Motif ID: Nhlh1
Z-value: 0.983
Transcription factors associated with Nhlh1:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| Nhlh1 | ENSMUSG00000051251.3 | Nhlh1 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Nhlh1 | mm10_v2_chr1_-_172057573_172057598 | -0.01 | 9.7e-01 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 2.2 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 0.5 | 2.1 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
| 0.5 | 1.4 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
| 0.5 | 1.4 | GO:1902310 | positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.4 | 1.3 | GO:0070649 | meiotic chromosome movement towards spindle pole(GO:0016344) formin-nucleated actin cable assembly(GO:0070649) |
| 0.4 | 1.3 | GO:0046077 | dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate metabolic process(GO:0009138) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
| 0.4 | 1.2 | GO:0003349 | epicardium-derived cardiac endothelial cell differentiation(GO:0003349) |
| 0.4 | 1.2 | GO:1903048 | regulation of acetylcholine-gated cation channel activity(GO:1903048) |
| 0.3 | 1.0 | GO:0072076 | hyaluranon cable assembly(GO:0036118) nephrogenic mesenchyme development(GO:0072076) negative regulation of glomerular mesangial cell proliferation(GO:0072125) negative regulation of glomerulus development(GO:0090194) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.3 | 2.5 | GO:0098712 | L-glutamate import across plasma membrane(GO:0098712) |
| 0.3 | 1.8 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.3 | 0.8 | GO:1900673 | olefin metabolic process(GO:1900673) |
| 0.3 | 0.6 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
| 0.3 | 0.8 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.3 | 0.8 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
| 0.3 | 1.0 | GO:0042905 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.2 | 1.0 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.2 | 0.7 | GO:0002669 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 0.2 | 1.2 | GO:0030643 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.2 | 1.0 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
| 0.2 | 2.6 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.2 | 2.4 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.2 | 1.4 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.2 | 0.9 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
| 0.2 | 0.7 | GO:0050925 | negative regulation of negative chemotaxis(GO:0050925) |
| 0.2 | 1.6 | GO:0051461 | protein import into peroxisome matrix, docking(GO:0016560) regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.2 | 1.1 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 0.2 | 2.4 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
| 0.2 | 0.7 | GO:0070671 | response to interleukin-12(GO:0070671) |
| 0.2 | 0.4 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
| 0.2 | 0.8 | GO:0010808 | positive regulation of synaptic vesicle priming(GO:0010808) |
| 0.2 | 0.8 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) |
| 0.2 | 0.6 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
| 0.2 | 1.1 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.2 | 2.5 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
| 0.2 | 1.3 | GO:0060923 | cardiac muscle cell fate commitment(GO:0060923) |
| 0.2 | 0.5 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.2 | 0.5 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
| 0.2 | 0.9 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.2 | 0.5 | GO:1903244 | positive regulation of cardiac muscle adaptation(GO:0010615) positive regulation of cardiac muscle hypertrophy in response to stress(GO:1903244) regulation of connective tissue replacement(GO:1905203) |
| 0.2 | 0.5 | GO:1900133 | renin secretion into blood stream(GO:0002001) regulation of renin secretion into blood stream(GO:1900133) |
| 0.2 | 0.7 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
| 0.2 | 0.5 | GO:0007403 | glial cell fate determination(GO:0007403) |
| 0.2 | 0.4 | GO:2000825 | positive regulation of androgen receptor activity(GO:2000825) |
| 0.2 | 0.3 | GO:1904020 | regulation of G-protein coupled receptor internalization(GO:1904020) |
| 0.2 | 0.8 | GO:0040009 | regulation of growth rate(GO:0040009) |
| 0.2 | 1.5 | GO:0071420 | cellular response to histamine(GO:0071420) |
| 0.2 | 1.3 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
| 0.2 | 0.5 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.2 | 0.5 | GO:0048162 | preantral ovarian follicle growth(GO:0001546) multi-layer follicle stage(GO:0048162) |
| 0.2 | 0.5 | GO:0090204 | protein localization to nuclear pore(GO:0090204) |
| 0.2 | 0.5 | GO:0001830 | trophectodermal cell fate commitment(GO:0001830) |
| 0.2 | 0.8 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) sphingolipid mediated signaling pathway(GO:0090520) |
| 0.2 | 0.5 | GO:1903538 | meiotic cell cycle process involved in oocyte maturation(GO:1903537) regulation of meiotic cell cycle process involved in oocyte maturation(GO:1903538) |
| 0.2 | 0.8 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.2 | 0.8 | GO:0045627 | positive regulation of T-helper 1 cell differentiation(GO:0045627) |
| 0.2 | 0.5 | GO:0071550 | regulation of muscle atrophy(GO:0014735) death-inducing signaling complex assembly(GO:0071550) |
| 0.1 | 0.7 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
| 0.1 | 0.4 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
| 0.1 | 0.7 | GO:1990034 | calcium ion export from cell(GO:1990034) |
| 0.1 | 0.6 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
| 0.1 | 0.4 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.1 | 0.6 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 0.1 | 0.6 | GO:0060025 | regulation of synaptic activity(GO:0060025) |
| 0.1 | 0.1 | GO:0019389 | glucuronoside metabolic process(GO:0019389) |
| 0.1 | 0.3 | GO:0010996 | response to auditory stimulus(GO:0010996) |
| 0.1 | 1.0 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.1 | 0.4 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) regulation of planar cell polarity pathway involved in axis elongation(GO:2000040) negative regulation of planar cell polarity pathway involved in axis elongation(GO:2000041) |
| 0.1 | 0.6 | GO:1904778 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
| 0.1 | 0.7 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
| 0.1 | 0.4 | GO:0010512 | negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
| 0.1 | 1.1 | GO:0045618 | positive regulation of keratinocyte differentiation(GO:0045618) |
| 0.1 | 0.8 | GO:2000483 | detection of bacterium(GO:0016045) detection of other organism(GO:0098543) negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.1 | 0.3 | GO:0086017 | Purkinje myocyte action potential(GO:0086017) membrane depolarization during Purkinje myocyte cell action potential(GO:0086047) |
| 0.1 | 0.5 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
| 0.1 | 0.3 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
| 0.1 | 0.9 | GO:0098762 | meiotic cell cycle phase(GO:0098762) meiosis I cell cycle phase(GO:0098764) |
| 0.1 | 0.3 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.1 | 0.5 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 0.1 | 0.3 | GO:0097026 | dendritic cell dendrite assembly(GO:0097026) |
| 0.1 | 0.6 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 2.9 | GO:0061029 | eyelid development in camera-type eye(GO:0061029) |
| 0.1 | 1.5 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.1 | 0.6 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 0.1 | 0.7 | GO:0032439 | endosome localization(GO:0032439) |
| 0.1 | 0.2 | GO:0014877 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 0.1 | 0.4 | GO:0046541 | saliva secretion(GO:0046541) |
| 0.1 | 1.4 | GO:1903818 | positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.1 | 0.6 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.1 | 0.6 | GO:0006537 | glutamate biosynthetic process(GO:0006537) glutamine catabolic process(GO:0006543) |
| 0.1 | 0.7 | GO:1903207 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
| 0.1 | 1.2 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.1 | 0.6 | GO:1903566 | positive regulation of protein localization to cilium(GO:1903566) |
| 0.1 | 0.4 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.1 | 0.2 | GO:0010593 | negative regulation of lamellipodium assembly(GO:0010593) |
| 0.1 | 0.7 | GO:0015791 | polyol transport(GO:0015791) |
| 0.1 | 0.4 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
| 0.1 | 1.1 | GO:0046085 | adenosine metabolic process(GO:0046085) |
| 0.1 | 0.6 | GO:1904923 | regulation of mitophagy in response to mitochondrial depolarization(GO:1904923) |
| 0.1 | 0.6 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.1 | 0.5 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.1 | 0.4 | GO:0044458 | motile cilium assembly(GO:0044458) |
| 0.1 | 1.1 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.1 | 0.5 | GO:1903275 | positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
| 0.1 | 0.9 | GO:0036371 | protein localization to M-band(GO:0036309) protein localization to T-tubule(GO:0036371) |
| 0.1 | 0.6 | GO:0090218 | positive regulation of lipid kinase activity(GO:0090218) |
| 0.1 | 0.6 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
| 0.1 | 1.0 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.1 | 0.3 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.1 | 0.6 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.1 | 0.9 | GO:0071941 | nitrogen cycle metabolic process(GO:0071941) |
| 0.1 | 0.3 | GO:0070672 | response to interleukin-15(GO:0070672) |
| 0.1 | 0.4 | GO:0001865 | NK T cell differentiation(GO:0001865) regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
| 0.1 | 0.6 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
| 0.1 | 0.4 | GO:0015888 | thiamine transport(GO:0015888) |
| 0.1 | 0.3 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.1 | 0.7 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
| 0.1 | 0.5 | GO:1900246 | positive regulation of RIG-I signaling pathway(GO:1900246) |
| 0.1 | 0.2 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
| 0.1 | 0.5 | GO:1901911 | diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
| 0.1 | 0.5 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.1 | 0.3 | GO:2001013 | adherens junction maintenance(GO:0034334) epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.1 | 0.7 | GO:0043313 | regulation of neutrophil degranulation(GO:0043313) regulation of neutrophil activation(GO:1902563) |
| 0.1 | 0.9 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.1 | 0.3 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.1 | 0.4 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
| 0.1 | 0.4 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.1 | 0.3 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.1 | 0.3 | GO:0030070 | insulin processing(GO:0030070) |
| 0.1 | 0.3 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
| 0.1 | 1.2 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.1 | 0.9 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
| 0.1 | 0.4 | GO:0098989 | NMDA selective glutamate receptor signaling pathway(GO:0098989) |
| 0.1 | 0.3 | GO:1904425 | negative regulation of GTP binding(GO:1904425) |
| 0.1 | 0.2 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.1 | 1.0 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
| 0.1 | 0.4 | GO:0051798 | positive regulation of hair follicle development(GO:0051798) |
| 0.1 | 0.8 | GO:0055075 | potassium ion homeostasis(GO:0055075) |
| 0.1 | 0.8 | GO:0051014 | actin filament severing(GO:0051014) |
| 0.1 | 0.2 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.1 | 0.2 | GO:1990504 | dense core granule exocytosis(GO:1990504) |
| 0.1 | 1.2 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.1 | 0.3 | GO:0019323 | pentose catabolic process(GO:0019323) |
| 0.1 | 0.1 | GO:0048819 | regulation of hair follicle maturation(GO:0048819) regulation of catagen(GO:0051794) |
| 0.1 | 0.5 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
| 0.1 | 0.2 | GO:0042536 | negative regulation of tumor necrosis factor biosynthetic process(GO:0042536) |
| 0.1 | 0.2 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) protein K6-linked deubiquitination(GO:0044313) |
| 0.1 | 0.3 | GO:1903028 | regulation of opsonization(GO:1903027) positive regulation of opsonization(GO:1903028) |
| 0.1 | 0.9 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
| 0.1 | 0.3 | GO:0072272 | proximal/distal pattern formation involved in metanephric nephron development(GO:0072272) |
| 0.1 | 3.1 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
| 0.1 | 1.0 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
| 0.1 | 0.2 | GO:0036228 | protein targeting to nuclear inner membrane(GO:0036228) |
| 0.1 | 0.4 | GO:0098964 | dendritic transport of ribonucleoprotein complex(GO:0098961) dendritic transport of messenger ribonucleoprotein complex(GO:0098963) anterograde dendritic transport of messenger ribonucleoprotein complex(GO:0098964) |
| 0.1 | 0.7 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
| 0.1 | 0.5 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
| 0.1 | 0.7 | GO:0001977 | renal system process involved in regulation of blood volume(GO:0001977) |
| 0.1 | 0.3 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
| 0.1 | 0.2 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) negative regulation of neutrophil differentiation(GO:0045659) |
| 0.1 | 0.4 | GO:0061110 | dense core granule biogenesis(GO:0061110) |
| 0.1 | 0.1 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.1 | 0.6 | GO:0009181 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
| 0.1 | 0.2 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) |
| 0.1 | 0.2 | GO:0032650 | regulation of interleukin-1 alpha production(GO:0032650) positive regulation of interleukin-1 alpha production(GO:0032730) cardiac cell fate determination(GO:0060913) |
| 0.1 | 0.3 | GO:0000415 | negative regulation of histone H3-K36 methylation(GO:0000415) |
| 0.1 | 0.5 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
| 0.1 | 0.1 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
| 0.1 | 0.2 | GO:1905049 | negative regulation of metalloendopeptidase activity(GO:1904684) negative regulation of metallopeptidase activity(GO:1905049) |
| 0.1 | 0.6 | GO:0030388 | fructose 6-phosphate metabolic process(GO:0006002) fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.1 | 1.6 | GO:0010763 | positive regulation of fibroblast migration(GO:0010763) |
| 0.1 | 0.9 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.1 | 0.3 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.1 | 0.6 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.1 | 0.3 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
| 0.1 | 0.1 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
| 0.1 | 1.5 | GO:0003301 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.1 | 0.1 | GO:1903061 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) regulation of protein lipidation(GO:1903059) positive regulation of protein lipidation(GO:1903061) |
| 0.1 | 0.8 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.1 | 0.3 | GO:0071500 | cellular response to nitrosative stress(GO:0071500) |
| 0.1 | 0.1 | GO:0006892 | post-Golgi vesicle-mediated transport(GO:0006892) |
| 0.1 | 0.3 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
| 0.1 | 0.3 | GO:0046666 | retinal cell programmed cell death(GO:0046666) |
| 0.1 | 0.4 | GO:0006312 | mitotic recombination(GO:0006312) |
| 0.1 | 0.6 | GO:0045176 | apical protein localization(GO:0045176) |
| 0.1 | 0.2 | GO:0060715 | syncytiotrophoblast cell differentiation involved in labyrinthine layer development(GO:0060715) |
| 0.1 | 0.7 | GO:0035459 | cargo loading into vesicle(GO:0035459) cargo loading into COPII-coated vesicle(GO:0090110) |
| 0.1 | 0.2 | GO:0070859 | positive regulation of bile acid biosynthetic process(GO:0070859) positive regulation of bile acid metabolic process(GO:1904253) |
| 0.1 | 0.5 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
| 0.1 | 0.1 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.1 | 0.4 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
| 0.1 | 0.4 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
| 0.1 | 0.3 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.1 | 0.2 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.1 | 0.1 | GO:1900368 | regulation of RNA interference(GO:1900368) |
| 0.1 | 0.6 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
| 0.1 | 0.9 | GO:0043045 | DNA methylation involved in embryo development(GO:0043045) changes to DNA methylation involved in embryo development(GO:1901538) |
| 0.1 | 0.8 | GO:0007638 | mechanosensory behavior(GO:0007638) |
| 0.1 | 1.2 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
| 0.1 | 0.8 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.1 | 0.7 | GO:0031069 | hair follicle morphogenesis(GO:0031069) |
| 0.1 | 0.4 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
| 0.1 | 0.9 | GO:2000300 | regulation of synaptic vesicle exocytosis(GO:2000300) |
| 0.1 | 0.5 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
| 0.1 | 1.6 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
| 0.1 | 0.2 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.1 | 0.3 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
| 0.1 | 0.5 | GO:0031268 | pseudopodium organization(GO:0031268) |
| 0.0 | 0.9 | GO:0030279 | negative regulation of ossification(GO:0030279) |
| 0.0 | 0.4 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.0 | 0.6 | GO:0095500 | acetylcholine receptor signaling pathway(GO:0095500) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
| 0.0 | 0.5 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.0 | 0.1 | GO:0016240 | autophagosome docking(GO:0016240) |
| 0.0 | 0.7 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
| 0.0 | 0.1 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
| 0.0 | 0.1 | GO:0070944 | neutrophil mediated killing of bacterium(GO:0070944) |
| 0.0 | 0.1 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
| 0.0 | 0.3 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
| 0.0 | 0.1 | GO:1901052 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
| 0.0 | 0.3 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
| 0.0 | 1.0 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
| 0.0 | 0.6 | GO:0046838 | phosphorylated carbohydrate dephosphorylation(GO:0046838) |
| 0.0 | 0.2 | GO:1902951 | negative regulation of dendritic spine maintenance(GO:1902951) |
| 0.0 | 0.1 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
| 0.0 | 0.2 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.0 | 0.2 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
| 0.0 | 0.3 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.0 | 0.2 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
| 0.0 | 0.8 | GO:0045103 | intermediate filament-based process(GO:0045103) |
| 0.0 | 0.4 | GO:0035280 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) |
| 0.0 | 0.0 | GO:0061054 | dermatome development(GO:0061054) regulation of dermatome development(GO:0061183) paramesonephric duct development(GO:0061205) regulation of testosterone biosynthetic process(GO:2000224) |
| 0.0 | 0.3 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
| 0.0 | 1.1 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
| 0.0 | 0.2 | GO:1901341 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.0 | 1.3 | GO:0007608 | sensory perception of smell(GO:0007608) |
| 0.0 | 0.1 | GO:0035720 | intraciliary anterograde transport(GO:0035720) |
| 0.0 | 0.6 | GO:0042711 | maternal behavior(GO:0042711) |
| 0.0 | 0.3 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.0 | 0.3 | GO:0009435 | NAD biosynthetic process(GO:0009435) |
| 0.0 | 0.1 | GO:0098928 | presynaptic signal transduction(GO:0098928) presynapse to nucleus signaling pathway(GO:0099526) |
| 0.0 | 0.2 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
| 0.0 | 0.5 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.0 | 0.2 | GO:0006586 | tryptophan metabolic process(GO:0006568) indolalkylamine metabolic process(GO:0006586) |
| 0.0 | 0.2 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.0 | 0.9 | GO:0010591 | regulation of lamellipodium assembly(GO:0010591) |
| 0.0 | 0.3 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) negative regulation of protein homooligomerization(GO:0032463) |
| 0.0 | 0.4 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.0 | 0.2 | GO:0006848 | pyruvate transport(GO:0006848) |
| 0.0 | 0.8 | GO:0070306 | lens fiber cell differentiation(GO:0070306) |
| 0.0 | 0.2 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.0 | 0.4 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
| 0.0 | 0.2 | GO:0045616 | regulation of keratinocyte differentiation(GO:0045616) |
| 0.0 | 0.5 | GO:1900153 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.0 | 0.5 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.0 | 0.1 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
| 0.0 | 0.2 | GO:0060371 | response to pyrethroid(GO:0046684) regulation of atrial cardiac muscle cell membrane depolarization(GO:0060371) |
| 0.0 | 0.3 | GO:0075044 | autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
| 0.0 | 0.2 | GO:0015889 | cobalamin transport(GO:0015889) |
| 0.0 | 0.2 | GO:0050857 | positive regulation of antigen receptor-mediated signaling pathway(GO:0050857) positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.0 | 0.5 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.0 | 0.6 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
| 0.0 | 0.3 | GO:0006544 | glycine metabolic process(GO:0006544) |
| 0.0 | 0.3 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.0 | 0.4 | GO:0016188 | synaptic vesicle maturation(GO:0016188) |
| 0.0 | 0.4 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.0 | 1.0 | GO:0050982 | detection of mechanical stimulus(GO:0050982) |
| 0.0 | 0.2 | GO:0045806 | negative regulation of endocytosis(GO:0045806) |
| 0.0 | 0.3 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.0 | 0.1 | GO:0071415 | cellular response to purine-containing compound(GO:0071415) |
| 0.0 | 0.1 | GO:0090594 | wound healing involved in inflammatory response(GO:0002246) inflammatory response to wounding(GO:0090594) |
| 0.0 | 0.1 | GO:0051409 | response to nitrosative stress(GO:0051409) |
| 0.0 | 0.2 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
| 0.0 | 0.3 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.0 | 0.6 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.0 | 0.3 | GO:0010459 | negative regulation of heart rate(GO:0010459) |
| 0.0 | 0.4 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.0 | 0.3 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 0.0 | 0.0 | GO:1990859 | cellular response to endothelin(GO:1990859) |
| 0.0 | 0.2 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
| 0.0 | 0.8 | GO:0035025 | positive regulation of Rho protein signal transduction(GO:0035025) |
| 0.0 | 0.2 | GO:0015074 | DNA integration(GO:0015074) |
| 0.0 | 0.1 | GO:1901355 | response to rapamycin(GO:1901355) |
| 0.0 | 0.1 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.0 | 0.2 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.0 | 0.1 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
| 0.0 | 0.7 | GO:0044030 | regulation of DNA methylation(GO:0044030) |
| 0.0 | 0.2 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
| 0.0 | 0.2 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.0 | 0.1 | GO:0098885 | actin filament bundle distribution(GO:0070650) modification of postsynaptic actin cytoskeleton(GO:0098885) |
| 0.0 | 0.2 | GO:0050774 | negative regulation of dendrite morphogenesis(GO:0050774) |
| 0.0 | 0.3 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
| 0.0 | 2.3 | GO:0043488 | regulation of mRNA stability(GO:0043488) |
| 0.0 | 0.7 | GO:0015991 | ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
| 0.0 | 0.1 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
| 0.0 | 0.1 | GO:0021825 | substrate-dependent cerebral cortex tangential migration(GO:0021825) |
| 0.0 | 0.9 | GO:0043171 | peptide catabolic process(GO:0043171) |
| 0.0 | 0.1 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.0 | 0.2 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
| 0.0 | 0.1 | GO:2000850 | protein-chromophore linkage(GO:0018298) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
| 0.0 | 0.1 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 0.0 | 0.3 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
| 0.0 | 0.4 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.0 | 0.3 | GO:0007194 | negative regulation of adenylate cyclase activity(GO:0007194) |
| 0.0 | 0.2 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.0 | 0.1 | GO:1904152 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) regulation of retrograde protein transport, ER to cytosol(GO:1904152) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.0 | 0.3 | GO:0048853 | forebrain morphogenesis(GO:0048853) |
| 0.0 | 0.1 | GO:0019372 | lipoxygenase pathway(GO:0019372) |
| 0.0 | 1.0 | GO:0021680 | cerebellar Purkinje cell layer development(GO:0021680) |
| 0.0 | 0.6 | GO:0097320 | membrane tubulation(GO:0097320) |
| 0.0 | 0.5 | GO:0048147 | negative regulation of fibroblast proliferation(GO:0048147) |
| 0.0 | 0.4 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
| 0.0 | 0.4 | GO:1903861 | positive regulation of dendrite extension(GO:1903861) |
| 0.0 | 0.2 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
| 0.0 | 0.6 | GO:0000132 | establishment of mitotic spindle orientation(GO:0000132) |
| 0.0 | 0.1 | GO:0033034 | positive regulation of neutrophil apoptotic process(GO:0033031) positive regulation of myeloid cell apoptotic process(GO:0033034) |
| 0.0 | 0.9 | GO:0030032 | lamellipodium assembly(GO:0030032) |
| 0.0 | 0.1 | GO:0046900 | tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.0 | 0.2 | GO:0009249 | protein lipoylation(GO:0009249) |
| 0.0 | 1.0 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
| 0.0 | 0.9 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
| 0.0 | 0.1 | GO:0045925 | positive regulation of female receptivity(GO:0045925) |
| 0.0 | 0.1 | GO:0010882 | regulation of cardiac muscle contraction by calcium ion signaling(GO:0010882) |
| 0.0 | 0.2 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.0 | 0.1 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
| 0.0 | 0.3 | GO:0019368 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.0 | 0.1 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.0 | 0.1 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
| 0.0 | 0.2 | GO:0071801 | regulation of podosome assembly(GO:0071801) |
| 0.0 | 0.2 | GO:1903301 | positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
| 0.0 | 0.2 | GO:0046512 | sphingosine biosynthetic process(GO:0046512) sphingoid biosynthetic process(GO:0046520) |
| 0.0 | 0.1 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.0 | 0.1 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.0 | 0.3 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.0 | 0.0 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.0 | 1.1 | GO:0006893 | Golgi to plasma membrane transport(GO:0006893) |
| 0.0 | 0.3 | GO:0046856 | phospholipid dephosphorylation(GO:0046839) phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.0 | 0.2 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.0 | 0.1 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 0.0 | 0.5 | GO:0007020 | microtubule nucleation(GO:0007020) |
| 0.0 | 0.0 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.0 | 0.7 | GO:1902850 | mitotic spindle assembly(GO:0090307) microtubule cytoskeleton organization involved in mitosis(GO:1902850) |
| 0.0 | 0.1 | GO:0070294 | renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
| 0.0 | 0.1 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.0 | 0.2 | GO:0035329 | hippo signaling(GO:0035329) |
| 0.0 | 0.1 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.0 | 0.1 | GO:0071372 | cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
| 0.0 | 0.3 | GO:0016601 | Rac protein signal transduction(GO:0016601) |
| 0.0 | 0.2 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
| 0.0 | 0.7 | GO:0051220 | cytoplasmic sequestering of protein(GO:0051220) |
| 0.0 | 0.1 | GO:0070296 | sarcoplasmic reticulum calcium ion transport(GO:0070296) |
| 0.0 | 0.4 | GO:0046928 | regulation of neurotransmitter secretion(GO:0046928) |
| 0.0 | 0.2 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.0 | 0.2 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
| 0.0 | 0.2 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.0 | 2.6 | GO:0050821 | protein stabilization(GO:0050821) |
| 0.0 | 0.1 | GO:0060613 | fat pad development(GO:0060613) |
| 0.0 | 0.1 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 0.0 | 0.1 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.0 | 0.1 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.0 | 0.1 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 0.0 | 0.5 | GO:0046621 | negative regulation of organ growth(GO:0046621) |
| 0.0 | 0.2 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
| 0.0 | 0.3 | GO:0051693 | actin filament capping(GO:0051693) |
| 0.0 | 0.6 | GO:0007585 | respiratory gaseous exchange(GO:0007585) |
| 0.0 | 0.1 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
| 0.0 | 0.5 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
| 0.0 | 0.1 | GO:2001053 | regulation of mesenchymal cell apoptotic process(GO:2001053) negative regulation of mesenchymal cell apoptotic process(GO:2001054) |
| 0.0 | 0.3 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
| 0.0 | 0.2 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
| 0.0 | 0.2 | GO:0030574 | collagen catabolic process(GO:0030574) |
| 0.0 | 0.2 | GO:2001244 | positive regulation of intrinsic apoptotic signaling pathway(GO:2001244) |
| 0.0 | 0.1 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.0 | 0.5 | GO:0019933 | cAMP-mediated signaling(GO:0019933) |
| 0.0 | 0.3 | GO:0007340 | acrosome reaction(GO:0007340) |
| 0.0 | 0.4 | GO:0002548 | monocyte chemotaxis(GO:0002548) |
| 0.0 | 0.2 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.0 | 0.0 | GO:0070166 | enamel mineralization(GO:0070166) |
| 0.0 | 0.0 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
| 0.0 | 0.0 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
| 0.0 | 0.3 | GO:1900449 | regulation of glutamate receptor signaling pathway(GO:1900449) |
| 0.0 | 0.3 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 0.0 | 0.2 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
| 0.0 | 1.6 | GO:0007266 | Rho protein signal transduction(GO:0007266) |
| 0.0 | 0.1 | GO:0006349 | regulation of gene expression by genetic imprinting(GO:0006349) |
| 0.0 | 0.7 | GO:0000768 | syncytium formation by plasma membrane fusion(GO:0000768) |
| 0.0 | 0.2 | GO:0060259 | regulation of feeding behavior(GO:0060259) |
| 0.0 | 0.1 | GO:0098780 | response to mitochondrial depolarisation(GO:0098780) |
| 0.0 | 0.0 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.0 | 0.1 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
| 0.0 | 0.3 | GO:0071480 | cellular response to gamma radiation(GO:0071480) |
| 0.0 | 0.5 | GO:0014037 | Schwann cell differentiation(GO:0014037) |
| 0.0 | 0.0 | GO:0042938 | dipeptide transport(GO:0042938) |
| 0.0 | 0.1 | GO:0014029 | neural crest formation(GO:0014029) |
| 0.0 | 0.0 | GO:0048820 | hair follicle maturation(GO:0048820) |
| 0.0 | 0.2 | GO:0050772 | positive regulation of axonogenesis(GO:0050772) |
| 0.0 | 0.1 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 0.0 | 1.0 | GO:0007030 | Golgi organization(GO:0007030) |
| 0.0 | 0.1 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.0 | 0.1 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
| 0.0 | 0.0 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.0 | 0.0 | GO:0035616 | histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.0 | 0.0 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 | 0.0 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.0 | 0.1 | GO:0042753 | positive regulation of circadian rhythm(GO:0042753) |
| 0.0 | 0.1 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.0 | 0.1 | GO:0034390 | smooth muscle cell apoptotic process(GO:0034390) regulation of smooth muscle cell apoptotic process(GO:0034391) |
| 0.0 | 0.2 | GO:0007029 | endoplasmic reticulum organization(GO:0007029) |
| 0.0 | 0.0 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
| 0.0 | 0.2 | GO:0003341 | cilium movement(GO:0003341) |
| 0.0 | 0.2 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.0 | 0.2 | GO:0051443 | positive regulation of ubiquitin-protein transferase activity(GO:0051443) |
| 0.0 | 0.2 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
| 0.0 | 0.2 | GO:0099517 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 1.4 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.4 | 1.6 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
| 0.3 | 1.2 | GO:0044307 | dendritic branch(GO:0044307) |
| 0.3 | 2.0 | GO:0070695 | FHF complex(GO:0070695) |
| 0.3 | 1.1 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.3 | 0.8 | GO:0070381 | endosome to plasma membrane transport vesicle(GO:0070381) |
| 0.2 | 0.7 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.2 | 0.7 | GO:0098855 | HCN channel complex(GO:0098855) |
| 0.2 | 0.7 | GO:0030934 | collagen type XII trimer(GO:0005595) anchoring collagen complex(GO:0030934) |
| 0.2 | 0.7 | GO:0000802 | transverse filament(GO:0000802) |
| 0.2 | 0.6 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
| 0.2 | 1.0 | GO:0098831 | presynaptic active zone cytoplasmic component(GO:0098831) |
| 0.2 | 1.5 | GO:0005883 | neurofilament(GO:0005883) |
| 0.2 | 1.1 | GO:0045179 | apical cortex(GO:0045179) |
| 0.2 | 2.4 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 0.2 | 0.5 | GO:0005940 | septin ring(GO:0005940) |
| 0.2 | 0.6 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.2 | 1.4 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.2 | 0.8 | GO:1990037 | Lewy body core(GO:1990037) |
| 0.2 | 0.8 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.1 | 5.7 | GO:0030673 | axolemma(GO:0030673) |
| 0.1 | 0.4 | GO:0099573 | glutamatergic postsynaptic density(GO:0099573) |
| 0.1 | 0.7 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.1 | 1.3 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.1 | 1.9 | GO:1902711 | GABA-A receptor complex(GO:1902711) |
| 0.1 | 0.7 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.1 | 0.6 | GO:0032389 | MutLalpha complex(GO:0032389) |
| 0.1 | 1.2 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.1 | 0.8 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.1 | 1.0 | GO:0097165 | nuclear stress granule(GO:0097165) |
| 0.1 | 0.8 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
| 0.1 | 0.6 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) DNA ligase IV complex(GO:0032807) |
| 0.1 | 1.0 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.1 | 0.7 | GO:0071203 | WASH complex(GO:0071203) |
| 0.1 | 0.5 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.1 | 0.8 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.1 | 1.1 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.1 | 1.2 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.1 | 0.3 | GO:0008091 | spectrin(GO:0008091) |
| 0.1 | 0.9 | GO:0045095 | keratin filament(GO:0045095) |
| 0.1 | 0.2 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
| 0.1 | 0.6 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.1 | 0.4 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.1 | 0.4 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.1 | 3.0 | GO:0031941 | filamentous actin(GO:0031941) |
| 0.1 | 0.3 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.1 | 0.7 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
| 0.1 | 0.2 | GO:0000818 | nuclear MIS12/MIND complex(GO:0000818) |
| 0.1 | 2.3 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.1 | 0.3 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.1 | 1.0 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.1 | 0.8 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.1 | 0.7 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.1 | 0.5 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.1 | 1.3 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.1 | 0.3 | GO:0032133 | interphase microtubule organizing center(GO:0031021) chromosome passenger complex(GO:0032133) |
| 0.1 | 0.3 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.0 | 1.0 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.0 | 0.1 | GO:0016342 | catenin complex(GO:0016342) |
| 0.0 | 0.3 | GO:0000938 | GARP complex(GO:0000938) |
| 0.0 | 0.3 | GO:0033503 | HULC complex(GO:0033503) |
| 0.0 | 1.0 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.0 | 0.7 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.0 | 0.9 | GO:0000145 | exocyst(GO:0000145) |
| 0.0 | 0.1 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
| 0.0 | 0.4 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.0 | 0.6 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 0.3 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.0 | 0.3 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.3 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.0 | 0.9 | GO:0005605 | basal lamina(GO:0005605) |
| 0.0 | 0.5 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.0 | 0.2 | GO:0000438 | core TFIIH complex portion of holo TFIIH complex(GO:0000438) |
| 0.0 | 4.0 | GO:0016605 | PML body(GO:0016605) |
| 0.0 | 0.6 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.0 | 1.1 | GO:0030904 | retromer complex(GO:0030904) |
| 0.0 | 0.2 | GO:1902636 | kinociliary basal body(GO:1902636) |
| 0.0 | 0.4 | GO:0000796 | condensin complex(GO:0000796) |
| 0.0 | 0.1 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.0 | 0.7 | GO:0097228 | sperm principal piece(GO:0097228) |
| 0.0 | 0.1 | GO:0032280 | symmetric synapse(GO:0032280) |
| 0.0 | 0.4 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.0 | 1.7 | GO:0045335 | phagocytic vesicle(GO:0045335) |
| 0.0 | 0.9 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.0 | 0.4 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
| 0.0 | 0.4 | GO:0045120 | pronucleus(GO:0045120) |
| 0.0 | 0.3 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.0 | 0.2 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
| 0.0 | 0.3 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
| 0.0 | 1.2 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.0 | 2.1 | GO:0014704 | intercalated disc(GO:0014704) |
| 0.0 | 0.4 | GO:0032039 | integrator complex(GO:0032039) |
| 0.0 | 0.5 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.0 | 0.2 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.0 | 0.8 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.0 | 1.0 | GO:0032420 | stereocilium(GO:0032420) |
| 0.0 | 0.1 | GO:0034657 | GID complex(GO:0034657) |
| 0.0 | 0.5 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.0 | 0.3 | GO:0010369 | chromocenter(GO:0010369) |
| 0.0 | 0.1 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.0 | 0.1 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.0 | 0.2 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.0 | 0.0 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.0 | 0.1 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.0 | 0.1 | GO:0002139 | stereocilia coupling link(GO:0002139) stereocilia ankle link(GO:0002141) |
| 0.0 | 0.2 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.0 | 0.7 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.0 | 0.4 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.0 | 0.4 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.0 | 1.1 | GO:0005902 | microvillus(GO:0005902) |
| 0.0 | 0.2 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.0 | 0.9 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.0 | 0.3 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.0 | 0.8 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
| 0.0 | 0.2 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.0 | 0.6 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.0 | 2.0 | GO:0000776 | kinetochore(GO:0000776) |
| 0.0 | 1.4 | GO:0005814 | centriole(GO:0005814) |
| 0.0 | 0.2 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.0 | 0.2 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.0 | 0.1 | GO:0097513 | myosin II filament(GO:0097513) |
| 0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.0 | 0.1 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.0 | 0.5 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.0 | 0.2 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 0.0 | 0.2 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.0 | 0.8 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.0 | 0.1 | GO:0071664 | beta-catenin-TCF7L2 complex(GO:0070369) catenin-TCF7L2 complex(GO:0071664) |
| 0.0 | 0.1 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.0 | 0.2 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.0 | 1.0 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.0 | 0.1 | GO:0030478 | actin cap(GO:0030478) |
| 0.0 | 1.4 | GO:0031225 | anchored component of membrane(GO:0031225) |
| 0.0 | 0.2 | GO:0060170 | ciliary membrane(GO:0060170) |
| 0.0 | 0.0 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.0 | 0.4 | GO:0016328 | lateral plasma membrane(GO:0016328) |
| 0.0 | 0.2 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 2.6 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.6 | 2.4 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.5 | 1.4 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
| 0.4 | 1.3 | GO:0004127 | cytidylate kinase activity(GO:0004127) uridylate kinase activity(GO:0009041) |
| 0.3 | 1.6 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.3 | 0.9 | GO:0019966 | interleukin-1 binding(GO:0019966) |
| 0.3 | 1.2 | GO:0047389 | glycerophosphocholine phosphodiesterase activity(GO:0047389) |
| 0.3 | 0.8 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.3 | 1.6 | GO:0015501 | glutamate:sodium symporter activity(GO:0015501) |
| 0.3 | 0.3 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.2 | 1.3 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.2 | 0.8 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
| 0.2 | 1.0 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
| 0.2 | 1.2 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
| 0.2 | 0.8 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.2 | 0.5 | GO:0051379 | epinephrine binding(GO:0051379) |
| 0.2 | 0.7 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.2 | 0.7 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
| 0.2 | 1.0 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.2 | 0.8 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
| 0.2 | 0.8 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
| 0.2 | 0.7 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.2 | 0.6 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
| 0.2 | 1.1 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.2 | 0.5 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
| 0.2 | 0.2 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 0.1 | 0.6 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
| 0.1 | 0.6 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
| 0.1 | 0.9 | GO:0046404 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.1 | 0.4 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
| 0.1 | 0.8 | GO:1904315 | transmitter-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1904315) |
| 0.1 | 0.7 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.1 | 0.4 | GO:0022865 | transmembrane electron transfer carrier(GO:0022865) |
| 0.1 | 1.0 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.1 | 0.9 | GO:0005314 | high-affinity glutamate transmembrane transporter activity(GO:0005314) |
| 0.1 | 0.9 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.1 | 0.5 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.1 | 0.4 | GO:0016314 | phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase activity(GO:0016314) |
| 0.1 | 0.6 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.1 | 0.5 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.1 | 1.1 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.1 | 0.4 | GO:0001129 | RNA polymerase II transcription factor activity, TBP-class protein binding, involved in preinitiation complex assembly(GO:0001129) RNA polymerase II transcription factor activity, TBP-class protein binding(GO:0001132) |
| 0.1 | 0.6 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.1 | 1.2 | GO:0022848 | acetylcholine-gated cation channel activity(GO:0022848) |
| 0.1 | 0.6 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.1 | 2.4 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.1 | 0.3 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.1 | 0.7 | GO:0004984 | olfactory receptor activity(GO:0004984) |
| 0.1 | 0.5 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.1 | 0.9 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.1 | 0.3 | GO:0042954 | lipoprotein transporter activity(GO:0042954) |
| 0.1 | 0.3 | GO:0098809 | nitrite reductase activity(GO:0098809) |
| 0.1 | 1.1 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.1 | 2.1 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.1 | 0.3 | GO:0047710 | bis(5'-adenosyl)-triphosphatase activity(GO:0047710) |
| 0.1 | 1.4 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.1 | 1.6 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.1 | 0.5 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.1 | 0.5 | GO:0000298 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) |
| 0.1 | 0.9 | GO:0008556 | sodium:potassium-exchanging ATPase activity(GO:0005391) potassium-transporting ATPase activity(GO:0008556) |
| 0.1 | 0.3 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) histone deacetylase activity (H4-K16 specific)(GO:0034739) Krueppel-associated box domain binding(GO:0035851) |
| 0.1 | 1.8 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.1 | 0.4 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.1 | 0.5 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.1 | 2.2 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.1 | 3.0 | GO:0005112 | Notch binding(GO:0005112) |
| 0.1 | 0.7 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| 0.1 | 0.4 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.1 | 0.4 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.1 | 1.2 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
| 0.1 | 0.3 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
| 0.1 | 3.2 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.1 | 1.3 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.1 | 1.4 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
| 0.1 | 1.0 | GO:0033764 | steroid dehydrogenase activity, acting on the CH-OH group of donors, NAD or NADP as acceptor(GO:0033764) |
| 0.1 | 0.3 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
| 0.1 | 0.3 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
| 0.1 | 0.4 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.1 | 0.6 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.1 | 0.7 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.1 | 0.2 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.1 | 1.1 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.1 | 1.7 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.1 | 1.5 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.1 | 2.7 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.1 | 0.5 | GO:0016312 | inositol bisphosphate phosphatase activity(GO:0016312) |
| 0.1 | 0.5 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
| 0.1 | 0.6 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.1 | 0.5 | GO:0042301 | phosphate ion binding(GO:0042301) |
| 0.1 | 1.4 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.1 | 0.4 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.1 | 0.5 | GO:0008227 | G-protein coupled amine receptor activity(GO:0008227) |
| 0.1 | 0.2 | GO:0071633 | dihydroceramidase activity(GO:0071633) |
| 0.1 | 0.7 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.1 | 0.2 | GO:0036361 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
| 0.1 | 1.3 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.1 | 2.3 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.1 | 0.2 | GO:0016979 | lipoate-protein ligase activity(GO:0016979) |
| 0.1 | 0.2 | GO:0004510 | tryptophan 5-monooxygenase activity(GO:0004510) |
| 0.1 | 0.9 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.1 | 0.2 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.1 | 0.6 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
| 0.1 | 0.2 | GO:0033142 | progesterone receptor binding(GO:0033142) |
| 0.1 | 0.5 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.1 | 0.3 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
| 0.1 | 0.4 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.1 | 1.3 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.1 | 0.8 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.1 | 0.2 | GO:0070012 | oligopeptidase activity(GO:0070012) |
| 0.1 | 0.6 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
| 0.1 | 0.6 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.1 | 0.5 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.1 | 0.6 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.1 | 0.4 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.0 | 0.8 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
| 0.0 | 5.3 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.0 | 0.1 | GO:0046997 | sarcosine dehydrogenase activity(GO:0008480) oxidoreductase activity, acting on the CH-NH group of donors, flavin as acceptor(GO:0046997) |
| 0.0 | 0.1 | GO:2001070 | starch binding(GO:2001070) |
| 0.0 | 3.9 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
| 0.0 | 0.2 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.0 | 0.2 | GO:0042610 | CD8 receptor binding(GO:0042610) |
| 0.0 | 0.1 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
| 0.0 | 0.8 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.0 | 0.7 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 0.0 | 0.3 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.0 | 0.2 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.0 | 0.2 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.0 | 0.2 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.0 | 0.2 | GO:0023029 | MHC class Ib protein binding(GO:0023029) |
| 0.0 | 0.3 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.0 | 0.2 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.0 | 0.4 | GO:0050308 | carbohydrate phosphatase activity(GO:0019203) sugar-phosphatase activity(GO:0050308) |
| 0.0 | 0.5 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.0 | 0.5 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.0 | 0.2 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.0 | 0.2 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.0 | 0.4 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.0 | 0.6 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
| 0.0 | 0.2 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.0 | 1.1 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.0 | 0.8 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.0 | 0.6 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.0 | 0.8 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
| 0.0 | 0.4 | GO:0015114 | phosphate ion transmembrane transporter activity(GO:0015114) |
| 0.0 | 1.1 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.2 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
| 0.0 | 0.4 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.0 | 0.3 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.0 | 0.2 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.0 | 0.1 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) acylglycerol O-acyltransferase activity(GO:0016411) |
| 0.0 | 0.2 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.0 | 0.1 | GO:0030172 | troponin C binding(GO:0030172) |
| 0.0 | 0.7 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.0 | 0.4 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.0 | 0.1 | GO:2001069 | glycogen binding(GO:2001069) |
| 0.0 | 0.6 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.0 | 0.6 | GO:0008009 | chemokine activity(GO:0008009) |
| 0.0 | 0.5 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.0 | 0.1 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.0 | 0.4 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.0 | 0.4 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.0 | 0.2 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.0 | 0.1 | GO:0034647 | histone demethylase activity (H3-trimethyl-K4 specific)(GO:0034647) |
| 0.0 | 0.8 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.0 | 0.1 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.0 | 0.1 | GO:0097677 | STAT family protein binding(GO:0097677) |
| 0.0 | 0.9 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
| 0.0 | 0.5 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.0 | 1.1 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.0 | 0.3 | GO:0048185 | activin binding(GO:0048185) |
| 0.0 | 0.1 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.0 | 0.8 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.0 | 0.4 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.1 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.0 | 0.4 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.0 | 0.2 | GO:0070696 | transmembrane receptor protein serine/threonine kinase binding(GO:0070696) |
| 0.0 | 2.1 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.0 | 0.1 | GO:0043758 | acetate-CoA ligase (ADP-forming) activity(GO:0043758) |
| 0.0 | 0.1 | GO:0008242 | omega peptidase activity(GO:0008242) |
| 0.0 | 0.8 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.0 | 0.1 | GO:0090079 | translation regulator activity, nucleic acid binding(GO:0090079) |
| 0.0 | 2.4 | GO:0030414 | peptidase inhibitor activity(GO:0030414) |
| 0.0 | 0.7 | GO:0019707 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.0 | 0.1 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
| 0.0 | 0.1 | GO:0008527 | taste receptor activity(GO:0008527) |
| 0.0 | 0.3 | GO:0009922 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.0 | 0.7 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.0 | 0.1 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.0 | 0.1 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.0 | 0.2 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
| 0.0 | 0.1 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.0 | 0.2 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.0 | 0.4 | GO:0005088 | Ras guanyl-nucleotide exchange factor activity(GO:0005088) |
| 0.0 | 0.1 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.0 | 0.4 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.0 | 0.1 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.0 | 0.1 | GO:0001729 | ceramide kinase activity(GO:0001729) |
| 0.0 | 0.1 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
| 0.0 | 0.1 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
| 0.0 | 0.0 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
| 0.0 | 0.4 | GO:0043236 | laminin binding(GO:0043236) |
| 0.0 | 3.3 | GO:0017124 | SH3 domain binding(GO:0017124) |
| 0.0 | 1.1 | GO:0019003 | GDP binding(GO:0019003) |
| 0.0 | 0.1 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 0.0 | 0.5 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.0 | 0.1 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.0 | 0.1 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
| 0.0 | 0.1 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.0 | 0.4 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
| 0.0 | 0.1 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.0 | 0.4 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.0 | 6.2 | GO:0003779 | actin binding(GO:0003779) |
| 0.0 | 0.1 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.0 | 0.8 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.0 | 0.2 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.0 | 0.1 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
| 0.0 | 0.2 | GO:0016208 | AMP binding(GO:0016208) |
| 0.0 | 0.1 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.0 | 0.8 | GO:0003684 | damaged DNA binding(GO:0003684) |
| 0.0 | 0.1 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.0 | 0.1 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
| 0.0 | 0.4 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.0 | 0.3 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.0 | 0.3 | GO:0052866 | phosphatidylinositol phosphate phosphatase activity(GO:0052866) |
| 0.0 | 0.1 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
| 0.0 | 0.2 | GO:0008517 | folic acid transporter activity(GO:0008517) |
| 0.0 | 3.5 | GO:0005096 | GTPase activator activity(GO:0005096) |
| 0.0 | 0.2 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.0 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.0 | 0.2 | GO:0031078 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
| 0.0 | 0.1 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
| 0.0 | 0.1 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.0 | 0.7 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.0 | 0.2 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.0 | 0.4 | GO:0001671 | ATPase activator activity(GO:0001671) |
| 0.0 | 0.1 | GO:0031702 | angiotensin receptor binding(GO:0031701) type 1 angiotensin receptor binding(GO:0031702) |
| 0.0 | 0.3 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.0 | 0.2 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.0 | 0.1 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.0 | 0.2 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.0 | 0.1 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.0 | 0.1 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.0 | 0.0 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| 0.0 | 0.2 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.0 | 0.0 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.0 | 0.1 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.0 | 0.4 | GO:0030507 | spectrin binding(GO:0030507) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 4.0 | PID_TCR_JNK_PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.2 | 0.7 | ST_IL_13_PATHWAY | Interleukin 13 (IL-13) Pathway |
| 0.1 | 5.7 | PID_CDC42_REG_PATHWAY | Regulation of CDC42 activity |
| 0.1 | 0.8 | PID_INTEGRIN4_PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.1 | 1.0 | PID_ALK2_PATHWAY | ALK2 signaling events |
| 0.1 | 3.6 | SIG_REGULATION_OF_THE_ACTIN_CYTOSKELETON_BY_RHO_GTPASES | Genes related to regulation of the actin cytoskeleton |
| 0.1 | 2.8 | PID_P38_MK2_PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.1 | 0.4 | ST_G_ALPHA_I_PATHWAY | G alpha i Pathway |
| 0.1 | 2.7 | PID_IL6_7_PATHWAY | IL6-mediated signaling events |
| 0.0 | 3.6 | PID_NOTCH_PATHWAY | Notch signaling pathway |
| 0.0 | 1.8 | PID_RAC1_REG_PATHWAY | Regulation of RAC1 activity |
| 0.0 | 0.4 | PID_RHODOPSIN_PATHWAY | Visual signal transduction: Rods |
| 0.0 | 1.5 | PID_AURORA_B_PATHWAY | Aurora B signaling |
| 0.0 | 0.9 | PID_PS1_PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 0.7 | PID_MAPK_TRK_PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.0 | 1.2 | PID_RHOA_PATHWAY | RhoA signaling pathway |
| 0.0 | 0.8 | PID_INTEGRIN_A9B1_PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 0.6 | PID_S1P_S1P1_PATHWAY | S1P1 pathway |
| 0.0 | 1.3 | PID_ERBB4_PATHWAY | ErbB4 signaling events |
| 0.0 | 0.1 | ST_ADRENERGIC | Adrenergic Pathway |
| 0.0 | 2.5 | PID_CMYB_PATHWAY | C-MYB transcription factor network |
| 0.0 | 0.2 | PID_FOXO_PATHWAY | FoxO family signaling |
| 0.0 | 0.5 | SA_B_CELL_RECEPTOR_COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.0 | 0.2 | PID_TNF_PATHWAY | TNF receptor signaling pathway |
| 0.0 | 0.1 | PID_PDGFRA_PATHWAY | PDGFR-alpha signaling pathway |
| 0.0 | 0.7 | PID_FRA_PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.0 | 0.6 | PID_AURORA_A_PATHWAY | Aurora A signaling |
| 0.0 | 0.4 | PID_TGFBR_PATHWAY | TGF-beta receptor signaling |
| 0.0 | 0.7 | PID_RET_PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.0 | 0.3 | PID_IFNG_PATHWAY | IFN-gamma pathway |
| 0.0 | 0.3 | PID_PI3K_PLC_TRK_PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.0 | 0.6 | PID_ERBB1_INTERNALIZATION_PATHWAY | Internalization of ErbB1 |
| 0.0 | 0.6 | PID_P38_ALPHA_BETA_DOWNSTREAM_PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.0 | 0.1 | PID_P38_GAMMA_DELTA_PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.0 | 0.1 | PID_THROMBIN_PAR4_PATHWAY | PAR4-mediated thrombin signaling events |
| 0.0 | 0.3 | PID_LPA4_PATHWAY | LPA4-mediated signaling events |
| 0.0 | 0.7 | PID_ERBB1_DOWNSTREAM_PATHWAY | ErbB1 downstream signaling |
| 0.0 | 0.5 | NABA_BASEMENT_MEMBRANES | Genes encoding structural components of basement membranes |
| 0.0 | 0.8 | PID_ERA_GENOMIC_PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.0 | 0.5 | PID_ARF6_PATHWAY | Arf6 signaling events |
| 0.0 | 0.1 | SIG_BCR_SIGNALING_PATHWAY | Members of the BCR signaling pathway |
| 0.0 | 0.2 | ST_G_ALPHA_S_PATHWAY | G alpha s Pathway |
| 0.0 | 0.1 | PID_VEGF_VEGFR_PATHWAY | VEGF and VEGFR signaling network |
| 0.0 | 0.5 | PID_HDAC_CLASSII_PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 0.2 | PID_HDAC_CLASSIII_PATHWAY | Signaling events mediated by HDAC Class III |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 1.0 | REACTOME_ETHANOL_OXIDATION | Genes involved in Ethanol oxidation |
| 0.2 | 3.0 | REACTOME_GABA_A_RECEPTOR_ACTIVATION | Genes involved in GABA A receptor activation |
| 0.1 | 1.2 | REACTOME_PRESYNAPTIC_NICOTINIC_ACETYLCHOLINE_RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
| 0.1 | 3.6 | REACTOME_CREB_PHOSPHORYLATION_THROUGH_THE_ACTIVATION_OF_CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
| 0.1 | 0.1 | REACTOME_AUTODEGRADATION_OF_THE_E3_UBIQUITIN_LIGASE_COP1 | Genes involved in Autodegradation of the E3 ubiquitin ligase COP1 |
| 0.1 | 0.4 | REACTOME_SYNTHESIS_OF_BILE_ACIDS_AND_BILE_SALTS_VIA_7ALPHA_HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
| 0.1 | 1.9 | REACTOME_ACTIVATION_OF_RAC | Genes involved in Activation of Rac |
| 0.1 | 2.3 | REACTOME_GLUTAMATE_NEUROTRANSMITTER_RELEASE_CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.1 | 1.1 | REACTOME_PURINE_CATABOLISM | Genes involved in Purine catabolism |
| 0.1 | 1.1 | REACTOME_AMINE_LIGAND_BINDING_RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.1 | 0.7 | REACTOME_IL_6_SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.1 | 2.0 | REACTOME_STRIATED_MUSCLE_CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.1 | 0.1 | REACTOME_THROMBOXANE_SIGNALLING_THROUGH_TP_RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
| 0.1 | 2.6 | REACTOME_SIGNALING_BY_FGFR1_FUSION_MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.1 | 0.4 | REACTOME_TANDEM_PORE_DOMAIN_POTASSIUM_CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.1 | 0.9 | REACTOME_SYNTHESIS_OF_PIPS_AT_THE_LATE_ENDOSOME_MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.1 | 1.4 | REACTOME_TRAFFICKING_OF_GLUR2_CONTAINING_AMPA_RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.1 | 1.2 | REACTOME_INSULIN_SYNTHESIS_AND_PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.1 | 0.8 | REACTOME_ADENYLATE_CYCLASE_INHIBITORY_PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
| 0.1 | 2.3 | REACTOME_VOLTAGE_GATED_POTASSIUM_CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.1 | 1.5 | REACTOME_SYNTHESIS_OF_VERY_LONG_CHAIN_FATTY_ACYL_COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
| 0.0 | 0.6 | REACTOME_GABA_SYNTHESIS_RELEASE_REUPTAKE_AND_DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.0 | 0.1 | REACTOME_TRIGLYCERIDE_BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
| 0.0 | 0.9 | REACTOME_CTNNB1_PHOSPHORYLATION_CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.0 | 0.6 | REACTOME_PKA_MEDIATED_PHOSPHORYLATION_OF_CREB | Genes involved in PKA-mediated phosphorylation of CREB |
| 0.0 | 1.2 | REACTOME_TRAF6_MEDIATED_NFKB_ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.0 | 1.2 | REACTOME_RAP1_SIGNALLING | Genes involved in Rap1 signalling |
| 0.0 | 0.8 | REACTOME_NEPHRIN_INTERACTIONS | Genes involved in Nephrin interactions |
| 0.0 | 0.8 | REACTOME_HS_GAG_BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.0 | 0.6 | REACTOME_INTEGRATION_OF_PROVIRUS | Genes involved in Integration of provirus |
| 0.0 | 0.2 | REACTOME_NFKB_IS_ACTIVATED_AND_SIGNALS_SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 0.0 | 0.7 | REACTOME_INSULIN_RECEPTOR_RECYCLING | Genes involved in Insulin receptor recycling |
| 0.0 | 3.2 | REACTOME_MITOTIC_PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.0 | 0.3 | REACTOME_CALNEXIN_CALRETICULIN_CYCLE | Genes involved in Calnexin/calreticulin cycle |
| 0.0 | 1.2 | REACTOME_ACTIVATED_NOTCH1_TRANSMITS_SIGNAL_TO_THE_NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.0 | 0.7 | REACTOME_THE_ROLE_OF_NEF_IN_HIV1_REPLICATION_AND_DISEASE_PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| 0.0 | 0.4 | REACTOME_DOWNSTREAM_TCR_SIGNALING | Genes involved in Downstream TCR signaling |
| 0.0 | 0.5 | REACTOME_ANTIGEN_PRESENTATION_FOLDING_ASSEMBLY_AND_PEPTIDE_LOADING_OF_CLASS_I_MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.0 | 1.0 | REACTOME_GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.6 | REACTOME_DARPP_32_EVENTS | Genes involved in DARPP-32 events |
| 0.0 | 0.8 | REACTOME_INTERACTION_BETWEEN_L1_AND_ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.0 | 0.6 | REACTOME_NCAM1_INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 0.3 | REACTOME_INTRINSIC_PATHWAY | Genes involved in Intrinsic Pathway |
| 0.0 | 0.1 | REACTOME_REGULATION_OF_IFNG_SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.0 | 0.5 | REACTOME_HS_GAG_DEGRADATION | Genes involved in HS-GAG degradation |
| 0.0 | 0.3 | REACTOME_APOPTOSIS_INDUCED_DNA_FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.0 | 0.6 | REACTOME_OTHER_SEMAPHORIN_INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.0 | 0.1 | REACTOME_REGULATION_OF_KIT_SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.0 | 0.3 | REACTOME_TIE2_SIGNALING | Genes involved in Tie2 Signaling |
| 0.0 | 3.5 | REACTOME_SIGNALING_BY_RHO_GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.0 | 0.9 | REACTOME_MRNA_3_END_PROCESSING | Genes involved in mRNA 3'-end processing |
| 0.0 | 0.3 | REACTOME_STEROID_HORMONES | Genes involved in Steroid hormones |
| 0.0 | 0.2 | REACTOME_TRYPTOPHAN_CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.0 | 0.1 | REACTOME_IL_7_SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.0 | 0.4 | REACTOME_FORMATION_OF_INCISION_COMPLEX_IN_GG_NER | Genes involved in Formation of incision complex in GG-NER |
| 0.0 | 0.2 | REACTOME_GLUCOSE_TRANSPORT | Genes involved in Glucose transport |
| 0.0 | 0.8 | REACTOME_APOPTOTIC_CLEAVAGE_OF_CELLULAR_PROTEINS | Genes involved in Apoptotic cleavage of cellular proteins |
| 0.0 | 0.4 | REACTOME_RNA_POL_II_TRANSCRIPTION_PRE_INITIATION_AND_PROMOTER_OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.0 | 0.7 | REACTOME_O_LINKED_GLYCOSYLATION_OF_MUCINS | Genes involved in O-linked glycosylation of mucins |
| 0.0 | 0.2 | REACTOME_SYNTHESIS_SECRETION_AND_INACTIVATION_OF_GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.0 | 0.3 | REACTOME_TGF_BETA_RECEPTOR_SIGNALING_IN_EMT_EPITHELIAL_TO_MESENCHYMAL_TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.0 | 0.3 | REACTOME_SIGNALING_BY_ROBO_RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.0 | 0.5 | REACTOME_ION_TRANSPORT_BY_P_TYPE_ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.0 | 0.1 | REACTOME_RECRUITMENT_OF_NUMA_TO_MITOTIC_CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.0 | 0.1 | REACTOME_FATTY_ACYL_COA_BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
| 0.0 | 0.1 | REACTOME_MICRORNA_MIRNA_BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
| 0.0 | 0.2 | REACTOME_HOMOLOGOUS_RECOMBINATION_REPAIR_OF_REPLICATION_INDEPENDENT_DOUBLE_STRAND_BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.0 | 0.8 | REACTOME_L1CAM_INTERACTIONS | Genes involved in L1CAM interactions |
| 0.0 | 0.4 | REACTOME_ADHERENS_JUNCTIONS_INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.0 | 0.1 | REACTOME_BILE_SALT_AND_ORGANIC_ANION_SLC_TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.0 | 0.4 | REACTOME_POST_TRANSLATIONAL_MODIFICATION_SYNTHESIS_OF_GPI_ANCHORED_PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.0 | 0.3 | REACTOME_DEADENYLATION_OF_MRNA | Genes involved in Deadenylation of mRNA |
| 0.0 | 0.1 | REACTOME_CYCLIN_A_B1_ASSOCIATED_EVENTS_DURING_G2_M_TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.0 | 1.2 | REACTOME_TRANSPORT_OF_INORGANIC_CATIONS_ANIONS_AND_AMINO_ACIDS_OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 0.0 | 0.6 | REACTOME_MHC_CLASS_II_ANTIGEN_PRESENTATION | Genes involved in MHC class II antigen presentation |
| 0.0 | 0.2 | REACTOME_MYOGENESIS | Genes involved in Myogenesis |
| 0.0 | 0.2 | REACTOME_FORMATION_OF_TRANSCRIPTION_COUPLED_NER_TC_NER_REPAIR_COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 0.0 | 0.9 | REACTOME_PEPTIDE_LIGAND_BINDING_RECEPTORS | Genes involved in Peptide ligand-binding receptors |
| 0.0 | 0.3 | REACTOME_SIGNALING_BY_HIPPO | Genes involved in Signaling by Hippo |
| 0.0 | 0.2 | REACTOME_DESTABILIZATION_OF_MRNA_BY_TRISTETRAPROLIN_TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.0 | 0.1 | REACTOME_ACTIVATION_OF_CHAPERONE_GENES_BY_ATF6_ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |


