| 13.9 |
83.5 |
GO:0097646 |
calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
| 13.6 |
40.9 |
GO:1903002 |
regulation of lipid transport across blood brain barrier(GO:1903000) positive regulation of lipid transport across blood brain barrier(GO:1903002) |
| 13.5 |
40.4 |
GO:0010512 |
negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
| 12.5 |
37.5 |
GO:0030827 |
negative regulation of cGMP metabolic process(GO:0030824) negative regulation of cGMP biosynthetic process(GO:0030827) negative regulation of guanylate cyclase activity(GO:0031283) |
| 11.8 |
35.5 |
GO:0061075 |
cerebral cortex GABAergic interneuron fate commitment(GO:0021893) positive regulation of neural retina development(GO:0061075) positive regulation of retina development in camera-type eye(GO:1902868) positive regulation of amacrine cell differentiation(GO:1902871) |
| 10.8 |
10.8 |
GO:0035793 |
cell migration involved in metanephros development(GO:0035788) metanephric mesenchymal cell migration(GO:0035789) positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) regulation of metanephric mesenchymal cell migration(GO:2000589) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
| 10.4 |
31.3 |
GO:0002030 |
inhibitory G-protein coupled receptor phosphorylation(GO:0002030) |
| 10.1 |
30.4 |
GO:0035934 |
corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
| 9.8 |
29.3 |
GO:1900738 |
positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 8.8 |
26.3 |
GO:0072378 |
blood coagulation, fibrin clot formation(GO:0072378) |
| 8.8 |
26.3 |
GO:0031117 |
positive regulation of microtubule depolymerization(GO:0031117) |
| 8.7 |
43.7 |
GO:0070327 |
thyroid hormone transport(GO:0070327) |
| 8.6 |
8.6 |
GO:1901252 |
regulation of intracellular transport of viral material(GO:1901252) |
| 7.6 |
38.1 |
GO:1903609 |
negative regulation of peptidyl-tyrosine autophosphorylation(GO:1900085) negative regulation of inward rectifier potassium channel activity(GO:1903609) |
| 7.6 |
7.6 |
GO:0061153 |
trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 7.4 |
37.2 |
GO:0051835 |
positive regulation of synapse structural plasticity(GO:0051835) |
| 7.4 |
37.0 |
GO:0048133 |
germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 7.4 |
36.8 |
GO:1900748 |
positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 7.3 |
36.6 |
GO:0045918 |
negative regulation of cytolysis(GO:0045918) |
| 7.2 |
28.8 |
GO:0090238 |
positive regulation of arachidonic acid secretion(GO:0090238) |
| 7.2 |
43.0 |
GO:0009449 |
gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 7.1 |
28.4 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 7.0 |
63.4 |
GO:0019800 |
peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 7.0 |
21.0 |
GO:0035585 |
calcium-mediated signaling using extracellular calcium source(GO:0035585) |
| 7.0 |
42.0 |
GO:2000672 |
negative regulation of motor neuron apoptotic process(GO:2000672) |
| 6.9 |
34.5 |
GO:0071692 |
protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
| 6.8 |
47.7 |
GO:0014053 |
negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
| 6.8 |
27.2 |
GO:0060265 |
positive regulation of respiratory burst involved in inflammatory response(GO:0060265) |
| 6.8 |
6.8 |
GO:0072223 |
metanephric glomerular mesangium development(GO:0072223) metanephric glomerular mesangial cell proliferation involved in metanephros development(GO:0072262) |
| 6.8 |
20.3 |
GO:0036072 |
intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 6.7 |
60.5 |
GO:0021894 |
cerebral cortex GABAergic interneuron development(GO:0021894) |
| 6.6 |
26.4 |
GO:0072272 |
proximal/distal pattern formation involved in metanephric nephron development(GO:0072272) |
| 6.6 |
6.6 |
GO:2000345 |
regulation of hepatocyte proliferation(GO:2000345) |
| 6.5 |
38.9 |
GO:1902998 |
macrophage proliferation(GO:0061517) microglial cell proliferation(GO:0061518) regulation of neuronal signal transduction(GO:1902847) positive regulation of neurofibrillary tangle assembly(GO:1902998) |
| 6.5 |
19.4 |
GO:0051582 |
positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 6.4 |
19.3 |
GO:1904020 |
regulation of G-protein coupled receptor internalization(GO:1904020) |
| 6.3 |
25.3 |
GO:0010046 |
response to mycotoxin(GO:0010046) |
| 6.3 |
37.7 |
GO:1901552 |
positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 6.2 |
18.6 |
GO:2000501 |
natural killer cell chemotaxis(GO:0035747) regulation of natural killer cell chemotaxis(GO:2000501) |
| 6.2 |
6.2 |
GO:0031508 |
pericentric heterochromatin assembly(GO:0031508) |
| 6.2 |
31.0 |
GO:1902683 |
regulation of receptor localization to synapse(GO:1902683) |
| 6.1 |
18.4 |
GO:0042323 |
negative regulation of circadian sleep/wake cycle, non-REM sleep(GO:0042323) negative regulation of mucus secretion(GO:0070256) |
| 6.1 |
30.5 |
GO:0043314 |
negative regulation of neutrophil degranulation(GO:0043314) negative regulation of blood vessel remodeling(GO:0060313) |
| 6.1 |
6.1 |
GO:0070366 |
regulation of hepatocyte differentiation(GO:0070366) |
| 6.0 |
6.0 |
GO:0060907 |
macrophage cytokine production(GO:0010934) regulation of macrophage cytokine production(GO:0010935) positive regulation of macrophage cytokine production(GO:0060907) |
| 6.0 |
6.0 |
GO:0071072 |
negative regulation of phospholipid biosynthetic process(GO:0071072) |
| 5.9 |
5.9 |
GO:0007176 |
regulation of epidermal growth factor-activated receptor activity(GO:0007176) |
| 5.9 |
23.5 |
GO:0044330 |
canonical Wnt signaling pathway involved in positive regulation of wound healing(GO:0044330) lactic acid secretion(GO:0046722) regulation of metanephric cap mesenchymal cell proliferation(GO:0090095) positive regulation of metanephric cap mesenchymal cell proliferation(GO:0090096) |
| 5.8 |
5.8 |
GO:1900372 |
negative regulation of nucleotide biosynthetic process(GO:0030809) negative regulation of purine nucleotide biosynthetic process(GO:1900372) |
| 5.8 |
28.9 |
GO:0010668 |
ectodermal cell differentiation(GO:0010668) |
| 5.8 |
5.8 |
GO:0060065 |
uterus development(GO:0060065) |
| 5.7 |
28.7 |
GO:0075136 |
response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
| 5.7 |
11.5 |
GO:0060166 |
olfactory pit development(GO:0060166) |
| 5.7 |
17.2 |
GO:0019043 |
establishment of viral latency(GO:0019043) |
| 5.7 |
17.2 |
GO:0042196 |
dichloromethane metabolic process(GO:0018900) chlorinated hydrocarbon metabolic process(GO:0042196) halogenated hydrocarbon metabolic process(GO:0042197) |
| 5.7 |
22.7 |
GO:1902512 |
positive regulation of apoptotic DNA fragmentation(GO:1902512) |
| 5.7 |
17.0 |
GO:1903279 |
regulation of calcium:sodium antiporter activity(GO:1903279) |
| 5.6 |
22.5 |
GO:0003278 |
apoptotic process involved in heart morphogenesis(GO:0003278) |
| 5.6 |
16.9 |
GO:0050975 |
sensory perception of touch(GO:0050975) |
| 5.6 |
44.8 |
GO:0070447 |
positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
| 5.6 |
16.7 |
GO:1905072 |
cardiac jelly development(GO:1905072) |
| 5.5 |
5.5 |
GO:0030431 |
sleep(GO:0030431) |
| 5.5 |
16.4 |
GO:1902219 |
negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 5.5 |
5.5 |
GO:2000138 |
positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 5.5 |
32.8 |
GO:0070294 |
renal sodium ion absorption(GO:0070294) |
| 5.5 |
5.5 |
GO:0032430 |
positive regulation of phospholipase A2 activity(GO:0032430) |
| 5.4 |
16.3 |
GO:0021529 |
spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 5.4 |
5.4 |
GO:0032805 |
positive regulation of low-density lipoprotein particle receptor catabolic process(GO:0032805) |
| 5.3 |
16.0 |
GO:0002586 |
positive regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002582) regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002586) positive regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002588) |
| 5.3 |
10.6 |
GO:0036166 |
phenotypic switching(GO:0036166) |
| 5.3 |
5.3 |
GO:0048484 |
enteric nervous system development(GO:0048484) |
| 5.2 |
15.6 |
GO:0051940 |
regulation of dopamine uptake involved in synaptic transmission(GO:0051584) regulation of catecholamine uptake involved in synaptic transmission(GO:0051940) |
| 5.2 |
15.6 |
GO:1903538 |
meiotic cell cycle process involved in oocyte maturation(GO:1903537) regulation of meiotic cell cycle process involved in oocyte maturation(GO:1903538) |
| 5.2 |
20.8 |
GO:0070459 |
prolactin secretion(GO:0070459) |
| 5.2 |
10.3 |
GO:0033159 |
negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 5.1 |
20.6 |
GO:0014012 |
peripheral nervous system axon regeneration(GO:0014012) |
| 5.1 |
5.1 |
GO:0002725 |
negative regulation of T cell cytokine production(GO:0002725) |
| 5.1 |
15.4 |
GO:0003430 |
growth plate cartilage chondrocyte growth(GO:0003430) |
| 5.1 |
15.4 |
GO:0097402 |
neuroblast migration(GO:0097402) |
| 5.1 |
40.9 |
GO:1900034 |
regulation of cellular response to heat(GO:1900034) |
| 5.1 |
15.3 |
GO:0099548 |
trans-synaptic signaling by nitric oxide(GO:0099548) |
| 5.1 |
15.3 |
GO:1903348 |
positive regulation of bicellular tight junction assembly(GO:1903348) |
| 5.1 |
25.5 |
GO:0070305 |
response to cGMP(GO:0070305) cellular response to cGMP(GO:0071321) |
| 5.1 |
10.2 |
GO:0043031 |
negative regulation of macrophage activation(GO:0043031) |
| 5.1 |
45.5 |
GO:2000467 |
positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 5.0 |
15.1 |
GO:0014826 |
vein smooth muscle contraction(GO:0014826) |
| 5.0 |
10.1 |
GO:0002484 |
antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway(GO:0002484) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway, TAP-dependent(GO:0002485) |
| 5.0 |
30.1 |
GO:0006452 |
translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 5.0 |
10.0 |
GO:0072138 |
mesenchymal cell proliferation involved in ureteric bud development(GO:0072138) |
| 5.0 |
19.8 |
GO:0051725 |
protein de-ADP-ribosylation(GO:0051725) |
| 4.9 |
14.8 |
GO:0021577 |
hindbrain structural organization(GO:0021577) cerebellum structural organization(GO:0021589) |
| 4.9 |
9.9 |
GO:0032713 |
negative regulation of interleukin-4 production(GO:0032713) |
| 4.9 |
14.8 |
GO:1903054 |
negative regulation of extracellular matrix organization(GO:1903054) |
| 4.9 |
9.9 |
GO:0003274 |
endocardial cushion fusion(GO:0003274) |
| 4.9 |
14.8 |
GO:0045014 |
carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 4.9 |
24.6 |
GO:0051365 |
cellular response to potassium ion starvation(GO:0051365) |
| 4.9 |
14.7 |
GO:0010989 |
negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 4.9 |
19.5 |
GO:0060437 |
lung growth(GO:0060437) |
| 4.8 |
33.9 |
GO:0002283 |
neutrophil activation involved in immune response(GO:0002283) |
| 4.8 |
4.8 |
GO:0044313 |
protein K6-linked deubiquitination(GO:0044313) |
| 4.8 |
48.3 |
GO:0034116 |
positive regulation of heterotypic cell-cell adhesion(GO:0034116) |
| 4.8 |
4.8 |
GO:0001922 |
B-1 B cell homeostasis(GO:0001922) |
| 4.8 |
19.1 |
GO:0046967 |
cytosol to ER transport(GO:0046967) |
| 4.8 |
4.8 |
GO:0061762 |
CAMKK-AMPK signaling cascade(GO:0061762) |
| 4.8 |
19.0 |
GO:0006529 |
asparagine biosynthetic process(GO:0006529) |
| 4.8 |
9.5 |
GO:0071806 |
intracellular protein transmembrane transport(GO:0065002) protein transmembrane transport(GO:0071806) |
| 4.7 |
9.5 |
GO:0003093 |
regulation of glomerular filtration(GO:0003093) |
| 4.7 |
9.5 |
GO:0033864 |
positive regulation of NAD(P)H oxidase activity(GO:0033864) |
| 4.7 |
14.2 |
GO:1903903 |
regulation of establishment of T cell polarity(GO:1903903) |
| 4.7 |
14.1 |
GO:0006059 |
hexitol metabolic process(GO:0006059) |
| 4.7 |
18.8 |
GO:0021586 |
pons maturation(GO:0021586) |
| 4.7 |
9.4 |
GO:1902869 |
regulation of amacrine cell differentiation(GO:1902869) |
| 4.7 |
28.2 |
GO:0098909 |
regulation of cardiac muscle cell action potential involved in regulation of contraction(GO:0098909) |
| 4.7 |
9.3 |
GO:0010533 |
regulation of activation of Janus kinase activity(GO:0010533) |
| 4.6 |
23.2 |
GO:2000255 |
negative regulation of male germ cell proliferation(GO:2000255) |
| 4.6 |
32.3 |
GO:0016185 |
synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
| 4.6 |
13.8 |
GO:0051342 |
regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
| 4.6 |
18.2 |
GO:0072069 |
DCT cell differentiation(GO:0072069) metanephric DCT cell differentiation(GO:0072240) |
| 4.5 |
4.5 |
GO:0010694 |
positive regulation of alkaline phosphatase activity(GO:0010694) |
| 4.5 |
13.6 |
GO:1905169 |
protein localization to phagocytic vesicle(GO:1905161) regulation of protein localization to phagocytic vesicle(GO:1905169) positive regulation of protein localization to phagocytic vesicle(GO:1905171) |
| 4.5 |
13.5 |
GO:0072086 |
specification of loop of Henle identity(GO:0072086) |
| 4.5 |
13.4 |
GO:1903984 |
regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 4.5 |
22.3 |
GO:0051012 |
microtubule sliding(GO:0051012) |
| 4.5 |
13.4 |
GO:1902949 |
positive regulation of tau-protein kinase activity(GO:1902949) |
| 4.4 |
4.4 |
GO:0098908 |
regulation of neuronal action potential(GO:0098908) |
| 4.4 |
22.1 |
GO:2001181 |
positive regulation of interleukin-10 secretion(GO:2001181) |
| 4.4 |
13.2 |
GO:0009298 |
GDP-mannose biosynthetic process(GO:0009298) |
| 4.4 |
4.4 |
GO:0010579 |
regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
| 4.4 |
26.2 |
GO:0032804 |
negative regulation of low-density lipoprotein particle receptor catabolic process(GO:0032804) |
| 4.4 |
13.1 |
GO:0016998 |
cell wall macromolecule catabolic process(GO:0016998) cell wall macromolecule metabolic process(GO:0044036) cell wall organization or biogenesis(GO:0071554) |
| 4.4 |
4.4 |
GO:1901492 |
positive regulation of lymphangiogenesis(GO:1901492) |
| 4.3 |
8.7 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 4.3 |
13.0 |
GO:0046166 |
glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 4.3 |
17.3 |
GO:0014050 |
negative regulation of glutamate secretion(GO:0014050) |
| 4.3 |
17.3 |
GO:0015825 |
L-serine transport(GO:0015825) |
| 4.3 |
8.6 |
GO:0034372 |
very-low-density lipoprotein particle remodeling(GO:0034372) |
| 4.3 |
8.6 |
GO:0061744 |
motor behavior(GO:0061744) |
| 4.3 |
8.6 |
GO:0048715 |
negative regulation of oligodendrocyte differentiation(GO:0048715) |
| 4.3 |
8.6 |
GO:0097350 |
neutrophil clearance(GO:0097350) |
| 4.3 |
4.3 |
GO:0009153 |
purine deoxyribonucleotide biosynthetic process(GO:0009153) |
| 4.3 |
12.9 |
GO:0001193 |
maintenance of transcriptional fidelity during DNA-templated transcription elongation(GO:0001192) maintenance of transcriptional fidelity during DNA-templated transcription elongation from RNA polymerase II promoter(GO:0001193) |
| 4.3 |
4.3 |
GO:0051490 |
negative regulation of filopodium assembly(GO:0051490) |
| 4.3 |
8.5 |
GO:0051892 |
negative regulation of cardioblast differentiation(GO:0051892) |
| 4.2 |
4.2 |
GO:0051542 |
elastin biosynthetic process(GO:0051542) |
| 4.2 |
12.6 |
GO:0010752 |
regulation of cGMP-mediated signaling(GO:0010752) |
| 4.2 |
16.8 |
GO:0007412 |
axon target recognition(GO:0007412) |
| 4.2 |
21.0 |
GO:0032423 |
regulation of mismatch repair(GO:0032423) |
| 4.2 |
4.2 |
GO:1902474 |
positive regulation of protein localization to synapse(GO:1902474) |
| 4.2 |
12.6 |
GO:0070625 |
zymogen granule exocytosis(GO:0070625) |
| 4.2 |
16.7 |
GO:0047484 |
regulation of response to osmotic stress(GO:0047484) |
| 4.2 |
12.5 |
GO:1902630 |
regulation of membrane hyperpolarization(GO:1902630) |
| 4.2 |
24.9 |
GO:0046598 |
positive regulation of viral entry into host cell(GO:0046598) |
| 4.2 |
16.6 |
GO:0010986 |
positive regulation of lipoprotein particle clearance(GO:0010986) |
| 4.1 |
4.1 |
GO:0090494 |
catecholamine uptake(GO:0090493) dopamine uptake(GO:0090494) |
| 4.1 |
20.7 |
GO:0018002 |
N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 4.1 |
16.5 |
GO:1900533 |
medium-chain fatty-acyl-CoA catabolic process(GO:0036114) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
| 4.1 |
41.0 |
GO:0007191 |
adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
| 4.1 |
12.2 |
GO:0001543 |
ovarian follicle rupture(GO:0001543) |
| 4.0 |
4.0 |
GO:1903294 |
regulation of glutamate secretion, neurotransmission(GO:1903294) positive regulation of glutamate secretion, neurotransmission(GO:1903296) |
| 4.0 |
4.0 |
GO:1900108 |
negative regulation of nodal signaling pathway(GO:1900108) |
| 4.0 |
28.1 |
GO:0060373 |
regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 4.0 |
12.0 |
GO:0048597 |
post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 4.0 |
16.1 |
GO:2001025 |
positive regulation of response to drug(GO:2001025) |
| 3.9 |
15.7 |
GO:0010626 |
negative regulation of Schwann cell proliferation(GO:0010626) |
| 3.9 |
15.7 |
GO:0018343 |
protein farnesylation(GO:0018343) |
| 3.9 |
7.9 |
GO:0035990 |
tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
| 3.9 |
15.7 |
GO:1903874 |
ferrous iron transmembrane transport(GO:1903874) |
| 3.9 |
3.9 |
GO:0032829 |
regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) |
| 3.9 |
19.5 |
GO:0015671 |
oxygen transport(GO:0015671) |
| 3.9 |
7.8 |
GO:2000987 |
positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
| 3.9 |
23.4 |
GO:0019695 |
choline metabolic process(GO:0019695) |
| 3.9 |
3.9 |
GO:0036115 |
fatty-acyl-CoA catabolic process(GO:0036115) |
| 3.9 |
7.8 |
GO:0043496 |
regulation of protein homodimerization activity(GO:0043496) |
| 3.9 |
11.7 |
GO:0048866 |
stem cell fate specification(GO:0048866) |
| 3.9 |
19.4 |
GO:0006177 |
GMP biosynthetic process(GO:0006177) |
| 3.9 |
3.9 |
GO:0032902 |
nerve growth factor production(GO:0032902) |
| 3.9 |
11.6 |
GO:0016561 |
protein import into peroxisome matrix, translocation(GO:0016561) |
| 3.9 |
34.8 |
GO:0001574 |
ganglioside biosynthetic process(GO:0001574) |
| 3.9 |
7.7 |
GO:0001787 |
natural killer cell proliferation(GO:0001787) |
| 3.8 |
11.5 |
GO:0061537 |
glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 3.8 |
3.8 |
GO:0008355 |
olfactory learning(GO:0008355) |
| 3.8 |
3.8 |
GO:0010499 |
proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 3.8 |
11.5 |
GO:0038128 |
ERBB2 signaling pathway(GO:0038128) |
| 3.8 |
76.3 |
GO:0000028 |
ribosomal small subunit assembly(GO:0000028) |
| 3.8 |
38.1 |
GO:0030322 |
stabilization of membrane potential(GO:0030322) |
| 3.8 |
11.4 |
GO:1990523 |
bone regeneration(GO:1990523) |
| 3.8 |
7.6 |
GO:1903596 |
regulation of gap junction assembly(GO:1903596) |
| 3.8 |
7.6 |
GO:0048148 |
behavioral response to cocaine(GO:0048148) |
| 3.8 |
15.1 |
GO:0035461 |
vitamin transmembrane transport(GO:0035461) |
| 3.8 |
18.9 |
GO:0006689 |
ganglioside catabolic process(GO:0006689) |
| 3.8 |
11.3 |
GO:0061623 |
glycolytic process from galactose(GO:0061623) |
| 3.8 |
3.8 |
GO:0071286 |
cellular response to magnesium ion(GO:0071286) |
| 3.7 |
3.7 |
GO:0003057 |
regulation of the force of heart contraction by chemical signal(GO:0003057) |
| 3.7 |
3.7 |
GO:0021913 |
regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
| 3.7 |
29.9 |
GO:0032471 |
negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
| 3.7 |
7.5 |
GO:0006507 |
GPI anchor release(GO:0006507) |
| 3.7 |
22.2 |
GO:0071474 |
cellular hyperosmotic response(GO:0071474) |
| 3.7 |
3.7 |
GO:0098528 |
skeletal muscle fiber differentiation(GO:0098528) |
| 3.7 |
3.7 |
GO:1902455 |
negative regulation of stem cell population maintenance(GO:1902455) |
| 3.7 |
14.7 |
GO:0048289 |
isotype switching to IgE isotypes(GO:0048289) regulation of isotype switching to IgE isotypes(GO:0048293) |
| 3.7 |
3.7 |
GO:2000668 |
dendritic cell apoptotic process(GO:0097048) regulation of dendritic cell apoptotic process(GO:2000668) positive regulation of dendritic cell apoptotic process(GO:2000670) |
| 3.7 |
18.3 |
GO:0003025 |
regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
| 3.6 |
32.8 |
GO:0010459 |
negative regulation of heart rate(GO:0010459) |
| 3.6 |
7.3 |
GO:0006226 |
dUMP biosynthetic process(GO:0006226) |
| 3.6 |
10.9 |
GO:0009182 |
purine deoxyribonucleoside diphosphate metabolic process(GO:0009182) dGDP metabolic process(GO:0046066) GDP metabolic process(GO:0046710) |
| 3.6 |
7.3 |
GO:1901731 |
positive regulation of platelet aggregation(GO:1901731) |
| 3.6 |
14.5 |
GO:0035814 |
negative regulation of renal sodium excretion(GO:0035814) |
| 3.6 |
14.5 |
GO:0070278 |
extracellular matrix constituent secretion(GO:0070278) |
| 3.6 |
18.1 |
GO:0018401 |
peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 3.6 |
18.1 |
GO:1903181 |
regulation of dopamine biosynthetic process(GO:1903179) positive regulation of dopamine biosynthetic process(GO:1903181) |
| 3.6 |
39.6 |
GO:0032482 |
Rab protein signal transduction(GO:0032482) |
| 3.6 |
18.0 |
GO:2000065 |
negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
| 3.6 |
10.8 |
GO:0007023 |
post-chaperonin tubulin folding pathway(GO:0007023) |
| 3.6 |
10.7 |
GO:0002940 |
tRNA N2-guanine methylation(GO:0002940) |
| 3.6 |
43.0 |
GO:0045217 |
cell-cell junction maintenance(GO:0045217) |
| 3.6 |
68.0 |
GO:0031115 |
negative regulation of microtubule polymerization(GO:0031115) |
| 3.6 |
10.7 |
GO:0045113 |
regulation of integrin biosynthetic process(GO:0045113) |
| 3.6 |
3.6 |
GO:0046101 |
hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
| 3.5 |
10.6 |
GO:0033030 |
negative regulation of neutrophil apoptotic process(GO:0033030) |
| 3.5 |
52.7 |
GO:0048681 |
negative regulation of axon regeneration(GO:0048681) |
| 3.5 |
10.5 |
GO:0030974 |
thiamine pyrophosphate transport(GO:0030974) |
| 3.5 |
3.5 |
GO:0033092 |
positive regulation of immature T cell proliferation in thymus(GO:0033092) |
| 3.5 |
14.0 |
GO:1904425 |
negative regulation of GTP binding(GO:1904425) |
| 3.5 |
3.5 |
GO:1903976 |
negative regulation of glial cell migration(GO:1903976) |
| 3.5 |
14.0 |
GO:0032488 |
Cdc42 protein signal transduction(GO:0032488) |
| 3.5 |
10.5 |
GO:1902310 |
positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 3.5 |
10.5 |
GO:0086047 |
membrane depolarization during Purkinje myocyte cell action potential(GO:0086047) |
| 3.5 |
10.5 |
GO:0035470 |
positive regulation of vascular wound healing(GO:0035470) |
| 3.5 |
3.5 |
GO:0018307 |
enzyme active site formation(GO:0018307) |
| 3.5 |
10.4 |
GO:0099590 |
neurotransmitter receptor internalization(GO:0099590) |
| 3.5 |
17.3 |
GO:0039536 |
negative regulation of RIG-I signaling pathway(GO:0039536) |
| 3.4 |
6.9 |
GO:0075525 |
viral translational termination-reinitiation(GO:0075525) |
| 3.4 |
41.2 |
GO:0007042 |
lysosomal lumen acidification(GO:0007042) |
| 3.4 |
6.9 |
GO:0006106 |
fumarate metabolic process(GO:0006106) |
| 3.4 |
3.4 |
GO:0007521 |
muscle cell fate determination(GO:0007521) |
| 3.4 |
6.8 |
GO:2001268 |
negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
| 3.4 |
10.3 |
GO:0060478 |
acrosomal vesicle exocytosis(GO:0060478) |
| 3.4 |
23.8 |
GO:0006621 |
protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 3.4 |
13.6 |
GO:0019673 |
GDP-mannose metabolic process(GO:0019673) |
| 3.4 |
3.4 |
GO:0010643 |
cell communication by chemical coupling(GO:0010643) |
| 3.4 |
10.2 |
GO:0060854 |
patterning of lymph vessels(GO:0060854) |
| 3.4 |
6.8 |
GO:0009448 |
gamma-aminobutyric acid metabolic process(GO:0009448) |
| 3.4 |
10.1 |
GO:0008612 |
peptidyl-lysine modification to peptidyl-hypusine(GO:0008612) |
| 3.4 |
16.8 |
GO:0080184 |
response to stilbenoid(GO:0035634) response to phenylpropanoid(GO:0080184) |
| 3.4 |
10.1 |
GO:0072737 |
response to diamide(GO:0072737) cellular response to diamide(GO:0072738) |
| 3.4 |
20.1 |
GO:0044375 |
regulation of peroxisome size(GO:0044375) |
| 3.3 |
13.4 |
GO:0045054 |
constitutive secretory pathway(GO:0045054) |
| 3.3 |
10.0 |
GO:0051715 |
cytolysis in other organism(GO:0051715) |
| 3.3 |
36.8 |
GO:0015816 |
glycine transport(GO:0015816) |
| 3.3 |
46.7 |
GO:0021527 |
spinal cord association neuron differentiation(GO:0021527) |
| 3.3 |
10.0 |
GO:0034035 |
sulfate assimilation(GO:0000103) purine ribonucleoside bisphosphate metabolic process(GO:0034035) 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 3.3 |
6.7 |
GO:0002238 |
response to molecule of fungal origin(GO:0002238) |
| 3.3 |
10.0 |
GO:0017055 |
negative regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0017055) |
| 3.3 |
10.0 |
GO:0014835 |
myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 3.3 |
16.6 |
GO:0090336 |
positive regulation of brown fat cell differentiation(GO:0090336) |
| 3.3 |
13.3 |
GO:0071726 |
response to diacyl bacterial lipopeptide(GO:0071724) cellular response to diacyl bacterial lipopeptide(GO:0071726) |
| 3.3 |
23.1 |
GO:0015862 |
uridine transport(GO:0015862) |
| 3.3 |
6.6 |
GO:0045590 |
negative regulation of regulatory T cell differentiation(GO:0045590) |
| 3.3 |
9.9 |
GO:0098886 |
modification of dendritic spine(GO:0098886) |
| 3.3 |
32.8 |
GO:0006123 |
mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 3.3 |
9.8 |
GO:2000275 |
regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
| 3.3 |
22.8 |
GO:0045650 |
negative regulation of macrophage differentiation(GO:0045650) |
| 3.3 |
3.3 |
GO:0031944 |
negative regulation of glucocorticoid metabolic process(GO:0031944) negative regulation of glucocorticoid biosynthetic process(GO:0031947) |
| 3.2 |
35.7 |
GO:0007190 |
activation of adenylate cyclase activity(GO:0007190) |
| 3.2 |
3.2 |
GO:0010543 |
regulation of platelet activation(GO:0010543) |
| 3.2 |
29.1 |
GO:0060732 |
positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
| 3.2 |
6.5 |
GO:1900126 |
negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 3.2 |
12.8 |
GO:0071880 |
adenylate cyclase-activating adrenergic receptor signaling pathway(GO:0071880) |
| 3.2 |
6.3 |
GO:0001803 |
type III hypersensitivity(GO:0001802) regulation of type III hypersensitivity(GO:0001803) positive regulation of type III hypersensitivity(GO:0001805) |
| 3.2 |
9.5 |
GO:0001692 |
histamine metabolic process(GO:0001692) |
| 3.2 |
19.0 |
GO:0010454 |
negative regulation of cell fate commitment(GO:0010454) |
| 3.2 |
12.6 |
GO:0006848 |
pyruvate transport(GO:0006848) |
| 3.2 |
6.3 |
GO:0010936 |
negative regulation of macrophage cytokine production(GO:0010936) |
| 3.2 |
9.5 |
GO:0046341 |
CDP-diacylglycerol metabolic process(GO:0046341) |
| 3.2 |
3.2 |
GO:0009826 |
unidimensional cell growth(GO:0009826) |
| 3.1 |
12.6 |
GO:1900110 |
negative regulation of histone H3-K9 dimethylation(GO:1900110) |
| 3.1 |
9.4 |
GO:1902109 |
negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
| 3.1 |
12.5 |
GO:0009227 |
UDP-N-acetylglucosamine catabolic process(GO:0006049) nucleotide-sugar catabolic process(GO:0009227) |
| 3.1 |
53.3 |
GO:0032287 |
peripheral nervous system myelin maintenance(GO:0032287) |
| 3.1 |
18.7 |
GO:0046645 |
positive regulation of gamma-delta T cell differentiation(GO:0045588) positive regulation of gamma-delta T cell activation(GO:0046645) |
| 3.1 |
3.1 |
GO:0032808 |
lacrimal gland development(GO:0032808) |
| 3.1 |
40.5 |
GO:0097091 |
synaptic vesicle clustering(GO:0097091) |
| 3.1 |
24.8 |
GO:0014824 |
artery smooth muscle contraction(GO:0014824) |
| 3.1 |
6.2 |
GO:0061622 |
glycolytic process through glucose-1-phosphate(GO:0061622) |
| 3.1 |
12.4 |
GO:0042822 |
pyridoxal phosphate metabolic process(GO:0042822) |
| 3.1 |
15.4 |
GO:0061620 |
glycolytic process through glucose-6-phosphate(GO:0061620) |
| 3.1 |
12.3 |
GO:0072369 |
regulation of lipid transport by positive regulation of transcription from RNA polymerase II promoter(GO:0072369) |
| 3.1 |
6.1 |
GO:1901165 |
positive regulation of trophoblast cell migration(GO:1901165) |
| 3.1 |
9.2 |
GO:0035880 |
embryonic nail plate morphogenesis(GO:0035880) |
| 3.1 |
9.2 |
GO:0019230 |
proprioception(GO:0019230) |
| 3.1 |
9.2 |
GO:0061743 |
motor learning(GO:0061743) |
| 3.0 |
33.5 |
GO:2000580 |
positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
| 3.0 |
15.2 |
GO:0051004 |
regulation of lipoprotein lipase activity(GO:0051004) |
| 3.0 |
9.1 |
GO:0009051 |
pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 3.0 |
6.1 |
GO:0071280 |
cellular response to copper ion(GO:0071280) |
| 3.0 |
3.0 |
GO:0032847 |
regulation of cellular pH reduction(GO:0032847) |
| 3.0 |
12.1 |
GO:0002457 |
T cell antigen processing and presentation(GO:0002457) |
| 3.0 |
3.0 |
GO:1903305 |
regulation of regulated secretory pathway(GO:1903305) |
| 3.0 |
9.1 |
GO:1901536 |
regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
| 3.0 |
3.0 |
GO:0035799 |
ureter maturation(GO:0035799) |
| 3.0 |
9.0 |
GO:0071374 |
cellular response to parathyroid hormone stimulus(GO:0071374) |
| 3.0 |
39.1 |
GO:0033211 |
adiponectin-activated signaling pathway(GO:0033211) |
| 3.0 |
3.0 |
GO:0032224 |
positive regulation of synaptic transmission, cholinergic(GO:0032224) |
| 3.0 |
9.0 |
GO:0001920 |
negative regulation of receptor recycling(GO:0001920) |
| 3.0 |
30.0 |
GO:0032098 |
regulation of appetite(GO:0032098) |
| 3.0 |
6.0 |
GO:0019401 |
alditol biosynthetic process(GO:0019401) |
| 3.0 |
12.0 |
GO:2000830 |
vacuolar phosphate transport(GO:0007037) vitamin D3 metabolic process(GO:0070640) positive regulation of parathyroid hormone secretion(GO:2000830) |
| 3.0 |
9.0 |
GO:0060684 |
epithelial-mesenchymal cell signaling(GO:0060684) |
| 3.0 |
3.0 |
GO:0072050 |
comma-shaped body morphogenesis(GO:0072049) S-shaped body morphogenesis(GO:0072050) |
| 3.0 |
3.0 |
GO:0042275 |
error-free postreplication DNA repair(GO:0042275) |
| 3.0 |
29.8 |
GO:2000821 |
regulation of grooming behavior(GO:2000821) |
| 3.0 |
5.9 |
GO:0072268 |
pattern specification involved in metanephros development(GO:0072268) |
| 3.0 |
3.0 |
GO:0035482 |
gastric motility(GO:0035482) gastric emptying(GO:0035483) |
| 3.0 |
8.9 |
GO:0050847 |
progesterone receptor signaling pathway(GO:0050847) |
| 2.9 |
11.8 |
GO:0048172 |
regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 2.9 |
2.9 |
GO:0071895 |
odontoblast differentiation(GO:0071895) |
| 2.9 |
8.8 |
GO:0031133 |
regulation of axon diameter(GO:0031133) |
| 2.9 |
8.8 |
GO:0071707 |
immunoglobulin heavy chain V-D-J recombination(GO:0071707) |
| 2.9 |
8.8 |
GO:0030070 |
insulin processing(GO:0030070) |
| 2.9 |
2.9 |
GO:0030854 |
positive regulation of granulocyte differentiation(GO:0030854) |
| 2.9 |
17.6 |
GO:0032796 |
uropod organization(GO:0032796) |
| 2.9 |
2.9 |
GO:1901897 |
regulation of relaxation of cardiac muscle(GO:1901897) |
| 2.9 |
52.4 |
GO:2000251 |
positive regulation of actin cytoskeleton reorganization(GO:2000251) |
| 2.9 |
8.7 |
GO:2001016 |
positive regulation of skeletal muscle cell differentiation(GO:2001016) |
| 2.9 |
11.6 |
GO:2000525 |
regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 2.9 |
14.5 |
GO:0030578 |
PML body organization(GO:0030578) |
| 2.9 |
8.7 |
GO:0003245 |
cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
| 2.9 |
5.8 |
GO:0072014 |
proximal tubule development(GO:0072014) |
| 2.9 |
14.4 |
GO:1902172 |
keratinocyte apoptotic process(GO:0097283) regulation of keratinocyte apoptotic process(GO:1902172) |
| 2.9 |
2.9 |
GO:0045575 |
basophil activation involved in immune response(GO:0002276) basophil activation(GO:0045575) |
| 2.9 |
2.9 |
GO:0051795 |
positive regulation of catagen(GO:0051795) |
| 2.9 |
11.5 |
GO:0033580 |
protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
| 2.9 |
23.0 |
GO:0032020 |
ISG15-protein conjugation(GO:0032020) |
| 2.9 |
11.5 |
GO:0010273 |
detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 2.9 |
8.6 |
GO:0038003 |
opioid receptor signaling pathway(GO:0038003) regulation of opioid receptor signaling pathway(GO:2000474) |
| 2.8 |
37.0 |
GO:0042182 |
ketone catabolic process(GO:0042182) |
| 2.8 |
22.7 |
GO:0098967 |
exocytic insertion of neurotransmitter receptor to plasma membrane(GO:0098881) exocytic insertion of neurotransmitter receptor to postsynaptic membrane(GO:0098967) |
| 2.8 |
14.1 |
GO:0050861 |
positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 2.8 |
5.7 |
GO:0043096 |
purine nucleobase salvage(GO:0043096) |
| 2.8 |
8.5 |
GO:0033634 |
positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 2.8 |
78.9 |
GO:0048791 |
calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 2.8 |
2.8 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 2.8 |
2.8 |
GO:2000435 |
regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
| 2.8 |
8.4 |
GO:0071544 |
diphosphoinositol polyphosphate catabolic process(GO:0071544) |
| 2.8 |
19.5 |
GO:0048227 |
plasma membrane to endosome transport(GO:0048227) |
| 2.8 |
5.6 |
GO:0045915 |
positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
| 2.8 |
2.8 |
GO:0021678 |
third ventricle development(GO:0021678) |
| 2.8 |
8.3 |
GO:0097274 |
urea homeostasis(GO:0097274) |
| 2.8 |
5.6 |
GO:0008626 |
granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 2.8 |
11.1 |
GO:1900186 |
negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 2.8 |
2.8 |
GO:0015870 |
acetylcholine transport(GO:0015870) acetate ester transport(GO:1901374) |
| 2.8 |
13.8 |
GO:0060279 |
positive regulation of ovulation(GO:0060279) |
| 2.8 |
2.8 |
GO:0002309 |
T cell proliferation involved in immune response(GO:0002309) |
| 2.8 |
2.8 |
GO:1990379 |
lipid transport across blood brain barrier(GO:1990379) |
| 2.8 |
8.3 |
GO:0015747 |
urate transport(GO:0015747) |
| 2.8 |
19.3 |
GO:0030579 |
ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 2.8 |
8.3 |
GO:0046022 |
regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
| 2.8 |
38.5 |
GO:0071353 |
cellular response to interleukin-4(GO:0071353) |
| 2.7 |
5.5 |
GO:0032510 |
endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
| 2.7 |
8.2 |
GO:0007621 |
negative regulation of female receptivity(GO:0007621) |
| 2.7 |
8.2 |
GO:1904046 |
negative regulation of vascular endothelial growth factor production(GO:1904046) |
| 2.7 |
2.7 |
GO:0034383 |
low-density lipoprotein particle clearance(GO:0034383) |
| 2.7 |
13.7 |
GO:0032534 |
regulation of microvillus assembly(GO:0032534) |
| 2.7 |
13.7 |
GO:0042699 |
follicle-stimulating hormone signaling pathway(GO:0042699) |
| 2.7 |
5.5 |
GO:2000744 |
anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 2.7 |
19.1 |
GO:0033008 |
positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
| 2.7 |
2.7 |
GO:0072199 |
mesenchymal cell proliferation involved in ureter development(GO:0072198) regulation of mesenchymal cell proliferation involved in ureter development(GO:0072199) |
| 2.7 |
8.2 |
GO:2000832 |
negative regulation of steroid hormone secretion(GO:2000832) |
| 2.7 |
13.6 |
GO:2000325 |
regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 2.7 |
10.8 |
GO:0006558 |
L-phenylalanine metabolic process(GO:0006558) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) |
| 2.7 |
2.7 |
GO:0055078 |
sodium ion homeostasis(GO:0055078) |
| 2.7 |
37.8 |
GO:0010759 |
positive regulation of macrophage chemotaxis(GO:0010759) |
| 2.7 |
35.1 |
GO:0021902 |
commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
| 2.7 |
13.5 |
GO:0019659 |
fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
| 2.7 |
8.1 |
GO:0046689 |
response to mercury ion(GO:0046689) |
| 2.7 |
10.7 |
GO:0070494 |
regulation of thrombin receptor signaling pathway(GO:0070494) negative regulation of thrombin receptor signaling pathway(GO:0070495) |
| 2.7 |
8.0 |
GO:2001160 |
regulation of histone H3-K79 methylation(GO:2001160) |
| 2.7 |
8.0 |
GO:0050703 |
interleukin-1 alpha secretion(GO:0050703) |
| 2.7 |
18.7 |
GO:0035269 |
protein O-linked mannosylation(GO:0035269) |
| 2.7 |
2.7 |
GO:0045646 |
regulation of erythrocyte differentiation(GO:0045646) |
| 2.7 |
13.3 |
GO:1903336 |
negative regulation of vacuolar transport(GO:1903336) |
| 2.7 |
29.3 |
GO:1990173 |
protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
| 2.7 |
2.7 |
GO:0048611 |
ectodermal digestive tract development(GO:0007439) embryonic ectodermal digestive tract development(GO:0048611) |
| 2.6 |
2.6 |
GO:0036480 |
neuron intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0036480) regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903376) |
| 2.6 |
2.6 |
GO:0046543 |
development of secondary sexual characteristics(GO:0045136) development of secondary female sexual characteristics(GO:0046543) |
| 2.6 |
7.9 |
GO:0042756 |
drinking behavior(GO:0042756) |
| 2.6 |
13.1 |
GO:0090170 |
regulation of Golgi inheritance(GO:0090170) |
| 2.6 |
5.2 |
GO:0014738 |
regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
| 2.6 |
2.6 |
GO:0060754 |
positive regulation of mast cell chemotaxis(GO:0060754) |
| 2.6 |
18.3 |
GO:0009181 |
purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
| 2.6 |
7.8 |
GO:0010596 |
negative regulation of endothelial cell migration(GO:0010596) |
| 2.6 |
2.6 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 2.6 |
2.6 |
GO:0006817 |
phosphate ion transport(GO:0006817) |
| 2.6 |
5.2 |
GO:0019935 |
cyclic-nucleotide-mediated signaling(GO:0019935) |
| 2.6 |
10.4 |
GO:0034650 |
cortisol metabolic process(GO:0034650) cortisol biosynthetic process(GO:0034651) |
| 2.6 |
2.6 |
GO:0036482 |
neuron intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036482) positive regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902958) regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903383) negative regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903384) |
| 2.6 |
12.9 |
GO:0007197 |
adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 2.6 |
2.6 |
GO:1904008 |
response to monosodium glutamate(GO:1904008) cellular response to monosodium glutamate(GO:1904009) |
| 2.6 |
2.6 |
GO:0002481 |
antigen processing and presentation of exogenous peptide antigen via MHC class Ib(GO:0002477) antigen processing and presentation of exogenous protein antigen via MHC class Ib, TAP-dependent(GO:0002481) |
| 2.6 |
10.3 |
GO:0014846 |
esophagus smooth muscle contraction(GO:0014846) |
| 2.6 |
5.1 |
GO:1900451 |
positive regulation of glutamate receptor signaling pathway(GO:1900451) |
| 2.6 |
20.5 |
GO:2000172 |
regulation of branching morphogenesis of a nerve(GO:2000172) |
| 2.5 |
7.6 |
GO:1903031 |
regulation of microtubule plus-end binding(GO:1903031) positive regulation of microtubule plus-end binding(GO:1903033) |
| 2.5 |
7.6 |
GO:0042364 |
water-soluble vitamin biosynthetic process(GO:0042364) |
| 2.5 |
10.1 |
GO:0051902 |
negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
| 2.5 |
7.6 |
GO:0046552 |
eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 2.5 |
5.1 |
GO:0050859 |
negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 2.5 |
2.5 |
GO:0032714 |
negative regulation of interleukin-13 production(GO:0032696) negative regulation of interleukin-5 production(GO:0032714) |
| 2.5 |
7.6 |
GO:0060158 |
phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 2.5 |
17.6 |
GO:0006102 |
isocitrate metabolic process(GO:0006102) |
| 2.5 |
7.5 |
GO:0035963 |
response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
| 2.5 |
10.0 |
GO:0015961 |
diadenosine polyphosphate catabolic process(GO:0015961) |
| 2.5 |
2.5 |
GO:2000170 |
positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
| 2.5 |
9.9 |
GO:0007258 |
JUN phosphorylation(GO:0007258) |
| 2.5 |
2.5 |
GO:1902856 |
negative regulation of nonmotile primary cilium assembly(GO:1902856) |
| 2.5 |
9.9 |
GO:0016128 |
phytosteroid metabolic process(GO:0016128) phytosteroid biosynthetic process(GO:0016129) |
| 2.5 |
9.9 |
GO:0043117 |
positive regulation of vascular permeability(GO:0043117) |
| 2.5 |
9.8 |
GO:0006121 |
mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
| 2.4 |
7.3 |
GO:1903630 |
regulation of aminoacyl-tRNA ligase activity(GO:1903630) positive regulation of aminoacyl-tRNA ligase activity(GO:1903632) |
| 2.4 |
26.9 |
GO:0043589 |
skin morphogenesis(GO:0043589) |
| 2.4 |
61.2 |
GO:2000311 |
regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 2.4 |
7.3 |
GO:1903244 |
positive regulation of cardiac muscle adaptation(GO:0010615) positive regulation of cardiac muscle hypertrophy in response to stress(GO:1903244) |
| 2.4 |
9.8 |
GO:0000379 |
tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 2.4 |
26.8 |
GO:0071260 |
cellular response to mechanical stimulus(GO:0071260) |
| 2.4 |
4.9 |
GO:1903207 |
neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
| 2.4 |
7.3 |
GO:0051866 |
general adaptation syndrome(GO:0051866) |
| 2.4 |
26.7 |
GO:0034551 |
respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 2.4 |
4.9 |
GO:0014060 |
regulation of epinephrine secretion(GO:0014060) |
| 2.4 |
2.4 |
GO:0072197 |
renal vesicle induction(GO:0072034) ureter morphogenesis(GO:0072197) |
| 2.4 |
4.8 |
GO:0003018 |
vascular process in circulatory system(GO:0003018) |
| 2.4 |
2.4 |
GO:0002636 |
positive regulation of germinal center formation(GO:0002636) |
| 2.4 |
9.6 |
GO:0097298 |
regulation of nucleus size(GO:0097298) |
| 2.4 |
9.6 |
GO:1903527 |
regulation of membrane tubulation(GO:1903525) positive regulation of membrane tubulation(GO:1903527) |
| 2.4 |
2.4 |
GO:0045716 |
positive regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045716) |
| 2.4 |
2.4 |
GO:2000468 |
regulation of peroxidase activity(GO:2000468) |
| 2.4 |
4.8 |
GO:0070317 |
negative regulation of G0 to G1 transition(GO:0070317) |
| 2.4 |
7.2 |
GO:0000050 |
urea cycle(GO:0000050) urea metabolic process(GO:0019627) |
| 2.4 |
7.2 |
GO:0045658 |
regulation of neutrophil differentiation(GO:0045658) negative regulation of neutrophil differentiation(GO:0045659) |
| 2.4 |
9.5 |
GO:0010735 |
positive regulation of transcription via serum response element binding(GO:0010735) |
| 2.4 |
9.5 |
GO:0019287 |
isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) isopentenyl diphosphate metabolic process(GO:0046490) |
| 2.4 |
11.8 |
GO:0001765 |
membrane raft assembly(GO:0001765) |
| 2.4 |
2.4 |
GO:0051901 |
positive regulation of mitochondrial depolarization(GO:0051901) |
| 2.4 |
7.1 |
GO:0090394 |
negative regulation of excitatory postsynaptic potential(GO:0090394) |
| 2.4 |
4.7 |
GO:0072720 |
response to dithiothreitol(GO:0072720) |
| 2.3 |
2.3 |
GO:0033033 |
negative regulation of myeloid cell apoptotic process(GO:0033033) |
| 2.3 |
7.0 |
GO:0090285 |
negative regulation of protein glycosylation in Golgi(GO:0090285) |
| 2.3 |
7.0 |
GO:0046016 |
regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) positive regulation of transcription by glucose(GO:0046016) |
| 2.3 |
7.0 |
GO:0034447 |
very-low-density lipoprotein particle clearance(GO:0034447) |
| 2.3 |
9.3 |
GO:0006244 |
pyrimidine nucleotide catabolic process(GO:0006244) pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
| 2.3 |
2.3 |
GO:0050779 |
RNA destabilization(GO:0050779) |
| 2.3 |
9.3 |
GO:0048711 |
positive regulation of astrocyte differentiation(GO:0048711) |
| 2.3 |
6.9 |
GO:0046462 |
monoacylglycerol metabolic process(GO:0046462) |
| 2.3 |
4.6 |
GO:0010288 |
response to lead ion(GO:0010288) |
| 2.3 |
27.7 |
GO:0006995 |
cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 2.3 |
13.8 |
GO:1901837 |
negative regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901837) |
| 2.3 |
11.5 |
GO:0043985 |
histone H4-R3 methylation(GO:0043985) |
| 2.3 |
4.6 |
GO:0045759 |
negative regulation of action potential(GO:0045759) |
| 2.3 |
54.9 |
GO:0015991 |
energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) |
| 2.3 |
2.3 |
GO:0002677 |
negative regulation of chronic inflammatory response(GO:0002677) |
| 2.3 |
11.4 |
GO:0016480 |
negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 2.3 |
6.8 |
GO:0021891 |
olfactory bulb interneuron development(GO:0021891) |
| 2.3 |
25.1 |
GO:0070050 |
neuron cellular homeostasis(GO:0070050) |
| 2.3 |
6.8 |
GO:0019676 |
ammonia assimilation cycle(GO:0019676) |
| 2.3 |
45.4 |
GO:0007212 |
dopamine receptor signaling pathway(GO:0007212) |
| 2.3 |
11.3 |
GO:0019370 |
leukotriene biosynthetic process(GO:0019370) |
| 2.3 |
2.3 |
GO:0048319 |
axial mesoderm morphogenesis(GO:0048319) |
| 2.3 |
2.3 |
GO:0048696 |
regulation of collateral sprouting in absence of injury(GO:0048696) |
| 2.3 |
2.3 |
GO:0014049 |
positive regulation of glutamate secretion(GO:0014049) |
| 2.2 |
6.7 |
GO:1902162 |
regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) |
| 2.2 |
9.0 |
GO:0072321 |
chaperone-mediated protein transport(GO:0072321) |
| 2.2 |
6.7 |
GO:0090559 |
regulation of membrane permeability(GO:0090559) |
| 2.2 |
8.9 |
GO:0006478 |
peptidyl-tyrosine sulfation(GO:0006478) |
| 2.2 |
2.2 |
GO:1903146 |
regulation of mitophagy(GO:1903146) |
| 2.2 |
4.4 |
GO:0048050 |
post-embryonic eye morphogenesis(GO:0048050) |
| 2.2 |
4.4 |
GO:1901857 |
positive regulation of cellular respiration(GO:1901857) |
| 2.2 |
35.4 |
GO:0030150 |
protein import into mitochondrial matrix(GO:0030150) |
| 2.2 |
26.5 |
GO:0006465 |
signal peptide processing(GO:0006465) |
| 2.2 |
4.4 |
GO:0021933 |
radial glia guided migration of cerebellar granule cell(GO:0021933) |
| 2.2 |
75.1 |
GO:0045746 |
negative regulation of Notch signaling pathway(GO:0045746) |
| 2.2 |
6.6 |
GO:0006624 |
vacuolar protein processing(GO:0006624) |
| 2.2 |
4.4 |
GO:0032464 |
positive regulation of protein homooligomerization(GO:0032464) |
| 2.2 |
8.8 |
GO:0031580 |
membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
| 2.2 |
11.0 |
GO:1902308 |
regulation of peptidyl-serine dephosphorylation(GO:1902308) |
| 2.2 |
6.6 |
GO:0032276 |
regulation of gonadotropin secretion(GO:0032276) |
| 2.2 |
2.2 |
GO:0010749 |
regulation of nitric oxide mediated signal transduction(GO:0010749) |
| 2.2 |
2.2 |
GO:0032610 |
interleukin-1 alpha production(GO:0032610) |
| 2.2 |
13.1 |
GO:0097484 |
dendrite extension(GO:0097484) |
| 2.2 |
17.3 |
GO:0030388 |
fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 2.2 |
86.6 |
GO:0097031 |
NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 2.2 |
2.2 |
GO:0033108 |
mitochondrial respiratory chain complex assembly(GO:0033108) |
| 2.2 |
6.5 |
GO:0009414 |
response to water deprivation(GO:0009414) |
| 2.2 |
4.3 |
GO:1904457 |
positive regulation of neuronal action potential(GO:1904457) |
| 2.2 |
12.9 |
GO:0031665 |
negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 2.2 |
12.9 |
GO:0046103 |
inosine biosynthetic process(GO:0046103) |
| 2.1 |
10.7 |
GO:0034227 |
tRNA thio-modification(GO:0034227) |
| 2.1 |
6.4 |
GO:0021884 |
forebrain neuron development(GO:0021884) |
| 2.1 |
8.6 |
GO:1900029 |
positive regulation of ruffle assembly(GO:1900029) |
| 2.1 |
4.3 |
GO:0071492 |
cellular response to UV-A(GO:0071492) |
| 2.1 |
14.9 |
GO:0016322 |
neuron remodeling(GO:0016322) |
| 2.1 |
17.0 |
GO:1903861 |
regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
| 2.1 |
10.6 |
GO:0043416 |
regulation of skeletal muscle tissue regeneration(GO:0043416) |
| 2.1 |
2.1 |
GO:0044803 |
multi-organism membrane organization(GO:0044803) |
| 2.1 |
8.5 |
GO:0090500 |
endocardial cushion to mesenchymal transition(GO:0090500) |
| 2.1 |
2.1 |
GO:0003383 |
apical constriction(GO:0003383) |
| 2.1 |
12.7 |
GO:0044027 |
hypermethylation of CpG island(GO:0044027) |
| 2.1 |
2.1 |
GO:0016093 |
polyprenol metabolic process(GO:0016093) |
| 2.1 |
2.1 |
GO:0060160 |
negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 2.1 |
6.3 |
GO:0097500 |
receptor localization to nonmotile primary cilium(GO:0097500) |
| 2.1 |
4.2 |
GO:0070682 |
proteasome regulatory particle assembly(GO:0070682) |
| 2.1 |
8.4 |
GO:0006780 |
uroporphyrinogen III biosynthetic process(GO:0006780) |
| 2.1 |
8.4 |
GO:0042373 |
vitamin K metabolic process(GO:0042373) |
| 2.1 |
6.3 |
GO:0050765 |
negative regulation of phagocytosis(GO:0050765) |
| 2.1 |
4.2 |
GO:0006528 |
asparagine metabolic process(GO:0006528) |
| 2.1 |
2.1 |
GO:1900037 |
regulation of cellular response to hypoxia(GO:1900037) |
| 2.1 |
14.6 |
GO:0070458 |
detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 2.1 |
8.3 |
GO:0045163 |
clustering of voltage-gated potassium channels(GO:0045163) |
| 2.1 |
45.8 |
GO:0035640 |
exploration behavior(GO:0035640) |
| 2.1 |
18.7 |
GO:0071392 |
cellular response to estradiol stimulus(GO:0071392) |
| 2.1 |
41.5 |
GO:0095500 |
acetylcholine receptor signaling pathway(GO:0095500) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
| 2.1 |
6.2 |
GO:0006296 |
nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
| 2.1 |
45.5 |
GO:0015985 |
energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 2.1 |
6.2 |
GO:0071929 |
alpha-tubulin acetylation(GO:0071929) |
| 2.1 |
12.4 |
GO:0006122 |
mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 2.1 |
20.6 |
GO:0043252 |
sodium-independent organic anion transport(GO:0043252) |
| 2.1 |
4.1 |
GO:0030644 |
cellular chloride ion homeostasis(GO:0030644) |
| 2.1 |
8.2 |
GO:1900150 |
regulation of defense response to fungus(GO:1900150) |
| 2.1 |
28.8 |
GO:0051386 |
regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
| 2.1 |
6.2 |
GO:0000448 |
cleavage in ITS2 between 5.8S rRNA and LSU-rRNA of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000448) |
| 2.1 |
10.3 |
GO:0045578 |
negative regulation of B cell differentiation(GO:0045578) |
| 2.1 |
10.3 |
GO:0010804 |
negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 2.1 |
2.1 |
GO:1904861 |
excitatory synapse assembly(GO:1904861) |
| 2.0 |
2.0 |
GO:0015959 |
diadenosine polyphosphate metabolic process(GO:0015959) |
| 2.0 |
12.3 |
GO:0005513 |
detection of calcium ion(GO:0005513) |
| 2.0 |
16.4 |
GO:0097421 |
liver regeneration(GO:0097421) |
| 2.0 |
2.0 |
GO:0046037 |
GMP metabolic process(GO:0046037) |
| 2.0 |
8.1 |
GO:0002086 |
diaphragm contraction(GO:0002086) |
| 2.0 |
2.0 |
GO:0018916 |
nitrobenzene metabolic process(GO:0018916) |
| 2.0 |
16.1 |
GO:0033689 |
negative regulation of osteoblast proliferation(GO:0033689) |
| 2.0 |
18.1 |
GO:0042311 |
vasodilation(GO:0042311) |
| 2.0 |
10.1 |
GO:0006682 |
galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 2.0 |
12.1 |
GO:1900121 |
negative regulation of receptor binding(GO:1900121) |
| 2.0 |
10.0 |
GO:0000447 |
endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 2.0 |
14.1 |
GO:0006012 |
galactose metabolic process(GO:0006012) |
| 2.0 |
18.1 |
GO:0034776 |
response to histamine(GO:0034776) cellular response to histamine(GO:0071420) |
| 2.0 |
2.0 |
GO:0042126 |
nitrate metabolic process(GO:0042126) |
| 2.0 |
2.0 |
GO:0060994 |
regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 2.0 |
6.0 |
GO:0071638 |
negative regulation of monocyte chemotactic protein-1 production(GO:0071638) |
| 2.0 |
8.0 |
GO:0046294 |
formaldehyde catabolic process(GO:0046294) |
| 2.0 |
4.0 |
GO:0010692 |
regulation of alkaline phosphatase activity(GO:0010692) |
| 2.0 |
14.0 |
GO:0036376 |
sodium ion export from cell(GO:0036376) |
| 2.0 |
12.0 |
GO:2000491 |
positive regulation of hepatic stellate cell activation(GO:2000491) |
| 2.0 |
2.0 |
GO:0007181 |
transforming growth factor beta receptor complex assembly(GO:0007181) |
| 2.0 |
2.0 |
GO:0048550 |
negative regulation of pinocytosis(GO:0048550) |
| 2.0 |
4.0 |
GO:0043456 |
regulation of pentose-phosphate shunt(GO:0043456) |
| 2.0 |
13.9 |
GO:2000310 |
regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
| 2.0 |
7.9 |
GO:1902340 |
telomeric heterochromatin assembly(GO:0031509) negative regulation of chromosome condensation(GO:1902340) |
| 2.0 |
23.7 |
GO:0030213 |
hyaluronan biosynthetic process(GO:0030213) |
| 2.0 |
5.9 |
GO:0042045 |
epithelial fluid transport(GO:0042045) |
| 2.0 |
3.9 |
GO:0019731 |
antibacterial humoral response(GO:0019731) |
| 2.0 |
7.9 |
GO:0032782 |
bile acid secretion(GO:0032782) |
| 2.0 |
7.8 |
GO:1902268 |
negative regulation of polyamine transmembrane transport(GO:1902268) |
| 2.0 |
5.9 |
GO:0006207 |
'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 2.0 |
5.9 |
GO:0015886 |
heme transport(GO:0015886) |
| 1.9 |
23.4 |
GO:0002227 |
innate immune response in mucosa(GO:0002227) |
| 1.9 |
11.6 |
GO:1900028 |
negative regulation of ruffle assembly(GO:1900028) |
| 1.9 |
1.9 |
GO:2000097 |
regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 1.9 |
19.3 |
GO:0009312 |
oligosaccharide biosynthetic process(GO:0009312) |
| 1.9 |
5.8 |
GO:0097154 |
GABAergic neuron differentiation(GO:0097154) |
| 1.9 |
3.9 |
GO:0007602 |
phototransduction(GO:0007602) |
| 1.9 |
9.6 |
GO:0006705 |
mineralocorticoid biosynthetic process(GO:0006705) aldosterone biosynthetic process(GO:0032342) |
| 1.9 |
3.8 |
GO:0010885 |
regulation of cholesterol storage(GO:0010885) |
| 1.9 |
7.7 |
GO:0070086 |
ubiquitin-dependent endocytosis(GO:0070086) |
| 1.9 |
1.9 |
GO:0021593 |
rhombomere morphogenesis(GO:0021593) |
| 1.9 |
3.8 |
GO:0015675 |
nickel cation transport(GO:0015675) |
| 1.9 |
13.4 |
GO:0006654 |
phosphatidic acid biosynthetic process(GO:0006654) |
| 1.9 |
3.8 |
GO:0072103 |
glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) |
| 1.9 |
1.9 |
GO:0045763 |
negative regulation of cellular amine metabolic process(GO:0033239) negative regulation of cellular amino acid metabolic process(GO:0045763) |
| 1.9 |
5.7 |
GO:1901421 |
positive regulation of response to alcohol(GO:1901421) |
| 1.9 |
5.7 |
GO:0072717 |
cellular response to actinomycin D(GO:0072717) |
| 1.9 |
3.8 |
GO:0060155 |
platelet dense granule organization(GO:0060155) |
| 1.9 |
15.2 |
GO:0030049 |
muscle filament sliding(GO:0030049) |
| 1.9 |
1.9 |
GO:0032105 |
negative regulation of response to extracellular stimulus(GO:0032105) negative regulation of response to nutrient levels(GO:0032108) |
| 1.9 |
9.5 |
GO:0010991 |
negative regulation of SMAD protein complex assembly(GO:0010991) |
| 1.9 |
22.7 |
GO:2000463 |
positive regulation of excitatory postsynaptic potential(GO:2000463) |
| 1.9 |
37.8 |
GO:0050650 |
chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
| 1.9 |
11.3 |
GO:0015015 |
heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 1.9 |
20.8 |
GO:0050965 |
detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
| 1.9 |
9.4 |
GO:0000492 |
box C/D snoRNP assembly(GO:0000492) |
| 1.9 |
11.3 |
GO:0061304 |
retinal blood vessel morphogenesis(GO:0061304) |
| 1.9 |
22.5 |
GO:2000480 |
negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 1.9 |
1.9 |
GO:0031077 |
post-embryonic camera-type eye development(GO:0031077) |
| 1.9 |
5.6 |
GO:0015712 |
hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 1.9 |
3.7 |
GO:0071873 |
response to norepinephrine(GO:0071873) |
| 1.9 |
5.6 |
GO:0071376 |
response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 1.9 |
5.6 |
GO:0035606 |
peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 1.9 |
7.5 |
GO:0033600 |
negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
| 1.9 |
9.4 |
GO:0060528 |
secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 1.9 |
14.9 |
GO:0071816 |
tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 1.9 |
48.3 |
GO:0048662 |
negative regulation of smooth muscle cell proliferation(GO:0048662) |
| 1.9 |
13.0 |
GO:0060347 |
heart trabecula formation(GO:0060347) |
| 1.9 |
3.7 |
GO:0042053 |
regulation of dopamine metabolic process(GO:0042053) |
| 1.9 |
9.3 |
GO:0071276 |
cellular response to cadmium ion(GO:0071276) |
| 1.9 |
5.6 |
GO:0009838 |
abscission(GO:0009838) |
| 1.8 |
7.4 |
GO:0006481 |
C-terminal protein methylation(GO:0006481) |
| 1.8 |
29.5 |
GO:2000060 |
positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
| 1.8 |
3.7 |
GO:1902498 |
regulation of protein autoubiquitination(GO:1902498) |
| 1.8 |
1.8 |
GO:0045039 |
protein import into mitochondrial inner membrane(GO:0045039) |
| 1.8 |
16.6 |
GO:0042092 |
type 2 immune response(GO:0042092) |
| 1.8 |
12.9 |
GO:1903025 |
regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 1.8 |
5.5 |
GO:1905051 |
regulation of base-excision repair(GO:1905051) positive regulation of base-excision repair(GO:1905053) |
| 1.8 |
20.3 |
GO:0006228 |
UTP biosynthetic process(GO:0006228) |
| 1.8 |
1.8 |
GO:0033088 |
negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 1.8 |
1.8 |
GO:0002437 |
inflammatory response to antigenic stimulus(GO:0002437) |
| 1.8 |
12.9 |
GO:0042745 |
circadian sleep/wake cycle(GO:0042745) |
| 1.8 |
5.5 |
GO:0042535 |
positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
| 1.8 |
3.7 |
GO:0061357 |
Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) positive regulation of Wnt protein secretion(GO:0061357) |
| 1.8 |
3.7 |
GO:0071603 |
endothelial cell-cell adhesion(GO:0071603) |
| 1.8 |
7.3 |
GO:0071340 |
skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
| 1.8 |
5.5 |
GO:0034162 |
toll-like receptor 9 signaling pathway(GO:0034162) |
| 1.8 |
7.3 |
GO:0001990 |
regulation of systemic arterial blood pressure by hormone(GO:0001990) |
| 1.8 |
21.8 |
GO:0000244 |
spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 1.8 |
9.0 |
GO:1904721 |
regulation of mRNA cleavage(GO:0031437) negative regulation of mRNA cleavage(GO:0031438) negative regulation of immunoglobulin secretion(GO:0051025) regulation of mRNA endonucleolytic cleavage involved in unfolded protein response(GO:1904720) negative regulation of mRNA endonucleolytic cleavage involved in unfolded protein response(GO:1904721) |
| 1.8 |
1.8 |
GO:0003219 |
cardiac right ventricle formation(GO:0003219) |
| 1.8 |
5.4 |
GO:0046900 |
tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 1.8 |
1.8 |
GO:0002314 |
germinal center B cell differentiation(GO:0002314) |
| 1.8 |
3.6 |
GO:0046851 |
negative regulation of bone resorption(GO:0045779) negative regulation of bone remodeling(GO:0046851) |
| 1.8 |
34.1 |
GO:0016226 |
iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 1.8 |
1.8 |
GO:0098917 |
retrograde trans-synaptic signaling(GO:0098917) |
| 1.8 |
9.0 |
GO:0016338 |
calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 1.8 |
9.0 |
GO:0071494 |
cellular response to UV-C(GO:0071494) |
| 1.8 |
5.4 |
GO:0051639 |
actin filament network formation(GO:0051639) |
| 1.8 |
3.6 |
GO:0002924 |
negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
| 1.8 |
1.8 |
GO:0034587 |
piRNA metabolic process(GO:0034587) |
| 1.8 |
5.4 |
GO:0097491 |
trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) neural crest cell migration involved in autonomic nervous system development(GO:1901166) |
| 1.8 |
8.9 |
GO:0018364 |
peptidyl-glutamine methylation(GO:0018364) |
| 1.8 |
1.8 |
GO:0034124 |
regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034124) |
| 1.8 |
5.3 |
GO:2001245 |
regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 1.8 |
3.6 |
GO:0030423 |
targeting of mRNA for destruction involved in RNA interference(GO:0030423) |
| 1.8 |
24.9 |
GO:0042407 |
cristae formation(GO:0042407) |
| 1.8 |
10.6 |
GO:0043951 |
negative regulation of cAMP-mediated signaling(GO:0043951) |
| 1.8 |
7.1 |
GO:0099628 |
receptor diffusion trapping(GO:0098953) postsynaptic neurotransmitter receptor diffusion trapping(GO:0098970) neurotransmitter receptor diffusion trapping(GO:0099628) |
| 1.8 |
7.1 |
GO:1904529 |
regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
| 1.8 |
8.8 |
GO:0006002 |
fructose 6-phosphate metabolic process(GO:0006002) |
| 1.8 |
5.3 |
GO:0006659 |
phosphatidylserine biosynthetic process(GO:0006659) |
| 1.8 |
14.1 |
GO:0031639 |
plasminogen activation(GO:0031639) |
| 1.8 |
3.5 |
GO:0032095 |
regulation of response to food(GO:0032095) |
| 1.8 |
15.9 |
GO:0050832 |
defense response to fungus(GO:0050832) |
| 1.8 |
10.6 |
GO:0098703 |
calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
| 1.8 |
7.0 |
GO:0000042 |
protein targeting to Golgi(GO:0000042) |
| 1.8 |
10.5 |
GO:1901030 |
positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
| 1.8 |
10.5 |
GO:0032511 |
late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) |
| 1.8 |
1.8 |
GO:0015822 |
ornithine transport(GO:0015822) |
| 1.8 |
7.0 |
GO:0033631 |
cell-cell adhesion mediated by integrin(GO:0033631) |
| 1.7 |
3.5 |
GO:0000393 |
spliceosomal conformational changes to generate catalytic conformation(GO:0000393) |
| 1.7 |
14.0 |
GO:0051014 |
actin filament severing(GO:0051014) |
| 1.7 |
27.9 |
GO:0008535 |
respiratory chain complex IV assembly(GO:0008535) |
| 1.7 |
12.1 |
GO:1903358 |
regulation of Golgi organization(GO:1903358) |
| 1.7 |
5.2 |
GO:0061739 |
protein lipidation involved in autophagosome assembly(GO:0061739) |
| 1.7 |
15.5 |
GO:0006450 |
regulation of translational fidelity(GO:0006450) |
| 1.7 |
12.0 |
GO:0045607 |
regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 1.7 |
6.8 |
GO:0099566 |
regulation of postsynaptic cytosolic calcium ion concentration(GO:0099566) |
| 1.7 |
6.8 |
GO:0015786 |
UDP-glucose transport(GO:0015786) |
| 1.7 |
3.4 |
GO:0042726 |
flavin-containing compound metabolic process(GO:0042726) |
| 1.7 |
8.5 |
GO:0002121 |
inter-male aggressive behavior(GO:0002121) |
| 1.7 |
3.4 |
GO:0048861 |
leukemia inhibitory factor signaling pathway(GO:0048861) |
| 1.7 |
6.8 |
GO:0061756 |
leukocyte tethering or rolling(GO:0050901) leukocyte adhesion to vascular endothelial cell(GO:0061756) |
| 1.7 |
1.7 |
GO:0009169 |
purine nucleoside monophosphate catabolic process(GO:0009128) ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
| 1.7 |
8.5 |
GO:0031034 |
myosin filament assembly(GO:0031034) striated muscle myosin thick filament assembly(GO:0071688) |
| 1.7 |
8.5 |
GO:1904177 |
regulation of adipose tissue development(GO:1904177) |
| 1.7 |
5.1 |
GO:0035617 |
stress granule disassembly(GO:0035617) |
| 1.7 |
1.7 |
GO:0060371 |
regulation of atrial cardiac muscle cell membrane depolarization(GO:0060371) |
| 1.7 |
15.3 |
GO:0070995 |
NADPH oxidation(GO:0070995) |
| 1.7 |
1.7 |
GO:0050930 |
induction of positive chemotaxis(GO:0050930) |
| 1.7 |
5.1 |
GO:0015803 |
branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
| 1.7 |
1.7 |
GO:0044805 |
late nucleophagy(GO:0044805) |
| 1.7 |
8.4 |
GO:0060837 |
blood vessel endothelial cell differentiation(GO:0060837) |
| 1.7 |
1.7 |
GO:0099563 |
modification of synaptic structure(GO:0099563) |
| 1.7 |
1.7 |
GO:0015744 |
succinate transport(GO:0015744) |
| 1.7 |
8.4 |
GO:0032790 |
ribosome disassembly(GO:0032790) |
| 1.7 |
1.7 |
GO:0032241 |
positive regulation of nucleobase-containing compound transport(GO:0032241) |
| 1.7 |
1.7 |
GO:0035809 |
regulation of urine volume(GO:0035809) |
| 1.7 |
13.4 |
GO:0031167 |
rRNA methylation(GO:0031167) |
| 1.7 |
3.3 |
GO:0048105 |
establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 1.7 |
5.0 |
GO:2000465 |
regulation of glycogen (starch) synthase activity(GO:2000465) |
| 1.7 |
1.7 |
GO:1904809 |
dense core granule localization(GO:0032253) dense core granule transport(GO:1901950) regulation of dense core granule transport(GO:1904809) positive regulation of dense core granule transport(GO:1904811) |
| 1.7 |
13.3 |
GO:0033599 |
regulation of mammary gland epithelial cell proliferation(GO:0033599) |
| 1.7 |
5.0 |
GO:0018125 |
peptidyl-cysteine methylation(GO:0018125) |
| 1.7 |
1.7 |
GO:0060334 |
regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
| 1.7 |
5.0 |
GO:2000858 |
mineralocorticoid secretion(GO:0035931) aldosterone secretion(GO:0035932) regulation of mineralocorticoid secretion(GO:2000855) positive regulation of mineralocorticoid secretion(GO:2000857) regulation of aldosterone secretion(GO:2000858) positive regulation of aldosterone secretion(GO:2000860) |
| 1.6 |
14.8 |
GO:0001516 |
prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
| 1.6 |
1.6 |
GO:0014809 |
regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014809) |
| 1.6 |
1.6 |
GO:0002538 |
arachidonic acid metabolite production involved in inflammatory response(GO:0002538) |
| 1.6 |
3.3 |
GO:0034393 |
positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 1.6 |
3.3 |
GO:1903772 |
regulation of viral budding via host ESCRT complex(GO:1903772) |
| 1.6 |
19.7 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 1.6 |
6.5 |
GO:0007253 |
cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 1.6 |
4.9 |
GO:1900060 |
negative regulation of ceramide biosynthetic process(GO:1900060) |
| 1.6 |
3.3 |
GO:0010700 |
negative regulation of norepinephrine secretion(GO:0010700) |
| 1.6 |
1.6 |
GO:0014061 |
regulation of norepinephrine secretion(GO:0014061) norepinephrine transport(GO:0015874) norepinephrine secretion(GO:0048243) |
| 1.6 |
1.6 |
GO:0002730 |
regulation of dendritic cell cytokine production(GO:0002730) |
| 1.6 |
1.6 |
GO:1990009 |
retinal cell apoptotic process(GO:1990009) |
| 1.6 |
9.7 |
GO:0042346 |
positive regulation of NF-kappaB import into nucleus(GO:0042346) |
| 1.6 |
6.5 |
GO:0071787 |
endoplasmic reticulum tubular network assembly(GO:0071787) |
| 1.6 |
11.3 |
GO:0006561 |
proline biosynthetic process(GO:0006561) |
| 1.6 |
4.8 |
GO:0032474 |
otolith morphogenesis(GO:0032474) |
| 1.6 |
1.6 |
GO:0006776 |
vitamin A metabolic process(GO:0006776) |
| 1.6 |
11.2 |
GO:0005981 |
regulation of glycogen catabolic process(GO:0005981) |
| 1.6 |
22.3 |
GO:1905214 |
regulation of RNA binding(GO:1905214) |
| 1.6 |
9.6 |
GO:0006693 |
prostanoid metabolic process(GO:0006692) prostaglandin metabolic process(GO:0006693) |
| 1.6 |
4.8 |
GO:0051030 |
snRNA transport(GO:0051030) |
| 1.6 |
1.6 |
GO:0002553 |
histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 1.6 |
7.9 |
GO:0006598 |
polyamine catabolic process(GO:0006598) spermine catabolic process(GO:0046208) |
| 1.6 |
3.2 |
GO:1905247 |
positive regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902961) positive regulation of aspartic-type peptidase activity(GO:1905247) |
| 1.6 |
4.8 |
GO:0007196 |
adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
| 1.6 |
11.1 |
GO:0006003 |
fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 1.6 |
64.9 |
GO:0006414 |
translational elongation(GO:0006414) |
| 1.6 |
11.0 |
GO:0019262 |
N-acetylneuraminate catabolic process(GO:0019262) |
| 1.6 |
9.4 |
GO:0016255 |
attachment of GPI anchor to protein(GO:0016255) |
| 1.6 |
6.3 |
GO:0010813 |
neuropeptide catabolic process(GO:0010813) |
| 1.6 |
7.9 |
GO:0006842 |
tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 1.6 |
6.3 |
GO:0014848 |
urinary tract smooth muscle contraction(GO:0014848) |
| 1.6 |
4.7 |
GO:0043084 |
penile erection(GO:0043084) |
| 1.6 |
3.1 |
GO:0043950 |
positive regulation of cAMP-mediated signaling(GO:0043950) |
| 1.6 |
11.0 |
GO:0042492 |
gamma-delta T cell differentiation(GO:0042492) |
| 1.6 |
3.1 |
GO:0002606 |
dendritic cell antigen processing and presentation(GO:0002468) regulation of dendritic cell antigen processing and presentation(GO:0002604) positive regulation of dendritic cell antigen processing and presentation(GO:0002606) |
| 1.6 |
4.7 |
GO:0032815 |
negative regulation of natural killer cell activation(GO:0032815) |
| 1.6 |
18.7 |
GO:0045647 |
negative regulation of erythrocyte differentiation(GO:0045647) |
| 1.6 |
6.2 |
GO:0002317 |
plasma cell differentiation(GO:0002317) |
| 1.6 |
7.8 |
GO:0060134 |
prepulse inhibition(GO:0060134) |
| 1.5 |
4.6 |
GO:0060672 |
epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 1.5 |
7.7 |
GO:1901097 |
negative regulation of autophagosome maturation(GO:1901097) |
| 1.5 |
1.5 |
GO:0072143 |
mesangial cell differentiation(GO:0072007) glomerular mesangial cell differentiation(GO:0072008) mesangial cell development(GO:0072143) glomerular mesangial cell development(GO:0072144) pericyte cell differentiation(GO:1904238) |
| 1.5 |
9.3 |
GO:0051534 |
negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 1.5 |
3.1 |
GO:0035696 |
monocyte extravasation(GO:0035696) regulation of monocyte extravasation(GO:2000437) |
| 1.5 |
3.1 |
GO:0090051 |
negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
| 1.5 |
1.5 |
GO:0001778 |
plasma membrane repair(GO:0001778) |
| 1.5 |
12.3 |
GO:0006362 |
transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 1.5 |
1.5 |
GO:0010359 |
regulation of anion channel activity(GO:0010359) |
| 1.5 |
1.5 |
GO:1901979 |
regulation of inward rectifier potassium channel activity(GO:1901979) |
| 1.5 |
13.7 |
GO:2000653 |
regulation of genetic imprinting(GO:2000653) |
| 1.5 |
3.0 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 1.5 |
15.2 |
GO:0006388 |
tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 1.5 |
10.6 |
GO:0061092 |
regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 1.5 |
3.0 |
GO:0043653 |
mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
| 1.5 |
6.1 |
GO:0031953 |
negative regulation of protein autophosphorylation(GO:0031953) |
| 1.5 |
60.5 |
GO:0006890 |
retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
| 1.5 |
9.0 |
GO:0019346 |
homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
| 1.5 |
1.5 |
GO:0044830 |
modulation by host of viral RNA genome replication(GO:0044830) |
| 1.5 |
4.5 |
GO:0006449 |
regulation of translational termination(GO:0006449) |
| 1.5 |
3.0 |
GO:0051967 |
negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 1.5 |
3.0 |
GO:0045213 |
neurotransmitter receptor metabolic process(GO:0045213) |
| 1.5 |
11.9 |
GO:0032469 |
endoplasmic reticulum calcium ion homeostasis(GO:0032469) |
| 1.5 |
1.5 |
GO:0042069 |
regulation of catecholamine metabolic process(GO:0042069) |
| 1.5 |
7.5 |
GO:1902255 |
positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
| 1.5 |
25.3 |
GO:0051764 |
actin crosslink formation(GO:0051764) |
| 1.5 |
19.3 |
GO:1901898 |
negative regulation of relaxation of cardiac muscle(GO:1901898) |
| 1.5 |
5.9 |
GO:0006564 |
L-serine biosynthetic process(GO:0006564) |
| 1.5 |
8.9 |
GO:0071577 |
zinc II ion transmembrane transport(GO:0071577) |
| 1.5 |
17.7 |
GO:0070842 |
aggresome assembly(GO:0070842) |
| 1.5 |
1.5 |
GO:0009125 |
nucleoside monophosphate catabolic process(GO:0009125) |
| 1.5 |
7.4 |
GO:0008343 |
adult feeding behavior(GO:0008343) |
| 1.5 |
5.9 |
GO:0021914 |
negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 1.5 |
2.9 |
GO:1901661 |
quinone metabolic process(GO:1901661) |
| 1.5 |
5.9 |
GO:0046604 |
positive regulation of mitotic centrosome separation(GO:0046604) |
| 1.5 |
2.9 |
GO:0030860 |
regulation of polarized epithelial cell differentiation(GO:0030860) |
| 1.5 |
5.8 |
GO:0045603 |
positive regulation of endothelial cell differentiation(GO:0045603) |
| 1.5 |
8.8 |
GO:0071035 |
nuclear ncRNA surveillance(GO:0071029) nuclear polyadenylation-dependent rRNA catabolic process(GO:0071035) nuclear polyadenylation-dependent ncRNA catabolic process(GO:0071046) |
| 1.5 |
4.4 |
GO:0045760 |
positive regulation of action potential(GO:0045760) |
| 1.5 |
1.5 |
GO:0046070 |
dGTP metabolic process(GO:0046070) purine deoxyribonucleoside metabolic process(GO:0046122) |
| 1.5 |
2.9 |
GO:0072656 |
maintenance of protein location in mitochondrion(GO:0072656) |
| 1.5 |
5.8 |
GO:0002862 |
negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 1.5 |
18.9 |
GO:0006734 |
NADH metabolic process(GO:0006734) |
| 1.5 |
4.4 |
GO:0061763 |
multivesicular body-lysosome fusion(GO:0061763) |
| 1.4 |
8.7 |
GO:0006013 |
mannose metabolic process(GO:0006013) |
| 1.4 |
1.4 |
GO:1903012 |
positive regulation of bone development(GO:1903012) |
| 1.4 |
1.4 |
GO:0002710 |
negative regulation of T cell mediated immunity(GO:0002710) |
| 1.4 |
14.4 |
GO:0033623 |
regulation of integrin activation(GO:0033623) |
| 1.4 |
4.3 |
GO:1901052 |
sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
| 1.4 |
7.2 |
GO:0030916 |
otic vesicle formation(GO:0030916) |
| 1.4 |
18.6 |
GO:0045026 |
plasma membrane fusion(GO:0045026) |
| 1.4 |
2.9 |
GO:0009446 |
putrescine biosynthetic process(GO:0009446) |
| 1.4 |
1.4 |
GO:0061535 |
glutamate secretion, neurotransmission(GO:0061535) |
| 1.4 |
30.0 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 1.4 |
1.4 |
GO:0060392 |
negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 1.4 |
4.3 |
GO:0043461 |
proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 1.4 |
2.8 |
GO:0006702 |
androgen biosynthetic process(GO:0006702) |
| 1.4 |
1.4 |
GO:0072203 |
cell proliferation involved in metanephros development(GO:0072203) |
| 1.4 |
8.5 |
GO:0060394 |
negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 1.4 |
1.4 |
GO:0001777 |
T cell homeostatic proliferation(GO:0001777) |
| 1.4 |
9.9 |
GO:0032525 |
somite rostral/caudal axis specification(GO:0032525) |
| 1.4 |
4.2 |
GO:0010796 |
regulation of multivesicular body size(GO:0010796) |
| 1.4 |
2.8 |
GO:0055064 |
chloride ion homeostasis(GO:0055064) |
| 1.4 |
4.2 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 1.4 |
8.4 |
GO:1902902 |
negative regulation of autophagosome assembly(GO:1902902) |
| 1.4 |
5.6 |
GO:1902235 |
regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902235) |
| 1.4 |
4.2 |
GO:0002014 |
vasoconstriction of artery involved in ischemic response to lowering of systemic arterial blood pressure(GO:0002014) |
| 1.4 |
5.6 |
GO:1903301 |
positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
| 1.4 |
2.8 |
GO:0015866 |
ADP transport(GO:0015866) |
| 1.4 |
66.5 |
GO:0032543 |
mitochondrial translation(GO:0032543) |
| 1.4 |
11.1 |
GO:0042572 |
retinol metabolic process(GO:0042572) |
| 1.4 |
96.5 |
GO:0042273 |
ribosomal large subunit biogenesis(GO:0042273) |
| 1.4 |
16.5 |
GO:0045063 |
T-helper 1 cell differentiation(GO:0045063) |
| 1.4 |
8.2 |
GO:0090315 |
negative regulation of protein targeting to membrane(GO:0090315) |
| 1.4 |
6.9 |
GO:0006189 |
'de novo' IMP biosynthetic process(GO:0006189) |
| 1.4 |
2.7 |
GO:0000957 |
mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 1.4 |
4.1 |
GO:0042268 |
regulation of cytolysis(GO:0042268) |
| 1.4 |
5.5 |
GO:0060050 |
positive regulation of protein glycosylation(GO:0060050) |
| 1.4 |
5.4 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 1.4 |
2.7 |
GO:1903817 |
negative regulation of voltage-gated potassium channel activity(GO:1903817) |
| 1.4 |
1.4 |
GO:0032329 |
serine transport(GO:0032329) |
| 1.3 |
2.7 |
GO:0042637 |
catagen(GO:0042637) |
| 1.3 |
16.2 |
GO:0002931 |
response to ischemia(GO:0002931) |
| 1.3 |
4.0 |
GO:1903726 |
negative regulation of phospholipid metabolic process(GO:1903726) |
| 1.3 |
5.4 |
GO:0017183 |
peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 1.3 |
2.7 |
GO:0097186 |
amelogenesis(GO:0097186) |
| 1.3 |
4.0 |
GO:0001830 |
trophectodermal cell fate commitment(GO:0001830) |
| 1.3 |
6.7 |
GO:0042401 |
amine biosynthetic process(GO:0009309) cellular biogenic amine biosynthetic process(GO:0042401) |
| 1.3 |
1.3 |
GO:0086046 |
membrane depolarization during SA node cell action potential(GO:0086046) |
| 1.3 |
8.1 |
GO:0006119 |
oxidative phosphorylation(GO:0006119) |
| 1.3 |
4.0 |
GO:0048069 |
eye pigmentation(GO:0048069) |
| 1.3 |
5.4 |
GO:0032439 |
endosome localization(GO:0032439) |
| 1.3 |
4.0 |
GO:1902527 |
positive regulation of protein monoubiquitination(GO:1902527) |
| 1.3 |
5.3 |
GO:0010447 |
response to acidic pH(GO:0010447) |
| 1.3 |
4.0 |
GO:0019885 |
antigen processing and presentation of endogenous peptide antigen via MHC class I(GO:0019885) |
| 1.3 |
29.3 |
GO:0045838 |
positive regulation of membrane potential(GO:0045838) |
| 1.3 |
1.3 |
GO:0061042 |
vascular wound healing(GO:0061042) |
| 1.3 |
5.3 |
GO:0031666 |
positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 1.3 |
1.3 |
GO:2000254 |
regulation of male germ cell proliferation(GO:2000254) |
| 1.3 |
6.6 |
GO:0003253 |
cardiac neural crest cell migration involved in outflow tract morphogenesis(GO:0003253) |
| 1.3 |
20.9 |
GO:0000338 |
protein deneddylation(GO:0000338) |
| 1.3 |
14.4 |
GO:0006516 |
glycoprotein catabolic process(GO:0006516) |
| 1.3 |
13.1 |
GO:0006044 |
N-acetylglucosamine metabolic process(GO:0006044) |
| 1.3 |
3.9 |
GO:0006669 |
sphinganine-1-phosphate biosynthetic process(GO:0006669) |
| 1.3 |
1.3 |
GO:1904526 |
regulation of microtubule binding(GO:1904526) |
| 1.3 |
6.4 |
GO:0061450 |
trophoblast cell migration(GO:0061450) regulation of trophoblast cell migration(GO:1901163) |
| 1.3 |
11.6 |
GO:0061051 |
positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
| 1.3 |
2.6 |
GO:0015721 |
bile acid and bile salt transport(GO:0015721) |
| 1.3 |
1.3 |
GO:2000401 |
regulation of lymphocyte migration(GO:2000401) |
| 1.3 |
1.3 |
GO:0008207 |
C21-steroid hormone metabolic process(GO:0008207) |
| 1.3 |
3.8 |
GO:0006788 |
heme oxidation(GO:0006788) |
| 1.3 |
26.8 |
GO:0006891 |
intra-Golgi vesicle-mediated transport(GO:0006891) |
| 1.3 |
5.1 |
GO:1904352 |
positive regulation of protein catabolic process in the vacuole(GO:1904352) |
| 1.3 |
3.8 |
GO:1900226 |
negative regulation of NLRP3 inflammasome complex assembly(GO:1900226) |
| 1.3 |
3.8 |
GO:0046368 |
GDP-L-fucose metabolic process(GO:0046368) |
| 1.3 |
1.3 |
GO:2001184 |
regulation of interleukin-12 secretion(GO:2001182) positive regulation of interleukin-12 secretion(GO:2001184) |
| 1.3 |
2.5 |
GO:0007406 |
negative regulation of neuroblast proliferation(GO:0007406) |
| 1.3 |
1.3 |
GO:0035426 |
extracellular matrix-cell signaling(GO:0035426) |
| 1.3 |
1.3 |
GO:1901228 |
positive regulation of transcription from RNA polymerase II promoter involved in heart development(GO:1901228) |
| 1.3 |
2.5 |
GO:0040031 |
snRNA modification(GO:0040031) |
| 1.2 |
3.7 |
GO:0032026 |
response to magnesium ion(GO:0032026) |
| 1.2 |
1.2 |
GO:0097089 |
methyl-branched fatty acid metabolic process(GO:0097089) |
| 1.2 |
3.7 |
GO:0006563 |
L-serine metabolic process(GO:0006563) |
| 1.2 |
5.0 |
GO:0001550 |
ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 1.2 |
3.7 |
GO:0036090 |
cleavage furrow ingression(GO:0036090) |
| 1.2 |
11.1 |
GO:0042744 |
hydrogen peroxide catabolic process(GO:0042744) |
| 1.2 |
16.0 |
GO:0001553 |
luteinization(GO:0001553) |
| 1.2 |
2.5 |
GO:0002159 |
desmosome assembly(GO:0002159) |
| 1.2 |
1.2 |
GO:0048703 |
embryonic viscerocranium morphogenesis(GO:0048703) |
| 1.2 |
6.1 |
GO:0061000 |
negative regulation of dendritic spine development(GO:0061000) |
| 1.2 |
6.1 |
GO:0046085 |
adenosine metabolic process(GO:0046085) |
| 1.2 |
3.7 |
GO:0044539 |
long-chain fatty acid import(GO:0044539) |
| 1.2 |
3.6 |
GO:0052428 |
modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 1.2 |
2.4 |
GO:2000811 |
negative regulation of anoikis(GO:2000811) |
| 1.2 |
3.6 |
GO:0015817 |
histidine transport(GO:0015817) |
| 1.2 |
6.0 |
GO:0034114 |
regulation of heterotypic cell-cell adhesion(GO:0034114) |
| 1.2 |
6.0 |
GO:0051013 |
microtubule severing(GO:0051013) |
| 1.2 |
3.6 |
GO:0042560 |
10-formyltetrahydrofolate catabolic process(GO:0009258) folic acid-containing compound catabolic process(GO:0009397) pteridine-containing compound catabolic process(GO:0042560) |
| 1.2 |
1.2 |
GO:0045112 |
integrin biosynthetic process(GO:0045112) |
| 1.2 |
10.8 |
GO:0032288 |
myelin assembly(GO:0032288) |
| 1.2 |
2.4 |
GO:0045776 |
negative regulation of blood pressure(GO:0045776) |
| 1.2 |
3.6 |
GO:0071918 |
urea transmembrane transport(GO:0071918) |
| 1.2 |
1.2 |
GO:2000646 |
positive regulation of receptor catabolic process(GO:2000646) |
| 1.2 |
3.6 |
GO:0048265 |
response to pain(GO:0048265) |
| 1.2 |
2.4 |
GO:0035526 |
retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 1.2 |
8.3 |
GO:0070301 |
cellular response to hydrogen peroxide(GO:0070301) |
| 1.2 |
5.9 |
GO:0090050 |
positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
| 1.2 |
4.7 |
GO:0015812 |
gamma-aminobutyric acid secretion(GO:0014051) gamma-aminobutyric acid transport(GO:0015812) |
| 1.2 |
4.7 |
GO:0016557 |
peroxisome membrane biogenesis(GO:0016557) |
| 1.2 |
3.6 |
GO:0034316 |
negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) negative regulation of actin nucleation(GO:0051126) |
| 1.2 |
4.7 |
GO:1901387 |
positive regulation of voltage-gated calcium channel activity(GO:1901387) |
| 1.2 |
2.4 |
GO:0071550 |
death-inducing signaling complex assembly(GO:0071550) |
| 1.2 |
1.2 |
GO:0042832 |
defense response to protozoan(GO:0042832) |
| 1.2 |
5.9 |
GO:0031424 |
keratinization(GO:0031424) |
| 1.2 |
8.3 |
GO:0005980 |
polysaccharide catabolic process(GO:0000272) glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
| 1.2 |
1.2 |
GO:0032914 |
positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 1.2 |
1.2 |
GO:0045932 |
negative regulation of muscle contraction(GO:0045932) |
| 1.2 |
4.7 |
GO:0006685 |
sphingomyelin catabolic process(GO:0006685) |
| 1.2 |
1.2 |
GO:1904207 |
chemokine (C-C motif) ligand 2 secretion(GO:0035926) regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904207) positive regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904209) |
| 1.2 |
2.4 |
GO:1904742 |
regulation of telomeric DNA binding(GO:1904742) |
| 1.2 |
5.9 |
GO:0006878 |
cellular copper ion homeostasis(GO:0006878) |
| 1.2 |
3.5 |
GO:0048548 |
regulation of pinocytosis(GO:0048548) |
| 1.2 |
1.2 |
GO:1900038 |
negative regulation of cellular response to hypoxia(GO:1900038) |
| 1.2 |
2.3 |
GO:1903378 |
positive regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903378) |
| 1.2 |
1.2 |
GO:0090219 |
negative regulation of lipid kinase activity(GO:0090219) |
| 1.2 |
1.2 |
GO:0009113 |
purine nucleobase biosynthetic process(GO:0009113) |
| 1.2 |
3.5 |
GO:0006662 |
glycerol ether metabolic process(GO:0006662) ether metabolic process(GO:0018904) |
| 1.2 |
2.3 |
GO:0060830 |
ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 1.2 |
1.2 |
GO:1905165 |
polyamine transport(GO:0015846) regulation of protein catabolic process in the vacuole(GO:1904350) regulation of lysosomal protein catabolic process(GO:1905165) |
| 1.2 |
5.8 |
GO:0044130 |
negative regulation of growth of symbiont in host(GO:0044130) negative regulation of growth of symbiont involved in interaction with host(GO:0044146) |
| 1.2 |
1.2 |
GO:0007128 |
meiotic prophase I(GO:0007128) prophase(GO:0051324) |
| 1.2 |
2.3 |
GO:0002339 |
B cell selection(GO:0002339) |
| 1.2 |
3.5 |
GO:0023041 |
neuronal signal transduction(GO:0023041) |
| 1.1 |
9.2 |
GO:1900262 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 1.1 |
4.6 |
GO:1903553 |
positive regulation of extracellular exosome assembly(GO:1903553) |
| 1.1 |
2.3 |
GO:0071051 |
polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
| 1.1 |
1.1 |
GO:0000423 |
macromitophagy(GO:0000423) |
| 1.1 |
3.4 |
GO:0035021 |
negative regulation of Rac protein signal transduction(GO:0035021) |
| 1.1 |
8.0 |
GO:0060670 |
branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 1.1 |
3.4 |
GO:0006627 |
protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 1.1 |
4.5 |
GO:0048539 |
bone marrow development(GO:0048539) |
| 1.1 |
13.6 |
GO:0032785 |
negative regulation of DNA-templated transcription, elongation(GO:0032785) |
| 1.1 |
1.1 |
GO:0044034 |
negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 1.1 |
2.3 |
GO:0031642 |
negative regulation of myelination(GO:0031642) |
| 1.1 |
3.4 |
GO:0051045 |
negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
| 1.1 |
4.5 |
GO:0030576 |
Cajal body organization(GO:0030576) |
| 1.1 |
1.1 |
GO:0035937 |
estrogen secretion(GO:0035937) estradiol secretion(GO:0035938) regulation of estrogen secretion(GO:2000861) regulation of estradiol secretion(GO:2000864) |
| 1.1 |
4.5 |
GO:0006857 |
oligopeptide transport(GO:0006857) |
| 1.1 |
2.2 |
GO:0006566 |
threonine metabolic process(GO:0006566) |
| 1.1 |
6.7 |
GO:0035887 |
aortic smooth muscle cell differentiation(GO:0035887) |
| 1.1 |
4.4 |
GO:0006432 |
phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 1.1 |
1.1 |
GO:0090241 |
negative regulation of histone H4 acetylation(GO:0090241) |
| 1.1 |
3.3 |
GO:1900042 |
positive regulation of interleukin-2 secretion(GO:1900042) |
| 1.1 |
3.3 |
GO:0045019 |
negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
| 1.1 |
15.4 |
GO:0060306 |
regulation of membrane repolarization(GO:0060306) |
| 1.1 |
8.8 |
GO:1901162 |
serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
| 1.1 |
3.3 |
GO:0035855 |
megakaryocyte development(GO:0035855) |
| 1.1 |
14.3 |
GO:0006491 |
N-glycan processing(GO:0006491) |
| 1.1 |
8.8 |
GO:0048268 |
clathrin coat assembly(GO:0048268) |
| 1.1 |
5.5 |
GO:0071361 |
cellular response to ethanol(GO:0071361) |
| 1.1 |
1.1 |
GO:0098735 |
positive regulation of the force of heart contraction(GO:0098735) |
| 1.1 |
3.3 |
GO:0072734 |
response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
| 1.1 |
5.5 |
GO:0002526 |
acute inflammatory response(GO:0002526) |
| 1.1 |
7.7 |
GO:0019884 |
antigen processing and presentation of exogenous antigen(GO:0019884) |
| 1.1 |
3.3 |
GO:0070212 |
protein poly-ADP-ribosylation(GO:0070212) |
| 1.1 |
20.7 |
GO:0006910 |
phagocytosis, recognition(GO:0006910) |
| 1.1 |
4.4 |
GO:0090282 |
positive regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071931) positive regulation of transcription involved in G2/M transition of mitotic cell cycle(GO:0090282) |
| 1.1 |
17.4 |
GO:0015701 |
bicarbonate transport(GO:0015701) |
| 1.1 |
5.4 |
GO:0031295 |
T cell costimulation(GO:0031295) |
| 1.1 |
8.7 |
GO:0032715 |
negative regulation of interleukin-6 production(GO:0032715) |
| 1.1 |
6.5 |
GO:0042989 |
sequestering of actin monomers(GO:0042989) |
| 1.1 |
5.4 |
GO:0035845 |
photoreceptor cell outer segment organization(GO:0035845) |
| 1.1 |
36.6 |
GO:0006778 |
porphyrin-containing compound metabolic process(GO:0006778) |
| 1.1 |
27.8 |
GO:0045806 |
negative regulation of endocytosis(GO:0045806) |
| 1.1 |
2.1 |
GO:0003417 |
growth plate cartilage development(GO:0003417) |
| 1.1 |
1.1 |
GO:0016559 |
peroxisome fission(GO:0016559) |
| 1.1 |
6.4 |
GO:1903755 |
regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 1.1 |
5.3 |
GO:0051481 |
negative regulation of cytosolic calcium ion concentration(GO:0051481) |
| 1.1 |
27.5 |
GO:0031146 |
SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 1.1 |
2.1 |
GO:0006534 |
cysteine metabolic process(GO:0006534) |
| 1.1 |
5.3 |
GO:0031293 |
membrane protein intracellular domain proteolysis(GO:0031293) |
| 1.1 |
1.1 |
GO:0031087 |
deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 1.1 |
3.2 |
GO:0034629 |
cellular protein complex localization(GO:0034629) |
| 1.0 |
3.1 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 1.0 |
4.2 |
GO:0006438 |
valyl-tRNA aminoacylation(GO:0006438) |
| 1.0 |
4.2 |
GO:1900016 |
negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 1.0 |
4.2 |
GO:0001963 |
synaptic transmission, dopaminergic(GO:0001963) |
| 1.0 |
7.3 |
GO:0043615 |
astrocyte cell migration(GO:0043615) |
| 1.0 |
1.0 |
GO:1904798 |
positive regulation of core promoter binding(GO:1904798) |
| 1.0 |
5.2 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 1.0 |
1.0 |
GO:0072592 |
oxygen metabolic process(GO:0072592) |
| 1.0 |
8.2 |
GO:0035036 |
binding of sperm to zona pellucida(GO:0007339) sperm-egg recognition(GO:0035036) |
| 1.0 |
1.0 |
GO:0060591 |
chondroblast differentiation(GO:0060591) |
| 1.0 |
2.1 |
GO:0046015 |
regulation of transcription by glucose(GO:0046015) |
| 1.0 |
2.1 |
GO:0071941 |
nitrogen cycle metabolic process(GO:0071941) |
| 1.0 |
2.1 |
GO:2000157 |
regulation of protein K48-linked deubiquitination(GO:1903093) negative regulation of protein K48-linked deubiquitination(GO:1903094) negative regulation of ubiquitin-specific protease activity(GO:2000157) |
| 1.0 |
26.6 |
GO:0032011 |
ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 1.0 |
2.0 |
GO:0035964 |
COPI-coated vesicle budding(GO:0035964) |
| 1.0 |
6.1 |
GO:0036444 |
calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 1.0 |
16.3 |
GO:0034389 |
lipid particle organization(GO:0034389) |
| 1.0 |
1.0 |
GO:0071169 |
establishment of protein localization to chromatin(GO:0071169) |
| 1.0 |
1.0 |
GO:0033140 |
regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033139) negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 1.0 |
7.0 |
GO:1902259 |
regulation of delayed rectifier potassium channel activity(GO:1902259) |
| 1.0 |
6.0 |
GO:2000786 |
positive regulation of autophagosome assembly(GO:2000786) |
| 1.0 |
2.0 |
GO:0019852 |
L-ascorbic acid metabolic process(GO:0019852) |
| 1.0 |
1.0 |
GO:0016246 |
RNA interference(GO:0016246) |
| 1.0 |
1.0 |
GO:0003241 |
growth involved in heart morphogenesis(GO:0003241) |
| 1.0 |
7.9 |
GO:0016139 |
glycoside catabolic process(GO:0016139) |
| 1.0 |
7.9 |
GO:0060052 |
neurofilament cytoskeleton organization(GO:0060052) |
| 1.0 |
2.0 |
GO:0033962 |
cytoplasmic mRNA processing body assembly(GO:0033962) |
| 1.0 |
7.9 |
GO:0090280 |
positive regulation of calcium ion import(GO:0090280) |
| 1.0 |
2.0 |
GO:0006011 |
UDP-glucose metabolic process(GO:0006011) |
| 1.0 |
5.9 |
GO:0042104 |
positive regulation of activated T cell proliferation(GO:0042104) |
| 1.0 |
1.0 |
GO:0014820 |
tonic smooth muscle contraction(GO:0014820) |
| 1.0 |
2.9 |
GO:0006000 |
fructose metabolic process(GO:0006000) |
| 1.0 |
1.0 |
GO:0048793 |
pronephros development(GO:0048793) |
| 1.0 |
9.7 |
GO:0061179 |
negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 1.0 |
9.7 |
GO:0045662 |
negative regulation of myoblast differentiation(GO:0045662) |
| 1.0 |
1.0 |
GO:0042663 |
regulation of endodermal cell fate specification(GO:0042663) |
| 1.0 |
1.0 |
GO:0009713 |
catechol-containing compound biosynthetic process(GO:0009713) catecholamine biosynthetic process(GO:0042423) |
| 1.0 |
2.9 |
GO:0010765 |
positive regulation of sodium ion transport(GO:0010765) |
| 1.0 |
1.9 |
GO:0009405 |
pathogenesis(GO:0009405) |
| 1.0 |
7.7 |
GO:0035774 |
positive regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0035774) |
| 1.0 |
1.0 |
GO:0016240 |
autophagosome docking(GO:0016240) |
| 1.0 |
1.9 |
GO:0046104 |
thymidine metabolic process(GO:0046104) |
| 1.0 |
1.9 |
GO:0010641 |
positive regulation of platelet-derived growth factor receptor signaling pathway(GO:0010641) |
| 1.0 |
6.7 |
GO:0046322 |
negative regulation of fatty acid oxidation(GO:0046322) |
| 1.0 |
1.0 |
GO:1902445 |
regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 1.0 |
3.8 |
GO:0032049 |
cardiolipin biosynthetic process(GO:0032049) |
| 1.0 |
1.0 |
GO:0032074 |
negative regulation of nuclease activity(GO:0032074) |
| 1.0 |
7.6 |
GO:0001921 |
positive regulation of receptor recycling(GO:0001921) |
| 1.0 |
3.8 |
GO:0019348 |
dolichol metabolic process(GO:0019348) |
| 1.0 |
4.8 |
GO:0061724 |
lipophagy(GO:0061724) |
| 1.0 |
1.0 |
GO:0046952 |
ketone body catabolic process(GO:0046952) |
| 1.0 |
6.7 |
GO:0019835 |
cytolysis(GO:0019835) |
| 0.9 |
1.9 |
GO:0010566 |
regulation of ketone biosynthetic process(GO:0010566) |
| 0.9 |
2.8 |
GO:0044208 |
'de novo' AMP biosynthetic process(GO:0044208) |
| 0.9 |
0.9 |
GO:0009226 |
nucleotide-sugar biosynthetic process(GO:0009226) |
| 0.9 |
5.6 |
GO:0003254 |
regulation of membrane depolarization(GO:0003254) |
| 0.9 |
8.5 |
GO:0006047 |
UDP-N-acetylglucosamine metabolic process(GO:0006047) |
| 0.9 |
3.8 |
GO:0042693 |
muscle cell fate commitment(GO:0042693) |
| 0.9 |
1.9 |
GO:0046110 |
xanthine metabolic process(GO:0046110) |
| 0.9 |
8.3 |
GO:0009143 |
nucleoside triphosphate catabolic process(GO:0009143) |
| 0.9 |
5.5 |
GO:0071236 |
cellular response to antibiotic(GO:0071236) |
| 0.9 |
2.7 |
GO:0060267 |
positive regulation of respiratory burst(GO:0060267) |
| 0.9 |
1.8 |
GO:0007066 |
female meiosis sister chromatid cohesion(GO:0007066) |
| 0.9 |
3.6 |
GO:0060456 |
positive regulation of digestive system process(GO:0060456) |
| 0.9 |
5.4 |
GO:0006390 |
transcription from mitochondrial promoter(GO:0006390) |
| 0.9 |
1.8 |
GO:0072537 |
fibroblast activation(GO:0072537) |
| 0.9 |
0.9 |
GO:0014874 |
response to stimulus involved in regulation of muscle adaptation(GO:0014874) |
| 0.9 |
11.7 |
GO:0006904 |
vesicle docking involved in exocytosis(GO:0006904) |
| 0.9 |
9.9 |
GO:0016191 |
synaptic vesicle uncoating(GO:0016191) |
| 0.9 |
2.7 |
GO:0035928 |
RNA import into mitochondrion(GO:0035927) rRNA import into mitochondrion(GO:0035928) |
| 0.9 |
0.9 |
GO:0006901 |
vesicle coating(GO:0006901) vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
| 0.9 |
3.6 |
GO:1902176 |
negative regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902176) |
| 0.9 |
1.8 |
GO:0043278 |
response to morphine(GO:0043278) |
| 0.9 |
1.8 |
GO:0043144 |
snoRNA processing(GO:0043144) |
| 0.9 |
0.9 |
GO:1903265 |
positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.9 |
0.9 |
GO:0032230 |
positive regulation of synaptic transmission, GABAergic(GO:0032230) |
| 0.9 |
3.5 |
GO:0046909 |
intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.9 |
4.4 |
GO:1904714 |
regulation of chaperone-mediated autophagy(GO:1904714) |
| 0.9 |
5.3 |
GO:2001241 |
positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.9 |
2.6 |
GO:0098969 |
neurotransmitter receptor transport to plasma membrane(GO:0098877) neurotransmitter receptor transport to postsynaptic membrane(GO:0098969) establishment of protein localization to postsynaptic membrane(GO:1903540) |
| 0.9 |
2.6 |
GO:0042993 |
positive regulation of transcription factor import into nucleus(GO:0042993) |
| 0.9 |
3.5 |
GO:0014010 |
Schwann cell proliferation(GO:0014010) |
| 0.9 |
3.5 |
GO:0032692 |
negative regulation of interleukin-1 production(GO:0032692) |
| 0.9 |
2.6 |
GO:0046688 |
response to copper ion(GO:0046688) |
| 0.9 |
17.4 |
GO:0009649 |
entrainment of circadian clock(GO:0009649) |
| 0.9 |
0.9 |
GO:0046007 |
negative regulation of activated T cell proliferation(GO:0046007) |
| 0.9 |
1.7 |
GO:1902031 |
regulation of NADP metabolic process(GO:1902031) |
| 0.9 |
4.3 |
GO:1905098 |
negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
| 0.9 |
29.9 |
GO:0035456 |
response to interferon-beta(GO:0035456) |
| 0.9 |
4.3 |
GO:0002098 |
tRNA wobble uridine modification(GO:0002098) |
| 0.9 |
0.9 |
GO:1901678 |
iron coordination entity transport(GO:1901678) |
| 0.8 |
4.2 |
GO:0051205 |
protein insertion into membrane(GO:0051205) |
| 0.8 |
2.5 |
GO:0072531 |
pyrimidine-containing compound transmembrane transport(GO:0072531) |
| 0.8 |
1.7 |
GO:0051491 |
positive regulation of filopodium assembly(GO:0051491) |
| 0.8 |
1.7 |
GO:1900369 |
negative regulation of RNA interference(GO:1900369) |
| 0.8 |
1.7 |
GO:0060025 |
regulation of synaptic activity(GO:0060025) |
| 0.8 |
6.6 |
GO:0032411 |
positive regulation of transporter activity(GO:0032411) |
| 0.8 |
0.8 |
GO:0006419 |
alanyl-tRNA aminoacylation(GO:0006419) |
| 0.8 |
1.7 |
GO:0060346 |
bone trabecula formation(GO:0060346) |
| 0.8 |
0.8 |
GO:0019511 |
peptidyl-proline hydroxylation(GO:0019511) |
| 0.8 |
5.8 |
GO:0001731 |
formation of translation preinitiation complex(GO:0001731) |
| 0.8 |
7.4 |
GO:0006268 |
DNA unwinding involved in DNA replication(GO:0006268) |
| 0.8 |
2.5 |
GO:0044268 |
multicellular organismal protein metabolic process(GO:0044268) |
| 0.8 |
3.3 |
GO:0090136 |
epithelial cell-cell adhesion(GO:0090136) |
| 0.8 |
7.3 |
GO:0038203 |
TORC2 signaling(GO:0038203) |
| 0.8 |
1.6 |
GO:0048102 |
autophagic cell death(GO:0048102) |
| 0.8 |
1.6 |
GO:0097411 |
hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.8 |
2.4 |
GO:0051152 |
positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.8 |
7.3 |
GO:0048619 |
embryonic hindgut morphogenesis(GO:0048619) |
| 0.8 |
2.4 |
GO:0070813 |
hydrogen sulfide metabolic process(GO:0070813) |
| 0.8 |
5.7 |
GO:0018065 |
protein-cofactor linkage(GO:0018065) |
| 0.8 |
2.4 |
GO:0050913 |
sensory perception of bitter taste(GO:0050913) |
| 0.8 |
4.8 |
GO:0034975 |
protein folding in endoplasmic reticulum(GO:0034975) |
| 0.8 |
3.2 |
GO:0045721 |
negative regulation of gluconeogenesis(GO:0045721) |
| 0.8 |
3.2 |
GO:0071025 |
RNA surveillance(GO:0071025) |
| 0.8 |
24.5 |
GO:0022900 |
electron transport chain(GO:0022900) |
| 0.8 |
1.6 |
GO:0007158 |
neuron cell-cell adhesion(GO:0007158) |
| 0.8 |
2.4 |
GO:0021756 |
striatum development(GO:0021756) |
| 0.8 |
1.6 |
GO:0035584 |
calcium-mediated signaling using intracellular calcium source(GO:0035584) |
| 0.8 |
1.6 |
GO:0051969 |
regulation of transmission of nerve impulse(GO:0051969) |
| 0.8 |
3.1 |
GO:1902236 |
negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
| 0.8 |
1.6 |
GO:0030168 |
platelet activation(GO:0030168) |
| 0.8 |
3.1 |
GO:0071712 |
ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.8 |
2.3 |
GO:0002002 |
regulation of angiotensin levels in blood(GO:0002002) |
| 0.8 |
2.3 |
GO:0015772 |
disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.8 |
3.1 |
GO:0045324 |
late endosome to vacuole transport(GO:0045324) |
| 0.8 |
1.5 |
GO:0006550 |
isoleucine catabolic process(GO:0006550) |
| 0.8 |
3.1 |
GO:0042138 |
meiotic DNA double-strand break formation(GO:0042138) |
| 0.8 |
2.3 |
GO:1900242 |
regulation of synaptic vesicle endocytosis(GO:1900242) |
| 0.8 |
9.2 |
GO:0000188 |
inactivation of MAPK activity(GO:0000188) |
| 0.8 |
0.8 |
GO:0035459 |
cargo loading into vesicle(GO:0035459) |
| 0.8 |
5.4 |
GO:0016486 |
peptide hormone processing(GO:0016486) |
| 0.8 |
3.8 |
GO:1901029 |
negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.8 |
2.3 |
GO:0046339 |
diacylglycerol metabolic process(GO:0046339) |
| 0.8 |
11.4 |
GO:0048011 |
neurotrophin TRK receptor signaling pathway(GO:0048011) |
| 0.8 |
2.3 |
GO:0061154 |
endothelial tube morphogenesis(GO:0061154) |
| 0.8 |
3.0 |
GO:0019509 |
L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.8 |
1.5 |
GO:0070889 |
platelet alpha granule organization(GO:0070889) |
| 0.8 |
2.3 |
GO:0032687 |
negative regulation of interferon-alpha production(GO:0032687) |
| 0.8 |
3.8 |
GO:0009642 |
response to light intensity(GO:0009642) |
| 0.8 |
17.4 |
GO:0034605 |
cellular response to heat(GO:0034605) |
| 0.8 |
0.8 |
GO:0055095 |
lipoprotein particle mediated signaling(GO:0055095) low-density lipoprotein particle mediated signaling(GO:0055096) |
| 0.8 |
1.5 |
GO:0071357 |
type I interferon signaling pathway(GO:0060337) cellular response to type I interferon(GO:0071357) |
| 0.7 |
8.2 |
GO:0060716 |
labyrinthine layer blood vessel development(GO:0060716) |
| 0.7 |
5.2 |
GO:0099612 |
protein localization to axon(GO:0099612) |
| 0.7 |
1.5 |
GO:0051531 |
NFAT protein import into nucleus(GO:0051531) |
| 0.7 |
3.7 |
GO:0050819 |
negative regulation of coagulation(GO:0050819) |
| 0.7 |
1.5 |
GO:0035878 |
nail development(GO:0035878) |
| 0.7 |
3.7 |
GO:1904294 |
positive regulation of ERAD pathway(GO:1904294) |
| 0.7 |
1.5 |
GO:0090160 |
Golgi to lysosome transport(GO:0090160) |
| 0.7 |
6.6 |
GO:0051898 |
negative regulation of protein kinase B signaling(GO:0051898) |
| 0.7 |
10.3 |
GO:0070208 |
protein heterotrimerization(GO:0070208) |
| 0.7 |
2.2 |
GO:0051354 |
negative regulation of oxidoreductase activity(GO:0051354) |
| 0.7 |
6.6 |
GO:0001682 |
tRNA 5'-leader removal(GO:0001682) |
| 0.7 |
2.9 |
GO:2000210 |
positive regulation of anoikis(GO:2000210) |
| 0.7 |
16.0 |
GO:1902305 |
regulation of sodium ion transmembrane transport(GO:1902305) |
| 0.7 |
1.4 |
GO:0043686 |
co-translational protein modification(GO:0043686) |
| 0.7 |
2.2 |
GO:0097309 |
cap1 mRNA methylation(GO:0097309) |
| 0.7 |
9.4 |
GO:2000785 |
regulation of autophagosome assembly(GO:2000785) |
| 0.7 |
0.7 |
GO:0060075 |
regulation of resting membrane potential(GO:0060075) |
| 0.7 |
10.1 |
GO:0016339 |
calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.7 |
2.9 |
GO:0006144 |
purine nucleobase metabolic process(GO:0006144) |
| 0.7 |
0.7 |
GO:0042554 |
superoxide anion generation(GO:0042554) |
| 0.7 |
40.8 |
GO:0006487 |
protein N-linked glycosylation(GO:0006487) |
| 0.7 |
1.4 |
GO:0035095 |
behavioral response to nicotine(GO:0035095) |
| 0.7 |
15.7 |
GO:0032008 |
positive regulation of TOR signaling(GO:0032008) |
| 0.7 |
13.6 |
GO:0000462 |
maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.7 |
2.1 |
GO:0070886 |
positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.7 |
2.1 |
GO:0036295 |
cellular response to increased oxygen levels(GO:0036295) |
| 0.7 |
2.1 |
GO:0034983 |
peptidyl-lysine deacetylation(GO:0034983) |
| 0.7 |
4.2 |
GO:0090527 |
actin filament reorganization(GO:0090527) |
| 0.7 |
0.7 |
GO:0051305 |
chromosome movement towards spindle pole(GO:0051305) |
| 0.7 |
2.1 |
GO:2000010 |
positive regulation of protein localization to cell surface(GO:2000010) |
| 0.7 |
42.0 |
GO:0051965 |
positive regulation of synapse assembly(GO:0051965) |
| 0.7 |
2.8 |
GO:0021942 |
radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.7 |
3.5 |
GO:0035092 |
sperm chromatin condensation(GO:0035092) |
| 0.7 |
0.7 |
GO:0009794 |
regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.7 |
4.8 |
GO:0006369 |
termination of RNA polymerase II transcription(GO:0006369) |
| 0.7 |
4.1 |
GO:0090503 |
RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.7 |
1.4 |
GO:0006590 |
thyroid hormone generation(GO:0006590) |
| 0.7 |
25.3 |
GO:0008637 |
apoptotic mitochondrial changes(GO:0008637) |
| 0.7 |
2.0 |
GO:0051503 |
adenine nucleotide transport(GO:0051503) |
| 0.7 |
3.4 |
GO:0021993 |
initiation of neural tube closure(GO:0021993) |
| 0.7 |
4.1 |
GO:1901223 |
negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.7 |
2.7 |
GO:0051560 |
mitochondrial calcium ion homeostasis(GO:0051560) |
| 0.7 |
1.4 |
GO:0033364 |
mast cell secretory granule organization(GO:0033364) |
| 0.7 |
1.4 |
GO:0044026 |
DNA hypermethylation(GO:0044026) |
| 0.7 |
0.7 |
GO:0006434 |
seryl-tRNA aminoacylation(GO:0006434) |
| 0.7 |
1.3 |
GO:0061055 |
myotome development(GO:0061055) |
| 0.7 |
2.0 |
GO:0048168 |
regulation of neuronal synaptic plasticity(GO:0048168) |
| 0.7 |
0.7 |
GO:0090335 |
regulation of brown fat cell differentiation(GO:0090335) |
| 0.7 |
6.7 |
GO:0043982 |
histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
| 0.7 |
4.0 |
GO:0000469 |
cleavage involved in rRNA processing(GO:0000469) |
| 0.7 |
4.0 |
GO:0000707 |
meiotic DNA recombinase assembly(GO:0000707) |
| 0.7 |
2.0 |
GO:0016264 |
gap junction assembly(GO:0016264) |
| 0.7 |
2.6 |
GO:0044829 |
positive regulation by host of viral genome replication(GO:0044829) |
| 0.7 |
0.7 |
GO:0098928 |
presynaptic signal transduction(GO:0098928) presynapse to nucleus signaling pathway(GO:0099526) |
| 0.7 |
1.3 |
GO:0090521 |
glomerular visceral epithelial cell migration(GO:0090521) |
| 0.7 |
7.2 |
GO:0015992 |
proton transport(GO:0015992) |
| 0.7 |
2.0 |
GO:0001980 |
regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
| 0.6 |
1.9 |
GO:0001916 |
positive regulation of T cell mediated cytotoxicity(GO:0001916) |
| 0.6 |
1.9 |
GO:0048742 |
regulation of skeletal muscle fiber development(GO:0048742) |
| 0.6 |
1.3 |
GO:0071985 |
multivesicular body sorting pathway(GO:0071985) |
| 0.6 |
13.5 |
GO:0043039 |
tRNA aminoacylation for protein translation(GO:0006418) tRNA aminoacylation(GO:0043039) |
| 0.6 |
14.1 |
GO:0034314 |
Arp2/3 complex-mediated actin nucleation(GO:0034314) |
| 0.6 |
0.6 |
GO:0044321 |
response to leptin(GO:0044321) |
| 0.6 |
3.8 |
GO:0009072 |
aromatic amino acid family metabolic process(GO:0009072) |
| 0.6 |
3.1 |
GO:0042178 |
xenobiotic catabolic process(GO:0042178) |
| 0.6 |
10.0 |
GO:0071277 |
cellular response to calcium ion(GO:0071277) |
| 0.6 |
0.6 |
GO:0014067 |
negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
| 0.6 |
7.5 |
GO:1900383 |
regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.6 |
7.4 |
GO:0042297 |
vocal learning(GO:0042297) imitative learning(GO:0098596) |
| 0.6 |
1.9 |
GO:0006556 |
S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.6 |
1.2 |
GO:1904645 |
response to beta-amyloid(GO:1904645) |
| 0.6 |
4.3 |
GO:0048169 |
regulation of long-term neuronal synaptic plasticity(GO:0048169) |
| 0.6 |
1.8 |
GO:0035751 |
regulation of lysosomal lumen pH(GO:0035751) |
| 0.6 |
9.8 |
GO:0045744 |
negative regulation of G-protein coupled receptor protein signaling pathway(GO:0045744) |
| 0.6 |
6.0 |
GO:0071549 |
cellular response to dexamethasone stimulus(GO:0071549) |
| 0.6 |
4.8 |
GO:2000727 |
positive regulation of cardiac muscle cell differentiation(GO:2000727) |
| 0.6 |
1.2 |
GO:0032700 |
negative regulation of interleukin-17 production(GO:0032700) |
| 0.6 |
2.4 |
GO:1901032 |
negative regulation of response to reactive oxygen species(GO:1901032) negative regulation of hydrogen peroxide-induced cell death(GO:1903206) |
| 0.6 |
1.2 |
GO:0090383 |
phagosome acidification(GO:0090383) |
| 0.6 |
5.3 |
GO:0090084 |
negative regulation of inclusion body assembly(GO:0090084) |
| 0.6 |
1.2 |
GO:0060060 |
post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
| 0.6 |
4.7 |
GO:1902042 |
negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
| 0.6 |
2.3 |
GO:0070314 |
G1 to G0 transition(GO:0070314) |
| 0.6 |
0.6 |
GO:1904211 |
membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
| 0.6 |
2.3 |
GO:0035873 |
lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.6 |
1.7 |
GO:1903977 |
positive regulation of Schwann cell migration(GO:1900149) positive regulation of glial cell migration(GO:1903977) |
| 0.6 |
0.6 |
GO:0021898 |
commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
| 0.6 |
1.7 |
GO:0000460 |
maturation of 5.8S rRNA(GO:0000460) |
| 0.6 |
1.7 |
GO:0034638 |
phosphatidylcholine catabolic process(GO:0034638) |
| 0.6 |
0.6 |
GO:0051953 |
negative regulation of amine transport(GO:0051953) |
| 0.6 |
1.7 |
GO:2001223 |
negative regulation of neuron migration(GO:2001223) |
| 0.6 |
2.2 |
GO:0015695 |
organic cation transport(GO:0015695) |
| 0.5 |
1.6 |
GO:0015868 |
purine ribonucleotide transport(GO:0015868) |
| 0.5 |
2.7 |
GO:0002534 |
cytokine production involved in inflammatory response(GO:0002534) regulation of cytokine production involved in inflammatory response(GO:1900015) |
| 0.5 |
2.2 |
GO:0006801 |
superoxide metabolic process(GO:0006801) |
| 0.5 |
1.1 |
GO:0009189 |
deoxyribonucleoside diphosphate biosynthetic process(GO:0009189) |
| 0.5 |
0.5 |
GO:0032056 |
positive regulation of translation in response to stress(GO:0032056) regulation of translation in response to stress(GO:0043555) |
| 0.5 |
0.5 |
GO:0036015 |
response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
| 0.5 |
6.5 |
GO:0006744 |
ubiquinone metabolic process(GO:0006743) ubiquinone biosynthetic process(GO:0006744) |
| 0.5 |
0.5 |
GO:0032929 |
negative regulation of superoxide anion generation(GO:0032929) |
| 0.5 |
0.5 |
GO:0090309 |
positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.5 |
1.1 |
GO:0006285 |
base-excision repair, AP site formation(GO:0006285) |
| 0.5 |
1.1 |
GO:0060056 |
mammary gland involution(GO:0060056) |
| 0.5 |
2.7 |
GO:0098734 |
protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
| 0.5 |
2.7 |
GO:0034308 |
primary alcohol metabolic process(GO:0034308) |
| 0.5 |
0.5 |
GO:0002024 |
diet induced thermogenesis(GO:0002024) |
| 0.5 |
3.7 |
GO:0072583 |
clathrin-mediated endocytosis(GO:0072583) |
| 0.5 |
1.1 |
GO:0071073 |
regulation of phospholipid biosynthetic process(GO:0071071) positive regulation of phospholipid biosynthetic process(GO:0071073) |
| 0.5 |
7.5 |
GO:0009083 |
branched-chain amino acid catabolic process(GO:0009083) |
| 0.5 |
10.1 |
GO:0032456 |
endocytic recycling(GO:0032456) |
| 0.5 |
0.5 |
GO:0030223 |
neutrophil differentiation(GO:0030223) |
| 0.5 |
7.9 |
GO:0043949 |
regulation of cAMP-mediated signaling(GO:0043949) |
| 0.5 |
2.1 |
GO:0030422 |
production of siRNA involved in RNA interference(GO:0030422) |
| 0.5 |
0.5 |
GO:0044110 |
growth involved in symbiotic interaction(GO:0044110) growth of symbiont involved in interaction with host(GO:0044116) growth of symbiont in host(GO:0044117) |
| 0.5 |
2.6 |
GO:0071470 |
cellular response to osmotic stress(GO:0071470) |
| 0.5 |
2.1 |
GO:0050884 |
neuromuscular process controlling posture(GO:0050884) |
| 0.5 |
1.0 |
GO:1901096 |
regulation of autophagosome maturation(GO:1901096) |
| 0.5 |
2.6 |
GO:0090201 |
negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
| 0.5 |
2.1 |
GO:0036481 |
intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036481) |
| 0.5 |
1.0 |
GO:0042097 |
interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) |
| 0.5 |
5.7 |
GO:0060628 |
regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.5 |
1.5 |
GO:0033003 |
regulation of mast cell activation(GO:0033003) |
| 0.5 |
1.5 |
GO:0035405 |
histone-threonine phosphorylation(GO:0035405) |
| 0.5 |
1.5 |
GO:0014068 |
positive regulation of phosphatidylinositol 3-kinase signaling(GO:0014068) |
| 0.5 |
0.5 |
GO:0051182 |
coenzyme transport(GO:0051182) |
| 0.5 |
0.5 |
GO:0072498 |
embryonic skeletal joint development(GO:0072498) |
| 0.5 |
3.1 |
GO:0015879 |
carnitine transport(GO:0015879) |
| 0.5 |
9.2 |
GO:0010507 |
negative regulation of autophagy(GO:0010507) |
| 0.5 |
2.0 |
GO:0019355 |
nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process(GO:0034627) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.5 |
0.5 |
GO:0006532 |
aspartate biosynthetic process(GO:0006532) |
| 0.5 |
19.2 |
GO:0061077 |
chaperone-mediated protein folding(GO:0061077) |
| 0.5 |
5.0 |
GO:0070262 |
peptidyl-serine dephosphorylation(GO:0070262) |
| 0.5 |
2.0 |
GO:0046415 |
urate metabolic process(GO:0046415) |
| 0.5 |
1.0 |
GO:0045743 |
positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.5 |
13.5 |
GO:0018345 |
protein palmitoylation(GO:0018345) |
| 0.5 |
3.5 |
GO:0034766 |
negative regulation of ion transmembrane transport(GO:0034766) |
| 0.5 |
9.0 |
GO:0030838 |
positive regulation of actin filament polymerization(GO:0030838) |
| 0.5 |
1.5 |
GO:0003214 |
cardiac left ventricle morphogenesis(GO:0003214) |
| 0.5 |
3.0 |
GO:1903963 |
arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
| 0.5 |
0.5 |
GO:2000822 |
regulation of fear response(GO:1903365) regulation of behavioral fear response(GO:2000822) |
| 0.5 |
3.0 |
GO:0018344 |
protein geranylgeranylation(GO:0018344) |
| 0.5 |
1.0 |
GO:1901654 |
response to ketone(GO:1901654) |
| 0.5 |
2.4 |
GO:0090003 |
regulation of Golgi to plasma membrane protein transport(GO:0042996) regulation of establishment of protein localization to plasma membrane(GO:0090003) |
| 0.5 |
1.0 |
GO:0070166 |
enamel mineralization(GO:0070166) |
| 0.5 |
4.4 |
GO:0034497 |
protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.5 |
1.5 |
GO:0090343 |
positive regulation of cell aging(GO:0090343) |
| 0.5 |
5.3 |
GO:0071480 |
cellular response to gamma radiation(GO:0071480) |
| 0.5 |
3.4 |
GO:0034067 |
protein localization to Golgi apparatus(GO:0034067) |
| 0.5 |
0.5 |
GO:0032616 |
interleukin-13 production(GO:0032616) |
| 0.5 |
0.5 |
GO:0097112 |
gamma-aminobutyric acid receptor clustering(GO:0097112) |
| 0.5 |
3.4 |
GO:0002347 |
response to tumor cell(GO:0002347) |
| 0.5 |
2.9 |
GO:0001913 |
T cell mediated cytotoxicity(GO:0001913) |
| 0.5 |
2.9 |
GO:0048642 |
negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.5 |
2.9 |
GO:0051958 |
methotrexate transport(GO:0051958) reduced folate transmembrane transport(GO:0098838) |
| 0.5 |
1.0 |
GO:0050651 |
dermatan sulfate biosynthetic process(GO:0030208) dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
| 0.5 |
1.0 |
GO:0006710 |
androgen catabolic process(GO:0006710) |
| 0.5 |
2.4 |
GO:0090292 |
nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.5 |
0.5 |
GO:2000825 |
positive regulation of androgen receptor activity(GO:2000825) |
| 0.5 |
0.5 |
GO:0007161 |
calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.5 |
0.5 |
GO:0006166 |
purine ribonucleoside salvage(GO:0006166) |
| 0.5 |
17.6 |
GO:0002181 |
cytoplasmic translation(GO:0002181) |
| 0.5 |
1.8 |
GO:1903818 |
positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.5 |
0.9 |
GO:0018158 |
protein oxidation(GO:0018158) |
| 0.5 |
0.5 |
GO:0051665 |
membrane raft localization(GO:0051665) |
| 0.5 |
0.5 |
GO:0034969 |
histone arginine methylation(GO:0034969) |
| 0.5 |
0.5 |
GO:0006667 |
sphinganine metabolic process(GO:0006667) |
| 0.5 |
3.2 |
GO:0090042 |
tubulin deacetylation(GO:0090042) |
| 0.5 |
0.5 |
GO:0006625 |
protein targeting to peroxisome(GO:0006625) peroxisomal transport(GO:0043574) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
| 0.5 |
1.4 |
GO:0016598 |
protein arginylation(GO:0016598) |
| 0.5 |
1.8 |
GO:0036265 |
RNA (guanine-N7)-methylation(GO:0036265) |
| 0.4 |
5.8 |
GO:0046498 |
S-adenosylhomocysteine metabolic process(GO:0046498) |
| 0.4 |
0.9 |
GO:0042403 |
thyroid hormone metabolic process(GO:0042403) |
| 0.4 |
4.9 |
GO:0033235 |
positive regulation of protein sumoylation(GO:0033235) |
| 0.4 |
0.4 |
GO:1900116 |
sequestering of extracellular ligand from receptor(GO:0035581) extracellular regulation of signal transduction(GO:1900115) extracellular negative regulation of signal transduction(GO:1900116) |
| 0.4 |
1.8 |
GO:0031960 |
response to corticosteroid(GO:0031960) |
| 0.4 |
0.4 |
GO:0006987 |
activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.4 |
2.2 |
GO:0072675 |
osteoclast fusion(GO:0072675) |
| 0.4 |
2.6 |
GO:1990440 |
positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
| 0.4 |
4.8 |
GO:0016558 |
protein import into peroxisome matrix(GO:0016558) |
| 0.4 |
1.3 |
GO:0098974 |
postsynaptic actin cytoskeleton organization(GO:0098974) |
| 0.4 |
5.2 |
GO:0046677 |
response to antibiotic(GO:0046677) |
| 0.4 |
3.0 |
GO:0006359 |
regulation of transcription from RNA polymerase III promoter(GO:0006359) |
| 0.4 |
1.7 |
GO:0000972 |
transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.4 |
1.7 |
GO:0090365 |
regulation of mRNA modification(GO:0090365) |
| 0.4 |
0.8 |
GO:0018216 |
peptidyl-arginine methylation(GO:0018216) |
| 0.4 |
2.1 |
GO:0008298 |
intracellular mRNA localization(GO:0008298) |
| 0.4 |
3.8 |
GO:0071569 |
protein ufmylation(GO:0071569) |
| 0.4 |
0.4 |
GO:0010040 |
response to iron(II) ion(GO:0010040) |
| 0.4 |
0.8 |
GO:0061588 |
calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylserine scrambling(GO:0061589) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) |
| 0.4 |
2.9 |
GO:0046685 |
response to arsenic-containing substance(GO:0046685) |
| 0.4 |
3.7 |
GO:0033198 |
response to ATP(GO:0033198) |
| 0.4 |
1.2 |
GO:0043403 |
skeletal muscle tissue regeneration(GO:0043403) |
| 0.4 |
0.4 |
GO:0006668 |
sphinganine-1-phosphate metabolic process(GO:0006668) |
| 0.4 |
1.7 |
GO:0032060 |
bleb assembly(GO:0032060) |
| 0.4 |
2.0 |
GO:0046033 |
AMP metabolic process(GO:0046033) |
| 0.4 |
0.4 |
GO:0021546 |
rhombomere development(GO:0021546) |
| 0.4 |
6.9 |
GO:0072376 |
protein activation cascade(GO:0072376) |
| 0.4 |
1.2 |
GO:2000297 |
negative regulation of synapse maturation(GO:2000297) |
| 0.4 |
1.2 |
GO:0045648 |
positive regulation of erythrocyte differentiation(GO:0045648) |
| 0.4 |
1.6 |
GO:0060690 |
epithelial cell differentiation involved in salivary gland development(GO:0060690) |
| 0.4 |
1.2 |
GO:0072429 |
response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.4 |
4.0 |
GO:0044243 |
multicellular organism catabolic process(GO:0044243) |
| 0.4 |
0.8 |
GO:0061314 |
Notch signaling involved in heart development(GO:0061314) |
| 0.4 |
1.6 |
GO:0060081 |
membrane hyperpolarization(GO:0060081) |
| 0.4 |
1.2 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.4 |
0.4 |
GO:0071709 |
membrane assembly(GO:0071709) |
| 0.4 |
0.8 |
GO:0010025 |
wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.4 |
2.3 |
GO:0033683 |
nucleotide-excision repair, DNA incision(GO:0033683) |
| 0.4 |
0.4 |
GO:0050857 |
positive regulation of antigen receptor-mediated signaling pathway(GO:0050857) |
| 0.4 |
8.4 |
GO:0019233 |
sensory perception of pain(GO:0019233) |
| 0.4 |
1.1 |
GO:1904424 |
regulation of GTP binding(GO:1904424) |
| 0.4 |
0.8 |
GO:0006751 |
glutathione catabolic process(GO:0006751) |
| 0.4 |
13.1 |
GO:0045454 |
cell redox homeostasis(GO:0045454) |
| 0.4 |
1.1 |
GO:0003418 |
growth plate cartilage chondrocyte differentiation(GO:0003418) |
| 0.4 |
1.1 |
GO:0061014 |
positive regulation of mRNA catabolic process(GO:0061014) |
| 0.4 |
0.4 |
GO:0044088 |
regulation of vacuole organization(GO:0044088) |
| 0.4 |
7.3 |
GO:1901379 |
regulation of potassium ion transmembrane transport(GO:1901379) |
| 0.4 |
2.9 |
GO:0048488 |
synaptic vesicle endocytosis(GO:0048488) |
| 0.4 |
1.8 |
GO:0001937 |
negative regulation of endothelial cell proliferation(GO:0001937) |
| 0.4 |
0.7 |
GO:0032077 |
positive regulation of deoxyribonuclease activity(GO:0032077) |
| 0.4 |
1.1 |
GO:2000680 |
regulation of rubidium ion transport(GO:2000680) |
| 0.4 |
2.5 |
GO:0009409 |
response to cold(GO:0009409) |
| 0.4 |
8.3 |
GO:0021680 |
cerebellar Purkinje cell layer development(GO:0021680) |
| 0.4 |
0.4 |
GO:0032570 |
response to progesterone(GO:0032570) |
| 0.4 |
1.4 |
GO:0010836 |
negative regulation of protein ADP-ribosylation(GO:0010836) |
| 0.4 |
0.7 |
GO:0000715 |
nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.4 |
0.4 |
GO:0034143 |
regulation of toll-like receptor 4 signaling pathway(GO:0034143) |
| 0.4 |
2.5 |
GO:0002093 |
auditory receptor cell morphogenesis(GO:0002093) |
| 0.4 |
0.4 |
GO:0031017 |
exocrine pancreas development(GO:0031017) |
| 0.4 |
0.7 |
GO:0021830 |
substrate-independent telencephalic tangential migration(GO:0021826) interneuron migration from the subpallium to the cortex(GO:0021830) substrate-independent telencephalic tangential interneuron migration(GO:0021843) |
| 0.3 |
1.4 |
GO:1990481 |
mRNA pseudouridine synthesis(GO:1990481) |
| 0.3 |
0.7 |
GO:0097494 |
regulation of vesicle size(GO:0097494) |
| 0.3 |
1.7 |
GO:0006616 |
SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.3 |
0.3 |
GO:0060278 |
regulation of ovulation(GO:0060278) |
| 0.3 |
2.4 |
GO:0060666 |
dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 0.3 |
0.3 |
GO:0055098 |
response to low-density lipoprotein particle(GO:0055098) |
| 0.3 |
0.7 |
GO:1990253 |
cellular response to leucine starvation(GO:1990253) |
| 0.3 |
4.0 |
GO:0035414 |
negative regulation of catenin import into nucleus(GO:0035414) |
| 0.3 |
2.7 |
GO:0006383 |
transcription from RNA polymerase III promoter(GO:0006383) |
| 0.3 |
0.3 |
GO:1902177 |
positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
| 0.3 |
3.7 |
GO:0045668 |
negative regulation of osteoblast differentiation(GO:0045668) |
| 0.3 |
0.7 |
GO:0007189 |
adenylate cyclase-activating G-protein coupled receptor signaling pathway(GO:0007189) |
| 0.3 |
18.9 |
GO:1903749 |
positive regulation of establishment of protein localization to mitochondrion(GO:1903749) positive regulation of protein targeting to mitochondrion(GO:1903955) |
| 0.3 |
0.3 |
GO:0090181 |
regulation of cholesterol metabolic process(GO:0090181) |
| 0.3 |
0.3 |
GO:0038166 |
angiotensin-activated signaling pathway(GO:0038166) |
| 0.3 |
1.0 |
GO:0097501 |
stress response to metal ion(GO:0097501) |
| 0.3 |
0.3 |
GO:0035902 |
response to immobilization stress(GO:0035902) |
| 0.3 |
4.3 |
GO:0010718 |
positive regulation of epithelial to mesenchymal transition(GO:0010718) |
| 0.3 |
0.3 |
GO:0090073 |
positive regulation of protein homodimerization activity(GO:0090073) |
| 0.3 |
1.0 |
GO:0001887 |
selenium compound metabolic process(GO:0001887) selenocysteine metabolic process(GO:0016259) |
| 0.3 |
0.6 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.3 |
12.6 |
GO:0030032 |
lamellipodium assembly(GO:0030032) |
| 0.3 |
0.3 |
GO:0036451 |
cap mRNA methylation(GO:0036451) |
| 0.3 |
0.9 |
GO:0046470 |
phosphatidylcholine metabolic process(GO:0046470) |
| 0.3 |
0.6 |
GO:0030321 |
transepithelial chloride transport(GO:0030321) |
| 0.3 |
0.3 |
GO:1900368 |
regulation of RNA interference(GO:1900368) |
| 0.3 |
1.2 |
GO:0015889 |
cobalamin transport(GO:0015889) |
| 0.3 |
1.2 |
GO:1990022 |
RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
| 0.3 |
0.3 |
GO:0044828 |
negative regulation by host of viral process(GO:0044793) negative regulation by host of viral genome replication(GO:0044828) |
| 0.3 |
6.3 |
GO:0070527 |
platelet aggregation(GO:0070527) |
| 0.3 |
0.6 |
GO:0051928 |
positive regulation of calcium ion transport(GO:0051928) |
| 0.3 |
0.3 |
GO:2000542 |
negative regulation of gastrulation(GO:2000542) |
| 0.3 |
0.6 |
GO:0090666 |
scaRNA localization to Cajal body(GO:0090666) |
| 0.3 |
0.6 |
GO:0032620 |
interleukin-17 production(GO:0032620) |
| 0.3 |
0.3 |
GO:0043217 |
myelin maintenance(GO:0043217) |
| 0.3 |
2.6 |
GO:0006805 |
xenobiotic metabolic process(GO:0006805) |
| 0.3 |
5.2 |
GO:0046513 |
ceramide biosynthetic process(GO:0046513) |
| 0.3 |
1.7 |
GO:0006729 |
tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.3 |
0.3 |
GO:1901894 |
regulation of calcium-transporting ATPase activity(GO:1901894) |
| 0.3 |
0.8 |
GO:0045003 |
DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.3 |
1.4 |
GO:0000305 |
response to oxygen radical(GO:0000305) |
| 0.3 |
0.8 |
GO:0060561 |
apoptotic process involved in morphogenesis(GO:0060561) |
| 0.3 |
1.1 |
GO:0046600 |
negative regulation of centriole replication(GO:0046600) |
| 0.3 |
0.5 |
GO:0044003 |
modification by symbiont of host morphology or physiology(GO:0044003) |
| 0.3 |
0.8 |
GO:0019236 |
response to pheromone(GO:0019236) |
| 0.3 |
1.1 |
GO:0014887 |
cardiac muscle adaptation(GO:0014887) |
| 0.3 |
0.3 |
GO:1901798 |
positive regulation of signal transduction by p53 class mediator(GO:1901798) |
| 0.3 |
0.5 |
GO:0046135 |
pyrimidine ribonucleoside catabolic process(GO:0046133) pyrimidine nucleoside catabolic process(GO:0046135) |
| 0.3 |
2.1 |
GO:0043173 |
nucleotide salvage(GO:0043173) |
| 0.3 |
1.3 |
GO:1904659 |
glucose transmembrane transport(GO:1904659) |
| 0.3 |
1.0 |
GO:0060312 |
regulation of blood vessel remodeling(GO:0060312) |
| 0.3 |
0.5 |
GO:0060046 |
regulation of acrosome reaction(GO:0060046) |
| 0.3 |
1.3 |
GO:0032233 |
positive regulation of actin filament bundle assembly(GO:0032233) |
| 0.3 |
0.8 |
GO:0043987 |
histone H3-S10 phosphorylation(GO:0043987) |
| 0.3 |
0.3 |
GO:0032380 |
regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.3 |
1.3 |
GO:0015858 |
nucleoside transport(GO:0015858) |
| 0.3 |
0.8 |
GO:0046173 |
polyol biosynthetic process(GO:0046173) |
| 0.3 |
0.5 |
GO:1900025 |
negative regulation of substrate adhesion-dependent cell spreading(GO:1900025) |
| 0.2 |
3.5 |
GO:0009303 |
rRNA transcription(GO:0009303) |
| 0.2 |
2.2 |
GO:0032024 |
positive regulation of insulin secretion(GO:0032024) |
| 0.2 |
0.2 |
GO:2000623 |
regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.2 |
0.2 |
GO:0016540 |
protein autoprocessing(GO:0016540) |
| 0.2 |
1.0 |
GO:0035547 |
interferon-beta secretion(GO:0035546) regulation of interferon-beta secretion(GO:0035547) positive regulation of interferon-beta secretion(GO:0035549) |
| 0.2 |
0.7 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.2 |
1.2 |
GO:0008063 |
Toll signaling pathway(GO:0008063) |
| 0.2 |
0.9 |
GO:0030091 |
protein repair(GO:0030091) |
| 0.2 |
3.1 |
GO:0097581 |
lamellipodium organization(GO:0097581) |
| 0.2 |
0.9 |
GO:1903299 |
regulation of glucokinase activity(GO:0033131) regulation of hexokinase activity(GO:1903299) |
| 0.2 |
0.5 |
GO:0018199 |
peptidyl-glutamine modification(GO:0018199) |
| 0.2 |
0.9 |
GO:0098937 |
dendritic transport(GO:0098935) anterograde dendritic transport(GO:0098937) |
| 0.2 |
0.2 |
GO:0060385 |
axonogenesis involved in innervation(GO:0060385) |
| 0.2 |
1.1 |
GO:0043518 |
negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.2 |
0.7 |
GO:0036462 |
TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.2 |
0.4 |
GO:0010739 |
positive regulation of protein kinase A signaling(GO:0010739) |
| 0.2 |
0.9 |
GO:0046036 |
CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
| 0.2 |
2.2 |
GO:0007205 |
protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
| 0.2 |
0.4 |
GO:0048298 |
positive regulation of isotype switching to IgA isotypes(GO:0048298) |
| 0.2 |
0.8 |
GO:0034390 |
smooth muscle cell apoptotic process(GO:0034390) regulation of smooth muscle cell apoptotic process(GO:0034391) |
| 0.2 |
0.4 |
GO:0044406 |
adhesion of symbiont to host(GO:0044406) |
| 0.2 |
0.8 |
GO:0001773 |
myeloid dendritic cell activation(GO:0001773) |
| 0.2 |
0.4 |
GO:0009814 |
defense response, incompatible interaction(GO:0009814) |
| 0.2 |
0.4 |
GO:0009211 |
pyrimidine deoxyribonucleoside triphosphate metabolic process(GO:0009211) |
| 0.2 |
1.6 |
GO:0006614 |
SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.2 |
0.8 |
GO:0090026 |
positive regulation of monocyte chemotaxis(GO:0090026) |
| 0.2 |
0.4 |
GO:0010884 |
positive regulation of lipid storage(GO:0010884) |
| 0.2 |
0.6 |
GO:0035511 |
oxidative DNA demethylation(GO:0035511) |
| 0.2 |
0.4 |
GO:2000270 |
negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.2 |
0.6 |
GO:0097211 |
response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.2 |
4.3 |
GO:0046939 |
nucleotide phosphorylation(GO:0046939) |
| 0.2 |
0.8 |
GO:0045541 |
negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.2 |
0.4 |
GO:0071926 |
endocannabinoid signaling pathway(GO:0071926) |
| 0.2 |
0.6 |
GO:0010968 |
regulation of microtubule nucleation(GO:0010968) |
| 0.2 |
0.2 |
GO:1904816 |
positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
| 0.2 |
0.2 |
GO:0060648 |
mammary gland bud morphogenesis(GO:0060648) |
| 0.2 |
0.2 |
GO:0070488 |
neutrophil aggregation(GO:0070488) |
| 0.2 |
0.7 |
GO:0072337 |
modified amino acid transport(GO:0072337) |
| 0.2 |
0.6 |
GO:0002097 |
tRNA wobble base modification(GO:0002097) |
| 0.2 |
0.7 |
GO:0033299 |
secretion of lysosomal enzymes(GO:0033299) |
| 0.2 |
0.4 |
GO:0006290 |
pyrimidine dimer repair(GO:0006290) |
| 0.2 |
0.4 |
GO:0043516 |
regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043516) |
| 0.2 |
0.4 |
GO:0046950 |
cellular ketone body metabolic process(GO:0046950) |
| 0.2 |
0.4 |
GO:0050849 |
negative regulation of calcium-mediated signaling(GO:0050849) |
| 0.2 |
0.2 |
GO:0034285 |
response to sucrose(GO:0009744) response to disaccharide(GO:0034285) |
| 0.2 |
0.3 |
GO:0036518 |
chemorepulsion of dopaminergic neuron axon(GO:0036518) |
| 0.2 |
2.8 |
GO:0031638 |
zymogen activation(GO:0031638) |
| 0.2 |
1.3 |
GO:0006020 |
inositol metabolic process(GO:0006020) |
| 0.2 |
0.2 |
GO:0009957 |
epidermal cell fate specification(GO:0009957) |
| 0.2 |
2.9 |
GO:0034063 |
stress granule assembly(GO:0034063) |
| 0.2 |
0.6 |
GO:0006363 |
termination of RNA polymerase I transcription(GO:0006363) |
| 0.2 |
0.5 |
GO:0070059 |
intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0070059) |
| 0.2 |
1.1 |
GO:0031118 |
rRNA pseudouridine synthesis(GO:0031118) |
| 0.2 |
0.6 |
GO:0048873 |
homeostasis of number of cells within a tissue(GO:0048873) |
| 0.2 |
0.2 |
GO:1904874 |
positive regulation of telomerase RNA localization to Cajal body(GO:1904874) |
| 0.2 |
0.3 |
GO:0006527 |
arginine catabolic process(GO:0006527) |
| 0.2 |
3.5 |
GO:0070979 |
protein K11-linked ubiquitination(GO:0070979) |
| 0.2 |
1.2 |
GO:0006767 |
water-soluble vitamin metabolic process(GO:0006767) |
| 0.2 |
0.3 |
GO:0034427 |
nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.2 |
0.3 |
GO:0042866 |
pyruvate biosynthetic process(GO:0042866) |
| 0.1 |
0.1 |
GO:0006818 |
hydrogen transport(GO:0006818) |
| 0.1 |
1.3 |
GO:0071578 |
zinc II ion transmembrane import(GO:0071578) |
| 0.1 |
0.3 |
GO:0034214 |
protein hexamerization(GO:0034214) |
| 0.1 |
0.3 |
GO:0002946 |
tRNA C5-cytosine methylation(GO:0002946) |
| 0.1 |
0.6 |
GO:0045123 |
cellular extravasation(GO:0045123) |
| 0.1 |
0.3 |
GO:0033004 |
negative regulation of mast cell activation(GO:0033004) |
| 0.1 |
1.9 |
GO:0002115 |
store-operated calcium entry(GO:0002115) |
| 0.1 |
0.4 |
GO:0010666 |
positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.1 |
1.6 |
GO:0031641 |
regulation of myelination(GO:0031641) |
| 0.1 |
0.7 |
GO:0032094 |
response to food(GO:0032094) |
| 0.1 |
0.3 |
GO:0061073 |
ciliary body morphogenesis(GO:0061073) |
| 0.1 |
0.3 |
GO:0032926 |
negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.1 |
0.3 |
GO:0045075 |
interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
| 0.1 |
0.9 |
GO:0015809 |
arginine transport(GO:0015809) |
| 0.1 |
0.1 |
GO:0006828 |
manganese ion transport(GO:0006828) |
| 0.1 |
0.2 |
GO:0032353 |
negative regulation of hormone metabolic process(GO:0032351) negative regulation of hormone biosynthetic process(GO:0032353) |
| 0.1 |
0.7 |
GO:0007193 |
adenylate cyclase-inhibiting G-protein coupled receptor signaling pathway(GO:0007193) |
| 0.1 |
5.0 |
GO:0006839 |
mitochondrial transport(GO:0006839) |
| 0.1 |
0.4 |
GO:0008300 |
isoprenoid catabolic process(GO:0008300) |
| 0.1 |
0.2 |
GO:0046549 |
retinal cone cell development(GO:0046549) |
| 0.1 |
0.2 |
GO:0045347 |
negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.1 |
0.4 |
GO:0032788 |
saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
| 0.1 |
1.2 |
GO:0032418 |
lysosome localization(GO:0032418) |
| 0.1 |
0.2 |
GO:0006613 |
cotranslational protein targeting to membrane(GO:0006613) |
| 0.1 |
0.1 |
GO:0061101 |
neuroendocrine cell differentiation(GO:0061101) |
| 0.1 |
0.3 |
GO:0071158 |
positive regulation of cell cycle arrest(GO:0071158) |
| 0.1 |
0.2 |
GO:0010762 |
regulation of fibroblast migration(GO:0010762) |
| 0.1 |
0.2 |
GO:0019585 |
uronic acid metabolic process(GO:0006063) glucuronate metabolic process(GO:0019585) |
| 0.1 |
0.1 |
GO:0097155 |
fasciculation of sensory neuron axon(GO:0097155) |
| 0.1 |
0.2 |
GO:1902804 |
negative regulation of synaptic vesicle transport(GO:1902804) |
| 0.1 |
1.4 |
GO:1901343 |
negative regulation of vasculature development(GO:1901343) |
| 0.1 |
0.5 |
GO:0000291 |
nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
| 0.1 |
0.3 |
GO:0032366 |
intracellular sterol transport(GO:0032366) intracellular cholesterol transport(GO:0032367) |
| 0.1 |
1.0 |
GO:0061462 |
protein localization to lysosome(GO:0061462) |
| 0.1 |
0.3 |
GO:0009651 |
response to salt stress(GO:0009651) |
| 0.1 |
0.7 |
GO:0000290 |
deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 |
1.6 |
GO:0042304 |
regulation of fatty acid biosynthetic process(GO:0042304) |
| 0.1 |
0.4 |
GO:0034472 |
snRNA 3'-end processing(GO:0034472) |
| 0.1 |
1.0 |
GO:0030199 |
collagen fibril organization(GO:0030199) |
| 0.1 |
0.7 |
GO:0044804 |
nucleophagy(GO:0044804) |
| 0.1 |
0.7 |
GO:0031065 |
positive regulation of histone deacetylation(GO:0031065) |
| 0.1 |
0.4 |
GO:1902231 |
positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.1 |
0.1 |
GO:2001053 |
regulation of mesenchymal cell apoptotic process(GO:2001053) negative regulation of mesenchymal cell apoptotic process(GO:2001054) |
| 0.1 |
3.2 |
GO:0051865 |
protein autoubiquitination(GO:0051865) |
| 0.1 |
0.5 |
GO:0051881 |
regulation of mitochondrial membrane potential(GO:0051881) |
| 0.1 |
0.2 |
GO:1902036 |
regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.1 |
0.1 |
GO:0036151 |
phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.1 |
0.4 |
GO:0016556 |
mRNA modification(GO:0016556) |
| 0.1 |
0.1 |
GO:0032918 |
polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
| 0.1 |
0.3 |
GO:0042219 |
cellular modified amino acid catabolic process(GO:0042219) |
| 0.1 |
0.1 |
GO:0008272 |
sulfate transport(GO:0008272) |
| 0.1 |
2.2 |
GO:0006821 |
chloride transport(GO:0006821) |
| 0.1 |
0.2 |
GO:0060216 |
definitive hemopoiesis(GO:0060216) |
| 0.1 |
0.5 |
GO:0051601 |
exocyst localization(GO:0051601) |
| 0.0 |
0.0 |
GO:1903546 |
protein localization to photoreceptor outer segment(GO:1903546) |
| 0.0 |
1.9 |
GO:0031338 |
regulation of vesicle fusion(GO:0031338) |
| 0.0 |
0.1 |
GO:0042796 |
snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.0 |
0.1 |
GO:0002692 |
negative regulation of cellular extravasation(GO:0002692) |
| 0.0 |
0.5 |
GO:0010866 |
regulation of triglyceride biosynthetic process(GO:0010866) |
| 0.0 |
0.2 |
GO:0035025 |
positive regulation of Rho protein signal transduction(GO:0035025) |
| 0.0 |
0.1 |
GO:0007016 |
cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.0 |
0.9 |
GO:0016578 |
histone deubiquitination(GO:0016578) |
| 0.0 |
0.0 |
GO:0050909 |
sensory perception of taste(GO:0050909) |
| 0.0 |
0.2 |
GO:0061052 |
negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.0 |
0.0 |
GO:0061365 |
positive regulation of triglyceride lipase activity(GO:0061365) |
| 0.0 |
0.3 |
GO:0097576 |
vacuole fusion(GO:0097576) |
| 0.0 |
0.2 |
GO:0035115 |
embryonic forelimb morphogenesis(GO:0035115) |
| 0.0 |
0.1 |
GO:0032305 |
positive regulation of icosanoid secretion(GO:0032305) |
| 0.0 |
0.1 |
GO:0071670 |
smooth muscle cell chemotaxis(GO:0071670) |
| 0.0 |
0.1 |
GO:0031053 |
primary miRNA processing(GO:0031053) |
| 0.0 |
0.1 |
GO:0019369 |
arachidonic acid metabolic process(GO:0019369) |
| 0.0 |
0.3 |
GO:0050873 |
brown fat cell differentiation(GO:0050873) |
| 0.0 |
0.0 |
GO:0055070 |
copper ion homeostasis(GO:0055070) |
| 0.0 |
0.1 |
GO:1903028 |
asymmetric Golgi ribbon formation(GO:0090164) regulation of opsonization(GO:1903027) positive regulation of opsonization(GO:1903028) |
| 0.0 |
0.0 |
GO:0019249 |
lactate biosynthetic process(GO:0019249) |
| 0.0 |
0.1 |
GO:0006515 |
misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
