| 4.2 |
16.7 |
GO:0070318 |
positive regulation of G0 to G1 transition(GO:0070318) |
| 2.1 |
10.7 |
GO:2000298 |
regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
| 1.8 |
5.4 |
GO:2001139 |
negative regulation of postsynaptic membrane organization(GO:1901627) negative regulation of dendritic spine maintenance(GO:1902951) negative regulation of phospholipid efflux(GO:1902999) regulation of lipid transport across blood brain barrier(GO:1903000) negative regulation of lipid transport across blood brain barrier(GO:1903001) positive regulation of lipid transport across blood brain barrier(GO:1903002) negative regulation of phospholipid transport(GO:2001139) |
| 1.0 |
3.9 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 0.8 |
4.5 |
GO:0032804 |
negative regulation of low-density lipoprotein particle receptor catabolic process(GO:0032804) |
| 0.7 |
2.2 |
GO:0003278 |
apoptotic process involved in heart morphogenesis(GO:0003278) |
| 0.7 |
2.2 |
GO:0048014 |
Tie signaling pathway(GO:0048014) |
| 0.7 |
4.6 |
GO:0006361 |
transcription initiation from RNA polymerase I promoter(GO:0006361) termination of RNA polymerase I transcription(GO:0006363) |
| 0.6 |
1.9 |
GO:1902358 |
sulfate transmembrane transport(GO:1902358) |
| 0.6 |
1.8 |
GO:1904685 |
positive regulation of metalloendopeptidase activity(GO:1904685) |
| 0.5 |
4.2 |
GO:0070314 |
G1 to G0 transition(GO:0070314) |
| 0.5 |
1.5 |
GO:1903795 |
regulation of inorganic anion transmembrane transport(GO:1903795) |
| 0.5 |
2.4 |
GO:0048143 |
astrocyte activation(GO:0048143) |
| 0.4 |
1.2 |
GO:0048866 |
stem cell fate specification(GO:0048866) |
| 0.4 |
2.6 |
GO:0072257 |
metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 0.4 |
1.9 |
GO:0060414 |
aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.4 |
0.7 |
GO:0072289 |
metanephric nephron tubule formation(GO:0072289) |
| 0.3 |
1.3 |
GO:0046552 |
eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 0.3 |
0.9 |
GO:1900158 |
regulation of osteoclast proliferation(GO:0090289) negative regulation of bone mineralization involved in bone maturation(GO:1900158) |
| 0.3 |
1.1 |
GO:1903251 |
multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.2 |
3.0 |
GO:0031274 |
positive regulation of pseudopodium assembly(GO:0031274) |
| 0.2 |
1.4 |
GO:0007253 |
cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.2 |
1.0 |
GO:0033136 |
serine phosphorylation of STAT3 protein(GO:0033136) |
| 0.2 |
2.1 |
GO:0060710 |
chorio-allantoic fusion(GO:0060710) |
| 0.2 |
0.4 |
GO:0033088 |
negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 0.2 |
3.9 |
GO:0015812 |
gamma-aminobutyric acid transport(GO:0015812) |
| 0.2 |
0.7 |
GO:0014846 |
esophagus smooth muscle contraction(GO:0014846) |
| 0.2 |
0.7 |
GO:0099624 |
regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) atrial cardiac muscle cell membrane repolarization(GO:0099624) |
| 0.2 |
1.6 |
GO:1902459 |
positive regulation of stem cell population maintenance(GO:1902459) |
| 0.2 |
1.1 |
GO:0043569 |
negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.2 |
1.1 |
GO:0015840 |
urea transport(GO:0015840) urea transmembrane transport(GO:0071918) |
| 0.2 |
0.6 |
GO:0042938 |
dipeptide transport(GO:0042938) |
| 0.1 |
1.1 |
GO:0016081 |
synaptic vesicle docking(GO:0016081) |
| 0.1 |
0.7 |
GO:2000987 |
positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
| 0.1 |
0.3 |
GO:1900127 |
positive regulation of hyaluronan biosynthetic process(GO:1900127) |
| 0.1 |
0.4 |
GO:1901628 |
positive regulation of postsynaptic membrane organization(GO:1901628) |
| 0.1 |
2.3 |
GO:2000353 |
positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.1 |
0.6 |
GO:0003406 |
retinal pigment epithelium development(GO:0003406) |
| 0.1 |
0.1 |
GO:0061324 |
canonical Wnt signaling pathway involved in positive regulation of cardiac outflow tract cell proliferation(GO:0061324) regulation of cell proliferation involved in outflow tract morphogenesis(GO:1901963) |
| 0.1 |
1.2 |
GO:0090385 |
phagosome-lysosome fusion(GO:0090385) |
| 0.1 |
0.6 |
GO:1903598 |
negative regulation of peptidyl-tyrosine autophosphorylation(GO:1900085) positive regulation of gap junction assembly(GO:1903598) |
| 0.1 |
0.4 |
GO:0001951 |
intestinal D-glucose absorption(GO:0001951) terminal web assembly(GO:1902896) |
| 0.1 |
2.0 |
GO:2000637 |
positive regulation of gene silencing by miRNA(GO:2000637) |
| 0.1 |
0.9 |
GO:0060662 |
tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
| 0.1 |
0.5 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.1 |
0.7 |
GO:0060576 |
intestinal epithelial cell development(GO:0060576) |
| 0.1 |
1.2 |
GO:0061299 |
retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 0.1 |
0.3 |
GO:0018214 |
peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.1 |
0.9 |
GO:0010839 |
negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.1 |
0.6 |
GO:0030382 |
sperm mitochondrion organization(GO:0030382) |
| 0.1 |
0.5 |
GO:0032298 |
positive regulation of DNA-dependent DNA replication initiation(GO:0032298) |
| 0.1 |
0.5 |
GO:0007021 |
tubulin complex assembly(GO:0007021) |
| 0.1 |
0.3 |
GO:0048739 |
cardiac muscle fiber development(GO:0048739) |
| 0.1 |
0.3 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.1 |
0.4 |
GO:0036151 |
phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.1 |
0.5 |
GO:0045654 |
positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.1 |
0.1 |
GO:0031272 |
regulation of pseudopodium assembly(GO:0031272) |
| 0.1 |
0.4 |
GO:0015879 |
carnitine transport(GO:0015879) |
| 0.1 |
0.5 |
GO:0090336 |
positive regulation of brown fat cell differentiation(GO:0090336) |
| 0.1 |
0.7 |
GO:0033631 |
cell-cell adhesion mediated by integrin(GO:0033631) |
| 0.1 |
0.8 |
GO:0019368 |
fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.1 |
0.3 |
GO:0090292 |
nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.1 |
0.3 |
GO:0048934 |
ventricular compact myocardium morphogenesis(GO:0003223) proprioception(GO:0019230) peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.1 |
0.5 |
GO:0000022 |
mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
| 0.1 |
0.4 |
GO:0003065 |
positive regulation of heart rate by epinephrine(GO:0003065) |
| 0.1 |
1.1 |
GO:0001946 |
lymphangiogenesis(GO:0001946) lymph vessel morphogenesis(GO:0036303) |
| 0.1 |
0.6 |
GO:0019800 |
peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.1 |
0.4 |
GO:0071376 |
response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.1 |
0.2 |
GO:0046487 |
glyoxylate metabolic process(GO:0046487) |
| 0.1 |
0.3 |
GO:0007406 |
negative regulation of neuroblast proliferation(GO:0007406) |
| 0.1 |
0.5 |
GO:0030035 |
microspike assembly(GO:0030035) |
| 0.1 |
0.3 |
GO:0016255 |
attachment of GPI anchor to protein(GO:0016255) |
| 0.1 |
0.5 |
GO:1902231 |
positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.0 |
0.7 |
GO:0043402 |
glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.0 |
0.3 |
GO:0035743 |
CD4-positive, alpha-beta T cell cytokine production(GO:0035743) T-helper 2 cell cytokine production(GO:0035745) |
| 0.0 |
0.4 |
GO:0043568 |
positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.0 |
0.3 |
GO:1903847 |
regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
| 0.0 |
0.2 |
GO:0086023 |
adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
| 0.0 |
2.4 |
GO:0032611 |
interleukin-1 beta production(GO:0032611) |
| 0.0 |
0.5 |
GO:0045723 |
positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.0 |
0.3 |
GO:0021780 |
oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.0 |
1.3 |
GO:0042462 |
eye photoreceptor cell development(GO:0042462) |
| 0.0 |
0.1 |
GO:2001015 |
regulation of branch elongation involved in ureteric bud branching(GO:0072095) regulation of ureteric bud formation(GO:0072106) positive regulation of ureteric bud formation(GO:0072107) negative regulation of skeletal muscle cell differentiation(GO:2001015) |
| 0.0 |
0.2 |
GO:0035428 |
hexose transmembrane transport(GO:0035428) |
| 0.0 |
0.1 |
GO:0002667 |
lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 0.0 |
0.3 |
GO:0006686 |
sphingomyelin biosynthetic process(GO:0006686) |
| 0.0 |
2.1 |
GO:0042058 |
regulation of epidermal growth factor receptor signaling pathway(GO:0042058) |
| 0.0 |
0.7 |
GO:0071260 |
cellular response to mechanical stimulus(GO:0071260) |
| 0.0 |
0.1 |
GO:1901301 |
regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.0 |
0.6 |
GO:0014067 |
negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
| 0.0 |
0.7 |
GO:0016082 |
synaptic vesicle priming(GO:0016082) |
| 0.0 |
1.1 |
GO:0045747 |
positive regulation of Notch signaling pathway(GO:0045747) |
| 0.0 |
1.1 |
GO:0000132 |
establishment of mitotic spindle orientation(GO:0000132) |
| 0.0 |
0.4 |
GO:0030213 |
hyaluronan biosynthetic process(GO:0030213) |
| 0.0 |
0.2 |
GO:0007343 |
egg activation(GO:0007343) |
| 0.0 |
0.1 |
GO:0007342 |
fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.0 |
0.1 |
GO:0036092 |
phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.0 |
0.6 |
GO:0045475 |
locomotor rhythm(GO:0045475) |
| 0.0 |
1.4 |
GO:2000134 |
negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
| 0.0 |
0.2 |
GO:0033147 |
negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.0 |
0.3 |
GO:0016479 |
negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
| 0.0 |
1.3 |
GO:0007628 |
adult walking behavior(GO:0007628) walking behavior(GO:0090659) |
| 0.0 |
0.6 |
GO:0010107 |
potassium ion import(GO:0010107) |
| 0.0 |
1.6 |
GO:0032088 |
negative regulation of NF-kappaB transcription factor activity(GO:0032088) |
| 0.0 |
0.2 |
GO:0002467 |
germinal center formation(GO:0002467) |
| 0.0 |
1.6 |
GO:0061077 |
chaperone-mediated protein folding(GO:0061077) |
| 0.0 |
0.4 |
GO:0044243 |
collagen catabolic process(GO:0030574) multicellular organism catabolic process(GO:0044243) |
| 0.0 |
0.0 |
GO:0008065 |
establishment of blood-nerve barrier(GO:0008065) |
| 0.0 |
0.1 |
GO:1990414 |
replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
| 0.0 |
0.4 |
GO:0001886 |
endothelial cell morphogenesis(GO:0001886) |
| 0.0 |
0.1 |
GO:1902683 |
regulation of receptor localization to synapse(GO:1902683) |
| 0.0 |
1.0 |
GO:0017145 |
stem cell division(GO:0017145) |
| 0.0 |
0.6 |
GO:0007026 |
negative regulation of microtubule depolymerization(GO:0007026) |
| 0.0 |
0.1 |
GO:1900220 |
semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.0 |
0.3 |
GO:0006828 |
manganese ion transport(GO:0006828) |
| 0.0 |
0.1 |
GO:0035726 |
common myeloid progenitor cell proliferation(GO:0035726) |
| 0.0 |
0.4 |
GO:0003229 |
ventricular cardiac muscle tissue development(GO:0003229) |
| 0.0 |
0.2 |
GO:1903846 |
positive regulation of transforming growth factor beta receptor signaling pathway(GO:0030511) positive regulation of cellular response to transforming growth factor beta stimulus(GO:1903846) |
| 0.0 |
0.4 |
GO:0045746 |
negative regulation of Notch signaling pathway(GO:0045746) |
| 0.0 |
2.0 |
GO:0007050 |
cell cycle arrest(GO:0007050) |
| 0.0 |
0.5 |
GO:2000249 |
regulation of actin cytoskeleton reorganization(GO:2000249) |
| 0.0 |
0.6 |
GO:0033014 |
porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
| 0.0 |
0.2 |
GO:0050884 |
neuromuscular process controlling posture(GO:0050884) |
| 0.0 |
0.6 |
GO:0006940 |
regulation of smooth muscle contraction(GO:0006940) |
| 0.0 |
0.1 |
GO:0018026 |
peptidyl-lysine monomethylation(GO:0018026) |
| 0.0 |
0.1 |
GO:0006995 |
cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.0 |
0.3 |
GO:0006825 |
copper ion transport(GO:0006825) |
| 0.0 |
0.2 |
GO:0060438 |
trachea development(GO:0060438) |
| 0.0 |
1.1 |
GO:0010811 |
positive regulation of cell-substrate adhesion(GO:0010811) |
| 0.0 |
0.1 |
GO:0090073 |
positive regulation of protein homodimerization activity(GO:0090073) |
| 0.0 |
0.1 |
GO:0010587 |
miRNA catabolic process(GO:0010587) |
| 0.0 |
0.2 |
GO:0010614 |
negative regulation of cardiac muscle hypertrophy(GO:0010614) |
| 0.0 |
0.5 |
GO:0006890 |
retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
| 0.0 |
0.9 |
GO:0000187 |
activation of MAPK activity(GO:0000187) |
| 0.0 |
0.0 |
GO:1902396 |
protein localization to bicellular tight junction(GO:1902396) |
| 0.0 |
0.2 |
GO:0060441 |
epithelial tube branching involved in lung morphogenesis(GO:0060441) |
| 0.0 |
0.2 |
GO:0034315 |
regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |