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
| 0.1 | 0.4 | GO:0046592 | polyamine oxidase activity(GO:0046592) spermine:oxygen oxidoreductase (spermidine-forming) activity(GO:0052901) |
| 0.1 | 0.9 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.1 | 0.4 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.1 | 0.4 | GO:0015928 | alpha-L-fucosidase activity(GO:0004560) fucosidase activity(GO:0015928) |
| 0.1 | 0.4 | GO:0036361 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
| 0.1 | 1.0 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
| 0.1 | 0.9 | GO:1990459 | transferrin receptor binding(GO:1990459) |
| 0.1 | 1.1 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.1 | 0.5 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
| 0.1 | 0.5 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
| 0.1 | 4.9 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.1 | 5.0 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.1 | 0.5 | GO:0032405 | exodeoxyribonuclease III activity(GO:0008853) MutLalpha complex binding(GO:0032405) |
| 0.1 | 1.8 | GO:0005537 | mannose binding(GO:0005537) |
| 0.1 | 1.5 | GO:0098505 | single-stranded telomeric DNA binding(GO:0043047) G-rich strand telomeric DNA binding(GO:0098505) |
| 0.1 | 1.3 | GO:0008649 | rRNA methyltransferase activity(GO:0008649) |
| 0.1 | 1.3 | GO:0035254 | glutamate receptor binding(GO:0035254) |
| 0.1 | 0.8 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.1 | 0.7 | GO:0000298 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) |
| 0.1 | 0.5 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.1 | 1.6 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 0.1 | 0.4 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.1 | 6.2 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 0.1 | 0.3 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.1 | 1.0 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.1 | 0.3 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.1 | 1.8 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.1 | 2.9 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.1 | 2.0 | GO:0043548 | phosphatidylinositol 3-kinase binding(GO:0043548) |
| 0.1 | 14.2 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.1 | 4.8 | GO:0019843 | rRNA binding(GO:0019843) |
| 0.1 | 1.5 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.1 | 0.2 | GO:0098847 | sequence-specific single stranded DNA binding(GO:0098847) |
| 0.1 | 1.1 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.1 | 1.6 | GO:0033549 | MAP kinase phosphatase activity(GO:0033549) |
| 0.1 | 0.8 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.1 | 0.4 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
| 0.1 | 2.3 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.1 | 0.6 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
| 0.1 | 0.3 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
| 0.1 | 1.0 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.1 | 0.4 | GO:0005093 | Rab GDP-dissociation inhibitor activity(GO:0005093) |
| 0.1 | 2.1 | GO:0005158 | insulin receptor binding(GO:0005158) |
| 0.1 | 0.7 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.1 | 0.4 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.1 | 0.2 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
| 0.1 | 1.9 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
| 0.1 | 1.3 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.1 | 1.5 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.1 | 1.0 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.1 | 1.0 | GO:0031701 | angiotensin receptor binding(GO:0031701) |
| 0.1 | 1.6 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.1 | 0.3 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.1 | 0.5 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.1 | 0.1 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.1 | 3.4 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.1 | 0.8 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.1 | 0.6 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.1 | 4.8 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
| 0.1 | 0.3 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.1 | 1.7 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.1 | 0.8 | GO:0031386 | protein tag(GO:0031386) |
| 0.1 | 4.2 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.1 | 1.4 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.1 | 2.0 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
| 0.1 | 0.4 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
| 0.1 | 0.7 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.1 | 1.1 | GO:0019200 | carbohydrate kinase activity(GO:0019200) |
| 0.1 | 1.2 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
| 0.1 | 0.6 | GO:0050733 | pre-mRNA 3'-splice site binding(GO:0030628) RS domain binding(GO:0050733) |
| 0.1 | 0.4 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
| 0.1 | 1.2 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.1 | 0.5 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.1 | 1.9 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.1 | 0.2 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 0.1 | 0.2 | GO:0001733 | galactosylceramide sulfotransferase activity(GO:0001733) |
| 0.1 | 1.0 | GO:0005504 | fatty acid binding(GO:0005504) |
| 0.1 | 2.0 | GO:0046875 | ephrin receptor binding(GO:0046875) |
| 0.1 | 1.0 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.1 | 0.1 | GO:0015099 | nickel cation transmembrane transporter activity(GO:0015099) |
| 0.1 | 1.1 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.1 | 1.0 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
| 0.1 | 0.4 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.1 | 0.6 | GO:0001163 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
| 0.1 | 0.7 | GO:0004180 | carboxypeptidase activity(GO:0004180) |
| 0.1 | 0.8 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.1 | 0.4 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
| 0.0 | 0.2 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) O-palmitoyltransferase activity(GO:0016416) |
| 0.0 | 0.3 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.0 | 0.2 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.0 | 0.8 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.0 | 0.2 | GO:0004096 | catalase activity(GO:0004096) |
| 0.0 | 1.2 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.0 | 0.8 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
| 0.0 | 1.8 | GO:0043621 | protein self-association(GO:0043621) |
| 0.0 | 0.7 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.0 | 0.3 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
| 0.0 | 0.2 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
| 0.0 | 0.5 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.0 | 0.3 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.0 | 0.8 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.0 | 1.0 | GO:0008235 | metalloexopeptidase activity(GO:0008235) |
| 0.0 | 0.2 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
| 0.0 | 0.7 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.0 | 0.5 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.0 | 2.9 | GO:0051219 | phosphoprotein binding(GO:0051219) |
| 0.0 | 9.7 | GO:0005096 | GTPase activator activity(GO:0005096) |
| 0.0 | 0.6 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.0 | 1.8 | GO:0002039 | p53 binding(GO:0002039) |
| 0.0 | 1.2 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) |
| 0.0 | 0.5 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.0 | 2.0 | GO:0005262 | calcium channel activity(GO:0005262) |
| 0.0 | 0.9 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.0 | 1.0 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.0 | 0.8 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.0 | 1.8 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.0 | 0.2 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
| 0.0 | 0.5 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
| 0.0 | 0.5 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.0 | 0.7 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.0 | 0.7 | GO:0031491 | nucleosome binding(GO:0031491) |
| 0.0 | 1.1 | GO:0003725 | double-stranded RNA binding(GO:0003725) |
| 0.0 | 0.2 | GO:0008430 | selenium binding(GO:0008430) |
| 0.0 | 1.6 | GO:0051087 | chaperone binding(GO:0051087) |
| 0.0 | 0.9 | GO:0019209 | kinase activator activity(GO:0019209) |
| 0.0 | 0.4 | GO:0000030 | mannosyltransferase activity(GO:0000030) |
| 0.0 | 0.1 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.0 | 0.5 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.0 | 0.1 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.0 | 0.3 | GO:0030170 | pyridoxal phosphate binding(GO:0030170) |
| 0.0 | 0.1 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.0 | 0.6 | GO:0004197 | cysteine-type endopeptidase activity(GO:0004197) |
| 0.0 | 0.9 | GO:0008080 | N-acetyltransferase activity(GO:0008080) |
| 0.0 | 0.1 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.0 | 0.1 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.0 | 2.0 | GO:0005198 | structural molecule activity(GO:0005198) |
| 0.0 | 0.1 | GO:0016428 | tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
| 0.0 | 0.1 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.0 | 0.1 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
| 0.0 | 0.0 | GO:0030156 | benzodiazepine receptor binding(GO:0030156) |
| 0.0 | 0.0 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.0 | 0.6 | GO:0019003 | GDP binding(GO:0019003) |
| 0.0 | 0.3 | GO:0070412 | R-SMAD binding(GO:0070412) |
| 0.0 | 0.1 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.7 | 9.8 | PID_INTEGRIN2_PATHWAY | Beta2 integrin cell surface interactions |
| 0.6 | 1.1 | SA_B_CELL_RECEPTOR_COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.4 | 21.4 | ST_WNT_BETA_CATENIN_PATHWAY | Wnt/beta-catenin Pathway |
| 0.4 | 4.2 | SA_MMP_CYTOKINE_CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.4 | 33.7 | PID_MYC_REPRESS_PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.4 | 5.5 | PID_TCR_RAS_PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.3 | 12.1 | PID_HIV_NEF_PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.3 | 5.6 | PID_A6B1_A6B4_INTEGRIN_PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.3 | 1.3 | SIG_IL4RECEPTOR_IN_B_LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.3 | 2.0 | PID_VEGF_VEGFR_PATHWAY | VEGF and VEGFR signaling network |
| 0.3 | 8.5 | SA_PTEN_PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.3 | 7.5 | PID_IL23_PATHWAY | IL23-mediated signaling events |
| 0.3 | 13.7 | PID_TCPTP_PATHWAY | Signaling events mediated by TCPTP |
| 0.3 | 0.9 | PID_PI3K_PLC_TRK_PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.3 | 5.6 | PID_LYMPH_ANGIOGENESIS_PATHWAY | VEGFR3 signaling in lymphatic endothelium |
| 0.3 | 8.6 | PID_ARF6_PATHWAY | Arf6 signaling events |
| 0.2 | 4.1 | PID_INTEGRIN_A9B1_PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.2 | 2.5 | PID_FCER1_PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.2 | 3.2 | PID_S1P_S1P3_PATHWAY | S1P3 pathway |
| 0.2 | 1.3 | PID_GLYPICAN_1PATHWAY | Glypican 1 network |
| 0.2 | 24.6 | PID_PDGFRB_PATHWAY | PDGFR-beta signaling pathway |
| 0.2 | 25.4 | NABA_ECM_AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.2 | 1.3 | PID_MET_PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.2 | 1.6 | ST_TUMOR_NECROSIS_FACTOR_PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.2 | 4.0 | PID_CERAMIDE_PATHWAY | Ceramide signaling pathway |
| 0.2 | 2.2 | PID_UPA_UPAR_PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| 0.2 | 4.5 | ST_DIFFERENTIATION_PATHWAY_IN_PC12_CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.2 | 3.9 | PID_SHP2_PATHWAY | SHP2 signaling |
| 0.2 | 4.8 | PID_INTEGRIN_A4B1_PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.2 | 7.9 | PID_AJDISS_2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.2 | 1.9 | PID_IGF1_PATHWAY | IGF1 pathway |
| 0.2 | 6.2 | NABA_BASEMENT_MEMBRANES | Genes encoding structural components of basement membranes |
| 0.2 | 4.5 | PID_IL12_2PATHWAY | IL12-mediated signaling events |
| 0.2 | 2.6 | PID_IL8_CXCR1_PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.2 | 2.5 | PID_PRL_SIGNALING_EVENTS_PATHWAY | Signaling events mediated by PRL |
| 0.1 | 2.6 | SIG_BCR_SIGNALING_PATHWAY | Members of the BCR signaling pathway |
| 0.1 | 1.2 | PID_SYNDECAN_4_PATHWAY | Syndecan-4-mediated signaling events |
| 0.1 | 1.5 | PID_FRA_PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.1 | 3.3 | NABA_PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.1 | 1.6 | PID_EPHRINB_REV_PATHWAY | Ephrin B reverse signaling |
| 0.1 | 0.5 | SA_CASPASE_CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.1 | 1.9 | PID_NCADHERIN_PATHWAY | N-cadherin signaling events |
| 0.1 | 0.6 | PID_PS1_PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.1 | 7.8 | PID_CMYB_PATHWAY | C-MYB transcription factor network |
| 0.1 | 0.8 | PID_PI3KCI_PATHWAY | Class I PI3K signaling events |
| 0.1 | 2.1 | PID_ERBB4_PATHWAY | ErbB4 signaling events |
| 0.1 | 1.7 | PID_BMP_PATHWAY | BMP receptor signaling |
| 0.1 | 1.1 | PID_EPHA_FWDPATHWAY | EPHA forward signaling |
| 0.1 | 5.9 | PID_HIF1_TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.1 | 14.0 | NABA_SECRETED_FACTORS | Genes encoding secreted soluble factors |
| 0.1 | 4.7 | PID_P73PATHWAY | p73 transcription factor network |
| 0.1 | 10.8 | NABA_ECM_REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.1 | 0.4 | PID_ECADHERIN_KERATINOCYTE_PATHWAY | E-cadherin signaling in keratinocytes |
| 0.1 | 4.6 | PID_MTOR_4PATHWAY | mTOR signaling pathway |
| 0.1 | 1.9 | PID_LIS1_PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.1 | 8.1 | NABA_ECM_GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.1 | 0.7 | PID_IL1_PATHWAY | IL1-mediated signaling events |
| 0.1 | 0.8 | PID_HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.0 | 0.5 | PID_CD8_TCR_DOWNSTREAM_PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 0.1 | PID_AR_NONGENOMIC_PATHWAY | Nongenotropic Androgen signaling |
| 0.0 | 0.9 | PID_ECADHERIN_STABILIZATION_PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.0 | 0.5 | PID_ECADHERIN_NASCENT_AJ_PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.0 | 0.6 | PID_ARF_3PATHWAY | Arf1 pathway |
| 0.0 | 0.9 | PID_ERBB1_INTERNALIZATION_PATHWAY | Internalization of ErbB1 |
| 0.0 | 0.3 | PID_EPHB_FWD_PATHWAY | EPHB forward signaling |
| 0.0 | 0.2 | PID_SMAD2_3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 0.2 | PID_IL2_STAT5_PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.0 | 0.4 | PID_TGFBR_PATHWAY | TGF-beta receptor signaling |
| 0.0 | 0.6 | PID_REG_GR_PATHWAY | Glucocorticoid receptor regulatory network |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.4 | 14.1 | REACTOME_CREATION_OF_C4_AND_C2_ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 1.2 | 9.8 | REACTOME_TRANSPORT_OF_ORGANIC_ANIONS | Genes involved in Transport of organic anions |
| 1.2 | 7.2 | REACTOME_COMMON_PATHWAY | Genes involved in Common Pathway |
| 1.0 | 6.0 | REACTOME_ORGANIC_CATION_ANION_ZWITTERION_TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.8 | 16.6 | REACTOME_IMMUNOREGULATORY_INTERACTIONS_BETWEEN_A_LYMPHOID_AND_A_NON_LYMPHOID_CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.7 | 6.8 | REACTOME_NA_CL_DEPENDENT_NEUROTRANSMITTER_TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.7 | 4.7 | REACTOME_GAMMA_CARBOXYLATION_TRANSPORT_AND_AMINO_TERMINAL_CLEAVAGE_OF_PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 0.6 | 5.0 | REACTOME_THE_ACTIVATION_OF_ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.6 | 5.5 | REACTOME_PTM_GAMMA_CARBOXYLATION_HYPUSINE_FORMATION_AND_ARYLSULFATASE_ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.6 | 6.0 | REACTOME_KERATAN_SULFATE_DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.6 | 27.5 | REACTOME_NCAM1_INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.5 | 17.5 | REACTOME_SYNTHESIS_OF_PA | Genes involved in Synthesis of PA |
| 0.5 | 2.6 | REACTOME_BILE_SALT_AND_ORGANIC_ANION_SLC_TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.5 | 6.6 | REACTOME_EXTRINSIC_PATHWAY_FOR_APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.5 | 3.5 | REACTOME_CYTOSOLIC_SULFONATION_OF_SMALL_MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.5 | 3.7 | REACTOME_REGULATION_OF_INSULIN_SECRETION_BY_ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.4 | 1.7 | REACTOME_REGULATION_OF_COMPLEMENT_CASCADE | Genes involved in Regulation of Complement cascade |
| 0.4 | 5.6 | REACTOME_ROLE_OF_DCC_IN_REGULATING_APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.4 | 13.7 | REACTOME_TIGHT_JUNCTION_INTERACTIONS | Genes involved in Tight junction interactions |
| 0.4 | 10.8 | REACTOME_RAS_ACTIVATION_UOPN_CA2_INFUX_THROUGH_NMDA_RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.4 | 8.9 | REACTOME_CHEMOKINE_RECEPTORS_BIND_CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.3 | 11.3 | REACTOME_TRANSPORT_OF_VITAMINS_NUCLEOSIDES_AND_RELATED_MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.3 | 4.7 | REACTOME_SIGNAL_REGULATORY_PROTEIN_SIRP_FAMILY_INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.3 | 11.8 | REACTOME_INTERFERON_ALPHA_BETA_SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.3 | 1.5 | REACTOME_ANTIGEN_PRESENTATION_FOLDING_ASSEMBLY_AND_PEPTIDE_LOADING_OF_CLASS_I_MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.3 | 4.7 | REACTOME_REGULATION_OF_INSULIN_LIKE_GROWTH_FACTOR_IGF_ACTIVITY_BY_INSULIN_LIKE_GROWTH_FACTOR_BINDING_PROTEINS_IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.3 | 6.6 | REACTOME_PKA_MEDIATED_PHOSPHORYLATION_OF_CREB | Genes involved in PKA-mediated phosphorylation of CREB |
| 0.3 | 4.5 | REACTOME_PRE_NOTCH_PROCESSING_IN_GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.3 | 12.9 | REACTOME_TRNA_AMINOACYLATION | Genes involved in tRNA Aminoacylation |
| 0.3 | 5.7 | REACTOME_ACTIVATION_OF_BH3_ONLY_PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.3 | 7.2 | REACTOME_NEPHRIN_INTERACTIONS | Genes involved in Nephrin interactions |
| 0.3 | 4.3 | REACTOME_SYNTHESIS_SECRETION_AND_DEACYLATION_OF_GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.3 | 2.3 | REACTOME_TRANSMISSION_ACROSS_CHEMICAL_SYNAPSES | Genes involved in Transmission across Chemical Synapses |
| 0.2 | 2.9 | REACTOME_CA_DEPENDENT_EVENTS | Genes involved in Ca-dependent events |
| 0.2 | 3.5 | REACTOME_TETRAHYDROBIOPTERIN_BH4_SYNTHESIS_RECYCLING_SALVAGE_AND_REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.2 | 3.2 | REACTOME_KERATAN_SULFATE_KERATIN_METABOLISM | Genes involved in Keratan sulfate/keratin metabolism |
| 0.2 | 6.9 | REACTOME_ABC_FAMILY_PROTEINS_MEDIATED_TRANSPORT | Genes involved in ABC-family proteins mediated transport |
| 0.2 | 3.7 | REACTOME_INHIBITION_OF_VOLTAGE_GATED_CA2_CHANNELS_VIA_GBETA_GAMMA_SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
| 0.2 | 6.1 | REACTOME_PHASE1_FUNCTIONALIZATION_OF_COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
| 0.2 | 16.3 | REACTOME_RESPONSE_TO_ELEVATED_PLATELET_CYTOSOLIC_CA2_ | Genes involved in Response to elevated platelet cytosolic Ca2+ |
| 0.2 | 0.2 | REACTOME_ACTIVATION_OF_NF_KAPPAB_IN_B_CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.2 | 3.6 | REACTOME_SIGNALING_BY_NODAL | Genes involved in Signaling by NODAL |
| 0.2 | 2.9 | REACTOME_PURINE_RIBONUCLEOSIDE_MONOPHOSPHATE_BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.2 | 2.2 | REACTOME_BASE_FREE_SUGAR_PHOSPHATE_REMOVAL_VIA_THE_SINGLE_NUCLEOTIDE_REPLACEMENT_PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.2 | 14.9 | REACTOME_G_ALPHA_I_SIGNALLING_EVENTS | Genes involved in G alpha (i) signalling events |
| 0.2 | 2.6 | REACTOME_RAP1_SIGNALLING | Genes involved in Rap1 signalling |
| 0.2 | 3.0 | REACTOME_POST_CHAPERONIN_TUBULIN_FOLDING_PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.2 | 4.7 | REACTOME_SYNTHESIS_OF_PC | Genes involved in Synthesis of PC |
| 0.2 | 4.2 | REACTOME_METABOLISM_OF_PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.2 | 3.2 | REACTOME_REGULATION_OF_SIGNALING_BY_CBL | Genes involved in Regulation of signaling by CBL |
| 0.2 | 14.9 | REACTOME_CLASS_B_2_SECRETIN_FAMILY_RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.2 | 4.7 | REACTOME_SIGNALING_BY_BMP | Genes involved in Signaling by BMP |
| 0.2 | 4.3 | REACTOME_NITRIC_OXIDE_STIMULATES_GUANYLATE_CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
| 0.2 | 2.1 | REACTOME_GAP_JUNCTION_ASSEMBLY | Genes involved in Gap junction assembly |
| 0.2 | 1.0 | REACTOME_REGULATION_OF_ORNITHINE_DECARBOXYLASE_ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.2 | 6.2 | REACTOME_ION_TRANSPORT_BY_P_TYPE_ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.2 | 3.5 | REACTOME_PYRIMIDINE_METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.2 | 17.4 | REACTOME_PEPTIDE_CHAIN_ELONGATION | Genes involved in Peptide chain elongation |
| 0.2 | 2.4 | REACTOME_MTORC1_MEDIATED_SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.2 | 5.1 | REACTOME_ADHERENS_JUNCTIONS_INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.2 | 2.8 | REACTOME_HORMONE_SENSITIVE_LIPASE_HSL_MEDIATED_TRIACYLGLYCEROL_HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.1 | 5.9 | REACTOME_PHASE_II_CONJUGATION | Genes involved in Phase II conjugation |
| 0.1 | 1.1 | REACTOME_MICRORNA_MIRNA_BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
| 0.1 | 1.1 | REACTOME_GPVI_MEDIATED_ACTIVATION_CASCADE | Genes involved in GPVI-mediated activation cascade |
| 0.1 | 1.4 | REACTOME_THROMBIN_SIGNALLING_THROUGH_PROTEINASE_ACTIVATED_RECEPTORS_PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.1 | 1.5 | REACTOME_HDL_MEDIATED_LIPID_TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.1 | 9.5 | REACTOME_RESPIRATORY_ELECTRON_TRANSPORT | Genes involved in Respiratory electron transport |
| 0.1 | 1.4 | REACTOME_ERKS_ARE_INACTIVATED | Genes involved in ERKs are inactivated |
| 0.1 | 1.6 | REACTOME_METABOLISM_OF_POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.1 | 0.6 | REACTOME_P38MAPK_EVENTS | Genes involved in p38MAPK events |
| 0.1 | 1.5 | REACTOME_TGF_BETA_RECEPTOR_SIGNALING_IN_EMT_EPITHELIAL_TO_MESENCHYMAL_TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.1 | 2.0 | REACTOME_PURINE_SALVAGE | Genes involved in Purine salvage |
| 0.1 | 2.0 | REACTOME_FORMATION_OF_TRANSCRIPTION_COUPLED_NER_TC_NER_REPAIR_COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 0.1 | 0.4 | REACTOME_PLC_BETA_MEDIATED_EVENTS | Genes involved in PLC beta mediated events |
| 0.1 | 2.7 | REACTOME_ENDOSOMAL_SORTING_COMPLEX_REQUIRED_FOR_TRANSPORT_ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.1 | 2.3 | REACTOME_GLYCOSPHINGOLIPID_METABOLISM | Genes involved in Glycosphingolipid metabolism |
| 0.1 | 0.6 | REACTOME_TANDEM_PORE_DOMAIN_POTASSIUM_CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.1 | 0.4 | REACTOME_INTRINSIC_PATHWAY | Genes involved in Intrinsic Pathway |
| 0.1 | 5.1 | REACTOME_METABOLISM_OF_VITAMINS_AND_COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.1 | 1.5 | REACTOME_DCC_MEDIATED_ATTRACTIVE_SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.1 | 1.0 | REACTOME_ELONGATION_ARREST_AND_RECOVERY | Genes involved in Elongation arrest and recovery |
| 0.1 | 1.3 | REACTOME_PYRUVATE_METABOLISM | Genes involved in Pyruvate metabolism |
| 0.1 | 2.0 | REACTOME_NONSENSE_MEDIATED_DECAY_ENHANCED_BY_THE_EXON_JUNCTION_COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.1 | 1.3 | REACTOME_SYNTHESIS_OF_SUBSTRATES_IN_N_GLYCAN_BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.1 | 4.0 | REACTOME_POTASSIUM_CHANNELS | Genes involved in Potassium Channels |
| 0.1 | 1.1 | REACTOME_METABOLISM_OF_STEROID_HORMONES_AND_VITAMINS_A_AND_D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
| 0.1 | 0.4 | REACTOME_ACTIVATION_OF_CHAPERONES_BY_ATF6_ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
| 0.1 | 1.0 | REACTOME_GENERIC_TRANSCRIPTION_PATHWAY | Genes involved in Generic Transcription Pathway |
| 0.1 | 1.3 | REACTOME_ZINC_TRANSPORTERS | Genes involved in Zinc transporters |
| 0.1 | 0.7 | REACTOME_PLATELET_SENSITIZATION_BY_LDL | Genes involved in Platelet sensitization by LDL |
| 0.1 | 1.1 | REACTOME_PROCESSING_OF_INTRONLESS_PRE_MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.1 | 3.0 | REACTOME_SPHINGOLIPID_METABOLISM | Genes involved in Sphingolipid metabolism |
| 0.1 | 2.5 | REACTOME_MHC_CLASS_II_ANTIGEN_PRESENTATION | Genes involved in MHC class II antigen presentation |
| 0.1 | 1.5 | REACTOME_INSULIN_RECEPTOR_RECYCLING | Genes involved in Insulin receptor recycling |
| 0.1 | 1.9 | REACTOME_CELL_JUNCTION_ORGANIZATION | Genes involved in Cell junction organization |
| 0.1 | 0.5 | REACTOME_TRAF6_MEDIATED_IRF7_ACTIVATION_IN_TLR7_8_OR_9_SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.1 | 0.3 | REACTOME_INHIBITION_OF_REPLICATION_INITIATION_OF_DAMAGED_DNA_BY_RB1_E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.1 | 0.3 | REACTOME_IRAK2_MEDIATED_ACTIVATION_OF_TAK1_COMPLEX_UPON_TLR7_8_OR_9_STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.1 | 1.3 | REACTOME_GABA_SYNTHESIS_RELEASE_REUPTAKE_AND_DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.1 | 1.9 | REACTOME_RORA_ACTIVATES_CIRCADIAN_EXPRESSION | Genes involved in RORA Activates Circadian Expression |
| 0.1 | 2.7 | REACTOME_MITOCHONDRIAL_PROTEIN_IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.1 | 2.2 | REACTOME_COLLAGEN_FORMATION | Genes involved in Collagen formation |
| 0.1 | 1.1 | REACTOME_BRANCHED_CHAIN_AMINO_ACID_CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.1 | 0.4 | REACTOME_FACILITATIVE_NA_INDEPENDENT_GLUCOSE_TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.0 | 2.3 | REACTOME_CELL_SURFACE_INTERACTIONS_AT_THE_VASCULAR_WALL | Genes involved in Cell surface interactions at the vascular wall |
| 0.0 | 2.3 | REACTOME_MRNA_SPLICING_MINOR_PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.0 | 0.7 | REACTOME_DESTABILIZATION_OF_MRNA_BY_TRISTETRAPROLIN_TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.0 | 1.0 | REACTOME_SRP_DEPENDENT_COTRANSLATIONAL_PROTEIN_TARGETING_TO_MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
| 0.0 | 1.3 | REACTOME_G_ALPHA_S_SIGNALLING_EVENTS | Genes involved in G alpha (s) signalling events |
| 0.0 | 0.7 | REACTOME_DEADENYLATION_OF_MRNA | Genes involved in Deadenylation of mRNA |
| 0.0 | 0.5 | REACTOME_REGULATED_PROTEOLYSIS_OF_P75NTR | Genes involved in Regulated proteolysis of p75NTR |
| 0.0 | 0.5 | REACTOME_ERK_MAPK_TARGETS | Genes involved in ERK/MAPK targets |
| 0.0 | 0.4 | REACTOME_IRON_UPTAKE_AND_TRANSPORT | Genes involved in Iron uptake and transport |
| 0.0 | 0.4 | REACTOME_BMAL1_CLOCK_NPAS2_ACTIVATES_CIRCADIAN_EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.0 | 0.8 | REACTOME_LYSOSOME_VESICLE_BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.0 | 0.8 | REACTOME_TRANSLATION | Genes involved in Translation |
| 0.0 | 0.3 | REACTOME_DOWNREGULATION_OF_ERBB2_ERBB3_SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.0 | 1.2 | REACTOME_TRANSCRIPTIONAL_REGULATION_OF_WHITE_ADIPOCYTE_DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.0 | 0.5 | REACTOME_AMINO_ACID_SYNTHESIS_AND_INTERCONVERSION_TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.0 | 0.6 | REACTOME_ACTIVATION_OF_CHAPERONE_GENES_BY_XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
