Motif ID: Zbtb3
Z-value: 0.664
Transcription factors associated with Zbtb3:
Gene Symbol | Entrez ID | Gene Name |
---|---|---|
Zbtb3 | ENSMUSG00000071661.6 | Zbtb3 |
Activity-expression correlation:
Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Zbtb3 | mm10_v2_chr19_+_8802486_8802530 | 0.04 | 8.9e-01 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.6 | GO:0010636 | positive regulation of mitochondrial fusion(GO:0010636) |
0.1 | 0.8 | GO:0015879 | carnitine transport(GO:0015879) |
0.1 | 0.3 | GO:0010512 | negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
0.1 | 0.3 | GO:0030070 | insulin processing(GO:0030070) |
0.1 | 0.6 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.1 | 0.2 | GO:1902524 | negative regulation of interferon-alpha production(GO:0032687) interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) negative regulation of interferon-beta biosynthetic process(GO:0045358) positive regulation of protein K48-linked ubiquitination(GO:1902524) |
0.1 | 0.2 | GO:0006106 | fumarate metabolic process(GO:0006106) aspartate catabolic process(GO:0006533) |
0.1 | 0.2 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
0.1 | 0.2 | GO:1904529 | regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
0.0 | 0.6 | GO:0060363 | cranial suture morphogenesis(GO:0060363) |
0.0 | 0.3 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.0 | 0.2 | GO:2001015 | negative regulation of skeletal muscle cell differentiation(GO:2001015) |
0.0 | 0.1 | GO:0090202 | transcriptional activation by promoter-enhancer looping(GO:0071733) regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
0.0 | 0.1 | GO:0035106 | operant conditioning(GO:0035106) |
0.0 | 0.1 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.0 | 0.1 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) proprioception(GO:0019230) |
0.0 | 0.3 | GO:0090232 | positive regulation of spindle checkpoint(GO:0090232) |
0.0 | 0.3 | GO:1901030 | positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
0.0 | 0.1 | GO:0032439 | endosome localization(GO:0032439) |
0.0 | 0.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.0 | 0.2 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
0.0 | 0.3 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
0.0 | 0.1 | GO:1903519 | penetration of zona pellucida(GO:0007341) apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
0.0 | 0.3 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
0.0 | 0.1 | GO:0009249 | protein lipoylation(GO:0009249) |
0.0 | 0.1 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
0.0 | 0.1 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
0.0 | 0.2 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
0.0 | 0.1 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.0 | 0.1 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.0 | 0.1 | GO:0031642 | negative regulation of myelination(GO:0031642) negative regulation of receptor catabolic process(GO:2000645) |
0.0 | 0.2 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
Gene overrepresentation in cellular_component category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.6 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.0 | 0.2 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.0 | 0.3 | GO:0031045 | dense core granule(GO:0031045) |
0.0 | 0.1 | GO:0071986 | Ragulator complex(GO:0071986) |
0.0 | 0.6 | GO:0005581 | collagen trimer(GO:0005581) |
0.0 | 0.1 | GO:0097255 | R2TP complex(GO:0097255) |
0.0 | 0.1 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.0 | 0.2 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.0 | 0.7 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.0 | 0.1 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.0 | 0.1 | GO:0031931 | TORC1 complex(GO:0031931) |
0.0 | 0.2 | GO:0035102 | PRC1 complex(GO:0035102) |
0.0 | 0.7 | GO:0016459 | myosin complex(GO:0016459) |
0.0 | 0.3 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
0.0 | 0.1 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
Gene overrepresentation in molecular_function category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 0.8 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
0.1 | 0.6 | GO:0008808 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
0.1 | 0.3 | GO:0042030 | ATPase inhibitor activity(GO:0042030) angiostatin binding(GO:0043532) |
0.1 | 0.2 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
0.0 | 0.1 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
0.0 | 0.1 | GO:0001888 | glucuronyl-galactosyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0001888) |
0.0 | 0.2 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.0 | 0.2 | GO:0008494 | translation activator activity(GO:0008494) |
0.0 | 0.3 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.0 | 0.2 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.0 | 0.2 | GO:0050786 | RAGE receptor binding(GO:0050786) |
0.0 | 0.3 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) cobalt ion binding(GO:0050897) |
0.0 | 0.3 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.0 | 0.2 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.0 | 0.3 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
0.0 | 0.2 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.0 | 0.3 | GO:0035380 | C-3 sterol dehydrogenase (C-4 sterol decarboxylase) activity(GO:0000252) mevaldate reductase activity(GO:0004495) gluconate dehydrogenase activity(GO:0008875) epoxide dehydrogenase activity(GO:0018451) 5-exo-hydroxycamphor dehydrogenase activity(GO:0018452) 2-hydroxytetrahydrofuran dehydrogenase activity(GO:0018453) acetoin dehydrogenase activity(GO:0019152) phenylcoumaran benzylic ether reductase activity(GO:0032442) D-xylose:NADP reductase activity(GO:0032866) L-arabinose:NADP reductase activity(GO:0032867) D-arabinitol dehydrogenase, D-ribulose forming (NADP+) activity(GO:0033709) (R)-(-)-1,2,3,4-tetrahydronaphthol dehydrogenase activity(GO:0034831) 3-hydroxymenthone dehydrogenase activity(GO:0034840) very long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0035380) dihydrotestosterone 17-beta-dehydrogenase activity(GO:0035410) (R)-2-hydroxyisocaproate dehydrogenase activity(GO:0043713) L-arabinose 1-dehydrogenase (NADP+) activity(GO:0044103) L-xylulose reductase (NAD+) activity(GO:0044105) 3-ketoglucose-reductase activity(GO:0048258) D-arabinitol dehydrogenase, D-xylulose forming (NADP+) activity(GO:0052677) |
0.0 | 0.1 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.0 | 0.1 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
0.0 | 0.1 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.0 | 0.1 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.0 | 0.1 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.0 | 0.2 | GO:0031005 | filamin binding(GO:0031005) |
0.0 | 0.0 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
0.0 | 0.1 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
0.0 | 0.1 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.0 | 0.3 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |