| 11.5 |
34.4 |
GO:0002302 |
CD8-positive, alpha-beta T cell differentiation involved in immune response(GO:0002302) |
| 11.4 |
56.9 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 7.8 |
23.4 |
GO:0030421 |
defecation(GO:0030421) |
| 7.7 |
23.2 |
GO:0003221 |
right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 5.9 |
5.9 |
GO:0060994 |
regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 5.7 |
17.0 |
GO:0060244 |
negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 5.5 |
16.5 |
GO:0071898 |
regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 5.0 |
15.1 |
GO:0001869 |
regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
| 4.5 |
4.5 |
GO:1902460 |
regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 4.5 |
9.0 |
GO:0060809 |
mesodermal to mesenchymal transition involved in gastrulation(GO:0060809) |
| 4.5 |
26.8 |
GO:0070094 |
positive regulation of glucagon secretion(GO:0070094) |
| 4.3 |
4.3 |
GO:0072106 |
regulation of branch elongation involved in ureteric bud branching(GO:0072095) regulation of ureteric bud formation(GO:0072106) positive regulation of ureteric bud formation(GO:0072107) |
| 4.2 |
8.3 |
GO:0021603 |
cranial nerve formation(GO:0021603) |
| 3.9 |
11.8 |
GO:0090425 |
hepatocyte cell migration(GO:0002194) branching involved in pancreas morphogenesis(GO:0061114) acinar cell differentiation(GO:0090425) positive regulation of forebrain neuron differentiation(GO:2000979) |
| 3.8 |
7.6 |
GO:0060857 |
establishment of glial blood-brain barrier(GO:0060857) |
| 3.7 |
11.1 |
GO:0060598 |
dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
| 3.6 |
21.9 |
GO:0021965 |
spinal cord ventral commissure morphogenesis(GO:0021965) |
| 3.6 |
10.9 |
GO:0071579 |
regulation of zinc ion transport(GO:0071579) |
| 3.6 |
10.8 |
GO:0016115 |
terpenoid catabolic process(GO:0016115) |
| 3.6 |
10.8 |
GO:0061303 |
cornea development in camera-type eye(GO:0061303) |
| 3.6 |
3.6 |
GO:0061113 |
pancreas morphogenesis(GO:0061113) |
| 3.5 |
10.5 |
GO:0021998 |
neural plate mediolateral regionalization(GO:0021998) mesoderm structural organization(GO:0048338) paraxial mesoderm structural organization(GO:0048352) positive regulation of cardiac ventricle development(GO:1904414) |
| 3.3 |
6.7 |
GO:0048852 |
diencephalon morphogenesis(GO:0048852) |
| 3.3 |
10.0 |
GO:0007228 |
positive regulation of hh target transcription factor activity(GO:0007228) |
| 3.3 |
9.9 |
GO:0007223 |
Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 3.2 |
9.6 |
GO:0061642 |
chemoattraction of axon(GO:0061642) |
| 3.1 |
3.1 |
GO:0002175 |
protein localization to paranode region of axon(GO:0002175) |
| 3.1 |
9.3 |
GO:1990705 |
cholangiocyte proliferation(GO:1990705) |
| 3.1 |
6.2 |
GO:0070671 |
response to interleukin-12(GO:0070671) |
| 3.1 |
9.3 |
GO:0061341 |
non-canonical Wnt signaling pathway involved in heart development(GO:0061341) planar cell polarity pathway involved in heart morphogenesis(GO:0061346) |
| 3.1 |
6.1 |
GO:0060849 |
regulation of transcription involved in lymphatic endothelial cell fate commitment(GO:0060849) |
| 3.0 |
6.1 |
GO:1900377 |
negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 3.0 |
23.9 |
GO:0021796 |
cerebral cortex regionalization(GO:0021796) |
| 2.9 |
8.8 |
GO:0003360 |
brainstem development(GO:0003360) |
| 2.9 |
11.5 |
GO:2001045 |
negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 2.8 |
27.9 |
GO:0048386 |
positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 2.8 |
8.3 |
GO:1903048 |
regulation of acetylcholine-gated cation channel activity(GO:1903048) |
| 2.7 |
11.0 |
GO:0086048 |
membrane depolarization during bundle of His cell action potential(GO:0086048) |
| 2.7 |
2.7 |
GO:0072697 |
protein localization to cell cortex(GO:0072697) |
| 2.7 |
2.7 |
GO:0002572 |
pro-T cell differentiation(GO:0002572) |
| 2.5 |
10.0 |
GO:1902724 |
positive regulation of skeletal muscle satellite cell proliferation(GO:1902724) positive regulation of growth factor dependent skeletal muscle satellite cell proliferation(GO:1902728) |
| 2.4 |
17.1 |
GO:0001842 |
neural fold formation(GO:0001842) |
| 2.3 |
9.3 |
GO:2000795 |
negative regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000795) |
| 2.3 |
18.4 |
GO:2001198 |
regulation of dendritic cell differentiation(GO:2001198) |
| 2.3 |
6.9 |
GO:0044837 |
assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 2.3 |
15.9 |
GO:0003190 |
atrioventricular valve formation(GO:0003190) |
| 2.3 |
6.8 |
GO:0097402 |
optic vesicle morphogenesis(GO:0003404) neuroblast migration(GO:0097402) |
| 2.3 |
9.1 |
GO:0043973 |
histone H3-K4 acetylation(GO:0043973) |
| 2.2 |
8.8 |
GO:0021764 |
amygdala development(GO:0021764) |
| 2.2 |
6.6 |
GO:0002248 |
connective tissue replacement involved in inflammatory response wound healing(GO:0002248) |
| 2.2 |
6.6 |
GO:0060729 |
intestinal epithelial structure maintenance(GO:0060729) |
| 2.2 |
2.2 |
GO:0061141 |
lung ciliated cell differentiation(GO:0061141) |
| 2.2 |
6.6 |
GO:0060853 |
arterial endothelial cell fate commitment(GO:0060844) blood vessel endothelial cell fate commitment(GO:0060846) endothelial cell fate specification(GO:0060847) Notch signaling pathway involved in arterial endothelial cell fate commitment(GO:0060853) blood vessel endothelial cell fate specification(GO:0097101) |
| 2.2 |
32.6 |
GO:0072189 |
ureter development(GO:0072189) |
| 2.2 |
6.5 |
GO:1902528 |
regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 2.1 |
6.4 |
GO:0006116 |
NADH oxidation(GO:0006116) |
| 2.1 |
6.4 |
GO:0021553 |
olfactory nerve development(GO:0021553) |
| 2.1 |
30.0 |
GO:0070102 |
interleukin-6-mediated signaling pathway(GO:0070102) |
| 2.1 |
6.4 |
GO:1903070 |
negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
| 2.1 |
2.1 |
GO:0070841 |
inclusion body assembly(GO:0070841) regulation of inclusion body assembly(GO:0090083) |
| 2.1 |
6.3 |
GO:1904719 |
excitatory chemical synaptic transmission(GO:0098976) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
| 2.1 |
8.4 |
GO:0000415 |
negative regulation of histone H3-K36 methylation(GO:0000415) |
| 2.1 |
18.8 |
GO:0021521 |
ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 2.1 |
6.3 |
GO:2000620 |
positive regulation of histone H4-K16 acetylation(GO:2000620) |
| 2.1 |
6.2 |
GO:0042732 |
D-xylose metabolic process(GO:0042732) |
| 2.0 |
4.1 |
GO:0060399 |
positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 2.0 |
8.0 |
GO:1900224 |
positive regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900224) |
| 2.0 |
8.0 |
GO:0070269 |
pyroptosis(GO:0070269) |
| 2.0 |
4.0 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 2.0 |
7.9 |
GO:0038027 |
apolipoprotein A-I-mediated signaling pathway(GO:0038027) |
| 2.0 |
35.5 |
GO:0010715 |
regulation of extracellular matrix disassembly(GO:0010715) |
| 2.0 |
19.6 |
GO:0060235 |
lens induction in camera-type eye(GO:0060235) |
| 2.0 |
5.9 |
GO:0002072 |
optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
| 1.9 |
7.8 |
GO:0007056 |
spindle assembly involved in female meiosis(GO:0007056) |
| 1.9 |
21.3 |
GO:0060539 |
diaphragm development(GO:0060539) |
| 1.9 |
5.8 |
GO:0032877 |
positive regulation of DNA endoreduplication(GO:0032877) |
| 1.9 |
5.8 |
GO:0090271 |
positive regulation of fibroblast growth factor production(GO:0090271) |
| 1.9 |
11.5 |
GO:0031536 |
positive regulation of exit from mitosis(GO:0031536) |
| 1.9 |
15.2 |
GO:0000395 |
mRNA 5'-splice site recognition(GO:0000395) |
| 1.9 |
3.8 |
GO:0003433 |
chondrocyte differentiation involved in endochondral bone morphogenesis(GO:0003413) chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 1.9 |
7.5 |
GO:0048319 |
axial mesoderm morphogenesis(GO:0048319) |
| 1.9 |
1.9 |
GO:0060298 |
positive regulation of sarcomere organization(GO:0060298) |
| 1.8 |
5.5 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 1.8 |
11.1 |
GO:0043622 |
cortical microtubule organization(GO:0043622) |
| 1.8 |
1.8 |
GO:0032916 |
positive regulation of transforming growth factor beta3 production(GO:0032916) |
| 1.8 |
5.4 |
GO:0035426 |
extracellular matrix-cell signaling(GO:0035426) |
| 1.8 |
12.6 |
GO:0021978 |
telencephalon regionalization(GO:0021978) |
| 1.8 |
5.4 |
GO:0034241 |
positive regulation of macrophage fusion(GO:0034241) |
| 1.8 |
1.8 |
GO:0060307 |
regulation of ventricular cardiac muscle cell membrane repolarization(GO:0060307) |
| 1.8 |
3.6 |
GO:0048368 |
lateral mesoderm development(GO:0048368) |
| 1.8 |
7.1 |
GO:2001274 |
negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 1.7 |
27.8 |
GO:0048385 |
regulation of retinoic acid receptor signaling pathway(GO:0048385) |
| 1.7 |
3.4 |
GO:1900220 |
semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 1.7 |
3.4 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 1.7 |
39.2 |
GO:0006978 |
DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) |
| 1.7 |
6.8 |
GO:0033140 |
negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 1.7 |
5.1 |
GO:0010847 |
regulation of chromatin assembly(GO:0010847) |
| 1.7 |
8.4 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 1.7 |
5.0 |
GO:1902915 |
negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 1.6 |
1.6 |
GO:0006268 |
DNA unwinding involved in DNA replication(GO:0006268) |
| 1.6 |
1.6 |
GO:0060489 |
orthogonal dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060488) planar dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060489) lateral sprouting involved in lung morphogenesis(GO:0060490) |
| 1.6 |
14.3 |
GO:1902715 |
positive regulation of interferon-gamma secretion(GO:1902715) |
| 1.6 |
11.1 |
GO:0034770 |
histone H4-K20 methylation(GO:0034770) |
| 1.6 |
3.2 |
GO:0014028 |
notochord formation(GO:0014028) |
| 1.6 |
9.4 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 1.6 |
6.3 |
GO:0036091 |
positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 1.5 |
7.7 |
GO:0035022 |
positive regulation of Rac protein signal transduction(GO:0035022) |
| 1.5 |
10.8 |
GO:0044806 |
G-quadruplex DNA unwinding(GO:0044806) |
| 1.5 |
7.7 |
GO:0014886 |
transition between slow and fast fiber(GO:0014886) |
| 1.5 |
4.6 |
GO:1990859 |
cellular response to endothelin(GO:1990859) |
| 1.5 |
6.1 |
GO:0003365 |
establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
| 1.5 |
6.1 |
GO:0060579 |
ventral spinal cord interneuron fate commitment(GO:0060579) cell fate commitment involved in pattern specification(GO:0060581) |
| 1.5 |
1.5 |
GO:0070172 |
positive regulation of tooth mineralization(GO:0070172) |
| 1.5 |
3.0 |
GO:0097368 |
establishment of Sertoli cell barrier(GO:0097368) |
| 1.5 |
12.0 |
GO:0002315 |
marginal zone B cell differentiation(GO:0002315) |
| 1.5 |
7.5 |
GO:2001032 |
regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 1.5 |
8.9 |
GO:0044351 |
macropinocytosis(GO:0044351) |
| 1.5 |
1.5 |
GO:0071930 |
negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 1.5 |
17.8 |
GO:0048617 |
embryonic foregut morphogenesis(GO:0048617) |
| 1.5 |
5.9 |
GO:1904672 |
regulation of somatic stem cell population maintenance(GO:1904672) |
| 1.5 |
5.8 |
GO:0018076 |
N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 1.5 |
8.7 |
GO:0045654 |
positive regulation of megakaryocyte differentiation(GO:0045654) |
| 1.4 |
4.2 |
GO:0070315 |
G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 1.4 |
8.5 |
GO:0071205 |
protein localization to juxtaparanode region of axon(GO:0071205) |
| 1.4 |
1.4 |
GO:1903490 |
regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 1.4 |
15.5 |
GO:0006105 |
succinate metabolic process(GO:0006105) |
| 1.4 |
1.4 |
GO:1903519 |
apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
| 1.4 |
4.1 |
GO:1903943 |
regulation of hepatocyte apoptotic process(GO:1903943) negative regulation of hepatocyte apoptotic process(GO:1903944) |
| 1.4 |
5.5 |
GO:0072365 |
regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 1.4 |
6.8 |
GO:1903690 |
negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 1.4 |
1.4 |
GO:0071378 |
growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
| 1.4 |
8.2 |
GO:0000920 |
cell separation after cytokinesis(GO:0000920) |
| 1.4 |
6.8 |
GO:0060024 |
rhythmic synaptic transmission(GO:0060024) |
| 1.3 |
8.0 |
GO:0003383 |
apical constriction(GO:0003383) |
| 1.3 |
2.7 |
GO:1904760 |
myofibroblast differentiation(GO:0036446) regulation of myofibroblast differentiation(GO:1904760) |
| 1.3 |
14.6 |
GO:0048934 |
peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 1.3 |
3.9 |
GO:0090274 |
positive regulation of somatostatin secretion(GO:0090274) |
| 1.3 |
7.8 |
GO:0043586 |
tongue development(GO:0043586) |
| 1.3 |
13.0 |
GO:0032876 |
negative regulation of DNA endoreduplication(GO:0032876) |
| 1.3 |
9.0 |
GO:1901970 |
positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
| 1.3 |
3.9 |
GO:0021698 |
cerebellar cortex structural organization(GO:0021698) |
| 1.3 |
6.4 |
GO:0035469 |
determination of pancreatic left/right asymmetry(GO:0035469) |
| 1.3 |
1.3 |
GO:0003175 |
tricuspid valve development(GO:0003175) tricuspid valve morphogenesis(GO:0003186) |
| 1.3 |
7.6 |
GO:0072615 |
interleukin-17 secretion(GO:0072615) |
| 1.3 |
2.5 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 1.3 |
3.8 |
GO:0048105 |
establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 1.3 |
3.8 |
GO:0001702 |
gastrulation with mouth forming second(GO:0001702) |
| 1.3 |
5.0 |
GO:0070829 |
heterochromatin maintenance(GO:0070829) |
| 1.3 |
1.3 |
GO:0033147 |
negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 1.2 |
10.0 |
GO:0071802 |
negative regulation of podosome assembly(GO:0071802) |
| 1.2 |
6.2 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 1.2 |
6.2 |
GO:0001561 |
fatty acid alpha-oxidation(GO:0001561) |
| 1.2 |
8.6 |
GO:0098762 |
meiotic cell cycle phase(GO:0098762) meiosis I cell cycle phase(GO:0098764) |
| 1.2 |
4.9 |
GO:1904565 |
response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 1.2 |
2.4 |
GO:1904996 |
positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 1.2 |
1.2 |
GO:1900275 |
negative regulation of phospholipase C activity(GO:1900275) |
| 1.2 |
1.2 |
GO:0061298 |
retina vasculature development in camera-type eye(GO:0061298) |
| 1.2 |
1.2 |
GO:0060689 |
cell differentiation involved in salivary gland development(GO:0060689) |
| 1.2 |
16.7 |
GO:0090103 |
cochlea morphogenesis(GO:0090103) |
| 1.2 |
8.3 |
GO:0035735 |
intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 1.2 |
3.5 |
GO:0060821 |
inactivation of X chromosome by DNA methylation(GO:0060821) |
| 1.2 |
4.7 |
GO:0007217 |
tachykinin receptor signaling pathway(GO:0007217) |
| 1.2 |
1.2 |
GO:0003308 |
negative regulation of Wnt signaling pathway involved in heart development(GO:0003308) |
| 1.2 |
2.3 |
GO:1904020 |
regulation of G-protein coupled receptor internalization(GO:1904020) |
| 1.2 |
5.8 |
GO:0034441 |
plasma lipoprotein particle oxidation(GO:0034441) |
| 1.1 |
2.3 |
GO:0051088 |
PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 1.1 |
5.7 |
GO:1903715 |
regulation of aerobic respiration(GO:1903715) |
| 1.1 |
3.3 |
GO:0019323 |
pentose catabolic process(GO:0019323) |
| 1.1 |
2.2 |
GO:0014722 |
regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 1.1 |
12.0 |
GO:0003334 |
keratinocyte development(GO:0003334) |
| 1.1 |
10.9 |
GO:0071481 |
cellular response to X-ray(GO:0071481) |
| 1.1 |
4.4 |
GO:0032901 |
positive regulation of neurotrophin production(GO:0032901) |
| 1.1 |
3.2 |
GO:0055099 |
response to high density lipoprotein particle(GO:0055099) |
| 1.1 |
9.7 |
GO:0070874 |
negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 1.1 |
8.6 |
GO:0002318 |
myeloid progenitor cell differentiation(GO:0002318) |
| 1.1 |
3.2 |
GO:0030200 |
heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 1.1 |
4.3 |
GO:0060903 |
positive regulation of meiosis I(GO:0060903) |
| 1.1 |
1.1 |
GO:0036092 |
phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 1.1 |
3.2 |
GO:0060084 |
synaptic transmission involved in micturition(GO:0060084) |
| 1.0 |
4.2 |
GO:0032053 |
ciliary basal body organization(GO:0032053) |
| 1.0 |
2.1 |
GO:0023016 |
signal transduction by trans-phosphorylation(GO:0023016) |
| 1.0 |
5.2 |
GO:1904948 |
midbrain dopaminergic neuron differentiation(GO:1904948) |
| 1.0 |
1.0 |
GO:1901187 |
regulation of ephrin receptor signaling pathway(GO:1901187) |
| 1.0 |
7.3 |
GO:0042760 |
very long-chain fatty acid catabolic process(GO:0042760) |
| 1.0 |
3.1 |
GO:0007144 |
female meiosis I(GO:0007144) |
| 1.0 |
3.1 |
GO:0007290 |
spermatid nucleus elongation(GO:0007290) |
| 1.0 |
1.0 |
GO:0006642 |
triglyceride mobilization(GO:0006642) |
| 1.0 |
3.1 |
GO:0019343 |
cysteine biosynthetic process via cystathionine(GO:0019343) cysteine biosynthetic process(GO:0019344) |
| 1.0 |
5.1 |
GO:0071894 |
histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 1.0 |
7.1 |
GO:0031508 |
pericentric heterochromatin assembly(GO:0031508) |
| 1.0 |
5.1 |
GO:1900170 |
negative regulation of glucocorticoid mediated signaling pathway(GO:1900170) |
| 1.0 |
10.1 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 1.0 |
7.1 |
GO:0010745 |
negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
| 1.0 |
6.0 |
GO:0046666 |
retinal cell programmed cell death(GO:0046666) |
| 1.0 |
6.0 |
GO:0031087 |
deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 1.0 |
4.0 |
GO:0033173 |
calcineurin-NFAT signaling cascade(GO:0033173) |
| 1.0 |
16.9 |
GO:0048864 |
stem cell development(GO:0048864) |
| 1.0 |
16.8 |
GO:0031571 |
mitotic G1 DNA damage checkpoint(GO:0031571) |
| 1.0 |
8.8 |
GO:1902373 |
negative regulation of mRNA catabolic process(GO:1902373) |
| 1.0 |
1.0 |
GO:0014902 |
myotube differentiation(GO:0014902) |
| 1.0 |
3.9 |
GO:0006244 |
pyrimidine nucleotide catabolic process(GO:0006244) pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
| 1.0 |
2.9 |
GO:0021937 |
cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
| 1.0 |
8.7 |
GO:2000794 |
positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000794) |
| 1.0 |
6.8 |
GO:0010908 |
regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) canonical Wnt signaling pathway involved in positive regulation of epithelial to mesenchymal transition(GO:0044334) |
| 1.0 |
4.8 |
GO:0098914 |
membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
| 1.0 |
1.9 |
GO:1902263 |
apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
| 1.0 |
6.7 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.9 |
2.8 |
GO:0002329 |
immature B cell differentiation(GO:0002327) pre-B cell differentiation(GO:0002329) |
| 0.9 |
6.6 |
GO:0048102 |
autophagic cell death(GO:0048102) |
| 0.9 |
4.7 |
GO:0090245 |
axis elongation involved in somitogenesis(GO:0090245) |
| 0.9 |
2.8 |
GO:0002191 |
cap-dependent translational initiation(GO:0002191) |
| 0.9 |
2.8 |
GO:0070844 |
misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 0.9 |
2.8 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.9 |
2.8 |
GO:0045819 |
plasmacytoid dendritic cell activation(GO:0002270) positive regulation of glycogen catabolic process(GO:0045819) |
| 0.9 |
3.7 |
GO:0030091 |
protein repair(GO:0030091) |
| 0.9 |
2.8 |
GO:1903753 |
negative regulation of p38MAPK cascade(GO:1903753) |
| 0.9 |
10.1 |
GO:0051574 |
positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.9 |
1.8 |
GO:0010519 |
negative regulation of phospholipase activity(GO:0010519) |
| 0.9 |
12.7 |
GO:0060009 |
Sertoli cell development(GO:0060009) |
| 0.9 |
1.8 |
GO:0042414 |
epinephrine metabolic process(GO:0042414) |
| 0.9 |
7.2 |
GO:0051255 |
spindle midzone assembly(GO:0051255) mitotic spindle midzone assembly(GO:0051256) |
| 0.9 |
7.2 |
GO:0000056 |
ribosomal small subunit export from nucleus(GO:0000056) |
| 0.9 |
0.9 |
GO:0003357 |
noradrenergic neuron differentiation(GO:0003357) |
| 0.9 |
16.2 |
GO:0031987 |
locomotion involved in locomotory behavior(GO:0031987) |
| 0.9 |
0.9 |
GO:0003347 |
epicardial cell to mesenchymal cell transition(GO:0003347) |
| 0.9 |
2.7 |
GO:0097026 |
dendritic cell dendrite assembly(GO:0097026) |
| 0.9 |
1.8 |
GO:1901629 |
presynaptic membrane organization(GO:0097090) regulation of presynaptic membrane organization(GO:1901629) |
| 0.9 |
5.4 |
GO:0021871 |
forebrain regionalization(GO:0021871) |
| 0.9 |
2.7 |
GO:0070634 |
transepithelial ammonium transport(GO:0070634) |
| 0.9 |
9.8 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 0.9 |
4.5 |
GO:0003420 |
regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
| 0.9 |
1.8 |
GO:1904975 |
response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
| 0.9 |
1.8 |
GO:0002326 |
B cell lineage commitment(GO:0002326) |
| 0.9 |
8.8 |
GO:0000712 |
resolution of meiotic recombination intermediates(GO:0000712) |
| 0.9 |
7.9 |
GO:0048251 |
elastic fiber assembly(GO:0048251) |
| 0.9 |
1.8 |
GO:1900048 |
positive regulation of blood coagulation(GO:0030194) positive regulation of coagulation(GO:0050820) positive regulation of hemostasis(GO:1900048) |
| 0.9 |
8.8 |
GO:0070307 |
lens fiber cell development(GO:0070307) |
| 0.9 |
0.9 |
GO:0007262 |
STAT protein import into nucleus(GO:0007262) |
| 0.9 |
1.7 |
GO:0036166 |
phenotypic switching(GO:0036166) |
| 0.9 |
3.4 |
GO:0060800 |
regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.9 |
2.6 |
GO:0086053 |
AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
| 0.9 |
6.0 |
GO:0061087 |
positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.9 |
2.6 |
GO:0060447 |
bud outgrowth involved in lung branching(GO:0060447) |
| 0.9 |
3.4 |
GO:0038128 |
ERBB2 signaling pathway(GO:0038128) |
| 0.9 |
0.9 |
GO:1900121 |
regulation of receptor binding(GO:1900120) negative regulation of receptor binding(GO:1900121) |
| 0.8 |
0.8 |
GO:0055005 |
ventricular cardiac myofibril assembly(GO:0055005) |
| 0.8 |
0.8 |
GO:2000314 |
negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
| 0.8 |
3.4 |
GO:0046469 |
platelet activating factor metabolic process(GO:0046469) |
| 0.8 |
0.8 |
GO:2000138 |
positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 0.8 |
3.4 |
GO:0006982 |
response to lipid hydroperoxide(GO:0006982) cellular response to lipid hydroperoxide(GO:0071449) |
| 0.8 |
1.7 |
GO:0043950 |
positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.8 |
8.4 |
GO:0030948 |
negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.8 |
3.3 |
GO:2000741 |
positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
| 0.8 |
7.5 |
GO:0034501 |
protein localization to kinetochore(GO:0034501) |
| 0.8 |
4.1 |
GO:0032354 |
response to follicle-stimulating hormone(GO:0032354) |
| 0.8 |
3.3 |
GO:1903347 |
negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.8 |
1.6 |
GO:2000324 |
positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.8 |
0.8 |
GO:0034239 |
regulation of macrophage fusion(GO:0034239) |
| 0.8 |
1.6 |
GO:0007067 |
mitotic nuclear division(GO:0007067) |
| 0.8 |
2.5 |
GO:0045578 |
negative regulation of B cell differentiation(GO:0045578) |
| 0.8 |
9.8 |
GO:0048199 |
vesicle targeting, to, from or within Golgi(GO:0048199) |
| 0.8 |
13.0 |
GO:0043567 |
regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.8 |
1.6 |
GO:2001014 |
regulation of skeletal muscle cell differentiation(GO:2001014) |
| 0.8 |
3.3 |
GO:0001880 |
Mullerian duct regression(GO:0001880) |
| 0.8 |
4.0 |
GO:1903961 |
regulation of plasma membrane long-chain fatty acid transport(GO:0010746) positive regulation of plasma membrane long-chain fatty acid transport(GO:0010747) plasma membrane long-chain fatty acid transport(GO:0015911) fatty acid transmembrane transport(GO:1902001) positive regulation of anion transmembrane transport(GO:1903961) |
| 0.8 |
2.4 |
GO:0044778 |
meiotic DNA integrity checkpoint(GO:0044778) |
| 0.8 |
13.7 |
GO:0050434 |
positive regulation of viral transcription(GO:0050434) |
| 0.8 |
2.4 |
GO:0048633 |
positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.8 |
0.8 |
GO:0046121 |
deoxyribonucleoside catabolic process(GO:0046121) |
| 0.8 |
6.4 |
GO:1903608 |
protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.8 |
6.3 |
GO:0015074 |
DNA integration(GO:0015074) |
| 0.8 |
4.7 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.8 |
6.3 |
GO:1904627 |
response to phorbol 13-acetate 12-myristate(GO:1904627) cellular response to phorbol 13-acetate 12-myristate(GO:1904628) |
| 0.8 |
0.8 |
GO:0045918 |
negative regulation of cytolysis(GO:0045918) |
| 0.8 |
7.0 |
GO:0070236 |
negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.8 |
5.4 |
GO:0090234 |
regulation of centromere complex assembly(GO:0090230) regulation of kinetochore assembly(GO:0090234) |
| 0.8 |
3.1 |
GO:0055071 |
cellular manganese ion homeostasis(GO:0030026) Golgi calcium ion homeostasis(GO:0032468) manganese ion homeostasis(GO:0055071) |
| 0.8 |
2.3 |
GO:0009880 |
embryonic pattern specification(GO:0009880) |
| 0.8 |
1.5 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 0.8 |
0.8 |
GO:0010637 |
negative regulation of mitochondrial fusion(GO:0010637) |
| 0.8 |
5.4 |
GO:1904217 |
regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.8 |
9.2 |
GO:0001779 |
natural killer cell differentiation(GO:0001779) |
| 0.8 |
1.5 |
GO:0002069 |
columnar/cuboidal epithelial cell maturation(GO:0002069) |
| 0.8 |
0.8 |
GO:0003415 |
chondrocyte hypertrophy(GO:0003415) |
| 0.8 |
6.1 |
GO:0014841 |
skeletal muscle satellite cell proliferation(GO:0014841) |
| 0.8 |
1.5 |
GO:0010571 |
positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.8 |
1.5 |
GO:0021943 |
formation of radial glial scaffolds(GO:0021943) |
| 0.8 |
7.5 |
GO:0090557 |
establishment of endothelial intestinal barrier(GO:0090557) |
| 0.7 |
2.2 |
GO:0051026 |
chiasma assembly(GO:0051026) |
| 0.7 |
0.7 |
GO:0090202 |
regulation of primitive erythrocyte differentiation(GO:0010725) transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 0.7 |
13.4 |
GO:0034508 |
centromere complex assembly(GO:0034508) |
| 0.7 |
3.0 |
GO:0050908 |
detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.7 |
3.7 |
GO:0098706 |
ferric iron import into cell(GO:0097461) ferric iron import across plasma membrane(GO:0098706) |
| 0.7 |
8.1 |
GO:0046548 |
retinal rod cell development(GO:0046548) |
| 0.7 |
1.5 |
GO:0097155 |
fasciculation of sensory neuron axon(GO:0097155) |
| 0.7 |
0.7 |
GO:0061314 |
Notch signaling involved in heart development(GO:0061314) |
| 0.7 |
1.5 |
GO:0009814 |
defense response, incompatible interaction(GO:0009814) |
| 0.7 |
2.2 |
GO:1903225 |
negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.7 |
3.6 |
GO:0032298 |
positive regulation of DNA-dependent DNA replication initiation(GO:0032298) |
| 0.7 |
4.3 |
GO:0045743 |
positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.7 |
2.2 |
GO:0044380 |
protein localization to cytoskeleton(GO:0044380) |
| 0.7 |
5.0 |
GO:0007296 |
vitellogenesis(GO:0007296) |
| 0.7 |
2.1 |
GO:0016554 |
cytidine to uridine editing(GO:0016554) |
| 0.7 |
2.9 |
GO:0015889 |
cobalamin transport(GO:0015889) |
| 0.7 |
2.1 |
GO:2000054 |
regulation of chondrocyte development(GO:0061181) regulation of centromeric sister chromatid cohesion(GO:0070602) negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
| 0.7 |
11.4 |
GO:0030866 |
cortical actin cytoskeleton organization(GO:0030866) |
| 0.7 |
3.5 |
GO:0031914 |
negative regulation of synaptic plasticity(GO:0031914) |
| 0.7 |
3.5 |
GO:0042256 |
mature ribosome assembly(GO:0042256) |
| 0.7 |
0.7 |
GO:0051572 |
negative regulation of histone H3-K4 methylation(GO:0051572) |
| 0.7 |
2.8 |
GO:0072257 |
metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 0.7 |
7.7 |
GO:0048096 |
chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.7 |
1.4 |
GO:0006083 |
acetate metabolic process(GO:0006083) |
| 0.7 |
4.2 |
GO:1904491 |
protein localization to ciliary transition zone(GO:1904491) |
| 0.7 |
1.4 |
GO:1904245 |
regulation of polynucleotide adenylyltransferase activity(GO:1904245) |
| 0.7 |
2.1 |
GO:0070493 |
thrombin receptor signaling pathway(GO:0070493) |
| 0.7 |
0.7 |
GO:0060971 |
embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.7 |
3.4 |
GO:0015867 |
ATP transport(GO:0015867) |
| 0.7 |
3.4 |
GO:0061158 |
3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.7 |
7.5 |
GO:0045974 |
miRNA mediated inhibition of translation(GO:0035278) negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
| 0.7 |
0.7 |
GO:0030951 |
establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.7 |
2.0 |
GO:1902004 |
positive regulation of beta-amyloid formation(GO:1902004) |
| 0.7 |
0.7 |
GO:0036120 |
response to platelet-derived growth factor(GO:0036119) cellular response to platelet-derived growth factor stimulus(GO:0036120) |
| 0.7 |
0.7 |
GO:0003161 |
cardiac conduction system development(GO:0003161) |
| 0.7 |
4.7 |
GO:0030242 |
pexophagy(GO:0030242) |
| 0.7 |
0.7 |
GO:0016445 |
somatic diversification of immunoglobulins(GO:0016445) |
| 0.7 |
5.3 |
GO:0048742 |
regulation of skeletal muscle fiber development(GO:0048742) |
| 0.7 |
2.0 |
GO:0060708 |
spongiotrophoblast differentiation(GO:0060708) |
| 0.7 |
1.3 |
GO:0051599 |
response to hydrostatic pressure(GO:0051599) |
| 0.7 |
6.6 |
GO:0043374 |
CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.7 |
5.3 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.7 |
2.0 |
GO:0060010 |
Sertoli cell fate commitment(GO:0060010) |
| 0.7 |
2.0 |
GO:1901675 |
negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 0.7 |
2.0 |
GO:0060011 |
Sertoli cell proliferation(GO:0060011) |
| 0.7 |
2.0 |
GO:0044208 |
'de novo' AMP biosynthetic process(GO:0044208) |
| 0.7 |
2.0 |
GO:0035621 |
ER to Golgi ceramide transport(GO:0035621) ceramide transport(GO:0035627) |
| 0.6 |
1.9 |
GO:1904059 |
regulation of locomotor rhythm(GO:1904059) |
| 0.6 |
1.3 |
GO:0046985 |
positive regulation of hemoglobin biosynthetic process(GO:0046985) |
| 0.6 |
17.3 |
GO:0008608 |
attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.6 |
1.3 |
GO:0060059 |
embryonic retina morphogenesis in camera-type eye(GO:0060059) |
| 0.6 |
0.6 |
GO:0044819 |
mitotic G1/S transition checkpoint(GO:0044819) |
| 0.6 |
3.8 |
GO:0035563 |
positive regulation of chromatin binding(GO:0035563) |
| 0.6 |
0.6 |
GO:0090526 |
regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.6 |
0.6 |
GO:0000117 |
regulation of transcription involved in G2/M transition of mitotic cell cycle(GO:0000117) |
| 0.6 |
1.2 |
GO:0035523 |
protein K29-linked deubiquitination(GO:0035523) |
| 0.6 |
3.1 |
GO:0060391 |
positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.6 |
4.9 |
GO:0051984 |
positive regulation of chromosome segregation(GO:0051984) |
| 0.6 |
8.0 |
GO:0070884 |
regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.6 |
3.1 |
GO:0044314 |
protein K27-linked ubiquitination(GO:0044314) |
| 0.6 |
3.1 |
GO:0034421 |
post-translational protein acetylation(GO:0034421) |
| 0.6 |
4.3 |
GO:0006369 |
termination of RNA polymerase II transcription(GO:0006369) |
| 0.6 |
1.2 |
GO:0030222 |
eosinophil differentiation(GO:0030222) |
| 0.6 |
0.6 |
GO:0072076 |
nephrogenic mesenchyme development(GO:0072076) |
| 0.6 |
3.0 |
GO:0043584 |
nose development(GO:0043584) |
| 0.6 |
6.0 |
GO:1902231 |
positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.6 |
2.4 |
GO:0007113 |
endomitotic cell cycle(GO:0007113) |
| 0.6 |
14.4 |
GO:1902807 |
negative regulation of cell cycle G1/S phase transition(GO:1902807) |
| 0.6 |
1.8 |
GO:1904211 |
membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
| 0.6 |
4.8 |
GO:0002087 |
regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
| 0.6 |
1.2 |
GO:0060907 |
positive regulation of macrophage cytokine production(GO:0060907) |
| 0.6 |
3.6 |
GO:0070423 |
nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
| 0.6 |
2.4 |
GO:0070537 |
histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.6 |
3.6 |
GO:0000160 |
phosphorelay signal transduction system(GO:0000160) |
| 0.6 |
2.4 |
GO:0045198 |
establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.6 |
4.7 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.6 |
1.8 |
GO:1903722 |
regulation of centriole elongation(GO:1903722) |
| 0.6 |
1.8 |
GO:0034334 |
adherens junction maintenance(GO:0034334) |
| 0.6 |
1.2 |
GO:0010911 |
regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
| 0.6 |
0.6 |
GO:1903644 |
regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.6 |
0.6 |
GO:0016578 |
histone deubiquitination(GO:0016578) |
| 0.6 |
1.7 |
GO:0051661 |
maintenance of centrosome location(GO:0051661) |
| 0.6 |
8.7 |
GO:1902459 |
positive regulation of stem cell population maintenance(GO:1902459) |
| 0.6 |
4.6 |
GO:0033148 |
positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
| 0.6 |
3.4 |
GO:0034720 |
histone H3-K4 demethylation(GO:0034720) |
| 0.6 |
2.3 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.6 |
0.6 |
GO:0060290 |
transdifferentiation(GO:0060290) |
| 0.6 |
1.7 |
GO:0070093 |
negative regulation of glucagon secretion(GO:0070093) |
| 0.6 |
1.1 |
GO:0072711 |
cellular response to hydroxyurea(GO:0072711) |
| 0.6 |
0.6 |
GO:1904058 |
positive regulation of sensory perception of pain(GO:1904058) |
| 0.6 |
3.9 |
GO:0007221 |
positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.6 |
16.1 |
GO:0051310 |
metaphase plate congression(GO:0051310) |
| 0.6 |
3.3 |
GO:0061029 |
eyelid development in camera-type eye(GO:0061029) |
| 0.6 |
1.1 |
GO:0051135 |
positive regulation of NK T cell activation(GO:0051135) |
| 0.6 |
2.2 |
GO:0060028 |
convergent extension involved in axis elongation(GO:0060028) |
| 0.6 |
1.1 |
GO:1901642 |
purine nucleoside transmembrane transport(GO:0015860) nucleoside transmembrane transport(GO:1901642) |
| 0.5 |
1.6 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.5 |
2.2 |
GO:0060213 |
regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
| 0.5 |
2.7 |
GO:0031022 |
nuclear migration along microfilament(GO:0031022) |
| 0.5 |
1.1 |
GO:0033184 |
positive regulation of histone ubiquitination(GO:0033184) |
| 0.5 |
1.1 |
GO:0070782 |
phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.5 |
3.8 |
GO:0032596 |
protein transport into membrane raft(GO:0032596) |
| 0.5 |
6.5 |
GO:0007076 |
mitotic chromosome condensation(GO:0007076) |
| 0.5 |
3.2 |
GO:0014054 |
positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
| 0.5 |
0.5 |
GO:0070375 |
ERK5 cascade(GO:0070375) |
| 0.5 |
1.6 |
GO:0071947 |
protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.5 |
0.5 |
GO:0035701 |
hematopoietic stem cell migration(GO:0035701) |
| 0.5 |
1.6 |
GO:0006553 |
lysine metabolic process(GO:0006553) |
| 0.5 |
2.1 |
GO:0032196 |
regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) transposition(GO:0032196) |
| 0.5 |
0.5 |
GO:0032627 |
interleukin-23 production(GO:0032627) regulation of interleukin-23 production(GO:0032667) |
| 0.5 |
5.3 |
GO:0031498 |
nucleosome disassembly(GO:0006337) chromatin disassembly(GO:0031498) |
| 0.5 |
6.3 |
GO:0060606 |
tube closure(GO:0060606) |
| 0.5 |
3.2 |
GO:0030643 |
cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.5 |
2.6 |
GO:0010587 |
miRNA catabolic process(GO:0010587) |
| 0.5 |
3.1 |
GO:0046459 |
short-chain fatty acid metabolic process(GO:0046459) |
| 0.5 |
3.1 |
GO:0036123 |
histone H3-K9 dimethylation(GO:0036123) |
| 0.5 |
1.6 |
GO:0033326 |
cerebrospinal fluid secretion(GO:0033326) |
| 0.5 |
5.7 |
GO:0021924 |
cell proliferation in external granule layer(GO:0021924) cerebellar granule cell precursor proliferation(GO:0021930) |
| 0.5 |
2.5 |
GO:0010636 |
positive regulation of mitochondrial fusion(GO:0010636) |
| 0.5 |
2.0 |
GO:0072553 |
terminal button organization(GO:0072553) |
| 0.5 |
3.5 |
GO:1902894 |
negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
| 0.5 |
12.1 |
GO:0035411 |
catenin import into nucleus(GO:0035411) |
| 0.5 |
1.5 |
GO:1903564 |
regulation of protein localization to cilium(GO:1903564) |
| 0.5 |
8.9 |
GO:0046069 |
cGMP catabolic process(GO:0046069) |
| 0.5 |
0.5 |
GO:0035359 |
negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 0.5 |
14.3 |
GO:0010390 |
histone monoubiquitination(GO:0010390) |
| 0.5 |
2.0 |
GO:0035754 |
B cell chemotaxis(GO:0035754) |
| 0.5 |
2.5 |
GO:1903215 |
negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.5 |
2.0 |
GO:1900169 |
regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.5 |
0.5 |
GO:0070228 |
regulation of lymphocyte apoptotic process(GO:0070228) |
| 0.5 |
0.5 |
GO:0033690 |
positive regulation of osteoblast proliferation(GO:0033690) |
| 0.5 |
1.5 |
GO:0007096 |
regulation of exit from mitosis(GO:0007096) |
| 0.5 |
3.4 |
GO:0051461 |
regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.5 |
0.5 |
GO:0051660 |
establishment of centrosome localization(GO:0051660) |
| 0.5 |
1.9 |
GO:0018095 |
protein polyglutamylation(GO:0018095) |
| 0.5 |
2.8 |
GO:1900246 |
positive regulation of RIG-I signaling pathway(GO:1900246) |
| 0.5 |
1.4 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 0.5 |
1.4 |
GO:0003349 |
epicardium-derived cardiac endothelial cell differentiation(GO:0003349) |
| 0.5 |
0.9 |
GO:0036292 |
DNA rewinding(GO:0036292) |
| 0.5 |
2.4 |
GO:0035561 |
regulation of chromatin binding(GO:0035561) |
| 0.5 |
1.4 |
GO:1903265 |
positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.5 |
3.3 |
GO:0030382 |
sperm mitochondrion organization(GO:0030382) |
| 0.5 |
1.4 |
GO:0072182 |
regulation of nephron tubule epithelial cell differentiation(GO:0072182) |
| 0.5 |
3.8 |
GO:0060736 |
prostate gland growth(GO:0060736) |
| 0.5 |
1.4 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 0.5 |
1.4 |
GO:0030828 |
positive regulation of cGMP biosynthetic process(GO:0030828) |
| 0.5 |
1.9 |
GO:0060687 |
regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
| 0.5 |
0.5 |
GO:0002063 |
chondrocyte development(GO:0002063) |
| 0.5 |
2.8 |
GO:0048706 |
embryonic skeletal system development(GO:0048706) |
| 0.5 |
2.8 |
GO:0090267 |
positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 0.5 |
1.8 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 0.5 |
0.5 |
GO:0001773 |
myeloid dendritic cell activation(GO:0001773) myeloid dendritic cell differentiation(GO:0043011) |
| 0.5 |
10.0 |
GO:1902186 |
regulation of viral release from host cell(GO:1902186) |
| 0.5 |
4.6 |
GO:0031119 |
tRNA pseudouridine synthesis(GO:0031119) |
| 0.5 |
1.4 |
GO:0048016 |
inositol phosphate-mediated signaling(GO:0048016) |
| 0.5 |
2.3 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 0.5 |
1.8 |
GO:0042891 |
antibiotic transport(GO:0042891) |
| 0.5 |
2.3 |
GO:0043267 |
negative regulation of potassium ion transport(GO:0043267) |
| 0.5 |
2.3 |
GO:2000483 |
negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.5 |
1.4 |
GO:0035878 |
nail development(GO:0035878) |
| 0.5 |
1.8 |
GO:0035606 |
peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 0.5 |
7.2 |
GO:0040034 |
regulation of development, heterochronic(GO:0040034) |
| 0.5 |
1.8 |
GO:0070317 |
negative regulation of G0 to G1 transition(GO:0070317) |
| 0.4 |
0.4 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.4 |
2.2 |
GO:1900095 |
regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
| 0.4 |
1.3 |
GO:1902071 |
regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
| 0.4 |
3.1 |
GO:0071850 |
mitotic cell cycle arrest(GO:0071850) |
| 0.4 |
1.3 |
GO:0070601 |
centromeric sister chromatid cohesion(GO:0070601) |
| 0.4 |
1.3 |
GO:0030718 |
germ-line stem cell population maintenance(GO:0030718) |
| 0.4 |
14.2 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 0.4 |
1.8 |
GO:0014005 |
microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.4 |
1.3 |
GO:2000616 |
negative regulation of histone H3-K9 acetylation(GO:2000616) |
| 0.4 |
2.6 |
GO:0033567 |
DNA replication, Okazaki fragment processing(GO:0033567) |
| 0.4 |
8.7 |
GO:0032288 |
myelin assembly(GO:0032288) |
| 0.4 |
2.6 |
GO:0035873 |
lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.4 |
1.7 |
GO:0070837 |
dehydroascorbic acid transport(GO:0070837) |
| 0.4 |
5.1 |
GO:1904262 |
negative regulation of TORC1 signaling(GO:1904262) |
| 0.4 |
3.4 |
GO:0010793 |
regulation of mRNA export from nucleus(GO:0010793) regulation of ribonucleoprotein complex localization(GO:2000197) |
| 0.4 |
0.9 |
GO:0034196 |
acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.4 |
0.4 |
GO:0090502 |
RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.4 |
0.9 |
GO:0042701 |
progesterone secretion(GO:0042701) |
| 0.4 |
4.7 |
GO:0021511 |
spinal cord patterning(GO:0021511) |
| 0.4 |
3.0 |
GO:1904754 |
positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
| 0.4 |
0.8 |
GO:1902022 |
L-lysine transport(GO:1902022) |
| 0.4 |
0.8 |
GO:2000675 |
negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 0.4 |
15.6 |
GO:0060612 |
adipose tissue development(GO:0060612) |
| 0.4 |
2.1 |
GO:0036337 |
Fas signaling pathway(GO:0036337) |
| 0.4 |
1.7 |
GO:0006529 |
asparagine biosynthetic process(GO:0006529) |
| 0.4 |
1.3 |
GO:0015793 |
renal water transport(GO:0003097) glycerol transport(GO:0015793) renal water absorption(GO:0070295) |
| 0.4 |
1.2 |
GO:0035507 |
regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.4 |
2.5 |
GO:0030035 |
microspike assembly(GO:0030035) |
| 0.4 |
0.4 |
GO:2000641 |
regulation of early endosome to late endosome transport(GO:2000641) |
| 0.4 |
4.1 |
GO:0070935 |
3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.4 |
0.4 |
GO:0045736 |
negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
| 0.4 |
1.2 |
GO:0034145 |
positive regulation of toll-like receptor 4 signaling pathway(GO:0034145) |
| 0.4 |
0.8 |
GO:0010958 |
regulation of amino acid import(GO:0010958) |
| 0.4 |
1.2 |
GO:0032962 |
regulation of inositol trisphosphate biosynthetic process(GO:0032960) positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
| 0.4 |
0.4 |
GO:0085020 |
protein K6-linked ubiquitination(GO:0085020) |
| 0.4 |
0.4 |
GO:1900127 |
positive regulation of hyaluronan biosynthetic process(GO:1900127) |
| 0.4 |
3.2 |
GO:1902083 |
negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.4 |
2.8 |
GO:0007588 |
excretion(GO:0007588) |
| 0.4 |
0.8 |
GO:0010389 |
regulation of G2/M transition of mitotic cell cycle(GO:0010389) |
| 0.4 |
0.4 |
GO:0035482 |
gastric motility(GO:0035482) gastric emptying(GO:0035483) |
| 0.4 |
1.2 |
GO:0036462 |
TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.4 |
3.5 |
GO:0006353 |
DNA-templated transcription, termination(GO:0006353) |
| 0.4 |
3.5 |
GO:0043615 |
astrocyte cell migration(GO:0043615) |
| 0.4 |
1.6 |
GO:0060766 |
negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.4 |
4.3 |
GO:0009404 |
toxin metabolic process(GO:0009404) |
| 0.4 |
1.9 |
GO:0009071 |
serine family amino acid catabolic process(GO:0009071) |
| 0.4 |
2.7 |
GO:0006971 |
hypotonic response(GO:0006971) |
| 0.4 |
1.9 |
GO:0010992 |
ubiquitin homeostasis(GO:0010992) |
| 0.4 |
0.8 |
GO:0051985 |
negative regulation of chromosome segregation(GO:0051985) |
| 0.4 |
0.8 |
GO:1901355 |
response to rapamycin(GO:1901355) |
| 0.4 |
0.4 |
GO:0060282 |
positive regulation of oocyte development(GO:0060282) |
| 0.4 |
1.1 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 0.4 |
3.0 |
GO:0015670 |
carbon dioxide transport(GO:0015670) |
| 0.4 |
1.1 |
GO:0031204 |
posttranslational protein targeting to membrane, translocation(GO:0031204) |
| 0.4 |
2.3 |
GO:0043383 |
negative T cell selection(GO:0043383) negative thymic T cell selection(GO:0045060) |
| 0.4 |
2.3 |
GO:0070779 |
D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
| 0.4 |
1.1 |
GO:0019085 |
early viral transcription(GO:0019085) |
| 0.4 |
3.8 |
GO:0031297 |
replication fork processing(GO:0031297) |
| 0.4 |
2.6 |
GO:0000083 |
regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.4 |
2.6 |
GO:0071435 |
potassium ion export(GO:0071435) |
| 0.4 |
0.7 |
GO:0032922 |
circadian regulation of gene expression(GO:0032922) |
| 0.4 |
3.7 |
GO:0051451 |
myoblast migration(GO:0051451) |
| 0.4 |
3.7 |
GO:0045603 |
positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.4 |
5.2 |
GO:2000001 |
regulation of DNA damage checkpoint(GO:2000001) |
| 0.4 |
1.1 |
GO:0042538 |
hyperosmotic salinity response(GO:0042538) |
| 0.4 |
0.4 |
GO:0048496 |
maintenance of organ identity(GO:0048496) |
| 0.4 |
1.5 |
GO:1901525 |
negative regulation of macromitophagy(GO:1901525) |
| 0.4 |
0.7 |
GO:1990839 |
response to endothelin(GO:1990839) |
| 0.4 |
2.9 |
GO:2000766 |
negative regulation of cytoplasmic translation(GO:2000766) |
| 0.4 |
4.3 |
GO:2000114 |
regulation of establishment of cell polarity(GO:2000114) |
| 0.4 |
3.3 |
GO:0035090 |
maintenance of apical/basal cell polarity(GO:0035090) |
| 0.4 |
1.1 |
GO:0061743 |
motor learning(GO:0061743) |
| 0.4 |
6.1 |
GO:0070816 |
phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.4 |
1.1 |
GO:2000973 |
regulation of pro-B cell differentiation(GO:2000973) |
| 0.4 |
0.4 |
GO:0045084 |
positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.4 |
1.1 |
GO:0042743 |
hydrogen peroxide metabolic process(GO:0042743) |
| 0.4 |
0.4 |
GO:1903760 |
regulation of voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1903760) regulation of membrane repolarization during ventricular cardiac muscle cell action potential(GO:1905024) |
| 0.4 |
5.3 |
GO:2000144 |
positive regulation of DNA-templated transcription, initiation(GO:2000144) |
| 0.4 |
2.1 |
GO:0031468 |
nuclear envelope reassembly(GO:0031468) |
| 0.3 |
3.8 |
GO:2000096 |
positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
| 0.3 |
0.3 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 0.3 |
0.3 |
GO:1903689 |
regulation of wound healing, spreading of epidermal cells(GO:1903689) |
| 0.3 |
1.7 |
GO:0006287 |
base-excision repair, gap-filling(GO:0006287) |
| 0.3 |
0.7 |
GO:0071500 |
cellular response to nitrosative stress(GO:0071500) |
| 0.3 |
1.0 |
GO:0071305 |
cellular response to vitamin D(GO:0071305) |
| 0.3 |
1.7 |
GO:0060644 |
mammary gland epithelial cell differentiation(GO:0060644) |
| 0.3 |
0.3 |
GO:2000807 |
regulation of synaptic vesicle clustering(GO:2000807) |
| 0.3 |
0.7 |
GO:0001828 |
inner cell mass cell fate commitment(GO:0001827) inner cell mass cellular morphogenesis(GO:0001828) |
| 0.3 |
7.3 |
GO:0010965 |
regulation of mitotic sister chromatid separation(GO:0010965) |
| 0.3 |
0.3 |
GO:0042117 |
monocyte activation(GO:0042117) |
| 0.3 |
1.0 |
GO:0006578 |
amino-acid betaine biosynthetic process(GO:0006578) |
| 0.3 |
0.3 |
GO:0032242 |
regulation of nucleoside transport(GO:0032242) |
| 0.3 |
1.0 |
GO:0010591 |
regulation of lamellipodium assembly(GO:0010591) |
| 0.3 |
7.9 |
GO:0007099 |
centriole replication(GO:0007099) |
| 0.3 |
6.2 |
GO:0010842 |
retina layer formation(GO:0010842) |
| 0.3 |
1.0 |
GO:0032918 |
polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
| 0.3 |
2.0 |
GO:0035428 |
hexose transmembrane transport(GO:0035428) |
| 0.3 |
0.6 |
GO:1990414 |
cellular response to camptothecin(GO:0072757) response to camptothecin(GO:1901563) replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
| 0.3 |
1.0 |
GO:0006545 |
glycine biosynthetic process(GO:0006545) |
| 0.3 |
0.6 |
GO:2000790 |
regulation of mesenchymal cell proliferation involved in lung development(GO:2000790) negative regulation of mesenchymal cell proliferation involved in lung development(GO:2000791) |
| 0.3 |
0.6 |
GO:0042758 |
long-chain fatty acid catabolic process(GO:0042758) |
| 0.3 |
1.3 |
GO:0033563 |
dorsal/ventral axon guidance(GO:0033563) |
| 0.3 |
1.3 |
GO:0010792 |
DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.3 |
0.3 |
GO:0098501 |
polynucleotide dephosphorylation(GO:0098501) |
| 0.3 |
1.9 |
GO:0006307 |
DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.3 |
1.3 |
GO:0061325 |
extraocular skeletal muscle development(GO:0002074) subthalamic nucleus development(GO:0021763) left lung development(GO:0060459) left lung morphogenesis(GO:0060460) pulmonary vein morphogenesis(GO:0060577) superior vena cava morphogenesis(GO:0060578) endodermal digestive tract morphogenesis(GO:0061031) cell proliferation involved in outflow tract morphogenesis(GO:0061325) |
| 0.3 |
3.8 |
GO:1904293 |
negative regulation of ERAD pathway(GO:1904293) |
| 0.3 |
1.3 |
GO:0071557 |
histone H3-K27 demethylation(GO:0071557) |
| 0.3 |
1.6 |
GO:0040032 |
post-embryonic body morphogenesis(GO:0040032) |
| 0.3 |
0.6 |
GO:0045085 |
negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.3 |
0.3 |
GO:0016332 |
establishment or maintenance of polarity of embryonic epithelium(GO:0016332) |
| 0.3 |
0.6 |
GO:2000383 |
regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 0.3 |
0.9 |
GO:1903976 |
negative regulation of glial cell migration(GO:1903976) |
| 0.3 |
10.3 |
GO:0006513 |
protein monoubiquitination(GO:0006513) |
| 0.3 |
0.3 |
GO:1901896 |
positive regulation of calcium-transporting ATPase activity(GO:1901896) |
| 0.3 |
0.3 |
GO:0071649 |
chemokine (C-C motif) ligand 5 production(GO:0071609) regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) |
| 0.3 |
0.3 |
GO:0019389 |
glucuronoside metabolic process(GO:0019389) |
| 0.3 |
0.6 |
GO:0006776 |
vitamin A metabolic process(GO:0006776) |
| 0.3 |
0.9 |
GO:0050915 |
sensory perception of sour taste(GO:0050915) |
| 0.3 |
4.7 |
GO:0045653 |
negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.3 |
1.8 |
GO:0030263 |
apoptotic chromosome condensation(GO:0030263) |
| 0.3 |
0.6 |
GO:0015712 |
hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.3 |
5.2 |
GO:0045116 |
protein neddylation(GO:0045116) |
| 0.3 |
0.9 |
GO:0042769 |
DNA damage response, detection of DNA damage(GO:0042769) |
| 0.3 |
0.3 |
GO:0009313 |
oligosaccharide catabolic process(GO:0009313) |
| 0.3 |
0.6 |
GO:0006537 |
glutamate biosynthetic process(GO:0006537) |
| 0.3 |
1.2 |
GO:0006742 |
NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
| 0.3 |
1.5 |
GO:0008343 |
adult feeding behavior(GO:0008343) |
| 0.3 |
0.3 |
GO:0002666 |
positive regulation of T cell tolerance induction(GO:0002666) positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 0.3 |
1.2 |
GO:0021847 |
ventricular zone neuroblast division(GO:0021847) |
| 0.3 |
1.8 |
GO:0031665 |
negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.3 |
1.8 |
GO:0015810 |
aspartate transport(GO:0015810) |
| 0.3 |
1.2 |
GO:0051684 |
maintenance of Golgi location(GO:0051684) |
| 0.3 |
1.5 |
GO:0007064 |
mitotic sister chromatid cohesion(GO:0007064) |
| 0.3 |
2.1 |
GO:0008228 |
opsonization(GO:0008228) |
| 0.3 |
0.9 |
GO:0060008 |
Sertoli cell differentiation(GO:0060008) |
| 0.3 |
0.6 |
GO:0051124 |
synaptic growth at neuromuscular junction(GO:0051124) |
| 0.3 |
3.5 |
GO:0051299 |
mitotic centrosome separation(GO:0007100) centrosome separation(GO:0051299) |
| 0.3 |
4.1 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 0.3 |
0.9 |
GO:0016572 |
histone phosphorylation(GO:0016572) |
| 0.3 |
0.9 |
GO:0019441 |
tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) kynurenine metabolic process(GO:0070189) |
| 0.3 |
1.2 |
GO:0061188 |
regulation of chromatin silencing at rDNA(GO:0061187) negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 0.3 |
0.3 |
GO:1903334 |
positive regulation of protein folding(GO:1903334) |
| 0.3 |
0.6 |
GO:0090649 |
response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
| 0.3 |
2.0 |
GO:0015838 |
amino-acid betaine transport(GO:0015838) |
| 0.3 |
2.0 |
GO:0030238 |
male sex determination(GO:0030238) |
| 0.3 |
0.6 |
GO:0097475 |
motor neuron migration(GO:0097475) |
| 0.3 |
0.9 |
GO:0071772 |
response to BMP(GO:0071772) cellular response to BMP stimulus(GO:0071773) |
| 0.3 |
5.7 |
GO:0010569 |
regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.3 |
3.1 |
GO:0009437 |
amino-acid betaine metabolic process(GO:0006577) carnitine metabolic process(GO:0009437) |
| 0.3 |
0.3 |
GO:0010453 |
regulation of cell fate commitment(GO:0010453) |
| 0.3 |
0.3 |
GO:0070873 |
regulation of glycogen metabolic process(GO:0070873) |
| 0.3 |
1.4 |
GO:0032682 |
negative regulation of chemokine production(GO:0032682) |
| 0.3 |
0.8 |
GO:1902310 |
positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.3 |
3.1 |
GO:0048535 |
lymph node development(GO:0048535) |
| 0.3 |
0.3 |
GO:0032286 |
central nervous system myelin maintenance(GO:0032286) |
| 0.3 |
0.6 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 0.3 |
2.8 |
GO:0045040 |
protein import into mitochondrial outer membrane(GO:0045040) |
| 0.3 |
0.8 |
GO:0006285 |
base-excision repair, AP site formation(GO:0006285) |
| 0.3 |
0.8 |
GO:0071211 |
protein targeting to vacuole involved in autophagy(GO:0071211) |
| 0.3 |
0.3 |
GO:0033085 |
negative regulation of T cell differentiation in thymus(GO:0033085) |
| 0.3 |
0.8 |
GO:0060536 |
cartilage morphogenesis(GO:0060536) |
| 0.3 |
0.8 |
GO:0048069 |
eye pigmentation(GO:0048069) |
| 0.3 |
2.2 |
GO:0014733 |
regulation of skeletal muscle adaptation(GO:0014733) |
| 0.3 |
1.1 |
GO:0090647 |
modulation of age-related behavioral decline(GO:0090647) |
| 0.3 |
1.1 |
GO:0006203 |
dGTP catabolic process(GO:0006203) |
| 0.3 |
0.3 |
GO:1902608 |
regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
| 0.3 |
1.1 |
GO:1902430 |
negative regulation of beta-amyloid formation(GO:1902430) negative regulation of amyloid precursor protein catabolic process(GO:1902992) |
| 0.3 |
1.1 |
GO:0031580 |
membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
| 0.3 |
0.3 |
GO:1990403 |
embryonic brain development(GO:1990403) |
| 0.3 |
1.9 |
GO:0044872 |
lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.3 |
2.4 |
GO:1900225 |
NLRP3 inflammasome complex assembly(GO:0044546) regulation of NLRP3 inflammasome complex assembly(GO:1900225) |
| 0.3 |
2.4 |
GO:0042118 |
endothelial cell activation(GO:0042118) |
| 0.3 |
2.4 |
GO:0045948 |
positive regulation of translational initiation(GO:0045948) |
| 0.3 |
0.3 |
GO:1903588 |
negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.3 |
2.4 |
GO:0032780 |
negative regulation of ATPase activity(GO:0032780) |
| 0.3 |
1.3 |
GO:2000643 |
positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.3 |
0.5 |
GO:0031936 |
negative regulation of chromatin silencing(GO:0031936) |
| 0.3 |
0.8 |
GO:0021849 |
neuroblast division in subventricular zone(GO:0021849) |
| 0.3 |
2.8 |
GO:0034498 |
early endosome to Golgi transport(GO:0034498) |
| 0.3 |
0.8 |
GO:1904578 |
response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) |
| 0.3 |
5.4 |
GO:0006471 |
protein ADP-ribosylation(GO:0006471) |
| 0.3 |
0.3 |
GO:0070649 |
polar body extrusion after meiotic divisions(GO:0040038) formin-nucleated actin cable assembly(GO:0070649) |
| 0.3 |
1.0 |
GO:0006297 |
nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.3 |
0.5 |
GO:2000189 |
positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.3 |
1.5 |
GO:0036159 |
inner dynein arm assembly(GO:0036159) |
| 0.3 |
0.3 |
GO:0090344 |
negative regulation of cell aging(GO:0090344) |
| 0.3 |
1.0 |
GO:0034612 |
response to tumor necrosis factor(GO:0034612) |
| 0.3 |
0.3 |
GO:2000035 |
regulation of stem cell division(GO:2000035) |
| 0.2 |
0.7 |
GO:1901843 |
positive regulation of high voltage-gated calcium channel activity(GO:1901843) positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.2 |
9.7 |
GO:0070303 |
negative regulation of stress-activated MAPK cascade(GO:0032873) negative regulation of stress-activated protein kinase signaling cascade(GO:0070303) |
| 0.2 |
0.7 |
GO:0000132 |
establishment of mitotic spindle orientation(GO:0000132) |
| 0.2 |
1.5 |
GO:0072081 |
pattern specification involved in kidney development(GO:0061004) proximal/distal pattern formation involved in nephron development(GO:0072047) renal system pattern specification(GO:0072048) specification of nephron tubule identity(GO:0072081) specification of loop of Henle identity(GO:0072086) |
| 0.2 |
1.7 |
GO:0006997 |
nucleus organization(GO:0006997) |
| 0.2 |
1.2 |
GO:2000394 |
positive regulation of lamellipodium morphogenesis(GO:2000394) |
| 0.2 |
0.7 |
GO:0030327 |
prenylated protein catabolic process(GO:0030327) |
| 0.2 |
4.7 |
GO:0043968 |
histone H2A acetylation(GO:0043968) |
| 0.2 |
0.7 |
GO:1903061 |
regulation of protein lipidation(GO:1903059) positive regulation of protein lipidation(GO:1903061) |
| 0.2 |
0.5 |
GO:0032792 |
negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.2 |
1.0 |
GO:0036089 |
cleavage furrow formation(GO:0036089) |
| 0.2 |
1.9 |
GO:0060159 |
regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.2 |
4.9 |
GO:0031572 |
G2 DNA damage checkpoint(GO:0031572) |
| 0.2 |
0.2 |
GO:0061157 |
mRNA destabilization(GO:0061157) |
| 0.2 |
1.7 |
GO:0098789 |
pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.2 |
14.2 |
GO:0001578 |
microtubule bundle formation(GO:0001578) |
| 0.2 |
0.5 |
GO:2001013 |
epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.2 |
0.2 |
GO:0021852 |
pyramidal neuron migration(GO:0021852) |
| 0.2 |
0.7 |
GO:0070193 |
synaptonemal complex organization(GO:0070193) |
| 0.2 |
0.2 |
GO:0002446 |
neutrophil mediated immunity(GO:0002446) |
| 0.2 |
0.2 |
GO:0060019 |
radial glial cell differentiation(GO:0060019) |
| 0.2 |
0.2 |
GO:0043092 |
L-amino acid import(GO:0043092) |
| 0.2 |
0.2 |
GO:0002578 |
negative regulation of antigen processing and presentation(GO:0002578) |
| 0.2 |
0.7 |
GO:0019919 |
peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
| 0.2 |
0.5 |
GO:0048818 |
positive regulation of hair follicle maturation(GO:0048818) |
| 0.2 |
0.7 |
GO:0003214 |
cardiac left ventricle morphogenesis(GO:0003214) |
| 0.2 |
1.1 |
GO:0035616 |
histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.2 |
1.4 |
GO:0034379 |
very-low-density lipoprotein particle assembly(GO:0034379) |
| 0.2 |
0.2 |
GO:0000414 |
regulation of histone H3-K36 methylation(GO:0000414) |
| 0.2 |
0.9 |
GO:0010961 |
cellular magnesium ion homeostasis(GO:0010961) |
| 0.2 |
0.2 |
GO:0048021 |
regulation of melanin biosynthetic process(GO:0048021) regulation of secondary metabolite biosynthetic process(GO:1900376) |
| 0.2 |
1.1 |
GO:0033603 |
positive regulation of dopamine secretion(GO:0033603) |
| 0.2 |
0.5 |
GO:0046485 |
ether lipid metabolic process(GO:0046485) |
| 0.2 |
1.1 |
GO:0044342 |
type B pancreatic cell proliferation(GO:0044342) |
| 0.2 |
0.4 |
GO:0019062 |
virion attachment to host cell(GO:0019062) adhesion of symbiont to host cell(GO:0044650) |
| 0.2 |
4.5 |
GO:0001738 |
morphogenesis of a polarized epithelium(GO:0001738) |
| 0.2 |
6.0 |
GO:0031122 |
cytoplasmic microtubule organization(GO:0031122) |
| 0.2 |
1.3 |
GO:0006968 |
cellular defense response(GO:0006968) |
| 0.2 |
0.7 |
GO:1902566 |
regulation of eosinophil activation(GO:1902566) |
| 0.2 |
0.7 |
GO:2000271 |
positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.2 |
0.2 |
GO:0006278 |
RNA-dependent DNA biosynthetic process(GO:0006278) telomere maintenance via telomerase(GO:0007004) |
| 0.2 |
1.7 |
GO:0031440 |
regulation of mRNA 3'-end processing(GO:0031440) |
| 0.2 |
0.4 |
GO:0002361 |
CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
| 0.2 |
0.4 |
GO:0051036 |
regulation of endosome size(GO:0051036) |
| 0.2 |
0.6 |
GO:0015819 |
lysine transport(GO:0015819) |
| 0.2 |
0.2 |
GO:0019074 |
viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
| 0.2 |
0.8 |
GO:0034219 |
carbohydrate transmembrane transport(GO:0034219) |
| 0.2 |
0.2 |
GO:0002092 |
positive regulation of receptor internalization(GO:0002092) |
| 0.2 |
0.8 |
GO:0002011 |
morphogenesis of an epithelial sheet(GO:0002011) |
| 0.2 |
3.6 |
GO:0000303 |
response to superoxide(GO:0000303) |
| 0.2 |
3.1 |
GO:0070527 |
platelet aggregation(GO:0070527) |
| 0.2 |
4.8 |
GO:0045724 |
positive regulation of cilium assembly(GO:0045724) |
| 0.2 |
1.2 |
GO:0019227 |
neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.2 |
0.8 |
GO:0046125 |
pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.2 |
0.2 |
GO:0035194 |
posttranscriptional gene silencing(GO:0016441) posttranscriptional gene silencing by RNA(GO:0035194) |
| 0.2 |
0.4 |
GO:0097029 |
mature conventional dendritic cell differentiation(GO:0097029) |
| 0.2 |
0.2 |
GO:0050862 |
positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.2 |
0.4 |
GO:0019372 |
lipoxygenase pathway(GO:0019372) |
| 0.2 |
2.0 |
GO:0061371 |
determination of heart left/right asymmetry(GO:0061371) |
| 0.2 |
0.8 |
GO:0071985 |
multivesicular body sorting pathway(GO:0071985) |
| 0.2 |
0.4 |
GO:0090118 |
receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.2 |
1.4 |
GO:0045292 |
mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.2 |
1.2 |
GO:0060136 |
embryonic process involved in female pregnancy(GO:0060136) |
| 0.2 |
1.8 |
GO:2000009 |
negative regulation of protein localization to cell surface(GO:2000009) |
| 0.2 |
1.0 |
GO:0060576 |
intestinal epithelial cell development(GO:0060576) |
| 0.2 |
1.0 |
GO:0008616 |
queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.2 |
1.8 |
GO:0070072 |
vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.2 |
0.2 |
GO:0014877 |
response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 0.2 |
0.8 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 0.2 |
0.4 |
GO:0036090 |
cleavage furrow ingression(GO:0036090) |
| 0.2 |
3.9 |
GO:0000184 |
nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.2 |
2.0 |
GO:0043046 |
DNA methylation involved in gamete generation(GO:0043046) |
| 0.2 |
0.8 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.2 |
0.4 |
GO:0048863 |
stem cell differentiation(GO:0048863) |
| 0.2 |
2.1 |
GO:0031570 |
DNA integrity checkpoint(GO:0031570) |
| 0.2 |
1.0 |
GO:1900122 |
positive regulation of receptor binding(GO:1900122) |
| 0.2 |
0.2 |
GO:0001575 |
globoside metabolic process(GO:0001575) |
| 0.2 |
0.8 |
GO:0050909 |
sensory perception of taste(GO:0050909) |
| 0.2 |
0.4 |
GO:0035095 |
behavioral response to nicotine(GO:0035095) |
| 0.2 |
1.0 |
GO:0000289 |
nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 0.2 |
1.2 |
GO:0070940 |
dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.2 |
0.6 |
GO:0018094 |
protein polyglycylation(GO:0018094) |
| 0.2 |
1.0 |
GO:2001238 |
positive regulation of extrinsic apoptotic signaling pathway(GO:2001238) |
| 0.2 |
1.1 |
GO:0031120 |
snRNA pseudouridine synthesis(GO:0031120) |
| 0.2 |
3.2 |
GO:2001273 |
regulation of glucose import in response to insulin stimulus(GO:2001273) |
| 0.2 |
0.6 |
GO:0045579 |
positive regulation of B cell differentiation(GO:0045579) |
| 0.2 |
1.5 |
GO:0031016 |
pancreas development(GO:0031016) |
| 0.2 |
0.4 |
GO:0039530 |
MDA-5 signaling pathway(GO:0039530) |
| 0.2 |
0.4 |
GO:1902913 |
regulation of melanocyte differentiation(GO:0045634) positive regulation of melanocyte differentiation(GO:0045636) positive regulation of developmental pigmentation(GO:0048087) regulation of pigment cell differentiation(GO:0050932) positive regulation of pigment cell differentiation(GO:0050942) positive regulation of neuroepithelial cell differentiation(GO:1902913) |
| 0.2 |
0.9 |
GO:0090074 |
negative regulation of protein homodimerization activity(GO:0090074) |
| 0.2 |
1.1 |
GO:0042989 |
sequestering of actin monomers(GO:0042989) |
| 0.2 |
0.9 |
GO:0048664 |
neuron fate determination(GO:0048664) |
| 0.2 |
0.4 |
GO:0031860 |
telomeric 3' overhang formation(GO:0031860) |
| 0.2 |
3.9 |
GO:0043392 |
negative regulation of DNA binding(GO:0043392) |
| 0.2 |
0.2 |
GO:1902514 |
regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
| 0.2 |
2.1 |
GO:0019368 |
fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.2 |
0.9 |
GO:0080111 |
DNA demethylation(GO:0080111) |
| 0.2 |
1.3 |
GO:0006855 |
drug transmembrane transport(GO:0006855) |
| 0.2 |
3.7 |
GO:0006284 |
base-excision repair(GO:0006284) |
| 0.2 |
0.4 |
GO:0060706 |
cell differentiation involved in embryonic placenta development(GO:0060706) |
| 0.2 |
0.6 |
GO:1901165 |
positive regulation of trophoblast cell migration(GO:1901165) |
| 0.2 |
0.2 |
GO:0061205 |
paramesonephric duct development(GO:0061205) |
| 0.2 |
0.6 |
GO:0002184 |
cytoplasmic translational termination(GO:0002184) |
| 0.2 |
0.4 |
GO:0097201 |
negative regulation of transcription from RNA polymerase II promoter in response to stress(GO:0097201) |
| 0.2 |
0.2 |
GO:0010593 |
negative regulation of lamellipodium assembly(GO:0010593) |
| 0.2 |
0.2 |
GO:0033182 |
regulation of histone ubiquitination(GO:0033182) |
| 0.2 |
0.2 |
GO:0043518 |
negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.2 |
2.4 |
GO:0035970 |
peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.2 |
0.2 |
GO:0071034 |
CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
| 0.2 |
0.2 |
GO:0032847 |
regulation of cellular pH reduction(GO:0032847) |
| 0.2 |
0.2 |
GO:0090164 |
asymmetric Golgi ribbon formation(GO:0090164) |
| 0.2 |
0.4 |
GO:0098727 |
maintenance of cell number(GO:0098727) |
| 0.2 |
1.3 |
GO:0035542 |
regulation of SNARE complex assembly(GO:0035542) |
| 0.2 |
0.7 |
GO:0071732 |
cellular response to nitric oxide(GO:0071732) |
| 0.2 |
1.3 |
GO:0035520 |
monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.2 |
0.4 |
GO:1904694 |
negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.2 |
2.5 |
GO:0071364 |
cellular response to epidermal growth factor stimulus(GO:0071364) |
| 0.2 |
0.2 |
GO:1903416 |
response to glycoside(GO:1903416) |
| 0.2 |
0.2 |
GO:0006071 |
glycerol metabolic process(GO:0006071) |
| 0.2 |
0.2 |
GO:0061428 |
negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
| 0.2 |
0.5 |
GO:0071447 |
cellular response to hydroperoxide(GO:0071447) |
| 0.2 |
0.5 |
GO:0036233 |
glycine import(GO:0036233) |
| 0.2 |
1.6 |
GO:1904355 |
regulation of telomere capping(GO:1904353) positive regulation of telomere capping(GO:1904355) |
| 0.2 |
0.4 |
GO:0030043 |
actin filament fragmentation(GO:0030043) |
| 0.2 |
2.6 |
GO:0040015 |
negative regulation of multicellular organism growth(GO:0040015) |
| 0.2 |
0.3 |
GO:0035356 |
cellular triglyceride homeostasis(GO:0035356) |
| 0.2 |
15.5 |
GO:0051028 |
mRNA transport(GO:0051028) |
| 0.2 |
0.2 |
GO:0051024 |
positive regulation of immunoglobulin secretion(GO:0051024) |
| 0.2 |
0.2 |
GO:0042938 |
dipeptide transport(GO:0042938) |
| 0.2 |
0.5 |
GO:2000105 |
positive regulation of DNA-dependent DNA replication(GO:2000105) |
| 0.2 |
2.1 |
GO:0050685 |
positive regulation of mRNA processing(GO:0050685) |
| 0.2 |
6.0 |
GO:0006261 |
DNA-dependent DNA replication(GO:0006261) |
| 0.2 |
0.9 |
GO:0032485 |
regulation of Ral protein signal transduction(GO:0032485) |
| 0.2 |
0.7 |
GO:0080009 |
mRNA methylation(GO:0080009) |
| 0.2 |
0.3 |
GO:0040010 |
positive regulation of growth rate(GO:0040010) |
| 0.2 |
0.3 |
GO:0060332 |
positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
| 0.2 |
0.2 |
GO:0072038 |
mesenchymal stem cell maintenance involved in nephron morphogenesis(GO:0072038) |
| 0.2 |
0.5 |
GO:0045835 |
negative regulation of meiotic nuclear division(GO:0045835) |
| 0.2 |
0.3 |
GO:0051973 |
positive regulation of telomerase activity(GO:0051973) |
| 0.2 |
0.5 |
GO:0001978 |
regulation of systemic arterial blood pressure by carotid sinus baroreceptor feedback(GO:0001978) |
| 0.2 |
0.5 |
GO:0030261 |
chromosome condensation(GO:0030261) |
| 0.2 |
0.2 |
GO:0021785 |
branchiomotor neuron axon guidance(GO:0021785) |
| 0.2 |
0.7 |
GO:2000051 |
negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.2 |
1.2 |
GO:0090435 |
protein localization to nuclear envelope(GO:0090435) |
| 0.2 |
0.3 |
GO:0014063 |
negative regulation of serotonin secretion(GO:0014063) |
| 0.2 |
0.2 |
GO:0042359 |
vitamin D metabolic process(GO:0042359) |
| 0.2 |
1.5 |
GO:0045662 |
negative regulation of myoblast differentiation(GO:0045662) |
| 0.2 |
2.6 |
GO:0043631 |
RNA polyadenylation(GO:0043631) |
| 0.2 |
1.1 |
GO:0006678 |
glucosylceramide metabolic process(GO:0006678) |
| 0.2 |
0.2 |
GO:0043970 |
histone H3-K9 acetylation(GO:0043970) |
| 0.2 |
0.6 |
GO:0033629 |
negative regulation of cell adhesion mediated by integrin(GO:0033629) |
| 0.2 |
1.3 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.2 |
0.2 |
GO:0019336 |
phenol-containing compound catabolic process(GO:0019336) |
| 0.2 |
0.5 |
GO:0019240 |
citrulline biosynthetic process(GO:0019240) |
| 0.2 |
0.6 |
GO:1903756 |
regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903756) negative regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903758) |
| 0.2 |
1.7 |
GO:0007250 |
activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.2 |
0.6 |
GO:2000353 |
positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.2 |
0.3 |
GO:0060390 |
regulation of SMAD protein import into nucleus(GO:0060390) |
| 0.2 |
0.8 |
GO:0042148 |
strand invasion(GO:0042148) |
| 0.2 |
0.2 |
GO:0051195 |
negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
| 0.2 |
0.6 |
GO:0000729 |
DNA double-strand break processing(GO:0000729) |
| 0.2 |
0.9 |
GO:0032703 |
negative regulation of interleukin-2 production(GO:0032703) |
| 0.2 |
1.1 |
GO:0008298 |
intracellular mRNA localization(GO:0008298) |
| 0.1 |
0.1 |
GO:0045445 |
myoblast differentiation(GO:0045445) |
| 0.1 |
0.6 |
GO:0032460 |
negative regulation of protein oligomerization(GO:0032460) negative regulation of protein homooligomerization(GO:0032463) |
| 0.1 |
0.6 |
GO:0030576 |
Cajal body organization(GO:0030576) |
| 0.1 |
0.4 |
GO:0032075 |
positive regulation of nuclease activity(GO:0032075) |
| 0.1 |
0.6 |
GO:0010826 |
negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 0.1 |
3.7 |
GO:0003301 |
physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.1 |
0.4 |
GO:0070682 |
proteasome regulatory particle assembly(GO:0070682) |
| 0.1 |
1.0 |
GO:0002755 |
MyD88-dependent toll-like receptor signaling pathway(GO:0002755) |
| 0.1 |
1.2 |
GO:0032049 |
cardiolipin biosynthetic process(GO:0032049) |
| 0.1 |
3.3 |
GO:0021591 |
ventricular system development(GO:0021591) |
| 0.1 |
0.1 |
GO:0008063 |
Toll signaling pathway(GO:0008063) |
| 0.1 |
0.3 |
GO:0097494 |
regulation of vesicle size(GO:0097494) |
| 0.1 |
0.4 |
GO:1903371 |
regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
| 0.1 |
0.1 |
GO:2001185 |
regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
| 0.1 |
0.1 |
GO:0035898 |
parathyroid hormone secretion(GO:0035898) |
| 0.1 |
0.3 |
GO:0097012 |
response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
| 0.1 |
0.3 |
GO:1903795 |
regulation of inorganic anion transmembrane transport(GO:1903795) |
| 0.1 |
0.1 |
GO:1990776 |
cellular response to angiotensin(GO:1904385) response to angiotensin(GO:1990776) |
| 0.1 |
0.1 |
GO:0060385 |
axonogenesis involved in innervation(GO:0060385) |
| 0.1 |
0.6 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.1 |
0.4 |
GO:0014835 |
myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.1 |
2.1 |
GO:0021859 |
pyramidal neuron differentiation(GO:0021859) |
| 0.1 |
0.8 |
GO:1903755 |
regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.1 |
0.4 |
GO:1902037 |
negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
| 0.1 |
0.4 |
GO:2000318 |
T-helper 2 cell activation(GO:0035712) positive regulation of T-helper 17 type immune response(GO:2000318) regulation of T-helper 2 cell activation(GO:2000569) positive regulation of T-helper 2 cell activation(GO:2000570) |
| 0.1 |
0.6 |
GO:0046947 |
hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.1 |
7.2 |
GO:0000245 |
spliceosomal complex assembly(GO:0000245) |
| 0.1 |
0.1 |
GO:0043570 |
maintenance of DNA repeat elements(GO:0043570) |
| 0.1 |
0.4 |
GO:0045602 |
negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.1 |
0.4 |
GO:0097401 |
synaptic vesicle lumen acidification(GO:0097401) |
| 0.1 |
0.3 |
GO:0015697 |
quaternary ammonium group transport(GO:0015697) |
| 0.1 |
0.7 |
GO:0045647 |
negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.1 |
0.1 |
GO:0034447 |
very-low-density lipoprotein particle clearance(GO:0034447) |
| 0.1 |
0.8 |
GO:0003084 |
positive regulation of systemic arterial blood pressure(GO:0003084) |
| 0.1 |
1.1 |
GO:0045911 |
positive regulation of DNA recombination(GO:0045911) |
| 0.1 |
1.9 |
GO:0033962 |
cytoplasmic mRNA processing body assembly(GO:0033962) |
| 0.1 |
0.5 |
GO:1900078 |
positive regulation of cellular response to insulin stimulus(GO:1900078) |
| 0.1 |
4.1 |
GO:0010501 |
RNA secondary structure unwinding(GO:0010501) |
| 0.1 |
0.4 |
GO:0090383 |
phagosome acidification(GO:0090383) |
| 0.1 |
0.3 |
GO:0006983 |
ER overload response(GO:0006983) |
| 0.1 |
0.1 |
GO:0009446 |
putrescine metabolic process(GO:0009445) putrescine biosynthetic process(GO:0009446) |
| 0.1 |
0.8 |
GO:0006591 |
ornithine metabolic process(GO:0006591) |
| 0.1 |
0.3 |
GO:1902916 |
positive regulation of protein polyubiquitination(GO:1902916) |
| 0.1 |
2.0 |
GO:0006516 |
glycoprotein catabolic process(GO:0006516) |
| 0.1 |
0.1 |
GO:0050891 |
multicellular organismal water homeostasis(GO:0050891) establishment of skin barrier(GO:0061436) |
| 0.1 |
0.4 |
GO:0006924 |
activation-induced cell death of T cells(GO:0006924) |
| 0.1 |
1.3 |
GO:0048280 |
vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.1 |
0.3 |
GO:0006868 |
glutamine transport(GO:0006868) |
| 0.1 |
0.8 |
GO:0046502 |
uroporphyrinogen III metabolic process(GO:0046502) |
| 0.1 |
0.9 |
GO:0039703 |
viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.1 |
0.4 |
GO:0035826 |
rubidium ion transport(GO:0035826) regulation of rubidium ion transport(GO:2000680) |
| 0.1 |
1.7 |
GO:0033539 |
fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.1 |
0.3 |
GO:0000055 |
ribosomal large subunit export from nucleus(GO:0000055) |
| 0.1 |
0.4 |
GO:0090037 |
positive regulation of protein kinase C signaling(GO:0090037) |
| 0.1 |
0.9 |
GO:0090263 |
positive regulation of canonical Wnt signaling pathway(GO:0090263) |
| 0.1 |
0.6 |
GO:0048840 |
otolith development(GO:0048840) |
| 0.1 |
0.7 |
GO:0036066 |
protein O-linked fucosylation(GO:0036066) |
| 0.1 |
3.7 |
GO:0043171 |
peptide catabolic process(GO:0043171) |
| 0.1 |
5.3 |
GO:0006402 |
mRNA catabolic process(GO:0006402) |
| 0.1 |
0.1 |
GO:0031497 |
chromatin assembly(GO:0031497) |
| 0.1 |
0.4 |
GO:0019276 |
UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.1 |
0.2 |
GO:2000195 |
negative regulation of female gonad development(GO:2000195) |
| 0.1 |
4.7 |
GO:0006281 |
DNA repair(GO:0006281) |
| 0.1 |
0.5 |
GO:0031915 |
positive regulation of synaptic plasticity(GO:0031915) |
| 0.1 |
1.1 |
GO:0048672 |
positive regulation of collateral sprouting(GO:0048672) |
| 0.1 |
0.2 |
GO:0002700 |
regulation of production of molecular mediator of immune response(GO:0002700) |
| 0.1 |
0.7 |
GO:2000269 |
regulation of fibroblast apoptotic process(GO:2000269) |
| 0.1 |
0.1 |
GO:0042637 |
catagen(GO:0042637) |
| 0.1 |
0.4 |
GO:0070932 |
histone H3 deacetylation(GO:0070932) |
| 0.1 |
0.7 |
GO:0046036 |
CTP biosynthetic process(GO:0006241) pyrimidine ribonucleoside triphosphate biosynthetic process(GO:0009209) CTP metabolic process(GO:0046036) |
| 0.1 |
0.5 |
GO:0072015 |
glomerular visceral epithelial cell development(GO:0072015) glomerular epithelial cell development(GO:0072310) |
| 0.1 |
1.4 |
GO:0051642 |
centrosome localization(GO:0051642) |
| 0.1 |
0.8 |
GO:0061635 |
regulation of protein complex stability(GO:0061635) |
| 0.1 |
0.6 |
GO:0006306 |
DNA alkylation(GO:0006305) DNA methylation(GO:0006306) |
| 0.1 |
0.7 |
GO:0010172 |
embryonic body morphogenesis(GO:0010172) |
| 0.1 |
0.4 |
GO:0032687 |
negative regulation of interferon-alpha production(GO:0032687) |
| 0.1 |
0.3 |
GO:0042985 |
negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.1 |
0.3 |
GO:1905150 |
regulation of voltage-gated sodium channel activity(GO:1905150) |
| 0.1 |
0.6 |
GO:0006685 |
sphingomyelin catabolic process(GO:0006685) |
| 0.1 |
1.4 |
GO:0090307 |
mitotic spindle assembly(GO:0090307) |
| 0.1 |
1.0 |
GO:0007168 |
receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.1 |
1.0 |
GO:0051043 |
regulation of membrane protein ectodomain proteolysis(GO:0051043) |
| 0.1 |
0.2 |
GO:0046874 |
quinolinate metabolic process(GO:0046874) |
| 0.1 |
0.3 |
GO:0048733 |
sebaceous gland development(GO:0048733) |
| 0.1 |
0.3 |
GO:0070476 |
rRNA (guanine-N7)-methylation(GO:0070476) |
| 0.1 |
0.2 |
GO:0032790 |
ribosome disassembly(GO:0032790) |
| 0.1 |
0.2 |
GO:0060316 |
positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
| 0.1 |
0.4 |
GO:0008611 |
ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) ether biosynthetic process(GO:1901503) |
| 0.1 |
1.1 |
GO:0046466 |
sphingolipid catabolic process(GO:0030149) membrane lipid catabolic process(GO:0046466) |
| 0.1 |
0.9 |
GO:0032957 |
inositol trisphosphate metabolic process(GO:0032957) |
| 0.1 |
0.2 |
GO:0048007 |
antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
| 0.1 |
0.7 |
GO:0051189 |
molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.1 |
0.8 |
GO:1901623 |
regulation of lymphocyte chemotaxis(GO:1901623) |
| 0.1 |
0.4 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.1 |
0.2 |
GO:0003085 |
negative regulation of systemic arterial blood pressure(GO:0003085) |
| 0.1 |
0.1 |
GO:1901509 |
regulation of endothelial tube morphogenesis(GO:1901509) |
| 0.1 |
0.2 |
GO:0010867 |
positive regulation of triglyceride biosynthetic process(GO:0010867) |
| 0.1 |
0.4 |
GO:0071105 |
response to interleukin-11(GO:0071105) |
| 0.1 |
0.1 |
GO:0046185 |
aldehyde catabolic process(GO:0046185) |
| 0.1 |
0.8 |
GO:0006370 |
7-methylguanosine mRNA capping(GO:0006370) |
| 0.1 |
0.3 |
GO:1903378 |
positive regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903378) |
| 0.1 |
0.7 |
GO:0019262 |
N-acetylneuraminate catabolic process(GO:0019262) |
| 0.1 |
0.6 |
GO:0071157 |
negative regulation of cell cycle arrest(GO:0071157) |
| 0.1 |
1.4 |
GO:0048240 |
sperm capacitation(GO:0048240) |
| 0.1 |
0.3 |
GO:0023019 |
signal transduction involved in regulation of gene expression(GO:0023019) |
| 0.1 |
1.3 |
GO:0045070 |
positive regulation of viral genome replication(GO:0045070) |
| 0.1 |
1.3 |
GO:0030520 |
intracellular estrogen receptor signaling pathway(GO:0030520) |
| 0.1 |
1.4 |
GO:0033235 |
positive regulation of protein sumoylation(GO:0033235) |
| 0.1 |
0.6 |
GO:0098734 |
protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
| 0.1 |
0.3 |
GO:0034724 |
DNA replication-independent nucleosome organization(GO:0034724) |
| 0.1 |
0.5 |
GO:0006189 |
'de novo' IMP biosynthetic process(GO:0006189) |
| 0.1 |
0.5 |
GO:0006388 |
tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.1 |
0.9 |
GO:0070574 |
cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.1 |
0.2 |
GO:0060575 |
intestinal epithelial cell differentiation(GO:0060575) |
| 0.1 |
0.3 |
GO:0090166 |
Golgi disassembly(GO:0090166) |
| 0.1 |
0.6 |
GO:0071577 |
zinc II ion transmembrane transport(GO:0071577) |
| 0.1 |
0.2 |
GO:0032369 |
negative regulation of lipid transport(GO:0032369) |
| 0.1 |
0.8 |
GO:0045742 |
positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) positive regulation of ERBB signaling pathway(GO:1901186) |
| 0.1 |
2.9 |
GO:0002474 |
antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 0.1 |
1.9 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.1 |
0.2 |
GO:0060923 |
cardiac cell fate commitment(GO:0060911) cardiac muscle cell fate commitment(GO:0060923) |
| 0.1 |
0.2 |
GO:0000098 |
sulfur amino acid catabolic process(GO:0000098) |
| 0.1 |
0.1 |
GO:0006290 |
pyrimidine dimer repair(GO:0006290) |
| 0.1 |
0.5 |
GO:0032202 |
telomere assembly(GO:0032202) |
| 0.1 |
0.4 |
GO:2000059 |
negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.1 |
0.7 |
GO:0000183 |
chromatin silencing at rDNA(GO:0000183) |
| 0.1 |
0.5 |
GO:0006451 |
selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.1 |
0.3 |
GO:0002934 |
desmosome organization(GO:0002934) |
| 0.1 |
0.2 |
GO:0030240 |
skeletal muscle thin filament assembly(GO:0030240) |
| 0.1 |
1.1 |
GO:0032968 |
positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.1 |
0.1 |
GO:0002051 |
osteoblast fate commitment(GO:0002051) |
| 0.1 |
0.4 |
GO:0015888 |
thiamine transport(GO:0015888) |
| 0.1 |
0.2 |
GO:0000966 |
RNA 5'-end processing(GO:0000966) |
| 0.1 |
0.2 |
GO:0006701 |
progesterone biosynthetic process(GO:0006701) |
| 0.1 |
0.2 |
GO:0034587 |
piRNA metabolic process(GO:0034587) |
| 0.1 |
0.2 |
GO:0045048 |
protein insertion into ER membrane(GO:0045048) |
| 0.1 |
0.3 |
GO:0051933 |
amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
| 0.1 |
0.2 |
GO:0045601 |
regulation of endothelial cell differentiation(GO:0045601) |
| 0.1 |
19.5 |
GO:0006397 |
mRNA processing(GO:0006397) |
| 0.1 |
0.4 |
GO:0042573 |
retinoic acid metabolic process(GO:0042573) |
| 0.1 |
0.7 |
GO:0006107 |
oxaloacetate metabolic process(GO:0006107) |
| 0.1 |
0.2 |
GO:0021942 |
radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.1 |
0.2 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.1 |
0.3 |
GO:0016226 |
iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.1 |
0.1 |
GO:0072103 |
renal system vasculature morphogenesis(GO:0061438) kidney vasculature morphogenesis(GO:0061439) glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) |
| 0.1 |
0.2 |
GO:0032439 |
endosome localization(GO:0032439) |
| 0.1 |
0.2 |
GO:0032695 |
negative regulation of interleukin-12 production(GO:0032695) |
| 0.1 |
0.9 |
GO:0003341 |
cilium movement(GO:0003341) |
| 0.1 |
0.4 |
GO:1900017 |
positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.1 |
0.2 |
GO:0035989 |
tendon development(GO:0035989) |
| 0.1 |
0.2 |
GO:0035315 |
hair cell differentiation(GO:0035315) auditory receptor cell differentiation(GO:0042491) |
| 0.1 |
0.3 |
GO:0006741 |
NADP biosynthetic process(GO:0006741) |
| 0.1 |
0.1 |
GO:0061739 |
protein lipidation involved in autophagosome assembly(GO:0061739) |
| 0.1 |
0.5 |
GO:0031670 |
cellular response to nutrient(GO:0031670) |
| 0.1 |
0.5 |
GO:0001833 |
inner cell mass cell proliferation(GO:0001833) |
| 0.1 |
0.1 |
GO:0006693 |
prostanoid metabolic process(GO:0006692) prostaglandin metabolic process(GO:0006693) |
| 0.1 |
1.1 |
GO:0008380 |
RNA splicing(GO:0008380) |
| 0.1 |
1.1 |
GO:0043488 |
regulation of mRNA stability(GO:0043488) |
| 0.1 |
0.2 |
GO:0060218 |
hematopoietic stem cell differentiation(GO:0060218) |
| 0.1 |
0.1 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 |
0.1 |
GO:1902498 |
regulation of protein autoubiquitination(GO:1902498) |
| 0.1 |
0.4 |
GO:0061088 |
sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
| 0.1 |
0.1 |
GO:2000851 |
positive regulation of glucocorticoid secretion(GO:2000851) |
| 0.1 |
0.2 |
GO:0000052 |
citrulline metabolic process(GO:0000052) |
| 0.1 |
0.3 |
GO:1904292 |
regulation of ERAD pathway(GO:1904292) |
| 0.1 |
0.1 |
GO:0021933 |
radial glia guided migration of cerebellar granule cell(GO:0021933) |
| 0.1 |
0.5 |
GO:0034453 |
microtubule anchoring(GO:0034453) |
| 0.1 |
0.1 |
GO:0043489 |
RNA stabilization(GO:0043489) |
| 0.1 |
0.2 |
GO:0032483 |
regulation of Rab protein signal transduction(GO:0032483) |
| 0.1 |
0.1 |
GO:0031627 |
telomeric loop formation(GO:0031627) |
| 0.1 |
0.2 |
GO:0018103 |
protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.1 |
0.1 |
GO:0035694 |
mitochondrial protein catabolic process(GO:0035694) |
| 0.1 |
0.2 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 0.1 |
0.2 |
GO:0006582 |
melanin metabolic process(GO:0006582) melanin biosynthetic process(GO:0042438) secondary metabolite biosynthetic process(GO:0044550) |
| 0.1 |
1.5 |
GO:0006446 |
regulation of translational initiation(GO:0006446) |
| 0.1 |
0.4 |
GO:0051388 |
positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.1 |
0.1 |
GO:0006014 |
D-ribose metabolic process(GO:0006014) |
| 0.1 |
0.1 |
GO:0071594 |
T cell differentiation in thymus(GO:0033077) thymocyte aggregation(GO:0071594) |
| 0.1 |
2.4 |
GO:0045727 |
positive regulation of translation(GO:0045727) |
| 0.1 |
0.4 |
GO:0033353 |
S-adenosylmethionine cycle(GO:0033353) |
| 0.1 |
0.1 |
GO:0002925 |
positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 0.1 |
0.2 |
GO:1901052 |
sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
| 0.1 |
0.1 |
GO:0015675 |
nickel cation transport(GO:0015675) |
| 0.1 |
0.1 |
GO:0051593 |
response to folic acid(GO:0051593) |
| 0.1 |
0.8 |
GO:0034315 |
regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
| 0.1 |
0.8 |
GO:0016180 |
snRNA processing(GO:0016180) |
| 0.1 |
0.3 |
GO:0017196 |
N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.1 |
0.1 |
GO:0061339 |
establishment of monopolar cell polarity(GO:0061162) establishment or maintenance of monopolar cell polarity(GO:0061339) |
| 0.1 |
0.2 |
GO:0006657 |
CDP-choline pathway(GO:0006657) |
| 0.1 |
0.4 |
GO:0036065 |
fucosylation(GO:0036065) |
| 0.1 |
0.2 |
GO:0002002 |
regulation of angiotensin levels in blood(GO:0002002) regulation of angiotensin metabolic process(GO:0060177) |
| 0.1 |
0.2 |
GO:0090063 |
positive regulation of microtubule nucleation(GO:0090063) |
| 0.1 |
0.6 |
GO:0006309 |
DNA catabolic process, endonucleolytic(GO:0000737) apoptotic DNA fragmentation(GO:0006309) |
| 0.1 |
0.3 |
GO:0015842 |
aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) |
| 0.1 |
0.2 |
GO:0001841 |
neural tube formation(GO:0001841) |
| 0.1 |
0.2 |
GO:0070162 |
adiponectin secretion(GO:0070162) regulation of adiponectin secretion(GO:0070163) negative regulation of adiponectin secretion(GO:0070164) |
| 0.1 |
0.1 |
GO:0035864 |
response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
| 0.1 |
0.3 |
GO:0032911 |
negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.1 |
0.2 |
GO:0045839 |
negative regulation of mitotic nuclear division(GO:0045839) |
| 0.1 |
0.4 |
GO:0006729 |
tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.1 |
0.3 |
GO:0023021 |
termination of signal transduction(GO:0023021) |
| 0.1 |
0.2 |
GO:0032486 |
Rap protein signal transduction(GO:0032486) |
| 0.1 |
0.1 |
GO:1901387 |
positive regulation of voltage-gated calcium channel activity(GO:1901387) |
| 0.1 |
0.1 |
GO:0051771 |
negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
| 0.1 |
0.1 |
GO:0048793 |
pronephros development(GO:0048793) |
| 0.1 |
0.5 |
GO:0097094 |
craniofacial suture morphogenesis(GO:0097094) |
| 0.1 |
0.1 |
GO:0042535 |
positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
| 0.1 |
0.1 |
GO:1904504 |
regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
| 0.1 |
0.5 |
GO:0036344 |
platelet morphogenesis(GO:0036344) |
| 0.1 |
0.6 |
GO:0009799 |
specification of symmetry(GO:0009799) |
| 0.1 |
0.2 |
GO:0071236 |
cellular response to antibiotic(GO:0071236) |
| 0.1 |
0.3 |
GO:0046512 |
sphingosine biosynthetic process(GO:0046512) sphingoid biosynthetic process(GO:0046520) |
| 0.1 |
0.3 |
GO:0046475 |
glycerophospholipid catabolic process(GO:0046475) |
| 0.1 |
0.5 |
GO:0035329 |
hippo signaling(GO:0035329) |
| 0.1 |
0.1 |
GO:1905049 |
negative regulation of metallopeptidase activity(GO:1905049) |
| 0.1 |
0.2 |
GO:0050892 |
intestinal absorption(GO:0050892) |
| 0.1 |
0.1 |
GO:0089700 |
protein kinase D signaling(GO:0089700) |
| 0.1 |
0.1 |
GO:0070508 |
sterol import(GO:0035376) cholesterol import(GO:0070508) |
| 0.1 |
0.2 |
GO:0040016 |
embryonic cleavage(GO:0040016) |
| 0.1 |
0.2 |
GO:1904978 |
regulation of endosome organization(GO:1904978) positive regulation of endosome organization(GO:1904980) |
| 0.1 |
0.3 |
GO:0043162 |
ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.1 |
0.1 |
GO:0060017 |
parathyroid gland development(GO:0060017) |
| 0.1 |
0.2 |
GO:0051409 |
response to nitrosative stress(GO:0051409) |
| 0.1 |
0.3 |
GO:0016255 |
attachment of GPI anchor to protein(GO:0016255) |
| 0.1 |
1.0 |
GO:0000413 |
protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.1 |
0.2 |
GO:1902626 |
assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.1 |
0.3 |
GO:0016926 |
protein desumoylation(GO:0016926) |
| 0.1 |
0.5 |
GO:0007097 |
nuclear migration(GO:0007097) establishment of nucleus localization(GO:0040023) |
| 0.1 |
0.4 |
GO:0080182 |
histone H3-K4 trimethylation(GO:0080182) |
| 0.1 |
0.1 |
GO:0006703 |
estrogen biosynthetic process(GO:0006703) |
| 0.1 |
0.1 |
GO:0016322 |
neuron remodeling(GO:0016322) |
| 0.1 |
0.1 |
GO:0060353 |
cell adhesion molecule production(GO:0060352) regulation of cell adhesion molecule production(GO:0060353) positive regulation of cell adhesion molecule production(GO:0060355) |
| 0.1 |
0.2 |
GO:0060672 |
epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.1 |
0.1 |
GO:1903546 |
protein localization to photoreceptor outer segment(GO:1903546) |
| 0.1 |
0.3 |
GO:0032929 |
negative regulation of superoxide anion generation(GO:0032929) |
| 0.1 |
2.8 |
GO:0007059 |
chromosome segregation(GO:0007059) |
| 0.1 |
0.4 |
GO:0097150 |
neuronal stem cell population maintenance(GO:0097150) |
| 0.1 |
0.2 |
GO:0060425 |
lung morphogenesis(GO:0060425) |
| 0.1 |
1.3 |
GO:0036075 |
endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.0 |
0.2 |
GO:0007320 |
insemination(GO:0007320) |
| 0.0 |
0.0 |
GO:0007161 |
calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.0 |
0.5 |
GO:0035721 |
intraciliary retrograde transport(GO:0035721) |
| 0.0 |
0.1 |
GO:0006409 |
tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.0 |
0.4 |
GO:0030901 |
midbrain development(GO:0030901) |
| 0.0 |
0.5 |
GO:0060117 |
auditory receptor cell development(GO:0060117) |
| 0.0 |
0.2 |
GO:2000036 |
regulation of stem cell population maintenance(GO:2000036) |
| 0.0 |
0.1 |
GO:0007141 |
male meiosis I(GO:0007141) |
| 0.0 |
0.1 |
GO:0006435 |
threonyl-tRNA aminoacylation(GO:0006435) |
| 0.0 |
0.1 |
GO:0036500 |
ATF6-mediated unfolded protein response(GO:0036500) |
| 0.0 |
0.1 |
GO:0046462 |
monoacylglycerol metabolic process(GO:0046462) |
| 0.0 |
0.3 |
GO:0043045 |
DNA methylation involved in embryo development(GO:0043045) changes to DNA methylation involved in embryo development(GO:1901538) |
| 0.0 |
0.5 |
GO:0072658 |
maintenance of protein location in membrane(GO:0072658) maintenance of protein location in plasma membrane(GO:0072660) |
| 0.0 |
0.3 |
GO:0021979 |
hypothalamus cell differentiation(GO:0021979) |
| 0.0 |
0.1 |
GO:0000185 |
activation of MAPKKK activity(GO:0000185) |
| 0.0 |
0.5 |
GO:0043984 |
histone H4-K16 acetylation(GO:0043984) |
| 0.0 |
0.4 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.0 |
0.0 |
GO:0033145 |
positive regulation of intracellular steroid hormone receptor signaling pathway(GO:0033145) |
| 0.0 |
0.1 |
GO:0000054 |
ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
| 0.0 |
0.2 |
GO:0016071 |
mRNA metabolic process(GO:0016071) |
| 0.0 |
0.2 |
GO:0042832 |
response to protozoan(GO:0001562) defense response to protozoan(GO:0042832) |
| 0.0 |
0.7 |
GO:1902043 |
positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.0 |
0.2 |
GO:0071596 |
ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.0 |
0.3 |
GO:0006551 |
leucine metabolic process(GO:0006551) |
| 0.0 |
0.1 |
GO:0060192 |
negative regulation of lipase activity(GO:0060192) |
| 0.0 |
0.1 |
GO:0006004 |
fucose metabolic process(GO:0006004) |
| 0.0 |
0.1 |
GO:0044036 |
cell wall macromolecule metabolic process(GO:0044036) cell wall organization or biogenesis(GO:0071554) |
| 0.0 |
1.4 |
GO:0006506 |
GPI anchor biosynthetic process(GO:0006506) |
| 0.0 |
0.1 |
GO:0089711 |
L-glutamate transmembrane transport(GO:0089711) |
| 0.0 |
0.1 |
GO:2000416 |
regulation of eosinophil migration(GO:2000416) positive regulation of eosinophil migration(GO:2000418) |
| 0.0 |
0.5 |
GO:0015693 |
magnesium ion transport(GO:0015693) |
| 0.0 |
0.2 |
GO:0071361 |
cellular response to ethanol(GO:0071361) |
| 0.0 |
0.1 |
GO:0033522 |
histone H2A ubiquitination(GO:0033522) |
| 0.0 |
0.5 |
GO:0030970 |
retrograde protein transport, ER to cytosol(GO:0030970) |
| 0.0 |
0.0 |
GO:0072734 |
response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
| 0.0 |
0.1 |
GO:0000733 |
DNA strand renaturation(GO:0000733) |
| 0.0 |
0.4 |
GO:0006000 |
fructose metabolic process(GO:0006000) |
| 0.0 |
0.8 |
GO:0033209 |
tumor necrosis factor-mediated signaling pathway(GO:0033209) |
| 0.0 |
0.2 |
GO:0051697 |
protein delipidation(GO:0051697) |
| 0.0 |
0.2 |
GO:0030574 |
collagen catabolic process(GO:0030574) multicellular organism catabolic process(GO:0044243) |
| 0.0 |
0.2 |
GO:0006517 |
protein deglycosylation(GO:0006517) |
| 0.0 |
0.0 |
GO:0033578 |
protein glycosylation in Golgi(GO:0033578) |
| 0.0 |
0.1 |
GO:0043651 |
linoleic acid metabolic process(GO:0043651) |
| 0.0 |
0.0 |
GO:0061357 |
Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) positive regulation of Wnt protein secretion(GO:0061357) |
| 0.0 |
0.0 |
GO:0046051 |
UTP metabolic process(GO:0046051) |
| 0.0 |
0.1 |
GO:0010592 |
positive regulation of lamellipodium assembly(GO:0010592) |
| 0.0 |
0.1 |
GO:0010713 |
negative regulation of collagen metabolic process(GO:0010713) negative regulation of collagen biosynthetic process(GO:0032966) negative regulation of multicellular organismal metabolic process(GO:0044252) |
| 0.0 |
0.1 |
GO:0021889 |
olfactory bulb interneuron differentiation(GO:0021889) |
| 0.0 |
0.1 |
GO:0019287 |
isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.0 |
0.9 |
GO:0006302 |
double-strand break repair(GO:0006302) |
| 0.0 |
0.0 |
GO:1901534 |
positive regulation of hematopoietic progenitor cell differentiation(GO:1901534) |
| 0.0 |
0.3 |
GO:0071218 |
cellular response to misfolded protein(GO:0071218) |
| 0.0 |
0.1 |
GO:0010839 |
negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.0 |
0.2 |
GO:0060746 |
parental behavior(GO:0060746) |
| 0.0 |
0.0 |
GO:0000012 |
single strand break repair(GO:0000012) |
| 0.0 |
0.2 |
GO:0002385 |
organ or tissue specific immune response(GO:0002251) mucosal immune response(GO:0002385) |
| 0.0 |
0.0 |
GO:0075044 |
autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
| 0.0 |
0.0 |
GO:0097066 |
response to thyroid hormone(GO:0097066) |
| 0.0 |
0.1 |
GO:0009584 |
detection of visible light(GO:0009584) |
| 0.0 |
0.1 |
GO:0006555 |
methionine metabolic process(GO:0006555) |
| 0.0 |
0.1 |
GO:0036260 |
7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
| 0.0 |
0.0 |
GO:0090141 |
positive regulation of mitochondrial fission(GO:0090141) |
| 0.0 |
0.0 |
GO:0001580 |
detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) sensory perception of bitter taste(GO:0050913) |
| 0.0 |
0.0 |
GO:0043456 |
regulation of pentose-phosphate shunt(GO:0043456) |
| 0.0 |
0.1 |
GO:2001241 |
positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.0 |
0.0 |
GO:0010889 |
regulation of sequestering of triglyceride(GO:0010889) |
| 0.0 |
0.1 |
GO:0019532 |
oxalate transport(GO:0019532) |
| 0.0 |
0.1 |
GO:0006474 |
N-terminal protein amino acid acetylation(GO:0006474) |
| 0.0 |
0.0 |
GO:0007028 |
cytoplasm organization(GO:0007028) |
| 0.0 |
0.0 |
GO:0032484 |
Ral protein signal transduction(GO:0032484) |
| 0.0 |
0.4 |
GO:1901998 |
toxin transport(GO:1901998) |
| 0.0 |
0.0 |
GO:0002862 |
negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.0 |
0.2 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
