| 1.0 |
3.1 |
GO:1990523 |
bone regeneration(GO:1990523) |
| 0.9 |
3.5 |
GO:0006982 |
response to lipid hydroperoxide(GO:0006982) cellular response to lipid hydroperoxide(GO:0071449) |
| 0.8 |
8.6 |
GO:0042572 |
retinol metabolic process(GO:0042572) |
| 0.7 |
5.6 |
GO:0048625 |
myoblast fate commitment(GO:0048625) |
| 0.6 |
1.8 |
GO:1900039 |
positive regulation of cellular response to hypoxia(GO:1900039) |
| 0.6 |
2.3 |
GO:0043490 |
malate-aspartate shuttle(GO:0043490) |
| 0.6 |
2.2 |
GO:0070327 |
thyroid hormone transport(GO:0070327) |
| 0.5 |
1.6 |
GO:2000435 |
regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
| 0.5 |
0.5 |
GO:1902460 |
regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.5 |
1.6 |
GO:0090425 |
hepatocyte cell migration(GO:0002194) branching involved in pancreas morphogenesis(GO:0061114) acinar cell differentiation(GO:0090425) positive regulation of forebrain neuron differentiation(GO:2000979) |
| 0.5 |
1.5 |
GO:0030421 |
defecation(GO:0030421) |
| 0.5 |
1.5 |
GO:0046110 |
xanthine metabolic process(GO:0046110) |
| 0.5 |
1.4 |
GO:0042097 |
interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) |
| 0.5 |
1.4 |
GO:0014809 |
regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014809) |
| 0.5 |
1.4 |
GO:0006553 |
lysine metabolic process(GO:0006553) |
| 0.4 |
3.1 |
GO:0051611 |
negative regulation of neurotransmitter uptake(GO:0051581) serotonin uptake(GO:0051610) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.4 |
1.3 |
GO:1904956 |
regulation of midbrain dopaminergic neuron differentiation(GO:1904956) |
| 0.4 |
0.4 |
GO:0070366 |
regulation of hepatocyte differentiation(GO:0070366) |
| 0.4 |
1.7 |
GO:0036518 |
chemorepulsion of dopaminergic neuron axon(GO:0036518) |
| 0.4 |
2.0 |
GO:0045918 |
negative regulation of cytolysis(GO:0045918) |
| 0.4 |
1.6 |
GO:0035905 |
ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
| 0.4 |
1.2 |
GO:0001580 |
detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
| 0.4 |
1.9 |
GO:0034421 |
post-translational protein acetylation(GO:0034421) |
| 0.4 |
1.1 |
GO:0060244 |
negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 0.4 |
0.4 |
GO:0003134 |
BMP signaling pathway involved in heart induction(GO:0003130) endodermal-mesodermal cell signaling(GO:0003133) endodermal-mesodermal cell signaling involved in heart induction(GO:0003134) |
| 0.4 |
1.8 |
GO:0042780 |
tRNA 3'-end processing(GO:0042780) |
| 0.4 |
1.4 |
GO:2000795 |
negative regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000795) |
| 0.4 |
1.4 |
GO:1904565 |
response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 0.3 |
0.7 |
GO:1902071 |
regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
| 0.3 |
0.3 |
GO:0038163 |
thrombopoietin-mediated signaling pathway(GO:0038163) |
| 0.3 |
1.0 |
GO:0034287 |
detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
| 0.3 |
1.0 |
GO:0070634 |
transepithelial ammonium transport(GO:0070634) |
| 0.3 |
1.7 |
GO:0021856 |
cerebral cortex tangential migration using cell-axon interactions(GO:0021824) gonadotrophin-releasing hormone neuronal migration to the hypothalamus(GO:0021828) hypothalamic tangential migration using cell-axon interactions(GO:0021856) facioacoustic ganglion development(GO:1903375) |
| 0.3 |
1.0 |
GO:0045113 |
regulation of integrin biosynthetic process(GO:0045113) |
| 0.3 |
1.0 |
GO:0097350 |
neutrophil clearance(GO:0097350) |
| 0.3 |
1.0 |
GO:0045819 |
plasmacytoid dendritic cell activation(GO:0002270) positive regulation of glycogen catabolic process(GO:0045819) |
| 0.3 |
1.3 |
GO:1901894 |
regulation of calcium-transporting ATPase activity(GO:1901894) |
| 0.3 |
0.6 |
GO:0033083 |
immature T cell proliferation(GO:0033079) regulation of immature T cell proliferation(GO:0033083) |
| 0.3 |
1.3 |
GO:0046655 |
folic acid metabolic process(GO:0046655) |
| 0.3 |
1.2 |
GO:0003342 |
proepicardium development(GO:0003342) septum transversum development(GO:0003343) |
| 0.3 |
1.5 |
GO:0070494 |
regulation of thrombin receptor signaling pathway(GO:0070494) negative regulation of thrombin receptor signaling pathway(GO:0070495) |
| 0.3 |
1.2 |
GO:0071475 |
cellular hyperosmotic salinity response(GO:0071475) |
| 0.3 |
1.7 |
GO:1900747 |
negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
| 0.3 |
0.9 |
GO:0045004 |
DNA replication proofreading(GO:0045004) |
| 0.3 |
0.3 |
GO:2000504 |
positive regulation of blood vessel remodeling(GO:2000504) |
| 0.3 |
1.4 |
GO:1900170 |
negative regulation of glucocorticoid mediated signaling pathway(GO:1900170) |
| 0.3 |
1.4 |
GO:0034441 |
plasma lipoprotein particle oxidation(GO:0034441) |
| 0.3 |
1.6 |
GO:0032196 |
regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) transposition(GO:0032196) |
| 0.3 |
3.0 |
GO:0015721 |
bile acid and bile salt transport(GO:0015721) |
| 0.3 |
0.8 |
GO:0060745 |
mammary gland branching involved in pregnancy(GO:0060745) |
| 0.3 |
0.5 |
GO:0006369 |
termination of RNA polymerase II transcription(GO:0006369) |
| 0.3 |
1.3 |
GO:0090427 |
activation of meiosis(GO:0090427) |
| 0.3 |
0.8 |
GO:1904170 |
regulation of bleb assembly(GO:1904170) |
| 0.3 |
0.3 |
GO:0009067 |
asparagine biosynthetic process(GO:0006529) aspartate family amino acid biosynthetic process(GO:0009067) |
| 0.2 |
0.7 |
GO:0006556 |
S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.2 |
1.5 |
GO:0007021 |
tubulin complex assembly(GO:0007021) |
| 0.2 |
0.7 |
GO:1903225 |
negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.2 |
2.7 |
GO:0006228 |
UTP biosynthetic process(GO:0006228) |
| 0.2 |
1.0 |
GO:0045578 |
negative regulation of B cell differentiation(GO:0045578) |
| 0.2 |
1.0 |
GO:0090324 |
negative regulation of oxidative phosphorylation(GO:0090324) |
| 0.2 |
0.2 |
GO:2000256 |
positive regulation of male germ cell proliferation(GO:2000256) |
| 0.2 |
0.5 |
GO:0001803 |
type III hypersensitivity(GO:0001802) regulation of type III hypersensitivity(GO:0001803) positive regulation of type III hypersensitivity(GO:0001805) |
| 0.2 |
0.2 |
GO:0061054 |
dermatome development(GO:0061054) regulation of dermatome development(GO:0061183) |
| 0.2 |
2.8 |
GO:0048664 |
neuron fate determination(GO:0048664) |
| 0.2 |
0.2 |
GO:0035989 |
tendon development(GO:0035989) |
| 0.2 |
3.2 |
GO:0006388 |
tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.2 |
1.4 |
GO:0031120 |
snRNA pseudouridine synthesis(GO:0031120) |
| 0.2 |
0.7 |
GO:0046133 |
pyrimidine ribonucleoside catabolic process(GO:0046133) |
| 0.2 |
0.9 |
GO:0070318 |
positive regulation of G0 to G1 transition(GO:0070318) |
| 0.2 |
0.7 |
GO:0031204 |
posttranslational protein targeting to membrane, translocation(GO:0031204) |
| 0.2 |
0.7 |
GO:1902524 |
positive regulation of protein K48-linked ubiquitination(GO:1902524) |
| 0.2 |
1.1 |
GO:0042538 |
hyperosmotic salinity response(GO:0042538) |
| 0.2 |
1.6 |
GO:0017196 |
N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.2 |
0.9 |
GO:2000525 |
regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.2 |
0.7 |
GO:2001187 |
positive regulation of CD8-positive, alpha-beta T cell activation(GO:2001187) |
| 0.2 |
0.2 |
GO:1901252 |
regulation of intracellular transport of viral material(GO:1901252) |
| 0.2 |
0.7 |
GO:2000314 |
negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
| 0.2 |
1.1 |
GO:1902623 |
negative regulation of neutrophil migration(GO:1902623) |
| 0.2 |
0.6 |
GO:0061744 |
motor behavior(GO:0061744) |
| 0.2 |
0.6 |
GO:0001193 |
maintenance of transcriptional fidelity during DNA-templated transcription elongation(GO:0001192) maintenance of transcriptional fidelity during DNA-templated transcription elongation from RNA polymerase II promoter(GO:0001193) |
| 0.2 |
0.6 |
GO:1905203 |
regulation of connective tissue replacement(GO:1905203) |
| 0.2 |
1.5 |
GO:0021847 |
ventricular zone neuroblast division(GO:0021847) |
| 0.2 |
0.2 |
GO:0010792 |
DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.2 |
0.4 |
GO:1902022 |
L-lysine transport(GO:1902022) |
| 0.2 |
0.8 |
GO:0046013 |
regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.2 |
0.4 |
GO:0048861 |
leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.2 |
0.8 |
GO:0070278 |
extracellular matrix constituent secretion(GO:0070278) |
| 0.2 |
0.6 |
GO:0046881 |
positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
| 0.2 |
0.6 |
GO:0006404 |
RNA import into nucleus(GO:0006404) |
| 0.2 |
1.0 |
GO:0036151 |
phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.2 |
0.8 |
GO:0045903 |
positive regulation of translational fidelity(GO:0045903) |
| 0.2 |
0.6 |
GO:0033088 |
negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 0.2 |
0.6 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.2 |
0.2 |
GO:0006287 |
base-excision repair, gap-filling(GO:0006287) |
| 0.2 |
0.2 |
GO:0072309 |
mesenchymal stem cell maintenance involved in metanephric nephron morphogenesis(GO:0072309) |
| 0.2 |
1.0 |
GO:0045039 |
protein import into mitochondrial inner membrane(GO:0045039) |
| 0.2 |
0.6 |
GO:0036500 |
ATF6-mediated unfolded protein response(GO:0036500) |
| 0.2 |
0.8 |
GO:0038145 |
macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.2 |
0.4 |
GO:0060242 |
contact inhibition(GO:0060242) |
| 0.2 |
0.6 |
GO:0090118 |
receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.2 |
1.1 |
GO:0048254 |
snoRNA localization(GO:0048254) |
| 0.2 |
1.1 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.2 |
1.8 |
GO:0032876 |
negative regulation of DNA endoreduplication(GO:0032876) |
| 0.2 |
0.7 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 0.2 |
0.4 |
GO:0014834 |
skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
| 0.2 |
0.5 |
GO:0014738 |
regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
| 0.2 |
0.2 |
GO:1902730 |
positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.2 |
0.5 |
GO:0072378 |
blood coagulation, fibrin clot formation(GO:0072378) |
| 0.2 |
0.5 |
GO:2000319 |
negative regulation of T-helper 17 type immune response(GO:2000317) regulation of T-helper 17 cell differentiation(GO:2000319) negative regulation of T-helper 17 cell differentiation(GO:2000320) |
| 0.2 |
0.2 |
GO:1900275 |
negative regulation of phospholipase C activity(GO:1900275) |
| 0.2 |
2.3 |
GO:0060134 |
prepulse inhibition(GO:0060134) |
| 0.2 |
0.5 |
GO:0006566 |
threonine metabolic process(GO:0006566) |
| 0.2 |
0.2 |
GO:0018158 |
protein oxidation(GO:0018158) |
| 0.2 |
0.5 |
GO:0048014 |
Tie signaling pathway(GO:0048014) |
| 0.2 |
0.5 |
GO:0044208 |
'de novo' AMP biosynthetic process(GO:0044208) |
| 0.2 |
2.6 |
GO:0021684 |
cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.2 |
1.0 |
GO:1903056 |
positive regulation of lens fiber cell differentiation(GO:1902748) regulation of melanosome organization(GO:1903056) |
| 0.2 |
0.5 |
GO:0046469 |
platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.2 |
1.0 |
GO:1904491 |
protein localization to ciliary transition zone(GO:1904491) |
| 0.2 |
1.9 |
GO:0006120 |
mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.2 |
0.7 |
GO:0045409 |
negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
| 0.2 |
0.7 |
GO:0006933 |
negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.2 |
0.2 |
GO:0003195 |
tricuspid valve formation(GO:0003195) |
| 0.2 |
3.0 |
GO:0045653 |
negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.2 |
0.2 |
GO:0038044 |
transforming growth factor-beta secretion(GO:0038044) |
| 0.2 |
0.8 |
GO:0042891 |
antibiotic transport(GO:0042891) |
| 0.2 |
0.2 |
GO:1990705 |
cholangiocyte proliferation(GO:1990705) |
| 0.2 |
1.3 |
GO:0006390 |
transcription from mitochondrial promoter(GO:0006390) |
| 0.2 |
0.2 |
GO:0042160 |
lipoprotein modification(GO:0042160) lipoprotein oxidation(GO:0042161) |
| 0.2 |
1.1 |
GO:0001867 |
complement activation, lectin pathway(GO:0001867) |
| 0.2 |
0.7 |
GO:1990481 |
mRNA pseudouridine synthesis(GO:1990481) |
| 0.2 |
0.5 |
GO:0006285 |
base-excision repair, AP site formation(GO:0006285) |
| 0.2 |
0.2 |
GO:0007161 |
calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.2 |
0.3 |
GO:1900377 |
negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 0.2 |
0.8 |
GO:0014062 |
regulation of serotonin secretion(GO:0014062) |
| 0.2 |
0.5 |
GO:0032765 |
positive regulation of mast cell cytokine production(GO:0032765) |
| 0.2 |
1.1 |
GO:0015862 |
uridine transport(GO:0015862) |
| 0.2 |
0.9 |
GO:0003350 |
pulmonary myocardium development(GO:0003350) |
| 0.2 |
1.1 |
GO:0042976 |
activation of Janus kinase activity(GO:0042976) |
| 0.2 |
0.2 |
GO:0002925 |
positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 0.2 |
0.3 |
GO:0034137 |
positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
| 0.2 |
0.3 |
GO:0060392 |
negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.2 |
0.9 |
GO:0036337 |
Fas signaling pathway(GO:0036337) |
| 0.1 |
0.4 |
GO:1990046 |
positive regulation of mitochondrial DNA replication(GO:0090297) regulation of cardiolipin metabolic process(GO:1900208) positive regulation of cardiolipin metabolic process(GO:1900210) stress-induced mitochondrial fusion(GO:1990046) |
| 0.1 |
0.4 |
GO:0016998 |
cell wall macromolecule catabolic process(GO:0016998) |
| 0.1 |
0.4 |
GO:2001160 |
regulation of histone H3-K79 methylation(GO:2001160) |
| 0.1 |
0.4 |
GO:0046689 |
response to mercury ion(GO:0046689) |
| 0.1 |
0.4 |
GO:0014877 |
response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 0.1 |
0.1 |
GO:0019262 |
N-acetylneuraminate catabolic process(GO:0019262) |
| 0.1 |
1.5 |
GO:0016127 |
cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.1 |
0.4 |
GO:1903977 |
positive regulation of Schwann cell migration(GO:1900149) positive regulation of glial cell migration(GO:1903977) |
| 0.1 |
0.6 |
GO:2000158 |
positive regulation of ubiquitin-specific protease activity(GO:2000158) |
| 0.1 |
0.4 |
GO:0050904 |
diapedesis(GO:0050904) |
| 0.1 |
0.3 |
GO:0006272 |
leading strand elongation(GO:0006272) |
| 0.1 |
2.1 |
GO:1900746 |
regulation of vascular endothelial growth factor signaling pathway(GO:1900746) |
| 0.1 |
0.1 |
GO:0097374 |
sensory neuron axon guidance(GO:0097374) |
| 0.1 |
0.9 |
GO:1990564 |
protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.1 |
1.0 |
GO:0097428 |
protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.1 |
0.1 |
GO:0000720 |
pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.1 |
0.9 |
GO:0036438 |
maintenance of lens transparency(GO:0036438) |
| 0.1 |
0.6 |
GO:0035582 |
sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.1 |
0.3 |
GO:0002423 |
natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002420) natural killer cell mediated immune response to tumor cell(GO:0002423) regulation of natural killer cell mediated immune response to tumor cell(GO:0002855) regulation of natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002858) |
| 0.1 |
1.0 |
GO:0042756 |
drinking behavior(GO:0042756) |
| 0.1 |
0.1 |
GO:1904833 |
positive regulation of superoxide dismutase activity(GO:1901671) positive regulation of removal of superoxide radicals(GO:1904833) |
| 0.1 |
0.4 |
GO:2000659 |
regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
| 0.1 |
1.0 |
GO:0016584 |
nucleosome positioning(GO:0016584) |
| 0.1 |
0.8 |
GO:1903275 |
positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
| 0.1 |
0.7 |
GO:0050861 |
positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.1 |
0.6 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.1 |
0.1 |
GO:0031990 |
mRNA export from nucleus in response to heat stress(GO:0031990) |
| 0.1 |
0.1 |
GO:0006924 |
activation-induced cell death of T cells(GO:0006924) |
| 0.1 |
1.0 |
GO:0047484 |
regulation of response to osmotic stress(GO:0047484) |
| 0.1 |
0.4 |
GO:0046356 |
acetyl-CoA catabolic process(GO:0046356) |
| 0.1 |
0.4 |
GO:1904395 |
positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
| 0.1 |
0.6 |
GO:0006616 |
SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.1 |
0.3 |
GO:0046122 |
purine deoxyribonucleoside metabolic process(GO:0046122) |
| 0.1 |
0.1 |
GO:0033087 |
negative regulation of immature T cell proliferation(GO:0033087) |
| 0.1 |
0.1 |
GO:0045349 |
interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) |
| 0.1 |
0.6 |
GO:0042138 |
meiotic DNA double-strand break formation(GO:0042138) |
| 0.1 |
1.0 |
GO:0060164 |
regulation of timing of neuron differentiation(GO:0060164) |
| 0.1 |
0.1 |
GO:0060667 |
fibroblast growth factor receptor signaling pathway involved in mammary gland specification(GO:0060595) mammary gland bud formation(GO:0060615) branch elongation involved in salivary gland morphogenesis(GO:0060667) mesenchymal cell differentiation involved in lung development(GO:0060915) |
| 0.1 |
0.3 |
GO:1904659 |
glucose transmembrane transport(GO:1904659) |
| 0.1 |
0.1 |
GO:1903463 |
regulation of mitotic cell cycle DNA replication(GO:1903463) |
| 0.1 |
0.3 |
GO:0060648 |
mammary gland bud morphogenesis(GO:0060648) |
| 0.1 |
0.3 |
GO:0050975 |
sensory perception of touch(GO:0050975) |
| 0.1 |
0.1 |
GO:2000426 |
negative regulation of apoptotic cell clearance(GO:2000426) |
| 0.1 |
0.1 |
GO:0002585 |
regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002580) positive regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002582) regulation of antigen processing and presentation of peptide antigen(GO:0002583) positive regulation of antigen processing and presentation of peptide antigen(GO:0002585) regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002586) positive regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002588) |
| 0.1 |
0.1 |
GO:0050855 |
regulation of B cell receptor signaling pathway(GO:0050855) negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.1 |
5.6 |
GO:0097031 |
NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.1 |
0.9 |
GO:0035948 |
positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) |
| 0.1 |
0.9 |
GO:0007418 |
ventral midline development(GO:0007418) |
| 0.1 |
0.4 |
GO:0070973 |
protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.1 |
2.1 |
GO:2000096 |
positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
| 0.1 |
0.4 |
GO:0035694 |
mitochondrial protein catabolic process(GO:0035694) |
| 0.1 |
0.4 |
GO:0042776 |
mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.1 |
0.5 |
GO:0010273 |
detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.1 |
0.1 |
GO:0072173 |
metanephric tubule morphogenesis(GO:0072173) |
| 0.1 |
0.8 |
GO:0002553 |
histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.1 |
0.3 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.1 |
1.2 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.1 |
0.5 |
GO:0070305 |
response to cGMP(GO:0070305) cellular response to cGMP(GO:0071321) |
| 0.1 |
0.4 |
GO:0006269 |
DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.1 |
1.7 |
GO:0000463 |
maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.1 |
0.3 |
GO:2000790 |
regulation of mesenchymal cell proliferation involved in lung development(GO:2000790) negative regulation of mesenchymal cell proliferation involved in lung development(GO:2000791) |
| 0.1 |
2.2 |
GO:0038063 |
collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.1 |
0.3 |
GO:0030240 |
skeletal muscle thin filament assembly(GO:0030240) |
| 0.1 |
0.5 |
GO:0060155 |
platelet dense granule organization(GO:0060155) |
| 0.1 |
0.3 |
GO:0021913 |
regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
| 0.1 |
0.8 |
GO:1901979 |
regulation of inward rectifier potassium channel activity(GO:1901979) |
| 0.1 |
0.5 |
GO:2000258 |
negative regulation of complement activation(GO:0045916) negative regulation of protein activation cascade(GO:2000258) |
| 0.1 |
0.4 |
GO:1905065 |
positive regulation of vascular smooth muscle cell differentiation(GO:1905065) |
| 0.1 |
0.1 |
GO:0061370 |
testosterone biosynthetic process(GO:0061370) |
| 0.1 |
0.5 |
GO:2000911 |
positive regulation of cholesterol import(GO:1904109) positive regulation of sterol import(GO:2000911) |
| 0.1 |
0.6 |
GO:0052428 |
modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.1 |
0.5 |
GO:0021861 |
forebrain radial glial cell differentiation(GO:0021861) |
| 0.1 |
0.5 |
GO:0075136 |
response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
| 0.1 |
0.9 |
GO:0030382 |
sperm mitochondrion organization(GO:0030382) |
| 0.1 |
0.2 |
GO:0097527 |
necroptotic signaling pathway(GO:0097527) |
| 0.1 |
0.5 |
GO:0051933 |
amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
| 0.1 |
0.7 |
GO:0097473 |
cellular response to light intensity(GO:0071484) cellular response to high light intensity(GO:0071486) retinal rod cell apoptotic process(GO:0097473) |
| 0.1 |
0.6 |
GO:0046208 |
spermine catabolic process(GO:0046208) |
| 0.1 |
0.1 |
GO:0070460 |
thyroid-stimulating hormone secretion(GO:0070460) |
| 0.1 |
0.6 |
GO:0080184 |
response to stilbenoid(GO:0035634) response to phenylpropanoid(GO:0080184) |
| 0.1 |
0.4 |
GO:0046900 |
tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.1 |
0.8 |
GO:0006627 |
protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.1 |
0.4 |
GO:0032701 |
negative regulation of interleukin-18 production(GO:0032701) |
| 0.1 |
0.6 |
GO:0060762 |
regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
| 0.1 |
0.1 |
GO:0051386 |
regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
| 0.1 |
0.7 |
GO:0051987 |
positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
| 0.1 |
0.2 |
GO:1903895 |
negative regulation of IRE1-mediated unfolded protein response(GO:1903895) |
| 0.1 |
0.8 |
GO:1903608 |
protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.1 |
0.2 |
GO:0060842 |
arterial endothelial cell differentiation(GO:0060842) |
| 0.1 |
0.6 |
GO:2001032 |
regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.1 |
0.5 |
GO:0000237 |
leptotene(GO:0000237) |
| 0.1 |
0.4 |
GO:0045213 |
neurotransmitter receptor metabolic process(GO:0045213) |
| 0.1 |
0.6 |
GO:0044314 |
protein K27-linked ubiquitination(GO:0044314) |
| 0.1 |
1.2 |
GO:0019934 |
cGMP-mediated signaling(GO:0019934) |
| 0.1 |
0.5 |
GO:0019323 |
pentose catabolic process(GO:0019323) |
| 0.1 |
0.7 |
GO:0034080 |
CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.1 |
0.8 |
GO:0051660 |
establishment of centrosome localization(GO:0051660) |
| 0.1 |
1.0 |
GO:1901386 |
negative regulation of voltage-gated calcium channel activity(GO:1901386) |
| 0.1 |
0.2 |
GO:0010693 |
negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.1 |
0.1 |
GO:1905075 |
occluding junction disassembly(GO:1905071) regulation of occluding junction disassembly(GO:1905073) positive regulation of occluding junction disassembly(GO:1905075) |
| 0.1 |
0.2 |
GO:0010643 |
cell communication by chemical coupling(GO:0010643) |
| 0.1 |
0.1 |
GO:0042421 |
norepinephrine biosynthetic process(GO:0042421) |
| 0.1 |
0.4 |
GO:0051541 |
elastin metabolic process(GO:0051541) |
| 0.1 |
0.1 |
GO:2000173 |
negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.1 |
0.1 |
GO:0002566 |
somatic diversification of immune receptors via somatic mutation(GO:0002566) somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.1 |
0.2 |
GO:0006348 |
chromatin silencing at telomere(GO:0006348) |
| 0.1 |
0.3 |
GO:0072139 |
glomerular parietal epithelial cell differentiation(GO:0072139) |
| 0.1 |
2.3 |
GO:0001913 |
T cell mediated cytotoxicity(GO:0001913) |
| 0.1 |
2.5 |
GO:0000028 |
ribosomal small subunit assembly(GO:0000028) |
| 0.1 |
0.2 |
GO:0046947 |
hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.1 |
0.4 |
GO:0002337 |
B-1a B cell differentiation(GO:0002337) |
| 0.1 |
0.3 |
GO:0060686 |
negative regulation of prostatic bud formation(GO:0060686) |
| 0.1 |
0.1 |
GO:0060681 |
branch elongation involved in ureteric bud branching(GO:0060681) |
| 0.1 |
0.2 |
GO:0051152 |
positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.1 |
0.9 |
GO:0034219 |
carbohydrate transmembrane transport(GO:0034219) |
| 0.1 |
0.5 |
GO:0002339 |
B cell selection(GO:0002339) |
| 0.1 |
0.8 |
GO:0006685 |
sphingomyelin catabolic process(GO:0006685) |
| 0.1 |
0.5 |
GO:1902774 |
late endosome to lysosome transport(GO:1902774) |
| 0.1 |
0.1 |
GO:0043457 |
regulation of cellular respiration(GO:0043457) |
| 0.1 |
0.9 |
GO:0038028 |
insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.1 |
1.1 |
GO:0072202 |
cell differentiation involved in metanephros development(GO:0072202) |
| 0.1 |
0.4 |
GO:0031442 |
positive regulation of mRNA 3'-end processing(GO:0031442) |
| 0.1 |
0.2 |
GO:0000966 |
RNA 5'-end processing(GO:0000966) |
| 0.1 |
0.3 |
GO:0007171 |
activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.1 |
0.3 |
GO:0032474 |
otolith morphogenesis(GO:0032474) |
| 0.1 |
0.3 |
GO:0006624 |
vacuolar protein processing(GO:0006624) |
| 0.1 |
0.2 |
GO:0001757 |
somite specification(GO:0001757) |
| 0.1 |
0.4 |
GO:0070837 |
dehydroascorbic acid transport(GO:0070837) |
| 0.1 |
1.1 |
GO:1901407 |
regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) |
| 0.1 |
0.8 |
GO:1901162 |
serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
| 0.1 |
0.1 |
GO:0021562 |
vestibulocochlear nerve development(GO:0021562) |
| 0.1 |
0.1 |
GO:0042270 |
protection from natural killer cell mediated cytotoxicity(GO:0042270) |
| 0.1 |
0.8 |
GO:1903874 |
ferrous iron transmembrane transport(GO:1903874) |
| 0.1 |
1.8 |
GO:0032967 |
positive regulation of collagen biosynthetic process(GO:0032967) |
| 0.1 |
0.2 |
GO:0051030 |
snRNA transport(GO:0051030) |
| 0.1 |
0.4 |
GO:0060272 |
embryonic skeletal joint morphogenesis(GO:0060272) |
| 0.1 |
0.2 |
GO:2000468 |
regulation of peroxidase activity(GO:2000468) |
| 0.1 |
1.9 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.1 |
0.4 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.1 |
0.3 |
GO:0070682 |
proteasome regulatory particle assembly(GO:0070682) |
| 0.1 |
0.2 |
GO:0071707 |
immunoglobulin heavy chain V-D-J recombination(GO:0071707) |
| 0.1 |
0.2 |
GO:0035947 |
regulation of gluconeogenesis by regulation of transcription from RNA polymerase II promoter(GO:0035947) |
| 0.1 |
0.4 |
GO:0006432 |
phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 |
0.2 |
GO:0003278 |
apoptotic process involved in heart morphogenesis(GO:0003278) |
| 0.1 |
0.5 |
GO:0045059 |
positive thymic T cell selection(GO:0045059) |
| 0.1 |
0.2 |
GO:0036292 |
DNA rewinding(GO:0036292) |
| 0.1 |
0.2 |
GO:0030210 |
heparin biosynthetic process(GO:0030210) |
| 0.1 |
0.1 |
GO:2000402 |
negative regulation of lymphocyte migration(GO:2000402) |
| 0.1 |
0.5 |
GO:0048478 |
replication fork protection(GO:0048478) |
| 0.1 |
0.4 |
GO:1902626 |
assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.1 |
0.1 |
GO:0009125 |
nucleoside monophosphate catabolic process(GO:0009125) |
| 0.1 |
0.8 |
GO:0006122 |
mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.1 |
1.0 |
GO:0001682 |
tRNA 5'-leader removal(GO:0001682) |
| 0.1 |
1.5 |
GO:0050901 |
leukocyte tethering or rolling(GO:0050901) |
| 0.1 |
0.4 |
GO:0007320 |
insemination(GO:0007320) |
| 0.1 |
0.2 |
GO:1903588 |
negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.1 |
0.4 |
GO:0070125 |
mitochondrial translational elongation(GO:0070125) |
| 0.1 |
0.1 |
GO:0051026 |
chiasma assembly(GO:0051026) |
| 0.1 |
0.1 |
GO:1904578 |
response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) |
| 0.1 |
0.5 |
GO:2000255 |
negative regulation of male germ cell proliferation(GO:2000255) |
| 0.1 |
0.5 |
GO:0060219 |
camera-type eye photoreceptor cell differentiation(GO:0060219) |
| 0.1 |
0.4 |
GO:0046909 |
intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.1 |
0.2 |
GO:0006167 |
AMP biosynthetic process(GO:0006167) |
| 0.1 |
0.5 |
GO:0050651 |
dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
| 0.1 |
0.3 |
GO:0048597 |
post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 0.1 |
0.8 |
GO:0070235 |
regulation of activation-induced cell death of T cells(GO:0070235) |
| 0.1 |
0.1 |
GO:0044253 |
positive regulation of collagen metabolic process(GO:0010714) positive regulation of multicellular organismal metabolic process(GO:0044253) |
| 0.1 |
0.5 |
GO:0010991 |
negative regulation of SMAD protein complex assembly(GO:0010991) |
| 0.1 |
0.2 |
GO:0002756 |
MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
| 0.1 |
0.6 |
GO:0042402 |
cellular biogenic amine catabolic process(GO:0042402) |
| 0.1 |
0.4 |
GO:0046294 |
formaldehyde catabolic process(GO:0046294) |
| 0.1 |
0.4 |
GO:0071051 |
polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
| 0.1 |
0.7 |
GO:0072529 |
pyrimidine-containing compound catabolic process(GO:0072529) |
| 0.1 |
0.1 |
GO:0072338 |
creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
| 0.1 |
0.6 |
GO:0006363 |
termination of RNA polymerase I transcription(GO:0006363) |
| 0.1 |
0.3 |
GO:0035754 |
B cell chemotaxis(GO:0035754) |
| 0.1 |
0.3 |
GO:0044028 |
DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
| 0.1 |
0.1 |
GO:0048859 |
formation of anatomical boundary(GO:0048859) |
| 0.1 |
0.4 |
GO:0019695 |
choline metabolic process(GO:0019695) |
| 0.1 |
0.4 |
GO:0015825 |
L-serine transport(GO:0015825) |
| 0.1 |
0.6 |
GO:0072081 |
proximal/distal pattern formation involved in nephron development(GO:0072047) specification of nephron tubule identity(GO:0072081) specification of loop of Henle identity(GO:0072086) |
| 0.1 |
0.6 |
GO:0032929 |
negative regulation of superoxide anion generation(GO:0032929) |
| 0.1 |
0.7 |
GO:2000288 |
positive regulation of myoblast proliferation(GO:2000288) |
| 0.1 |
0.7 |
GO:0006614 |
SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.1 |
0.4 |
GO:0090502 |
RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.1 |
0.9 |
GO:0070933 |
histone H4 deacetylation(GO:0070933) |
| 0.1 |
0.3 |
GO:0002901 |
mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 0.1 |
0.6 |
GO:0035735 |
intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.1 |
0.3 |
GO:0042126 |
nitrate metabolic process(GO:0042126) |
| 0.1 |
0.3 |
GO:0045627 |
positive regulation of T-helper 1 cell differentiation(GO:0045627) |
| 0.1 |
0.1 |
GO:1904431 |
positive regulation of t-circle formation(GO:1904431) |
| 0.1 |
0.7 |
GO:0000395 |
mRNA 5'-splice site recognition(GO:0000395) |
| 0.1 |
1.4 |
GO:0042347 |
negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.1 |
0.4 |
GO:0030091 |
protein repair(GO:0030091) |
| 0.1 |
0.1 |
GO:0035359 |
negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 0.1 |
0.4 |
GO:0060018 |
astrocyte fate commitment(GO:0060018) |
| 0.1 |
0.2 |
GO:0035330 |
regulation of hippo signaling(GO:0035330) |
| 0.1 |
0.2 |
GO:0030718 |
germ-line stem cell population maintenance(GO:0030718) |
| 0.1 |
0.2 |
GO:1903054 |
negative regulation of extracellular matrix organization(GO:1903054) |
| 0.1 |
0.5 |
GO:0070493 |
thrombin receptor signaling pathway(GO:0070493) |
| 0.1 |
1.5 |
GO:0021796 |
cerebral cortex regionalization(GO:0021796) |
| 0.1 |
0.2 |
GO:1900041 |
negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.1 |
1.5 |
GO:0015701 |
bicarbonate transport(GO:0015701) |
| 0.1 |
0.5 |
GO:0072602 |
interleukin-4 secretion(GO:0072602) |
| 0.1 |
0.4 |
GO:0032788 |
saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
| 0.1 |
0.2 |
GO:0060126 |
somatotropin secreting cell differentiation(GO:0060126) |
| 0.1 |
0.6 |
GO:0015670 |
carbon dioxide transport(GO:0015670) |
| 0.1 |
0.3 |
GO:0048687 |
positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) |
| 0.1 |
0.7 |
GO:0018344 |
protein geranylgeranylation(GO:0018344) |
| 0.1 |
0.2 |
GO:1904238 |
pericyte cell differentiation(GO:1904238) |
| 0.1 |
0.6 |
GO:0043922 |
negative regulation by host of viral transcription(GO:0043922) |
| 0.1 |
0.4 |
GO:0042255 |
ribosome assembly(GO:0042255) |
| 0.1 |
0.4 |
GO:0033499 |
galactose catabolic process via UDP-galactose(GO:0033499) |
| 0.1 |
2.5 |
GO:0002474 |
antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 0.1 |
0.5 |
GO:1904177 |
regulation of adipose tissue development(GO:1904177) |
| 0.1 |
0.4 |
GO:0021914 |
negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 0.1 |
0.3 |
GO:1901526 |
positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
| 0.1 |
0.3 |
GO:0035864 |
response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
| 0.1 |
0.3 |
GO:0006435 |
threonyl-tRNA aminoacylation(GO:0006435) |
| 0.1 |
0.5 |
GO:0043586 |
tongue development(GO:0043586) |
| 0.1 |
0.3 |
GO:0043654 |
recognition of apoptotic cell(GO:0043654) |
| 0.1 |
0.3 |
GO:1901678 |
iron coordination entity transport(GO:1901678) |
| 0.1 |
0.3 |
GO:0051096 |
regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
| 0.1 |
0.3 |
GO:0051562 |
negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.1 |
0.3 |
GO:2000774 |
positive regulation of cellular senescence(GO:2000774) |
| 0.1 |
0.3 |
GO:0006578 |
amino-acid betaine biosynthetic process(GO:0006578) |
| 0.1 |
0.3 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.1 |
0.4 |
GO:0000492 |
box C/D snoRNP assembly(GO:0000492) |
| 0.1 |
0.9 |
GO:0045899 |
positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.1 |
0.3 |
GO:1900150 |
regulation of defense response to fungus(GO:1900150) |
| 0.1 |
0.4 |
GO:0070171 |
negative regulation of tooth mineralization(GO:0070171) |
| 0.1 |
0.3 |
GO:0043144 |
snoRNA processing(GO:0043144) |
| 0.1 |
0.1 |
GO:0070234 |
positive regulation of T cell apoptotic process(GO:0070234) |
| 0.1 |
0.1 |
GO:0006998 |
nuclear envelope organization(GO:0006998) |
| 0.1 |
1.3 |
GO:1900153 |
regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.1 |
0.2 |
GO:2001245 |
regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 0.1 |
0.6 |
GO:0046549 |
retinal cone cell development(GO:0046549) |
| 0.1 |
0.2 |
GO:1903847 |
regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
| 0.1 |
0.2 |
GO:0032497 |
detection of lipopolysaccharide(GO:0032497) |
| 0.1 |
0.2 |
GO:0050667 |
homocysteine metabolic process(GO:0050667) |
| 0.1 |
0.4 |
GO:0050747 |
positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.1 |
0.2 |
GO:0042256 |
mature ribosome assembly(GO:0042256) |
| 0.1 |
0.3 |
GO:0042535 |
positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
| 0.1 |
0.2 |
GO:0006710 |
androgen catabolic process(GO:0006710) |
| 0.1 |
0.2 |
GO:2000675 |
negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 0.1 |
0.4 |
GO:1902177 |
positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
| 0.1 |
0.4 |
GO:0035036 |
binding of sperm to zona pellucida(GO:0007339) sperm-egg recognition(GO:0035036) |
| 0.1 |
0.2 |
GO:0010730 |
negative regulation of hydrogen peroxide metabolic process(GO:0010727) negative regulation of hydrogen peroxide biosynthetic process(GO:0010730) |
| 0.1 |
1.2 |
GO:0042759 |
long-chain fatty acid biosynthetic process(GO:0042759) |
| 0.1 |
0.2 |
GO:0060558 |
regulation of calcidiol 1-monooxygenase activity(GO:0060558) |
| 0.1 |
0.5 |
GO:0090070 |
positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.1 |
0.6 |
GO:0002920 |
regulation of humoral immune response(GO:0002920) |
| 0.1 |
0.2 |
GO:0010911 |
regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
| 0.1 |
0.2 |
GO:1904139 |
microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) |
| 0.1 |
0.2 |
GO:0006011 |
UDP-glucose metabolic process(GO:0006011) |
| 0.1 |
0.2 |
GO:0045793 |
positive regulation of cell size(GO:0045793) |
| 0.1 |
0.2 |
GO:0031590 |
wybutosine metabolic process(GO:0031590) wybutosine biosynthetic process(GO:0031591) |
| 0.1 |
0.3 |
GO:0006975 |
DNA damage induced protein phosphorylation(GO:0006975) |
| 0.1 |
0.1 |
GO:0060124 |
positive regulation of growth hormone secretion(GO:0060124) |
| 0.1 |
0.9 |
GO:0031272 |
regulation of pseudopodium assembly(GO:0031272) |
| 0.1 |
0.4 |
GO:1902583 |
viral mRNA export from host cell nucleus(GO:0046784) intracellular transport of virus(GO:0075733) multi-organism intracellular transport(GO:1902583) |
| 0.1 |
0.3 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 |
0.3 |
GO:0045607 |
regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.1 |
0.9 |
GO:0034244 |
negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.1 |
0.2 |
GO:0003376 |
sphingosine-1-phosphate signaling pathway(GO:0003376) sphingolipid mediated signaling pathway(GO:0090520) |
| 0.1 |
2.8 |
GO:0032728 |
positive regulation of interferon-beta production(GO:0032728) |
| 0.1 |
0.2 |
GO:1904059 |
regulation of locomotor rhythm(GO:1904059) |
| 0.1 |
0.1 |
GO:0071677 |
positive regulation of mononuclear cell migration(GO:0071677) |
| 0.1 |
0.1 |
GO:0019805 |
quinolinate biosynthetic process(GO:0019805) quinolinate metabolic process(GO:0046874) |
| 0.1 |
0.8 |
GO:0071578 |
zinc II ion transmembrane import(GO:0071578) |
| 0.1 |
0.8 |
GO:0036159 |
inner dynein arm assembly(GO:0036159) |
| 0.1 |
0.9 |
GO:0072189 |
ureter development(GO:0072189) |
| 0.1 |
0.5 |
GO:0001980 |
regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
| 0.1 |
0.2 |
GO:0060019 |
radial glial cell differentiation(GO:0060019) |
| 0.1 |
0.1 |
GO:0043985 |
histone H4-R3 methylation(GO:0043985) |
| 0.1 |
0.7 |
GO:0097341 |
inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) |
| 0.1 |
0.1 |
GO:0001676 |
long-chain fatty acid metabolic process(GO:0001676) |
| 0.1 |
0.3 |
GO:0071985 |
multivesicular body sorting pathway(GO:0071985) |
| 0.1 |
0.6 |
GO:0043029 |
T cell homeostasis(GO:0043029) |
| 0.1 |
0.2 |
GO:0030827 |
negative regulation of cGMP metabolic process(GO:0030824) negative regulation of cGMP biosynthetic process(GO:0030827) negative regulation of guanylate cyclase activity(GO:0031283) |
| 0.1 |
0.1 |
GO:0036112 |
medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.1 |
0.1 |
GO:0006014 |
D-ribose metabolic process(GO:0006014) |
| 0.1 |
0.8 |
GO:0035520 |
monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.1 |
0.4 |
GO:0097368 |
establishment of Sertoli cell barrier(GO:0097368) |
| 0.1 |
1.8 |
GO:0000027 |
ribosomal large subunit assembly(GO:0000027) |
| 0.1 |
0.1 |
GO:0046051 |
UTP metabolic process(GO:0046051) |
| 0.1 |
3.3 |
GO:0042274 |
ribosomal small subunit biogenesis(GO:0042274) |
| 0.1 |
0.4 |
GO:0046477 |
glycosylceramide catabolic process(GO:0046477) |
| 0.1 |
0.8 |
GO:0009404 |
toxin metabolic process(GO:0009404) |
| 0.1 |
0.1 |
GO:0006059 |
hexitol metabolic process(GO:0006059) |
| 0.1 |
0.1 |
GO:0060414 |
aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.1 |
0.2 |
GO:0061101 |
neuroendocrine cell differentiation(GO:0061101) |
| 0.1 |
0.2 |
GO:0051365 |
cellular response to potassium ion starvation(GO:0051365) |
| 0.1 |
0.2 |
GO:1903750 |
regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
| 0.1 |
0.6 |
GO:0051561 |
positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
| 0.1 |
0.9 |
GO:0044550 |
secondary metabolite biosynthetic process(GO:0044550) |
| 0.1 |
1.4 |
GO:0006044 |
N-acetylglucosamine metabolic process(GO:0006044) |
| 0.1 |
0.4 |
GO:2000301 |
negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.1 |
0.3 |
GO:0030644 |
cellular chloride ion homeostasis(GO:0030644) |
| 0.1 |
1.0 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 0.1 |
0.2 |
GO:0060447 |
bud outgrowth involved in lung branching(GO:0060447) |
| 0.1 |
0.6 |
GO:0035881 |
amacrine cell differentiation(GO:0035881) |
| 0.1 |
0.1 |
GO:0060334 |
regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
| 0.1 |
0.4 |
GO:0034551 |
respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.1 |
0.6 |
GO:0001886 |
endothelial cell morphogenesis(GO:0001886) |
| 0.1 |
0.1 |
GO:0071921 |
establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.1 |
0.3 |
GO:0015889 |
cobalamin transport(GO:0015889) |
| 0.1 |
0.3 |
GO:0031293 |
membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.1 |
0.6 |
GO:1904667 |
negative regulation of ubiquitin protein ligase activity(GO:1904667) |
| 0.1 |
0.1 |
GO:0060594 |
mammary gland specification(GO:0060594) |
| 0.1 |
0.3 |
GO:0032804 |
negative regulation of low-density lipoprotein particle receptor catabolic process(GO:0032804) dibasic protein processing(GO:0090472) |
| 0.1 |
0.2 |
GO:0048633 |
positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.1 |
0.7 |
GO:0001731 |
formation of translation preinitiation complex(GO:0001731) |
| 0.1 |
0.1 |
GO:0060849 |
regulation of transcription involved in lymphatic endothelial cell fate commitment(GO:0060849) |
| 0.1 |
0.1 |
GO:2000049 |
positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 0.1 |
0.1 |
GO:0043117 |
positive regulation of vascular permeability(GO:0043117) |
| 0.1 |
0.5 |
GO:0036123 |
histone H3-K9 dimethylation(GO:0036123) |
| 0.1 |
0.3 |
GO:0033004 |
negative regulation of mast cell activation(GO:0033004) |
| 0.1 |
0.1 |
GO:0009814 |
defense response, incompatible interaction(GO:0009814) |
| 0.1 |
0.4 |
GO:0032000 |
positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.1 |
0.4 |
GO:0043568 |
positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.1 |
0.2 |
GO:0050909 |
sensory perception of taste(GO:0050909) |
| 0.1 |
0.2 |
GO:0060662 |
tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
| 0.1 |
0.9 |
GO:2000353 |
positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.1 |
0.2 |
GO:0006597 |
spermine biosynthetic process(GO:0006597) |
| 0.1 |
0.3 |
GO:0010961 |
cellular magnesium ion homeostasis(GO:0010961) |
| 0.1 |
0.7 |
GO:0006534 |
cysteine metabolic process(GO:0006534) |
| 0.1 |
0.1 |
GO:1903207 |
neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
| 0.1 |
1.0 |
GO:0060707 |
trophoblast giant cell differentiation(GO:0060707) |
| 0.1 |
0.1 |
GO:0033522 |
histone H2A ubiquitination(GO:0033522) |
| 0.1 |
0.1 |
GO:0071600 |
otic vesicle morphogenesis(GO:0071600) |
| 0.1 |
0.1 |
GO:0055099 |
response to high density lipoprotein particle(GO:0055099) |
| 0.1 |
0.2 |
GO:0046462 |
monoacylglycerol metabolic process(GO:0046462) |
| 0.1 |
0.2 |
GO:0050957 |
equilibrioception(GO:0050957) |
| 0.1 |
0.2 |
GO:0002331 |
pre-B cell allelic exclusion(GO:0002331) |
| 0.1 |
0.6 |
GO:0030388 |
fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.1 |
0.2 |
GO:0009177 |
deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate metabolic process(GO:0009176) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
| 0.1 |
0.6 |
GO:0035269 |
protein O-linked mannosylation(GO:0035269) |
| 0.1 |
0.1 |
GO:0002827 |
positive regulation of T-helper 1 type immune response(GO:0002827) |
| 0.1 |
0.3 |
GO:0098700 |
neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.1 |
0.1 |
GO:0010700 |
negative regulation of norepinephrine secretion(GO:0010700) |
| 0.1 |
0.1 |
GO:0034145 |
positive regulation of toll-like receptor 4 signaling pathway(GO:0034145) |
| 0.1 |
0.1 |
GO:0070384 |
Harderian gland development(GO:0070384) |
| 0.1 |
0.3 |
GO:1901341 |
activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.1 |
1.2 |
GO:0060416 |
response to growth hormone(GO:0060416) |
| 0.1 |
0.3 |
GO:0008611 |
ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) ether biosynthetic process(GO:1901503) |
| 0.1 |
0.2 |
GO:0060075 |
regulation of resting membrane potential(GO:0060075) |
| 0.1 |
1.0 |
GO:0030903 |
notochord development(GO:0030903) |
| 0.1 |
0.1 |
GO:0090071 |
negative regulation of ribosome biogenesis(GO:0090071) |
| 0.1 |
0.4 |
GO:0031119 |
tRNA pseudouridine synthesis(GO:0031119) |
| 0.1 |
0.5 |
GO:0040034 |
regulation of development, heterochronic(GO:0040034) |
| 0.1 |
0.1 |
GO:0002678 |
positive regulation of chronic inflammatory response(GO:0002678) |
| 0.1 |
0.1 |
GO:0000957 |
mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.1 |
0.3 |
GO:0002317 |
plasma cell differentiation(GO:0002317) |
| 0.1 |
0.3 |
GO:0032695 |
negative regulation of interleukin-12 production(GO:0032695) |
| 0.1 |
3.7 |
GO:0045454 |
cell redox homeostasis(GO:0045454) |
| 0.1 |
0.4 |
GO:0097646 |
calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
| 0.1 |
0.4 |
GO:1901970 |
positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
| 0.1 |
0.2 |
GO:0090086 |
negative regulation of protein deubiquitination(GO:0090086) |
| 0.1 |
0.2 |
GO:0055091 |
phospholipid homeostasis(GO:0055091) |
| 0.1 |
0.6 |
GO:0033273 |
response to vitamin(GO:0033273) |
| 0.1 |
0.2 |
GO:0031086 |
nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.1 |
0.2 |
GO:1905247 |
positive regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902961) positive regulation of aspartic-type peptidase activity(GO:1905247) |
| 0.1 |
0.4 |
GO:0060753 |
regulation of mast cell chemotaxis(GO:0060753) |
| 0.1 |
0.3 |
GO:1900095 |
regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
| 0.1 |
2.8 |
GO:0032543 |
mitochondrial translation(GO:0032543) |
| 0.1 |
0.2 |
GO:0035523 |
protein K29-linked deubiquitination(GO:0035523) |
| 0.1 |
0.1 |
GO:0060252 |
positive regulation of glial cell proliferation(GO:0060252) |
| 0.1 |
0.1 |
GO:0051572 |
negative regulation of histone H3-K4 methylation(GO:0051572) |
| 0.1 |
3.3 |
GO:0002181 |
cytoplasmic translation(GO:0002181) |
| 0.1 |
0.1 |
GO:0046322 |
negative regulation of fatty acid oxidation(GO:0046322) |
| 0.1 |
0.1 |
GO:0035964 |
COPI-coated vesicle budding(GO:0035964) |
| 0.1 |
0.2 |
GO:0006655 |
phosphatidylglycerol biosynthetic process(GO:0006655) cardiolipin biosynthetic process(GO:0032049) |
| 0.1 |
0.1 |
GO:1902746 |
regulation of lens fiber cell differentiation(GO:1902746) |
| 0.1 |
0.3 |
GO:0031034 |
myosin filament assembly(GO:0031034) striated muscle myosin thick filament assembly(GO:0071688) |
| 0.1 |
1.6 |
GO:0000413 |
protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.1 |
0.2 |
GO:0048698 |
negative regulation of collateral sprouting in absence of injury(GO:0048698) |
| 0.1 |
0.2 |
GO:2000616 |
negative regulation of histone H3-K9 acetylation(GO:2000616) |
| 0.1 |
0.5 |
GO:0042167 |
porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.1 |
0.3 |
GO:1901563 |
response to camptothecin(GO:1901563) |
| 0.1 |
0.1 |
GO:0042938 |
dipeptide transport(GO:0042938) |
| 0.1 |
0.7 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.1 |
0.2 |
GO:2000279 |
negative regulation of DNA biosynthetic process(GO:2000279) |
| 0.1 |
0.3 |
GO:0015788 |
UDP-N-acetylglucosamine transport(GO:0015788) |
| 0.1 |
0.1 |
GO:0071211 |
protein targeting to vacuole involved in autophagy(GO:0071211) |
| 0.1 |
0.2 |
GO:0042104 |
positive regulation of activated T cell proliferation(GO:0042104) |
| 0.1 |
0.4 |
GO:0006729 |
tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.1 |
0.3 |
GO:2000271 |
positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.1 |
0.9 |
GO:0009081 |
branched-chain amino acid metabolic process(GO:0009081) branched-chain amino acid catabolic process(GO:0009083) |
| 0.1 |
0.2 |
GO:0034184 |
positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.1 |
0.3 |
GO:0000290 |
deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 |
0.2 |
GO:0090271 |
positive regulation of fibroblast growth factor production(GO:0090271) |
| 0.1 |
0.1 |
GO:0097500 |
receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.1 |
0.2 |
GO:0031860 |
telomeric 3' overhang formation(GO:0031860) |
| 0.1 |
1.2 |
GO:0030212 |
hyaluronan metabolic process(GO:0030212) |
| 0.1 |
1.3 |
GO:0042773 |
ATP synthesis coupled electron transport(GO:0042773) |
| 0.1 |
0.1 |
GO:0042117 |
monocyte activation(GO:0042117) |
| 0.1 |
0.4 |
GO:0033603 |
positive regulation of dopamine secretion(GO:0033603) |
| 0.1 |
0.1 |
GO:0035166 |
post-embryonic hemopoiesis(GO:0035166) |
| 0.1 |
0.1 |
GO:0031652 |
positive regulation of heat generation(GO:0031652) |
| 0.1 |
0.1 |
GO:0046544 |
development of secondary male sexual characteristics(GO:0046544) |
| 0.1 |
0.1 |
GO:0019405 |
alditol catabolic process(GO:0019405) |
| 0.1 |
0.1 |
GO:0010936 |
negative regulation of macrophage cytokine production(GO:0010936) |
| 0.1 |
0.2 |
GO:0060766 |
negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.1 |
0.2 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 0.1 |
0.4 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 |
0.3 |
GO:1900029 |
positive regulation of ruffle assembly(GO:1900029) |
| 0.1 |
0.2 |
GO:0006290 |
pyrimidine dimer repair(GO:0006290) |
| 0.1 |
0.3 |
GO:0007089 |
traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.1 |
0.1 |
GO:0043388 |
positive regulation of DNA binding(GO:0043388) |
| 0.1 |
0.4 |
GO:1902570 |
protein localization to nucleolus(GO:1902570) |
| 0.1 |
2.0 |
GO:0035456 |
response to interferon-beta(GO:0035456) |
| 0.1 |
0.3 |
GO:1990573 |
potassium ion import across plasma membrane(GO:1990573) |
| 0.1 |
0.2 |
GO:0090365 |
regulation of mRNA modification(GO:0090365) |
| 0.1 |
0.2 |
GO:0070525 |
tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
| 0.1 |
0.2 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 0.1 |
0.1 |
GO:1902188 |
positive regulation of viral release from host cell(GO:1902188) |
| 0.1 |
0.1 |
GO:1904959 |
regulation of electron carrier activity(GO:1904732) regulation of cytochrome-c oxidase activity(GO:1904959) |
| 0.1 |
0.1 |
GO:0003190 |
heart valve formation(GO:0003188) atrioventricular valve formation(GO:0003190) mitral valve formation(GO:0003192) |
| 0.1 |
0.5 |
GO:0042640 |
anagen(GO:0042640) |
| 0.1 |
0.8 |
GO:0006744 |
ubiquinone biosynthetic process(GO:0006744) |
| 0.1 |
0.4 |
GO:0034316 |
negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
| 0.1 |
0.4 |
GO:0045647 |
negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.1 |
0.2 |
GO:0046032 |
ADP catabolic process(GO:0046032) |
| 0.1 |
0.4 |
GO:0010032 |
meiotic chromosome condensation(GO:0010032) |
| 0.1 |
0.4 |
GO:0070816 |
phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.0 |
0.6 |
GO:0036065 |
fucosylation(GO:0036065) |
| 0.0 |
0.2 |
GO:0035752 |
lysosomal lumen pH elevation(GO:0035752) |
| 0.0 |
0.1 |
GO:0010757 |
negative regulation of plasminogen activation(GO:0010757) |
| 0.0 |
0.8 |
GO:1903204 |
negative regulation of oxidative stress-induced neuron death(GO:1903204) |
| 0.0 |
0.3 |
GO:0044375 |
regulation of peroxisome size(GO:0044375) |
| 0.0 |
0.0 |
GO:1903546 |
protein localization to photoreceptor outer segment(GO:1903546) |
| 0.0 |
0.0 |
GO:0009068 |
aspartate family amino acid catabolic process(GO:0009068) |
| 0.0 |
0.1 |
GO:0003433 |
chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.0 |
0.1 |
GO:0031657 |
regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031657) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031659) |
| 0.0 |
0.2 |
GO:0018206 |
peptidyl-methionine modification(GO:0018206) |
| 0.0 |
0.7 |
GO:0006958 |
complement activation, classical pathway(GO:0006958) |
| 0.0 |
0.2 |
GO:1904705 |
regulation of vascular smooth muscle cell proliferation(GO:1904705) vascular smooth muscle cell proliferation(GO:1990874) |
| 0.0 |
0.1 |
GO:0055118 |
negative regulation of cardiac muscle contraction(GO:0055118) |
| 0.0 |
0.4 |
GO:0042832 |
defense response to protozoan(GO:0042832) |
| 0.0 |
0.1 |
GO:0071918 |
urea transmembrane transport(GO:0071918) |
| 0.0 |
1.1 |
GO:0006298 |
mismatch repair(GO:0006298) |
| 0.0 |
0.1 |
GO:0060330 |
regulation of response to interferon-gamma(GO:0060330) |
| 0.0 |
0.4 |
GO:0046643 |
regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.0 |
0.2 |
GO:0061042 |
vascular wound healing(GO:0061042) |
| 0.0 |
0.1 |
GO:0043461 |
proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 0.0 |
0.2 |
GO:0010745 |
negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
| 0.0 |
0.0 |
GO:0002536 |
respiratory burst involved in inflammatory response(GO:0002536) |
| 0.0 |
0.0 |
GO:0046292 |
formaldehyde metabolic process(GO:0046292) |
| 0.0 |
0.1 |
GO:0010992 |
ubiquitin homeostasis(GO:0010992) |
| 0.0 |
0.2 |
GO:0019659 |
fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
| 0.0 |
0.1 |
GO:0001991 |
regulation of systemic arterial blood pressure by circulatory renin-angiotensin(GO:0001991) |
| 0.0 |
0.7 |
GO:0030150 |
protein import into mitochondrial matrix(GO:0030150) |
| 0.0 |
0.1 |
GO:0008272 |
sulfate transport(GO:0008272) |
| 0.0 |
0.1 |
GO:0006297 |
nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.0 |
0.5 |
GO:0019243 |
methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.0 |
0.3 |
GO:0007035 |
vacuolar acidification(GO:0007035) |
| 0.0 |
0.2 |
GO:2000794 |
regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000794) |
| 0.0 |
0.1 |
GO:0000469 |
cleavage involved in rRNA processing(GO:0000469) |
| 0.0 |
0.6 |
GO:0042541 |
hemoglobin biosynthetic process(GO:0042541) |
| 0.0 |
0.2 |
GO:0006953 |
acute-phase response(GO:0006953) |
| 0.0 |
0.8 |
GO:0051044 |
positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.0 |
0.3 |
GO:0006105 |
succinate metabolic process(GO:0006105) |
| 0.0 |
0.2 |
GO:0071480 |
cellular response to gamma radiation(GO:0071480) |
| 0.0 |
0.1 |
GO:1902965 |
regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 0.0 |
0.1 |
GO:2000674 |
regulation of type B pancreatic cell apoptotic process(GO:2000674) |
| 0.0 |
0.1 |
GO:0001659 |
temperature homeostasis(GO:0001659) |
| 0.0 |
0.8 |
GO:0010866 |
regulation of triglyceride biosynthetic process(GO:0010866) |
| 0.0 |
0.0 |
GO:0009595 |
detection of biotic stimulus(GO:0009595) detection of bacterium(GO:0016045) detection of other organism(GO:0098543) detection of external biotic stimulus(GO:0098581) |
| 0.0 |
0.3 |
GO:0000289 |
nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 0.0 |
0.8 |
GO:0007064 |
mitotic sister chromatid cohesion(GO:0007064) |
| 0.0 |
0.1 |
GO:0070200 |
establishment of protein localization to telomere(GO:0070200) |
| 0.0 |
0.2 |
GO:0071361 |
cellular response to ethanol(GO:0071361) |
| 0.0 |
0.2 |
GO:1904627 |
response to phorbol 13-acetate 12-myristate(GO:1904627) cellular response to phorbol 13-acetate 12-myristate(GO:1904628) |
| 0.0 |
0.4 |
GO:0045931 |
positive regulation of mitotic cell cycle(GO:0045931) |
| 0.0 |
0.2 |
GO:0071670 |
smooth muscle cell chemotaxis(GO:0071670) |
| 0.0 |
0.3 |
GO:0007221 |
positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.0 |
0.1 |
GO:0043415 |
positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.0 |
0.2 |
GO:0050812 |
regulation of acyl-CoA biosynthetic process(GO:0050812) |
| 0.0 |
0.1 |
GO:0035106 |
operant conditioning(GO:0035106) |
| 0.0 |
0.1 |
GO:1903976 |
negative regulation of glial cell migration(GO:1903976) |
| 0.0 |
0.1 |
GO:0042196 |
dichloromethane metabolic process(GO:0018900) chlorinated hydrocarbon metabolic process(GO:0042196) halogenated hydrocarbon metabolic process(GO:0042197) |
| 0.0 |
0.3 |
GO:0060973 |
cell migration involved in heart development(GO:0060973) |
| 0.0 |
0.0 |
GO:0019244 |
lactate biosynthetic process from pyruvate(GO:0019244) |
| 0.0 |
0.3 |
GO:0032516 |
positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
| 0.0 |
0.1 |
GO:1902741 |
type I interferon secretion(GO:0072641) interferon-alpha secretion(GO:0072642) regulation of interferon-alpha secretion(GO:1902739) positive regulation of interferon-alpha secretion(GO:1902741) |
| 0.0 |
0.2 |
GO:0046826 |
negative regulation of protein export from nucleus(GO:0046826) |
| 0.0 |
0.6 |
GO:0006152 |
purine nucleoside catabolic process(GO:0006152) ribonucleoside catabolic process(GO:0042454) purine ribonucleoside catabolic process(GO:0046130) |
| 0.0 |
0.1 |
GO:0030854 |
positive regulation of granulocyte differentiation(GO:0030854) |
| 0.0 |
0.1 |
GO:0075525 |
viral translational termination-reinitiation(GO:0075525) |
| 0.0 |
0.4 |
GO:0006465 |
signal peptide processing(GO:0006465) |
| 0.0 |
0.0 |
GO:0006703 |
estrogen biosynthetic process(GO:0006703) |
| 0.0 |
0.3 |
GO:0019433 |
triglyceride catabolic process(GO:0019433) |
| 0.0 |
0.1 |
GO:0048714 |
positive regulation of oligodendrocyte differentiation(GO:0048714) |
| 0.0 |
0.2 |
GO:0051004 |
regulation of lipoprotein lipase activity(GO:0051004) |
| 0.0 |
0.2 |
GO:0006177 |
GMP biosynthetic process(GO:0006177) |
| 0.0 |
0.1 |
GO:0086046 |
membrane depolarization during SA node cell action potential(GO:0086046) |
| 0.0 |
0.2 |
GO:0098706 |
iron ion transmembrane transport(GO:0034755) iron ion import into cell(GO:0097459) ferric iron import into cell(GO:0097461) ferric iron import across plasma membrane(GO:0098706) iron ion import across plasma membrane(GO:0098711) |
| 0.0 |
0.3 |
GO:0018026 |
peptidyl-lysine monomethylation(GO:0018026) |
| 0.0 |
0.0 |
GO:0060708 |
spongiotrophoblast differentiation(GO:0060708) |
| 0.0 |
0.1 |
GO:0035621 |
ER to Golgi ceramide transport(GO:0035621) ceramide transport(GO:0035627) |
| 0.0 |
0.3 |
GO:0032731 |
positive regulation of interleukin-1 beta production(GO:0032731) |
| 0.0 |
0.0 |
GO:0045617 |
negative regulation of keratinocyte differentiation(GO:0045617) |
| 0.0 |
0.3 |
GO:0042276 |
error-prone translesion synthesis(GO:0042276) |
| 0.0 |
1.1 |
GO:0007214 |
gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.0 |
0.0 |
GO:0032430 |
positive regulation of phospholipase A2 activity(GO:0032430) |
| 0.0 |
0.1 |
GO:0060572 |
morphogenesis of an epithelial bud(GO:0060572) |
| 0.0 |
0.2 |
GO:0003406 |
retinal pigment epithelium development(GO:0003406) |
| 0.0 |
0.1 |
GO:0035810 |
positive regulation of urine volume(GO:0035810) |
| 0.0 |
0.2 |
GO:0098535 |
de novo centriole assembly(GO:0098535) |
| 0.0 |
0.1 |
GO:1901072 |
chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) glucosamine-containing compound catabolic process(GO:1901072) |
| 0.0 |
0.1 |
GO:0051309 |
female meiosis chromosome separation(GO:0051309) |
| 0.0 |
0.2 |
GO:0002086 |
diaphragm contraction(GO:0002086) |
| 0.0 |
0.1 |
GO:0097435 |
fibril organization(GO:0097435) |
| 0.0 |
0.1 |
GO:0015712 |
hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.0 |
0.1 |
GO:0032914 |
positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.0 |
0.4 |
GO:0071456 |
cellular response to decreased oxygen levels(GO:0036294) cellular response to hypoxia(GO:0071456) |
| 0.0 |
0.6 |
GO:2000001 |
regulation of DNA damage checkpoint(GO:2000001) |
| 0.0 |
0.5 |
GO:0019835 |
cytolysis(GO:0019835) |
| 0.0 |
0.2 |
GO:0098914 |
membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
| 0.0 |
0.2 |
GO:0001937 |
negative regulation of endothelial cell proliferation(GO:0001937) |
| 0.0 |
0.1 |
GO:0000715 |
nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.0 |
0.1 |
GO:0002676 |
regulation of chronic inflammatory response(GO:0002676) |
| 0.0 |
0.4 |
GO:0006268 |
DNA unwinding involved in DNA replication(GO:0006268) |
| 0.0 |
0.5 |
GO:1900383 |
regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.0 |
0.1 |
GO:0045086 |
positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.0 |
0.0 |
GO:0016114 |
terpenoid biosynthetic process(GO:0016114) |
| 0.0 |
0.2 |
GO:0048853 |
forebrain morphogenesis(GO:0048853) |
| 0.0 |
0.5 |
GO:0042407 |
cristae formation(GO:0042407) |
| 0.0 |
0.0 |
GO:0090193 |
glomerular mesangium development(GO:0072109) regulation of glomerular mesangial cell proliferation(GO:0072124) positive regulation of glomerular mesangial cell proliferation(GO:0072126) regulation of glomerulus development(GO:0090192) positive regulation of glomerulus development(GO:0090193) |
| 0.0 |
0.1 |
GO:0043383 |
negative T cell selection(GO:0043383) negative thymic T cell selection(GO:0045060) |
| 0.0 |
0.2 |
GO:0032331 |
negative regulation of chondrocyte differentiation(GO:0032331) |
| 0.0 |
0.2 |
GO:0061343 |
cell adhesion involved in heart morphogenesis(GO:0061343) |
| 0.0 |
0.1 |
GO:0060231 |
mesenchymal to epithelial transition(GO:0060231) |
| 0.0 |
0.1 |
GO:0035726 |
common myeloid progenitor cell proliferation(GO:0035726) |
| 0.0 |
0.2 |
GO:0033580 |
protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
| 0.0 |
0.0 |
GO:1902953 |
positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
| 0.0 |
0.3 |
GO:0017144 |
drug metabolic process(GO:0017144) |
| 0.0 |
0.2 |
GO:0071044 |
histone mRNA catabolic process(GO:0071044) |
| 0.0 |
1.0 |
GO:0035019 |
somatic stem cell population maintenance(GO:0035019) |
| 0.0 |
0.2 |
GO:0005981 |
regulation of glycogen catabolic process(GO:0005981) |
| 0.0 |
0.2 |
GO:0007256 |
activation of JNKK activity(GO:0007256) |
| 0.0 |
0.2 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 0.0 |
0.2 |
GO:1904778 |
regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
| 0.0 |
0.1 |
GO:0045187 |
regulation of circadian sleep/wake cycle(GO:0042749) regulation of circadian sleep/wake cycle, sleep(GO:0045187) |
| 0.0 |
0.1 |
GO:0071163 |
DNA replication preinitiation complex assembly(GO:0071163) |
| 0.0 |
0.3 |
GO:0090557 |
establishment of endothelial intestinal barrier(GO:0090557) |
| 0.0 |
0.4 |
GO:0061014 |
positive regulation of mRNA catabolic process(GO:0061014) |
| 0.0 |
0.3 |
GO:0035814 |
negative regulation of renal sodium excretion(GO:0035814) |
| 0.0 |
0.1 |
GO:1904879 |
positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.0 |
0.3 |
GO:0035337 |
fatty-acyl-CoA metabolic process(GO:0035337) |
| 0.0 |
0.1 |
GO:0060159 |
regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.0 |
0.2 |
GO:2000194 |
regulation of female gonad development(GO:2000194) |
| 0.0 |
0.2 |
GO:0072383 |
plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.0 |
0.1 |
GO:0015791 |
polyol transport(GO:0015791) |
| 0.0 |
0.3 |
GO:0006271 |
DNA strand elongation involved in DNA replication(GO:0006271) |
| 0.0 |
0.1 |
GO:0035590 |
purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.0 |
0.0 |
GO:0003091 |
renal water homeostasis(GO:0003091) |
| 0.0 |
0.2 |
GO:2000483 |
negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.0 |
0.2 |
GO:0036297 |
interstrand cross-link repair(GO:0036297) |
| 0.0 |
0.4 |
GO:0042311 |
vasodilation(GO:0042311) |
| 0.0 |
0.2 |
GO:0030242 |
pexophagy(GO:0030242) |
| 0.0 |
0.1 |
GO:0014005 |
microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.0 |
0.6 |
GO:0030225 |
macrophage differentiation(GO:0030225) |
| 0.0 |
0.5 |
GO:0000038 |
very long-chain fatty acid metabolic process(GO:0000038) |
| 0.0 |
0.2 |
GO:0009235 |
cobalamin metabolic process(GO:0009235) |
| 0.0 |
0.1 |
GO:0006116 |
NADH oxidation(GO:0006116) |
| 0.0 |
0.1 |
GO:0022904 |
respiratory electron transport chain(GO:0022904) |
| 0.0 |
0.1 |
GO:0051316 |
attachment of spindle microtubules to kinetochore involved in meiotic chromosome segregation(GO:0051316) |
| 0.0 |
0.2 |
GO:0090234 |
regulation of kinetochore assembly(GO:0090234) |
| 0.0 |
0.2 |
GO:0016266 |
O-glycan processing(GO:0016266) |
| 0.0 |
0.3 |
GO:0051988 |
regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.0 |
0.1 |
GO:0043328 |
protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.0 |
0.0 |
GO:2000780 |
negative regulation of DNA repair(GO:0045738) negative regulation of double-strand break repair(GO:2000780) |
| 0.0 |
0.5 |
GO:0031365 |
N-terminal protein amino acid modification(GO:0031365) |
| 0.0 |
0.0 |
GO:1990379 |
lipid transport across blood brain barrier(GO:1990379) |
| 0.0 |
0.1 |
GO:0071481 |
cellular response to X-ray(GO:0071481) |
| 0.0 |
0.1 |
GO:0070343 |
white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
| 0.0 |
0.1 |
GO:0061302 |
smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.0 |
0.0 |
GO:0032621 |
interleukin-18 production(GO:0032621) |
| 0.0 |
0.1 |
GO:0048630 |
skeletal muscle tissue growth(GO:0048630) |
| 0.0 |
0.1 |
GO:0006419 |
alanyl-tRNA aminoacylation(GO:0006419) |
| 0.0 |
0.2 |
GO:0030431 |
sleep(GO:0030431) |
| 0.0 |
0.2 |
GO:2001204 |
regulation of osteoclast development(GO:2001204) |
| 0.0 |
0.4 |
GO:0032793 |
positive regulation of CREB transcription factor activity(GO:0032793) |
| 0.0 |
1.7 |
GO:0098773 |
skin epidermis development(GO:0098773) |
| 0.0 |
0.2 |
GO:0060394 |
negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 0.0 |
0.2 |
GO:0006983 |
ER overload response(GO:0006983) |
| 0.0 |
0.3 |
GO:0033574 |
response to testosterone(GO:0033574) |
| 0.0 |
0.1 |
GO:0090400 |
stress-induced premature senescence(GO:0090400) |
| 0.0 |
0.2 |
GO:0071428 |
rRNA-containing ribonucleoprotein complex export from nucleus(GO:0071428) |
| 0.0 |
0.4 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 0.0 |
1.0 |
GO:0031146 |
SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.0 |
0.1 |
GO:2000973 |
regulation of pro-B cell differentiation(GO:2000973) |
| 0.0 |
0.2 |
GO:0042573 |
retinoic acid metabolic process(GO:0042573) |
| 0.0 |
0.1 |
GO:1903774 |
positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.0 |
0.1 |
GO:0002347 |
response to tumor cell(GO:0002347) |
| 0.0 |
0.1 |
GO:0033129 |
positive regulation of histone phosphorylation(GO:0033129) |
| 0.0 |
0.3 |
GO:1903963 |
arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
| 0.0 |
0.2 |
GO:0021542 |
dentate gyrus development(GO:0021542) |
| 0.0 |
0.1 |
GO:0015744 |
succinate transport(GO:0015744) |
| 0.0 |
0.1 |
GO:1900121 |
negative regulation of receptor binding(GO:1900121) |
| 0.0 |
0.2 |
GO:2000210 |
positive regulation of anoikis(GO:2000210) |
| 0.0 |
0.3 |
GO:0050434 |
positive regulation of viral transcription(GO:0050434) |
| 0.0 |
0.1 |
GO:0019395 |
fatty acid oxidation(GO:0019395) lipid oxidation(GO:0034440) |
| 0.0 |
0.1 |
GO:0006026 |
aminoglycan catabolic process(GO:0006026) |
| 0.0 |
0.1 |
GO:0018401 |
peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.0 |
0.1 |
GO:0009208 |
pyrimidine ribonucleoside triphosphate metabolic process(GO:0009208) |
| 0.0 |
0.1 |
GO:0051964 |
negative regulation of synapse assembly(GO:0051964) |
| 0.0 |
0.1 |
GO:1990440 |
positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
| 0.0 |
0.5 |
GO:0044804 |
nucleophagy(GO:0044804) |
| 0.0 |
0.0 |
GO:0035455 |
response to interferon-alpha(GO:0035455) |
| 0.0 |
0.3 |
GO:0080009 |
mRNA methylation(GO:0080009) |
| 0.0 |
0.2 |
GO:0051045 |
negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
| 0.0 |
0.1 |
GO:0010566 |
regulation of ketone biosynthetic process(GO:0010566) |
| 0.0 |
0.1 |
GO:0060346 |
bone trabecula formation(GO:0060346) |
| 0.0 |
0.1 |
GO:0009597 |
detection of virus(GO:0009597) |
| 0.0 |
0.1 |
GO:0032757 |
positive regulation of interleukin-8 production(GO:0032757) |
| 0.0 |
0.1 |
GO:0016480 |
negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.0 |
0.1 |
GO:0072530 |
purine-containing compound transmembrane transport(GO:0072530) |
| 0.0 |
0.2 |
GO:0007342 |
fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.0 |
0.4 |
GO:0045737 |
positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
| 0.0 |
0.0 |
GO:0098528 |
skeletal muscle fiber differentiation(GO:0098528) |
| 0.0 |
0.2 |
GO:0006102 |
isocitrate metabolic process(GO:0006102) |
| 0.0 |
0.2 |
GO:0044241 |
lipid digestion(GO:0044241) |
| 0.0 |
0.0 |
GO:0002360 |
T cell lineage commitment(GO:0002360) |
| 0.0 |
0.0 |
GO:0071850 |
mitotic cell cycle arrest(GO:0071850) |
| 0.0 |
0.4 |
GO:0072528 |
pyrimidine-containing compound biosynthetic process(GO:0072528) |
| 0.0 |
0.2 |
GO:0034587 |
piRNA metabolic process(GO:0034587) |
| 0.0 |
0.1 |
GO:0051311 |
meiotic metaphase plate congression(GO:0051311) |
| 0.0 |
0.1 |
GO:0042730 |
fibrinolysis(GO:0042730) |
| 0.0 |
0.1 |
GO:0034308 |
primary alcohol metabolic process(GO:0034308) |
| 0.0 |
0.1 |
GO:0048304 |
positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.0 |
0.2 |
GO:0007042 |
lysosomal lumen acidification(GO:0007042) |
| 0.0 |
0.2 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 0.0 |
0.1 |
GO:1900262 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.0 |
0.1 |
GO:2000811 |
negative regulation of anoikis(GO:2000811) |
| 0.0 |
0.1 |
GO:0032570 |
response to progesterone(GO:0032570) |
| 0.0 |
0.0 |
GO:1990009 |
retinal cell apoptotic process(GO:1990009) |
| 0.0 |
0.1 |
GO:0006968 |
cellular defense response(GO:0006968) |
| 0.0 |
0.4 |
GO:0045116 |
protein neddylation(GO:0045116) |
| 0.0 |
0.3 |
GO:1901741 |
positive regulation of myoblast fusion(GO:1901741) |
| 0.0 |
0.2 |
GO:0032060 |
bleb assembly(GO:0032060) |
| 0.0 |
0.2 |
GO:0098964 |
dendritic transport of ribonucleoprotein complex(GO:0098961) dendritic transport of messenger ribonucleoprotein complex(GO:0098963) anterograde dendritic transport of messenger ribonucleoprotein complex(GO:0098964) |
| 0.0 |
0.1 |
GO:0044030 |
regulation of DNA methylation(GO:0044030) |
| 0.0 |
0.1 |
GO:0007066 |
female meiosis sister chromatid cohesion(GO:0007066) |
| 0.0 |
0.1 |
GO:0010968 |
regulation of microtubule nucleation(GO:0010968) |
| 0.0 |
0.7 |
GO:0032011 |
ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.0 |
0.5 |
GO:0010842 |
retina layer formation(GO:0010842) |
| 0.0 |
0.1 |
GO:0032096 |
negative regulation of response to food(GO:0032096) negative regulation of appetite(GO:0032099) |
| 0.0 |
0.1 |
GO:1900244 |
positive regulation of synaptic vesicle endocytosis(GO:1900244) |
| 0.0 |
0.2 |
GO:0042795 |
snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.0 |
0.1 |
GO:0046851 |
negative regulation of bone resorption(GO:0045779) negative regulation of bone remodeling(GO:0046851) |
| 0.0 |
0.1 |
GO:0007063 |
regulation of sister chromatid cohesion(GO:0007063) |
| 0.0 |
0.2 |
GO:0010955 |
negative regulation of protein processing(GO:0010955) negative regulation of protein maturation(GO:1903318) |
| 0.0 |
0.1 |
GO:0072092 |
ureteric bud invasion(GO:0072092) metanephric renal vesicle formation(GO:0072093) |
| 0.0 |
0.2 |
GO:0006362 |
transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.0 |
0.1 |
GO:1903902 |
positive regulation of viral life cycle(GO:1903902) |
| 0.0 |
0.2 |
GO:0031339 |
negative regulation of vesicle fusion(GO:0031339) |
| 0.0 |
0.1 |
GO:0021540 |
corpus callosum morphogenesis(GO:0021540) |
| 0.0 |
0.0 |
GO:0036388 |
pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 0.0 |
0.6 |
GO:0045670 |
regulation of osteoclast differentiation(GO:0045670) |
| 0.0 |
0.1 |
GO:0060055 |
angiogenesis involved in wound healing(GO:0060055) |
| 0.0 |
0.3 |
GO:0048642 |
negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.0 |
0.0 |
GO:0090037 |
positive regulation of protein kinase C signaling(GO:0090037) |
| 0.0 |
0.2 |
GO:1902170 |
cellular response to reactive nitrogen species(GO:1902170) |
| 0.0 |
0.3 |
GO:0007131 |
reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
| 0.0 |
0.1 |
GO:0032688 |
negative regulation of interferon-beta production(GO:0032688) |
| 0.0 |
0.1 |
GO:1903912 |
negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
| 0.0 |
0.2 |
GO:0007076 |
mitotic chromosome condensation(GO:0007076) |
| 0.0 |
0.1 |
GO:0070625 |
zymogen granule exocytosis(GO:0070625) |
| 0.0 |
0.1 |
GO:0051182 |
coenzyme transport(GO:0051182) |
| 0.0 |
0.3 |
GO:0019884 |
antigen processing and presentation of exogenous antigen(GO:0019884) |
| 0.0 |
0.1 |
GO:0014821 |
phasic smooth muscle contraction(GO:0014821) |
| 0.0 |
0.1 |
GO:0046688 |
response to copper ion(GO:0046688) |
| 0.0 |
0.1 |
GO:0008355 |
olfactory learning(GO:0008355) |
| 0.0 |
0.1 |
GO:0051725 |
protein de-ADP-ribosylation(GO:0051725) |
| 0.0 |
0.1 |
GO:0006370 |
7-methylguanosine mRNA capping(GO:0006370) |
| 0.0 |
0.0 |
GO:1901727 |
positive regulation of histone deacetylase activity(GO:1901727) |
| 0.0 |
0.3 |
GO:1901629 |
regulation of presynaptic membrane organization(GO:1901629) |
| 0.0 |
0.7 |
GO:0006289 |
nucleotide-excision repair(GO:0006289) |
| 0.0 |
0.2 |
GO:0015868 |
purine ribonucleotide transport(GO:0015868) |
| 0.0 |
0.1 |
GO:0006452 |
translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.0 |
0.2 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.0 |
0.1 |
GO:1902261 |
positive regulation of delayed rectifier potassium channel activity(GO:1902261) |
| 0.0 |
0.1 |
GO:0098869 |
cellular oxidant detoxification(GO:0098869) |
| 0.0 |
0.3 |
GO:0034315 |
regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
| 0.0 |
0.2 |
GO:0042633 |
molting cycle(GO:0042303) hair cycle(GO:0042633) |
| 0.0 |
0.0 |
GO:0042732 |
D-xylose metabolic process(GO:0042732) |
| 0.0 |
0.0 |
GO:0030862 |
positive regulation of polarized epithelial cell differentiation(GO:0030862) |
| 0.0 |
0.0 |
GO:0090230 |
regulation of centromere complex assembly(GO:0090230) |
| 0.0 |
0.1 |
GO:0051534 |
negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.0 |
0.2 |
GO:0031664 |
regulation of lipopolysaccharide-mediated signaling pathway(GO:0031664) |
| 0.0 |
0.0 |
GO:1902455 |
negative regulation of stem cell population maintenance(GO:1902455) |
| 0.0 |
0.0 |
GO:0040018 |
positive regulation of multicellular organism growth(GO:0040018) |
| 0.0 |
0.3 |
GO:0031297 |
replication fork processing(GO:0031297) |
| 0.0 |
0.1 |
GO:0018126 |
protein hydroxylation(GO:0018126) |
| 0.0 |
0.2 |
GO:0070986 |
left/right axis specification(GO:0070986) |
| 0.0 |
0.0 |
GO:0060672 |
epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.0 |
0.0 |
GO:0033364 |
mast cell secretory granule organization(GO:0033364) |
| 0.0 |
0.0 |
GO:0034770 |
histone H4-K20 methylation(GO:0034770) |
| 0.0 |
0.1 |
GO:0042559 |
pteridine-containing compound biosynthetic process(GO:0042559) |
| 0.0 |
0.1 |
GO:0006172 |
ADP biosynthetic process(GO:0006172) |
| 0.0 |
0.0 |
GO:2000812 |
regulation of barbed-end actin filament capping(GO:2000812) |
| 0.0 |
0.1 |
GO:0046325 |
negative regulation of glucose import(GO:0046325) |
| 0.0 |
0.1 |
GO:0010804 |
negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.0 |
0.1 |
GO:2001286 |
regulation of caveolin-mediated endocytosis(GO:2001286) |
| 0.0 |
0.1 |
GO:0060770 |
negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.0 |
0.4 |
GO:0043171 |
peptide catabolic process(GO:0043171) |
| 0.0 |
0.1 |
GO:0002315 |
marginal zone B cell differentiation(GO:0002315) |
| 0.0 |
0.2 |
GO:0030104 |
water homeostasis(GO:0030104) |
| 0.0 |
0.0 |
GO:0090327 |
negative regulation of locomotion involved in locomotory behavior(GO:0090327) |
| 0.0 |
0.0 |
GO:2000298 |
regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
| 0.0 |
0.1 |
GO:0046604 |
positive regulation of mitotic centrosome separation(GO:0046604) |
| 0.0 |
0.1 |
GO:0015910 |
peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.0 |
0.0 |
GO:0032673 |
regulation of interleukin-4 production(GO:0032673) positive regulation of interleukin-4 production(GO:0032753) |
| 0.0 |
0.0 |
GO:0060312 |
regulation of blood vessel remodeling(GO:0060312) |
| 0.0 |
0.3 |
GO:0048662 |
negative regulation of smooth muscle cell proliferation(GO:0048662) |
| 0.0 |
0.1 |
GO:0032926 |
negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.0 |
0.0 |
GO:0071474 |
cellular hyperosmotic response(GO:0071474) |
| 0.0 |
0.0 |
GO:0033313 |
meiotic cell cycle checkpoint(GO:0033313) |
| 0.0 |
0.0 |
GO:0035928 |
RNA import into mitochondrion(GO:0035927) rRNA import into mitochondrion(GO:0035928) rRNA transport(GO:0051029) |
| 0.0 |
0.1 |
GO:0071470 |
cellular response to osmotic stress(GO:0071470) |
| 0.0 |
0.1 |
GO:1901165 |
positive regulation of trophoblast cell migration(GO:1901165) |
| 0.0 |
0.2 |
GO:0070584 |
mitochondrion morphogenesis(GO:0070584) |
| 0.0 |
0.4 |
GO:0001756 |
somitogenesis(GO:0001756) |
| 0.0 |
0.2 |
GO:0032020 |
ISG15-protein conjugation(GO:0032020) |
| 0.0 |
0.2 |
GO:0009142 |
nucleoside triphosphate biosynthetic process(GO:0009142) |
| 0.0 |
0.1 |
GO:0090666 |
scaRNA localization to Cajal body(GO:0090666) |
| 0.0 |
0.0 |
GO:0032713 |
negative regulation of interleukin-4 production(GO:0032713) |
| 0.0 |
0.1 |
GO:0042182 |
ketone catabolic process(GO:0042182) |
| 0.0 |
0.1 |
GO:0035511 |
oxidative DNA demethylation(GO:0035511) |
| 0.0 |
0.1 |
GO:0071624 |
positive regulation of granulocyte chemotaxis(GO:0071624) positive regulation of neutrophil chemotaxis(GO:0090023) |
| 0.0 |
0.1 |
GO:0018364 |
peptidyl-glutamine methylation(GO:0018364) rRNA (guanine-N7)-methylation(GO:0070476) |
| 0.0 |
0.1 |
GO:0006777 |
Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) |
| 0.0 |
0.1 |
GO:0070092 |
glucagon secretion(GO:0070091) regulation of glucagon secretion(GO:0070092) |
| 0.0 |
0.1 |
GO:0031145 |
anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.0 |
0.3 |
GO:0051569 |
regulation of histone H3-K4 methylation(GO:0051569) |
| 0.0 |
0.2 |
GO:0042119 |
neutrophil activation(GO:0042119) |
| 0.0 |
0.0 |
GO:0042993 |
positive regulation of transcription factor import into nucleus(GO:0042993) |
| 0.0 |
0.7 |
GO:0006400 |
tRNA modification(GO:0006400) |
| 0.0 |
0.1 |
GO:0046602 |
regulation of mitotic centrosome separation(GO:0046602) |
| 0.0 |
0.1 |
GO:0006613 |
cotranslational protein targeting to membrane(GO:0006613) |
| 0.0 |
0.1 |
GO:0000188 |
inactivation of MAPK activity(GO:0000188) |
| 0.0 |
0.1 |
GO:0043174 |
purine ribonucleoside salvage(GO:0006166) nucleoside salvage(GO:0043174) |
| 0.0 |
0.2 |
GO:0016322 |
neuron remodeling(GO:0016322) |
| 0.0 |
0.3 |
GO:0017004 |
cytochrome complex assembly(GO:0017004) |
| 0.0 |
0.1 |
GO:0071569 |
protein ufmylation(GO:0071569) |
| 0.0 |
0.1 |
GO:0038018 |
Wnt receptor catabolic process(GO:0038018) |
| 0.0 |
0.1 |
GO:0051967 |
negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 |
0.2 |
GO:0033539 |
fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.0 |
0.1 |
GO:0021514 |
ventral spinal cord interneuron differentiation(GO:0021514) |
| 0.0 |
0.1 |
GO:0006451 |
selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 |
0.0 |
GO:0071806 |
intracellular protein transmembrane transport(GO:0065002) protein transmembrane transport(GO:0071806) |
| 0.0 |
0.0 |
GO:0002544 |
chronic inflammatory response(GO:0002544) |
| 0.0 |
0.1 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.0 |
0.0 |
GO:0045069 |
regulation of viral genome replication(GO:0045069) |
| 0.0 |
0.1 |
GO:0014002 |
astrocyte development(GO:0014002) |
| 0.0 |
0.6 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.0 |
0.0 |
GO:1903960 |
negative regulation of anion transmembrane transport(GO:1903960) |
| 0.0 |
0.1 |
GO:0090201 |
negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
| 0.0 |
0.2 |
GO:0006303 |
non-recombinational repair(GO:0000726) double-strand break repair via nonhomologous end joining(GO:0006303) |
| 0.0 |
0.1 |
GO:0090074 |
negative regulation of protein homodimerization activity(GO:0090074) |
| 0.0 |
0.0 |
GO:0070232 |
regulation of T cell apoptotic process(GO:0070232) |
| 0.0 |
0.2 |
GO:0006555 |
methionine metabolic process(GO:0006555) |
| 0.0 |
0.1 |
GO:0035022 |
positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.0 |
0.1 |
GO:0033140 |
negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.0 |
0.1 |
GO:0030206 |
chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.0 |
0.1 |
GO:0023041 |
neuronal signal transduction(GO:0023041) |
| 0.0 |
0.1 |
GO:0090282 |
trophectodermal cellular morphogenesis(GO:0001831) positive regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071931) positive regulation of transcription involved in G2/M transition of mitotic cell cycle(GO:0090282) |
| 0.0 |
0.5 |
GO:0031050 |
dsRNA fragmentation(GO:0031050) production of miRNAs involved in gene silencing by miRNA(GO:0035196) production of small RNA involved in gene silencing by RNA(GO:0070918) |
| 0.0 |
0.0 |
GO:0070782 |
phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.0 |
0.6 |
GO:0000956 |
nuclear-transcribed mRNA catabolic process(GO:0000956) |
| 0.0 |
0.1 |
GO:0097211 |
response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.0 |
0.0 |
GO:0000393 |
spliceosomal conformational changes to generate catalytic conformation(GO:0000393) |
| 0.0 |
0.1 |
GO:0034285 |
response to sucrose(GO:0009744) response to disaccharide(GO:0034285) |
| 0.0 |
0.1 |
GO:0046033 |
AMP metabolic process(GO:0046033) |
| 0.0 |
0.2 |
GO:0044342 |
type B pancreatic cell proliferation(GO:0044342) |
| 0.0 |
0.9 |
GO:0000380 |
alternative mRNA splicing, via spliceosome(GO:0000380) |
| 0.0 |
0.1 |
GO:1905169 |
protein localization to phagocytic vesicle(GO:1905161) regulation of protein localization to phagocytic vesicle(GO:1905169) positive regulation of protein localization to phagocytic vesicle(GO:1905171) |
| 0.0 |
0.0 |
GO:0006646 |
phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.0 |
0.0 |
GO:0010726 |
positive regulation of hydrogen peroxide metabolic process(GO:0010726) regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
| 0.0 |
0.0 |
GO:0007000 |
nucleolus organization(GO:0007000) |
| 0.0 |
0.2 |
GO:0045056 |
transcytosis(GO:0045056) |
| 0.0 |
0.0 |
GO:0051984 |
positive regulation of chromosome segregation(GO:0051984) |
| 0.0 |
0.0 |
GO:0051085 |
chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.0 |
0.2 |
GO:0000338 |
protein deneddylation(GO:0000338) |
| 0.0 |
0.2 |
GO:0036037 |
CD8-positive, alpha-beta T cell activation(GO:0036037) CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.0 |
0.0 |
GO:1902608 |
regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
| 0.0 |
0.0 |
GO:0060261 |
positive regulation of transcription initiation from RNA polymerase II promoter(GO:0060261) |
| 0.0 |
0.0 |
GO:0086053 |
AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
| 0.0 |
0.1 |
GO:1901029 |
negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.0 |
0.0 |
GO:0006667 |
sphinganine metabolic process(GO:0006667) |
| 0.0 |
0.0 |
GO:0006544 |
glycine metabolic process(GO:0006544) |
| 0.0 |
0.0 |
GO:0070535 |
histone H2A K63-linked ubiquitination(GO:0070535) |
| 0.0 |
0.5 |
GO:0061077 |
chaperone-mediated protein folding(GO:0061077) |
| 0.0 |
0.2 |
GO:0030520 |
intracellular estrogen receptor signaling pathway(GO:0030520) |
| 0.0 |
0.0 |
GO:0045654 |
positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.0 |
0.0 |
GO:0060965 |
negative regulation of gene silencing by miRNA(GO:0060965) |
| 0.0 |
0.1 |
GO:0050884 |
neuromuscular process controlling posture(GO:0050884) |
| 0.0 |
0.1 |
GO:0051684 |
maintenance of Golgi location(GO:0051684) |
| 0.0 |
0.4 |
GO:0001919 |
regulation of receptor recycling(GO:0001919) |
| 0.0 |
0.1 |
GO:0000731 |
DNA synthesis involved in DNA repair(GO:0000731) |
| 0.0 |
0.1 |
GO:1901984 |
negative regulation of protein acetylation(GO:1901984) negative regulation of peptidyl-lysine acetylation(GO:2000757) |
| 0.0 |
0.1 |
GO:0045065 |
cytotoxic T cell differentiation(GO:0045065) |
| 0.0 |
0.1 |
GO:0061635 |
regulation of protein complex stability(GO:0061635) |
| 0.0 |
0.1 |
GO:0090383 |
phagosome acidification(GO:0090383) |
| 0.0 |
0.0 |
GO:0046341 |
CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.0 |
0.1 |
GO:0051490 |
negative regulation of filopodium assembly(GO:0051490) |
| 0.0 |
0.2 |
GO:0000154 |
rRNA modification(GO:0000154) |
| 0.0 |
0.3 |
GO:0007608 |
sensory perception of smell(GO:0007608) |
| 0.0 |
0.0 |
GO:2000542 |
negative regulation of gastrulation(GO:2000542) |
| 0.0 |
0.0 |
GO:0021852 |
pyramidal neuron migration(GO:0021852) |
| 0.0 |
0.0 |
GO:0046639 |
negative regulation of T-helper 2 cell differentiation(GO:0045629) negative regulation of alpha-beta T cell differentiation(GO:0046639) |
| 0.0 |
0.1 |
GO:1904781 |
positive regulation of protein localization to centrosome(GO:1904781) |
| 0.0 |
0.0 |
GO:0035963 |
response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
| 0.0 |
0.1 |
GO:0045494 |
photoreceptor cell maintenance(GO:0045494) |
| 0.0 |
0.0 |
GO:0051835 |
positive regulation of synapse structural plasticity(GO:0051835) |
| 0.0 |
0.1 |
GO:0009437 |
amino-acid betaine metabolic process(GO:0006577) carnitine metabolic process(GO:0009437) |
| 0.0 |
0.2 |
GO:0070536 |
protein K63-linked deubiquitination(GO:0070536) |
| 0.0 |
0.0 |
GO:2001022 |
positive regulation of response to DNA damage stimulus(GO:2001022) |
| 0.0 |
0.1 |
GO:0030322 |
stabilization of membrane potential(GO:0030322) |
| 0.0 |
0.2 |
GO:0030199 |
collagen fibril organization(GO:0030199) |
| 0.0 |
0.2 |
GO:0019731 |
antibacterial humoral response(GO:0019731) |
| 0.0 |
0.1 |
GO:0042769 |
DNA damage response, detection of DNA damage(GO:0042769) |
| 0.0 |
0.1 |
GO:0042755 |
eating behavior(GO:0042755) |
| 0.0 |
0.0 |
GO:0042271 |
susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.0 |
0.1 |
GO:0010457 |
centriole-centriole cohesion(GO:0010457) |
| 0.0 |
0.0 |
GO:0046501 |
protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.0 |
0.0 |
GO:0043686 |
co-translational protein modification(GO:0043686) |
| 0.0 |
0.1 |
GO:0007398 |
ectoderm development(GO:0007398) |
| 0.0 |
0.2 |
GO:0033119 |
negative regulation of RNA splicing(GO:0033119) |
| 0.0 |
0.0 |
GO:1990022 |
RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
| 0.0 |
0.3 |
GO:0095500 |
acetylcholine receptor signaling pathway(GO:0095500) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
| 0.0 |
0.1 |
GO:2001199 |
negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.0 |
0.3 |
GO:0006749 |
glutathione metabolic process(GO:0006749) |
| 0.0 |
0.1 |
GO:0046185 |
aldehyde catabolic process(GO:0046185) |
| 0.0 |
0.1 |
GO:0010390 |
histone monoubiquitination(GO:0010390) |
| 0.0 |
0.1 |
GO:0070389 |
chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.0 |
0.0 |
GO:0035063 |
nuclear speck organization(GO:0035063) |
| 0.0 |
0.4 |
GO:0090305 |
nucleic acid phosphodiester bond hydrolysis(GO:0090305) |
| 0.0 |
0.1 |
GO:0045776 |
negative regulation of blood pressure(GO:0045776) |
| 0.0 |
0.1 |
GO:0071577 |
zinc II ion transmembrane transport(GO:0071577) |
| 0.0 |
0.1 |
GO:0036010 |
protein localization to endosome(GO:0036010) |
| 0.0 |
0.0 |
GO:0030576 |
Cajal body organization(GO:0030576) |
| 0.0 |
0.1 |
GO:0032298 |
positive regulation of DNA-dependent DNA replication initiation(GO:0032298) |
| 0.0 |
0.0 |
GO:0008616 |
queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.0 |
0.8 |
GO:0042254 |
ribosome biogenesis(GO:0042254) |
| 0.0 |
0.0 |
GO:0006361 |
transcription initiation from RNA polymerase I promoter for nuclear large rRNA transcript(GO:0001180) transcription initiation from RNA polymerase I promoter(GO:0006361) |
| 0.0 |
0.0 |
GO:0070168 |
negative regulation of biomineral tissue development(GO:0070168) |
| 0.0 |
0.1 |
GO:0006301 |
postreplication repair(GO:0006301) |
| 0.0 |
0.1 |
GO:0043486 |
histone exchange(GO:0043486) |
