| 0.4 |
1.3 |
GO:0010989 |
negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.4 |
1.2 |
GO:0002432 |
granuloma formation(GO:0002432) |
| 0.4 |
1.5 |
GO:0001907 |
killing by symbiont of host cells(GO:0001907) induction of programmed cell death(GO:0012502) disruption by symbiont of host cell(GO:0044004) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) positive regulation of apoptotic process by virus(GO:0060139) apoptotic process involved in embryonic digit morphogenesis(GO:1902263) positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.4 |
1.1 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.4 |
1.4 |
GO:0071139 |
resolution of recombination intermediates(GO:0071139) |
| 0.3 |
1.9 |
GO:0060718 |
chorionic trophoblast cell differentiation(GO:0060718) |
| 0.3 |
1.7 |
GO:0048934 |
peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.2 |
0.7 |
GO:1902498 |
regulation of protein autoubiquitination(GO:1902498) |
| 0.2 |
0.6 |
GO:0003096 |
renal sodium ion transport(GO:0003096) |
| 0.2 |
0.6 |
GO:1900041 |
negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.2 |
0.8 |
GO:0097168 |
condensed mesenchymal cell proliferation(GO:0072137) mesenchymal stem cell proliferation(GO:0097168) |
| 0.2 |
4.8 |
GO:0007214 |
gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.2 |
0.5 |
GO:0060423 |
foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
| 0.2 |
1.2 |
GO:0090336 |
positive regulation of brown fat cell differentiation(GO:0090336) |
| 0.2 |
0.5 |
GO:0007521 |
muscle cell fate determination(GO:0007521) mammary placode formation(GO:0060596) |
| 0.2 |
0.3 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.1 |
1.0 |
GO:1902416 |
positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
| 0.1 |
0.9 |
GO:0019695 |
choline metabolic process(GO:0019695) |
| 0.1 |
3.4 |
GO:2000310 |
regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
| 0.1 |
0.4 |
GO:0030070 |
insulin processing(GO:0030070) |
| 0.1 |
1.2 |
GO:0042760 |
very long-chain fatty acid catabolic process(GO:0042760) |
| 0.1 |
0.5 |
GO:0042276 |
error-prone translesion synthesis(GO:0042276) |
| 0.1 |
0.7 |
GO:0035590 |
purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.1 |
0.6 |
GO:0006447 |
regulation of translational initiation by iron(GO:0006447) positive regulation of translational initiation by iron(GO:0045994) |
| 0.1 |
0.4 |
GO:0046958 |
nonassociative learning(GO:0046958) habituation(GO:0046959) |
| 0.1 |
0.5 |
GO:1904425 |
negative regulation of GTP binding(GO:1904425) |
| 0.1 |
0.3 |
GO:0048208 |
vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
| 0.1 |
0.5 |
GO:0031022 |
nuclear migration along microfilament(GO:0031022) |
| 0.1 |
3.7 |
GO:0045746 |
negative regulation of Notch signaling pathway(GO:0045746) |
| 0.1 |
1.0 |
GO:0010459 |
negative regulation of heart rate(GO:0010459) |
| 0.1 |
0.3 |
GO:0042138 |
meiotic DNA double-strand break formation(GO:0042138) |
| 0.1 |
0.5 |
GO:2000074 |
regulation of type B pancreatic cell development(GO:2000074) |
| 0.1 |
0.7 |
GO:0035092 |
sperm chromatin condensation(GO:0035092) |
| 0.1 |
0.4 |
GO:0032788 |
saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
| 0.1 |
0.6 |
GO:1905206 |
positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
| 0.1 |
0.4 |
GO:0060075 |
regulation of resting membrane potential(GO:0060075) |
| 0.1 |
0.4 |
GO:0034454 |
microtubule anchoring at centrosome(GO:0034454) |
| 0.1 |
0.5 |
GO:0044034 |
negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.1 |
1.4 |
GO:0021891 |
olfactory bulb interneuron development(GO:0021891) |
| 0.1 |
0.4 |
GO:0090234 |
regulation of kinetochore assembly(GO:0090234) |
| 0.1 |
0.3 |
GO:0045617 |
negative regulation of keratinocyte differentiation(GO:0045617) |
| 0.1 |
0.2 |
GO:0030167 |
proteoglycan catabolic process(GO:0030167) |
| 0.1 |
0.3 |
GO:2000525 |
regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.1 |
0.8 |
GO:0006020 |
inositol metabolic process(GO:0006020) |
| 0.1 |
0.6 |
GO:2000300 |
regulation of synaptic vesicle exocytosis(GO:2000300) |
| 0.1 |
0.6 |
GO:0036506 |
maintenance of unfolded protein(GO:0036506) protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.1 |
0.3 |
GO:0090286 |
cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.1 |
0.3 |
GO:0019509 |
L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.1 |
3.6 |
GO:0042058 |
regulation of epidermal growth factor receptor signaling pathway(GO:0042058) |
| 0.1 |
0.7 |
GO:0010457 |
centriole-centriole cohesion(GO:0010457) |
| 0.1 |
0.2 |
GO:0045039 |
protein import into mitochondrial inner membrane(GO:0045039) |
| 0.1 |
0.5 |
GO:0000185 |
activation of MAPKKK activity(GO:0000185) |
| 0.1 |
0.4 |
GO:0018158 |
protein oxidation(GO:0018158) |
| 0.1 |
0.2 |
GO:1903519 |
penetration of zona pellucida(GO:0007341) apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
| 0.1 |
0.4 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 0.1 |
0.8 |
GO:0036120 |
response to platelet-derived growth factor(GO:0036119) cellular response to platelet-derived growth factor stimulus(GO:0036120) |
| 0.1 |
0.2 |
GO:2000642 |
negative regulation of early endosome to late endosome transport(GO:2000642) |
| 0.1 |
0.5 |
GO:0035095 |
behavioral response to nicotine(GO:0035095) |
| 0.1 |
0.2 |
GO:0071544 |
diphosphoinositol polyphosphate metabolic process(GO:0071543) diphosphoinositol polyphosphate catabolic process(GO:0071544) |
| 0.1 |
0.3 |
GO:0002904 |
positive regulation of B cell apoptotic process(GO:0002904) regulation of pro-B cell differentiation(GO:2000973) |
| 0.1 |
0.2 |
GO:0007354 |
zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 0.1 |
0.4 |
GO:0019348 |
dolichol metabolic process(GO:0019348) |
| 0.0 |
0.2 |
GO:2000301 |
negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.0 |
0.7 |
GO:0060394 |
negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 0.0 |
0.2 |
GO:0002457 |
T cell antigen processing and presentation(GO:0002457) |
| 0.0 |
0.6 |
GO:2000465 |
regulation of glycogen (starch) synthase activity(GO:2000465) |
| 0.0 |
0.3 |
GO:0090188 |
negative regulation of pancreatic juice secretion(GO:0090188) |
| 0.0 |
0.2 |
GO:0060709 |
glycogen cell differentiation involved in embryonic placenta development(GO:0060709) |
| 0.0 |
0.8 |
GO:0021796 |
cerebral cortex regionalization(GO:0021796) |
| 0.0 |
0.9 |
GO:0042249 |
establishment of planar polarity of embryonic epithelium(GO:0042249) |
| 0.0 |
0.5 |
GO:0045974 |
miRNA mediated inhibition of translation(GO:0035278) negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
| 0.0 |
0.3 |
GO:1902261 |
positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.0 |
0.3 |
GO:0046339 |
diacylglycerol metabolic process(GO:0046339) |
| 0.0 |
1.0 |
GO:0016082 |
synaptic vesicle priming(GO:0016082) |
| 0.0 |
0.1 |
GO:0001866 |
NK T cell proliferation(GO:0001866) |
| 0.0 |
0.5 |
GO:0060710 |
chorio-allantoic fusion(GO:0060710) |
| 0.0 |
0.6 |
GO:2001222 |
regulation of neuron migration(GO:2001222) |
| 0.0 |
0.2 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 0.0 |
0.3 |
GO:0090385 |
phagosome-lysosome fusion(GO:0090385) |
| 0.0 |
0.0 |
GO:0018307 |
enzyme active site formation(GO:0018307) |
| 0.0 |
0.7 |
GO:0043552 |
positive regulation of phosphatidylinositol 3-kinase activity(GO:0043552) |
| 0.0 |
0.2 |
GO:2000193 |
positive regulation of fatty acid transport(GO:2000193) |
| 0.0 |
0.5 |
GO:0021860 |
pyramidal neuron development(GO:0021860) |
| 0.0 |
1.8 |
GO:0001676 |
long-chain fatty acid metabolic process(GO:0001676) |
| 0.0 |
0.2 |
GO:0034134 |
toll-like receptor 2 signaling pathway(GO:0034134) negative regulation of cholesterol efflux(GO:0090370) |
| 0.0 |
0.1 |
GO:0090110 |
cargo loading into COPII-coated vesicle(GO:0090110) |
| 0.0 |
0.1 |
GO:0070100 |
negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
| 0.0 |
0.7 |
GO:0006346 |
methylation-dependent chromatin silencing(GO:0006346) |
| 0.0 |
0.7 |
GO:0070306 |
lens fiber cell differentiation(GO:0070306) |
| 0.0 |
0.3 |
GO:0043508 |
negative regulation of JUN kinase activity(GO:0043508) |
| 0.0 |
0.7 |
GO:0046854 |
phosphatidylinositol phosphorylation(GO:0046854) |
| 0.0 |
0.3 |
GO:0061179 |
negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.0 |
0.8 |
GO:0015909 |
long-chain fatty acid transport(GO:0015909) |
| 0.0 |
0.3 |
GO:0034773 |
histone H4-K20 trimethylation(GO:0034773) |
| 0.0 |
0.4 |
GO:0007263 |
nitric oxide mediated signal transduction(GO:0007263) |
| 0.0 |
0.1 |
GO:0060903 |
positive regulation of meiosis I(GO:0060903) |
| 0.0 |
0.4 |
GO:1903861 |
regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
| 0.0 |
0.2 |
GO:0032486 |
Rap protein signal transduction(GO:0032486) |
| 0.0 |
0.1 |
GO:0060971 |
embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.0 |
0.1 |
GO:0042373 |
vitamin K metabolic process(GO:0042373) |
| 0.0 |
0.1 |
GO:0089700 |
protein kinase D signaling(GO:0089700) |
| 0.0 |
1.2 |
GO:0009062 |
fatty acid catabolic process(GO:0009062) |
| 0.0 |
0.3 |
GO:0033599 |
regulation of mammary gland epithelial cell proliferation(GO:0033599) |
| 0.0 |
0.5 |
GO:0022617 |
extracellular matrix disassembly(GO:0022617) |
| 0.0 |
0.1 |
GO:0090084 |
negative regulation of inclusion body assembly(GO:0090084) |
| 0.0 |
0.1 |
GO:0090306 |
spindle assembly involved in meiosis(GO:0090306) |
| 0.0 |
0.3 |
GO:0010603 |
regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
| 0.0 |
0.3 |
GO:0002021 |
response to dietary excess(GO:0002021) |
| 0.0 |
0.1 |
GO:0090267 |
positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 0.0 |
0.2 |
GO:1900745 |
positive regulation of p38MAPK cascade(GO:1900745) |
| 0.0 |
0.2 |
GO:1990403 |
embryonic brain development(GO:1990403) |
| 0.0 |
0.5 |
GO:0048599 |
oocyte development(GO:0048599) |
| 0.0 |
0.4 |
GO:0046677 |
response to antibiotic(GO:0046677) |
| 0.0 |
0.0 |
GO:0060854 |
patterning of lymph vessels(GO:0060854) |
| 0.0 |
0.0 |
GO:0039692 |
single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) |
| 0.0 |
0.4 |
GO:0034629 |
cellular protein complex localization(GO:0034629) |
| 0.0 |
0.1 |
GO:1900145 |
regulation of nodal signaling pathway involved in determination of left/right asymmetry(GO:1900145) regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900175) positive regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900224) |
| 0.0 |
0.1 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.0 |
0.1 |
GO:0046464 |
neutral lipid catabolic process(GO:0046461) acylglycerol catabolic process(GO:0046464) |
| 0.0 |
0.9 |
GO:0048286 |
lung alveolus development(GO:0048286) |
| 0.0 |
0.5 |
GO:0002474 |
antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 0.0 |
0.7 |
GO:2000134 |
negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
| 0.0 |
0.2 |
GO:0051044 |
positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.0 |
0.4 |
GO:0009299 |
mRNA transcription(GO:0009299) |
| 0.0 |
0.2 |
GO:0071549 |
cellular response to dexamethasone stimulus(GO:0071549) |
| 0.0 |
0.3 |
GO:0061014 |
positive regulation of mRNA catabolic process(GO:0061014) |
| 0.0 |
0.0 |
GO:0051643 |
endoplasmic reticulum localization(GO:0051643) |
| 0.0 |
1.2 |
GO:0008217 |
regulation of blood pressure(GO:0008217) |
| 0.0 |
0.3 |
GO:0072337 |
modified amino acid transport(GO:0072337) |
| 0.0 |
0.1 |
GO:0071545 |
inositol phosphate catabolic process(GO:0071545) |
