Motif ID: Ebf1
Z-value: 1.205
Transcription factors associated with Ebf1:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| Ebf1 | ENSMUSG00000078561.3 | Ebf1 |
| Ebf1 | ENSMUSG00000057098.8 | Ebf1 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Ebf1 | mm10_v2_chr11_+_44617310_44617336 | 0.01 | 9.5e-01 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.8 | 8.4 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
| 1.2 | 1.2 | GO:0060535 | trachea cartilage morphogenesis(GO:0060535) |
| 1.2 | 2.3 | GO:2000157 | regulation of protein K48-linked deubiquitination(GO:1903093) negative regulation of protein K48-linked deubiquitination(GO:1903094) negative regulation of ubiquitin-specific protease activity(GO:2000157) |
| 1.0 | 4.0 | GO:0002484 | antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway(GO:0002484) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway, TAP-dependent(GO:0002485) |
| 0.9 | 4.5 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
| 0.8 | 2.5 | GO:0072180 | mesonephric duct development(GO:0072177) mesonephric duct morphogenesis(GO:0072180) |
| 0.8 | 2.5 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 0.8 | 3.3 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.8 | 2.4 | GO:0060598 | dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
| 0.8 | 2.3 | GO:0060129 | thyroid-stimulating hormone-secreting cell differentiation(GO:0060129) |
| 0.7 | 2.1 | GO:0061075 | cerebral cortex GABAergic interneuron fate commitment(GO:0021893) positive regulation of neural retina development(GO:0061075) positive regulation of retina development in camera-type eye(GO:1902868) positive regulation of amacrine cell differentiation(GO:1902871) |
| 0.7 | 0.7 | GO:0060032 | notochord regression(GO:0060032) |
| 0.7 | 3.5 | GO:0046864 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) alveolar primary septum development(GO:0061143) |
| 0.7 | 5.3 | GO:2001198 | regulation of dendritic cell differentiation(GO:2001198) |
| 0.7 | 3.3 | GO:0048682 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
| 0.6 | 3.2 | GO:0010273 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.6 | 2.5 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
| 0.6 | 1.8 | GO:0044208 | 'de novo' AMP biosynthetic process(GO:0044208) |
| 0.6 | 1.8 | GO:0010533 | regulation of activation of Janus kinase activity(GO:0010533) |
| 0.5 | 1.6 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
| 0.5 | 1.0 | GO:0033864 | positive regulation of NAD(P)H oxidase activity(GO:0033864) |
| 0.5 | 3.6 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
| 0.5 | 2.0 | GO:2000256 | endomitotic cell cycle(GO:0007113) thrombopoietin-mediated signaling pathway(GO:0038163) positive regulation of male germ cell proliferation(GO:2000256) |
| 0.5 | 2.5 | GO:0051593 | response to folic acid(GO:0051593) |
| 0.5 | 2.0 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
| 0.5 | 1.9 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.5 | 1.4 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
| 0.5 | 2.4 | GO:0061642 | chemoattraction of axon(GO:0061642) |
| 0.5 | 2.9 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.5 | 1.9 | GO:1903416 | response to glycoside(GO:1903416) |
| 0.5 | 2.3 | GO:0021905 | pancreatic A cell development(GO:0003322) forebrain-midbrain boundary formation(GO:0021905) somatic motor neuron fate commitment(GO:0021917) regulation of transcription from RNA polymerase II promoter involved in somatic motor neuron fate commitment(GO:0021918) sensory neuron migration(GO:1904937) |
| 0.5 | 1.4 | GO:0046061 | dATP catabolic process(GO:0046061) |
| 0.5 | 2.3 | GO:0015705 | iodide transport(GO:0015705) |
| 0.4 | 2.7 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
| 0.4 | 1.3 | GO:0021557 | oculomotor nerve development(GO:0021557) |
| 0.4 | 1.7 | GO:0060857 | establishment of glial blood-brain barrier(GO:0060857) |
| 0.4 | 2.2 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
| 0.4 | 2.1 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) sphingolipid mediated signaling pathway(GO:0090520) |
| 0.4 | 0.4 | GO:0060591 | chondroblast differentiation(GO:0060591) |
| 0.4 | 1.6 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) cellular response to lipid hydroperoxide(GO:0071449) |
| 0.4 | 2.4 | GO:0001980 | regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
| 0.4 | 1.1 | GO:0072708 | DNA replication preinitiation complex assembly(GO:0071163) response to sorbitol(GO:0072708) |
| 0.4 | 0.7 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 0.4 | 1.1 | GO:0036166 | phenotypic switching(GO:0036166) |
| 0.4 | 1.8 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) |
| 0.4 | 2.2 | GO:0071499 | response to laminar fluid shear stress(GO:0034616) cellular response to laminar fluid shear stress(GO:0071499) |
| 0.4 | 1.8 | GO:0006538 | glutamate catabolic process(GO:0006538) |
| 0.4 | 1.8 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.4 | 1.1 | GO:0001787 | natural killer cell proliferation(GO:0001787) |
| 0.3 | 1.4 | GO:0030091 | protein repair(GO:0030091) |
| 0.3 | 1.0 | GO:0072139 | glomerular parietal epithelial cell differentiation(GO:0072139) |
| 0.3 | 0.7 | GO:1902956 | regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902956) |
| 0.3 | 2.3 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.3 | 1.6 | GO:0045918 | negative regulation of cytolysis(GO:0045918) |
| 0.3 | 2.2 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.3 | 0.6 | GO:0010512 | negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
| 0.3 | 1.3 | GO:0015744 | succinate transport(GO:0015744) |
| 0.3 | 1.0 | GO:0010725 | regulation of primitive erythrocyte differentiation(GO:0010725) |
| 0.3 | 1.3 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.3 | 1.3 | GO:1904565 | response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 0.3 | 1.3 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.3 | 1.6 | GO:0010593 | negative regulation of lamellipodium assembly(GO:0010593) |
| 0.3 | 2.2 | GO:0032782 | bile acid secretion(GO:0032782) |
| 0.3 | 0.6 | GO:1902869 | regulation of amacrine cell differentiation(GO:1902869) |
| 0.3 | 1.2 | GO:0032805 | positive regulation of low-density lipoprotein particle receptor catabolic process(GO:0032805) |
| 0.3 | 1.5 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.3 | 1.2 | GO:0051316 | attachment of spindle microtubules to kinetochore involved in meiotic chromosome segregation(GO:0051316) |
| 0.3 | 1.2 | GO:0042905 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.3 | 0.6 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
| 0.3 | 1.5 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.3 | 0.6 | GO:0021913 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
| 0.3 | 0.9 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.3 | 1.5 | GO:0002339 | B cell selection(GO:0002339) |
| 0.3 | 1.2 | GO:0010836 | negative regulation of protein ADP-ribosylation(GO:0010836) |
| 0.3 | 0.9 | GO:0060821 | inactivation of X chromosome by DNA methylation(GO:0060821) |
| 0.3 | 0.9 | GO:0051794 | regulation of catagen(GO:0051794) |
| 0.3 | 1.1 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 0.3 | 0.8 | GO:0021759 | globus pallidus development(GO:0021759) |
| 0.3 | 0.8 | GO:1904879 | positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.3 | 2.4 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.3 | 0.8 | GO:0060166 | retinoic acid biosynthetic process(GO:0002138) diterpenoid biosynthetic process(GO:0016102) olfactory pit development(GO:0060166) Harderian gland development(GO:0070384) |
| 0.3 | 1.1 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
| 0.3 | 0.8 | GO:0009446 | putrescine biosynthetic process(GO:0009446) |
| 0.3 | 0.5 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.3 | 1.3 | GO:0018158 | protein oxidation(GO:0018158) |
| 0.3 | 0.8 | GO:0019043 | establishment of viral latency(GO:0019043) |
| 0.3 | 1.0 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.3 | 2.0 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.2 | 1.0 | GO:0006558 | L-phenylalanine metabolic process(GO:0006558) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) |
| 0.2 | 0.7 | GO:0034370 | triglyceride-rich lipoprotein particle remodeling(GO:0034370) |
| 0.2 | 0.7 | GO:2001160 | regulation of histone H3-K79 methylation(GO:2001160) |
| 0.2 | 0.7 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.2 | 0.5 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
| 0.2 | 1.0 | GO:0046947 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.2 | 1.6 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.2 | 0.9 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
| 0.2 | 1.4 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.2 | 0.7 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.2 | 0.9 | GO:1901145 | regulation of mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:0072039) negative regulation of mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:0072040) mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:1901145) negative regulation of somatic stem cell population maintenance(GO:1904673) |
| 0.2 | 1.5 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
| 0.2 | 4.2 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
| 0.2 | 1.1 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
| 0.2 | 1.3 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
| 0.2 | 2.2 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.2 | 0.4 | GO:0033484 | nitric oxide homeostasis(GO:0033484) |
| 0.2 | 2.2 | GO:0030049 | muscle filament sliding(GO:0030049) |
| 0.2 | 1.1 | GO:0032901 | positive regulation of neurotrophin production(GO:0032901) |
| 0.2 | 0.6 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.2 | 0.6 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.2 | 1.1 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.2 | 0.6 | GO:0010519 | negative regulation of phospholipase activity(GO:0010519) |
| 0.2 | 0.4 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.2 | 0.6 | GO:0050847 | progesterone receptor signaling pathway(GO:0050847) |
| 0.2 | 0.4 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
| 0.2 | 1.2 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.2 | 0.6 | GO:0034184 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.2 | 0.2 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
| 0.2 | 2.8 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) collagen-activated signaling pathway(GO:0038065) |
| 0.2 | 0.2 | GO:0032632 | interleukin-3 production(GO:0032632) |
| 0.2 | 0.8 | GO:0015825 | L-serine transport(GO:0015825) |
| 0.2 | 1.2 | GO:0086028 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
| 0.2 | 1.2 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
| 0.2 | 0.8 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) |
| 0.2 | 0.6 | GO:0030300 | regulation of intestinal cholesterol absorption(GO:0030300) negative regulation of intestinal absorption(GO:1904479) |
| 0.2 | 1.2 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.2 | 0.6 | GO:0071673 | positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
| 0.2 | 1.0 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
| 0.2 | 1.0 | GO:1901552 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.2 | 0.4 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
| 0.2 | 2.5 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
| 0.2 | 0.4 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.2 | 1.5 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 0.2 | 2.5 | GO:0060579 | ventral spinal cord interneuron fate commitment(GO:0060579) cell fate commitment involved in pattern specification(GO:0060581) |
| 0.2 | 0.6 | GO:2000314 | negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
| 0.2 | 3.4 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
| 0.2 | 0.4 | GO:0000255 | allantoin metabolic process(GO:0000255) |
| 0.2 | 0.2 | GO:0032222 | regulation of synaptic transmission, cholinergic(GO:0032222) positive regulation of synaptic transmission, cholinergic(GO:0032224) |
| 0.2 | 1.1 | GO:0097646 | calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
| 0.2 | 0.7 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.2 | 0.6 | GO:0044381 | glucose import in response to insulin stimulus(GO:0044381) regulation of glucose import in response to insulin stimulus(GO:2001273) |
| 0.2 | 0.9 | GO:1990839 | response to endothelin(GO:1990839) |
| 0.2 | 1.1 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.2 | 0.5 | GO:2000620 | positive regulation of histone H4-K16 acetylation(GO:2000620) |
| 0.2 | 0.4 | GO:0071316 | cellular response to nicotine(GO:0071316) |
| 0.2 | 0.4 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
| 0.2 | 1.5 | GO:0098700 | neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.2 | 0.4 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
| 0.2 | 0.5 | GO:0002351 | type III hypersensitivity(GO:0001802) regulation of type III hypersensitivity(GO:0001803) positive regulation of type III hypersensitivity(GO:0001805) serotonin production involved in inflammatory response(GO:0002351) serotonin secretion involved in inflammatory response(GO:0002442) serotonin secretion by platelet(GO:0002554) positive regulation of mast cell cytokine production(GO:0032765) |
| 0.2 | 0.9 | GO:0003383 | apical constriction(GO:0003383) |
| 0.2 | 0.9 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
| 0.2 | 1.1 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.2 | 0.7 | GO:0060155 | platelet dense granule organization(GO:0060155) |
| 0.2 | 0.4 | GO:0032829 | regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) |
| 0.2 | 0.5 | GO:0060217 | hemangioblast cell differentiation(GO:0060217) |
| 0.2 | 1.4 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
| 0.2 | 1.2 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.2 | 0.5 | GO:0032877 | positive regulation of DNA endoreduplication(GO:0032877) |
| 0.2 | 0.5 | GO:0048162 | preantral ovarian follicle growth(GO:0001546) multi-layer follicle stage(GO:0048162) |
| 0.2 | 0.2 | GO:0072553 | terminal button organization(GO:0072553) |
| 0.2 | 0.8 | GO:0032472 | Golgi calcium ion transport(GO:0032472) |
| 0.2 | 0.5 | GO:1904975 | response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
| 0.2 | 0.5 | GO:0070093 | negative regulation of glucagon secretion(GO:0070093) |
| 0.2 | 0.3 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 0.2 | 0.3 | GO:0035470 | positive regulation of vascular wound healing(GO:0035470) |
| 0.2 | 0.5 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
| 0.2 | 1.3 | GO:0001977 | renal system process involved in regulation of blood volume(GO:0001977) |
| 0.2 | 0.5 | GO:0006097 | glyoxylate cycle(GO:0006097) negative regulation of glial cell migration(GO:1903976) |
| 0.2 | 0.3 | GO:0090272 | negative regulation of fibroblast growth factor production(GO:0090272) |
| 0.2 | 0.6 | GO:1904451 | regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904451) positive regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904453) |
| 0.2 | 0.5 | GO:0061537 | glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.2 | 0.8 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) |
| 0.2 | 0.5 | GO:1901228 | positive regulation of transcription from RNA polymerase II promoter involved in heart development(GO:1901228) |
| 0.2 | 0.5 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.2 | 0.6 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
| 0.2 | 0.5 | GO:1902310 | positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.2 | 0.3 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) terminal web assembly(GO:1902896) |
| 0.2 | 0.5 | GO:0090324 | negative regulation of oxidative phosphorylation(GO:0090324) |
| 0.2 | 1.4 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.2 | 0.5 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
| 0.2 | 0.5 | GO:0061198 | fungiform papilla formation(GO:0061198) |
| 0.2 | 0.3 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
| 0.2 | 0.5 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
| 0.2 | 0.3 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
| 0.1 | 2.2 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.1 | 0.4 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
| 0.1 | 0.7 | GO:0006105 | succinate metabolic process(GO:0006105) |
| 0.1 | 0.4 | GO:0044778 | meiotic DNA integrity checkpoint(GO:0044778) |
| 0.1 | 0.7 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
| 0.1 | 0.6 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.1 | 0.7 | GO:0009068 | aspartate family amino acid catabolic process(GO:0009068) |
| 0.1 | 0.4 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.1 | 0.6 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.1 | 0.6 | GO:0043973 | histone H3-K4 acetylation(GO:0043973) |
| 0.1 | 0.6 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.1 | 0.4 | GO:1903048 | regulation of acetylcholine-gated cation channel activity(GO:1903048) |
| 0.1 | 0.4 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
| 0.1 | 2.3 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.1 | 0.6 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
| 0.1 | 0.3 | GO:2000224 | regulation of testosterone biosynthetic process(GO:2000224) |
| 0.1 | 0.7 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.1 | 0.4 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.1 | 4.1 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.1 | 0.8 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.1 | 0.8 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.1 | 1.2 | GO:0006560 | proline metabolic process(GO:0006560) |
| 0.1 | 0.4 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.1 | 0.7 | GO:0052428 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.1 | 0.3 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.1 | 1.9 | GO:0002313 | mature B cell differentiation involved in immune response(GO:0002313) |
| 0.1 | 0.9 | GO:1903975 | regulation of glial cell migration(GO:1903975) |
| 0.1 | 0.4 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
| 0.1 | 0.9 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
| 0.1 | 0.4 | GO:0032493 | response to bacterial lipoprotein(GO:0032493) |
| 0.1 | 0.6 | GO:0006586 | tryptophan metabolic process(GO:0006568) indolalkylamine metabolic process(GO:0006586) |
| 0.1 | 0.6 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
| 0.1 | 0.3 | GO:0046881 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
| 0.1 | 1.1 | GO:0008543 | fibroblast growth factor receptor signaling pathway(GO:0008543) cellular response to fibroblast growth factor stimulus(GO:0044344) |
| 0.1 | 0.5 | GO:0006014 | D-ribose metabolic process(GO:0006014) |
| 0.1 | 0.6 | GO:0046016 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) positive regulation of transcription by glucose(GO:0046016) |
| 0.1 | 0.8 | GO:0072615 | interleukin-17 secretion(GO:0072615) |
| 0.1 | 0.5 | GO:0035036 | binding of sperm to zona pellucida(GO:0007339) sperm-egg recognition(GO:0035036) |
| 0.1 | 0.7 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.1 | 1.1 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.1 | 1.2 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
| 0.1 | 0.5 | GO:0042535 | positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
| 0.1 | 0.5 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.1 | 0.5 | GO:0072675 | osteoclast fusion(GO:0072675) |
| 0.1 | 1.2 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.1 | 0.2 | GO:0061762 | CAMKK-AMPK signaling cascade(GO:0061762) |
| 0.1 | 0.2 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
| 0.1 | 0.8 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.1 | 0.6 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.1 | 0.1 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
| 0.1 | 0.6 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.1 | 0.8 | GO:0036093 | germ cell proliferation(GO:0036093) |
| 0.1 | 0.5 | GO:2001168 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.1 | 0.3 | GO:0010641 | positive regulation of platelet-derived growth factor receptor signaling pathway(GO:0010641) |
| 0.1 | 0.7 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
| 0.1 | 0.8 | GO:0060019 | radial glial cell differentiation(GO:0060019) |
| 0.1 | 0.3 | GO:0035989 | tendon development(GO:0035989) |
| 0.1 | 0.5 | GO:0045346 | regulation of MHC class II biosynthetic process(GO:0045346) negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.1 | 1.3 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.1 | 0.3 | GO:0035106 | operant conditioning(GO:0035106) |
| 0.1 | 0.2 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
| 0.1 | 0.3 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.1 | 0.8 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.1 | 0.3 | GO:0008612 | peptidyl-lysine modification to peptidyl-hypusine(GO:0008612) |
| 0.1 | 0.3 | GO:0032962 | positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
| 0.1 | 0.1 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 0.1 | 0.9 | GO:0061436 | establishment of skin barrier(GO:0061436) |
| 0.1 | 0.7 | GO:0046060 | dATP metabolic process(GO:0046060) |
| 0.1 | 0.2 | GO:0072554 | arterial endothelial cell fate commitment(GO:0060844) blood vessel endothelial cell fate commitment(GO:0060846) endothelial cell fate specification(GO:0060847) Notch signaling pathway involved in arterial endothelial cell fate commitment(GO:0060853) regulation of cell adhesion involved in heart morphogenesis(GO:0061344) blood vessel lumenization(GO:0072554) blood vessel endothelial cell fate specification(GO:0097101) positive regulation of ephrin receptor signaling pathway(GO:1901189) regulation of canonical Wnt signaling pathway involved in cardiac muscle cell fate commitment(GO:1901295) positive regulation of heart induction(GO:1901321) regulation of canonical Wnt signaling pathway involved in heart development(GO:1905066) |
| 0.1 | 0.4 | GO:0046294 | formaldehyde catabolic process(GO:0046294) |
| 0.1 | 0.8 | GO:2000194 | regulation of female gonad development(GO:2000194) |
| 0.1 | 0.4 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
| 0.1 | 0.9 | GO:0006691 | leukotriene metabolic process(GO:0006691) |
| 0.1 | 0.5 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
| 0.1 | 0.6 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.1 | 0.5 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.1 | 2.0 | GO:0050909 | sensory perception of taste(GO:0050909) |
| 0.1 | 1.5 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
| 0.1 | 0.3 | GO:0043328 | protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.1 | 0.4 | GO:0002517 | T cell tolerance induction(GO:0002517) regulation of T cell tolerance induction(GO:0002664) |
| 0.1 | 1.3 | GO:0045577 | regulation of B cell differentiation(GO:0045577) |
| 0.1 | 0.3 | GO:1902460 | transforming growth factor beta activation(GO:0036363) regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.1 | 0.3 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
| 0.1 | 0.2 | GO:0023016 | signal transduction by trans-phosphorylation(GO:0023016) |
| 0.1 | 0.4 | GO:0050849 | negative regulation of calcium-mediated signaling(GO:0050849) |
| 0.1 | 0.4 | GO:0035752 | lysosomal lumen pH elevation(GO:0035752) |
| 0.1 | 0.3 | GO:0042823 | pyridoxal phosphate biosynthetic process(GO:0042823) |
| 0.1 | 0.3 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
| 0.1 | 0.5 | GO:0003420 | regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
| 0.1 | 1.3 | GO:0046036 | CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
| 0.1 | 2.6 | GO:0046596 | regulation of viral entry into host cell(GO:0046596) |
| 0.1 | 0.9 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.1 | 0.3 | GO:0015793 | glycerol transport(GO:0015793) |
| 0.1 | 0.2 | GO:0051342 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
| 0.1 | 0.3 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
| 0.1 | 1.2 | GO:0035115 | embryonic forelimb morphogenesis(GO:0035115) |
| 0.1 | 0.2 | GO:0061009 | common bile duct development(GO:0061009) |
| 0.1 | 0.3 | GO:1902714 | negative regulation of interferon-gamma secretion(GO:1902714) |
| 0.1 | 0.2 | GO:0097501 | stress response to metal ion(GO:0097501) |
| 0.1 | 0.1 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
| 0.1 | 0.3 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.1 | 0.3 | GO:1904578 | response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) |
| 0.1 | 0.5 | GO:0080184 | response to stilbenoid(GO:0035634) response to phenylpropanoid(GO:0080184) |
| 0.1 | 0.1 | GO:0019062 | virion attachment to host cell(GO:0019062) adhesion of symbiont to host cell(GO:0044650) |
| 0.1 | 0.3 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.1 | 1.2 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
| 0.1 | 0.3 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
| 0.1 | 0.4 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.1 | 0.7 | GO:0045199 | maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.1 | 0.5 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
| 0.1 | 0.3 | GO:0060763 | mammary duct terminal end bud growth(GO:0060763) transepithelial ammonium transport(GO:0070634) |
| 0.1 | 2.8 | GO:0046677 | response to antibiotic(GO:0046677) |
| 0.1 | 0.3 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.1 | 0.5 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
| 0.1 | 0.2 | GO:2000192 | negative regulation of fatty acid transport(GO:2000192) |
| 0.1 | 1.9 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
| 0.1 | 0.4 | GO:0061325 | extraocular skeletal muscle development(GO:0002074) cardiac neural crest cell migration involved in outflow tract morphogenesis(GO:0003253) subthalamic nucleus development(GO:0021763) deltoid tuberosity development(GO:0035993) left lung development(GO:0060459) left lung morphogenesis(GO:0060460) pulmonary vein morphogenesis(GO:0060577) superior vena cava morphogenesis(GO:0060578) cell proliferation involved in outflow tract morphogenesis(GO:0061325) |
| 0.1 | 0.5 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
| 0.1 | 0.5 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.1 | 0.3 | GO:1903490 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 0.1 | 0.3 | GO:2000393 | negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.1 | 0.3 | GO:0046601 | positive regulation of centriole replication(GO:0046601) |
| 0.1 | 1.1 | GO:0060219 | camera-type eye photoreceptor cell differentiation(GO:0060219) |
| 0.1 | 0.4 | GO:0007044 | cell-substrate junction assembly(GO:0007044) |
| 0.1 | 0.3 | GO:0006601 | creatine metabolic process(GO:0006600) creatine biosynthetic process(GO:0006601) |
| 0.1 | 0.5 | GO:0051096 | regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
| 0.1 | 0.3 | GO:0046645 | positive regulation of gamma-delta T cell differentiation(GO:0045588) positive regulation of gamma-delta T cell activation(GO:0046645) |
| 0.1 | 2.1 | GO:0010972 | negative regulation of G2/M transition of mitotic cell cycle(GO:0010972) |
| 0.1 | 0.4 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.1 | 0.2 | GO:0048853 | forebrain morphogenesis(GO:0048853) |
| 0.1 | 0.8 | GO:0002523 | leukocyte migration involved in inflammatory response(GO:0002523) |
| 0.1 | 0.5 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 0.1 | 2.4 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 0.1 | 0.3 | GO:0002326 | B cell lineage commitment(GO:0002326) |
| 0.1 | 0.4 | GO:0071493 | cellular response to UV-B(GO:0071493) |
| 0.1 | 0.2 | GO:0010700 | negative regulation of norepinephrine secretion(GO:0010700) |
| 0.1 | 0.3 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.1 | 0.5 | GO:0050655 | dermatan sulfate proteoglycan metabolic process(GO:0050655) |
| 0.1 | 1.0 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.1 | 0.2 | GO:0042772 | DNA damage response, signal transduction resulting in transcription(GO:0042772) |
| 0.1 | 0.3 | GO:0032653 | regulation of interleukin-10 production(GO:0032653) |
| 0.1 | 0.2 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
| 0.1 | 0.2 | GO:0006702 | androgen biosynthetic process(GO:0006702) |
| 0.1 | 0.3 | GO:1904778 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
| 0.1 | 0.4 | GO:1990034 | calcium ion export from cell(GO:1990034) |
| 0.1 | 0.5 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
| 0.1 | 0.7 | GO:0043084 | penile erection(GO:0043084) |
| 0.1 | 0.5 | GO:0070253 | somatostatin secretion(GO:0070253) |
| 0.1 | 0.6 | GO:0043201 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
| 0.1 | 0.7 | GO:0043312 | neutrophil degranulation(GO:0043312) |
| 0.1 | 0.2 | GO:1901355 | response to rapamycin(GO:1901355) |
| 0.1 | 0.1 | GO:0071630 | nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
| 0.1 | 0.7 | GO:0038203 | TORC2 signaling(GO:0038203) |
| 0.1 | 0.3 | GO:0033182 | regulation of histone ubiquitination(GO:0033182) |
| 0.1 | 0.5 | GO:0006953 | acute-phase response(GO:0006953) |
| 0.1 | 1.7 | GO:0060445 | branching involved in salivary gland morphogenesis(GO:0060445) |
| 0.1 | 2.1 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
| 0.1 | 1.2 | GO:0002437 | inflammatory response to antigenic stimulus(GO:0002437) |
| 0.1 | 0.1 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
| 0.1 | 0.5 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
| 0.1 | 0.2 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
| 0.1 | 0.3 | GO:0007352 | zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.1 | 0.5 | GO:0060330 | regulation of response to interferon-gamma(GO:0060330) |
| 0.1 | 0.1 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.1 | 1.4 | GO:0001913 | T cell mediated cytotoxicity(GO:0001913) |
| 0.1 | 0.9 | GO:0021854 | hypothalamus development(GO:0021854) |
| 0.1 | 0.2 | GO:0071649 | regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) |
| 0.1 | 0.6 | GO:0035413 | positive regulation of catenin import into nucleus(GO:0035413) |
| 0.1 | 0.1 | GO:0071072 | negative regulation of phospholipid biosynthetic process(GO:0071072) |
| 0.1 | 0.2 | GO:0071579 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) regulation of zinc ion transport(GO:0071579) |
| 0.1 | 0.5 | GO:0031441 | negative regulation of mRNA 3'-end processing(GO:0031441) |
| 0.1 | 0.5 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.1 | 0.6 | GO:0006968 | cellular defense response(GO:0006968) |
| 0.1 | 0.3 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.1 | 0.2 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
| 0.1 | 0.2 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.1 | 0.3 | GO:0042573 | retinoic acid metabolic process(GO:0042573) |
| 0.1 | 0.7 | GO:1901409 | positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.1 | 0.5 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.1 | 0.8 | GO:0044406 | adhesion of symbiont to host(GO:0044406) |
| 0.1 | 0.2 | GO:0016056 | phototransduction, visible light(GO:0007603) rhodopsin mediated signaling pathway(GO:0016056) post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
| 0.1 | 0.4 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.1 | 0.5 | GO:0015879 | carnitine transport(GO:0015879) |
| 0.1 | 0.6 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.1 | 0.4 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
| 0.1 | 1.0 | GO:0055070 | copper ion homeostasis(GO:0055070) |
| 0.1 | 1.3 | GO:0015701 | bicarbonate transport(GO:0015701) |
| 0.1 | 0.6 | GO:0042135 | neurotransmitter catabolic process(GO:0042135) |
| 0.1 | 1.4 | GO:0042474 | middle ear morphogenesis(GO:0042474) |
| 0.1 | 0.7 | GO:1904707 | positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.1 | 0.1 | GO:0070459 | prolactin secretion(GO:0070459) |
| 0.1 | 0.1 | GO:0034382 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 0.1 | 1.0 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.1 | 0.3 | GO:0032229 | negative regulation of synaptic transmission, GABAergic(GO:0032229) |
| 0.1 | 0.9 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
| 0.1 | 1.0 | GO:0060433 | bronchus development(GO:0060433) |
| 0.1 | 0.4 | GO:0032439 | endosome localization(GO:0032439) |
| 0.1 | 0.3 | GO:0000305 | response to oxygen radical(GO:0000305) |
| 0.1 | 0.3 | GO:0033580 | protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
| 0.1 | 0.4 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
| 0.1 | 0.6 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
| 0.1 | 0.6 | GO:1903961 | positive regulation of anion transmembrane transport(GO:1903961) |
| 0.1 | 0.1 | GO:2001027 | negative regulation of endothelial cell chemotaxis(GO:2001027) |
| 0.1 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 1.0 | GO:0042407 | cristae formation(GO:0042407) |
| 0.1 | 0.3 | GO:0009204 | deoxyribonucleoside triphosphate catabolic process(GO:0009204) |
| 0.1 | 1.2 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.1 | 0.3 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.1 | 0.7 | GO:0000022 | mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
| 0.1 | 0.5 | GO:0006071 | glycerol metabolic process(GO:0006071) |
| 0.1 | 0.5 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.1 | 0.2 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.1 | 0.7 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.1 | 0.5 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.1 | 0.3 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) pyroptosis(GO:0070269) |
| 0.1 | 0.5 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.1 | 2.1 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.1 | 0.1 | GO:1900377 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 0.1 | 0.1 | GO:0033160 | positive regulation of protein import into nucleus, translocation(GO:0033160) |
| 0.1 | 0.7 | GO:0019243 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.1 | 0.5 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.1 | 0.3 | GO:0045472 | response to ether(GO:0045472) |
| 0.1 | 0.6 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
| 0.1 | 0.6 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.1 | 0.4 | GO:0043489 | RNA stabilization(GO:0043489) |
| 0.1 | 1.6 | GO:0060706 | cell differentiation involved in embryonic placenta development(GO:0060706) |
| 0.1 | 0.3 | GO:0050908 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.1 | 0.5 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.1 | 0.6 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
| 0.1 | 0.6 | GO:2000381 | negative regulation of mesoderm development(GO:2000381) |
| 0.1 | 0.3 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.1 | 0.3 | GO:0030576 | Cajal body organization(GO:0030576) |
| 0.1 | 0.3 | GO:0044854 | plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) |
| 0.1 | 0.9 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
| 0.1 | 0.3 | GO:0010898 | positive regulation of triglyceride catabolic process(GO:0010898) |
| 0.1 | 0.3 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.1 | 0.4 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.1 | 0.4 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.1 | 0.2 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.1 | 1.1 | GO:0006754 | ATP biosynthetic process(GO:0006754) |
| 0.1 | 0.4 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
| 0.1 | 0.4 | GO:0051852 | disruption by host of symbiont cells(GO:0051852) killing by host of symbiont cells(GO:0051873) |
| 0.1 | 0.2 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.1 | 0.4 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.1 | 0.1 | GO:1901642 | purine nucleoside transmembrane transport(GO:0015860) nucleoside transmembrane transport(GO:1901642) |
| 0.1 | 0.4 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.1 | 0.4 | GO:0045187 | regulation of circadian sleep/wake cycle(GO:0042749) regulation of circadian sleep/wake cycle, sleep(GO:0045187) |
| 0.1 | 1.6 | GO:0051497 | negative regulation of stress fiber assembly(GO:0051497) |
| 0.1 | 0.4 | GO:0045607 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.1 | 0.2 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
| 0.1 | 0.1 | GO:0090045 | positive regulation of deacetylase activity(GO:0090045) |
| 0.1 | 0.4 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
| 0.1 | 0.5 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 0.1 | 0.2 | GO:0015886 | heme transport(GO:0015886) |
| 0.1 | 0.3 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
| 0.1 | 0.2 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
| 0.1 | 0.6 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
| 0.1 | 0.3 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.1 | 0.9 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 0.1 | 0.2 | GO:0036500 | ATF6-mediated unfolded protein response(GO:0036500) |
| 0.1 | 0.1 | GO:0006083 | acetate metabolic process(GO:0006083) |
| 0.1 | 0.6 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
| 0.1 | 0.2 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
| 0.1 | 2.1 | GO:0010390 | histone monoubiquitination(GO:0010390) |
| 0.1 | 0.3 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.1 | 0.6 | GO:0030903 | notochord development(GO:0030903) |
| 0.1 | 0.3 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.1 | 0.5 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
| 0.1 | 1.0 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
| 0.1 | 0.6 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.1 | 0.3 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
| 0.1 | 0.4 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
| 0.1 | 0.2 | GO:0045671 | negative regulation of osteoclast differentiation(GO:0045671) |
| 0.1 | 0.1 | GO:0052805 | imidazole-containing compound catabolic process(GO:0052805) |
| 0.1 | 0.3 | GO:0019244 | lactate biosynthetic process from pyruvate(GO:0019244) |
| 0.1 | 0.4 | GO:0002063 | chondrocyte development(GO:0002063) |
| 0.1 | 0.3 | GO:0071635 | negative regulation of transforming growth factor beta production(GO:0071635) |
| 0.1 | 0.1 | GO:0043388 | positive regulation of DNA binding(GO:0043388) |
| 0.1 | 0.4 | GO:0032757 | positive regulation of interleukin-8 production(GO:0032757) |
| 0.1 | 0.4 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.1 | 1.1 | GO:0030513 | positive regulation of BMP signaling pathway(GO:0030513) |
| 0.1 | 0.6 | GO:2000580 | positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
| 0.1 | 0.3 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.1 | 0.1 | GO:0015675 | nickel cation transport(GO:0015675) |
| 0.1 | 0.7 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
| 0.1 | 0.2 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.1 | 2.8 | GO:0005978 | glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
| 0.1 | 0.8 | GO:0010667 | negative regulation of cardiac muscle cell apoptotic process(GO:0010667) |
| 0.1 | 0.3 | GO:0051958 | methotrexate transport(GO:0051958) reduced folate transmembrane transport(GO:0098838) |
| 0.1 | 1.5 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.1 | 0.1 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
| 0.1 | 0.3 | GO:0050858 | negative regulation of antigen receptor-mediated signaling pathway(GO:0050858) |
| 0.1 | 0.8 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.1 | 0.4 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.1 | 0.2 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
| 0.1 | 0.1 | GO:0019614 | catechol-containing compound catabolic process(GO:0019614) dopamine catabolic process(GO:0042420) catecholamine catabolic process(GO:0042424) |
| 0.1 | 0.2 | GO:0034162 | toll-like receptor 9 signaling pathway(GO:0034162) |
| 0.1 | 0.6 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
| 0.1 | 0.1 | GO:1903244 | positive regulation of cardiac muscle adaptation(GO:0010615) positive regulation of cardiac muscle hypertrophy in response to stress(GO:1903244) |
| 0.1 | 0.2 | GO:1902047 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.1 | 0.1 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
| 0.1 | 0.3 | GO:0010826 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 0.1 | 0.2 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
| 0.1 | 0.3 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
| 0.1 | 0.5 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.1 | 0.2 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
| 0.0 | 0.2 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.0 | 1.3 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.0 | 0.1 | GO:0070423 | nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
| 0.0 | 0.4 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
| 0.0 | 0.1 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) |
| 0.0 | 0.4 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.0 | 0.1 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
| 0.0 | 0.5 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.0 | 0.2 | GO:0050812 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) regulation of acyl-CoA biosynthetic process(GO:0050812) |
| 0.0 | 0.9 | GO:0031065 | positive regulation of histone deacetylation(GO:0031065) |
| 0.0 | 0.3 | GO:0032693 | negative regulation of interleukin-10 production(GO:0032693) |
| 0.0 | 0.5 | GO:0007588 | excretion(GO:0007588) |
| 0.0 | 0.0 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.0 | 0.6 | GO:0051451 | myoblast migration(GO:0051451) |
| 0.0 | 0.1 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
| 0.0 | 0.1 | GO:0014050 | negative regulation of glutamate secretion(GO:0014050) |
| 0.0 | 0.3 | GO:0070458 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 0.0 | 0.2 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.0 | 0.1 | GO:0098751 | bone cell development(GO:0098751) |
| 0.0 | 0.1 | GO:0046077 | dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate metabolic process(GO:0009138) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) deoxyribonucleoside diphosphate biosynthetic process(GO:0009189) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
| 0.0 | 0.3 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.0 | 1.8 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.0 | 0.1 | GO:0045759 | negative regulation of action potential(GO:0045759) |
| 0.0 | 0.1 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
| 0.0 | 0.1 | GO:0006547 | histidine metabolic process(GO:0006547) |
| 0.0 | 0.2 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
| 0.0 | 0.3 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.0 | 0.3 | GO:0045907 | positive regulation of vasoconstriction(GO:0045907) |
| 0.0 | 0.2 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.0 | 0.2 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.0 | 0.2 | GO:0098915 | membrane repolarization during ventricular cardiac muscle cell action potential(GO:0098915) |
| 0.0 | 0.8 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.0 | 0.0 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
| 0.0 | 0.1 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.0 | 1.3 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.0 | 0.3 | GO:0006910 | phagocytosis, recognition(GO:0006910) |
| 0.0 | 0.7 | GO:0052646 | alditol phosphate metabolic process(GO:0052646) |
| 0.0 | 0.0 | GO:0070346 | positive regulation of fat cell proliferation(GO:0070346) |
| 0.0 | 0.4 | GO:0018195 | peptidyl-arginine modification(GO:0018195) |
| 0.0 | 0.3 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.0 | 0.2 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
| 0.0 | 0.3 | GO:0046688 | response to copper ion(GO:0046688) |
| 0.0 | 1.4 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.0 | 0.1 | GO:0006337 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
| 0.0 | 0.1 | GO:0045869 | negative regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045869) |
| 0.0 | 0.6 | GO:0034315 | regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
| 0.0 | 0.6 | GO:0010586 | miRNA metabolic process(GO:0010586) |
| 0.0 | 0.6 | GO:0034314 | Arp2/3 complex-mediated actin nucleation(GO:0034314) |
| 0.0 | 0.3 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.0 | 0.9 | GO:0042775 | mitochondrial ATP synthesis coupled electron transport(GO:0042775) |
| 0.0 | 0.2 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.0 | 1.0 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
| 0.0 | 0.5 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.0 | 0.6 | GO:0007080 | mitotic metaphase plate congression(GO:0007080) |
| 0.0 | 0.3 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
| 0.0 | 0.8 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
| 0.0 | 1.0 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.0 | 0.3 | GO:0006354 | DNA-templated transcription, elongation(GO:0006354) |
| 0.0 | 0.0 | GO:0021849 | neuroblast division in subventricular zone(GO:0021849) |
| 0.0 | 0.1 | GO:1902219 | regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 0.0 | 0.1 | GO:1904046 | seryl-tRNA aminoacylation(GO:0006434) negative regulation of vascular endothelial growth factor production(GO:1904046) |
| 0.0 | 0.3 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
| 0.0 | 0.5 | GO:0007229 | integrin-mediated signaling pathway(GO:0007229) |
| 0.0 | 0.9 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
| 0.0 | 0.3 | GO:0060033 | anatomical structure regression(GO:0060033) |
| 0.0 | 0.2 | GO:0006531 | aspartate metabolic process(GO:0006531) |
| 0.0 | 0.4 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.0 | 0.3 | GO:0042346 | positive regulation of NF-kappaB import into nucleus(GO:0042346) |
| 0.0 | 0.5 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
| 0.0 | 0.6 | GO:1903077 | negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
| 0.0 | 0.3 | GO:0043615 | astrocyte cell migration(GO:0043615) |
| 0.0 | 0.3 | GO:0032967 | positive regulation of collagen biosynthetic process(GO:0032967) |
| 0.0 | 0.2 | GO:0019236 | response to pheromone(GO:0019236) |
| 0.0 | 0.3 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
| 0.0 | 0.3 | GO:0060297 | regulation of sarcomere organization(GO:0060297) |
| 0.0 | 0.2 | GO:0097503 | sialylation(GO:0097503) |
| 0.0 | 0.7 | GO:0044458 | motile cilium assembly(GO:0044458) |
| 0.0 | 0.6 | GO:0009299 | mRNA transcription(GO:0009299) |
| 0.0 | 0.3 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.0 | 0.2 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.0 | 0.2 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.0 | 0.6 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
| 0.0 | 0.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.0 | 0.4 | GO:0042640 | anagen(GO:0042640) |
| 0.0 | 0.4 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
| 0.0 | 0.6 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.0 | 0.6 | GO:0071470 | cellular response to osmotic stress(GO:0071470) |
| 0.0 | 0.0 | GO:1901526 | positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
| 0.0 | 0.1 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.0 | 0.2 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
| 0.0 | 0.1 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.0 | 1.1 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
| 0.0 | 0.3 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.0 | 0.4 | GO:0003301 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 | 0.2 | GO:0021678 | third ventricle development(GO:0021678) |
| 0.0 | 0.0 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
| 0.0 | 0.6 | GO:0006023 | aminoglycan biosynthetic process(GO:0006023) |
| 0.0 | 0.1 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
| 0.0 | 0.5 | GO:0031572 | G2 DNA damage checkpoint(GO:0031572) |
| 0.0 | 0.5 | GO:0045737 | positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
| 0.0 | 0.1 | GO:2001015 | negative regulation of skeletal muscle cell differentiation(GO:2001015) |
| 0.0 | 0.2 | GO:0005980 | polysaccharide catabolic process(GO:0000272) glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
| 0.0 | 0.2 | GO:0045583 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.0 | 0.4 | GO:0051382 | kinetochore assembly(GO:0051382) |
| 0.0 | 0.7 | GO:0000281 | mitotic cytokinesis(GO:0000281) |
| 0.0 | 0.4 | GO:0034377 | plasma lipoprotein particle assembly(GO:0034377) |
| 0.0 | 0.2 | GO:0071320 | cellular response to cAMP(GO:0071320) |
| 0.0 | 0.6 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.0 | 0.8 | GO:0015804 | neutral amino acid transport(GO:0015804) |
| 0.0 | 0.1 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.0 | 0.2 | GO:0045646 | regulation of erythrocyte differentiation(GO:0045646) |
| 0.0 | 0.5 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 | 0.3 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.0 | 0.3 | GO:0032463 | negative regulation of protein homooligomerization(GO:0032463) |
| 0.0 | 0.1 | GO:0034238 | macrophage fusion(GO:0034238) regulation of macrophage fusion(GO:0034239) |
| 0.0 | 0.8 | GO:0001964 | startle response(GO:0001964) |
| 0.0 | 1.2 | GO:0071230 | cellular response to amino acid stimulus(GO:0071230) |
| 0.0 | 0.2 | GO:1903755 | regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.0 | 0.8 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.0 | 0.1 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.0 | 0.0 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) |
| 0.0 | 0.0 | GO:0060753 | regulation of mast cell chemotaxis(GO:0060753) |
| 0.0 | 0.0 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) regulation of planar cell polarity pathway involved in axis elongation(GO:2000040) negative regulation of planar cell polarity pathway involved in axis elongation(GO:2000041) |
| 0.0 | 0.5 | GO:0006302 | double-strand break repair(GO:0006302) |
| 0.0 | 0.2 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
| 0.0 | 1.2 | GO:0000725 | double-strand break repair via homologous recombination(GO:0000724) recombinational repair(GO:0000725) |
| 0.0 | 0.3 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.0 | 0.2 | GO:0007131 | reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
| 0.0 | 0.4 | GO:0034219 | carbohydrate transmembrane transport(GO:0034219) |
| 0.0 | 0.1 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.0 | 0.1 | GO:0036509 | trimming of terminal mannose on B branch(GO:0036509) |
| 0.0 | 0.1 | GO:1902022 | L-lysine transport(GO:1902022) |
| 0.0 | 0.1 | GO:0060768 | epithelial cell proliferation involved in prostate gland development(GO:0060767) regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.0 | 0.3 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.0 | 0.1 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.0 | 0.2 | GO:0006004 | fucose metabolic process(GO:0006004) |
| 0.0 | 0.2 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.0 | 0.2 | GO:0045840 | positive regulation of mitotic nuclear division(GO:0045840) |
| 0.0 | 0.4 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
| 0.0 | 0.1 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.0 | 1.4 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
| 0.0 | 0.2 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.0 | 0.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.0 | 0.2 | GO:0043970 | histone H3-K9 acetylation(GO:0043970) |
| 0.0 | 0.2 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
| 0.0 | 1.3 | GO:0006635 | fatty acid beta-oxidation(GO:0006635) |
| 0.0 | 0.3 | GO:0001945 | lymph vessel development(GO:0001945) |
| 0.0 | 0.0 | GO:0042255 | ribosome assembly(GO:0042255) |
| 0.0 | 0.2 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
| 0.0 | 0.4 | GO:0031960 | response to corticosteroid(GO:0031960) response to glucocorticoid(GO:0051384) |
| 0.0 | 0.1 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.0 | 0.1 | GO:0090003 | regulation of Golgi to plasma membrane protein transport(GO:0042996) regulation of establishment of protein localization to plasma membrane(GO:0090003) |
| 0.0 | 0.2 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
| 0.0 | 0.6 | GO:0043966 | histone H3 acetylation(GO:0043966) |
| 0.0 | 0.5 | GO:0003016 | respiratory system process(GO:0003016) |
| 0.0 | 0.1 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.0 | 0.3 | GO:0010591 | regulation of lamellipodium assembly(GO:0010591) |
| 0.0 | 0.1 | GO:0006458 | 'de novo' protein folding(GO:0006458) |
| 0.0 | 0.1 | GO:0006824 | cobalt ion transport(GO:0006824) |
| 0.0 | 0.2 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) |
| 0.0 | 0.2 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
| 0.0 | 0.1 | GO:0045915 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
| 0.0 | 0.2 | GO:0034244 | negative regulation of DNA-templated transcription, elongation(GO:0032785) negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.0 | 1.2 | GO:0032543 | mitochondrial translation(GO:0032543) |
| 0.0 | 0.1 | GO:0060307 | regulation of ventricular cardiac muscle cell membrane repolarization(GO:0060307) |
| 0.0 | 0.1 | GO:0042832 | response to protozoan(GO:0001562) defense response to protozoan(GO:0042832) |
| 0.0 | 0.2 | GO:0030520 | intracellular estrogen receptor signaling pathway(GO:0030520) |
| 0.0 | 0.0 | GO:0032717 | negative regulation of interleukin-8 production(GO:0032717) |
| 0.0 | 0.1 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.0 | 0.3 | GO:0002042 | cell migration involved in sprouting angiogenesis(GO:0002042) |
| 0.0 | 0.1 | GO:1990481 | mRNA pseudouridine synthesis(GO:1990481) |
| 0.0 | 0.1 | GO:0042541 | hemoglobin biosynthetic process(GO:0042541) |
| 0.0 | 0.1 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.0 | 0.1 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
| 0.0 | 0.3 | GO:0007340 | acrosome reaction(GO:0007340) |
| 0.0 | 0.2 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.0 | 0.0 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.0 | 0.2 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.0 | 0.1 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
| 0.0 | 0.0 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
| 0.0 | 0.2 | GO:0043982 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
| 0.0 | 0.1 | GO:0043501 | regulation of skeletal muscle adaptation(GO:0014733) skeletal muscle adaptation(GO:0043501) |
| 0.0 | 0.1 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
| 0.0 | 0.1 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
| 0.0 | 0.1 | GO:0006983 | ER overload response(GO:0006983) |
| 0.0 | 0.6 | GO:0031016 | pancreas development(GO:0031016) |
| 0.0 | 0.1 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 | 0.1 | GO:2000301 | negative regulation of neurotransmitter secretion(GO:0046929) negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.0 | 0.1 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.0 | 0.1 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.0 | 0.2 | GO:2000772 | regulation of cellular senescence(GO:2000772) |
| 0.0 | 0.1 | GO:0090201 | negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
| 0.0 | 0.1 | GO:0051150 | regulation of smooth muscle cell differentiation(GO:0051150) |
| 0.0 | 0.1 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.0 | 0.1 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.0 | 0.1 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.0 | 0.4 | GO:1902235 | regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902235) |
| 0.0 | 0.3 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.0 | 0.3 | GO:0070527 | platelet aggregation(GO:0070527) |
| 0.0 | 0.1 | GO:0035067 | negative regulation of histone acetylation(GO:0035067) |
| 0.0 | 0.0 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.0 | 0.1 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.0 | 0.2 | GO:0050853 | B cell receptor signaling pathway(GO:0050853) |
| 0.0 | 0.4 | GO:0035456 | response to interferon-beta(GO:0035456) |
| 0.0 | 0.3 | GO:0042462 | eye photoreceptor cell development(GO:0042462) |
| 0.0 | 0.2 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.0 | 0.1 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
| 0.0 | 0.1 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.0 | 0.1 | GO:0043144 | snoRNA processing(GO:0043144) |
| 0.0 | 0.2 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.0 | 0.2 | GO:0030574 | collagen catabolic process(GO:0030574) |
| 0.0 | 0.1 | GO:0044791 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
| 0.0 | 0.2 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
| 0.0 | 0.0 | GO:0000454 | snoRNA guided rRNA pseudouridine synthesis(GO:0000454) |
| 0.0 | 0.1 | GO:0046599 | regulation of centriole replication(GO:0046599) |
| 0.0 | 0.1 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.0 | 0.1 | GO:0000394 | RNA splicing, via endonucleolytic cleavage and ligation(GO:0000394) tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.0 | 0.2 | GO:0000132 | establishment of mitotic spindle orientation(GO:0000132) establishment of mitotic spindle localization(GO:0040001) |
| 0.0 | 0.3 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
| 0.0 | 0.1 | GO:0097034 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.0 | 0.2 | GO:0045739 | positive regulation of DNA repair(GO:0045739) |
| 0.0 | 0.0 | GO:0015822 | ornithine transport(GO:0015822) |
| 0.0 | 0.4 | GO:0003341 | cilium movement(GO:0003341) |
| 0.0 | 0.1 | GO:0014046 | dopamine secretion(GO:0014046) regulation of dopamine secretion(GO:0014059) |
| 0.0 | 0.1 | GO:0032200 | telomere maintenance(GO:0000723) telomere organization(GO:0032200) |
| 0.0 | 0.1 | GO:0033129 | positive regulation of histone phosphorylation(GO:0033129) |
| 0.0 | 0.1 | GO:0006833 | water transport(GO:0006833) |
| 0.0 | 0.1 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.0 | 0.1 | GO:0022617 | extracellular matrix disassembly(GO:0022617) |
| 0.0 | 0.1 | GO:0021780 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.0 | 0.0 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.0 | 0.0 | GO:0060978 | angiogenesis involved in coronary vascular morphogenesis(GO:0060978) |
| 0.0 | 0.1 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.0 | 0.1 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.4 | 8.4 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 1.3 | 3.9 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 1.0 | 3.1 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.9 | 2.7 | GO:0031680 | G-protein beta/gamma-subunit complex(GO:0031680) |
| 0.8 | 5.0 | GO:0043256 | laminin complex(GO:0043256) |
| 0.8 | 3.2 | GO:1990584 | cardiac Troponin complex(GO:1990584) |
| 0.5 | 2.7 | GO:0005587 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
| 0.5 | 6.0 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.5 | 2.9 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.4 | 1.3 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 0.4 | 1.2 | GO:1990667 | PCSK9-AnxA2 complex(GO:1990667) |
| 0.4 | 1.2 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
| 0.4 | 0.4 | GO:0005861 | troponin complex(GO:0005861) |
| 0.4 | 2.2 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.4 | 6.2 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.4 | 1.8 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.4 | 1.4 | GO:0000939 | condensed chromosome inner kinetochore(GO:0000939) |
| 0.3 | 1.0 | GO:0071914 | prominosome(GO:0071914) |
| 0.3 | 3.7 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.3 | 2.2 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.2 | 0.7 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 0.2 | 0.5 | GO:0030991 | intraciliary transport particle(GO:0030990) intraciliary transport particle A(GO:0030991) |
| 0.2 | 0.7 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.2 | 0.7 | GO:0005584 | collagen type I trimer(GO:0005584) |
| 0.2 | 0.9 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.2 | 1.8 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.2 | 1.1 | GO:1903440 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
| 0.2 | 1.0 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.2 | 0.6 | GO:0098592 | cytoplasmic side of apical plasma membrane(GO:0098592) |
| 0.2 | 0.6 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.2 | 2.2 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
| 0.2 | 2.0 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.2 | 0.6 | GO:0036156 | inner dynein arm(GO:0036156) |
| 0.2 | 2.8 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
| 0.2 | 0.4 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.2 | 1.4 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.2 | 1.0 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
| 0.2 | 0.6 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
| 0.2 | 0.6 | GO:0043540 | 6-phosphofructo-2-kinase/fructose-2,6-biphosphatase complex(GO:0043540) |
| 0.2 | 0.6 | GO:0071149 | TEAD-2-YAP complex(GO:0071149) |
| 0.2 | 1.7 | GO:0000796 | condensin complex(GO:0000796) |
| 0.2 | 0.7 | GO:0030906 | retromer, cargo-selective complex(GO:0030906) |
| 0.2 | 0.9 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.2 | 1.5 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 0.2 | 0.5 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
| 0.2 | 0.5 | GO:0033193 | Lsd1/2 complex(GO:0033193) |
| 0.2 | 0.5 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.2 | 2.2 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 0.2 | 2.4 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
| 0.2 | 1.7 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.2 | 1.2 | GO:0070187 | telosome(GO:0070187) |
| 0.2 | 0.6 | GO:0097574 | lateral part of cell(GO:0097574) basolateral part of cell(GO:1990794) rod bipolar cell terminal bouton(GO:1990795) |
| 0.2 | 0.8 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.2 | 1.1 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.2 | 0.8 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| 0.2 | 2.1 | GO:0005922 | connexon complex(GO:0005922) |
| 0.2 | 0.8 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
| 0.1 | 0.9 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.1 | 8.4 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.1 | 0.7 | GO:1990357 | terminal web(GO:1990357) |
| 0.1 | 0.4 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
| 0.1 | 0.6 | GO:0098559 | cytoplasmic side of early endosome membrane(GO:0098559) |
| 0.1 | 0.1 | GO:0044450 | microtubule organizing center part(GO:0044450) |
| 0.1 | 0.4 | GO:0031251 | PAN complex(GO:0031251) |
| 0.1 | 1.2 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.1 | 0.7 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.1 | 2.9 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.1 | 1.2 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.1 | 0.4 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.1 | 0.8 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.1 | 0.4 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.1 | 0.6 | GO:0010369 | chromocenter(GO:0010369) |
| 0.1 | 1.6 | GO:0005605 | basal lamina(GO:0005605) |
| 0.1 | 0.6 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.1 | 2.0 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.1 | 0.4 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
| 0.1 | 0.7 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
| 0.1 | 1.2 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.1 | 1.5 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.1 | 0.7 | GO:0009897 | external side of plasma membrane(GO:0009897) |
| 0.1 | 0.3 | GO:0031372 | UBC13-MMS2 complex(GO:0031372) |
| 0.1 | 0.6 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 0.1 | 0.3 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.1 | 0.6 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.1 | 0.6 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.1 | 0.5 | GO:0097226 | sperm mitochondrial sheath(GO:0097226) |
| 0.1 | 1.3 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.1 | 4.7 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
| 0.1 | 0.4 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.1 | 0.1 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.1 | 1.0 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.1 | 3.7 | GO:0034707 | chloride channel complex(GO:0034707) |
| 0.1 | 1.2 | GO:0045095 | keratin filament(GO:0045095) |
| 0.1 | 0.7 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.1 | 0.3 | GO:0098855 | HCN channel complex(GO:0098855) |
| 0.1 | 0.5 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.1 | 0.3 | GO:0038045 | large latent transforming growth factor-beta complex(GO:0038045) |
| 0.1 | 0.6 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.1 | 0.3 | GO:0045283 | mitochondrial respiratory chain complex II, succinate dehydrogenase complex (ubiquinone)(GO:0005749) succinate dehydrogenase complex (ubiquinone)(GO:0045257) respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) fumarate reductase complex(GO:0045283) |
| 0.1 | 0.5 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.1 | 4.8 | GO:0000791 | euchromatin(GO:0000791) |
| 0.1 | 0.3 | GO:0034684 | integrin alphav-beta5 complex(GO:0034684) |
| 0.1 | 0.5 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
| 0.1 | 0.6 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.1 | 0.5 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.1 | 1.1 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.1 | 0.2 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
| 0.1 | 2.6 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.1 | 0.2 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) cytoplasmic side of late endosome membrane(GO:0098560) |
| 0.1 | 0.3 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.1 | 0.4 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.1 | 0.4 | GO:0098536 | deuterosome(GO:0098536) |
| 0.1 | 0.4 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.1 | 0.4 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.1 | 0.8 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.1 | 0.3 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.1 | 0.3 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
| 0.1 | 0.3 | GO:0042627 | chylomicron(GO:0042627) |
| 0.1 | 1.2 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
| 0.1 | 0.5 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.1 | 0.2 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.1 | 1.1 | GO:0036038 | MKS complex(GO:0036038) |
| 0.1 | 0.3 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.1 | 0.3 | GO:0001651 | dense fibrillar component(GO:0001651) |
| 0.1 | 0.3 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.1 | 0.7 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.1 | 1.0 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.1 | 3.6 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.1 | 0.3 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.1 | 0.3 | GO:0031983 | vesicle lumen(GO:0031983) |
| 0.1 | 0.3 | GO:0043511 | inhibin complex(GO:0043511) |
| 0.1 | 2.0 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.1 | 0.3 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.1 | 3.0 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.1 | 0.3 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.1 | 0.9 | GO:0044292 | dendrite terminus(GO:0044292) |
| 0.1 | 1.3 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.1 | 0.2 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
| 0.1 | 1.3 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.1 | 2.8 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
| 0.1 | 2.8 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.1 | 0.9 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.1 | 0.2 | GO:0042827 | platelet dense granule(GO:0042827) |
| 0.1 | 0.9 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.1 | 1.8 | GO:0051233 | spindle midzone(GO:0051233) |
| 0.1 | 0.5 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.1 | 0.4 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.1 | 0.5 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.1 | 0.3 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.1 | 0.4 | GO:0034464 | BBSome(GO:0034464) |
| 0.1 | 0.3 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.1 | 0.4 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.1 | 0.3 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.1 | 0.5 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.1 | 0.2 | GO:1903095 | microprocessor complex(GO:0070877) ribonuclease III complex(GO:1903095) |
| 0.1 | 3.2 | GO:0005604 | basement membrane(GO:0005604) |
| 0.1 | 0.8 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.1 | 0.7 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.1 | 0.6 | GO:0000781 | chromosome, telomeric region(GO:0000781) |
| 0.1 | 0.4 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.0 | 0.1 | GO:0071012 | catalytic step 1 spliceosome(GO:0071012) |
| 0.0 | 0.4 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.0 | 0.4 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
| 0.0 | 0.0 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.0 | 0.3 | GO:0060293 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
| 0.0 | 2.0 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.0 | 0.5 | GO:0070938 | contractile ring(GO:0070938) |
| 0.0 | 0.4 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.0 | 0.3 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.0 | 0.2 | GO:0071144 | SMAD2-SMAD3 protein complex(GO:0071144) |
| 0.0 | 0.6 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.0 | 0.7 | GO:0032156 | septin cytoskeleton(GO:0032156) |
| 0.0 | 0.4 | GO:0030478 | actin cap(GO:0030478) |
| 0.0 | 0.2 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.0 | 0.0 | GO:1990812 | growth cone filopodium(GO:1990812) |
| 0.0 | 0.0 | GO:0045179 | apical cortex(GO:0045179) |
| 0.0 | 0.2 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.0 | 1.8 | GO:0072562 | blood microparticle(GO:0072562) |
| 0.0 | 0.0 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.0 | 0.2 | GO:0032021 | NELF complex(GO:0032021) |
| 0.0 | 0.6 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.0 | 0.2 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.0 | 0.4 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.0 | 0.8 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
| 0.0 | 0.1 | GO:0048269 | methionine adenosyltransferase complex(GO:0048269) |
| 0.0 | 0.5 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.0 | 0.2 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
| 0.0 | 0.1 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
| 0.0 | 0.2 | GO:0042383 | sarcolemma(GO:0042383) |
| 0.0 | 1.7 | GO:0009925 | basal plasma membrane(GO:0009925) |
| 0.0 | 0.6 | GO:0098687 | chromosomal region(GO:0098687) |
| 0.0 | 0.4 | GO:0042571 | immunoglobulin complex, circulating(GO:0042571) |
| 0.0 | 0.3 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.0 | 0.3 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.0 | 14.4 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.0 | 0.2 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 0.0 | 0.9 | GO:0005746 | mitochondrial respiratory chain(GO:0005746) |
| 0.0 | 1.3 | GO:0016328 | lateral plasma membrane(GO:0016328) |
| 0.0 | 0.2 | GO:0097513 | myosin II filament(GO:0097513) |
| 0.0 | 0.6 | GO:0000800 | lateral element(GO:0000800) |
| 0.0 | 1.4 | GO:0016363 | nuclear matrix(GO:0016363) |
| 0.0 | 0.1 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.0 | 0.2 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) TAP complex(GO:0042825) |
| 0.0 | 0.2 | GO:0071203 | WASH complex(GO:0071203) |
| 0.0 | 0.6 | GO:0001741 | XY body(GO:0001741) |
| 0.0 | 4.2 | GO:0022626 | cytosolic ribosome(GO:0022626) |
| 0.0 | 0.3 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.0 | 0.1 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.0 | 0.4 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.0 | 1.8 | GO:0031970 | organelle envelope lumen(GO:0031970) |
| 0.0 | 1.0 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.0 | 2.6 | GO:0000922 | spindle pole(GO:0000922) |
| 0.0 | 0.2 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) |
| 0.0 | 0.2 | GO:1990356 | sumoylated E2 ligase complex(GO:1990356) |
| 0.0 | 0.7 | GO:0097546 | ciliary base(GO:0097546) |
| 0.0 | 0.1 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
| 0.0 | 0.7 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.0 | 1.5 | GO:0016459 | myosin complex(GO:0016459) |
| 0.0 | 8.5 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
| 0.0 | 0.2 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.0 | 0.4 | GO:0016324 | apical plasma membrane(GO:0016324) |
| 0.0 | 0.2 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.0 | 0.7 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
| 0.0 | 0.8 | GO:0030904 | retromer complex(GO:0030904) |
| 0.0 | 0.2 | GO:0089701 | U2AF(GO:0089701) |
| 0.0 | 0.3 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.0 | 0.4 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.0 | 0.4 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 0.2 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.0 | 7.3 | GO:0031012 | extracellular matrix(GO:0031012) |
| 0.0 | 0.9 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 1.5 | GO:0005844 | polysome(GO:0005844) |
| 0.0 | 0.3 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.0 | 2.6 | GO:0032993 | protein-DNA complex(GO:0032993) |
| 0.0 | 0.2 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.0 | 0.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.0 | 0.5 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.0 | 0.1 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.0 | 2.7 | GO:0000776 | kinetochore(GO:0000776) |
| 0.0 | 0.2 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.0 | 0.1 | GO:0001939 | female pronucleus(GO:0001939) |
| 0.0 | 0.1 | GO:0031902 | late endosome membrane(GO:0031902) |
| 0.0 | 1.0 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.0 | 0.2 | GO:0031011 | Ino80 complex(GO:0031011) |
| 0.0 | 0.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.0 | 0.5 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.0 | 0.2 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.8 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.0 | 1.4 | GO:0005814 | centriole(GO:0005814) |
| 0.0 | 0.2 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 0.4 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.0 | 0.1 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.0 | 0.2 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 0.3 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.0 | 0.4 | GO:0005840 | ribosome(GO:0005840) |
| 0.0 | 1.2 | GO:0000784 | nuclear chromosome, telomeric region(GO:0000784) |
| 0.0 | 0.2 | GO:0008305 | integrin complex(GO:0008305) protein complex involved in cell adhesion(GO:0098636) |
| 0.0 | 0.3 | GO:0032039 | integrator complex(GO:0032039) |
| 0.0 | 0.3 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
| 0.0 | 1.9 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.0 | 1.0 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.0 | 0.2 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.0 | 0.2 | GO:0016589 | NURF complex(GO:0016589) |
| 0.0 | 0.2 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.0 | 11.0 | GO:0005615 | extracellular space(GO:0005615) |
| 0.0 | 0.2 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.0 | 0.5 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
| 0.0 | 0.1 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.0 | 0.1 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.0 | 0.2 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
| 0.0 | 1.8 | GO:0000790 | nuclear chromatin(GO:0000790) |
| 0.0 | 0.1 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.0 | 1.1 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
| 0.0 | 0.1 | GO:0031514 | motile cilium(GO:0031514) |
| 0.0 | 0.2 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
| 0.0 | 0.1 | GO:0097165 | nuclear stress granule(GO:0097165) |
| 0.0 | 0.2 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.0 | 0.1 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.0 | 0.1 | GO:0045180 | basal cortex(GO:0045180) |
| 0.0 | 0.1 | GO:0009986 | cell surface(GO:0009986) |
| 0.0 | 0.4 | GO:0001669 | acrosomal vesicle(GO:0001669) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.1 | 3.4 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 1.1 | 3.3 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 1.0 | 3.9 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
| 0.9 | 3.6 | GO:0003844 | 1,4-alpha-glucan branching enzyme activity(GO:0003844) |
| 0.8 | 2.5 | GO:0004454 | ketohexokinase activity(GO:0004454) |
| 0.8 | 2.4 | GO:0030172 | troponin C binding(GO:0030172) |
| 0.7 | 3.0 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 0.7 | 2.1 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.7 | 11.2 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
| 0.6 | 1.2 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.6 | 2.4 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.6 | 2.3 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
| 0.6 | 7.4 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
| 0.6 | 1.7 | GO:0051870 | methotrexate binding(GO:0051870) |
| 0.6 | 2.3 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.5 | 3.8 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.5 | 2.2 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
| 0.4 | 3.1 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
| 0.4 | 1.3 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
| 0.4 | 2.0 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
| 0.4 | 1.2 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.4 | 1.1 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.4 | 0.4 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.4 | 1.8 | GO:0015166 | polyol transmembrane transporter activity(GO:0015166) glycerol transmembrane transporter activity(GO:0015168) |
| 0.4 | 2.2 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.4 | 1.4 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
| 0.4 | 1.1 | GO:0036132 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
| 0.3 | 0.7 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) phospholipase A2 inhibitor activity(GO:0019834) |
| 0.3 | 1.3 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
| 0.3 | 1.6 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.3 | 1.0 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
| 0.3 | 1.5 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.3 | 1.5 | GO:0070320 | inward rectifier potassium channel inhibitor activity(GO:0070320) |
| 0.3 | 0.6 | GO:1904680 | peptide transmembrane transporter activity(GO:1904680) |
| 0.3 | 1.2 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.3 | 0.9 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
| 0.3 | 0.8 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.3 | 2.8 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.3 | 1.1 | GO:0050436 | microfibril binding(GO:0050436) |
| 0.3 | 1.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.3 | 0.8 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.3 | 1.0 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.3 | 2.6 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.3 | 1.3 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
| 0.3 | 0.8 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
| 0.3 | 1.3 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
| 0.2 | 0.7 | GO:0071936 | coreceptor activity involved in Wnt signaling pathway(GO:0071936) |
| 0.2 | 1.2 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
| 0.2 | 1.0 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.2 | 1.0 | GO:0004104 | cholinesterase activity(GO:0004104) choline binding(GO:0033265) |
| 0.2 | 3.6 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.2 | 1.0 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
| 0.2 | 1.2 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.2 | 5.1 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.2 | 1.2 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
| 0.2 | 1.8 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.2 | 2.3 | GO:0031404 | chloride ion binding(GO:0031404) |
| 0.2 | 0.7 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.2 | 1.4 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.2 | 2.5 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.2 | 0.2 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
| 0.2 | 0.7 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
| 0.2 | 1.5 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.2 | 1.1 | GO:0097643 | amylin receptor activity(GO:0097643) |
| 0.2 | 0.6 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
| 0.2 | 0.6 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
| 0.2 | 0.2 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.2 | 0.6 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
| 0.2 | 1.0 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
| 0.2 | 2.6 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.2 | 0.8 | GO:0036468 | aromatic-L-amino-acid decarboxylase activity(GO:0004058) L-dopa decarboxylase activity(GO:0036468) |
| 0.2 | 0.8 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.2 | 0.6 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.2 | 0.2 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
| 0.2 | 1.7 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
| 0.2 | 1.7 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.2 | 0.8 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.2 | 0.8 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.2 | 1.5 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
| 0.2 | 0.4 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
| 0.2 | 5.2 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.2 | 1.3 | GO:0008430 | selenium binding(GO:0008430) |
| 0.2 | 1.3 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
| 0.2 | 3.2 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
| 0.2 | 1.4 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.2 | 0.5 | GO:0003996 | acyl-CoA ligase activity(GO:0003996) |
| 0.2 | 0.7 | GO:0031762 | alpha-1A adrenergic receptor binding(GO:0031691) alpha-1B adrenergic receptor binding(GO:0031692) follicle-stimulating hormone receptor binding(GO:0031762) |
| 0.2 | 0.2 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.2 | 2.4 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
| 0.2 | 2.2 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 0.2 | 1.3 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.2 | 0.7 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.2 | 0.5 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
| 0.2 | 0.7 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 0.2 | 0.5 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
| 0.2 | 0.6 | GO:2001069 | glycogen binding(GO:2001069) |
| 0.2 | 3.0 | GO:0005044 | scavenger receptor activity(GO:0005044) |
| 0.2 | 0.3 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.2 | 0.5 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
| 0.2 | 1.4 | GO:1990239 | steroid hormone binding(GO:1990239) |
| 0.2 | 0.8 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
| 0.2 | 0.6 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
| 0.2 | 0.6 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) |
| 0.2 | 0.2 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
| 0.2 | 0.8 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.2 | 0.2 | GO:0004962 | endothelin receptor activity(GO:0004962) |
| 0.2 | 0.3 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.1 | 0.7 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.1 | 0.9 | GO:0002054 | nucleobase binding(GO:0002054) |
| 0.1 | 2.5 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.1 | 0.4 | GO:0031779 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
| 0.1 | 0.7 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
| 0.1 | 1.8 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.1 | 1.0 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.1 | 0.4 | GO:0018738 | S-formylglutathione hydrolase activity(GO:0018738) |
| 0.1 | 0.7 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.1 | 0.6 | GO:0003883 | CTP synthase activity(GO:0003883) |
| 0.1 | 0.4 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
| 0.1 | 0.4 | GO:0046964 | 3'-phosphoadenosine 5'-phosphosulfate transmembrane transporter activity(GO:0046964) |
| 0.1 | 3.0 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
| 0.1 | 0.6 | GO:0086038 | calcium:sodium antiporter activity involved in regulation of cardiac muscle cell membrane potential(GO:0086038) |
| 0.1 | 1.8 | GO:0042605 | peptide antigen binding(GO:0042605) |
| 0.1 | 0.4 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.1 | 1.0 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.1 | 0.5 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
| 0.1 | 1.1 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.1 | 0.9 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
| 0.1 | 3.6 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.1 | 0.3 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.1 | 0.7 | GO:0070330 | aromatase activity(GO:0070330) |
| 0.1 | 0.5 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.1 | 0.3 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.1 | 4.5 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.1 | 0.8 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.1 | 0.4 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) U7 snRNA binding(GO:0071209) |
| 0.1 | 0.5 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.1 | 1.1 | GO:0016641 | oxidoreductase activity, acting on the CH-NH2 group of donors, oxygen as acceptor(GO:0016641) |
| 0.1 | 0.7 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
| 0.1 | 0.1 | GO:0004321 | fatty-acyl-CoA synthase activity(GO:0004321) |
| 0.1 | 0.5 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.1 | 1.0 | GO:0001848 | complement binding(GO:0001848) |
| 0.1 | 0.2 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.1 | 0.6 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.1 | 0.7 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.1 | 1.9 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
| 0.1 | 0.6 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.1 | 0.8 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.1 | 0.3 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.1 | 0.9 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.1 | 3.4 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.1 | 0.3 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
| 0.1 | 1.2 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.1 | 0.6 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.1 | 1.0 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
| 0.1 | 0.4 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
| 0.1 | 2.0 | GO:0005003 | ephrin receptor activity(GO:0005003) |
| 0.1 | 0.9 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
| 0.1 | 0.8 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.1 | 0.3 | GO:0031403 | lithium ion binding(GO:0031403) |
| 0.1 | 0.4 | GO:0036122 | BMP binding(GO:0036122) |
| 0.1 | 0.4 | GO:0005008 | hepatocyte growth factor-activated receptor activity(GO:0005008) |
| 0.1 | 0.3 | GO:0052740 | phosphatidylserine 1-acylhydrolase activity(GO:0052739) 1-acyl-2-lysophosphatidylserine acylhydrolase activity(GO:0052740) |
| 0.1 | 0.2 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
| 0.1 | 0.8 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.1 | 0.6 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.1 | 4.1 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.1 | 3.7 | GO:0005507 | copper ion binding(GO:0005507) |
| 0.1 | 0.3 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.1 | 0.4 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.1 | 0.3 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 0.1 | 1.3 | GO:0033764 | steroid dehydrogenase activity, acting on the CH-OH group of donors, NAD or NADP as acceptor(GO:0033764) |
| 0.1 | 0.4 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.1 | 0.3 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.1 | 1.1 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
| 0.1 | 0.7 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 0.1 | 0.7 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.1 | 0.9 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
| 0.1 | 0.4 | GO:0008227 | G-protein coupled amine receptor activity(GO:0008227) |
| 0.1 | 1.1 | GO:0001618 | virus receptor activity(GO:0001618) |
| 0.1 | 2.2 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.1 | 1.5 | GO:0043236 | laminin binding(GO:0043236) |
| 0.1 | 0.8 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.1 | 0.4 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.1 | 0.2 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.1 | 0.3 | GO:0003998 | acylphosphatase activity(GO:0003998) |
| 0.1 | 0.9 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
| 0.1 | 0.3 | GO:0019863 | IgE binding(GO:0019863) |
| 0.1 | 0.5 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.1 | 0.5 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
| 0.1 | 0.5 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
| 0.1 | 0.3 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.1 | 1.0 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.1 | 0.4 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.1 | 0.6 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.1 | 1.6 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.1 | 2.2 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.1 | 0.2 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.1 | 0.6 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
| 0.1 | 0.2 | GO:0008176 | tRNA (guanine-N7-)-methyltransferase activity(GO:0008176) |
| 0.1 | 1.6 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.1 | 0.4 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) O-palmitoyltransferase activity(GO:0016416) |
| 0.1 | 0.2 | GO:0047751 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) steroid dehydrogenase activity, acting on the CH-CH group of donors(GO:0033765) enone reductase activity(GO:0035671) cholestenone 5-alpha-reductase activity(GO:0047751) |
| 0.1 | 0.4 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.1 | 0.2 | GO:0070140 | isopeptidase activity(GO:0070122) ubiquitin-like protein-specific isopeptidase activity(GO:0070138) SUMO-specific isopeptidase activity(GO:0070140) |
| 0.1 | 0.2 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.1 | 0.8 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.1 | 0.9 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.1 | 0.5 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.1 | 0.1 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
| 0.1 | 0.6 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.1 | 0.1 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
| 0.1 | 1.5 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 0.1 | 1.4 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.1 | 0.7 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.1 | 0.6 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.1 | 0.2 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
| 0.1 | 0.7 | GO:0003993 | acid phosphatase activity(GO:0003993) |
| 0.1 | 0.2 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.1 | 1.4 | GO:0001223 | transcription coactivator binding(GO:0001223) |
| 0.1 | 0.3 | GO:0031720 | haptoglobin binding(GO:0031720) |
| 0.1 | 6.8 | GO:0000980 | RNA polymerase II distal enhancer sequence-specific DNA binding(GO:0000980) |
| 0.1 | 0.2 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
| 0.1 | 0.4 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
| 0.1 | 0.3 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
| 0.1 | 0.3 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.1 | 0.4 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.1 | 0.6 | GO:0070990 | snRNP binding(GO:0070990) |
| 0.1 | 1.1 | GO:0070402 | NADPH binding(GO:0070402) |
| 0.1 | 0.7 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.1 | 0.3 | GO:0070492 | oligosaccharide binding(GO:0070492) |
| 0.1 | 0.1 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
| 0.1 | 2.2 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.1 | 0.4 | GO:0004342 | glucosamine-6-phosphate deaminase activity(GO:0004342) |
| 0.1 | 0.3 | GO:0004692 | cGMP-dependent protein kinase activity(GO:0004692) |
| 0.1 | 0.3 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 0.1 | 1.0 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.1 | 3.4 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 0.1 | 0.7 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.1 | 0.1 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
| 0.1 | 0.5 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.1 | 1.0 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
| 0.1 | 0.9 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.1 | 0.6 | GO:0022848 | acetylcholine-gated cation channel activity(GO:0022848) |
| 0.1 | 1.8 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.1 | 0.4 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.1 | 0.2 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
| 0.1 | 0.9 | GO:0031702 | angiotensin receptor binding(GO:0031701) type 1 angiotensin receptor binding(GO:0031702) |
| 0.1 | 0.3 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.1 | 0.6 | GO:0016004 | phospholipase activator activity(GO:0016004) lipase activator activity(GO:0060229) |
| 0.1 | 0.3 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.1 | 0.5 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
| 0.1 | 0.2 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.1 | 0.7 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
| 0.1 | 0.3 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
| 0.1 | 1.7 | GO:0019789 | SUMO transferase activity(GO:0019789) |
| 0.1 | 4.1 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.1 | 0.2 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.1 | 0.3 | GO:0031432 | titin binding(GO:0031432) |
| 0.1 | 0.4 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.1 | 0.4 | GO:0051861 | glycolipid binding(GO:0051861) |
| 0.1 | 4.6 | GO:0005178 | integrin binding(GO:0005178) |
| 0.1 | 0.6 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
| 0.1 | 0.8 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.1 | 0.3 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.1 | 0.5 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.1 | 0.3 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.1 | 0.6 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.1 | 0.7 | GO:0005355 | glucose transmembrane transporter activity(GO:0005355) |
| 0.1 | 1.1 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.1 | 0.2 | GO:0008988 | rRNA (adenine-N6-)-methyltransferase activity(GO:0008988) |
| 0.1 | 0.3 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
| 0.1 | 0.2 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.1 | 0.3 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
| 0.1 | 0.1 | GO:0015087 | cobalt ion transmembrane transporter activity(GO:0015087) nickel cation transmembrane transporter activity(GO:0015099) |
| 0.1 | 0.3 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.1 | 0.3 | GO:0008518 | reduced folate carrier activity(GO:0008518) methotrexate transporter activity(GO:0015350) |
| 0.1 | 3.2 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.1 | 0.5 | GO:0015036 | disulfide oxidoreductase activity(GO:0015036) |
| 0.1 | 1.4 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
| 0.1 | 0.2 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.1 | 0.6 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
| 0.0 | 0.2 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
| 0.0 | 1.1 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.0 | 0.3 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.0 | 0.3 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.0 | 0.2 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.0 | 0.4 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.0 | 1.2 | GO:0004180 | carboxypeptidase activity(GO:0004180) |
| 0.0 | 0.2 | GO:0015250 | water channel activity(GO:0015250) |
| 0.0 | 0.6 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.0 | 2.0 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.0 | 1.0 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.0 | 0.1 | GO:0070905 | serine binding(GO:0070905) |
| 0.0 | 0.2 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.0 | 1.5 | GO:0005080 | protein kinase C binding(GO:0005080) |
| 0.0 | 0.1 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.0 | 3.7 | GO:0008201 | heparin binding(GO:0008201) |
| 0.0 | 0.9 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.0 | 0.9 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.0 | 7.7 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.4 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.0 | 1.9 | GO:0004896 | cytokine receptor activity(GO:0004896) |
| 0.0 | 0.7 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 0.0 | 0.2 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 0.0 | 0.2 | GO:0001032 | RNA polymerase III type 3 promoter DNA binding(GO:0001032) |
| 0.0 | 0.3 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.0 | 0.3 | GO:0015288 | porin activity(GO:0015288) |
| 0.0 | 0.2 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.0 | 0.3 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.0 | 2.3 | GO:0016879 | ligase activity, forming carbon-nitrogen bonds(GO:0016879) |
| 0.0 | 0.2 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.0 | 0.1 | GO:0004660 | protein farnesyltransferase activity(GO:0004660) |
| 0.0 | 0.9 | GO:0016859 | cis-trans isomerase activity(GO:0016859) |
| 0.0 | 0.1 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.0 | 0.3 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
| 0.0 | 0.4 | GO:0070034 | telomerase RNA binding(GO:0070034) |
| 0.0 | 0.1 | GO:0016405 | CoA-ligase activity(GO:0016405) |
| 0.0 | 0.7 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
| 0.0 | 0.1 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
| 0.0 | 1.8 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
| 0.0 | 0.6 | GO:0001158 | enhancer sequence-specific DNA binding(GO:0001158) |
| 0.0 | 0.2 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.0 | 0.3 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.0 | 0.8 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.0 | 0.5 | GO:0045503 | dynein light chain binding(GO:0045503) |
| 0.0 | 0.3 | GO:0031490 | chromatin DNA binding(GO:0031490) |
| 0.0 | 0.6 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.0 | 0.1 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.0 | 0.2 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.0 | 0.3 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.0 | 0.1 | GO:0008311 | double-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008311) |
| 0.0 | 1.4 | GO:0016836 | hydro-lyase activity(GO:0016836) |
| 0.0 | 0.2 | GO:0015266 | protein channel activity(GO:0015266) |
| 0.0 | 0.6 | GO:0071949 | FAD binding(GO:0071949) |
| 0.0 | 0.1 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.0 | 0.2 | GO:0005047 | signal recognition particle binding(GO:0005047) 7S RNA binding(GO:0008312) |
| 0.0 | 0.3 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
| 0.0 | 0.8 | GO:0036442 | hydrogen-exporting ATPase activity(GO:0036442) |
| 0.0 | 1.6 | GO:0001046 | core promoter sequence-specific DNA binding(GO:0001046) |
| 0.0 | 0.4 | GO:0004576 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 0.2 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
| 0.0 | 0.1 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
| 0.0 | 0.3 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.0 | 0.3 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.0 | 0.2 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.0 | 0.1 | GO:0034597 | phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) |
| 0.0 | 0.2 | GO:0004525 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
| 0.0 | 0.3 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.0 | 0.3 | GO:0019213 | deacetylase activity(GO:0019213) |
| 0.0 | 0.2 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
| 0.0 | 0.1 | GO:0033691 | sialic acid binding(GO:0033691) |
| 0.0 | 0.2 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.0 | 0.2 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.0 | 0.2 | GO:0015114 | phosphate ion transmembrane transporter activity(GO:0015114) |
| 0.0 | 0.1 | GO:0004382 | guanosine-diphosphatase activity(GO:0004382) |
| 0.0 | 0.2 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.0 | 0.0 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
| 0.0 | 0.7 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.0 | 0.3 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.0 | 0.2 | GO:0015464 | acetylcholine receptor activity(GO:0015464) |
| 0.0 | 0.6 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.0 | 0.5 | GO:0004714 | transmembrane receptor protein tyrosine kinase activity(GO:0004714) |
| 0.0 | 0.0 | GO:0070012 | oligopeptidase activity(GO:0070012) |
| 0.0 | 0.1 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.0 | 0.1 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.0 | 0.3 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
| 0.0 | 0.3 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.0 | 0.5 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.0 | 0.1 | GO:0003977 | UDP-N-acetylglucosamine diphosphorylase activity(GO:0003977) |
| 0.0 | 0.2 | GO:0009055 | electron carrier activity(GO:0009055) |
| 0.0 | 0.4 | GO:0016835 | carbon-oxygen lyase activity(GO:0016835) |
| 0.0 | 0.6 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
| 0.0 | 0.1 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.0 | 0.5 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.0 | 0.2 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.0 | 0.2 | GO:0015929 | hexosaminidase activity(GO:0015929) |
| 0.0 | 2.1 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
| 0.0 | 0.2 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
| 0.0 | 0.4 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.0 | 0.2 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.0 | 1.2 | GO:0005179 | hormone activity(GO:0005179) |
| 0.0 | 2.2 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
| 0.0 | 0.2 | GO:0003678 | DNA helicase activity(GO:0003678) |
| 0.0 | 0.4 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
| 0.0 | 0.4 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.0 | 0.3 | GO:0030276 | clathrin binding(GO:0030276) |
| 0.0 | 0.1 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
| 0.0 | 0.1 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.0 | 0.2 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.0 | 0.2 | GO:0043495 | protein anchor(GO:0043495) |
| 0.0 | 0.6 | GO:0004521 | endoribonuclease activity(GO:0004521) |
| 0.0 | 1.1 | GO:0001047 | core promoter binding(GO:0001047) |
| 0.0 | 0.3 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.0 | 0.5 | GO:0030170 | pyridoxal phosphate binding(GO:0030170) |
| 0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.0 | 0.3 | GO:0004659 | prenyltransferase activity(GO:0004659) |
| 0.0 | 0.5 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.0 | 0.1 | GO:0019002 | GMP binding(GO:0019002) |
| 0.0 | 0.5 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.0 | 0.2 | GO:0005243 | gap junction channel activity(GO:0005243) wide pore channel activity(GO:0022829) |
| 0.0 | 0.1 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.0 | 0.1 | GO:0008242 | omega peptidase activity(GO:0008242) |
| 0.0 | 0.3 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.0 | 0.6 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.0 | 1.1 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.0 | 0.2 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
| 0.0 | 0.1 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
| 0.0 | 0.2 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.0 | 0.5 | GO:0008235 | metalloexopeptidase activity(GO:0008235) |
| 0.0 | 0.1 | GO:0032813 | death receptor binding(GO:0005123) tumor necrosis factor receptor superfamily binding(GO:0032813) |
| 0.0 | 0.9 | GO:0061733 | peptide-lysine-N-acetyltransferase activity(GO:0061733) |
| 0.0 | 0.2 | GO:0004467 | long-chain fatty acid-CoA ligase activity(GO:0004467) fatty acid ligase activity(GO:0015645) |
| 0.0 | 0.1 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.0 | 0.1 | GO:0042301 | phosphate ion binding(GO:0042301) |
| 0.0 | 0.2 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 0.0 | 0.1 | GO:0052654 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
| 0.0 | 0.1 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.0 | 0.2 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
| 0.0 | 0.0 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 0.0 | 0.5 | GO:0003684 | damaged DNA binding(GO:0003684) |
| 0.0 | 0.3 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
| 0.0 | 0.1 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.0 | 0.1 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.0 | 0.1 | GO:0031386 | protein tag(GO:0031386) |
| 0.0 | 0.3 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.0 | 0.1 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.0 | 0.1 | GO:0042608 | T cell receptor binding(GO:0042608) |
| 0.0 | 0.2 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.0 | 0.2 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.0 | 6.4 | GO:0000977 | RNA polymerase II regulatory region sequence-specific DNA binding(GO:0000977) |
| 0.0 | 0.1 | GO:0033188 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
| 0.0 | 0.5 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
| 0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.0 | 0.9 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.5 | GO:0008565 | protein transporter activity(GO:0008565) |
| 0.0 | 0.2 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.0 | 0.2 | GO:0005521 | lamin binding(GO:0005521) |
| 0.0 | 0.0 | GO:0043532 | angiostatin binding(GO:0043532) |
| 0.0 | 0.1 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.0 | 0.2 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.0 | 0.0 | GO:0047237 | glucuronylgalactosylproteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047237) glucuronosyl-N-acetylgalactosaminyl-proteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047238) |
| 0.0 | 0.1 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.0 | 0.1 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
| 0.0 | 0.1 | GO:0030371 | translation repressor activity(GO:0030371) |
| 0.0 | 0.1 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.0 | 0.1 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.9 | 1.9 | PID_AMB2_NEUTROPHILS_PATHWAY | amb2 Integrin signaling |
| 0.6 | 5.0 | PID_INTEGRIN4_PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.4 | 3.7 | SA_G2_AND_M_PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.3 | 8.4 | NABA_BASEMENT_MEMBRANES | Genes encoding structural components of basement membranes |
| 0.2 | 0.9 | PID_CXCR4_PATHWAY | CXCR4-mediated signaling events |
| 0.2 | 1.3 | ST_PAC1_RECEPTOR_PATHWAY | PAC1 Receptor Pathway |
| 0.2 | 1.2 | PID_S1P_S1P1_PATHWAY | S1P1 pathway |
| 0.2 | 1.9 | PID_VEGF_VEGFR_PATHWAY | VEGF and VEGFR signaling network |
| 0.1 | 4.3 | NABA_COLLAGENS | Genes encoding collagen proteins |
| 0.1 | 1.2 | PID_P38_MK2_PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.1 | 1.8 | SA_REG_CASCADE_OF_CYCLIN_EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.1 | 1.5 | PID_EPO_PATHWAY | EPO signaling pathway |
| 0.1 | 0.2 | PID_IL3_PATHWAY | IL3-mediated signaling events |
| 0.1 | 1.6 | PID_INTEGRIN2_PATHWAY | Beta2 integrin cell surface interactions |
| 0.1 | 2.1 | PID_PRL_SIGNALING_EVENTS_PATHWAY | Signaling events mediated by PRL |
| 0.1 | 1.2 | PID_TCR_JNK_PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.1 | 0.6 | PID_SYNDECAN_2_PATHWAY | Syndecan-2-mediated signaling events |
| 0.1 | 4.1 | PID_EPHRINB_REV_PATHWAY | Ephrin B reverse signaling |
| 0.1 | 2.4 | PID_INTEGRIN3_PATHWAY | Beta3 integrin cell surface interactions |
| 0.1 | 0.4 | PID_INTEGRIN_A9B1_PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.1 | 1.1 | PID_ALK2_PATHWAY | ALK2 signaling events |
| 0.1 | 10.9 | NABA_ECM_GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.1 | 0.4 | PID_NFKAPPAB_ATYPICAL_PATHWAY | Atypical NF-kappaB pathway |
| 0.1 | 4.0 | PID_ATF2_PATHWAY | ATF-2 transcription factor network |
| 0.1 | 2.3 | PID_ALK1_PATHWAY | ALK1 signaling events |
| 0.1 | 2.3 | PID_WNT_SIGNALING_PATHWAY | Wnt signaling network |
| 0.1 | 4.3 | PID_AURORA_B_PATHWAY | Aurora B signaling |
| 0.1 | 6.1 | PID_FGF_PATHWAY | FGF signaling pathway |
| 0.1 | 0.1 | PID_P38_GAMMA_DELTA_PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.1 | 0.3 | PID_INTEGRIN5_PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.1 | 3.4 | PID_IL4_2PATHWAY | IL4-mediated signaling events |
| 0.1 | 0.1 | PID_SYNDECAN_4_PATHWAY | Syndecan-4-mediated signaling events |
| 0.1 | 6.1 | PID_AR_PATHWAY | Coregulation of Androgen receptor activity |
| 0.1 | 1.5 | PID_AVB3_INTEGRIN_PATHWAY | Integrins in angiogenesis |
| 0.1 | 0.4 | PID_SYNDECAN_1_PATHWAY | Syndecan-1-mediated signaling events |
| 0.1 | 1.3 | PID_INTEGRIN1_PATHWAY | Beta1 integrin cell surface interactions |
| 0.1 | 2.2 | PID_RETINOIC_ACID_PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.1 | 0.5 | ST_INTERFERON_GAMMA_PATHWAY | Interferon gamma pathway. |
| 0.1 | 0.3 | PID_VEGFR1_PATHWAY | VEGFR1 specific signals |
| 0.1 | 3.3 | PID_P73PATHWAY | p73 transcription factor network |
| 0.1 | 0.5 | SA_B_CELL_RECEPTOR_COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.1 | 6.4 | NABA_ECM_AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.1 | 2.8 | PID_TAP63_PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.1 | 1.1 | PID_P38_ALPHA_BETA_DOWNSTREAM_PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.1 | 1.6 | ST_P38_MAPK_PATHWAY | p38 MAPK Pathway |
| 0.1 | 0.1 | PID_PI3K_PLC_TRK_PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.1 | 6.8 | NABA_ECM_REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.0 | 2.7 | PID_SMAD2_3NUCLEAR_PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.0 | 0.6 | ST_G_ALPHA_S_PATHWAY | G alpha s Pathway |
| 0.0 | 0.7 | PID_FOXM1_PATHWAY | FOXM1 transcription factor network |
| 0.0 | 1.3 | NABA_PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 0.3 | PID_IL2_STAT5_PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.0 | 1.0 | SIG_PIP3_SIGNALING_IN_B_LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.0 | 0.1 | ST_PHOSPHOINOSITIDE_3_KINASE_PATHWAY | PI3K Pathway |
| 0.0 | 0.8 | PID_RAS_PATHWAY | Regulation of Ras family activation |
| 0.0 | 0.1 | PID_ANTHRAX_PATHWAY | Cellular roles of Anthrax toxin |
| 0.0 | 0.8 | PID_NFAT_TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.0 | 1.0 | PID_HNF3B_PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.0 | 0.2 | PID_NECTIN_PATHWAY | Nectin adhesion pathway |
| 0.0 | 0.1 | PID_PS1_PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 1.0 | PID_E2F_PATHWAY | E2F transcription factor network |
| 0.0 | 0.1 | SA_MMP_CYTOKINE_CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.0 | 1.0 | PID_BETA_CATENIN_NUC_PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.0 | 0.4 | PID_DELTA_NP63_PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.0 | 0.5 | PID_FCER1_PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.0 | 0.2 | PID_IL8_CXCR1_PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.0 | 0.2 | PID_MYC_PATHWAY | C-MYC pathway |
| 0.0 | 0.7 | PID_TELOMERASE_PATHWAY | Regulation of Telomerase |
| 0.0 | 0.9 | PID_CMYB_PATHWAY | C-MYB transcription factor network |
| 0.0 | 0.5 | PID_BARD1_PATHWAY | BARD1 signaling events |
| 0.0 | 0.2 | ST_ERK1_ERK2_MAPK_PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.0 | 3.0 | NABA_SECRETED_FACTORS | Genes encoding secreted soluble factors |
| 0.0 | 0.1 | PID_S1P_S1P2_PATHWAY | S1P2 pathway |
| 0.0 | 0.2 | PID_BCR_5PATHWAY | BCR signaling pathway |
| 0.0 | 0.4 | PID_ATM_PATHWAY | ATM pathway |
| 0.0 | 0.2 | PID_CONE_PATHWAY | Visual signal transduction: Cones |
| 0.0 | 0.2 | PID_CD40_PATHWAY | CD40/CD40L signaling |
| 0.0 | 0.8 | PID_CDC42_PATHWAY | CDC42 signaling events |
| 0.0 | 0.5 | PID_MYC_REPRESS_PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.0 | 0.6 | PID_ERA_GENOMIC_PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.0 | 0.1 | PID_ERB_GENOMIC_PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 0.1 | PID_HDAC_CLASSIII_PATHWAY | Signaling events mediated by HDAC Class III |
| 0.0 | 0.1 | PID_RANBP2_PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.0 | 0.1 | PID_ER_NONGENOMIC_PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.0 | 0.4 | PID_HES_HEY_PATHWAY | Notch-mediated HES/HEY network |
| 0.0 | 0.5 | PID_P53_REGULATION_PATHWAY | p53 pathway |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 0.5 | REACTOME_INTERACTIONS_OF_VPR_WITH_HOST_CELLULAR_PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.5 | 2.7 | REACTOME_CREATION_OF_C4_AND_C2_ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 0.4 | 0.4 | REACTOME_LATENT_INFECTION_OF_HOMO_SAPIENS_WITH_MYCOBACTERIUM_TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.4 | 3.3 | REACTOME_FGFR4_LIGAND_BINDING_AND_ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 0.4 | 0.7 | REACTOME_SIGNALING_BY_FGFR | Genes involved in Signaling by FGFR |
| 0.3 | 2.7 | REACTOME_PASSIVE_TRANSPORT_BY_AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.3 | 3.3 | REACTOME_AMINE_DERIVED_HORMONES | Genes involved in Amine-derived hormones |
| 0.3 | 8.7 | REACTOME_TIGHT_JUNCTION_INTERACTIONS | Genes involved in Tight junction interactions |
| 0.3 | 1.6 | REACTOME_COMMON_PATHWAY | Genes involved in Common Pathway |
| 0.2 | 6.3 | REACTOME_STRIATED_MUSCLE_CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.2 | 5.5 | REACTOME_HS_GAG_DEGRADATION | Genes involved in HS-GAG degradation |
| 0.2 | 1.6 | REACTOME_ENDOGENOUS_STEROLS | Genes involved in Endogenous sterols |
| 0.2 | 2.8 | REACTOME_REGULATION_OF_IFNG_SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.2 | 3.6 | REACTOME_SYNTHESIS_SECRETION_AND_INACTIVATION_OF_GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
| 0.2 | 2.2 | REACTOME_VEGF_LIGAND_RECEPTOR_INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.2 | 2.1 | REACTOME_GAP_JUNCTION_ASSEMBLY | Genes involved in Gap junction assembly |
| 0.2 | 2.9 | REACTOME_CYCLIN_A_B1_ASSOCIATED_EVENTS_DURING_G2_M_TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.2 | 2.9 | REACTOME_FORMATION_OF_ATP_BY_CHEMIOSMOTIC_COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.2 | 14.2 | REACTOME_INTEGRIN_CELL_SURFACE_INTERACTIONS | Genes involved in Integrin cell surface interactions |
| 0.2 | 1.4 | REACTOME_BILE_SALT_AND_ORGANIC_ANION_SLC_TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.2 | 0.2 | REACTOME_ANTIGEN_ACTIVATES_B_CELL_RECEPTOR_LEADING_TO_GENERATION_OF_SECOND_MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.1 | 2.9 | REACTOME_PRE_NOTCH_PROCESSING_IN_GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.1 | 0.4 | REACTOME_SCFSKP2_MEDIATED_DEGRADATION_OF_P27_P21 | Genes involved in SCF(Skp2)-mediated degradation of p27/p21 |
| 0.1 | 0.1 | REACTOME_YAP1_AND_WWTR1_TAZ_STIMULATED_GENE_EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.1 | 0.6 | REACTOME_ETHANOL_OXIDATION | Genes involved in Ethanol oxidation |
| 0.1 | 0.1 | REACTOME_REGULATION_OF_AMPK_ACTIVITY_VIA_LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.1 | 2.3 | REACTOME_SIGNALING_BY_NODAL | Genes involved in Signaling by NODAL |
| 0.1 | 1.7 | REACTOME_HDL_MEDIATED_LIPID_TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.1 | 1.0 | REACTOME_TRANSPORT_OF_ORGANIC_ANIONS | Genes involved in Transport of organic anions |
| 0.1 | 2.1 | REACTOME_G1_S_SPECIFIC_TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.1 | 2.1 | REACTOME_MITOCHONDRIAL_FATTY_ACID_BETA_OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.1 | 3.1 | REACTOME_TRAF6_MEDIATED_NFKB_ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.1 | 6.1 | REACTOME_COLLAGEN_FORMATION | Genes involved in Collagen formation |
| 0.1 | 1.6 | REACTOME_PURINE_RIBONUCLEOSIDE_MONOPHOSPHATE_BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.1 | 1.0 | REACTOME_PYRIMIDINE_CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.1 | 3.5 | REACTOME_SMAD2_SMAD3_SMAD4_HETEROTRIMER_REGULATES_TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.1 | 1.5 | REACTOME_P38MAPK_EVENTS | Genes involved in p38MAPK events |
| 0.1 | 0.8 | REACTOME_ACYL_CHAIN_REMODELLING_OF_PI | Genes involved in Acyl chain remodelling of PI |
| 0.1 | 0.8 | REACTOME_APOBEC3G_MEDIATED_RESISTANCE_TO_HIV1_INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.1 | 0.8 | REACTOME_SYNTHESIS_SECRETION_AND_DEACYLATION_OF_GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.1 | 1.8 | REACTOME_CHONDROITIN_SULFATE_BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.1 | 0.5 | REACTOME_ORGANIC_CATION_ANION_ZWITTERION_TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.1 | 1.8 | REACTOME_CITRIC_ACID_CYCLE_TCA_CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.1 | 2.2 | REACTOME_G1_PHASE | Genes involved in G1 Phase |
| 0.1 | 3.1 | REACTOME_GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.1 | 0.7 | REACTOME_REMOVAL_OF_THE_FLAP_INTERMEDIATE_FROM_THE_C_STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 0.1 | 2.5 | REACTOME_LIPID_DIGESTION_MOBILIZATION_AND_TRANSPORT | Genes involved in Lipid digestion, mobilization, and transport |
| 0.1 | 1.2 | REACTOME_HOMOLOGOUS_RECOMBINATION_REPAIR_OF_REPLICATION_INDEPENDENT_DOUBLE_STRAND_BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.1 | 2.6 | REACTOME_AMINO_ACID_TRANSPORT_ACROSS_THE_PLASMA_MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.1 | 0.2 | REACTOME_CD28_DEPENDENT_VAV1_PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
| 0.1 | 0.9 | REACTOME_DEGRADATION_OF_THE_EXTRACELLULAR_MATRIX | Genes involved in Degradation of the extracellular matrix |
| 0.1 | 1.0 | REACTOME_APOPTOSIS_INDUCED_DNA_FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.1 | 0.8 | REACTOME_NA_CL_DEPENDENT_NEUROTRANSMITTER_TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.1 | 2.2 | REACTOME_G_BETA_GAMMA_SIGNALLING_THROUGH_PLC_BETA | Genes involved in G beta:gamma signalling through PLC beta |
| 0.1 | 1.1 | REACTOME_METABOLISM_OF_POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.1 | 0.7 | REACTOME_TETRAHYDROBIOPTERIN_BH4_SYNTHESIS_RECYCLING_SALVAGE_AND_REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.1 | 7.0 | REACTOME_MITOTIC_PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.1 | 1.7 | REACTOME_REGULATION_OF_BETA_CELL_DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.1 | 1.2 | REACTOME_CONVERSION_FROM_APC_C_CDC20_TO_APC_C_CDH1_IN_LATE_ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.1 | 0.4 | REACTOME_CYTOCHROME_P450_ARRANGED_BY_SUBSTRATE_TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
| 0.1 | 0.6 | REACTOME_PROLACTIN_RECEPTOR_SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.1 | 0.3 | REACTOME_GLYCOPROTEIN_HORMONES | Genes involved in Glycoprotein hormones |
| 0.1 | 0.4 | REACTOME_CDC6_ASSOCIATION_WITH_THE_ORC_ORIGIN_COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.1 | 0.4 | REACTOME_AQUAPORIN_MEDIATED_TRANSPORT | Genes involved in Aquaporin-mediated transport |
| 0.1 | 1.0 | REACTOME_ZINC_TRANSPORTERS | Genes involved in Zinc transporters |
| 0.1 | 1.0 | REACTOME_MTORC1_MEDIATED_SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.1 | 0.2 | REACTOME_ANDROGEN_BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.1 | 2.4 | REACTOME_MITOCHONDRIAL_PROTEIN_IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.1 | 0.4 | REACTOME_PRESYNAPTIC_NICOTINIC_ACETYLCHOLINE_RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
| 0.1 | 3.5 | REACTOME_RESPIRATORY_ELECTRON_TRANSPORT | Genes involved in Respiratory electron transport |
| 0.1 | 1.0 | REACTOME_MUSCLE_CONTRACTION | Genes involved in Muscle contraction |
| 0.1 | 0.7 | REACTOME_ACTIVATION_OF_KAINATE_RECEPTORS_UPON_GLUTAMATE_BINDING | Genes involved in Activation of Kainate Receptors upon glutamate binding |
| 0.1 | 1.3 | REACTOME_GLUTATHIONE_CONJUGATION | Genes involved in Glutathione conjugation |
| 0.0 | 1.1 | REACTOME_SYNTHESIS_OF_PC | Genes involved in Synthesis of PC |
| 0.0 | 1.1 | REACTOME_OTHER_SEMAPHORIN_INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.0 | 0.7 | REACTOME_OXYGEN_DEPENDENT_PROLINE_HYDROXYLATION_OF_HYPOXIA_INDUCIBLE_FACTOR_ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.0 | 0.3 | REACTOME_TRANSLOCATION_OF_ZAP_70_TO_IMMUNOLOGICAL_SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 0.0 | 0.5 | REACTOME_SLBP_DEPENDENT_PROCESSING_OF_REPLICATION_DEPENDENT_HISTONE_PRE_MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.0 | 0.3 | REACTOME_REGULATION_OF_IFNA_SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.0 | 0.4 | REACTOME_KERATAN_SULFATE_DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.0 | 0.2 | REACTOME_RESPIRATORY_ELECTRON_TRANSPORT_ATP_SYNTHESIS_BY_CHEMIOSMOTIC_COUPLING_AND_HEAT_PRODUCTION_BY_UNCOUPLING_PROTEINS_ | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.0 | 1.3 | REACTOME_SIGNALING_BY_ROBO_RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.0 | 3.0 | REACTOME_ANTIGEN_PROCESSING_CROSS_PRESENTATION | Genes involved in Antigen processing-Cross presentation |
| 0.0 | 0.2 | REACTOME_DESTABILIZATION_OF_MRNA_BY_AUF1_HNRNP_D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.0 | 1.0 | REACTOME_TRANSFERRIN_ENDOCYTOSIS_AND_RECYCLING | Genes involved in Transferrin endocytosis and recycling |
| 0.0 | 2.2 | REACTOME_CLASS_B_2_SECRETIN_FAMILY_RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.0 | 0.3 | REACTOME_THE_ACTIVATION_OF_ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.0 | 0.8 | REACTOME_CREB_PHOSPHORYLATION_THROUGH_THE_ACTIVATION_OF_CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
| 0.0 | 0.2 | REACTOME_SYNTHESIS_OF_BILE_ACIDS_AND_BILE_SALTS_VIA_24_HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.0 | 0.4 | REACTOME_NOTCH_HLH_TRANSCRIPTION_PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.0 | 1.0 | REACTOME_RNA_POL_I_TRANSCRIPTION_INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.0 | 1.6 | REACTOME_MRNA_SPLICING_MINOR_PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.0 | 0.3 | REACTOME_SIGNAL_REGULATORY_PROTEIN_SIRP_FAMILY_INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.0 | 0.3 | REACTOME_RECEPTOR_LIGAND_BINDING_INITIATES_THE_SECOND_PROTEOLYTIC_CLEAVAGE_OF_NOTCH_RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.0 | 0.4 | REACTOME_PTM_GAMMA_CARBOXYLATION_HYPUSINE_FORMATION_AND_ARYLSULFATASE_ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.0 | 0.2 | REACTOME_IRAK1_RECRUITS_IKK_COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.0 | 0.2 | REACTOME_ADP_SIGNALLING_THROUGH_P2RY12 | Genes involved in ADP signalling through P2Y purinoceptor 12 |
| 0.0 | 0.4 | REACTOME_ORC1_REMOVAL_FROM_CHROMATIN | Genes involved in Orc1 removal from chromatin |
| 0.0 | 3.6 | REACTOME_METABOLISM_OF_AMINO_ACIDS_AND_DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.0 | 0.3 | REACTOME_MITOTIC_M_M_G1_PHASES | Genes involved in Mitotic M-M/G1 phases |
| 0.0 | 0.1 | REACTOME_PLATELET_ADHESION_TO_EXPOSED_COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.0 | 1.2 | REACTOME_PACKAGING_OF_TELOMERE_ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.0 | 0.3 | REACTOME_A_TETRASACCHARIDE_LINKER_SEQUENCE_IS_REQUIRED_FOR_GAG_SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
| 0.0 | 0.5 | REACTOME_GENERATION_OF_SECOND_MESSENGER_MOLECULES | Genes involved in Generation of second messenger molecules |
| 0.0 | 1.8 | REACTOME_ACTIVATION_OF_THE_MRNA_UPON_BINDING_OF_THE_CAP_BINDING_COMPLEX_AND_EIFS_AND_SUBSEQUENT_BINDING_TO_43S | Genes involved in Activation of the mRNA upon binding of the cap-binding complex and eIFs, and subsequent binding to 43S |
| 0.0 | 0.1 | REACTOME_KINESINS | Genes involved in Kinesins |
| 0.0 | 1.0 | REACTOME_PREFOLDIN_MEDIATED_TRANSFER_OF_SUBSTRATE_TO_CCT_TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
| 0.0 | 0.2 | REACTOME_ELEVATION_OF_CYTOSOLIC_CA2_LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.0 | 0.2 | REACTOME_REGULATION_OF_KIT_SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.0 | 1.8 | REACTOME_3_UTR_MEDIATED_TRANSLATIONAL_REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
| 0.0 | 2.0 | REACTOME_NUCLEAR_RECEPTOR_TRANSCRIPTION_PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 0.3 | REACTOME_PRE_NOTCH_EXPRESSION_AND_PROCESSING | Genes involved in Pre-NOTCH Expression and Processing |
| 0.0 | 0.2 | REACTOME_FORMATION_OF_TRANSCRIPTION_COUPLED_NER_TC_NER_REPAIR_COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 0.0 | 0.6 | REACTOME_CHEMOKINE_RECEPTORS_BIND_CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.0 | 0.5 | REACTOME_DOWNREGULATION_OF_TGF_BETA_RECEPTOR_SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.0 | 0.7 | REACTOME_ACTIVATED_NOTCH1_TRANSMITS_SIGNAL_TO_THE_NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.0 | 0.5 | REACTOME_TELOMERE_MAINTENANCE | Genes involved in Telomere Maintenance |
| 0.0 | 0.4 | REACTOME_RNA_POL_I_PROMOTER_OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.0 | 0.6 | REACTOME_SYNTHESIS_AND_INTERCONVERSION_OF_NUCLEOTIDE_DI_AND_TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.0 | 0.0 | REACTOME_CS_DS_DEGRADATION | Genes involved in CS/DS degradation |
| 0.0 | 0.2 | REACTOME_SEMA3A_PAK_DEPENDENT_AXON_REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.0 | 0.9 | REACTOME_O_LINKED_GLYCOSYLATION_OF_MUCINS | Genes involved in O-linked glycosylation of mucins |
| 0.0 | 0.1 | REACTOME_RAF_MAP_KINASE_CASCADE | Genes involved in RAF/MAP kinase cascade |
| 0.0 | 0.4 | REACTOME_ANTIVIRAL_MECHANISM_BY_IFN_STIMULATED_GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.0 | 0.6 | REACTOME_NCAM1_INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 0.2 | REACTOME_SIGNALING_BY_WNT | Genes involved in Signaling by Wnt |
| 0.0 | 0.0 | REACTOME_SHC_MEDIATED_SIGNALLING | Genes involved in SHC-mediated signalling |
| 0.0 | 0.1 | REACTOME_SIGNALING_BY_ACTIVATED_POINT_MUTANTS_OF_FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 0.0 | 0.2 | REACTOME_METAL_ION_SLC_TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.0 | 0.1 | REACTOME_INFLUENZA_VIRAL_RNA_TRANSCRIPTION_AND_REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.0 | 0.2 | REACTOME_REGULATORY_RNA_PATHWAYS | Genes involved in Regulatory RNA pathways |
| 0.0 | 0.2 | REACTOME_ACTIVATION_OF_CHAPERONE_GENES_BY_ATF6_ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 0.0 | 0.1 | REACTOME_PHASE1_FUNCTIONALIZATION_OF_COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
| 0.0 | 0.8 | REACTOME_TRANSLATION | Genes involved in Translation |
| 0.0 | 0.5 | REACTOME_SYNTHESIS_OF_VERY_LONG_CHAIN_FATTY_ACYL_COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
| 0.0 | 0.2 | REACTOME_EXTRINSIC_PATHWAY_FOR_APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.0 | 0.3 | REACTOME_DEADENYLATION_OF_MRNA | Genes involved in Deadenylation of mRNA |
| 0.0 | 0.1 | REACTOME_SYNTHESIS_OF_PIPS_AT_THE_EARLY_ENDOSOME_MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
| 0.0 | 0.5 | REACTOME_TRANSPORT_OF_VITAMINS_NUCLEOSIDES_AND_RELATED_MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.0 | 1.2 | REACTOME_MRNA_SPLICING | Genes involved in mRNA Splicing |
| 0.0 | 0.2 | REACTOME_REGULATION_OF_INSULIN_LIKE_GROWTH_FACTOR_IGF_ACTIVITY_BY_INSULIN_LIKE_GROWTH_FACTOR_BINDING_PROTEINS_IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.0 | 0.3 | REACTOME_INTERFERON_ALPHA_BETA_SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.0 | 0.2 | REACTOME_RNA_POL_II_TRANSCRIPTION_PRE_INITIATION_AND_PROMOTER_OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.0 | 0.1 | REACTOME_FRS2_MEDIATED_CASCADE | Genes involved in FRS2-mediated cascade |
| 0.0 | 0.1 | REACTOME_METABOLISM_OF_STEROID_HORMONES_AND_VITAMINS_A_AND_D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
| 0.0 | 0.1 | REACTOME_MRNA_DECAY_BY_3_TO_5_EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.0 | 0.5 | REACTOME_ACTIVATION_OF_CHAPERONE_GENES_BY_XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |


