Motif ID: Zbtb3
Z-value: 0.504
Transcription factors associated with Zbtb3:
Gene Symbol | Entrez ID | Gene Name |
---|---|---|
Zbtb3 | ENSMUSG00000071661.6 | Zbtb3 |
Activity-expression correlation:
Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Zbtb3 | mm10_v2_chr19_+_8802486_8802530 | 0.27 | 1.7e-02 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 2.6 | GO:0015671 | oxygen transport(GO:0015671) |
0.5 | 1.4 | GO:0010512 | negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
0.4 | 1.1 | GO:0032918 | polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
0.3 | 0.9 | GO:0006106 | fumarate metabolic process(GO:0006106) aspartate biosynthetic process(GO:0006532) aspartate catabolic process(GO:0006533) |
0.3 | 1.9 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.3 | 1.1 | GO:1904529 | regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
0.2 | 0.7 | GO:0006116 | NADH oxidation(GO:0006116) |
0.2 | 1.2 | GO:0019230 | proprioception(GO:0019230) |
0.2 | 0.6 | GO:2000393 | negative regulation of lamellipodium morphogenesis(GO:2000393) |
0.2 | 2.0 | GO:0090232 | positive regulation of spindle checkpoint(GO:0090232) |
0.2 | 0.8 | GO:0010636 | positive regulation of mitochondrial fusion(GO:0010636) |
0.1 | 1.6 | GO:2000580 | positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
0.1 | 0.6 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.1 | 1.4 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.1 | 0.8 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.1 | 0.4 | GO:0030070 | insulin processing(GO:0030070) |
0.1 | 0.6 | GO:1901526 | positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
0.1 | 0.3 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
0.1 | 0.3 | GO:0090202 | transcriptional activation by promoter-enhancer looping(GO:0071733) regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
0.1 | 0.3 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
0.1 | 1.4 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
0.1 | 0.6 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
0.1 | 0.4 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.1 | 0.4 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 0.4 | GO:0032439 | endosome localization(GO:0032439) regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
0.1 | 0.6 | GO:0009249 | protein lipoylation(GO:0009249) |
0.1 | 0.6 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
0.1 | 3.4 | GO:0006406 | mRNA export from nucleus(GO:0006406) mRNA-containing ribonucleoprotein complex export from nucleus(GO:0071427) |
0.0 | 0.7 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
0.0 | 2.0 | GO:0006378 | mRNA polyadenylation(GO:0006378) |
0.0 | 0.6 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
0.0 | 0.7 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
0.0 | 0.4 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
0.0 | 0.7 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
0.0 | 0.6 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
0.0 | 0.3 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.0 | 0.7 | GO:0031998 | regulation of fatty acid beta-oxidation(GO:0031998) |
0.0 | 0.9 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.0 | 0.7 | GO:0050774 | negative regulation of dendrite morphogenesis(GO:0050774) |
0.0 | 0.6 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.0 | 0.1 | GO:0009838 | abscission(GO:0009838) |
0.0 | 0.2 | GO:0098887 | neurotransmitter receptor transport, endosome to postsynaptic membrane(GO:0098887) |
0.0 | 1.3 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.1 | GO:1902524 | interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) positive regulation of protein K48-linked ubiquitination(GO:1902524) |
0.0 | 0.4 | GO:0030953 | astral microtubule organization(GO:0030953) |
0.0 | 2.6 | GO:0014065 | phosphatidylinositol 3-kinase signaling(GO:0014065) |
0.0 | 0.5 | GO:0032967 | positive regulation of collagen biosynthetic process(GO:0032967) |
0.0 | 0.5 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.0 | 0.2 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
0.0 | 0.8 | GO:0007193 | adenylate cyclase-inhibiting G-protein coupled receptor signaling pathway(GO:0007193) |
0.0 | 0.7 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
0.0 | 0.2 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
0.0 | 0.3 | GO:0030262 | apoptotic nuclear changes(GO:0030262) |
0.0 | 2.0 | GO:0050731 | positive regulation of peptidyl-tyrosine phosphorylation(GO:0050731) |
0.0 | 0.5 | GO:0018279 | protein N-linked glycosylation via asparagine(GO:0018279) |
0.0 | 0.6 | GO:0045599 | negative regulation of fat cell differentiation(GO:0045599) |
0.0 | 0.0 | GO:0046909 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
0.0 | 0.1 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.0 | 0.1 | GO:0048251 | elastic fiber assembly(GO:0048251) |
Gene overrepresentation in cellular_component category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 2.6 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.2 | 2.0 | GO:0097165 | nuclear stress granule(GO:0097165) |
0.1 | 0.5 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.1 | 0.4 | GO:0071986 | Ragulator complex(GO:0071986) |
0.1 | 0.4 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.1 | 0.6 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.1 | 2.0 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.1 | 0.7 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.1 | 2.5 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.1 | 0.6 | GO:0031931 | TORC1 complex(GO:0031931) |
0.0 | 0.3 | GO:0097255 | R2TP complex(GO:0097255) |
0.0 | 2.7 | GO:0016459 | myosin complex(GO:0016459) |
0.0 | 0.7 | GO:0035102 | PRC1 complex(GO:0035102) |
0.0 | 1.8 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.0 | 0.3 | GO:0033503 | HULC complex(GO:0033503) |
0.0 | 2.4 | GO:0005581 | collagen trimer(GO:0005581) |
0.0 | 0.3 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.0 | 0.4 | GO:0098845 | postsynaptic endosome(GO:0098845) |
0.0 | 1.6 | GO:0030286 | dynein complex(GO:0030286) |
0.0 | 0.3 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.0 | 0.6 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
0.0 | 2.1 | GO:0005902 | microvillus(GO:0005902) |
0.0 | 1.1 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 0.8 | GO:0097440 | apical dendrite(GO:0097440) |
0.0 | 0.4 | GO:0031045 | dense core granule(GO:0031045) |
0.0 | 0.7 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.0 | 0.9 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.0 | 0.6 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.0 | 2.0 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 0.1 | GO:0090543 | Flemming body(GO:0090543) |
0.0 | 1.7 | GO:0001650 | fibrillar center(GO:0001650) |
Gene overrepresentation in molecular_function category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 2.6 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
0.4 | 1.1 | GO:0004145 | diamine N-acetyltransferase activity(GO:0004145) |
0.3 | 0.9 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
0.2 | 0.7 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
0.2 | 0.7 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.1 | 0.9 | GO:0008494 | translation activator activity(GO:0008494) |
0.1 | 0.5 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.1 | 1.4 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.1 | 0.6 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.1 | 0.6 | GO:0043532 | angiostatin binding(GO:0043532) |
0.1 | 0.8 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.1 | 1.4 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.1 | 1.1 | GO:0031005 | filamin binding(GO:0031005) |
0.1 | 0.2 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
0.1 | 1.6 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.1 | 0.9 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.1 | 0.3 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
0.1 | 0.2 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
0.1 | 0.3 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
0.1 | 0.8 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
0.0 | 2.0 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.0 | 0.4 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.0 | 0.6 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
0.0 | 0.5 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.0 | 0.7 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
0.0 | 1.1 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.0 | 2.8 | GO:0004004 | RNA helicase activity(GO:0003724) ATP-dependent RNA helicase activity(GO:0004004) |
0.0 | 0.4 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
0.0 | 0.5 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.0 | 0.3 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.0 | 0.3 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.0 | 0.4 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.0 | 0.2 | GO:0008556 | sodium:potassium-exchanging ATPase activity(GO:0005391) potassium-transporting ATPase activity(GO:0008556) |
0.0 | 0.1 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.0 | 2.7 | GO:0003774 | motor activity(GO:0003774) |
0.0 | 1.2 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.0 | 0.6 | GO:0003785 | actin monomer binding(GO:0003785) |
0.0 | 0.4 | GO:0070628 | proteasome binding(GO:0070628) |
0.0 | 2.0 | GO:0005178 | integrin binding(GO:0005178) |
0.0 | 0.8 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
0.0 | 0.5 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.0 | 0.5 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.0 | 0.8 | GO:0004521 | endoribonuclease activity(GO:0004521) |
0.0 | 0.5 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.0 | 0.8 | GO:0015485 | cholesterol binding(GO:0015485) |
0.0 | 0.4 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.0 | 0.7 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
0.0 | 0.4 | GO:0015036 | disulfide oxidoreductase activity(GO:0015036) |
0.0 | 0.6 | GO:0019842 | vitamin binding(GO:0019842) |
Gene overrepresentation in C2:CP category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 1.6 | PID_THROMBIN_PAR4_PATHWAY | PAR4-mediated thrombin signaling events |
0.1 | 0.8 | PID_S1P_S1P4_PATHWAY | S1P4 pathway |
0.0 | 0.5 | ST_INTERFERON_GAMMA_PATHWAY | Interferon gamma pathway. |
0.0 | 2.0 | PID_RET_PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.0 | 1.4 | PID_P38_MKK3_6PATHWAY | p38 MAPK signaling pathway |
0.0 | 1.1 | PID_INTEGRIN_A9B1_PATHWAY | Alpha9 beta1 integrin signaling events |
0.0 | 0.8 | PID_HEDGEHOG_2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 2.0 | PID_MYC_REPRESS_PATHWAY | Validated targets of C-MYC transcriptional repression |
0.0 | 1.2 | PID_IL4_2PATHWAY | IL4-mediated signaling events |
0.0 | 1.4 | PID_CERAMIDE_PATHWAY | Ceramide signaling pathway |
0.0 | 0.4 | PID_SYNDECAN_4_PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 1.2 | PID_ERA_GENOMIC_PATHWAY | Validated nuclear estrogen receptor alpha network |
0.0 | 0.6 | SIG_REGULATION_OF_THE_ACTIN_CYTOSKELETON_BY_RHO_GTPASES | Genes related to regulation of the actin cytoskeleton |
0.0 | 0.4 | PID_WNT_SIGNALING_PATHWAY | Wnt signaling network |
0.0 | 0.4 | PID_PS1_PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.7 | PID_RHOA_PATHWAY | RhoA signaling pathway |
0.0 | 0.7 | PID_ERBB4_PATHWAY | ErbB4 signaling events |
0.0 | 0.7 | PID_ILK_PATHWAY | Integrin-linked kinase signaling |
0.0 | 2.1 | NABA_SECRETED_FACTORS | Genes encoding secreted soluble factors |
Gene overrepresentation in C2:CP:REACTOME category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 1.4 | REACTOME_TANDEM_PORE_DOMAIN_POTASSIUM_CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.1 | 1.8 | REACTOME_CRMPS_IN_SEMA3A_SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.1 | 2.5 | REACTOME_G_PROTEIN_ACTIVATION | Genes involved in G-protein activation |
0.1 | 1.1 | REACTOME_METABOLISM_OF_POLYAMINES | Genes involved in Metabolism of polyamines |
0.1 | 0.7 | REACTOME_COPI_MEDIATED_TRANSPORT | Genes involved in COPI Mediated Transport |
0.1 | 1.2 | REACTOME_RETROGRADE_NEUROTROPHIN_SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.1 | 0.5 | REACTOME_TERMINATION_OF_O_GLYCAN_BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
0.0 | 0.6 | REACTOME_VITAMIN_B5_PANTOTHENATE_METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.0 | 2.0 | REACTOME_NCAM1_INTERACTIONS | Genes involved in NCAM1 interactions |
0.0 | 1.1 | REACTOME_GLUTATHIONE_CONJUGATION | Genes involved in Glutathione conjugation |
0.0 | 0.9 | REACTOME_AMINO_ACID_SYNTHESIS_AND_INTERCONVERSION_TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.0 | 0.6 | REACTOME_DESTABILIZATION_OF_MRNA_BY_KSRP | Genes involved in Destabilization of mRNA by KSRP |
0.0 | 1.8 | REACTOME_RESPIRATORY_ELECTRON_TRANSPORT | Genes involved in Respiratory electron transport |
0.0 | 0.6 | REACTOME_AKT_PHOSPHORYLATES_TARGETS_IN_THE_CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
0.0 | 0.3 | REACTOME_N_GLYCAN_ANTENNAE_ELONGATION | Genes involved in N-Glycan antennae elongation |
0.0 | 0.4 | REACTOME_INSULIN_SYNTHESIS_AND_PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.6 | REACTOME_SIGNALING_BY_ROBO_RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 0.6 | REACTOME_NUCLEAR_SIGNALING_BY_ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.0 | 1.4 | REACTOME_RESPONSE_TO_ELEVATED_PLATELET_CYTOSOLIC_CA2_ | Genes involved in Response to elevated platelet cytosolic Ca2+ |
0.0 | 0.3 | REACTOME_ABORTIVE_ELONGATION_OF_HIV1_TRANSCRIPT_IN_THE_ABSENCE_OF_TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
0.0 | 3.3 | REACTOME_ANTIGEN_PROCESSING_UBIQUITINATION_PROTEASOME_DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.0 | 0.3 | REACTOME_EXTENSION_OF_TELOMERES | Genes involved in Extension of Telomeres |